babylon.2.1-alpha.debug.js 1.5 MB

1234567891011121314151617181920212223242526272829303132333435363738394041424344454647484950515253545556575859606162636465666768697071727374757677787980818283848586878889909192939495969798991001011021031041051061071081091101111121131141151161171181191201211221231241251261271281291301311321331341351361371381391401411421431441451461471481491501511521531541551561571581591601611621631641651661671681691701711721731741751761771781791801811821831841851861871881891901911921931941951961971981992002012022032042052062072082092102112122132142152162172182192202212222232242252262272282292302312322332342352362372382392402412422432442452462472482492502512522532542552562572582592602612622632642652662672682692702712722732742752762772782792802812822832842852862872882892902912922932942952962972982993003013023033043053063073083093103113123133143153163173183193203213223233243253263273283293303313323333343353363373383393403413423433443453463473483493503513523533543553563573583593603613623633643653663673683693703713723733743753763773783793803813823833843853863873883893903913923933943953963973983994004014024034044054064074084094104114124134144154164174184194204214224234244254264274284294304314324334344354364374384394404414424434444454464474484494504514524534544554564574584594604614624634644654664674684694704714724734744754764774784794804814824834844854864874884894904914924934944954964974984995005015025035045055065075085095105115125135145155165175185195205215225235245255265275285295305315325335345355365375385395405415425435445455465475485495505515525535545555565575585595605615625635645655665675685695705715725735745755765775785795805815825835845855865875885895905915925935945955965975985996006016026036046056066076086096106116126136146156166176186196206216226236246256266276286296306316326336346356366376386396406416426436446456466476486496506516526536546556566576586596606616626636646656666676686696706716726736746756766776786796806816826836846856866876886896906916926936946956966976986997007017027037047057067077087097107117127137147157167177187197207217227237247257267277287297307317327337347357367377387397407417427437447457467477487497507517527537547557567577587597607617627637647657667677687697707717727737747757767777787797807817827837847857867877887897907917927937947957967977987998008018028038048058068078088098108118128138148158168178188198208218228238248258268278288298308318328338348358368378388398408418428438448458468478488498508518528538548558568578588598608618628638648658668678688698708718728738748758768778788798808818828838848858868878888898908918928938948958968978988999009019029039049059069079089099109119129139149159169179189199209219229239249259269279289299309319329339349359369379389399409419429439449459469479489499509519529539549559569579589599609619629639649659669679689699709719729739749759769779789799809819829839849859869879889899909919929939949959969979989991000100110021003100410051006100710081009101010111012101310141015101610171018101910201021102210231024102510261027102810291030103110321033103410351036103710381039104010411042104310441045104610471048104910501051105210531054105510561057105810591060106110621063106410651066106710681069107010711072107310741075107610771078107910801081108210831084108510861087108810891090109110921093109410951096109710981099110011011102110311041105110611071108110911101111111211131114111511161117111811191120112111221123112411251126112711281129113011311132113311341135113611371138113911401141114211431144114511461147114811491150115111521153115411551156115711581159116011611162116311641165116611671168116911701171117211731174117511761177117811791180118111821183118411851186118711881189119011911192119311941195119611971198119912001201120212031204120512061207120812091210121112121213121412151216121712181219122012211222122312241225122612271228122912301231123212331234123512361237123812391240124112421243124412451246124712481249125012511252125312541255125612571258125912601261126212631264126512661267126812691270127112721273127412751276127712781279128012811282128312841285128612871288128912901291129212931294129512961297129812991300130113021303130413051306130713081309131013111312131313141315131613171318131913201321132213231324132513261327132813291330133113321333133413351336133713381339134013411342134313441345134613471348134913501351135213531354135513561357135813591360136113621363136413651366136713681369137013711372137313741375137613771378137913801381138213831384138513861387138813891390139113921393139413951396139713981399140014011402140314041405140614071408140914101411141214131414141514161417141814191420142114221423142414251426142714281429143014311432143314341435143614371438143914401441144214431444144514461447144814491450145114521453145414551456145714581459146014611462146314641465146614671468146914701471147214731474147514761477147814791480148114821483148414851486148714881489149014911492149314941495149614971498149915001501150215031504150515061507150815091510151115121513151415151516151715181519152015211522152315241525152615271528152915301531153215331534153515361537153815391540154115421543154415451546154715481549155015511552155315541555155615571558155915601561156215631564156515661567156815691570157115721573157415751576157715781579158015811582158315841585158615871588158915901591159215931594159515961597159815991600160116021603160416051606160716081609161016111612161316141615161616171618161916201621162216231624162516261627162816291630163116321633163416351636163716381639164016411642164316441645164616471648164916501651165216531654165516561657165816591660166116621663166416651666166716681669167016711672167316741675167616771678167916801681168216831684168516861687168816891690169116921693169416951696169716981699170017011702170317041705170617071708170917101711171217131714171517161717171817191720172117221723172417251726172717281729173017311732173317341735173617371738173917401741174217431744174517461747174817491750175117521753175417551756175717581759176017611762176317641765176617671768176917701771177217731774177517761777177817791780178117821783178417851786178717881789179017911792179317941795179617971798179918001801180218031804180518061807180818091810181118121813181418151816181718181819182018211822182318241825182618271828182918301831183218331834183518361837183818391840184118421843184418451846184718481849185018511852185318541855185618571858185918601861186218631864186518661867186818691870187118721873187418751876187718781879188018811882188318841885188618871888188918901891189218931894189518961897189818991900190119021903190419051906190719081909191019111912191319141915191619171918191919201921192219231924192519261927192819291930193119321933193419351936193719381939194019411942194319441945194619471948194919501951195219531954195519561957195819591960196119621963196419651966196719681969197019711972197319741975197619771978197919801981198219831984198519861987198819891990199119921993199419951996199719981999200020012002200320042005200620072008200920102011201220132014201520162017201820192020202120222023202420252026202720282029203020312032203320342035203620372038203920402041204220432044204520462047204820492050205120522053205420552056205720582059206020612062206320642065206620672068206920702071207220732074207520762077207820792080208120822083208420852086208720882089209020912092209320942095209620972098209921002101210221032104210521062107210821092110211121122113211421152116211721182119212021212122212321242125212621272128212921302131213221332134213521362137213821392140214121422143214421452146214721482149215021512152215321542155215621572158215921602161216221632164216521662167216821692170217121722173217421752176217721782179218021812182218321842185218621872188218921902191219221932194219521962197219821992200220122022203220422052206220722082209221022112212221322142215221622172218221922202221222222232224222522262227222822292230223122322233223422352236223722382239224022412242224322442245224622472248224922502251225222532254225522562257225822592260226122622263226422652266226722682269227022712272227322742275227622772278227922802281228222832284228522862287228822892290229122922293229422952296229722982299230023012302230323042305230623072308230923102311231223132314231523162317231823192320232123222323232423252326232723282329233023312332233323342335233623372338233923402341234223432344234523462347234823492350235123522353235423552356235723582359236023612362236323642365236623672368236923702371237223732374237523762377237823792380238123822383238423852386238723882389239023912392239323942395239623972398239924002401240224032404240524062407240824092410241124122413241424152416241724182419242024212422242324242425242624272428242924302431243224332434243524362437243824392440244124422443244424452446244724482449245024512452245324542455245624572458245924602461246224632464246524662467246824692470247124722473247424752476247724782479248024812482248324842485248624872488248924902491249224932494249524962497249824992500250125022503250425052506250725082509251025112512251325142515251625172518251925202521252225232524252525262527252825292530253125322533253425352536253725382539254025412542254325442545254625472548254925502551255225532554255525562557255825592560256125622563256425652566256725682569257025712572257325742575257625772578257925802581258225832584258525862587258825892590259125922593259425952596259725982599260026012602260326042605260626072608260926102611261226132614261526162617261826192620262126222623262426252626262726282629263026312632263326342635263626372638263926402641264226432644264526462647264826492650265126522653265426552656265726582659266026612662266326642665266626672668266926702671267226732674267526762677267826792680268126822683268426852686268726882689269026912692269326942695269626972698269927002701270227032704270527062707270827092710271127122713271427152716271727182719272027212722272327242725272627272728272927302731273227332734273527362737273827392740274127422743274427452746274727482749275027512752275327542755275627572758275927602761276227632764276527662767276827692770277127722773277427752776277727782779278027812782278327842785278627872788278927902791279227932794279527962797279827992800280128022803280428052806280728082809281028112812281328142815281628172818281928202821282228232824282528262827282828292830283128322833283428352836283728382839284028412842284328442845284628472848284928502851285228532854285528562857285828592860286128622863286428652866286728682869287028712872287328742875287628772878287928802881288228832884288528862887288828892890289128922893289428952896289728982899290029012902290329042905290629072908290929102911291229132914291529162917291829192920292129222923292429252926292729282929293029312932293329342935293629372938293929402941294229432944294529462947294829492950295129522953295429552956295729582959296029612962296329642965296629672968296929702971297229732974297529762977297829792980298129822983298429852986298729882989299029912992299329942995299629972998299930003001300230033004300530063007300830093010301130123013301430153016301730183019302030213022302330243025302630273028302930303031303230333034303530363037303830393040304130423043304430453046304730483049305030513052305330543055305630573058305930603061306230633064306530663067306830693070307130723073307430753076307730783079308030813082308330843085308630873088308930903091309230933094309530963097309830993100310131023103310431053106310731083109311031113112311331143115311631173118311931203121312231233124312531263127312831293130313131323133313431353136313731383139314031413142314331443145314631473148314931503151315231533154315531563157315831593160316131623163316431653166316731683169317031713172317331743175317631773178317931803181318231833184318531863187318831893190319131923193319431953196319731983199320032013202320332043205320632073208320932103211321232133214321532163217321832193220322132223223322432253226322732283229323032313232323332343235323632373238323932403241324232433244324532463247324832493250325132523253325432553256325732583259326032613262326332643265326632673268326932703271327232733274327532763277327832793280328132823283328432853286328732883289329032913292329332943295329632973298329933003301330233033304330533063307330833093310331133123313331433153316331733183319332033213322332333243325332633273328332933303331333233333334333533363337333833393340334133423343334433453346334733483349335033513352335333543355335633573358335933603361336233633364336533663367336833693370337133723373337433753376337733783379338033813382338333843385338633873388338933903391339233933394339533963397339833993400340134023403340434053406340734083409341034113412341334143415341634173418341934203421342234233424342534263427342834293430343134323433343434353436343734383439344034413442344334443445344634473448344934503451345234533454345534563457345834593460346134623463346434653466346734683469347034713472347334743475347634773478347934803481348234833484348534863487348834893490349134923493349434953496349734983499350035013502350335043505350635073508350935103511351235133514351535163517351835193520352135223523352435253526352735283529353035313532353335343535353635373538353935403541354235433544354535463547354835493550355135523553355435553556355735583559356035613562356335643565356635673568356935703571357235733574357535763577357835793580358135823583358435853586358735883589359035913592359335943595359635973598359936003601360236033604360536063607360836093610361136123613361436153616361736183619362036213622362336243625362636273628362936303631363236333634363536363637363836393640364136423643364436453646364736483649365036513652365336543655365636573658365936603661366236633664366536663667366836693670367136723673367436753676367736783679368036813682368336843685368636873688368936903691369236933694369536963697369836993700370137023703370437053706370737083709371037113712371337143715371637173718371937203721372237233724372537263727372837293730373137323733373437353736373737383739374037413742374337443745374637473748374937503751375237533754375537563757375837593760376137623763376437653766376737683769377037713772377337743775377637773778377937803781378237833784378537863787378837893790379137923793379437953796379737983799380038013802380338043805380638073808380938103811381238133814381538163817381838193820382138223823382438253826382738283829383038313832383338343835383638373838383938403841384238433844384538463847384838493850385138523853385438553856385738583859386038613862386338643865386638673868386938703871387238733874387538763877387838793880388138823883388438853886388738883889389038913892389338943895389638973898389939003901390239033904390539063907390839093910391139123913391439153916391739183919392039213922392339243925392639273928392939303931393239333934393539363937393839393940394139423943394439453946394739483949395039513952395339543955395639573958395939603961396239633964396539663967396839693970397139723973397439753976397739783979398039813982398339843985398639873988398939903991399239933994399539963997399839994000400140024003400440054006400740084009401040114012401340144015401640174018401940204021402240234024402540264027402840294030403140324033403440354036403740384039404040414042404340444045404640474048404940504051405240534054405540564057405840594060406140624063406440654066406740684069407040714072407340744075407640774078407940804081408240834084408540864087408840894090409140924093409440954096409740984099410041014102410341044105410641074108410941104111411241134114411541164117411841194120412141224123412441254126412741284129413041314132413341344135413641374138413941404141414241434144414541464147414841494150415141524153415441554156415741584159416041614162416341644165416641674168416941704171417241734174417541764177417841794180418141824183418441854186418741884189419041914192419341944195419641974198419942004201420242034204420542064207420842094210421142124213421442154216421742184219422042214222422342244225422642274228422942304231423242334234423542364237423842394240424142424243424442454246424742484249425042514252425342544255425642574258425942604261426242634264426542664267426842694270427142724273427442754276427742784279428042814282428342844285428642874288428942904291429242934294429542964297429842994300430143024303430443054306430743084309431043114312431343144315431643174318431943204321432243234324432543264327432843294330433143324333433443354336433743384339434043414342434343444345434643474348434943504351435243534354435543564357435843594360436143624363436443654366436743684369437043714372437343744375437643774378437943804381438243834384438543864387438843894390439143924393439443954396439743984399440044014402440344044405440644074408440944104411441244134414441544164417441844194420442144224423442444254426442744284429443044314432443344344435443644374438443944404441444244434444444544464447444844494450445144524453445444554456445744584459446044614462446344644465446644674468446944704471447244734474447544764477447844794480448144824483448444854486448744884489449044914492449344944495449644974498449945004501450245034504450545064507450845094510451145124513451445154516451745184519452045214522452345244525452645274528452945304531453245334534453545364537453845394540454145424543454445454546454745484549455045514552455345544555455645574558455945604561456245634564456545664567456845694570457145724573457445754576457745784579458045814582458345844585458645874588458945904591459245934594459545964597459845994600460146024603460446054606460746084609461046114612461346144615461646174618461946204621462246234624462546264627462846294630463146324633463446354636463746384639464046414642464346444645464646474648464946504651465246534654465546564657465846594660466146624663466446654666466746684669467046714672467346744675467646774678467946804681468246834684468546864687468846894690469146924693469446954696469746984699470047014702470347044705470647074708470947104711471247134714471547164717471847194720472147224723472447254726472747284729473047314732473347344735473647374738473947404741474247434744474547464747474847494750475147524753475447554756475747584759476047614762476347644765476647674768476947704771477247734774477547764777477847794780478147824783478447854786478747884789479047914792479347944795479647974798479948004801480248034804480548064807480848094810481148124813481448154816481748184819482048214822482348244825482648274828482948304831483248334834483548364837483848394840484148424843484448454846484748484849485048514852485348544855485648574858485948604861486248634864486548664867486848694870487148724873487448754876487748784879488048814882488348844885488648874888488948904891489248934894489548964897489848994900490149024903490449054906490749084909491049114912491349144915491649174918491949204921492249234924492549264927492849294930493149324933493449354936493749384939494049414942494349444945494649474948494949504951495249534954495549564957495849594960496149624963496449654966496749684969497049714972497349744975497649774978497949804981498249834984498549864987498849894990499149924993499449954996499749984999500050015002500350045005500650075008500950105011501250135014501550165017501850195020502150225023502450255026502750285029503050315032503350345035503650375038503950405041504250435044504550465047504850495050505150525053505450555056505750585059506050615062506350645065506650675068506950705071507250735074507550765077507850795080508150825083508450855086508750885089509050915092509350945095509650975098509951005101510251035104510551065107510851095110511151125113511451155116511751185119512051215122512351245125512651275128512951305131513251335134513551365137513851395140514151425143514451455146514751485149515051515152515351545155515651575158515951605161516251635164516551665167516851695170517151725173517451755176517751785179518051815182518351845185518651875188518951905191519251935194519551965197519851995200520152025203520452055206520752085209521052115212521352145215521652175218521952205221522252235224522552265227522852295230523152325233523452355236523752385239524052415242524352445245524652475248524952505251525252535254525552565257525852595260526152625263526452655266526752685269527052715272527352745275527652775278527952805281528252835284528552865287528852895290529152925293529452955296529752985299530053015302530353045305530653075308530953105311531253135314531553165317531853195320532153225323532453255326532753285329533053315332533353345335533653375338533953405341534253435344534553465347534853495350535153525353535453555356535753585359536053615362536353645365536653675368536953705371537253735374537553765377537853795380538153825383538453855386538753885389539053915392539353945395539653975398539954005401540254035404540554065407540854095410541154125413541454155416541754185419542054215422542354245425542654275428542954305431543254335434543554365437543854395440544154425443544454455446544754485449545054515452545354545455545654575458545954605461546254635464546554665467546854695470547154725473547454755476547754785479548054815482548354845485548654875488548954905491549254935494549554965497549854995500550155025503550455055506550755085509551055115512551355145515551655175518551955205521552255235524552555265527552855295530553155325533553455355536553755385539554055415542554355445545554655475548554955505551555255535554555555565557555855595560556155625563556455655566556755685569557055715572557355745575557655775578557955805581558255835584558555865587558855895590559155925593559455955596559755985599560056015602560356045605560656075608560956105611561256135614561556165617561856195620562156225623562456255626562756285629563056315632563356345635563656375638563956405641564256435644564556465647564856495650565156525653565456555656565756585659566056615662566356645665566656675668566956705671567256735674567556765677567856795680568156825683568456855686568756885689569056915692569356945695569656975698569957005701570257035704570557065707570857095710571157125713571457155716571757185719572057215722572357245725572657275728572957305731573257335734573557365737573857395740574157425743574457455746574757485749575057515752575357545755575657575758575957605761576257635764576557665767576857695770577157725773577457755776577757785779578057815782578357845785578657875788578957905791579257935794579557965797579857995800580158025803580458055806580758085809581058115812581358145815581658175818581958205821582258235824582558265827582858295830583158325833583458355836583758385839584058415842584358445845584658475848584958505851585258535854585558565857585858595860586158625863586458655866586758685869587058715872587358745875587658775878587958805881588258835884588558865887588858895890589158925893589458955896589758985899590059015902590359045905590659075908590959105911591259135914591559165917591859195920592159225923592459255926592759285929593059315932593359345935593659375938593959405941594259435944594559465947594859495950595159525953595459555956595759585959596059615962596359645965596659675968596959705971597259735974597559765977597859795980598159825983598459855986598759885989599059915992599359945995599659975998599960006001600260036004600560066007600860096010601160126013601460156016601760186019602060216022602360246025602660276028602960306031603260336034603560366037603860396040604160426043604460456046604760486049605060516052605360546055605660576058605960606061606260636064606560666067606860696070607160726073607460756076607760786079608060816082608360846085608660876088608960906091609260936094609560966097609860996100610161026103610461056106610761086109611061116112611361146115611661176118611961206121612261236124612561266127612861296130613161326133613461356136613761386139614061416142614361446145614661476148614961506151615261536154615561566157615861596160616161626163616461656166616761686169617061716172617361746175617661776178617961806181618261836184618561866187618861896190619161926193619461956196619761986199620062016202620362046205620662076208620962106211621262136214621562166217621862196220622162226223622462256226622762286229623062316232623362346235623662376238623962406241624262436244624562466247624862496250625162526253625462556256625762586259626062616262626362646265626662676268626962706271627262736274627562766277627862796280628162826283628462856286628762886289629062916292629362946295629662976298629963006301630263036304630563066307630863096310631163126313631463156316631763186319632063216322632363246325632663276328632963306331633263336334633563366337633863396340634163426343634463456346634763486349635063516352635363546355635663576358635963606361636263636364636563666367636863696370637163726373637463756376637763786379638063816382638363846385638663876388638963906391639263936394639563966397639863996400640164026403640464056406640764086409641064116412641364146415641664176418641964206421642264236424642564266427642864296430643164326433643464356436643764386439644064416442644364446445644664476448644964506451645264536454645564566457645864596460646164626463646464656466646764686469647064716472647364746475647664776478647964806481648264836484648564866487648864896490649164926493649464956496649764986499650065016502650365046505650665076508650965106511651265136514651565166517651865196520652165226523652465256526652765286529653065316532653365346535653665376538653965406541654265436544654565466547654865496550655165526553655465556556655765586559656065616562656365646565656665676568656965706571657265736574657565766577657865796580658165826583658465856586658765886589659065916592659365946595659665976598659966006601660266036604660566066607660866096610661166126613661466156616661766186619662066216622662366246625662666276628662966306631663266336634663566366637663866396640664166426643664466456646664766486649665066516652665366546655665666576658665966606661666266636664666566666667666866696670667166726673667466756676667766786679668066816682668366846685668666876688668966906691669266936694669566966697669866996700670167026703670467056706670767086709671067116712671367146715671667176718671967206721672267236724672567266727672867296730673167326733673467356736673767386739674067416742674367446745674667476748674967506751675267536754675567566757675867596760676167626763676467656766676767686769677067716772677367746775677667776778677967806781678267836784678567866787678867896790679167926793679467956796679767986799680068016802680368046805680668076808680968106811681268136814681568166817681868196820682168226823682468256826682768286829683068316832683368346835683668376838683968406841684268436844684568466847684868496850685168526853685468556856685768586859686068616862686368646865686668676868686968706871687268736874687568766877687868796880688168826883688468856886688768886889689068916892689368946895689668976898689969006901690269036904690569066907690869096910691169126913691469156916691769186919692069216922692369246925692669276928692969306931693269336934693569366937693869396940694169426943694469456946694769486949695069516952695369546955695669576958695969606961696269636964696569666967696869696970697169726973697469756976697769786979698069816982698369846985698669876988698969906991699269936994699569966997699869997000700170027003700470057006700770087009701070117012701370147015701670177018701970207021702270237024702570267027702870297030703170327033703470357036703770387039704070417042704370447045704670477048704970507051705270537054705570567057705870597060706170627063706470657066706770687069707070717072707370747075707670777078707970807081708270837084708570867087708870897090709170927093709470957096709770987099710071017102710371047105710671077108710971107111711271137114711571167117711871197120712171227123712471257126712771287129713071317132713371347135713671377138713971407141714271437144714571467147714871497150715171527153715471557156715771587159716071617162716371647165716671677168716971707171717271737174717571767177717871797180718171827183718471857186718771887189719071917192719371947195719671977198719972007201720272037204720572067207720872097210721172127213721472157216721772187219722072217222722372247225722672277228722972307231723272337234723572367237723872397240724172427243724472457246724772487249725072517252725372547255725672577258725972607261726272637264726572667267726872697270727172727273727472757276727772787279728072817282728372847285728672877288728972907291729272937294729572967297729872997300730173027303730473057306730773087309731073117312731373147315731673177318731973207321732273237324732573267327732873297330733173327333733473357336733773387339734073417342734373447345734673477348734973507351735273537354735573567357735873597360736173627363736473657366736773687369737073717372737373747375737673777378737973807381738273837384738573867387738873897390739173927393739473957396739773987399740074017402740374047405740674077408740974107411741274137414741574167417741874197420742174227423742474257426742774287429743074317432743374347435743674377438743974407441744274437444744574467447744874497450745174527453745474557456745774587459746074617462746374647465746674677468746974707471747274737474747574767477747874797480748174827483748474857486748774887489749074917492749374947495749674977498749975007501750275037504750575067507750875097510751175127513751475157516751775187519752075217522752375247525752675277528752975307531753275337534753575367537753875397540754175427543754475457546754775487549755075517552755375547555755675577558755975607561756275637564756575667567756875697570757175727573757475757576757775787579758075817582758375847585758675877588758975907591759275937594759575967597759875997600760176027603760476057606760776087609761076117612761376147615761676177618761976207621762276237624762576267627762876297630763176327633763476357636763776387639764076417642764376447645764676477648764976507651765276537654765576567657765876597660766176627663766476657666766776687669767076717672767376747675767676777678767976807681768276837684768576867687768876897690769176927693769476957696769776987699770077017702770377047705770677077708770977107711771277137714771577167717771877197720772177227723772477257726772777287729773077317732773377347735773677377738773977407741774277437744774577467747774877497750775177527753775477557756775777587759776077617762776377647765776677677768776977707771777277737774777577767777777877797780778177827783778477857786778777887789779077917792779377947795779677977798779978007801780278037804780578067807780878097810781178127813781478157816781778187819782078217822782378247825782678277828782978307831783278337834783578367837783878397840784178427843784478457846784778487849785078517852785378547855785678577858785978607861786278637864786578667867786878697870787178727873787478757876787778787879788078817882788378847885788678877888788978907891789278937894789578967897789878997900790179027903790479057906790779087909791079117912791379147915791679177918791979207921792279237924792579267927792879297930793179327933793479357936793779387939794079417942794379447945794679477948794979507951795279537954795579567957795879597960796179627963796479657966796779687969797079717972797379747975797679777978797979807981798279837984798579867987798879897990799179927993799479957996799779987999800080018002800380048005800680078008800980108011801280138014801580168017801880198020802180228023802480258026802780288029803080318032803380348035803680378038803980408041804280438044804580468047804880498050805180528053805480558056805780588059806080618062806380648065806680678068806980708071807280738074807580768077807880798080808180828083808480858086808780888089809080918092809380948095809680978098809981008101810281038104810581068107810881098110811181128113811481158116811781188119812081218122812381248125812681278128812981308131813281338134813581368137813881398140814181428143814481458146814781488149815081518152815381548155815681578158815981608161816281638164816581668167816881698170817181728173817481758176817781788179818081818182818381848185818681878188818981908191819281938194819581968197819881998200820182028203820482058206820782088209821082118212821382148215821682178218821982208221822282238224822582268227822882298230823182328233823482358236823782388239824082418242824382448245824682478248824982508251825282538254825582568257825882598260826182628263826482658266826782688269827082718272827382748275827682778278827982808281828282838284828582868287828882898290829182928293829482958296829782988299830083018302830383048305830683078308830983108311831283138314831583168317831883198320832183228323832483258326832783288329833083318332833383348335833683378338833983408341834283438344834583468347834883498350835183528353835483558356835783588359836083618362836383648365836683678368836983708371837283738374837583768377837883798380838183828383838483858386838783888389839083918392839383948395839683978398839984008401840284038404840584068407840884098410841184128413841484158416841784188419842084218422842384248425842684278428842984308431843284338434843584368437843884398440844184428443844484458446844784488449845084518452845384548455845684578458845984608461846284638464846584668467846884698470847184728473847484758476847784788479848084818482848384848485848684878488848984908491849284938494849584968497849884998500850185028503850485058506850785088509851085118512851385148515851685178518851985208521852285238524852585268527852885298530853185328533853485358536853785388539854085418542854385448545854685478548854985508551855285538554855585568557855885598560856185628563856485658566856785688569857085718572857385748575857685778578857985808581858285838584858585868587858885898590859185928593859485958596859785988599860086018602860386048605860686078608860986108611861286138614861586168617861886198620862186228623862486258626862786288629863086318632863386348635863686378638863986408641864286438644864586468647864886498650865186528653865486558656865786588659866086618662866386648665866686678668866986708671867286738674867586768677867886798680868186828683868486858686868786888689869086918692869386948695869686978698869987008701870287038704870587068707870887098710871187128713871487158716871787188719872087218722872387248725872687278728872987308731873287338734873587368737873887398740874187428743874487458746874787488749875087518752875387548755875687578758875987608761876287638764876587668767876887698770877187728773877487758776877787788779878087818782878387848785878687878788878987908791879287938794879587968797879887998800880188028803880488058806880788088809881088118812881388148815881688178818881988208821882288238824882588268827882888298830883188328833883488358836883788388839884088418842884388448845884688478848884988508851885288538854885588568857885888598860886188628863886488658866886788688869887088718872887388748875887688778878887988808881888288838884888588868887888888898890889188928893889488958896889788988899890089018902890389048905890689078908890989108911891289138914891589168917891889198920892189228923892489258926892789288929893089318932893389348935893689378938893989408941894289438944894589468947894889498950895189528953895489558956895789588959896089618962896389648965896689678968896989708971897289738974897589768977897889798980898189828983898489858986898789888989899089918992899389948995899689978998899990009001900290039004900590069007900890099010901190129013901490159016901790189019902090219022902390249025902690279028902990309031903290339034903590369037903890399040904190429043904490459046904790489049905090519052905390549055905690579058905990609061906290639064906590669067906890699070907190729073907490759076907790789079908090819082908390849085908690879088908990909091909290939094909590969097909890999100910191029103910491059106910791089109911091119112911391149115911691179118911991209121912291239124912591269127912891299130913191329133913491359136913791389139914091419142914391449145914691479148914991509151915291539154915591569157915891599160916191629163916491659166916791689169917091719172917391749175917691779178917991809181918291839184918591869187918891899190919191929193919491959196919791989199920092019202920392049205920692079208920992109211921292139214921592169217921892199220922192229223922492259226922792289229923092319232923392349235923692379238923992409241924292439244924592469247924892499250925192529253925492559256925792589259926092619262926392649265926692679268926992709271927292739274927592769277927892799280928192829283928492859286928792889289929092919292929392949295929692979298929993009301930293039304930593069307930893099310931193129313931493159316931793189319932093219322932393249325932693279328932993309331933293339334933593369337933893399340934193429343934493459346934793489349935093519352935393549355935693579358935993609361936293639364936593669367936893699370937193729373937493759376937793789379938093819382938393849385938693879388938993909391939293939394939593969397939893999400940194029403940494059406940794089409941094119412941394149415941694179418941994209421942294239424942594269427942894299430943194329433943494359436943794389439944094419442944394449445944694479448944994509451945294539454945594569457945894599460946194629463946494659466946794689469947094719472947394749475947694779478947994809481948294839484948594869487948894899490949194929493949494959496949794989499950095019502950395049505950695079508950995109511951295139514951595169517951895199520952195229523952495259526952795289529953095319532953395349535953695379538953995409541954295439544954595469547954895499550955195529553955495559556955795589559956095619562956395649565956695679568956995709571957295739574957595769577957895799580958195829583958495859586958795889589959095919592959395949595959695979598959996009601960296039604960596069607960896099610961196129613961496159616961796189619962096219622962396249625962696279628962996309631963296339634963596369637963896399640964196429643964496459646964796489649965096519652965396549655965696579658965996609661966296639664966596669667966896699670967196729673967496759676967796789679968096819682968396849685968696879688968996909691969296939694969596969697969896999700970197029703970497059706970797089709971097119712971397149715971697179718971997209721972297239724972597269727972897299730973197329733973497359736973797389739974097419742974397449745974697479748974997509751975297539754975597569757975897599760976197629763976497659766976797689769977097719772977397749775977697779778977997809781978297839784978597869787978897899790979197929793979497959796979797989799980098019802980398049805980698079808980998109811981298139814981598169817981898199820982198229823982498259826982798289829983098319832983398349835983698379838983998409841984298439844984598469847984898499850985198529853985498559856985798589859986098619862986398649865986698679868986998709871987298739874987598769877987898799880988198829883988498859886988798889889989098919892989398949895989698979898989999009901990299039904990599069907990899099910991199129913991499159916991799189919992099219922992399249925992699279928992999309931993299339934993599369937993899399940994199429943994499459946994799489949995099519952995399549955995699579958995999609961996299639964996599669967996899699970997199729973997499759976997799789979998099819982998399849985998699879988998999909991999299939994999599969997999899991000010001100021000310004100051000610007100081000910010100111001210013100141001510016100171001810019100201002110022100231002410025100261002710028100291003010031100321003310034100351003610037100381003910040100411004210043100441004510046100471004810049100501005110052100531005410055100561005710058100591006010061100621006310064100651006610067100681006910070100711007210073100741007510076100771007810079100801008110082100831008410085100861008710088100891009010091100921009310094100951009610097100981009910100101011010210103101041010510106101071010810109101101011110112101131011410115101161011710118101191012010121101221012310124101251012610127101281012910130101311013210133101341013510136101371013810139101401014110142101431014410145101461014710148101491015010151101521015310154101551015610157101581015910160101611016210163101641016510166101671016810169101701017110172101731017410175101761017710178101791018010181101821018310184101851018610187101881018910190101911019210193101941019510196101971019810199102001020110202102031020410205102061020710208102091021010211102121021310214102151021610217102181021910220102211022210223102241022510226102271022810229102301023110232102331023410235102361023710238102391024010241102421024310244102451024610247102481024910250102511025210253102541025510256102571025810259102601026110262102631026410265102661026710268102691027010271102721027310274102751027610277102781027910280102811028210283102841028510286102871028810289102901029110292102931029410295102961029710298102991030010301103021030310304103051030610307103081030910310103111031210313103141031510316103171031810319103201032110322103231032410325103261032710328103291033010331103321033310334103351033610337103381033910340103411034210343103441034510346103471034810349103501035110352103531035410355103561035710358103591036010361103621036310364103651036610367103681036910370103711037210373103741037510376103771037810379103801038110382103831038410385103861038710388103891039010391103921039310394103951039610397103981039910400104011040210403104041040510406104071040810409104101041110412104131041410415104161041710418104191042010421104221042310424104251042610427104281042910430104311043210433104341043510436104371043810439104401044110442104431044410445104461044710448104491045010451104521045310454104551045610457104581045910460104611046210463104641046510466104671046810469104701047110472104731047410475104761047710478104791048010481104821048310484104851048610487104881048910490104911049210493104941049510496104971049810499105001050110502105031050410505105061050710508105091051010511105121051310514105151051610517105181051910520105211052210523105241052510526105271052810529105301053110532105331053410535105361053710538105391054010541105421054310544105451054610547105481054910550105511055210553105541055510556105571055810559105601056110562105631056410565105661056710568105691057010571105721057310574105751057610577105781057910580105811058210583105841058510586105871058810589105901059110592105931059410595105961059710598105991060010601106021060310604106051060610607106081060910610106111061210613106141061510616106171061810619106201062110622106231062410625106261062710628106291063010631106321063310634106351063610637106381063910640106411064210643106441064510646106471064810649106501065110652106531065410655106561065710658106591066010661106621066310664106651066610667106681066910670106711067210673106741067510676106771067810679106801068110682106831068410685106861068710688106891069010691106921069310694106951069610697106981069910700107011070210703107041070510706107071070810709107101071110712107131071410715107161071710718107191072010721107221072310724107251072610727107281072910730107311073210733107341073510736107371073810739107401074110742107431074410745107461074710748107491075010751107521075310754107551075610757107581075910760107611076210763107641076510766107671076810769107701077110772107731077410775107761077710778107791078010781107821078310784107851078610787107881078910790107911079210793107941079510796107971079810799108001080110802108031080410805108061080710808108091081010811108121081310814108151081610817108181081910820108211082210823108241082510826108271082810829108301083110832108331083410835108361083710838108391084010841108421084310844108451084610847108481084910850108511085210853108541085510856108571085810859108601086110862108631086410865108661086710868108691087010871108721087310874108751087610877108781087910880108811088210883108841088510886108871088810889108901089110892108931089410895108961089710898108991090010901109021090310904109051090610907109081090910910109111091210913109141091510916109171091810919109201092110922109231092410925109261092710928109291093010931109321093310934109351093610937109381093910940109411094210943109441094510946109471094810949109501095110952109531095410955109561095710958109591096010961109621096310964109651096610967109681096910970109711097210973109741097510976109771097810979109801098110982109831098410985109861098710988109891099010991109921099310994109951099610997109981099911000110011100211003110041100511006110071100811009110101101111012110131101411015110161101711018110191102011021110221102311024110251102611027110281102911030110311103211033110341103511036110371103811039110401104111042110431104411045110461104711048110491105011051110521105311054110551105611057110581105911060110611106211063110641106511066110671106811069110701107111072110731107411075110761107711078110791108011081110821108311084110851108611087110881108911090110911109211093110941109511096110971109811099111001110111102111031110411105111061110711108111091111011111111121111311114111151111611117111181111911120111211112211123111241112511126111271112811129111301113111132111331113411135111361113711138111391114011141111421114311144111451114611147111481114911150111511115211153111541115511156111571115811159111601116111162111631116411165111661116711168111691117011171111721117311174111751117611177111781117911180111811118211183111841118511186111871118811189111901119111192111931119411195111961119711198111991120011201112021120311204112051120611207112081120911210112111121211213112141121511216112171121811219112201122111222112231122411225112261122711228112291123011231112321123311234112351123611237112381123911240112411124211243112441124511246112471124811249112501125111252112531125411255112561125711258112591126011261112621126311264112651126611267112681126911270112711127211273112741127511276112771127811279112801128111282112831128411285112861128711288112891129011291112921129311294112951129611297112981129911300113011130211303113041130511306113071130811309113101131111312113131131411315113161131711318113191132011321113221132311324113251132611327113281132911330113311133211333113341133511336113371133811339113401134111342113431134411345113461134711348113491135011351113521135311354113551135611357113581135911360113611136211363113641136511366113671136811369113701137111372113731137411375113761137711378113791138011381113821138311384113851138611387113881138911390113911139211393113941139511396113971139811399114001140111402114031140411405114061140711408114091141011411114121141311414114151141611417114181141911420114211142211423114241142511426114271142811429114301143111432114331143411435114361143711438114391144011441114421144311444114451144611447114481144911450114511145211453114541145511456114571145811459114601146111462114631146411465114661146711468114691147011471114721147311474114751147611477114781147911480114811148211483114841148511486114871148811489114901149111492114931149411495114961149711498114991150011501115021150311504115051150611507115081150911510115111151211513115141151511516115171151811519115201152111522115231152411525115261152711528115291153011531115321153311534115351153611537115381153911540115411154211543115441154511546115471154811549115501155111552115531155411555115561155711558115591156011561115621156311564115651156611567115681156911570115711157211573115741157511576115771157811579115801158111582115831158411585115861158711588115891159011591115921159311594115951159611597115981159911600116011160211603116041160511606116071160811609116101161111612116131161411615116161161711618116191162011621116221162311624116251162611627116281162911630116311163211633116341163511636116371163811639116401164111642116431164411645116461164711648116491165011651116521165311654116551165611657116581165911660116611166211663116641166511666116671166811669116701167111672116731167411675116761167711678116791168011681116821168311684116851168611687116881168911690116911169211693116941169511696116971169811699117001170111702117031170411705117061170711708117091171011711117121171311714117151171611717117181171911720117211172211723117241172511726117271172811729117301173111732117331173411735117361173711738117391174011741117421174311744117451174611747117481174911750117511175211753117541175511756117571175811759117601176111762117631176411765117661176711768117691177011771117721177311774117751177611777117781177911780117811178211783117841178511786117871178811789117901179111792117931179411795117961179711798117991180011801118021180311804118051180611807118081180911810118111181211813118141181511816118171181811819118201182111822118231182411825118261182711828118291183011831118321183311834118351183611837118381183911840118411184211843118441184511846118471184811849118501185111852118531185411855118561185711858118591186011861118621186311864118651186611867118681186911870118711187211873118741187511876118771187811879118801188111882118831188411885118861188711888118891189011891118921189311894118951189611897118981189911900119011190211903119041190511906119071190811909119101191111912119131191411915119161191711918119191192011921119221192311924119251192611927119281192911930119311193211933119341193511936119371193811939119401194111942119431194411945119461194711948119491195011951119521195311954119551195611957119581195911960119611196211963119641196511966119671196811969119701197111972119731197411975119761197711978119791198011981119821198311984119851198611987119881198911990119911199211993119941199511996119971199811999120001200112002120031200412005120061200712008120091201012011120121201312014120151201612017120181201912020120211202212023120241202512026120271202812029120301203112032120331203412035120361203712038120391204012041120421204312044120451204612047120481204912050120511205212053120541205512056120571205812059120601206112062120631206412065120661206712068120691207012071120721207312074120751207612077120781207912080120811208212083120841208512086120871208812089120901209112092120931209412095120961209712098120991210012101121021210312104121051210612107121081210912110121111211212113121141211512116121171211812119121201212112122121231212412125121261212712128121291213012131121321213312134121351213612137121381213912140121411214212143121441214512146121471214812149121501215112152121531215412155121561215712158121591216012161121621216312164121651216612167121681216912170121711217212173121741217512176121771217812179121801218112182121831218412185121861218712188121891219012191121921219312194121951219612197121981219912200122011220212203122041220512206122071220812209122101221112212122131221412215122161221712218122191222012221122221222312224122251222612227122281222912230122311223212233122341223512236122371223812239122401224112242122431224412245122461224712248122491225012251122521225312254122551225612257122581225912260122611226212263122641226512266122671226812269122701227112272122731227412275122761227712278122791228012281122821228312284122851228612287122881228912290122911229212293122941229512296122971229812299123001230112302123031230412305123061230712308123091231012311123121231312314123151231612317123181231912320123211232212323123241232512326123271232812329123301233112332123331233412335123361233712338123391234012341123421234312344123451234612347123481234912350123511235212353123541235512356123571235812359123601236112362123631236412365123661236712368123691237012371123721237312374123751237612377123781237912380123811238212383123841238512386123871238812389123901239112392123931239412395123961239712398123991240012401124021240312404124051240612407124081240912410124111241212413124141241512416124171241812419124201242112422124231242412425124261242712428124291243012431124321243312434124351243612437124381243912440124411244212443124441244512446124471244812449124501245112452124531245412455124561245712458124591246012461124621246312464124651246612467124681246912470124711247212473124741247512476124771247812479124801248112482124831248412485124861248712488124891249012491124921249312494124951249612497124981249912500125011250212503125041250512506125071250812509125101251112512125131251412515125161251712518125191252012521125221252312524125251252612527125281252912530125311253212533125341253512536125371253812539125401254112542125431254412545125461254712548125491255012551125521255312554125551255612557125581255912560125611256212563125641256512566125671256812569125701257112572125731257412575125761257712578125791258012581125821258312584125851258612587125881258912590125911259212593125941259512596125971259812599126001260112602126031260412605126061260712608126091261012611126121261312614126151261612617126181261912620126211262212623126241262512626126271262812629126301263112632126331263412635126361263712638126391264012641126421264312644126451264612647126481264912650126511265212653126541265512656126571265812659126601266112662126631266412665126661266712668126691267012671126721267312674126751267612677126781267912680126811268212683126841268512686126871268812689126901269112692126931269412695126961269712698126991270012701127021270312704127051270612707127081270912710127111271212713127141271512716127171271812719127201272112722127231272412725127261272712728127291273012731127321273312734127351273612737127381273912740127411274212743127441274512746127471274812749127501275112752127531275412755127561275712758127591276012761127621276312764127651276612767127681276912770127711277212773127741277512776127771277812779127801278112782127831278412785127861278712788127891279012791127921279312794127951279612797127981279912800128011280212803128041280512806128071280812809128101281112812128131281412815128161281712818128191282012821128221282312824128251282612827128281282912830128311283212833128341283512836128371283812839128401284112842128431284412845128461284712848128491285012851128521285312854128551285612857128581285912860128611286212863128641286512866128671286812869128701287112872128731287412875128761287712878128791288012881128821288312884128851288612887128881288912890128911289212893128941289512896128971289812899129001290112902129031290412905129061290712908129091291012911129121291312914129151291612917129181291912920129211292212923129241292512926129271292812929129301293112932129331293412935129361293712938129391294012941129421294312944129451294612947129481294912950129511295212953129541295512956129571295812959129601296112962129631296412965129661296712968129691297012971129721297312974129751297612977129781297912980129811298212983129841298512986129871298812989129901299112992129931299412995129961299712998129991300013001130021300313004130051300613007130081300913010130111301213013130141301513016130171301813019130201302113022130231302413025130261302713028130291303013031130321303313034130351303613037130381303913040130411304213043130441304513046130471304813049130501305113052130531305413055130561305713058130591306013061130621306313064130651306613067130681306913070130711307213073130741307513076130771307813079130801308113082130831308413085130861308713088130891309013091130921309313094130951309613097130981309913100131011310213103131041310513106131071310813109131101311113112131131311413115131161311713118131191312013121131221312313124131251312613127131281312913130131311313213133131341313513136131371313813139131401314113142131431314413145131461314713148131491315013151131521315313154131551315613157131581315913160131611316213163131641316513166131671316813169131701317113172131731317413175131761317713178131791318013181131821318313184131851318613187131881318913190131911319213193131941319513196131971319813199132001320113202132031320413205132061320713208132091321013211132121321313214132151321613217132181321913220132211322213223132241322513226132271322813229132301323113232132331323413235132361323713238132391324013241132421324313244132451324613247132481324913250132511325213253132541325513256132571325813259132601326113262132631326413265132661326713268132691327013271132721327313274132751327613277132781327913280132811328213283132841328513286132871328813289132901329113292132931329413295132961329713298132991330013301133021330313304133051330613307133081330913310133111331213313133141331513316133171331813319133201332113322133231332413325133261332713328133291333013331133321333313334133351333613337133381333913340133411334213343133441334513346133471334813349133501335113352133531335413355133561335713358133591336013361133621336313364133651336613367133681336913370133711337213373133741337513376133771337813379133801338113382133831338413385133861338713388133891339013391133921339313394133951339613397133981339913400134011340213403134041340513406134071340813409134101341113412134131341413415134161341713418134191342013421134221342313424134251342613427134281342913430134311343213433134341343513436134371343813439134401344113442134431344413445134461344713448134491345013451134521345313454134551345613457134581345913460134611346213463134641346513466134671346813469134701347113472134731347413475134761347713478134791348013481134821348313484134851348613487134881348913490134911349213493134941349513496134971349813499135001350113502135031350413505135061350713508135091351013511135121351313514135151351613517135181351913520135211352213523135241352513526135271352813529135301353113532135331353413535135361353713538135391354013541135421354313544135451354613547135481354913550135511355213553135541355513556135571355813559135601356113562135631356413565135661356713568135691357013571135721357313574135751357613577135781357913580135811358213583135841358513586135871358813589135901359113592135931359413595135961359713598135991360013601136021360313604136051360613607136081360913610136111361213613136141361513616136171361813619136201362113622136231362413625136261362713628136291363013631136321363313634136351363613637136381363913640136411364213643136441364513646136471364813649136501365113652136531365413655136561365713658136591366013661136621366313664136651366613667136681366913670136711367213673136741367513676136771367813679136801368113682136831368413685136861368713688136891369013691136921369313694136951369613697136981369913700137011370213703137041370513706137071370813709137101371113712137131371413715137161371713718137191372013721137221372313724137251372613727137281372913730137311373213733137341373513736137371373813739137401374113742137431374413745137461374713748137491375013751137521375313754137551375613757137581375913760137611376213763137641376513766137671376813769137701377113772137731377413775137761377713778137791378013781137821378313784137851378613787137881378913790137911379213793137941379513796137971379813799138001380113802138031380413805138061380713808138091381013811138121381313814138151381613817138181381913820138211382213823138241382513826138271382813829138301383113832138331383413835138361383713838138391384013841138421384313844138451384613847138481384913850138511385213853138541385513856138571385813859138601386113862138631386413865138661386713868138691387013871138721387313874138751387613877138781387913880138811388213883138841388513886138871388813889138901389113892138931389413895138961389713898138991390013901139021390313904139051390613907139081390913910139111391213913139141391513916139171391813919139201392113922139231392413925139261392713928139291393013931139321393313934139351393613937139381393913940139411394213943139441394513946139471394813949139501395113952139531395413955139561395713958139591396013961139621396313964139651396613967139681396913970139711397213973139741397513976139771397813979139801398113982139831398413985139861398713988139891399013991139921399313994139951399613997139981399914000140011400214003140041400514006140071400814009140101401114012140131401414015140161401714018140191402014021140221402314024140251402614027140281402914030140311403214033140341403514036140371403814039140401404114042140431404414045140461404714048140491405014051140521405314054140551405614057140581405914060140611406214063140641406514066140671406814069140701407114072140731407414075140761407714078140791408014081140821408314084140851408614087140881408914090140911409214093140941409514096140971409814099141001410114102141031410414105141061410714108141091411014111141121411314114141151411614117141181411914120141211412214123141241412514126141271412814129141301413114132141331413414135141361413714138141391414014141141421414314144141451414614147141481414914150141511415214153141541415514156141571415814159141601416114162141631416414165141661416714168141691417014171141721417314174141751417614177141781417914180141811418214183141841418514186141871418814189141901419114192141931419414195141961419714198141991420014201142021420314204142051420614207142081420914210142111421214213142141421514216142171421814219142201422114222142231422414225142261422714228142291423014231142321423314234142351423614237142381423914240142411424214243142441424514246142471424814249142501425114252142531425414255142561425714258142591426014261142621426314264142651426614267142681426914270142711427214273142741427514276142771427814279142801428114282142831428414285142861428714288142891429014291142921429314294142951429614297142981429914300143011430214303143041430514306143071430814309143101431114312143131431414315143161431714318143191432014321143221432314324143251432614327143281432914330143311433214333143341433514336143371433814339143401434114342143431434414345143461434714348143491435014351143521435314354143551435614357143581435914360143611436214363143641436514366143671436814369143701437114372143731437414375143761437714378143791438014381143821438314384143851438614387143881438914390143911439214393143941439514396143971439814399144001440114402144031440414405144061440714408144091441014411144121441314414144151441614417144181441914420144211442214423144241442514426144271442814429144301443114432144331443414435144361443714438144391444014441144421444314444144451444614447144481444914450144511445214453144541445514456144571445814459144601446114462144631446414465144661446714468144691447014471144721447314474144751447614477144781447914480144811448214483144841448514486144871448814489144901449114492144931449414495144961449714498144991450014501145021450314504145051450614507145081450914510145111451214513145141451514516145171451814519145201452114522145231452414525145261452714528145291453014531145321453314534145351453614537145381453914540145411454214543145441454514546145471454814549145501455114552145531455414555145561455714558145591456014561145621456314564145651456614567145681456914570145711457214573145741457514576145771457814579145801458114582145831458414585145861458714588145891459014591145921459314594145951459614597145981459914600146011460214603146041460514606146071460814609146101461114612146131461414615146161461714618146191462014621146221462314624146251462614627146281462914630146311463214633146341463514636146371463814639146401464114642146431464414645146461464714648146491465014651146521465314654146551465614657146581465914660146611466214663146641466514666146671466814669146701467114672146731467414675146761467714678146791468014681146821468314684146851468614687146881468914690146911469214693146941469514696146971469814699147001470114702147031470414705147061470714708147091471014711147121471314714147151471614717147181471914720147211472214723147241472514726147271472814729147301473114732147331473414735147361473714738147391474014741147421474314744147451474614747147481474914750147511475214753147541475514756147571475814759147601476114762147631476414765147661476714768147691477014771147721477314774147751477614777147781477914780147811478214783147841478514786147871478814789147901479114792147931479414795147961479714798147991480014801148021480314804148051480614807148081480914810148111481214813148141481514816148171481814819148201482114822148231482414825148261482714828148291483014831148321483314834148351483614837148381483914840148411484214843148441484514846148471484814849148501485114852148531485414855148561485714858148591486014861148621486314864148651486614867148681486914870148711487214873148741487514876148771487814879148801488114882148831488414885148861488714888148891489014891148921489314894148951489614897148981489914900149011490214903149041490514906149071490814909149101491114912149131491414915149161491714918149191492014921149221492314924149251492614927149281492914930149311493214933149341493514936149371493814939149401494114942149431494414945149461494714948149491495014951149521495314954149551495614957149581495914960149611496214963149641496514966149671496814969149701497114972149731497414975149761497714978149791498014981149821498314984149851498614987149881498914990149911499214993149941499514996149971499814999150001500115002150031500415005150061500715008150091501015011150121501315014150151501615017150181501915020150211502215023150241502515026150271502815029150301503115032150331503415035150361503715038150391504015041150421504315044150451504615047150481504915050150511505215053150541505515056150571505815059150601506115062150631506415065150661506715068150691507015071150721507315074150751507615077150781507915080150811508215083150841508515086150871508815089150901509115092150931509415095150961509715098150991510015101151021510315104151051510615107151081510915110151111511215113151141511515116151171511815119151201512115122151231512415125151261512715128151291513015131151321513315134151351513615137151381513915140151411514215143151441514515146151471514815149151501515115152151531515415155151561515715158151591516015161151621516315164151651516615167151681516915170151711517215173151741517515176151771517815179151801518115182151831518415185151861518715188151891519015191151921519315194151951519615197151981519915200152011520215203152041520515206152071520815209152101521115212152131521415215152161521715218152191522015221152221522315224152251522615227152281522915230152311523215233152341523515236152371523815239152401524115242152431524415245152461524715248152491525015251152521525315254152551525615257152581525915260152611526215263152641526515266152671526815269152701527115272152731527415275152761527715278152791528015281152821528315284152851528615287152881528915290152911529215293152941529515296152971529815299153001530115302153031530415305153061530715308153091531015311153121531315314153151531615317153181531915320153211532215323153241532515326153271532815329153301533115332153331533415335153361533715338153391534015341153421534315344153451534615347153481534915350153511535215353153541535515356153571535815359153601536115362153631536415365153661536715368153691537015371153721537315374153751537615377153781537915380153811538215383153841538515386153871538815389153901539115392153931539415395153961539715398153991540015401154021540315404154051540615407154081540915410154111541215413154141541515416154171541815419154201542115422154231542415425154261542715428154291543015431154321543315434154351543615437154381543915440154411544215443154441544515446154471544815449154501545115452154531545415455154561545715458154591546015461154621546315464154651546615467154681546915470154711547215473154741547515476154771547815479154801548115482154831548415485154861548715488154891549015491154921549315494154951549615497154981549915500155011550215503155041550515506155071550815509155101551115512155131551415515155161551715518155191552015521155221552315524155251552615527155281552915530155311553215533155341553515536155371553815539155401554115542155431554415545155461554715548155491555015551155521555315554155551555615557155581555915560155611556215563155641556515566155671556815569155701557115572155731557415575155761557715578155791558015581155821558315584155851558615587155881558915590155911559215593155941559515596155971559815599156001560115602156031560415605156061560715608156091561015611156121561315614156151561615617156181561915620156211562215623156241562515626156271562815629156301563115632156331563415635156361563715638156391564015641156421564315644156451564615647156481564915650156511565215653156541565515656156571565815659156601566115662156631566415665156661566715668156691567015671156721567315674156751567615677156781567915680156811568215683156841568515686156871568815689156901569115692156931569415695156961569715698156991570015701157021570315704157051570615707157081570915710157111571215713157141571515716157171571815719157201572115722157231572415725157261572715728157291573015731157321573315734157351573615737157381573915740157411574215743157441574515746157471574815749157501575115752157531575415755157561575715758157591576015761157621576315764157651576615767157681576915770157711577215773157741577515776157771577815779157801578115782157831578415785157861578715788157891579015791157921579315794157951579615797157981579915800158011580215803158041580515806158071580815809158101581115812158131581415815158161581715818158191582015821158221582315824158251582615827158281582915830158311583215833158341583515836158371583815839158401584115842158431584415845158461584715848158491585015851158521585315854158551585615857158581585915860158611586215863158641586515866158671586815869158701587115872158731587415875158761587715878158791588015881158821588315884158851588615887158881588915890158911589215893158941589515896158971589815899159001590115902159031590415905159061590715908159091591015911159121591315914159151591615917159181591915920159211592215923159241592515926159271592815929159301593115932159331593415935159361593715938159391594015941159421594315944159451594615947159481594915950159511595215953159541595515956159571595815959159601596115962159631596415965159661596715968159691597015971159721597315974159751597615977159781597915980159811598215983159841598515986159871598815989159901599115992159931599415995159961599715998159991600016001160021600316004160051600616007160081600916010160111601216013160141601516016160171601816019160201602116022160231602416025160261602716028160291603016031160321603316034160351603616037160381603916040160411604216043160441604516046160471604816049160501605116052160531605416055160561605716058160591606016061160621606316064160651606616067160681606916070160711607216073160741607516076160771607816079160801608116082160831608416085160861608716088160891609016091160921609316094160951609616097160981609916100161011610216103161041610516106161071610816109161101611116112161131611416115161161611716118161191612016121161221612316124161251612616127161281612916130161311613216133161341613516136161371613816139161401614116142161431614416145161461614716148161491615016151161521615316154161551615616157161581615916160161611616216163161641616516166161671616816169161701617116172161731617416175161761617716178161791618016181161821618316184161851618616187161881618916190161911619216193161941619516196161971619816199162001620116202162031620416205162061620716208162091621016211162121621316214162151621616217162181621916220162211622216223162241622516226162271622816229162301623116232162331623416235162361623716238162391624016241162421624316244162451624616247162481624916250162511625216253162541625516256162571625816259162601626116262162631626416265162661626716268162691627016271162721627316274162751627616277162781627916280162811628216283162841628516286162871628816289162901629116292162931629416295162961629716298162991630016301163021630316304163051630616307163081630916310163111631216313163141631516316163171631816319163201632116322163231632416325163261632716328163291633016331163321633316334163351633616337163381633916340163411634216343163441634516346163471634816349163501635116352163531635416355163561635716358163591636016361163621636316364163651636616367163681636916370163711637216373163741637516376163771637816379163801638116382163831638416385163861638716388163891639016391163921639316394163951639616397163981639916400164011640216403164041640516406164071640816409164101641116412164131641416415164161641716418164191642016421164221642316424164251642616427164281642916430164311643216433164341643516436164371643816439164401644116442164431644416445164461644716448164491645016451164521645316454164551645616457164581645916460164611646216463164641646516466164671646816469164701647116472164731647416475164761647716478164791648016481164821648316484164851648616487164881648916490164911649216493164941649516496164971649816499165001650116502165031650416505165061650716508165091651016511165121651316514165151651616517165181651916520165211652216523165241652516526165271652816529165301653116532165331653416535165361653716538165391654016541165421654316544165451654616547165481654916550165511655216553165541655516556165571655816559165601656116562165631656416565165661656716568165691657016571165721657316574165751657616577165781657916580165811658216583165841658516586165871658816589165901659116592165931659416595165961659716598165991660016601166021660316604166051660616607166081660916610166111661216613166141661516616166171661816619166201662116622166231662416625166261662716628166291663016631166321663316634166351663616637166381663916640166411664216643166441664516646166471664816649166501665116652166531665416655166561665716658166591666016661166621666316664166651666616667166681666916670166711667216673166741667516676166771667816679166801668116682166831668416685166861668716688166891669016691166921669316694166951669616697166981669916700167011670216703167041670516706167071670816709167101671116712167131671416715167161671716718167191672016721167221672316724167251672616727167281672916730167311673216733167341673516736167371673816739167401674116742167431674416745167461674716748167491675016751167521675316754167551675616757167581675916760167611676216763167641676516766167671676816769167701677116772167731677416775167761677716778167791678016781167821678316784167851678616787167881678916790167911679216793167941679516796167971679816799168001680116802168031680416805168061680716808168091681016811168121681316814168151681616817168181681916820168211682216823168241682516826168271682816829168301683116832168331683416835168361683716838168391684016841168421684316844168451684616847168481684916850168511685216853168541685516856168571685816859168601686116862168631686416865168661686716868168691687016871168721687316874168751687616877168781687916880168811688216883168841688516886168871688816889168901689116892168931689416895168961689716898168991690016901169021690316904169051690616907169081690916910169111691216913169141691516916169171691816919169201692116922169231692416925169261692716928169291693016931169321693316934169351693616937169381693916940169411694216943169441694516946169471694816949169501695116952169531695416955169561695716958169591696016961169621696316964169651696616967169681696916970169711697216973169741697516976169771697816979169801698116982169831698416985169861698716988169891699016991169921699316994169951699616997169981699917000170011700217003170041700517006170071700817009170101701117012170131701417015170161701717018170191702017021170221702317024170251702617027170281702917030170311703217033170341703517036170371703817039170401704117042170431704417045170461704717048170491705017051170521705317054170551705617057170581705917060170611706217063170641706517066170671706817069170701707117072170731707417075170761707717078170791708017081170821708317084170851708617087170881708917090170911709217093170941709517096170971709817099171001710117102171031710417105171061710717108171091711017111171121711317114171151711617117171181711917120171211712217123171241712517126171271712817129171301713117132171331713417135171361713717138171391714017141171421714317144171451714617147171481714917150171511715217153171541715517156171571715817159171601716117162171631716417165171661716717168171691717017171171721717317174171751717617177171781717917180171811718217183171841718517186171871718817189171901719117192171931719417195171961719717198171991720017201172021720317204172051720617207172081720917210172111721217213172141721517216172171721817219172201722117222172231722417225172261722717228172291723017231172321723317234172351723617237172381723917240172411724217243172441724517246172471724817249172501725117252172531725417255172561725717258172591726017261172621726317264172651726617267172681726917270172711727217273172741727517276172771727817279172801728117282172831728417285172861728717288172891729017291172921729317294172951729617297172981729917300173011730217303173041730517306173071730817309173101731117312173131731417315173161731717318173191732017321173221732317324173251732617327173281732917330173311733217333173341733517336173371733817339173401734117342173431734417345173461734717348173491735017351173521735317354173551735617357173581735917360173611736217363173641736517366173671736817369173701737117372173731737417375173761737717378173791738017381173821738317384173851738617387173881738917390173911739217393173941739517396173971739817399174001740117402174031740417405174061740717408174091741017411174121741317414174151741617417174181741917420174211742217423174241742517426174271742817429174301743117432174331743417435174361743717438174391744017441174421744317444174451744617447174481744917450174511745217453174541745517456174571745817459174601746117462174631746417465174661746717468174691747017471174721747317474174751747617477174781747917480174811748217483174841748517486174871748817489174901749117492174931749417495174961749717498174991750017501175021750317504175051750617507175081750917510175111751217513175141751517516175171751817519175201752117522175231752417525175261752717528175291753017531175321753317534175351753617537175381753917540175411754217543175441754517546175471754817549175501755117552175531755417555175561755717558175591756017561175621756317564175651756617567175681756917570175711757217573175741757517576175771757817579175801758117582175831758417585175861758717588175891759017591175921759317594175951759617597175981759917600176011760217603176041760517606176071760817609176101761117612176131761417615176161761717618176191762017621176221762317624176251762617627176281762917630176311763217633176341763517636176371763817639176401764117642176431764417645176461764717648176491765017651176521765317654176551765617657176581765917660176611766217663176641766517666176671766817669176701767117672176731767417675176761767717678176791768017681176821768317684176851768617687176881768917690176911769217693176941769517696176971769817699177001770117702177031770417705177061770717708177091771017711177121771317714177151771617717177181771917720177211772217723177241772517726177271772817729177301773117732177331773417735177361773717738177391774017741177421774317744177451774617747177481774917750177511775217753177541775517756177571775817759177601776117762177631776417765177661776717768177691777017771177721777317774177751777617777177781777917780177811778217783177841778517786177871778817789177901779117792177931779417795177961779717798177991780017801178021780317804178051780617807178081780917810178111781217813178141781517816178171781817819178201782117822178231782417825178261782717828178291783017831178321783317834178351783617837178381783917840178411784217843178441784517846178471784817849178501785117852178531785417855178561785717858178591786017861178621786317864178651786617867178681786917870178711787217873178741787517876178771787817879178801788117882178831788417885178861788717888178891789017891178921789317894178951789617897178981789917900179011790217903179041790517906179071790817909179101791117912179131791417915179161791717918179191792017921179221792317924179251792617927179281792917930179311793217933179341793517936179371793817939179401794117942179431794417945179461794717948179491795017951179521795317954179551795617957179581795917960179611796217963179641796517966179671796817969179701797117972179731797417975179761797717978179791798017981179821798317984179851798617987179881798917990179911799217993179941799517996179971799817999180001800118002180031800418005180061800718008180091801018011180121801318014180151801618017180181801918020180211802218023180241802518026180271802818029180301803118032180331803418035180361803718038180391804018041180421804318044180451804618047180481804918050180511805218053180541805518056180571805818059180601806118062180631806418065180661806718068180691807018071180721807318074180751807618077180781807918080180811808218083180841808518086180871808818089180901809118092180931809418095180961809718098180991810018101181021810318104181051810618107181081810918110181111811218113181141811518116181171811818119181201812118122181231812418125181261812718128181291813018131181321813318134181351813618137181381813918140181411814218143181441814518146181471814818149181501815118152181531815418155181561815718158181591816018161181621816318164181651816618167181681816918170181711817218173181741817518176181771817818179181801818118182181831818418185181861818718188181891819018191181921819318194181951819618197181981819918200182011820218203182041820518206182071820818209182101821118212182131821418215182161821718218182191822018221182221822318224182251822618227182281822918230182311823218233182341823518236182371823818239182401824118242182431824418245182461824718248182491825018251182521825318254182551825618257182581825918260182611826218263182641826518266182671826818269182701827118272182731827418275182761827718278182791828018281182821828318284182851828618287182881828918290182911829218293182941829518296182971829818299183001830118302183031830418305183061830718308183091831018311183121831318314183151831618317183181831918320183211832218323183241832518326183271832818329183301833118332183331833418335183361833718338183391834018341183421834318344183451834618347183481834918350183511835218353183541835518356183571835818359183601836118362183631836418365183661836718368183691837018371183721837318374183751837618377183781837918380183811838218383183841838518386183871838818389183901839118392183931839418395183961839718398183991840018401184021840318404184051840618407184081840918410184111841218413184141841518416184171841818419184201842118422184231842418425184261842718428184291843018431184321843318434184351843618437184381843918440184411844218443184441844518446184471844818449184501845118452184531845418455184561845718458184591846018461184621846318464184651846618467184681846918470184711847218473184741847518476184771847818479184801848118482184831848418485184861848718488184891849018491184921849318494184951849618497184981849918500185011850218503185041850518506185071850818509185101851118512185131851418515185161851718518185191852018521185221852318524185251852618527185281852918530185311853218533185341853518536185371853818539185401854118542185431854418545185461854718548185491855018551185521855318554185551855618557185581855918560185611856218563185641856518566185671856818569185701857118572185731857418575185761857718578185791858018581185821858318584185851858618587185881858918590185911859218593185941859518596185971859818599186001860118602186031860418605186061860718608186091861018611186121861318614186151861618617186181861918620186211862218623186241862518626186271862818629186301863118632186331863418635186361863718638186391864018641186421864318644186451864618647186481864918650186511865218653186541865518656186571865818659186601866118662186631866418665186661866718668186691867018671186721867318674186751867618677186781867918680186811868218683186841868518686186871868818689186901869118692186931869418695186961869718698186991870018701187021870318704187051870618707187081870918710187111871218713187141871518716187171871818719187201872118722187231872418725187261872718728187291873018731187321873318734187351873618737187381873918740187411874218743187441874518746187471874818749187501875118752187531875418755187561875718758187591876018761187621876318764187651876618767187681876918770187711877218773187741877518776187771877818779187801878118782187831878418785187861878718788187891879018791187921879318794187951879618797187981879918800188011880218803188041880518806188071880818809188101881118812188131881418815188161881718818188191882018821188221882318824188251882618827188281882918830188311883218833188341883518836188371883818839188401884118842188431884418845188461884718848188491885018851188521885318854188551885618857188581885918860188611886218863188641886518866188671886818869188701887118872188731887418875188761887718878188791888018881188821888318884188851888618887188881888918890188911889218893188941889518896188971889818899189001890118902189031890418905189061890718908189091891018911189121891318914189151891618917189181891918920189211892218923189241892518926189271892818929189301893118932189331893418935189361893718938189391894018941189421894318944189451894618947189481894918950189511895218953189541895518956189571895818959189601896118962189631896418965189661896718968189691897018971189721897318974189751897618977189781897918980189811898218983189841898518986189871898818989189901899118992189931899418995189961899718998189991900019001190021900319004190051900619007190081900919010190111901219013190141901519016190171901819019190201902119022190231902419025190261902719028190291903019031190321903319034190351903619037190381903919040190411904219043190441904519046190471904819049190501905119052190531905419055190561905719058190591906019061190621906319064190651906619067190681906919070190711907219073190741907519076190771907819079190801908119082190831908419085190861908719088190891909019091190921909319094190951909619097190981909919100191011910219103191041910519106191071910819109191101911119112191131911419115191161911719118191191912019121191221912319124191251912619127191281912919130191311913219133191341913519136191371913819139191401914119142191431914419145191461914719148191491915019151191521915319154191551915619157191581915919160191611916219163191641916519166191671916819169191701917119172191731917419175191761917719178191791918019181191821918319184191851918619187191881918919190191911919219193191941919519196191971919819199192001920119202192031920419205192061920719208192091921019211192121921319214192151921619217192181921919220192211922219223192241922519226192271922819229192301923119232192331923419235192361923719238192391924019241192421924319244192451924619247192481924919250192511925219253192541925519256192571925819259192601926119262192631926419265192661926719268192691927019271192721927319274192751927619277192781927919280192811928219283192841928519286192871928819289192901929119292192931929419295192961929719298192991930019301193021930319304193051930619307193081930919310193111931219313193141931519316193171931819319193201932119322193231932419325193261932719328193291933019331193321933319334193351933619337193381933919340193411934219343193441934519346193471934819349193501935119352193531935419355193561935719358193591936019361193621936319364193651936619367193681936919370193711937219373193741937519376193771937819379193801938119382193831938419385193861938719388193891939019391193921939319394193951939619397193981939919400194011940219403194041940519406194071940819409194101941119412194131941419415194161941719418194191942019421194221942319424194251942619427194281942919430194311943219433194341943519436194371943819439194401944119442194431944419445194461944719448194491945019451194521945319454194551945619457194581945919460194611946219463194641946519466194671946819469194701947119472194731947419475194761947719478194791948019481194821948319484194851948619487194881948919490194911949219493194941949519496194971949819499195001950119502195031950419505195061950719508195091951019511195121951319514195151951619517195181951919520195211952219523195241952519526195271952819529195301953119532195331953419535195361953719538195391954019541195421954319544195451954619547195481954919550195511955219553195541955519556195571955819559195601956119562195631956419565195661956719568195691957019571195721957319574195751957619577195781957919580195811958219583195841958519586195871958819589195901959119592195931959419595195961959719598195991960019601196021960319604196051960619607196081960919610196111961219613196141961519616196171961819619196201962119622196231962419625196261962719628196291963019631196321963319634196351963619637196381963919640196411964219643196441964519646196471964819649196501965119652196531965419655196561965719658196591966019661196621966319664196651966619667196681966919670196711967219673196741967519676196771967819679196801968119682196831968419685196861968719688196891969019691196921969319694196951969619697196981969919700197011970219703197041970519706197071970819709197101971119712197131971419715197161971719718197191972019721197221972319724197251972619727197281972919730197311973219733197341973519736197371973819739197401974119742197431974419745197461974719748197491975019751197521975319754197551975619757197581975919760197611976219763197641976519766197671976819769197701977119772197731977419775197761977719778197791978019781197821978319784197851978619787197881978919790197911979219793197941979519796197971979819799198001980119802198031980419805198061980719808198091981019811198121981319814198151981619817198181981919820198211982219823198241982519826198271982819829198301983119832198331983419835198361983719838198391984019841198421984319844198451984619847198481984919850198511985219853198541985519856198571985819859198601986119862198631986419865198661986719868198691987019871198721987319874198751987619877198781987919880198811988219883198841988519886198871988819889198901989119892198931989419895198961989719898198991990019901199021990319904199051990619907199081990919910199111991219913199141991519916199171991819919199201992119922199231992419925199261992719928199291993019931199321993319934199351993619937199381993919940199411994219943199441994519946199471994819949199501995119952199531995419955199561995719958199591996019961199621996319964199651996619967199681996919970199711997219973199741997519976199771997819979199801998119982199831998419985199861998719988199891999019991199921999319994199951999619997199981999920000200012000220003200042000520006200072000820009200102001120012200132001420015200162001720018200192002020021200222002320024200252002620027200282002920030200312003220033200342003520036200372003820039200402004120042200432004420045200462004720048200492005020051200522005320054200552005620057200582005920060200612006220063200642006520066200672006820069200702007120072200732007420075200762007720078200792008020081200822008320084200852008620087200882008920090200912009220093200942009520096200972009820099201002010120102201032010420105201062010720108201092011020111201122011320114201152011620117201182011920120201212012220123201242012520126201272012820129201302013120132201332013420135201362013720138201392014020141201422014320144201452014620147201482014920150201512015220153201542015520156201572015820159201602016120162201632016420165201662016720168201692017020171201722017320174201752017620177201782017920180201812018220183201842018520186201872018820189201902019120192201932019420195201962019720198201992020020201202022020320204202052020620207202082020920210202112021220213202142021520216202172021820219202202022120222202232022420225202262022720228202292023020231202322023320234202352023620237202382023920240202412024220243202442024520246202472024820249202502025120252202532025420255202562025720258202592026020261202622026320264202652026620267202682026920270202712027220273202742027520276202772027820279202802028120282202832028420285202862028720288202892029020291202922029320294202952029620297202982029920300203012030220303203042030520306203072030820309203102031120312203132031420315203162031720318203192032020321203222032320324203252032620327203282032920330203312033220333203342033520336203372033820339203402034120342203432034420345203462034720348203492035020351203522035320354203552035620357203582035920360203612036220363203642036520366203672036820369203702037120372203732037420375203762037720378203792038020381203822038320384203852038620387203882038920390203912039220393203942039520396203972039820399204002040120402204032040420405204062040720408204092041020411204122041320414204152041620417204182041920420204212042220423204242042520426204272042820429204302043120432204332043420435204362043720438204392044020441204422044320444204452044620447204482044920450204512045220453204542045520456204572045820459204602046120462204632046420465204662046720468204692047020471204722047320474204752047620477204782047920480204812048220483204842048520486204872048820489204902049120492204932049420495204962049720498204992050020501205022050320504205052050620507205082050920510205112051220513205142051520516205172051820519205202052120522205232052420525205262052720528205292053020531205322053320534205352053620537205382053920540205412054220543205442054520546205472054820549205502055120552205532055420555205562055720558205592056020561205622056320564205652056620567205682056920570205712057220573205742057520576205772057820579205802058120582205832058420585205862058720588205892059020591205922059320594205952059620597205982059920600206012060220603206042060520606206072060820609206102061120612206132061420615206162061720618206192062020621206222062320624206252062620627206282062920630206312063220633206342063520636206372063820639206402064120642206432064420645206462064720648206492065020651206522065320654206552065620657206582065920660206612066220663206642066520666206672066820669206702067120672206732067420675206762067720678206792068020681206822068320684206852068620687206882068920690206912069220693206942069520696206972069820699207002070120702207032070420705207062070720708207092071020711207122071320714207152071620717207182071920720207212072220723207242072520726207272072820729207302073120732207332073420735207362073720738207392074020741207422074320744207452074620747207482074920750207512075220753207542075520756207572075820759207602076120762207632076420765207662076720768207692077020771207722077320774207752077620777207782077920780207812078220783207842078520786207872078820789207902079120792207932079420795207962079720798207992080020801208022080320804208052080620807208082080920810208112081220813208142081520816208172081820819208202082120822208232082420825208262082720828208292083020831208322083320834208352083620837208382083920840208412084220843208442084520846208472084820849208502085120852208532085420855208562085720858208592086020861208622086320864208652086620867208682086920870208712087220873208742087520876208772087820879208802088120882208832088420885208862088720888208892089020891208922089320894208952089620897208982089920900209012090220903209042090520906209072090820909209102091120912209132091420915209162091720918209192092020921209222092320924209252092620927209282092920930209312093220933209342093520936209372093820939209402094120942209432094420945209462094720948209492095020951209522095320954209552095620957209582095920960209612096220963209642096520966209672096820969209702097120972209732097420975209762097720978209792098020981209822098320984209852098620987209882098920990209912099220993209942099520996209972099820999210002100121002210032100421005210062100721008210092101021011210122101321014210152101621017210182101921020210212102221023210242102521026210272102821029210302103121032210332103421035210362103721038210392104021041210422104321044210452104621047210482104921050210512105221053210542105521056210572105821059210602106121062210632106421065210662106721068210692107021071210722107321074210752107621077210782107921080210812108221083210842108521086210872108821089210902109121092210932109421095210962109721098210992110021101211022110321104211052110621107211082110921110211112111221113211142111521116211172111821119211202112121122211232112421125211262112721128211292113021131211322113321134211352113621137211382113921140211412114221143211442114521146211472114821149211502115121152211532115421155211562115721158211592116021161211622116321164211652116621167211682116921170211712117221173211742117521176211772117821179211802118121182211832118421185211862118721188211892119021191211922119321194211952119621197211982119921200212012120221203212042120521206212072120821209212102121121212212132121421215212162121721218212192122021221212222122321224212252122621227212282122921230212312123221233212342123521236212372123821239212402124121242212432124421245212462124721248212492125021251212522125321254212552125621257212582125921260212612126221263212642126521266212672126821269212702127121272212732127421275212762127721278212792128021281212822128321284212852128621287212882128921290212912129221293212942129521296212972129821299213002130121302213032130421305213062130721308213092131021311213122131321314213152131621317213182131921320213212132221323213242132521326213272132821329213302133121332213332133421335213362133721338213392134021341213422134321344213452134621347213482134921350213512135221353213542135521356213572135821359213602136121362213632136421365213662136721368213692137021371213722137321374213752137621377213782137921380213812138221383213842138521386213872138821389213902139121392213932139421395213962139721398213992140021401214022140321404214052140621407214082140921410214112141221413214142141521416214172141821419214202142121422214232142421425214262142721428214292143021431214322143321434214352143621437214382143921440214412144221443214442144521446214472144821449214502145121452214532145421455214562145721458214592146021461214622146321464214652146621467214682146921470214712147221473214742147521476214772147821479214802148121482214832148421485214862148721488214892149021491214922149321494214952149621497214982149921500215012150221503215042150521506215072150821509215102151121512215132151421515215162151721518215192152021521215222152321524215252152621527215282152921530215312153221533215342153521536215372153821539215402154121542215432154421545215462154721548215492155021551215522155321554215552155621557215582155921560215612156221563215642156521566215672156821569215702157121572215732157421575215762157721578215792158021581215822158321584215852158621587215882158921590215912159221593215942159521596215972159821599216002160121602216032160421605216062160721608216092161021611216122161321614216152161621617216182161921620216212162221623216242162521626216272162821629216302163121632216332163421635216362163721638216392164021641216422164321644216452164621647216482164921650216512165221653216542165521656216572165821659216602166121662216632166421665216662166721668216692167021671216722167321674216752167621677216782167921680216812168221683216842168521686216872168821689216902169121692216932169421695216962169721698216992170021701217022170321704217052170621707217082170921710217112171221713217142171521716217172171821719217202172121722217232172421725217262172721728217292173021731217322173321734217352173621737217382173921740217412174221743217442174521746217472174821749217502175121752217532175421755217562175721758217592176021761217622176321764217652176621767217682176921770217712177221773217742177521776217772177821779217802178121782217832178421785217862178721788217892179021791217922179321794217952179621797217982179921800218012180221803218042180521806218072180821809218102181121812218132181421815218162181721818218192182021821218222182321824218252182621827218282182921830218312183221833218342183521836218372183821839218402184121842218432184421845218462184721848218492185021851218522185321854218552185621857218582185921860218612186221863218642186521866218672186821869218702187121872218732187421875218762187721878218792188021881218822188321884218852188621887218882188921890218912189221893218942189521896218972189821899219002190121902219032190421905219062190721908219092191021911219122191321914219152191621917219182191921920219212192221923219242192521926219272192821929219302193121932219332193421935219362193721938219392194021941219422194321944219452194621947219482194921950219512195221953219542195521956219572195821959219602196121962219632196421965219662196721968219692197021971219722197321974219752197621977219782197921980219812198221983219842198521986219872198821989219902199121992219932199421995219962199721998219992200022001220022200322004220052200622007220082200922010220112201222013220142201522016220172201822019220202202122022220232202422025220262202722028220292203022031220322203322034220352203622037220382203922040220412204222043220442204522046220472204822049220502205122052220532205422055220562205722058220592206022061220622206322064220652206622067220682206922070220712207222073220742207522076220772207822079220802208122082220832208422085220862208722088220892209022091220922209322094220952209622097220982209922100221012210222103221042210522106221072210822109221102211122112221132211422115221162211722118221192212022121221222212322124221252212622127221282212922130221312213222133221342213522136221372213822139221402214122142221432214422145221462214722148221492215022151221522215322154221552215622157221582215922160221612216222163221642216522166221672216822169221702217122172221732217422175221762217722178221792218022181221822218322184221852218622187221882218922190221912219222193221942219522196221972219822199222002220122202222032220422205222062220722208222092221022211222122221322214222152221622217222182221922220222212222222223222242222522226222272222822229222302223122232222332223422235222362223722238222392224022241222422224322244222452224622247222482224922250222512225222253222542225522256222572225822259222602226122262222632226422265222662226722268222692227022271222722227322274222752227622277222782227922280222812228222283222842228522286222872228822289222902229122292222932229422295222962229722298222992230022301223022230322304223052230622307223082230922310223112231222313223142231522316223172231822319223202232122322223232232422325223262232722328223292233022331223322233322334223352233622337223382233922340223412234222343223442234522346223472234822349223502235122352223532235422355223562235722358223592236022361223622236322364223652236622367223682236922370223712237222373223742237522376223772237822379223802238122382223832238422385223862238722388223892239022391223922239322394223952239622397223982239922400224012240222403224042240522406224072240822409224102241122412224132241422415224162241722418224192242022421224222242322424224252242622427224282242922430224312243222433224342243522436224372243822439224402244122442224432244422445224462244722448224492245022451224522245322454224552245622457224582245922460224612246222463224642246522466224672246822469224702247122472224732247422475224762247722478224792248022481224822248322484224852248622487224882248922490224912249222493224942249522496224972249822499225002250122502225032250422505225062250722508225092251022511225122251322514225152251622517225182251922520225212252222523225242252522526225272252822529225302253122532225332253422535225362253722538225392254022541225422254322544225452254622547225482254922550225512255222553225542255522556225572255822559225602256122562225632256422565225662256722568225692257022571225722257322574225752257622577225782257922580225812258222583225842258522586225872258822589225902259122592225932259422595225962259722598225992260022601226022260322604226052260622607226082260922610226112261222613226142261522616226172261822619226202262122622226232262422625226262262722628226292263022631226322263322634226352263622637226382263922640226412264222643226442264522646226472264822649226502265122652226532265422655226562265722658226592266022661226622266322664226652266622667226682266922670226712267222673226742267522676226772267822679226802268122682226832268422685226862268722688226892269022691226922269322694226952269622697226982269922700227012270222703227042270522706227072270822709227102271122712227132271422715227162271722718227192272022721227222272322724227252272622727227282272922730227312273222733227342273522736227372273822739227402274122742227432274422745227462274722748227492275022751227522275322754227552275622757227582275922760227612276222763227642276522766227672276822769227702277122772227732277422775227762277722778227792278022781227822278322784227852278622787227882278922790227912279222793227942279522796227972279822799228002280122802228032280422805228062280722808228092281022811228122281322814228152281622817228182281922820228212282222823228242282522826228272282822829228302283122832228332283422835228362283722838228392284022841228422284322844228452284622847228482284922850228512285222853228542285522856228572285822859228602286122862228632286422865228662286722868228692287022871228722287322874228752287622877228782287922880228812288222883228842288522886228872288822889228902289122892228932289422895228962289722898228992290022901229022290322904229052290622907229082290922910229112291222913229142291522916229172291822919229202292122922229232292422925229262292722928229292293022931229322293322934229352293622937229382293922940229412294222943229442294522946229472294822949229502295122952229532295422955229562295722958229592296022961229622296322964229652296622967229682296922970229712297222973229742297522976229772297822979229802298122982229832298422985229862298722988229892299022991229922299322994229952299622997229982299923000230012300223003230042300523006230072300823009230102301123012230132301423015230162301723018230192302023021230222302323024230252302623027230282302923030230312303223033230342303523036230372303823039230402304123042230432304423045230462304723048230492305023051230522305323054230552305623057230582305923060230612306223063230642306523066230672306823069230702307123072230732307423075230762307723078230792308023081230822308323084230852308623087230882308923090230912309223093230942309523096230972309823099231002310123102231032310423105231062310723108231092311023111231122311323114231152311623117231182311923120231212312223123231242312523126231272312823129231302313123132231332313423135231362313723138231392314023141231422314323144231452314623147231482314923150231512315223153231542315523156231572315823159231602316123162231632316423165231662316723168231692317023171231722317323174231752317623177231782317923180231812318223183231842318523186231872318823189231902319123192231932319423195231962319723198231992320023201232022320323204232052320623207232082320923210232112321223213232142321523216232172321823219232202322123222232232322423225232262322723228232292323023231232322323323234232352323623237232382323923240232412324223243232442324523246232472324823249232502325123252232532325423255232562325723258232592326023261232622326323264232652326623267232682326923270232712327223273232742327523276232772327823279232802328123282232832328423285232862328723288232892329023291232922329323294232952329623297232982329923300233012330223303233042330523306233072330823309233102331123312233132331423315233162331723318233192332023321233222332323324233252332623327233282332923330233312333223333233342333523336233372333823339233402334123342233432334423345233462334723348233492335023351233522335323354233552335623357233582335923360233612336223363233642336523366233672336823369233702337123372233732337423375233762337723378233792338023381233822338323384233852338623387233882338923390233912339223393233942339523396233972339823399234002340123402234032340423405234062340723408234092341023411234122341323414234152341623417234182341923420234212342223423234242342523426234272342823429234302343123432234332343423435234362343723438234392344023441234422344323444234452344623447234482344923450234512345223453234542345523456234572345823459234602346123462234632346423465234662346723468234692347023471234722347323474234752347623477234782347923480234812348223483234842348523486234872348823489234902349123492234932349423495234962349723498234992350023501235022350323504235052350623507235082350923510235112351223513235142351523516235172351823519235202352123522235232352423525235262352723528235292353023531235322353323534235352353623537235382353923540235412354223543235442354523546235472354823549235502355123552235532355423555235562355723558235592356023561235622356323564235652356623567235682356923570235712357223573235742357523576235772357823579235802358123582235832358423585235862358723588235892359023591235922359323594235952359623597235982359923600236012360223603236042360523606236072360823609236102361123612236132361423615236162361723618236192362023621236222362323624236252362623627236282362923630236312363223633236342363523636236372363823639236402364123642236432364423645236462364723648236492365023651236522365323654236552365623657236582365923660236612366223663236642366523666236672366823669236702367123672236732367423675236762367723678236792368023681236822368323684236852368623687236882368923690236912369223693236942369523696236972369823699237002370123702237032370423705237062370723708237092371023711237122371323714237152371623717237182371923720237212372223723237242372523726237272372823729237302373123732237332373423735237362373723738237392374023741237422374323744237452374623747237482374923750237512375223753237542375523756237572375823759237602376123762237632376423765237662376723768237692377023771237722377323774237752377623777237782377923780237812378223783237842378523786237872378823789237902379123792237932379423795237962379723798237992380023801238022380323804238052380623807238082380923810238112381223813238142381523816238172381823819238202382123822238232382423825238262382723828238292383023831238322383323834238352383623837238382383923840238412384223843238442384523846238472384823849238502385123852238532385423855238562385723858238592386023861238622386323864238652386623867238682386923870238712387223873238742387523876238772387823879238802388123882238832388423885238862388723888238892389023891238922389323894238952389623897238982389923900239012390223903239042390523906239072390823909239102391123912239132391423915239162391723918239192392023921239222392323924239252392623927239282392923930239312393223933239342393523936239372393823939239402394123942239432394423945239462394723948239492395023951239522395323954239552395623957239582395923960239612396223963239642396523966239672396823969239702397123972239732397423975239762397723978239792398023981239822398323984239852398623987239882398923990239912399223993239942399523996239972399823999240002400124002240032400424005240062400724008240092401024011240122401324014240152401624017240182401924020240212402224023240242402524026240272402824029240302403124032240332403424035240362403724038240392404024041240422404324044240452404624047240482404924050240512405224053240542405524056240572405824059240602406124062240632406424065240662406724068240692407024071240722407324074240752407624077240782407924080240812408224083240842408524086240872408824089240902409124092240932409424095240962409724098240992410024101241022410324104241052410624107241082410924110241112411224113241142411524116241172411824119241202412124122241232412424125241262412724128241292413024131241322413324134241352413624137241382413924140241412414224143241442414524146241472414824149241502415124152241532415424155241562415724158241592416024161241622416324164241652416624167241682416924170241712417224173241742417524176241772417824179241802418124182241832418424185241862418724188241892419024191241922419324194241952419624197241982419924200242012420224203242042420524206242072420824209242102421124212242132421424215242162421724218242192422024221242222422324224242252422624227242282422924230242312423224233242342423524236242372423824239242402424124242242432424424245242462424724248242492425024251242522425324254242552425624257242582425924260242612426224263242642426524266242672426824269242702427124272242732427424275242762427724278242792428024281242822428324284242852428624287242882428924290242912429224293242942429524296242972429824299243002430124302243032430424305243062430724308243092431024311243122431324314243152431624317243182431924320243212432224323243242432524326243272432824329243302433124332243332433424335243362433724338243392434024341243422434324344243452434624347243482434924350243512435224353243542435524356243572435824359243602436124362243632436424365243662436724368243692437024371243722437324374243752437624377243782437924380243812438224383243842438524386243872438824389243902439124392243932439424395243962439724398243992440024401244022440324404244052440624407244082440924410244112441224413244142441524416244172441824419244202442124422244232442424425244262442724428244292443024431244322443324434244352443624437244382443924440244412444224443244442444524446244472444824449244502445124452244532445424455244562445724458244592446024461244622446324464244652446624467244682446924470244712447224473244742447524476244772447824479244802448124482244832448424485244862448724488244892449024491244922449324494244952449624497244982449924500245012450224503245042450524506245072450824509245102451124512245132451424515245162451724518245192452024521245222452324524245252452624527245282452924530245312453224533245342453524536245372453824539245402454124542245432454424545245462454724548245492455024551245522455324554245552455624557245582455924560245612456224563245642456524566245672456824569245702457124572245732457424575245762457724578245792458024581245822458324584245852458624587245882458924590245912459224593245942459524596245972459824599246002460124602246032460424605246062460724608246092461024611246122461324614246152461624617246182461924620246212462224623246242462524626246272462824629246302463124632246332463424635246362463724638246392464024641246422464324644246452464624647246482464924650246512465224653246542465524656246572465824659246602466124662246632466424665246662466724668246692467024671246722467324674246752467624677246782467924680246812468224683246842468524686246872468824689246902469124692246932469424695246962469724698246992470024701247022470324704247052470624707247082470924710247112471224713247142471524716247172471824719247202472124722247232472424725247262472724728247292473024731247322473324734247352473624737247382473924740247412474224743247442474524746247472474824749247502475124752247532475424755247562475724758247592476024761247622476324764247652476624767247682476924770247712477224773247742477524776247772477824779247802478124782247832478424785247862478724788247892479024791247922479324794247952479624797247982479924800248012480224803248042480524806248072480824809248102481124812248132481424815248162481724818248192482024821248222482324824248252482624827248282482924830248312483224833248342483524836248372483824839248402484124842248432484424845248462484724848248492485024851248522485324854248552485624857248582485924860248612486224863248642486524866248672486824869248702487124872248732487424875248762487724878248792488024881248822488324884248852488624887248882488924890248912489224893248942489524896248972489824899249002490124902249032490424905249062490724908249092491024911249122491324914249152491624917249182491924920249212492224923249242492524926249272492824929249302493124932249332493424935249362493724938249392494024941249422494324944249452494624947249482494924950249512495224953249542495524956249572495824959249602496124962249632496424965249662496724968249692497024971249722497324974249752497624977249782497924980249812498224983249842498524986249872498824989249902499124992249932499424995249962499724998249992500025001250022500325004250052500625007250082500925010250112501225013250142501525016250172501825019250202502125022250232502425025250262502725028250292503025031250322503325034250352503625037250382503925040250412504225043250442504525046250472504825049250502505125052250532505425055250562505725058250592506025061250622506325064250652506625067250682506925070250712507225073250742507525076250772507825079250802508125082250832508425085250862508725088250892509025091250922509325094250952509625097250982509925100251012510225103251042510525106251072510825109251102511125112251132511425115251162511725118251192512025121251222512325124251252512625127251282512925130251312513225133251342513525136251372513825139251402514125142251432514425145251462514725148251492515025151251522515325154251552515625157251582515925160251612516225163251642516525166251672516825169251702517125172251732517425175251762517725178251792518025181251822518325184251852518625187251882518925190251912519225193251942519525196251972519825199252002520125202252032520425205252062520725208252092521025211252122521325214252152521625217252182521925220252212522225223252242522525226252272522825229252302523125232252332523425235252362523725238252392524025241252422524325244252452524625247252482524925250252512525225253252542525525256252572525825259252602526125262252632526425265252662526725268252692527025271252722527325274252752527625277252782527925280252812528225283252842528525286252872528825289252902529125292252932529425295252962529725298252992530025301253022530325304253052530625307253082530925310253112531225313253142531525316253172531825319253202532125322253232532425325253262532725328253292533025331253322533325334253352533625337253382533925340253412534225343253442534525346253472534825349253502535125352253532535425355253562535725358253592536025361253622536325364253652536625367253682536925370253712537225373253742537525376253772537825379253802538125382253832538425385253862538725388253892539025391253922539325394253952539625397253982539925400254012540225403254042540525406254072540825409254102541125412254132541425415254162541725418254192542025421254222542325424254252542625427254282542925430254312543225433254342543525436254372543825439254402544125442254432544425445254462544725448254492545025451254522545325454254552545625457254582545925460254612546225463254642546525466254672546825469254702547125472254732547425475254762547725478254792548025481254822548325484254852548625487254882548925490254912549225493254942549525496254972549825499255002550125502255032550425505255062550725508255092551025511255122551325514255152551625517255182551925520255212552225523255242552525526255272552825529255302553125532255332553425535255362553725538255392554025541255422554325544255452554625547255482554925550255512555225553255542555525556255572555825559255602556125562255632556425565255662556725568255692557025571255722557325574255752557625577255782557925580255812558225583255842558525586255872558825589255902559125592255932559425595255962559725598255992560025601256022560325604256052560625607256082560925610256112561225613256142561525616256172561825619256202562125622256232562425625256262562725628256292563025631256322563325634256352563625637256382563925640256412564225643256442564525646256472564825649256502565125652256532565425655256562565725658256592566025661256622566325664256652566625667256682566925670256712567225673256742567525676256772567825679256802568125682256832568425685256862568725688256892569025691256922569325694256952569625697256982569925700257012570225703257042570525706257072570825709257102571125712257132571425715257162571725718257192572025721257222572325724257252572625727257282572925730257312573225733257342573525736257372573825739257402574125742257432574425745257462574725748257492575025751257522575325754257552575625757257582575925760257612576225763257642576525766257672576825769257702577125772257732577425775257762577725778257792578025781257822578325784257852578625787257882578925790257912579225793257942579525796257972579825799258002580125802258032580425805258062580725808258092581025811258122581325814258152581625817258182581925820258212582225823258242582525826258272582825829258302583125832258332583425835258362583725838258392584025841258422584325844258452584625847258482584925850258512585225853258542585525856258572585825859258602586125862258632586425865258662586725868258692587025871258722587325874258752587625877258782587925880258812588225883258842588525886258872588825889258902589125892258932589425895258962589725898258992590025901259022590325904259052590625907259082590925910259112591225913259142591525916259172591825919259202592125922259232592425925259262592725928259292593025931259322593325934259352593625937259382593925940259412594225943259442594525946259472594825949259502595125952259532595425955259562595725958259592596025961259622596325964259652596625967259682596925970259712597225973259742597525976259772597825979259802598125982259832598425985259862598725988259892599025991259922599325994259952599625997259982599926000260012600226003260042600526006260072600826009260102601126012260132601426015260162601726018260192602026021260222602326024260252602626027260282602926030260312603226033260342603526036260372603826039260402604126042260432604426045260462604726048260492605026051260522605326054260552605626057260582605926060260612606226063260642606526066260672606826069260702607126072260732607426075260762607726078260792608026081260822608326084260852608626087260882608926090260912609226093260942609526096260972609826099261002610126102261032610426105261062610726108261092611026111261122611326114261152611626117261182611926120261212612226123261242612526126261272612826129261302613126132261332613426135261362613726138261392614026141261422614326144261452614626147261482614926150261512615226153261542615526156261572615826159261602616126162261632616426165261662616726168261692617026171261722617326174261752617626177261782617926180261812618226183261842618526186261872618826189261902619126192261932619426195261962619726198261992620026201262022620326204262052620626207262082620926210262112621226213262142621526216262172621826219262202622126222262232622426225262262622726228262292623026231262322623326234262352623626237262382623926240262412624226243262442624526246262472624826249262502625126252262532625426255262562625726258262592626026261262622626326264262652626626267262682626926270262712627226273262742627526276262772627826279262802628126282262832628426285262862628726288262892629026291262922629326294262952629626297262982629926300263012630226303263042630526306263072630826309263102631126312263132631426315263162631726318263192632026321263222632326324263252632626327263282632926330263312633226333263342633526336263372633826339263402634126342263432634426345263462634726348263492635026351263522635326354263552635626357263582635926360263612636226363263642636526366263672636826369263702637126372263732637426375263762637726378263792638026381263822638326384263852638626387263882638926390263912639226393263942639526396263972639826399264002640126402264032640426405264062640726408264092641026411264122641326414264152641626417264182641926420264212642226423264242642526426264272642826429264302643126432264332643426435264362643726438264392644026441264422644326444264452644626447264482644926450264512645226453264542645526456264572645826459264602646126462264632646426465264662646726468264692647026471264722647326474264752647626477264782647926480264812648226483264842648526486264872648826489264902649126492264932649426495264962649726498264992650026501265022650326504265052650626507265082650926510265112651226513265142651526516265172651826519265202652126522265232652426525265262652726528265292653026531265322653326534265352653626537265382653926540265412654226543265442654526546265472654826549265502655126552265532655426555265562655726558265592656026561265622656326564265652656626567265682656926570265712657226573265742657526576265772657826579265802658126582265832658426585265862658726588265892659026591265922659326594265952659626597265982659926600266012660226603266042660526606266072660826609266102661126612266132661426615266162661726618266192662026621266222662326624266252662626627266282662926630266312663226633266342663526636266372663826639266402664126642266432664426645266462664726648266492665026651266522665326654266552665626657266582665926660266612666226663266642666526666266672666826669266702667126672266732667426675266762667726678266792668026681266822668326684266852668626687266882668926690266912669226693266942669526696266972669826699267002670126702267032670426705267062670726708267092671026711267122671326714267152671626717267182671926720267212672226723267242672526726267272672826729267302673126732267332673426735267362673726738267392674026741267422674326744267452674626747267482674926750267512675226753267542675526756267572675826759267602676126762267632676426765267662676726768267692677026771267722677326774267752677626777267782677926780267812678226783267842678526786267872678826789267902679126792267932679426795267962679726798267992680026801268022680326804268052680626807268082680926810268112681226813268142681526816268172681826819268202682126822268232682426825268262682726828268292683026831268322683326834268352683626837268382683926840268412684226843268442684526846268472684826849268502685126852268532685426855268562685726858268592686026861268622686326864268652686626867268682686926870268712687226873268742687526876268772687826879268802688126882268832688426885268862688726888268892689026891268922689326894268952689626897268982689926900269012690226903269042690526906269072690826909269102691126912269132691426915269162691726918269192692026921269222692326924269252692626927269282692926930269312693226933269342693526936269372693826939269402694126942269432694426945269462694726948269492695026951269522695326954269552695626957269582695926960269612696226963269642696526966269672696826969269702697126972269732697426975269762697726978269792698026981269822698326984269852698626987269882698926990269912699226993269942699526996269972699826999270002700127002270032700427005270062700727008270092701027011270122701327014270152701627017270182701927020270212702227023270242702527026270272702827029270302703127032270332703427035270362703727038270392704027041270422704327044270452704627047270482704927050270512705227053270542705527056270572705827059270602706127062270632706427065270662706727068270692707027071270722707327074270752707627077270782707927080270812708227083270842708527086270872708827089270902709127092270932709427095270962709727098270992710027101271022710327104271052710627107271082710927110271112711227113271142711527116271172711827119271202712127122271232712427125271262712727128271292713027131271322713327134271352713627137271382713927140271412714227143271442714527146271472714827149271502715127152271532715427155271562715727158271592716027161271622716327164271652716627167271682716927170271712717227173271742717527176271772717827179271802718127182271832718427185271862718727188271892719027191271922719327194271952719627197271982719927200272012720227203272042720527206272072720827209272102721127212272132721427215272162721727218272192722027221272222722327224272252722627227272282722927230272312723227233272342723527236272372723827239272402724127242272432724427245272462724727248272492725027251272522725327254272552725627257272582725927260272612726227263272642726527266272672726827269272702727127272272732727427275272762727727278272792728027281272822728327284272852728627287272882728927290272912729227293272942729527296272972729827299273002730127302273032730427305273062730727308273092731027311273122731327314273152731627317273182731927320273212732227323273242732527326273272732827329273302733127332273332733427335273362733727338273392734027341273422734327344273452734627347273482734927350273512735227353273542735527356273572735827359273602736127362273632736427365273662736727368273692737027371273722737327374273752737627377273782737927380273812738227383273842738527386273872738827389273902739127392273932739427395273962739727398273992740027401274022740327404274052740627407274082740927410274112741227413274142741527416274172741827419274202742127422274232742427425274262742727428274292743027431274322743327434274352743627437274382743927440274412744227443274442744527446274472744827449274502745127452274532745427455274562745727458274592746027461274622746327464274652746627467274682746927470274712747227473274742747527476274772747827479274802748127482274832748427485274862748727488274892749027491274922749327494274952749627497274982749927500275012750227503275042750527506275072750827509275102751127512275132751427515275162751727518275192752027521275222752327524275252752627527275282752927530275312753227533275342753527536275372753827539275402754127542275432754427545275462754727548275492755027551275522755327554275552755627557275582755927560275612756227563275642756527566275672756827569275702757127572275732757427575275762757727578275792758027581275822758327584275852758627587275882758927590275912759227593275942759527596275972759827599276002760127602276032760427605276062760727608276092761027611276122761327614276152761627617276182761927620276212762227623276242762527626276272762827629276302763127632276332763427635276362763727638276392764027641276422764327644276452764627647276482764927650276512765227653276542765527656276572765827659276602766127662276632766427665276662766727668276692767027671276722767327674276752767627677276782767927680276812768227683276842768527686276872768827689276902769127692276932769427695276962769727698276992770027701277022770327704277052770627707277082770927710277112771227713277142771527716277172771827719277202772127722277232772427725277262772727728277292773027731277322773327734277352773627737277382773927740277412774227743277442774527746277472774827749277502775127752277532775427755277562775727758277592776027761277622776327764277652776627767277682776927770277712777227773277742777527776277772777827779277802778127782277832778427785277862778727788277892779027791277922779327794277952779627797277982779927800278012780227803278042780527806278072780827809278102781127812278132781427815278162781727818278192782027821278222782327824278252782627827278282782927830278312783227833278342783527836278372783827839278402784127842278432784427845278462784727848278492785027851278522785327854278552785627857278582785927860278612786227863278642786527866278672786827869278702787127872278732787427875278762787727878278792788027881278822788327884278852788627887278882788927890278912789227893278942789527896278972789827899279002790127902279032790427905279062790727908279092791027911279122791327914279152791627917279182791927920279212792227923279242792527926279272792827929279302793127932279332793427935279362793727938279392794027941279422794327944279452794627947279482794927950279512795227953279542795527956279572795827959279602796127962279632796427965279662796727968279692797027971279722797327974279752797627977279782797927980279812798227983279842798527986279872798827989279902799127992279932799427995279962799727998279992800028001280022800328004280052800628007280082800928010280112801228013280142801528016280172801828019280202802128022280232802428025280262802728028280292803028031280322803328034280352803628037280382803928040280412804228043280442804528046280472804828049280502805128052280532805428055280562805728058280592806028061280622806328064280652806628067280682806928070280712807228073280742807528076280772807828079280802808128082280832808428085280862808728088280892809028091280922809328094280952809628097280982809928100281012810228103281042810528106281072810828109281102811128112281132811428115281162811728118281192812028121281222812328124281252812628127281282812928130281312813228133281342813528136281372813828139281402814128142281432814428145281462814728148281492815028151281522815328154281552815628157281582815928160281612816228163281642816528166281672816828169281702817128172281732817428175281762817728178281792818028181281822818328184281852818628187281882818928190281912819228193281942819528196281972819828199282002820128202282032820428205282062820728208282092821028211282122821328214282152821628217282182821928220282212822228223282242822528226282272822828229282302823128232282332823428235282362823728238282392824028241282422824328244282452824628247282482824928250282512825228253282542825528256282572825828259282602826128262282632826428265282662826728268282692827028271282722827328274282752827628277282782827928280282812828228283282842828528286282872828828289282902829128292282932829428295282962829728298282992830028301283022830328304283052830628307283082830928310283112831228313283142831528316283172831828319283202832128322283232832428325283262832728328283292833028331283322833328334283352833628337283382833928340283412834228343283442834528346283472834828349283502835128352283532835428355283562835728358283592836028361283622836328364283652836628367283682836928370283712837228373283742837528376283772837828379283802838128382283832838428385283862838728388283892839028391283922839328394283952839628397283982839928400284012840228403284042840528406284072840828409284102841128412284132841428415284162841728418284192842028421284222842328424284252842628427284282842928430284312843228433284342843528436284372843828439284402844128442284432844428445284462844728448284492845028451284522845328454284552845628457284582845928460284612846228463284642846528466284672846828469284702847128472284732847428475284762847728478284792848028481284822848328484284852848628487284882848928490284912849228493284942849528496284972849828499285002850128502285032850428505285062850728508285092851028511285122851328514285152851628517285182851928520285212852228523285242852528526285272852828529285302853128532285332853428535285362853728538285392854028541285422854328544285452854628547285482854928550285512855228553285542855528556285572855828559285602856128562285632856428565285662856728568285692857028571285722857328574285752857628577285782857928580285812858228583285842858528586285872858828589285902859128592285932859428595285962859728598285992860028601286022860328604286052860628607286082860928610286112861228613286142861528616286172861828619286202862128622286232862428625286262862728628286292863028631286322863328634286352863628637286382863928640286412864228643286442864528646286472864828649286502865128652286532865428655286562865728658286592866028661286622866328664286652866628667286682866928670286712867228673286742867528676286772867828679286802868128682286832868428685286862868728688286892869028691286922869328694286952869628697286982869928700287012870228703287042870528706287072870828709287102871128712287132871428715287162871728718287192872028721287222872328724287252872628727287282872928730287312873228733287342873528736287372873828739287402874128742287432874428745287462874728748287492875028751287522875328754287552875628757287582875928760287612876228763287642876528766287672876828769287702877128772287732877428775287762877728778287792878028781287822878328784287852878628787287882878928790287912879228793287942879528796287972879828799288002880128802288032880428805288062880728808288092881028811288122881328814288152881628817288182881928820288212882228823288242882528826288272882828829288302883128832288332883428835288362883728838288392884028841288422884328844288452884628847288482884928850288512885228853288542885528856288572885828859288602886128862288632886428865288662886728868288692887028871288722887328874288752887628877288782887928880288812888228883288842888528886288872888828889288902889128892288932889428895288962889728898288992890028901289022890328904289052890628907289082890928910289112891228913289142891528916289172891828919289202892128922289232892428925289262892728928289292893028931289322893328934289352893628937289382893928940289412894228943289442894528946289472894828949289502895128952289532895428955289562895728958289592896028961289622896328964289652896628967289682896928970289712897228973289742897528976289772897828979289802898128982289832898428985289862898728988289892899028991289922899328994289952899628997289982899929000290012900229003290042900529006290072900829009290102901129012290132901429015290162901729018290192902029021290222902329024290252902629027290282902929030290312903229033290342903529036290372903829039290402904129042290432904429045290462904729048290492905029051290522905329054290552905629057290582905929060290612906229063290642906529066290672906829069290702907129072290732907429075290762907729078290792908029081290822908329084290852908629087290882908929090290912909229093290942909529096290972909829099291002910129102291032910429105291062910729108291092911029111291122911329114291152911629117291182911929120291212912229123291242912529126291272912829129291302913129132291332913429135291362913729138291392914029141291422914329144291452914629147291482914929150291512915229153291542915529156291572915829159291602916129162291632916429165291662916729168291692917029171291722917329174291752917629177291782917929180291812918229183291842918529186291872918829189291902919129192291932919429195291962919729198291992920029201292022920329204292052920629207292082920929210292112921229213292142921529216292172921829219292202922129222292232922429225292262922729228292292923029231292322923329234292352923629237292382923929240292412924229243292442924529246292472924829249292502925129252292532925429255292562925729258292592926029261292622926329264292652926629267292682926929270292712927229273292742927529276292772927829279292802928129282292832928429285292862928729288292892929029291292922929329294292952929629297292982929929300293012930229303293042930529306293072930829309293102931129312293132931429315293162931729318293192932029321293222932329324293252932629327293282932929330293312933229333293342933529336293372933829339293402934129342293432934429345293462934729348293492935029351293522935329354293552935629357293582935929360293612936229363293642936529366293672936829369293702937129372293732937429375293762937729378293792938029381293822938329384293852938629387293882938929390293912939229393293942939529396293972939829399294002940129402294032940429405294062940729408294092941029411294122941329414294152941629417294182941929420294212942229423294242942529426294272942829429294302943129432294332943429435294362943729438294392944029441294422944329444294452944629447294482944929450294512945229453294542945529456294572945829459294602946129462294632946429465294662946729468294692947029471294722947329474294752947629477294782947929480294812948229483294842948529486294872948829489294902949129492294932949429495294962949729498294992950029501295022950329504295052950629507295082950929510295112951229513295142951529516295172951829519295202952129522295232952429525295262952729528295292953029531295322953329534295352953629537295382953929540295412954229543295442954529546295472954829549295502955129552295532955429555295562955729558295592956029561295622956329564295652956629567295682956929570295712957229573295742957529576295772957829579295802958129582295832958429585295862958729588295892959029591295922959329594295952959629597295982959929600296012960229603296042960529606296072960829609296102961129612296132961429615296162961729618296192962029621296222962329624296252962629627296282962929630296312963229633296342963529636296372963829639296402964129642296432964429645296462964729648296492965029651296522965329654296552965629657296582965929660296612966229663296642966529666296672966829669296702967129672296732967429675296762967729678296792968029681296822968329684296852968629687296882968929690296912969229693296942969529696296972969829699297002970129702297032970429705297062970729708297092971029711297122971329714297152971629717297182971929720297212972229723297242972529726297272972829729297302973129732297332973429735297362973729738297392974029741297422974329744297452974629747297482974929750297512975229753297542975529756297572975829759297602976129762297632976429765297662976729768297692977029771297722977329774297752977629777297782977929780297812978229783297842978529786297872978829789297902979129792297932979429795297962979729798297992980029801298022980329804298052980629807298082980929810298112981229813298142981529816298172981829819298202982129822298232982429825298262982729828298292983029831298322983329834298352983629837298382983929840298412984229843298442984529846298472984829849298502985129852298532985429855298562985729858298592986029861298622986329864298652986629867298682986929870298712987229873298742987529876298772987829879298802988129882298832988429885298862988729888298892989029891298922989329894298952989629897298982989929900299012990229903299042990529906299072990829909299102991129912299132991429915299162991729918299192992029921299222992329924299252992629927299282992929930299312993229933299342993529936299372993829939299402994129942299432994429945299462994729948299492995029951299522995329954299552995629957299582995929960299612996229963299642996529966299672996829969299702997129972299732997429975299762997729978299792998029981299822998329984299852998629987299882998929990299912999229993299942999529996299972999829999300003000130002300033000430005300063000730008300093001030011300123001330014300153001630017300183001930020300213002230023300243002530026300273002830029300303003130032300333003430035300363003730038300393004030041300423004330044300453004630047300483004930050300513005230053300543005530056300573005830059300603006130062300633006430065300663006730068300693007030071300723007330074300753007630077300783007930080300813008230083300843008530086300873008830089300903009130092300933009430095300963009730098300993010030101301023010330104301053010630107301083010930110301113011230113301143011530116301173011830119301203012130122301233012430125301263012730128301293013030131301323013330134301353013630137301383013930140301413014230143301443014530146301473014830149301503015130152301533015430155301563015730158301593016030161301623016330164301653016630167301683016930170301713017230173301743017530176301773017830179301803018130182301833018430185301863018730188301893019030191301923019330194301953019630197301983019930200302013020230203302043020530206302073020830209302103021130212302133021430215302163021730218302193022030221302223022330224302253022630227302283022930230302313023230233302343023530236302373023830239302403024130242302433024430245302463024730248302493025030251302523025330254302553025630257302583025930260302613026230263302643026530266302673026830269302703027130272302733027430275302763027730278302793028030281302823028330284302853028630287302883028930290302913029230293302943029530296302973029830299303003030130302303033030430305303063030730308303093031030311303123031330314303153031630317303183031930320303213032230323303243032530326303273032830329303303033130332303333033430335303363033730338303393034030341303423034330344303453034630347303483034930350303513035230353303543035530356303573035830359303603036130362303633036430365303663036730368303693037030371303723037330374303753037630377303783037930380303813038230383303843038530386303873038830389303903039130392303933039430395303963039730398303993040030401304023040330404304053040630407304083040930410304113041230413304143041530416304173041830419304203042130422304233042430425304263042730428304293043030431304323043330434304353043630437304383043930440304413044230443304443044530446304473044830449304503045130452304533045430455304563045730458304593046030461304623046330464304653046630467304683046930470304713047230473304743047530476304773047830479304803048130482304833048430485304863048730488304893049030491304923049330494304953049630497304983049930500305013050230503305043050530506305073050830509
  1. var __extends = this.__extends || function (d, b) {
  2. for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p];
  3. function __() { this.constructor = d; }
  4. __.prototype = b.prototype;
  5. d.prototype = new __();
  6. };var BABYLON;
  7. (function (BABYLON) {
  8. var Color3 = (function () {
  9. function Color3(r, g, b) {
  10. if (r === void 0) { r = 0; }
  11. if (g === void 0) { g = 0; }
  12. if (b === void 0) { b = 0; }
  13. this.r = r;
  14. this.g = g;
  15. this.b = b;
  16. }
  17. Color3.prototype.toString = function () {
  18. return "{R: " + this.r + " G:" + this.g + " B:" + this.b + "}";
  19. };
  20. // Operators
  21. Color3.prototype.toArray = function (array, index) {
  22. if (index === undefined) {
  23. index = 0;
  24. }
  25. array[index] = this.r;
  26. array[index + 1] = this.g;
  27. array[index + 2] = this.b;
  28. return this;
  29. };
  30. Color3.prototype.toColor4 = function (alpha) {
  31. if (alpha === void 0) { alpha = 1; }
  32. return new Color4(this.r, this.g, this.b, alpha);
  33. };
  34. Color3.prototype.asArray = function () {
  35. var result = [];
  36. this.toArray(result, 0);
  37. return result;
  38. };
  39. Color3.prototype.toLuminance = function () {
  40. return this.r * 0.3 + this.g * 0.59 + this.b * 0.11;
  41. };
  42. Color3.prototype.multiply = function (otherColor) {
  43. return new Color3(this.r * otherColor.r, this.g * otherColor.g, this.b * otherColor.b);
  44. };
  45. Color3.prototype.multiplyToRef = function (otherColor, result) {
  46. result.r = this.r * otherColor.r;
  47. result.g = this.g * otherColor.g;
  48. result.b = this.b * otherColor.b;
  49. return this;
  50. };
  51. Color3.prototype.equals = function (otherColor) {
  52. return otherColor && this.r === otherColor.r && this.g === otherColor.g && this.b === otherColor.b;
  53. };
  54. Color3.prototype.scale = function (scale) {
  55. return new Color3(this.r * scale, this.g * scale, this.b * scale);
  56. };
  57. Color3.prototype.scaleToRef = function (scale, result) {
  58. result.r = this.r * scale;
  59. result.g = this.g * scale;
  60. result.b = this.b * scale;
  61. return this;
  62. };
  63. Color3.prototype.add = function (otherColor) {
  64. return new Color3(this.r + otherColor.r, this.g + otherColor.g, this.b + otherColor.b);
  65. };
  66. Color3.prototype.addToRef = function (otherColor, result) {
  67. result.r = this.r + otherColor.r;
  68. result.g = this.g + otherColor.g;
  69. result.b = this.b + otherColor.b;
  70. return this;
  71. };
  72. Color3.prototype.subtract = function (otherColor) {
  73. return new Color3(this.r - otherColor.r, this.g - otherColor.g, this.b - otherColor.b);
  74. };
  75. Color3.prototype.subtractToRef = function (otherColor, result) {
  76. result.r = this.r - otherColor.r;
  77. result.g = this.g - otherColor.g;
  78. result.b = this.b - otherColor.b;
  79. return this;
  80. };
  81. Color3.prototype.clone = function () {
  82. return new Color3(this.r, this.g, this.b);
  83. };
  84. Color3.prototype.copyFrom = function (source) {
  85. this.r = source.r;
  86. this.g = source.g;
  87. this.b = source.b;
  88. return this;
  89. };
  90. Color3.prototype.copyFromFloats = function (r, g, b) {
  91. this.r = r;
  92. this.g = g;
  93. this.b = b;
  94. return this;
  95. };
  96. // Statics
  97. Color3.FromArray = function (array, offset) {
  98. if (offset === void 0) { offset = 0; }
  99. return new Color3(array[offset], array[offset + 1], array[offset + 2]);
  100. };
  101. Color3.FromInts = function (r, g, b) {
  102. return new Color3(r / 255.0, g / 255.0, b / 255.0);
  103. };
  104. Color3.Lerp = function (start, end, amount) {
  105. var r = start.r + ((end.r - start.r) * amount);
  106. var g = start.g + ((end.g - start.g) * amount);
  107. var b = start.b + ((end.b - start.b) * amount);
  108. return new Color3(r, g, b);
  109. };
  110. Color3.Red = function () {
  111. return new Color3(1, 0, 0);
  112. };
  113. Color3.Green = function () {
  114. return new Color3(0, 1, 0);
  115. };
  116. Color3.Blue = function () {
  117. return new Color3(0, 0, 1);
  118. };
  119. Color3.Black = function () {
  120. return new Color3(0, 0, 0);
  121. };
  122. Color3.White = function () {
  123. return new Color3(1, 1, 1);
  124. };
  125. Color3.Purple = function () {
  126. return new Color3(0.5, 0, 0.5);
  127. };
  128. Color3.Magenta = function () {
  129. return new Color3(1, 0, 1);
  130. };
  131. Color3.Yellow = function () {
  132. return new Color3(1, 1, 0);
  133. };
  134. Color3.Gray = function () {
  135. return new Color3(0.5, 0.5, 0.5);
  136. };
  137. return Color3;
  138. })();
  139. BABYLON.Color3 = Color3;
  140. var Color4 = (function () {
  141. function Color4(r, g, b, a) {
  142. this.r = r;
  143. this.g = g;
  144. this.b = b;
  145. this.a = a;
  146. }
  147. // Operators
  148. Color4.prototype.addInPlace = function (right) {
  149. this.r += right.r;
  150. this.g += right.g;
  151. this.b += right.b;
  152. this.a += right.a;
  153. return this;
  154. };
  155. Color4.prototype.asArray = function () {
  156. var result = [];
  157. this.toArray(result, 0);
  158. return result;
  159. };
  160. Color4.prototype.toArray = function (array, index) {
  161. if (index === undefined) {
  162. index = 0;
  163. }
  164. array[index] = this.r;
  165. array[index + 1] = this.g;
  166. array[index + 2] = this.b;
  167. array[index + 3] = this.a;
  168. return this;
  169. };
  170. Color4.prototype.add = function (right) {
  171. return new Color4(this.r + right.r, this.g + right.g, this.b + right.b, this.a + right.a);
  172. };
  173. Color4.prototype.subtract = function (right) {
  174. return new Color4(this.r - right.r, this.g - right.g, this.b - right.b, this.a - right.a);
  175. };
  176. Color4.prototype.subtractToRef = function (right, result) {
  177. result.r = this.r - right.r;
  178. result.g = this.g - right.g;
  179. result.b = this.b - right.b;
  180. result.a = this.a - right.a;
  181. return this;
  182. };
  183. Color4.prototype.scale = function (scale) {
  184. return new Color4(this.r * scale, this.g * scale, this.b * scale, this.a * scale);
  185. };
  186. Color4.prototype.scaleToRef = function (scale, result) {
  187. result.r = this.r * scale;
  188. result.g = this.g * scale;
  189. result.b = this.b * scale;
  190. result.a = this.a * scale;
  191. return this;
  192. };
  193. Color4.prototype.toString = function () {
  194. return "{R: " + this.r + " G:" + this.g + " B:" + this.b + " A:" + this.a + "}";
  195. };
  196. Color4.prototype.clone = function () {
  197. return new Color4(this.r, this.g, this.b, this.a);
  198. };
  199. Color4.prototype.copyFrom = function (source) {
  200. this.r = source.r;
  201. this.g = source.g;
  202. this.b = source.b;
  203. this.a = source.a;
  204. return this;
  205. };
  206. // Statics
  207. Color4.Lerp = function (left, right, amount) {
  208. var result = new Color4(0, 0, 0, 0);
  209. Color4.LerpToRef(left, right, amount, result);
  210. return result;
  211. };
  212. Color4.LerpToRef = function (left, right, amount, result) {
  213. result.r = left.r + (right.r - left.r) * amount;
  214. result.g = left.g + (right.g - left.g) * amount;
  215. result.b = left.b + (right.b - left.b) * amount;
  216. result.a = left.a + (right.a - left.a) * amount;
  217. };
  218. Color4.FromArray = function (array, offset) {
  219. if (offset === void 0) { offset = 0; }
  220. return new Color4(array[offset], array[offset + 1], array[offset + 2], array[offset + 3]);
  221. };
  222. Color4.FromInts = function (r, g, b, a) {
  223. return new Color4(r / 255.0, g / 255.0, b / 255.0, a / 255.0);
  224. };
  225. return Color4;
  226. })();
  227. BABYLON.Color4 = Color4;
  228. var Vector2 = (function () {
  229. function Vector2(x, y) {
  230. this.x = x;
  231. this.y = y;
  232. }
  233. Vector2.prototype.toString = function () {
  234. return "{X: " + this.x + " Y:" + this.y + "}";
  235. };
  236. // Operators
  237. Vector2.prototype.toArray = function (array, index) {
  238. if (index === void 0) { index = 0; }
  239. array[index] = this.x;
  240. array[index + 1] = this.y;
  241. return this;
  242. };
  243. Vector2.prototype.asArray = function () {
  244. var result = [];
  245. this.toArray(result, 0);
  246. return result;
  247. };
  248. Vector2.prototype.copyFrom = function (source) {
  249. this.x = source.x;
  250. this.y = source.y;
  251. return this;
  252. };
  253. Vector2.prototype.copyFromFloats = function (x, y) {
  254. this.x = x;
  255. this.y = y;
  256. return this;
  257. };
  258. Vector2.prototype.add = function (otherVector) {
  259. return new Vector2(this.x + otherVector.x, this.y + otherVector.y);
  260. };
  261. Vector2.prototype.addVector3 = function (otherVector) {
  262. return new Vector2(this.x + otherVector.x, this.y + otherVector.y);
  263. };
  264. Vector2.prototype.subtract = function (otherVector) {
  265. return new Vector2(this.x - otherVector.x, this.y - otherVector.y);
  266. };
  267. Vector2.prototype.subtractInPlace = function (otherVector) {
  268. this.x -= otherVector.x;
  269. this.y -= otherVector.y;
  270. return this;
  271. };
  272. Vector2.prototype.multiplyInPlace = function (otherVector) {
  273. this.x *= otherVector.x;
  274. this.y *= otherVector.y;
  275. return this;
  276. };
  277. Vector2.prototype.multiply = function (otherVector) {
  278. return new Vector2(this.x * otherVector.x, this.y * otherVector.y);
  279. };
  280. Vector2.prototype.multiplyToRef = function (otherVector, result) {
  281. result.x = this.x * otherVector.x;
  282. result.y = this.y * otherVector.y;
  283. return this;
  284. };
  285. Vector2.prototype.multiplyByFloats = function (x, y) {
  286. return new Vector2(this.x * x, this.y * y);
  287. };
  288. Vector2.prototype.divide = function (otherVector) {
  289. return new Vector2(this.x / otherVector.x, this.y / otherVector.y);
  290. };
  291. Vector2.prototype.divideToRef = function (otherVector, result) {
  292. result.x = this.x / otherVector.x;
  293. result.y = this.y / otherVector.y;
  294. return this;
  295. };
  296. Vector2.prototype.negate = function () {
  297. return new Vector2(-this.x, -this.y);
  298. };
  299. Vector2.prototype.scaleInPlace = function (scale) {
  300. this.x *= scale;
  301. this.y *= scale;
  302. return this;
  303. };
  304. Vector2.prototype.scale = function (scale) {
  305. return new Vector2(this.x * scale, this.y * scale);
  306. };
  307. Vector2.prototype.equals = function (otherVector) {
  308. return otherVector && this.x === otherVector.x && this.y === otherVector.y;
  309. };
  310. // Properties
  311. Vector2.prototype.length = function () {
  312. return Math.sqrt(this.x * this.x + this.y * this.y);
  313. };
  314. Vector2.prototype.lengthSquared = function () {
  315. return (this.x * this.x + this.y * this.y);
  316. };
  317. // Methods
  318. Vector2.prototype.normalize = function () {
  319. var len = this.length();
  320. if (len === 0)
  321. return this;
  322. var num = 1.0 / len;
  323. this.x *= num;
  324. this.y *= num;
  325. return this;
  326. };
  327. Vector2.prototype.clone = function () {
  328. return new Vector2(this.x, this.y);
  329. };
  330. // Statics
  331. Vector2.Zero = function () {
  332. return new Vector2(0, 0);
  333. };
  334. Vector2.FromArray = function (array, offset) {
  335. if (offset === void 0) { offset = 0; }
  336. return new Vector2(array[offset], array[offset + 1]);
  337. };
  338. Vector2.FromArrayToRef = function (array, offset, result) {
  339. result.x = array[offset];
  340. result.y = array[offset + 1];
  341. };
  342. Vector2.CatmullRom = function (value1, value2, value3, value4, amount) {
  343. var squared = amount * amount;
  344. var cubed = amount * squared;
  345. var x = 0.5 * ((((2.0 * value2.x) + ((-value1.x + value3.x) * amount)) + (((((2.0 * value1.x) - (5.0 * value2.x)) + (4.0 * value3.x)) - value4.x) * squared)) + ((((-value1.x + (3.0 * value2.x)) - (3.0 * value3.x)) + value4.x) * cubed));
  346. var y = 0.5 * ((((2.0 * value2.y) + ((-value1.y + value3.y) * amount)) + (((((2.0 * value1.y) - (5.0 * value2.y)) + (4.0 * value3.y)) - value4.y) * squared)) + ((((-value1.y + (3.0 * value2.y)) - (3.0 * value3.y)) + value4.y) * cubed));
  347. return new Vector2(x, y);
  348. };
  349. Vector2.Clamp = function (value, min, max) {
  350. var x = value.x;
  351. x = (x > max.x) ? max.x : x;
  352. x = (x < min.x) ? min.x : x;
  353. var y = value.y;
  354. y = (y > max.y) ? max.y : y;
  355. y = (y < min.y) ? min.y : y;
  356. return new Vector2(x, y);
  357. };
  358. Vector2.Hermite = function (value1, tangent1, value2, tangent2, amount) {
  359. var squared = amount * amount;
  360. var cubed = amount * squared;
  361. var part1 = ((2.0 * cubed) - (3.0 * squared)) + 1.0;
  362. var part2 = (-2.0 * cubed) + (3.0 * squared);
  363. var part3 = (cubed - (2.0 * squared)) + amount;
  364. var part4 = cubed - squared;
  365. var x = (((value1.x * part1) + (value2.x * part2)) + (tangent1.x * part3)) + (tangent2.x * part4);
  366. var y = (((value1.y * part1) + (value2.y * part2)) + (tangent1.y * part3)) + (tangent2.y * part4);
  367. return new Vector2(x, y);
  368. };
  369. Vector2.Lerp = function (start, end, amount) {
  370. var x = start.x + ((end.x - start.x) * amount);
  371. var y = start.y + ((end.y - start.y) * amount);
  372. return new Vector2(x, y);
  373. };
  374. Vector2.Dot = function (left, right) {
  375. return left.x * right.x + left.y * right.y;
  376. };
  377. Vector2.Normalize = function (vector) {
  378. var newVector = vector.clone();
  379. newVector.normalize();
  380. return newVector;
  381. };
  382. Vector2.Minimize = function (left, right) {
  383. var x = (left.x < right.x) ? left.x : right.x;
  384. var y = (left.y < right.y) ? left.y : right.y;
  385. return new Vector2(x, y);
  386. };
  387. Vector2.Maximize = function (left, right) {
  388. var x = (left.x > right.x) ? left.x : right.x;
  389. var y = (left.y > right.y) ? left.y : right.y;
  390. return new Vector2(x, y);
  391. };
  392. Vector2.Transform = function (vector, transformation) {
  393. var x = (vector.x * transformation.m[0]) + (vector.y * transformation.m[4]);
  394. var y = (vector.x * transformation.m[1]) + (vector.y * transformation.m[5]);
  395. return new Vector2(x, y);
  396. };
  397. Vector2.Distance = function (value1, value2) {
  398. return Math.sqrt(Vector2.DistanceSquared(value1, value2));
  399. };
  400. Vector2.DistanceSquared = function (value1, value2) {
  401. var x = value1.x - value2.x;
  402. var y = value1.y - value2.y;
  403. return (x * x) + (y * y);
  404. };
  405. return Vector2;
  406. })();
  407. BABYLON.Vector2 = Vector2;
  408. var Vector3 = (function () {
  409. function Vector3(x, y, z) {
  410. this.x = x;
  411. this.y = y;
  412. this.z = z;
  413. }
  414. Vector3.prototype.toString = function () {
  415. return "{X: " + this.x + " Y:" + this.y + " Z:" + this.z + "}";
  416. };
  417. // Operators
  418. Vector3.prototype.asArray = function () {
  419. var result = [];
  420. this.toArray(result, 0);
  421. return result;
  422. };
  423. Vector3.prototype.toArray = function (array, index) {
  424. if (index === void 0) { index = 0; }
  425. array[index] = this.x;
  426. array[index + 1] = this.y;
  427. array[index + 2] = this.z;
  428. return this;
  429. };
  430. Vector3.prototype.toQuaternion = function () {
  431. var result = new Quaternion(0, 0, 0, 1);
  432. var cosxPlusz = Math.cos((this.x + this.z) * 0.5);
  433. var sinxPlusz = Math.sin((this.x + this.z) * 0.5);
  434. var coszMinusx = Math.cos((this.z - this.x) * 0.5);
  435. var sinzMinusx = Math.sin((this.z - this.x) * 0.5);
  436. var cosy = Math.cos(this.y * 0.5);
  437. var siny = Math.sin(this.y * 0.5);
  438. result.x = coszMinusx * siny;
  439. result.y = -sinzMinusx * siny;
  440. result.z = sinxPlusz * cosy;
  441. result.w = cosxPlusz * cosy;
  442. return result;
  443. };
  444. Vector3.prototype.addInPlace = function (otherVector) {
  445. this.x += otherVector.x;
  446. this.y += otherVector.y;
  447. this.z += otherVector.z;
  448. return this;
  449. };
  450. Vector3.prototype.add = function (otherVector) {
  451. return new Vector3(this.x + otherVector.x, this.y + otherVector.y, this.z + otherVector.z);
  452. };
  453. Vector3.prototype.addToRef = function (otherVector, result) {
  454. result.x = this.x + otherVector.x;
  455. result.y = this.y + otherVector.y;
  456. result.z = this.z + otherVector.z;
  457. return this;
  458. };
  459. Vector3.prototype.subtractInPlace = function (otherVector) {
  460. this.x -= otherVector.x;
  461. this.y -= otherVector.y;
  462. this.z -= otherVector.z;
  463. return this;
  464. };
  465. Vector3.prototype.subtract = function (otherVector) {
  466. return new Vector3(this.x - otherVector.x, this.y - otherVector.y, this.z - otherVector.z);
  467. };
  468. Vector3.prototype.subtractToRef = function (otherVector, result) {
  469. result.x = this.x - otherVector.x;
  470. result.y = this.y - otherVector.y;
  471. result.z = this.z - otherVector.z;
  472. return this;
  473. };
  474. Vector3.prototype.subtractFromFloats = function (x, y, z) {
  475. return new Vector3(this.x - x, this.y - y, this.z - z);
  476. };
  477. Vector3.prototype.subtractFromFloatsToRef = function (x, y, z, result) {
  478. result.x = this.x - x;
  479. result.y = this.y - y;
  480. result.z = this.z - z;
  481. return this;
  482. };
  483. Vector3.prototype.negate = function () {
  484. return new Vector3(-this.x, -this.y, -this.z);
  485. };
  486. Vector3.prototype.scaleInPlace = function (scale) {
  487. this.x *= scale;
  488. this.y *= scale;
  489. this.z *= scale;
  490. return this;
  491. };
  492. Vector3.prototype.scale = function (scale) {
  493. return new Vector3(this.x * scale, this.y * scale, this.z * scale);
  494. };
  495. Vector3.prototype.scaleToRef = function (scale, result) {
  496. result.x = this.x * scale;
  497. result.y = this.y * scale;
  498. result.z = this.z * scale;
  499. };
  500. Vector3.prototype.equals = function (otherVector) {
  501. return otherVector && this.x === otherVector.x && this.y === otherVector.y && this.z === otherVector.z;
  502. };
  503. Vector3.prototype.equalsWithEpsilon = function (otherVector) {
  504. return Math.abs(this.x - otherVector.x) < BABYLON.Engine.Epsilon && Math.abs(this.y - otherVector.y) < BABYLON.Engine.Epsilon && Math.abs(this.z - otherVector.z) < BABYLON.Engine.Epsilon;
  505. };
  506. Vector3.prototype.equalsToFloats = function (x, y, z) {
  507. return this.x === x && this.y === y && this.z === z;
  508. };
  509. Vector3.prototype.multiplyInPlace = function (otherVector) {
  510. this.x *= otherVector.x;
  511. this.y *= otherVector.y;
  512. this.z *= otherVector.z;
  513. return this;
  514. };
  515. Vector3.prototype.multiply = function (otherVector) {
  516. return new Vector3(this.x * otherVector.x, this.y * otherVector.y, this.z * otherVector.z);
  517. };
  518. Vector3.prototype.multiplyToRef = function (otherVector, result) {
  519. result.x = this.x * otherVector.x;
  520. result.y = this.y * otherVector.y;
  521. result.z = this.z * otherVector.z;
  522. return this;
  523. };
  524. Vector3.prototype.multiplyByFloats = function (x, y, z) {
  525. return new Vector3(this.x * x, this.y * y, this.z * z);
  526. };
  527. Vector3.prototype.divide = function (otherVector) {
  528. return new Vector3(this.x / otherVector.x, this.y / otherVector.y, this.z / otherVector.z);
  529. };
  530. Vector3.prototype.divideToRef = function (otherVector, result) {
  531. result.x = this.x / otherVector.x;
  532. result.y = this.y / otherVector.y;
  533. result.z = this.z / otherVector.z;
  534. return this;
  535. };
  536. Vector3.prototype.MinimizeInPlace = function (other) {
  537. if (other.x < this.x)
  538. this.x = other.x;
  539. if (other.y < this.y)
  540. this.y = other.y;
  541. if (other.z < this.z)
  542. this.z = other.z;
  543. return this;
  544. };
  545. Vector3.prototype.MaximizeInPlace = function (other) {
  546. if (other.x > this.x)
  547. this.x = other.x;
  548. if (other.y > this.y)
  549. this.y = other.y;
  550. if (other.z > this.z)
  551. this.z = other.z;
  552. return this;
  553. };
  554. // Properties
  555. Vector3.prototype.length = function () {
  556. return Math.sqrt(this.x * this.x + this.y * this.y + this.z * this.z);
  557. };
  558. Vector3.prototype.lengthSquared = function () {
  559. return (this.x * this.x + this.y * this.y + this.z * this.z);
  560. };
  561. // Methods
  562. Vector3.prototype.normalize = function () {
  563. var len = this.length();
  564. if (len === 0)
  565. return this;
  566. var num = 1.0 / len;
  567. this.x *= num;
  568. this.y *= num;
  569. this.z *= num;
  570. return this;
  571. };
  572. Vector3.prototype.clone = function () {
  573. return new Vector3(this.x, this.y, this.z);
  574. };
  575. Vector3.prototype.copyFrom = function (source) {
  576. this.x = source.x;
  577. this.y = source.y;
  578. this.z = source.z;
  579. return this;
  580. };
  581. Vector3.prototype.copyFromFloats = function (x, y, z) {
  582. this.x = x;
  583. this.y = y;
  584. this.z = z;
  585. return this;
  586. };
  587. // Statics
  588. Vector3.GetClipFactor = function (vector0, vector1, axis, size) {
  589. var d0 = Vector3.Dot(vector0, axis) - size;
  590. var d1 = Vector3.Dot(vector1, axis) - size;
  591. var s = d0 / (d0 - d1);
  592. return s;
  593. };
  594. Vector3.FromArray = function (array, offset) {
  595. if (!offset) {
  596. offset = 0;
  597. }
  598. return new Vector3(array[offset], array[offset + 1], array[offset + 2]);
  599. };
  600. Vector3.FromArrayToRef = function (array, offset, result) {
  601. result.x = array[offset];
  602. result.y = array[offset + 1];
  603. result.z = array[offset + 2];
  604. };
  605. Vector3.FromFloatArrayToRef = function (array, offset, result) {
  606. result.x = array[offset];
  607. result.y = array[offset + 1];
  608. result.z = array[offset + 2];
  609. };
  610. Vector3.FromFloatsToRef = function (x, y, z, result) {
  611. result.x = x;
  612. result.y = y;
  613. result.z = z;
  614. };
  615. Vector3.Zero = function () {
  616. return new Vector3(0, 0, 0);
  617. };
  618. Vector3.Up = function () {
  619. return new Vector3(0, 1.0, 0);
  620. };
  621. Vector3.TransformCoordinates = function (vector, transformation) {
  622. var result = Vector3.Zero();
  623. Vector3.TransformCoordinatesToRef(vector, transformation, result);
  624. return result;
  625. };
  626. Vector3.TransformCoordinatesToRef = function (vector, transformation, result) {
  627. var x = (vector.x * transformation.m[0]) + (vector.y * transformation.m[4]) + (vector.z * transformation.m[8]) + transformation.m[12];
  628. var y = (vector.x * transformation.m[1]) + (vector.y * transformation.m[5]) + (vector.z * transformation.m[9]) + transformation.m[13];
  629. var z = (vector.x * transformation.m[2]) + (vector.y * transformation.m[6]) + (vector.z * transformation.m[10]) + transformation.m[14];
  630. var w = (vector.x * transformation.m[3]) + (vector.y * transformation.m[7]) + (vector.z * transformation.m[11]) + transformation.m[15];
  631. result.x = x / w;
  632. result.y = y / w;
  633. result.z = z / w;
  634. };
  635. Vector3.TransformCoordinatesFromFloatsToRef = function (x, y, z, transformation, result) {
  636. var rx = (x * transformation.m[0]) + (y * transformation.m[4]) + (z * transformation.m[8]) + transformation.m[12];
  637. var ry = (x * transformation.m[1]) + (y * transformation.m[5]) + (z * transformation.m[9]) + transformation.m[13];
  638. var rz = (x * transformation.m[2]) + (y * transformation.m[6]) + (z * transformation.m[10]) + transformation.m[14];
  639. var rw = (x * transformation.m[3]) + (y * transformation.m[7]) + (z * transformation.m[11]) + transformation.m[15];
  640. result.x = rx / rw;
  641. result.y = ry / rw;
  642. result.z = rz / rw;
  643. };
  644. Vector3.TransformCoordinatesToRefSIMD = function (vector, transformation, result) {
  645. var v = SIMD.float32x4.loadXYZ(vector._data, 0);
  646. var m0 = SIMD.float32x4.load(transformation.m, 0);
  647. var m1 = SIMD.float32x4.load(transformation.m, 4);
  648. var m2 = SIMD.float32x4.load(transformation.m, 8);
  649. var m3 = SIMD.float32x4.load(transformation.m, 12);
  650. var r = SIMD.float32x4.add(SIMD.float32x4.add(SIMD.float32x4.mul(SIMD.float32x4.swizzle(v, 0, 0, 0, 0), m0), SIMD.float32x4.mul(SIMD.float32x4.swizzle(v, 1, 1, 1, 1), m1)), SIMD.float32x4.add(SIMD.float32x4.mul(SIMD.float32x4.swizzle(v, 2, 2, 2, 2), m2), m3));
  651. r = SIMD.float32x4.div(r, SIMD.float32x4.swizzle(r, 3, 3, 3, 3));
  652. SIMD.float32x4.storeXYZ(result._data, 0, r);
  653. };
  654. Vector3.TransformCoordinatesFromFloatsToRefSIMD = function (x, y, z, transformation, result) {
  655. var v0 = SIMD.float32x4.splat(x);
  656. var v1 = SIMD.float32x4.splat(y);
  657. var v2 = SIMD.float32x4.splat(z);
  658. var m0 = SIMD.float32x4.load(transformation.m, 0);
  659. var m1 = SIMD.float32x4.load(transformation.m, 4);
  660. var m2 = SIMD.float32x4.load(transformation.m, 8);
  661. var m3 = SIMD.float32x4.load(transformation.m, 12);
  662. var r = SIMD.float32x4.add(SIMD.float32x4.add(SIMD.float32x4.mul(v0, m0), SIMD.float32x4.mul(v1, m1)), SIMD.float32x4.add(SIMD.float32x4.mul(v2, m2), m3));
  663. r = SIMD.float32x4.div(r, SIMD.float32x4.swizzle(r, 3, 3, 3, 3));
  664. SIMD.float32x4.storeXYZ(result._data, 0, r);
  665. };
  666. Vector3.TransformNormal = function (vector, transformation) {
  667. var result = Vector3.Zero();
  668. Vector3.TransformNormalToRef(vector, transformation, result);
  669. return result;
  670. };
  671. Vector3.TransformNormalToRef = function (vector, transformation, result) {
  672. result.x = (vector.x * transformation.m[0]) + (vector.y * transformation.m[4]) + (vector.z * transformation.m[8]);
  673. result.y = (vector.x * transformation.m[1]) + (vector.y * transformation.m[5]) + (vector.z * transformation.m[9]);
  674. result.z = (vector.x * transformation.m[2]) + (vector.y * transformation.m[6]) + (vector.z * transformation.m[10]);
  675. };
  676. Vector3.TransformNormalFromFloatsToRef = function (x, y, z, transformation, result) {
  677. result.x = (x * transformation.m[0]) + (y * transformation.m[4]) + (z * transformation.m[8]);
  678. result.y = (x * transformation.m[1]) + (y * transformation.m[5]) + (z * transformation.m[9]);
  679. result.z = (x * transformation.m[2]) + (y * transformation.m[6]) + (z * transformation.m[10]);
  680. };
  681. Vector3.CatmullRom = function (value1, value2, value3, value4, amount) {
  682. var squared = amount * amount;
  683. var cubed = amount * squared;
  684. var x = 0.5 * ((((2.0 * value2.x) + ((-value1.x + value3.x) * amount)) + (((((2.0 * value1.x) - (5.0 * value2.x)) + (4.0 * value3.x)) - value4.x) * squared)) + ((((-value1.x + (3.0 * value2.x)) - (3.0 * value3.x)) + value4.x) * cubed));
  685. var y = 0.5 * ((((2.0 * value2.y) + ((-value1.y + value3.y) * amount)) + (((((2.0 * value1.y) - (5.0 * value2.y)) + (4.0 * value3.y)) - value4.y) * squared)) + ((((-value1.y + (3.0 * value2.y)) - (3.0 * value3.y)) + value4.y) * cubed));
  686. var z = 0.5 * ((((2.0 * value2.z) + ((-value1.z + value3.z) * amount)) + (((((2.0 * value1.z) - (5.0 * value2.z)) + (4.0 * value3.z)) - value4.z) * squared)) + ((((-value1.z + (3.0 * value2.z)) - (3.0 * value3.z)) + value4.z) * cubed));
  687. return new Vector3(x, y, z);
  688. };
  689. Vector3.Clamp = function (value, min, max) {
  690. var x = value.x;
  691. x = (x > max.x) ? max.x : x;
  692. x = (x < min.x) ? min.x : x;
  693. var y = value.y;
  694. y = (y > max.y) ? max.y : y;
  695. y = (y < min.y) ? min.y : y;
  696. var z = value.z;
  697. z = (z > max.z) ? max.z : z;
  698. z = (z < min.z) ? min.z : z;
  699. return new Vector3(x, y, z);
  700. };
  701. Vector3.Hermite = function (value1, tangent1, value2, tangent2, amount) {
  702. var squared = amount * amount;
  703. var cubed = amount * squared;
  704. var part1 = ((2.0 * cubed) - (3.0 * squared)) + 1.0;
  705. var part2 = (-2.0 * cubed) + (3.0 * squared);
  706. var part3 = (cubed - (2.0 * squared)) + amount;
  707. var part4 = cubed - squared;
  708. var x = (((value1.x * part1) + (value2.x * part2)) + (tangent1.x * part3)) + (tangent2.x * part4);
  709. var y = (((value1.y * part1) + (value2.y * part2)) + (tangent1.y * part3)) + (tangent2.y * part4);
  710. var z = (((value1.z * part1) + (value2.z * part2)) + (tangent1.z * part3)) + (tangent2.z * part4);
  711. return new Vector3(x, y, z);
  712. };
  713. Vector3.Lerp = function (start, end, amount) {
  714. var x = start.x + ((end.x - start.x) * amount);
  715. var y = start.y + ((end.y - start.y) * amount);
  716. var z = start.z + ((end.z - start.z) * amount);
  717. return new Vector3(x, y, z);
  718. };
  719. Vector3.Dot = function (left, right) {
  720. return (left.x * right.x + left.y * right.y + left.z * right.z);
  721. };
  722. Vector3.Cross = function (left, right) {
  723. var result = Vector3.Zero();
  724. Vector3.CrossToRef(left, right, result);
  725. return result;
  726. };
  727. Vector3.CrossToRef = function (left, right, result) {
  728. result.x = left.y * right.z - left.z * right.y;
  729. result.y = left.z * right.x - left.x * right.z;
  730. result.z = left.x * right.y - left.y * right.x;
  731. };
  732. Vector3.Normalize = function (vector) {
  733. var result = Vector3.Zero();
  734. Vector3.NormalizeToRef(vector, result);
  735. return result;
  736. };
  737. Vector3.NormalizeToRef = function (vector, result) {
  738. result.copyFrom(vector);
  739. result.normalize();
  740. };
  741. Vector3.Project = function (vector, world, transform, viewport) {
  742. var cw = viewport.width;
  743. var ch = viewport.height;
  744. var cx = viewport.x;
  745. var cy = viewport.y;
  746. var viewportMatrix = Matrix.FromValues(cw / 2.0, 0, 0, 0, 0, -ch / 2.0, 0, 0, 0, 0, 1, 0, cx + cw / 2.0, ch / 2.0 + cy, 0, 1);
  747. var finalMatrix = world.multiply(transform).multiply(viewportMatrix);
  748. return Vector3.TransformCoordinates(vector, finalMatrix);
  749. };
  750. Vector3.UnprojectFromTransform = function (source, viewportWidth, viewportHeight, world, transform) {
  751. var matrix = world.multiply(transform);
  752. matrix.invert();
  753. source.x = source.x / viewportWidth * 2 - 1;
  754. source.y = -(source.y / viewportHeight * 2 - 1);
  755. var vector = Vector3.TransformCoordinates(source, matrix);
  756. var num = source.x * matrix.m[3] + source.y * matrix.m[7] + source.z * matrix.m[11] + matrix.m[15];
  757. if (BABYLON.Tools.WithinEpsilon(num, 1.0)) {
  758. vector = vector.scale(1.0 / num);
  759. }
  760. return vector;
  761. };
  762. Vector3.Unproject = function (source, viewportWidth, viewportHeight, world, view, projection) {
  763. var matrix = world.multiply(view).multiply(projection);
  764. matrix.invert();
  765. source.x = source.x / viewportWidth * 2 - 1;
  766. source.y = -(source.y / viewportHeight * 2 - 1);
  767. var vector = Vector3.TransformCoordinates(source, matrix);
  768. var num = source.x * matrix.m[3] + source.y * matrix.m[7] + source.z * matrix.m[11] + matrix.m[15];
  769. if (BABYLON.Tools.WithinEpsilon(num, 1.0)) {
  770. vector = vector.scale(1.0 / num);
  771. }
  772. return vector;
  773. };
  774. Vector3.Minimize = function (left, right) {
  775. var min = left.clone();
  776. min.MinimizeInPlace(right);
  777. return min;
  778. };
  779. Vector3.Maximize = function (left, right) {
  780. var max = left.clone();
  781. max.MaximizeInPlace(right);
  782. return max;
  783. };
  784. Vector3.Distance = function (value1, value2) {
  785. return Math.sqrt(Vector3.DistanceSquared(value1, value2));
  786. };
  787. Vector3.DistanceSquared = function (value1, value2) {
  788. var x = value1.x - value2.x;
  789. var y = value1.y - value2.y;
  790. var z = value1.z - value2.z;
  791. return (x * x) + (y * y) + (z * z);
  792. };
  793. Vector3.Center = function (value1, value2) {
  794. var center = value1.add(value2);
  795. center.scaleInPlace(0.5);
  796. return center;
  797. };
  798. return Vector3;
  799. })();
  800. BABYLON.Vector3 = Vector3;
  801. //Vector4 class created for EulerAngle class conversion to Quaternion
  802. var Vector4 = (function () {
  803. function Vector4(x, y, z, w) {
  804. this.x = x;
  805. this.y = y;
  806. this.z = z;
  807. this.w = w;
  808. }
  809. Vector4.prototype.toString = function () {
  810. return "{X: " + this.x + " Y:" + this.y + " Z:" + this.z + "W:" + this.w + "}";
  811. };
  812. // Operators
  813. Vector4.prototype.asArray = function () {
  814. var result = [];
  815. this.toArray(result, 0);
  816. return result;
  817. };
  818. Vector4.prototype.toArray = function (array, index) {
  819. if (index === undefined) {
  820. index = 0;
  821. }
  822. array[index] = this.x;
  823. array[index + 1] = this.y;
  824. array[index + 2] = this.z;
  825. array[index + 3] = this.w;
  826. return this;
  827. };
  828. Vector4.prototype.addInPlace = function (otherVector) {
  829. this.x += otherVector.x;
  830. this.y += otherVector.y;
  831. this.z += otherVector.z;
  832. this.w += otherVector.w;
  833. return this;
  834. };
  835. Vector4.prototype.add = function (otherVector) {
  836. return new Vector4(this.x + otherVector.x, this.y + otherVector.y, this.z + otherVector.z, this.w + otherVector.w);
  837. };
  838. Vector4.prototype.addToRef = function (otherVector, result) {
  839. result.x = this.x + otherVector.x;
  840. result.y = this.y + otherVector.y;
  841. result.z = this.z + otherVector.z;
  842. result.w = this.w + otherVector.w;
  843. return this;
  844. };
  845. Vector4.prototype.subtractInPlace = function (otherVector) {
  846. this.x -= otherVector.x;
  847. this.y -= otherVector.y;
  848. this.z -= otherVector.z;
  849. this.w -= otherVector.w;
  850. return this;
  851. };
  852. Vector4.prototype.subtract = function (otherVector) {
  853. return new Vector4(this.x - otherVector.x, this.y - otherVector.y, this.z - otherVector.z, this.w - otherVector.w);
  854. };
  855. Vector4.prototype.subtractToRef = function (otherVector, result) {
  856. result.x = this.x - otherVector.x;
  857. result.y = this.y - otherVector.y;
  858. result.z = this.z - otherVector.z;
  859. result.w = this.w - otherVector.w;
  860. return this;
  861. };
  862. Vector4.prototype.subtractFromFloats = function (x, y, z, w) {
  863. return new Vector4(this.x - x, this.y - y, this.z - z, this.w - w);
  864. };
  865. Vector4.prototype.subtractFromFloatsToRef = function (x, y, z, w, result) {
  866. result.x = this.x - x;
  867. result.y = this.y - y;
  868. result.z = this.z - z;
  869. result.w = this.w - w;
  870. return this;
  871. };
  872. Vector4.prototype.negate = function () {
  873. return new Vector4(-this.x, -this.y, -this.z, -this.w);
  874. };
  875. Vector4.prototype.scaleInPlace = function (scale) {
  876. this.x *= scale;
  877. this.y *= scale;
  878. this.z *= scale;
  879. this.w *= scale;
  880. return this;
  881. };
  882. Vector4.prototype.scale = function (scale) {
  883. return new Vector4(this.x * scale, this.y * scale, this.z * scale, this.w * scale);
  884. };
  885. Vector4.prototype.scaleToRef = function (scale, result) {
  886. result.x = this.x * scale;
  887. result.y = this.y * scale;
  888. result.z = this.z * scale;
  889. result.w = this.w * scale;
  890. };
  891. Vector4.prototype.equals = function (otherVector) {
  892. return otherVector && this.x === otherVector.x && this.y === otherVector.y && this.z === otherVector.z && this.w === otherVector.w;
  893. };
  894. Vector4.prototype.equalsWithEpsilon = function (otherVector) {
  895. return Math.abs(this.x - otherVector.x) < BABYLON.Engine.Epsilon && Math.abs(this.y - otherVector.y) < BABYLON.Engine.Epsilon && Math.abs(this.z - otherVector.z) < BABYLON.Engine.Epsilon && Math.abs(this.w - otherVector.w) < BABYLON.Engine.Epsilon;
  896. };
  897. Vector4.prototype.equalsToFloats = function (x, y, z, w) {
  898. return this.x === x && this.y === y && this.z === z && this.w === w;
  899. };
  900. Vector4.prototype.multiplyInPlace = function (otherVector) {
  901. this.x *= otherVector.x;
  902. this.y *= otherVector.y;
  903. this.z *= otherVector.z;
  904. this.w *= otherVector.w;
  905. return this;
  906. };
  907. Vector4.prototype.multiply = function (otherVector) {
  908. return new Vector4(this.x * otherVector.x, this.y * otherVector.y, this.z * otherVector.z, this.w * otherVector.w);
  909. };
  910. Vector4.prototype.multiplyToRef = function (otherVector, result) {
  911. result.x = this.x * otherVector.x;
  912. result.y = this.y * otherVector.y;
  913. result.z = this.z * otherVector.z;
  914. result.w = this.w * otherVector.w;
  915. return this;
  916. };
  917. Vector4.prototype.multiplyByFloats = function (x, y, z, w) {
  918. return new Vector4(this.x * x, this.y * y, this.z * z, this.w * w);
  919. };
  920. Vector4.prototype.divide = function (otherVector) {
  921. return new Vector4(this.x / otherVector.x, this.y / otherVector.y, this.z / otherVector.z, this.w / otherVector.w);
  922. };
  923. Vector4.prototype.divideToRef = function (otherVector, result) {
  924. result.x = this.x / otherVector.x;
  925. result.y = this.y / otherVector.y;
  926. result.z = this.z / otherVector.z;
  927. result.w = this.w / otherVector.w;
  928. return this;
  929. };
  930. Vector4.prototype.MinimizeInPlace = function (other) {
  931. if (other.x < this.x)
  932. this.x = other.x;
  933. if (other.y < this.y)
  934. this.y = other.y;
  935. if (other.z < this.z)
  936. this.z = other.z;
  937. if (other.w < this.w)
  938. this.w = other.w;
  939. return this;
  940. };
  941. Vector4.prototype.MaximizeInPlace = function (other) {
  942. if (other.x > this.x)
  943. this.x = other.x;
  944. if (other.y > this.y)
  945. this.y = other.y;
  946. if (other.z > this.z)
  947. this.z = other.z;
  948. if (other.w > this.w)
  949. this.w = other.w;
  950. return this;
  951. };
  952. // Properties
  953. Vector4.prototype.length = function () {
  954. return Math.sqrt(this.x * this.x + this.y * this.y + this.z * this.z + this.w * this.w);
  955. };
  956. Vector4.prototype.lengthSquared = function () {
  957. return (this.x * this.x + this.y * this.y + this.z * this.z + this.w * this.w);
  958. };
  959. // Methods
  960. Vector4.prototype.normalize = function () {
  961. var len = this.length();
  962. if (len === 0)
  963. return this;
  964. var num = 1.0 / len;
  965. this.x *= num;
  966. this.y *= num;
  967. this.z *= num;
  968. this.w *= num;
  969. return this;
  970. };
  971. Vector4.prototype.clone = function () {
  972. return new Vector4(this.x, this.y, this.z, this.w);
  973. };
  974. Vector4.prototype.copyFrom = function (source) {
  975. this.x = source.x;
  976. this.y = source.y;
  977. this.z = source.z;
  978. this.w = source.w;
  979. return this;
  980. };
  981. Vector4.prototype.copyFromFloats = function (x, y, z, w) {
  982. this.x = x;
  983. this.y = y;
  984. this.z = z;
  985. this.w = w;
  986. return this;
  987. };
  988. // Statics
  989. Vector4.FromArray = function (array, offset) {
  990. if (!offset) {
  991. offset = 0;
  992. }
  993. return new Vector4(array[offset], array[offset + 1], array[offset + 2], array[offset + 3]);
  994. };
  995. Vector4.FromArrayToRef = function (array, offset, result) {
  996. result.x = array[offset];
  997. result.y = array[offset + 1];
  998. result.z = array[offset + 2];
  999. result.w = array[offset + 3];
  1000. };
  1001. Vector4.FromFloatArrayToRef = function (array, offset, result) {
  1002. result.x = array[offset];
  1003. result.y = array[offset + 1];
  1004. result.z = array[offset + 2];
  1005. result.w = array[offset + 3];
  1006. };
  1007. Vector4.FromFloatsToRef = function (x, y, z, w, result) {
  1008. result.x = x;
  1009. result.y = y;
  1010. result.z = z;
  1011. result.w = w;
  1012. };
  1013. Vector4.Zero = function () {
  1014. return new Vector4(0, 0, 0, 0);
  1015. };
  1016. Vector4.Normalize = function (vector) {
  1017. var result = Vector4.Zero();
  1018. Vector4.NormalizeToRef(vector, result);
  1019. return result;
  1020. };
  1021. Vector4.NormalizeToRef = function (vector, result) {
  1022. result.copyFrom(vector);
  1023. result.normalize();
  1024. };
  1025. Vector4.Minimize = function (left, right) {
  1026. var min = left.clone();
  1027. min.MinimizeInPlace(right);
  1028. return min;
  1029. };
  1030. Vector4.Maximize = function (left, right) {
  1031. var max = left.clone();
  1032. max.MaximizeInPlace(right);
  1033. return max;
  1034. };
  1035. Vector4.Distance = function (value1, value2) {
  1036. return Math.sqrt(Vector4.DistanceSquared(value1, value2));
  1037. };
  1038. Vector4.DistanceSquared = function (value1, value2) {
  1039. var x = value1.x - value2.x;
  1040. var y = value1.y - value2.y;
  1041. var z = value1.z - value2.z;
  1042. var w = value1.w - value2.w;
  1043. return (x * x) + (y * y) + (z * z) + (w * w);
  1044. };
  1045. Vector4.Center = function (value1, value2) {
  1046. var center = value1.add(value2);
  1047. center.scaleInPlace(0.5);
  1048. return center;
  1049. };
  1050. return Vector4;
  1051. })();
  1052. BABYLON.Vector4 = Vector4;
  1053. var Quaternion = (function () {
  1054. function Quaternion(x, y, z, w) {
  1055. if (x === void 0) { x = 0; }
  1056. if (y === void 0) { y = 0; }
  1057. if (z === void 0) { z = 0; }
  1058. if (w === void 0) { w = 1; }
  1059. this.x = x;
  1060. this.y = y;
  1061. this.z = z;
  1062. this.w = w;
  1063. }
  1064. Quaternion.prototype.toString = function () {
  1065. return "{X: " + this.x + " Y:" + this.y + " Z:" + this.z + " W:" + this.w + "}";
  1066. };
  1067. Quaternion.prototype.asArray = function () {
  1068. return [this.x, this.y, this.z, this.w];
  1069. };
  1070. Quaternion.prototype.equals = function (otherQuaternion) {
  1071. return otherQuaternion && this.x === otherQuaternion.x && this.y === otherQuaternion.y && this.z === otherQuaternion.z && this.w === otherQuaternion.w;
  1072. };
  1073. Quaternion.prototype.clone = function () {
  1074. return new Quaternion(this.x, this.y, this.z, this.w);
  1075. };
  1076. Quaternion.prototype.copyFrom = function (other) {
  1077. this.x = other.x;
  1078. this.y = other.y;
  1079. this.z = other.z;
  1080. this.w = other.w;
  1081. return this;
  1082. };
  1083. Quaternion.prototype.copyFromFloats = function (x, y, z, w) {
  1084. this.x = x;
  1085. this.y = y;
  1086. this.z = z;
  1087. this.w = w;
  1088. return this;
  1089. };
  1090. Quaternion.prototype.add = function (other) {
  1091. return new Quaternion(this.x + other.x, this.y + other.y, this.z + other.z, this.w + other.w);
  1092. };
  1093. Quaternion.prototype.subtract = function (other) {
  1094. return new Quaternion(this.x - other.x, this.y - other.y, this.z - other.z, this.w - other.w);
  1095. };
  1096. Quaternion.prototype.scale = function (value) {
  1097. return new Quaternion(this.x * value, this.y * value, this.z * value, this.w * value);
  1098. };
  1099. Quaternion.prototype.multiply = function (q1) {
  1100. var result = new Quaternion(0, 0, 0, 1.0);
  1101. this.multiplyToRef(q1, result);
  1102. return result;
  1103. };
  1104. Quaternion.prototype.multiplyToRef = function (q1, result) {
  1105. result.x = this.x * q1.w + this.y * q1.z - this.z * q1.y + this.w * q1.x;
  1106. result.y = -this.x * q1.z + this.y * q1.w + this.z * q1.x + this.w * q1.y;
  1107. result.z = this.x * q1.y - this.y * q1.x + this.z * q1.w + this.w * q1.z;
  1108. result.w = -this.x * q1.x - this.y * q1.y - this.z * q1.z + this.w * q1.w;
  1109. return this;
  1110. };
  1111. Quaternion.prototype.length = function () {
  1112. return Math.sqrt((this.x * this.x) + (this.y * this.y) + (this.z * this.z) + (this.w * this.w));
  1113. };
  1114. Quaternion.prototype.normalize = function () {
  1115. var length = 1.0 / this.length();
  1116. this.x *= length;
  1117. this.y *= length;
  1118. this.z *= length;
  1119. this.w *= length;
  1120. return this;
  1121. };
  1122. Quaternion.prototype.toEulerAngles = function () {
  1123. var result = Vector3.Zero();
  1124. this.toEulerAnglesToRef(result);
  1125. return result;
  1126. };
  1127. Quaternion.prototype.toEulerAnglesToRef = function (result) {
  1128. //result is an EulerAngles in the in the z-x-z convention
  1129. var qx = this.x;
  1130. var qy = this.y;
  1131. var qz = this.z;
  1132. var qw = this.w;
  1133. var qxy = qx * qy;
  1134. var qxz = qx * qz;
  1135. var qwy = qw * qy;
  1136. var qwz = qw * qz;
  1137. var qwx = qw * qx;
  1138. var qyz = qy * qz;
  1139. var sqx = qx * qx;
  1140. var sqy = qy * qy;
  1141. var determinant = sqx + sqy;
  1142. if (determinant !== 0.000 && determinant !== 1.000) {
  1143. result.x = Math.atan2(qxz + qwy, qwx - qyz);
  1144. result.y = Math.acos(1 - 2 * determinant);
  1145. result.z = Math.atan2(qxz - qwy, qwx + qyz);
  1146. }
  1147. else {
  1148. if (determinant === 0.0) {
  1149. result.x = 0.0;
  1150. result.y = 0.0;
  1151. result.z = Math.atan2(qxy - qwz, 0.5 - sqy - qz * qz); //actually, degeneracy gives us choice with x+z=Math.atan2(qxy-qwz,0.5-sqy-qz*qz)
  1152. }
  1153. else {
  1154. result.x = Math.atan2(qxy - qwz, 0.5 - sqy - qz * qz); //actually, degeneracy gives us choice with x-z=Math.atan2(qxy-qwz,0.5-sqy-qz*qz)
  1155. result.y = Math.PI;
  1156. result.z = 0.0;
  1157. }
  1158. }
  1159. return this;
  1160. };
  1161. Quaternion.prototype.toRotationMatrix = function (result) {
  1162. var xx = this.x * this.x;
  1163. var yy = this.y * this.y;
  1164. var zz = this.z * this.z;
  1165. var xy = this.x * this.y;
  1166. var zw = this.z * this.w;
  1167. var zx = this.z * this.x;
  1168. var yw = this.y * this.w;
  1169. var yz = this.y * this.z;
  1170. var xw = this.x * this.w;
  1171. result.m[0] = 1.0 - (2.0 * (yy + zz));
  1172. result.m[1] = 2.0 * (xy + zw);
  1173. result.m[2] = 2.0 * (zx - yw);
  1174. result.m[3] = 0;
  1175. result.m[4] = 2.0 * (xy - zw);
  1176. result.m[5] = 1.0 - (2.0 * (zz + xx));
  1177. result.m[6] = 2.0 * (yz + xw);
  1178. result.m[7] = 0;
  1179. result.m[8] = 2.0 * (zx + yw);
  1180. result.m[9] = 2.0 * (yz - xw);
  1181. result.m[10] = 1.0 - (2.0 * (yy + xx));
  1182. result.m[11] = 0;
  1183. result.m[12] = 0;
  1184. result.m[13] = 0;
  1185. result.m[14] = 0;
  1186. result.m[15] = 1.0;
  1187. return this;
  1188. };
  1189. Quaternion.prototype.fromRotationMatrix = function (matrix) {
  1190. Quaternion.FromRotationMatrixToRef(matrix, this);
  1191. return this;
  1192. };
  1193. // Statics
  1194. Quaternion.FromRotationMatrix = function (matrix) {
  1195. var result = new Quaternion();
  1196. Quaternion.FromRotationMatrixToRef(matrix, result);
  1197. return result;
  1198. };
  1199. Quaternion.FromRotationMatrixToRef = function (matrix, result) {
  1200. var data = matrix.m;
  1201. var m11 = data[0], m12 = data[4], m13 = data[8];
  1202. var m21 = data[1], m22 = data[5], m23 = data[9];
  1203. var m31 = data[2], m32 = data[6], m33 = data[10];
  1204. var trace = m11 + m22 + m33;
  1205. var s;
  1206. if (trace > 0) {
  1207. s = 0.5 / Math.sqrt(trace + 1.0);
  1208. result.w = 0.25 / s;
  1209. result.x = (m32 - m23) * s;
  1210. result.y = (m13 - m31) * s;
  1211. result.z = (m21 - m12) * s;
  1212. }
  1213. else if (m11 > m22 && m11 > m33) {
  1214. s = 2.0 * Math.sqrt(1.0 + m11 - m22 - m33);
  1215. result.w = (m32 - m23) / s;
  1216. result.x = 0.25 * s;
  1217. result.y = (m12 + m21) / s;
  1218. result.z = (m13 + m31) / s;
  1219. }
  1220. else if (m22 > m33) {
  1221. s = 2.0 * Math.sqrt(1.0 + m22 - m11 - m33);
  1222. result.w = (m13 - m31) / s;
  1223. result.x = (m12 + m21) / s;
  1224. result.y = 0.25 * s;
  1225. result.z = (m23 + m32) / s;
  1226. }
  1227. else {
  1228. s = 2.0 * Math.sqrt(1.0 + m33 - m11 - m22);
  1229. result.w = (m21 - m12) / s;
  1230. result.x = (m13 + m31) / s;
  1231. result.y = (m23 + m32) / s;
  1232. result.z = 0.25 * s;
  1233. }
  1234. };
  1235. Quaternion.Inverse = function (q) {
  1236. return new Quaternion(-q.x, -q.y, -q.z, q.w);
  1237. };
  1238. Quaternion.Identity = function () {
  1239. return new Quaternion(0, 0, 0, 1);
  1240. };
  1241. Quaternion.RotationAxis = function (axis, angle) {
  1242. var result = new Quaternion();
  1243. var sin = Math.sin(angle / 2);
  1244. result.w = Math.cos(angle / 2);
  1245. result.x = axis.x * sin;
  1246. result.y = axis.y * sin;
  1247. result.z = axis.z * sin;
  1248. return result;
  1249. };
  1250. Quaternion.FromArray = function (array, offset) {
  1251. if (!offset) {
  1252. offset = 0;
  1253. }
  1254. return new Quaternion(array[offset], array[offset + 1], array[offset + 2], array[offset + 3]);
  1255. };
  1256. Quaternion.RotationYawPitchRoll = function (yaw, pitch, roll) {
  1257. var result = new Quaternion();
  1258. Quaternion.RotationYawPitchRollToRef(yaw, pitch, roll, result);
  1259. return result;
  1260. };
  1261. Quaternion.RotationYawPitchRollToRef = function (yaw, pitch, roll, result) {
  1262. // Produces a quaternion from Euler angles in the z-y-x orientation (Tait-Bryan angles)
  1263. var halfRoll = roll * 0.5;
  1264. var halfPitch = pitch * 0.5;
  1265. var halfYaw = yaw * 0.5;
  1266. var sinRoll = Math.sin(halfRoll);
  1267. var cosRoll = Math.cos(halfRoll);
  1268. var sinPitch = Math.sin(halfPitch);
  1269. var cosPitch = Math.cos(halfPitch);
  1270. var sinYaw = Math.sin(halfYaw);
  1271. var cosYaw = Math.cos(halfYaw);
  1272. result.x = (cosYaw * sinPitch * cosRoll) + (sinYaw * cosPitch * sinRoll);
  1273. result.y = (sinYaw * cosPitch * cosRoll) - (cosYaw * sinPitch * sinRoll);
  1274. result.z = (cosYaw * cosPitch * sinRoll) - (sinYaw * sinPitch * cosRoll);
  1275. result.w = (cosYaw * cosPitch * cosRoll) + (sinYaw * sinPitch * sinRoll);
  1276. };
  1277. Quaternion.RotationAlphaBetaGamma = function (alpha, beta, gamma) {
  1278. var result = new Quaternion();
  1279. Quaternion.RotationAlphaBetaGammaToRef(alpha, beta, gamma, result);
  1280. return result;
  1281. };
  1282. Quaternion.RotationAlphaBetaGammaToRef = function (alpha, beta, gamma, result) {
  1283. // Produces a quaternion from Euler angles in the z-x-z orientation
  1284. var halfGammaPlusAlpha = (gamma + alpha) * 0.5;
  1285. var halfGammaMinusAlpha = (gamma - alpha) * 0.5;
  1286. var halfBeta = beta * 0.5;
  1287. result.x = Math.cos(halfGammaMinusAlpha) * Math.sin(halfBeta);
  1288. result.y = Math.sin(halfGammaMinusAlpha) * Math.sin(halfBeta);
  1289. result.z = Math.sin(halfGammaPlusAlpha) * Math.cos(halfBeta);
  1290. result.w = Math.cos(halfGammaPlusAlpha) * Math.cos(halfBeta);
  1291. };
  1292. Quaternion.Slerp = function (left, right, amount) {
  1293. var num2;
  1294. var num3;
  1295. var num = amount;
  1296. var num4 = (((left.x * right.x) + (left.y * right.y)) + (left.z * right.z)) + (left.w * right.w);
  1297. var flag = false;
  1298. if (num4 < 0) {
  1299. flag = true;
  1300. num4 = -num4;
  1301. }
  1302. if (num4 > 0.999999) {
  1303. num3 = 1 - num;
  1304. num2 = flag ? -num : num;
  1305. }
  1306. else {
  1307. var num5 = Math.acos(num4);
  1308. var num6 = (1.0 / Math.sin(num5));
  1309. num3 = (Math.sin((1.0 - num) * num5)) * num6;
  1310. num2 = flag ? ((-Math.sin(num * num5)) * num6) : ((Math.sin(num * num5)) * num6);
  1311. }
  1312. return new Quaternion((num3 * left.x) + (num2 * right.x), (num3 * left.y) + (num2 * right.y), (num3 * left.z) + (num2 * right.z), (num3 * left.w) + (num2 * right.w));
  1313. };
  1314. return Quaternion;
  1315. })();
  1316. BABYLON.Quaternion = Quaternion;
  1317. var Matrix = (function () {
  1318. function Matrix() {
  1319. this.m = new Float32Array(16);
  1320. }
  1321. // Properties
  1322. Matrix.prototype.isIdentity = function () {
  1323. if (this.m[0] !== 1.0 || this.m[5] !== 1.0 || this.m[10] !== 1.0 || this.m[15] !== 1.0)
  1324. return false;
  1325. if (this.m[1] !== 0.0 || this.m[2] !== 0.0 || this.m[3] !== 0.0 || this.m[4] !== 0.0 || this.m[6] !== 0.0 || this.m[7] !== 0.0 || this.m[8] !== 0.0 || this.m[9] !== 0.0 || this.m[11] !== 0.0 || this.m[12] !== 0.0 || this.m[13] !== 0.0 || this.m[14] !== 0.0)
  1326. return false;
  1327. return true;
  1328. };
  1329. Matrix.prototype.determinant = function () {
  1330. var temp1 = (this.m[10] * this.m[15]) - (this.m[11] * this.m[14]);
  1331. var temp2 = (this.m[9] * this.m[15]) - (this.m[11] * this.m[13]);
  1332. var temp3 = (this.m[9] * this.m[14]) - (this.m[10] * this.m[13]);
  1333. var temp4 = (this.m[8] * this.m[15]) - (this.m[11] * this.m[12]);
  1334. var temp5 = (this.m[8] * this.m[14]) - (this.m[10] * this.m[12]);
  1335. var temp6 = (this.m[8] * this.m[13]) - (this.m[9] * this.m[12]);
  1336. return ((((this.m[0] * (((this.m[5] * temp1) - (this.m[6] * temp2)) + (this.m[7] * temp3))) - (this.m[1] * (((this.m[4] * temp1) - (this.m[6] * temp4)) + (this.m[7] * temp5)))) + (this.m[2] * (((this.m[4] * temp2) - (this.m[5] * temp4)) + (this.m[7] * temp6)))) - (this.m[3] * (((this.m[4] * temp3) - (this.m[5] * temp5)) + (this.m[6] * temp6))));
  1337. };
  1338. // Methods
  1339. Matrix.prototype.toArray = function () {
  1340. return this.m;
  1341. };
  1342. Matrix.prototype.asArray = function () {
  1343. return this.toArray();
  1344. };
  1345. Matrix.prototype.invert = function () {
  1346. this.invertToRef(this);
  1347. return this;
  1348. };
  1349. Matrix.prototype.invertToRef = function (other) {
  1350. var l1 = this.m[0];
  1351. var l2 = this.m[1];
  1352. var l3 = this.m[2];
  1353. var l4 = this.m[3];
  1354. var l5 = this.m[4];
  1355. var l6 = this.m[5];
  1356. var l7 = this.m[6];
  1357. var l8 = this.m[7];
  1358. var l9 = this.m[8];
  1359. var l10 = this.m[9];
  1360. var l11 = this.m[10];
  1361. var l12 = this.m[11];
  1362. var l13 = this.m[12];
  1363. var l14 = this.m[13];
  1364. var l15 = this.m[14];
  1365. var l16 = this.m[15];
  1366. var l17 = (l11 * l16) - (l12 * l15);
  1367. var l18 = (l10 * l16) - (l12 * l14);
  1368. var l19 = (l10 * l15) - (l11 * l14);
  1369. var l20 = (l9 * l16) - (l12 * l13);
  1370. var l21 = (l9 * l15) - (l11 * l13);
  1371. var l22 = (l9 * l14) - (l10 * l13);
  1372. var l23 = ((l6 * l17) - (l7 * l18)) + (l8 * l19);
  1373. var l24 = -(((l5 * l17) - (l7 * l20)) + (l8 * l21));
  1374. var l25 = ((l5 * l18) - (l6 * l20)) + (l8 * l22);
  1375. var l26 = -(((l5 * l19) - (l6 * l21)) + (l7 * l22));
  1376. var l27 = 1.0 / ((((l1 * l23) + (l2 * l24)) + (l3 * l25)) + (l4 * l26));
  1377. var l28 = (l7 * l16) - (l8 * l15);
  1378. var l29 = (l6 * l16) - (l8 * l14);
  1379. var l30 = (l6 * l15) - (l7 * l14);
  1380. var l31 = (l5 * l16) - (l8 * l13);
  1381. var l32 = (l5 * l15) - (l7 * l13);
  1382. var l33 = (l5 * l14) - (l6 * l13);
  1383. var l34 = (l7 * l12) - (l8 * l11);
  1384. var l35 = (l6 * l12) - (l8 * l10);
  1385. var l36 = (l6 * l11) - (l7 * l10);
  1386. var l37 = (l5 * l12) - (l8 * l9);
  1387. var l38 = (l5 * l11) - (l7 * l9);
  1388. var l39 = (l5 * l10) - (l6 * l9);
  1389. other.m[0] = l23 * l27;
  1390. other.m[4] = l24 * l27;
  1391. other.m[8] = l25 * l27;
  1392. other.m[12] = l26 * l27;
  1393. other.m[1] = -(((l2 * l17) - (l3 * l18)) + (l4 * l19)) * l27;
  1394. other.m[5] = (((l1 * l17) - (l3 * l20)) + (l4 * l21)) * l27;
  1395. other.m[9] = -(((l1 * l18) - (l2 * l20)) + (l4 * l22)) * l27;
  1396. other.m[13] = (((l1 * l19) - (l2 * l21)) + (l3 * l22)) * l27;
  1397. other.m[2] = (((l2 * l28) - (l3 * l29)) + (l4 * l30)) * l27;
  1398. other.m[6] = -(((l1 * l28) - (l3 * l31)) + (l4 * l32)) * l27;
  1399. other.m[10] = (((l1 * l29) - (l2 * l31)) + (l4 * l33)) * l27;
  1400. other.m[14] = -(((l1 * l30) - (l2 * l32)) + (l3 * l33)) * l27;
  1401. other.m[3] = -(((l2 * l34) - (l3 * l35)) + (l4 * l36)) * l27;
  1402. other.m[7] = (((l1 * l34) - (l3 * l37)) + (l4 * l38)) * l27;
  1403. other.m[11] = -(((l1 * l35) - (l2 * l37)) + (l4 * l39)) * l27;
  1404. other.m[15] = (((l1 * l36) - (l2 * l38)) + (l3 * l39)) * l27;
  1405. return this;
  1406. };
  1407. Matrix.prototype.invertToRefSIMD = function (other) {
  1408. var src = this.m;
  1409. var dest = other.m;
  1410. var row0, row1, row2, row3;
  1411. var tmp1;
  1412. var minor0, minor1, minor2, minor3;
  1413. var det;
  1414. // Load the 4 rows
  1415. var src0 = SIMD.float32x4.load(src, 0);
  1416. var src1 = SIMD.float32x4.load(src, 4);
  1417. var src2 = SIMD.float32x4.load(src, 8);
  1418. var src3 = SIMD.float32x4.load(src, 12);
  1419. // Transpose the source matrix. Sort of. Not a true transpose operation
  1420. tmp1 = SIMD.float32x4.shuffle(src0, src1, 0, 1, 4, 5);
  1421. row1 = SIMD.float32x4.shuffle(src2, src3, 0, 1, 4, 5);
  1422. row0 = SIMD.float32x4.shuffle(tmp1, row1, 0, 2, 4, 6);
  1423. row1 = SIMD.float32x4.shuffle(row1, tmp1, 1, 3, 5, 7);
  1424. tmp1 = SIMD.float32x4.shuffle(src0, src1, 2, 3, 6, 7);
  1425. row3 = SIMD.float32x4.shuffle(src2, src3, 2, 3, 6, 7);
  1426. row2 = SIMD.float32x4.shuffle(tmp1, row3, 0, 2, 4, 6);
  1427. row3 = SIMD.float32x4.shuffle(row3, tmp1, 1, 3, 5, 7);
  1428. // This is a true transposition, but it will lead to an incorrect result
  1429. //tmp1 = SIMD.float32x4.shuffle(src0, src1, 0, 1, 4, 5);
  1430. //tmp2 = SIMD.float32x4.shuffle(src2, src3, 0, 1, 4, 5);
  1431. //row0 = SIMD.float32x4.shuffle(tmp1, tmp2, 0, 2, 4, 6);
  1432. //row1 = SIMD.float32x4.shuffle(tmp1, tmp2, 1, 3, 5, 7);
  1433. //tmp1 = SIMD.float32x4.shuffle(src0, src1, 2, 3, 6, 7);
  1434. //tmp2 = SIMD.float32x4.shuffle(src2, src3, 2, 3, 6, 7);
  1435. //row2 = SIMD.float32x4.shuffle(tmp1, tmp2, 0, 2, 4, 6);
  1436. //row3 = SIMD.float32x4.shuffle(tmp1, tmp2, 1, 3, 5, 7);
  1437. // ----
  1438. tmp1 = SIMD.float32x4.mul(row2, row3);
  1439. tmp1 = SIMD.float32x4.swizzle(tmp1, 1, 0, 3, 2); // 0xB1 = 10110001
  1440. minor0 = SIMD.float32x4.mul(row1, tmp1);
  1441. minor1 = SIMD.float32x4.mul(row0, tmp1);
  1442. tmp1 = SIMD.float32x4.swizzle(tmp1, 2, 3, 0, 1); // 0x4E = 01001110
  1443. minor0 = SIMD.float32x4.sub(SIMD.float32x4.mul(row1, tmp1), minor0);
  1444. minor1 = SIMD.float32x4.sub(SIMD.float32x4.mul(row0, tmp1), minor1);
  1445. minor1 = SIMD.float32x4.swizzle(minor1, 2, 3, 0, 1); // 0x4E = 01001110
  1446. // ----
  1447. tmp1 = SIMD.float32x4.mul(row1, row2);
  1448. tmp1 = SIMD.float32x4.swizzle(tmp1, 1, 0, 3, 2); // 0xB1 = 10110001
  1449. minor0 = SIMD.float32x4.add(SIMD.float32x4.mul(row3, tmp1), minor0);
  1450. minor3 = SIMD.float32x4.mul(row0, tmp1);
  1451. tmp1 = SIMD.float32x4.swizzle(tmp1, 2, 3, 0, 1); // 0x4E = 01001110
  1452. minor0 = SIMD.float32x4.sub(minor0, SIMD.float32x4.mul(row3, tmp1));
  1453. minor3 = SIMD.float32x4.sub(SIMD.float32x4.mul(row0, tmp1), minor3);
  1454. minor3 = SIMD.float32x4.swizzle(minor3, 2, 3, 0, 1); // 0x4E = 01001110
  1455. // ----
  1456. tmp1 = SIMD.float32x4.mul(SIMD.float32x4.swizzle(row1, 2, 3, 0, 1), row3); // 0x4E = 01001110
  1457. tmp1 = SIMD.float32x4.swizzle(tmp1, 1, 0, 3, 2); // 0xB1 = 10110001
  1458. row2 = SIMD.float32x4.swizzle(row2, 2, 3, 0, 1); // 0x4E = 01001110
  1459. minor0 = SIMD.float32x4.add(SIMD.float32x4.mul(row2, tmp1), minor0);
  1460. minor2 = SIMD.float32x4.mul(row0, tmp1);
  1461. tmp1 = SIMD.float32x4.swizzle(tmp1, 2, 3, 0, 1); // 0x4E = 01001110
  1462. minor0 = SIMD.float32x4.sub(minor0, SIMD.float32x4.mul(row2, tmp1));
  1463. minor2 = SIMD.float32x4.sub(SIMD.float32x4.mul(row0, tmp1), minor2);
  1464. minor2 = SIMD.float32x4.swizzle(minor2, 2, 3, 0, 1); // 0x4E = 01001110
  1465. // ----
  1466. tmp1 = SIMD.float32x4.mul(row0, row1);
  1467. tmp1 = SIMD.float32x4.swizzle(tmp1, 1, 0, 3, 2); // 0xB1 = 10110001
  1468. minor2 = SIMD.float32x4.add(SIMD.float32x4.mul(row3, tmp1), minor2);
  1469. minor3 = SIMD.float32x4.sub(SIMD.float32x4.mul(row2, tmp1), minor3);
  1470. tmp1 = SIMD.float32x4.swizzle(tmp1, 2, 3, 0, 1); // 0x4E = 01001110
  1471. minor2 = SIMD.float32x4.sub(SIMD.float32x4.mul(row3, tmp1), minor2);
  1472. minor3 = SIMD.float32x4.sub(minor3, SIMD.float32x4.mul(row2, tmp1));
  1473. // ----
  1474. tmp1 = SIMD.float32x4.mul(row0, row3);
  1475. tmp1 = SIMD.float32x4.swizzle(tmp1, 1, 0, 3, 2); // 0xB1 = 10110001
  1476. minor1 = SIMD.float32x4.sub(minor1, SIMD.float32x4.mul(row2, tmp1));
  1477. minor2 = SIMD.float32x4.add(SIMD.float32x4.mul(row1, tmp1), minor2);
  1478. tmp1 = SIMD.float32x4.swizzle(tmp1, 2, 3, 0, 1); // 0x4E = 01001110
  1479. minor1 = SIMD.float32x4.add(SIMD.float32x4.mul(row2, tmp1), minor1);
  1480. minor2 = SIMD.float32x4.sub(minor2, SIMD.float32x4.mul(row1, tmp1));
  1481. // ----
  1482. tmp1 = SIMD.float32x4.mul(row0, row2);
  1483. tmp1 = SIMD.float32x4.swizzle(tmp1, 1, 0, 3, 2); // 0xB1 = 10110001
  1484. minor1 = SIMD.float32x4.add(SIMD.float32x4.mul(row3, tmp1), minor1);
  1485. minor3 = SIMD.float32x4.sub(minor3, SIMD.float32x4.mul(row1, tmp1));
  1486. tmp1 = SIMD.float32x4.swizzle(tmp1, 2, 3, 0, 1); // 0x4E = 01001110
  1487. minor1 = SIMD.float32x4.sub(minor1, SIMD.float32x4.mul(row3, tmp1));
  1488. minor3 = SIMD.float32x4.add(SIMD.float32x4.mul(row1, tmp1), minor3);
  1489. // Compute determinant
  1490. det = SIMD.float32x4.mul(row0, minor0);
  1491. det = SIMD.float32x4.add(SIMD.float32x4.swizzle(det, 2, 3, 0, 1), det); // 0x4E = 01001110
  1492. det = SIMD.float32x4.add(SIMD.float32x4.swizzle(det, 1, 0, 3, 2), det); // 0xB1 = 10110001
  1493. tmp1 = SIMD.float32x4.reciprocalApproximation(det);
  1494. det = SIMD.float32x4.sub(SIMD.float32x4.add(tmp1, tmp1), SIMD.float32x4.mul(det, SIMD.float32x4.mul(tmp1, tmp1)));
  1495. det = SIMD.float32x4.swizzle(det, 0, 0, 0, 0);
  1496. // These shuffles aren't necessary if the faulty transposition is done
  1497. // up at the top of this function.
  1498. //minor0 = SIMD.float32x4.swizzle(minor0, 2, 1, 0, 3);
  1499. //minor1 = SIMD.float32x4.swizzle(minor1, 2, 1, 0, 3);
  1500. //minor2 = SIMD.float32x4.swizzle(minor2, 2, 1, 0, 3);
  1501. //minor3 = SIMD.float32x4.swizzle(minor3, 2, 1, 0, 3);
  1502. // Compute final values by multiplying with 1/det
  1503. minor0 = SIMD.float32x4.mul(det, minor0);
  1504. minor1 = SIMD.float32x4.mul(det, minor1);
  1505. minor2 = SIMD.float32x4.mul(det, minor2);
  1506. minor3 = SIMD.float32x4.mul(det, minor3);
  1507. SIMD.float32x4.store(dest, 0, minor0);
  1508. SIMD.float32x4.store(dest, 4, minor1);
  1509. SIMD.float32x4.store(dest, 8, minor2);
  1510. SIMD.float32x4.store(dest, 12, minor3);
  1511. return this;
  1512. };
  1513. Matrix.prototype.setTranslation = function (vector3) {
  1514. this.m[12] = vector3.x;
  1515. this.m[13] = vector3.y;
  1516. this.m[14] = vector3.z;
  1517. return this;
  1518. };
  1519. Matrix.prototype.multiply = function (other) {
  1520. var result = new Matrix();
  1521. this.multiplyToRef(other, result);
  1522. return result;
  1523. };
  1524. Matrix.prototype.copyFrom = function (other) {
  1525. for (var index = 0; index < 16; index++) {
  1526. this.m[index] = other.m[index];
  1527. }
  1528. return this;
  1529. };
  1530. Matrix.prototype.copyToArray = function (array, offset) {
  1531. if (offset === void 0) { offset = 0; }
  1532. for (var index = 0; index < 16; index++) {
  1533. array[offset + index] = this.m[index];
  1534. }
  1535. return this;
  1536. };
  1537. Matrix.prototype.multiplyToRef = function (other, result) {
  1538. this.multiplyToArray(other, result.m, 0);
  1539. return this;
  1540. };
  1541. Matrix.prototype.multiplyToArray = function (other, result, offset) {
  1542. var tm0 = this.m[0];
  1543. var tm1 = this.m[1];
  1544. var tm2 = this.m[2];
  1545. var tm3 = this.m[3];
  1546. var tm4 = this.m[4];
  1547. var tm5 = this.m[5];
  1548. var tm6 = this.m[6];
  1549. var tm7 = this.m[7];
  1550. var tm8 = this.m[8];
  1551. var tm9 = this.m[9];
  1552. var tm10 = this.m[10];
  1553. var tm11 = this.m[11];
  1554. var tm12 = this.m[12];
  1555. var tm13 = this.m[13];
  1556. var tm14 = this.m[14];
  1557. var tm15 = this.m[15];
  1558. var om0 = other.m[0];
  1559. var om1 = other.m[1];
  1560. var om2 = other.m[2];
  1561. var om3 = other.m[3];
  1562. var om4 = other.m[4];
  1563. var om5 = other.m[5];
  1564. var om6 = other.m[6];
  1565. var om7 = other.m[7];
  1566. var om8 = other.m[8];
  1567. var om9 = other.m[9];
  1568. var om10 = other.m[10];
  1569. var om11 = other.m[11];
  1570. var om12 = other.m[12];
  1571. var om13 = other.m[13];
  1572. var om14 = other.m[14];
  1573. var om15 = other.m[15];
  1574. result[offset] = tm0 * om0 + tm1 * om4 + tm2 * om8 + tm3 * om12;
  1575. result[offset + 1] = tm0 * om1 + tm1 * om5 + tm2 * om9 + tm3 * om13;
  1576. result[offset + 2] = tm0 * om2 + tm1 * om6 + tm2 * om10 + tm3 * om14;
  1577. result[offset + 3] = tm0 * om3 + tm1 * om7 + tm2 * om11 + tm3 * om15;
  1578. result[offset + 4] = tm4 * om0 + tm5 * om4 + tm6 * om8 + tm7 * om12;
  1579. result[offset + 5] = tm4 * om1 + tm5 * om5 + tm6 * om9 + tm7 * om13;
  1580. result[offset + 6] = tm4 * om2 + tm5 * om6 + tm6 * om10 + tm7 * om14;
  1581. result[offset + 7] = tm4 * om3 + tm5 * om7 + tm6 * om11 + tm7 * om15;
  1582. result[offset + 8] = tm8 * om0 + tm9 * om4 + tm10 * om8 + tm11 * om12;
  1583. result[offset + 9] = tm8 * om1 + tm9 * om5 + tm10 * om9 + tm11 * om13;
  1584. result[offset + 10] = tm8 * om2 + tm9 * om6 + tm10 * om10 + tm11 * om14;
  1585. result[offset + 11] = tm8 * om3 + tm9 * om7 + tm10 * om11 + tm11 * om15;
  1586. result[offset + 12] = tm12 * om0 + tm13 * om4 + tm14 * om8 + tm15 * om12;
  1587. result[offset + 13] = tm12 * om1 + tm13 * om5 + tm14 * om9 + tm15 * om13;
  1588. result[offset + 14] = tm12 * om2 + tm13 * om6 + tm14 * om10 + tm15 * om14;
  1589. result[offset + 15] = tm12 * om3 + tm13 * om7 + tm14 * om11 + tm15 * om15;
  1590. return this;
  1591. };
  1592. Matrix.prototype.multiplyToArraySIMD = function (other, result, offset) {
  1593. if (offset === void 0) { offset = 0; }
  1594. var tm = this.m;
  1595. var om = other.m;
  1596. var om0 = SIMD.float32x4.load(om, 0);
  1597. var om1 = SIMD.float32x4.load(om, 4);
  1598. var om2 = SIMD.float32x4.load(om, 8);
  1599. var om3 = SIMD.float32x4.load(om, 12);
  1600. var tm0 = SIMD.float32x4.load(tm, 0);
  1601. SIMD.float32x4.store(result, offset + 0, SIMD.float32x4.add(SIMD.float32x4.mul(SIMD.float32x4.swizzle(tm0, 0, 0, 0, 0), om0), SIMD.float32x4.add(SIMD.float32x4.mul(SIMD.float32x4.swizzle(tm0, 1, 1, 1, 1), om1), SIMD.float32x4.add(SIMD.float32x4.mul(SIMD.float32x4.swizzle(tm0, 2, 2, 2, 2), om2), SIMD.float32x4.mul(SIMD.float32x4.swizzle(tm0, 3, 3, 3, 3), om3)))));
  1602. var tm1 = SIMD.float32x4.load(tm, 4);
  1603. SIMD.float32x4.store(result, offset + 4, SIMD.float32x4.add(SIMD.float32x4.mul(SIMD.float32x4.swizzle(tm1, 0, 0, 0, 0), om0), SIMD.float32x4.add(SIMD.float32x4.mul(SIMD.float32x4.swizzle(tm1, 1, 1, 1, 1), om1), SIMD.float32x4.add(SIMD.float32x4.mul(SIMD.float32x4.swizzle(tm1, 2, 2, 2, 2), om2), SIMD.float32x4.mul(SIMD.float32x4.swizzle(tm1, 3, 3, 3, 3), om3)))));
  1604. var tm2 = SIMD.float32x4.load(tm, 8);
  1605. SIMD.float32x4.store(result, offset + 8, SIMD.float32x4.add(SIMD.float32x4.mul(SIMD.float32x4.swizzle(tm2, 0, 0, 0, 0), om0), SIMD.float32x4.add(SIMD.float32x4.mul(SIMD.float32x4.swizzle(tm2, 1, 1, 1, 1), om1), SIMD.float32x4.add(SIMD.float32x4.mul(SIMD.float32x4.swizzle(tm2, 2, 2, 2, 2), om2), SIMD.float32x4.mul(SIMD.float32x4.swizzle(tm2, 3, 3, 3, 3), om3)))));
  1606. var tm3 = SIMD.float32x4.load(tm, 12);
  1607. SIMD.float32x4.store(result, offset + 12, SIMD.float32x4.add(SIMD.float32x4.mul(SIMD.float32x4.swizzle(tm3, 0, 0, 0, 0), om0), SIMD.float32x4.add(SIMD.float32x4.mul(SIMD.float32x4.swizzle(tm3, 1, 1, 1, 1), om1), SIMD.float32x4.add(SIMD.float32x4.mul(SIMD.float32x4.swizzle(tm3, 2, 2, 2, 2), om2), SIMD.float32x4.mul(SIMD.float32x4.swizzle(tm3, 3, 3, 3, 3), om3)))));
  1608. };
  1609. Matrix.prototype.equals = function (value) {
  1610. return value && (this.m[0] === value.m[0] && this.m[1] === value.m[1] && this.m[2] === value.m[2] && this.m[3] === value.m[3] && this.m[4] === value.m[4] && this.m[5] === value.m[5] && this.m[6] === value.m[6] && this.m[7] === value.m[7] && this.m[8] === value.m[8] && this.m[9] === value.m[9] && this.m[10] === value.m[10] && this.m[11] === value.m[11] && this.m[12] === value.m[12] && this.m[13] === value.m[13] && this.m[14] === value.m[14] && this.m[15] === value.m[15]);
  1611. };
  1612. Matrix.prototype.clone = function () {
  1613. return Matrix.FromValues(this.m[0], this.m[1], this.m[2], this.m[3], this.m[4], this.m[5], this.m[6], this.m[7], this.m[8], this.m[9], this.m[10], this.m[11], this.m[12], this.m[13], this.m[14], this.m[15]);
  1614. };
  1615. Matrix.prototype.decompose = function (scale, rotation, translation) {
  1616. translation.x = this.m[12];
  1617. translation.y = this.m[13];
  1618. translation.z = this.m[14];
  1619. var xs = BABYLON.Tools.Sign(this.m[0] * this.m[1] * this.m[2] * this.m[3]) < 0 ? -1 : 1;
  1620. var ys = BABYLON.Tools.Sign(this.m[4] * this.m[5] * this.m[6] * this.m[7]) < 0 ? -1 : 1;
  1621. var zs = BABYLON.Tools.Sign(this.m[8] * this.m[9] * this.m[10] * this.m[11]) < 0 ? -1 : 1;
  1622. scale.x = xs * Math.sqrt(this.m[0] * this.m[0] + this.m[1] * this.m[1] + this.m[2] * this.m[2]);
  1623. scale.y = ys * Math.sqrt(this.m[4] * this.m[4] + this.m[5] * this.m[5] + this.m[6] * this.m[6]);
  1624. scale.z = zs * Math.sqrt(this.m[8] * this.m[8] + this.m[9] * this.m[9] + this.m[10] * this.m[10]);
  1625. if (scale.x === 0 || scale.y === 0 || scale.z === 0) {
  1626. rotation.x = 0;
  1627. rotation.y = 0;
  1628. rotation.z = 0;
  1629. rotation.w = 1;
  1630. return false;
  1631. }
  1632. var rotationMatrix = Matrix.FromValues(this.m[0] / scale.x, this.m[1] / scale.x, this.m[2] / scale.x, 0, this.m[4] / scale.y, this.m[5] / scale.y, this.m[6] / scale.y, 0, this.m[8] / scale.z, this.m[9] / scale.z, this.m[10] / scale.z, 0, 0, 0, 0, 1);
  1633. Quaternion.FromRotationMatrixToRef(rotationMatrix, rotation);
  1634. return true;
  1635. };
  1636. // Statics
  1637. Matrix.FromArray = function (array, offset) {
  1638. var result = new Matrix();
  1639. if (!offset) {
  1640. offset = 0;
  1641. }
  1642. Matrix.FromArrayToRef(array, offset, result);
  1643. return result;
  1644. };
  1645. Matrix.FromArrayToRef = function (array, offset, result) {
  1646. for (var index = 0; index < 16; index++) {
  1647. result.m[index] = array[index + offset];
  1648. }
  1649. };
  1650. Matrix.FromValuesToRef = function (initialM11, initialM12, initialM13, initialM14, initialM21, initialM22, initialM23, initialM24, initialM31, initialM32, initialM33, initialM34, initialM41, initialM42, initialM43, initialM44, result) {
  1651. result.m[0] = initialM11;
  1652. result.m[1] = initialM12;
  1653. result.m[2] = initialM13;
  1654. result.m[3] = initialM14;
  1655. result.m[4] = initialM21;
  1656. result.m[5] = initialM22;
  1657. result.m[6] = initialM23;
  1658. result.m[7] = initialM24;
  1659. result.m[8] = initialM31;
  1660. result.m[9] = initialM32;
  1661. result.m[10] = initialM33;
  1662. result.m[11] = initialM34;
  1663. result.m[12] = initialM41;
  1664. result.m[13] = initialM42;
  1665. result.m[14] = initialM43;
  1666. result.m[15] = initialM44;
  1667. };
  1668. Matrix.FromValues = function (initialM11, initialM12, initialM13, initialM14, initialM21, initialM22, initialM23, initialM24, initialM31, initialM32, initialM33, initialM34, initialM41, initialM42, initialM43, initialM44) {
  1669. var result = new Matrix();
  1670. result.m[0] = initialM11;
  1671. result.m[1] = initialM12;
  1672. result.m[2] = initialM13;
  1673. result.m[3] = initialM14;
  1674. result.m[4] = initialM21;
  1675. result.m[5] = initialM22;
  1676. result.m[6] = initialM23;
  1677. result.m[7] = initialM24;
  1678. result.m[8] = initialM31;
  1679. result.m[9] = initialM32;
  1680. result.m[10] = initialM33;
  1681. result.m[11] = initialM34;
  1682. result.m[12] = initialM41;
  1683. result.m[13] = initialM42;
  1684. result.m[14] = initialM43;
  1685. result.m[15] = initialM44;
  1686. return result;
  1687. };
  1688. Matrix.Compose = function (scale, rotation, translation) {
  1689. var result = Matrix.FromValues(scale.x, 0, 0, 0, 0, scale.y, 0, 0, 0, 0, scale.z, 0, 0, 0, 0, 1);
  1690. var rotationMatrix = Matrix.Identity();
  1691. rotation.toRotationMatrix(rotationMatrix);
  1692. result = result.multiply(rotationMatrix);
  1693. result.setTranslation(translation);
  1694. return result;
  1695. };
  1696. Matrix.Identity = function () {
  1697. return Matrix.FromValues(1.0, 0, 0, 0, 0, 1.0, 0, 0, 0, 0, 1.0, 0, 0, 0, 0, 1.0);
  1698. };
  1699. Matrix.IdentityToRef = function (result) {
  1700. Matrix.FromValuesToRef(1.0, 0, 0, 0, 0, 1.0, 0, 0, 0, 0, 1.0, 0, 0, 0, 0, 1.0, result);
  1701. };
  1702. Matrix.Zero = function () {
  1703. return Matrix.FromValues(0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0);
  1704. };
  1705. Matrix.RotationX = function (angle) {
  1706. var result = new Matrix();
  1707. Matrix.RotationXToRef(angle, result);
  1708. return result;
  1709. };
  1710. Matrix.Invert = function (source) {
  1711. var result = new Matrix();
  1712. source.invertToRef(result);
  1713. return result;
  1714. };
  1715. Matrix.RotationXToRef = function (angle, result) {
  1716. var s = Math.sin(angle);
  1717. var c = Math.cos(angle);
  1718. result.m[0] = 1.0;
  1719. result.m[15] = 1.0;
  1720. result.m[5] = c;
  1721. result.m[10] = c;
  1722. result.m[9] = -s;
  1723. result.m[6] = s;
  1724. result.m[1] = 0;
  1725. result.m[2] = 0;
  1726. result.m[3] = 0;
  1727. result.m[4] = 0;
  1728. result.m[7] = 0;
  1729. result.m[8] = 0;
  1730. result.m[11] = 0;
  1731. result.m[12] = 0;
  1732. result.m[13] = 0;
  1733. result.m[14] = 0;
  1734. };
  1735. Matrix.RotationY = function (angle) {
  1736. var result = new Matrix();
  1737. Matrix.RotationYToRef(angle, result);
  1738. return result;
  1739. };
  1740. Matrix.RotationYToRef = function (angle, result) {
  1741. var s = Math.sin(angle);
  1742. var c = Math.cos(angle);
  1743. result.m[5] = 1.0;
  1744. result.m[15] = 1.0;
  1745. result.m[0] = c;
  1746. result.m[2] = -s;
  1747. result.m[8] = s;
  1748. result.m[10] = c;
  1749. result.m[1] = 0;
  1750. result.m[3] = 0;
  1751. result.m[4] = 0;
  1752. result.m[6] = 0;
  1753. result.m[7] = 0;
  1754. result.m[9] = 0;
  1755. result.m[11] = 0;
  1756. result.m[12] = 0;
  1757. result.m[13] = 0;
  1758. result.m[14] = 0;
  1759. };
  1760. Matrix.RotationZ = function (angle) {
  1761. var result = new Matrix();
  1762. Matrix.RotationZToRef(angle, result);
  1763. return result;
  1764. };
  1765. Matrix.RotationZToRef = function (angle, result) {
  1766. var s = Math.sin(angle);
  1767. var c = Math.cos(angle);
  1768. result.m[10] = 1.0;
  1769. result.m[15] = 1.0;
  1770. result.m[0] = c;
  1771. result.m[1] = s;
  1772. result.m[4] = -s;
  1773. result.m[5] = c;
  1774. result.m[2] = 0;
  1775. result.m[3] = 0;
  1776. result.m[6] = 0;
  1777. result.m[7] = 0;
  1778. result.m[8] = 0;
  1779. result.m[9] = 0;
  1780. result.m[11] = 0;
  1781. result.m[12] = 0;
  1782. result.m[13] = 0;
  1783. result.m[14] = 0;
  1784. };
  1785. Matrix.RotationAxis = function (axis, angle) {
  1786. var s = Math.sin(-angle);
  1787. var c = Math.cos(-angle);
  1788. var c1 = 1 - c;
  1789. axis.normalize();
  1790. var result = Matrix.Zero();
  1791. result.m[0] = (axis.x * axis.x) * c1 + c;
  1792. result.m[1] = (axis.x * axis.y) * c1 - (axis.z * s);
  1793. result.m[2] = (axis.x * axis.z) * c1 + (axis.y * s);
  1794. result.m[3] = 0.0;
  1795. result.m[4] = (axis.y * axis.x) * c1 + (axis.z * s);
  1796. result.m[5] = (axis.y * axis.y) * c1 + c;
  1797. result.m[6] = (axis.y * axis.z) * c1 - (axis.x * s);
  1798. result.m[7] = 0.0;
  1799. result.m[8] = (axis.z * axis.x) * c1 - (axis.y * s);
  1800. result.m[9] = (axis.z * axis.y) * c1 + (axis.x * s);
  1801. result.m[10] = (axis.z * axis.z) * c1 + c;
  1802. result.m[11] = 0.0;
  1803. result.m[15] = 1.0;
  1804. return result;
  1805. };
  1806. Matrix.RotationYawPitchRoll = function (yaw, pitch, roll) {
  1807. var result = new Matrix();
  1808. Matrix.RotationYawPitchRollToRef(yaw, pitch, roll, result);
  1809. return result;
  1810. };
  1811. Matrix.RotationYawPitchRollToRef = function (yaw, pitch, roll, result) {
  1812. Quaternion.RotationYawPitchRollToRef(yaw, pitch, roll, this._tempQuaternion);
  1813. this._tempQuaternion.toRotationMatrix(result);
  1814. };
  1815. Matrix.Scaling = function (x, y, z) {
  1816. var result = Matrix.Zero();
  1817. Matrix.ScalingToRef(x, y, z, result);
  1818. return result;
  1819. };
  1820. Matrix.ScalingToRef = function (x, y, z, result) {
  1821. result.m[0] = x;
  1822. result.m[1] = 0;
  1823. result.m[2] = 0;
  1824. result.m[3] = 0;
  1825. result.m[4] = 0;
  1826. result.m[5] = y;
  1827. result.m[6] = 0;
  1828. result.m[7] = 0;
  1829. result.m[8] = 0;
  1830. result.m[9] = 0;
  1831. result.m[10] = z;
  1832. result.m[11] = 0;
  1833. result.m[12] = 0;
  1834. result.m[13] = 0;
  1835. result.m[14] = 0;
  1836. result.m[15] = 1.0;
  1837. };
  1838. Matrix.Translation = function (x, y, z) {
  1839. var result = Matrix.Identity();
  1840. Matrix.TranslationToRef(x, y, z, result);
  1841. return result;
  1842. };
  1843. Matrix.TranslationToRef = function (x, y, z, result) {
  1844. Matrix.FromValuesToRef(1.0, 0, 0, 0, 0, 1.0, 0, 0, 0, 0, 1.0, 0, x, y, z, 1.0, result);
  1845. };
  1846. Matrix.LookAtLH = function (eye, target, up) {
  1847. var result = Matrix.Zero();
  1848. Matrix.LookAtLHToRef(eye, target, up, result);
  1849. return result;
  1850. };
  1851. Matrix.LookAtLHToRef = function (eye, target, up, result) {
  1852. // Z axis
  1853. target.subtractToRef(eye, this._zAxis);
  1854. this._zAxis.normalize();
  1855. // X axis
  1856. Vector3.CrossToRef(up, this._zAxis, this._xAxis);
  1857. this._xAxis.normalize();
  1858. // Y axis
  1859. Vector3.CrossToRef(this._zAxis, this._xAxis, this._yAxis);
  1860. this._yAxis.normalize();
  1861. // Eye angles
  1862. var ex = -Vector3.Dot(this._xAxis, eye);
  1863. var ey = -Vector3.Dot(this._yAxis, eye);
  1864. var ez = -Vector3.Dot(this._zAxis, eye);
  1865. return Matrix.FromValuesToRef(this._xAxis.x, this._yAxis.x, this._zAxis.x, 0, this._xAxis.y, this._yAxis.y, this._zAxis.y, 0, this._xAxis.z, this._yAxis.z, this._zAxis.z, 0, ex, ey, ez, 1, result);
  1866. };
  1867. Matrix.LookAtLHToRefSIMD = function (eyeRef, targetRef, upRef, result) {
  1868. var out = result.m;
  1869. var center = SIMD.float32x4(targetRef.x, targetRef.y, targetRef.z, 0);
  1870. var eye = SIMD.float32x4(eyeRef.x, eyeRef.y, eyeRef.z, 0);
  1871. var up = SIMD.float32x4(upRef.x, upRef.y, upRef.z, 0);
  1872. // cc.kmVec3Subtract(f, pCenter, pEye);
  1873. var f = SIMD.float32x4.sub(center, eye);
  1874. // cc.kmVec3Normalize(f, f);
  1875. var tmp = SIMD.float32x4.mul(f, f);
  1876. tmp = SIMD.float32x4.add(tmp, SIMD.float32x4.add(SIMD.float32x4.swizzle(tmp, 1, 2, 0, 3), SIMD.float32x4.swizzle(tmp, 2, 0, 1, 3)));
  1877. f = SIMD.float32x4.mul(f, SIMD.float32x4.reciprocalSqrtApproximation(tmp));
  1878. // cc.kmVec3Assign(up, pUp);
  1879. // cc.kmVec3Normalize(up, up);
  1880. tmp = SIMD.float32x4.mul(up, up);
  1881. tmp = SIMD.float32x4.add(tmp, SIMD.float32x4.add(SIMD.float32x4.swizzle(tmp, 1, 2, 0, 3), SIMD.float32x4.swizzle(tmp, 2, 0, 1, 3)));
  1882. up = SIMD.float32x4.mul(up, SIMD.float32x4.reciprocalSqrtApproximation(tmp));
  1883. // cc.kmVec3Cross(s, f, up);
  1884. var s = SIMD.float32x4.sub(SIMD.float32x4.mul(SIMD.float32x4.swizzle(f, 1, 2, 0, 3), SIMD.float32x4.swizzle(up, 2, 0, 1, 3)), SIMD.float32x4.mul(SIMD.float32x4.swizzle(f, 2, 0, 1, 3), SIMD.float32x4.swizzle(up, 1, 2, 0, 3)));
  1885. // cc.kmVec3Normalize(s, s);
  1886. tmp = SIMD.float32x4.mul(s, s);
  1887. tmp = SIMD.float32x4.add(tmp, SIMD.float32x4.add(SIMD.float32x4.swizzle(tmp, 1, 2, 0, 3), SIMD.float32x4.swizzle(tmp, 2, 0, 1, 3)));
  1888. s = SIMD.float32x4.mul(s, SIMD.float32x4.reciprocalSqrtApproximation(tmp));
  1889. // cc.kmVec3Cross(u, s, f);
  1890. var u = SIMD.float32x4.sub(SIMD.float32x4.mul(SIMD.float32x4.swizzle(s, 1, 2, 0, 3), SIMD.float32x4.swizzle(f, 2, 0, 1, 3)), SIMD.float32x4.mul(SIMD.float32x4.swizzle(s, 2, 0, 1, 3), SIMD.float32x4.swizzle(f, 1, 2, 0, 3)));
  1891. // cc.kmVec3Normalize(s, s);
  1892. tmp = SIMD.float32x4.mul(s, s);
  1893. tmp = SIMD.float32x4.add(tmp, SIMD.float32x4.add(SIMD.float32x4.swizzle(tmp, 1, 2, 0, 3), SIMD.float32x4.swizzle(tmp, 2, 0, 1, 3)));
  1894. s = SIMD.float32x4.mul(s, SIMD.float32x4.reciprocalSqrtApproximation(tmp));
  1895. var zero = SIMD.float32x4.splat(0.0);
  1896. s = SIMD.float32x4.neg(s);
  1897. var tmp01 = SIMD.float32x4.shuffle(s, u, 0, 1, 4, 5);
  1898. var tmp23 = SIMD.float32x4.shuffle(f, zero, 0, 1, 4, 5);
  1899. var a0 = SIMD.float32x4.shuffle(tmp01, tmp23, 0, 2, 4, 6);
  1900. var a1 = SIMD.float32x4.shuffle(tmp01, tmp23, 1, 3, 5, 7);
  1901. tmp01 = SIMD.float32x4.shuffle(s, u, 2, 3, 6, 7);
  1902. tmp23 = SIMD.float32x4.shuffle(f, zero, 2, 3, 6, 7);
  1903. var a2 = SIMD.float32x4.shuffle(tmp01, tmp23, 0, 2, 4, 6);
  1904. var a3 = SIMD.float32x4(0.0, 0.0, 0.0, 1.0);
  1905. var b0 = SIMD.float32x4(1.0, 0.0, 0.0, 0.0);
  1906. var b1 = SIMD.float32x4(0.0, 1.0, 0.0, 0.0);
  1907. var b2 = SIMD.float32x4(0.0, 0.0, 1.0, 0.0);
  1908. var b3 = SIMD.float32x4.neg(eye);
  1909. b3 = SIMD.float32x4.withW(b3, 1.0);
  1910. SIMD.float32x4.store(out, 0, SIMD.float32x4.add(SIMD.float32x4.mul(SIMD.float32x4.swizzle(b0, 0, 0, 0, 0), a0), SIMD.float32x4.add(SIMD.float32x4.mul(SIMD.float32x4.swizzle(b0, 1, 1, 1, 1), a1), SIMD.float32x4.add(SIMD.float32x4.mul(SIMD.float32x4.swizzle(b0, 2, 2, 2, 2), a2), SIMD.float32x4.mul(SIMD.float32x4.swizzle(b0, 3, 3, 3, 3), a3)))));
  1911. SIMD.float32x4.store(out, 4, SIMD.float32x4.add(SIMD.float32x4.mul(SIMD.float32x4.swizzle(b1, 0, 0, 0, 0), a0), SIMD.float32x4.add(SIMD.float32x4.mul(SIMD.float32x4.swizzle(b1, 1, 1, 1, 1), a1), SIMD.float32x4.add(SIMD.float32x4.mul(SIMD.float32x4.swizzle(b1, 2, 2, 2, 2), a2), SIMD.float32x4.mul(SIMD.float32x4.swizzle(b1, 3, 3, 3, 3), a3)))));
  1912. SIMD.float32x4.store(out, 8, SIMD.float32x4.add(SIMD.float32x4.mul(SIMD.float32x4.swizzle(b2, 0, 0, 0, 0), a0), SIMD.float32x4.add(SIMD.float32x4.mul(SIMD.float32x4.swizzle(b2, 1, 1, 1, 1), a1), SIMD.float32x4.add(SIMD.float32x4.mul(SIMD.float32x4.swizzle(b2, 2, 2, 2, 2), a2), SIMD.float32x4.mul(SIMD.float32x4.swizzle(b2, 3, 3, 3, 3), a3)))));
  1913. SIMD.float32x4.store(out, 12, SIMD.float32x4.add(SIMD.float32x4.mul(SIMD.float32x4.swizzle(b3, 0, 0, 0, 0), a0), SIMD.float32x4.add(SIMD.float32x4.mul(SIMD.float32x4.swizzle(b3, 1, 1, 1, 1), a1), SIMD.float32x4.add(SIMD.float32x4.mul(SIMD.float32x4.swizzle(b3, 2, 2, 2, 2), a2), SIMD.float32x4.mul(SIMD.float32x4.swizzle(b3, 3, 3, 3, 3), a3)))));
  1914. };
  1915. Matrix.OrthoLH = function (width, height, znear, zfar) {
  1916. var matrix = Matrix.Zero();
  1917. Matrix.OrthoLHToRef(width, height, znear, zfar, matrix);
  1918. return matrix;
  1919. };
  1920. Matrix.OrthoLHToRef = function (width, height, znear, zfar, result) {
  1921. var hw = 2.0 / width;
  1922. var hh = 2.0 / height;
  1923. var id = 1.0 / (zfar - znear);
  1924. var nid = znear / (znear - zfar);
  1925. Matrix.FromValuesToRef(hw, 0, 0, 0, 0, hh, 0, 0, 0, 0, id, 0, 0, 0, nid, 1, result);
  1926. };
  1927. Matrix.OrthoOffCenterLH = function (left, right, bottom, top, znear, zfar) {
  1928. var matrix = Matrix.Zero();
  1929. Matrix.OrthoOffCenterLHToRef(left, right, bottom, top, znear, zfar, matrix);
  1930. return matrix;
  1931. };
  1932. Matrix.OrthoOffCenterLHToRef = function (left, right, bottom, top, znear, zfar, result) {
  1933. result.m[0] = 2.0 / (right - left);
  1934. result.m[1] = result.m[2] = result.m[3] = 0;
  1935. result.m[5] = 2.0 / (top - bottom);
  1936. result.m[4] = result.m[6] = result.m[7] = 0;
  1937. result.m[10] = -1.0 / (znear - zfar);
  1938. result.m[8] = result.m[9] = result.m[11] = 0;
  1939. result.m[12] = (left + right) / (left - right);
  1940. result.m[13] = (top + bottom) / (bottom - top);
  1941. result.m[14] = znear / (znear - zfar);
  1942. result.m[15] = 1.0;
  1943. };
  1944. Matrix.PerspectiveLH = function (width, height, znear, zfar) {
  1945. var matrix = Matrix.Zero();
  1946. matrix.m[0] = (2.0 * znear) / width;
  1947. matrix.m[1] = matrix.m[2] = matrix.m[3] = 0.0;
  1948. matrix.m[5] = (2.0 * znear) / height;
  1949. matrix.m[4] = matrix.m[6] = matrix.m[7] = 0.0;
  1950. matrix.m[10] = -zfar / (znear - zfar);
  1951. matrix.m[8] = matrix.m[9] = 0.0;
  1952. matrix.m[11] = 1.0;
  1953. matrix.m[12] = matrix.m[13] = matrix.m[15] = 0.0;
  1954. matrix.m[14] = (znear * zfar) / (znear - zfar);
  1955. return matrix;
  1956. };
  1957. Matrix.PerspectiveFovLH = function (fov, aspect, znear, zfar) {
  1958. var matrix = Matrix.Zero();
  1959. Matrix.PerspectiveFovLHToRef(fov, aspect, znear, zfar, matrix);
  1960. return matrix;
  1961. };
  1962. Matrix.PerspectiveFovLHToRef = function (fov, aspect, znear, zfar, result, fovMode) {
  1963. if (fovMode === void 0) { fovMode = BABYLON.Camera.FOVMODE_VERTICAL_FIXED; }
  1964. var tan = 1.0 / (Math.tan(fov * 0.5));
  1965. var v_fixed = (fovMode === BABYLON.Camera.FOVMODE_VERTICAL_FIXED);
  1966. if (v_fixed) {
  1967. result.m[0] = tan / aspect;
  1968. }
  1969. else {
  1970. result.m[0] = tan;
  1971. }
  1972. result.m[1] = result.m[2] = result.m[3] = 0.0;
  1973. if (v_fixed) {
  1974. result.m[5] = tan;
  1975. }
  1976. else {
  1977. result.m[5] = tan * aspect;
  1978. }
  1979. result.m[4] = result.m[6] = result.m[7] = 0.0;
  1980. result.m[8] = result.m[9] = 0.0;
  1981. result.m[10] = -zfar / (znear - zfar);
  1982. result.m[11] = 1.0;
  1983. result.m[12] = result.m[13] = result.m[15] = 0.0;
  1984. result.m[14] = (znear * zfar) / (znear - zfar);
  1985. };
  1986. Matrix.GetFinalMatrix = function (viewport, world, view, projection, zmin, zmax) {
  1987. var cw = viewport.width;
  1988. var ch = viewport.height;
  1989. var cx = viewport.x;
  1990. var cy = viewport.y;
  1991. var viewportMatrix = Matrix.FromValues(cw / 2.0, 0, 0, 0, 0, -ch / 2.0, 0, 0, 0, 0, zmax - zmin, 0, cx + cw / 2.0, ch / 2.0 + cy, zmin, 1);
  1992. return world.multiply(view).multiply(projection).multiply(viewportMatrix);
  1993. };
  1994. Matrix.Transpose = function (matrix) {
  1995. var result = new Matrix();
  1996. result.m[0] = matrix.m[0];
  1997. result.m[1] = matrix.m[4];
  1998. result.m[2] = matrix.m[8];
  1999. result.m[3] = matrix.m[12];
  2000. result.m[4] = matrix.m[1];
  2001. result.m[5] = matrix.m[5];
  2002. result.m[6] = matrix.m[9];
  2003. result.m[7] = matrix.m[13];
  2004. result.m[8] = matrix.m[2];
  2005. result.m[9] = matrix.m[6];
  2006. result.m[10] = matrix.m[10];
  2007. result.m[11] = matrix.m[14];
  2008. result.m[12] = matrix.m[3];
  2009. result.m[13] = matrix.m[7];
  2010. result.m[14] = matrix.m[11];
  2011. result.m[15] = matrix.m[15];
  2012. return result;
  2013. };
  2014. Matrix.Reflection = function (plane) {
  2015. var matrix = new Matrix();
  2016. Matrix.ReflectionToRef(plane, matrix);
  2017. return matrix;
  2018. };
  2019. Matrix.ReflectionToRef = function (plane, result) {
  2020. plane.normalize();
  2021. var x = plane.normal.x;
  2022. var y = plane.normal.y;
  2023. var z = plane.normal.z;
  2024. var temp = -2 * x;
  2025. var temp2 = -2 * y;
  2026. var temp3 = -2 * z;
  2027. result.m[0] = (temp * x) + 1;
  2028. result.m[1] = temp2 * x;
  2029. result.m[2] = temp3 * x;
  2030. result.m[3] = 0.0;
  2031. result.m[4] = temp * y;
  2032. result.m[5] = (temp2 * y) + 1;
  2033. result.m[6] = temp3 * y;
  2034. result.m[7] = 0.0;
  2035. result.m[8] = temp * z;
  2036. result.m[9] = temp2 * z;
  2037. result.m[10] = (temp3 * z) + 1;
  2038. result.m[11] = 0.0;
  2039. result.m[12] = temp * plane.d;
  2040. result.m[13] = temp2 * plane.d;
  2041. result.m[14] = temp3 * plane.d;
  2042. result.m[15] = 1.0;
  2043. };
  2044. Matrix._tempQuaternion = new Quaternion();
  2045. Matrix._xAxis = Vector3.Zero();
  2046. Matrix._yAxis = Vector3.Zero();
  2047. Matrix._zAxis = Vector3.Zero();
  2048. return Matrix;
  2049. })();
  2050. BABYLON.Matrix = Matrix;
  2051. var Plane = (function () {
  2052. function Plane(a, b, c, d) {
  2053. this.normal = new Vector3(a, b, c);
  2054. this.d = d;
  2055. }
  2056. Plane.prototype.asArray = function () {
  2057. return [this.normal.x, this.normal.y, this.normal.z, this.d];
  2058. };
  2059. // Methods
  2060. Plane.prototype.clone = function () {
  2061. return new Plane(this.normal.x, this.normal.y, this.normal.z, this.d);
  2062. };
  2063. Plane.prototype.normalize = function () {
  2064. var norm = (Math.sqrt((this.normal.x * this.normal.x) + (this.normal.y * this.normal.y) + (this.normal.z * this.normal.z)));
  2065. var magnitude = 0;
  2066. if (norm !== 0) {
  2067. magnitude = 1.0 / norm;
  2068. }
  2069. this.normal.x *= magnitude;
  2070. this.normal.y *= magnitude;
  2071. this.normal.z *= magnitude;
  2072. this.d *= magnitude;
  2073. return this;
  2074. };
  2075. Plane.prototype.transform = function (transformation) {
  2076. var transposedMatrix = Matrix.Transpose(transformation);
  2077. var x = this.normal.x;
  2078. var y = this.normal.y;
  2079. var z = this.normal.z;
  2080. var d = this.d;
  2081. var normalX = (((x * transposedMatrix.m[0]) + (y * transposedMatrix.m[1])) + (z * transposedMatrix.m[2])) + (d * transposedMatrix.m[3]);
  2082. var normalY = (((x * transposedMatrix.m[4]) + (y * transposedMatrix.m[5])) + (z * transposedMatrix.m[6])) + (d * transposedMatrix.m[7]);
  2083. var normalZ = (((x * transposedMatrix.m[8]) + (y * transposedMatrix.m[9])) + (z * transposedMatrix.m[10])) + (d * transposedMatrix.m[11]);
  2084. var finalD = (((x * transposedMatrix.m[12]) + (y * transposedMatrix.m[13])) + (z * transposedMatrix.m[14])) + (d * transposedMatrix.m[15]);
  2085. return new Plane(normalX, normalY, normalZ, finalD);
  2086. };
  2087. Plane.prototype.dotCoordinate = function (point) {
  2088. return ((((this.normal.x * point.x) + (this.normal.y * point.y)) + (this.normal.z * point.z)) + this.d);
  2089. };
  2090. Plane.prototype.copyFromPoints = function (point1, point2, point3) {
  2091. var x1 = point2.x - point1.x;
  2092. var y1 = point2.y - point1.y;
  2093. var z1 = point2.z - point1.z;
  2094. var x2 = point3.x - point1.x;
  2095. var y2 = point3.y - point1.y;
  2096. var z2 = point3.z - point1.z;
  2097. var yz = (y1 * z2) - (z1 * y2);
  2098. var xz = (z1 * x2) - (x1 * z2);
  2099. var xy = (x1 * y2) - (y1 * x2);
  2100. var pyth = (Math.sqrt((yz * yz) + (xz * xz) + (xy * xy)));
  2101. var invPyth;
  2102. if (pyth !== 0) {
  2103. invPyth = 1.0 / pyth;
  2104. }
  2105. else {
  2106. invPyth = 0;
  2107. }
  2108. this.normal.x = yz * invPyth;
  2109. this.normal.y = xz * invPyth;
  2110. this.normal.z = xy * invPyth;
  2111. this.d = -((this.normal.x * point1.x) + (this.normal.y * point1.y) + (this.normal.z * point1.z));
  2112. return this;
  2113. };
  2114. Plane.prototype.isFrontFacingTo = function (direction, epsilon) {
  2115. var dot = Vector3.Dot(this.normal, direction);
  2116. return (dot <= epsilon);
  2117. };
  2118. Plane.prototype.signedDistanceTo = function (point) {
  2119. return Vector3.Dot(point, this.normal) + this.d;
  2120. };
  2121. // Statics
  2122. Plane.FromArray = function (array) {
  2123. return new Plane(array[0], array[1], array[2], array[3]);
  2124. };
  2125. Plane.FromPoints = function (point1, point2, point3) {
  2126. var result = new Plane(0, 0, 0, 0);
  2127. result.copyFromPoints(point1, point2, point3);
  2128. return result;
  2129. };
  2130. Plane.FromPositionAndNormal = function (origin, normal) {
  2131. var result = new Plane(0, 0, 0, 0);
  2132. normal.normalize();
  2133. result.normal = normal;
  2134. result.d = -(normal.x * origin.x + normal.y * origin.y + normal.z * origin.z);
  2135. return result;
  2136. };
  2137. Plane.SignedDistanceToPlaneFromPositionAndNormal = function (origin, normal, point) {
  2138. var d = -(normal.x * origin.x + normal.y * origin.y + normal.z * origin.z);
  2139. return Vector3.Dot(point, normal) + d;
  2140. };
  2141. return Plane;
  2142. })();
  2143. BABYLON.Plane = Plane;
  2144. var Viewport = (function () {
  2145. function Viewport(x, y, width, height) {
  2146. this.x = x;
  2147. this.y = y;
  2148. this.width = width;
  2149. this.height = height;
  2150. }
  2151. Viewport.prototype.toGlobal = function (engine) {
  2152. var width = engine.getRenderWidth();
  2153. var height = engine.getRenderHeight();
  2154. return new Viewport(this.x * width, this.y * height, this.width * width, this.height * height);
  2155. };
  2156. return Viewport;
  2157. })();
  2158. BABYLON.Viewport = Viewport;
  2159. var Frustum = (function () {
  2160. function Frustum() {
  2161. }
  2162. Frustum.GetPlanes = function (transform) {
  2163. var frustumPlanes = [];
  2164. for (var index = 0; index < 6; index++) {
  2165. frustumPlanes.push(new Plane(0, 0, 0, 0));
  2166. }
  2167. Frustum.GetPlanesToRef(transform, frustumPlanes);
  2168. return frustumPlanes;
  2169. };
  2170. Frustum.GetPlanesToRef = function (transform, frustumPlanes) {
  2171. // Near
  2172. frustumPlanes[0].normal.x = transform.m[3] + transform.m[2];
  2173. frustumPlanes[0].normal.y = transform.m[7] + transform.m[6];
  2174. frustumPlanes[0].normal.z = transform.m[10] + transform.m[10];
  2175. frustumPlanes[0].d = transform.m[15] + transform.m[14];
  2176. frustumPlanes[0].normalize();
  2177. // Far
  2178. frustumPlanes[1].normal.x = transform.m[3] - transform.m[2];
  2179. frustumPlanes[1].normal.y = transform.m[7] - transform.m[6];
  2180. frustumPlanes[1].normal.z = transform.m[11] - transform.m[10];
  2181. frustumPlanes[1].d = transform.m[15] - transform.m[14];
  2182. frustumPlanes[1].normalize();
  2183. // Left
  2184. frustumPlanes[2].normal.x = transform.m[3] + transform.m[0];
  2185. frustumPlanes[2].normal.y = transform.m[7] + transform.m[4];
  2186. frustumPlanes[2].normal.z = transform.m[11] + transform.m[8];
  2187. frustumPlanes[2].d = transform.m[15] + transform.m[12];
  2188. frustumPlanes[2].normalize();
  2189. // Right
  2190. frustumPlanes[3].normal.x = transform.m[3] - transform.m[0];
  2191. frustumPlanes[3].normal.y = transform.m[7] - transform.m[4];
  2192. frustumPlanes[3].normal.z = transform.m[11] - transform.m[8];
  2193. frustumPlanes[3].d = transform.m[15] - transform.m[12];
  2194. frustumPlanes[3].normalize();
  2195. // Top
  2196. frustumPlanes[4].normal.x = transform.m[3] - transform.m[1];
  2197. frustumPlanes[4].normal.y = transform.m[7] - transform.m[5];
  2198. frustumPlanes[4].normal.z = transform.m[11] - transform.m[9];
  2199. frustumPlanes[4].d = transform.m[15] - transform.m[13];
  2200. frustumPlanes[4].normalize();
  2201. // Bottom
  2202. frustumPlanes[5].normal.x = transform.m[3] + transform.m[1];
  2203. frustumPlanes[5].normal.y = transform.m[7] + transform.m[5];
  2204. frustumPlanes[5].normal.z = transform.m[11] + transform.m[9];
  2205. frustumPlanes[5].d = transform.m[15] + transform.m[13];
  2206. frustumPlanes[5].normalize();
  2207. };
  2208. return Frustum;
  2209. })();
  2210. BABYLON.Frustum = Frustum;
  2211. var Ray = (function () {
  2212. function Ray(origin, direction, length) {
  2213. if (length === void 0) { length = Number.MAX_VALUE; }
  2214. this.origin = origin;
  2215. this.direction = direction;
  2216. this.length = length;
  2217. }
  2218. // Methods
  2219. Ray.prototype.intersectsBoxMinMax = function (minimum, maximum) {
  2220. var d = 0.0;
  2221. var maxValue = Number.MAX_VALUE;
  2222. if (Math.abs(this.direction.x) < 0.0000001) {
  2223. if (this.origin.x < minimum.x || this.origin.x > maximum.x) {
  2224. return false;
  2225. }
  2226. }
  2227. else {
  2228. var inv = 1.0 / this.direction.x;
  2229. var min = (minimum.x - this.origin.x) * inv;
  2230. var max = (maximum.x - this.origin.x) * inv;
  2231. if (max === -Infinity) {
  2232. max = Infinity;
  2233. }
  2234. if (min > max) {
  2235. var temp = min;
  2236. min = max;
  2237. max = temp;
  2238. }
  2239. d = Math.max(min, d);
  2240. maxValue = Math.min(max, maxValue);
  2241. if (d > maxValue) {
  2242. return false;
  2243. }
  2244. }
  2245. if (Math.abs(this.direction.y) < 0.0000001) {
  2246. if (this.origin.y < minimum.y || this.origin.y > maximum.y) {
  2247. return false;
  2248. }
  2249. }
  2250. else {
  2251. inv = 1.0 / this.direction.y;
  2252. min = (minimum.y - this.origin.y) * inv;
  2253. max = (maximum.y - this.origin.y) * inv;
  2254. if (max === -Infinity) {
  2255. max = Infinity;
  2256. }
  2257. if (min > max) {
  2258. temp = min;
  2259. min = max;
  2260. max = temp;
  2261. }
  2262. d = Math.max(min, d);
  2263. maxValue = Math.min(max, maxValue);
  2264. if (d > maxValue) {
  2265. return false;
  2266. }
  2267. }
  2268. if (Math.abs(this.direction.z) < 0.0000001) {
  2269. if (this.origin.z < minimum.z || this.origin.z > maximum.z) {
  2270. return false;
  2271. }
  2272. }
  2273. else {
  2274. inv = 1.0 / this.direction.z;
  2275. min = (minimum.z - this.origin.z) * inv;
  2276. max = (maximum.z - this.origin.z) * inv;
  2277. if (max === -Infinity) {
  2278. max = Infinity;
  2279. }
  2280. if (min > max) {
  2281. temp = min;
  2282. min = max;
  2283. max = temp;
  2284. }
  2285. d = Math.max(min, d);
  2286. maxValue = Math.min(max, maxValue);
  2287. if (d > maxValue) {
  2288. return false;
  2289. }
  2290. }
  2291. return true;
  2292. };
  2293. Ray.prototype.intersectsBox = function (box) {
  2294. return this.intersectsBoxMinMax(box.minimum, box.maximum);
  2295. };
  2296. Ray.prototype.intersectsSphere = function (sphere) {
  2297. var x = sphere.center.x - this.origin.x;
  2298. var y = sphere.center.y - this.origin.y;
  2299. var z = sphere.center.z - this.origin.z;
  2300. var pyth = (x * x) + (y * y) + (z * z);
  2301. var rr = sphere.radius * sphere.radius;
  2302. if (pyth <= rr) {
  2303. return true;
  2304. }
  2305. var dot = (x * this.direction.x) + (y * this.direction.y) + (z * this.direction.z);
  2306. if (dot < 0.0) {
  2307. return false;
  2308. }
  2309. var temp = pyth - (dot * dot);
  2310. return temp <= rr;
  2311. };
  2312. Ray.prototype.intersectsTriangle = function (vertex0, vertex1, vertex2) {
  2313. if (!this._edge1) {
  2314. this._edge1 = Vector3.Zero();
  2315. this._edge2 = Vector3.Zero();
  2316. this._pvec = Vector3.Zero();
  2317. this._tvec = Vector3.Zero();
  2318. this._qvec = Vector3.Zero();
  2319. }
  2320. vertex1.subtractToRef(vertex0, this._edge1);
  2321. vertex2.subtractToRef(vertex0, this._edge2);
  2322. Vector3.CrossToRef(this.direction, this._edge2, this._pvec);
  2323. var det = Vector3.Dot(this._edge1, this._pvec);
  2324. if (det === 0) {
  2325. return null;
  2326. }
  2327. var invdet = 1 / det;
  2328. this.origin.subtractToRef(vertex0, this._tvec);
  2329. var bu = Vector3.Dot(this._tvec, this._pvec) * invdet;
  2330. if (bu < 0 || bu > 1.0) {
  2331. return null;
  2332. }
  2333. Vector3.CrossToRef(this._tvec, this._edge1, this._qvec);
  2334. var bv = Vector3.Dot(this.direction, this._qvec) * invdet;
  2335. if (bv < 0 || bu + bv > 1.0) {
  2336. return null;
  2337. }
  2338. //check if the distance is longer than the predefined length.
  2339. var distance = Vector3.Dot(this._edge2, this._qvec) * invdet;
  2340. if (distance > this.length) {
  2341. return null;
  2342. }
  2343. return new BABYLON.IntersectionInfo(bu, bv, distance);
  2344. };
  2345. // Statics
  2346. Ray.CreateNew = function (x, y, viewportWidth, viewportHeight, world, view, projection) {
  2347. var start = Vector3.Unproject(new Vector3(x, y, 0), viewportWidth, viewportHeight, world, view, projection);
  2348. var end = Vector3.Unproject(new Vector3(x, y, 1), viewportWidth, viewportHeight, world, view, projection);
  2349. var direction = end.subtract(start);
  2350. direction.normalize();
  2351. return new Ray(start, direction);
  2352. };
  2353. /**
  2354. * Function will create a new transformed ray starting from origin and ending at the end point. Ray's length will be set, and ray will be
  2355. * transformed to the given world matrix.
  2356. * @param origin The origin point
  2357. * @param end The end point
  2358. * @param world a matrix to transform the ray to. Default is the identity matrix.
  2359. */
  2360. Ray.CreateNewFromTo = function (origin, end, world) {
  2361. if (world === void 0) { world = Matrix.Identity(); }
  2362. var direction = end.subtract(origin);
  2363. var length = Math.sqrt((direction.x * direction.x) + (direction.y * direction.y) + (direction.z * direction.z));
  2364. direction.normalize();
  2365. return Ray.Transform(new Ray(origin, direction, length), world);
  2366. };
  2367. Ray.Transform = function (ray, matrix) {
  2368. var newOrigin = Vector3.TransformCoordinates(ray.origin, matrix);
  2369. var newDirection = Vector3.TransformNormal(ray.direction, matrix);
  2370. return new Ray(newOrigin, newDirection, ray.length);
  2371. };
  2372. return Ray;
  2373. })();
  2374. BABYLON.Ray = Ray;
  2375. (function (Space) {
  2376. Space[Space["LOCAL"] = 0] = "LOCAL";
  2377. Space[Space["WORLD"] = 1] = "WORLD";
  2378. })(BABYLON.Space || (BABYLON.Space = {}));
  2379. var Space = BABYLON.Space;
  2380. var Axis = (function () {
  2381. function Axis() {
  2382. }
  2383. Axis.X = new Vector3(1, 0, 0);
  2384. Axis.Y = new Vector3(0, 1, 0);
  2385. Axis.Z = new Vector3(0, 0, 1);
  2386. return Axis;
  2387. })();
  2388. BABYLON.Axis = Axis;
  2389. ;
  2390. var BezierCurve = (function () {
  2391. function BezierCurve() {
  2392. }
  2393. BezierCurve.interpolate = function (t, x1, y1, x2, y2) {
  2394. // Extract X (which is equal to time here)
  2395. var f0 = 1 - 3 * x2 + 3 * x1;
  2396. var f1 = 3 * x2 - 6 * x1;
  2397. var f2 = 3 * x1;
  2398. var refinedT = t;
  2399. for (var i = 0; i < 5; i++) {
  2400. var refinedT2 = refinedT * refinedT;
  2401. var refinedT3 = refinedT2 * refinedT;
  2402. var x = f0 * refinedT3 + f1 * refinedT2 + f2 * refinedT;
  2403. var slope = 1.0 / (3.0 * f0 * refinedT2 + 2.0 * f1 * refinedT + f2);
  2404. refinedT -= (x - t) * slope;
  2405. refinedT = Math.min(1, Math.max(0, refinedT));
  2406. }
  2407. // Resolve cubic bezier for the given x
  2408. return 3 * Math.pow(1 - refinedT, 2) * refinedT * y1 + 3 * (1 - refinedT) * Math.pow(refinedT, 2) * y2 + Math.pow(refinedT, 3);
  2409. };
  2410. return BezierCurve;
  2411. })();
  2412. BABYLON.BezierCurve = BezierCurve;
  2413. (function (Orientation) {
  2414. Orientation[Orientation["CW"] = 0] = "CW";
  2415. Orientation[Orientation["CCW"] = 1] = "CCW";
  2416. })(BABYLON.Orientation || (BABYLON.Orientation = {}));
  2417. var Orientation = BABYLON.Orientation;
  2418. var Angle = (function () {
  2419. function Angle(radians) {
  2420. var _this = this;
  2421. this.degrees = function () { return _this._radians * 180 / Math.PI; };
  2422. this.radians = function () { return _this._radians; };
  2423. this._radians = radians;
  2424. if (this._radians < 0)
  2425. this._radians += (2 * Math.PI);
  2426. }
  2427. Angle.BetweenTwoPoints = function (a, b) {
  2428. var delta = b.subtract(a);
  2429. var theta = Math.atan2(delta.y, delta.x);
  2430. return new Angle(theta);
  2431. };
  2432. Angle.FromRadians = function (radians) {
  2433. return new Angle(radians);
  2434. };
  2435. Angle.FromDegrees = function (degrees) {
  2436. return new Angle(degrees * Math.PI / 180);
  2437. };
  2438. return Angle;
  2439. })();
  2440. BABYLON.Angle = Angle;
  2441. var Arc2 = (function () {
  2442. function Arc2(startPoint, midPoint, endPoint) {
  2443. this.startPoint = startPoint;
  2444. this.midPoint = midPoint;
  2445. this.endPoint = endPoint;
  2446. var temp = Math.pow(midPoint.x, 2) + Math.pow(midPoint.y, 2);
  2447. var startToMid = (Math.pow(startPoint.x, 2) + Math.pow(startPoint.y, 2) - temp) / 2.;
  2448. var midToEnd = (temp - Math.pow(endPoint.x, 2) - Math.pow(endPoint.y, 2)) / 2.;
  2449. var det = (startPoint.x - midPoint.x) * (midPoint.y - endPoint.y) - (midPoint.x - endPoint.x) * (startPoint.y - midPoint.y);
  2450. this.centerPoint = new Vector2((startToMid * (midPoint.y - endPoint.y) - midToEnd * (startPoint.y - midPoint.y)) / det, ((startPoint.x - midPoint.x) * midToEnd - (midPoint.x - endPoint.x) * startToMid) / det);
  2451. this.radius = this.centerPoint.subtract(this.startPoint).length();
  2452. this.startAngle = Angle.BetweenTwoPoints(this.centerPoint, this.startPoint);
  2453. var a1 = this.startAngle.degrees();
  2454. var a2 = Angle.BetweenTwoPoints(this.centerPoint, this.midPoint).degrees();
  2455. var a3 = Angle.BetweenTwoPoints(this.centerPoint, this.endPoint).degrees();
  2456. // angles correction
  2457. if (a2 - a1 > +180.0)
  2458. a2 -= 360.0;
  2459. if (a2 - a1 < -180.0)
  2460. a2 += 360.0;
  2461. if (a3 - a2 > +180.0)
  2462. a3 -= 360.0;
  2463. if (a3 - a2 < -180.0)
  2464. a3 += 360.0;
  2465. this.orientation = (a2 - a1) < 0 ? 0 /* CW */ : 1 /* CCW */;
  2466. this.angle = Angle.FromDegrees(this.orientation === 0 /* CW */ ? a1 - a3 : a3 - a1);
  2467. }
  2468. return Arc2;
  2469. })();
  2470. BABYLON.Arc2 = Arc2;
  2471. var PathCursor = (function () {
  2472. function PathCursor(path) {
  2473. this.path = path;
  2474. this._onchange = new Array();
  2475. this.value = 0;
  2476. this.animations = new Array();
  2477. }
  2478. PathCursor.prototype.getPoint = function () {
  2479. var point = this.path.getPointAtLengthPosition(this.value);
  2480. return new Vector3(point.x, 0, point.y);
  2481. };
  2482. PathCursor.prototype.moveAhead = function (step) {
  2483. if (step === void 0) { step = 0.002; }
  2484. this.move(step);
  2485. return this;
  2486. };
  2487. PathCursor.prototype.moveBack = function (step) {
  2488. if (step === void 0) { step = 0.002; }
  2489. this.move(-step);
  2490. return this;
  2491. };
  2492. PathCursor.prototype.move = function (step) {
  2493. if (Math.abs(step) > 1) {
  2494. throw "step size should be less than 1.";
  2495. }
  2496. this.value += step;
  2497. this.ensureLimits();
  2498. this.raiseOnChange();
  2499. return this;
  2500. };
  2501. PathCursor.prototype.ensureLimits = function () {
  2502. while (this.value > 1) {
  2503. this.value -= 1;
  2504. }
  2505. while (this.value < 0) {
  2506. this.value += 1;
  2507. }
  2508. return this;
  2509. };
  2510. // used by animation engine
  2511. PathCursor.prototype.markAsDirty = function (propertyName) {
  2512. this.ensureLimits();
  2513. this.raiseOnChange();
  2514. return this;
  2515. };
  2516. PathCursor.prototype.raiseOnChange = function () {
  2517. var _this = this;
  2518. this._onchange.forEach(function (f) { return f(_this); });
  2519. return this;
  2520. };
  2521. PathCursor.prototype.onchange = function (f) {
  2522. this._onchange.push(f);
  2523. return this;
  2524. };
  2525. return PathCursor;
  2526. })();
  2527. BABYLON.PathCursor = PathCursor;
  2528. var Path2 = (function () {
  2529. function Path2(x, y) {
  2530. this._points = new Array();
  2531. this._length = 0;
  2532. this.closed = false;
  2533. this._points.push(new Vector2(x, y));
  2534. }
  2535. Path2.prototype.addLineTo = function (x, y) {
  2536. if (closed) {
  2537. BABYLON.Tools.Error("cannot add lines to closed paths");
  2538. return this;
  2539. }
  2540. var newPoint = new Vector2(x, y);
  2541. var previousPoint = this._points[this._points.length - 1];
  2542. this._points.push(newPoint);
  2543. this._length += newPoint.subtract(previousPoint).length();
  2544. return this;
  2545. };
  2546. Path2.prototype.addArcTo = function (midX, midY, endX, endY, numberOfSegments) {
  2547. if (numberOfSegments === void 0) { numberOfSegments = 36; }
  2548. if (closed) {
  2549. BABYLON.Tools.Error("cannot add arcs to closed paths");
  2550. return this;
  2551. }
  2552. var startPoint = this._points[this._points.length - 1];
  2553. var midPoint = new Vector2(midX, midY);
  2554. var endPoint = new Vector2(endX, endY);
  2555. var arc = new Arc2(startPoint, midPoint, endPoint);
  2556. var increment = arc.angle.radians() / numberOfSegments;
  2557. if (arc.orientation === 0 /* CW */)
  2558. increment *= -1;
  2559. var currentAngle = arc.startAngle.radians() + increment;
  2560. for (var i = 0; i < numberOfSegments; i++) {
  2561. var x = Math.cos(currentAngle) * arc.radius + arc.centerPoint.x;
  2562. var y = Math.sin(currentAngle) * arc.radius + arc.centerPoint.y;
  2563. this.addLineTo(x, y);
  2564. currentAngle += increment;
  2565. }
  2566. return this;
  2567. };
  2568. Path2.prototype.close = function () {
  2569. this.closed = true;
  2570. return this;
  2571. };
  2572. Path2.prototype.length = function () {
  2573. var result = this._length;
  2574. if (!this.closed) {
  2575. var lastPoint = this._points[this._points.length - 1];
  2576. var firstPoint = this._points[0];
  2577. result += (firstPoint.subtract(lastPoint).length());
  2578. }
  2579. return result;
  2580. };
  2581. Path2.prototype.getPoints = function () {
  2582. return this._points;
  2583. };
  2584. Path2.prototype.getPointAtLengthPosition = function (normalizedLengthPosition) {
  2585. if (normalizedLengthPosition < 0 || normalizedLengthPosition > 1) {
  2586. BABYLON.Tools.Error("normalized length position should be between 0 and 1.");
  2587. return Vector2.Zero();
  2588. }
  2589. var lengthPosition = normalizedLengthPosition * this.length();
  2590. var previousOffset = 0;
  2591. for (var i = 0; i < this._points.length; i++) {
  2592. var j = (i + 1) % this._points.length;
  2593. var a = this._points[i];
  2594. var b = this._points[j];
  2595. var bToA = b.subtract(a);
  2596. var nextOffset = (bToA.length() + previousOffset);
  2597. if (lengthPosition >= previousOffset && lengthPosition <= nextOffset) {
  2598. var dir = bToA.normalize();
  2599. var localOffset = lengthPosition - previousOffset;
  2600. return new Vector2(a.x + (dir.x * localOffset), a.y + (dir.y * localOffset));
  2601. }
  2602. previousOffset = nextOffset;
  2603. }
  2604. BABYLON.Tools.Error("internal error");
  2605. return Vector2.Zero();
  2606. };
  2607. Path2.StartingAt = function (x, y) {
  2608. return new Path2(x, y);
  2609. };
  2610. return Path2;
  2611. })();
  2612. BABYLON.Path2 = Path2;
  2613. var Path3D = (function () {
  2614. function Path3D(path) {
  2615. this.path = path;
  2616. this._curve = new Array();
  2617. this._distances = new Array();
  2618. this._tangents = new Array();
  2619. this._normals = new Array();
  2620. this._binormals = new Array();
  2621. this._curve = path.slice(); // copy array
  2622. this._compute();
  2623. }
  2624. Path3D.prototype.getCurve = function () {
  2625. return this._curve;
  2626. };
  2627. Path3D.prototype.getTangents = function () {
  2628. return this._tangents;
  2629. };
  2630. Path3D.prototype.getNormals = function () {
  2631. return this._normals;
  2632. };
  2633. Path3D.prototype.getBinormals = function () {
  2634. return this._binormals;
  2635. };
  2636. Path3D.prototype.getDistances = function () {
  2637. return this._distances;
  2638. };
  2639. Path3D.prototype.update = function (path) {
  2640. for (var i = 0; i < path.length; i++) {
  2641. this._curve[i] = path[i];
  2642. }
  2643. this._compute();
  2644. return this;
  2645. };
  2646. // private function compute() : computes tangents, normals and binormals
  2647. Path3D.prototype._compute = function () {
  2648. var l = this._curve.length;
  2649. // first and last tangents
  2650. this._tangents[0] = this._curve[1].subtract(this._curve[0]);
  2651. this._tangents[0].normalize();
  2652. this._tangents[l - 1] = this._curve[l - 1].subtract(this._curve[l - 2]);
  2653. this._tangents[l - 1].normalize();
  2654. // normals and binormals at first point : arbitrary vector with _normalVector()
  2655. var tg0 = this._tangents[0];
  2656. var pp0 = this._normalVector(this._curve[0], tg0);
  2657. this._normals[0] = pp0;
  2658. this._normals[0].normalize();
  2659. this._binormals[0] = Vector3.Cross(tg0, this._normals[0]);
  2660. this._normals[0].normalize();
  2661. this._distances[0] = 0;
  2662. // normals and binormals : next points
  2663. var prev; // previous vector (segment)
  2664. var cur; // current vector (segment)
  2665. var curTang; // current tangent
  2666. var prevNorm; // previous normal
  2667. var prevBinor; // previous binormal
  2668. for (var i = 1; i < l; i++) {
  2669. // tangents
  2670. prev = this._curve[i].subtract(this._curve[i - 1]);
  2671. if (i < l - 1) {
  2672. cur = this._curve[i + 1].subtract(this._curve[i]);
  2673. this._tangents[i] = prev.add(cur);
  2674. this._tangents[i].normalize();
  2675. }
  2676. this._distances[i] = this._distances[i - 1] + prev.length();
  2677. // normals and binormals
  2678. // http://www.cs.cmu.edu/afs/andrew/scs/cs/15-462/web/old/asst2camera.html
  2679. curTang = this._tangents[i];
  2680. prevNorm = this._normals[i - 1];
  2681. prevBinor = this._binormals[i - 1];
  2682. this._normals[i] = Vector3.Cross(prevBinor, curTang);
  2683. this._normals[i].normalize();
  2684. this._binormals[i] = Vector3.Cross(curTang, this._normals[i]);
  2685. this._binormals[i].normalize();
  2686. }
  2687. };
  2688. // private function normalVector(v0, vt) :
  2689. // returns an arbitrary point in the plane defined by the point v0 and the vector vt orthogonal to this plane
  2690. Path3D.prototype._normalVector = function (v0, vt) {
  2691. var point;
  2692. if (vt.x !== 1) {
  2693. point = new Vector3(1, 0, 0);
  2694. }
  2695. else if (vt.y !== 1) {
  2696. point = new Vector3(0, 1, 0);
  2697. }
  2698. else if (vt.z !== 1) {
  2699. point = new Vector3(0, 0, 1);
  2700. }
  2701. var normal0 = Vector3.Cross(vt, point);
  2702. normal0.normalize();
  2703. return normal0;
  2704. };
  2705. return Path3D;
  2706. })();
  2707. BABYLON.Path3D = Path3D;
  2708. var Curve3 = (function () {
  2709. function Curve3(points) {
  2710. this._points = points;
  2711. }
  2712. // QuadraticBezier(origin_V3, control_V3, destination_V3 )
  2713. Curve3.CreateQuadraticBezier = function (v0, v1, v2, nbPoints) {
  2714. nbPoints = nbPoints > 2 ? nbPoints : 3;
  2715. var bez = new Array();
  2716. var step = 1 / nbPoints;
  2717. var equation = function (t, val0, val1, val2) {
  2718. var res = (1 - t) * (1 - t) * val0 + 2 * t * (1 - t) * val1 + t * t * val2;
  2719. return res;
  2720. };
  2721. for (var i = 0; i <= 1; i += step) {
  2722. bez.push(new Vector3(equation(i, v0.x, v1.x, v2.x), equation(i, v0.y, v1.y, v2.y), equation(i, v0.z, v1.z, v2.z)));
  2723. }
  2724. return new Curve3(bez);
  2725. };
  2726. // CubicBezier(origin_V3, control1_V3, control2_V3, destination_V3)
  2727. Curve3.CreateCubicBezier = function (v0, v1, v2, v3, nbPoints) {
  2728. nbPoints = nbPoints > 3 ? nbPoints : 4;
  2729. var bez = new Array();
  2730. var step = 1 / nbPoints;
  2731. var equation = function (t, val0, val1, val2, val3) {
  2732. var res = (1 - t) * (1 - t) * (1 - t) * val0 + 3 * t * (1 - t) * (1 - t) * val1 + 3 * t * t * (1 - t) * val2 + t * t * t * val3;
  2733. return res;
  2734. };
  2735. for (var i = 0; i <= 1; i += step) {
  2736. bez.push(new Vector3(equation(i, v0.x, v1.x, v2.x, v3.x), equation(i, v0.y, v1.y, v2.y, v3.y), equation(i, v0.z, v1.z, v2.z, v3.z)));
  2737. }
  2738. return new Curve3(bez);
  2739. };
  2740. Curve3.prototype.getPoints = function () {
  2741. return this._points;
  2742. };
  2743. Curve3.prototype.continue = function (curve) {
  2744. var lastPoint = this._points[this._points.length - 1];
  2745. var continuedPoints = this._points.slice();
  2746. var curvePoints = curve.getPoints();
  2747. for (var i = 1; i < curvePoints.length; i++) {
  2748. continuedPoints.push(curvePoints[i].add(lastPoint));
  2749. }
  2750. return new Curve3(continuedPoints);
  2751. };
  2752. return Curve3;
  2753. })();
  2754. BABYLON.Curve3 = Curve3;
  2755. // Vertex formats
  2756. var PositionNormalVertex = (function () {
  2757. function PositionNormalVertex(position, normal) {
  2758. if (position === void 0) { position = Vector3.Zero(); }
  2759. if (normal === void 0) { normal = Vector3.Up(); }
  2760. this.position = position;
  2761. this.normal = normal;
  2762. }
  2763. PositionNormalVertex.prototype.clone = function () {
  2764. return new PositionNormalVertex(this.position.clone(), this.normal.clone());
  2765. };
  2766. return PositionNormalVertex;
  2767. })();
  2768. BABYLON.PositionNormalVertex = PositionNormalVertex;
  2769. var PositionNormalTextureVertex = (function () {
  2770. function PositionNormalTextureVertex(position, normal, uv) {
  2771. if (position === void 0) { position = Vector3.Zero(); }
  2772. if (normal === void 0) { normal = Vector3.Up(); }
  2773. if (uv === void 0) { uv = Vector2.Zero(); }
  2774. this.position = position;
  2775. this.normal = normal;
  2776. this.uv = uv;
  2777. }
  2778. PositionNormalTextureVertex.prototype.clone = function () {
  2779. return new PositionNormalTextureVertex(this.position.clone(), this.normal.clone(), this.uv.clone());
  2780. };
  2781. return PositionNormalTextureVertex;
  2782. })();
  2783. BABYLON.PositionNormalTextureVertex = PositionNormalTextureVertex;
  2784. // SIMD
  2785. var previousMultiplyToArray = Matrix.prototype.multiplyToArray;
  2786. var previousInvertToRef = Matrix.prototype.invertToRef;
  2787. var previousLookAtLHToRef = Matrix.LookAtLHToRef;
  2788. var previousTransformCoordinatesToRef = Vector3.TransformCoordinatesToRef;
  2789. var previousTransformCoordinatesFromFloatsToRef = Vector3.TransformCoordinatesFromFloatsToRef;
  2790. var SIMDHelper = (function () {
  2791. function SIMDHelper() {
  2792. }
  2793. Object.defineProperty(SIMDHelper, "IsEnabled", {
  2794. get: function () {
  2795. return SIMDHelper._isEnabled;
  2796. },
  2797. enumerable: true,
  2798. configurable: true
  2799. });
  2800. SIMDHelper.DisableSIMD = function () {
  2801. // Replace functions
  2802. Matrix.prototype.multiplyToArray = previousMultiplyToArray;
  2803. Matrix.prototype.invertToRef = previousInvertToRef;
  2804. Matrix.LookAtLHToRef = previousLookAtLHToRef;
  2805. Vector3.TransformCoordinatesToRef = previousTransformCoordinatesToRef;
  2806. Vector3.TransformCoordinatesFromFloatsToRef = previousTransformCoordinatesFromFloatsToRef;
  2807. SIMDHelper._isEnabled = false;
  2808. };
  2809. SIMDHelper.EnableSIMD = function () {
  2810. if (window.SIMD === undefined) {
  2811. return;
  2812. }
  2813. // Replace functions
  2814. Matrix.prototype.multiplyToArray = Matrix.prototype.multiplyToArraySIMD;
  2815. Matrix.prototype.invertToRef = Matrix.prototype.invertToRefSIMD;
  2816. Matrix.LookAtLHToRef = Matrix.LookAtLHToRefSIMD;
  2817. Vector3.TransformCoordinatesToRef = Vector3.TransformCoordinatesToRefSIMD;
  2818. Vector3.TransformCoordinatesFromFloatsToRef = Vector3.TransformCoordinatesFromFloatsToRefSIMD;
  2819. Object.defineProperty(BABYLON.Vector3.prototype, "x", {
  2820. get: function () {
  2821. return this._data[0];
  2822. },
  2823. set: function (value) {
  2824. if (!this._data) {
  2825. this._data = new Float32Array(3);
  2826. }
  2827. this._data[0] = value;
  2828. }
  2829. });
  2830. Object.defineProperty(BABYLON.Vector3.prototype, "y", {
  2831. get: function () {
  2832. return this._data[1];
  2833. },
  2834. set: function (value) {
  2835. this._data[1] = value;
  2836. }
  2837. });
  2838. Object.defineProperty(BABYLON.Vector3.prototype, "z", {
  2839. get: function () {
  2840. return this._data[2];
  2841. },
  2842. set: function (value) {
  2843. this._data[2] = value;
  2844. }
  2845. });
  2846. SIMDHelper._isEnabled = true;
  2847. };
  2848. SIMDHelper._isEnabled = false;
  2849. return SIMDHelper;
  2850. })();
  2851. BABYLON.SIMDHelper = SIMDHelper;
  2852. if (window.SIMD !== undefined) {
  2853. SIMDHelper.EnableSIMD();
  2854. }
  2855. })(BABYLON || (BABYLON = {}));
  2856. //# sourceMappingURL=babylon.math.js.mapvar BABYLON;
  2857. (function (BABYLON) {
  2858. // Screenshots
  2859. var screenshotCanvas;
  2860. var cloneValue = function (source, destinationObject) {
  2861. if (!source)
  2862. return null;
  2863. if (source instanceof BABYLON.Mesh) {
  2864. return null;
  2865. }
  2866. if (source instanceof BABYLON.SubMesh) {
  2867. return source.clone(destinationObject);
  2868. }
  2869. else if (source.clone) {
  2870. return source.clone();
  2871. }
  2872. return null;
  2873. };
  2874. var Tools = (function () {
  2875. function Tools() {
  2876. }
  2877. Tools.GetFilename = function (path) {
  2878. var index = path.lastIndexOf("/");
  2879. if (index < 0)
  2880. return path;
  2881. return path.substring(index + 1);
  2882. };
  2883. Tools.GetDOMTextContent = function (element) {
  2884. var result = "";
  2885. var child = element.firstChild;
  2886. while (child) {
  2887. if (child.nodeType === 3) {
  2888. result += child.textContent;
  2889. }
  2890. child = child.nextSibling;
  2891. }
  2892. return result;
  2893. };
  2894. Tools.ToDegrees = function (angle) {
  2895. return angle * 180 / Math.PI;
  2896. };
  2897. Tools.ToRadians = function (angle) {
  2898. return angle * Math.PI / 180;
  2899. };
  2900. Tools.ExtractMinAndMaxIndexed = function (positions, indices, indexStart, indexCount) {
  2901. var minimum = new BABYLON.Vector3(Number.MAX_VALUE, Number.MAX_VALUE, Number.MAX_VALUE);
  2902. var maximum = new BABYLON.Vector3(-Number.MAX_VALUE, -Number.MAX_VALUE, -Number.MAX_VALUE);
  2903. for (var index = indexStart; index < indexStart + indexCount; index++) {
  2904. var current = new BABYLON.Vector3(positions[indices[index] * 3], positions[indices[index] * 3 + 1], positions[indices[index] * 3 + 2]);
  2905. minimum = BABYLON.Vector3.Minimize(current, minimum);
  2906. maximum = BABYLON.Vector3.Maximize(current, maximum);
  2907. }
  2908. return {
  2909. minimum: minimum,
  2910. maximum: maximum
  2911. };
  2912. };
  2913. Tools.ExtractMinAndMax = function (positions, start, count) {
  2914. var minimum = new BABYLON.Vector3(Number.MAX_VALUE, Number.MAX_VALUE, Number.MAX_VALUE);
  2915. var maximum = new BABYLON.Vector3(-Number.MAX_VALUE, -Number.MAX_VALUE, -Number.MAX_VALUE);
  2916. for (var index = start; index < start + count; index++) {
  2917. var current = new BABYLON.Vector3(positions[index * 3], positions[index * 3 + 1], positions[index * 3 + 2]);
  2918. minimum = BABYLON.Vector3.Minimize(current, minimum);
  2919. maximum = BABYLON.Vector3.Maximize(current, maximum);
  2920. }
  2921. return {
  2922. minimum: minimum,
  2923. maximum: maximum
  2924. };
  2925. };
  2926. Tools.MakeArray = function (obj, allowsNullUndefined) {
  2927. if (allowsNullUndefined !== true && (obj === undefined || obj == null))
  2928. return undefined;
  2929. return Array.isArray(obj) ? obj : [obj];
  2930. };
  2931. // Misc.
  2932. Tools.GetPointerPrefix = function () {
  2933. var eventPrefix = "pointer";
  2934. // Check if hand.js is referenced or if the browser natively supports pointer events
  2935. if (!navigator.pointerEnabled) {
  2936. eventPrefix = "mouse";
  2937. }
  2938. return eventPrefix;
  2939. };
  2940. Tools.QueueNewFrame = function (func) {
  2941. if (window.requestAnimationFrame)
  2942. window.requestAnimationFrame(func);
  2943. else if (window.msRequestAnimationFrame)
  2944. window.msRequestAnimationFrame(func);
  2945. else if (window.webkitRequestAnimationFrame)
  2946. window.webkitRequestAnimationFrame(func);
  2947. else if (window.mozRequestAnimationFrame)
  2948. window.mozRequestAnimationFrame(func);
  2949. else if (window.oRequestAnimationFrame)
  2950. window.oRequestAnimationFrame(func);
  2951. else {
  2952. window.setTimeout(func, 16);
  2953. }
  2954. };
  2955. Tools.RequestFullscreen = function (element) {
  2956. if (element.requestFullscreen)
  2957. element.requestFullscreen();
  2958. else if (element.msRequestFullscreen)
  2959. element.msRequestFullscreen();
  2960. else if (element.webkitRequestFullscreen)
  2961. element.webkitRequestFullscreen();
  2962. else if (element.mozRequestFullScreen)
  2963. element.mozRequestFullScreen();
  2964. };
  2965. Tools.ExitFullscreen = function () {
  2966. if (document.exitFullscreen) {
  2967. document.exitFullscreen();
  2968. }
  2969. else if (document.mozCancelFullScreen) {
  2970. document.mozCancelFullScreen();
  2971. }
  2972. else if (document.webkitCancelFullScreen) {
  2973. document.webkitCancelFullScreen();
  2974. }
  2975. else if (document.msCancelFullScreen) {
  2976. document.msCancelFullScreen();
  2977. }
  2978. };
  2979. // External files
  2980. Tools.CleanUrl = function (url) {
  2981. url = url.replace(/#/mg, "%23");
  2982. return url;
  2983. };
  2984. Tools.LoadImage = function (url, onload, onerror, database) {
  2985. url = Tools.CleanUrl(url);
  2986. var img = new Image();
  2987. if (url.substr(0, 5) !== "data:")
  2988. img.crossOrigin = 'anonymous';
  2989. img.onload = function () {
  2990. onload(img);
  2991. };
  2992. img.onerror = function (err) {
  2993. onerror(img, err);
  2994. };
  2995. var noIndexedDB = function () {
  2996. img.src = url;
  2997. };
  2998. var loadFromIndexedDB = function () {
  2999. database.loadImageFromDB(url, img);
  3000. };
  3001. //ANY database to do!
  3002. if (database && database.enableTexturesOffline && BABYLON.Database.isUASupportingBlobStorage) {
  3003. database.openAsync(loadFromIndexedDB, noIndexedDB);
  3004. }
  3005. else {
  3006. if (url.indexOf("file:") === -1) {
  3007. noIndexedDB();
  3008. }
  3009. else {
  3010. try {
  3011. var textureName = url.substring(5);
  3012. var blobURL;
  3013. try {
  3014. blobURL = URL.createObjectURL(BABYLON.FilesInput.FilesTextures[textureName], { oneTimeOnly: true });
  3015. }
  3016. catch (ex) {
  3017. // Chrome doesn't support oneTimeOnly parameter
  3018. blobURL = URL.createObjectURL(BABYLON.FilesInput.FilesTextures[textureName]);
  3019. }
  3020. img.src = blobURL;
  3021. }
  3022. catch (e) {
  3023. Tools.Log("Error while trying to load texture: " + textureName);
  3024. img.src = null;
  3025. }
  3026. }
  3027. }
  3028. return img;
  3029. };
  3030. //ANY
  3031. Tools.LoadFile = function (url, callback, progressCallBack, database, useArrayBuffer, onError) {
  3032. url = Tools.CleanUrl(url);
  3033. var noIndexedDB = function () {
  3034. var request = new XMLHttpRequest();
  3035. var loadUrl = Tools.BaseUrl + url;
  3036. request.open('GET', loadUrl, true);
  3037. if (useArrayBuffer) {
  3038. request.responseType = "arraybuffer";
  3039. }
  3040. request.onprogress = progressCallBack;
  3041. request.onreadystatechange = function () {
  3042. if (request.readyState === 4) {
  3043. if (request.status === 200 || Tools.ValidateXHRData(request, !useArrayBuffer ? 1 : 6)) {
  3044. callback(!useArrayBuffer ? request.responseText : request.response);
  3045. }
  3046. else {
  3047. if (onError) {
  3048. onError();
  3049. }
  3050. else {
  3051. throw new Error("Error status: " + request.status + " - Unable to load " + loadUrl);
  3052. }
  3053. }
  3054. }
  3055. };
  3056. request.send(null);
  3057. };
  3058. var loadFromIndexedDB = function () {
  3059. database.loadFileFromDB(url, callback, progressCallBack, noIndexedDB, useArrayBuffer);
  3060. };
  3061. if (url.indexOf("file:") !== -1) {
  3062. var fileName = url.substring(5);
  3063. Tools.ReadFile(BABYLON.FilesInput.FilesToLoad[fileName], callback, progressCallBack, true);
  3064. }
  3065. else {
  3066. // Caching all files
  3067. if (database && database.enableSceneOffline) {
  3068. database.openAsync(loadFromIndexedDB, noIndexedDB);
  3069. }
  3070. else {
  3071. noIndexedDB();
  3072. }
  3073. }
  3074. };
  3075. Tools.ReadFileAsDataURL = function (fileToLoad, callback, progressCallback) {
  3076. var reader = new FileReader();
  3077. reader.onload = function (e) {
  3078. //target doesn't have result from ts 1.3
  3079. callback(e.target['result']);
  3080. };
  3081. reader.onprogress = progressCallback;
  3082. reader.readAsDataURL(fileToLoad);
  3083. };
  3084. Tools.ReadFile = function (fileToLoad, callback, progressCallBack, useArrayBuffer) {
  3085. var reader = new FileReader();
  3086. reader.onerror = function (e) {
  3087. Tools.Log("Error while reading file: " + fileToLoad.name);
  3088. callback(JSON.stringify({ autoClear: true, clearColor: [1, 0, 0], ambientColor: [0, 0, 0], gravity: [0, -9.81, 0], meshes: [], cameras: [], lights: [] }));
  3089. };
  3090. reader.onload = function (e) {
  3091. //target doesn't have result from ts 1.3
  3092. callback(e.target['result']);
  3093. };
  3094. reader.onprogress = progressCallBack;
  3095. if (!useArrayBuffer) {
  3096. // Asynchronous read
  3097. reader.readAsText(fileToLoad);
  3098. }
  3099. else {
  3100. reader.readAsArrayBuffer(fileToLoad);
  3101. }
  3102. };
  3103. // Misc.
  3104. Tools.Clamp = function (value, min, max) {
  3105. if (min === void 0) { min = 0; }
  3106. if (max === void 0) { max = 1; }
  3107. return Math.min(max, Math.max(min, value));
  3108. };
  3109. // Returns -1 when value is a negative number and
  3110. // +1 when value is a positive number.
  3111. Tools.Sign = function (value) {
  3112. value = +value; // convert to a number
  3113. if (value === 0 || isNaN(value))
  3114. return value;
  3115. return value > 0 ? 1 : -1;
  3116. };
  3117. Tools.Format = function (value, decimals) {
  3118. if (decimals === void 0) { decimals = 2; }
  3119. return value.toFixed(decimals);
  3120. };
  3121. Tools.CheckExtends = function (v, min, max) {
  3122. if (v.x < min.x)
  3123. min.x = v.x;
  3124. if (v.y < min.y)
  3125. min.y = v.y;
  3126. if (v.z < min.z)
  3127. min.z = v.z;
  3128. if (v.x > max.x)
  3129. max.x = v.x;
  3130. if (v.y > max.y)
  3131. max.y = v.y;
  3132. if (v.z > max.z)
  3133. max.z = v.z;
  3134. };
  3135. Tools.WithinEpsilon = function (a, b, epsilon) {
  3136. if (epsilon === void 0) { epsilon = 1.401298E-45; }
  3137. var num = a - b;
  3138. return -epsilon <= num && num <= epsilon;
  3139. };
  3140. Tools.DeepCopy = function (source, destination, doNotCopyList, mustCopyList) {
  3141. for (var prop in source) {
  3142. if (prop[0] === "_" && (!mustCopyList || mustCopyList.indexOf(prop) === -1)) {
  3143. continue;
  3144. }
  3145. if (doNotCopyList && doNotCopyList.indexOf(prop) !== -1) {
  3146. continue;
  3147. }
  3148. var sourceValue = source[prop];
  3149. var typeOfSourceValue = typeof sourceValue;
  3150. if (typeOfSourceValue === "function") {
  3151. continue;
  3152. }
  3153. if (typeOfSourceValue === "object") {
  3154. if (sourceValue instanceof Array) {
  3155. destination[prop] = [];
  3156. if (sourceValue.length > 0) {
  3157. if (typeof sourceValue[0] == "object") {
  3158. for (var index = 0; index < sourceValue.length; index++) {
  3159. var clonedValue = cloneValue(sourceValue[index], destination);
  3160. if (destination[prop].indexOf(clonedValue) === -1) {
  3161. destination[prop].push(clonedValue);
  3162. }
  3163. }
  3164. }
  3165. else {
  3166. destination[prop] = sourceValue.slice(0);
  3167. }
  3168. }
  3169. }
  3170. else {
  3171. destination[prop] = cloneValue(sourceValue, destination);
  3172. }
  3173. }
  3174. else {
  3175. destination[prop] = sourceValue;
  3176. }
  3177. }
  3178. };
  3179. Tools.IsEmpty = function (obj) {
  3180. for (var i in obj) {
  3181. return false;
  3182. }
  3183. return true;
  3184. };
  3185. Tools.RegisterTopRootEvents = function (events) {
  3186. for (var index = 0; index < events.length; index++) {
  3187. var event = events[index];
  3188. window.addEventListener(event.name, event.handler, false);
  3189. try {
  3190. if (window.parent) {
  3191. window.parent.addEventListener(event.name, event.handler, false);
  3192. }
  3193. }
  3194. catch (e) {
  3195. }
  3196. }
  3197. };
  3198. Tools.UnregisterTopRootEvents = function (events) {
  3199. for (var index = 0; index < events.length; index++) {
  3200. var event = events[index];
  3201. window.removeEventListener(event.name, event.handler);
  3202. try {
  3203. if (window.parent) {
  3204. window.parent.removeEventListener(event.name, event.handler);
  3205. }
  3206. }
  3207. catch (e) {
  3208. }
  3209. }
  3210. };
  3211. Tools.DumpFramebuffer = function (width, height, engine) {
  3212. // Read the contents of the framebuffer
  3213. var numberOfChannelsByLine = width * 4;
  3214. var halfHeight = height / 2;
  3215. //Reading datas from WebGL
  3216. var data = engine.readPixels(0, 0, width, height);
  3217. for (var i = 0; i < halfHeight; i++) {
  3218. for (var j = 0; j < numberOfChannelsByLine; j++) {
  3219. var currentCell = j + i * numberOfChannelsByLine;
  3220. var targetLine = height - i - 1;
  3221. var targetCell = j + targetLine * numberOfChannelsByLine;
  3222. var temp = data[currentCell];
  3223. data[currentCell] = data[targetCell];
  3224. data[targetCell] = temp;
  3225. }
  3226. }
  3227. // Create a 2D canvas to store the result
  3228. if (!screenshotCanvas) {
  3229. screenshotCanvas = document.createElement('canvas');
  3230. }
  3231. screenshotCanvas.width = width;
  3232. screenshotCanvas.height = height;
  3233. var context = screenshotCanvas.getContext('2d');
  3234. // Copy the pixels to a 2D canvas
  3235. var imageData = context.createImageData(width, height);
  3236. //cast is due to ts error in lib.d.ts, see here - https://github.com/Microsoft/TypeScript/issues/949
  3237. var castData = imageData.data;
  3238. castData.set(data);
  3239. context.putImageData(imageData, 0, 0);
  3240. var base64Image = screenshotCanvas.toDataURL();
  3241. //Creating a link if the browser have the download attribute on the a tag, to automatically start download generated image.
  3242. if (("download" in document.createElement("a"))) {
  3243. var a = window.document.createElement("a");
  3244. a.href = base64Image;
  3245. var date = new Date();
  3246. var stringDate = date.getFullYear() + "/" + date.getMonth() + "/" + date.getDate() + "-" + date.getHours() + ":" + date.getMinutes();
  3247. a.setAttribute("download", "screenshot-" + stringDate + ".png");
  3248. window.document.body.appendChild(a);
  3249. a.addEventListener("click", function () {
  3250. a.parentElement.removeChild(a);
  3251. });
  3252. a.click();
  3253. }
  3254. else {
  3255. var newWindow = window.open("");
  3256. var img = newWindow.document.createElement("img");
  3257. img.src = base64Image;
  3258. newWindow.document.body.appendChild(img);
  3259. }
  3260. };
  3261. Tools.CreateScreenshot = function (engine, camera, size) {
  3262. var width;
  3263. var height;
  3264. var scene = camera.getScene();
  3265. var previousCamera = null;
  3266. if (scene.activeCamera !== camera) {
  3267. previousCamera = scene.activeCamera;
  3268. scene.activeCamera = camera;
  3269. }
  3270. //If a precision value is specified
  3271. if (size.precision) {
  3272. width = Math.round(engine.getRenderWidth() * size.precision);
  3273. height = Math.round(width / engine.getAspectRatio(camera));
  3274. size = { width: width, height: height };
  3275. }
  3276. else if (size.width && size.height) {
  3277. width = size.width;
  3278. height = size.height;
  3279. }
  3280. else if (size.width && !size.height) {
  3281. width = size.width;
  3282. height = Math.round(width / engine.getAspectRatio(camera));
  3283. size = { width: width, height: height };
  3284. }
  3285. else if (size.height && !size.width) {
  3286. height = size.height;
  3287. width = Math.round(height * engine.getAspectRatio(camera));
  3288. size = { width: width, height: height };
  3289. }
  3290. else if (!isNaN(size)) {
  3291. height = size;
  3292. width = size;
  3293. }
  3294. else {
  3295. Tools.Error("Invalid 'size' parameter !");
  3296. return;
  3297. }
  3298. //At this point size can be a number, or an object (according to engine.prototype.createRenderTargetTexture method)
  3299. var texture = new BABYLON.RenderTargetTexture("screenShot", size, scene, false, false);
  3300. texture.renderList = scene.meshes;
  3301. texture.onAfterRender = function () {
  3302. Tools.DumpFramebuffer(width, height, engine);
  3303. };
  3304. scene.incrementRenderId();
  3305. texture.render(true);
  3306. texture.dispose();
  3307. if (previousCamera) {
  3308. scene.activeCamera = previousCamera;
  3309. }
  3310. };
  3311. // XHR response validator for local file scenario
  3312. Tools.ValidateXHRData = function (xhr, dataType) {
  3313. // 1 for text (.babylon, manifest and shaders), 2 for TGA, 4 for DDS, 7 for all
  3314. if (dataType === void 0) { dataType = 7; }
  3315. try {
  3316. if (dataType & 1) {
  3317. if (xhr.responseText && xhr.responseText.length > 0) {
  3318. return true;
  3319. }
  3320. else if (dataType === 1) {
  3321. return false;
  3322. }
  3323. }
  3324. if (dataType & 2) {
  3325. // Check header width and height since there is no "TGA" magic number
  3326. var tgaHeader = BABYLON.Internals.TGATools.GetTGAHeader(xhr.response);
  3327. if (tgaHeader.width && tgaHeader.height && tgaHeader.width > 0 && tgaHeader.height > 0) {
  3328. return true;
  3329. }
  3330. else if (dataType === 2) {
  3331. return false;
  3332. }
  3333. }
  3334. if (dataType & 4) {
  3335. // Check for the "DDS" magic number
  3336. var ddsHeader = new Uint8Array(xhr.response, 0, 3);
  3337. if (ddsHeader[0] === 68 && ddsHeader[1] === 68 && ddsHeader[2] === 83) {
  3338. return true;
  3339. }
  3340. else {
  3341. return false;
  3342. }
  3343. }
  3344. }
  3345. catch (e) {
  3346. }
  3347. return false;
  3348. };
  3349. Object.defineProperty(Tools, "NoneLogLevel", {
  3350. get: function () {
  3351. return Tools._NoneLogLevel;
  3352. },
  3353. enumerable: true,
  3354. configurable: true
  3355. });
  3356. Object.defineProperty(Tools, "MessageLogLevel", {
  3357. get: function () {
  3358. return Tools._MessageLogLevel;
  3359. },
  3360. enumerable: true,
  3361. configurable: true
  3362. });
  3363. Object.defineProperty(Tools, "WarningLogLevel", {
  3364. get: function () {
  3365. return Tools._WarningLogLevel;
  3366. },
  3367. enumerable: true,
  3368. configurable: true
  3369. });
  3370. Object.defineProperty(Tools, "ErrorLogLevel", {
  3371. get: function () {
  3372. return Tools._ErrorLogLevel;
  3373. },
  3374. enumerable: true,
  3375. configurable: true
  3376. });
  3377. Object.defineProperty(Tools, "AllLogLevel", {
  3378. get: function () {
  3379. return Tools._MessageLogLevel | Tools._WarningLogLevel | Tools._ErrorLogLevel;
  3380. },
  3381. enumerable: true,
  3382. configurable: true
  3383. });
  3384. Tools._AddLogEntry = function (entry) {
  3385. Tools._LogCache = entry + Tools._LogCache;
  3386. if (Tools.OnNewCacheEntry) {
  3387. Tools.OnNewCacheEntry(entry);
  3388. }
  3389. };
  3390. Tools._FormatMessage = function (message) {
  3391. var padStr = function (i) { return (i < 10) ? "0" + i : "" + i; };
  3392. var date = new Date();
  3393. return "[" + padStr(date.getHours()) + ":" + padStr(date.getMinutes()) + ":" + padStr(date.getSeconds()) + "]: " + message;
  3394. };
  3395. Tools._LogDisabled = function (message) {
  3396. // nothing to do
  3397. };
  3398. Tools._LogEnabled = function (message) {
  3399. var formattedMessage = Tools._FormatMessage(message);
  3400. console.log("BJS - " + formattedMessage);
  3401. var entry = "<div style='color:white'>" + formattedMessage + "</div><br>";
  3402. Tools._AddLogEntry(entry);
  3403. };
  3404. Tools._WarnDisabled = function (message) {
  3405. // nothing to do
  3406. };
  3407. Tools._WarnEnabled = function (message) {
  3408. var formattedMessage = Tools._FormatMessage(message);
  3409. console.warn("BJS - " + formattedMessage);
  3410. var entry = "<div style='color:orange'>" + formattedMessage + "</div><br>";
  3411. Tools._AddLogEntry(entry);
  3412. };
  3413. Tools._ErrorDisabled = function (message) {
  3414. // nothing to do
  3415. };
  3416. Tools._ErrorEnabled = function (message) {
  3417. var formattedMessage = Tools._FormatMessage(message);
  3418. console.error("BJS - " + formattedMessage);
  3419. var entry = "<div style='color:red'>" + formattedMessage + "</div><br>";
  3420. Tools._AddLogEntry(entry);
  3421. };
  3422. Object.defineProperty(Tools, "LogCache", {
  3423. get: function () {
  3424. return Tools._LogCache;
  3425. },
  3426. enumerable: true,
  3427. configurable: true
  3428. });
  3429. Object.defineProperty(Tools, "LogLevels", {
  3430. set: function (level) {
  3431. if ((level & Tools.MessageLogLevel) === Tools.MessageLogLevel) {
  3432. Tools.Log = Tools._LogEnabled;
  3433. }
  3434. else {
  3435. Tools.Log = Tools._LogDisabled;
  3436. }
  3437. if ((level & Tools.WarningLogLevel) === Tools.WarningLogLevel) {
  3438. Tools.Warn = Tools._WarnEnabled;
  3439. }
  3440. else {
  3441. Tools.Warn = Tools._WarnDisabled;
  3442. }
  3443. if ((level & Tools.ErrorLogLevel) === Tools.ErrorLogLevel) {
  3444. Tools.Error = Tools._ErrorEnabled;
  3445. }
  3446. else {
  3447. Tools.Error = Tools._ErrorDisabled;
  3448. }
  3449. },
  3450. enumerable: true,
  3451. configurable: true
  3452. });
  3453. Object.defineProperty(Tools, "PerformanceNoneLogLevel", {
  3454. get: function () {
  3455. return Tools._PerformanceNoneLogLevel;
  3456. },
  3457. enumerable: true,
  3458. configurable: true
  3459. });
  3460. Object.defineProperty(Tools, "PerformanceUserMarkLogLevel", {
  3461. get: function () {
  3462. return Tools._PerformanceUserMarkLogLevel;
  3463. },
  3464. enumerable: true,
  3465. configurable: true
  3466. });
  3467. Object.defineProperty(Tools, "PerformanceConsoleLogLevel", {
  3468. get: function () {
  3469. return Tools._PerformanceConsoleLogLevel;
  3470. },
  3471. enumerable: true,
  3472. configurable: true
  3473. });
  3474. Object.defineProperty(Tools, "PerformanceLogLevel", {
  3475. set: function (level) {
  3476. if ((level & Tools.PerformanceUserMarkLogLevel) === Tools.PerformanceUserMarkLogLevel) {
  3477. Tools.StartPerformanceCounter = Tools._StartUserMark;
  3478. Tools.EndPerformanceCounter = Tools._EndUserMark;
  3479. return;
  3480. }
  3481. if ((level & Tools.PerformanceConsoleLogLevel) === Tools.PerformanceConsoleLogLevel) {
  3482. Tools.StartPerformanceCounter = Tools._StartPerformanceConsole;
  3483. Tools.EndPerformanceCounter = Tools._EndPerformanceConsole;
  3484. return;
  3485. }
  3486. Tools.StartPerformanceCounter = Tools._StartPerformanceCounterDisabled;
  3487. Tools.EndPerformanceCounter = Tools._EndPerformanceCounterDisabled;
  3488. },
  3489. enumerable: true,
  3490. configurable: true
  3491. });
  3492. Tools._StartPerformanceCounterDisabled = function (counterName, condition) {
  3493. };
  3494. Tools._EndPerformanceCounterDisabled = function (counterName, condition) {
  3495. };
  3496. Tools._StartUserMark = function (counterName, condition) {
  3497. if (condition === void 0) { condition = true; }
  3498. if (!condition || !Tools._performance.mark) {
  3499. return;
  3500. }
  3501. Tools._performance.mark(counterName + "-Begin");
  3502. };
  3503. Tools._EndUserMark = function (counterName, condition) {
  3504. if (condition === void 0) { condition = true; }
  3505. if (!condition || !Tools._performance.mark) {
  3506. return;
  3507. }
  3508. Tools._performance.mark(counterName + "-End");
  3509. Tools._performance.measure(counterName, counterName + "-Begin", counterName + "-End");
  3510. };
  3511. Tools._StartPerformanceConsole = function (counterName, condition) {
  3512. if (condition === void 0) { condition = true; }
  3513. if (!condition) {
  3514. return;
  3515. }
  3516. Tools._StartUserMark(counterName, condition);
  3517. if (console.time) {
  3518. console.time(counterName);
  3519. }
  3520. };
  3521. Tools._EndPerformanceConsole = function (counterName, condition) {
  3522. if (condition === void 0) { condition = true; }
  3523. if (!condition) {
  3524. return;
  3525. }
  3526. Tools._EndUserMark(counterName, condition);
  3527. if (console.time) {
  3528. console.timeEnd(counterName);
  3529. }
  3530. };
  3531. Object.defineProperty(Tools, "Now", {
  3532. get: function () {
  3533. if (window.performance && window.performance.now) {
  3534. return window.performance.now();
  3535. }
  3536. return new Date().getTime();
  3537. },
  3538. enumerable: true,
  3539. configurable: true
  3540. });
  3541. // Deprecated
  3542. Tools.GetFps = function () {
  3543. Tools.Warn("Tools.GetFps() is deprecated. Please use engine.getFps() instead");
  3544. return 0;
  3545. };
  3546. Tools.BaseUrl = "";
  3547. Tools.GetExponantOfTwo = function (value, max) {
  3548. var count = 1;
  3549. do {
  3550. count *= 2;
  3551. } while (count < value);
  3552. if (count > max)
  3553. count = max;
  3554. return count;
  3555. };
  3556. // Logs
  3557. Tools._NoneLogLevel = 0;
  3558. Tools._MessageLogLevel = 1;
  3559. Tools._WarningLogLevel = 2;
  3560. Tools._ErrorLogLevel = 4;
  3561. Tools._LogCache = "";
  3562. Tools.Log = Tools._LogEnabled;
  3563. Tools.Warn = Tools._WarnEnabled;
  3564. Tools.Error = Tools._ErrorEnabled;
  3565. // Performances
  3566. Tools._PerformanceNoneLogLevel = 0;
  3567. Tools._PerformanceUserMarkLogLevel = 1;
  3568. Tools._PerformanceConsoleLogLevel = 2;
  3569. Tools._performance = window.performance;
  3570. Tools.StartPerformanceCounter = Tools._StartPerformanceCounterDisabled;
  3571. Tools.EndPerformanceCounter = Tools._EndPerformanceCounterDisabled;
  3572. return Tools;
  3573. })();
  3574. BABYLON.Tools = Tools;
  3575. /**
  3576. * An implementation of a loop for asynchronous functions.
  3577. */
  3578. var AsyncLoop = (function () {
  3579. /**
  3580. * Constroctor.
  3581. * @param iterations the number of iterations.
  3582. * @param _fn the function to run each iteration
  3583. * @param _successCallback the callback that will be called upon succesful execution
  3584. * @param offset starting offset.
  3585. */
  3586. function AsyncLoop(iterations, _fn, _successCallback, offset) {
  3587. if (offset === void 0) { offset = 0; }
  3588. this.iterations = iterations;
  3589. this._fn = _fn;
  3590. this._successCallback = _successCallback;
  3591. this.index = offset - 1;
  3592. this._done = false;
  3593. }
  3594. /**
  3595. * Execute the next iteration. Must be called after the last iteration was finished.
  3596. */
  3597. AsyncLoop.prototype.executeNext = function () {
  3598. if (!this._done) {
  3599. if (this.index + 1 < this.iterations) {
  3600. ++this.index;
  3601. this._fn(this);
  3602. }
  3603. else {
  3604. this.breakLoop();
  3605. }
  3606. }
  3607. };
  3608. /**
  3609. * Break the loop and run the success callback.
  3610. */
  3611. AsyncLoop.prototype.breakLoop = function () {
  3612. this._done = true;
  3613. this._successCallback();
  3614. };
  3615. /**
  3616. * Helper function
  3617. */
  3618. AsyncLoop.Run = function (iterations, _fn, _successCallback, offset) {
  3619. if (offset === void 0) { offset = 0; }
  3620. var loop = new AsyncLoop(iterations, _fn, _successCallback, offset);
  3621. loop.executeNext();
  3622. return loop;
  3623. };
  3624. /**
  3625. * A for-loop that will run a given number of iterations synchronous and the rest async.
  3626. * @param iterations total number of iterations
  3627. * @param syncedIterations number of synchronous iterations in each async iteration.
  3628. * @param fn the function to call each iteration.
  3629. * @param callback a success call back that will be called when iterating stops.
  3630. * @param breakFunction a break condition (optional)
  3631. * @param timeout timeout settings for the setTimeout function. default - 0.
  3632. * @constructor
  3633. */
  3634. AsyncLoop.SyncAsyncForLoop = function (iterations, syncedIterations, fn, callback, breakFunction, timeout) {
  3635. if (timeout === void 0) { timeout = 0; }
  3636. AsyncLoop.Run(Math.ceil(iterations / syncedIterations), function (loop) {
  3637. if (breakFunction && breakFunction())
  3638. loop.breakLoop();
  3639. else {
  3640. setTimeout(function () {
  3641. for (var i = 0; i < syncedIterations; ++i) {
  3642. var iteration = (loop.index * syncedIterations) + i;
  3643. if (iteration >= iterations)
  3644. break;
  3645. fn(iteration);
  3646. if (breakFunction && breakFunction()) {
  3647. loop.breakLoop();
  3648. break;
  3649. }
  3650. }
  3651. loop.executeNext();
  3652. }, timeout);
  3653. }
  3654. }, callback);
  3655. };
  3656. return AsyncLoop;
  3657. })();
  3658. BABYLON.AsyncLoop = AsyncLoop;
  3659. })(BABYLON || (BABYLON = {}));
  3660. //# sourceMappingURL=babylon.tools.js.mapvar BABYLON;
  3661. (function (BABYLON) {
  3662. var _DepthCullingState = (function () {
  3663. function _DepthCullingState() {
  3664. this._isDepthTestDirty = false;
  3665. this._isDepthMaskDirty = false;
  3666. this._isDepthFuncDirty = false;
  3667. this._isCullFaceDirty = false;
  3668. this._isCullDirty = false;
  3669. this._isZOffsetDirty = false;
  3670. }
  3671. Object.defineProperty(_DepthCullingState.prototype, "isDirty", {
  3672. get: function () {
  3673. return this._isDepthFuncDirty || this._isDepthTestDirty || this._isDepthMaskDirty || this._isCullFaceDirty || this._isCullDirty || this._isZOffsetDirty;
  3674. },
  3675. enumerable: true,
  3676. configurable: true
  3677. });
  3678. Object.defineProperty(_DepthCullingState.prototype, "zOffset", {
  3679. get: function () {
  3680. return this._zOffset;
  3681. },
  3682. set: function (value) {
  3683. if (this._zOffset === value) {
  3684. return;
  3685. }
  3686. this._zOffset = value;
  3687. this._isZOffsetDirty = true;
  3688. },
  3689. enumerable: true,
  3690. configurable: true
  3691. });
  3692. Object.defineProperty(_DepthCullingState.prototype, "cullFace", {
  3693. get: function () {
  3694. return this._cullFace;
  3695. },
  3696. set: function (value) {
  3697. if (this._cullFace === value) {
  3698. return;
  3699. }
  3700. this._cullFace = value;
  3701. this._isCullFaceDirty = true;
  3702. },
  3703. enumerable: true,
  3704. configurable: true
  3705. });
  3706. Object.defineProperty(_DepthCullingState.prototype, "cull", {
  3707. get: function () {
  3708. return this._cull;
  3709. },
  3710. set: function (value) {
  3711. if (this._cull === value) {
  3712. return;
  3713. }
  3714. this._cull = value;
  3715. this._isCullDirty = true;
  3716. },
  3717. enumerable: true,
  3718. configurable: true
  3719. });
  3720. Object.defineProperty(_DepthCullingState.prototype, "depthFunc", {
  3721. get: function () {
  3722. return this._depthFunc;
  3723. },
  3724. set: function (value) {
  3725. if (this._depthFunc === value) {
  3726. return;
  3727. }
  3728. this._depthFunc = value;
  3729. this._isDepthFuncDirty = true;
  3730. },
  3731. enumerable: true,
  3732. configurable: true
  3733. });
  3734. Object.defineProperty(_DepthCullingState.prototype, "depthMask", {
  3735. get: function () {
  3736. return this._depthMask;
  3737. },
  3738. set: function (value) {
  3739. if (this._depthMask === value) {
  3740. return;
  3741. }
  3742. this._depthMask = value;
  3743. this._isDepthMaskDirty = true;
  3744. },
  3745. enumerable: true,
  3746. configurable: true
  3747. });
  3748. Object.defineProperty(_DepthCullingState.prototype, "depthTest", {
  3749. get: function () {
  3750. return this._depthTest;
  3751. },
  3752. set: function (value) {
  3753. if (this._depthTest === value) {
  3754. return;
  3755. }
  3756. this._depthTest = value;
  3757. this._isDepthTestDirty = true;
  3758. },
  3759. enumerable: true,
  3760. configurable: true
  3761. });
  3762. _DepthCullingState.prototype.reset = function () {
  3763. this._depthMask = true;
  3764. this._depthTest = true;
  3765. this._depthFunc = null;
  3766. this._cull = null;
  3767. this._cullFace = null;
  3768. this._zOffset = 0;
  3769. this._isDepthTestDirty = true;
  3770. this._isDepthMaskDirty = true;
  3771. this._isDepthFuncDirty = false;
  3772. this._isCullFaceDirty = false;
  3773. this._isCullDirty = false;
  3774. this._isZOffsetDirty = false;
  3775. };
  3776. _DepthCullingState.prototype.apply = function (gl) {
  3777. if (!this.isDirty) {
  3778. return;
  3779. }
  3780. // Cull
  3781. if (this._isCullDirty) {
  3782. if (this.cull) {
  3783. gl.enable(gl.CULL_FACE);
  3784. }
  3785. else {
  3786. gl.disable(gl.CULL_FACE);
  3787. }
  3788. this._isCullDirty = false;
  3789. }
  3790. // Cull face
  3791. if (this._isCullFaceDirty) {
  3792. gl.cullFace(this.cullFace);
  3793. this._isCullFaceDirty = false;
  3794. }
  3795. // Depth mask
  3796. if (this._isDepthMaskDirty) {
  3797. gl.depthMask(this.depthMask);
  3798. this._isDepthMaskDirty = false;
  3799. }
  3800. // Depth test
  3801. if (this._isDepthTestDirty) {
  3802. if (this.depthTest) {
  3803. gl.enable(gl.DEPTH_TEST);
  3804. }
  3805. else {
  3806. gl.disable(gl.DEPTH_TEST);
  3807. }
  3808. this._isDepthTestDirty = false;
  3809. }
  3810. // Depth func
  3811. if (this._isDepthFuncDirty) {
  3812. gl.depthFunc(this.depthFunc);
  3813. this._isDepthFuncDirty = false;
  3814. }
  3815. // zOffset
  3816. if (this._isZOffsetDirty) {
  3817. if (this.zOffset) {
  3818. gl.enable(gl.POLYGON_OFFSET_FILL);
  3819. gl.polygonOffset(this.zOffset, 0);
  3820. }
  3821. else {
  3822. gl.disable(gl.POLYGON_OFFSET_FILL);
  3823. }
  3824. this._isZOffsetDirty = false;
  3825. }
  3826. };
  3827. return _DepthCullingState;
  3828. })();
  3829. BABYLON._DepthCullingState = _DepthCullingState;
  3830. var _AlphaState = (function () {
  3831. function _AlphaState() {
  3832. this._isAlphaBlendDirty = false;
  3833. this._isBlendFunctionParametersDirty = false;
  3834. this._alphaBlend = false;
  3835. this._blendFunctionParameters = new Array(4);
  3836. }
  3837. Object.defineProperty(_AlphaState.prototype, "isDirty", {
  3838. get: function () {
  3839. return this._isAlphaBlendDirty || this._isBlendFunctionParametersDirty;
  3840. },
  3841. enumerable: true,
  3842. configurable: true
  3843. });
  3844. Object.defineProperty(_AlphaState.prototype, "alphaBlend", {
  3845. get: function () {
  3846. return this._alphaBlend;
  3847. },
  3848. set: function (value) {
  3849. if (this._alphaBlend === value) {
  3850. return;
  3851. }
  3852. this._alphaBlend = value;
  3853. this._isAlphaBlendDirty = true;
  3854. },
  3855. enumerable: true,
  3856. configurable: true
  3857. });
  3858. _AlphaState.prototype.setAlphaBlendFunctionParameters = function (value0, value1, value2, value3) {
  3859. if (this._blendFunctionParameters[0] === value0 && this._blendFunctionParameters[1] === value1 && this._blendFunctionParameters[2] === value2 && this._blendFunctionParameters[3] === value3) {
  3860. return;
  3861. }
  3862. this._blendFunctionParameters[0] = value0;
  3863. this._blendFunctionParameters[1] = value1;
  3864. this._blendFunctionParameters[2] = value2;
  3865. this._blendFunctionParameters[3] = value3;
  3866. this._isBlendFunctionParametersDirty = true;
  3867. };
  3868. _AlphaState.prototype.reset = function () {
  3869. this._alphaBlend = false;
  3870. this._blendFunctionParameters[0] = null;
  3871. this._blendFunctionParameters[1] = null;
  3872. this._blendFunctionParameters[2] = null;
  3873. this._blendFunctionParameters[3] = null;
  3874. this._isAlphaBlendDirty = true;
  3875. this._isBlendFunctionParametersDirty = false;
  3876. };
  3877. _AlphaState.prototype.apply = function (gl) {
  3878. if (!this.isDirty) {
  3879. return;
  3880. }
  3881. // Alpha blend
  3882. if (this._isAlphaBlendDirty) {
  3883. if (this._alphaBlend) {
  3884. gl.enable(gl.BLEND);
  3885. }
  3886. else {
  3887. gl.disable(gl.BLEND);
  3888. }
  3889. this._isAlphaBlendDirty = false;
  3890. }
  3891. // Alpha function
  3892. if (this._isBlendFunctionParametersDirty) {
  3893. gl.blendFuncSeparate(this._blendFunctionParameters[0], this._blendFunctionParameters[1], this._blendFunctionParameters[2], this._blendFunctionParameters[3]);
  3894. this._isBlendFunctionParametersDirty = false;
  3895. }
  3896. };
  3897. return _AlphaState;
  3898. })();
  3899. BABYLON._AlphaState = _AlphaState;
  3900. var compileShader = function (gl, source, type, defines) {
  3901. var shader = gl.createShader(type === "vertex" ? gl.VERTEX_SHADER : gl.FRAGMENT_SHADER);
  3902. gl.shaderSource(shader, (defines ? defines + "\n" : "") + source);
  3903. gl.compileShader(shader);
  3904. if (!gl.getShaderParameter(shader, gl.COMPILE_STATUS)) {
  3905. throw new Error(gl.getShaderInfoLog(shader));
  3906. }
  3907. return shader;
  3908. };
  3909. var getWebGLTextureType = function (gl, type) {
  3910. var textureType = gl.UNSIGNED_BYTE;
  3911. if (type === Engine.TEXTURETYPE_FLOAT)
  3912. textureType = gl.FLOAT;
  3913. return textureType;
  3914. };
  3915. var getSamplingParameters = function (samplingMode, generateMipMaps, gl) {
  3916. var magFilter = gl.NEAREST;
  3917. var minFilter = gl.NEAREST;
  3918. if (samplingMode === BABYLON.Texture.BILINEAR_SAMPLINGMODE) {
  3919. magFilter = gl.LINEAR;
  3920. if (generateMipMaps) {
  3921. minFilter = gl.LINEAR_MIPMAP_NEAREST;
  3922. }
  3923. else {
  3924. minFilter = gl.LINEAR;
  3925. }
  3926. }
  3927. else if (samplingMode === BABYLON.Texture.TRILINEAR_SAMPLINGMODE) {
  3928. magFilter = gl.LINEAR;
  3929. if (generateMipMaps) {
  3930. minFilter = gl.LINEAR_MIPMAP_LINEAR;
  3931. }
  3932. else {
  3933. minFilter = gl.LINEAR;
  3934. }
  3935. }
  3936. else if (samplingMode === BABYLON.Texture.NEAREST_SAMPLINGMODE) {
  3937. magFilter = gl.NEAREST;
  3938. if (generateMipMaps) {
  3939. minFilter = gl.NEAREST_MIPMAP_LINEAR;
  3940. }
  3941. else {
  3942. minFilter = gl.NEAREST;
  3943. }
  3944. }
  3945. return {
  3946. min: minFilter,
  3947. mag: magFilter
  3948. };
  3949. };
  3950. var prepareWebGLTexture = function (texture, gl, scene, width, height, invertY, noMipmap, isCompressed, processFunction, samplingMode) {
  3951. if (samplingMode === void 0) { samplingMode = BABYLON.Texture.TRILINEAR_SAMPLINGMODE; }
  3952. var engine = scene.getEngine();
  3953. var potWidth = BABYLON.Tools.GetExponantOfTwo(width, engine.getCaps().maxTextureSize);
  3954. var potHeight = BABYLON.Tools.GetExponantOfTwo(height, engine.getCaps().maxTextureSize);
  3955. gl.bindTexture(gl.TEXTURE_2D, texture);
  3956. gl.pixelStorei(gl.UNPACK_FLIP_Y_WEBGL, invertY === undefined ? 1 : (invertY ? 1 : 0));
  3957. texture._baseWidth = width;
  3958. texture._baseHeight = height;
  3959. texture._width = potWidth;
  3960. texture._height = potHeight;
  3961. texture.isReady = true;
  3962. processFunction(potWidth, potHeight);
  3963. var filters = getSamplingParameters(samplingMode, !noMipmap, gl);
  3964. gl.texParameteri(gl.TEXTURE_2D, gl.TEXTURE_MAG_FILTER, filters.mag);
  3965. gl.texParameteri(gl.TEXTURE_2D, gl.TEXTURE_MIN_FILTER, filters.min);
  3966. if (!noMipmap && !isCompressed) {
  3967. gl.generateMipmap(gl.TEXTURE_2D);
  3968. }
  3969. gl.bindTexture(gl.TEXTURE_2D, null);
  3970. engine._activeTexturesCache = [];
  3971. texture.samplingMode = samplingMode;
  3972. scene._removePendingData(texture);
  3973. };
  3974. var partialLoad = function (url, index, loadedImages, scene, onfinish) {
  3975. var onload = function () {
  3976. loadedImages[index] = img;
  3977. loadedImages._internalCount++;
  3978. scene._removePendingData(img);
  3979. if (loadedImages._internalCount === 6) {
  3980. onfinish(loadedImages);
  3981. }
  3982. };
  3983. var onerror = function () {
  3984. scene._removePendingData(img);
  3985. };
  3986. var img = BABYLON.Tools.LoadImage(url, onload, onerror, scene.database);
  3987. scene._addPendingData(img);
  3988. };
  3989. var cascadeLoad = function (rootUrl, scene, onfinish, extensions) {
  3990. var loadedImages = [];
  3991. loadedImages._internalCount = 0;
  3992. for (var index = 0; index < 6; index++) {
  3993. partialLoad(rootUrl + extensions[index], index, loadedImages, scene, onfinish);
  3994. }
  3995. };
  3996. var EngineCapabilities = (function () {
  3997. function EngineCapabilities() {
  3998. }
  3999. return EngineCapabilities;
  4000. })();
  4001. BABYLON.EngineCapabilities = EngineCapabilities;
  4002. /**
  4003. * The engine class is responsible for interfacing with all lower-level APIs such as WebGL and Audio.
  4004. */
  4005. var Engine = (function () {
  4006. /**
  4007. * @constructor
  4008. * @param {HTMLCanvasElement} canvas - the canvas to be used for rendering
  4009. * @param {boolean} [antialias] - enable antialias
  4010. * @param options - further options to be sent to the getContext function
  4011. */
  4012. function Engine(canvas, antialias, options) {
  4013. var _this = this;
  4014. // Public members
  4015. this.isFullscreen = false;
  4016. this.isPointerLock = false;
  4017. this.cullBackFaces = true;
  4018. this.renderEvenInBackground = true;
  4019. this.scenes = new Array();
  4020. this._windowIsBackground = false;
  4021. this._loadingDivBackgroundColor = "black";
  4022. this._drawCalls = 0;
  4023. this._renderingQueueLaunched = false;
  4024. this._activeRenderLoops = [];
  4025. // FPS
  4026. this.fpsRange = 60;
  4027. this.previousFramesDuration = [];
  4028. this.fps = 60;
  4029. this.deltaTime = 0;
  4030. // States
  4031. this._depthCullingState = new _DepthCullingState();
  4032. this._alphaState = new _AlphaState();
  4033. this._alphaMode = Engine.ALPHA_DISABLE;
  4034. // Cache
  4035. this._loadedTexturesCache = new Array();
  4036. this._activeTexturesCache = new Array();
  4037. this._compiledEffects = {};
  4038. this._uintIndicesCurrentlySet = false;
  4039. this._renderingCanvas = canvas;
  4040. this._canvasClientRect = this._renderingCanvas.getBoundingClientRect();
  4041. options = options || {};
  4042. options.antialias = antialias;
  4043. try {
  4044. this._gl = canvas.getContext("webgl", options) || canvas.getContext("experimental-webgl", options);
  4045. }
  4046. catch (e) {
  4047. throw new Error("WebGL not supported");
  4048. }
  4049. if (!this._gl) {
  4050. throw new Error("WebGL not supported");
  4051. }
  4052. this._onBlur = function () {
  4053. _this._windowIsBackground = true;
  4054. };
  4055. this._onFocus = function () {
  4056. _this._windowIsBackground = false;
  4057. };
  4058. window.addEventListener("blur", this._onBlur);
  4059. window.addEventListener("focus", this._onFocus);
  4060. // Viewport
  4061. this._hardwareScalingLevel = 1.0 / (window.devicePixelRatio || 1.0);
  4062. this.resize();
  4063. // Caps
  4064. this._caps = new EngineCapabilities();
  4065. this._caps.maxTexturesImageUnits = this._gl.getParameter(this._gl.MAX_TEXTURE_IMAGE_UNITS);
  4066. this._caps.maxTextureSize = this._gl.getParameter(this._gl.MAX_TEXTURE_SIZE);
  4067. this._caps.maxCubemapTextureSize = this._gl.getParameter(this._gl.MAX_CUBE_MAP_TEXTURE_SIZE);
  4068. this._caps.maxRenderTextureSize = this._gl.getParameter(this._gl.MAX_RENDERBUFFER_SIZE);
  4069. // Infos
  4070. this._glVersion = this._gl.getParameter(this._gl.VERSION);
  4071. var rendererInfo = this._gl.getExtension("WEBGL_debug_renderer_info");
  4072. if (rendererInfo != null) {
  4073. this._glRenderer = this._gl.getParameter(rendererInfo.UNMASKED_RENDERER_WEBGL);
  4074. this._glVendor = this._gl.getParameter(rendererInfo.UNMASKED_VENDOR_WEBGL);
  4075. }
  4076. if (!this._glVendor) {
  4077. this._glVendor = "Unknown vendor";
  4078. }
  4079. if (!this._glRenderer) {
  4080. this._glRenderer = "Unknown renderer";
  4081. }
  4082. // Extensions
  4083. this._caps.standardDerivatives = (this._gl.getExtension('OES_standard_derivatives') !== null);
  4084. this._caps.s3tc = this._gl.getExtension('WEBGL_compressed_texture_s3tc');
  4085. this._caps.textureFloat = (this._gl.getExtension('OES_texture_float') !== null);
  4086. this._caps.textureAnisotropicFilterExtension = this._gl.getExtension('EXT_texture_filter_anisotropic') || this._gl.getExtension('WEBKIT_EXT_texture_filter_anisotropic') || this._gl.getExtension('MOZ_EXT_texture_filter_anisotropic');
  4087. this._caps.maxAnisotropy = this._caps.textureAnisotropicFilterExtension ? this._gl.getParameter(this._caps.textureAnisotropicFilterExtension.MAX_TEXTURE_MAX_ANISOTROPY_EXT) : 0;
  4088. this._caps.instancedArrays = this._gl.getExtension('ANGLE_instanced_arrays');
  4089. this._caps.uintIndices = this._gl.getExtension('OES_element_index_uint') !== null;
  4090. this._caps.highPrecisionShaderSupported = true;
  4091. if (this._gl.getShaderPrecisionFormat) {
  4092. var highp = this._gl.getShaderPrecisionFormat(this._gl.FRAGMENT_SHADER, this._gl.HIGH_FLOAT);
  4093. this._caps.highPrecisionShaderSupported = highp.precision != 0;
  4094. }
  4095. // Depth buffer
  4096. this.setDepthBuffer(true);
  4097. this.setDepthFunctionToLessOrEqual();
  4098. this.setDepthWrite(true);
  4099. // Fullscreen
  4100. this._onFullscreenChange = function () {
  4101. if (document.fullscreen !== undefined) {
  4102. _this.isFullscreen = document.fullscreen;
  4103. }
  4104. else if (document.mozFullScreen !== undefined) {
  4105. _this.isFullscreen = document.mozFullScreen;
  4106. }
  4107. else if (document.webkitIsFullScreen !== undefined) {
  4108. _this.isFullscreen = document.webkitIsFullScreen;
  4109. }
  4110. else if (document.msIsFullScreen !== undefined) {
  4111. _this.isFullscreen = document.msIsFullScreen;
  4112. }
  4113. // Pointer lock
  4114. if (_this.isFullscreen && _this._pointerLockRequested) {
  4115. canvas.requestPointerLock = canvas.requestPointerLock || canvas.msRequestPointerLock || canvas.mozRequestPointerLock || canvas.webkitRequestPointerLock;
  4116. if (canvas.requestPointerLock) {
  4117. canvas.requestPointerLock();
  4118. }
  4119. }
  4120. };
  4121. document.addEventListener("fullscreenchange", this._onFullscreenChange, false);
  4122. document.addEventListener("mozfullscreenchange", this._onFullscreenChange, false);
  4123. document.addEventListener("webkitfullscreenchange", this._onFullscreenChange, false);
  4124. document.addEventListener("msfullscreenchange", this._onFullscreenChange, false);
  4125. // Pointer lock
  4126. this._onPointerLockChange = function () {
  4127. _this.isPointerLock = (document.mozPointerLockElement === canvas || document.webkitPointerLockElement === canvas || document.msPointerLockElement === canvas || document.pointerLockElement === canvas);
  4128. };
  4129. document.addEventListener("pointerlockchange", this._onPointerLockChange, false);
  4130. document.addEventListener("mspointerlockchange", this._onPointerLockChange, false);
  4131. document.addEventListener("mozpointerlockchange", this._onPointerLockChange, false);
  4132. document.addEventListener("webkitpointerlockchange", this._onPointerLockChange, false);
  4133. if (!Engine.audioEngine) {
  4134. Engine.audioEngine = new BABYLON.AudioEngine();
  4135. }
  4136. BABYLON.Tools.Log("Babylon.js engine (v" + Engine.Version + ") launched");
  4137. }
  4138. Object.defineProperty(Engine, "ALPHA_DISABLE", {
  4139. get: function () {
  4140. return Engine._ALPHA_DISABLE;
  4141. },
  4142. enumerable: true,
  4143. configurable: true
  4144. });
  4145. Object.defineProperty(Engine, "ALPHA_ADD", {
  4146. get: function () {
  4147. return Engine._ALPHA_ADD;
  4148. },
  4149. enumerable: true,
  4150. configurable: true
  4151. });
  4152. Object.defineProperty(Engine, "ALPHA_COMBINE", {
  4153. get: function () {
  4154. return Engine._ALPHA_COMBINE;
  4155. },
  4156. enumerable: true,
  4157. configurable: true
  4158. });
  4159. Object.defineProperty(Engine, "DELAYLOADSTATE_NONE", {
  4160. get: function () {
  4161. return Engine._DELAYLOADSTATE_NONE;
  4162. },
  4163. enumerable: true,
  4164. configurable: true
  4165. });
  4166. Object.defineProperty(Engine, "DELAYLOADSTATE_LOADED", {
  4167. get: function () {
  4168. return Engine._DELAYLOADSTATE_LOADED;
  4169. },
  4170. enumerable: true,
  4171. configurable: true
  4172. });
  4173. Object.defineProperty(Engine, "DELAYLOADSTATE_LOADING", {
  4174. get: function () {
  4175. return Engine._DELAYLOADSTATE_LOADING;
  4176. },
  4177. enumerable: true,
  4178. configurable: true
  4179. });
  4180. Object.defineProperty(Engine, "DELAYLOADSTATE_NOTLOADED", {
  4181. get: function () {
  4182. return Engine._DELAYLOADSTATE_NOTLOADED;
  4183. },
  4184. enumerable: true,
  4185. configurable: true
  4186. });
  4187. Object.defineProperty(Engine, "TEXTUREFORMAT_ALPHA", {
  4188. get: function () {
  4189. return Engine._TEXTUREFORMAT_ALPHA;
  4190. },
  4191. enumerable: true,
  4192. configurable: true
  4193. });
  4194. Object.defineProperty(Engine, "TEXTUREFORMAT_LUMINANCE", {
  4195. get: function () {
  4196. return Engine._TEXTUREFORMAT_LUMINANCE;
  4197. },
  4198. enumerable: true,
  4199. configurable: true
  4200. });
  4201. Object.defineProperty(Engine, "TEXTUREFORMAT_LUMINANCE_ALPHA", {
  4202. get: function () {
  4203. return Engine._TEXTUREFORMAT_LUMINANCE_ALPHA;
  4204. },
  4205. enumerable: true,
  4206. configurable: true
  4207. });
  4208. Object.defineProperty(Engine, "TEXTUREFORMAT_RGB", {
  4209. get: function () {
  4210. return Engine._TEXTUREFORMAT_RGB;
  4211. },
  4212. enumerable: true,
  4213. configurable: true
  4214. });
  4215. Object.defineProperty(Engine, "TEXTUREFORMAT_RGBA", {
  4216. get: function () {
  4217. return Engine._TEXTUREFORMAT_RGBA;
  4218. },
  4219. enumerable: true,
  4220. configurable: true
  4221. });
  4222. Object.defineProperty(Engine, "TEXTURETYPE_UNSIGNED_INT", {
  4223. get: function () {
  4224. return Engine._TEXTURETYPE_UNSIGNED_INT;
  4225. },
  4226. enumerable: true,
  4227. configurable: true
  4228. });
  4229. Object.defineProperty(Engine, "TEXTURETYPE_FLOAT", {
  4230. get: function () {
  4231. return Engine._TEXTURETYPE_FLOAT;
  4232. },
  4233. enumerable: true,
  4234. configurable: true
  4235. });
  4236. Object.defineProperty(Engine, "Version", {
  4237. get: function () {
  4238. return "2.1.0 alpha";
  4239. },
  4240. enumerable: true,
  4241. configurable: true
  4242. });
  4243. Engine.prototype._prepareWorkingCanvas = function () {
  4244. if (this._workingCanvas) {
  4245. return;
  4246. }
  4247. this._workingCanvas = document.createElement("canvas");
  4248. this._workingContext = this._workingCanvas.getContext("2d");
  4249. };
  4250. Engine.prototype.getGlInfo = function () {
  4251. return {
  4252. vendor: this._glVendor,
  4253. renderer: this._glRenderer,
  4254. version: this._glVersion
  4255. };
  4256. };
  4257. Engine.prototype.getAspectRatio = function (camera) {
  4258. var viewport = camera.viewport;
  4259. return (this.getRenderWidth() * viewport.width) / (this.getRenderHeight() * viewport.height);
  4260. };
  4261. Engine.prototype.getRenderWidth = function () {
  4262. if (this._currentRenderTarget) {
  4263. return this._currentRenderTarget._width;
  4264. }
  4265. return this._renderingCanvas.width;
  4266. };
  4267. Engine.prototype.getRenderHeight = function () {
  4268. if (this._currentRenderTarget) {
  4269. return this._currentRenderTarget._height;
  4270. }
  4271. return this._renderingCanvas.height;
  4272. };
  4273. Engine.prototype.getRenderingCanvas = function () {
  4274. return this._renderingCanvas;
  4275. };
  4276. Engine.prototype.getRenderingCanvasClientRect = function () {
  4277. return this._renderingCanvas.getBoundingClientRect();
  4278. };
  4279. Engine.prototype.setHardwareScalingLevel = function (level) {
  4280. this._hardwareScalingLevel = level;
  4281. this.resize();
  4282. };
  4283. Engine.prototype.getHardwareScalingLevel = function () {
  4284. return this._hardwareScalingLevel;
  4285. };
  4286. Engine.prototype.getLoadedTexturesCache = function () {
  4287. return this._loadedTexturesCache;
  4288. };
  4289. Engine.prototype.getCaps = function () {
  4290. return this._caps;
  4291. };
  4292. Object.defineProperty(Engine.prototype, "drawCalls", {
  4293. get: function () {
  4294. return this._drawCalls;
  4295. },
  4296. enumerable: true,
  4297. configurable: true
  4298. });
  4299. // Methods
  4300. Engine.prototype.resetDrawCalls = function () {
  4301. this._drawCalls = 0;
  4302. };
  4303. Engine.prototype.setDepthFunctionToGreater = function () {
  4304. this._depthCullingState.depthFunc = this._gl.GREATER;
  4305. };
  4306. Engine.prototype.setDepthFunctionToGreaterOrEqual = function () {
  4307. this._depthCullingState.depthFunc = this._gl.GEQUAL;
  4308. };
  4309. Engine.prototype.setDepthFunctionToLess = function () {
  4310. this._depthCullingState.depthFunc = this._gl.LESS;
  4311. };
  4312. Engine.prototype.setDepthFunctionToLessOrEqual = function () {
  4313. this._depthCullingState.depthFunc = this._gl.LEQUAL;
  4314. };
  4315. /**
  4316. * stop executing a render loop function and remove it from the execution array
  4317. * @param {Function} [renderFunction] the function to be removed. If not provided all functions will be removed.
  4318. */
  4319. Engine.prototype.stopRenderLoop = function (renderFunction) {
  4320. if (!renderFunction) {
  4321. this._activeRenderLoops = [];
  4322. return;
  4323. }
  4324. var index = this._activeRenderLoops.indexOf(renderFunction);
  4325. if (index >= 0) {
  4326. this._activeRenderLoops.splice(index, 1);
  4327. }
  4328. };
  4329. Engine.prototype._renderLoop = function () {
  4330. var _this = this;
  4331. var shouldRender = true;
  4332. if (!this.renderEvenInBackground && this._windowIsBackground) {
  4333. shouldRender = false;
  4334. }
  4335. if (shouldRender) {
  4336. // Start new frame
  4337. this.beginFrame();
  4338. for (var index = 0; index < this._activeRenderLoops.length; index++) {
  4339. var renderFunction = this._activeRenderLoops[index];
  4340. renderFunction();
  4341. }
  4342. // Present
  4343. this.endFrame();
  4344. }
  4345. if (this._activeRenderLoops.length > 0) {
  4346. // Register new frame
  4347. BABYLON.Tools.QueueNewFrame(function () {
  4348. _this._renderLoop();
  4349. });
  4350. }
  4351. else {
  4352. this._renderingQueueLaunched = false;
  4353. }
  4354. };
  4355. /**
  4356. * Register and execute a render loop. The engine can have more than one render function.
  4357. * @param {Function} renderFunction - the function to continuesly execute starting the next render loop.
  4358. * @example
  4359. * engine.runRenderLoop(function () {
  4360. * scene.render()
  4361. * })
  4362. */
  4363. Engine.prototype.runRenderLoop = function (renderFunction) {
  4364. var _this = this;
  4365. if (this._activeRenderLoops.indexOf(renderFunction) !== -1) {
  4366. return;
  4367. }
  4368. this._activeRenderLoops.push(renderFunction);
  4369. if (!this._renderingQueueLaunched) {
  4370. this._renderingQueueLaunched = true;
  4371. BABYLON.Tools.QueueNewFrame(function () {
  4372. _this._renderLoop();
  4373. });
  4374. }
  4375. };
  4376. /**
  4377. * Toggle full screen mode.
  4378. * @param {boolean} requestPointerLock - should a pointer lock be requested from the user
  4379. */
  4380. Engine.prototype.switchFullscreen = function (requestPointerLock) {
  4381. if (this.isFullscreen) {
  4382. BABYLON.Tools.ExitFullscreen();
  4383. }
  4384. else {
  4385. this._pointerLockRequested = requestPointerLock;
  4386. BABYLON.Tools.RequestFullscreen(this._renderingCanvas);
  4387. }
  4388. };
  4389. Engine.prototype.clear = function (color, backBuffer, depthStencil) {
  4390. this.applyStates();
  4391. this._gl.clearColor(color.r, color.g, color.b, color.a !== undefined ? color.a : 1.0);
  4392. if (this._depthCullingState.depthMask) {
  4393. this._gl.clearDepth(1.0);
  4394. }
  4395. var mode = 0;
  4396. if (backBuffer)
  4397. mode |= this._gl.COLOR_BUFFER_BIT;
  4398. if (depthStencil && this._depthCullingState.depthMask)
  4399. mode |= this._gl.DEPTH_BUFFER_BIT;
  4400. this._gl.clear(mode);
  4401. };
  4402. /**
  4403. * Set the WebGL's viewport
  4404. * @param {BABYLON.Viewport} viewport - the viewport element to be used.
  4405. * @param {number} [requiredWidth] - the width required for rendering. If not provided the rendering canvas' width is used.
  4406. * @param {number} [requiredHeight] - the height required for rendering. If not provided the rendering canvas' height is used.
  4407. */
  4408. Engine.prototype.setViewport = function (viewport, requiredWidth, requiredHeight) {
  4409. var width = requiredWidth || this._renderingCanvas.width;
  4410. var height = requiredHeight || this._renderingCanvas.height;
  4411. var x = viewport.x || 0;
  4412. var y = viewport.y || 0;
  4413. this._cachedViewport = viewport;
  4414. this._gl.viewport(x * width, y * height, width * viewport.width, height * viewport.height);
  4415. };
  4416. Engine.prototype.setDirectViewport = function (x, y, width, height) {
  4417. this._cachedViewport = null;
  4418. this._gl.viewport(x, y, width, height);
  4419. };
  4420. Engine.prototype.beginFrame = function () {
  4421. this._measureFps();
  4422. };
  4423. Engine.prototype.endFrame = function () {
  4424. //this.flushFramebuffer();
  4425. };
  4426. /**
  4427. * resize the view according to the canvas' size.
  4428. * @example
  4429. * window.addEventListener("resize", function () {
  4430. * engine.resize();
  4431. * });
  4432. */
  4433. Engine.prototype.resize = function () {
  4434. this.setSize(this._renderingCanvas.clientWidth / this._hardwareScalingLevel, this._renderingCanvas.clientHeight / this._hardwareScalingLevel);
  4435. };
  4436. /**
  4437. * force a specific size of the canvas
  4438. * @param {number} width - the new canvas' width
  4439. * @param {number} height - the new canvas' height
  4440. */
  4441. Engine.prototype.setSize = function (width, height) {
  4442. this._renderingCanvas.width = width;
  4443. this._renderingCanvas.height = height;
  4444. this._canvasClientRect = this._renderingCanvas.getBoundingClientRect();
  4445. };
  4446. Engine.prototype.bindFramebuffer = function (texture) {
  4447. this._currentRenderTarget = texture;
  4448. var gl = this._gl;
  4449. gl.bindFramebuffer(gl.FRAMEBUFFER, texture._framebuffer);
  4450. this._gl.viewport(0, 0, texture._width, texture._height);
  4451. this.wipeCaches();
  4452. };
  4453. Engine.prototype.unBindFramebuffer = function (texture) {
  4454. this._currentRenderTarget = null;
  4455. if (texture.generateMipMaps) {
  4456. var gl = this._gl;
  4457. gl.bindTexture(gl.TEXTURE_2D, texture);
  4458. gl.generateMipmap(gl.TEXTURE_2D);
  4459. gl.bindTexture(gl.TEXTURE_2D, null);
  4460. }
  4461. this._gl.bindFramebuffer(this._gl.FRAMEBUFFER, null);
  4462. };
  4463. Engine.prototype.flushFramebuffer = function () {
  4464. this._gl.flush();
  4465. };
  4466. Engine.prototype.restoreDefaultFramebuffer = function () {
  4467. this._currentRenderTarget = null;
  4468. this._gl.bindFramebuffer(this._gl.FRAMEBUFFER, null);
  4469. this.setViewport(this._cachedViewport);
  4470. this.wipeCaches();
  4471. };
  4472. // VBOs
  4473. Engine.prototype._resetVertexBufferBinding = function () {
  4474. this._gl.bindBuffer(this._gl.ARRAY_BUFFER, null);
  4475. this._cachedVertexBuffers = null;
  4476. };
  4477. Engine.prototype.createVertexBuffer = function (vertices) {
  4478. var vbo = this._gl.createBuffer();
  4479. this._gl.bindBuffer(this._gl.ARRAY_BUFFER, vbo);
  4480. this._gl.bufferData(this._gl.ARRAY_BUFFER, new Float32Array(vertices), this._gl.STATIC_DRAW);
  4481. this._resetVertexBufferBinding();
  4482. vbo.references = 1;
  4483. return vbo;
  4484. };
  4485. Engine.prototype.createDynamicVertexBuffer = function (capacity) {
  4486. var vbo = this._gl.createBuffer();
  4487. this._gl.bindBuffer(this._gl.ARRAY_BUFFER, vbo);
  4488. this._gl.bufferData(this._gl.ARRAY_BUFFER, capacity, this._gl.DYNAMIC_DRAW);
  4489. this._resetVertexBufferBinding();
  4490. vbo.references = 1;
  4491. return vbo;
  4492. };
  4493. Engine.prototype.updateDynamicVertexBuffer = function (vertexBuffer, vertices, offset) {
  4494. this._gl.bindBuffer(this._gl.ARRAY_BUFFER, vertexBuffer);
  4495. if (offset === undefined) {
  4496. offset = 0;
  4497. }
  4498. if (vertices instanceof Float32Array) {
  4499. this._gl.bufferSubData(this._gl.ARRAY_BUFFER, offset, vertices);
  4500. }
  4501. else {
  4502. this._gl.bufferSubData(this._gl.ARRAY_BUFFER, offset, new Float32Array(vertices));
  4503. }
  4504. this._resetVertexBufferBinding();
  4505. };
  4506. Engine.prototype._resetIndexBufferBinding = function () {
  4507. this._gl.bindBuffer(this._gl.ELEMENT_ARRAY_BUFFER, null);
  4508. this._cachedIndexBuffer = null;
  4509. };
  4510. Engine.prototype.createIndexBuffer = function (indices) {
  4511. var vbo = this._gl.createBuffer();
  4512. this._gl.bindBuffer(this._gl.ELEMENT_ARRAY_BUFFER, vbo);
  4513. // Check for 32 bits indices
  4514. var arrayBuffer;
  4515. var need32Bits = false;
  4516. if (this._caps.uintIndices) {
  4517. for (var index = 0; index < indices.length; index++) {
  4518. if (indices[index] > 65535) {
  4519. need32Bits = true;
  4520. break;
  4521. }
  4522. }
  4523. arrayBuffer = need32Bits ? new Uint32Array(indices) : new Uint16Array(indices);
  4524. }
  4525. else {
  4526. arrayBuffer = new Uint16Array(indices);
  4527. }
  4528. this._gl.bufferData(this._gl.ELEMENT_ARRAY_BUFFER, arrayBuffer, this._gl.STATIC_DRAW);
  4529. this._resetIndexBufferBinding();
  4530. vbo.references = 1;
  4531. vbo.is32Bits = need32Bits;
  4532. return vbo;
  4533. };
  4534. Engine.prototype.bindBuffers = function (vertexBuffer, indexBuffer, vertexDeclaration, vertexStrideSize, effect) {
  4535. if (this._cachedVertexBuffers !== vertexBuffer || this._cachedEffectForVertexBuffers !== effect) {
  4536. this._cachedVertexBuffers = vertexBuffer;
  4537. this._cachedEffectForVertexBuffers = effect;
  4538. this._gl.bindBuffer(this._gl.ARRAY_BUFFER, vertexBuffer);
  4539. var offset = 0;
  4540. for (var index = 0; index < vertexDeclaration.length; index++) {
  4541. var order = effect.getAttributeLocation(index);
  4542. if (order >= 0) {
  4543. this._gl.vertexAttribPointer(order, vertexDeclaration[index], this._gl.FLOAT, false, vertexStrideSize, offset);
  4544. }
  4545. offset += vertexDeclaration[index] * 4;
  4546. }
  4547. }
  4548. if (this._cachedIndexBuffer !== indexBuffer) {
  4549. this._cachedIndexBuffer = indexBuffer;
  4550. this._gl.bindBuffer(this._gl.ELEMENT_ARRAY_BUFFER, indexBuffer);
  4551. this._uintIndicesCurrentlySet = indexBuffer.is32Bits;
  4552. }
  4553. };
  4554. Engine.prototype.bindMultiBuffers = function (vertexBuffers, indexBuffer, effect) {
  4555. if (this._cachedVertexBuffers !== vertexBuffers || this._cachedEffectForVertexBuffers !== effect) {
  4556. this._cachedVertexBuffers = vertexBuffers;
  4557. this._cachedEffectForVertexBuffers = effect;
  4558. var attributes = effect.getAttributesNames();
  4559. for (var index = 0; index < attributes.length; index++) {
  4560. var order = effect.getAttributeLocation(index);
  4561. if (order >= 0) {
  4562. var vertexBuffer = vertexBuffers[attributes[index]];
  4563. if (!vertexBuffer) {
  4564. continue;
  4565. }
  4566. var stride = vertexBuffer.getStrideSize();
  4567. this._gl.bindBuffer(this._gl.ARRAY_BUFFER, vertexBuffer.getBuffer());
  4568. this._gl.vertexAttribPointer(order, stride, this._gl.FLOAT, false, stride * 4, 0);
  4569. }
  4570. }
  4571. }
  4572. if (indexBuffer != null && this._cachedIndexBuffer !== indexBuffer) {
  4573. this._cachedIndexBuffer = indexBuffer;
  4574. this._gl.bindBuffer(this._gl.ELEMENT_ARRAY_BUFFER, indexBuffer);
  4575. this._uintIndicesCurrentlySet = indexBuffer.is32Bits;
  4576. }
  4577. };
  4578. Engine.prototype._releaseBuffer = function (buffer) {
  4579. buffer.references--;
  4580. if (buffer.references === 0) {
  4581. this._gl.deleteBuffer(buffer);
  4582. return true;
  4583. }
  4584. return false;
  4585. };
  4586. Engine.prototype.createInstancesBuffer = function (capacity) {
  4587. var buffer = this._gl.createBuffer();
  4588. buffer.capacity = capacity;
  4589. this._gl.bindBuffer(this._gl.ARRAY_BUFFER, buffer);
  4590. this._gl.bufferData(this._gl.ARRAY_BUFFER, capacity, this._gl.DYNAMIC_DRAW);
  4591. return buffer;
  4592. };
  4593. Engine.prototype.deleteInstancesBuffer = function (buffer) {
  4594. this._gl.deleteBuffer(buffer);
  4595. };
  4596. Engine.prototype.updateAndBindInstancesBuffer = function (instancesBuffer, data, offsetLocations) {
  4597. this._gl.bindBuffer(this._gl.ARRAY_BUFFER, instancesBuffer);
  4598. this._gl.bufferSubData(this._gl.ARRAY_BUFFER, 0, data);
  4599. for (var index = 0; index < 4; index++) {
  4600. var offsetLocation = offsetLocations[index];
  4601. this._gl.enableVertexAttribArray(offsetLocation);
  4602. this._gl.vertexAttribPointer(offsetLocation, 4, this._gl.FLOAT, false, 64, index * 16);
  4603. this._caps.instancedArrays.vertexAttribDivisorANGLE(offsetLocation, 1);
  4604. }
  4605. };
  4606. Engine.prototype.unBindInstancesBuffer = function (instancesBuffer, offsetLocations) {
  4607. this._gl.bindBuffer(this._gl.ARRAY_BUFFER, instancesBuffer);
  4608. for (var index = 0; index < 4; index++) {
  4609. var offsetLocation = offsetLocations[index];
  4610. this._gl.disableVertexAttribArray(offsetLocation);
  4611. this._caps.instancedArrays.vertexAttribDivisorANGLE(offsetLocation, 0);
  4612. }
  4613. };
  4614. Engine.prototype.applyStates = function () {
  4615. this._depthCullingState.apply(this._gl);
  4616. this._alphaState.apply(this._gl);
  4617. };
  4618. Engine.prototype.draw = function (useTriangles, indexStart, indexCount, instancesCount) {
  4619. // Apply states
  4620. this.applyStates();
  4621. this._drawCalls++;
  4622. // Render
  4623. var indexFormat = this._uintIndicesCurrentlySet ? this._gl.UNSIGNED_INT : this._gl.UNSIGNED_SHORT;
  4624. if (instancesCount) {
  4625. this._caps.instancedArrays.drawElementsInstancedANGLE(useTriangles ? this._gl.TRIANGLES : this._gl.LINES, indexCount, indexFormat, indexStart * 2, instancesCount);
  4626. return;
  4627. }
  4628. this._gl.drawElements(useTriangles ? this._gl.TRIANGLES : this._gl.LINES, indexCount, indexFormat, indexStart * 2);
  4629. };
  4630. Engine.prototype.drawPointClouds = function (verticesStart, verticesCount, instancesCount) {
  4631. // Apply states
  4632. this.applyStates();
  4633. this._drawCalls++;
  4634. if (instancesCount) {
  4635. this._caps.instancedArrays.drawArraysInstancedANGLE(this._gl.POINTS, verticesStart, verticesCount, instancesCount);
  4636. return;
  4637. }
  4638. this._gl.drawArrays(this._gl.POINTS, verticesStart, verticesCount);
  4639. };
  4640. // Shaders
  4641. Engine.prototype._releaseEffect = function (effect) {
  4642. if (this._compiledEffects[effect._key]) {
  4643. delete this._compiledEffects[effect._key];
  4644. if (effect.getProgram()) {
  4645. this._gl.deleteProgram(effect.getProgram());
  4646. }
  4647. }
  4648. };
  4649. Engine.prototype.createEffect = function (baseName, attributesNames, uniformsNames, samplers, defines, fallbacks, onCompiled, onError) {
  4650. var vertex = baseName.vertexElement || baseName.vertex || baseName;
  4651. var fragment = baseName.fragmentElement || baseName.fragment || baseName;
  4652. var name = vertex + "+" + fragment + "@" + defines;
  4653. if (this._compiledEffects[name]) {
  4654. return this._compiledEffects[name];
  4655. }
  4656. var effect = new BABYLON.Effect(baseName, attributesNames, uniformsNames, samplers, this, defines, fallbacks, onCompiled, onError);
  4657. effect._key = name;
  4658. this._compiledEffects[name] = effect;
  4659. return effect;
  4660. };
  4661. Engine.prototype.createEffectForParticles = function (fragmentName, uniformsNames, samplers, defines, fallbacks, onCompiled, onError) {
  4662. if (uniformsNames === void 0) { uniformsNames = []; }
  4663. if (samplers === void 0) { samplers = []; }
  4664. if (defines === void 0) { defines = ""; }
  4665. return this.createEffect({
  4666. vertex: "particles",
  4667. fragmentElement: fragmentName
  4668. }, ["position", "color", "options"], ["view", "projection"].concat(uniformsNames), ["diffuseSampler"].concat(samplers), defines, fallbacks, onCompiled, onError);
  4669. };
  4670. Engine.prototype.createShaderProgram = function (vertexCode, fragmentCode, defines) {
  4671. var vertexShader = compileShader(this._gl, vertexCode, "vertex", defines);
  4672. var fragmentShader = compileShader(this._gl, fragmentCode, "fragment", defines);
  4673. var shaderProgram = this._gl.createProgram();
  4674. this._gl.attachShader(shaderProgram, vertexShader);
  4675. this._gl.attachShader(shaderProgram, fragmentShader);
  4676. this._gl.linkProgram(shaderProgram);
  4677. var linked = this._gl.getProgramParameter(shaderProgram, this._gl.LINK_STATUS);
  4678. if (!linked) {
  4679. var error = this._gl.getProgramInfoLog(shaderProgram);
  4680. if (error) {
  4681. throw new Error(error);
  4682. }
  4683. }
  4684. this._gl.deleteShader(vertexShader);
  4685. this._gl.deleteShader(fragmentShader);
  4686. return shaderProgram;
  4687. };
  4688. Engine.prototype.getUniforms = function (shaderProgram, uniformsNames) {
  4689. var results = [];
  4690. for (var index = 0; index < uniformsNames.length; index++) {
  4691. results.push(this._gl.getUniformLocation(shaderProgram, uniformsNames[index]));
  4692. }
  4693. return results;
  4694. };
  4695. Engine.prototype.getAttributes = function (shaderProgram, attributesNames) {
  4696. var results = [];
  4697. for (var index = 0; index < attributesNames.length; index++) {
  4698. try {
  4699. results.push(this._gl.getAttribLocation(shaderProgram, attributesNames[index]));
  4700. }
  4701. catch (e) {
  4702. results.push(-1);
  4703. }
  4704. }
  4705. return results;
  4706. };
  4707. Engine.prototype.enableEffect = function (effect) {
  4708. if (!effect || !effect.getAttributesCount() || this._currentEffect === effect) {
  4709. if (effect && effect.onBind) {
  4710. effect.onBind(effect);
  4711. }
  4712. return;
  4713. }
  4714. this._vertexAttribArrays = this._vertexAttribArrays || [];
  4715. // Use program
  4716. this._gl.useProgram(effect.getProgram());
  4717. for (var i in this._vertexAttribArrays) {
  4718. if (i > this._gl.VERTEX_ATTRIB_ARRAY_ENABLED || !this._vertexAttribArrays[i]) {
  4719. continue;
  4720. }
  4721. this._vertexAttribArrays[i] = false;
  4722. this._gl.disableVertexAttribArray(i);
  4723. }
  4724. var attributesCount = effect.getAttributesCount();
  4725. for (var index = 0; index < attributesCount; index++) {
  4726. // Attributes
  4727. var order = effect.getAttributeLocation(index);
  4728. if (order >= 0) {
  4729. this._vertexAttribArrays[order] = true;
  4730. this._gl.enableVertexAttribArray(order);
  4731. }
  4732. }
  4733. this._currentEffect = effect;
  4734. if (effect.onBind) {
  4735. effect.onBind(effect);
  4736. }
  4737. };
  4738. Engine.prototype.setArray = function (uniform, array) {
  4739. if (!uniform)
  4740. return;
  4741. this._gl.uniform1fv(uniform, array);
  4742. };
  4743. Engine.prototype.setArray2 = function (uniform, array) {
  4744. if (!uniform || array.length % 2 !== 0)
  4745. return;
  4746. this._gl.uniform2fv(uniform, array);
  4747. };
  4748. Engine.prototype.setArray3 = function (uniform, array) {
  4749. if (!uniform || array.length % 3 !== 0)
  4750. return;
  4751. this._gl.uniform3fv(uniform, array);
  4752. };
  4753. Engine.prototype.setArray4 = function (uniform, array) {
  4754. if (!uniform || array.length % 4 !== 0)
  4755. return;
  4756. this._gl.uniform4fv(uniform, array);
  4757. };
  4758. Engine.prototype.setMatrices = function (uniform, matrices) {
  4759. if (!uniform)
  4760. return;
  4761. this._gl.uniformMatrix4fv(uniform, false, matrices);
  4762. };
  4763. Engine.prototype.setMatrix = function (uniform, matrix) {
  4764. if (!uniform)
  4765. return;
  4766. this._gl.uniformMatrix4fv(uniform, false, matrix.toArray());
  4767. };
  4768. Engine.prototype.setFloat = function (uniform, value) {
  4769. if (!uniform)
  4770. return;
  4771. this._gl.uniform1f(uniform, value);
  4772. };
  4773. Engine.prototype.setFloat2 = function (uniform, x, y) {
  4774. if (!uniform)
  4775. return;
  4776. this._gl.uniform2f(uniform, x, y);
  4777. };
  4778. Engine.prototype.setFloat3 = function (uniform, x, y, z) {
  4779. if (!uniform)
  4780. return;
  4781. this._gl.uniform3f(uniform, x, y, z);
  4782. };
  4783. Engine.prototype.setBool = function (uniform, bool) {
  4784. if (!uniform)
  4785. return;
  4786. this._gl.uniform1i(uniform, bool);
  4787. };
  4788. Engine.prototype.setFloat4 = function (uniform, x, y, z, w) {
  4789. if (!uniform)
  4790. return;
  4791. this._gl.uniform4f(uniform, x, y, z, w);
  4792. };
  4793. Engine.prototype.setColor3 = function (uniform, color3) {
  4794. if (!uniform)
  4795. return;
  4796. this._gl.uniform3f(uniform, color3.r, color3.g, color3.b);
  4797. };
  4798. Engine.prototype.setColor4 = function (uniform, color3, alpha) {
  4799. if (!uniform)
  4800. return;
  4801. this._gl.uniform4f(uniform, color3.r, color3.g, color3.b, alpha);
  4802. };
  4803. // States
  4804. Engine.prototype.setState = function (culling, zOffset, force) {
  4805. if (zOffset === void 0) { zOffset = 0; }
  4806. // Culling
  4807. if (this._depthCullingState.cull !== culling || force) {
  4808. if (culling) {
  4809. this._depthCullingState.cullFace = this.cullBackFaces ? this._gl.BACK : this._gl.FRONT;
  4810. this._depthCullingState.cull = true;
  4811. }
  4812. else {
  4813. this._depthCullingState.cull = false;
  4814. }
  4815. }
  4816. // Z offset
  4817. this._depthCullingState.zOffset = zOffset;
  4818. };
  4819. Engine.prototype.setDepthBuffer = function (enable) {
  4820. this._depthCullingState.depthTest = enable;
  4821. };
  4822. Engine.prototype.getDepthWrite = function () {
  4823. return this._depthCullingState.depthMask;
  4824. };
  4825. Engine.prototype.setDepthWrite = function (enable) {
  4826. this._depthCullingState.depthMask = enable;
  4827. };
  4828. Engine.prototype.setColorWrite = function (enable) {
  4829. this._gl.colorMask(enable, enable, enable, enable);
  4830. };
  4831. Engine.prototype.setAlphaMode = function (mode) {
  4832. switch (mode) {
  4833. case Engine.ALPHA_DISABLE:
  4834. this.setDepthWrite(true);
  4835. this._alphaState.alphaBlend = false;
  4836. break;
  4837. case Engine.ALPHA_COMBINE:
  4838. this.setDepthWrite(false);
  4839. this._alphaState.setAlphaBlendFunctionParameters(this._gl.SRC_ALPHA, this._gl.ONE_MINUS_SRC_ALPHA, this._gl.ONE, this._gl.ONE);
  4840. this._alphaState.alphaBlend = true;
  4841. break;
  4842. case Engine.ALPHA_ADD:
  4843. this.setDepthWrite(false);
  4844. this._alphaState.setAlphaBlendFunctionParameters(this._gl.ONE, this._gl.ONE, this._gl.ZERO, this._gl.ONE);
  4845. this._alphaState.alphaBlend = true;
  4846. break;
  4847. }
  4848. this._alphaMode = mode;
  4849. };
  4850. Engine.prototype.getAlphaMode = function () {
  4851. return this._alphaMode;
  4852. };
  4853. Engine.prototype.setAlphaTesting = function (enable) {
  4854. this._alphaTest = enable;
  4855. };
  4856. Engine.prototype.getAlphaTesting = function () {
  4857. return this._alphaTest;
  4858. };
  4859. // Textures
  4860. Engine.prototype.wipeCaches = function () {
  4861. this._activeTexturesCache = [];
  4862. this._currentEffect = null;
  4863. this._depthCullingState.reset();
  4864. this._alphaState.reset();
  4865. this._cachedVertexBuffers = null;
  4866. this._cachedIndexBuffer = null;
  4867. this._cachedEffectForVertexBuffers = null;
  4868. };
  4869. Engine.prototype.setSamplingMode = function (texture, samplingMode) {
  4870. var gl = this._gl;
  4871. gl.bindTexture(gl.TEXTURE_2D, texture);
  4872. var magFilter = gl.NEAREST;
  4873. var minFilter = gl.NEAREST;
  4874. if (samplingMode === BABYLON.Texture.BILINEAR_SAMPLINGMODE) {
  4875. magFilter = gl.LINEAR;
  4876. minFilter = gl.LINEAR;
  4877. }
  4878. else if (samplingMode === BABYLON.Texture.TRILINEAR_SAMPLINGMODE) {
  4879. magFilter = gl.LINEAR;
  4880. minFilter = gl.LINEAR_MIPMAP_LINEAR;
  4881. }
  4882. gl.texParameteri(gl.TEXTURE_2D, gl.TEXTURE_MAG_FILTER, magFilter);
  4883. gl.texParameteri(gl.TEXTURE_2D, gl.TEXTURE_MIN_FILTER, minFilter);
  4884. gl.bindTexture(gl.TEXTURE_2D, null);
  4885. texture.samplingMode = samplingMode;
  4886. };
  4887. Engine.prototype.createTexture = function (url, noMipmap, invertY, scene, samplingMode, onLoad, onError, buffer) {
  4888. var _this = this;
  4889. if (samplingMode === void 0) { samplingMode = BABYLON.Texture.TRILINEAR_SAMPLINGMODE; }
  4890. if (onLoad === void 0) { onLoad = null; }
  4891. if (onError === void 0) { onError = null; }
  4892. if (buffer === void 0) { buffer = null; }
  4893. var texture = this._gl.createTexture();
  4894. var extension;
  4895. var fromData = false;
  4896. if (url.substr(0, 5) === "data:") {
  4897. fromData = true;
  4898. }
  4899. if (!fromData)
  4900. extension = url.substr(url.length - 4, 4).toLowerCase();
  4901. else {
  4902. var oldUrl = url;
  4903. fromData = oldUrl.split(':');
  4904. url = oldUrl;
  4905. extension = fromData[1].substr(fromData[1].length - 4, 4).toLowerCase();
  4906. }
  4907. var isDDS = this.getCaps().s3tc && (extension === ".dds");
  4908. var isTGA = (extension === ".tga");
  4909. scene._addPendingData(texture);
  4910. texture.url = url;
  4911. texture.noMipmap = noMipmap;
  4912. texture.references = 1;
  4913. this._loadedTexturesCache.push(texture);
  4914. var onerror = function () {
  4915. scene._removePendingData(texture);
  4916. if (onError) {
  4917. onError();
  4918. }
  4919. };
  4920. if (isTGA) {
  4921. var callback = function (arrayBuffer) {
  4922. var data = new Uint8Array(arrayBuffer);
  4923. var header = BABYLON.Internals.TGATools.GetTGAHeader(data);
  4924. prepareWebGLTexture(texture, _this._gl, scene, header.width, header.height, invertY, noMipmap, false, function () {
  4925. BABYLON.Internals.TGATools.UploadContent(_this._gl, data);
  4926. if (onLoad) {
  4927. onLoad();
  4928. }
  4929. }, samplingMode);
  4930. };
  4931. if (!(fromData instanceof Array))
  4932. BABYLON.Tools.LoadFile(url, function (arrayBuffer) {
  4933. callback(arrayBuffer);
  4934. }, onerror, scene.database, true);
  4935. else
  4936. callback(buffer);
  4937. }
  4938. else if (isDDS) {
  4939. callback = function (data) {
  4940. var info = BABYLON.Internals.DDSTools.GetDDSInfo(data);
  4941. var loadMipmap = (info.isRGB || info.isLuminance || info.mipmapCount > 1) && !noMipmap && ((info.width >> (info.mipmapCount - 1)) === 1);
  4942. prepareWebGLTexture(texture, _this._gl, scene, info.width, info.height, invertY, !loadMipmap, info.isFourCC, function () {
  4943. BABYLON.Internals.DDSTools.UploadDDSLevels(_this._gl, _this.getCaps().s3tc, data, info, loadMipmap, 1);
  4944. if (onLoad) {
  4945. onLoad();
  4946. }
  4947. }, samplingMode);
  4948. };
  4949. if (!(fromData instanceof Array))
  4950. BABYLON.Tools.LoadFile(url, function (data) {
  4951. callback(data);
  4952. }, onerror, scene.database, true);
  4953. else
  4954. callback(buffer);
  4955. }
  4956. else {
  4957. var onload = function (img) {
  4958. prepareWebGLTexture(texture, _this._gl, scene, img.width, img.height, invertY, noMipmap, false, function (potWidth, potHeight) {
  4959. var isPot = (img.width === potWidth && img.height === potHeight);
  4960. if (!isPot) {
  4961. _this._prepareWorkingCanvas();
  4962. _this._workingCanvas.width = potWidth;
  4963. _this._workingCanvas.height = potHeight;
  4964. if (samplingMode === BABYLON.Texture.NEAREST_SAMPLINGMODE) {
  4965. _this._workingContext.imageSmoothingEnabled = false;
  4966. _this._workingContext.mozImageSmoothingEnabled = false;
  4967. _this._workingContext.oImageSmoothingEnabled = false;
  4968. _this._workingContext.webkitImageSmoothingEnabled = false;
  4969. _this._workingContext.msImageSmoothingEnabled = false;
  4970. }
  4971. _this._workingContext.drawImage(img, 0, 0, img.width, img.height, 0, 0, potWidth, potHeight);
  4972. if (samplingMode === BABYLON.Texture.NEAREST_SAMPLINGMODE) {
  4973. _this._workingContext.imageSmoothingEnabled = true;
  4974. _this._workingContext.mozImageSmoothingEnabled = true;
  4975. _this._workingContext.oImageSmoothingEnabled = true;
  4976. _this._workingContext.webkitImageSmoothingEnabled = true;
  4977. _this._workingContext.msImageSmoothingEnabled = true;
  4978. }
  4979. }
  4980. _this._gl.texImage2D(_this._gl.TEXTURE_2D, 0, _this._gl.RGBA, _this._gl.RGBA, _this._gl.UNSIGNED_BYTE, isPot ? img : _this._workingCanvas);
  4981. if (onLoad) {
  4982. onLoad();
  4983. }
  4984. }, samplingMode);
  4985. };
  4986. if (!(fromData instanceof Array))
  4987. BABYLON.Tools.LoadImage(url, onload, onerror, scene.database);
  4988. else
  4989. BABYLON.Tools.LoadImage(buffer, onload, onerror, scene.database);
  4990. }
  4991. return texture;
  4992. };
  4993. Engine.prototype.createRawTexture = function (data, width, height, format, generateMipMaps, invertY, samplingMode) {
  4994. var texture = this._gl.createTexture();
  4995. this._gl.bindTexture(this._gl.TEXTURE_2D, texture);
  4996. this._gl.pixelStorei(this._gl.UNPACK_FLIP_Y_WEBGL, invertY === undefined ? 1 : (invertY ? 1 : 0));
  4997. // Format
  4998. var internalFormat = this._gl.RGBA;
  4999. switch (format) {
  5000. case Engine.TEXTUREFORMAT_ALPHA:
  5001. internalFormat = this._gl.ALPHA;
  5002. break;
  5003. case Engine.TEXTUREFORMAT_LUMINANCE:
  5004. internalFormat = this._gl.LUMINANCE;
  5005. break;
  5006. case Engine.TEXTUREFORMAT_LUMINANCE_ALPHA:
  5007. internalFormat = this._gl.LUMINANCE_ALPHA;
  5008. break;
  5009. case Engine.TEXTUREFORMAT_RGB:
  5010. internalFormat = this._gl.RGB;
  5011. break;
  5012. case Engine.TEXTUREFORMAT_RGBA:
  5013. internalFormat = this._gl.RGBA;
  5014. break;
  5015. }
  5016. this._gl.texImage2D(this._gl.TEXTURE_2D, 0, internalFormat, width, height, 0, internalFormat, this._gl.UNSIGNED_BYTE, data);
  5017. if (generateMipMaps) {
  5018. this._gl.generateMipmap(this._gl.TEXTURE_2D);
  5019. }
  5020. // Filters
  5021. var filters = getSamplingParameters(samplingMode, generateMipMaps, this._gl);
  5022. this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_MAG_FILTER, filters.mag);
  5023. this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_MIN_FILTER, filters.min);
  5024. this._gl.bindTexture(this._gl.TEXTURE_2D, null);
  5025. this._activeTexturesCache = [];
  5026. texture._baseWidth = width;
  5027. texture._baseHeight = height;
  5028. texture._width = width;
  5029. texture._height = height;
  5030. texture.isReady = true;
  5031. texture.references = 1;
  5032. texture.samplingMode = samplingMode;
  5033. this._loadedTexturesCache.push(texture);
  5034. return texture;
  5035. };
  5036. Engine.prototype.createDynamicTexture = function (width, height, generateMipMaps, samplingMode) {
  5037. var texture = this._gl.createTexture();
  5038. width = BABYLON.Tools.GetExponantOfTwo(width, this._caps.maxTextureSize);
  5039. height = BABYLON.Tools.GetExponantOfTwo(height, this._caps.maxTextureSize);
  5040. this._activeTexturesCache = [];
  5041. texture._baseWidth = width;
  5042. texture._baseHeight = height;
  5043. texture._width = width;
  5044. texture._height = height;
  5045. texture.isReady = false;
  5046. texture.generateMipMaps = generateMipMaps;
  5047. texture.references = 1;
  5048. texture.samplingMode = samplingMode;
  5049. this.updateTextureSamplingMode(samplingMode, texture);
  5050. this._loadedTexturesCache.push(texture);
  5051. return texture;
  5052. };
  5053. Engine.prototype.updateTextureSamplingMode = function (samplingMode, texture) {
  5054. var filters = getSamplingParameters(samplingMode, texture.generateMipMaps, this._gl);
  5055. this._gl.bindTexture(this._gl.TEXTURE_2D, texture);
  5056. this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_MAG_FILTER, filters.mag);
  5057. this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_MIN_FILTER, filters.min);
  5058. this._gl.bindTexture(this._gl.TEXTURE_2D, null);
  5059. };
  5060. Engine.prototype.updateDynamicTexture = function (texture, canvas, invertY) {
  5061. this._gl.bindTexture(this._gl.TEXTURE_2D, texture);
  5062. this._gl.pixelStorei(this._gl.UNPACK_FLIP_Y_WEBGL, invertY ? 1 : 0);
  5063. this._gl.texImage2D(this._gl.TEXTURE_2D, 0, this._gl.RGBA, this._gl.RGBA, this._gl.UNSIGNED_BYTE, canvas);
  5064. if (texture.generateMipMaps) {
  5065. this._gl.generateMipmap(this._gl.TEXTURE_2D);
  5066. }
  5067. this._gl.bindTexture(this._gl.TEXTURE_2D, null);
  5068. this._activeTexturesCache = [];
  5069. texture.isReady = true;
  5070. };
  5071. Engine.prototype.updateVideoTexture = function (texture, video, invertY) {
  5072. this._gl.bindTexture(this._gl.TEXTURE_2D, texture);
  5073. this._gl.pixelStorei(this._gl.UNPACK_FLIP_Y_WEBGL, invertY ? 0 : 1); // Video are upside down by default
  5074. // Scale the video if it is a NPOT using the current working canvas
  5075. if (video.videoWidth !== texture._width || video.videoHeight !== texture._height) {
  5076. if (!texture._workingCanvas) {
  5077. texture._workingCanvas = document.createElement("canvas");
  5078. texture._workingContext = texture._workingCanvas.getContext("2d");
  5079. texture._workingCanvas.width = texture._width;
  5080. texture._workingCanvas.height = texture._height;
  5081. }
  5082. texture._workingContext.drawImage(video, 0, 0, video.videoWidth, video.videoHeight, 0, 0, texture._width, texture._height);
  5083. this._gl.texImage2D(this._gl.TEXTURE_2D, 0, this._gl.RGBA, this._gl.RGBA, this._gl.UNSIGNED_BYTE, texture._workingCanvas);
  5084. }
  5085. else {
  5086. this._gl.texImage2D(this._gl.TEXTURE_2D, 0, this._gl.RGBA, this._gl.RGBA, this._gl.UNSIGNED_BYTE, video);
  5087. }
  5088. if (texture.generateMipMaps) {
  5089. this._gl.generateMipmap(this._gl.TEXTURE_2D);
  5090. }
  5091. this._gl.bindTexture(this._gl.TEXTURE_2D, null);
  5092. this._activeTexturesCache = [];
  5093. texture.isReady = true;
  5094. };
  5095. Engine.prototype.createRenderTargetTexture = function (size, options) {
  5096. // old version had a "generateMipMaps" arg instead of options.
  5097. // if options.generateMipMaps is undefined, consider that options itself if the generateMipmaps value
  5098. // in the same way, generateDepthBuffer is defaulted to true
  5099. var generateMipMaps = false;
  5100. var generateDepthBuffer = true;
  5101. var type = Engine.TEXTURETYPE_UNSIGNED_INT;
  5102. var samplingMode = BABYLON.Texture.TRILINEAR_SAMPLINGMODE;
  5103. if (options !== undefined) {
  5104. generateMipMaps = options.generateMipMaps === undefined ? options : options.generateMipmaps;
  5105. generateDepthBuffer = options.generateDepthBuffer === undefined ? true : options.generateDepthBuffer;
  5106. type = options.type === undefined ? type : options.type;
  5107. if (options.samplingMode !== undefined) {
  5108. samplingMode = options.samplingMode;
  5109. }
  5110. if (type === Engine.TEXTURETYPE_FLOAT) {
  5111. // if floating point (gl.FLOAT) then force to NEAREST_SAMPLINGMODE
  5112. samplingMode = BABYLON.Texture.NEAREST_SAMPLINGMODE;
  5113. }
  5114. }
  5115. var gl = this._gl;
  5116. var texture = gl.createTexture();
  5117. gl.bindTexture(gl.TEXTURE_2D, texture);
  5118. var width = size.width || size;
  5119. var height = size.height || size;
  5120. var filters = getSamplingParameters(samplingMode, generateMipMaps, gl);
  5121. if (type === Engine.TEXTURETYPE_FLOAT && !this._caps.textureFloat) {
  5122. type = Engine.TEXTURETYPE_UNSIGNED_INT;
  5123. BABYLON.Tools.Warn("Float textures are not supported. Render target forced to TEXTURETYPE_UNSIGNED_BYTE type");
  5124. }
  5125. gl.texParameteri(gl.TEXTURE_2D, gl.TEXTURE_MAG_FILTER, filters.mag);
  5126. gl.texParameteri(gl.TEXTURE_2D, gl.TEXTURE_MIN_FILTER, filters.min);
  5127. gl.texParameteri(gl.TEXTURE_2D, gl.TEXTURE_WRAP_S, gl.CLAMP_TO_EDGE);
  5128. gl.texParameteri(gl.TEXTURE_2D, gl.TEXTURE_WRAP_T, gl.CLAMP_TO_EDGE);
  5129. gl.texImage2D(gl.TEXTURE_2D, 0, gl.RGBA, width, height, 0, gl.RGBA, getWebGLTextureType(gl, type), null);
  5130. var depthBuffer;
  5131. // Create the depth buffer
  5132. if (generateDepthBuffer) {
  5133. depthBuffer = gl.createRenderbuffer();
  5134. gl.bindRenderbuffer(gl.RENDERBUFFER, depthBuffer);
  5135. gl.renderbufferStorage(gl.RENDERBUFFER, gl.DEPTH_COMPONENT16, width, height);
  5136. }
  5137. // Create the framebuffer
  5138. var framebuffer = gl.createFramebuffer();
  5139. gl.bindFramebuffer(gl.FRAMEBUFFER, framebuffer);
  5140. gl.framebufferTexture2D(gl.FRAMEBUFFER, gl.COLOR_ATTACHMENT0, gl.TEXTURE_2D, texture, 0);
  5141. if (generateDepthBuffer) {
  5142. gl.framebufferRenderbuffer(gl.FRAMEBUFFER, gl.DEPTH_ATTACHMENT, gl.RENDERBUFFER, depthBuffer);
  5143. }
  5144. // Unbind
  5145. gl.bindTexture(gl.TEXTURE_2D, null);
  5146. gl.bindRenderbuffer(gl.RENDERBUFFER, null);
  5147. gl.bindFramebuffer(gl.FRAMEBUFFER, null);
  5148. texture._framebuffer = framebuffer;
  5149. if (generateDepthBuffer) {
  5150. texture._depthBuffer = depthBuffer;
  5151. }
  5152. texture._width = width;
  5153. texture._height = height;
  5154. texture.isReady = true;
  5155. texture.generateMipMaps = generateMipMaps;
  5156. texture.references = 1;
  5157. texture.samplingMode = samplingMode;
  5158. this._activeTexturesCache = [];
  5159. this._loadedTexturesCache.push(texture);
  5160. return texture;
  5161. };
  5162. Engine.prototype.createCubeTexture = function (rootUrl, scene, extensions, noMipmap) {
  5163. var _this = this;
  5164. var gl = this._gl;
  5165. var texture = gl.createTexture();
  5166. texture.isCube = true;
  5167. texture.url = rootUrl;
  5168. texture.references = 1;
  5169. this._loadedTexturesCache.push(texture);
  5170. var extension = rootUrl.substr(rootUrl.length - 4, 4).toLowerCase();
  5171. var isDDS = this.getCaps().s3tc && (extension === ".dds");
  5172. if (isDDS) {
  5173. BABYLON.Tools.LoadFile(rootUrl, function (data) {
  5174. var info = BABYLON.Internals.DDSTools.GetDDSInfo(data);
  5175. var loadMipmap = (info.isRGB || info.isLuminance || info.mipmapCount > 1) && !noMipmap;
  5176. gl.bindTexture(gl.TEXTURE_CUBE_MAP, texture);
  5177. gl.pixelStorei(gl.UNPACK_FLIP_Y_WEBGL, 1);
  5178. BABYLON.Internals.DDSTools.UploadDDSLevels(_this._gl, _this.getCaps().s3tc, data, info, loadMipmap, 6);
  5179. if (!noMipmap && !info.isFourCC && info.mipmapCount === 1) {
  5180. gl.generateMipmap(gl.TEXTURE_CUBE_MAP);
  5181. }
  5182. gl.texParameteri(gl.TEXTURE_CUBE_MAP, gl.TEXTURE_MAG_FILTER, gl.LINEAR);
  5183. gl.texParameteri(gl.TEXTURE_CUBE_MAP, gl.TEXTURE_MIN_FILTER, loadMipmap ? gl.LINEAR_MIPMAP_LINEAR : gl.LINEAR);
  5184. gl.texParameteri(gl.TEXTURE_CUBE_MAP, gl.TEXTURE_WRAP_S, gl.CLAMP_TO_EDGE);
  5185. gl.texParameteri(gl.TEXTURE_CUBE_MAP, gl.TEXTURE_WRAP_T, gl.CLAMP_TO_EDGE);
  5186. gl.bindTexture(gl.TEXTURE_CUBE_MAP, null);
  5187. _this._activeTexturesCache = [];
  5188. texture._width = info.width;
  5189. texture._height = info.height;
  5190. texture.isReady = true;
  5191. }, null, null, true);
  5192. }
  5193. else {
  5194. cascadeLoad(rootUrl, scene, function (imgs) {
  5195. var width = BABYLON.Tools.GetExponantOfTwo(imgs[0].width, _this._caps.maxCubemapTextureSize);
  5196. var height = width;
  5197. _this._prepareWorkingCanvas();
  5198. _this._workingCanvas.width = width;
  5199. _this._workingCanvas.height = height;
  5200. var faces = [
  5201. gl.TEXTURE_CUBE_MAP_POSITIVE_X,
  5202. gl.TEXTURE_CUBE_MAP_POSITIVE_Y,
  5203. gl.TEXTURE_CUBE_MAP_POSITIVE_Z,
  5204. gl.TEXTURE_CUBE_MAP_NEGATIVE_X,
  5205. gl.TEXTURE_CUBE_MAP_NEGATIVE_Y,
  5206. gl.TEXTURE_CUBE_MAP_NEGATIVE_Z
  5207. ];
  5208. gl.bindTexture(gl.TEXTURE_CUBE_MAP, texture);
  5209. gl.pixelStorei(gl.UNPACK_FLIP_Y_WEBGL, 0);
  5210. for (var index = 0; index < faces.length; index++) {
  5211. _this._workingContext.drawImage(imgs[index], 0, 0, imgs[index].width, imgs[index].height, 0, 0, width, height);
  5212. gl.texImage2D(faces[index], 0, gl.RGBA, gl.RGBA, gl.UNSIGNED_BYTE, _this._workingCanvas);
  5213. }
  5214. if (!noMipmap) {
  5215. gl.generateMipmap(gl.TEXTURE_CUBE_MAP);
  5216. }
  5217. gl.texParameteri(gl.TEXTURE_CUBE_MAP, gl.TEXTURE_MAG_FILTER, gl.LINEAR);
  5218. gl.texParameteri(gl.TEXTURE_CUBE_MAP, gl.TEXTURE_MIN_FILTER, noMipmap ? gl.LINEAR : gl.LINEAR_MIPMAP_LINEAR);
  5219. gl.texParameteri(gl.TEXTURE_CUBE_MAP, gl.TEXTURE_WRAP_S, gl.CLAMP_TO_EDGE);
  5220. gl.texParameteri(gl.TEXTURE_CUBE_MAP, gl.TEXTURE_WRAP_T, gl.CLAMP_TO_EDGE);
  5221. gl.bindTexture(gl.TEXTURE_CUBE_MAP, null);
  5222. _this._activeTexturesCache = [];
  5223. texture._width = width;
  5224. texture._height = height;
  5225. texture.isReady = true;
  5226. }, extensions);
  5227. }
  5228. return texture;
  5229. };
  5230. Engine.prototype._releaseTexture = function (texture) {
  5231. var gl = this._gl;
  5232. if (texture._framebuffer) {
  5233. gl.deleteFramebuffer(texture._framebuffer);
  5234. }
  5235. if (texture._depthBuffer) {
  5236. gl.deleteRenderbuffer(texture._depthBuffer);
  5237. }
  5238. gl.deleteTexture(texture);
  5239. for (var channel = 0; channel < this._caps.maxTexturesImageUnits; channel++) {
  5240. this._gl.activeTexture(this._gl["TEXTURE" + channel]);
  5241. this._gl.bindTexture(this._gl.TEXTURE_2D, null);
  5242. this._gl.bindTexture(this._gl.TEXTURE_CUBE_MAP, null);
  5243. this._activeTexturesCache[channel] = null;
  5244. }
  5245. var index = this._loadedTexturesCache.indexOf(texture);
  5246. if (index !== -1) {
  5247. this._loadedTexturesCache.splice(index, 1);
  5248. }
  5249. };
  5250. Engine.prototype.bindSamplers = function (effect) {
  5251. this._gl.useProgram(effect.getProgram());
  5252. var samplers = effect.getSamplers();
  5253. for (var index = 0; index < samplers.length; index++) {
  5254. var uniform = effect.getUniform(samplers[index]);
  5255. this._gl.uniform1i(uniform, index);
  5256. }
  5257. this._currentEffect = null;
  5258. };
  5259. Engine.prototype._bindTexture = function (channel, texture) {
  5260. this._gl.activeTexture(this._gl["TEXTURE" + channel]);
  5261. this._gl.bindTexture(this._gl.TEXTURE_2D, texture);
  5262. this._activeTexturesCache[channel] = null;
  5263. };
  5264. Engine.prototype.setTextureFromPostProcess = function (channel, postProcess) {
  5265. this._bindTexture(channel, postProcess._textures.data[postProcess._currentRenderTextureInd]);
  5266. };
  5267. Engine.prototype.setTexture = function (channel, texture) {
  5268. if (channel < 0) {
  5269. return;
  5270. }
  5271. // Not ready?
  5272. if (!texture || !texture.isReady()) {
  5273. if (this._activeTexturesCache[channel] != null) {
  5274. this._gl.activeTexture(this._gl["TEXTURE" + channel]);
  5275. this._gl.bindTexture(this._gl.TEXTURE_2D, null);
  5276. this._gl.bindTexture(this._gl.TEXTURE_CUBE_MAP, null);
  5277. this._activeTexturesCache[channel] = null;
  5278. }
  5279. return;
  5280. }
  5281. // Video
  5282. if (texture instanceof BABYLON.VideoTexture) {
  5283. if (texture.update()) {
  5284. this._activeTexturesCache[channel] = null;
  5285. }
  5286. }
  5287. else if (texture.delayLoadState === Engine.DELAYLOADSTATE_NOTLOADED) {
  5288. texture.delayLoad();
  5289. return;
  5290. }
  5291. if (this._activeTexturesCache[channel] === texture) {
  5292. return;
  5293. }
  5294. this._activeTexturesCache[channel] = texture;
  5295. var internalTexture = texture.getInternalTexture();
  5296. this._gl.activeTexture(this._gl["TEXTURE" + channel]);
  5297. if (internalTexture.isCube) {
  5298. this._gl.bindTexture(this._gl.TEXTURE_CUBE_MAP, internalTexture);
  5299. if (internalTexture._cachedCoordinatesMode !== texture.coordinatesMode) {
  5300. internalTexture._cachedCoordinatesMode = texture.coordinatesMode;
  5301. // CUBIC_MODE and SKYBOX_MODE both require CLAMP_TO_EDGE. All other modes use REPEAT.
  5302. var textureWrapMode = (texture.coordinatesMode !== BABYLON.Texture.CUBIC_MODE && texture.coordinatesMode !== BABYLON.Texture.SKYBOX_MODE) ? this._gl.REPEAT : this._gl.CLAMP_TO_EDGE;
  5303. this._gl.texParameteri(this._gl.TEXTURE_CUBE_MAP, this._gl.TEXTURE_WRAP_S, textureWrapMode);
  5304. this._gl.texParameteri(this._gl.TEXTURE_CUBE_MAP, this._gl.TEXTURE_WRAP_T, textureWrapMode);
  5305. }
  5306. this._setAnisotropicLevel(this._gl.TEXTURE_CUBE_MAP, texture);
  5307. }
  5308. else {
  5309. this._gl.bindTexture(this._gl.TEXTURE_2D, internalTexture);
  5310. if (internalTexture._cachedWrapU !== texture.wrapU) {
  5311. internalTexture._cachedWrapU = texture.wrapU;
  5312. switch (texture.wrapU) {
  5313. case BABYLON.Texture.WRAP_ADDRESSMODE:
  5314. this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_WRAP_S, this._gl.REPEAT);
  5315. break;
  5316. case BABYLON.Texture.CLAMP_ADDRESSMODE:
  5317. this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_WRAP_S, this._gl.CLAMP_TO_EDGE);
  5318. break;
  5319. case BABYLON.Texture.MIRROR_ADDRESSMODE:
  5320. this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_WRAP_S, this._gl.MIRRORED_REPEAT);
  5321. break;
  5322. }
  5323. }
  5324. if (internalTexture._cachedWrapV !== texture.wrapV) {
  5325. internalTexture._cachedWrapV = texture.wrapV;
  5326. switch (texture.wrapV) {
  5327. case BABYLON.Texture.WRAP_ADDRESSMODE:
  5328. this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_WRAP_T, this._gl.REPEAT);
  5329. break;
  5330. case BABYLON.Texture.CLAMP_ADDRESSMODE:
  5331. this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_WRAP_T, this._gl.CLAMP_TO_EDGE);
  5332. break;
  5333. case BABYLON.Texture.MIRROR_ADDRESSMODE:
  5334. this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_WRAP_T, this._gl.MIRRORED_REPEAT);
  5335. break;
  5336. }
  5337. }
  5338. this._setAnisotropicLevel(this._gl.TEXTURE_2D, texture);
  5339. }
  5340. };
  5341. Engine.prototype._setAnisotropicLevel = function (key, texture) {
  5342. var anisotropicFilterExtension = this._caps.textureAnisotropicFilterExtension;
  5343. var value = texture.anisotropicFilteringLevel;
  5344. if (texture.getInternalTexture().samplingMode === BABYLON.Texture.NEAREST_SAMPLINGMODE) {
  5345. value = 1;
  5346. }
  5347. if (anisotropicFilterExtension && texture._cachedAnisotropicFilteringLevel !== value) {
  5348. this._gl.texParameterf(key, anisotropicFilterExtension.TEXTURE_MAX_ANISOTROPY_EXT, Math.min(value, this._caps.maxAnisotropy));
  5349. texture._cachedAnisotropicFilteringLevel = value;
  5350. }
  5351. };
  5352. Engine.prototype.readPixels = function (x, y, width, height) {
  5353. var data = new Uint8Array(height * width * 4);
  5354. this._gl.readPixels(0, 0, width, height, this._gl.RGBA, this._gl.UNSIGNED_BYTE, data);
  5355. return data;
  5356. };
  5357. // Dispose
  5358. Engine.prototype.dispose = function () {
  5359. this.hideLoadingUI();
  5360. this.stopRenderLoop();
  5361. while (this.scenes.length) {
  5362. this.scenes[0].dispose();
  5363. }
  5364. // Release audio engine
  5365. Engine.audioEngine.dispose();
  5366. for (var name in this._compiledEffects) {
  5367. this._gl.deleteProgram(this._compiledEffects[name]._program);
  5368. }
  5369. for (var i in this._vertexAttribArrays) {
  5370. if (i > this._gl.VERTEX_ATTRIB_ARRAY_ENABLED || !this._vertexAttribArrays[i]) {
  5371. continue;
  5372. }
  5373. this._gl.disableVertexAttribArray(i);
  5374. }
  5375. // Events
  5376. window.removeEventListener("blur", this._onBlur);
  5377. window.removeEventListener("focus", this._onFocus);
  5378. document.removeEventListener("fullscreenchange", this._onFullscreenChange);
  5379. document.removeEventListener("mozfullscreenchange", this._onFullscreenChange);
  5380. document.removeEventListener("webkitfullscreenchange", this._onFullscreenChange);
  5381. document.removeEventListener("msfullscreenchange", this._onFullscreenChange);
  5382. document.removeEventListener("pointerlockchange", this._onPointerLockChange);
  5383. document.removeEventListener("mspointerlockchange", this._onPointerLockChange);
  5384. document.removeEventListener("mozpointerlockchange", this._onPointerLockChange);
  5385. document.removeEventListener("webkitpointerlockchange", this._onPointerLockChange);
  5386. };
  5387. // Loading screen
  5388. Engine.prototype.displayLoadingUI = function () {
  5389. var _this = this;
  5390. this._loadingDiv = document.createElement("div");
  5391. this._loadingDiv.style.opacity = "0";
  5392. this._loadingDiv.style.transition = "opacity 1.5s ease";
  5393. // Loading text
  5394. this._loadingTextDiv = document.createElement("div");
  5395. this._loadingTextDiv.style.position = "absolute";
  5396. this._loadingTextDiv.style.left = "0";
  5397. this._loadingTextDiv.style.top = "50%";
  5398. this._loadingTextDiv.style.marginTop = "80px";
  5399. this._loadingTextDiv.style.width = "100%";
  5400. this._loadingTextDiv.style.height = "20px";
  5401. this._loadingTextDiv.style.fontFamily = "Arial";
  5402. this._loadingTextDiv.style.fontSize = "14px";
  5403. this._loadingTextDiv.style.color = "white";
  5404. this._loadingTextDiv.style.textAlign = "center";
  5405. this._loadingTextDiv.innerHTML = "Loading";
  5406. this._loadingDiv.appendChild(this._loadingTextDiv);
  5407. // Loading img
  5408. var imgBack = new Image();
  5409. imgBack.src = "data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAGQAAABkCAYAAABw4pVUAAAAAXNSR0IArs4c6QAAAARnQU1BAACxjwv8YQUAAAAJcEhZcwAADsMAAA7DAcdvqGQAAAAYdEVYdFNvZnR3YXJlAHBhaW50Lm5ldCA0LjAuM4zml1AAAARbSURBVHhe7Z09aFNRFMc716kuLrq4FdyLq4Wi4CAoRQcR0UJBUBdRiuLSIYMo6CA4FF2sgw6CFAdFUOpSQYcWO4hD26UQCfXrIQrx/JJzw1OSWq3NPeL/B4Fy+0jg/HO+7j3vpUcI8b/Q39+/49ihfWdPHT94Yf/e3Se3bd263f8lus218TPn6vV6Ya8Wi/MzNRNmj18iusX9W1evmP1/EKNEIVG6CMbG6E3bt+fT++pHha8NoHdT72bLE8NDg7tGU64gLLndV4Wc4m8j/pS+vr4tGB/DT16v3Fyr8dvBe/jbit8BL0AES9LX1iPAz+BR/hFiLVCynj95dPzNy6fv3IZ/k4L3948Sq7FzYGBg4vLFGxitabuOFCbWNKGrMnbiUuo18KaV6tIHv6YtvL9/nOgE31jCktmrY7k6+/zhE4yP4Vf7hiNqh/BWWEl8mzDol4p22Lf7cIdvdUMEvv0Y2S9fE5S1hLzpqTsPkiep//gFGPnR3Yl7GL5p/xYFBrTwM+iXio3GqpwDGL5p/xYNIX7XG8Q6IJRgdIzf1KBBgafII7oMidhyQtVFaMA2Bt7il4huQRhaXphbcR2g4RXqBzKAGHiCCwGFVUAj/m/RTRDj29cvn10I0PZ3LghH5f4CL1EFlQmqqXK3jDDKFxmhQ3Yt6oQseUZGKmMnTpsOqc8o1F9kBOMjQlOLeqEeIyOc6JV6jYLJD/+XyIFvnzdgl9aXRQ5I2qZDK1SpospMqaoqON/wZZGDciLnMMiXRS7IF4hhqMTNTdk7CFu+LHLhR7BQqBvPDJUUQqCGvCMATHUgBmhWNgApmdOda9YpM+VwRYfuyyIXDK8hBlilNerLIheMZCKGwlUAyru6GlwOgPUbRxADdJ9FAChxXY864viyyEXqPxhc0M2TAfAbatSdRyHtXymhByEdRnE3ky+JnHAIhSA0h74kckETmHoQbSgGwJrCIRMEPSRIBCRIMAhZaYhaggQhJXUJEoRU9mofKwh+F22dLRRfEjlJM7w6KQwCoQpBOKTyJZETjmwRxKqtGV8SOSkNOGjKPQppBEgDDkFgpxdBVGkFgaYQQXRIFQSObk0P5ZFIpAZRHXsQ0r0hCluBWKkuvVbYCkQaCdL5ehBScudJP4yY+rLISdps1NBDEJKXMMmoSfggWC4ZQRR17oFYXph7hSiquIKQ+hJGTX1J5MYSPD/GVdNzsgLBwZVCVyAQAkF0ohiI/c1fS6tNXq9UfEnkhudmIQolsS+J3Hh/UtNDzQLhj42VKJFInqLwFYiUU5ToA+HdfI0JevUpQUAIn+vSz2lHIuUV/dJOIHhOY/IWVWGBIHQtzs88s9zyWBuTgcBLzGOmeNnfF/QslSDgMeQW85i3DOQxuipxAkCyZ8SIm4Omp+7MMlCB59j6sKZcMoM4iIEoeI2J9AKxrFobZx0v4vYInuHFS4J1GQRCAGaLEYQXfyMML5XSQgghhBBCCCH+cXp6vgNhKpSKX/XdOAAAAABJRU5ErkJggg==";
  5410. imgBack.style.position = "absolute";
  5411. imgBack.style.left = "50%";
  5412. imgBack.style.top = "50%";
  5413. imgBack.style.marginLeft = "-50px";
  5414. imgBack.style.marginTop = "-50px";
  5415. imgBack.style.transition = "transform 1.0s ease";
  5416. imgBack.style.webkitTransition = "-webkit-transform 1.0s ease";
  5417. var deg = 360;
  5418. var onTransitionEnd = function () {
  5419. deg += 360;
  5420. imgBack.style.transform = "rotateZ(" + deg + "deg)";
  5421. imgBack.style.webkitTransform = "rotateZ(" + deg + "deg)";
  5422. };
  5423. imgBack.addEventListener("transitionend", onTransitionEnd);
  5424. imgBack.addEventListener("webkitTransitionEnd", onTransitionEnd);
  5425. this._loadingDiv.appendChild(imgBack);
  5426. // front image
  5427. var imgFront = new Image();
  5428. imgFront.src = "data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAGQAAABkCAYAAABw4pVUAAAAAXNSR0IArs4c6QAAAARnQU1BAACxjwv8YQUAAAAJcEhZcwAADsMAAA7DAcdvqGQAAAAYdEVYdFNvZnR3YXJlAHBhaW50Lm5ldCA0LjAuM4zml1AAAAYJSURBVHhe7Zy/qx1FFMff/2Av2Nvbi4WFiiAEY/OQ2IgQsbCJQoqkCAgpFLXyoZURLfwBIiIpgqZJoYQYlWelNsIrNOxDJcrzfHe+G97dnTl75u7euzv7zgcWHrlnZmfOmXPmzI/NjuM4juM4juM4juM4juM4juM4juM4juM45fPic08/uHf5/CvffH7lnT8PfrtxdHS0n3p+/fHGl5+89/prr5599iEWd8bg0rkXHoFyqehKnlxQpjYSDHTm9JMPsGrHylOPPXofvICKXMcIGtXdf/76AYbm6xyNW9e/eAtKC7rbKLXnvHHx5Sf4auc4Ek7OQkFU1Dap/vv37k/wSjblZANFiFIGzw98hhizwqBgs04mCBdQRNCHidoAEtY+lLIvtSdoGFeyql2ZH57HBH4sE7O+o/r9l+8/ZXUni68+2jsHBQQ9qNRGeP/tSxdSYQX/roUcpL4/f3vtM9TD+jTq92n1LQ7jxF1hhGPtwWL3gGccy8JuS1r8sVWBGXNVdSKMYjBGPUJjCzooiGuSpnwlnnOGP2dhHRSLNgpHp2oMKIriK8TmG4Qh/rwW8D6pps9b9im+LDDipXOqMVJrAngBfg9i98gevWKA+/nnCod3Dr5GfaHaDgidVym6HKRjGIkpqthcAVKGxNqBImbEo66kjCih8AOpNmkUmbMuUrR8kEqiU6FvHZLGAPJ71JCYSyhiBqmwFE2GoD6jLGIfDHtG6EzoU4dK21PCqIRMEF0FGRjFzGDtIkXVAdATvsqfT9CJ0JcOFdYiFIsiMlqYy1YOFpQo2OddqBtyEaq9y+efoVh5oPHoROjLKn0j3JIE5Ka8UqZRtGrMnneX6yVofOhDh94MSbznTcpqmDOt1vyQzOgaJAF4F3JBfIXesrNEGWWmjIX7UBZ6jRJbBMLg/DmJiKUGVHleIpnVNTa+jakzkAviJqLhi4MC9XQGBrZeKJZESSrKy7ik0VGFWhQBRDTHIACKQ5l9nAjy75gya4a2w+Jhs0FJdc0xX/GwUbAqFBkZi7QpJ2w16WUbjFyK9MJF3KaoEM74KhVtLrQOrsmRxkbdHEqmSC/c+EuGnIFkjW7Ih2Kr4CCMIvNG2hrrgLpCjiFloooYCjyYrzCRyvhyBthkIPuQtsZGdnbMTezyDiU71KTC5zr7aVsHbsz2tllrEkS5UHwU1tq1HbtPW4UbeB0O7xx8R5EsMJql+BheUmHjkNVmIRP7LutoM3+D4O4tG7vCkNO9ESZ4lL3J6rKRMPx4qKbD/A0icf8CG7tC7kTahnMTwleuYSrsS7GatRAvfZh1tTm5BmmQCdZ8a0Sefe28xUrRBkmFLKy8KTIKUDRX0Y1xagPgwbaIdeFnQULmKak3xvwNMkVGgok/N5XNoehJvejRlCDl9escI28dJU0tZ++nBTJE9mEF647x5Ehbo4s5hDOKFIU0PdofeA5F5k1q63zIWmQqNI/P3ZubjFTqKxQ3jyjHAOX0RdlgVO9hzRFpczRcjZ3Gbxxpc7Qj6+5pTYF2OFXawNI+yDGf1k2NcvOlzBQeDQ/t7zD7DsEDpJ2xATXaNtDWUS4IzP4DS2ljajAVu57SUkYw245ptxZxA5JiZaJ0DswudGn3kYUy54426EjoT4dZfYbccxC2nI92cDkZHQr96jD4AGkMDKeSy/COBsRe6VTSKFN6irLeaCh3IteQjt1E5+oudsG/b/2DfZ5AqsYo8vMDK9LB1HzSsLWvlGThdxXvC6+NsqyPPWP0pMINtbdsajfVeC6f/GZ+cdAofQoB1d+Hf9waY98I7+RXWab3Lt4zYkjHtTnlOLXHYMsCh1zWeQYehu1zfNPOOiys/d91LAKEBSgh6MJMbSA82AaHofDgAIwbgvVvlLNS11nModMm4UZergLHZBZrodmBuA3lBB1thdorSjkOmATMDwg/UBQVtglqQyx6fbEJ+H3IWIapjYAjAfeIgeCMHldueJvFaqDaAHhwf8qNsEEQ1iQbOoUUGIbCLRc8+Bvfp4jyd2FEijuO4ziO4ziO4ziO4ziO4ziO4ziO4ziOUzw7O/8D0P7rcZ/GEboAAAAASUVORK5CYII=";
  5429. imgFront.style.position = "absolute";
  5430. imgFront.style.left = "50%";
  5431. imgFront.style.top = "50%";
  5432. imgFront.style.marginLeft = "-50px";
  5433. imgFront.style.marginTop = "-50px";
  5434. this._loadingDiv.appendChild(imgFront);
  5435. // Resize
  5436. this._resizeLoadingUI = function () {
  5437. var canvasRect = _this.getRenderingCanvasClientRect();
  5438. _this._loadingDiv.style.position = "absolute";
  5439. _this._loadingDiv.style.left = canvasRect.left + "px";
  5440. _this._loadingDiv.style.top = canvasRect.top + "px";
  5441. _this._loadingDiv.style.width = canvasRect.width + "px";
  5442. _this._loadingDiv.style.height = canvasRect.height + "px";
  5443. };
  5444. this._resizeLoadingUI();
  5445. window.addEventListener("resize", this._resizeLoadingUI);
  5446. this._loadingDiv.style.backgroundColor = this._loadingDivBackgroundColor;
  5447. document.body.appendChild(this._loadingDiv);
  5448. setTimeout(function () {
  5449. _this._loadingDiv.style.opacity = "1";
  5450. imgBack.style.transform = "rotateZ(360deg)";
  5451. imgBack.style.webkitTransform = "rotateZ(360deg)";
  5452. }, 0);
  5453. };
  5454. Object.defineProperty(Engine.prototype, "loadingUIText", {
  5455. set: function (text) {
  5456. if (!this._loadingDiv) {
  5457. return;
  5458. }
  5459. this._loadingTextDiv.innerHTML = text;
  5460. },
  5461. enumerable: true,
  5462. configurable: true
  5463. });
  5464. Object.defineProperty(Engine.prototype, "loadingUIBackgroundColor", {
  5465. get: function () {
  5466. return this._loadingDivBackgroundColor;
  5467. },
  5468. set: function (color) {
  5469. this._loadingDivBackgroundColor = color;
  5470. if (!this._loadingDiv) {
  5471. return;
  5472. }
  5473. this._loadingDiv.style.backgroundColor = this._loadingDivBackgroundColor;
  5474. },
  5475. enumerable: true,
  5476. configurable: true
  5477. });
  5478. Engine.prototype.hideLoadingUI = function () {
  5479. var _this = this;
  5480. if (!this._loadingDiv) {
  5481. return;
  5482. }
  5483. var onTransitionEnd = function () {
  5484. if (!_this._loadingDiv) {
  5485. return;
  5486. }
  5487. document.body.removeChild(_this._loadingDiv);
  5488. window.removeEventListener("resize", _this._resizeLoadingUI);
  5489. _this._loadingDiv = null;
  5490. };
  5491. this._loadingDiv.style.opacity = "0";
  5492. this._loadingDiv.addEventListener("transitionend", onTransitionEnd);
  5493. };
  5494. // FPS
  5495. Engine.prototype.getFps = function () {
  5496. return this.fps;
  5497. };
  5498. Engine.prototype.getDeltaTime = function () {
  5499. return this.deltaTime;
  5500. };
  5501. Engine.prototype._measureFps = function () {
  5502. this.previousFramesDuration.push(BABYLON.Tools.Now);
  5503. var length = this.previousFramesDuration.length;
  5504. if (length >= 2) {
  5505. this.deltaTime = this.previousFramesDuration[length - 1] - this.previousFramesDuration[length - 2];
  5506. }
  5507. if (length >= this.fpsRange) {
  5508. if (length > this.fpsRange) {
  5509. this.previousFramesDuration.splice(0, 1);
  5510. length = this.previousFramesDuration.length;
  5511. }
  5512. var sum = 0;
  5513. for (var id = 0; id < length - 1; id++) {
  5514. sum += this.previousFramesDuration[id + 1] - this.previousFramesDuration[id];
  5515. }
  5516. this.fps = 1000.0 / (sum / (length - 1));
  5517. }
  5518. };
  5519. // Statics
  5520. Engine.isSupported = function () {
  5521. try {
  5522. // Avoid creating an unsized context for CocoonJS, since size determined on first creation. Is not resizable
  5523. if (navigator.isCocoonJS) {
  5524. return true;
  5525. }
  5526. var tempcanvas = document.createElement("canvas");
  5527. var gl = tempcanvas.getContext("webgl") || tempcanvas.getContext("experimental-webgl");
  5528. return gl != null && !!window.WebGLRenderingContext;
  5529. }
  5530. catch (e) {
  5531. return false;
  5532. }
  5533. };
  5534. // Const statics
  5535. Engine._ALPHA_DISABLE = 0;
  5536. Engine._ALPHA_ADD = 1;
  5537. Engine._ALPHA_COMBINE = 2;
  5538. Engine._DELAYLOADSTATE_NONE = 0;
  5539. Engine._DELAYLOADSTATE_LOADED = 1;
  5540. Engine._DELAYLOADSTATE_LOADING = 2;
  5541. Engine._DELAYLOADSTATE_NOTLOADED = 4;
  5542. Engine._TEXTUREFORMAT_ALPHA = 0;
  5543. Engine._TEXTUREFORMAT_LUMINANCE = 1;
  5544. Engine._TEXTUREFORMAT_LUMINANCE_ALPHA = 2;
  5545. Engine._TEXTUREFORMAT_RGB = 4;
  5546. Engine._TEXTUREFORMAT_RGBA = 4;
  5547. Engine._TEXTURETYPE_UNSIGNED_INT = 0;
  5548. Engine._TEXTURETYPE_FLOAT = 1;
  5549. // Updatable statics so stick with vars here
  5550. Engine.Epsilon = 0.001;
  5551. Engine.CollisionsEpsilon = 0.001;
  5552. Engine.ShadersRepository = "Babylon/Shaders/";
  5553. return Engine;
  5554. })();
  5555. BABYLON.Engine = Engine;
  5556. })(BABYLON || (BABYLON = {}));
  5557. //# sourceMappingURL=babylon.engine.js.mapvar BABYLON;
  5558. (function (BABYLON) {
  5559. /**
  5560. * Node is the basic class for all scene objects (Mesh, Light Camera).
  5561. */
  5562. var Node = (function () {
  5563. /**
  5564. * @constructor
  5565. * @param {string} name - the name and id to be given to this node
  5566. * @param {BABYLON.Scene} the scene this node will be added to
  5567. */
  5568. function Node(name, scene) {
  5569. this.state = "";
  5570. this.animations = new Array();
  5571. this._childrenFlag = -1;
  5572. this._isEnabled = true;
  5573. this._isReady = true;
  5574. this._currentRenderId = -1;
  5575. this._parentRenderId = -1;
  5576. this.name = name;
  5577. this.id = name;
  5578. this._scene = scene;
  5579. this._initCache();
  5580. }
  5581. Node.prototype.getScene = function () {
  5582. return this._scene;
  5583. };
  5584. Node.prototype.getEngine = function () {
  5585. return this._scene.getEngine();
  5586. };
  5587. // override it in derived class
  5588. Node.prototype.getWorldMatrix = function () {
  5589. return BABYLON.Matrix.Identity();
  5590. };
  5591. // override it in derived class if you add new variables to the cache
  5592. // and call the parent class method
  5593. Node.prototype._initCache = function () {
  5594. this._cache = {};
  5595. this._cache.parent = undefined;
  5596. };
  5597. Node.prototype.updateCache = function (force) {
  5598. if (!force && this.isSynchronized())
  5599. return;
  5600. this._cache.parent = this.parent;
  5601. this._updateCache();
  5602. };
  5603. // override it in derived class if you add new variables to the cache
  5604. // and call the parent class method if !ignoreParentClass
  5605. Node.prototype._updateCache = function (ignoreParentClass) {
  5606. };
  5607. // override it in derived class if you add new variables to the cache
  5608. Node.prototype._isSynchronized = function () {
  5609. return true;
  5610. };
  5611. Node.prototype.isSynchronizedWithParent = function () {
  5612. if (!this.parent) {
  5613. return true;
  5614. }
  5615. if (this._parentRenderId !== this.parent._currentRenderId) {
  5616. this._parentRenderId = this.parent._currentRenderId;
  5617. return false;
  5618. }
  5619. return this.parent.isSynchronized();
  5620. };
  5621. Node.prototype.isSynchronized = function (updateCache) {
  5622. var check = this.hasNewParent();
  5623. check = check || !this.isSynchronizedWithParent();
  5624. check = check || !this._isSynchronized();
  5625. if (updateCache)
  5626. this.updateCache(true);
  5627. return !check;
  5628. };
  5629. Node.prototype.hasNewParent = function (update) {
  5630. if (this._cache.parent === this.parent)
  5631. return false;
  5632. if (update)
  5633. this._cache.parent = this.parent;
  5634. return true;
  5635. };
  5636. /**
  5637. * Is this node ready to be used/rendered
  5638. * @return {boolean} is it ready
  5639. */
  5640. Node.prototype.isReady = function () {
  5641. return this._isReady;
  5642. };
  5643. /**
  5644. * Is this node enabled.
  5645. * If the node has a parent and is enabled, the parent will be inspected as well.
  5646. * @return {boolean} whether this node (and its parent) is enabled.
  5647. * @see setEnabled
  5648. */
  5649. Node.prototype.isEnabled = function () {
  5650. if (!this._isEnabled) {
  5651. return false;
  5652. }
  5653. if (this.parent) {
  5654. return this.parent.isEnabled();
  5655. }
  5656. return true;
  5657. };
  5658. /**
  5659. * Set the enabled state of this node.
  5660. * @param {boolean} value - the new enabled state
  5661. * @see isEnabled
  5662. */
  5663. Node.prototype.setEnabled = function (value) {
  5664. this._isEnabled = value;
  5665. };
  5666. /**
  5667. * Is this node a descendant of the given node.
  5668. * The function will iterate up the hierarchy until the ancestor was found or no more parents defined.
  5669. * @param {BABYLON.Node} ancestor - The parent node to inspect
  5670. * @see parent
  5671. */
  5672. Node.prototype.isDescendantOf = function (ancestor) {
  5673. if (this.parent) {
  5674. if (this.parent === ancestor) {
  5675. return true;
  5676. }
  5677. return this.parent.isDescendantOf(ancestor);
  5678. }
  5679. return false;
  5680. };
  5681. Node.prototype._getDescendants = function (list, results) {
  5682. for (var index = 0; index < list.length; index++) {
  5683. var item = list[index];
  5684. if (item.isDescendantOf(this)) {
  5685. results.push(item);
  5686. }
  5687. }
  5688. };
  5689. /**
  5690. * Will return all nodes that have this node as parent.
  5691. * @return {BABYLON.Node[]} all children nodes of all types.
  5692. */
  5693. Node.prototype.getDescendants = function () {
  5694. var results = [];
  5695. this._getDescendants(this._scene.meshes, results);
  5696. this._getDescendants(this._scene.lights, results);
  5697. this._getDescendants(this._scene.cameras, results);
  5698. return results;
  5699. };
  5700. Node.prototype._setReady = function (state) {
  5701. if (state == this._isReady) {
  5702. return;
  5703. }
  5704. if (!state) {
  5705. this._isReady = false;
  5706. return;
  5707. }
  5708. this._isReady = true;
  5709. if (this.onReady) {
  5710. this.onReady(this);
  5711. }
  5712. };
  5713. return Node;
  5714. })();
  5715. BABYLON.Node = Node;
  5716. })(BABYLON || (BABYLON = {}));
  5717. //# sourceMappingURL=babylon.node.js.mapvar BABYLON;
  5718. (function (BABYLON) {
  5719. var BoundingSphere = (function () {
  5720. function BoundingSphere(minimum, maximum) {
  5721. this.minimum = minimum;
  5722. this.maximum = maximum;
  5723. this._tempRadiusVector = BABYLON.Vector3.Zero();
  5724. var distance = BABYLON.Vector3.Distance(minimum, maximum);
  5725. this.center = BABYLON.Vector3.Lerp(minimum, maximum, 0.5);
  5726. this.radius = distance * 0.5;
  5727. this.centerWorld = BABYLON.Vector3.Zero();
  5728. this._update(BABYLON.Matrix.Identity());
  5729. }
  5730. // Methods
  5731. BoundingSphere.prototype._update = function (world) {
  5732. BABYLON.Vector3.TransformCoordinatesToRef(this.center, world, this.centerWorld);
  5733. BABYLON.Vector3.TransformNormalFromFloatsToRef(1.0, 1.0, 1.0, world, this._tempRadiusVector);
  5734. this.radiusWorld = Math.max(Math.abs(this._tempRadiusVector.x), Math.abs(this._tempRadiusVector.y), Math.abs(this._tempRadiusVector.z)) * this.radius;
  5735. };
  5736. BoundingSphere.prototype.isInFrustum = function (frustumPlanes) {
  5737. for (var i = 0; i < 6; i++) {
  5738. if (frustumPlanes[i].dotCoordinate(this.centerWorld) <= -this.radiusWorld)
  5739. return false;
  5740. }
  5741. return true;
  5742. };
  5743. BoundingSphere.prototype.intersectsPoint = function (point) {
  5744. var x = this.centerWorld.x - point.x;
  5745. var y = this.centerWorld.y - point.y;
  5746. var z = this.centerWorld.z - point.z;
  5747. var distance = Math.sqrt((x * x) + (y * y) + (z * z));
  5748. if (Math.abs(this.radiusWorld - distance) < BABYLON.Engine.Epsilon)
  5749. return false;
  5750. return true;
  5751. };
  5752. // Statics
  5753. BoundingSphere.Intersects = function (sphere0, sphere1) {
  5754. var x = sphere0.centerWorld.x - sphere1.centerWorld.x;
  5755. var y = sphere0.centerWorld.y - sphere1.centerWorld.y;
  5756. var z = sphere0.centerWorld.z - sphere1.centerWorld.z;
  5757. var distance = Math.sqrt((x * x) + (y * y) + (z * z));
  5758. if (sphere0.radiusWorld + sphere1.radiusWorld < distance)
  5759. return false;
  5760. return true;
  5761. };
  5762. return BoundingSphere;
  5763. })();
  5764. BABYLON.BoundingSphere = BoundingSphere;
  5765. })(BABYLON || (BABYLON = {}));
  5766. //# sourceMappingURL=babylon.boundingSphere.js.mapvar BABYLON;
  5767. (function (BABYLON) {
  5768. var BoundingBox = (function () {
  5769. function BoundingBox(minimum, maximum) {
  5770. this.minimum = minimum;
  5771. this.maximum = maximum;
  5772. this.vectors = new Array();
  5773. this.vectorsWorld = new Array();
  5774. // Bounding vectors
  5775. this.vectors.push(this.minimum.clone());
  5776. this.vectors.push(this.maximum.clone());
  5777. this.vectors.push(this.minimum.clone());
  5778. this.vectors[2].x = this.maximum.x;
  5779. this.vectors.push(this.minimum.clone());
  5780. this.vectors[3].y = this.maximum.y;
  5781. this.vectors.push(this.minimum.clone());
  5782. this.vectors[4].z = this.maximum.z;
  5783. this.vectors.push(this.maximum.clone());
  5784. this.vectors[5].z = this.minimum.z;
  5785. this.vectors.push(this.maximum.clone());
  5786. this.vectors[6].x = this.minimum.x;
  5787. this.vectors.push(this.maximum.clone());
  5788. this.vectors[7].y = this.minimum.y;
  5789. // OBB
  5790. this.center = this.maximum.add(this.minimum).scale(0.5);
  5791. this.extendSize = this.maximum.subtract(this.minimum).scale(0.5);
  5792. this.directions = [BABYLON.Vector3.Zero(), BABYLON.Vector3.Zero(), BABYLON.Vector3.Zero()];
  5793. for (var index = 0; index < this.vectors.length; index++) {
  5794. this.vectorsWorld[index] = BABYLON.Vector3.Zero();
  5795. }
  5796. this.minimumWorld = BABYLON.Vector3.Zero();
  5797. this.maximumWorld = BABYLON.Vector3.Zero();
  5798. this._update(BABYLON.Matrix.Identity());
  5799. }
  5800. // Methods
  5801. BoundingBox.prototype.getWorldMatrix = function () {
  5802. return this._worldMatrix;
  5803. };
  5804. BoundingBox.prototype._update = function (world) {
  5805. BABYLON.Vector3.FromFloatsToRef(Number.MAX_VALUE, Number.MAX_VALUE, Number.MAX_VALUE, this.minimumWorld);
  5806. BABYLON.Vector3.FromFloatsToRef(-Number.MAX_VALUE, -Number.MAX_VALUE, -Number.MAX_VALUE, this.maximumWorld);
  5807. for (var index = 0; index < this.vectors.length; index++) {
  5808. var v = this.vectorsWorld[index];
  5809. BABYLON.Vector3.TransformCoordinatesToRef(this.vectors[index], world, v);
  5810. if (v.x < this.minimumWorld.x)
  5811. this.minimumWorld.x = v.x;
  5812. if (v.y < this.minimumWorld.y)
  5813. this.minimumWorld.y = v.y;
  5814. if (v.z < this.minimumWorld.z)
  5815. this.minimumWorld.z = v.z;
  5816. if (v.x > this.maximumWorld.x)
  5817. this.maximumWorld.x = v.x;
  5818. if (v.y > this.maximumWorld.y)
  5819. this.maximumWorld.y = v.y;
  5820. if (v.z > this.maximumWorld.z)
  5821. this.maximumWorld.z = v.z;
  5822. }
  5823. // OBB
  5824. this.maximumWorld.addToRef(this.minimumWorld, this.center);
  5825. this.center.scaleInPlace(0.5);
  5826. BABYLON.Vector3.FromFloatArrayToRef(world.m, 0, this.directions[0]);
  5827. BABYLON.Vector3.FromFloatArrayToRef(world.m, 4, this.directions[1]);
  5828. BABYLON.Vector3.FromFloatArrayToRef(world.m, 8, this.directions[2]);
  5829. this._worldMatrix = world;
  5830. };
  5831. BoundingBox.prototype.isInFrustum = function (frustumPlanes) {
  5832. return BoundingBox.IsInFrustum(this.vectorsWorld, frustumPlanes);
  5833. };
  5834. BoundingBox.prototype.isCompletelyInFrustum = function (frustumPlanes) {
  5835. return BoundingBox.IsCompletelyInFrustum(this.vectorsWorld, frustumPlanes);
  5836. };
  5837. BoundingBox.prototype.intersectsPoint = function (point) {
  5838. var delta = BABYLON.Engine.Epsilon;
  5839. if (this.maximumWorld.x - point.x < delta || delta > point.x - this.minimumWorld.x)
  5840. return false;
  5841. if (this.maximumWorld.y - point.y < delta || delta > point.y - this.minimumWorld.y)
  5842. return false;
  5843. if (this.maximumWorld.z - point.z < delta || delta > point.z - this.minimumWorld.z)
  5844. return false;
  5845. return true;
  5846. };
  5847. BoundingBox.prototype.intersectsSphere = function (sphere) {
  5848. return BoundingBox.IntersectsSphere(this.minimumWorld, this.maximumWorld, sphere.centerWorld, sphere.radiusWorld);
  5849. };
  5850. BoundingBox.prototype.intersectsMinMax = function (min, max) {
  5851. if (this.maximumWorld.x < min.x || this.minimumWorld.x > max.x)
  5852. return false;
  5853. if (this.maximumWorld.y < min.y || this.minimumWorld.y > max.y)
  5854. return false;
  5855. if (this.maximumWorld.z < min.z || this.minimumWorld.z > max.z)
  5856. return false;
  5857. return true;
  5858. };
  5859. // Statics
  5860. BoundingBox.Intersects = function (box0, box1) {
  5861. if (box0.maximumWorld.x < box1.minimumWorld.x || box0.minimumWorld.x > box1.maximumWorld.x)
  5862. return false;
  5863. if (box0.maximumWorld.y < box1.minimumWorld.y || box0.minimumWorld.y > box1.maximumWorld.y)
  5864. return false;
  5865. if (box0.maximumWorld.z < box1.minimumWorld.z || box0.minimumWorld.z > box1.maximumWorld.z)
  5866. return false;
  5867. return true;
  5868. };
  5869. BoundingBox.IntersectsSphere = function (minPoint, maxPoint, sphereCenter, sphereRadius) {
  5870. var vector = BABYLON.Vector3.Clamp(sphereCenter, minPoint, maxPoint);
  5871. var num = BABYLON.Vector3.DistanceSquared(sphereCenter, vector);
  5872. return (num <= (sphereRadius * sphereRadius));
  5873. };
  5874. BoundingBox.IsCompletelyInFrustum = function (boundingVectors, frustumPlanes) {
  5875. for (var p = 0; p < 6; p++) {
  5876. for (var i = 0; i < 8; i++) {
  5877. if (frustumPlanes[p].dotCoordinate(boundingVectors[i]) < 0) {
  5878. return false;
  5879. }
  5880. }
  5881. }
  5882. return true;
  5883. };
  5884. BoundingBox.IsInFrustum = function (boundingVectors, frustumPlanes) {
  5885. for (var p = 0; p < 6; p++) {
  5886. var inCount = 8;
  5887. for (var i = 0; i < 8; i++) {
  5888. if (frustumPlanes[p].dotCoordinate(boundingVectors[i]) < 0) {
  5889. --inCount;
  5890. }
  5891. else {
  5892. break;
  5893. }
  5894. }
  5895. if (inCount === 0)
  5896. return false;
  5897. }
  5898. return true;
  5899. };
  5900. return BoundingBox;
  5901. })();
  5902. BABYLON.BoundingBox = BoundingBox;
  5903. })(BABYLON || (BABYLON = {}));
  5904. //# sourceMappingURL=babylon.boundingBox.js.mapvar BABYLON;
  5905. (function (BABYLON) {
  5906. var computeBoxExtents = function (axis, box) {
  5907. var p = BABYLON.Vector3.Dot(box.center, axis);
  5908. var r0 = Math.abs(BABYLON.Vector3.Dot(box.directions[0], axis)) * box.extendSize.x;
  5909. var r1 = Math.abs(BABYLON.Vector3.Dot(box.directions[1], axis)) * box.extendSize.y;
  5910. var r2 = Math.abs(BABYLON.Vector3.Dot(box.directions[2], axis)) * box.extendSize.z;
  5911. var r = r0 + r1 + r2;
  5912. return {
  5913. min: p - r,
  5914. max: p + r
  5915. };
  5916. };
  5917. var extentsOverlap = function (min0, max0, min1, max1) { return !(min0 > max1 || min1 > max0); };
  5918. var axisOverlap = function (axis, box0, box1) {
  5919. var result0 = computeBoxExtents(axis, box0);
  5920. var result1 = computeBoxExtents(axis, box1);
  5921. return extentsOverlap(result0.min, result0.max, result1.min, result1.max);
  5922. };
  5923. var BoundingInfo = (function () {
  5924. function BoundingInfo(minimum, maximum) {
  5925. this.minimum = minimum;
  5926. this.maximum = maximum;
  5927. this.boundingBox = new BABYLON.BoundingBox(minimum, maximum);
  5928. this.boundingSphere = new BABYLON.BoundingSphere(minimum, maximum);
  5929. }
  5930. // Methods
  5931. BoundingInfo.prototype._update = function (world) {
  5932. this.boundingBox._update(world);
  5933. this.boundingSphere._update(world);
  5934. };
  5935. BoundingInfo.prototype.isInFrustum = function (frustumPlanes) {
  5936. if (!this.boundingSphere.isInFrustum(frustumPlanes))
  5937. return false;
  5938. return this.boundingBox.isInFrustum(frustumPlanes);
  5939. };
  5940. BoundingInfo.prototype.isCompletelyInFrustum = function (frustumPlanes) {
  5941. return this.boundingBox.isCompletelyInFrustum(frustumPlanes);
  5942. };
  5943. BoundingInfo.prototype._checkCollision = function (collider) {
  5944. return collider._canDoCollision(this.boundingSphere.centerWorld, this.boundingSphere.radiusWorld, this.boundingBox.minimumWorld, this.boundingBox.maximumWorld);
  5945. };
  5946. BoundingInfo.prototype.intersectsPoint = function (point) {
  5947. if (!this.boundingSphere.centerWorld) {
  5948. return false;
  5949. }
  5950. if (!this.boundingSphere.intersectsPoint(point)) {
  5951. return false;
  5952. }
  5953. if (!this.boundingBox.intersectsPoint(point)) {
  5954. return false;
  5955. }
  5956. return true;
  5957. };
  5958. BoundingInfo.prototype.intersects = function (boundingInfo, precise) {
  5959. if (!this.boundingSphere.centerWorld || !boundingInfo.boundingSphere.centerWorld) {
  5960. return false;
  5961. }
  5962. if (!BABYLON.BoundingSphere.Intersects(this.boundingSphere, boundingInfo.boundingSphere)) {
  5963. return false;
  5964. }
  5965. if (!BABYLON.BoundingBox.Intersects(this.boundingBox, boundingInfo.boundingBox)) {
  5966. return false;
  5967. }
  5968. if (!precise) {
  5969. return true;
  5970. }
  5971. var box0 = this.boundingBox;
  5972. var box1 = boundingInfo.boundingBox;
  5973. if (!axisOverlap(box0.directions[0], box0, box1))
  5974. return false;
  5975. if (!axisOverlap(box0.directions[1], box0, box1))
  5976. return false;
  5977. if (!axisOverlap(box0.directions[2], box0, box1))
  5978. return false;
  5979. if (!axisOverlap(box1.directions[0], box0, box1))
  5980. return false;
  5981. if (!axisOverlap(box1.directions[1], box0, box1))
  5982. return false;
  5983. if (!axisOverlap(box1.directions[2], box0, box1))
  5984. return false;
  5985. if (!axisOverlap(BABYLON.Vector3.Cross(box0.directions[0], box1.directions[0]), box0, box1))
  5986. return false;
  5987. if (!axisOverlap(BABYLON.Vector3.Cross(box0.directions[0], box1.directions[1]), box0, box1))
  5988. return false;
  5989. if (!axisOverlap(BABYLON.Vector3.Cross(box0.directions[0], box1.directions[2]), box0, box1))
  5990. return false;
  5991. if (!axisOverlap(BABYLON.Vector3.Cross(box0.directions[1], box1.directions[0]), box0, box1))
  5992. return false;
  5993. if (!axisOverlap(BABYLON.Vector3.Cross(box0.directions[1], box1.directions[1]), box0, box1))
  5994. return false;
  5995. if (!axisOverlap(BABYLON.Vector3.Cross(box0.directions[1], box1.directions[2]), box0, box1))
  5996. return false;
  5997. if (!axisOverlap(BABYLON.Vector3.Cross(box0.directions[2], box1.directions[0]), box0, box1))
  5998. return false;
  5999. if (!axisOverlap(BABYLON.Vector3.Cross(box0.directions[2], box1.directions[1]), box0, box1))
  6000. return false;
  6001. if (!axisOverlap(BABYLON.Vector3.Cross(box0.directions[2], box1.directions[2]), box0, box1))
  6002. return false;
  6003. return true;
  6004. };
  6005. return BoundingInfo;
  6006. })();
  6007. BABYLON.BoundingInfo = BoundingInfo;
  6008. })(BABYLON || (BABYLON = {}));
  6009. //# sourceMappingURL=babylon.boundingInfo.js.map
  6010. var BABYLON;
  6011. (function (BABYLON) {
  6012. var Light = (function (_super) {
  6013. __extends(Light, _super);
  6014. function Light(name, scene) {
  6015. _super.call(this, name, scene);
  6016. this.diffuse = new BABYLON.Color3(1.0, 1.0, 1.0);
  6017. this.specular = new BABYLON.Color3(1.0, 1.0, 1.0);
  6018. this.intensity = 1.0;
  6019. this.range = Number.MAX_VALUE;
  6020. this.includeOnlyWithLayerMask = 0;
  6021. this.includedOnlyMeshes = new Array();
  6022. this.excludedMeshes = new Array();
  6023. this.excludeWithLayerMask = 0;
  6024. this._excludedMeshesIds = new Array();
  6025. this._includedOnlyMeshesIds = new Array();
  6026. scene.addLight(this);
  6027. }
  6028. Light.prototype.getShadowGenerator = function () {
  6029. return this._shadowGenerator;
  6030. };
  6031. Light.prototype.getAbsolutePosition = function () {
  6032. return BABYLON.Vector3.Zero();
  6033. };
  6034. Light.prototype.transferToEffect = function (effect, uniformName0, uniformName1) {
  6035. };
  6036. Light.prototype._getWorldMatrix = function () {
  6037. return BABYLON.Matrix.Identity();
  6038. };
  6039. Light.prototype.canAffectMesh = function (mesh) {
  6040. if (!mesh) {
  6041. return true;
  6042. }
  6043. if (this.includedOnlyMeshes.length > 0 && this.includedOnlyMeshes.indexOf(mesh) === -1) {
  6044. return false;
  6045. }
  6046. if (this.excludedMeshes.length > 0 && this.excludedMeshes.indexOf(mesh) !== -1) {
  6047. return false;
  6048. }
  6049. if (this.includeOnlyWithLayerMask !== 0 && (this.includeOnlyWithLayerMask & mesh.layerMask) === 0) {
  6050. return false;
  6051. }
  6052. if (this.excludeWithLayerMask !== 0 && this.excludeWithLayerMask & mesh.layerMask) {
  6053. return false;
  6054. }
  6055. return true;
  6056. };
  6057. Light.prototype.getWorldMatrix = function () {
  6058. this._currentRenderId = this.getScene().getRenderId();
  6059. var worldMatrix = this._getWorldMatrix();
  6060. if (this.parent && this.parent.getWorldMatrix) {
  6061. if (!this._parentedWorldMatrix) {
  6062. this._parentedWorldMatrix = BABYLON.Matrix.Identity();
  6063. }
  6064. worldMatrix.multiplyToRef(this.parent.getWorldMatrix(), this._parentedWorldMatrix);
  6065. return this._parentedWorldMatrix;
  6066. }
  6067. return worldMatrix;
  6068. };
  6069. Light.prototype.dispose = function () {
  6070. if (this._shadowGenerator) {
  6071. this._shadowGenerator.dispose();
  6072. this._shadowGenerator = null;
  6073. }
  6074. // Remove from scene
  6075. this.getScene().removeLight(this);
  6076. };
  6077. return Light;
  6078. })(BABYLON.Node);
  6079. BABYLON.Light = Light;
  6080. })(BABYLON || (BABYLON = {}));
  6081. //# sourceMappingURL=babylon.light.js.map
  6082. var BABYLON;
  6083. (function (BABYLON) {
  6084. var PointLight = (function (_super) {
  6085. __extends(PointLight, _super);
  6086. function PointLight(name, position, scene) {
  6087. _super.call(this, name, scene);
  6088. this.position = position;
  6089. }
  6090. PointLight.prototype.getAbsolutePosition = function () {
  6091. return this._transformedPosition ? this._transformedPosition : this.position;
  6092. };
  6093. PointLight.prototype.transferToEffect = function (effect, positionUniformName) {
  6094. if (this.parent && this.parent.getWorldMatrix) {
  6095. if (!this._transformedPosition) {
  6096. this._transformedPosition = BABYLON.Vector3.Zero();
  6097. }
  6098. BABYLON.Vector3.TransformCoordinatesToRef(this.position, this.parent.getWorldMatrix(), this._transformedPosition);
  6099. effect.setFloat4(positionUniformName, this._transformedPosition.x, this._transformedPosition.y, this._transformedPosition.z, 0);
  6100. return;
  6101. }
  6102. effect.setFloat4(positionUniformName, this.position.x, this.position.y, this.position.z, 0);
  6103. };
  6104. PointLight.prototype.getShadowGenerator = function () {
  6105. return null;
  6106. };
  6107. PointLight.prototype._getWorldMatrix = function () {
  6108. if (!this._worldMatrix) {
  6109. this._worldMatrix = BABYLON.Matrix.Identity();
  6110. }
  6111. BABYLON.Matrix.TranslationToRef(this.position.x, this.position.y, this.position.z, this._worldMatrix);
  6112. return this._worldMatrix;
  6113. };
  6114. return PointLight;
  6115. })(BABYLON.Light);
  6116. BABYLON.PointLight = PointLight;
  6117. })(BABYLON || (BABYLON = {}));
  6118. //# sourceMappingURL=babylon.pointLight.js.map
  6119. var BABYLON;
  6120. (function (BABYLON) {
  6121. var SpotLight = (function (_super) {
  6122. __extends(SpotLight, _super);
  6123. function SpotLight(name, position, direction, angle, exponent, scene) {
  6124. _super.call(this, name, scene);
  6125. this.position = position;
  6126. this.direction = direction;
  6127. this.angle = angle;
  6128. this.exponent = exponent;
  6129. }
  6130. SpotLight.prototype.getAbsolutePosition = function () {
  6131. return this.transformedPosition ? this.transformedPosition : this.position;
  6132. };
  6133. SpotLight.prototype.setShadowProjectionMatrix = function (matrix, viewMatrix, renderList) {
  6134. var activeCamera = this.getScene().activeCamera;
  6135. BABYLON.Matrix.PerspectiveFovLHToRef(this.angle, 1.0, activeCamera.minZ, activeCamera.maxZ, matrix);
  6136. };
  6137. SpotLight.prototype.supportsVSM = function () {
  6138. return true;
  6139. };
  6140. SpotLight.prototype.needRefreshPerFrame = function () {
  6141. return false;
  6142. };
  6143. SpotLight.prototype.setDirectionToTarget = function (target) {
  6144. this.direction = BABYLON.Vector3.Normalize(target.subtract(this.position));
  6145. return this.direction;
  6146. };
  6147. SpotLight.prototype.computeTransformedPosition = function () {
  6148. if (this.parent && this.parent.getWorldMatrix) {
  6149. if (!this.transformedPosition) {
  6150. this.transformedPosition = BABYLON.Vector3.Zero();
  6151. }
  6152. BABYLON.Vector3.TransformCoordinatesToRef(this.position, this.parent.getWorldMatrix(), this.transformedPosition);
  6153. return true;
  6154. }
  6155. return false;
  6156. };
  6157. SpotLight.prototype.transferToEffect = function (effect, positionUniformName, directionUniformName) {
  6158. var normalizeDirection;
  6159. if (this.parent && this.parent.getWorldMatrix) {
  6160. if (!this._transformedDirection) {
  6161. this._transformedDirection = BABYLON.Vector3.Zero();
  6162. }
  6163. this.computeTransformedPosition();
  6164. BABYLON.Vector3.TransformNormalToRef(this.direction, this.parent.getWorldMatrix(), this._transformedDirection);
  6165. effect.setFloat4(positionUniformName, this.transformedPosition.x, this.transformedPosition.y, this.transformedPosition.z, this.exponent);
  6166. normalizeDirection = BABYLON.Vector3.Normalize(this._transformedDirection);
  6167. }
  6168. else {
  6169. effect.setFloat4(positionUniformName, this.position.x, this.position.y, this.position.z, this.exponent);
  6170. normalizeDirection = BABYLON.Vector3.Normalize(this.direction);
  6171. }
  6172. effect.setFloat4(directionUniformName, normalizeDirection.x, normalizeDirection.y, normalizeDirection.z, Math.cos(this.angle * 0.5));
  6173. };
  6174. SpotLight.prototype._getWorldMatrix = function () {
  6175. if (!this._worldMatrix) {
  6176. this._worldMatrix = BABYLON.Matrix.Identity();
  6177. }
  6178. BABYLON.Matrix.TranslationToRef(this.position.x, this.position.y, this.position.z, this._worldMatrix);
  6179. return this._worldMatrix;
  6180. };
  6181. return SpotLight;
  6182. })(BABYLON.Light);
  6183. BABYLON.SpotLight = SpotLight;
  6184. })(BABYLON || (BABYLON = {}));
  6185. //# sourceMappingURL=babylon.spotLight.js.map
  6186. var BABYLON;
  6187. (function (BABYLON) {
  6188. var DirectionalLight = (function (_super) {
  6189. __extends(DirectionalLight, _super);
  6190. function DirectionalLight(name, direction, scene) {
  6191. _super.call(this, name, scene);
  6192. this.direction = direction;
  6193. this.shadowOrthoScale = 0.5;
  6194. this.position = direction.scale(-1);
  6195. }
  6196. DirectionalLight.prototype.getAbsolutePosition = function () {
  6197. return this.transformedPosition ? this.transformedPosition : this.position;
  6198. };
  6199. DirectionalLight.prototype.setDirectionToTarget = function (target) {
  6200. this.direction = BABYLON.Vector3.Normalize(target.subtract(this.position));
  6201. return this.direction;
  6202. };
  6203. DirectionalLight.prototype.setShadowProjectionMatrix = function (matrix, viewMatrix, renderList) {
  6204. var orthoLeft = Number.MAX_VALUE;
  6205. var orthoRight = Number.MIN_VALUE;
  6206. var orthoTop = Number.MIN_VALUE;
  6207. var orthoBottom = Number.MAX_VALUE;
  6208. var tempVector3 = BABYLON.Vector3.Zero();
  6209. var activeCamera = this.getScene().activeCamera;
  6210. for (var meshIndex = 0; meshIndex < renderList.length; meshIndex++) {
  6211. var mesh = renderList[meshIndex];
  6212. if (!mesh) {
  6213. continue;
  6214. }
  6215. var boundingInfo = mesh.getBoundingInfo();
  6216. if (!boundingInfo) {
  6217. continue;
  6218. }
  6219. var boundingBox = boundingInfo.boundingBox;
  6220. for (var index = 0; index < boundingBox.vectorsWorld.length; index++) {
  6221. BABYLON.Vector3.TransformCoordinatesToRef(boundingBox.vectorsWorld[index], viewMatrix, tempVector3);
  6222. if (tempVector3.x < orthoLeft)
  6223. orthoLeft = tempVector3.x;
  6224. if (tempVector3.y < orthoBottom)
  6225. orthoBottom = tempVector3.y;
  6226. if (tempVector3.x > orthoRight)
  6227. orthoRight = tempVector3.x;
  6228. if (tempVector3.y > orthoTop)
  6229. orthoTop = tempVector3.y;
  6230. }
  6231. }
  6232. var xOffset = orthoRight - orthoLeft;
  6233. var yOffset = orthoTop - orthoBottom;
  6234. BABYLON.Matrix.OrthoOffCenterLHToRef(orthoLeft - xOffset * this.shadowOrthoScale, orthoRight + xOffset * this.shadowOrthoScale, orthoBottom - yOffset * this.shadowOrthoScale, orthoTop + yOffset * this.shadowOrthoScale, -activeCamera.maxZ, activeCamera.maxZ, matrix);
  6235. };
  6236. DirectionalLight.prototype.supportsVSM = function () {
  6237. return true;
  6238. };
  6239. DirectionalLight.prototype.needRefreshPerFrame = function () {
  6240. return true;
  6241. };
  6242. DirectionalLight.prototype.computeTransformedPosition = function () {
  6243. if (this.parent && this.parent.getWorldMatrix) {
  6244. if (!this.transformedPosition) {
  6245. this.transformedPosition = BABYLON.Vector3.Zero();
  6246. }
  6247. BABYLON.Vector3.TransformCoordinatesToRef(this.position, this.parent.getWorldMatrix(), this.transformedPosition);
  6248. return true;
  6249. }
  6250. return false;
  6251. };
  6252. DirectionalLight.prototype.transferToEffect = function (effect, directionUniformName) {
  6253. if (this.parent && this.parent.getWorldMatrix) {
  6254. if (!this._transformedDirection) {
  6255. this._transformedDirection = BABYLON.Vector3.Zero();
  6256. }
  6257. BABYLON.Vector3.TransformNormalToRef(this.direction, this.parent.getWorldMatrix(), this._transformedDirection);
  6258. effect.setFloat4(directionUniformName, this._transformedDirection.x, this._transformedDirection.y, this._transformedDirection.z, 1);
  6259. return;
  6260. }
  6261. effect.setFloat4(directionUniformName, this.direction.x, this.direction.y, this.direction.z, 1);
  6262. };
  6263. DirectionalLight.prototype._getWorldMatrix = function () {
  6264. if (!this._worldMatrix) {
  6265. this._worldMatrix = BABYLON.Matrix.Identity();
  6266. }
  6267. BABYLON.Matrix.TranslationToRef(this.position.x, this.position.y, this.position.z, this._worldMatrix);
  6268. return this._worldMatrix;
  6269. };
  6270. return DirectionalLight;
  6271. })(BABYLON.Light);
  6272. BABYLON.DirectionalLight = DirectionalLight;
  6273. })(BABYLON || (BABYLON = {}));
  6274. //# sourceMappingURL=babylon.directionalLight.js.mapvar BABYLON;
  6275. (function (BABYLON) {
  6276. var ShadowGenerator = (function () {
  6277. function ShadowGenerator(mapSize, light) {
  6278. var _this = this;
  6279. // Members
  6280. this._filter = ShadowGenerator.FILTER_NONE;
  6281. this.blurScale = 2;
  6282. this._blurBoxOffset = 0;
  6283. this._bias = 0.00005;
  6284. this._darkness = 0;
  6285. this._transparencyShadow = false;
  6286. this._viewMatrix = BABYLON.Matrix.Zero();
  6287. this._projectionMatrix = BABYLON.Matrix.Zero();
  6288. this._transformMatrix = BABYLON.Matrix.Zero();
  6289. this._worldViewProjection = BABYLON.Matrix.Zero();
  6290. this._light = light;
  6291. this._scene = light.getScene();
  6292. this._mapSize = mapSize;
  6293. light._shadowGenerator = this;
  6294. // Render target
  6295. this._shadowMap = new BABYLON.RenderTargetTexture(light.name + "_shadowMap", mapSize, this._scene, false);
  6296. this._shadowMap.wrapU = BABYLON.Texture.CLAMP_ADDRESSMODE;
  6297. this._shadowMap.wrapV = BABYLON.Texture.CLAMP_ADDRESSMODE;
  6298. this._shadowMap.anisotropicFilteringLevel = 1;
  6299. this._shadowMap.updateSamplingMode(BABYLON.Texture.NEAREST_SAMPLINGMODE);
  6300. this._shadowMap.renderParticles = false;
  6301. this._shadowMap.onAfterUnbind = function () {
  6302. if (!_this.useBlurVarianceShadowMap) {
  6303. return;
  6304. }
  6305. if (!_this._shadowMap2) {
  6306. _this._shadowMap2 = new BABYLON.RenderTargetTexture(light.name + "_shadowMap", mapSize, _this._scene, false);
  6307. _this._shadowMap2.wrapU = BABYLON.Texture.CLAMP_ADDRESSMODE;
  6308. _this._shadowMap2.wrapV = BABYLON.Texture.CLAMP_ADDRESSMODE;
  6309. _this._shadowMap2.updateSamplingMode(BABYLON.Texture.TRILINEAR_SAMPLINGMODE);
  6310. _this._downSamplePostprocess = new BABYLON.PassPostProcess("downScale", 1.0 / _this.blurScale, null, BABYLON.Texture.BILINEAR_SAMPLINGMODE, _this._scene.getEngine());
  6311. _this._downSamplePostprocess.onApply = function (effect) {
  6312. effect.setTexture("textureSampler", _this._shadowMap);
  6313. };
  6314. _this.blurBoxOffset = 1;
  6315. }
  6316. _this._scene.postProcessManager.directRender([_this._downSamplePostprocess, _this._boxBlurPostprocess], _this._shadowMap2.getInternalTexture());
  6317. };
  6318. // Custom render function
  6319. var renderSubMesh = function (subMesh) {
  6320. var mesh = subMesh.getRenderingMesh();
  6321. var scene = _this._scene;
  6322. var engine = scene.getEngine();
  6323. // Culling
  6324. engine.setState(subMesh.getMaterial().backFaceCulling);
  6325. // Managing instances
  6326. var batch = mesh._getInstancesRenderList(subMesh._id);
  6327. if (batch.mustReturn) {
  6328. return;
  6329. }
  6330. var hardwareInstancedRendering = (engine.getCaps().instancedArrays !== null) && (batch.visibleInstances[subMesh._id] !== null);
  6331. if (_this.isReady(subMesh, hardwareInstancedRendering)) {
  6332. engine.enableEffect(_this._effect);
  6333. mesh._bind(subMesh, _this._effect, BABYLON.Material.TriangleFillMode);
  6334. var material = subMesh.getMaterial();
  6335. _this._effect.setMatrix("viewProjection", _this.getTransformMatrix());
  6336. // Alpha test
  6337. if (material && material.needAlphaTesting()) {
  6338. var alphaTexture = material.getAlphaTestTexture();
  6339. _this._effect.setTexture("diffuseSampler", alphaTexture);
  6340. _this._effect.setMatrix("diffuseMatrix", alphaTexture.getTextureMatrix());
  6341. }
  6342. // Bones
  6343. if (mesh.useBones) {
  6344. _this._effect.setMatrices("mBones", mesh.skeleton.getTransformMatrices());
  6345. }
  6346. // Draw
  6347. mesh._processRendering(subMesh, _this._effect, BABYLON.Material.TriangleFillMode, batch, hardwareInstancedRendering, function (isInstance, world) { return _this._effect.setMatrix("world", world); });
  6348. }
  6349. else {
  6350. // Need to reset refresh rate of the shadowMap
  6351. _this._shadowMap.resetRefreshCounter();
  6352. }
  6353. };
  6354. this._shadowMap.customRenderFunction = function (opaqueSubMeshes, alphaTestSubMeshes, transparentSubMeshes) {
  6355. var index;
  6356. for (index = 0; index < opaqueSubMeshes.length; index++) {
  6357. renderSubMesh(opaqueSubMeshes.data[index]);
  6358. }
  6359. for (index = 0; index < alphaTestSubMeshes.length; index++) {
  6360. renderSubMesh(alphaTestSubMeshes.data[index]);
  6361. }
  6362. if (_this._transparencyShadow) {
  6363. for (index = 0; index < transparentSubMeshes.length; index++) {
  6364. renderSubMesh(transparentSubMeshes.data[index]);
  6365. }
  6366. }
  6367. };
  6368. this._shadowMap.onClear = function (engine) {
  6369. if (_this.useBlurVarianceShadowMap || _this.useVarianceShadowMap) {
  6370. engine.clear(new BABYLON.Color4(0, 0, 0, 0), true, true);
  6371. }
  6372. else {
  6373. engine.clear(new BABYLON.Color4(1.0, 1.0, 1.0, 1.0), true, true);
  6374. }
  6375. };
  6376. }
  6377. Object.defineProperty(ShadowGenerator, "FILTER_NONE", {
  6378. // Static
  6379. get: function () {
  6380. return ShadowGenerator._FILTER_NONE;
  6381. },
  6382. enumerable: true,
  6383. configurable: true
  6384. });
  6385. Object.defineProperty(ShadowGenerator, "FILTER_VARIANCESHADOWMAP", {
  6386. get: function () {
  6387. return ShadowGenerator._FILTER_VARIANCESHADOWMAP;
  6388. },
  6389. enumerable: true,
  6390. configurable: true
  6391. });
  6392. Object.defineProperty(ShadowGenerator, "FILTER_POISSONSAMPLING", {
  6393. get: function () {
  6394. return ShadowGenerator._FILTER_POISSONSAMPLING;
  6395. },
  6396. enumerable: true,
  6397. configurable: true
  6398. });
  6399. Object.defineProperty(ShadowGenerator, "FILTER_BLURVARIANCESHADOWMAP", {
  6400. get: function () {
  6401. return ShadowGenerator._FILTER_BLURVARIANCESHADOWMAP;
  6402. },
  6403. enumerable: true,
  6404. configurable: true
  6405. });
  6406. Object.defineProperty(ShadowGenerator.prototype, "bias", {
  6407. get: function () {
  6408. return this._bias;
  6409. },
  6410. set: function (bias) {
  6411. this._bias = bias;
  6412. },
  6413. enumerable: true,
  6414. configurable: true
  6415. });
  6416. Object.defineProperty(ShadowGenerator.prototype, "blurBoxOffset", {
  6417. get: function () {
  6418. return this._blurBoxOffset;
  6419. },
  6420. set: function (value) {
  6421. var _this = this;
  6422. if (this._blurBoxOffset === value) {
  6423. return;
  6424. }
  6425. this._blurBoxOffset = value;
  6426. if (this._boxBlurPostprocess) {
  6427. this._boxBlurPostprocess.dispose();
  6428. }
  6429. this._boxBlurPostprocess = new BABYLON.PostProcess("DepthBoxBlur", "depthBoxBlur", ["screenSize", "boxOffset"], [], 1.0 / this.blurScale, null, BABYLON.Texture.BILINEAR_SAMPLINGMODE, this._scene.getEngine(), false, "#define OFFSET " + value);
  6430. this._boxBlurPostprocess.onApply = function (effect) {
  6431. effect.setFloat2("screenSize", _this._mapSize / _this.blurScale, _this._mapSize / _this.blurScale);
  6432. };
  6433. },
  6434. enumerable: true,
  6435. configurable: true
  6436. });
  6437. Object.defineProperty(ShadowGenerator.prototype, "filter", {
  6438. get: function () {
  6439. return this._filter;
  6440. },
  6441. set: function (value) {
  6442. if (this._filter === value) {
  6443. return;
  6444. }
  6445. this._filter = value;
  6446. if (this.useVarianceShadowMap || this.useBlurVarianceShadowMap) {
  6447. this._shadowMap.anisotropicFilteringLevel = 16;
  6448. this._shadowMap.updateSamplingMode(BABYLON.Texture.BILINEAR_SAMPLINGMODE);
  6449. }
  6450. else {
  6451. this._shadowMap.anisotropicFilteringLevel = 1;
  6452. this._shadowMap.updateSamplingMode(BABYLON.Texture.NEAREST_SAMPLINGMODE);
  6453. }
  6454. },
  6455. enumerable: true,
  6456. configurable: true
  6457. });
  6458. Object.defineProperty(ShadowGenerator.prototype, "useVarianceShadowMap", {
  6459. get: function () {
  6460. return this.filter === ShadowGenerator.FILTER_VARIANCESHADOWMAP && this._light.supportsVSM();
  6461. },
  6462. set: function (value) {
  6463. this.filter = (value ? ShadowGenerator.FILTER_VARIANCESHADOWMAP : ShadowGenerator.FILTER_NONE);
  6464. },
  6465. enumerable: true,
  6466. configurable: true
  6467. });
  6468. Object.defineProperty(ShadowGenerator.prototype, "usePoissonSampling", {
  6469. get: function () {
  6470. return this.filter === ShadowGenerator.FILTER_POISSONSAMPLING || (!this._light.supportsVSM() && (this.filter === ShadowGenerator.FILTER_VARIANCESHADOWMAP || this.filter === ShadowGenerator.FILTER_BLURVARIANCESHADOWMAP));
  6471. },
  6472. set: function (value) {
  6473. this.filter = (value ? ShadowGenerator.FILTER_POISSONSAMPLING : ShadowGenerator.FILTER_NONE);
  6474. },
  6475. enumerable: true,
  6476. configurable: true
  6477. });
  6478. Object.defineProperty(ShadowGenerator.prototype, "useBlurVarianceShadowMap", {
  6479. get: function () {
  6480. return this.filter === ShadowGenerator.FILTER_BLURVARIANCESHADOWMAP && this._light.supportsVSM();
  6481. },
  6482. set: function (value) {
  6483. this.filter = (value ? ShadowGenerator.FILTER_BLURVARIANCESHADOWMAP : ShadowGenerator.FILTER_NONE);
  6484. },
  6485. enumerable: true,
  6486. configurable: true
  6487. });
  6488. ShadowGenerator.prototype.isReady = function (subMesh, useInstances) {
  6489. var defines = [];
  6490. if (this.useVarianceShadowMap || this.useBlurVarianceShadowMap) {
  6491. defines.push("#define VSM");
  6492. }
  6493. var attribs = [BABYLON.VertexBuffer.PositionKind];
  6494. var mesh = subMesh.getMesh();
  6495. var material = subMesh.getMaterial();
  6496. // Alpha test
  6497. if (material && material.needAlphaTesting()) {
  6498. defines.push("#define ALPHATEST");
  6499. if (mesh.isVerticesDataPresent(BABYLON.VertexBuffer.UVKind)) {
  6500. attribs.push(BABYLON.VertexBuffer.UVKind);
  6501. defines.push("#define UV1");
  6502. }
  6503. if (mesh.isVerticesDataPresent(BABYLON.VertexBuffer.UV2Kind)) {
  6504. attribs.push(BABYLON.VertexBuffer.UV2Kind);
  6505. defines.push("#define UV2");
  6506. }
  6507. }
  6508. // Bones
  6509. if (mesh.useBones) {
  6510. attribs.push(BABYLON.VertexBuffer.MatricesIndicesKind);
  6511. attribs.push(BABYLON.VertexBuffer.MatricesWeightsKind);
  6512. defines.push("#define BONES");
  6513. defines.push("#define BonesPerMesh " + (mesh.skeleton.bones.length + 1));
  6514. }
  6515. // Instances
  6516. if (useInstances) {
  6517. defines.push("#define INSTANCES");
  6518. attribs.push("world0");
  6519. attribs.push("world1");
  6520. attribs.push("world2");
  6521. attribs.push("world3");
  6522. }
  6523. // Get correct effect
  6524. var join = defines.join("\n");
  6525. if (this._cachedDefines !== join) {
  6526. this._cachedDefines = join;
  6527. this._effect = this._scene.getEngine().createEffect("shadowMap", attribs, ["world", "mBones", "viewProjection", "diffuseMatrix"], ["diffuseSampler"], join);
  6528. }
  6529. return this._effect.isReady();
  6530. };
  6531. ShadowGenerator.prototype.getShadowMap = function () {
  6532. return this._shadowMap;
  6533. };
  6534. ShadowGenerator.prototype.getShadowMapForRendering = function () {
  6535. if (this._shadowMap2) {
  6536. return this._shadowMap2;
  6537. }
  6538. return this._shadowMap;
  6539. };
  6540. ShadowGenerator.prototype.getLight = function () {
  6541. return this._light;
  6542. };
  6543. // Methods
  6544. ShadowGenerator.prototype.getTransformMatrix = function () {
  6545. var scene = this._scene;
  6546. if (this._currentRenderID === scene.getRenderId()) {
  6547. return this._transformMatrix;
  6548. }
  6549. this._currentRenderID = scene.getRenderId();
  6550. var lightPosition = this._light.position;
  6551. var lightDirection = this._light.direction;
  6552. if (this._light.computeTransformedPosition()) {
  6553. lightPosition = this._light.transformedPosition;
  6554. }
  6555. if (this._light.needRefreshPerFrame() || !this._cachedPosition || !this._cachedDirection || !lightPosition.equals(this._cachedPosition) || !lightDirection.equals(this._cachedDirection)) {
  6556. this._cachedPosition = lightPosition.clone();
  6557. this._cachedDirection = lightDirection.clone();
  6558. BABYLON.Matrix.LookAtLHToRef(lightPosition, this._light.position.add(lightDirection), BABYLON.Vector3.Up(), this._viewMatrix);
  6559. this._light.setShadowProjectionMatrix(this._projectionMatrix, this._viewMatrix, this.getShadowMap().renderList);
  6560. this._viewMatrix.multiplyToRef(this._projectionMatrix, this._transformMatrix);
  6561. }
  6562. return this._transformMatrix;
  6563. };
  6564. ShadowGenerator.prototype.getDarkness = function () {
  6565. return this._darkness;
  6566. };
  6567. ShadowGenerator.prototype.setDarkness = function (darkness) {
  6568. if (darkness >= 1.0)
  6569. this._darkness = 1.0;
  6570. else if (darkness <= 0.0)
  6571. this._darkness = 0.0;
  6572. else
  6573. this._darkness = darkness;
  6574. };
  6575. ShadowGenerator.prototype.setTransparencyShadow = function (hasShadow) {
  6576. this._transparencyShadow = hasShadow;
  6577. };
  6578. ShadowGenerator.prototype._packHalf = function (depth) {
  6579. var scale = depth * 255.0;
  6580. var fract = scale - Math.floor(scale);
  6581. return new BABYLON.Vector2(depth - fract / 255.0, fract);
  6582. };
  6583. ShadowGenerator.prototype.dispose = function () {
  6584. this._shadowMap.dispose();
  6585. if (this._shadowMap2) {
  6586. this._shadowMap2.dispose();
  6587. }
  6588. if (this._downSamplePostprocess) {
  6589. this._downSamplePostprocess.dispose();
  6590. }
  6591. if (this._boxBlurPostprocess) {
  6592. this._boxBlurPostprocess.dispose();
  6593. }
  6594. };
  6595. ShadowGenerator._FILTER_NONE = 0;
  6596. ShadowGenerator._FILTER_VARIANCESHADOWMAP = 1;
  6597. ShadowGenerator._FILTER_POISSONSAMPLING = 2;
  6598. ShadowGenerator._FILTER_BLURVARIANCESHADOWMAP = 3;
  6599. return ShadowGenerator;
  6600. })();
  6601. BABYLON.ShadowGenerator = ShadowGenerator;
  6602. })(BABYLON || (BABYLON = {}));
  6603. //# sourceMappingURL=babylon.shadowGenerator.js.map
  6604. var BABYLON;
  6605. (function (BABYLON) {
  6606. var HemisphericLight = (function (_super) {
  6607. __extends(HemisphericLight, _super);
  6608. function HemisphericLight(name, direction, scene) {
  6609. _super.call(this, name, scene);
  6610. this.direction = direction;
  6611. this.groundColor = new BABYLON.Color3(0.0, 0.0, 0.0);
  6612. }
  6613. HemisphericLight.prototype.setDirectionToTarget = function (target) {
  6614. this.direction = BABYLON.Vector3.Normalize(target.subtract(BABYLON.Vector3.Zero()));
  6615. return this.direction;
  6616. };
  6617. HemisphericLight.prototype.getShadowGenerator = function () {
  6618. return null;
  6619. };
  6620. HemisphericLight.prototype.transferToEffect = function (effect, directionUniformName, groundColorUniformName) {
  6621. var normalizeDirection = BABYLON.Vector3.Normalize(this.direction);
  6622. effect.setFloat4(directionUniformName, normalizeDirection.x, normalizeDirection.y, normalizeDirection.z, 0);
  6623. effect.setColor3(groundColorUniformName, this.groundColor.scale(this.intensity));
  6624. };
  6625. HemisphericLight.prototype._getWorldMatrix = function () {
  6626. if (!this._worldMatrix) {
  6627. this._worldMatrix = BABYLON.Matrix.Identity();
  6628. }
  6629. return this._worldMatrix;
  6630. };
  6631. return HemisphericLight;
  6632. })(BABYLON.Light);
  6633. BABYLON.HemisphericLight = HemisphericLight;
  6634. })(BABYLON || (BABYLON = {}));
  6635. //# sourceMappingURL=babylon.hemisphericLight.js.mapvar BABYLON;
  6636. (function (BABYLON) {
  6637. var intersectBoxAASphere = function (boxMin, boxMax, sphereCenter, sphereRadius) {
  6638. if (boxMin.x > sphereCenter.x + sphereRadius)
  6639. return false;
  6640. if (sphereCenter.x - sphereRadius > boxMax.x)
  6641. return false;
  6642. if (boxMin.y > sphereCenter.y + sphereRadius)
  6643. return false;
  6644. if (sphereCenter.y - sphereRadius > boxMax.y)
  6645. return false;
  6646. if (boxMin.z > sphereCenter.z + sphereRadius)
  6647. return false;
  6648. if (sphereCenter.z - sphereRadius > boxMax.z)
  6649. return false;
  6650. return true;
  6651. };
  6652. var getLowestRoot = function (a, b, c, maxR) {
  6653. var determinant = b * b - 4.0 * a * c;
  6654. var result = { root: 0, found: false };
  6655. if (determinant < 0)
  6656. return result;
  6657. var sqrtD = Math.sqrt(determinant);
  6658. var r1 = (-b - sqrtD) / (2.0 * a);
  6659. var r2 = (-b + sqrtD) / (2.0 * a);
  6660. if (r1 > r2) {
  6661. var temp = r2;
  6662. r2 = r1;
  6663. r1 = temp;
  6664. }
  6665. if (r1 > 0 && r1 < maxR) {
  6666. result.root = r1;
  6667. result.found = true;
  6668. return result;
  6669. }
  6670. if (r2 > 0 && r2 < maxR) {
  6671. result.root = r2;
  6672. result.found = true;
  6673. return result;
  6674. }
  6675. return result;
  6676. };
  6677. var Collider = (function () {
  6678. function Collider() {
  6679. this.radius = new BABYLON.Vector3(1, 1, 1);
  6680. this.retry = 0;
  6681. this.basePointWorld = BABYLON.Vector3.Zero();
  6682. this.velocityWorld = BABYLON.Vector3.Zero();
  6683. this.normalizedVelocity = BABYLON.Vector3.Zero();
  6684. this._collisionPoint = BABYLON.Vector3.Zero();
  6685. this._planeIntersectionPoint = BABYLON.Vector3.Zero();
  6686. this._tempVector = BABYLON.Vector3.Zero();
  6687. this._tempVector2 = BABYLON.Vector3.Zero();
  6688. this._tempVector3 = BABYLON.Vector3.Zero();
  6689. this._tempVector4 = BABYLON.Vector3.Zero();
  6690. this._edge = BABYLON.Vector3.Zero();
  6691. this._baseToVertex = BABYLON.Vector3.Zero();
  6692. this._destinationPoint = BABYLON.Vector3.Zero();
  6693. this._slidePlaneNormal = BABYLON.Vector3.Zero();
  6694. this._displacementVector = BABYLON.Vector3.Zero();
  6695. }
  6696. // Methods
  6697. Collider.prototype._initialize = function (source, dir, e) {
  6698. this.velocity = dir;
  6699. BABYLON.Vector3.NormalizeToRef(dir, this.normalizedVelocity);
  6700. this.basePoint = source;
  6701. source.multiplyToRef(this.radius, this.basePointWorld);
  6702. dir.multiplyToRef(this.radius, this.velocityWorld);
  6703. this.velocityWorldLength = this.velocityWorld.length();
  6704. this.epsilon = e;
  6705. this.collisionFound = false;
  6706. };
  6707. Collider.prototype._checkPointInTriangle = function (point, pa, pb, pc, n) {
  6708. pa.subtractToRef(point, this._tempVector);
  6709. pb.subtractToRef(point, this._tempVector2);
  6710. BABYLON.Vector3.CrossToRef(this._tempVector, this._tempVector2, this._tempVector4);
  6711. var d = BABYLON.Vector3.Dot(this._tempVector4, n);
  6712. if (d < 0)
  6713. return false;
  6714. pc.subtractToRef(point, this._tempVector3);
  6715. BABYLON.Vector3.CrossToRef(this._tempVector2, this._tempVector3, this._tempVector4);
  6716. d = BABYLON.Vector3.Dot(this._tempVector4, n);
  6717. if (d < 0)
  6718. return false;
  6719. BABYLON.Vector3.CrossToRef(this._tempVector3, this._tempVector, this._tempVector4);
  6720. d = BABYLON.Vector3.Dot(this._tempVector4, n);
  6721. return d >= 0;
  6722. };
  6723. Collider.prototype._canDoCollision = function (sphereCenter, sphereRadius, vecMin, vecMax) {
  6724. var distance = BABYLON.Vector3.Distance(this.basePointWorld, sphereCenter);
  6725. var max = Math.max(this.radius.x, this.radius.y, this.radius.z);
  6726. if (distance > this.velocityWorldLength + max + sphereRadius) {
  6727. return false;
  6728. }
  6729. if (!intersectBoxAASphere(vecMin, vecMax, this.basePointWorld, this.velocityWorldLength + max))
  6730. return false;
  6731. return true;
  6732. };
  6733. Collider.prototype._testTriangle = function (faceIndex, subMesh, p1, p2, p3) {
  6734. var t0;
  6735. var embeddedInPlane = false;
  6736. if (!subMesh._trianglePlanes) {
  6737. subMesh._trianglePlanes = [];
  6738. }
  6739. if (!subMesh._trianglePlanes[faceIndex]) {
  6740. subMesh._trianglePlanes[faceIndex] = new BABYLON.Plane(0, 0, 0, 0);
  6741. subMesh._trianglePlanes[faceIndex].copyFromPoints(p1, p2, p3);
  6742. }
  6743. var trianglePlane = subMesh._trianglePlanes[faceIndex];
  6744. if ((!subMesh.getMaterial()) && !trianglePlane.isFrontFacingTo(this.normalizedVelocity, 0))
  6745. return;
  6746. var signedDistToTrianglePlane = trianglePlane.signedDistanceTo(this.basePoint);
  6747. var normalDotVelocity = BABYLON.Vector3.Dot(trianglePlane.normal, this.velocity);
  6748. if (normalDotVelocity == 0) {
  6749. if (Math.abs(signedDistToTrianglePlane) >= 1.0)
  6750. return;
  6751. embeddedInPlane = true;
  6752. t0 = 0;
  6753. }
  6754. else {
  6755. t0 = (-1.0 - signedDistToTrianglePlane) / normalDotVelocity;
  6756. var t1 = (1.0 - signedDistToTrianglePlane) / normalDotVelocity;
  6757. if (t0 > t1) {
  6758. var temp = t1;
  6759. t1 = t0;
  6760. t0 = temp;
  6761. }
  6762. if (t0 > 1.0 || t1 < 0.0)
  6763. return;
  6764. if (t0 < 0)
  6765. t0 = 0;
  6766. if (t0 > 1.0)
  6767. t0 = 1.0;
  6768. }
  6769. this._collisionPoint.copyFromFloats(0, 0, 0);
  6770. var found = false;
  6771. var t = 1.0;
  6772. if (!embeddedInPlane) {
  6773. this.basePoint.subtractToRef(trianglePlane.normal, this._planeIntersectionPoint);
  6774. this.velocity.scaleToRef(t0, this._tempVector);
  6775. this._planeIntersectionPoint.addInPlace(this._tempVector);
  6776. if (this._checkPointInTriangle(this._planeIntersectionPoint, p1, p2, p3, trianglePlane.normal)) {
  6777. found = true;
  6778. t = t0;
  6779. this._collisionPoint.copyFrom(this._planeIntersectionPoint);
  6780. }
  6781. }
  6782. if (!found) {
  6783. var velocitySquaredLength = this.velocity.lengthSquared();
  6784. var a = velocitySquaredLength;
  6785. this.basePoint.subtractToRef(p1, this._tempVector);
  6786. var b = 2.0 * (BABYLON.Vector3.Dot(this.velocity, this._tempVector));
  6787. var c = this._tempVector.lengthSquared() - 1.0;
  6788. var lowestRoot = getLowestRoot(a, b, c, t);
  6789. if (lowestRoot.found) {
  6790. t = lowestRoot.root;
  6791. found = true;
  6792. this._collisionPoint.copyFrom(p1);
  6793. }
  6794. this.basePoint.subtractToRef(p2, this._tempVector);
  6795. b = 2.0 * (BABYLON.Vector3.Dot(this.velocity, this._tempVector));
  6796. c = this._tempVector.lengthSquared() - 1.0;
  6797. lowestRoot = getLowestRoot(a, b, c, t);
  6798. if (lowestRoot.found) {
  6799. t = lowestRoot.root;
  6800. found = true;
  6801. this._collisionPoint.copyFrom(p2);
  6802. }
  6803. this.basePoint.subtractToRef(p3, this._tempVector);
  6804. b = 2.0 * (BABYLON.Vector3.Dot(this.velocity, this._tempVector));
  6805. c = this._tempVector.lengthSquared() - 1.0;
  6806. lowestRoot = getLowestRoot(a, b, c, t);
  6807. if (lowestRoot.found) {
  6808. t = lowestRoot.root;
  6809. found = true;
  6810. this._collisionPoint.copyFrom(p3);
  6811. }
  6812. p2.subtractToRef(p1, this._edge);
  6813. p1.subtractToRef(this.basePoint, this._baseToVertex);
  6814. var edgeSquaredLength = this._edge.lengthSquared();
  6815. var edgeDotVelocity = BABYLON.Vector3.Dot(this._edge, this.velocity);
  6816. var edgeDotBaseToVertex = BABYLON.Vector3.Dot(this._edge, this._baseToVertex);
  6817. a = edgeSquaredLength * (-velocitySquaredLength) + edgeDotVelocity * edgeDotVelocity;
  6818. b = edgeSquaredLength * (2.0 * BABYLON.Vector3.Dot(this.velocity, this._baseToVertex)) - 2.0 * edgeDotVelocity * edgeDotBaseToVertex;
  6819. c = edgeSquaredLength * (1.0 - this._baseToVertex.lengthSquared()) + edgeDotBaseToVertex * edgeDotBaseToVertex;
  6820. lowestRoot = getLowestRoot(a, b, c, t);
  6821. if (lowestRoot.found) {
  6822. var f = (edgeDotVelocity * lowestRoot.root - edgeDotBaseToVertex) / edgeSquaredLength;
  6823. if (f >= 0.0 && f <= 1.0) {
  6824. t = lowestRoot.root;
  6825. found = true;
  6826. this._edge.scaleInPlace(f);
  6827. p1.addToRef(this._edge, this._collisionPoint);
  6828. }
  6829. }
  6830. p3.subtractToRef(p2, this._edge);
  6831. p2.subtractToRef(this.basePoint, this._baseToVertex);
  6832. edgeSquaredLength = this._edge.lengthSquared();
  6833. edgeDotVelocity = BABYLON.Vector3.Dot(this._edge, this.velocity);
  6834. edgeDotBaseToVertex = BABYLON.Vector3.Dot(this._edge, this._baseToVertex);
  6835. a = edgeSquaredLength * (-velocitySquaredLength) + edgeDotVelocity * edgeDotVelocity;
  6836. b = edgeSquaredLength * (2.0 * BABYLON.Vector3.Dot(this.velocity, this._baseToVertex)) - 2.0 * edgeDotVelocity * edgeDotBaseToVertex;
  6837. c = edgeSquaredLength * (1.0 - this._baseToVertex.lengthSquared()) + edgeDotBaseToVertex * edgeDotBaseToVertex;
  6838. lowestRoot = getLowestRoot(a, b, c, t);
  6839. if (lowestRoot.found) {
  6840. f = (edgeDotVelocity * lowestRoot.root - edgeDotBaseToVertex) / edgeSquaredLength;
  6841. if (f >= 0.0 && f <= 1.0) {
  6842. t = lowestRoot.root;
  6843. found = true;
  6844. this._edge.scaleInPlace(f);
  6845. p2.addToRef(this._edge, this._collisionPoint);
  6846. }
  6847. }
  6848. p1.subtractToRef(p3, this._edge);
  6849. p3.subtractToRef(this.basePoint, this._baseToVertex);
  6850. edgeSquaredLength = this._edge.lengthSquared();
  6851. edgeDotVelocity = BABYLON.Vector3.Dot(this._edge, this.velocity);
  6852. edgeDotBaseToVertex = BABYLON.Vector3.Dot(this._edge, this._baseToVertex);
  6853. a = edgeSquaredLength * (-velocitySquaredLength) + edgeDotVelocity * edgeDotVelocity;
  6854. b = edgeSquaredLength * (2.0 * BABYLON.Vector3.Dot(this.velocity, this._baseToVertex)) - 2.0 * edgeDotVelocity * edgeDotBaseToVertex;
  6855. c = edgeSquaredLength * (1.0 - this._baseToVertex.lengthSquared()) + edgeDotBaseToVertex * edgeDotBaseToVertex;
  6856. lowestRoot = getLowestRoot(a, b, c, t);
  6857. if (lowestRoot.found) {
  6858. f = (edgeDotVelocity * lowestRoot.root - edgeDotBaseToVertex) / edgeSquaredLength;
  6859. if (f >= 0.0 && f <= 1.0) {
  6860. t = lowestRoot.root;
  6861. found = true;
  6862. this._edge.scaleInPlace(f);
  6863. p3.addToRef(this._edge, this._collisionPoint);
  6864. }
  6865. }
  6866. }
  6867. if (found) {
  6868. var distToCollision = t * this.velocity.length();
  6869. if (!this.collisionFound || distToCollision < this.nearestDistance) {
  6870. if (!this.intersectionPoint) {
  6871. this.intersectionPoint = this._collisionPoint.clone();
  6872. }
  6873. else {
  6874. this.intersectionPoint.copyFrom(this._collisionPoint);
  6875. }
  6876. this.nearestDistance = distToCollision;
  6877. this.collisionFound = true;
  6878. this.collidedMesh = subMesh.getMesh();
  6879. }
  6880. }
  6881. };
  6882. Collider.prototype._collide = function (subMesh, pts, indices, indexStart, indexEnd, decal) {
  6883. for (var i = indexStart; i < indexEnd; i += 3) {
  6884. var p1 = pts[indices[i] - decal];
  6885. var p2 = pts[indices[i + 1] - decal];
  6886. var p3 = pts[indices[i + 2] - decal];
  6887. this._testTriangle(i, subMesh, p3, p2, p1);
  6888. }
  6889. };
  6890. Collider.prototype._getResponse = function (pos, vel) {
  6891. pos.addToRef(vel, this._destinationPoint);
  6892. vel.scaleInPlace((this.nearestDistance / vel.length()));
  6893. this.basePoint.addToRef(vel, pos);
  6894. pos.subtractToRef(this.intersectionPoint, this._slidePlaneNormal);
  6895. this._slidePlaneNormal.normalize();
  6896. this._slidePlaneNormal.scaleToRef(this.epsilon, this._displacementVector);
  6897. pos.addInPlace(this._displacementVector);
  6898. this.intersectionPoint.addInPlace(this._displacementVector);
  6899. this._slidePlaneNormal.scaleInPlace(BABYLON.Plane.SignedDistanceToPlaneFromPositionAndNormal(this.intersectionPoint, this._slidePlaneNormal, this._destinationPoint));
  6900. this._destinationPoint.subtractInPlace(this._slidePlaneNormal);
  6901. this._destinationPoint.subtractToRef(this.intersectionPoint, vel);
  6902. };
  6903. return Collider;
  6904. })();
  6905. BABYLON.Collider = Collider;
  6906. })(BABYLON || (BABYLON = {}));
  6907. //# sourceMappingURL=babylon.collider.js.map
  6908. var BABYLON;
  6909. (function (BABYLON) {
  6910. var Camera = (function (_super) {
  6911. __extends(Camera, _super);
  6912. function Camera(name, position, scene) {
  6913. _super.call(this, name, scene);
  6914. this.position = position;
  6915. // Members
  6916. this.upVector = BABYLON.Vector3.Up();
  6917. this.orthoLeft = null;
  6918. this.orthoRight = null;
  6919. this.orthoBottom = null;
  6920. this.orthoTop = null;
  6921. this.fov = 0.8;
  6922. this.minZ = 1.0;
  6923. this.maxZ = 10000.0;
  6924. this.inertia = 0.9;
  6925. this.mode = Camera.PERSPECTIVE_CAMERA;
  6926. this.isIntermediate = false;
  6927. this.viewport = new BABYLON.Viewport(0, 0, 1.0, 1.0);
  6928. this.subCameras = [];
  6929. this.layerMask = 0xFFFFFFFF;
  6930. this.fovMode = Camera.FOVMODE_VERTICAL_FIXED;
  6931. this._computedViewMatrix = BABYLON.Matrix.Identity();
  6932. this._projectionMatrix = new BABYLON.Matrix();
  6933. this._postProcesses = new Array();
  6934. this._postProcessesTakenIndices = [];
  6935. this._activeMeshes = new BABYLON.SmartArray(256);
  6936. this._globalPosition = BABYLON.Vector3.Zero();
  6937. scene.addCamera(this);
  6938. if (!scene.activeCamera) {
  6939. scene.activeCamera = this;
  6940. }
  6941. }
  6942. Object.defineProperty(Camera, "PERSPECTIVE_CAMERA", {
  6943. get: function () {
  6944. return Camera._PERSPECTIVE_CAMERA;
  6945. },
  6946. enumerable: true,
  6947. configurable: true
  6948. });
  6949. Object.defineProperty(Camera, "ORTHOGRAPHIC_CAMERA", {
  6950. get: function () {
  6951. return Camera._ORTHOGRAPHIC_CAMERA;
  6952. },
  6953. enumerable: true,
  6954. configurable: true
  6955. });
  6956. Object.defineProperty(Camera, "FOVMODE_VERTICAL_FIXED", {
  6957. get: function () {
  6958. return Camera._FOVMODE_VERTICAL_FIXED;
  6959. },
  6960. enumerable: true,
  6961. configurable: true
  6962. });
  6963. Object.defineProperty(Camera, "FOVMODE_HORIZONTAL_FIXED", {
  6964. get: function () {
  6965. return Camera._FOVMODE_HORIZONTAL_FIXED;
  6966. },
  6967. enumerable: true,
  6968. configurable: true
  6969. });
  6970. Object.defineProperty(Camera.prototype, "globalPosition", {
  6971. get: function () {
  6972. return this._globalPosition;
  6973. },
  6974. enumerable: true,
  6975. configurable: true
  6976. });
  6977. Camera.prototype.getActiveMeshes = function () {
  6978. return this._activeMeshes;
  6979. };
  6980. Camera.prototype.isActiveMesh = function (mesh) {
  6981. return (this._activeMeshes.indexOf(mesh) !== -1);
  6982. };
  6983. //Cache
  6984. Camera.prototype._initCache = function () {
  6985. _super.prototype._initCache.call(this);
  6986. this._cache.position = new BABYLON.Vector3(Number.MAX_VALUE, Number.MAX_VALUE, Number.MAX_VALUE);
  6987. this._cache.upVector = new BABYLON.Vector3(Number.MAX_VALUE, Number.MAX_VALUE, Number.MAX_VALUE);
  6988. this._cache.mode = undefined;
  6989. this._cache.minZ = undefined;
  6990. this._cache.maxZ = undefined;
  6991. this._cache.fov = undefined;
  6992. this._cache.aspectRatio = undefined;
  6993. this._cache.orthoLeft = undefined;
  6994. this._cache.orthoRight = undefined;
  6995. this._cache.orthoBottom = undefined;
  6996. this._cache.orthoTop = undefined;
  6997. this._cache.renderWidth = undefined;
  6998. this._cache.renderHeight = undefined;
  6999. };
  7000. Camera.prototype._updateCache = function (ignoreParentClass) {
  7001. if (!ignoreParentClass) {
  7002. _super.prototype._updateCache.call(this);
  7003. }
  7004. var engine = this.getEngine();
  7005. this._cache.position.copyFrom(this.position);
  7006. this._cache.upVector.copyFrom(this.upVector);
  7007. this._cache.mode = this.mode;
  7008. this._cache.minZ = this.minZ;
  7009. this._cache.maxZ = this.maxZ;
  7010. this._cache.fov = this.fov;
  7011. this._cache.aspectRatio = engine.getAspectRatio(this);
  7012. this._cache.orthoLeft = this.orthoLeft;
  7013. this._cache.orthoRight = this.orthoRight;
  7014. this._cache.orthoBottom = this.orthoBottom;
  7015. this._cache.orthoTop = this.orthoTop;
  7016. this._cache.renderWidth = engine.getRenderWidth();
  7017. this._cache.renderHeight = engine.getRenderHeight();
  7018. };
  7019. Camera.prototype._updateFromScene = function () {
  7020. this.updateCache();
  7021. this._update();
  7022. };
  7023. // Synchronized
  7024. Camera.prototype.isSynchronizedWithParent = function () {
  7025. return false;
  7026. };
  7027. Camera.prototype._isSynchronized = function () {
  7028. return this._isSynchronizedViewMatrix() && this._isSynchronizedProjectionMatrix();
  7029. };
  7030. Camera.prototype._isSynchronizedViewMatrix = function () {
  7031. if (!_super.prototype._isSynchronized.call(this))
  7032. return false;
  7033. return this._cache.position.equals(this.position) && this._cache.upVector.equals(this.upVector) && this.isSynchronizedWithParent();
  7034. };
  7035. Camera.prototype._isSynchronizedProjectionMatrix = function () {
  7036. var check = this._cache.mode === this.mode && this._cache.minZ === this.minZ && this._cache.maxZ === this.maxZ;
  7037. if (!check) {
  7038. return false;
  7039. }
  7040. var engine = this.getEngine();
  7041. if (this.mode === Camera.PERSPECTIVE_CAMERA) {
  7042. check = this._cache.fov === this.fov && this._cache.aspectRatio === engine.getAspectRatio(this);
  7043. }
  7044. else {
  7045. check = this._cache.orthoLeft === this.orthoLeft && this._cache.orthoRight === this.orthoRight && this._cache.orthoBottom === this.orthoBottom && this._cache.orthoTop === this.orthoTop && this._cache.renderWidth === engine.getRenderWidth() && this._cache.renderHeight === engine.getRenderHeight();
  7046. }
  7047. return check;
  7048. };
  7049. // Controls
  7050. Camera.prototype.attachControl = function (element) {
  7051. };
  7052. Camera.prototype.detachControl = function (element) {
  7053. };
  7054. Camera.prototype._update = function () {
  7055. };
  7056. Camera.prototype.attachPostProcess = function (postProcess, insertAt) {
  7057. if (insertAt === void 0) { insertAt = null; }
  7058. if (!postProcess.isReusable() && this._postProcesses.indexOf(postProcess) > -1) {
  7059. BABYLON.Tools.Error("You're trying to reuse a post process not defined as reusable.");
  7060. return 0;
  7061. }
  7062. if (insertAt == null || insertAt < 0) {
  7063. this._postProcesses.push(postProcess);
  7064. this._postProcessesTakenIndices.push(this._postProcesses.length - 1);
  7065. return this._postProcesses.length - 1;
  7066. }
  7067. var add = 0;
  7068. if (this._postProcesses[insertAt]) {
  7069. var start = this._postProcesses.length - 1;
  7070. for (var i = start; i >= insertAt + 1; --i) {
  7071. this._postProcesses[i + 1] = this._postProcesses[i];
  7072. }
  7073. add = 1;
  7074. }
  7075. for (i = 0; i < this._postProcessesTakenIndices.length; ++i) {
  7076. if (this._postProcessesTakenIndices[i] < insertAt) {
  7077. continue;
  7078. }
  7079. start = this._postProcessesTakenIndices.length - 1;
  7080. for (var j = start; j >= i; --j) {
  7081. this._postProcessesTakenIndices[j + 1] = this._postProcessesTakenIndices[j] + add;
  7082. }
  7083. this._postProcessesTakenIndices[i] = insertAt;
  7084. break;
  7085. }
  7086. if (!add && this._postProcessesTakenIndices.indexOf(insertAt) == -1) {
  7087. this._postProcessesTakenIndices.push(insertAt);
  7088. }
  7089. var result = insertAt + add;
  7090. this._postProcesses[result] = postProcess;
  7091. return result;
  7092. };
  7093. Camera.prototype.detachPostProcess = function (postProcess, atIndices) {
  7094. if (atIndices === void 0) { atIndices = null; }
  7095. var result = [];
  7096. if (!atIndices) {
  7097. var length = this._postProcesses.length;
  7098. for (var i = 0; i < length; i++) {
  7099. if (this._postProcesses[i] !== postProcess) {
  7100. continue;
  7101. }
  7102. delete this._postProcesses[i];
  7103. var index = this._postProcessesTakenIndices.indexOf(i);
  7104. this._postProcessesTakenIndices.splice(index, 1);
  7105. }
  7106. }
  7107. else {
  7108. atIndices = (atIndices instanceof Array) ? atIndices : [atIndices];
  7109. for (i = 0; i < atIndices.length; i++) {
  7110. var foundPostProcess = this._postProcesses[atIndices[i]];
  7111. if (foundPostProcess !== postProcess) {
  7112. result.push(i);
  7113. continue;
  7114. }
  7115. delete this._postProcesses[atIndices[i]];
  7116. index = this._postProcessesTakenIndices.indexOf(atIndices[i]);
  7117. this._postProcessesTakenIndices.splice(index, 1);
  7118. }
  7119. }
  7120. return result;
  7121. };
  7122. Camera.prototype.getWorldMatrix = function () {
  7123. if (!this._worldMatrix) {
  7124. this._worldMatrix = BABYLON.Matrix.Identity();
  7125. }
  7126. var viewMatrix = this.getViewMatrix();
  7127. viewMatrix.invertToRef(this._worldMatrix);
  7128. return this._worldMatrix;
  7129. };
  7130. Camera.prototype._getViewMatrix = function () {
  7131. return BABYLON.Matrix.Identity();
  7132. };
  7133. Camera.prototype.getViewMatrix = function () {
  7134. this._computedViewMatrix = this._computeViewMatrix();
  7135. if (!this.parent || !this.parent.getWorldMatrix || this.isSynchronized()) {
  7136. this._globalPosition.copyFrom(this.position);
  7137. return this._computedViewMatrix;
  7138. }
  7139. if (!this._worldMatrix) {
  7140. this._worldMatrix = BABYLON.Matrix.Identity();
  7141. }
  7142. this._computedViewMatrix.invertToRef(this._worldMatrix);
  7143. this._worldMatrix.multiplyToRef(this.parent.getWorldMatrix(), this._computedViewMatrix);
  7144. this._globalPosition.copyFromFloats(this._computedViewMatrix.m[12], this._computedViewMatrix.m[13], this._computedViewMatrix.m[14]);
  7145. this._computedViewMatrix.invert();
  7146. this._currentRenderId = this.getScene().getRenderId();
  7147. return this._computedViewMatrix;
  7148. };
  7149. Camera.prototype._computeViewMatrix = function (force) {
  7150. if (!force && this._isSynchronizedViewMatrix()) {
  7151. return this._computedViewMatrix;
  7152. }
  7153. this._computedViewMatrix = this._getViewMatrix();
  7154. this._currentRenderId = this.getScene().getRenderId();
  7155. return this._computedViewMatrix;
  7156. };
  7157. Camera.prototype.getProjectionMatrix = function (force) {
  7158. if (!force && this._isSynchronizedProjectionMatrix()) {
  7159. return this._projectionMatrix;
  7160. }
  7161. var engine = this.getEngine();
  7162. if (this.mode === Camera.PERSPECTIVE_CAMERA) {
  7163. if (this.minZ <= 0) {
  7164. this.minZ = 0.1;
  7165. }
  7166. BABYLON.Matrix.PerspectiveFovLHToRef(this.fov, engine.getAspectRatio(this), this.minZ, this.maxZ, this._projectionMatrix, this.fovMode);
  7167. return this._projectionMatrix;
  7168. }
  7169. var halfWidth = engine.getRenderWidth() / 2.0;
  7170. var halfHeight = engine.getRenderHeight() / 2.0;
  7171. BABYLON.Matrix.OrthoOffCenterLHToRef(this.orthoLeft || -halfWidth, this.orthoRight || halfWidth, this.orthoBottom || -halfHeight, this.orthoTop || halfHeight, this.minZ, this.maxZ, this._projectionMatrix);
  7172. return this._projectionMatrix;
  7173. };
  7174. Camera.prototype.dispose = function () {
  7175. // Remove from scene
  7176. this.getScene().removeCamera(this);
  7177. for (var i = 0; i < this._postProcessesTakenIndices.length; ++i) {
  7178. this._postProcesses[this._postProcessesTakenIndices[i]].dispose(this);
  7179. }
  7180. };
  7181. // Statics
  7182. Camera._PERSPECTIVE_CAMERA = 0;
  7183. Camera._ORTHOGRAPHIC_CAMERA = 1;
  7184. Camera._FOVMODE_VERTICAL_FIXED = 0;
  7185. Camera._FOVMODE_HORIZONTAL_FIXED = 1;
  7186. return Camera;
  7187. })(BABYLON.Node);
  7188. BABYLON.Camera = Camera;
  7189. })(BABYLON || (BABYLON = {}));
  7190. //# sourceMappingURL=babylon.camera.js.map
  7191. var BABYLON;
  7192. (function (BABYLON) {
  7193. var TargetCamera = (function (_super) {
  7194. __extends(TargetCamera, _super);
  7195. function TargetCamera(name, position, scene) {
  7196. _super.call(this, name, position, scene);
  7197. this.cameraDirection = new BABYLON.Vector3(0, 0, 0);
  7198. this.cameraRotation = new BABYLON.Vector2(0, 0);
  7199. this.rotation = new BABYLON.Vector3(0, 0, 0);
  7200. this.speed = 2.0;
  7201. this.noRotationConstraint = false;
  7202. this.lockedTarget = null;
  7203. this._currentTarget = BABYLON.Vector3.Zero();
  7204. this._viewMatrix = BABYLON.Matrix.Zero();
  7205. this._camMatrix = BABYLON.Matrix.Zero();
  7206. this._cameraTransformMatrix = BABYLON.Matrix.Zero();
  7207. this._cameraRotationMatrix = BABYLON.Matrix.Zero();
  7208. this._referencePoint = new BABYLON.Vector3(0, 0, 1);
  7209. this._transformedReferencePoint = BABYLON.Vector3.Zero();
  7210. this._lookAtTemp = BABYLON.Matrix.Zero();
  7211. this._tempMatrix = BABYLON.Matrix.Zero();
  7212. }
  7213. TargetCamera.prototype._getLockedTargetPosition = function () {
  7214. if (!this.lockedTarget) {
  7215. return null;
  7216. }
  7217. return this.lockedTarget.position || this.lockedTarget;
  7218. };
  7219. // Cache
  7220. TargetCamera.prototype._initCache = function () {
  7221. _super.prototype._initCache.call(this);
  7222. this._cache.lockedTarget = new BABYLON.Vector3(Number.MAX_VALUE, Number.MAX_VALUE, Number.MAX_VALUE);
  7223. this._cache.rotation = new BABYLON.Vector3(Number.MAX_VALUE, Number.MAX_VALUE, Number.MAX_VALUE);
  7224. };
  7225. TargetCamera.prototype._updateCache = function (ignoreParentClass) {
  7226. if (!ignoreParentClass) {
  7227. _super.prototype._updateCache.call(this);
  7228. }
  7229. var lockedTargetPosition = this._getLockedTargetPosition();
  7230. if (!lockedTargetPosition) {
  7231. this._cache.lockedTarget = null;
  7232. }
  7233. else {
  7234. if (!this._cache.lockedTarget) {
  7235. this._cache.lockedTarget = lockedTargetPosition.clone();
  7236. }
  7237. else {
  7238. this._cache.lockedTarget.copyFrom(lockedTargetPosition);
  7239. }
  7240. }
  7241. this._cache.rotation.copyFrom(this.rotation);
  7242. };
  7243. // Synchronized
  7244. TargetCamera.prototype._isSynchronizedViewMatrix = function () {
  7245. if (!_super.prototype._isSynchronizedViewMatrix.call(this)) {
  7246. return false;
  7247. }
  7248. var lockedTargetPosition = this._getLockedTargetPosition();
  7249. return (this._cache.lockedTarget ? this._cache.lockedTarget.equals(lockedTargetPosition) : !lockedTargetPosition) && this._cache.rotation.equals(this.rotation);
  7250. };
  7251. // Methods
  7252. TargetCamera.prototype._computeLocalCameraSpeed = function () {
  7253. var engine = this.getEngine();
  7254. return this.speed * ((engine.getDeltaTime() / (engine.getFps() * 10.0)));
  7255. };
  7256. // Target
  7257. TargetCamera.prototype.setTarget = function (target) {
  7258. this.upVector.normalize();
  7259. BABYLON.Matrix.LookAtLHToRef(this.position, target, this.upVector, this._camMatrix);
  7260. this._camMatrix.invert();
  7261. this.rotation.x = Math.atan(this._camMatrix.m[6] / this._camMatrix.m[10]);
  7262. var vDir = target.subtract(this.position);
  7263. if (vDir.x >= 0.0) {
  7264. this.rotation.y = (-Math.atan(vDir.z / vDir.x) + Math.PI / 2.0);
  7265. }
  7266. else {
  7267. this.rotation.y = (-Math.atan(vDir.z / vDir.x) - Math.PI / 2.0);
  7268. }
  7269. this.rotation.z = -Math.acos(BABYLON.Vector3.Dot(new BABYLON.Vector3(0, 1.0, 0), this.upVector));
  7270. if (isNaN(this.rotation.x)) {
  7271. this.rotation.x = 0;
  7272. }
  7273. if (isNaN(this.rotation.y)) {
  7274. this.rotation.y = 0;
  7275. }
  7276. if (isNaN(this.rotation.z)) {
  7277. this.rotation.z = 0;
  7278. }
  7279. };
  7280. TargetCamera.prototype.getTarget = function () {
  7281. return this._currentTarget;
  7282. };
  7283. TargetCamera.prototype._decideIfNeedsToMove = function () {
  7284. return Math.abs(this.cameraDirection.x) > 0 || Math.abs(this.cameraDirection.y) > 0 || Math.abs(this.cameraDirection.z) > 0;
  7285. };
  7286. TargetCamera.prototype._updatePosition = function () {
  7287. this.position.addInPlace(this.cameraDirection);
  7288. };
  7289. TargetCamera.prototype._update = function () {
  7290. var needToMove = this._decideIfNeedsToMove();
  7291. var needToRotate = Math.abs(this.cameraRotation.x) > 0 || Math.abs(this.cameraRotation.y) > 0;
  7292. // Move
  7293. if (needToMove) {
  7294. this._updatePosition();
  7295. }
  7296. // Rotate
  7297. if (needToRotate) {
  7298. this.rotation.x += this.cameraRotation.x;
  7299. this.rotation.y += this.cameraRotation.y;
  7300. if (!this.noRotationConstraint) {
  7301. var limit = (Math.PI / 2) * 0.95;
  7302. if (this.rotation.x > limit)
  7303. this.rotation.x = limit;
  7304. if (this.rotation.x < -limit)
  7305. this.rotation.x = -limit;
  7306. }
  7307. }
  7308. // Inertia
  7309. if (needToMove) {
  7310. if (Math.abs(this.cameraDirection.x) < BABYLON.Engine.Epsilon) {
  7311. this.cameraDirection.x = 0;
  7312. }
  7313. if (Math.abs(this.cameraDirection.y) < BABYLON.Engine.Epsilon) {
  7314. this.cameraDirection.y = 0;
  7315. }
  7316. if (Math.abs(this.cameraDirection.z) < BABYLON.Engine.Epsilon) {
  7317. this.cameraDirection.z = 0;
  7318. }
  7319. this.cameraDirection.scaleInPlace(this.inertia);
  7320. }
  7321. if (needToRotate) {
  7322. if (Math.abs(this.cameraRotation.x) < BABYLON.Engine.Epsilon) {
  7323. this.cameraRotation.x = 0;
  7324. }
  7325. if (Math.abs(this.cameraRotation.y) < BABYLON.Engine.Epsilon) {
  7326. this.cameraRotation.y = 0;
  7327. }
  7328. this.cameraRotation.scaleInPlace(this.inertia);
  7329. }
  7330. };
  7331. TargetCamera.prototype._getViewMatrix = function () {
  7332. if (!this.lockedTarget) {
  7333. // Compute
  7334. if (this.upVector.x !== 0 || this.upVector.y !== 1.0 || this.upVector.z !== 0) {
  7335. BABYLON.Matrix.LookAtLHToRef(BABYLON.Vector3.Zero(), this._referencePoint, this.upVector, this._lookAtTemp);
  7336. BABYLON.Matrix.RotationYawPitchRollToRef(this.rotation.y, this.rotation.x, this.rotation.z, this._cameraRotationMatrix);
  7337. this._lookAtTemp.multiplyToRef(this._cameraRotationMatrix, this._tempMatrix);
  7338. this._lookAtTemp.invert();
  7339. this._tempMatrix.multiplyToRef(this._lookAtTemp, this._cameraRotationMatrix);
  7340. }
  7341. else {
  7342. BABYLON.Matrix.RotationYawPitchRollToRef(this.rotation.y, this.rotation.x, this.rotation.z, this._cameraRotationMatrix);
  7343. }
  7344. BABYLON.Vector3.TransformCoordinatesToRef(this._referencePoint, this._cameraRotationMatrix, this._transformedReferencePoint);
  7345. // Computing target and final matrix
  7346. this.position.addToRef(this._transformedReferencePoint, this._currentTarget);
  7347. }
  7348. else {
  7349. this._currentTarget.copyFrom(this._getLockedTargetPosition());
  7350. }
  7351. BABYLON.Matrix.LookAtLHToRef(this.position, this._currentTarget, this.upVector, this._viewMatrix);
  7352. return this._viewMatrix;
  7353. };
  7354. return TargetCamera;
  7355. })(BABYLON.Camera);
  7356. BABYLON.TargetCamera = TargetCamera;
  7357. })(BABYLON || (BABYLON = {}));
  7358. //# sourceMappingURL=babylon.targetCamera.js.map
  7359. var BABYLON;
  7360. (function (BABYLON) {
  7361. var FollowCamera = (function (_super) {
  7362. __extends(FollowCamera, _super);
  7363. function FollowCamera(name, position, scene) {
  7364. _super.call(this, name, position, scene);
  7365. this.radius = 12;
  7366. this.rotationOffset = 0;
  7367. this.heightOffset = 4;
  7368. this.cameraAcceleration = 0.05;
  7369. this.maxCameraSpeed = 20;
  7370. }
  7371. FollowCamera.prototype.getRadians = function (degrees) {
  7372. return degrees * Math.PI / 180;
  7373. };
  7374. FollowCamera.prototype.follow = function (cameraTarget) {
  7375. if (!cameraTarget)
  7376. return;
  7377. var radians = this.getRadians(this.rotationOffset) + cameraTarget.rotation.y;
  7378. var targetX = cameraTarget.position.x + Math.sin(radians) * this.radius;
  7379. var targetZ = cameraTarget.position.z + Math.cos(radians) * this.radius;
  7380. var dx = targetX - this.position.x;
  7381. var dy = (cameraTarget.position.y + this.heightOffset) - this.position.y;
  7382. var dz = (targetZ) - this.position.z;
  7383. var vx = dx * this.cameraAcceleration * 2; //this is set to .05
  7384. var vy = dy * this.cameraAcceleration;
  7385. var vz = dz * this.cameraAcceleration * 2;
  7386. if (vx > this.maxCameraSpeed || vx < -this.maxCameraSpeed) {
  7387. vx = vx < 1 ? -this.maxCameraSpeed : this.maxCameraSpeed;
  7388. }
  7389. if (vy > this.maxCameraSpeed || vy < -this.maxCameraSpeed) {
  7390. vy = vy < 1 ? -this.maxCameraSpeed : this.maxCameraSpeed;
  7391. }
  7392. if (vz > this.maxCameraSpeed || vz < -this.maxCameraSpeed) {
  7393. vz = vz < 1 ? -this.maxCameraSpeed : this.maxCameraSpeed;
  7394. }
  7395. this.position = new BABYLON.Vector3(this.position.x + vx, this.position.y + vy, this.position.z + vz);
  7396. this.setTarget(cameraTarget.position);
  7397. };
  7398. FollowCamera.prototype._update = function () {
  7399. _super.prototype._update.call(this);
  7400. this.follow(this.target);
  7401. };
  7402. return FollowCamera;
  7403. })(BABYLON.TargetCamera);
  7404. BABYLON.FollowCamera = FollowCamera;
  7405. })(BABYLON || (BABYLON = {}));
  7406. //# sourceMappingURL=babylon.followCamera.js.map
  7407. var BABYLON;
  7408. (function (BABYLON) {
  7409. var FreeCamera = (function (_super) {
  7410. __extends(FreeCamera, _super);
  7411. function FreeCamera(name, position, scene) {
  7412. _super.call(this, name, position, scene);
  7413. this.ellipsoid = new BABYLON.Vector3(0.5, 1, 0.5);
  7414. this.keysUp = [38];
  7415. this.keysDown = [40];
  7416. this.keysLeft = [37];
  7417. this.keysRight = [39];
  7418. this.checkCollisions = false;
  7419. this.applyGravity = false;
  7420. this.angularSensibility = 2000.0;
  7421. this._keys = [];
  7422. this._collider = new BABYLON.Collider();
  7423. this._needMoveForGravity = true;
  7424. this._oldPosition = BABYLON.Vector3.Zero();
  7425. this._diffPosition = BABYLON.Vector3.Zero();
  7426. this._newPosition = BABYLON.Vector3.Zero();
  7427. }
  7428. // Controls
  7429. FreeCamera.prototype.attachControl = function (element, noPreventDefault) {
  7430. var _this = this;
  7431. var previousPosition;
  7432. var engine = this.getEngine();
  7433. if (this._attachedElement) {
  7434. return;
  7435. }
  7436. this._attachedElement = element;
  7437. if (this._onMouseDown === undefined) {
  7438. this._onMouseDown = function (evt) {
  7439. previousPosition = {
  7440. x: evt.clientX,
  7441. y: evt.clientY
  7442. };
  7443. if (!noPreventDefault) {
  7444. evt.preventDefault();
  7445. }
  7446. };
  7447. this._onMouseUp = function (evt) {
  7448. previousPosition = null;
  7449. if (!noPreventDefault) {
  7450. evt.preventDefault();
  7451. }
  7452. };
  7453. this._onMouseOut = function (evt) {
  7454. previousPosition = null;
  7455. _this._keys = [];
  7456. if (!noPreventDefault) {
  7457. evt.preventDefault();
  7458. }
  7459. };
  7460. this._onMouseMove = function (evt) {
  7461. if (!previousPosition && !engine.isPointerLock) {
  7462. return;
  7463. }
  7464. var offsetX;
  7465. var offsetY;
  7466. if (!engine.isPointerLock) {
  7467. offsetX = evt.clientX - previousPosition.x;
  7468. offsetY = evt.clientY - previousPosition.y;
  7469. }
  7470. else {
  7471. offsetX = evt.movementX || evt.mozMovementX || evt.webkitMovementX || evt.msMovementX || 0;
  7472. offsetY = evt.movementY || evt.mozMovementY || evt.webkitMovementY || evt.msMovementY || 0;
  7473. }
  7474. _this.cameraRotation.y += offsetX / _this.angularSensibility;
  7475. _this.cameraRotation.x += offsetY / _this.angularSensibility;
  7476. previousPosition = {
  7477. x: evt.clientX,
  7478. y: evt.clientY
  7479. };
  7480. if (!noPreventDefault) {
  7481. evt.preventDefault();
  7482. }
  7483. };
  7484. this._onKeyDown = function (evt) {
  7485. if (_this.keysUp.indexOf(evt.keyCode) !== -1 || _this.keysDown.indexOf(evt.keyCode) !== -1 || _this.keysLeft.indexOf(evt.keyCode) !== -1 || _this.keysRight.indexOf(evt.keyCode) !== -1) {
  7486. var index = _this._keys.indexOf(evt.keyCode);
  7487. if (index === -1) {
  7488. _this._keys.push(evt.keyCode);
  7489. }
  7490. if (!noPreventDefault) {
  7491. evt.preventDefault();
  7492. }
  7493. }
  7494. };
  7495. this._onKeyUp = function (evt) {
  7496. if (_this.keysUp.indexOf(evt.keyCode) !== -1 || _this.keysDown.indexOf(evt.keyCode) !== -1 || _this.keysLeft.indexOf(evt.keyCode) !== -1 || _this.keysRight.indexOf(evt.keyCode) !== -1) {
  7497. var index = _this._keys.indexOf(evt.keyCode);
  7498. if (index >= 0) {
  7499. _this._keys.splice(index, 1);
  7500. }
  7501. if (!noPreventDefault) {
  7502. evt.preventDefault();
  7503. }
  7504. }
  7505. };
  7506. this._onLostFocus = function () {
  7507. _this._keys = [];
  7508. };
  7509. this._reset = function () {
  7510. _this._keys = [];
  7511. previousPosition = null;
  7512. _this.cameraDirection = new BABYLON.Vector3(0, 0, 0);
  7513. _this.cameraRotation = new BABYLON.Vector2(0, 0);
  7514. };
  7515. }
  7516. element.addEventListener("mousedown", this._onMouseDown, false);
  7517. element.addEventListener("mouseup", this._onMouseUp, false);
  7518. element.addEventListener("mouseout", this._onMouseOut, false);
  7519. element.addEventListener("mousemove", this._onMouseMove, false);
  7520. BABYLON.Tools.RegisterTopRootEvents([
  7521. { name: "keydown", handler: this._onKeyDown },
  7522. { name: "keyup", handler: this._onKeyUp },
  7523. { name: "blur", handler: this._onLostFocus }
  7524. ]);
  7525. };
  7526. FreeCamera.prototype.detachControl = function (element) {
  7527. if (this._attachedElement != element) {
  7528. return;
  7529. }
  7530. element.removeEventListener("mousedown", this._onMouseDown);
  7531. element.removeEventListener("mouseup", this._onMouseUp);
  7532. element.removeEventListener("mouseout", this._onMouseOut);
  7533. element.removeEventListener("mousemove", this._onMouseMove);
  7534. BABYLON.Tools.UnregisterTopRootEvents([
  7535. { name: "keydown", handler: this._onKeyDown },
  7536. { name: "keyup", handler: this._onKeyUp },
  7537. { name: "blur", handler: this._onLostFocus }
  7538. ]);
  7539. this._attachedElement = null;
  7540. if (this._reset) {
  7541. this._reset();
  7542. }
  7543. };
  7544. FreeCamera.prototype._collideWithWorld = function (velocity) {
  7545. var globalPosition;
  7546. if (this.parent) {
  7547. globalPosition = BABYLON.Vector3.TransformCoordinates(this.position, this.parent.getWorldMatrix());
  7548. }
  7549. else {
  7550. globalPosition = this.position;
  7551. }
  7552. globalPosition.subtractFromFloatsToRef(0, this.ellipsoid.y, 0, this._oldPosition);
  7553. this._collider.radius = this.ellipsoid;
  7554. this.getScene()._getNewPosition(this._oldPosition, velocity, this._collider, 3, this._newPosition);
  7555. this._newPosition.subtractToRef(this._oldPosition, this._diffPosition);
  7556. if (this._diffPosition.length() > BABYLON.Engine.CollisionsEpsilon) {
  7557. this.position.addInPlace(this._diffPosition);
  7558. if (this.onCollide) {
  7559. this.onCollide(this._collider.collidedMesh);
  7560. }
  7561. }
  7562. };
  7563. FreeCamera.prototype._checkInputs = function () {
  7564. if (!this._localDirection) {
  7565. this._localDirection = BABYLON.Vector3.Zero();
  7566. this._transformedDirection = BABYLON.Vector3.Zero();
  7567. }
  7568. for (var index = 0; index < this._keys.length; index++) {
  7569. var keyCode = this._keys[index];
  7570. var speed = this._computeLocalCameraSpeed();
  7571. if (this.keysLeft.indexOf(keyCode) !== -1) {
  7572. this._localDirection.copyFromFloats(-speed, 0, 0);
  7573. }
  7574. else if (this.keysUp.indexOf(keyCode) !== -1) {
  7575. this._localDirection.copyFromFloats(0, 0, speed);
  7576. }
  7577. else if (this.keysRight.indexOf(keyCode) !== -1) {
  7578. this._localDirection.copyFromFloats(speed, 0, 0);
  7579. }
  7580. else if (this.keysDown.indexOf(keyCode) !== -1) {
  7581. this._localDirection.copyFromFloats(0, 0, -speed);
  7582. }
  7583. this.getViewMatrix().invertToRef(this._cameraTransformMatrix);
  7584. BABYLON.Vector3.TransformNormalToRef(this._localDirection, this._cameraTransformMatrix, this._transformedDirection);
  7585. this.cameraDirection.addInPlace(this._transformedDirection);
  7586. }
  7587. };
  7588. FreeCamera.prototype._decideIfNeedsToMove = function () {
  7589. return this._needMoveForGravity || Math.abs(this.cameraDirection.x) > 0 || Math.abs(this.cameraDirection.y) > 0 || Math.abs(this.cameraDirection.z) > 0;
  7590. };
  7591. FreeCamera.prototype._updatePosition = function () {
  7592. if (this.checkCollisions && this.getScene().collisionsEnabled) {
  7593. this._collideWithWorld(this.cameraDirection);
  7594. if (this.applyGravity) {
  7595. var oldPosition = this.position;
  7596. this._collideWithWorld(this.getScene().gravity);
  7597. this._needMoveForGravity = (BABYLON.Vector3.DistanceSquared(oldPosition, this.position) != 0);
  7598. }
  7599. }
  7600. else {
  7601. this.position.addInPlace(this.cameraDirection);
  7602. }
  7603. };
  7604. FreeCamera.prototype._update = function () {
  7605. this._checkInputs();
  7606. _super.prototype._update.call(this);
  7607. };
  7608. return FreeCamera;
  7609. })(BABYLON.TargetCamera);
  7610. BABYLON.FreeCamera = FreeCamera;
  7611. })(BABYLON || (BABYLON = {}));
  7612. //# sourceMappingURL=babylon.freeCamera.js.map
  7613. var BABYLON;
  7614. (function (BABYLON) {
  7615. // We're mainly based on the logic defined into the FreeCamera code
  7616. var TouchCamera = (function (_super) {
  7617. __extends(TouchCamera, _super);
  7618. function TouchCamera(name, position, scene) {
  7619. _super.call(this, name, position, scene);
  7620. this._offsetX = null;
  7621. this._offsetY = null;
  7622. this._pointerCount = 0;
  7623. this._pointerPressed = [];
  7624. this.angularSensibility = 200000.0;
  7625. this.moveSensibility = 500.0;
  7626. }
  7627. TouchCamera.prototype.attachControl = function (canvas, noPreventDefault) {
  7628. var _this = this;
  7629. var previousPosition;
  7630. if (this._attachedCanvas) {
  7631. return;
  7632. }
  7633. this._attachedCanvas = canvas;
  7634. if (this._onPointerDown === undefined) {
  7635. this._onPointerDown = function (evt) {
  7636. if (!noPreventDefault) {
  7637. evt.preventDefault();
  7638. }
  7639. _this._pointerPressed.push(evt.pointerId);
  7640. if (_this._pointerPressed.length !== 1) {
  7641. return;
  7642. }
  7643. previousPosition = {
  7644. x: evt.clientX,
  7645. y: evt.clientY
  7646. };
  7647. };
  7648. this._onPointerUp = function (evt) {
  7649. if (!noPreventDefault) {
  7650. evt.preventDefault();
  7651. }
  7652. var index = _this._pointerPressed.indexOf(evt.pointerId);
  7653. if (index === -1) {
  7654. return;
  7655. }
  7656. _this._pointerPressed.splice(index, 1);
  7657. if (index != 0) {
  7658. return;
  7659. }
  7660. previousPosition = null;
  7661. _this._offsetX = null;
  7662. _this._offsetY = null;
  7663. };
  7664. this._onPointerMove = function (evt) {
  7665. if (!noPreventDefault) {
  7666. evt.preventDefault();
  7667. }
  7668. if (!previousPosition) {
  7669. return;
  7670. }
  7671. var index = _this._pointerPressed.indexOf(evt.pointerId);
  7672. if (index != 0) {
  7673. return;
  7674. }
  7675. _this._offsetX = evt.clientX - previousPosition.x;
  7676. _this._offsetY = -(evt.clientY - previousPosition.y);
  7677. };
  7678. this._onLostFocus = function () {
  7679. _this._offsetX = null;
  7680. _this._offsetY = null;
  7681. };
  7682. }
  7683. canvas.addEventListener("pointerdown", this._onPointerDown);
  7684. canvas.addEventListener("pointerup", this._onPointerUp);
  7685. canvas.addEventListener("pointerout", this._onPointerUp);
  7686. canvas.addEventListener("pointermove", this._onPointerMove);
  7687. BABYLON.Tools.RegisterTopRootEvents([
  7688. { name: "blur", handler: this._onLostFocus }
  7689. ]);
  7690. };
  7691. TouchCamera.prototype.detachControl = function (canvas) {
  7692. if (this._attachedCanvas != canvas) {
  7693. return;
  7694. }
  7695. canvas.removeEventListener("pointerdown", this._onPointerDown);
  7696. canvas.removeEventListener("pointerup", this._onPointerUp);
  7697. canvas.removeEventListener("pointerout", this._onPointerUp);
  7698. canvas.removeEventListener("pointermove", this._onPointerMove);
  7699. BABYLON.Tools.UnregisterTopRootEvents([
  7700. { name: "blur", handler: this._onLostFocus }
  7701. ]);
  7702. this._attachedCanvas = null;
  7703. };
  7704. TouchCamera.prototype._checkInputs = function () {
  7705. if (!this._offsetX) {
  7706. return;
  7707. }
  7708. this.cameraRotation.y += this._offsetX / this.angularSensibility;
  7709. if (this._pointerPressed.length > 1) {
  7710. this.cameraRotation.x += -this._offsetY / this.angularSensibility;
  7711. }
  7712. else {
  7713. var speed = this._computeLocalCameraSpeed();
  7714. var direction = new BABYLON.Vector3(0, 0, speed * this._offsetY / this.moveSensibility);
  7715. BABYLON.Matrix.RotationYawPitchRollToRef(this.rotation.y, this.rotation.x, 0, this._cameraRotationMatrix);
  7716. this.cameraDirection.addInPlace(BABYLON.Vector3.TransformCoordinates(direction, this._cameraRotationMatrix));
  7717. }
  7718. };
  7719. return TouchCamera;
  7720. })(BABYLON.FreeCamera);
  7721. BABYLON.TouchCamera = TouchCamera;
  7722. })(BABYLON || (BABYLON = {}));
  7723. //# sourceMappingURL=babylon.touchCamera.js.map
  7724. var BABYLON;
  7725. (function (BABYLON) {
  7726. // We're mainly based on the logic defined into the FreeCamera code
  7727. var DeviceOrientationCamera = (function (_super) {
  7728. __extends(DeviceOrientationCamera, _super);
  7729. function DeviceOrientationCamera(name, position, scene) {
  7730. var _this = this;
  7731. _super.call(this, name, position, scene);
  7732. this._offsetX = null;
  7733. this._offsetY = null;
  7734. this._orientationGamma = 0;
  7735. this._orientationBeta = 0;
  7736. this._initialOrientationGamma = 0;
  7737. this._initialOrientationBeta = 0;
  7738. this.angularSensibility = 10000.0;
  7739. this.moveSensibility = 50.0;
  7740. window.addEventListener("resize", function () {
  7741. _this._initialOrientationGamma = null;
  7742. }, false);
  7743. }
  7744. DeviceOrientationCamera.prototype.attachControl = function (canvas, noPreventDefault) {
  7745. var _this = this;
  7746. if (this._attachedCanvas) {
  7747. return;
  7748. }
  7749. this._attachedCanvas = canvas;
  7750. if (!this._orientationChanged) {
  7751. this._orientationChanged = function (evt) {
  7752. if (!_this._initialOrientationGamma) {
  7753. _this._initialOrientationGamma = evt.gamma;
  7754. _this._initialOrientationBeta = evt.beta;
  7755. }
  7756. _this._orientationGamma = evt.gamma;
  7757. _this._orientationBeta = evt.beta;
  7758. _this._offsetY = (_this._initialOrientationBeta - _this._orientationBeta);
  7759. _this._offsetX = (_this._initialOrientationGamma - _this._orientationGamma);
  7760. };
  7761. }
  7762. window.addEventListener("deviceorientation", this._orientationChanged);
  7763. };
  7764. DeviceOrientationCamera.prototype.detachControl = function (canvas) {
  7765. if (this._attachedCanvas != canvas) {
  7766. return;
  7767. }
  7768. window.removeEventListener("deviceorientation", this._orientationChanged);
  7769. this._attachedCanvas = null;
  7770. this._orientationGamma = 0;
  7771. this._orientationBeta = 0;
  7772. this._initialOrientationGamma = 0;
  7773. this._initialOrientationBeta = 0;
  7774. };
  7775. DeviceOrientationCamera.prototype._checkInputs = function () {
  7776. if (!this._offsetX) {
  7777. return;
  7778. }
  7779. this.cameraRotation.y -= this._offsetX / this.angularSensibility;
  7780. var speed = this._computeLocalCameraSpeed();
  7781. var direction = new BABYLON.Vector3(0, 0, speed * this._offsetY / this.moveSensibility);
  7782. BABYLON.Matrix.RotationYawPitchRollToRef(this.rotation.y, this.rotation.x, 0, this._cameraRotationMatrix);
  7783. this.cameraDirection.addInPlace(BABYLON.Vector3.TransformCoordinates(direction, this._cameraRotationMatrix));
  7784. };
  7785. return DeviceOrientationCamera;
  7786. })(BABYLON.FreeCamera);
  7787. BABYLON.DeviceOrientationCamera = DeviceOrientationCamera;
  7788. })(BABYLON || (BABYLON = {}));
  7789. //# sourceMappingURL=babylon.deviceOrientationCamera.js.map
  7790. var BABYLON;
  7791. (function (BABYLON) {
  7792. var eventPrefix = BABYLON.Tools.GetPointerPrefix();
  7793. var ArcRotateCamera = (function (_super) {
  7794. __extends(ArcRotateCamera, _super);
  7795. function ArcRotateCamera(name, alpha, beta, radius, target, scene) {
  7796. _super.call(this, name, BABYLON.Vector3.Zero(), scene);
  7797. this.alpha = alpha;
  7798. this.beta = beta;
  7799. this.radius = radius;
  7800. this.target = target;
  7801. this.inertialAlphaOffset = 0;
  7802. this.inertialBetaOffset = 0;
  7803. this.inertialRadiusOffset = 0;
  7804. this.lowerAlphaLimit = null;
  7805. this.upperAlphaLimit = null;
  7806. this.lowerBetaLimit = 0.01;
  7807. this.upperBetaLimit = Math.PI;
  7808. this.lowerRadiusLimit = null;
  7809. this.upperRadiusLimit = null;
  7810. this.angularSensibility = 1000.0;
  7811. this.wheelPrecision = 3.0;
  7812. this.pinchPrecision = 2.0;
  7813. this.keysUp = [38];
  7814. this.keysDown = [40];
  7815. this.keysLeft = [37];
  7816. this.keysRight = [39];
  7817. this.zoomOnFactor = 1;
  7818. this.targetScreenOffset = BABYLON.Vector2.Zero();
  7819. this._keys = [];
  7820. this._viewMatrix = new BABYLON.Matrix();
  7821. this.checkCollisions = false;
  7822. this.collisionRadius = new BABYLON.Vector3(0.5, 0.5, 0.5);
  7823. this._collider = new BABYLON.Collider();
  7824. this._previousPosition = BABYLON.Vector3.Zero();
  7825. this._collisionVelocity = BABYLON.Vector3.Zero();
  7826. this._newPosition = BABYLON.Vector3.Zero();
  7827. if (!this.target) {
  7828. this.target = BABYLON.Vector3.Zero();
  7829. }
  7830. this.getViewMatrix();
  7831. }
  7832. ArcRotateCamera.prototype._getTargetPosition = function () {
  7833. return this.target.position || this.target;
  7834. };
  7835. // Cache
  7836. ArcRotateCamera.prototype._initCache = function () {
  7837. _super.prototype._initCache.call(this);
  7838. this._cache.target = new BABYLON.Vector3(Number.MAX_VALUE, Number.MAX_VALUE, Number.MAX_VALUE);
  7839. this._cache.alpha = undefined;
  7840. this._cache.beta = undefined;
  7841. this._cache.radius = undefined;
  7842. this._cache.targetScreenOffset = undefined;
  7843. };
  7844. ArcRotateCamera.prototype._updateCache = function (ignoreParentClass) {
  7845. if (!ignoreParentClass) {
  7846. _super.prototype._updateCache.call(this);
  7847. }
  7848. this._cache.target.copyFrom(this._getTargetPosition());
  7849. this._cache.alpha = this.alpha;
  7850. this._cache.beta = this.beta;
  7851. this._cache.radius = this.radius;
  7852. this._cache.targetScreenOffset = this.targetScreenOffset.clone();
  7853. };
  7854. // Synchronized
  7855. ArcRotateCamera.prototype._isSynchronizedViewMatrix = function () {
  7856. if (!_super.prototype._isSynchronizedViewMatrix.call(this))
  7857. return false;
  7858. return this._cache.target.equals(this._getTargetPosition()) && this._cache.alpha === this.alpha && this._cache.beta === this.beta && this._cache.radius === this.radius && this._cache.targetScreenOffset.equals(this.targetScreenOffset);
  7859. };
  7860. // Methods
  7861. ArcRotateCamera.prototype.attachControl = function (element, noPreventDefault) {
  7862. var _this = this;
  7863. var cacheSoloPointer; // cache pointer object for better perf on camera rotation
  7864. var previousPinchDistance = 0;
  7865. var pointers = new BABYLON.SmartCollection();
  7866. if (this._attachedElement) {
  7867. return;
  7868. }
  7869. this._attachedElement = element;
  7870. var engine = this.getEngine();
  7871. if (this._onPointerDown === undefined) {
  7872. this._onPointerDown = function (evt) {
  7873. pointers.add(evt.pointerId, { x: evt.clientX, y: evt.clientY, type: evt.pointerType });
  7874. cacheSoloPointer = pointers.item(evt.pointerId);
  7875. if (!noPreventDefault) {
  7876. evt.preventDefault();
  7877. }
  7878. };
  7879. this._onPointerUp = function (evt) {
  7880. cacheSoloPointer = null;
  7881. previousPinchDistance = 0;
  7882. pointers.remove(evt.pointerId);
  7883. if (!noPreventDefault) {
  7884. evt.preventDefault();
  7885. }
  7886. };
  7887. this._onPointerMove = function (evt) {
  7888. if (!noPreventDefault) {
  7889. evt.preventDefault();
  7890. }
  7891. switch (pointers.count) {
  7892. case 1:
  7893. //var offsetX = evt.clientX - pointers.item(evt.pointerId).x;
  7894. //var offsetY = evt.clientY - pointers.item(evt.pointerId).y;
  7895. var offsetX = evt.clientX - cacheSoloPointer.x;
  7896. var offsetY = evt.clientY - cacheSoloPointer.y;
  7897. _this.inertialAlphaOffset -= offsetX / _this.angularSensibility;
  7898. _this.inertialBetaOffset -= offsetY / _this.angularSensibility;
  7899. //pointers.item(evt.pointerId).x = evt.clientX;
  7900. //pointers.item(evt.pointerId).y = evt.clientY;
  7901. cacheSoloPointer.x = evt.clientX;
  7902. cacheSoloPointer.y = evt.clientY;
  7903. break;
  7904. case 2:
  7905. //if (noPreventDefault) { evt.preventDefault(); } //if pinch gesture, could be usefull to force preventDefault to avoid html page scroll/zoom in some mobile browsers
  7906. pointers.item(evt.pointerId).x = evt.clientX;
  7907. pointers.item(evt.pointerId).y = evt.clientY;
  7908. var direction = 1;
  7909. var distX = pointers.getItemByIndex(0).x - pointers.getItemByIndex(1).x;
  7910. var distY = pointers.getItemByIndex(0).y - pointers.getItemByIndex(1).y;
  7911. var pinchSquaredDistance = (distX * distX) + (distY * distY);
  7912. if (previousPinchDistance === 0) {
  7913. previousPinchDistance = pinchSquaredDistance;
  7914. return;
  7915. }
  7916. if (pinchSquaredDistance !== previousPinchDistance) {
  7917. if (pinchSquaredDistance > previousPinchDistance) {
  7918. direction = -1;
  7919. }
  7920. _this.inertialRadiusOffset += (pinchSquaredDistance - previousPinchDistance) / (_this.pinchPrecision * _this.wheelPrecision * _this.angularSensibility);
  7921. previousPinchDistance = pinchSquaredDistance;
  7922. }
  7923. break;
  7924. default:
  7925. if (pointers.item(evt.pointerId)) {
  7926. pointers.item(evt.pointerId).x = evt.clientX;
  7927. pointers.item(evt.pointerId).y = evt.clientY;
  7928. }
  7929. }
  7930. };
  7931. this._onMouseMove = function (evt) {
  7932. if (!engine.isPointerLock) {
  7933. return;
  7934. }
  7935. var offsetX = evt.movementX || evt.mozMovementX || evt.webkitMovementX || evt.msMovementX || 0;
  7936. var offsetY = evt.movementY || evt.mozMovementY || evt.webkitMovementY || evt.msMovementY || 0;
  7937. _this.inertialAlphaOffset -= offsetX / _this.angularSensibility;
  7938. _this.inertialBetaOffset -= offsetY / _this.angularSensibility;
  7939. if (!noPreventDefault) {
  7940. evt.preventDefault();
  7941. }
  7942. };
  7943. this._wheel = function (event) {
  7944. var delta = 0;
  7945. if (event.wheelDelta) {
  7946. delta = event.wheelDelta / (_this.wheelPrecision * 40);
  7947. }
  7948. else if (event.detail) {
  7949. delta = -event.detail / _this.wheelPrecision;
  7950. }
  7951. if (delta)
  7952. _this.inertialRadiusOffset += delta;
  7953. if (event.preventDefault) {
  7954. if (!noPreventDefault) {
  7955. event.preventDefault();
  7956. }
  7957. }
  7958. };
  7959. this._onKeyDown = function (evt) {
  7960. if (_this.keysUp.indexOf(evt.keyCode) !== -1 || _this.keysDown.indexOf(evt.keyCode) !== -1 || _this.keysLeft.indexOf(evt.keyCode) !== -1 || _this.keysRight.indexOf(evt.keyCode) !== -1) {
  7961. var index = _this._keys.indexOf(evt.keyCode);
  7962. if (index === -1) {
  7963. _this._keys.push(evt.keyCode);
  7964. }
  7965. if (evt.preventDefault) {
  7966. if (!noPreventDefault) {
  7967. evt.preventDefault();
  7968. }
  7969. }
  7970. }
  7971. };
  7972. this._onKeyUp = function (evt) {
  7973. if (_this.keysUp.indexOf(evt.keyCode) !== -1 || _this.keysDown.indexOf(evt.keyCode) !== -1 || _this.keysLeft.indexOf(evt.keyCode) !== -1 || _this.keysRight.indexOf(evt.keyCode) !== -1) {
  7974. var index = _this._keys.indexOf(evt.keyCode);
  7975. if (index >= 0) {
  7976. _this._keys.splice(index, 1);
  7977. }
  7978. if (evt.preventDefault) {
  7979. if (!noPreventDefault) {
  7980. evt.preventDefault();
  7981. }
  7982. }
  7983. }
  7984. };
  7985. this._onLostFocus = function () {
  7986. _this._keys = [];
  7987. pointers.empty();
  7988. previousPinchDistance = 0;
  7989. cacheSoloPointer = null;
  7990. };
  7991. this._onGestureStart = function (e) {
  7992. if (window.MSGesture === undefined) {
  7993. return;
  7994. }
  7995. if (!_this._MSGestureHandler) {
  7996. _this._MSGestureHandler = new MSGesture();
  7997. _this._MSGestureHandler.target = element;
  7998. }
  7999. _this._MSGestureHandler.addPointer(e.pointerId);
  8000. };
  8001. this._onGesture = function (e) {
  8002. _this.radius *= e.scale;
  8003. if (e.preventDefault) {
  8004. if (!noPreventDefault) {
  8005. e.stopPropagation();
  8006. e.preventDefault();
  8007. }
  8008. }
  8009. };
  8010. this._reset = function () {
  8011. _this._keys = [];
  8012. _this.inertialAlphaOffset = 0;
  8013. _this.inertialBetaOffset = 0;
  8014. _this.inertialRadiusOffset = 0;
  8015. pointers.empty();
  8016. previousPinchDistance = 0;
  8017. cacheSoloPointer = null;
  8018. };
  8019. }
  8020. element.addEventListener(eventPrefix + "down", this._onPointerDown, false);
  8021. element.addEventListener(eventPrefix + "up", this._onPointerUp, false);
  8022. element.addEventListener(eventPrefix + "out", this._onPointerUp, false);
  8023. element.addEventListener(eventPrefix + "move", this._onPointerMove, false);
  8024. element.addEventListener("mousemove", this._onMouseMove, false);
  8025. element.addEventListener("MSPointerDown", this._onGestureStart, false);
  8026. element.addEventListener("MSGestureChange", this._onGesture, false);
  8027. element.addEventListener('mousewheel', this._wheel, false);
  8028. element.addEventListener('DOMMouseScroll', this._wheel, false);
  8029. BABYLON.Tools.RegisterTopRootEvents([
  8030. { name: "keydown", handler: this._onKeyDown },
  8031. { name: "keyup", handler: this._onKeyUp },
  8032. { name: "blur", handler: this._onLostFocus }
  8033. ]);
  8034. };
  8035. ArcRotateCamera.prototype.detachControl = function (element) {
  8036. if (this._attachedElement !== element) {
  8037. return;
  8038. }
  8039. element.removeEventListener(eventPrefix + "down", this._onPointerDown);
  8040. element.removeEventListener(eventPrefix + "up", this._onPointerUp);
  8041. element.removeEventListener(eventPrefix + "out", this._onPointerUp);
  8042. element.removeEventListener(eventPrefix + "move", this._onPointerMove);
  8043. element.removeEventListener("mousemove", this._onMouseMove);
  8044. element.removeEventListener("MSPointerDown", this._onGestureStart);
  8045. element.removeEventListener("MSGestureChange", this._onGesture);
  8046. element.removeEventListener('mousewheel', this._wheel);
  8047. element.removeEventListener('DOMMouseScroll', this._wheel);
  8048. BABYLON.Tools.UnregisterTopRootEvents([
  8049. { name: "keydown", handler: this._onKeyDown },
  8050. { name: "keyup", handler: this._onKeyUp },
  8051. { name: "blur", handler: this._onLostFocus }
  8052. ]);
  8053. this._MSGestureHandler = null;
  8054. this._attachedElement = null;
  8055. if (this._reset) {
  8056. this._reset();
  8057. }
  8058. };
  8059. ArcRotateCamera.prototype._update = function () {
  8060. for (var index = 0; index < this._keys.length; index++) {
  8061. var keyCode = this._keys[index];
  8062. if (this.keysLeft.indexOf(keyCode) !== -1) {
  8063. this.inertialAlphaOffset -= 0.01;
  8064. }
  8065. else if (this.keysUp.indexOf(keyCode) !== -1) {
  8066. this.inertialBetaOffset -= 0.01;
  8067. }
  8068. else if (this.keysRight.indexOf(keyCode) !== -1) {
  8069. this.inertialAlphaOffset += 0.01;
  8070. }
  8071. else if (this.keysDown.indexOf(keyCode) !== -1) {
  8072. this.inertialBetaOffset += 0.01;
  8073. }
  8074. }
  8075. // Inertia
  8076. if (this.inertialAlphaOffset !== 0 || this.inertialBetaOffset !== 0 || this.inertialRadiusOffset != 0) {
  8077. this.alpha += this.inertialAlphaOffset;
  8078. this.beta += this.inertialBetaOffset;
  8079. this.radius -= this.inertialRadiusOffset;
  8080. this.inertialAlphaOffset *= this.inertia;
  8081. this.inertialBetaOffset *= this.inertia;
  8082. this.inertialRadiusOffset *= this.inertia;
  8083. if (Math.abs(this.inertialAlphaOffset) < BABYLON.Engine.Epsilon)
  8084. this.inertialAlphaOffset = 0;
  8085. if (Math.abs(this.inertialBetaOffset) < BABYLON.Engine.Epsilon)
  8086. this.inertialBetaOffset = 0;
  8087. if (Math.abs(this.inertialRadiusOffset) < BABYLON.Engine.Epsilon)
  8088. this.inertialRadiusOffset = 0;
  8089. }
  8090. // Limits
  8091. if (this.lowerAlphaLimit && this.alpha < this.lowerAlphaLimit) {
  8092. this.alpha = this.lowerAlphaLimit;
  8093. }
  8094. if (this.upperAlphaLimit && this.alpha > this.upperAlphaLimit) {
  8095. this.alpha = this.upperAlphaLimit;
  8096. }
  8097. if (this.lowerBetaLimit && this.beta < this.lowerBetaLimit) {
  8098. this.beta = this.lowerBetaLimit;
  8099. }
  8100. if (this.upperBetaLimit && this.beta > this.upperBetaLimit) {
  8101. this.beta = this.upperBetaLimit;
  8102. }
  8103. if (this.lowerRadiusLimit && this.radius < this.lowerRadiusLimit) {
  8104. this.radius = this.lowerRadiusLimit;
  8105. }
  8106. if (this.upperRadiusLimit && this.radius > this.upperRadiusLimit) {
  8107. this.radius = this.upperRadiusLimit;
  8108. }
  8109. };
  8110. ArcRotateCamera.prototype.setPosition = function (position) {
  8111. var radiusv3 = position.subtract(this._getTargetPosition());
  8112. this.radius = radiusv3.length();
  8113. // Alpha
  8114. this.alpha = Math.acos(radiusv3.x / Math.sqrt(Math.pow(radiusv3.x, 2) + Math.pow(radiusv3.z, 2)));
  8115. if (radiusv3.z < 0) {
  8116. this.alpha = 2 * Math.PI - this.alpha;
  8117. }
  8118. // Beta
  8119. this.beta = Math.acos(radiusv3.y / this.radius);
  8120. };
  8121. ArcRotateCamera.prototype._getViewMatrix = function () {
  8122. // Compute
  8123. var cosa = Math.cos(this.alpha);
  8124. var sina = Math.sin(this.alpha);
  8125. var cosb = Math.cos(this.beta);
  8126. var sinb = Math.sin(this.beta);
  8127. var target = this._getTargetPosition();
  8128. target.addToRef(new BABYLON.Vector3(this.radius * cosa * sinb, this.radius * cosb, this.radius * sina * sinb), this.position);
  8129. if (this.checkCollisions) {
  8130. this._collider.radius = this.collisionRadius;
  8131. this.position.subtractToRef(this._previousPosition, this._collisionVelocity);
  8132. this.getScene()._getNewPosition(this._previousPosition, this._collisionVelocity, this._collider, 3, this._newPosition);
  8133. if (!this._newPosition.equalsWithEpsilon(this.position)) {
  8134. this.position.copyFrom(this._previousPosition);
  8135. this.alpha = this._previousAlpha;
  8136. this.beta = this._previousBeta;
  8137. this.radius = this._previousRadius;
  8138. if (this.onCollide) {
  8139. this.onCollide(this._collider.collidedMesh);
  8140. }
  8141. }
  8142. }
  8143. BABYLON.Matrix.LookAtLHToRef(this.position, target, this.upVector, this._viewMatrix);
  8144. this._previousAlpha = this.alpha;
  8145. this._previousBeta = this.beta;
  8146. this._previousRadius = this.radius;
  8147. this._previousPosition.copyFrom(this.position);
  8148. this._viewMatrix.m[12] += this.targetScreenOffset.x;
  8149. this._viewMatrix.m[13] += this.targetScreenOffset.y;
  8150. return this._viewMatrix;
  8151. };
  8152. ArcRotateCamera.prototype.zoomOn = function (meshes) {
  8153. meshes = meshes || this.getScene().meshes;
  8154. var minMaxVector = BABYLON.Mesh.MinMax(meshes);
  8155. var distance = BABYLON.Vector3.Distance(minMaxVector.min, minMaxVector.max);
  8156. this.radius = distance * this.zoomOnFactor;
  8157. this.focusOn({ min: minMaxVector.min, max: minMaxVector.max, distance: distance });
  8158. };
  8159. ArcRotateCamera.prototype.focusOn = function (meshesOrMinMaxVectorAndDistance) {
  8160. var meshesOrMinMaxVector;
  8161. var distance;
  8162. if (meshesOrMinMaxVectorAndDistance.min === undefined) {
  8163. meshesOrMinMaxVector = meshesOrMinMaxVectorAndDistance || this.getScene().meshes;
  8164. meshesOrMinMaxVector = BABYLON.Mesh.MinMax(meshesOrMinMaxVector);
  8165. distance = BABYLON.Vector3.Distance(meshesOrMinMaxVector.min, meshesOrMinMaxVector.max);
  8166. }
  8167. else {
  8168. meshesOrMinMaxVector = meshesOrMinMaxVectorAndDistance;
  8169. distance = meshesOrMinMaxVectorAndDistance.distance;
  8170. }
  8171. this.target = BABYLON.Mesh.Center(meshesOrMinMaxVector);
  8172. this.maxZ = distance * 2;
  8173. };
  8174. return ArcRotateCamera;
  8175. })(BABYLON.Camera);
  8176. BABYLON.ArcRotateCamera = ArcRotateCamera;
  8177. })(BABYLON || (BABYLON = {}));
  8178. //# sourceMappingURL=babylon.arcRotateCamera.js.mapvar BABYLON;
  8179. (function (BABYLON) {
  8180. /**
  8181. * Represents a scene to be rendered by the engine.
  8182. * @see http://doc.babylonjs.com/page.php?p=21911
  8183. */
  8184. var Scene = (function () {
  8185. /**
  8186. * @constructor
  8187. * @param {BABYLON.Engine} engine - the engine to be used to render this scene.
  8188. */
  8189. function Scene(engine) {
  8190. // Members
  8191. this.autoClear = true;
  8192. this.clearColor = new BABYLON.Color3(0.2, 0.2, 0.3);
  8193. this.ambientColor = new BABYLON.Color3(0, 0, 0);
  8194. this.forceWireframe = false;
  8195. this.forcePointsCloud = false;
  8196. this.forceShowBoundingBoxes = false;
  8197. this.animationsEnabled = true;
  8198. this.cameraToUseForPointers = null; // Define this parameter if you are using multiple cameras and you want to specify which one should be used for pointer position
  8199. // Fog
  8200. /**
  8201. * is fog enabled on this scene.
  8202. * @type {boolean}
  8203. */
  8204. this.fogEnabled = true;
  8205. this.fogMode = Scene.FOGMODE_NONE;
  8206. this.fogColor = new BABYLON.Color3(0.2, 0.2, 0.3);
  8207. this.fogDensity = 0.1;
  8208. this.fogStart = 0;
  8209. this.fogEnd = 1000.0;
  8210. // Lights
  8211. /**
  8212. * is shadow enabled on this scene.
  8213. * @type {boolean}
  8214. */
  8215. this.shadowsEnabled = true;
  8216. /**
  8217. * is light enabled on this scene.
  8218. * @type {boolean}
  8219. */
  8220. this.lightsEnabled = true;
  8221. /**
  8222. * All of the lights added to this scene.
  8223. * @see BABYLON.Light
  8224. * @type {BABYLON.Light[]}
  8225. */
  8226. this.lights = new Array();
  8227. // Cameras
  8228. /**
  8229. * All of the cameras added to this scene.
  8230. * @see BABYLON.Camera
  8231. * @type {BABYLON.Camera[]}
  8232. */
  8233. this.cameras = new Array();
  8234. this.activeCameras = new Array();
  8235. // Meshes
  8236. /**
  8237. * All of the (abstract) meshes added to this scene.
  8238. * @see BABYLON.AbstractMesh
  8239. * @type {BABYLON.AbstractMesh[]}
  8240. */
  8241. this.meshes = new Array();
  8242. // Geometries
  8243. this._geometries = new Array();
  8244. this.materials = new Array();
  8245. this.multiMaterials = new Array();
  8246. this.defaultMaterial = new BABYLON.StandardMaterial("default material", this);
  8247. // Textures
  8248. this.texturesEnabled = true;
  8249. this.textures = new Array();
  8250. // Particles
  8251. this.particlesEnabled = true;
  8252. this.particleSystems = new Array();
  8253. // Sprites
  8254. this.spritesEnabled = true;
  8255. this.spriteManagers = new Array();
  8256. // Layers
  8257. this.layers = new Array();
  8258. // Skeletons
  8259. this.skeletonsEnabled = true;
  8260. this.skeletons = new Array();
  8261. // Lens flares
  8262. this.lensFlaresEnabled = true;
  8263. this.lensFlareSystems = new Array();
  8264. // Collisions
  8265. this.collisionsEnabled = true;
  8266. this.gravity = new BABYLON.Vector3(0, -9.0, 0);
  8267. // Postprocesses
  8268. this.postProcessesEnabled = true;
  8269. // Customs render targets
  8270. this.renderTargetsEnabled = true;
  8271. this.dumpNextRenderTargets = false;
  8272. this.customRenderTargets = new Array();
  8273. // Imported meshes
  8274. this.importedMeshesFiles = new Array();
  8275. this._actionManagers = new Array();
  8276. this._meshesForIntersections = new BABYLON.SmartArray(256);
  8277. // Procedural textures
  8278. this.proceduralTexturesEnabled = true;
  8279. this._proceduralTextures = new Array();
  8280. this.soundTracks = new Array();
  8281. this._audioEnabled = true;
  8282. this._headphone = false;
  8283. this._totalVertices = 0;
  8284. this._activeIndices = 0;
  8285. this._activeParticles = 0;
  8286. this._lastFrameDuration = 0;
  8287. this._evaluateActiveMeshesDuration = 0;
  8288. this._renderTargetsDuration = 0;
  8289. this._particlesDuration = 0;
  8290. this._renderDuration = 0;
  8291. this._spritesDuration = 0;
  8292. this._animationRatio = 0;
  8293. this._renderId = 0;
  8294. this._executeWhenReadyTimeoutId = -1;
  8295. this._toBeDisposed = new BABYLON.SmartArray(256);
  8296. this._onReadyCallbacks = new Array();
  8297. this._pendingData = []; //ANY
  8298. this._onBeforeRenderCallbacks = new Array();
  8299. this._onAfterRenderCallbacks = new Array();
  8300. this._activeMeshes = new BABYLON.SmartArray(256);
  8301. this._processedMaterials = new BABYLON.SmartArray(256);
  8302. this._renderTargets = new BABYLON.SmartArray(256);
  8303. this._activeParticleSystems = new BABYLON.SmartArray(256);
  8304. this._activeSkeletons = new BABYLON.SmartArray(32);
  8305. this._activeBones = 0;
  8306. this._activeAnimatables = new Array();
  8307. this._transformMatrix = BABYLON.Matrix.Zero();
  8308. this._scaledPosition = BABYLON.Vector3.Zero();
  8309. this._scaledVelocity = BABYLON.Vector3.Zero();
  8310. this._uniqueIdCounter = 0;
  8311. this._engine = engine;
  8312. engine.scenes.push(this);
  8313. this._renderingManager = new BABYLON.RenderingManager(this);
  8314. this.postProcessManager = new BABYLON.PostProcessManager(this);
  8315. this.postProcessRenderPipelineManager = new BABYLON.PostProcessRenderPipelineManager();
  8316. this._boundingBoxRenderer = new BABYLON.BoundingBoxRenderer(this);
  8317. this._outlineRenderer = new BABYLON.OutlineRenderer(this);
  8318. this.attachControl();
  8319. this._debugLayer = new BABYLON.DebugLayer(this);
  8320. this.mainSoundTrack = new BABYLON.SoundTrack(this, { mainTrack: true });
  8321. //simplification queue
  8322. this.simplificationQueue = new BABYLON.SimplificationQueue();
  8323. }
  8324. Object.defineProperty(Scene, "FOGMODE_NONE", {
  8325. get: function () {
  8326. return Scene._FOGMODE_NONE;
  8327. },
  8328. enumerable: true,
  8329. configurable: true
  8330. });
  8331. Object.defineProperty(Scene, "FOGMODE_EXP", {
  8332. get: function () {
  8333. return Scene._FOGMODE_EXP;
  8334. },
  8335. enumerable: true,
  8336. configurable: true
  8337. });
  8338. Object.defineProperty(Scene, "FOGMODE_EXP2", {
  8339. get: function () {
  8340. return Scene._FOGMODE_EXP2;
  8341. },
  8342. enumerable: true,
  8343. configurable: true
  8344. });
  8345. Object.defineProperty(Scene, "FOGMODE_LINEAR", {
  8346. get: function () {
  8347. return Scene._FOGMODE_LINEAR;
  8348. },
  8349. enumerable: true,
  8350. configurable: true
  8351. });
  8352. Object.defineProperty(Scene.prototype, "debugLayer", {
  8353. // Properties
  8354. get: function () {
  8355. return this._debugLayer;
  8356. },
  8357. enumerable: true,
  8358. configurable: true
  8359. });
  8360. Object.defineProperty(Scene.prototype, "meshUnderPointer", {
  8361. /**
  8362. * The mesh that is currently under the pointer.
  8363. * @return {BABYLON.AbstractMesh} mesh under the pointer/mouse cursor or null if none.
  8364. */
  8365. get: function () {
  8366. return this._meshUnderPointer;
  8367. },
  8368. enumerable: true,
  8369. configurable: true
  8370. });
  8371. Object.defineProperty(Scene.prototype, "pointerX", {
  8372. /**
  8373. * Current on-screen X position of the pointer
  8374. * @return {number} X position of the pointer
  8375. */
  8376. get: function () {
  8377. return this._pointerX;
  8378. },
  8379. enumerable: true,
  8380. configurable: true
  8381. });
  8382. Object.defineProperty(Scene.prototype, "pointerY", {
  8383. /**
  8384. * Current on-screen Y position of the pointer
  8385. * @return {number} Y position of the pointer
  8386. */
  8387. get: function () {
  8388. return this._pointerY;
  8389. },
  8390. enumerable: true,
  8391. configurable: true
  8392. });
  8393. Scene.prototype.getCachedMaterial = function () {
  8394. return this._cachedMaterial;
  8395. };
  8396. Scene.prototype.getBoundingBoxRenderer = function () {
  8397. return this._boundingBoxRenderer;
  8398. };
  8399. Scene.prototype.getOutlineRenderer = function () {
  8400. return this._outlineRenderer;
  8401. };
  8402. Scene.prototype.getEngine = function () {
  8403. return this._engine;
  8404. };
  8405. Scene.prototype.getTotalVertices = function () {
  8406. return this._totalVertices;
  8407. };
  8408. Scene.prototype.getActiveIndices = function () {
  8409. return this._activeIndices;
  8410. };
  8411. Scene.prototype.getActiveParticles = function () {
  8412. return this._activeParticles;
  8413. };
  8414. Scene.prototype.getActiveBones = function () {
  8415. return this._activeBones;
  8416. };
  8417. // Stats
  8418. Scene.prototype.getLastFrameDuration = function () {
  8419. return this._lastFrameDuration;
  8420. };
  8421. Scene.prototype.getEvaluateActiveMeshesDuration = function () {
  8422. return this._evaluateActiveMeshesDuration;
  8423. };
  8424. Scene.prototype.getActiveMeshes = function () {
  8425. return this._activeMeshes;
  8426. };
  8427. Scene.prototype.getRenderTargetsDuration = function () {
  8428. return this._renderTargetsDuration;
  8429. };
  8430. Scene.prototype.getRenderDuration = function () {
  8431. return this._renderDuration;
  8432. };
  8433. Scene.prototype.getParticlesDuration = function () {
  8434. return this._particlesDuration;
  8435. };
  8436. Scene.prototype.getSpritesDuration = function () {
  8437. return this._spritesDuration;
  8438. };
  8439. Scene.prototype.getAnimationRatio = function () {
  8440. return this._animationRatio;
  8441. };
  8442. Scene.prototype.getRenderId = function () {
  8443. return this._renderId;
  8444. };
  8445. Scene.prototype.incrementRenderId = function () {
  8446. this._renderId++;
  8447. };
  8448. Scene.prototype._updatePointerPosition = function (evt) {
  8449. var canvasRect = this._engine.getRenderingCanvasClientRect();
  8450. this._pointerX = evt.clientX - canvasRect.left;
  8451. this._pointerY = evt.clientY - canvasRect.top;
  8452. if (this.cameraToUseForPointers) {
  8453. this._pointerX = this._pointerX - this.cameraToUseForPointers.viewport.x * this._engine.getRenderWidth();
  8454. this._pointerY = this._pointerY - this.cameraToUseForPointers.viewport.y * this._engine.getRenderHeight();
  8455. }
  8456. };
  8457. // Pointers handling
  8458. Scene.prototype.attachControl = function () {
  8459. var _this = this;
  8460. this._onPointerMove = function (evt) {
  8461. var canvas = _this._engine.getRenderingCanvas();
  8462. _this._updatePointerPosition(evt);
  8463. var pickResult = _this.pick(_this._pointerX, _this._pointerY, function (mesh) { return mesh.isPickable && mesh.isVisible && mesh.isReady() && mesh.actionManager && mesh.actionManager.hasPointerTriggers; }, false, _this.cameraToUseForPointers);
  8464. if (pickResult.hit) {
  8465. _this._meshUnderPointer = pickResult.pickedMesh;
  8466. _this.setPointerOverMesh(pickResult.pickedMesh);
  8467. canvas.style.cursor = "pointer";
  8468. }
  8469. else {
  8470. _this.setPointerOverMesh(null);
  8471. canvas.style.cursor = "";
  8472. _this._meshUnderPointer = null;
  8473. }
  8474. };
  8475. this._onPointerDown = function (evt) {
  8476. var predicate = null;
  8477. if (!_this.onPointerDown) {
  8478. predicate = function (mesh) {
  8479. return mesh.isPickable && mesh.isVisible && mesh.isReady() && mesh.actionManager && mesh.actionManager.hasPickTriggers;
  8480. };
  8481. }
  8482. _this._updatePointerPosition(evt);
  8483. var pickResult = _this.pick(_this._pointerX, _this._pointerY, predicate, false, _this.cameraToUseForPointers);
  8484. if (pickResult.hit) {
  8485. if (pickResult.pickedMesh.actionManager) {
  8486. switch (evt.button) {
  8487. case 0:
  8488. pickResult.pickedMesh.actionManager.processTrigger(BABYLON.ActionManager.OnLeftPickTrigger, BABYLON.ActionEvent.CreateNew(pickResult.pickedMesh, evt));
  8489. break;
  8490. case 1:
  8491. pickResult.pickedMesh.actionManager.processTrigger(BABYLON.ActionManager.OnCenterPickTrigger, BABYLON.ActionEvent.CreateNew(pickResult.pickedMesh, evt));
  8492. break;
  8493. case 2:
  8494. pickResult.pickedMesh.actionManager.processTrigger(BABYLON.ActionManager.OnRightPickTrigger, BABYLON.ActionEvent.CreateNew(pickResult.pickedMesh, evt));
  8495. break;
  8496. }
  8497. pickResult.pickedMesh.actionManager.processTrigger(BABYLON.ActionManager.OnPickTrigger, BABYLON.ActionEvent.CreateNew(pickResult.pickedMesh, evt));
  8498. }
  8499. }
  8500. if (_this.onPointerDown) {
  8501. _this.onPointerDown(evt, pickResult);
  8502. }
  8503. };
  8504. this._onKeyDown = function (evt) {
  8505. if (_this.actionManager) {
  8506. _this.actionManager.processTrigger(BABYLON.ActionManager.OnKeyDownTrigger, BABYLON.ActionEvent.CreateNewFromScene(_this, evt));
  8507. }
  8508. };
  8509. this._onKeyUp = function (evt) {
  8510. if (_this.actionManager) {
  8511. _this.actionManager.processTrigger(BABYLON.ActionManager.OnKeyUpTrigger, BABYLON.ActionEvent.CreateNewFromScene(_this, evt));
  8512. }
  8513. };
  8514. var eventPrefix = BABYLON.Tools.GetPointerPrefix();
  8515. this._engine.getRenderingCanvas().addEventListener(eventPrefix + "move", this._onPointerMove, false);
  8516. this._engine.getRenderingCanvas().addEventListener(eventPrefix + "down", this._onPointerDown, false);
  8517. BABYLON.Tools.RegisterTopRootEvents([
  8518. { name: "keydown", handler: this._onKeyDown },
  8519. { name: "keyup", handler: this._onKeyUp }
  8520. ]);
  8521. };
  8522. Scene.prototype.detachControl = function () {
  8523. var eventPrefix = BABYLON.Tools.GetPointerPrefix();
  8524. this._engine.getRenderingCanvas().removeEventListener(eventPrefix + "move", this._onPointerMove);
  8525. this._engine.getRenderingCanvas().removeEventListener(eventPrefix + "down", this._onPointerDown);
  8526. BABYLON.Tools.UnregisterTopRootEvents([
  8527. { name: "keydown", handler: this._onKeyDown },
  8528. { name: "keyup", handler: this._onKeyUp }
  8529. ]);
  8530. };
  8531. // Ready
  8532. Scene.prototype.isReady = function () {
  8533. if (this._pendingData.length > 0) {
  8534. return false;
  8535. }
  8536. for (var index = 0; index < this._geometries.length; index++) {
  8537. var geometry = this._geometries[index];
  8538. if (geometry.delayLoadState === BABYLON.Engine.DELAYLOADSTATE_LOADING) {
  8539. return false;
  8540. }
  8541. }
  8542. for (index = 0; index < this.meshes.length; index++) {
  8543. var mesh = this.meshes[index];
  8544. if (!mesh.isReady()) {
  8545. return false;
  8546. }
  8547. var mat = mesh.material;
  8548. if (mat) {
  8549. if (!mat.isReady(mesh)) {
  8550. return false;
  8551. }
  8552. }
  8553. }
  8554. return true;
  8555. };
  8556. Scene.prototype.resetCachedMaterial = function () {
  8557. this._cachedMaterial = null;
  8558. };
  8559. Scene.prototype.registerBeforeRender = function (func) {
  8560. this._onBeforeRenderCallbacks.push(func);
  8561. };
  8562. Scene.prototype.unregisterBeforeRender = function (func) {
  8563. var index = this._onBeforeRenderCallbacks.indexOf(func);
  8564. if (index > -1) {
  8565. this._onBeforeRenderCallbacks.splice(index, 1);
  8566. }
  8567. };
  8568. Scene.prototype.registerAfterRender = function (func) {
  8569. this._onAfterRenderCallbacks.push(func);
  8570. };
  8571. Scene.prototype.unregisterAfterRender = function (func) {
  8572. var index = this._onAfterRenderCallbacks.indexOf(func);
  8573. if (index > -1) {
  8574. this._onAfterRenderCallbacks.splice(index, 1);
  8575. }
  8576. };
  8577. Scene.prototype._addPendingData = function (data) {
  8578. this._pendingData.push(data);
  8579. };
  8580. Scene.prototype._removePendingData = function (data) {
  8581. var index = this._pendingData.indexOf(data);
  8582. if (index !== -1) {
  8583. this._pendingData.splice(index, 1);
  8584. }
  8585. };
  8586. Scene.prototype.getWaitingItemsCount = function () {
  8587. return this._pendingData.length;
  8588. };
  8589. /**
  8590. * Registers a function to be executed when the scene is ready.
  8591. * @param {Function} func - the function to be executed.
  8592. */
  8593. Scene.prototype.executeWhenReady = function (func) {
  8594. var _this = this;
  8595. this._onReadyCallbacks.push(func);
  8596. if (this._executeWhenReadyTimeoutId !== -1) {
  8597. return;
  8598. }
  8599. this._executeWhenReadyTimeoutId = setTimeout(function () {
  8600. _this._checkIsReady();
  8601. }, 150);
  8602. };
  8603. Scene.prototype._checkIsReady = function () {
  8604. var _this = this;
  8605. if (this.isReady()) {
  8606. this._onReadyCallbacks.forEach(function (func) {
  8607. func();
  8608. });
  8609. this._onReadyCallbacks = [];
  8610. this._executeWhenReadyTimeoutId = -1;
  8611. return;
  8612. }
  8613. this._executeWhenReadyTimeoutId = setTimeout(function () {
  8614. _this._checkIsReady();
  8615. }, 150);
  8616. };
  8617. // Animations
  8618. /**
  8619. * Will start the animation sequence of a given target
  8620. * @param target - the target
  8621. * @param {number} from - from which frame should animation start
  8622. * @param {number} to - till which frame should animation run.
  8623. * @param {boolean} [loop] - should the animation loop
  8624. * @param {number} [speedRatio] - the speed in which to run the animation
  8625. * @param {Function} [onAnimationEnd] function to be executed when the animation ended.
  8626. * @param {BABYLON.Animatable} [animatable] an animatable object. If not provided a new one will be created from the given params.
  8627. * @return {BABYLON.Animatable} the animatable object created for this animation
  8628. * @see BABYLON.Animatable
  8629. * @see http://doc.babylonjs.com/page.php?p=22081
  8630. */
  8631. Scene.prototype.beginAnimation = function (target, from, to, loop, speedRatio, onAnimationEnd, animatable) {
  8632. if (speedRatio === undefined) {
  8633. speedRatio = 1.0;
  8634. }
  8635. this.stopAnimation(target);
  8636. if (!animatable) {
  8637. animatable = new BABYLON.Animatable(this, target, from, to, loop, speedRatio, onAnimationEnd);
  8638. }
  8639. // Local animations
  8640. if (target.animations) {
  8641. animatable.appendAnimations(target, target.animations);
  8642. }
  8643. // Children animations
  8644. if (target.getAnimatables) {
  8645. var animatables = target.getAnimatables();
  8646. for (var index = 0; index < animatables.length; index++) {
  8647. this.beginAnimation(animatables[index], from, to, loop, speedRatio, onAnimationEnd, animatable);
  8648. }
  8649. }
  8650. return animatable;
  8651. };
  8652. Scene.prototype.beginDirectAnimation = function (target, animations, from, to, loop, speedRatio, onAnimationEnd) {
  8653. if (speedRatio === undefined) {
  8654. speedRatio = 1.0;
  8655. }
  8656. var animatable = new BABYLON.Animatable(this, target, from, to, loop, speedRatio, onAnimationEnd, animations);
  8657. return animatable;
  8658. };
  8659. Scene.prototype.getAnimatableByTarget = function (target) {
  8660. for (var index = 0; index < this._activeAnimatables.length; index++) {
  8661. if (this._activeAnimatables[index].target === target) {
  8662. return this._activeAnimatables[index];
  8663. }
  8664. }
  8665. return null;
  8666. };
  8667. /**
  8668. * Will stop the animation of the given target
  8669. * @param target - the target
  8670. * @see beginAnimation
  8671. */
  8672. Scene.prototype.stopAnimation = function (target) {
  8673. var animatable = this.getAnimatableByTarget(target);
  8674. if (animatable) {
  8675. animatable.stop();
  8676. }
  8677. };
  8678. Scene.prototype._animate = function () {
  8679. if (!this.animationsEnabled) {
  8680. return;
  8681. }
  8682. if (!this._animationStartDate) {
  8683. this._animationStartDate = BABYLON.Tools.Now;
  8684. }
  8685. // Getting time
  8686. var now = BABYLON.Tools.Now;
  8687. var delay = now - this._animationStartDate;
  8688. for (var index = 0; index < this._activeAnimatables.length; index++) {
  8689. this._activeAnimatables[index]._animate(delay);
  8690. }
  8691. };
  8692. // Matrix
  8693. Scene.prototype.getViewMatrix = function () {
  8694. return this._viewMatrix;
  8695. };
  8696. Scene.prototype.getProjectionMatrix = function () {
  8697. return this._projectionMatrix;
  8698. };
  8699. Scene.prototype.getTransformMatrix = function () {
  8700. return this._transformMatrix;
  8701. };
  8702. Scene.prototype.setTransformMatrix = function (view, projection) {
  8703. this._viewMatrix = view;
  8704. this._projectionMatrix = projection;
  8705. this._viewMatrix.multiplyToRef(this._projectionMatrix, this._transformMatrix);
  8706. };
  8707. // Methods
  8708. Scene.prototype.addMesh = function (newMesh) {
  8709. newMesh.uniqueId = this._uniqueIdCounter++;
  8710. var position = this.meshes.push(newMesh);
  8711. if (this.onNewMeshAdded) {
  8712. this.onNewMeshAdded(newMesh, position, this);
  8713. }
  8714. };
  8715. Scene.prototype.removeMesh = function (toRemove) {
  8716. var index = this.meshes.indexOf(toRemove);
  8717. if (index !== -1) {
  8718. // Remove from the scene if mesh found
  8719. this.meshes.splice(index, 1);
  8720. }
  8721. if (this.onMeshRemoved) {
  8722. this.onMeshRemoved(toRemove);
  8723. }
  8724. return index;
  8725. };
  8726. Scene.prototype.removeLight = function (toRemove) {
  8727. var index = this.lights.indexOf(toRemove);
  8728. if (index !== -1) {
  8729. // Remove from the scene if mesh found
  8730. this.lights.splice(index, 1);
  8731. }
  8732. if (this.onLightRemoved) {
  8733. this.onLightRemoved(toRemove);
  8734. }
  8735. return index;
  8736. };
  8737. Scene.prototype.removeCamera = function (toRemove) {
  8738. var index = this.cameras.indexOf(toRemove);
  8739. if (index !== -1) {
  8740. // Remove from the scene if mesh found
  8741. this.cameras.splice(index, 1);
  8742. }
  8743. // Remove from activeCameras
  8744. var index2 = this.activeCameras.indexOf(toRemove);
  8745. if (index2 !== -1) {
  8746. // Remove from the scene if mesh found
  8747. this.activeCameras.splice(index2, 1);
  8748. }
  8749. // Reset the activeCamera
  8750. if (this.activeCamera === toRemove) {
  8751. if (this.cameras.length > 0) {
  8752. this.activeCamera = this.cameras[0];
  8753. }
  8754. else {
  8755. this.activeCamera = null;
  8756. }
  8757. }
  8758. if (this.onCameraRemoved) {
  8759. this.onCameraRemoved(toRemove);
  8760. }
  8761. return index;
  8762. };
  8763. Scene.prototype.addLight = function (newLight) {
  8764. newLight.uniqueId = this._uniqueIdCounter++;
  8765. var position = this.lights.push(newLight);
  8766. if (this.onNewLightAdded) {
  8767. this.onNewLightAdded(newLight, position, this);
  8768. }
  8769. };
  8770. Scene.prototype.addCamera = function (newCamera) {
  8771. newCamera.uniqueId = this._uniqueIdCounter++;
  8772. var position = this.cameras.push(newCamera);
  8773. if (this.onNewCameraAdded) {
  8774. this.onNewCameraAdded(newCamera, position, this);
  8775. }
  8776. };
  8777. /**
  8778. * sets the active camera of the scene using its ID
  8779. * @param {string} id - the camera's ID
  8780. * @return {BABYLON.Camera|null} the new active camera or null if none found.
  8781. * @see activeCamera
  8782. */
  8783. Scene.prototype.setActiveCameraByID = function (id) {
  8784. var camera = this.getCameraByID(id);
  8785. if (camera) {
  8786. this.activeCamera = camera;
  8787. return camera;
  8788. }
  8789. return null;
  8790. };
  8791. /**
  8792. * sets the active camera of the scene using its name
  8793. * @param {string} name - the camera's name
  8794. * @return {BABYLON.Camera|null} the new active camera or null if none found.
  8795. * @see activeCamera
  8796. */
  8797. Scene.prototype.setActiveCameraByName = function (name) {
  8798. var camera = this.getCameraByName(name);
  8799. if (camera) {
  8800. this.activeCamera = camera;
  8801. return camera;
  8802. }
  8803. return null;
  8804. };
  8805. /**
  8806. * get a material using its id
  8807. * @param {string} the material's ID
  8808. * @return {BABYLON.Material|null} the material or null if none found.
  8809. */
  8810. Scene.prototype.getMaterialByID = function (id) {
  8811. for (var index = 0; index < this.materials.length; index++) {
  8812. if (this.materials[index].id === id) {
  8813. return this.materials[index];
  8814. }
  8815. }
  8816. return null;
  8817. };
  8818. /**
  8819. * get a material using its name
  8820. * @param {string} the material's name
  8821. * @return {BABYLON.Material|null} the material or null if none found.
  8822. */
  8823. Scene.prototype.getMaterialByName = function (name) {
  8824. for (var index = 0; index < this.materials.length; index++) {
  8825. if (this.materials[index].name === name) {
  8826. return this.materials[index];
  8827. }
  8828. }
  8829. return null;
  8830. };
  8831. Scene.prototype.getCameraByID = function (id) {
  8832. for (var index = 0; index < this.cameras.length; index++) {
  8833. if (this.cameras[index].id === id) {
  8834. return this.cameras[index];
  8835. }
  8836. }
  8837. return null;
  8838. };
  8839. Scene.prototype.getCameraByUniqueID = function (uniqueId) {
  8840. for (var index = 0; index < this.cameras.length; index++) {
  8841. if (this.cameras[index].uniqueId === uniqueId) {
  8842. return this.cameras[index];
  8843. }
  8844. }
  8845. return null;
  8846. };
  8847. /**
  8848. * get a camera using its name
  8849. * @param {string} the camera's name
  8850. * @return {BABYLON.Camera|null} the camera or null if none found.
  8851. */
  8852. Scene.prototype.getCameraByName = function (name) {
  8853. for (var index = 0; index < this.cameras.length; index++) {
  8854. if (this.cameras[index].name === name) {
  8855. return this.cameras[index];
  8856. }
  8857. }
  8858. return null;
  8859. };
  8860. /**
  8861. * get a light node using its name
  8862. * @param {string} the light's name
  8863. * @return {BABYLON.Light|null} the light or null if none found.
  8864. */
  8865. Scene.prototype.getLightByName = function (name) {
  8866. for (var index = 0; index < this.lights.length; index++) {
  8867. if (this.lights[index].name === name) {
  8868. return this.lights[index];
  8869. }
  8870. }
  8871. return null;
  8872. };
  8873. /**
  8874. * get a light node using its ID
  8875. * @param {string} the light's id
  8876. * @return {BABYLON.Light|null} the light or null if none found.
  8877. */
  8878. Scene.prototype.getLightByID = function (id) {
  8879. for (var index = 0; index < this.lights.length; index++) {
  8880. if (this.lights[index].id === id) {
  8881. return this.lights[index];
  8882. }
  8883. }
  8884. return null;
  8885. };
  8886. /**
  8887. * get a light node using its scene-generated unique ID
  8888. * @param {number} the light's unique id
  8889. * @return {BABYLON.Light|null} the light or null if none found.
  8890. */
  8891. Scene.prototype.getLightByUniqueID = function (uniqueId) {
  8892. for (var index = 0; index < this.lights.length; index++) {
  8893. if (this.lights[index].uniqueId === uniqueId) {
  8894. return this.lights[index];
  8895. }
  8896. }
  8897. return null;
  8898. };
  8899. /**
  8900. * get a geometry using its ID
  8901. * @param {string} the geometry's id
  8902. * @return {BABYLON.Geometry|null} the geometry or null if none found.
  8903. */
  8904. Scene.prototype.getGeometryByID = function (id) {
  8905. for (var index = 0; index < this._geometries.length; index++) {
  8906. if (this._geometries[index].id === id) {
  8907. return this._geometries[index];
  8908. }
  8909. }
  8910. return null;
  8911. };
  8912. /**
  8913. * add a new geometry to this scene.
  8914. * @param {BABYLON.Geometry} geometry - the geometry to be added to the scene.
  8915. * @param {boolean} [force] - force addition, even if a geometry with this ID already exists
  8916. * @return {boolean} was the geometry added or not
  8917. */
  8918. Scene.prototype.pushGeometry = function (geometry, force) {
  8919. if (!force && this.getGeometryByID(geometry.id)) {
  8920. return false;
  8921. }
  8922. this._geometries.push(geometry);
  8923. if (this.onGeometryAdded) {
  8924. this.onGeometryAdded(geometry);
  8925. }
  8926. return true;
  8927. };
  8928. /**
  8929. * Removes an existing geometry
  8930. * @param {BABYLON.Geometry} geometry - the geometry to be removed from the scene.
  8931. * @return {boolean} was the geometry removed or not
  8932. */
  8933. Scene.prototype.removeGeometry = function (geometry) {
  8934. var index = this._geometries.indexOf(geometry);
  8935. if (index > -1) {
  8936. this._geometries.splice(index, 1);
  8937. if (this.onGeometryRemoved) {
  8938. this.onGeometryRemoved(geometry);
  8939. }
  8940. return true;
  8941. }
  8942. return false;
  8943. };
  8944. Scene.prototype.getGeometries = function () {
  8945. return this._geometries;
  8946. };
  8947. /**
  8948. * Get the first added mesh found of a given ID
  8949. * @param {string} id - the id to search for
  8950. * @return {BABYLON.AbstractMesh|null} the mesh found or null if not found at all.
  8951. */
  8952. Scene.prototype.getMeshByID = function (id) {
  8953. for (var index = 0; index < this.meshes.length; index++) {
  8954. if (this.meshes[index].id === id) {
  8955. return this.meshes[index];
  8956. }
  8957. }
  8958. return null;
  8959. };
  8960. /**
  8961. * Get a mesh with its auto-generated unique id
  8962. * @param {number} uniqueId - the unique id to search for
  8963. * @return {BABYLON.AbstractMesh|null} the mesh found or null if not found at all.
  8964. */
  8965. Scene.prototype.getMeshByUniqueID = function (uniqueId) {
  8966. for (var index = 0; index < this.meshes.length; index++) {
  8967. if (this.meshes[index].uniqueId === uniqueId) {
  8968. return this.meshes[index];
  8969. }
  8970. }
  8971. return null;
  8972. };
  8973. /**
  8974. * Get a the last added mesh found of a given ID
  8975. * @param {string} id - the id to search for
  8976. * @return {BABYLON.AbstractMesh|null} the mesh found or null if not found at all.
  8977. */
  8978. Scene.prototype.getLastMeshByID = function (id) {
  8979. for (var index = this.meshes.length - 1; index >= 0; index--) {
  8980. if (this.meshes[index].id === id) {
  8981. return this.meshes[index];
  8982. }
  8983. }
  8984. return null;
  8985. };
  8986. /**
  8987. * Get a the last added node (Mesh, Camera, Light) found of a given ID
  8988. * @param {string} id - the id to search for
  8989. * @return {BABYLON.Node|null} the node found or null if not found at all.
  8990. */
  8991. Scene.prototype.getLastEntryByID = function (id) {
  8992. for (var index = this.meshes.length - 1; index >= 0; index--) {
  8993. if (this.meshes[index].id === id) {
  8994. return this.meshes[index];
  8995. }
  8996. }
  8997. for (index = this.cameras.length - 1; index >= 0; index--) {
  8998. if (this.cameras[index].id === id) {
  8999. return this.cameras[index];
  9000. }
  9001. }
  9002. for (index = this.lights.length - 1; index >= 0; index--) {
  9003. if (this.lights[index].id === id) {
  9004. return this.lights[index];
  9005. }
  9006. }
  9007. return null;
  9008. };
  9009. Scene.prototype.getNodeByName = function (name) {
  9010. var mesh = this.getMeshByName(name);
  9011. if (mesh) {
  9012. return mesh;
  9013. }
  9014. var light = this.getLightByName(name);
  9015. if (light) {
  9016. return light;
  9017. }
  9018. return this.getCameraByName(name);
  9019. };
  9020. Scene.prototype.getMeshByName = function (name) {
  9021. for (var index = 0; index < this.meshes.length; index++) {
  9022. if (this.meshes[index].name === name) {
  9023. return this.meshes[index];
  9024. }
  9025. }
  9026. return null;
  9027. };
  9028. Scene.prototype.getSoundByName = function (name) {
  9029. for (var index = 0; index < this.mainSoundTrack.soundCollection.length; index++) {
  9030. if (this.mainSoundTrack.soundCollection[index].name === name) {
  9031. return this.mainSoundTrack.soundCollection[index];
  9032. }
  9033. }
  9034. for (var sdIndex = 0; sdIndex < this.soundTracks.length; sdIndex++) {
  9035. for (index = 0; index < this.soundTracks[sdIndex].soundCollection.length; index++) {
  9036. if (this.soundTracks[sdIndex].soundCollection[index].name === name) {
  9037. return this.soundTracks[sdIndex].soundCollection[index];
  9038. }
  9039. }
  9040. }
  9041. return null;
  9042. };
  9043. Scene.prototype.getLastSkeletonByID = function (id) {
  9044. for (var index = this.skeletons.length - 1; index >= 0; index--) {
  9045. if (this.skeletons[index].id === id) {
  9046. return this.skeletons[index];
  9047. }
  9048. }
  9049. return null;
  9050. };
  9051. Scene.prototype.getSkeletonById = function (id) {
  9052. for (var index = 0; index < this.skeletons.length; index++) {
  9053. if (this.skeletons[index].id === id) {
  9054. return this.skeletons[index];
  9055. }
  9056. }
  9057. return null;
  9058. };
  9059. Scene.prototype.getSkeletonByName = function (name) {
  9060. for (var index = 0; index < this.skeletons.length; index++) {
  9061. if (this.skeletons[index].name === name) {
  9062. return this.skeletons[index];
  9063. }
  9064. }
  9065. return null;
  9066. };
  9067. Scene.prototype.isActiveMesh = function (mesh) {
  9068. return (this._activeMeshes.indexOf(mesh) !== -1);
  9069. };
  9070. Scene.prototype._evaluateSubMesh = function (subMesh, mesh) {
  9071. if (mesh.subMeshes.length === 1 || subMesh.isInFrustum(this._frustumPlanes)) {
  9072. var material = subMesh.getMaterial();
  9073. if (mesh.showSubMeshesBoundingBox) {
  9074. this._boundingBoxRenderer.renderList.push(subMesh.getBoundingInfo().boundingBox);
  9075. }
  9076. if (material) {
  9077. // Render targets
  9078. if (material.getRenderTargetTextures) {
  9079. if (this._processedMaterials.indexOf(material) === -1) {
  9080. this._processedMaterials.push(material);
  9081. this._renderTargets.concat(material.getRenderTargetTextures());
  9082. }
  9083. }
  9084. // Dispatch
  9085. this._activeIndices += subMesh.indexCount;
  9086. this._renderingManager.dispatch(subMesh);
  9087. }
  9088. }
  9089. };
  9090. Scene.prototype._evaluateActiveMeshes = function () {
  9091. this.activeCamera._activeMeshes.reset();
  9092. this._activeMeshes.reset();
  9093. this._renderingManager.reset();
  9094. this._processedMaterials.reset();
  9095. this._activeParticleSystems.reset();
  9096. this._activeSkeletons.reset();
  9097. this._boundingBoxRenderer.reset();
  9098. if (!this._frustumPlanes) {
  9099. this._frustumPlanes = BABYLON.Frustum.GetPlanes(this._transformMatrix);
  9100. }
  9101. else {
  9102. BABYLON.Frustum.GetPlanesToRef(this._transformMatrix, this._frustumPlanes);
  9103. }
  9104. // Meshes
  9105. var meshes;
  9106. var len;
  9107. if (this._selectionOctree) {
  9108. var selection = this._selectionOctree.select(this._frustumPlanes);
  9109. meshes = selection.data;
  9110. len = selection.length;
  9111. }
  9112. else {
  9113. len = this.meshes.length;
  9114. meshes = this.meshes;
  9115. }
  9116. for (var meshIndex = 0; meshIndex < len; meshIndex++) {
  9117. var mesh = meshes[meshIndex];
  9118. if (mesh.isBlocked) {
  9119. continue;
  9120. }
  9121. this._totalVertices += mesh.getTotalVertices();
  9122. if (!mesh.isReady()) {
  9123. continue;
  9124. }
  9125. mesh.computeWorldMatrix();
  9126. // Intersections
  9127. if (mesh.actionManager && mesh.actionManager.hasSpecificTriggers([BABYLON.ActionManager.OnIntersectionEnterTrigger, BABYLON.ActionManager.OnIntersectionExitTrigger])) {
  9128. this._meshesForIntersections.pushNoDuplicate(mesh);
  9129. }
  9130. // Switch to current LOD
  9131. var meshLOD = mesh.getLOD(this.activeCamera);
  9132. if (!meshLOD) {
  9133. continue;
  9134. }
  9135. mesh._preActivate();
  9136. if (mesh.isEnabled() && mesh.isVisible && mesh.visibility > 0 && ((mesh.layerMask & this.activeCamera.layerMask) !== 0) && mesh.isInFrustum(this._frustumPlanes)) {
  9137. this._activeMeshes.push(mesh);
  9138. this.activeCamera._activeMeshes.push(mesh);
  9139. mesh._activate(this._renderId);
  9140. this._activeMesh(meshLOD);
  9141. }
  9142. }
  9143. // Particle systems
  9144. var beforeParticlesDate = BABYLON.Tools.Now;
  9145. if (this.particlesEnabled) {
  9146. BABYLON.Tools.StartPerformanceCounter("Particles", this.particleSystems.length > 0);
  9147. for (var particleIndex = 0; particleIndex < this.particleSystems.length; particleIndex++) {
  9148. var particleSystem = this.particleSystems[particleIndex];
  9149. if (!particleSystem.isStarted()) {
  9150. continue;
  9151. }
  9152. if (!particleSystem.emitter.position || (particleSystem.emitter && particleSystem.emitter.isEnabled())) {
  9153. this._activeParticleSystems.push(particleSystem);
  9154. particleSystem.animate();
  9155. }
  9156. }
  9157. BABYLON.Tools.EndPerformanceCounter("Particles", this.particleSystems.length > 0);
  9158. }
  9159. this._particlesDuration += BABYLON.Tools.Now - beforeParticlesDate;
  9160. };
  9161. Scene.prototype._activeMesh = function (mesh) {
  9162. if (mesh.skeleton && this.skeletonsEnabled) {
  9163. this._activeSkeletons.pushNoDuplicate(mesh.skeleton);
  9164. }
  9165. if (mesh.showBoundingBox || this.forceShowBoundingBoxes) {
  9166. this._boundingBoxRenderer.renderList.push(mesh.getBoundingInfo().boundingBox);
  9167. }
  9168. if (mesh && mesh.subMeshes) {
  9169. // Submeshes Octrees
  9170. var len;
  9171. var subMeshes;
  9172. if (mesh._submeshesOctree && mesh.useOctreeForRenderingSelection) {
  9173. var intersections = mesh._submeshesOctree.select(this._frustumPlanes);
  9174. len = intersections.length;
  9175. subMeshes = intersections.data;
  9176. }
  9177. else {
  9178. subMeshes = mesh.subMeshes;
  9179. len = subMeshes.length;
  9180. }
  9181. for (var subIndex = 0; subIndex < len; subIndex++) {
  9182. var subMesh = subMeshes[subIndex];
  9183. this._evaluateSubMesh(subMesh, mesh);
  9184. }
  9185. }
  9186. };
  9187. Scene.prototype.updateTransformMatrix = function (force) {
  9188. this.setTransformMatrix(this.activeCamera.getViewMatrix(), this.activeCamera.getProjectionMatrix(force));
  9189. };
  9190. Scene.prototype._renderForCamera = function (camera) {
  9191. var engine = this._engine;
  9192. this.activeCamera = camera;
  9193. if (!this.activeCamera)
  9194. throw new Error("Active camera not set");
  9195. BABYLON.Tools.StartPerformanceCounter("Rendering camera " + this.activeCamera.name);
  9196. // Viewport
  9197. engine.setViewport(this.activeCamera.viewport);
  9198. // Camera
  9199. this._renderId++;
  9200. this.updateTransformMatrix();
  9201. if (this.beforeCameraRender) {
  9202. this.beforeCameraRender(this.activeCamera);
  9203. }
  9204. // Meshes
  9205. var beforeEvaluateActiveMeshesDate = BABYLON.Tools.Now;
  9206. BABYLON.Tools.StartPerformanceCounter("Active meshes evaluation");
  9207. this._evaluateActiveMeshes();
  9208. this._evaluateActiveMeshesDuration += BABYLON.Tools.Now - beforeEvaluateActiveMeshesDate;
  9209. BABYLON.Tools.EndPerformanceCounter("Active meshes evaluation");
  9210. for (var skeletonIndex = 0; skeletonIndex < this._activeSkeletons.length; skeletonIndex++) {
  9211. var skeleton = this._activeSkeletons.data[skeletonIndex];
  9212. skeleton.prepare();
  9213. }
  9214. // Render targets
  9215. var beforeRenderTargetDate = BABYLON.Tools.Now;
  9216. if (this.renderTargetsEnabled) {
  9217. BABYLON.Tools.StartPerformanceCounter("Render targets", this._renderTargets.length > 0);
  9218. for (var renderIndex = 0; renderIndex < this._renderTargets.length; renderIndex++) {
  9219. var renderTarget = this._renderTargets.data[renderIndex];
  9220. if (renderTarget._shouldRender()) {
  9221. this._renderId++;
  9222. var hasSpecialRenderTargetCamera = renderTarget.activeCamera && renderTarget.activeCamera !== this.activeCamera;
  9223. renderTarget.render(hasSpecialRenderTargetCamera, this.dumpNextRenderTargets);
  9224. }
  9225. }
  9226. BABYLON.Tools.EndPerformanceCounter("Render targets", this._renderTargets.length > 0);
  9227. this._renderId++;
  9228. }
  9229. if (this._renderTargets.length > 0) {
  9230. engine.restoreDefaultFramebuffer();
  9231. }
  9232. this._renderTargetsDuration += BABYLON.Tools.Now - beforeRenderTargetDate;
  9233. // Prepare Frame
  9234. this.postProcessManager._prepareFrame();
  9235. var beforeRenderDate = BABYLON.Tools.Now;
  9236. // Backgrounds
  9237. if (this.layers.length) {
  9238. engine.setDepthBuffer(false);
  9239. var layerIndex;
  9240. var layer;
  9241. for (layerIndex = 0; layerIndex < this.layers.length; layerIndex++) {
  9242. layer = this.layers[layerIndex];
  9243. if (layer.isBackground) {
  9244. layer.render();
  9245. }
  9246. }
  9247. engine.setDepthBuffer(true);
  9248. }
  9249. // Render
  9250. BABYLON.Tools.StartPerformanceCounter("Main render");
  9251. this._renderingManager.render(null, null, true, true);
  9252. BABYLON.Tools.EndPerformanceCounter("Main render");
  9253. // Bounding boxes
  9254. this._boundingBoxRenderer.render();
  9255. // Lens flares
  9256. if (this.lensFlaresEnabled) {
  9257. BABYLON.Tools.StartPerformanceCounter("Lens flares", this.lensFlareSystems.length > 0);
  9258. for (var lensFlareSystemIndex = 0; lensFlareSystemIndex < this.lensFlareSystems.length; lensFlareSystemIndex++) {
  9259. this.lensFlareSystems[lensFlareSystemIndex].render();
  9260. }
  9261. BABYLON.Tools.EndPerformanceCounter("Lens flares", this.lensFlareSystems.length > 0);
  9262. }
  9263. // Foregrounds
  9264. if (this.layers.length) {
  9265. engine.setDepthBuffer(false);
  9266. for (layerIndex = 0; layerIndex < this.layers.length; layerIndex++) {
  9267. layer = this.layers[layerIndex];
  9268. if (!layer.isBackground) {
  9269. layer.render();
  9270. }
  9271. }
  9272. engine.setDepthBuffer(true);
  9273. }
  9274. this._renderDuration += BABYLON.Tools.Now - beforeRenderDate;
  9275. // Finalize frame
  9276. this.postProcessManager._finalizeFrame(camera.isIntermediate);
  9277. // Update camera
  9278. this.activeCamera._updateFromScene();
  9279. // Reset some special arrays
  9280. this._renderTargets.reset();
  9281. if (this.afterCameraRender) {
  9282. this.afterCameraRender(this.activeCamera);
  9283. }
  9284. BABYLON.Tools.EndPerformanceCounter("Rendering camera " + this.activeCamera.name);
  9285. };
  9286. Scene.prototype._processSubCameras = function (camera) {
  9287. if (camera.subCameras.length === 0) {
  9288. this._renderForCamera(camera);
  9289. return;
  9290. }
  9291. for (var index = 0; index < camera.subCameras.length; index++) {
  9292. this._renderForCamera(camera.subCameras[index]);
  9293. }
  9294. this.activeCamera = camera;
  9295. this.setTransformMatrix(this.activeCamera.getViewMatrix(), this.activeCamera.getProjectionMatrix());
  9296. // Update camera
  9297. this.activeCamera._updateFromScene();
  9298. };
  9299. Scene.prototype._checkIntersections = function () {
  9300. for (var index = 0; index < this._meshesForIntersections.length; index++) {
  9301. var sourceMesh = this._meshesForIntersections.data[index];
  9302. for (var actionIndex = 0; actionIndex < sourceMesh.actionManager.actions.length; actionIndex++) {
  9303. var action = sourceMesh.actionManager.actions[actionIndex];
  9304. if (action.trigger === BABYLON.ActionManager.OnIntersectionEnterTrigger || action.trigger === BABYLON.ActionManager.OnIntersectionExitTrigger) {
  9305. var parameters = action.getTriggerParameter();
  9306. var otherMesh = parameters instanceof BABYLON.AbstractMesh ? parameters : parameters.mesh;
  9307. var areIntersecting = otherMesh.intersectsMesh(sourceMesh, parameters.usePreciseIntersection);
  9308. var currentIntersectionInProgress = sourceMesh._intersectionsInProgress.indexOf(otherMesh);
  9309. if (areIntersecting && currentIntersectionInProgress === -1) {
  9310. if (action.trigger === BABYLON.ActionManager.OnIntersectionEnterTrigger) {
  9311. action._executeCurrent(BABYLON.ActionEvent.CreateNew(sourceMesh));
  9312. sourceMesh._intersectionsInProgress.push(otherMesh);
  9313. }
  9314. else if (action.trigger === BABYLON.ActionManager.OnIntersectionExitTrigger) {
  9315. sourceMesh._intersectionsInProgress.push(otherMesh);
  9316. }
  9317. }
  9318. else if (!areIntersecting && currentIntersectionInProgress > -1 && action.trigger === BABYLON.ActionManager.OnIntersectionExitTrigger) {
  9319. action._executeCurrent(BABYLON.ActionEvent.CreateNew(sourceMesh));
  9320. var indexOfOther = sourceMesh._intersectionsInProgress.indexOf(otherMesh);
  9321. if (indexOfOther > -1) {
  9322. sourceMesh._intersectionsInProgress.splice(indexOfOther, 1);
  9323. }
  9324. }
  9325. }
  9326. }
  9327. }
  9328. };
  9329. Scene.prototype.render = function () {
  9330. var startDate = BABYLON.Tools.Now;
  9331. this._particlesDuration = 0;
  9332. this._spritesDuration = 0;
  9333. this._activeParticles = 0;
  9334. this._renderDuration = 0;
  9335. this._renderTargetsDuration = 0;
  9336. this._evaluateActiveMeshesDuration = 0;
  9337. this._totalVertices = 0;
  9338. this._activeIndices = 0;
  9339. this._activeBones = 0;
  9340. this.getEngine().resetDrawCalls();
  9341. this._meshesForIntersections.reset();
  9342. this.resetCachedMaterial();
  9343. BABYLON.Tools.StartPerformanceCounter("Scene rendering");
  9344. // Actions
  9345. if (this.actionManager) {
  9346. this.actionManager.processTrigger(BABYLON.ActionManager.OnEveryFrameTrigger, null);
  9347. }
  9348. //Simplification Queue
  9349. if (!this.simplificationQueue.running) {
  9350. this.simplificationQueue.executeNext();
  9351. }
  9352. // Before render
  9353. if (this.beforeRender) {
  9354. this.beforeRender();
  9355. }
  9356. for (var callbackIndex = 0; callbackIndex < this._onBeforeRenderCallbacks.length; callbackIndex++) {
  9357. this._onBeforeRenderCallbacks[callbackIndex]();
  9358. }
  9359. // Animations
  9360. var deltaTime = Math.max(Scene.MinDeltaTime, Math.min(this._engine.getDeltaTime(), Scene.MaxDeltaTime));
  9361. this._animationRatio = deltaTime * (60.0 / 1000.0);
  9362. this._animate();
  9363. // Physics
  9364. if (this._physicsEngine) {
  9365. BABYLON.Tools.StartPerformanceCounter("Physics");
  9366. this._physicsEngine._runOneStep(deltaTime / 1000.0);
  9367. BABYLON.Tools.EndPerformanceCounter("Physics");
  9368. }
  9369. // Customs render targets
  9370. var beforeRenderTargetDate = BABYLON.Tools.Now;
  9371. var engine = this.getEngine();
  9372. var currentActiveCamera = this.activeCamera;
  9373. if (this.renderTargetsEnabled) {
  9374. BABYLON.Tools.StartPerformanceCounter("Custom render targets", this.customRenderTargets.length > 0);
  9375. for (var customIndex = 0; customIndex < this.customRenderTargets.length; customIndex++) {
  9376. var renderTarget = this.customRenderTargets[customIndex];
  9377. if (renderTarget._shouldRender()) {
  9378. this._renderId++;
  9379. this.activeCamera = renderTarget.activeCamera || this.activeCamera;
  9380. if (!this.activeCamera)
  9381. throw new Error("Active camera not set");
  9382. // Viewport
  9383. engine.setViewport(this.activeCamera.viewport);
  9384. // Camera
  9385. this.updateTransformMatrix();
  9386. renderTarget.render(currentActiveCamera !== this.activeCamera, this.dumpNextRenderTargets);
  9387. }
  9388. }
  9389. BABYLON.Tools.EndPerformanceCounter("Custom render targets", this.customRenderTargets.length > 0);
  9390. this._renderId++;
  9391. }
  9392. if (this.customRenderTargets.length > 0) {
  9393. engine.restoreDefaultFramebuffer();
  9394. }
  9395. this._renderTargetsDuration += BABYLON.Tools.Now - beforeRenderTargetDate;
  9396. this.activeCamera = currentActiveCamera;
  9397. // Procedural textures
  9398. if (this.proceduralTexturesEnabled) {
  9399. BABYLON.Tools.StartPerformanceCounter("Procedural textures", this._proceduralTextures.length > 0);
  9400. for (var proceduralIndex = 0; proceduralIndex < this._proceduralTextures.length; proceduralIndex++) {
  9401. var proceduralTexture = this._proceduralTextures[proceduralIndex];
  9402. if (proceduralTexture._shouldRender()) {
  9403. proceduralTexture.render();
  9404. }
  9405. }
  9406. BABYLON.Tools.EndPerformanceCounter("Procedural textures", this._proceduralTextures.length > 0);
  9407. }
  9408. // Clear
  9409. this._engine.clear(this.clearColor, this.autoClear || this.forceWireframe || this.forcePointsCloud, true);
  9410. // Shadows
  9411. if (this.shadowsEnabled) {
  9412. for (var lightIndex = 0; lightIndex < this.lights.length; lightIndex++) {
  9413. var light = this.lights[lightIndex];
  9414. var shadowGenerator = light.getShadowGenerator();
  9415. if (light.isEnabled() && shadowGenerator && shadowGenerator.getShadowMap().getScene().textures.indexOf(shadowGenerator.getShadowMap()) !== -1) {
  9416. this._renderTargets.push(shadowGenerator.getShadowMap());
  9417. }
  9418. }
  9419. }
  9420. // Depth renderer
  9421. if (this._depthRenderer) {
  9422. this._renderTargets.push(this._depthRenderer.getDepthMap());
  9423. }
  9424. // RenderPipeline
  9425. this.postProcessRenderPipelineManager.update();
  9426. // Multi-cameras?
  9427. if (this.activeCameras.length > 0) {
  9428. var currentRenderId = this._renderId;
  9429. for (var cameraIndex = 0; cameraIndex < this.activeCameras.length; cameraIndex++) {
  9430. this._renderId = currentRenderId;
  9431. this._processSubCameras(this.activeCameras[cameraIndex]);
  9432. }
  9433. }
  9434. else {
  9435. if (!this.activeCamera) {
  9436. throw new Error("No camera defined");
  9437. }
  9438. this._processSubCameras(this.activeCamera);
  9439. }
  9440. // Intersection checks
  9441. this._checkIntersections();
  9442. // Update the audio listener attached to the camera
  9443. this._updateAudioParameters();
  9444. // After render
  9445. if (this.afterRender) {
  9446. this.afterRender();
  9447. }
  9448. for (callbackIndex = 0; callbackIndex < this._onAfterRenderCallbacks.length; callbackIndex++) {
  9449. this._onAfterRenderCallbacks[callbackIndex]();
  9450. }
  9451. for (var index = 0; index < this._toBeDisposed.length; index++) {
  9452. this._toBeDisposed.data[index].dispose();
  9453. this._toBeDisposed[index] = null;
  9454. }
  9455. this._toBeDisposed.reset();
  9456. if (this.dumpNextRenderTargets) {
  9457. this.dumpNextRenderTargets = false;
  9458. }
  9459. BABYLON.Tools.EndPerformanceCounter("Scene rendering");
  9460. this._lastFrameDuration = BABYLON.Tools.Now - startDate;
  9461. };
  9462. Scene.prototype._updateAudioParameters = function () {
  9463. if (!this.audioEnabled || (this.mainSoundTrack.soundCollection.length === 0 && this.soundTracks.length === 0)) {
  9464. return;
  9465. }
  9466. var listeningCamera;
  9467. var audioEngine = BABYLON.Engine.audioEngine;
  9468. if (this.activeCameras.length > 0) {
  9469. listeningCamera = this.activeCameras[0];
  9470. }
  9471. else {
  9472. listeningCamera = this.activeCamera;
  9473. }
  9474. if (listeningCamera && audioEngine.canUseWebAudio) {
  9475. audioEngine.audioContext.listener.setPosition(listeningCamera.position.x, listeningCamera.position.y, listeningCamera.position.z);
  9476. var mat = BABYLON.Matrix.Invert(listeningCamera.getViewMatrix());
  9477. var cameraDirection = BABYLON.Vector3.TransformNormal(new BABYLON.Vector3(0, 0, -1), mat);
  9478. cameraDirection.normalize();
  9479. audioEngine.audioContext.listener.setOrientation(cameraDirection.x, cameraDirection.y, cameraDirection.z, 0, 1, 0);
  9480. for (var i = 0; i < this.mainSoundTrack.soundCollection.length; i++) {
  9481. var sound = this.mainSoundTrack.soundCollection[i];
  9482. if (sound.useCustomAttenuation) {
  9483. sound.updateDistanceFromListener();
  9484. }
  9485. }
  9486. for (i = 0; i < this.soundTracks.length; i++) {
  9487. for (var j = 0; j < this.soundTracks[i].soundCollection.length; j++) {
  9488. sound = this.soundTracks[i].soundCollection[j];
  9489. if (sound.useCustomAttenuation) {
  9490. sound.updateDistanceFromListener();
  9491. }
  9492. }
  9493. }
  9494. }
  9495. };
  9496. Object.defineProperty(Scene.prototype, "audioEnabled", {
  9497. // Audio
  9498. get: function () {
  9499. return this._audioEnabled;
  9500. },
  9501. set: function (value) {
  9502. this._audioEnabled = value;
  9503. if (this._audioEnabled) {
  9504. this._enableAudio();
  9505. }
  9506. else {
  9507. this._disableAudio();
  9508. }
  9509. },
  9510. enumerable: true,
  9511. configurable: true
  9512. });
  9513. Scene.prototype._disableAudio = function () {
  9514. for (var i = 0; i < this.mainSoundTrack.soundCollection.length; i++) {
  9515. this.mainSoundTrack.soundCollection[i].pause();
  9516. }
  9517. for (i = 0; i < this.soundTracks.length; i++) {
  9518. for (var j = 0; j < this.soundTracks[i].soundCollection.length; j++) {
  9519. this.soundTracks[i].soundCollection[j].pause();
  9520. }
  9521. }
  9522. };
  9523. Scene.prototype._enableAudio = function () {
  9524. for (var i = 0; i < this.mainSoundTrack.soundCollection.length; i++) {
  9525. if (this.mainSoundTrack.soundCollection[i].isPaused) {
  9526. this.mainSoundTrack.soundCollection[i].play();
  9527. }
  9528. }
  9529. for (i = 0; i < this.soundTracks.length; i++) {
  9530. for (var j = 0; j < this.soundTracks[i].soundCollection.length; j++) {
  9531. if (this.soundTracks[i].soundCollection[j].isPaused) {
  9532. this.soundTracks[i].soundCollection[j].play();
  9533. }
  9534. }
  9535. }
  9536. };
  9537. Object.defineProperty(Scene.prototype, "headphone", {
  9538. get: function () {
  9539. return this._headphone;
  9540. },
  9541. set: function (value) {
  9542. this._headphone = value;
  9543. if (this._headphone) {
  9544. this._switchAudioModeForHeadphones();
  9545. }
  9546. else {
  9547. this._switchAudioModeForNormalSpeakers();
  9548. }
  9549. },
  9550. enumerable: true,
  9551. configurable: true
  9552. });
  9553. Scene.prototype._switchAudioModeForHeadphones = function () {
  9554. this.mainSoundTrack.switchPanningModelToHRTF();
  9555. for (var i = 0; i < this.soundTracks.length; i++) {
  9556. this.soundTracks[i].switchPanningModelToHRTF();
  9557. }
  9558. };
  9559. Scene.prototype._switchAudioModeForNormalSpeakers = function () {
  9560. this.mainSoundTrack.switchPanningModelToEqualPower();
  9561. for (var i = 0; i < this.soundTracks.length; i++) {
  9562. this.soundTracks[i].switchPanningModelToEqualPower();
  9563. }
  9564. };
  9565. Scene.prototype.enableDepthRenderer = function () {
  9566. if (this._depthRenderer) {
  9567. return this._depthRenderer;
  9568. }
  9569. this._depthRenderer = new BABYLON.DepthRenderer(this);
  9570. return this._depthRenderer;
  9571. };
  9572. Scene.prototype.disableDepthRenderer = function () {
  9573. if (!this._depthRenderer) {
  9574. return;
  9575. }
  9576. this._depthRenderer.dispose();
  9577. this._depthRenderer = null;
  9578. };
  9579. Scene.prototype.dispose = function () {
  9580. this.beforeRender = null;
  9581. this.afterRender = null;
  9582. this.skeletons = [];
  9583. this._boundingBoxRenderer.dispose();
  9584. if (this._depthRenderer) {
  9585. this._depthRenderer.dispose();
  9586. }
  9587. // Debug layer
  9588. this.debugLayer.hide();
  9589. // Events
  9590. if (this.onDispose) {
  9591. this.onDispose();
  9592. }
  9593. this._onBeforeRenderCallbacks = [];
  9594. this._onAfterRenderCallbacks = [];
  9595. this.detachControl();
  9596. // Release sounds & sounds tracks
  9597. this.disposeSounds();
  9598. // Detach cameras
  9599. var canvas = this._engine.getRenderingCanvas();
  9600. var index;
  9601. for (index = 0; index < this.cameras.length; index++) {
  9602. this.cameras[index].detachControl(canvas);
  9603. }
  9604. while (this.lights.length) {
  9605. this.lights[0].dispose();
  9606. }
  9607. while (this.meshes.length) {
  9608. this.meshes[0].dispose(true);
  9609. }
  9610. while (this.cameras.length) {
  9611. this.cameras[0].dispose();
  9612. }
  9613. while (this.materials.length) {
  9614. this.materials[0].dispose();
  9615. }
  9616. while (this.particleSystems.length) {
  9617. this.particleSystems[0].dispose();
  9618. }
  9619. while (this.spriteManagers.length) {
  9620. this.spriteManagers[0].dispose();
  9621. }
  9622. while (this.layers.length) {
  9623. this.layers[0].dispose();
  9624. }
  9625. while (this.textures.length) {
  9626. this.textures[0].dispose();
  9627. }
  9628. // Post-processes
  9629. this.postProcessManager.dispose();
  9630. // Physics
  9631. if (this._physicsEngine) {
  9632. this.disablePhysicsEngine();
  9633. }
  9634. // Remove from engine
  9635. index = this._engine.scenes.indexOf(this);
  9636. if (index > -1) {
  9637. this._engine.scenes.splice(index, 1);
  9638. }
  9639. this._engine.wipeCaches();
  9640. };
  9641. // Release sounds & sounds tracks
  9642. Scene.prototype.disposeSounds = function () {
  9643. this.mainSoundTrack.dispose();
  9644. for (var scIndex = 0; scIndex < this.soundTracks.length; scIndex++) {
  9645. this.soundTracks[scIndex].dispose();
  9646. }
  9647. };
  9648. // Collisions
  9649. Scene.prototype._getNewPosition = function (position, velocity, collider, maximumRetry, finalPosition, excludedMesh) {
  9650. if (excludedMesh === void 0) { excludedMesh = null; }
  9651. position.divideToRef(collider.radius, this._scaledPosition);
  9652. velocity.divideToRef(collider.radius, this._scaledVelocity);
  9653. collider.retry = 0;
  9654. collider.initialVelocity = this._scaledVelocity;
  9655. collider.initialPosition = this._scaledPosition;
  9656. this._collideWithWorld(this._scaledPosition, this._scaledVelocity, collider, maximumRetry, finalPosition, excludedMesh);
  9657. finalPosition.multiplyInPlace(collider.radius);
  9658. };
  9659. Scene.prototype._collideWithWorld = function (position, velocity, collider, maximumRetry, finalPosition, excludedMesh) {
  9660. if (excludedMesh === void 0) { excludedMesh = null; }
  9661. var closeDistance = BABYLON.Engine.CollisionsEpsilon * 10.0;
  9662. if (collider.retry >= maximumRetry) {
  9663. finalPosition.copyFrom(position);
  9664. return;
  9665. }
  9666. collider._initialize(position, velocity, closeDistance);
  9667. for (var index = 0; index < this.meshes.length; index++) {
  9668. var mesh = this.meshes[index];
  9669. if (mesh.isEnabled() && mesh.checkCollisions && mesh.subMeshes && mesh !== excludedMesh) {
  9670. mesh._checkCollision(collider);
  9671. }
  9672. }
  9673. if (!collider.collisionFound) {
  9674. position.addToRef(velocity, finalPosition);
  9675. return;
  9676. }
  9677. if (velocity.x !== 0 || velocity.y !== 0 || velocity.z !== 0) {
  9678. collider._getResponse(position, velocity);
  9679. }
  9680. if (velocity.length() <= closeDistance) {
  9681. finalPosition.copyFrom(position);
  9682. return;
  9683. }
  9684. collider.retry++;
  9685. this._collideWithWorld(position, velocity, collider, maximumRetry, finalPosition, excludedMesh);
  9686. };
  9687. // Octrees
  9688. Scene.prototype.getWorldExtends = function () {
  9689. var min = new BABYLON.Vector3(Number.MAX_VALUE, Number.MAX_VALUE, Number.MAX_VALUE);
  9690. var max = new BABYLON.Vector3(-Number.MAX_VALUE, -Number.MAX_VALUE, -Number.MAX_VALUE);
  9691. for (var index = 0; index < this.meshes.length; index++) {
  9692. var mesh = this.meshes[index];
  9693. mesh.computeWorldMatrix(true);
  9694. var minBox = mesh.getBoundingInfo().boundingBox.minimumWorld;
  9695. var maxBox = mesh.getBoundingInfo().boundingBox.maximumWorld;
  9696. BABYLON.Tools.CheckExtends(minBox, min, max);
  9697. BABYLON.Tools.CheckExtends(maxBox, min, max);
  9698. }
  9699. return {
  9700. min: min,
  9701. max: max
  9702. };
  9703. };
  9704. Scene.prototype.createOrUpdateSelectionOctree = function (maxCapacity, maxDepth) {
  9705. if (maxCapacity === void 0) { maxCapacity = 64; }
  9706. if (maxDepth === void 0) { maxDepth = 2; }
  9707. if (!this._selectionOctree) {
  9708. this._selectionOctree = new BABYLON.Octree(BABYLON.Octree.CreationFuncForMeshes, maxCapacity, maxDepth);
  9709. }
  9710. var worldExtends = this.getWorldExtends();
  9711. // Update octree
  9712. this._selectionOctree.update(worldExtends.min, worldExtends.max, this.meshes);
  9713. return this._selectionOctree;
  9714. };
  9715. // Picking
  9716. Scene.prototype.createPickingRay = function (x, y, world, camera) {
  9717. var engine = this._engine;
  9718. if (!camera) {
  9719. if (!this.activeCamera)
  9720. throw new Error("Active camera not set");
  9721. camera = this.activeCamera;
  9722. }
  9723. var cameraViewport = camera.viewport;
  9724. var viewport = cameraViewport.toGlobal(engine);
  9725. // Moving coordinates to local viewport world
  9726. x = x / this._engine.getHardwareScalingLevel() - viewport.x;
  9727. y = y / this._engine.getHardwareScalingLevel() - (this._engine.getRenderHeight() - viewport.y - viewport.height);
  9728. return BABYLON.Ray.CreateNew(x, y, viewport.width, viewport.height, world ? world : BABYLON.Matrix.Identity(), camera.getViewMatrix(), camera.getProjectionMatrix());
  9729. // return BABYLON.Ray.CreateNew(x / window.devicePixelRatio, y / window.devicePixelRatio, viewport.width, viewport.height, world ? world : BABYLON.Matrix.Identity(), camera.getViewMatrix(), camera.getProjectionMatrix());
  9730. };
  9731. Scene.prototype._internalPick = function (rayFunction, predicate, fastCheck) {
  9732. var pickingInfo = null;
  9733. for (var meshIndex = 0; meshIndex < this.meshes.length; meshIndex++) {
  9734. var mesh = this.meshes[meshIndex];
  9735. if (predicate) {
  9736. if (!predicate(mesh)) {
  9737. continue;
  9738. }
  9739. }
  9740. else if (!mesh.isEnabled() || !mesh.isVisible || !mesh.isPickable) {
  9741. continue;
  9742. }
  9743. var world = mesh.getWorldMatrix();
  9744. var ray = rayFunction(world);
  9745. var result = mesh.intersects(ray, fastCheck);
  9746. if (!result || !result.hit)
  9747. continue;
  9748. if (!fastCheck && pickingInfo != null && result.distance >= pickingInfo.distance)
  9749. continue;
  9750. pickingInfo = result;
  9751. if (fastCheck) {
  9752. break;
  9753. }
  9754. }
  9755. return pickingInfo || new BABYLON.PickingInfo();
  9756. };
  9757. Scene.prototype.pick = function (x, y, predicate, fastCheck, camera) {
  9758. var _this = this;
  9759. /// <summary>Launch a ray to try to pick a mesh in the scene</summary>
  9760. /// <param name="x">X position on screen</param>
  9761. /// <param name="y">Y position on screen</param>
  9762. /// <param name="predicate">Predicate function used to determine eligible meshes. Can be set to null. In this case, a mesh must be enabled, visible and with isPickable set to true</param>
  9763. /// <param name="fastCheck">Launch a fast check only using the bounding boxes. Can be set to null.</param>
  9764. /// <param name="camera">camera to use for computing the picking ray. Can be set to null. In this case, the scene.activeCamera will be used</param>
  9765. return this._internalPick(function (world) { return _this.createPickingRay(x, y, world, camera); }, predicate, fastCheck);
  9766. };
  9767. Scene.prototype.pickWithRay = function (ray, predicate, fastCheck) {
  9768. var _this = this;
  9769. return this._internalPick(function (world) {
  9770. if (!_this._pickWithRayInverseMatrix) {
  9771. _this._pickWithRayInverseMatrix = BABYLON.Matrix.Identity();
  9772. }
  9773. world.invertToRef(_this._pickWithRayInverseMatrix);
  9774. return BABYLON.Ray.Transform(ray, _this._pickWithRayInverseMatrix);
  9775. }, predicate, fastCheck);
  9776. };
  9777. Scene.prototype.setPointerOverMesh = function (mesh) {
  9778. if (this._pointerOverMesh === mesh) {
  9779. return;
  9780. }
  9781. if (this._pointerOverMesh && this._pointerOverMesh.actionManager) {
  9782. this._pointerOverMesh.actionManager.processTrigger(BABYLON.ActionManager.OnPointerOutTrigger, BABYLON.ActionEvent.CreateNew(this._pointerOverMesh));
  9783. }
  9784. this._pointerOverMesh = mesh;
  9785. if (this._pointerOverMesh && this._pointerOverMesh.actionManager) {
  9786. this._pointerOverMesh.actionManager.processTrigger(BABYLON.ActionManager.OnPointerOverTrigger, BABYLON.ActionEvent.CreateNew(this._pointerOverMesh));
  9787. }
  9788. };
  9789. Scene.prototype.getPointerOverMesh = function () {
  9790. return this._pointerOverMesh;
  9791. };
  9792. // Physics
  9793. Scene.prototype.getPhysicsEngine = function () {
  9794. return this._physicsEngine;
  9795. };
  9796. Scene.prototype.enablePhysics = function (gravity, plugin) {
  9797. if (this._physicsEngine) {
  9798. return true;
  9799. }
  9800. this._physicsEngine = new BABYLON.PhysicsEngine(plugin);
  9801. if (!this._physicsEngine.isSupported()) {
  9802. this._physicsEngine = null;
  9803. return false;
  9804. }
  9805. this._physicsEngine._initialize(gravity);
  9806. return true;
  9807. };
  9808. Scene.prototype.disablePhysicsEngine = function () {
  9809. if (!this._physicsEngine) {
  9810. return;
  9811. }
  9812. this._physicsEngine.dispose();
  9813. this._physicsEngine = undefined;
  9814. };
  9815. Scene.prototype.isPhysicsEnabled = function () {
  9816. return this._physicsEngine !== undefined;
  9817. };
  9818. Scene.prototype.setGravity = function (gravity) {
  9819. if (!this._physicsEngine) {
  9820. return;
  9821. }
  9822. this._physicsEngine._setGravity(gravity);
  9823. };
  9824. Scene.prototype.createCompoundImpostor = function (parts, options) {
  9825. if (parts.parts) {
  9826. options = parts;
  9827. parts = parts.parts;
  9828. }
  9829. if (!this._physicsEngine) {
  9830. return null;
  9831. }
  9832. for (var index = 0; index < parts.length; index++) {
  9833. var mesh = parts[index].mesh;
  9834. mesh._physicImpostor = parts[index].impostor;
  9835. mesh._physicsMass = options.mass / parts.length;
  9836. mesh._physicsFriction = options.friction;
  9837. mesh._physicRestitution = options.restitution;
  9838. }
  9839. return this._physicsEngine._registerMeshesAsCompound(parts, options);
  9840. };
  9841. Scene.prototype.deleteCompoundImpostor = function (compound) {
  9842. for (var index = 0; index < compound.parts.length; index++) {
  9843. var mesh = compound.parts[index].mesh;
  9844. mesh._physicImpostor = BABYLON.PhysicsEngine.NoImpostor;
  9845. this._physicsEngine._unregisterMesh(mesh);
  9846. }
  9847. };
  9848. // Misc.
  9849. Scene.prototype.createDefaultCameraOrLight = function () {
  9850. // Light
  9851. if (this.lights.length === 0) {
  9852. new BABYLON.HemisphericLight("default light", BABYLON.Vector3.Up(), this);
  9853. }
  9854. // Camera
  9855. if (!this.activeCamera) {
  9856. var camera = new BABYLON.FreeCamera("default camera", BABYLON.Vector3.Zero(), this);
  9857. // Compute position
  9858. var worldExtends = this.getWorldExtends();
  9859. var worldCenter = worldExtends.min.add(worldExtends.max.subtract(worldExtends.min).scale(0.5));
  9860. camera.position = new BABYLON.Vector3(worldCenter.x, worldCenter.y, worldExtends.min.z - (worldExtends.max.z - worldExtends.min.z));
  9861. camera.setTarget(worldCenter);
  9862. this.activeCamera = camera;
  9863. }
  9864. };
  9865. // Tags
  9866. Scene.prototype._getByTags = function (list, tagsQuery, forEach) {
  9867. if (tagsQuery === undefined) {
  9868. // returns the complete list (could be done with BABYLON.Tags.MatchesQuery but no need to have a for-loop here)
  9869. return list;
  9870. }
  9871. var listByTags = [];
  9872. forEach = forEach || (function (item) {
  9873. return;
  9874. });
  9875. for (var i in list) {
  9876. var item = list[i];
  9877. if (BABYLON.Tags.MatchesQuery(item, tagsQuery)) {
  9878. listByTags.push(item);
  9879. forEach(item);
  9880. }
  9881. }
  9882. return listByTags;
  9883. };
  9884. Scene.prototype.getMeshesByTags = function (tagsQuery, forEach) {
  9885. return this._getByTags(this.meshes, tagsQuery, forEach);
  9886. };
  9887. Scene.prototype.getCamerasByTags = function (tagsQuery, forEach) {
  9888. return this._getByTags(this.cameras, tagsQuery, forEach);
  9889. };
  9890. Scene.prototype.getLightsByTags = function (tagsQuery, forEach) {
  9891. return this._getByTags(this.lights, tagsQuery, forEach);
  9892. };
  9893. Scene.prototype.getMaterialByTags = function (tagsQuery, forEach) {
  9894. return this._getByTags(this.materials, tagsQuery, forEach).concat(this._getByTags(this.multiMaterials, tagsQuery, forEach));
  9895. };
  9896. // Statics
  9897. Scene._FOGMODE_NONE = 0;
  9898. Scene._FOGMODE_EXP = 1;
  9899. Scene._FOGMODE_EXP2 = 2;
  9900. Scene._FOGMODE_LINEAR = 3;
  9901. Scene.MinDeltaTime = 1.0;
  9902. Scene.MaxDeltaTime = 1000.0;
  9903. return Scene;
  9904. })();
  9905. BABYLON.Scene = Scene;
  9906. })(BABYLON || (BABYLON = {}));
  9907. //# sourceMappingURL=babylon.scene.js.mapvar BABYLON;
  9908. (function (BABYLON) {
  9909. var VertexBuffer = (function () {
  9910. function VertexBuffer(engine, data, kind, updatable, postponeInternalCreation, stride) {
  9911. if (engine instanceof BABYLON.Mesh) {
  9912. this._engine = engine.getScene().getEngine();
  9913. }
  9914. else {
  9915. this._engine = engine;
  9916. }
  9917. this._updatable = updatable;
  9918. this._data = data;
  9919. if (!postponeInternalCreation) {
  9920. this.create();
  9921. }
  9922. this._kind = kind;
  9923. if (stride) {
  9924. this._strideSize = stride;
  9925. return;
  9926. }
  9927. switch (kind) {
  9928. case VertexBuffer.PositionKind:
  9929. this._strideSize = 3;
  9930. break;
  9931. case VertexBuffer.NormalKind:
  9932. this._strideSize = 3;
  9933. break;
  9934. case VertexBuffer.UVKind:
  9935. this._strideSize = 2;
  9936. break;
  9937. case VertexBuffer.UV2Kind:
  9938. this._strideSize = 2;
  9939. break;
  9940. case VertexBuffer.ColorKind:
  9941. this._strideSize = 4;
  9942. break;
  9943. case VertexBuffer.MatricesIndicesKind:
  9944. this._strideSize = 4;
  9945. break;
  9946. case VertexBuffer.MatricesWeightsKind:
  9947. this._strideSize = 4;
  9948. break;
  9949. }
  9950. }
  9951. // Properties
  9952. VertexBuffer.prototype.isUpdatable = function () {
  9953. return this._updatable;
  9954. };
  9955. VertexBuffer.prototype.getData = function () {
  9956. return this._data;
  9957. };
  9958. VertexBuffer.prototype.getBuffer = function () {
  9959. return this._buffer;
  9960. };
  9961. VertexBuffer.prototype.getStrideSize = function () {
  9962. return this._strideSize;
  9963. };
  9964. // Methods
  9965. VertexBuffer.prototype.create = function (data) {
  9966. if (!data && this._buffer) {
  9967. return; // nothing to do
  9968. }
  9969. data = data || this._data;
  9970. if (!this._buffer) {
  9971. if (this._updatable) {
  9972. this._buffer = this._engine.createDynamicVertexBuffer(data.length * 4);
  9973. }
  9974. else {
  9975. this._buffer = this._engine.createVertexBuffer(data);
  9976. }
  9977. }
  9978. if (this._updatable) {
  9979. this._engine.updateDynamicVertexBuffer(this._buffer, data);
  9980. this._data = data;
  9981. }
  9982. };
  9983. VertexBuffer.prototype.update = function (data) {
  9984. this.create(data);
  9985. };
  9986. VertexBuffer.prototype.updateDirectly = function (data, offset) {
  9987. if (!this._buffer) {
  9988. return;
  9989. }
  9990. if (this._updatable) {
  9991. this._engine.updateDynamicVertexBuffer(this._buffer, data, offset);
  9992. this._data = null;
  9993. }
  9994. };
  9995. VertexBuffer.prototype.dispose = function () {
  9996. if (!this._buffer) {
  9997. return;
  9998. }
  9999. if (this._engine._releaseBuffer(this._buffer)) {
  10000. this._buffer = null;
  10001. }
  10002. };
  10003. Object.defineProperty(VertexBuffer, "PositionKind", {
  10004. get: function () {
  10005. return VertexBuffer._PositionKind;
  10006. },
  10007. enumerable: true,
  10008. configurable: true
  10009. });
  10010. Object.defineProperty(VertexBuffer, "NormalKind", {
  10011. get: function () {
  10012. return VertexBuffer._NormalKind;
  10013. },
  10014. enumerable: true,
  10015. configurable: true
  10016. });
  10017. Object.defineProperty(VertexBuffer, "UVKind", {
  10018. get: function () {
  10019. return VertexBuffer._UVKind;
  10020. },
  10021. enumerable: true,
  10022. configurable: true
  10023. });
  10024. Object.defineProperty(VertexBuffer, "UV2Kind", {
  10025. get: function () {
  10026. return VertexBuffer._UV2Kind;
  10027. },
  10028. enumerable: true,
  10029. configurable: true
  10030. });
  10031. Object.defineProperty(VertexBuffer, "ColorKind", {
  10032. get: function () {
  10033. return VertexBuffer._ColorKind;
  10034. },
  10035. enumerable: true,
  10036. configurable: true
  10037. });
  10038. Object.defineProperty(VertexBuffer, "MatricesIndicesKind", {
  10039. get: function () {
  10040. return VertexBuffer._MatricesIndicesKind;
  10041. },
  10042. enumerable: true,
  10043. configurable: true
  10044. });
  10045. Object.defineProperty(VertexBuffer, "MatricesWeightsKind", {
  10046. get: function () {
  10047. return VertexBuffer._MatricesWeightsKind;
  10048. },
  10049. enumerable: true,
  10050. configurable: true
  10051. });
  10052. // Enums
  10053. VertexBuffer._PositionKind = "position";
  10054. VertexBuffer._NormalKind = "normal";
  10055. VertexBuffer._UVKind = "uv";
  10056. VertexBuffer._UV2Kind = "uv2";
  10057. VertexBuffer._ColorKind = "color";
  10058. VertexBuffer._MatricesIndicesKind = "matricesIndices";
  10059. VertexBuffer._MatricesWeightsKind = "matricesWeights";
  10060. return VertexBuffer;
  10061. })();
  10062. BABYLON.VertexBuffer = VertexBuffer;
  10063. })(BABYLON || (BABYLON = {}));
  10064. //# sourceMappingURL=babylon.vertexBuffer.js.map
  10065. var BABYLON;
  10066. (function (BABYLON) {
  10067. var AbstractMesh = (function (_super) {
  10068. __extends(AbstractMesh, _super);
  10069. function AbstractMesh(name, scene) {
  10070. _super.call(this, name, scene);
  10071. // Properties
  10072. this.definedFacingForward = true; // orientation for POV movement & rotation
  10073. this.position = new BABYLON.Vector3(0, 0, 0);
  10074. this.rotation = new BABYLON.Vector3(0, 0, 0);
  10075. this.scaling = new BABYLON.Vector3(1, 1, 1);
  10076. this.billboardMode = AbstractMesh.BILLBOARDMODE_NONE;
  10077. this.visibility = 1.0;
  10078. this.alphaIndex = Number.MAX_VALUE;
  10079. this.infiniteDistance = false;
  10080. this.isVisible = true;
  10081. this.isPickable = true;
  10082. this.showBoundingBox = false;
  10083. this.showSubMeshesBoundingBox = false;
  10084. this.onDispose = null;
  10085. this.checkCollisions = false;
  10086. this.isBlocker = false;
  10087. this.renderingGroupId = 0;
  10088. this.receiveShadows = false;
  10089. this.renderOutline = false;
  10090. this.outlineColor = BABYLON.Color3.Red();
  10091. this.outlineWidth = 0.02;
  10092. this.renderOverlay = false;
  10093. this.overlayColor = BABYLON.Color3.Red();
  10094. this.overlayAlpha = 0.5;
  10095. this.hasVertexAlpha = false;
  10096. this.useVertexColors = true;
  10097. this.applyFog = true;
  10098. this.useOctreeForRenderingSelection = true;
  10099. this.useOctreeForPicking = true;
  10100. this.useOctreeForCollisions = true;
  10101. this.layerMask = 0x0FFFFFFF;
  10102. // Physics
  10103. this._physicImpostor = BABYLON.PhysicsEngine.NoImpostor;
  10104. // Collisions
  10105. this.ellipsoid = new BABYLON.Vector3(0.5, 1, 0.5);
  10106. this.ellipsoidOffset = new BABYLON.Vector3(0, 0, 0);
  10107. this._collider = new BABYLON.Collider();
  10108. this._oldPositionForCollisions = new BABYLON.Vector3(0, 0, 0);
  10109. this._diffPositionForCollisions = new BABYLON.Vector3(0, 0, 0);
  10110. this._newPositionForCollisions = new BABYLON.Vector3(0, 0, 0);
  10111. // Cache
  10112. this._localScaling = BABYLON.Matrix.Zero();
  10113. this._localRotation = BABYLON.Matrix.Zero();
  10114. this._localTranslation = BABYLON.Matrix.Zero();
  10115. this._localBillboard = BABYLON.Matrix.Zero();
  10116. this._localPivotScaling = BABYLON.Matrix.Zero();
  10117. this._localPivotScalingRotation = BABYLON.Matrix.Zero();
  10118. this._localWorld = BABYLON.Matrix.Zero();
  10119. this._worldMatrix = BABYLON.Matrix.Zero();
  10120. this._rotateYByPI = BABYLON.Matrix.RotationY(Math.PI);
  10121. this._absolutePosition = BABYLON.Vector3.Zero();
  10122. this._collisionsTransformMatrix = BABYLON.Matrix.Zero();
  10123. this._collisionsScalingMatrix = BABYLON.Matrix.Zero();
  10124. this._isDirty = false;
  10125. this._pivotMatrix = BABYLON.Matrix.Identity();
  10126. this._isDisposed = false;
  10127. this._renderId = 0;
  10128. this._intersectionsInProgress = new Array();
  10129. this._onAfterWorldMatrixUpdate = new Array();
  10130. scene.addMesh(this);
  10131. }
  10132. Object.defineProperty(AbstractMesh, "BILLBOARDMODE_NONE", {
  10133. get: function () {
  10134. return AbstractMesh._BILLBOARDMODE_NONE;
  10135. },
  10136. enumerable: true,
  10137. configurable: true
  10138. });
  10139. Object.defineProperty(AbstractMesh, "BILLBOARDMODE_X", {
  10140. get: function () {
  10141. return AbstractMesh._BILLBOARDMODE_X;
  10142. },
  10143. enumerable: true,
  10144. configurable: true
  10145. });
  10146. Object.defineProperty(AbstractMesh, "BILLBOARDMODE_Y", {
  10147. get: function () {
  10148. return AbstractMesh._BILLBOARDMODE_Y;
  10149. },
  10150. enumerable: true,
  10151. configurable: true
  10152. });
  10153. Object.defineProperty(AbstractMesh, "BILLBOARDMODE_Z", {
  10154. get: function () {
  10155. return AbstractMesh._BILLBOARDMODE_Z;
  10156. },
  10157. enumerable: true,
  10158. configurable: true
  10159. });
  10160. Object.defineProperty(AbstractMesh, "BILLBOARDMODE_ALL", {
  10161. get: function () {
  10162. return AbstractMesh._BILLBOARDMODE_ALL;
  10163. },
  10164. enumerable: true,
  10165. configurable: true
  10166. });
  10167. Object.defineProperty(AbstractMesh.prototype, "isBlocked", {
  10168. // Methods
  10169. get: function () {
  10170. return false;
  10171. },
  10172. enumerable: true,
  10173. configurable: true
  10174. });
  10175. AbstractMesh.prototype.getLOD = function (camera) {
  10176. return this;
  10177. };
  10178. AbstractMesh.prototype.getTotalVertices = function () {
  10179. return 0;
  10180. };
  10181. AbstractMesh.prototype.getIndices = function () {
  10182. return null;
  10183. };
  10184. AbstractMesh.prototype.getVerticesData = function (kind) {
  10185. return null;
  10186. };
  10187. AbstractMesh.prototype.isVerticesDataPresent = function (kind) {
  10188. return false;
  10189. };
  10190. AbstractMesh.prototype.getBoundingInfo = function () {
  10191. if (this._masterMesh) {
  10192. return this._masterMesh.getBoundingInfo();
  10193. }
  10194. if (!this._boundingInfo) {
  10195. this._updateBoundingInfo();
  10196. }
  10197. return this._boundingInfo;
  10198. };
  10199. Object.defineProperty(AbstractMesh.prototype, "useBones", {
  10200. get: function () {
  10201. return this.skeleton && this.getScene().skeletonsEnabled && this.isVerticesDataPresent(BABYLON.VertexBuffer.MatricesIndicesKind) && this.isVerticesDataPresent(BABYLON.VertexBuffer.MatricesWeightsKind);
  10202. },
  10203. enumerable: true,
  10204. configurable: true
  10205. });
  10206. AbstractMesh.prototype._preActivate = function () {
  10207. };
  10208. AbstractMesh.prototype._activate = function (renderId) {
  10209. this._renderId = renderId;
  10210. };
  10211. AbstractMesh.prototype.getWorldMatrix = function () {
  10212. if (this._masterMesh) {
  10213. return this._masterMesh.getWorldMatrix();
  10214. }
  10215. if (this._currentRenderId !== this.getScene().getRenderId()) {
  10216. this.computeWorldMatrix();
  10217. }
  10218. return this._worldMatrix;
  10219. };
  10220. Object.defineProperty(AbstractMesh.prototype, "worldMatrixFromCache", {
  10221. get: function () {
  10222. return this._worldMatrix;
  10223. },
  10224. enumerable: true,
  10225. configurable: true
  10226. });
  10227. Object.defineProperty(AbstractMesh.prototype, "absolutePosition", {
  10228. get: function () {
  10229. return this._absolutePosition;
  10230. },
  10231. enumerable: true,
  10232. configurable: true
  10233. });
  10234. AbstractMesh.prototype.rotate = function (axis, amount, space) {
  10235. if (!this.rotationQuaternion) {
  10236. this.rotationQuaternion = BABYLON.Quaternion.RotationYawPitchRoll(this.rotation.y, this.rotation.x, this.rotation.z);
  10237. this.rotation = BABYLON.Vector3.Zero();
  10238. }
  10239. if (!space || space === 0 /* LOCAL */) {
  10240. var rotationQuaternion = BABYLON.Quaternion.RotationAxis(axis, amount);
  10241. this.rotationQuaternion = this.rotationQuaternion.multiply(rotationQuaternion);
  10242. }
  10243. else {
  10244. if (this.parent) {
  10245. var invertParentWorldMatrix = this.parent.getWorldMatrix().clone();
  10246. invertParentWorldMatrix.invert();
  10247. axis = BABYLON.Vector3.TransformNormal(axis, invertParentWorldMatrix);
  10248. }
  10249. rotationQuaternion = BABYLON.Quaternion.RotationAxis(axis, amount);
  10250. this.rotationQuaternion = rotationQuaternion.multiply(this.rotationQuaternion);
  10251. }
  10252. };
  10253. AbstractMesh.prototype.translate = function (axis, distance, space) {
  10254. var displacementVector = axis.scale(distance);
  10255. if (!space || space === 0 /* LOCAL */) {
  10256. var tempV3 = this.getPositionExpressedInLocalSpace().add(displacementVector);
  10257. this.setPositionWithLocalVector(tempV3);
  10258. }
  10259. else {
  10260. this.setAbsolutePosition(this.getAbsolutePosition().add(displacementVector));
  10261. }
  10262. };
  10263. AbstractMesh.prototype.getAbsolutePosition = function () {
  10264. this.computeWorldMatrix();
  10265. return this._absolutePosition;
  10266. };
  10267. AbstractMesh.prototype.setAbsolutePosition = function (absolutePosition) {
  10268. if (!absolutePosition) {
  10269. return;
  10270. }
  10271. var absolutePositionX;
  10272. var absolutePositionY;
  10273. var absolutePositionZ;
  10274. if (absolutePosition.x === undefined) {
  10275. if (arguments.length < 3) {
  10276. return;
  10277. }
  10278. absolutePositionX = arguments[0];
  10279. absolutePositionY = arguments[1];
  10280. absolutePositionZ = arguments[2];
  10281. }
  10282. else {
  10283. absolutePositionX = absolutePosition.x;
  10284. absolutePositionY = absolutePosition.y;
  10285. absolutePositionZ = absolutePosition.z;
  10286. }
  10287. if (this.parent) {
  10288. var invertParentWorldMatrix = this.parent.getWorldMatrix().clone();
  10289. invertParentWorldMatrix.invert();
  10290. var worldPosition = new BABYLON.Vector3(absolutePositionX, absolutePositionY, absolutePositionZ);
  10291. this.position = BABYLON.Vector3.TransformCoordinates(worldPosition, invertParentWorldMatrix);
  10292. }
  10293. else {
  10294. this.position.x = absolutePositionX;
  10295. this.position.y = absolutePositionY;
  10296. this.position.z = absolutePositionZ;
  10297. }
  10298. };
  10299. // ================================== Point of View Movement =================================
  10300. /**
  10301. * Perform relative position change from the point of view of behind the front of the mesh.
  10302. * This is performed taking into account the meshes current rotation, so you do not have to care.
  10303. * Supports definition of mesh facing forward or backward.
  10304. * @param {number} amountRight
  10305. * @param {number} amountUp
  10306. * @param {number} amountForward
  10307. */
  10308. AbstractMesh.prototype.movePOV = function (amountRight, amountUp, amountForward) {
  10309. this.position.addInPlace(this.calcMovePOV(amountRight, amountUp, amountForward));
  10310. };
  10311. /**
  10312. * Calculate relative position change from the point of view of behind the front of the mesh.
  10313. * This is performed taking into account the meshes current rotation, so you do not have to care.
  10314. * Supports definition of mesh facing forward or backward.
  10315. * @param {number} amountRight
  10316. * @param {number} amountUp
  10317. * @param {number} amountForward
  10318. */
  10319. AbstractMesh.prototype.calcMovePOV = function (amountRight, amountUp, amountForward) {
  10320. var rotMatrix = new BABYLON.Matrix();
  10321. var rotQuaternion = (this.rotationQuaternion) ? this.rotationQuaternion : BABYLON.Quaternion.RotationYawPitchRoll(this.rotation.y, this.rotation.x, this.rotation.z);
  10322. rotQuaternion.toRotationMatrix(rotMatrix);
  10323. var translationDelta = BABYLON.Vector3.Zero();
  10324. var defForwardMult = this.definedFacingForward ? -1 : 1;
  10325. BABYLON.Vector3.TransformCoordinatesFromFloatsToRef(amountRight * defForwardMult, amountUp, amountForward * defForwardMult, rotMatrix, translationDelta);
  10326. return translationDelta;
  10327. };
  10328. // ================================== Point of View Rotation =================================
  10329. /**
  10330. * Perform relative rotation change from the point of view of behind the front of the mesh.
  10331. * Supports definition of mesh facing forward or backward.
  10332. * @param {number} flipBack
  10333. * @param {number} twirlClockwise
  10334. * @param {number} tiltRight
  10335. */
  10336. AbstractMesh.prototype.rotatePOV = function (flipBack, twirlClockwise, tiltRight) {
  10337. this.rotation.addInPlace(this.calcRotatePOV(flipBack, twirlClockwise, tiltRight));
  10338. };
  10339. /**
  10340. * Calculate relative rotation change from the point of view of behind the front of the mesh.
  10341. * Supports definition of mesh facing forward or backward.
  10342. * @param {number} flipBack
  10343. * @param {number} twirlClockwise
  10344. * @param {number} tiltRight
  10345. */
  10346. AbstractMesh.prototype.calcRotatePOV = function (flipBack, twirlClockwise, tiltRight) {
  10347. var defForwardMult = this.definedFacingForward ? 1 : -1;
  10348. return new BABYLON.Vector3(flipBack * defForwardMult, twirlClockwise, tiltRight * defForwardMult);
  10349. };
  10350. AbstractMesh.prototype.setPivotMatrix = function (matrix) {
  10351. this._pivotMatrix = matrix;
  10352. this._cache.pivotMatrixUpdated = true;
  10353. };
  10354. AbstractMesh.prototype.getPivotMatrix = function () {
  10355. return this._pivotMatrix;
  10356. };
  10357. AbstractMesh.prototype._isSynchronized = function () {
  10358. if (this._isDirty) {
  10359. return false;
  10360. }
  10361. if (this.billboardMode !== AbstractMesh.BILLBOARDMODE_NONE)
  10362. return false;
  10363. if (this._cache.pivotMatrixUpdated) {
  10364. return false;
  10365. }
  10366. if (this.infiniteDistance) {
  10367. return false;
  10368. }
  10369. if (!this._cache.position.equals(this.position))
  10370. return false;
  10371. if (this.rotationQuaternion) {
  10372. if (!this._cache.rotationQuaternion.equals(this.rotationQuaternion))
  10373. return false;
  10374. }
  10375. else {
  10376. if (!this._cache.rotation.equals(this.rotation))
  10377. return false;
  10378. }
  10379. if (!this._cache.scaling.equals(this.scaling))
  10380. return false;
  10381. return true;
  10382. };
  10383. AbstractMesh.prototype._initCache = function () {
  10384. _super.prototype._initCache.call(this);
  10385. this._cache.localMatrixUpdated = false;
  10386. this._cache.position = BABYLON.Vector3.Zero();
  10387. this._cache.scaling = BABYLON.Vector3.Zero();
  10388. this._cache.rotation = BABYLON.Vector3.Zero();
  10389. this._cache.rotationQuaternion = new BABYLON.Quaternion(0, 0, 0, 0);
  10390. };
  10391. AbstractMesh.prototype.markAsDirty = function (property) {
  10392. if (property === "rotation") {
  10393. this.rotationQuaternion = null;
  10394. }
  10395. this._currentRenderId = Number.MAX_VALUE;
  10396. this._isDirty = true;
  10397. };
  10398. AbstractMesh.prototype._updateBoundingInfo = function () {
  10399. this._boundingInfo = this._boundingInfo || new BABYLON.BoundingInfo(this.absolutePosition, this.absolutePosition);
  10400. this._boundingInfo._update(this.worldMatrixFromCache);
  10401. this._updateSubMeshesBoundingInfo(this.worldMatrixFromCache);
  10402. };
  10403. AbstractMesh.prototype._updateSubMeshesBoundingInfo = function (matrix) {
  10404. if (!this.subMeshes) {
  10405. return;
  10406. }
  10407. for (var subIndex = 0; subIndex < this.subMeshes.length; subIndex++) {
  10408. var subMesh = this.subMeshes[subIndex];
  10409. subMesh.updateBoundingInfo(matrix);
  10410. }
  10411. };
  10412. AbstractMesh.prototype.computeWorldMatrix = function (force) {
  10413. if (!force && (this._currentRenderId === this.getScene().getRenderId() || this.isSynchronized(true))) {
  10414. return this._worldMatrix;
  10415. }
  10416. this._cache.position.copyFrom(this.position);
  10417. this._cache.scaling.copyFrom(this.scaling);
  10418. this._cache.pivotMatrixUpdated = false;
  10419. this._currentRenderId = this.getScene().getRenderId();
  10420. this._isDirty = false;
  10421. // Scaling
  10422. BABYLON.Matrix.ScalingToRef(this.scaling.x, this.scaling.y, this.scaling.z, this._localScaling);
  10423. // Rotation
  10424. if (this.rotationQuaternion) {
  10425. this.rotationQuaternion.toRotationMatrix(this._localRotation);
  10426. this._cache.rotationQuaternion.copyFrom(this.rotationQuaternion);
  10427. }
  10428. else {
  10429. BABYLON.Matrix.RotationYawPitchRollToRef(this.rotation.y, this.rotation.x, this.rotation.z, this._localRotation);
  10430. this._cache.rotation.copyFrom(this.rotation);
  10431. }
  10432. // Translation
  10433. if (this.infiniteDistance && !this.parent) {
  10434. var camera = this.getScene().activeCamera;
  10435. var cameraWorldMatrix = camera.getWorldMatrix();
  10436. var cameraGlobalPosition = new BABYLON.Vector3(cameraWorldMatrix.m[12], cameraWorldMatrix.m[13], cameraWorldMatrix.m[14]);
  10437. BABYLON.Matrix.TranslationToRef(this.position.x + cameraGlobalPosition.x, this.position.y + cameraGlobalPosition.y, this.position.z + cameraGlobalPosition.z, this._localTranslation);
  10438. }
  10439. else {
  10440. BABYLON.Matrix.TranslationToRef(this.position.x, this.position.y, this.position.z, this._localTranslation);
  10441. }
  10442. // Composing transformations
  10443. this._pivotMatrix.multiplyToRef(this._localScaling, this._localPivotScaling);
  10444. this._localPivotScaling.multiplyToRef(this._localRotation, this._localPivotScalingRotation);
  10445. // Billboarding
  10446. if (this.billboardMode !== AbstractMesh.BILLBOARDMODE_NONE && this.getScene().activeCamera) {
  10447. var localPosition = this.position.clone();
  10448. var zero = this.getScene().activeCamera.globalPosition.clone();
  10449. if (this.parent && this.parent.position) {
  10450. localPosition.addInPlace(this.parent.position);
  10451. BABYLON.Matrix.TranslationToRef(localPosition.x, localPosition.y, localPosition.z, this._localTranslation);
  10452. }
  10453. if ((this.billboardMode & AbstractMesh.BILLBOARDMODE_ALL) != AbstractMesh.BILLBOARDMODE_ALL) {
  10454. if (this.billboardMode & AbstractMesh.BILLBOARDMODE_X)
  10455. zero.x = localPosition.x + BABYLON.Engine.Epsilon;
  10456. if (this.billboardMode & AbstractMesh.BILLBOARDMODE_Y)
  10457. zero.y = localPosition.y + 0.001;
  10458. if (this.billboardMode & AbstractMesh.BILLBOARDMODE_Z)
  10459. zero.z = localPosition.z + 0.001;
  10460. }
  10461. BABYLON.Matrix.LookAtLHToRef(localPosition, zero, BABYLON.Vector3.Up(), this._localBillboard);
  10462. this._localBillboard.m[12] = this._localBillboard.m[13] = this._localBillboard.m[14] = 0;
  10463. this._localBillboard.invert();
  10464. this._localPivotScalingRotation.multiplyToRef(this._localBillboard, this._localWorld);
  10465. this._rotateYByPI.multiplyToRef(this._localWorld, this._localPivotScalingRotation);
  10466. }
  10467. // Local world
  10468. this._localPivotScalingRotation.multiplyToRef(this._localTranslation, this._localWorld);
  10469. // Parent
  10470. if (this.parent && this.parent.getWorldMatrix && this.billboardMode === AbstractMesh.BILLBOARDMODE_NONE) {
  10471. this._localWorld.multiplyToRef(this.parent.getWorldMatrix(), this._worldMatrix);
  10472. }
  10473. else {
  10474. this._worldMatrix.copyFrom(this._localWorld);
  10475. }
  10476. // Bounding info
  10477. this._updateBoundingInfo();
  10478. // Absolute position
  10479. this._absolutePosition.copyFromFloats(this._worldMatrix.m[12], this._worldMatrix.m[13], this._worldMatrix.m[14]);
  10480. for (var callbackIndex = 0; callbackIndex < this._onAfterWorldMatrixUpdate.length; callbackIndex++) {
  10481. this._onAfterWorldMatrixUpdate[callbackIndex](this);
  10482. }
  10483. return this._worldMatrix;
  10484. };
  10485. /**
  10486. * If you'd like to be callbacked after the mesh position, rotation or scaling has been updated
  10487. * @param func: callback function to add
  10488. */
  10489. AbstractMesh.prototype.registerAfterWorldMatrixUpdate = function (func) {
  10490. this._onAfterWorldMatrixUpdate.push(func);
  10491. };
  10492. AbstractMesh.prototype.unregisterAfterWorldMatrixUpdate = function (func) {
  10493. var index = this._onAfterWorldMatrixUpdate.indexOf(func);
  10494. if (index > -1) {
  10495. this._onAfterWorldMatrixUpdate.splice(index, 1);
  10496. }
  10497. };
  10498. AbstractMesh.prototype.setPositionWithLocalVector = function (vector3) {
  10499. this.computeWorldMatrix();
  10500. this.position = BABYLON.Vector3.TransformNormal(vector3, this._localWorld);
  10501. };
  10502. AbstractMesh.prototype.getPositionExpressedInLocalSpace = function () {
  10503. this.computeWorldMatrix();
  10504. var invLocalWorldMatrix = this._localWorld.clone();
  10505. invLocalWorldMatrix.invert();
  10506. return BABYLON.Vector3.TransformNormal(this.position, invLocalWorldMatrix);
  10507. };
  10508. AbstractMesh.prototype.locallyTranslate = function (vector3) {
  10509. this.computeWorldMatrix();
  10510. this.position = BABYLON.Vector3.TransformCoordinates(vector3, this._localWorld);
  10511. };
  10512. AbstractMesh.prototype.lookAt = function (targetPoint, yawCor, pitchCor, rollCor) {
  10513. /// <summary>Orients a mesh towards a target point. Mesh must be drawn facing user.</summary>
  10514. /// <param name="targetPoint" type="Vector3">The position (must be in same space as current mesh) to look at</param>
  10515. /// <param name="yawCor" type="Number">optional yaw (y-axis) correction in radians</param>
  10516. /// <param name="pitchCor" type="Number">optional pitch (x-axis) correction in radians</param>
  10517. /// <param name="rollCor" type="Number">optional roll (z-axis) correction in radians</param>
  10518. /// <returns>Mesh oriented towards targetMesh</returns>
  10519. yawCor = yawCor || 0; // default to zero if undefined
  10520. pitchCor = pitchCor || 0;
  10521. rollCor = rollCor || 0;
  10522. var dv = targetPoint.subtract(this.position);
  10523. var yaw = -Math.atan2(dv.z, dv.x) - Math.PI / 2;
  10524. var len = Math.sqrt(dv.x * dv.x + dv.z * dv.z);
  10525. var pitch = Math.atan2(dv.y, len);
  10526. this.rotationQuaternion = BABYLON.Quaternion.RotationYawPitchRoll(yaw + yawCor, pitch + pitchCor, rollCor);
  10527. };
  10528. AbstractMesh.prototype.isInFrustum = function (frustumPlanes) {
  10529. if (!this._boundingInfo.isInFrustum(frustumPlanes)) {
  10530. return false;
  10531. }
  10532. return true;
  10533. };
  10534. AbstractMesh.prototype.isCompletelyInFrustum = function (camera) {
  10535. if (!camera) {
  10536. camera = this.getScene().activeCamera;
  10537. }
  10538. var transformMatrix = camera.getViewMatrix().multiply(camera.getProjectionMatrix());
  10539. if (!this._boundingInfo.isCompletelyInFrustum(BABYLON.Frustum.GetPlanes(transformMatrix))) {
  10540. return false;
  10541. }
  10542. return true;
  10543. };
  10544. AbstractMesh.prototype.intersectsMesh = function (mesh, precise) {
  10545. if (!this._boundingInfo || !mesh._boundingInfo) {
  10546. return false;
  10547. }
  10548. return this._boundingInfo.intersects(mesh._boundingInfo, precise);
  10549. };
  10550. AbstractMesh.prototype.intersectsPoint = function (point) {
  10551. if (!this._boundingInfo) {
  10552. return false;
  10553. }
  10554. return this._boundingInfo.intersectsPoint(point);
  10555. };
  10556. // Physics
  10557. AbstractMesh.prototype.setPhysicsState = function (impostor, options) {
  10558. var physicsEngine = this.getScene().getPhysicsEngine();
  10559. if (!physicsEngine) {
  10560. return;
  10561. }
  10562. impostor = impostor || BABYLON.PhysicsEngine.NoImpostor;
  10563. if (impostor.impostor) {
  10564. // Old API
  10565. options = impostor;
  10566. impostor = impostor.impostor;
  10567. }
  10568. if (impostor === BABYLON.PhysicsEngine.NoImpostor) {
  10569. physicsEngine._unregisterMesh(this);
  10570. return;
  10571. }
  10572. if (!options) {
  10573. options = { mass: 0, friction: 0.2, restitution: 0.2 };
  10574. }
  10575. else {
  10576. if (!options.mass && options.mass !== 0)
  10577. options.mass = 0;
  10578. if (!options.friction && options.friction !== 0)
  10579. options.friction = 0.2;
  10580. if (!options.restitution && options.restitution !== 0)
  10581. options.restitution = 0.2;
  10582. }
  10583. this._physicImpostor = impostor;
  10584. this._physicsMass = options.mass;
  10585. this._physicsFriction = options.friction;
  10586. this._physicRestitution = options.restitution;
  10587. return physicsEngine._registerMesh(this, impostor, options);
  10588. };
  10589. AbstractMesh.prototype.getPhysicsImpostor = function () {
  10590. if (!this._physicImpostor) {
  10591. return BABYLON.PhysicsEngine.NoImpostor;
  10592. }
  10593. return this._physicImpostor;
  10594. };
  10595. AbstractMesh.prototype.getPhysicsMass = function () {
  10596. if (!this._physicsMass) {
  10597. return 0;
  10598. }
  10599. return this._physicsMass;
  10600. };
  10601. AbstractMesh.prototype.getPhysicsFriction = function () {
  10602. if (!this._physicsFriction) {
  10603. return 0;
  10604. }
  10605. return this._physicsFriction;
  10606. };
  10607. AbstractMesh.prototype.getPhysicsRestitution = function () {
  10608. if (!this._physicRestitution) {
  10609. return 0;
  10610. }
  10611. return this._physicRestitution;
  10612. };
  10613. AbstractMesh.prototype.getPositionInCameraSpace = function (camera) {
  10614. if (!camera) {
  10615. camera = this.getScene().activeCamera;
  10616. }
  10617. return BABYLON.Vector3.TransformCoordinates(this.absolutePosition, camera.getViewMatrix());
  10618. };
  10619. AbstractMesh.prototype.getDistanceToCamera = function (camera) {
  10620. if (!camera) {
  10621. camera = this.getScene().activeCamera;
  10622. }
  10623. return this.absolutePosition.subtract(camera.position).length();
  10624. };
  10625. AbstractMesh.prototype.applyImpulse = function (force, contactPoint) {
  10626. if (!this._physicImpostor) {
  10627. return;
  10628. }
  10629. this.getScene().getPhysicsEngine()._applyImpulse(this, force, contactPoint);
  10630. };
  10631. AbstractMesh.prototype.setPhysicsLinkWith = function (otherMesh, pivot1, pivot2, options) {
  10632. if (!this._physicImpostor) {
  10633. return;
  10634. }
  10635. this.getScene().getPhysicsEngine()._createLink(this, otherMesh, pivot1, pivot2, options);
  10636. };
  10637. AbstractMesh.prototype.updatePhysicsBodyPosition = function () {
  10638. if (!this._physicImpostor) {
  10639. return;
  10640. }
  10641. this.getScene().getPhysicsEngine()._updateBodyPosition(this);
  10642. };
  10643. // Collisions
  10644. AbstractMesh.prototype.moveWithCollisions = function (velocity) {
  10645. var globalPosition = this.getAbsolutePosition();
  10646. globalPosition.subtractFromFloatsToRef(0, this.ellipsoid.y, 0, this._oldPositionForCollisions);
  10647. this._oldPositionForCollisions.addInPlace(this.ellipsoidOffset);
  10648. this._collider.radius = this.ellipsoid;
  10649. this.getScene()._getNewPosition(this._oldPositionForCollisions, velocity, this._collider, 3, this._newPositionForCollisions, this);
  10650. this._newPositionForCollisions.subtractToRef(this._oldPositionForCollisions, this._diffPositionForCollisions);
  10651. if (this._diffPositionForCollisions.length() > BABYLON.Engine.CollisionsEpsilon) {
  10652. this.position.addInPlace(this._diffPositionForCollisions);
  10653. }
  10654. };
  10655. // Submeshes octree
  10656. /**
  10657. * This function will create an octree to help select the right submeshes for rendering, picking and collisions
  10658. * Please note that you must have a decent number of submeshes to get performance improvements when using octree
  10659. */
  10660. AbstractMesh.prototype.createOrUpdateSubmeshesOctree = function (maxCapacity, maxDepth) {
  10661. if (maxCapacity === void 0) { maxCapacity = 64; }
  10662. if (maxDepth === void 0) { maxDepth = 2; }
  10663. if (!this._submeshesOctree) {
  10664. this._submeshesOctree = new BABYLON.Octree(BABYLON.Octree.CreationFuncForSubMeshes, maxCapacity, maxDepth);
  10665. }
  10666. this.computeWorldMatrix(true);
  10667. // Update octree
  10668. var bbox = this.getBoundingInfo().boundingBox;
  10669. this._submeshesOctree.update(bbox.minimumWorld, bbox.maximumWorld, this.subMeshes);
  10670. return this._submeshesOctree;
  10671. };
  10672. // Collisions
  10673. AbstractMesh.prototype._collideForSubMesh = function (subMesh, transformMatrix, collider) {
  10674. this._generatePointsArray();
  10675. // Transformation
  10676. if (!subMesh._lastColliderWorldVertices || !subMesh._lastColliderTransformMatrix.equals(transformMatrix)) {
  10677. subMesh._lastColliderTransformMatrix = transformMatrix.clone();
  10678. subMesh._lastColliderWorldVertices = [];
  10679. subMesh._trianglePlanes = [];
  10680. var start = subMesh.verticesStart;
  10681. var end = (subMesh.verticesStart + subMesh.verticesCount);
  10682. for (var i = start; i < end; i++) {
  10683. subMesh._lastColliderWorldVertices.push(BABYLON.Vector3.TransformCoordinates(this._positions[i], transformMatrix));
  10684. }
  10685. }
  10686. // Collide
  10687. collider._collide(subMesh, subMesh._lastColliderWorldVertices, this.getIndices(), subMesh.indexStart, subMesh.indexStart + subMesh.indexCount, subMesh.verticesStart);
  10688. };
  10689. AbstractMesh.prototype._processCollisionsForSubMeshes = function (collider, transformMatrix) {
  10690. var subMeshes;
  10691. var len;
  10692. // Octrees
  10693. if (this._submeshesOctree && this.useOctreeForCollisions) {
  10694. var radius = collider.velocityWorldLength + Math.max(collider.radius.x, collider.radius.y, collider.radius.z);
  10695. var intersections = this._submeshesOctree.intersects(collider.basePointWorld, radius);
  10696. len = intersections.length;
  10697. subMeshes = intersections.data;
  10698. }
  10699. else {
  10700. subMeshes = this.subMeshes;
  10701. len = subMeshes.length;
  10702. }
  10703. for (var index = 0; index < len; index++) {
  10704. var subMesh = subMeshes[index];
  10705. // Bounding test
  10706. if (len > 1 && !subMesh._checkCollision(collider))
  10707. continue;
  10708. this._collideForSubMesh(subMesh, transformMatrix, collider);
  10709. }
  10710. };
  10711. AbstractMesh.prototype._checkCollision = function (collider) {
  10712. // Bounding box test
  10713. if (!this._boundingInfo._checkCollision(collider))
  10714. return;
  10715. // Transformation matrix
  10716. BABYLON.Matrix.ScalingToRef(1.0 / collider.radius.x, 1.0 / collider.radius.y, 1.0 / collider.radius.z, this._collisionsScalingMatrix);
  10717. this.worldMatrixFromCache.multiplyToRef(this._collisionsScalingMatrix, this._collisionsTransformMatrix);
  10718. this._processCollisionsForSubMeshes(collider, this._collisionsTransformMatrix);
  10719. };
  10720. // Picking
  10721. AbstractMesh.prototype._generatePointsArray = function () {
  10722. return false;
  10723. };
  10724. AbstractMesh.prototype.intersects = function (ray, fastCheck) {
  10725. var pickingInfo = new BABYLON.PickingInfo();
  10726. if (!this.subMeshes || !this._boundingInfo || !ray.intersectsSphere(this._boundingInfo.boundingSphere) || !ray.intersectsBox(this._boundingInfo.boundingBox)) {
  10727. return pickingInfo;
  10728. }
  10729. if (!this._generatePointsArray()) {
  10730. return pickingInfo;
  10731. }
  10732. var intersectInfo = null;
  10733. // Octrees
  10734. var subMeshes;
  10735. var len;
  10736. if (this._submeshesOctree && this.useOctreeForPicking) {
  10737. var worldRay = BABYLON.Ray.Transform(ray, this.getWorldMatrix());
  10738. var intersections = this._submeshesOctree.intersectsRay(worldRay);
  10739. len = intersections.length;
  10740. subMeshes = intersections.data;
  10741. }
  10742. else {
  10743. subMeshes = this.subMeshes;
  10744. len = subMeshes.length;
  10745. }
  10746. for (var index = 0; index < len; index++) {
  10747. var subMesh = subMeshes[index];
  10748. // Bounding test
  10749. if (len > 1 && !subMesh.canIntersects(ray))
  10750. continue;
  10751. var currentIntersectInfo = subMesh.intersects(ray, this._positions, this.getIndices(), fastCheck);
  10752. if (currentIntersectInfo) {
  10753. if (fastCheck || !intersectInfo || currentIntersectInfo.distance < intersectInfo.distance) {
  10754. intersectInfo = currentIntersectInfo;
  10755. intersectInfo.subMeshId = index;
  10756. if (fastCheck) {
  10757. break;
  10758. }
  10759. }
  10760. }
  10761. }
  10762. if (intersectInfo) {
  10763. // Get picked point
  10764. var world = this.getWorldMatrix();
  10765. var worldOrigin = BABYLON.Vector3.TransformCoordinates(ray.origin, world);
  10766. var direction = ray.direction.clone();
  10767. direction = direction.scale(intersectInfo.distance);
  10768. var worldDirection = BABYLON.Vector3.TransformNormal(direction, world);
  10769. var pickedPoint = worldOrigin.add(worldDirection);
  10770. // Return result
  10771. pickingInfo.hit = true;
  10772. pickingInfo.distance = BABYLON.Vector3.Distance(worldOrigin, pickedPoint);
  10773. pickingInfo.pickedPoint = pickedPoint;
  10774. pickingInfo.pickedMesh = this;
  10775. pickingInfo.bu = intersectInfo.bu;
  10776. pickingInfo.bv = intersectInfo.bv;
  10777. pickingInfo.faceId = intersectInfo.faceId;
  10778. pickingInfo.subMeshId = intersectInfo.subMeshId;
  10779. return pickingInfo;
  10780. }
  10781. return pickingInfo;
  10782. };
  10783. AbstractMesh.prototype.clone = function (name, newParent, doNotCloneChildren) {
  10784. return null;
  10785. };
  10786. AbstractMesh.prototype.releaseSubMeshes = function () {
  10787. if (this.subMeshes) {
  10788. while (this.subMeshes.length) {
  10789. this.subMeshes[0].dispose();
  10790. }
  10791. }
  10792. else {
  10793. this.subMeshes = new Array();
  10794. }
  10795. };
  10796. AbstractMesh.prototype.dispose = function (doNotRecurse) {
  10797. var index;
  10798. // Physics
  10799. if (this.getPhysicsImpostor() !== BABYLON.PhysicsEngine.NoImpostor) {
  10800. this.setPhysicsState(BABYLON.PhysicsEngine.NoImpostor);
  10801. }
  10802. for (index = 0; index < this._intersectionsInProgress.length; index++) {
  10803. var other = this._intersectionsInProgress[index];
  10804. var pos = other._intersectionsInProgress.indexOf(this);
  10805. other._intersectionsInProgress.splice(pos, 1);
  10806. }
  10807. this._intersectionsInProgress = [];
  10808. // SubMeshes
  10809. this.releaseSubMeshes();
  10810. // Remove from scene
  10811. this.getScene().removeMesh(this);
  10812. if (!doNotRecurse) {
  10813. for (index = 0; index < this.getScene().particleSystems.length; index++) {
  10814. if (this.getScene().particleSystems[index].emitter === this) {
  10815. this.getScene().particleSystems[index].dispose();
  10816. index--;
  10817. }
  10818. }
  10819. // Children
  10820. var objects = this.getScene().meshes.slice(0);
  10821. for (index = 0; index < objects.length; index++) {
  10822. if (objects[index].parent === this) {
  10823. objects[index].dispose();
  10824. }
  10825. }
  10826. }
  10827. else {
  10828. for (index = 0; index < this.getScene().meshes.length; index++) {
  10829. var obj = this.getScene().meshes[index];
  10830. if (obj.parent === this) {
  10831. obj.parent = null;
  10832. obj.computeWorldMatrix(true);
  10833. }
  10834. }
  10835. }
  10836. this._onAfterWorldMatrixUpdate = [];
  10837. this._isDisposed = true;
  10838. // Callback
  10839. if (this.onDispose) {
  10840. this.onDispose();
  10841. }
  10842. };
  10843. // Statics
  10844. AbstractMesh._BILLBOARDMODE_NONE = 0;
  10845. AbstractMesh._BILLBOARDMODE_X = 1;
  10846. AbstractMesh._BILLBOARDMODE_Y = 2;
  10847. AbstractMesh._BILLBOARDMODE_Z = 4;
  10848. AbstractMesh._BILLBOARDMODE_ALL = 7;
  10849. return AbstractMesh;
  10850. })(BABYLON.Node);
  10851. BABYLON.AbstractMesh = AbstractMesh;
  10852. })(BABYLON || (BABYLON = {}));
  10853. //# sourceMappingURL=babylon.abstractMesh.js.map
  10854. var BABYLON;
  10855. (function (BABYLON) {
  10856. var _InstancesBatch = (function () {
  10857. function _InstancesBatch() {
  10858. this.mustReturn = false;
  10859. this.visibleInstances = new Array();
  10860. this.renderSelf = new Array();
  10861. }
  10862. return _InstancesBatch;
  10863. })();
  10864. BABYLON._InstancesBatch = _InstancesBatch;
  10865. var Mesh = (function (_super) {
  10866. __extends(Mesh, _super);
  10867. /**
  10868. * @constructor
  10869. * @param {string} name - The value used by scene.getMeshByName() to do a lookup.
  10870. * @param {Scene} scene - The scene to add this mesh to.
  10871. * @param {Node} parent - The parent of this mesh, if it has one
  10872. * @param {Mesh} source - An optional Mesh from which geometry is shared, cloned.
  10873. * @param {boolean} doNotCloneChildren - When cloning, skip cloning child meshes of source, default False.
  10874. * When false, achieved by calling a clone(), also passing False.
  10875. * This will make creation of children, recursive.
  10876. */
  10877. function Mesh(name, scene, parent, source, doNotCloneChildren) {
  10878. if (parent === void 0) { parent = null; }
  10879. _super.call(this, name, scene);
  10880. // Members
  10881. this.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_NONE;
  10882. this.instances = new Array();
  10883. this._LODLevels = new Array();
  10884. this._onBeforeRenderCallbacks = new Array();
  10885. this._onAfterRenderCallbacks = new Array();
  10886. this._visibleInstances = {};
  10887. this._renderIdForInstances = new Array();
  10888. this._batchCache = new _InstancesBatch();
  10889. this._instancesBufferSize = 32 * 16 * 4; // let's start with a maximum of 32 instances
  10890. this._sideOrientation = Mesh._DEFAULTSIDE;
  10891. if (source) {
  10892. // Geometry
  10893. if (source._geometry) {
  10894. source._geometry.applyToMesh(this);
  10895. }
  10896. // Deep copy
  10897. BABYLON.Tools.DeepCopy(source, this, ["name", "material", "skeleton"], []);
  10898. // Material
  10899. this.material = source.material;
  10900. if (!doNotCloneChildren) {
  10901. for (var index = 0; index < scene.meshes.length; index++) {
  10902. var mesh = scene.meshes[index];
  10903. if (mesh.parent === source) {
  10904. // doNotCloneChildren is always going to be False
  10905. var newChild = mesh.clone(name + "." + mesh.name, this, doNotCloneChildren);
  10906. }
  10907. }
  10908. }
  10909. for (index = 0; index < scene.particleSystems.length; index++) {
  10910. var system = scene.particleSystems[index];
  10911. if (system.emitter === source) {
  10912. system.clone(system.name, this);
  10913. }
  10914. }
  10915. this.computeWorldMatrix(true);
  10916. }
  10917. // Parent
  10918. if (parent !== null) {
  10919. this.parent = parent;
  10920. }
  10921. }
  10922. Object.defineProperty(Mesh, "FRONTSIDE", {
  10923. get: function () {
  10924. return Mesh._FRONTSIDE;
  10925. },
  10926. enumerable: true,
  10927. configurable: true
  10928. });
  10929. Object.defineProperty(Mesh, "BACKSIDE", {
  10930. get: function () {
  10931. return Mesh._BACKSIDE;
  10932. },
  10933. enumerable: true,
  10934. configurable: true
  10935. });
  10936. Object.defineProperty(Mesh, "DOUBLESIDE", {
  10937. get: function () {
  10938. return Mesh._DOUBLESIDE;
  10939. },
  10940. enumerable: true,
  10941. configurable: true
  10942. });
  10943. Object.defineProperty(Mesh, "DEFAULTSIDE", {
  10944. get: function () {
  10945. return Mesh._DEFAULTSIDE;
  10946. },
  10947. enumerable: true,
  10948. configurable: true
  10949. });
  10950. Object.defineProperty(Mesh.prototype, "hasLODLevels", {
  10951. // Methods
  10952. get: function () {
  10953. return this._LODLevels.length > 0;
  10954. },
  10955. enumerable: true,
  10956. configurable: true
  10957. });
  10958. Mesh.prototype._sortLODLevels = function () {
  10959. this._LODLevels.sort(function (a, b) {
  10960. if (a.distance < b.distance) {
  10961. return 1;
  10962. }
  10963. if (a.distance > b.distance) {
  10964. return -1;
  10965. }
  10966. return 0;
  10967. });
  10968. };
  10969. /**
  10970. * Add a mesh as LOD level triggered at the given distance.
  10971. * @param {number} distance - the distance from the center of the object to show this level
  10972. * @param {BABYLON.Mesh} mesh - the mesh to be added as LOD level
  10973. * @return {BABYLON.Mesh} this mesh (for chaining)
  10974. */
  10975. Mesh.prototype.addLODLevel = function (distance, mesh) {
  10976. if (mesh && mesh._masterMesh) {
  10977. BABYLON.Tools.Warn("You cannot use a mesh as LOD level twice");
  10978. return this;
  10979. }
  10980. var level = new BABYLON.Internals.MeshLODLevel(distance, mesh);
  10981. this._LODLevels.push(level);
  10982. if (mesh) {
  10983. mesh._masterMesh = this;
  10984. }
  10985. this._sortLODLevels();
  10986. return this;
  10987. };
  10988. Mesh.prototype.getLODLevelAtDistance = function (distance) {
  10989. for (var index = 0; index < this._LODLevels.length; index++) {
  10990. var level = this._LODLevels[index];
  10991. if (level.distance === distance) {
  10992. return level.mesh;
  10993. }
  10994. }
  10995. return null;
  10996. };
  10997. /**
  10998. * Remove a mesh from the LOD array
  10999. * @param {BABYLON.Mesh} mesh - the mesh to be removed.
  11000. * @return {BABYLON.Mesh} this mesh (for chaining)
  11001. */
  11002. Mesh.prototype.removeLODLevel = function (mesh) {
  11003. for (var index = 0; index < this._LODLevels.length; index++) {
  11004. if (this._LODLevels[index].mesh === mesh) {
  11005. this._LODLevels.splice(index, 1);
  11006. if (mesh) {
  11007. mesh._masterMesh = null;
  11008. }
  11009. }
  11010. }
  11011. this._sortLODLevels();
  11012. return this;
  11013. };
  11014. Mesh.prototype.getLOD = function (camera, boundingSphere) {
  11015. if (!this._LODLevels || this._LODLevels.length === 0) {
  11016. return this;
  11017. }
  11018. var distanceToCamera = (boundingSphere ? boundingSphere : this.getBoundingInfo().boundingSphere).centerWorld.subtract(camera.position).length();
  11019. if (this._LODLevels[this._LODLevels.length - 1].distance > distanceToCamera) {
  11020. if (this.onLODLevelSelection) {
  11021. this.onLODLevelSelection(distanceToCamera, this, this._LODLevels[this._LODLevels.length - 1].mesh);
  11022. }
  11023. return this;
  11024. }
  11025. for (var index = 0; index < this._LODLevels.length; index++) {
  11026. var level = this._LODLevels[index];
  11027. if (level.distance < distanceToCamera) {
  11028. if (level.mesh) {
  11029. level.mesh._preActivate();
  11030. level.mesh._updateSubMeshesBoundingInfo(this.worldMatrixFromCache);
  11031. }
  11032. if (this.onLODLevelSelection) {
  11033. this.onLODLevelSelection(distanceToCamera, this, level.mesh);
  11034. }
  11035. return level.mesh;
  11036. }
  11037. }
  11038. if (this.onLODLevelSelection) {
  11039. this.onLODLevelSelection(distanceToCamera, this, this);
  11040. }
  11041. return this;
  11042. };
  11043. Object.defineProperty(Mesh.prototype, "geometry", {
  11044. get: function () {
  11045. return this._geometry;
  11046. },
  11047. enumerable: true,
  11048. configurable: true
  11049. });
  11050. Mesh.prototype.getTotalVertices = function () {
  11051. if (!this._geometry) {
  11052. return 0;
  11053. }
  11054. return this._geometry.getTotalVertices();
  11055. };
  11056. Mesh.prototype.getVerticesData = function (kind) {
  11057. if (!this._geometry) {
  11058. return null;
  11059. }
  11060. return this._geometry.getVerticesData(kind);
  11061. };
  11062. Mesh.prototype.getVertexBuffer = function (kind) {
  11063. if (!this._geometry) {
  11064. return undefined;
  11065. }
  11066. return this._geometry.getVertexBuffer(kind);
  11067. };
  11068. Mesh.prototype.isVerticesDataPresent = function (kind) {
  11069. if (!this._geometry) {
  11070. if (this._delayInfo) {
  11071. return this._delayInfo.indexOf(kind) !== -1;
  11072. }
  11073. return false;
  11074. }
  11075. return this._geometry.isVerticesDataPresent(kind);
  11076. };
  11077. Mesh.prototype.getVerticesDataKinds = function () {
  11078. if (!this._geometry) {
  11079. var result = [];
  11080. if (this._delayInfo) {
  11081. for (var kind in this._delayInfo) {
  11082. result.push(kind);
  11083. }
  11084. }
  11085. return result;
  11086. }
  11087. return this._geometry.getVerticesDataKinds();
  11088. };
  11089. Mesh.prototype.getTotalIndices = function () {
  11090. if (!this._geometry) {
  11091. return 0;
  11092. }
  11093. return this._geometry.getTotalIndices();
  11094. };
  11095. Mesh.prototype.getIndices = function () {
  11096. if (!this._geometry) {
  11097. return [];
  11098. }
  11099. return this._geometry.getIndices();
  11100. };
  11101. Object.defineProperty(Mesh.prototype, "isBlocked", {
  11102. get: function () {
  11103. return this._masterMesh !== null && this._masterMesh !== undefined;
  11104. },
  11105. enumerable: true,
  11106. configurable: true
  11107. });
  11108. Mesh.prototype.isReady = function () {
  11109. if (this.delayLoadState === BABYLON.Engine.DELAYLOADSTATE_LOADING) {
  11110. return false;
  11111. }
  11112. return _super.prototype.isReady.call(this);
  11113. };
  11114. Mesh.prototype.isDisposed = function () {
  11115. return this._isDisposed;
  11116. };
  11117. Object.defineProperty(Mesh.prototype, "sideOrientation", {
  11118. get: function () {
  11119. return this._sideOrientation;
  11120. },
  11121. set: function (sideO) {
  11122. this._sideOrientation = sideO;
  11123. },
  11124. enumerable: true,
  11125. configurable: true
  11126. });
  11127. // Methods
  11128. Mesh.prototype._preActivate = function () {
  11129. var sceneRenderId = this.getScene().getRenderId();
  11130. if (this._preActivateId === sceneRenderId) {
  11131. return;
  11132. }
  11133. this._preActivateId = sceneRenderId;
  11134. this._visibleInstances = null;
  11135. };
  11136. Mesh.prototype._registerInstanceForRenderId = function (instance, renderId) {
  11137. if (!this._visibleInstances) {
  11138. this._visibleInstances = {};
  11139. this._visibleInstances.defaultRenderId = renderId;
  11140. this._visibleInstances.selfDefaultRenderId = this._renderId;
  11141. }
  11142. if (!this._visibleInstances[renderId]) {
  11143. this._visibleInstances[renderId] = new Array();
  11144. }
  11145. this._visibleInstances[renderId].push(instance);
  11146. };
  11147. Mesh.prototype.refreshBoundingInfo = function () {
  11148. var data = this.getVerticesData(BABYLON.VertexBuffer.PositionKind);
  11149. if (data) {
  11150. var extend = BABYLON.Tools.ExtractMinAndMax(data, 0, this.getTotalVertices());
  11151. this._boundingInfo = new BABYLON.BoundingInfo(extend.minimum, extend.maximum);
  11152. }
  11153. if (this.subMeshes) {
  11154. for (var index = 0; index < this.subMeshes.length; index++) {
  11155. this.subMeshes[index].refreshBoundingInfo();
  11156. }
  11157. }
  11158. this._updateBoundingInfo();
  11159. };
  11160. Mesh.prototype._createGlobalSubMesh = function () {
  11161. var totalVertices = this.getTotalVertices();
  11162. if (!totalVertices || !this.getIndices()) {
  11163. return null;
  11164. }
  11165. this.releaseSubMeshes();
  11166. return new BABYLON.SubMesh(0, 0, totalVertices, 0, this.getTotalIndices(), this);
  11167. };
  11168. Mesh.prototype.subdivide = function (count) {
  11169. if (count < 1) {
  11170. return;
  11171. }
  11172. var totalIndices = this.getTotalIndices();
  11173. var subdivisionSize = (totalIndices / count) | 0;
  11174. var offset = 0;
  11175. while (subdivisionSize % 3 !== 0) {
  11176. subdivisionSize++;
  11177. }
  11178. this.releaseSubMeshes();
  11179. for (var index = 0; index < count; index++) {
  11180. if (offset >= totalIndices) {
  11181. break;
  11182. }
  11183. BABYLON.SubMesh.CreateFromIndices(0, offset, Math.min(subdivisionSize, totalIndices - offset), this);
  11184. offset += subdivisionSize;
  11185. }
  11186. this.synchronizeInstances();
  11187. };
  11188. Mesh.prototype.setVerticesData = function (kind, data, updatable, stride) {
  11189. if (kind instanceof Array) {
  11190. var temp = data;
  11191. data = kind;
  11192. kind = temp;
  11193. BABYLON.Tools.Warn("Deprecated usage of setVerticesData detected (since v1.12). Current signature is setVerticesData(kind, data, updatable).");
  11194. }
  11195. if (!this._geometry) {
  11196. var vertexData = new BABYLON.VertexData();
  11197. vertexData.set(data, kind);
  11198. var scene = this.getScene();
  11199. new BABYLON.Geometry(BABYLON.Geometry.RandomId(), scene, vertexData, updatable, this);
  11200. }
  11201. else {
  11202. this._geometry.setVerticesData(kind, data, updatable, stride);
  11203. }
  11204. };
  11205. Mesh.prototype.updateVerticesData = function (kind, data, updateExtends, makeItUnique) {
  11206. if (!this._geometry) {
  11207. return;
  11208. }
  11209. if (!makeItUnique) {
  11210. this._geometry.updateVerticesData(kind, data, updateExtends);
  11211. }
  11212. else {
  11213. this.makeGeometryUnique();
  11214. this.updateVerticesData(kind, data, updateExtends, false);
  11215. }
  11216. };
  11217. Mesh.prototype.updateVerticesDataDirectly = function (kind, data, offset, makeItUnique) {
  11218. if (!this._geometry) {
  11219. return;
  11220. }
  11221. if (!makeItUnique) {
  11222. this._geometry.updateVerticesDataDirectly(kind, data, offset);
  11223. }
  11224. else {
  11225. this.makeGeometryUnique();
  11226. this.updateVerticesDataDirectly(kind, data, offset, false);
  11227. }
  11228. };
  11229. // Mesh positions update function :
  11230. // updates the mesh positions according to the positionFunction returned values.
  11231. // The positionFunction argument must be a javascript function accepting the mesh "positions" array as parameter.
  11232. // This dedicated positionFunction computes new mesh positions according to the given mesh type.
  11233. Mesh.prototype.updateMeshPositions = function (positionFunction, computeNormals) {
  11234. if (computeNormals === void 0) { computeNormals = true; }
  11235. var positions = this.getVerticesData(BABYLON.VertexBuffer.PositionKind);
  11236. positionFunction(positions);
  11237. this.updateVerticesData(BABYLON.VertexBuffer.PositionKind, positions, false, false);
  11238. if (computeNormals) {
  11239. var indices = this.getIndices();
  11240. var normals = this.getVerticesData(BABYLON.VertexBuffer.NormalKind);
  11241. BABYLON.VertexData.ComputeNormals(positions, indices, normals);
  11242. this.updateVerticesData(BABYLON.VertexBuffer.NormalKind, normals, false, false);
  11243. }
  11244. };
  11245. Mesh.prototype.makeGeometryUnique = function () {
  11246. if (!this._geometry) {
  11247. return;
  11248. }
  11249. var geometry = this._geometry.copy(BABYLON.Geometry.RandomId());
  11250. geometry.applyToMesh(this);
  11251. };
  11252. Mesh.prototype.setIndices = function (indices, totalVertices) {
  11253. if (!this._geometry) {
  11254. var vertexData = new BABYLON.VertexData();
  11255. vertexData.indices = indices;
  11256. var scene = this.getScene();
  11257. new BABYLON.Geometry(BABYLON.Geometry.RandomId(), scene, vertexData, false, this);
  11258. }
  11259. else {
  11260. this._geometry.setIndices(indices, totalVertices);
  11261. }
  11262. };
  11263. Mesh.prototype._bind = function (subMesh, effect, fillMode) {
  11264. var engine = this.getScene().getEngine();
  11265. // Wireframe
  11266. var indexToBind;
  11267. switch (fillMode) {
  11268. case BABYLON.Material.PointFillMode:
  11269. indexToBind = null;
  11270. break;
  11271. case BABYLON.Material.WireFrameFillMode:
  11272. indexToBind = subMesh.getLinesIndexBuffer(this.getIndices(), engine);
  11273. break;
  11274. default:
  11275. case BABYLON.Material.TriangleFillMode:
  11276. indexToBind = this._geometry.getIndexBuffer();
  11277. break;
  11278. }
  11279. // VBOs
  11280. engine.bindMultiBuffers(this._geometry.getVertexBuffers(), indexToBind, effect);
  11281. };
  11282. Mesh.prototype._draw = function (subMesh, fillMode, instancesCount) {
  11283. if (!this._geometry || !this._geometry.getVertexBuffers() || !this._geometry.getIndexBuffer()) {
  11284. return;
  11285. }
  11286. var engine = this.getScene().getEngine();
  11287. switch (fillMode) {
  11288. case BABYLON.Material.PointFillMode:
  11289. engine.drawPointClouds(subMesh.verticesStart, subMesh.verticesCount, instancesCount);
  11290. break;
  11291. case BABYLON.Material.WireFrameFillMode:
  11292. engine.draw(false, 0, subMesh.linesIndexCount, instancesCount);
  11293. break;
  11294. default:
  11295. engine.draw(true, subMesh.indexStart, subMesh.indexCount, instancesCount);
  11296. }
  11297. };
  11298. Mesh.prototype.registerBeforeRender = function (func) {
  11299. this._onBeforeRenderCallbacks.push(func);
  11300. };
  11301. Mesh.prototype.unregisterBeforeRender = function (func) {
  11302. var index = this._onBeforeRenderCallbacks.indexOf(func);
  11303. if (index > -1) {
  11304. this._onBeforeRenderCallbacks.splice(index, 1);
  11305. }
  11306. };
  11307. Mesh.prototype.registerAfterRender = function (func) {
  11308. this._onAfterRenderCallbacks.push(func);
  11309. };
  11310. Mesh.prototype.unregisterAfterRender = function (func) {
  11311. var index = this._onAfterRenderCallbacks.indexOf(func);
  11312. if (index > -1) {
  11313. this._onAfterRenderCallbacks.splice(index, 1);
  11314. }
  11315. };
  11316. Mesh.prototype._getInstancesRenderList = function (subMeshId) {
  11317. var scene = this.getScene();
  11318. this._batchCache.mustReturn = false;
  11319. this._batchCache.renderSelf[subMeshId] = this.isEnabled() && this.isVisible;
  11320. this._batchCache.visibleInstances[subMeshId] = null;
  11321. if (this._visibleInstances) {
  11322. var currentRenderId = scene.getRenderId();
  11323. this._batchCache.visibleInstances[subMeshId] = this._visibleInstances[currentRenderId];
  11324. var selfRenderId = this._renderId;
  11325. if (!this._batchCache.visibleInstances[subMeshId] && this._visibleInstances.defaultRenderId) {
  11326. this._batchCache.visibleInstances[subMeshId] = this._visibleInstances[this._visibleInstances.defaultRenderId];
  11327. currentRenderId = Math.max(this._visibleInstances.defaultRenderId, currentRenderId);
  11328. selfRenderId = Math.max(this._visibleInstances.selfDefaultRenderId, currentRenderId);
  11329. }
  11330. if (this._batchCache.visibleInstances[subMeshId] && this._batchCache.visibleInstances[subMeshId].length) {
  11331. if (this._renderIdForInstances[subMeshId] === currentRenderId) {
  11332. this._batchCache.mustReturn = true;
  11333. return this._batchCache;
  11334. }
  11335. if (currentRenderId !== selfRenderId) {
  11336. this._batchCache.renderSelf[subMeshId] = false;
  11337. }
  11338. }
  11339. this._renderIdForInstances[subMeshId] = currentRenderId;
  11340. }
  11341. return this._batchCache;
  11342. };
  11343. Mesh.prototype._renderWithInstances = function (subMesh, fillMode, batch, effect, engine) {
  11344. var visibleInstances = batch.visibleInstances[subMesh._id];
  11345. var matricesCount = visibleInstances.length + 1;
  11346. var bufferSize = matricesCount * 16 * 4;
  11347. while (this._instancesBufferSize < bufferSize) {
  11348. this._instancesBufferSize *= 2;
  11349. }
  11350. if (!this._worldMatricesInstancesBuffer || this._worldMatricesInstancesBuffer.capacity < this._instancesBufferSize) {
  11351. if (this._worldMatricesInstancesBuffer) {
  11352. engine.deleteInstancesBuffer(this._worldMatricesInstancesBuffer);
  11353. }
  11354. this._worldMatricesInstancesBuffer = engine.createInstancesBuffer(this._instancesBufferSize);
  11355. this._worldMatricesInstancesArray = new Float32Array(this._instancesBufferSize / 4);
  11356. }
  11357. var offset = 0;
  11358. var instancesCount = 0;
  11359. var world = this.getWorldMatrix();
  11360. if (batch.renderSelf[subMesh._id]) {
  11361. world.copyToArray(this._worldMatricesInstancesArray, offset);
  11362. offset += 16;
  11363. instancesCount++;
  11364. }
  11365. if (visibleInstances) {
  11366. for (var instanceIndex = 0; instanceIndex < visibleInstances.length; instanceIndex++) {
  11367. var instance = visibleInstances[instanceIndex];
  11368. instance.getWorldMatrix().copyToArray(this._worldMatricesInstancesArray, offset);
  11369. offset += 16;
  11370. instancesCount++;
  11371. }
  11372. }
  11373. var offsetLocation0 = effect.getAttributeLocationByName("world0");
  11374. var offsetLocation1 = effect.getAttributeLocationByName("world1");
  11375. var offsetLocation2 = effect.getAttributeLocationByName("world2");
  11376. var offsetLocation3 = effect.getAttributeLocationByName("world3");
  11377. var offsetLocations = [offsetLocation0, offsetLocation1, offsetLocation2, offsetLocation3];
  11378. engine.updateAndBindInstancesBuffer(this._worldMatricesInstancesBuffer, this._worldMatricesInstancesArray, offsetLocations);
  11379. this._draw(subMesh, fillMode, instancesCount);
  11380. engine.unBindInstancesBuffer(this._worldMatricesInstancesBuffer, offsetLocations);
  11381. };
  11382. Mesh.prototype._processRendering = function (subMesh, effect, fillMode, batch, hardwareInstancedRendering, onBeforeDraw) {
  11383. var scene = this.getScene();
  11384. var engine = scene.getEngine();
  11385. if (hardwareInstancedRendering) {
  11386. this._renderWithInstances(subMesh, fillMode, batch, effect, engine);
  11387. }
  11388. else {
  11389. if (batch.renderSelf[subMesh._id]) {
  11390. // Draw
  11391. if (onBeforeDraw) {
  11392. onBeforeDraw(false, this.getWorldMatrix());
  11393. }
  11394. this._draw(subMesh, fillMode);
  11395. }
  11396. if (batch.visibleInstances[subMesh._id]) {
  11397. for (var instanceIndex = 0; instanceIndex < batch.visibleInstances[subMesh._id].length; instanceIndex++) {
  11398. var instance = batch.visibleInstances[subMesh._id][instanceIndex];
  11399. // World
  11400. var world = instance.getWorldMatrix();
  11401. if (onBeforeDraw) {
  11402. onBeforeDraw(true, world);
  11403. }
  11404. // Draw
  11405. this._draw(subMesh, fillMode);
  11406. }
  11407. }
  11408. }
  11409. };
  11410. Mesh.prototype.render = function (subMesh) {
  11411. var scene = this.getScene();
  11412. // Managing instances
  11413. var batch = this._getInstancesRenderList(subMesh._id);
  11414. if (batch.mustReturn) {
  11415. return;
  11416. }
  11417. // Checking geometry state
  11418. if (!this._geometry || !this._geometry.getVertexBuffers() || !this._geometry.getIndexBuffer()) {
  11419. return;
  11420. }
  11421. for (var callbackIndex = 0; callbackIndex < this._onBeforeRenderCallbacks.length; callbackIndex++) {
  11422. this._onBeforeRenderCallbacks[callbackIndex](this);
  11423. }
  11424. var engine = scene.getEngine();
  11425. var hardwareInstancedRendering = (engine.getCaps().instancedArrays !== null) && (batch.visibleInstances[subMesh._id] !== null) && (batch.visibleInstances[subMesh._id] !== undefined);
  11426. // Material
  11427. var effectiveMaterial = subMesh.getMaterial();
  11428. if (!effectiveMaterial || !effectiveMaterial.isReady(this, hardwareInstancedRendering)) {
  11429. return;
  11430. }
  11431. // Outline - step 1
  11432. var savedDepthWrite = engine.getDepthWrite();
  11433. if (this.renderOutline) {
  11434. engine.setDepthWrite(false);
  11435. scene.getOutlineRenderer().render(subMesh, batch);
  11436. engine.setDepthWrite(savedDepthWrite);
  11437. }
  11438. effectiveMaterial._preBind();
  11439. var effect = effectiveMaterial.getEffect();
  11440. // Bind
  11441. var fillMode = scene.forcePointsCloud ? BABYLON.Material.PointFillMode : (scene.forceWireframe ? BABYLON.Material.WireFrameFillMode : effectiveMaterial.fillMode);
  11442. this._bind(subMesh, effect, fillMode);
  11443. var world = this.getWorldMatrix();
  11444. effectiveMaterial.bind(world, this);
  11445. // Draw
  11446. this._processRendering(subMesh, effect, fillMode, batch, hardwareInstancedRendering, function (isInstance, world) {
  11447. if (isInstance) {
  11448. effectiveMaterial.bindOnlyWorldMatrix(world);
  11449. }
  11450. });
  11451. // Unbind
  11452. effectiveMaterial.unbind();
  11453. // Outline - step 2
  11454. if (this.renderOutline && savedDepthWrite) {
  11455. engine.setDepthWrite(true);
  11456. engine.setColorWrite(false);
  11457. scene.getOutlineRenderer().render(subMesh, batch);
  11458. engine.setColorWrite(true);
  11459. }
  11460. // Overlay
  11461. if (this.renderOverlay) {
  11462. var currentMode = engine.getAlphaMode();
  11463. engine.setAlphaMode(BABYLON.Engine.ALPHA_COMBINE);
  11464. scene.getOutlineRenderer().render(subMesh, batch, true);
  11465. engine.setAlphaMode(currentMode);
  11466. }
  11467. for (callbackIndex = 0; callbackIndex < this._onAfterRenderCallbacks.length; callbackIndex++) {
  11468. this._onAfterRenderCallbacks[callbackIndex](this);
  11469. }
  11470. };
  11471. Mesh.prototype.getEmittedParticleSystems = function () {
  11472. var results = new Array();
  11473. for (var index = 0; index < this.getScene().particleSystems.length; index++) {
  11474. var particleSystem = this.getScene().particleSystems[index];
  11475. if (particleSystem.emitter === this) {
  11476. results.push(particleSystem);
  11477. }
  11478. }
  11479. return results;
  11480. };
  11481. Mesh.prototype.getHierarchyEmittedParticleSystems = function () {
  11482. var results = new Array();
  11483. var descendants = this.getDescendants();
  11484. descendants.push(this);
  11485. for (var index = 0; index < this.getScene().particleSystems.length; index++) {
  11486. var particleSystem = this.getScene().particleSystems[index];
  11487. if (descendants.indexOf(particleSystem.emitter) !== -1) {
  11488. results.push(particleSystem);
  11489. }
  11490. }
  11491. return results;
  11492. };
  11493. Mesh.prototype.getChildren = function () {
  11494. var results = [];
  11495. for (var index = 0; index < this.getScene().meshes.length; index++) {
  11496. var mesh = this.getScene().meshes[index];
  11497. if (mesh.parent === this) {
  11498. results.push(mesh);
  11499. }
  11500. }
  11501. return results;
  11502. };
  11503. Mesh.prototype._checkDelayState = function () {
  11504. var _this = this;
  11505. var that = this;
  11506. var scene = this.getScene();
  11507. if (this._geometry) {
  11508. this._geometry.load(scene);
  11509. }
  11510. else if (that.delayLoadState === BABYLON.Engine.DELAYLOADSTATE_NOTLOADED) {
  11511. that.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_LOADING;
  11512. scene._addPendingData(that);
  11513. var getBinaryData = (this.delayLoadingFile.indexOf(".babylonbinarymeshdata") !== -1);
  11514. BABYLON.Tools.LoadFile(this.delayLoadingFile, function (data) {
  11515. if (data instanceof ArrayBuffer) {
  11516. _this._delayLoadingFunction(data, _this);
  11517. }
  11518. else {
  11519. _this._delayLoadingFunction(JSON.parse(data), _this);
  11520. }
  11521. _this.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_LOADED;
  11522. scene._removePendingData(_this);
  11523. }, function () {
  11524. }, scene.database, getBinaryData);
  11525. }
  11526. };
  11527. Mesh.prototype.isInFrustum = function (frustumPlanes) {
  11528. if (this.delayLoadState === BABYLON.Engine.DELAYLOADSTATE_LOADING) {
  11529. return false;
  11530. }
  11531. if (!_super.prototype.isInFrustum.call(this, frustumPlanes)) {
  11532. return false;
  11533. }
  11534. this._checkDelayState();
  11535. return true;
  11536. };
  11537. Mesh.prototype.setMaterialByID = function (id) {
  11538. var materials = this.getScene().materials;
  11539. for (var index = 0; index < materials.length; index++) {
  11540. if (materials[index].id === id) {
  11541. this.material = materials[index];
  11542. return;
  11543. }
  11544. }
  11545. // Multi
  11546. var multiMaterials = this.getScene().multiMaterials;
  11547. for (index = 0; index < multiMaterials.length; index++) {
  11548. if (multiMaterials[index].id === id) {
  11549. this.material = multiMaterials[index];
  11550. return;
  11551. }
  11552. }
  11553. };
  11554. Mesh.prototype.getAnimatables = function () {
  11555. var results = [];
  11556. if (this.material) {
  11557. results.push(this.material);
  11558. }
  11559. if (this.skeleton) {
  11560. results.push(this.skeleton);
  11561. }
  11562. return results;
  11563. };
  11564. // Geometry
  11565. Mesh.prototype.bakeTransformIntoVertices = function (transform) {
  11566. // Position
  11567. if (!this.isVerticesDataPresent(BABYLON.VertexBuffer.PositionKind)) {
  11568. return;
  11569. }
  11570. this._resetPointsArrayCache();
  11571. var data = this.getVerticesData(BABYLON.VertexBuffer.PositionKind);
  11572. var temp = [];
  11573. for (var index = 0; index < data.length; index += 3) {
  11574. BABYLON.Vector3.TransformCoordinates(BABYLON.Vector3.FromArray(data, index), transform).toArray(temp, index);
  11575. }
  11576. this.setVerticesData(BABYLON.VertexBuffer.PositionKind, temp, this.getVertexBuffer(BABYLON.VertexBuffer.PositionKind).isUpdatable());
  11577. // Normals
  11578. if (!this.isVerticesDataPresent(BABYLON.VertexBuffer.NormalKind)) {
  11579. return;
  11580. }
  11581. data = this.getVerticesData(BABYLON.VertexBuffer.NormalKind);
  11582. for (index = 0; index < data.length; index += 3) {
  11583. BABYLON.Vector3.TransformNormal(BABYLON.Vector3.FromArray(data, index), transform).toArray(temp, index);
  11584. }
  11585. this.setVerticesData(BABYLON.VertexBuffer.NormalKind, temp, this.getVertexBuffer(BABYLON.VertexBuffer.NormalKind).isUpdatable());
  11586. };
  11587. // Cache
  11588. Mesh.prototype._resetPointsArrayCache = function () {
  11589. this._positions = null;
  11590. };
  11591. Mesh.prototype._generatePointsArray = function () {
  11592. if (this._positions)
  11593. return true;
  11594. this._positions = [];
  11595. var data = this.getVerticesData(BABYLON.VertexBuffer.PositionKind);
  11596. if (!data) {
  11597. return false;
  11598. }
  11599. for (var index = 0; index < data.length; index += 3) {
  11600. this._positions.push(BABYLON.Vector3.FromArray(data, index));
  11601. }
  11602. return true;
  11603. };
  11604. // Clone
  11605. Mesh.prototype.clone = function (name, newParent, doNotCloneChildren) {
  11606. return new Mesh(name, this.getScene(), newParent, this, doNotCloneChildren);
  11607. };
  11608. // Dispose
  11609. Mesh.prototype.dispose = function (doNotRecurse) {
  11610. if (this._geometry) {
  11611. this._geometry.releaseForMesh(this, true);
  11612. }
  11613. // Instances
  11614. if (this._worldMatricesInstancesBuffer) {
  11615. this.getEngine().deleteInstancesBuffer(this._worldMatricesInstancesBuffer);
  11616. this._worldMatricesInstancesBuffer = null;
  11617. }
  11618. while (this.instances.length) {
  11619. this.instances[0].dispose();
  11620. }
  11621. _super.prototype.dispose.call(this, doNotRecurse);
  11622. };
  11623. // Geometric tools
  11624. Mesh.prototype.applyDisplacementMap = function (url, minHeight, maxHeight, onSuccess) {
  11625. var _this = this;
  11626. var scene = this.getScene();
  11627. var onload = function (img) {
  11628. // Getting height map data
  11629. var canvas = document.createElement("canvas");
  11630. var context = canvas.getContext("2d");
  11631. var heightMapWidth = img.width;
  11632. var heightMapHeight = img.height;
  11633. canvas.width = heightMapWidth;
  11634. canvas.height = heightMapHeight;
  11635. context.drawImage(img, 0, 0);
  11636. // Create VertexData from map data
  11637. //Cast is due to wrong definition in lib.d.ts from ts 1.3 - https://github.com/Microsoft/TypeScript/issues/949
  11638. var buffer = context.getImageData(0, 0, heightMapWidth, heightMapHeight).data;
  11639. _this.applyDisplacementMapFromBuffer(buffer, heightMapWidth, heightMapHeight, minHeight, maxHeight);
  11640. //execute success callback, if set
  11641. if (onSuccess) {
  11642. onSuccess(_this);
  11643. }
  11644. };
  11645. BABYLON.Tools.LoadImage(url, onload, function () {
  11646. }, scene.database);
  11647. };
  11648. Mesh.prototype.applyDisplacementMapFromBuffer = function (buffer, heightMapWidth, heightMapHeight, minHeight, maxHeight) {
  11649. if (!this.isVerticesDataPresent(BABYLON.VertexBuffer.PositionKind) || !this.isVerticesDataPresent(BABYLON.VertexBuffer.NormalKind) || !this.isVerticesDataPresent(BABYLON.VertexBuffer.UVKind)) {
  11650. BABYLON.Tools.Warn("Cannot call applyDisplacementMap: Given mesh is not complete. Position, Normal or UV are missing");
  11651. return;
  11652. }
  11653. var positions = this.getVerticesData(BABYLON.VertexBuffer.PositionKind);
  11654. var normals = this.getVerticesData(BABYLON.VertexBuffer.NormalKind);
  11655. var uvs = this.getVerticesData(BABYLON.VertexBuffer.UVKind);
  11656. var position = BABYLON.Vector3.Zero();
  11657. var normal = BABYLON.Vector3.Zero();
  11658. var uv = BABYLON.Vector2.Zero();
  11659. for (var index = 0; index < positions.length; index += 3) {
  11660. BABYLON.Vector3.FromArrayToRef(positions, index, position);
  11661. BABYLON.Vector3.FromArrayToRef(normals, index, normal);
  11662. BABYLON.Vector2.FromArrayToRef(uvs, (index / 3) * 2, uv);
  11663. // Compute height
  11664. var u = ((Math.abs(uv.x) * heightMapWidth) % heightMapWidth) | 0;
  11665. var v = ((Math.abs(uv.y) * heightMapHeight) % heightMapHeight) | 0;
  11666. var pos = (u + v * heightMapWidth) * 4;
  11667. var r = buffer[pos] / 255.0;
  11668. var g = buffer[pos + 1] / 255.0;
  11669. var b = buffer[pos + 2] / 255.0;
  11670. var gradient = r * 0.3 + g * 0.59 + b * 0.11;
  11671. normal.normalize();
  11672. normal.scaleInPlace(minHeight + (maxHeight - minHeight) * gradient);
  11673. position = position.add(normal);
  11674. position.toArray(positions, index);
  11675. }
  11676. BABYLON.VertexData.ComputeNormals(positions, this.getIndices(), normals);
  11677. this.updateVerticesData(BABYLON.VertexBuffer.PositionKind, positions);
  11678. this.updateVerticesData(BABYLON.VertexBuffer.NormalKind, normals);
  11679. };
  11680. Mesh.prototype.convertToFlatShadedMesh = function () {
  11681. /// <summary>Update normals and vertices to get a flat shading rendering.</summary>
  11682. /// <summary>Warning: This may imply adding vertices to the mesh in order to get exactly 3 vertices per face</summary>
  11683. var kinds = this.getVerticesDataKinds();
  11684. var vbs = [];
  11685. var data = [];
  11686. var newdata = [];
  11687. var updatableNormals = false;
  11688. for (var kindIndex = 0; kindIndex < kinds.length; kindIndex++) {
  11689. var kind = kinds[kindIndex];
  11690. var vertexBuffer = this.getVertexBuffer(kind);
  11691. if (kind === BABYLON.VertexBuffer.NormalKind) {
  11692. updatableNormals = vertexBuffer.isUpdatable();
  11693. kinds.splice(kindIndex, 1);
  11694. kindIndex--;
  11695. continue;
  11696. }
  11697. vbs[kind] = vertexBuffer;
  11698. data[kind] = vbs[kind].getData();
  11699. newdata[kind] = [];
  11700. }
  11701. // Save previous submeshes
  11702. var previousSubmeshes = this.subMeshes.slice(0);
  11703. var indices = this.getIndices();
  11704. var totalIndices = this.getTotalIndices();
  11705. for (var index = 0; index < totalIndices; index++) {
  11706. var vertexIndex = indices[index];
  11707. for (kindIndex = 0; kindIndex < kinds.length; kindIndex++) {
  11708. kind = kinds[kindIndex];
  11709. var stride = vbs[kind].getStrideSize();
  11710. for (var offset = 0; offset < stride; offset++) {
  11711. newdata[kind].push(data[kind][vertexIndex * stride + offset]);
  11712. }
  11713. }
  11714. }
  11715. // Updating faces & normal
  11716. var normals = [];
  11717. var positions = newdata[BABYLON.VertexBuffer.PositionKind];
  11718. for (index = 0; index < totalIndices; index += 3) {
  11719. indices[index] = index;
  11720. indices[index + 1] = index + 1;
  11721. indices[index + 2] = index + 2;
  11722. var p1 = BABYLON.Vector3.FromArray(positions, index * 3);
  11723. var p2 = BABYLON.Vector3.FromArray(positions, (index + 1) * 3);
  11724. var p3 = BABYLON.Vector3.FromArray(positions, (index + 2) * 3);
  11725. var p1p2 = p1.subtract(p2);
  11726. var p3p2 = p3.subtract(p2);
  11727. var normal = BABYLON.Vector3.Normalize(BABYLON.Vector3.Cross(p1p2, p3p2));
  11728. for (var localIndex = 0; localIndex < 3; localIndex++) {
  11729. normals.push(normal.x);
  11730. normals.push(normal.y);
  11731. normals.push(normal.z);
  11732. }
  11733. }
  11734. this.setIndices(indices);
  11735. this.setVerticesData(BABYLON.VertexBuffer.NormalKind, normals, updatableNormals);
  11736. for (kindIndex = 0; kindIndex < kinds.length; kindIndex++) {
  11737. kind = kinds[kindIndex];
  11738. this.setVerticesData(kind, newdata[kind], vbs[kind].isUpdatable());
  11739. }
  11740. // Updating submeshes
  11741. this.releaseSubMeshes();
  11742. for (var submeshIndex = 0; submeshIndex < previousSubmeshes.length; submeshIndex++) {
  11743. var previousOne = previousSubmeshes[submeshIndex];
  11744. var subMesh = new BABYLON.SubMesh(previousOne.materialIndex, previousOne.indexStart, previousOne.indexCount, previousOne.indexStart, previousOne.indexCount, this);
  11745. }
  11746. this.synchronizeInstances();
  11747. };
  11748. // Instances
  11749. Mesh.prototype.createInstance = function (name) {
  11750. return new BABYLON.InstancedMesh(name, this);
  11751. };
  11752. Mesh.prototype.synchronizeInstances = function () {
  11753. for (var instanceIndex = 0; instanceIndex < this.instances.length; instanceIndex++) {
  11754. var instance = this.instances[instanceIndex];
  11755. instance._syncSubMeshes();
  11756. }
  11757. };
  11758. /**
  11759. * Simplify the mesh according to the given array of settings.
  11760. * Function will return immediately and will simplify async.
  11761. * @param settings a collection of simplification settings.
  11762. * @param parallelProcessing should all levels calculate parallel or one after the other.
  11763. * @param type the type of simplification to run.
  11764. * @param successCallback optional success callback to be called after the simplification finished processing all settings.
  11765. */
  11766. Mesh.prototype.simplify = function (settings, parallelProcessing, simplificationType, successCallback) {
  11767. if (parallelProcessing === void 0) { parallelProcessing = true; }
  11768. if (simplificationType === void 0) { simplificationType = 0 /* QUADRATIC */; }
  11769. this.getScene().simplificationQueue.addTask({
  11770. settings: settings,
  11771. parallelProcessing: parallelProcessing,
  11772. mesh: this,
  11773. simplificationType: simplificationType,
  11774. successCallback: successCallback
  11775. });
  11776. };
  11777. /**
  11778. * Optimization of the mesh's indices, in case a mesh has duplicated vertices.
  11779. * The function will only reorder the indices and will not remove unused vertices to avoid problems with submeshes.
  11780. * This should be used together with the simplification to avoid disappearing triangles.
  11781. * @param successCallback an optional success callback to be called after the optimization finished.
  11782. */
  11783. Mesh.prototype.optimizeIndices = function (successCallback) {
  11784. var _this = this;
  11785. var indices = this.getIndices();
  11786. var positions = this.getVerticesData(BABYLON.VertexBuffer.PositionKind);
  11787. var vectorPositions = [];
  11788. for (var pos = 0; pos < positions.length; pos = pos + 3) {
  11789. vectorPositions.push(BABYLON.Vector3.FromArray(positions, pos));
  11790. }
  11791. var dupes = [];
  11792. BABYLON.AsyncLoop.SyncAsyncForLoop(vectorPositions.length, 40, function (iteration) {
  11793. var realPos = vectorPositions.length - 1 - iteration;
  11794. var testedPosition = vectorPositions[realPos];
  11795. for (var j = 0; j < realPos; ++j) {
  11796. var againstPosition = vectorPositions[j];
  11797. if (testedPosition.equals(againstPosition)) {
  11798. dupes[realPos] = j;
  11799. break;
  11800. }
  11801. }
  11802. }, function () {
  11803. for (var i = 0; i < indices.length; ++i) {
  11804. indices[i] = dupes[indices[i]] || indices[i];
  11805. }
  11806. //indices are now reordered
  11807. var originalSubMeshes = _this.subMeshes.slice(0);
  11808. _this.setIndices(indices);
  11809. _this.subMeshes = originalSubMeshes;
  11810. if (successCallback) {
  11811. successCallback(_this);
  11812. }
  11813. });
  11814. };
  11815. // Statics
  11816. Mesh.CreateRibbon = function (name, pathArray, closeArray, closePath, offset, scene, updatable, sideOrientation, ribbonInstance) {
  11817. if (sideOrientation === void 0) { sideOrientation = Mesh.DEFAULTSIDE; }
  11818. if (ribbonInstance === void 0) { ribbonInstance = null; }
  11819. if (ribbonInstance) {
  11820. // positionFunction : ribbon case
  11821. // only pathArray and sideOrientation parameters are taken into account for positions update
  11822. var positionsOfRibbon = function (pathArray, sideOrientation) {
  11823. var positionFunction = function (positions) {
  11824. var minlg = pathArray[0].length;
  11825. var i = 0;
  11826. var ns = (sideOrientation == BABYLON.Mesh.DOUBLESIDE) ? 2 : 1;
  11827. for (var si = 1; si <= ns; si++) {
  11828. for (var p = 0; p < pathArray.length; p++) {
  11829. var path = pathArray[p];
  11830. var l = path.length;
  11831. minlg = (minlg < l) ? minlg : l;
  11832. var j = 0;
  11833. while (j < minlg) {
  11834. positions[i] = path[j].x;
  11835. positions[i + 1] = path[j].y;
  11836. positions[i + 2] = path[j].z;
  11837. j++;
  11838. i += 3;
  11839. }
  11840. }
  11841. }
  11842. };
  11843. return positionFunction;
  11844. };
  11845. var sideOrientation = ribbonInstance.sideOrientation;
  11846. var positionFunction = positionsOfRibbon(pathArray, sideOrientation);
  11847. ribbonInstance.updateMeshPositions(positionFunction, true);
  11848. return ribbonInstance;
  11849. }
  11850. else {
  11851. var ribbon = new Mesh(name, scene);
  11852. ribbon.sideOrientation = sideOrientation;
  11853. var vertexData = BABYLON.VertexData.CreateRibbon(pathArray, closeArray, closePath, offset, sideOrientation);
  11854. vertexData.applyToMesh(ribbon, updatable);
  11855. return ribbon;
  11856. }
  11857. };
  11858. Mesh.CreateDisc = function (name, radius, tessellation, scene, updatable, sideOrientation) {
  11859. if (sideOrientation === void 0) { sideOrientation = Mesh.DEFAULTSIDE; }
  11860. var disc = new Mesh(name, scene);
  11861. var vertexData = BABYLON.VertexData.CreateDisc(radius, tessellation, sideOrientation);
  11862. vertexData.applyToMesh(disc, updatable);
  11863. return disc;
  11864. };
  11865. Mesh.CreateBox = function (name, size, scene, updatable, sideOrientation) {
  11866. if (sideOrientation === void 0) { sideOrientation = Mesh.DEFAULTSIDE; }
  11867. var box = new Mesh(name, scene);
  11868. var vertexData = BABYLON.VertexData.CreateBox(size, sideOrientation);
  11869. vertexData.applyToMesh(box, updatable);
  11870. return box;
  11871. };
  11872. Mesh.CreateSphere = function (name, segments, diameter, scene, updatable, sideOrientation) {
  11873. if (sideOrientation === void 0) { sideOrientation = Mesh.DEFAULTSIDE; }
  11874. var sphere = new Mesh(name, scene);
  11875. var vertexData = BABYLON.VertexData.CreateSphere(segments, diameter, sideOrientation);
  11876. vertexData.applyToMesh(sphere, updatable);
  11877. return sphere;
  11878. };
  11879. // Cylinder and cone (Code inspired by SharpDX.org)
  11880. Mesh.CreateCylinder = function (name, height, diameterTop, diameterBottom, tessellation, subdivisions, scene, updatable, sideOrientation) {
  11881. if (sideOrientation === void 0) { sideOrientation = Mesh.DEFAULTSIDE; }
  11882. // subdivisions is a new parameter, we need to support old signature
  11883. if (scene === undefined || !(scene instanceof BABYLON.Scene)) {
  11884. if (scene !== undefined) {
  11885. updatable = scene;
  11886. }
  11887. scene = subdivisions;
  11888. subdivisions = 1;
  11889. }
  11890. var cylinder = new Mesh(name, scene);
  11891. var vertexData = BABYLON.VertexData.CreateCylinder(height, diameterTop, diameterBottom, tessellation, subdivisions);
  11892. vertexData.applyToMesh(cylinder, updatable);
  11893. return cylinder;
  11894. };
  11895. // Torus (Code from SharpDX.org)
  11896. Mesh.CreateTorus = function (name, diameter, thickness, tessellation, scene, updatable, sideOrientation) {
  11897. if (sideOrientation === void 0) { sideOrientation = Mesh.DEFAULTSIDE; }
  11898. var torus = new Mesh(name, scene);
  11899. var vertexData = BABYLON.VertexData.CreateTorus(diameter, thickness, tessellation, sideOrientation);
  11900. vertexData.applyToMesh(torus, updatable);
  11901. return torus;
  11902. };
  11903. Mesh.CreateTorusKnot = function (name, radius, tube, radialSegments, tubularSegments, p, q, scene, updatable, sideOrientation) {
  11904. if (sideOrientation === void 0) { sideOrientation = Mesh.DEFAULTSIDE; }
  11905. var torusKnot = new Mesh(name, scene);
  11906. var vertexData = BABYLON.VertexData.CreateTorusKnot(radius, tube, radialSegments, tubularSegments, p, q, sideOrientation);
  11907. vertexData.applyToMesh(torusKnot, updatable);
  11908. return torusKnot;
  11909. };
  11910. // Lines
  11911. Mesh.CreateLines = function (name, points, scene, updatable, linesInstance) {
  11912. if (linesInstance === void 0) { linesInstance = null; }
  11913. if (linesInstance) {
  11914. var positionsOfLines = function (points) {
  11915. var positionFunction = function (positions) {
  11916. var i = 0;
  11917. for (var p = 0; p < points.length; p++) {
  11918. positions[i] = points[p].x;
  11919. positions[i + 1] = points[p].y;
  11920. positions[i + 2] = points[p].z;
  11921. i += 3;
  11922. }
  11923. };
  11924. return positionFunction;
  11925. };
  11926. var positionFunction = positionsOfLines(points);
  11927. linesInstance.updateMeshPositions(positionFunction, false);
  11928. return linesInstance;
  11929. }
  11930. // lines creation
  11931. var lines = new BABYLON.LinesMesh(name, scene, updatable);
  11932. var vertexData = BABYLON.VertexData.CreateLines(points);
  11933. vertexData.applyToMesh(lines, updatable);
  11934. return lines;
  11935. };
  11936. // Extrusion
  11937. Mesh.ExtrudeShape = function (name, shape, path, scale, rotation, scene, updatable, sideOrientation, extrudedInstance) {
  11938. if (sideOrientation === void 0) { sideOrientation = Mesh.DEFAULTSIDE; }
  11939. if (extrudedInstance === void 0) { extrudedInstance = null; }
  11940. scale = scale || 1;
  11941. rotation = rotation || 0;
  11942. var extruded = Mesh._ExtrudeShapeGeneric(name, shape, path, scale, rotation, null, null, false, false, false, scene, updatable, sideOrientation, extrudedInstance);
  11943. return extruded;
  11944. };
  11945. Mesh.ExtrudeShapeCustom = function (name, shape, path, scaleFunction, rotationFunction, ribbonCloseArray, ribbonClosePath, scene, updatable, sideOrientation, extrudedInstance) {
  11946. if (sideOrientation === void 0) { sideOrientation = Mesh.DEFAULTSIDE; }
  11947. if (extrudedInstance === void 0) { extrudedInstance = null; }
  11948. var extrudedCustom = Mesh._ExtrudeShapeGeneric(name, shape, path, null, null, scaleFunction, rotationFunction, ribbonCloseArray, ribbonClosePath, true, scene, updatable, sideOrientation, extrudedInstance);
  11949. return extrudedCustom;
  11950. };
  11951. Mesh._ExtrudeShapeGeneric = function (name, shape, curve, scale, rotation, scaleFunction, rotateFunction, rbCA, rbCP, custom, scene, updtbl, side, instance) {
  11952. // extrusion geometry
  11953. var extrusionPathArray = function (shape, curve, path3D, shapePaths, scale, rotation, scaleFunction, rotateFunction, custom) {
  11954. var tangents = path3D.getTangents();
  11955. var normals = path3D.getNormals();
  11956. var binormals = path3D.getBinormals();
  11957. var distances = path3D.getDistances();
  11958. var angle = 0;
  11959. var returnScale = function (i, distance) {
  11960. return scale;
  11961. };
  11962. var returnRotation = function (i, distance) {
  11963. return rotation;
  11964. };
  11965. var rotate = custom ? rotateFunction : returnRotation;
  11966. var scl = custom ? scaleFunction : returnScale;
  11967. var index = 0;
  11968. for (var i = 0; i < curve.length; i++) {
  11969. var shapePath = new Array();
  11970. var angleStep = rotate(i, distances[i]);
  11971. var scaleRatio = scl(i, distances[i]);
  11972. for (var p = 0; p < shape.length; p++) {
  11973. var rotationMatrix = BABYLON.Matrix.RotationAxis(tangents[i], angle);
  11974. var planed = ((tangents[i].scale(shape[p].z)).add(normals[i].scale(shape[p].x)).add(binormals[i].scale(shape[p].y)));
  11975. var rotated = BABYLON.Vector3.TransformCoordinates(planed, rotationMatrix).scaleInPlace(scaleRatio).add(curve[i]);
  11976. shapePath.push(rotated);
  11977. }
  11978. shapePaths[index] = shapePath;
  11979. angle += angleStep;
  11980. index++;
  11981. }
  11982. return shapePaths;
  11983. };
  11984. if (instance) {
  11985. var path3D = (instance.path3D).update(curve);
  11986. var pathArray = extrusionPathArray(shape, curve, instance.path3D, instance.pathArray, scale, rotation, scaleFunction, rotateFunction, custom);
  11987. instance = Mesh.CreateRibbon(null, pathArray, null, null, null, null, null, null, instance);
  11988. return instance;
  11989. }
  11990. // extruded shape creation
  11991. var path3D = new BABYLON.Path3D(curve);
  11992. var newShapePaths = new Array();
  11993. var pathArray = extrusionPathArray(shape, curve, path3D, newShapePaths, scale, rotation, scaleFunction, rotateFunction, custom);
  11994. var extrudedGeneric = Mesh.CreateRibbon(name, pathArray, rbCA, rbCP, 0, scene, updtbl, side);
  11995. extrudedGeneric.pathArray = pathArray;
  11996. extrudedGeneric.path3D = path3D;
  11997. return extrudedGeneric;
  11998. };
  11999. // Plane & ground
  12000. Mesh.CreatePlane = function (name, size, scene, updatable, sideOrientation) {
  12001. if (sideOrientation === void 0) { sideOrientation = Mesh.DEFAULTSIDE; }
  12002. var plane = new Mesh(name, scene);
  12003. var vertexData = BABYLON.VertexData.CreatePlane(size, sideOrientation);
  12004. vertexData.applyToMesh(plane, updatable);
  12005. return plane;
  12006. };
  12007. Mesh.CreateGround = function (name, width, height, subdivisions, scene, updatable) {
  12008. var ground = new BABYLON.GroundMesh(name, scene);
  12009. ground._setReady(false);
  12010. ground._subdivisions = subdivisions;
  12011. var vertexData = BABYLON.VertexData.CreateGround(width, height, subdivisions);
  12012. vertexData.applyToMesh(ground, updatable);
  12013. ground._setReady(true);
  12014. return ground;
  12015. };
  12016. Mesh.CreateTiledGround = function (name, xmin, zmin, xmax, zmax, subdivisions, precision, scene, updatable) {
  12017. var tiledGround = new Mesh(name, scene);
  12018. var vertexData = BABYLON.VertexData.CreateTiledGround(xmin, zmin, xmax, zmax, subdivisions, precision);
  12019. vertexData.applyToMesh(tiledGround, updatable);
  12020. return tiledGround;
  12021. };
  12022. Mesh.CreateGroundFromHeightMap = function (name, url, width, height, subdivisions, minHeight, maxHeight, scene, updatable, onReady) {
  12023. var ground = new BABYLON.GroundMesh(name, scene);
  12024. ground._subdivisions = subdivisions;
  12025. ground._setReady(false);
  12026. var onload = function (img) {
  12027. // Getting height map data
  12028. var canvas = document.createElement("canvas");
  12029. var context = canvas.getContext("2d");
  12030. var heightMapWidth = img.width;
  12031. var heightMapHeight = img.height;
  12032. canvas.width = heightMapWidth;
  12033. canvas.height = heightMapHeight;
  12034. context.drawImage(img, 0, 0);
  12035. // Create VertexData from map data
  12036. // Cast is due to wrong definition in lib.d.ts from ts 1.3 - https://github.com/Microsoft/TypeScript/issues/949
  12037. var buffer = context.getImageData(0, 0, heightMapWidth, heightMapHeight).data;
  12038. var vertexData = BABYLON.VertexData.CreateGroundFromHeightMap(width, height, subdivisions, minHeight, maxHeight, buffer, heightMapWidth, heightMapHeight);
  12039. vertexData.applyToMesh(ground, updatable);
  12040. ground._setReady(true);
  12041. //execute ready callback, if set
  12042. if (onReady) {
  12043. onReady(ground);
  12044. }
  12045. };
  12046. BABYLON.Tools.LoadImage(url, onload, function () {
  12047. }, scene.database);
  12048. return ground;
  12049. };
  12050. Mesh.CreateTube = function (name, path, radius, tessellation, radiusFunction, scene, updatable, sideOrientation, tubeInstance) {
  12051. if (sideOrientation === void 0) { sideOrientation = Mesh.DEFAULTSIDE; }
  12052. if (tubeInstance === void 0) { tubeInstance = null; }
  12053. // tube geometry
  12054. var tubePathArray = function (path, path3D, circlePaths, radius, tessellation, radiusFunction) {
  12055. var tangents = path3D.getTangents();
  12056. var normals = path3D.getNormals();
  12057. var distances = path3D.getDistances();
  12058. var pi2 = Math.PI * 2;
  12059. var step = pi2 / tessellation;
  12060. var returnRadius = function (i, distance) { return radius; };
  12061. var radiusFunctionFinal = radiusFunction || returnRadius;
  12062. var circlePath;
  12063. var rad;
  12064. var normal;
  12065. var rotated;
  12066. var rotationMatrix;
  12067. var index = 0;
  12068. for (var i = 0; i < path.length; i++) {
  12069. rad = radiusFunctionFinal(i, distances[i]); // current radius
  12070. circlePath = Array(); // current circle array
  12071. normal = normals[i]; // current normal
  12072. for (var ang = 0; ang < pi2; ang += step) {
  12073. rotationMatrix = BABYLON.Matrix.RotationAxis(tangents[i], ang);
  12074. rotated = BABYLON.Vector3.TransformCoordinates(normal, rotationMatrix).scaleInPlace(rad).add(path[i]);
  12075. circlePath.push(rotated);
  12076. }
  12077. circlePaths[index] = circlePath;
  12078. index++;
  12079. }
  12080. return circlePaths;
  12081. };
  12082. if (tubeInstance) {
  12083. var path3D = (tubeInstance.path3D).update(path);
  12084. var pathArray = tubePathArray(path, path3D, tubeInstance.pathArray, radius, tubeInstance.tessellation, radiusFunction);
  12085. tubeInstance = Mesh.CreateRibbon(null, pathArray, null, null, null, null, null, null, tubeInstance);
  12086. return tubeInstance;
  12087. }
  12088. // tube creation
  12089. var path3D = new BABYLON.Path3D(path);
  12090. var newPathArray = new Array();
  12091. var pathArray = tubePathArray(path, path3D, newPathArray, radius, tessellation, radiusFunction);
  12092. var tube = Mesh.CreateRibbon(name, pathArray, false, true, 0, scene, updatable, sideOrientation);
  12093. tube.pathArray = pathArray;
  12094. tube.path3D = path3D;
  12095. tube.tessellation = tessellation;
  12096. return tube;
  12097. };
  12098. // Decals
  12099. Mesh.CreateDecal = function (name, sourceMesh, position, normal, size, angle) {
  12100. if (angle === void 0) { angle = 0; }
  12101. var indices = sourceMesh.getIndices();
  12102. var positions = sourceMesh.getVerticesData(BABYLON.VertexBuffer.PositionKind);
  12103. var normals = sourceMesh.getVerticesData(BABYLON.VertexBuffer.NormalKind);
  12104. // Getting correct rotation
  12105. if (!normal) {
  12106. var target = new BABYLON.Vector3(0, 0, 1);
  12107. var camera = sourceMesh.getScene().activeCamera;
  12108. var cameraWorldTarget = BABYLON.Vector3.TransformCoordinates(target, camera.getWorldMatrix());
  12109. normal = camera.globalPosition.subtract(cameraWorldTarget);
  12110. }
  12111. var yaw = -Math.atan2(normal.z, normal.x) - Math.PI / 2;
  12112. var len = Math.sqrt(normal.x * normal.x + normal.z * normal.z);
  12113. var pitch = Math.atan2(normal.y, len);
  12114. // Matrix
  12115. var decalWorldMatrix = BABYLON.Matrix.RotationYawPitchRoll(yaw, pitch, angle).multiply(BABYLON.Matrix.Translation(position.x, position.y, position.z));
  12116. var inverseDecalWorldMatrix = BABYLON.Matrix.Invert(decalWorldMatrix);
  12117. var meshWorldMatrix = sourceMesh.getWorldMatrix();
  12118. var transformMatrix = meshWorldMatrix.multiply(inverseDecalWorldMatrix);
  12119. var vertexData = new BABYLON.VertexData();
  12120. vertexData.indices = [];
  12121. vertexData.positions = [];
  12122. vertexData.normals = [];
  12123. vertexData.uvs = [];
  12124. var currentVertexDataIndex = 0;
  12125. var extractDecalVector3 = function (indexId) {
  12126. var vertexId = indices[indexId];
  12127. var result = new BABYLON.PositionNormalVertex();
  12128. result.position = new BABYLON.Vector3(positions[vertexId * 3], positions[vertexId * 3 + 1], positions[vertexId * 3 + 2]);
  12129. // Send vector to decal local world
  12130. result.position = BABYLON.Vector3.TransformCoordinates(result.position, transformMatrix);
  12131. // Get normal
  12132. result.normal = new BABYLON.Vector3(normals[vertexId * 3], normals[vertexId * 3 + 1], normals[vertexId * 3 + 2]);
  12133. return result;
  12134. };
  12135. // Inspired by https://github.com/mrdoob/three.js/blob/eee231960882f6f3b6113405f524956145148146/examples/js/geometries/DecalGeometry.js
  12136. var clip = function (vertices, axis) {
  12137. if (vertices.length === 0) {
  12138. return vertices;
  12139. }
  12140. var clipSize = 0.5 * Math.abs(BABYLON.Vector3.Dot(size, axis));
  12141. var clipVertices = function (v0, v1) {
  12142. var clipFactor = BABYLON.Vector3.GetClipFactor(v0.position, v1.position, axis, clipSize);
  12143. return new BABYLON.PositionNormalVertex(BABYLON.Vector3.Lerp(v0.position, v1.position, clipFactor), BABYLON.Vector3.Lerp(v0.normal, v1.normal, clipFactor));
  12144. };
  12145. var result = new Array();
  12146. for (var index = 0; index < vertices.length; index += 3) {
  12147. var v1Out;
  12148. var v2Out;
  12149. var v3Out;
  12150. var total = 0;
  12151. var nV1, nV2, nV3, nV4;
  12152. var d1 = BABYLON.Vector3.Dot(vertices[index].position, axis) - clipSize;
  12153. var d2 = BABYLON.Vector3.Dot(vertices[index + 1].position, axis) - clipSize;
  12154. var d3 = BABYLON.Vector3.Dot(vertices[index + 2].position, axis) - clipSize;
  12155. v1Out = d1 > 0;
  12156. v2Out = d2 > 0;
  12157. v3Out = d3 > 0;
  12158. total = (v1Out ? 1 : 0) + (v2Out ? 1 : 0) + (v3Out ? 1 : 0);
  12159. switch (total) {
  12160. case 0:
  12161. result.push(vertices[index]);
  12162. result.push(vertices[index + 1]);
  12163. result.push(vertices[index + 2]);
  12164. break;
  12165. case 1:
  12166. if (v1Out) {
  12167. nV1 = vertices[index + 1];
  12168. nV2 = vertices[index + 2];
  12169. nV3 = clipVertices(vertices[index], nV1);
  12170. nV4 = clipVertices(vertices[index], nV2);
  12171. }
  12172. if (v2Out) {
  12173. nV1 = vertices[index];
  12174. nV2 = vertices[index + 2];
  12175. nV3 = clipVertices(vertices[index + 1], nV1);
  12176. nV4 = clipVertices(vertices[index + 1], nV2);
  12177. result.push(nV3);
  12178. result.push(nV2.clone());
  12179. result.push(nV1.clone());
  12180. result.push(nV2.clone());
  12181. result.push(nV3.clone());
  12182. result.push(nV4);
  12183. break;
  12184. }
  12185. if (v3Out) {
  12186. nV1 = vertices[index];
  12187. nV2 = vertices[index + 1];
  12188. nV3 = clipVertices(vertices[index + 2], nV1);
  12189. nV4 = clipVertices(vertices[index + 2], nV2);
  12190. }
  12191. result.push(nV1.clone());
  12192. result.push(nV2.clone());
  12193. result.push(nV3);
  12194. result.push(nV4);
  12195. result.push(nV3.clone());
  12196. result.push(nV2.clone());
  12197. break;
  12198. case 2:
  12199. if (!v1Out) {
  12200. nV1 = vertices[index].clone();
  12201. nV2 = clipVertices(nV1, vertices[index + 1]);
  12202. nV3 = clipVertices(nV1, vertices[index + 2]);
  12203. result.push(nV1);
  12204. result.push(nV2);
  12205. result.push(nV3);
  12206. }
  12207. if (!v2Out) {
  12208. nV1 = vertices[index + 1].clone();
  12209. nV2 = clipVertices(nV1, vertices[index + 2]);
  12210. nV3 = clipVertices(nV1, vertices[index]);
  12211. result.push(nV1);
  12212. result.push(nV2);
  12213. result.push(nV3);
  12214. }
  12215. if (!v3Out) {
  12216. nV1 = vertices[index + 2].clone();
  12217. nV2 = clipVertices(nV1, vertices[index]);
  12218. nV3 = clipVertices(nV1, vertices[index + 1]);
  12219. result.push(nV1);
  12220. result.push(nV2);
  12221. result.push(nV3);
  12222. }
  12223. break;
  12224. case 3:
  12225. break;
  12226. }
  12227. }
  12228. return result;
  12229. };
  12230. for (var index = 0; index < indices.length; index += 3) {
  12231. var faceVertices = new Array();
  12232. faceVertices.push(extractDecalVector3(index));
  12233. faceVertices.push(extractDecalVector3(index + 1));
  12234. faceVertices.push(extractDecalVector3(index + 2));
  12235. // Clip
  12236. faceVertices = clip(faceVertices, new BABYLON.Vector3(1, 0, 0));
  12237. faceVertices = clip(faceVertices, new BABYLON.Vector3(-1, 0, 0));
  12238. faceVertices = clip(faceVertices, new BABYLON.Vector3(0, 1, 0));
  12239. faceVertices = clip(faceVertices, new BABYLON.Vector3(0, -1, 0));
  12240. faceVertices = clip(faceVertices, new BABYLON.Vector3(0, 0, 1));
  12241. faceVertices = clip(faceVertices, new BABYLON.Vector3(0, 0, -1));
  12242. if (faceVertices.length === 0) {
  12243. continue;
  12244. }
  12245. // Add UVs and get back to world
  12246. var localRotationMatrix = BABYLON.Matrix.RotationYawPitchRoll(yaw, pitch, angle);
  12247. for (var vIndex = 0; vIndex < faceVertices.length; vIndex++) {
  12248. var vertex = faceVertices[vIndex];
  12249. vertexData.indices.push(currentVertexDataIndex);
  12250. vertex.position.toArray(vertexData.positions, currentVertexDataIndex * 3);
  12251. vertex.normal.toArray(vertexData.normals, currentVertexDataIndex * 3);
  12252. vertexData.uvs.push(0.5 + vertex.position.x / size.x);
  12253. vertexData.uvs.push(0.5 + vertex.position.y / size.y);
  12254. currentVertexDataIndex++;
  12255. }
  12256. }
  12257. // Return mesh
  12258. var decal = new Mesh(name, sourceMesh.getScene());
  12259. vertexData.applyToMesh(decal);
  12260. decal.position = position.clone();
  12261. decal.rotation = new BABYLON.Vector3(pitch, yaw, angle);
  12262. return decal;
  12263. };
  12264. // Tools
  12265. Mesh.MinMax = function (meshes) {
  12266. var minVector = null;
  12267. var maxVector = null;
  12268. for (var i in meshes) {
  12269. var mesh = meshes[i];
  12270. var boundingBox = mesh.getBoundingInfo().boundingBox;
  12271. if (!minVector) {
  12272. minVector = boundingBox.minimumWorld;
  12273. maxVector = boundingBox.maximumWorld;
  12274. continue;
  12275. }
  12276. minVector.MinimizeInPlace(boundingBox.minimumWorld);
  12277. maxVector.MaximizeInPlace(boundingBox.maximumWorld);
  12278. }
  12279. return {
  12280. min: minVector,
  12281. max: maxVector
  12282. };
  12283. };
  12284. Mesh.Center = function (meshesOrMinMaxVector) {
  12285. var minMaxVector = meshesOrMinMaxVector.min !== undefined ? meshesOrMinMaxVector : Mesh.MinMax(meshesOrMinMaxVector);
  12286. return BABYLON.Vector3.Center(minMaxVector.min, minMaxVector.max);
  12287. };
  12288. Mesh.MergeMeshes = function (meshes, disposeSource, allow32BitsIndices) {
  12289. if (disposeSource === void 0) { disposeSource = true; }
  12290. var source = meshes[0];
  12291. var material = source.material;
  12292. var scene = source.getScene();
  12293. if (!allow32BitsIndices) {
  12294. var totalVertices = 0;
  12295. for (var index = 0; index < meshes.length; index++) {
  12296. totalVertices += meshes[index].getTotalVertices();
  12297. if (totalVertices > 65536) {
  12298. BABYLON.Tools.Warn("Cannot merge meshes because resulting mesh will have more than 65536 vertices. Please use allow32BitsIndices = true to use 32 bits indices");
  12299. return null;
  12300. }
  12301. }
  12302. }
  12303. // Merge
  12304. var vertexData = BABYLON.VertexData.ExtractFromMesh(source);
  12305. vertexData.transform(source.getWorldMatrix());
  12306. for (index = 1; index < meshes.length; index++) {
  12307. var otherVertexData = BABYLON.VertexData.ExtractFromMesh(meshes[index]);
  12308. otherVertexData.transform(meshes[index].getWorldMatrix());
  12309. vertexData.merge(otherVertexData);
  12310. }
  12311. var newMesh = new Mesh(source.name + "_merged", scene);
  12312. vertexData.applyToMesh(newMesh);
  12313. // Setting properties
  12314. newMesh.material = material;
  12315. newMesh.checkCollisions = source.checkCollisions;
  12316. // Cleaning
  12317. if (disposeSource) {
  12318. for (index = 0; index < meshes.length; index++) {
  12319. meshes[index].dispose();
  12320. }
  12321. }
  12322. return newMesh;
  12323. };
  12324. // Consts
  12325. Mesh._FRONTSIDE = 0;
  12326. Mesh._BACKSIDE = 1;
  12327. Mesh._DOUBLESIDE = 2;
  12328. Mesh._DEFAULTSIDE = 0;
  12329. return Mesh;
  12330. })(BABYLON.AbstractMesh);
  12331. BABYLON.Mesh = Mesh;
  12332. })(BABYLON || (BABYLON = {}));
  12333. //# sourceMappingURL=babylon.mesh.js.map
  12334. var BABYLON;
  12335. (function (BABYLON) {
  12336. var GroundMesh = (function (_super) {
  12337. __extends(GroundMesh, _super);
  12338. function GroundMesh(name, scene) {
  12339. _super.call(this, name, scene);
  12340. this.generateOctree = false;
  12341. this._worldInverse = new BABYLON.Matrix();
  12342. }
  12343. Object.defineProperty(GroundMesh.prototype, "subdivisions", {
  12344. get: function () {
  12345. return this._subdivisions;
  12346. },
  12347. enumerable: true,
  12348. configurable: true
  12349. });
  12350. GroundMesh.prototype.optimize = function (chunksCount) {
  12351. this.subdivide(this._subdivisions);
  12352. this.createOrUpdateSubmeshesOctree(32);
  12353. };
  12354. GroundMesh.prototype.getHeightAtCoordinates = function (x, z) {
  12355. var ray = new BABYLON.Ray(new BABYLON.Vector3(x, this.getBoundingInfo().boundingBox.maximumWorld.y + 1, z), new BABYLON.Vector3(0, -1, 0));
  12356. this.getWorldMatrix().invertToRef(this._worldInverse);
  12357. ray = BABYLON.Ray.Transform(ray, this._worldInverse);
  12358. var pickInfo = this.intersects(ray);
  12359. if (pickInfo.hit) {
  12360. return pickInfo.pickedPoint.y;
  12361. }
  12362. return 0;
  12363. };
  12364. return GroundMesh;
  12365. })(BABYLON.Mesh);
  12366. BABYLON.GroundMesh = GroundMesh;
  12367. })(BABYLON || (BABYLON = {}));
  12368. //# sourceMappingURL=babylon.groundMesh.js.map
  12369. var BABYLON;
  12370. (function (BABYLON) {
  12371. /**
  12372. * Creates an instance based on a source mesh.
  12373. */
  12374. var InstancedMesh = (function (_super) {
  12375. __extends(InstancedMesh, _super);
  12376. function InstancedMesh(name, source) {
  12377. _super.call(this, name, source.getScene());
  12378. source.instances.push(this);
  12379. this._sourceMesh = source;
  12380. this.position.copyFrom(source.position);
  12381. this.rotation.copyFrom(source.rotation);
  12382. this.scaling.copyFrom(source.scaling);
  12383. if (source.rotationQuaternion) {
  12384. this.rotationQuaternion = source.rotationQuaternion.clone();
  12385. }
  12386. this.infiniteDistance = source.infiniteDistance;
  12387. this.setPivotMatrix(source.getPivotMatrix());
  12388. this.refreshBoundingInfo();
  12389. this._syncSubMeshes();
  12390. }
  12391. Object.defineProperty(InstancedMesh.prototype, "receiveShadows", {
  12392. // Methods
  12393. get: function () {
  12394. return this._sourceMesh.receiveShadows;
  12395. },
  12396. enumerable: true,
  12397. configurable: true
  12398. });
  12399. Object.defineProperty(InstancedMesh.prototype, "material", {
  12400. get: function () {
  12401. return this._sourceMesh.material;
  12402. },
  12403. enumerable: true,
  12404. configurable: true
  12405. });
  12406. Object.defineProperty(InstancedMesh.prototype, "visibility", {
  12407. get: function () {
  12408. return this._sourceMesh.visibility;
  12409. },
  12410. enumerable: true,
  12411. configurable: true
  12412. });
  12413. Object.defineProperty(InstancedMesh.prototype, "skeleton", {
  12414. get: function () {
  12415. return this._sourceMesh.skeleton;
  12416. },
  12417. enumerable: true,
  12418. configurable: true
  12419. });
  12420. InstancedMesh.prototype.getTotalVertices = function () {
  12421. return this._sourceMesh.getTotalVertices();
  12422. };
  12423. Object.defineProperty(InstancedMesh.prototype, "sourceMesh", {
  12424. get: function () {
  12425. return this._sourceMesh;
  12426. },
  12427. enumerable: true,
  12428. configurable: true
  12429. });
  12430. InstancedMesh.prototype.getVerticesData = function (kind) {
  12431. return this._sourceMesh.getVerticesData(kind);
  12432. };
  12433. InstancedMesh.prototype.isVerticesDataPresent = function (kind) {
  12434. return this._sourceMesh.isVerticesDataPresent(kind);
  12435. };
  12436. InstancedMesh.prototype.getIndices = function () {
  12437. return this._sourceMesh.getIndices();
  12438. };
  12439. Object.defineProperty(InstancedMesh.prototype, "_positions", {
  12440. get: function () {
  12441. return this._sourceMesh._positions;
  12442. },
  12443. enumerable: true,
  12444. configurable: true
  12445. });
  12446. InstancedMesh.prototype.refreshBoundingInfo = function () {
  12447. var data = this._sourceMesh.getVerticesData(BABYLON.VertexBuffer.PositionKind);
  12448. if (data) {
  12449. var extend = BABYLON.Tools.ExtractMinAndMax(data, 0, this._sourceMesh.getTotalVertices());
  12450. this._boundingInfo = new BABYLON.BoundingInfo(extend.minimum, extend.maximum);
  12451. }
  12452. this._updateBoundingInfo();
  12453. };
  12454. InstancedMesh.prototype._preActivate = function () {
  12455. if (this._currentLOD) {
  12456. this._currentLOD._preActivate();
  12457. }
  12458. };
  12459. InstancedMesh.prototype._activate = function (renderId) {
  12460. if (this._currentLOD) {
  12461. this._currentLOD._registerInstanceForRenderId(this, renderId);
  12462. }
  12463. };
  12464. InstancedMesh.prototype.getLOD = function (camera) {
  12465. this._currentLOD = this.sourceMesh.getLOD(this.getScene().activeCamera, this.getBoundingInfo().boundingSphere);
  12466. if (this._currentLOD === this.sourceMesh) {
  12467. return this;
  12468. }
  12469. return this._currentLOD;
  12470. };
  12471. InstancedMesh.prototype._syncSubMeshes = function () {
  12472. this.releaseSubMeshes();
  12473. if (this._sourceMesh.subMeshes) {
  12474. for (var index = 0; index < this._sourceMesh.subMeshes.length; index++) {
  12475. this._sourceMesh.subMeshes[index].clone(this, this._sourceMesh);
  12476. }
  12477. }
  12478. };
  12479. InstancedMesh.prototype._generatePointsArray = function () {
  12480. return this._sourceMesh._generatePointsArray();
  12481. };
  12482. // Clone
  12483. InstancedMesh.prototype.clone = function (name, newParent, doNotCloneChildren) {
  12484. var result = this._sourceMesh.createInstance(name);
  12485. // Deep copy
  12486. BABYLON.Tools.DeepCopy(this, result, ["name"], []);
  12487. // Bounding info
  12488. this.refreshBoundingInfo();
  12489. // Parent
  12490. if (newParent) {
  12491. result.parent = newParent;
  12492. }
  12493. if (!doNotCloneChildren) {
  12494. for (var index = 0; index < this.getScene().meshes.length; index++) {
  12495. var mesh = this.getScene().meshes[index];
  12496. if (mesh.parent === this) {
  12497. mesh.clone(mesh.name, result);
  12498. }
  12499. }
  12500. }
  12501. result.computeWorldMatrix(true);
  12502. return result;
  12503. };
  12504. // Dispoe
  12505. InstancedMesh.prototype.dispose = function (doNotRecurse) {
  12506. // Remove from mesh
  12507. var index = this._sourceMesh.instances.indexOf(this);
  12508. this._sourceMesh.instances.splice(index, 1);
  12509. _super.prototype.dispose.call(this, doNotRecurse);
  12510. };
  12511. return InstancedMesh;
  12512. })(BABYLON.AbstractMesh);
  12513. BABYLON.InstancedMesh = InstancedMesh;
  12514. })(BABYLON || (BABYLON = {}));
  12515. //# sourceMappingURL=babylon.instancedMesh.js.mapvar BABYLON;
  12516. (function (BABYLON) {
  12517. var SubMesh = (function () {
  12518. function SubMesh(materialIndex, verticesStart, verticesCount, indexStart, indexCount, mesh, renderingMesh, createBoundingBox) {
  12519. if (createBoundingBox === void 0) { createBoundingBox = true; }
  12520. this.materialIndex = materialIndex;
  12521. this.verticesStart = verticesStart;
  12522. this.verticesCount = verticesCount;
  12523. this.indexStart = indexStart;
  12524. this.indexCount = indexCount;
  12525. this._renderId = 0;
  12526. this._mesh = mesh;
  12527. this._renderingMesh = renderingMesh || mesh;
  12528. mesh.subMeshes.push(this);
  12529. this._id = mesh.subMeshes.length - 1;
  12530. if (createBoundingBox) {
  12531. this.refreshBoundingInfo();
  12532. mesh.computeWorldMatrix(true);
  12533. }
  12534. }
  12535. SubMesh.prototype.getBoundingInfo = function () {
  12536. return this._boundingInfo;
  12537. };
  12538. SubMesh.prototype.getMesh = function () {
  12539. return this._mesh;
  12540. };
  12541. SubMesh.prototype.getRenderingMesh = function () {
  12542. return this._renderingMesh;
  12543. };
  12544. SubMesh.prototype.getMaterial = function () {
  12545. var rootMaterial = this._renderingMesh.material;
  12546. if (rootMaterial && rootMaterial instanceof BABYLON.MultiMaterial) {
  12547. var multiMaterial = rootMaterial;
  12548. return multiMaterial.getSubMaterial(this.materialIndex);
  12549. }
  12550. if (!rootMaterial) {
  12551. return this._mesh.getScene().defaultMaterial;
  12552. }
  12553. return rootMaterial;
  12554. };
  12555. // Methods
  12556. SubMesh.prototype.refreshBoundingInfo = function () {
  12557. var data = this._renderingMesh.getVerticesData(BABYLON.VertexBuffer.PositionKind);
  12558. if (!data) {
  12559. this._boundingInfo = this._mesh._boundingInfo;
  12560. return;
  12561. }
  12562. var indices = this._renderingMesh.getIndices();
  12563. var extend;
  12564. if (this.indexStart === 0 && this.indexCount === indices.length) {
  12565. extend = BABYLON.Tools.ExtractMinAndMax(data, this.verticesStart, this.verticesCount);
  12566. }
  12567. else {
  12568. extend = BABYLON.Tools.ExtractMinAndMaxIndexed(data, indices, this.indexStart, this.indexCount);
  12569. }
  12570. this._boundingInfo = new BABYLON.BoundingInfo(extend.minimum, extend.maximum);
  12571. };
  12572. SubMesh.prototype._checkCollision = function (collider) {
  12573. return this._boundingInfo._checkCollision(collider);
  12574. };
  12575. SubMesh.prototype.updateBoundingInfo = function (world) {
  12576. if (!this._boundingInfo) {
  12577. this.refreshBoundingInfo();
  12578. }
  12579. this._boundingInfo._update(world);
  12580. };
  12581. SubMesh.prototype.isInFrustum = function (frustumPlanes) {
  12582. return this._boundingInfo.isInFrustum(frustumPlanes);
  12583. };
  12584. SubMesh.prototype.render = function () {
  12585. this._renderingMesh.render(this);
  12586. };
  12587. SubMesh.prototype.getLinesIndexBuffer = function (indices, engine) {
  12588. if (!this._linesIndexBuffer) {
  12589. var linesIndices = [];
  12590. for (var index = this.indexStart; index < this.indexStart + this.indexCount; index += 3) {
  12591. linesIndices.push(indices[index], indices[index + 1], indices[index + 1], indices[index + 2], indices[index + 2], indices[index]);
  12592. }
  12593. this._linesIndexBuffer = engine.createIndexBuffer(linesIndices);
  12594. this.linesIndexCount = linesIndices.length;
  12595. }
  12596. return this._linesIndexBuffer;
  12597. };
  12598. SubMesh.prototype.canIntersects = function (ray) {
  12599. return ray.intersectsBox(this._boundingInfo.boundingBox);
  12600. };
  12601. SubMesh.prototype.intersects = function (ray, positions, indices, fastCheck) {
  12602. var intersectInfo = null;
  12603. for (var index = this.indexStart; index < this.indexStart + this.indexCount; index += 3) {
  12604. var p0 = positions[indices[index]];
  12605. var p1 = positions[indices[index + 1]];
  12606. var p2 = positions[indices[index + 2]];
  12607. var currentIntersectInfo = ray.intersectsTriangle(p0, p1, p2);
  12608. if (currentIntersectInfo) {
  12609. if (currentIntersectInfo.distance < 0) {
  12610. continue;
  12611. }
  12612. if (fastCheck || !intersectInfo || currentIntersectInfo.distance < intersectInfo.distance) {
  12613. intersectInfo = currentIntersectInfo;
  12614. intersectInfo.faceId = index / 3;
  12615. if (fastCheck) {
  12616. break;
  12617. }
  12618. }
  12619. }
  12620. }
  12621. return intersectInfo;
  12622. };
  12623. // Clone
  12624. SubMesh.prototype.clone = function (newMesh, newRenderingMesh) {
  12625. var result = new SubMesh(this.materialIndex, this.verticesStart, this.verticesCount, this.indexStart, this.indexCount, newMesh, newRenderingMesh, false);
  12626. result._boundingInfo = new BABYLON.BoundingInfo(this._boundingInfo.minimum, this._boundingInfo.maximum);
  12627. return result;
  12628. };
  12629. // Dispose
  12630. SubMesh.prototype.dispose = function () {
  12631. if (this._linesIndexBuffer) {
  12632. this._mesh.getScene().getEngine()._releaseBuffer(this._linesIndexBuffer);
  12633. this._linesIndexBuffer = null;
  12634. }
  12635. // Remove from mesh
  12636. var index = this._mesh.subMeshes.indexOf(this);
  12637. this._mesh.subMeshes.splice(index, 1);
  12638. };
  12639. // Statics
  12640. SubMesh.CreateFromIndices = function (materialIndex, startIndex, indexCount, mesh, renderingMesh) {
  12641. var minVertexIndex = Number.MAX_VALUE;
  12642. var maxVertexIndex = -Number.MAX_VALUE;
  12643. renderingMesh = renderingMesh || mesh;
  12644. var indices = renderingMesh.getIndices();
  12645. for (var index = startIndex; index < startIndex + indexCount; index++) {
  12646. var vertexIndex = indices[index];
  12647. if (vertexIndex < minVertexIndex)
  12648. minVertexIndex = vertexIndex;
  12649. if (vertexIndex > maxVertexIndex)
  12650. maxVertexIndex = vertexIndex;
  12651. }
  12652. return new BABYLON.SubMesh(materialIndex, minVertexIndex, maxVertexIndex - minVertexIndex + 1, startIndex, indexCount, mesh, renderingMesh);
  12653. };
  12654. return SubMesh;
  12655. })();
  12656. BABYLON.SubMesh = SubMesh;
  12657. })(BABYLON || (BABYLON = {}));
  12658. //# sourceMappingURL=babylon.subMesh.js.mapvar BABYLON;
  12659. (function (BABYLON) {
  12660. var BaseTexture = (function () {
  12661. function BaseTexture(scene) {
  12662. this.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_NONE;
  12663. this.hasAlpha = false;
  12664. this.getAlphaFromRGB = false;
  12665. this.level = 1;
  12666. this.isCube = false;
  12667. this.isRenderTarget = false;
  12668. this.animations = new Array();
  12669. this.coordinatesIndex = 0;
  12670. this.coordinatesMode = BABYLON.Texture.EXPLICIT_MODE;
  12671. this.wrapU = BABYLON.Texture.WRAP_ADDRESSMODE;
  12672. this.wrapV = BABYLON.Texture.WRAP_ADDRESSMODE;
  12673. this.anisotropicFilteringLevel = 4;
  12674. this._scene = scene;
  12675. this._scene.textures.push(this);
  12676. }
  12677. BaseTexture.prototype.getScene = function () {
  12678. return this._scene;
  12679. };
  12680. BaseTexture.prototype.getTextureMatrix = function () {
  12681. return null;
  12682. };
  12683. BaseTexture.prototype.getReflectionTextureMatrix = function () {
  12684. return null;
  12685. };
  12686. BaseTexture.prototype.getInternalTexture = function () {
  12687. return this._texture;
  12688. };
  12689. BaseTexture.prototype.isReady = function () {
  12690. if (this.delayLoadState === BABYLON.Engine.DELAYLOADSTATE_NOTLOADED) {
  12691. return true;
  12692. }
  12693. if (this._texture) {
  12694. return this._texture.isReady;
  12695. }
  12696. return false;
  12697. };
  12698. BaseTexture.prototype.getSize = function () {
  12699. if (this._texture._width) {
  12700. return { width: this._texture._width, height: this._texture._height };
  12701. }
  12702. if (this._texture._size) {
  12703. return { width: this._texture._size, height: this._texture._size };
  12704. }
  12705. return { width: 0, height: 0 };
  12706. };
  12707. BaseTexture.prototype.getBaseSize = function () {
  12708. if (!this.isReady())
  12709. return { width: 0, height: 0 };
  12710. if (this._texture._size) {
  12711. return { width: this._texture._size, height: this._texture._size };
  12712. }
  12713. return { width: this._texture._baseWidth, height: this._texture._baseHeight };
  12714. };
  12715. BaseTexture.prototype.scale = function (ratio) {
  12716. };
  12717. Object.defineProperty(BaseTexture.prototype, "canRescale", {
  12718. get: function () {
  12719. return false;
  12720. },
  12721. enumerable: true,
  12722. configurable: true
  12723. });
  12724. BaseTexture.prototype._removeFromCache = function (url, noMipmap) {
  12725. var texturesCache = this._scene.getEngine().getLoadedTexturesCache();
  12726. for (var index = 0; index < texturesCache.length; index++) {
  12727. var texturesCacheEntry = texturesCache[index];
  12728. if (texturesCacheEntry.url === url && texturesCacheEntry.noMipmap === noMipmap) {
  12729. texturesCache.splice(index, 1);
  12730. return;
  12731. }
  12732. }
  12733. };
  12734. BaseTexture.prototype._getFromCache = function (url, noMipmap, sampling) {
  12735. var texturesCache = this._scene.getEngine().getLoadedTexturesCache();
  12736. for (var index = 0; index < texturesCache.length; index++) {
  12737. var texturesCacheEntry = texturesCache[index];
  12738. if (texturesCacheEntry.url === url && texturesCacheEntry.noMipmap === noMipmap) {
  12739. if (!sampling || sampling === texturesCacheEntry.samplingMode) {
  12740. texturesCacheEntry.references++;
  12741. return texturesCacheEntry;
  12742. }
  12743. }
  12744. }
  12745. return null;
  12746. };
  12747. BaseTexture.prototype.delayLoad = function () {
  12748. };
  12749. BaseTexture.prototype.releaseInternalTexture = function () {
  12750. if (!this._texture) {
  12751. return;
  12752. }
  12753. var texturesCache = this._scene.getEngine().getLoadedTexturesCache();
  12754. this._texture.references--;
  12755. // Final reference ?
  12756. if (this._texture.references === 0) {
  12757. var index = texturesCache.indexOf(this._texture);
  12758. texturesCache.splice(index, 1);
  12759. this._scene.getEngine()._releaseTexture(this._texture);
  12760. delete this._texture;
  12761. }
  12762. };
  12763. BaseTexture.prototype.clone = function () {
  12764. return null;
  12765. };
  12766. BaseTexture.prototype.dispose = function () {
  12767. // Remove from scene
  12768. var index = this._scene.textures.indexOf(this);
  12769. if (index >= 0) {
  12770. this._scene.textures.splice(index, 1);
  12771. }
  12772. if (this._texture === undefined) {
  12773. return;
  12774. }
  12775. this.releaseInternalTexture();
  12776. // Callback
  12777. if (this.onDispose) {
  12778. this.onDispose();
  12779. }
  12780. };
  12781. return BaseTexture;
  12782. })();
  12783. BABYLON.BaseTexture = BaseTexture;
  12784. })(BABYLON || (BABYLON = {}));
  12785. //# sourceMappingURL=babylon.baseTexture.js.mapvar BABYLON;
  12786. (function (BABYLON) {
  12787. var RenderingGroup = (function () {
  12788. function RenderingGroup(index, scene) {
  12789. this.index = index;
  12790. this._opaqueSubMeshes = new BABYLON.SmartArray(256);
  12791. this._transparentSubMeshes = new BABYLON.SmartArray(256);
  12792. this._alphaTestSubMeshes = new BABYLON.SmartArray(256);
  12793. this._scene = scene;
  12794. }
  12795. RenderingGroup.prototype.render = function (customRenderFunction) {
  12796. if (customRenderFunction) {
  12797. customRenderFunction(this._opaqueSubMeshes, this._alphaTestSubMeshes, this._transparentSubMeshes);
  12798. return true;
  12799. }
  12800. if (this._opaqueSubMeshes.length === 0 && this._alphaTestSubMeshes.length === 0 && this._transparentSubMeshes.length === 0) {
  12801. return false;
  12802. }
  12803. var engine = this._scene.getEngine();
  12804. // Opaque
  12805. var subIndex;
  12806. var submesh;
  12807. for (subIndex = 0; subIndex < this._opaqueSubMeshes.length; subIndex++) {
  12808. submesh = this._opaqueSubMeshes.data[subIndex];
  12809. submesh.render();
  12810. }
  12811. // Alpha test
  12812. engine.setAlphaTesting(true);
  12813. for (subIndex = 0; subIndex < this._alphaTestSubMeshes.length; subIndex++) {
  12814. submesh = this._alphaTestSubMeshes.data[subIndex];
  12815. submesh.render();
  12816. }
  12817. engine.setAlphaTesting(false);
  12818. // Transparent
  12819. if (this._transparentSubMeshes.length) {
  12820. for (subIndex = 0; subIndex < this._transparentSubMeshes.length; subIndex++) {
  12821. submesh = this._transparentSubMeshes.data[subIndex];
  12822. submesh._alphaIndex = submesh.getMesh().alphaIndex;
  12823. submesh._distanceToCamera = submesh.getBoundingInfo().boundingSphere.centerWorld.subtract(this._scene.activeCamera.position).length();
  12824. }
  12825. var sortedArray = this._transparentSubMeshes.data.slice(0, this._transparentSubMeshes.length);
  12826. sortedArray.sort(function (a, b) {
  12827. // Alpha index first
  12828. if (a._alphaIndex > b._alphaIndex) {
  12829. return 1;
  12830. }
  12831. if (a._alphaIndex < b._alphaIndex) {
  12832. return -1;
  12833. }
  12834. // Then distance to camera
  12835. if (a._distanceToCamera < b._distanceToCamera) {
  12836. return 1;
  12837. }
  12838. if (a._distanceToCamera > b._distanceToCamera) {
  12839. return -1;
  12840. }
  12841. return 0;
  12842. });
  12843. // Rendering
  12844. engine.setAlphaMode(BABYLON.Engine.ALPHA_COMBINE);
  12845. for (subIndex = 0; subIndex < sortedArray.length; subIndex++) {
  12846. submesh = sortedArray[subIndex];
  12847. submesh.render();
  12848. }
  12849. engine.setAlphaMode(BABYLON.Engine.ALPHA_DISABLE);
  12850. }
  12851. return true;
  12852. };
  12853. RenderingGroup.prototype.prepare = function () {
  12854. this._opaqueSubMeshes.reset();
  12855. this._transparentSubMeshes.reset();
  12856. this._alphaTestSubMeshes.reset();
  12857. };
  12858. RenderingGroup.prototype.dispatch = function (subMesh) {
  12859. var material = subMesh.getMaterial();
  12860. var mesh = subMesh.getMesh();
  12861. if (material.needAlphaBlending() || mesh.visibility < 1.0 || mesh.hasVertexAlpha) {
  12862. this._transparentSubMeshes.push(subMesh);
  12863. }
  12864. else if (material.needAlphaTesting()) {
  12865. this._alphaTestSubMeshes.push(subMesh);
  12866. }
  12867. else {
  12868. this._opaqueSubMeshes.push(subMesh); // Opaque
  12869. }
  12870. };
  12871. return RenderingGroup;
  12872. })();
  12873. BABYLON.RenderingGroup = RenderingGroup;
  12874. })(BABYLON || (BABYLON = {}));
  12875. //# sourceMappingURL=babylon.renderingGroup.js.mapvar BABYLON;
  12876. (function (BABYLON) {
  12877. var RenderingManager = (function () {
  12878. function RenderingManager(scene) {
  12879. this._renderingGroups = new Array();
  12880. this._scene = scene;
  12881. }
  12882. RenderingManager.prototype._renderParticles = function (index, activeMeshes) {
  12883. if (this._scene._activeParticleSystems.length === 0) {
  12884. return;
  12885. }
  12886. // Particles
  12887. var beforeParticlesDate = BABYLON.Tools.Now;
  12888. for (var particleIndex = 0; particleIndex < this._scene._activeParticleSystems.length; particleIndex++) {
  12889. var particleSystem = this._scene._activeParticleSystems.data[particleIndex];
  12890. if (particleSystem.renderingGroupId !== index) {
  12891. continue;
  12892. }
  12893. this._clearDepthBuffer();
  12894. if (!particleSystem.emitter.position || !activeMeshes || activeMeshes.indexOf(particleSystem.emitter) !== -1) {
  12895. this._scene._activeParticles += particleSystem.render();
  12896. }
  12897. }
  12898. this._scene._particlesDuration += BABYLON.Tools.Now - beforeParticlesDate;
  12899. };
  12900. RenderingManager.prototype._renderSprites = function (index) {
  12901. if (!this._scene.spritesEnabled || this._scene.spriteManagers.length === 0) {
  12902. return;
  12903. }
  12904. // Sprites
  12905. var beforeSpritessDate = BABYLON.Tools.Now;
  12906. for (var id = 0; id < this._scene.spriteManagers.length; id++) {
  12907. var spriteManager = this._scene.spriteManagers[id];
  12908. if (spriteManager.renderingGroupId === index) {
  12909. this._clearDepthBuffer();
  12910. spriteManager.render();
  12911. }
  12912. }
  12913. this._scene._spritesDuration += BABYLON.Tools.Now - beforeSpritessDate;
  12914. };
  12915. RenderingManager.prototype._clearDepthBuffer = function () {
  12916. if (this._depthBufferAlreadyCleaned) {
  12917. return;
  12918. }
  12919. this._scene.getEngine().clear(0, false, true);
  12920. this._depthBufferAlreadyCleaned = true;
  12921. };
  12922. RenderingManager.prototype.render = function (customRenderFunction, activeMeshes, renderParticles, renderSprites) {
  12923. for (var index = 0; index < RenderingManager.MAX_RENDERINGGROUPS; index++) {
  12924. this._depthBufferAlreadyCleaned = false;
  12925. var renderingGroup = this._renderingGroups[index];
  12926. var needToStepBack = false;
  12927. if (renderingGroup) {
  12928. this._clearDepthBuffer();
  12929. if (!renderingGroup.render(customRenderFunction)) {
  12930. this._renderingGroups.splice(index, 1);
  12931. needToStepBack = true;
  12932. }
  12933. }
  12934. if (renderSprites) {
  12935. this._renderSprites(index);
  12936. }
  12937. if (renderParticles) {
  12938. this._renderParticles(index, activeMeshes);
  12939. }
  12940. if (needToStepBack) {
  12941. index--;
  12942. }
  12943. }
  12944. };
  12945. RenderingManager.prototype.reset = function () {
  12946. for (var index in this._renderingGroups) {
  12947. var renderingGroup = this._renderingGroups[index];
  12948. renderingGroup.prepare();
  12949. }
  12950. };
  12951. RenderingManager.prototype.dispatch = function (subMesh) {
  12952. var mesh = subMesh.getMesh();
  12953. var renderingGroupId = mesh.renderingGroupId || 0;
  12954. if (!this._renderingGroups[renderingGroupId]) {
  12955. this._renderingGroups[renderingGroupId] = new BABYLON.RenderingGroup(renderingGroupId, this._scene);
  12956. }
  12957. this._renderingGroups[renderingGroupId].dispatch(subMesh);
  12958. };
  12959. RenderingManager.MAX_RENDERINGGROUPS = 4;
  12960. return RenderingManager;
  12961. })();
  12962. BABYLON.RenderingManager = RenderingManager;
  12963. })(BABYLON || (BABYLON = {}));
  12964. //# sourceMappingURL=babylon.renderingManager.js.map
  12965. var BABYLON;
  12966. (function (BABYLON) {
  12967. var Texture = (function (_super) {
  12968. __extends(Texture, _super);
  12969. function Texture(url, scene, noMipmap, invertY, samplingMode, onLoad, onError, buffer, deleteBuffer) {
  12970. if (samplingMode === void 0) { samplingMode = Texture.TRILINEAR_SAMPLINGMODE; }
  12971. if (onLoad === void 0) { onLoad = null; }
  12972. if (onError === void 0) { onError = null; }
  12973. if (buffer === void 0) { buffer = null; }
  12974. if (deleteBuffer === void 0) { deleteBuffer = false; }
  12975. _super.call(this, scene);
  12976. this.uOffset = 0;
  12977. this.vOffset = 0;
  12978. this.uScale = 1.0;
  12979. this.vScale = 1.0;
  12980. this.uAng = 0;
  12981. this.vAng = 0;
  12982. this.wAng = 0;
  12983. this.name = url;
  12984. this.url = url;
  12985. this._noMipmap = noMipmap;
  12986. this._invertY = invertY;
  12987. this._samplingMode = samplingMode;
  12988. this._buffer = buffer;
  12989. this._deleteBuffer = deleteBuffer;
  12990. if (!url) {
  12991. return;
  12992. }
  12993. this._texture = this._getFromCache(url, noMipmap, samplingMode);
  12994. if (!this._texture) {
  12995. if (!scene.useDelayedTextureLoading) {
  12996. this._texture = scene.getEngine().createTexture(url, noMipmap, invertY, scene, this._samplingMode, onLoad, onError, this._buffer);
  12997. if (deleteBuffer) {
  12998. delete this._buffer;
  12999. }
  13000. }
  13001. else {
  13002. this.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_NOTLOADED;
  13003. }
  13004. }
  13005. }
  13006. Texture.prototype.delayLoad = function () {
  13007. if (this.delayLoadState !== BABYLON.Engine.DELAYLOADSTATE_NOTLOADED) {
  13008. return;
  13009. }
  13010. this.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_LOADED;
  13011. this._texture = this._getFromCache(this.url, this._noMipmap, this._samplingMode);
  13012. if (!this._texture) {
  13013. this._texture = this.getScene().getEngine().createTexture(this.url, this._noMipmap, this._invertY, this.getScene(), this._samplingMode, null, null, this._buffer);
  13014. if (this._deleteBuffer) {
  13015. delete this._buffer;
  13016. }
  13017. }
  13018. };
  13019. Texture.prototype.updateSamplingMode = function (samplingMode) {
  13020. if (!this._texture) {
  13021. return;
  13022. }
  13023. this.getScene().getEngine().updateTextureSamplingMode(samplingMode, this._texture);
  13024. };
  13025. Texture.prototype._prepareRowForTextureGeneration = function (x, y, z, t) {
  13026. x -= this.uOffset + 0.5;
  13027. y -= this.vOffset + 0.5;
  13028. z -= 0.5;
  13029. BABYLON.Vector3.TransformCoordinatesFromFloatsToRef(x, y, z, this._rowGenerationMatrix, t);
  13030. t.x *= this.uScale;
  13031. t.y *= this.vScale;
  13032. t.x += 0.5;
  13033. t.y += 0.5;
  13034. t.z += 0.5;
  13035. };
  13036. Texture.prototype.getTextureMatrix = function () {
  13037. if (this.uOffset === this._cachedUOffset && this.vOffset === this._cachedVOffset && this.uScale === this._cachedUScale && this.vScale === this._cachedVScale && this.uAng === this._cachedUAng && this.vAng === this._cachedVAng && this.wAng === this._cachedWAng) {
  13038. return this._cachedTextureMatrix;
  13039. }
  13040. this._cachedUOffset = this.uOffset;
  13041. this._cachedVOffset = this.vOffset;
  13042. this._cachedUScale = this.uScale;
  13043. this._cachedVScale = this.vScale;
  13044. this._cachedUAng = this.uAng;
  13045. this._cachedVAng = this.vAng;
  13046. this._cachedWAng = this.wAng;
  13047. if (!this._cachedTextureMatrix) {
  13048. this._cachedTextureMatrix = BABYLON.Matrix.Zero();
  13049. this._rowGenerationMatrix = new BABYLON.Matrix();
  13050. this._t0 = BABYLON.Vector3.Zero();
  13051. this._t1 = BABYLON.Vector3.Zero();
  13052. this._t2 = BABYLON.Vector3.Zero();
  13053. }
  13054. BABYLON.Matrix.RotationYawPitchRollToRef(this.vAng, this.uAng, this.wAng, this._rowGenerationMatrix);
  13055. this._prepareRowForTextureGeneration(0, 0, 0, this._t0);
  13056. this._prepareRowForTextureGeneration(1.0, 0, 0, this._t1);
  13057. this._prepareRowForTextureGeneration(0, 1.0, 0, this._t2);
  13058. this._t1.subtractInPlace(this._t0);
  13059. this._t2.subtractInPlace(this._t0);
  13060. BABYLON.Matrix.IdentityToRef(this._cachedTextureMatrix);
  13061. this._cachedTextureMatrix.m[0] = this._t1.x;
  13062. this._cachedTextureMatrix.m[1] = this._t1.y;
  13063. this._cachedTextureMatrix.m[2] = this._t1.z;
  13064. this._cachedTextureMatrix.m[4] = this._t2.x;
  13065. this._cachedTextureMatrix.m[5] = this._t2.y;
  13066. this._cachedTextureMatrix.m[6] = this._t2.z;
  13067. this._cachedTextureMatrix.m[8] = this._t0.x;
  13068. this._cachedTextureMatrix.m[9] = this._t0.y;
  13069. this._cachedTextureMatrix.m[10] = this._t0.z;
  13070. return this._cachedTextureMatrix;
  13071. };
  13072. Texture.prototype.getReflectionTextureMatrix = function () {
  13073. if (this.uOffset === this._cachedUOffset && this.vOffset === this._cachedVOffset && this.uScale === this._cachedUScale && this.vScale === this._cachedVScale && this.coordinatesMode === this._cachedCoordinatesMode) {
  13074. return this._cachedTextureMatrix;
  13075. }
  13076. if (!this._cachedTextureMatrix) {
  13077. this._cachedTextureMatrix = BABYLON.Matrix.Zero();
  13078. this._projectionModeMatrix = BABYLON.Matrix.Zero();
  13079. }
  13080. this._cachedCoordinatesMode = this.coordinatesMode;
  13081. switch (this.coordinatesMode) {
  13082. case Texture.SPHERICAL_MODE:
  13083. BABYLON.Matrix.IdentityToRef(this._cachedTextureMatrix);
  13084. this._cachedTextureMatrix[0] = -0.5 * this.uScale;
  13085. this._cachedTextureMatrix[5] = -0.5 * this.vScale;
  13086. this._cachedTextureMatrix[12] = 0.5 + this.uOffset;
  13087. this._cachedTextureMatrix[13] = 0.5 + this.vOffset;
  13088. break;
  13089. case Texture.PLANAR_MODE:
  13090. BABYLON.Matrix.IdentityToRef(this._cachedTextureMatrix);
  13091. this._cachedTextureMatrix[0] = this.uScale;
  13092. this._cachedTextureMatrix[5] = this.vScale;
  13093. this._cachedTextureMatrix[12] = this.uOffset;
  13094. this._cachedTextureMatrix[13] = this.vOffset;
  13095. break;
  13096. case Texture.PROJECTION_MODE:
  13097. BABYLON.Matrix.IdentityToRef(this._projectionModeMatrix);
  13098. this._projectionModeMatrix.m[0] = 0.5;
  13099. this._projectionModeMatrix.m[5] = -0.5;
  13100. this._projectionModeMatrix.m[10] = 0.0;
  13101. this._projectionModeMatrix.m[12] = 0.5;
  13102. this._projectionModeMatrix.m[13] = 0.5;
  13103. this._projectionModeMatrix.m[14] = 1.0;
  13104. this._projectionModeMatrix.m[15] = 1.0;
  13105. this.getScene().getProjectionMatrix().multiplyToRef(this._projectionModeMatrix, this._cachedTextureMatrix);
  13106. break;
  13107. default:
  13108. BABYLON.Matrix.IdentityToRef(this._cachedTextureMatrix);
  13109. break;
  13110. }
  13111. return this._cachedTextureMatrix;
  13112. };
  13113. Texture.prototype.clone = function () {
  13114. var newTexture = new Texture(this._texture.url, this.getScene(), this._noMipmap, this._invertY, this._samplingMode);
  13115. // Base texture
  13116. newTexture.hasAlpha = this.hasAlpha;
  13117. newTexture.level = this.level;
  13118. newTexture.wrapU = this.wrapU;
  13119. newTexture.wrapV = this.wrapV;
  13120. newTexture.coordinatesIndex = this.coordinatesIndex;
  13121. newTexture.coordinatesMode = this.coordinatesMode;
  13122. // Texture
  13123. newTexture.uOffset = this.uOffset;
  13124. newTexture.vOffset = this.vOffset;
  13125. newTexture.uScale = this.uScale;
  13126. newTexture.vScale = this.vScale;
  13127. newTexture.uAng = this.uAng;
  13128. newTexture.vAng = this.vAng;
  13129. newTexture.wAng = this.wAng;
  13130. return newTexture;
  13131. };
  13132. // Statics
  13133. Texture.CreateFromBase64String = function (data, name, scene, noMipmap, invertY, samplingMode, onLoad, onError) {
  13134. if (samplingMode === void 0) { samplingMode = Texture.TRILINEAR_SAMPLINGMODE; }
  13135. if (onLoad === void 0) { onLoad = null; }
  13136. if (onError === void 0) { onError = null; }
  13137. return new Texture("data:" + name, scene, noMipmap, invertY, samplingMode, onLoad, onError, data);
  13138. };
  13139. // Constants
  13140. Texture.NEAREST_SAMPLINGMODE = 1;
  13141. Texture.BILINEAR_SAMPLINGMODE = 2;
  13142. Texture.TRILINEAR_SAMPLINGMODE = 3;
  13143. Texture.EXPLICIT_MODE = 0;
  13144. Texture.SPHERICAL_MODE = 1;
  13145. Texture.PLANAR_MODE = 2;
  13146. Texture.CUBIC_MODE = 3;
  13147. Texture.PROJECTION_MODE = 4;
  13148. Texture.SKYBOX_MODE = 5;
  13149. Texture.CLAMP_ADDRESSMODE = 0;
  13150. Texture.WRAP_ADDRESSMODE = 1;
  13151. Texture.MIRROR_ADDRESSMODE = 2;
  13152. return Texture;
  13153. })(BABYLON.BaseTexture);
  13154. BABYLON.Texture = Texture;
  13155. })(BABYLON || (BABYLON = {}));
  13156. //# sourceMappingURL=babylon.texture.js.map
  13157. var BABYLON;
  13158. (function (BABYLON) {
  13159. var CubeTexture = (function (_super) {
  13160. __extends(CubeTexture, _super);
  13161. function CubeTexture(rootUrl, scene, extensions, noMipmap) {
  13162. _super.call(this, scene);
  13163. this.coordinatesMode = BABYLON.Texture.CUBIC_MODE;
  13164. this.name = rootUrl;
  13165. this.url = rootUrl;
  13166. this._noMipmap = noMipmap;
  13167. this.hasAlpha = false;
  13168. this._texture = this._getFromCache(rootUrl, noMipmap);
  13169. if (!extensions) {
  13170. extensions = ["_px.jpg", "_py.jpg", "_pz.jpg", "_nx.jpg", "_ny.jpg", "_nz.jpg"];
  13171. }
  13172. this._extensions = extensions;
  13173. if (!this._texture) {
  13174. if (!scene.useDelayedTextureLoading) {
  13175. this._texture = scene.getEngine().createCubeTexture(rootUrl, scene, extensions, noMipmap);
  13176. }
  13177. else {
  13178. this.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_NOTLOADED;
  13179. }
  13180. }
  13181. this.isCube = true;
  13182. this._textureMatrix = BABYLON.Matrix.Identity();
  13183. }
  13184. CubeTexture.prototype.clone = function () {
  13185. var newTexture = new CubeTexture(this.url, this.getScene(), this._extensions, this._noMipmap);
  13186. // Base texture
  13187. newTexture.level = this.level;
  13188. newTexture.wrapU = this.wrapU;
  13189. newTexture.wrapV = this.wrapV;
  13190. newTexture.coordinatesIndex = this.coordinatesIndex;
  13191. newTexture.coordinatesMode = this.coordinatesMode;
  13192. return newTexture;
  13193. };
  13194. // Methods
  13195. CubeTexture.prototype.delayLoad = function () {
  13196. if (this.delayLoadState !== BABYLON.Engine.DELAYLOADSTATE_NOTLOADED) {
  13197. return;
  13198. }
  13199. this.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_LOADED;
  13200. this._texture = this._getFromCache(this.url, this._noMipmap);
  13201. if (!this._texture) {
  13202. this._texture = this.getScene().getEngine().createCubeTexture(this.url, this.getScene(), this._extensions);
  13203. }
  13204. };
  13205. CubeTexture.prototype.getReflectionTextureMatrix = function () {
  13206. return this._textureMatrix;
  13207. };
  13208. return CubeTexture;
  13209. })(BABYLON.BaseTexture);
  13210. BABYLON.CubeTexture = CubeTexture;
  13211. })(BABYLON || (BABYLON = {}));
  13212. //# sourceMappingURL=babylon.cubeTexture.js.map
  13213. var BABYLON;
  13214. (function (BABYLON) {
  13215. var RenderTargetTexture = (function (_super) {
  13216. __extends(RenderTargetTexture, _super);
  13217. function RenderTargetTexture(name, size, scene, generateMipMaps, doNotChangeAspectRatio, type) {
  13218. if (doNotChangeAspectRatio === void 0) { doNotChangeAspectRatio = true; }
  13219. if (type === void 0) { type = BABYLON.Engine.TEXTURETYPE_UNSIGNED_INT; }
  13220. _super.call(this, null, scene, !generateMipMaps);
  13221. this.renderList = new Array();
  13222. this.renderParticles = true;
  13223. this.renderSprites = false;
  13224. this.coordinatesMode = BABYLON.Texture.PROJECTION_MODE;
  13225. this._currentRefreshId = -1;
  13226. this._refreshRate = 1;
  13227. this.name = name;
  13228. this.isRenderTarget = true;
  13229. this._size = size;
  13230. this._generateMipMaps = generateMipMaps;
  13231. this._doNotChangeAspectRatio = doNotChangeAspectRatio;
  13232. this._texture = scene.getEngine().createRenderTargetTexture(size, { generateMipMaps: generateMipMaps, type: type });
  13233. // Rendering groups
  13234. this._renderingManager = new BABYLON.RenderingManager(scene);
  13235. }
  13236. RenderTargetTexture.prototype.resetRefreshCounter = function () {
  13237. this._currentRefreshId = -1;
  13238. };
  13239. Object.defineProperty(RenderTargetTexture.prototype, "refreshRate", {
  13240. get: function () {
  13241. return this._refreshRate;
  13242. },
  13243. // Use 0 to render just once, 1 to render on every frame, 2 to render every two frames and so on...
  13244. set: function (value) {
  13245. this._refreshRate = value;
  13246. this.resetRefreshCounter();
  13247. },
  13248. enumerable: true,
  13249. configurable: true
  13250. });
  13251. RenderTargetTexture.prototype._shouldRender = function () {
  13252. if (this._currentRefreshId === -1) {
  13253. this._currentRefreshId = 1;
  13254. return true;
  13255. }
  13256. if (this.refreshRate === this._currentRefreshId) {
  13257. this._currentRefreshId = 1;
  13258. return true;
  13259. }
  13260. this._currentRefreshId++;
  13261. return false;
  13262. };
  13263. RenderTargetTexture.prototype.isReady = function () {
  13264. if (!this.getScene().renderTargetsEnabled) {
  13265. return false;
  13266. }
  13267. return _super.prototype.isReady.call(this);
  13268. };
  13269. RenderTargetTexture.prototype.getRenderSize = function () {
  13270. return this._size;
  13271. };
  13272. Object.defineProperty(RenderTargetTexture.prototype, "canRescale", {
  13273. get: function () {
  13274. return true;
  13275. },
  13276. enumerable: true,
  13277. configurable: true
  13278. });
  13279. RenderTargetTexture.prototype.scale = function (ratio) {
  13280. var newSize = this._size * ratio;
  13281. this.resize(newSize, this._generateMipMaps);
  13282. };
  13283. RenderTargetTexture.prototype.resize = function (size, generateMipMaps) {
  13284. this.releaseInternalTexture();
  13285. this._texture = this.getScene().getEngine().createRenderTargetTexture(size, generateMipMaps);
  13286. };
  13287. RenderTargetTexture.prototype.render = function (useCameraPostProcess, dumpForDebug) {
  13288. var scene = this.getScene();
  13289. var engine = scene.getEngine();
  13290. if (this._waitingRenderList) {
  13291. this.renderList = [];
  13292. for (var index = 0; index < this._waitingRenderList.length; index++) {
  13293. var id = this._waitingRenderList[index];
  13294. this.renderList.push(scene.getMeshByID(id));
  13295. }
  13296. delete this._waitingRenderList;
  13297. }
  13298. if (this.renderList && this.renderList.length === 0) {
  13299. return;
  13300. }
  13301. // Bind
  13302. if (!useCameraPostProcess || !scene.postProcessManager._prepareFrame(this._texture)) {
  13303. engine.bindFramebuffer(this._texture);
  13304. }
  13305. this._renderingManager.reset();
  13306. var currentRenderList = this.renderList ? this.renderList : scene.getActiveMeshes().data;
  13307. for (var meshIndex = 0; meshIndex < currentRenderList.length; meshIndex++) {
  13308. var mesh = currentRenderList[meshIndex];
  13309. if (mesh) {
  13310. if (!mesh.isReady()) {
  13311. // Reset _currentRefreshId
  13312. this.resetRefreshCounter();
  13313. continue;
  13314. }
  13315. if (mesh.isEnabled() && mesh.isVisible && mesh.subMeshes && ((mesh.layerMask & scene.activeCamera.layerMask) !== 0)) {
  13316. mesh._activate(scene.getRenderId());
  13317. for (var subIndex = 0; subIndex < mesh.subMeshes.length; subIndex++) {
  13318. var subMesh = mesh.subMeshes[subIndex];
  13319. scene._activeIndices += subMesh.indexCount;
  13320. this._renderingManager.dispatch(subMesh);
  13321. }
  13322. }
  13323. }
  13324. }
  13325. if (this.onBeforeRender) {
  13326. this.onBeforeRender();
  13327. }
  13328. // Clear
  13329. if (this.onClear) {
  13330. this.onClear(engine);
  13331. }
  13332. else {
  13333. engine.clear(scene.clearColor, true, true);
  13334. }
  13335. if (!this._doNotChangeAspectRatio) {
  13336. scene.updateTransformMatrix(true);
  13337. }
  13338. // Render
  13339. this._renderingManager.render(this.customRenderFunction, currentRenderList, this.renderParticles, this.renderSprites);
  13340. if (useCameraPostProcess) {
  13341. scene.postProcessManager._finalizeFrame(false, this._texture);
  13342. }
  13343. if (!this._doNotChangeAspectRatio) {
  13344. scene.updateTransformMatrix(true);
  13345. }
  13346. if (this.onAfterRender) {
  13347. this.onAfterRender();
  13348. }
  13349. // Dump ?
  13350. if (dumpForDebug) {
  13351. BABYLON.Tools.DumpFramebuffer(this._size, this._size, engine);
  13352. }
  13353. // Unbind
  13354. engine.unBindFramebuffer(this._texture);
  13355. if (this.onAfterUnbind) {
  13356. this.onAfterUnbind();
  13357. }
  13358. };
  13359. RenderTargetTexture.prototype.clone = function () {
  13360. var textureSize = this.getSize();
  13361. var newTexture = new RenderTargetTexture(this.name, textureSize.width, this.getScene(), this._generateMipMaps);
  13362. // Base texture
  13363. newTexture.hasAlpha = this.hasAlpha;
  13364. newTexture.level = this.level;
  13365. // RenderTarget Texture
  13366. newTexture.coordinatesMode = this.coordinatesMode;
  13367. newTexture.renderList = this.renderList.slice(0);
  13368. return newTexture;
  13369. };
  13370. return RenderTargetTexture;
  13371. })(BABYLON.Texture);
  13372. BABYLON.RenderTargetTexture = RenderTargetTexture;
  13373. })(BABYLON || (BABYLON = {}));
  13374. //# sourceMappingURL=babylon.renderTargetTexture.js.map
  13375. var BABYLON;
  13376. (function (BABYLON) {
  13377. var ProceduralTexture = (function (_super) {
  13378. __extends(ProceduralTexture, _super);
  13379. function ProceduralTexture(name, size, fragment, scene, fallbackTexture, generateMipMaps) {
  13380. if (generateMipMaps === void 0) { generateMipMaps = true; }
  13381. _super.call(this, null, scene, !generateMipMaps);
  13382. this._currentRefreshId = -1;
  13383. this._refreshRate = 1;
  13384. this._vertexDeclaration = [2];
  13385. this._vertexStrideSize = 2 * 4;
  13386. this._uniforms = new Array();
  13387. this._samplers = new Array();
  13388. this._textures = new Array();
  13389. this._floats = new Array();
  13390. this._floatsArrays = {};
  13391. this._colors3 = new Array();
  13392. this._colors4 = new Array();
  13393. this._vectors2 = new Array();
  13394. this._vectors3 = new Array();
  13395. this._matrices = new Array();
  13396. this._fallbackTextureUsed = false;
  13397. scene._proceduralTextures.push(this);
  13398. this.name = name;
  13399. this.isRenderTarget = true;
  13400. this._size = size;
  13401. this._generateMipMaps = generateMipMaps;
  13402. this.setFragment(fragment);
  13403. this._fallbackTexture = fallbackTexture;
  13404. this._texture = scene.getEngine().createRenderTargetTexture(size, generateMipMaps);
  13405. // VBO
  13406. var vertices = [];
  13407. vertices.push(1, 1);
  13408. vertices.push(-1, 1);
  13409. vertices.push(-1, -1);
  13410. vertices.push(1, -1);
  13411. this._vertexBuffer = scene.getEngine().createVertexBuffer(vertices);
  13412. // Indices
  13413. var indices = [];
  13414. indices.push(0);
  13415. indices.push(1);
  13416. indices.push(2);
  13417. indices.push(0);
  13418. indices.push(2);
  13419. indices.push(3);
  13420. this._indexBuffer = scene.getEngine().createIndexBuffer(indices);
  13421. }
  13422. ProceduralTexture.prototype.reset = function () {
  13423. if (this._effect === undefined) {
  13424. return;
  13425. }
  13426. var engine = this.getScene().getEngine();
  13427. engine._releaseEffect(this._effect);
  13428. };
  13429. ProceduralTexture.prototype.isReady = function () {
  13430. var _this = this;
  13431. var engine = this.getScene().getEngine();
  13432. var shaders;
  13433. if (!this._fragment) {
  13434. return false;
  13435. }
  13436. if (this._fallbackTextureUsed) {
  13437. return true;
  13438. }
  13439. if (this._fragment.fragmentElement !== undefined) {
  13440. shaders = { vertex: "procedural", fragmentElement: this._fragment.fragmentElement };
  13441. }
  13442. else {
  13443. shaders = { vertex: "procedural", fragment: this._fragment };
  13444. }
  13445. this._effect = engine.createEffect(shaders, ["position"], this._uniforms, this._samplers, "", null, null, function () {
  13446. _this.releaseInternalTexture();
  13447. if (_this._fallbackTexture) {
  13448. _this._texture = _this._fallbackTexture._texture;
  13449. _this._texture.references++;
  13450. }
  13451. _this._fallbackTextureUsed = true;
  13452. });
  13453. return this._effect.isReady();
  13454. };
  13455. ProceduralTexture.prototype.resetRefreshCounter = function () {
  13456. this._currentRefreshId = -1;
  13457. };
  13458. ProceduralTexture.prototype.setFragment = function (fragment) {
  13459. this._fragment = fragment;
  13460. };
  13461. Object.defineProperty(ProceduralTexture.prototype, "refreshRate", {
  13462. get: function () {
  13463. return this._refreshRate;
  13464. },
  13465. // Use 0 to render just once, 1 to render on every frame, 2 to render every two frames and so on...
  13466. set: function (value) {
  13467. this._refreshRate = value;
  13468. this.resetRefreshCounter();
  13469. },
  13470. enumerable: true,
  13471. configurable: true
  13472. });
  13473. ProceduralTexture.prototype._shouldRender = function () {
  13474. if (!this.isReady() || !this._texture) {
  13475. return false;
  13476. }
  13477. if (this._fallbackTextureUsed) {
  13478. return false;
  13479. }
  13480. if (this._currentRefreshId === -1) {
  13481. this._currentRefreshId = 1;
  13482. return true;
  13483. }
  13484. if (this.refreshRate === this._currentRefreshId) {
  13485. this._currentRefreshId = 1;
  13486. return true;
  13487. }
  13488. this._currentRefreshId++;
  13489. return false;
  13490. };
  13491. ProceduralTexture.prototype.getRenderSize = function () {
  13492. return this._size;
  13493. };
  13494. ProceduralTexture.prototype.resize = function (size, generateMipMaps) {
  13495. if (this._fallbackTextureUsed) {
  13496. return;
  13497. }
  13498. this.releaseInternalTexture();
  13499. this._texture = this.getScene().getEngine().createRenderTargetTexture(size, generateMipMaps);
  13500. };
  13501. ProceduralTexture.prototype._checkUniform = function (uniformName) {
  13502. if (this._uniforms.indexOf(uniformName) === -1) {
  13503. this._uniforms.push(uniformName);
  13504. }
  13505. };
  13506. ProceduralTexture.prototype.setTexture = function (name, texture) {
  13507. if (this._samplers.indexOf(name) === -1) {
  13508. this._samplers.push(name);
  13509. }
  13510. this._textures[name] = texture;
  13511. return this;
  13512. };
  13513. ProceduralTexture.prototype.setFloat = function (name, value) {
  13514. this._checkUniform(name);
  13515. this._floats[name] = value;
  13516. return this;
  13517. };
  13518. ProceduralTexture.prototype.setFloats = function (name, value) {
  13519. this._checkUniform(name);
  13520. this._floatsArrays[name] = value;
  13521. return this;
  13522. };
  13523. ProceduralTexture.prototype.setColor3 = function (name, value) {
  13524. this._checkUniform(name);
  13525. this._colors3[name] = value;
  13526. return this;
  13527. };
  13528. ProceduralTexture.prototype.setColor4 = function (name, value) {
  13529. this._checkUniform(name);
  13530. this._colors4[name] = value;
  13531. return this;
  13532. };
  13533. ProceduralTexture.prototype.setVector2 = function (name, value) {
  13534. this._checkUniform(name);
  13535. this._vectors2[name] = value;
  13536. return this;
  13537. };
  13538. ProceduralTexture.prototype.setVector3 = function (name, value) {
  13539. this._checkUniform(name);
  13540. this._vectors3[name] = value;
  13541. return this;
  13542. };
  13543. ProceduralTexture.prototype.setMatrix = function (name, value) {
  13544. this._checkUniform(name);
  13545. this._matrices[name] = value;
  13546. return this;
  13547. };
  13548. ProceduralTexture.prototype.render = function (useCameraPostProcess) {
  13549. var scene = this.getScene();
  13550. var engine = scene.getEngine();
  13551. engine.bindFramebuffer(this._texture);
  13552. // Clear
  13553. engine.clear(scene.clearColor, true, true);
  13554. // Render
  13555. engine.enableEffect(this._effect);
  13556. engine.setState(false);
  13557. for (var name in this._textures) {
  13558. this._effect.setTexture(name, this._textures[name]);
  13559. }
  13560. for (name in this._floats) {
  13561. this._effect.setFloat(name, this._floats[name]);
  13562. }
  13563. for (name in this._floatsArrays) {
  13564. this._effect.setArray(name, this._floatsArrays[name]);
  13565. }
  13566. for (name in this._colors3) {
  13567. this._effect.setColor3(name, this._colors3[name]);
  13568. }
  13569. for (name in this._colors4) {
  13570. var color = this._colors4[name];
  13571. this._effect.setFloat4(name, color.r, color.g, color.b, color.a);
  13572. }
  13573. for (name in this._vectors2) {
  13574. this._effect.setVector2(name, this._vectors2[name]);
  13575. }
  13576. for (name in this._vectors3) {
  13577. this._effect.setVector3(name, this._vectors3[name]);
  13578. }
  13579. for (name in this._matrices) {
  13580. this._effect.setMatrix(name, this._matrices[name]);
  13581. }
  13582. // VBOs
  13583. engine.bindBuffers(this._vertexBuffer, this._indexBuffer, this._vertexDeclaration, this._vertexStrideSize, this._effect);
  13584. // Draw order
  13585. engine.draw(true, 0, 6);
  13586. // Unbind
  13587. engine.unBindFramebuffer(this._texture);
  13588. };
  13589. ProceduralTexture.prototype.clone = function () {
  13590. var textureSize = this.getSize();
  13591. var newTexture = new ProceduralTexture(this.name, textureSize.width, this._fragment, this.getScene(), this._fallbackTexture, this._generateMipMaps);
  13592. // Base texture
  13593. newTexture.hasAlpha = this.hasAlpha;
  13594. newTexture.level = this.level;
  13595. // RenderTarget Texture
  13596. newTexture.coordinatesMode = this.coordinatesMode;
  13597. return newTexture;
  13598. };
  13599. ProceduralTexture.prototype.dispose = function () {
  13600. var index = this.getScene()._proceduralTextures.indexOf(this);
  13601. if (index >= 0) {
  13602. this.getScene()._proceduralTextures.splice(index, 1);
  13603. }
  13604. _super.prototype.dispose.call(this);
  13605. };
  13606. return ProceduralTexture;
  13607. })(BABYLON.Texture);
  13608. BABYLON.ProceduralTexture = ProceduralTexture;
  13609. })(BABYLON || (BABYLON = {}));
  13610. //# sourceMappingURL=babylon.proceduralTexture.js.map
  13611. var BABYLON;
  13612. (function (BABYLON) {
  13613. var WoodProceduralTexture = (function (_super) {
  13614. __extends(WoodProceduralTexture, _super);
  13615. function WoodProceduralTexture(name, size, scene, fallbackTexture, generateMipMaps) {
  13616. _super.call(this, name, size, "wood", scene, fallbackTexture, generateMipMaps);
  13617. this._ampScale = 100.0;
  13618. this._woodColor = new BABYLON.Color3(0.32, 0.17, 0.09);
  13619. this.updateShaderUniforms();
  13620. this.refreshRate = 0;
  13621. }
  13622. WoodProceduralTexture.prototype.updateShaderUniforms = function () {
  13623. this.setFloat("ampScale", this._ampScale);
  13624. this.setColor3("woodColor", this._woodColor);
  13625. };
  13626. Object.defineProperty(WoodProceduralTexture.prototype, "ampScale", {
  13627. get: function () {
  13628. return this._ampScale;
  13629. },
  13630. set: function (value) {
  13631. this._ampScale = value;
  13632. this.updateShaderUniforms();
  13633. },
  13634. enumerable: true,
  13635. configurable: true
  13636. });
  13637. Object.defineProperty(WoodProceduralTexture.prototype, "woodColor", {
  13638. get: function () {
  13639. return this._woodColor;
  13640. },
  13641. set: function (value) {
  13642. this._woodColor = value;
  13643. this.updateShaderUniforms();
  13644. },
  13645. enumerable: true,
  13646. configurable: true
  13647. });
  13648. return WoodProceduralTexture;
  13649. })(BABYLON.ProceduralTexture);
  13650. BABYLON.WoodProceduralTexture = WoodProceduralTexture;
  13651. var FireProceduralTexture = (function (_super) {
  13652. __extends(FireProceduralTexture, _super);
  13653. function FireProceduralTexture(name, size, scene, fallbackTexture, generateMipMaps) {
  13654. _super.call(this, name, size, "fire", scene, fallbackTexture, generateMipMaps);
  13655. this._time = 0.0;
  13656. this._speed = new BABYLON.Vector2(0.5, 0.3);
  13657. this._autoGenerateTime = true;
  13658. this._alphaThreshold = 0.5;
  13659. this._fireColors = FireProceduralTexture.RedFireColors;
  13660. this.updateShaderUniforms();
  13661. this.refreshRate = 1;
  13662. }
  13663. FireProceduralTexture.prototype.updateShaderUniforms = function () {
  13664. this.setFloat("time", this._time);
  13665. this.setVector2("speed", this._speed);
  13666. this.setColor3("c1", this._fireColors[0]);
  13667. this.setColor3("c2", this._fireColors[1]);
  13668. this.setColor3("c3", this._fireColors[2]);
  13669. this.setColor3("c4", this._fireColors[3]);
  13670. this.setColor3("c5", this._fireColors[4]);
  13671. this.setColor3("c6", this._fireColors[5]);
  13672. this.setFloat("alphaThreshold", this._alphaThreshold);
  13673. };
  13674. FireProceduralTexture.prototype.render = function (useCameraPostProcess) {
  13675. if (this._autoGenerateTime) {
  13676. this._time += this.getScene().getAnimationRatio() * 0.03;
  13677. this.updateShaderUniforms();
  13678. }
  13679. _super.prototype.render.call(this, useCameraPostProcess);
  13680. };
  13681. Object.defineProperty(FireProceduralTexture, "PurpleFireColors", {
  13682. get: function () {
  13683. return [
  13684. new BABYLON.Color3(0.5, 0.0, 1.0),
  13685. new BABYLON.Color3(0.9, 0.0, 1.0),
  13686. new BABYLON.Color3(0.2, 0.0, 1.0),
  13687. new BABYLON.Color3(1.0, 0.9, 1.0),
  13688. new BABYLON.Color3(0.1, 0.1, 1.0),
  13689. new BABYLON.Color3(0.9, 0.9, 1.0)
  13690. ];
  13691. },
  13692. enumerable: true,
  13693. configurable: true
  13694. });
  13695. Object.defineProperty(FireProceduralTexture, "GreenFireColors", {
  13696. get: function () {
  13697. return [
  13698. new BABYLON.Color3(0.5, 1.0, 0.0),
  13699. new BABYLON.Color3(0.5, 1.0, 0.0),
  13700. new BABYLON.Color3(0.3, 0.4, 0.0),
  13701. new BABYLON.Color3(0.5, 1.0, 0.0),
  13702. new BABYLON.Color3(0.2, 0.0, 0.0),
  13703. new BABYLON.Color3(0.5, 1.0, 0.0)
  13704. ];
  13705. },
  13706. enumerable: true,
  13707. configurable: true
  13708. });
  13709. Object.defineProperty(FireProceduralTexture, "RedFireColors", {
  13710. get: function () {
  13711. return [
  13712. new BABYLON.Color3(0.5, 0.0, 0.1),
  13713. new BABYLON.Color3(0.9, 0.0, 0.0),
  13714. new BABYLON.Color3(0.2, 0.0, 0.0),
  13715. new BABYLON.Color3(1.0, 0.9, 0.0),
  13716. new BABYLON.Color3(0.1, 0.1, 0.1),
  13717. new BABYLON.Color3(0.9, 0.9, 0.9)
  13718. ];
  13719. },
  13720. enumerable: true,
  13721. configurable: true
  13722. });
  13723. Object.defineProperty(FireProceduralTexture, "BlueFireColors", {
  13724. get: function () {
  13725. return [
  13726. new BABYLON.Color3(0.1, 0.0, 0.5),
  13727. new BABYLON.Color3(0.0, 0.0, 0.5),
  13728. new BABYLON.Color3(0.1, 0.0, 0.2),
  13729. new BABYLON.Color3(0.0, 0.0, 1.0),
  13730. new BABYLON.Color3(0.1, 0.2, 0.3),
  13731. new BABYLON.Color3(0.0, 0.2, 0.9)
  13732. ];
  13733. },
  13734. enumerable: true,
  13735. configurable: true
  13736. });
  13737. Object.defineProperty(FireProceduralTexture.prototype, "fireColors", {
  13738. get: function () {
  13739. return this._fireColors;
  13740. },
  13741. set: function (value) {
  13742. this._fireColors = value;
  13743. this.updateShaderUniforms();
  13744. },
  13745. enumerable: true,
  13746. configurable: true
  13747. });
  13748. Object.defineProperty(FireProceduralTexture.prototype, "time", {
  13749. get: function () {
  13750. return this._time;
  13751. },
  13752. set: function (value) {
  13753. this._time = value;
  13754. this.updateShaderUniforms();
  13755. },
  13756. enumerable: true,
  13757. configurable: true
  13758. });
  13759. Object.defineProperty(FireProceduralTexture.prototype, "speed", {
  13760. get: function () {
  13761. return this._speed;
  13762. },
  13763. set: function (value) {
  13764. this._speed = value;
  13765. this.updateShaderUniforms();
  13766. },
  13767. enumerable: true,
  13768. configurable: true
  13769. });
  13770. Object.defineProperty(FireProceduralTexture.prototype, "alphaThreshold", {
  13771. get: function () {
  13772. return this._alphaThreshold;
  13773. },
  13774. set: function (value) {
  13775. this._alphaThreshold = value;
  13776. this.updateShaderUniforms();
  13777. },
  13778. enumerable: true,
  13779. configurable: true
  13780. });
  13781. return FireProceduralTexture;
  13782. })(BABYLON.ProceduralTexture);
  13783. BABYLON.FireProceduralTexture = FireProceduralTexture;
  13784. var CloudProceduralTexture = (function (_super) {
  13785. __extends(CloudProceduralTexture, _super);
  13786. function CloudProceduralTexture(name, size, scene, fallbackTexture, generateMipMaps) {
  13787. _super.call(this, name, size, "cloud", scene, fallbackTexture, generateMipMaps);
  13788. this._skyColor = new BABYLON.Color3(0.15, 0.68, 1.0);
  13789. this._cloudColor = new BABYLON.Color3(1, 1, 1);
  13790. this.updateShaderUniforms();
  13791. this.refreshRate = 0;
  13792. }
  13793. CloudProceduralTexture.prototype.updateShaderUniforms = function () {
  13794. this.setColor3("skyColor", this._skyColor);
  13795. this.setColor3("cloudColor", this._cloudColor);
  13796. };
  13797. Object.defineProperty(CloudProceduralTexture.prototype, "skyColor", {
  13798. get: function () {
  13799. return this._skyColor;
  13800. },
  13801. set: function (value) {
  13802. this._skyColor = value;
  13803. this.updateShaderUniforms();
  13804. },
  13805. enumerable: true,
  13806. configurable: true
  13807. });
  13808. Object.defineProperty(CloudProceduralTexture.prototype, "cloudColor", {
  13809. get: function () {
  13810. return this._cloudColor;
  13811. },
  13812. set: function (value) {
  13813. this._cloudColor = value;
  13814. this.updateShaderUniforms();
  13815. },
  13816. enumerable: true,
  13817. configurable: true
  13818. });
  13819. return CloudProceduralTexture;
  13820. })(BABYLON.ProceduralTexture);
  13821. BABYLON.CloudProceduralTexture = CloudProceduralTexture;
  13822. var GrassProceduralTexture = (function (_super) {
  13823. __extends(GrassProceduralTexture, _super);
  13824. function GrassProceduralTexture(name, size, scene, fallbackTexture, generateMipMaps) {
  13825. _super.call(this, name, size, "grass", scene, fallbackTexture, generateMipMaps);
  13826. this._herb1 = new BABYLON.Color3(0.29, 0.38, 0.02);
  13827. this._herb2 = new BABYLON.Color3(0.36, 0.49, 0.09);
  13828. this._herb3 = new BABYLON.Color3(0.51, 0.6, 0.28);
  13829. this._groundColor = new BABYLON.Color3(1, 1, 1);
  13830. this._grassColors = [
  13831. new BABYLON.Color3(0.29, 0.38, 0.02),
  13832. new BABYLON.Color3(0.36, 0.49, 0.09),
  13833. new BABYLON.Color3(0.51, 0.6, 0.28)
  13834. ];
  13835. this.updateShaderUniforms();
  13836. this.refreshRate = 0;
  13837. }
  13838. GrassProceduralTexture.prototype.updateShaderUniforms = function () {
  13839. this.setColor3("herb1Color", this._grassColors[0]);
  13840. this.setColor3("herb2Color", this._grassColors[1]);
  13841. this.setColor3("herb3Color", this._grassColors[2]);
  13842. this.setColor3("groundColor", this._groundColor);
  13843. };
  13844. Object.defineProperty(GrassProceduralTexture.prototype, "grassColors", {
  13845. get: function () {
  13846. return this._grassColors;
  13847. },
  13848. set: function (value) {
  13849. this._grassColors = value;
  13850. this.updateShaderUniforms();
  13851. },
  13852. enumerable: true,
  13853. configurable: true
  13854. });
  13855. Object.defineProperty(GrassProceduralTexture.prototype, "groundColor", {
  13856. get: function () {
  13857. return this._groundColor;
  13858. },
  13859. set: function (value) {
  13860. this.groundColor = value;
  13861. this.updateShaderUniforms();
  13862. },
  13863. enumerable: true,
  13864. configurable: true
  13865. });
  13866. return GrassProceduralTexture;
  13867. })(BABYLON.ProceduralTexture);
  13868. BABYLON.GrassProceduralTexture = GrassProceduralTexture;
  13869. var RoadProceduralTexture = (function (_super) {
  13870. __extends(RoadProceduralTexture, _super);
  13871. function RoadProceduralTexture(name, size, scene, fallbackTexture, generateMipMaps) {
  13872. _super.call(this, name, size, "road", scene, fallbackTexture, generateMipMaps);
  13873. this._roadColor = new BABYLON.Color3(0.53, 0.53, 0.53);
  13874. this.updateShaderUniforms();
  13875. this.refreshRate = 0;
  13876. }
  13877. RoadProceduralTexture.prototype.updateShaderUniforms = function () {
  13878. this.setColor3("roadColor", this._roadColor);
  13879. };
  13880. Object.defineProperty(RoadProceduralTexture.prototype, "roadColor", {
  13881. get: function () {
  13882. return this._roadColor;
  13883. },
  13884. set: function (value) {
  13885. this._roadColor = value;
  13886. this.updateShaderUniforms();
  13887. },
  13888. enumerable: true,
  13889. configurable: true
  13890. });
  13891. return RoadProceduralTexture;
  13892. })(BABYLON.ProceduralTexture);
  13893. BABYLON.RoadProceduralTexture = RoadProceduralTexture;
  13894. var BrickProceduralTexture = (function (_super) {
  13895. __extends(BrickProceduralTexture, _super);
  13896. function BrickProceduralTexture(name, size, scene, fallbackTexture, generateMipMaps) {
  13897. _super.call(this, name, size, "brick", scene, fallbackTexture, generateMipMaps);
  13898. this._numberOfBricksHeight = 15;
  13899. this._numberOfBricksWidth = 5;
  13900. this._jointColor = new BABYLON.Color3(0.72, 0.72, 0.72);
  13901. this._brickColor = new BABYLON.Color3(0.77, 0.47, 0.40);
  13902. this.updateShaderUniforms();
  13903. this.refreshRate = 0;
  13904. }
  13905. BrickProceduralTexture.prototype.updateShaderUniforms = function () {
  13906. this.setFloat("numberOfBricksHeight", this._numberOfBricksHeight);
  13907. this.setFloat("numberOfBricksWidth", this._numberOfBricksWidth);
  13908. this.setColor3("brickColor", this._brickColor);
  13909. this.setColor3("jointColor", this._jointColor);
  13910. };
  13911. Object.defineProperty(BrickProceduralTexture.prototype, "numberOfBricksHeight", {
  13912. get: function () {
  13913. return this._numberOfBricksHeight;
  13914. },
  13915. set: function (value) {
  13916. this._numberOfBricksHeight = value;
  13917. this.updateShaderUniforms();
  13918. },
  13919. enumerable: true,
  13920. configurable: true
  13921. });
  13922. Object.defineProperty(BrickProceduralTexture.prototype, "numberOfBricksWidth", {
  13923. get: function () {
  13924. return this._numberOfBricksWidth;
  13925. },
  13926. set: function (value) {
  13927. this._numberOfBricksHeight = value;
  13928. this.updateShaderUniforms();
  13929. },
  13930. enumerable: true,
  13931. configurable: true
  13932. });
  13933. Object.defineProperty(BrickProceduralTexture.prototype, "jointColor", {
  13934. get: function () {
  13935. return this._jointColor;
  13936. },
  13937. set: function (value) {
  13938. this._jointColor = value;
  13939. this.updateShaderUniforms();
  13940. },
  13941. enumerable: true,
  13942. configurable: true
  13943. });
  13944. Object.defineProperty(BrickProceduralTexture.prototype, "brickColor", {
  13945. get: function () {
  13946. return this._brickColor;
  13947. },
  13948. set: function (value) {
  13949. this._brickColor = value;
  13950. this.updateShaderUniforms();
  13951. },
  13952. enumerable: true,
  13953. configurable: true
  13954. });
  13955. return BrickProceduralTexture;
  13956. })(BABYLON.ProceduralTexture);
  13957. BABYLON.BrickProceduralTexture = BrickProceduralTexture;
  13958. var MarbleProceduralTexture = (function (_super) {
  13959. __extends(MarbleProceduralTexture, _super);
  13960. function MarbleProceduralTexture(name, size, scene, fallbackTexture, generateMipMaps) {
  13961. _super.call(this, name, size, "marble", scene, fallbackTexture, generateMipMaps);
  13962. this._numberOfTilesHeight = 3;
  13963. this._numberOfTilesWidth = 3;
  13964. this._amplitude = 9.0;
  13965. this._marbleColor = new BABYLON.Color3(0.77, 0.47, 0.40);
  13966. this._jointColor = new BABYLON.Color3(0.72, 0.72, 0.72);
  13967. this.updateShaderUniforms();
  13968. this.refreshRate = 0;
  13969. }
  13970. MarbleProceduralTexture.prototype.updateShaderUniforms = function () {
  13971. this.setFloat("numberOfTilesHeight", this._numberOfTilesHeight);
  13972. this.setFloat("numberOfTilesWidth", this._numberOfTilesWidth);
  13973. this.setFloat("amplitude", this._amplitude);
  13974. this.setColor3("marbleColor", this._marbleColor);
  13975. this.setColor3("jointColor", this._jointColor);
  13976. };
  13977. Object.defineProperty(MarbleProceduralTexture.prototype, "numberOfTilesHeight", {
  13978. get: function () {
  13979. return this._numberOfTilesHeight;
  13980. },
  13981. set: function (value) {
  13982. this._numberOfTilesHeight = value;
  13983. this.updateShaderUniforms();
  13984. },
  13985. enumerable: true,
  13986. configurable: true
  13987. });
  13988. Object.defineProperty(MarbleProceduralTexture.prototype, "numberOfTilesWidth", {
  13989. get: function () {
  13990. return this._numberOfTilesWidth;
  13991. },
  13992. set: function (value) {
  13993. this._numberOfTilesWidth = value;
  13994. this.updateShaderUniforms();
  13995. },
  13996. enumerable: true,
  13997. configurable: true
  13998. });
  13999. Object.defineProperty(MarbleProceduralTexture.prototype, "jointColor", {
  14000. get: function () {
  14001. return this._jointColor;
  14002. },
  14003. set: function (value) {
  14004. this._jointColor = value;
  14005. this.updateShaderUniforms();
  14006. },
  14007. enumerable: true,
  14008. configurable: true
  14009. });
  14010. Object.defineProperty(MarbleProceduralTexture.prototype, "marbleColor", {
  14011. get: function () {
  14012. return this._marbleColor;
  14013. },
  14014. set: function (value) {
  14015. this._marbleColor = value;
  14016. this.updateShaderUniforms();
  14017. },
  14018. enumerable: true,
  14019. configurable: true
  14020. });
  14021. return MarbleProceduralTexture;
  14022. })(BABYLON.ProceduralTexture);
  14023. BABYLON.MarbleProceduralTexture = MarbleProceduralTexture;
  14024. })(BABYLON || (BABYLON = {}));
  14025. //# sourceMappingURL=babylon.standardProceduralTexture.js.map
  14026. var BABYLON;
  14027. (function (BABYLON) {
  14028. var CustomProceduralTexture = (function (_super) {
  14029. __extends(CustomProceduralTexture, _super);
  14030. function CustomProceduralTexture(name, texturePath, size, scene, fallbackTexture, generateMipMaps) {
  14031. _super.call(this, name, size, null, scene, fallbackTexture, generateMipMaps);
  14032. this._animate = true;
  14033. this._time = 0;
  14034. this._texturePath = texturePath;
  14035. //Try to load json
  14036. this.loadJson(texturePath);
  14037. this.refreshRate = 1;
  14038. }
  14039. CustomProceduralTexture.prototype.loadJson = function (jsonUrl) {
  14040. var _this = this;
  14041. var that = this;
  14042. function noConfigFile() {
  14043. BABYLON.Tools.Log("No config file found in " + jsonUrl + " trying to use ShadersStore or DOM element");
  14044. try {
  14045. that.setFragment(that._texturePath);
  14046. }
  14047. catch (ex) {
  14048. BABYLON.Tools.Error("No json or ShaderStore or DOM element found for CustomProceduralTexture");
  14049. }
  14050. }
  14051. var configFileUrl = jsonUrl + "/config.json";
  14052. var xhr = new XMLHttpRequest();
  14053. xhr.open("GET", configFileUrl, true);
  14054. xhr.addEventListener("load", function () {
  14055. if (xhr.status === 200 || BABYLON.Tools.ValidateXHRData(xhr, 1)) {
  14056. try {
  14057. _this._config = JSON.parse(xhr.response);
  14058. _this.updateShaderUniforms();
  14059. _this.updateTextures();
  14060. _this.setFragment(_this._texturePath + "/custom");
  14061. _this._animate = _this._config.animate;
  14062. _this.refreshRate = _this._config.refreshrate;
  14063. }
  14064. catch (ex) {
  14065. noConfigFile();
  14066. }
  14067. }
  14068. else {
  14069. noConfigFile();
  14070. }
  14071. }, false);
  14072. xhr.addEventListener("error", function () {
  14073. noConfigFile();
  14074. }, false);
  14075. try {
  14076. xhr.send();
  14077. }
  14078. catch (ex) {
  14079. BABYLON.Tools.Error("CustomProceduralTexture: Error on XHR send request.");
  14080. }
  14081. };
  14082. CustomProceduralTexture.prototype.isReady = function () {
  14083. if (!_super.prototype.isReady.call(this)) {
  14084. return false;
  14085. }
  14086. for (var name in this._textures) {
  14087. var texture = this._textures[name];
  14088. if (!texture.isReady()) {
  14089. return false;
  14090. }
  14091. }
  14092. return true;
  14093. };
  14094. CustomProceduralTexture.prototype.render = function (useCameraPostProcess) {
  14095. if (this._animate) {
  14096. this._time += this.getScene().getAnimationRatio() * 0.03;
  14097. this.updateShaderUniforms();
  14098. }
  14099. _super.prototype.render.call(this, useCameraPostProcess);
  14100. };
  14101. CustomProceduralTexture.prototype.updateTextures = function () {
  14102. for (var i = 0; i < this._config.sampler2Ds.length; i++) {
  14103. this.setTexture(this._config.sampler2Ds[i].sample2Dname, new BABYLON.Texture(this._texturePath + "/" + this._config.sampler2Ds[i].textureRelativeUrl, this.getScene()));
  14104. }
  14105. };
  14106. CustomProceduralTexture.prototype.updateShaderUniforms = function () {
  14107. if (this._config) {
  14108. for (var j = 0; j < this._config.uniforms.length; j++) {
  14109. var uniform = this._config.uniforms[j];
  14110. switch (uniform.type) {
  14111. case "float":
  14112. this.setFloat(uniform.name, uniform.value);
  14113. break;
  14114. case "color3":
  14115. this.setColor3(uniform.name, new BABYLON.Color3(uniform.r, uniform.g, uniform.b));
  14116. break;
  14117. case "color4":
  14118. this.setColor4(uniform.name, new BABYLON.Color4(uniform.r, uniform.g, uniform.b, uniform.a));
  14119. break;
  14120. case "vector2":
  14121. this.setVector2(uniform.name, new BABYLON.Vector2(uniform.x, uniform.y));
  14122. break;
  14123. case "vector3":
  14124. this.setVector3(uniform.name, new BABYLON.Vector3(uniform.x, uniform.y, uniform.z));
  14125. break;
  14126. }
  14127. }
  14128. }
  14129. this.setFloat("time", this._time);
  14130. };
  14131. Object.defineProperty(CustomProceduralTexture.prototype, "animate", {
  14132. get: function () {
  14133. return this._animate;
  14134. },
  14135. set: function (value) {
  14136. this._animate = value;
  14137. },
  14138. enumerable: true,
  14139. configurable: true
  14140. });
  14141. return CustomProceduralTexture;
  14142. })(BABYLON.ProceduralTexture);
  14143. BABYLON.CustomProceduralTexture = CustomProceduralTexture;
  14144. })(BABYLON || (BABYLON = {}));
  14145. //# sourceMappingURL=babylon.customProceduralTexture.js.map
  14146. var BABYLON;
  14147. (function (BABYLON) {
  14148. var MirrorTexture = (function (_super) {
  14149. __extends(MirrorTexture, _super);
  14150. function MirrorTexture(name, size, scene, generateMipMaps) {
  14151. var _this = this;
  14152. _super.call(this, name, size, scene, generateMipMaps, true);
  14153. this.mirrorPlane = new BABYLON.Plane(0, 1, 0, 1);
  14154. this._transformMatrix = BABYLON.Matrix.Zero();
  14155. this._mirrorMatrix = BABYLON.Matrix.Zero();
  14156. this.onBeforeRender = function () {
  14157. BABYLON.Matrix.ReflectionToRef(_this.mirrorPlane, _this._mirrorMatrix);
  14158. _this._savedViewMatrix = scene.getViewMatrix();
  14159. _this._mirrorMatrix.multiplyToRef(_this._savedViewMatrix, _this._transformMatrix);
  14160. scene.setTransformMatrix(_this._transformMatrix, scene.getProjectionMatrix());
  14161. scene.clipPlane = _this.mirrorPlane;
  14162. scene.getEngine().cullBackFaces = false;
  14163. };
  14164. this.onAfterRender = function () {
  14165. scene.setTransformMatrix(_this._savedViewMatrix, scene.getProjectionMatrix());
  14166. scene.getEngine().cullBackFaces = true;
  14167. delete scene.clipPlane;
  14168. };
  14169. }
  14170. MirrorTexture.prototype.clone = function () {
  14171. var textureSize = this.getSize();
  14172. var newTexture = new BABYLON.MirrorTexture(this.name, textureSize.width, this.getScene(), this._generateMipMaps);
  14173. // Base texture
  14174. newTexture.hasAlpha = this.hasAlpha;
  14175. newTexture.level = this.level;
  14176. // Mirror Texture
  14177. newTexture.mirrorPlane = this.mirrorPlane.clone();
  14178. newTexture.renderList = this.renderList.slice(0);
  14179. return newTexture;
  14180. };
  14181. return MirrorTexture;
  14182. })(BABYLON.RenderTargetTexture);
  14183. BABYLON.MirrorTexture = MirrorTexture;
  14184. })(BABYLON || (BABYLON = {}));
  14185. //# sourceMappingURL=babylon.mirrorTexture.js.map
  14186. var BABYLON;
  14187. (function (BABYLON) {
  14188. var DynamicTexture = (function (_super) {
  14189. __extends(DynamicTexture, _super);
  14190. function DynamicTexture(name, options, scene, generateMipMaps, samplingMode) {
  14191. if (samplingMode === void 0) { samplingMode = BABYLON.Texture.TRILINEAR_SAMPLINGMODE; }
  14192. _super.call(this, null, scene, !generateMipMaps);
  14193. this.name = name;
  14194. this.wrapU = BABYLON.Texture.CLAMP_ADDRESSMODE;
  14195. this.wrapV = BABYLON.Texture.CLAMP_ADDRESSMODE;
  14196. this._generateMipMaps = generateMipMaps;
  14197. if (options.getContext) {
  14198. this._canvas = options;
  14199. this._texture = scene.getEngine().createDynamicTexture(options.width, options.height, generateMipMaps, samplingMode);
  14200. }
  14201. else {
  14202. this._canvas = document.createElement("canvas");
  14203. if (options.width) {
  14204. this._texture = scene.getEngine().createDynamicTexture(options.width, options.height, generateMipMaps, samplingMode);
  14205. }
  14206. else {
  14207. this._texture = scene.getEngine().createDynamicTexture(options, options, generateMipMaps, samplingMode);
  14208. }
  14209. }
  14210. var textureSize = this.getSize();
  14211. this._canvas.width = textureSize.width;
  14212. this._canvas.height = textureSize.height;
  14213. this._context = this._canvas.getContext("2d");
  14214. }
  14215. Object.defineProperty(DynamicTexture.prototype, "canRescale", {
  14216. get: function () {
  14217. return true;
  14218. },
  14219. enumerable: true,
  14220. configurable: true
  14221. });
  14222. DynamicTexture.prototype.scale = function (ratio) {
  14223. var textureSize = this.getSize();
  14224. textureSize.width *= ratio;
  14225. textureSize.height *= ratio;
  14226. this._canvas.width = textureSize.width;
  14227. this._canvas.height = textureSize.height;
  14228. this.releaseInternalTexture();
  14229. this._texture = this.getScene().getEngine().createDynamicTexture(textureSize.width, textureSize.height, this._generateMipMaps, this._samplingMode);
  14230. };
  14231. DynamicTexture.prototype.getContext = function () {
  14232. return this._context;
  14233. };
  14234. DynamicTexture.prototype.clear = function () {
  14235. var size = this.getSize();
  14236. this._context.fillRect(0, 0, size.width, size.height);
  14237. };
  14238. DynamicTexture.prototype.update = function (invertY) {
  14239. this.getScene().getEngine().updateDynamicTexture(this._texture, this._canvas, invertY === undefined ? true : invertY);
  14240. };
  14241. DynamicTexture.prototype.drawText = function (text, x, y, font, color, clearColor, invertY, update) {
  14242. if (update === void 0) { update = true; }
  14243. var size = this.getSize();
  14244. if (clearColor) {
  14245. this._context.fillStyle = clearColor;
  14246. this._context.fillRect(0, 0, size.width, size.height);
  14247. }
  14248. this._context.font = font;
  14249. if (x === null) {
  14250. var textSize = this._context.measureText(text);
  14251. x = (size.width - textSize.width) / 2;
  14252. }
  14253. this._context.fillStyle = color;
  14254. this._context.fillText(text, x, y);
  14255. if (update) {
  14256. this.update(invertY);
  14257. }
  14258. };
  14259. DynamicTexture.prototype.clone = function () {
  14260. var textureSize = this.getSize();
  14261. var newTexture = new DynamicTexture(this.name, textureSize.width, this.getScene(), this._generateMipMaps);
  14262. // Base texture
  14263. newTexture.hasAlpha = this.hasAlpha;
  14264. newTexture.level = this.level;
  14265. // Dynamic Texture
  14266. newTexture.wrapU = this.wrapU;
  14267. newTexture.wrapV = this.wrapV;
  14268. return newTexture;
  14269. };
  14270. return DynamicTexture;
  14271. })(BABYLON.Texture);
  14272. BABYLON.DynamicTexture = DynamicTexture;
  14273. })(BABYLON || (BABYLON = {}));
  14274. //# sourceMappingURL=babylon.dynamicTexture.js.map
  14275. var BABYLON;
  14276. (function (BABYLON) {
  14277. var VideoTexture = (function (_super) {
  14278. __extends(VideoTexture, _super);
  14279. function VideoTexture(name, urls, size, scene, generateMipMaps, invertY, samplingMode) {
  14280. var _this = this;
  14281. if (samplingMode === void 0) { samplingMode = BABYLON.Texture.TRILINEAR_SAMPLINGMODE; }
  14282. _super.call(this, null, scene, !generateMipMaps, invertY);
  14283. this._autoLaunch = true;
  14284. this.name = name;
  14285. this.wrapU = BABYLON.Texture.WRAP_ADDRESSMODE;
  14286. this.wrapV = BABYLON.Texture.WRAP_ADDRESSMODE;
  14287. var requiredWidth = size.width || size;
  14288. var requiredHeight = size.height || size;
  14289. this._texture = scene.getEngine().createDynamicTexture(requiredWidth, requiredHeight, generateMipMaps, samplingMode);
  14290. var textureSize = this.getSize();
  14291. this.video = document.createElement("video");
  14292. this.video.width = textureSize.width;
  14293. this.video.height = textureSize.height;
  14294. this.video.autoplay = false;
  14295. this.video.loop = true;
  14296. this.video.addEventListener("canplaythrough", function () {
  14297. if (_this._texture) {
  14298. _this._texture.isReady = true;
  14299. }
  14300. });
  14301. urls.forEach(function (url) {
  14302. //Backwards-compatibility for typescript 1. from 1.3 it should say "SOURCE". see here - https://github.com/Microsoft/TypeScript/issues/1850
  14303. var source = document.createElement("source");
  14304. source.src = url;
  14305. _this.video.appendChild(source);
  14306. });
  14307. this._lastUpdate = BABYLON.Tools.Now;
  14308. }
  14309. VideoTexture.prototype.update = function () {
  14310. if (this._autoLaunch) {
  14311. this._autoLaunch = false;
  14312. this.video.play();
  14313. }
  14314. var now = BABYLON.Tools.Now;
  14315. if (now - this._lastUpdate < 15) {
  14316. return false;
  14317. }
  14318. this._lastUpdate = now;
  14319. this.getScene().getEngine().updateVideoTexture(this._texture, this.video, this._invertY);
  14320. return true;
  14321. };
  14322. return VideoTexture;
  14323. })(BABYLON.Texture);
  14324. BABYLON.VideoTexture = VideoTexture;
  14325. })(BABYLON || (BABYLON = {}));
  14326. //# sourceMappingURL=babylon.videoTexture.js.mapvar BABYLON;
  14327. (function (BABYLON) {
  14328. var EffectFallbacks = (function () {
  14329. function EffectFallbacks() {
  14330. this._defines = {};
  14331. this._currentRank = 32;
  14332. this._maxRank = -1;
  14333. }
  14334. EffectFallbacks.prototype.addFallback = function (rank, define) {
  14335. if (!this._defines[rank]) {
  14336. if (rank < this._currentRank) {
  14337. this._currentRank = rank;
  14338. }
  14339. if (rank > this._maxRank) {
  14340. this._maxRank = rank;
  14341. }
  14342. this._defines[rank] = new Array();
  14343. }
  14344. this._defines[rank].push(define);
  14345. };
  14346. Object.defineProperty(EffectFallbacks.prototype, "isMoreFallbacks", {
  14347. get: function () {
  14348. return this._currentRank <= this._maxRank;
  14349. },
  14350. enumerable: true,
  14351. configurable: true
  14352. });
  14353. EffectFallbacks.prototype.reduce = function (currentDefines) {
  14354. var currentFallbacks = this._defines[this._currentRank];
  14355. for (var index = 0; index < currentFallbacks.length; index++) {
  14356. currentDefines = currentDefines.replace("#define " + currentFallbacks[index], "");
  14357. }
  14358. this._currentRank++;
  14359. return currentDefines;
  14360. };
  14361. return EffectFallbacks;
  14362. })();
  14363. BABYLON.EffectFallbacks = EffectFallbacks;
  14364. var Effect = (function () {
  14365. function Effect(baseName, attributesNames, uniformsNames, samplers, engine, defines, fallbacks, onCompiled, onError) {
  14366. var _this = this;
  14367. this._isReady = false;
  14368. this._compilationError = "";
  14369. this._valueCache = [];
  14370. this._engine = engine;
  14371. this.name = baseName;
  14372. this.defines = defines;
  14373. this._uniformsNames = uniformsNames.concat(samplers);
  14374. this._samplers = samplers;
  14375. this._attributesNames = attributesNames;
  14376. this.onError = onError;
  14377. this.onCompiled = onCompiled;
  14378. var vertexSource;
  14379. var fragmentSource;
  14380. if (baseName.vertexElement) {
  14381. vertexSource = document.getElementById(baseName.vertexElement);
  14382. if (!vertexSource) {
  14383. vertexSource = baseName.vertexElement;
  14384. }
  14385. }
  14386. else {
  14387. vertexSource = baseName.vertex || baseName;
  14388. }
  14389. if (baseName.fragmentElement) {
  14390. fragmentSource = document.getElementById(baseName.fragmentElement);
  14391. if (!fragmentSource) {
  14392. fragmentSource = baseName.fragmentElement;
  14393. }
  14394. }
  14395. else {
  14396. fragmentSource = baseName.fragment || baseName;
  14397. }
  14398. this._loadVertexShader(vertexSource, function (vertexCode) {
  14399. _this._loadFragmentShader(fragmentSource, function (fragmentCode) {
  14400. _this._prepareEffect(vertexCode, fragmentCode, attributesNames, defines, fallbacks);
  14401. });
  14402. });
  14403. }
  14404. // Properties
  14405. Effect.prototype.isReady = function () {
  14406. return this._isReady;
  14407. };
  14408. Effect.prototype.getProgram = function () {
  14409. return this._program;
  14410. };
  14411. Effect.prototype.getAttributesNames = function () {
  14412. return this._attributesNames;
  14413. };
  14414. Effect.prototype.getAttributeLocation = function (index) {
  14415. return this._attributes[index];
  14416. };
  14417. Effect.prototype.getAttributeLocationByName = function (name) {
  14418. var index = this._attributesNames.indexOf(name);
  14419. return this._attributes[index];
  14420. };
  14421. Effect.prototype.getAttributesCount = function () {
  14422. return this._attributes.length;
  14423. };
  14424. Effect.prototype.getUniformIndex = function (uniformName) {
  14425. return this._uniformsNames.indexOf(uniformName);
  14426. };
  14427. Effect.prototype.getUniform = function (uniformName) {
  14428. return this._uniforms[this._uniformsNames.indexOf(uniformName)];
  14429. };
  14430. Effect.prototype.getSamplers = function () {
  14431. return this._samplers;
  14432. };
  14433. Effect.prototype.getCompilationError = function () {
  14434. return this._compilationError;
  14435. };
  14436. // Methods
  14437. Effect.prototype._loadVertexShader = function (vertex, callback) {
  14438. // DOM element ?
  14439. if (vertex instanceof HTMLElement) {
  14440. var vertexCode = BABYLON.Tools.GetDOMTextContent(vertex);
  14441. callback(vertexCode);
  14442. return;
  14443. }
  14444. // Is in local store ?
  14445. if (Effect.ShadersStore[vertex + "VertexShader"]) {
  14446. callback(Effect.ShadersStore[vertex + "VertexShader"]);
  14447. return;
  14448. }
  14449. var vertexShaderUrl;
  14450. if (vertex[0] === ".") {
  14451. vertexShaderUrl = vertex;
  14452. }
  14453. else {
  14454. vertexShaderUrl = BABYLON.Engine.ShadersRepository + vertex;
  14455. }
  14456. // Vertex shader
  14457. BABYLON.Tools.LoadFile(vertexShaderUrl + ".vertex.fx", callback);
  14458. };
  14459. Effect.prototype._loadFragmentShader = function (fragment, callback) {
  14460. // DOM element ?
  14461. if (fragment instanceof HTMLElement) {
  14462. var fragmentCode = BABYLON.Tools.GetDOMTextContent(fragment);
  14463. callback(fragmentCode);
  14464. return;
  14465. }
  14466. // Is in local store ?
  14467. if (Effect.ShadersStore[fragment + "PixelShader"]) {
  14468. callback(Effect.ShadersStore[fragment + "PixelShader"]);
  14469. return;
  14470. }
  14471. if (Effect.ShadersStore[fragment + "FragmentShader"]) {
  14472. callback(Effect.ShadersStore[fragment + "FragmentShader"]);
  14473. return;
  14474. }
  14475. var fragmentShaderUrl;
  14476. if (fragment[0] === ".") {
  14477. fragmentShaderUrl = fragment;
  14478. }
  14479. else {
  14480. fragmentShaderUrl = BABYLON.Engine.ShadersRepository + fragment;
  14481. }
  14482. // Fragment shader
  14483. BABYLON.Tools.LoadFile(fragmentShaderUrl + ".fragment.fx", callback);
  14484. };
  14485. Effect.prototype._prepareEffect = function (vertexSourceCode, fragmentSourceCode, attributesNames, defines, fallbacks) {
  14486. try {
  14487. var engine = this._engine;
  14488. if (!engine.getCaps().highPrecisionShaderSupported) {
  14489. vertexSourceCode = vertexSourceCode.replace("precision highp float", "precision mediump float");
  14490. fragmentSourceCode = fragmentSourceCode.replace("precision highp float", "precision mediump float");
  14491. }
  14492. this._program = engine.createShaderProgram(vertexSourceCode, fragmentSourceCode, defines);
  14493. this._uniforms = engine.getUniforms(this._program, this._uniformsNames);
  14494. this._attributes = engine.getAttributes(this._program, attributesNames);
  14495. for (var index = 0; index < this._samplers.length; index++) {
  14496. var sampler = this.getUniform(this._samplers[index]);
  14497. if (sampler == null) {
  14498. this._samplers.splice(index, 1);
  14499. index--;
  14500. }
  14501. }
  14502. engine.bindSamplers(this);
  14503. this._isReady = true;
  14504. if (this.onCompiled) {
  14505. this.onCompiled(this);
  14506. }
  14507. }
  14508. catch (e) {
  14509. // Is it a problem with precision?
  14510. if (e.message.indexOf("highp") !== -1) {
  14511. vertexSourceCode = vertexSourceCode.replace("precision highp float", "precision mediump float");
  14512. fragmentSourceCode = fragmentSourceCode.replace("precision highp float", "precision mediump float");
  14513. this._prepareEffect(vertexSourceCode, fragmentSourceCode, attributesNames, defines, fallbacks);
  14514. return;
  14515. }
  14516. // Let's go through fallbacks then
  14517. if (fallbacks && fallbacks.isMoreFallbacks) {
  14518. defines = fallbacks.reduce(defines);
  14519. this._prepareEffect(vertexSourceCode, fragmentSourceCode, attributesNames, defines, fallbacks);
  14520. }
  14521. else {
  14522. BABYLON.Tools.Error("Unable to compile effect: " + this.name);
  14523. BABYLON.Tools.Error("Defines: " + defines);
  14524. BABYLON.Tools.Error("Error: " + e.message);
  14525. this._compilationError = e.message;
  14526. if (this.onError) {
  14527. this.onError(this, this._compilationError);
  14528. }
  14529. }
  14530. }
  14531. };
  14532. Effect.prototype._bindTexture = function (channel, texture) {
  14533. this._engine._bindTexture(this._samplers.indexOf(channel), texture);
  14534. };
  14535. Effect.prototype.setTexture = function (channel, texture) {
  14536. this._engine.setTexture(this._samplers.indexOf(channel), texture);
  14537. };
  14538. Effect.prototype.setTextureFromPostProcess = function (channel, postProcess) {
  14539. this._engine.setTextureFromPostProcess(this._samplers.indexOf(channel), postProcess);
  14540. };
  14541. //public _cacheMatrix(uniformName, matrix) {
  14542. // if (!this._valueCache[uniformName]) {
  14543. // this._valueCache[uniformName] = new BABYLON.Matrix();
  14544. // }
  14545. // for (var index = 0; index < 16; index++) {
  14546. // this._valueCache[uniformName].m[index] = matrix.m[index];
  14547. // }
  14548. //};
  14549. Effect.prototype._cacheFloat2 = function (uniformName, x, y) {
  14550. if (!this._valueCache[uniformName]) {
  14551. this._valueCache[uniformName] = [x, y];
  14552. return;
  14553. }
  14554. this._valueCache[uniformName][0] = x;
  14555. this._valueCache[uniformName][1] = y;
  14556. };
  14557. Effect.prototype._cacheFloat3 = function (uniformName, x, y, z) {
  14558. if (!this._valueCache[uniformName]) {
  14559. this._valueCache[uniformName] = [x, y, z];
  14560. return;
  14561. }
  14562. this._valueCache[uniformName][0] = x;
  14563. this._valueCache[uniformName][1] = y;
  14564. this._valueCache[uniformName][2] = z;
  14565. };
  14566. Effect.prototype._cacheFloat4 = function (uniformName, x, y, z, w) {
  14567. if (!this._valueCache[uniformName]) {
  14568. this._valueCache[uniformName] = [x, y, z, w];
  14569. return;
  14570. }
  14571. this._valueCache[uniformName][0] = x;
  14572. this._valueCache[uniformName][1] = y;
  14573. this._valueCache[uniformName][2] = z;
  14574. this._valueCache[uniformName][3] = w;
  14575. };
  14576. Effect.prototype.setArray = function (uniformName, array) {
  14577. this._engine.setArray(this.getUniform(uniformName), array);
  14578. return this;
  14579. };
  14580. Effect.prototype.setArray2 = function (uniformName, array) {
  14581. this._engine.setArray2(this.getUniform(uniformName), array);
  14582. return this;
  14583. };
  14584. Effect.prototype.setArray3 = function (uniformName, array) {
  14585. this._engine.setArray3(this.getUniform(uniformName), array);
  14586. return this;
  14587. };
  14588. Effect.prototype.setArray4 = function (uniformName, array) {
  14589. this._engine.setArray4(this.getUniform(uniformName), array);
  14590. return this;
  14591. };
  14592. Effect.prototype.setMatrices = function (uniformName, matrices) {
  14593. this._engine.setMatrices(this.getUniform(uniformName), matrices);
  14594. return this;
  14595. };
  14596. Effect.prototype.setMatrix = function (uniformName, matrix) {
  14597. //if (this._valueCache[uniformName] && this._valueCache[uniformName].equals(matrix))
  14598. // return;
  14599. //this._cacheMatrix(uniformName, matrix);
  14600. this._engine.setMatrix(this.getUniform(uniformName), matrix);
  14601. return this;
  14602. };
  14603. Effect.prototype.setFloat = function (uniformName, value) {
  14604. if (this._valueCache[uniformName] && this._valueCache[uniformName] === value)
  14605. return this;
  14606. this._valueCache[uniformName] = value;
  14607. this._engine.setFloat(this.getUniform(uniformName), value);
  14608. return this;
  14609. };
  14610. Effect.prototype.setBool = function (uniformName, bool) {
  14611. if (this._valueCache[uniformName] && this._valueCache[uniformName] === bool)
  14612. return this;
  14613. this._valueCache[uniformName] = bool;
  14614. this._engine.setBool(this.getUniform(uniformName), bool ? 1 : 0);
  14615. return this;
  14616. };
  14617. Effect.prototype.setVector2 = function (uniformName, vector2) {
  14618. if (this._valueCache[uniformName] && this._valueCache[uniformName][0] === vector2.x && this._valueCache[uniformName][1] === vector2.y)
  14619. return this;
  14620. this._cacheFloat2(uniformName, vector2.x, vector2.y);
  14621. this._engine.setFloat2(this.getUniform(uniformName), vector2.x, vector2.y);
  14622. return this;
  14623. };
  14624. Effect.prototype.setFloat2 = function (uniformName, x, y) {
  14625. if (this._valueCache[uniformName] && this._valueCache[uniformName][0] === x && this._valueCache[uniformName][1] === y)
  14626. return this;
  14627. this._cacheFloat2(uniformName, x, y);
  14628. this._engine.setFloat2(this.getUniform(uniformName), x, y);
  14629. return this;
  14630. };
  14631. Effect.prototype.setVector3 = function (uniformName, vector3) {
  14632. if (this._valueCache[uniformName] && this._valueCache[uniformName][0] === vector3.x && this._valueCache[uniformName][1] === vector3.y && this._valueCache[uniformName][2] === vector3.z)
  14633. return this;
  14634. this._cacheFloat3(uniformName, vector3.x, vector3.y, vector3.z);
  14635. this._engine.setFloat3(this.getUniform(uniformName), vector3.x, vector3.y, vector3.z);
  14636. return this;
  14637. };
  14638. Effect.prototype.setFloat3 = function (uniformName, x, y, z) {
  14639. if (this._valueCache[uniformName] && this._valueCache[uniformName][0] === x && this._valueCache[uniformName][1] === y && this._valueCache[uniformName][2] === z)
  14640. return this;
  14641. this._cacheFloat3(uniformName, x, y, z);
  14642. this._engine.setFloat3(this.getUniform(uniformName), x, y, z);
  14643. return this;
  14644. };
  14645. Effect.prototype.setFloat4 = function (uniformName, x, y, z, w) {
  14646. if (this._valueCache[uniformName] && this._valueCache[uniformName][0] === x && this._valueCache[uniformName][1] === y && this._valueCache[uniformName][2] === z && this._valueCache[uniformName][3] === w)
  14647. return this;
  14648. this._cacheFloat4(uniformName, x, y, z, w);
  14649. this._engine.setFloat4(this.getUniform(uniformName), x, y, z, w);
  14650. return this;
  14651. };
  14652. Effect.prototype.setColor3 = function (uniformName, color3) {
  14653. if (this._valueCache[uniformName] && this._valueCache[uniformName][0] === color3.r && this._valueCache[uniformName][1] === color3.g && this._valueCache[uniformName][2] === color3.b)
  14654. return this;
  14655. this._cacheFloat3(uniformName, color3.r, color3.g, color3.b);
  14656. this._engine.setColor3(this.getUniform(uniformName), color3);
  14657. return this;
  14658. };
  14659. Effect.prototype.setColor4 = function (uniformName, color3, alpha) {
  14660. if (this._valueCache[uniformName] && this._valueCache[uniformName][0] === color3.r && this._valueCache[uniformName][1] === color3.g && this._valueCache[uniformName][2] === color3.b && this._valueCache[uniformName][3] === alpha)
  14661. return this;
  14662. this._cacheFloat4(uniformName, color3.r, color3.g, color3.b, alpha);
  14663. this._engine.setColor4(this.getUniform(uniformName), color3, alpha);
  14664. return this;
  14665. };
  14666. // Statics
  14667. Effect.ShadersStore={anaglyphPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\nvarying vec2 vUV;\nuniform sampler2D textureSampler;\nuniform sampler2D leftSampler;\n\nvoid main(void)\n{\nvec4 leftFrag = texture2D(leftSampler, vUV);\nleftFrag = vec4(1.0, leftFrag.g, leftFrag.b, 1.0);\n\nvec4 rightFrag = texture2D(textureSampler, vUV);\nrightFrag = vec4(rightFrag.r, 1.0, 1.0, 1.0);\n\ngl_FragColor = vec4(rightFrag.rgb * leftFrag.rgb, 1.0);\n}",
  14668. blackAndWhitePixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\nvarying vec2 vUV;\nuniform sampler2D textureSampler;\n\nvoid main(void)\n{\nfloat luminance = dot(texture2D(textureSampler, vUV).rgb, vec3(0.3, 0.59, 0.11));\ngl_FragColor = vec4(luminance, luminance, luminance, 1.0);\n}",
  14669. blurPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\nvarying vec2 vUV;\nuniform sampler2D textureSampler;\n\nuniform vec2 screenSize;\nuniform vec2 direction;\nuniform float blurWidth;\n\nvoid main(void)\n{\nfloat weights[7];\nweights[0] = 0.05;\nweights[1] = 0.1;\nweights[2] = 0.2;\nweights[3] = 0.3;\nweights[4] = 0.2;\nweights[5] = 0.1;\nweights[6] = 0.05;\n\nvec2 texelSize = vec2(1.0 / screenSize.x, 1.0 / screenSize.y);\nvec2 texelStep = texelSize * direction * blurWidth;\nvec2 start = vUV - 3.0 * texelStep;\n\nvec4 baseColor = vec4(0., 0., 0., 0.);\nvec2 texelOffset = vec2(0., 0.);\n\nfor (int i = 0; i < 7; i++)\n{\nbaseColor += texture2D(textureSampler, start + texelOffset) * weights[i];\ntexelOffset += texelStep;\n}\n\ngl_FragColor = baseColor;\n}",
  14670. brickPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\nvarying vec2 vPosition;\nvarying vec2 vUV;\n\nuniform float numberOfBricksHeight;\nuniform float numberOfBricksWidth;\nuniform vec3 brickColor;\nuniform vec3 jointColor;\n\nfloat rand(vec2 n) {\nreturn fract(cos(dot(n, vec2(12.9898, 4.1414))) * 43758.5453);\n}\n\nfloat noise(vec2 n) {\nconst vec2 d = vec2(0.0, 1.0);\nvec2 b = floor(n), f = smoothstep(vec2(0.0), vec2(1.0), fract(n));\nreturn mix(mix(rand(b), rand(b + d.yx), f.x), mix(rand(b + d.xy), rand(b + d.yy), f.x), f.y);\n}\n\nfloat fbm(vec2 n) {\nfloat total = 0.0, amplitude = 1.0;\nfor (int i = 0; i < 4; i++) {\ntotal += noise(n) * amplitude;\nn += n;\namplitude *= 0.5;\n}\nreturn total;\n}\n\nfloat round(float number){\nreturn sign(number)*floor(abs(number) + 0.5);\n}\n\nvoid main(void)\n{\nfloat brickW = 1.0 / numberOfBricksWidth;\nfloat brickH = 1.0 / numberOfBricksHeight;\nfloat jointWPercentage = 0.01;\nfloat jointHPercentage = 0.05;\nvec3 color = brickColor;\nfloat yi = vUV.y / brickH;\nfloat nyi = round(yi);\nfloat xi = vUV.x / brickW;\n\nif (mod(floor(yi), 2.0) == 0.0){\nxi = xi - 0.5;\n}\n\nfloat nxi = round(xi);\nvec2 brickvUV = vec2((xi - floor(xi)) / brickH, (yi - floor(yi)) / brickW);\n\nif (yi < nyi + jointHPercentage && yi > nyi - jointHPercentage){\ncolor = mix(jointColor, vec3(0.37, 0.25, 0.25), (yi - nyi) / jointHPercentage + 0.2);\n}\nelse if (xi < nxi + jointWPercentage && xi > nxi - jointWPercentage){\ncolor = mix(jointColor, vec3(0.44, 0.44, 0.44), (xi - nxi) / jointWPercentage + 0.2);\n}\nelse {\nfloat brickColorSwitch = mod(floor(yi) + floor(xi), 3.0);\n\nif (brickColorSwitch == 0.0)\ncolor = mix(color, vec3(0.33, 0.33, 0.33), 0.3);\nelse if (brickColorSwitch == 2.0)\ncolor = mix(color, vec3(0.11, 0.11, 0.11), 0.3);\n}\n\ngl_FragColor = vec4(color, 1.0);\n}",
  14671. chromaticAberrationPixelShader:"\n#ifdef GL_ES\nprecision highp float;\n#endif\n\nuniform sampler2D textureSampler; // original color\n\nuniform float chromatic_aberration;\nuniform float screen_width;\nuniform float screen_height;\n\nvarying vec2 vUV;\n\nvoid main(void)\n{\nvec2 centered_screen_pos = vec2(vUV.x - 0.5, vUV.y - 0.5);\nfloat radius2 = centered_screen_pos.x*centered_screen_pos.x\n+ centered_screen_pos.y*centered_screen_pos.y;\nfloat radius = sqrt(radius2);\n\nvec4 original = texture2D(textureSampler, vUV);\n\nif (chromatic_aberration > 0.0) {\nvec3 ref_indices = vec3(-0.3, 0.0, 0.3);\nfloat ref_shiftX = chromatic_aberration * radius * 17.0 / screen_width;\nfloat ref_shiftY = chromatic_aberration * radius * 17.0 / screen_height;\n\nvec2 ref_coords_r = vec2(vUV.x + ref_indices.r*ref_shiftX, vUV.y + ref_indices.r*ref_shiftY*0.5);\nvec2 ref_coords_g = vec2(vUV.x + ref_indices.g*ref_shiftX, vUV.y + ref_indices.g*ref_shiftY*0.5);\nvec2 ref_coords_b = vec2(vUV.x + ref_indices.b*ref_shiftX, vUV.y + ref_indices.b*ref_shiftY*0.5);\n\noriginal.r = texture2D(textureSampler, ref_coords_r).r;\noriginal.g = texture2D(textureSampler, ref_coords_g).g;\noriginal.b = texture2D(textureSampler, ref_coords_b).b;\n}\n\ngl_FragColor = original;\n}",
  14672. cloudPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\nvarying vec2 vUV;\n\nuniform vec3 skyColor;\nuniform vec3 cloudColor;\n\nfloat rand(vec2 n) {\nreturn fract(cos(dot(n, vec2(12.9898, 4.1414))) * 43758.5453);\n}\n\nfloat noise(vec2 n) {\nconst vec2 d = vec2(0.0, 1.0);\nvec2 b = floor(n), f = smoothstep(vec2(0.0), vec2(1.0), fract(n));\nreturn mix(mix(rand(b), rand(b + d.yx), f.x), mix(rand(b + d.xy), rand(b + d.yy), f.x), f.y);\n}\n\nfloat fbm(vec2 n) {\nfloat total = 0.0, amplitude = 1.0;\nfor (int i = 0; i < 4; i++) {\ntotal += noise(n) * amplitude;\nn += n;\namplitude *= 0.5;\n}\nreturn total;\n}\n\nvoid main() {\n\nvec2 p = vUV * 12.0;\nvec3 c = mix(skyColor, cloudColor, fbm(p));\ngl_FragColor = vec4(c, 1);\n\n}",
  14673. colorPixelShader:"precision highp float;\n\nuniform vec4 color;\n\nvoid main(void) {\ngl_FragColor = color;\n}",
  14674. colorVertexShader:"precision highp float;\n\nattribute vec3 position;\n\nuniform mat4 worldViewProjection;\n\nvoid main(void) {\ngl_Position = worldViewProjection * vec4(position, 1.0);\n}",
  14675. colorCorrectionPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\nuniform sampler2D textureSampler; // screen render\nuniform sampler2D colorTable; // color table with modified colors\n\nvarying vec2 vUV;\n\nconst float SLICE_COUNT = 16.0; // how many slices in the color cube; 1 slice = 1 pixel\n\nvec4 sampleAs3DTexture(sampler2D texture, vec3 uv, float width) {\nfloat sliceSize = 1.0 / width; // space of 1 slice\nfloat slicePixelSize = sliceSize / width; // space of 1 pixel\nfloat sliceInnerSize = slicePixelSize * (width - 1.0); // space of width pixels\nfloat zSlice0 = min(floor(uv.z * width), width - 1.0);\nfloat zSlice1 = min(zSlice0 + 1.0, width - 1.0);\nfloat xOffset = slicePixelSize * 0.5 + uv.x * sliceInnerSize;\nfloat s0 = xOffset + (zSlice0 * sliceSize);\nfloat s1 = xOffset + (zSlice1 * sliceSize);\nvec4 slice0Color = texture2D(texture, vec2(s0, uv.y));\nvec4 slice1Color = texture2D(texture, vec2(s1, uv.y));\nfloat zOffset = mod(uv.z * width, 1.0);\nvec4 result = mix(slice0Color, slice1Color, zOffset);\nreturn result;\n}\n\nvoid main(void)\n{\nvec4 screen_color = texture2D(textureSampler, vUV);\ngl_FragColor = sampleAs3DTexture(colorTable, screen_color.rgb, SLICE_COUNT);\n\n}",
  14676. convolutionPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\nvarying vec2 vUV;\nuniform sampler2D textureSampler;\n\nuniform vec2 screenSize;\nuniform float kernel[9];\n\nvoid main(void)\n{\nvec2 onePixel = vec2(1.0, 1.0) / screenSize;\nvec4 colorSum =\ntexture2D(textureSampler, vUV + onePixel * vec2(-1, -1)) * kernel[0] +\ntexture2D(textureSampler, vUV + onePixel * vec2(0, -1)) * kernel[1] +\ntexture2D(textureSampler, vUV + onePixel * vec2(1, -1)) * kernel[2] +\ntexture2D(textureSampler, vUV + onePixel * vec2(-1, 0)) * kernel[3] +\ntexture2D(textureSampler, vUV + onePixel * vec2(0, 0)) * kernel[4] +\ntexture2D(textureSampler, vUV + onePixel * vec2(1, 0)) * kernel[5] +\ntexture2D(textureSampler, vUV + onePixel * vec2(-1, 1)) * kernel[6] +\ntexture2D(textureSampler, vUV + onePixel * vec2(0, 1)) * kernel[7] +\ntexture2D(textureSampler, vUV + onePixel * vec2(1, 1)) * kernel[8];\n\nfloat kernelWeight =\nkernel[0] +\nkernel[1] +\nkernel[2] +\nkernel[3] +\nkernel[4] +\nkernel[5] +\nkernel[6] +\nkernel[7] +\nkernel[8];\n\nif (kernelWeight <= 0.0) {\nkernelWeight = 1.0;\n}\n\ngl_FragColor = vec4((colorSum / kernelWeight).rgb, 1);\n}",
  14677. defaultPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n#define MAP_EXPLICIT 0.\n#define MAP_SPHERICAL 1.\n#define MAP_PLANAR 2.\n#define MAP_CUBIC 3.\n#define MAP_PROJECTION 4.\n#define MAP_SKYBOX 5.\n\nuniform vec3 vEyePosition;\nuniform vec3 vAmbientColor;\nuniform vec4 vDiffuseColor;\nuniform vec4 vSpecularColor;\nuniform vec3 vEmissiveColor;\n\nvarying vec3 vPositionW;\n\n#ifdef NORMAL\nvarying vec3 vNormalW;\n#endif\n\n#ifdef VERTEXCOLOR\nvarying vec4 vColor;\n#endif\n\n#ifdef LIGHT0\nuniform vec4 vLightData0;\nuniform vec4 vLightDiffuse0;\nuniform vec3 vLightSpecular0;\n#ifdef SHADOW0\nvarying vec4 vPositionFromLight0;\nuniform sampler2D shadowSampler0;\nuniform vec3 shadowsInfo0;\n#endif\n#ifdef SPOTLIGHT0\nuniform vec4 vLightDirection0;\n#endif\n#ifdef HEMILIGHT0\nuniform vec3 vLightGround0;\n#endif\n#endif\n\n#ifdef LIGHT1\nuniform vec4 vLightData1;\nuniform vec4 vLightDiffuse1;\nuniform vec3 vLightSpecular1;\n#ifdef SHADOW1\nvarying vec4 vPositionFromLight1;\nuniform sampler2D shadowSampler1;\nuniform vec3 shadowsInfo1;\n#endif\n#ifdef SPOTLIGHT1\nuniform vec4 vLightDirection1;\n#endif\n#ifdef HEMILIGHT1\nuniform vec3 vLightGround1;\n#endif\n#endif\n\n#ifdef LIGHT2\nuniform vec4 vLightData2;\nuniform vec4 vLightDiffuse2;\nuniform vec3 vLightSpecular2;\n#ifdef SHADOW2\nvarying vec4 vPositionFromLight2;\nuniform sampler2D shadowSampler2;\nuniform vec3 shadowsInfo2;\n#endif\n#ifdef SPOTLIGHT2\nuniform vec4 vLightDirection2;\n#endif\n#ifdef HEMILIGHT2\nuniform vec3 vLightGround2;\n#endif\n#endif\n\n#ifdef LIGHT3\nuniform vec4 vLightData3;\nuniform vec4 vLightDiffuse3;\nuniform vec3 vLightSpecular3;\n#ifdef SHADOW3\nvarying vec4 vPositionFromLight3;\nuniform sampler2D shadowSampler3;\nuniform vec3 shadowsInfo3;\n#endif\n#ifdef SPOTLIGHT3\nuniform vec4 vLightDirection3;\n#endif\n#ifdef HEMILIGHT3\nuniform vec3 vLightGround3;\n#endif\n#endif\n\n#ifdef DIFFUSE\nvarying vec2 vDiffuseUV;\nuniform sampler2D diffuseSampler;\nuniform vec2 vDiffuseInfos;\n#endif\n\n#ifdef AMBIENT\nvarying vec2 vAmbientUV;\nuniform sampler2D ambientSampler;\nuniform vec2 vAmbientInfos;\n#endif\n\n#ifdef OPACITY\nvarying vec2 vOpacityUV;\nuniform sampler2D opacitySampler;\nuniform vec2 vOpacityInfos;\n#endif\n\n#ifdef EMISSIVE\nvarying vec2 vEmissiveUV;\nuniform vec2 vEmissiveInfos;\nuniform sampler2D emissiveSampler;\n#endif\n\n#ifdef SPECULAR\nvarying vec2 vSpecularUV;\nuniform vec2 vSpecularInfos;\nuniform sampler2D specularSampler;\n#endif\n\n#ifdef FRESNEL\nfloat computeFresnelTerm(vec3 viewDirection, vec3 worldNormal, float bias, float power)\n{\nfloat fresnelTerm = pow(bias + abs(dot(viewDirection, worldNormal)), power);\nreturn clamp(fresnelTerm, 0., 1.);\n}\n#endif\n\n#ifdef DIFFUSEFRESNEL\nuniform vec4 diffuseLeftColor;\nuniform vec4 diffuseRightColor;\n#endif\n\n#ifdef OPACITYFRESNEL\nuniform vec4 opacityParts;\n#endif\n\n#ifdef REFLECTIONFRESNEL\nuniform vec4 reflectionLeftColor;\nuniform vec4 reflectionRightColor;\n#endif\n\n#ifdef EMISSIVEFRESNEL\nuniform vec4 emissiveLeftColor;\nuniform vec4 emissiveRightColor;\n#endif\n\n#ifdef REFLECTION\nvarying vec3 vPositionUVW;\nuniform samplerCube reflectionCubeSampler;\nuniform sampler2D reflection2DSampler;\nuniform vec3 vReflectionInfos;\nuniform mat4 reflectionMatrix;\nuniform mat4 view;\n\nvec3 computeReflectionCoords(float mode, vec4 worldPos, vec3 worldNormal)\n{\nif (mode == MAP_SPHERICAL)\n{\nvec3 coords = vec3(view * vec4(worldNormal, 0.0));\n\nreturn vec3(reflectionMatrix * vec4(coords, 1.0));\n}\nelse if (mode == MAP_PLANAR)\n{\nvec3 viewDir = worldPos.xyz - vEyePosition;\nvec3 coords = normalize(reflect(viewDir, worldNormal));\n\nreturn vec3(reflectionMatrix * vec4(coords, 1));\n}\nelse if (mode == MAP_CUBIC)\n{\nvec3 viewDir = worldPos.xyz - vEyePosition;\nvec3 coords = reflect(viewDir, worldNormal);\n\nreturn vec3(reflectionMatrix * vec4(coords, 0));\n}\nelse if (mode == MAP_PROJECTION)\n{\nreturn vec3(reflectionMatrix * (view * worldPos));\n}\nelse if (mode == MAP_SKYBOX)\n{\nreturn vPositionUVW;\n}\n\nreturn vec3(0, 0, 0);\n}\n#endif\n\n#ifdef SHADOWS\n\nfloat unpack(vec4 color)\n{\nconst vec4 bit_shift = vec4(1.0 / (255.0 * 255.0 * 255.0), 1.0 / (255.0 * 255.0), 1.0 / 255.0, 1.0);\nreturn dot(color, bit_shift);\n}\n\nfloat unpackHalf(vec2 color)\n{\nreturn color.x + (color.y / 255.0);\n}\n\nfloat computeShadow(vec4 vPositionFromLight, sampler2D shadowSampler, float darkness, float bias)\n{\nvec3 depth = vPositionFromLight.xyz / vPositionFromLight.w;\ndepth = 0.5 * depth + vec3(0.5);\nvec2 uv = depth.xy;\n\nif (uv.x < 0. || uv.x > 1.0 || uv.y < 0. || uv.y > 1.0)\n{\nreturn 1.0;\n}\n\nfloat shadow = unpack(texture2D(shadowSampler, uv)) + bias;\n\nif (depth.z > shadow)\n{\nreturn darkness;\n}\nreturn 1.;\n}\n\nfloat computeShadowWithPCF(vec4 vPositionFromLight, sampler2D shadowSampler, float mapSize, float bias)\n{\nvec3 depth = vPositionFromLight.xyz / vPositionFromLight.w;\ndepth = 0.5 * depth + vec3(0.5);\nvec2 uv = depth.xy;\n\nif (uv.x < 0. || uv.x > 1.0 || uv.y < 0. || uv.y > 1.0)\n{\nreturn 1.0;\n}\n\nfloat visibility = 1.;\n\nvec2 poissonDisk[4];\npoissonDisk[0] = vec2(-0.94201624, -0.39906216);\npoissonDisk[1] = vec2(0.94558609, -0.76890725);\npoissonDisk[2] = vec2(-0.094184101, -0.92938870);\npoissonDisk[3] = vec2(0.34495938, 0.29387760);\n\nfloat biasedDepth = depth.z - bias;\n\nif (unpack(texture2D(shadowSampler, uv + poissonDisk[0] / mapSize)) < biasedDepth) visibility -= 0.25;\nif (unpack(texture2D(shadowSampler, uv + poissonDisk[1] / mapSize)) < biasedDepth) visibility -= 0.25;\nif (unpack(texture2D(shadowSampler, uv + poissonDisk[2] / mapSize)) < biasedDepth) visibility -= 0.25;\nif (unpack(texture2D(shadowSampler, uv + poissonDisk[3] / mapSize)) < biasedDepth) visibility -= 0.25;\n\nreturn visibility;\n}\n\nfloat linstep(float low, float high, float v) {\nreturn clamp((v - low) / (high - low), 0.0, 1.0);\n}\n\nfloat ChebychevInequality(vec2 moments, float compare, float bias)\n{\nfloat p = smoothstep(compare - bias, compare, moments.x);\nfloat variance = max(moments.y - moments.x * moments.x, 0.02);\nfloat d = compare - moments.x;\nfloat p_max = linstep(0.2, 1.0, variance / (variance + d * d));\n\nreturn clamp(max(p, p_max), 0.0, 1.0);\n}\n\nfloat computeShadowWithVSM(vec4 vPositionFromLight, sampler2D shadowSampler, float bias)\n{\nvec3 depth = vPositionFromLight.xyz / vPositionFromLight.w;\ndepth = 0.5 * depth + vec3(0.5);\nvec2 uv = depth.xy;\n\nif (uv.x < 0. || uv.x > 1.0 || uv.y < 0. || uv.y > 1.0 || depth.z >= 1.0)\n{\nreturn 1.0;\n}\n\nvec4 texel = texture2D(shadowSampler, uv);\n\nvec2 moments = vec2(unpackHalf(texel.xy), unpackHalf(texel.zw));\nreturn 1.0 - ChebychevInequality(moments, depth.z, bias);\n}\n#endif\n\n#ifdef BUMP\n#extension GL_OES_standard_derivatives : enable\nvarying vec2 vBumpUV;\nuniform vec2 vBumpInfos;\nuniform sampler2D bumpSampler;\n\nmat3 cotangent_frame(vec3 normal, vec3 p, vec2 uv)\n{\nvec3 dp1 = dFdx(p);\nvec3 dp2 = dFdy(p);\nvec2 duv1 = dFdx(uv);\nvec2 duv2 = dFdy(uv);\n\nvec3 dp2perp = cross(dp2, normal);\nvec3 dp1perp = cross(normal, dp1);\nvec3 tangent = dp2perp * duv1.x + dp1perp * duv2.x;\nvec3 binormal = dp2perp * duv1.y + dp1perp * duv2.y;\n\nfloat invmax = inversesqrt(max(dot(tangent, tangent), dot(binormal, binormal)));\nreturn mat3(tangent * invmax, binormal * invmax, normal);\n}\n\nvec3 perturbNormal(vec3 viewDir)\n{\nvec3 map = texture2D(bumpSampler, vBumpUV).xyz;\nmap = map * 255. / 127. - 128. / 127.;\nmat3 TBN = cotangent_frame(vNormalW * vBumpInfos.y, -viewDir, vBumpUV);\nreturn normalize(TBN * map);\n}\n#endif\n\n#ifdef CLIPPLANE\nvarying float fClipDistance;\n#endif\n\n#ifdef FOG\n\n#define FOGMODE_NONE 0.\n#define FOGMODE_EXP 1.\n#define FOGMODE_EXP2 2.\n#define FOGMODE_LINEAR 3.\n#define E 2.71828\n\nuniform vec4 vFogInfos;\nuniform vec3 vFogColor;\nvarying float fFogDistance;\n\nfloat CalcFogFactor()\n{\nfloat fogCoeff = 1.0;\nfloat fogStart = vFogInfos.y;\nfloat fogEnd = vFogInfos.z;\nfloat fogDensity = vFogInfos.w;\n\nif (FOGMODE_LINEAR == vFogInfos.x)\n{\nfogCoeff = (fogEnd - fFogDistance) / (fogEnd - fogStart);\n}\nelse if (FOGMODE_EXP == vFogInfos.x)\n{\nfogCoeff = 1.0 / pow(E, fFogDistance * fogDensity);\n}\nelse if (FOGMODE_EXP2 == vFogInfos.x)\n{\nfogCoeff = 1.0 / pow(E, fFogDistance * fFogDistance * fogDensity * fogDensity);\n}\n\nreturn clamp(fogCoeff, 0.0, 1.0);\n}\n#endif\n\nstruct lightingInfo\n{\nvec3 diffuse;\nvec3 specular;\n};\n\nlightingInfo computeLighting(vec3 viewDirectionW, vec3 vNormal, vec4 lightData, vec3 diffuseColor, vec3 specularColor, float range) {\nlightingInfo result;\n\nvec3 lightVectorW;\nfloat attenuation = 1.0;\nif (lightData.w == 0.)\n{\nvec3 direction = lightData.xyz - vPositionW;\n\nattenuation = max(0., 1.0 - length(direction) / range);\nlightVectorW = normalize(direction);\n}\nelse\n{\nlightVectorW = normalize(-lightData.xyz);\n}\n\nfloat ndl = max(0., dot(vNormal, lightVectorW));\n\nvec3 angleW = normalize(viewDirectionW + lightVectorW);\nfloat specComp = max(0., dot(vNormal, angleW));\nspecComp = pow(specComp, max(1., vSpecularColor.a));\n\nresult.diffuse = ndl * diffuseColor * attenuation;\nresult.specular = specComp * specularColor * attenuation;\n\nreturn result;\n}\n\nlightingInfo computeSpotLighting(vec3 viewDirectionW, vec3 vNormal, vec4 lightData, vec4 lightDirection, vec3 diffuseColor, vec3 specularColor, float range) {\nlightingInfo result;\n\nvec3 direction = lightData.xyz - vPositionW;\nvec3 lightVectorW = normalize(direction);\nfloat attenuation = max(0., 1.0 - length(direction) / range);\n\nfloat cosAngle = max(0., dot(-lightDirection.xyz, lightVectorW));\nfloat spotAtten = 0.0;\n\nif (cosAngle >= lightDirection.w)\n{\ncosAngle = max(0., pow(cosAngle, lightData.w));\nspotAtten = clamp((cosAngle - lightDirection.w) / (1. - cosAngle), 0.0, 1.0);\n\nfloat ndl = max(0., dot(vNormal, -lightDirection.xyz));\n\nvec3 angleW = normalize(viewDirectionW - lightDirection.xyz);\nfloat specComp = max(0., dot(vNormal, angleW));\nspecComp = pow(specComp, vSpecularColor.a);\n\nresult.diffuse = ndl * spotAtten * diffuseColor * attenuation;\nresult.specular = specComp * specularColor * spotAtten * attenuation;\n\nreturn result;\n}\n\nresult.diffuse = vec3(0.);\nresult.specular = vec3(0.);\n\nreturn result;\n}\n\nlightingInfo computeHemisphericLighting(vec3 viewDirectionW, vec3 vNormal, vec4 lightData, vec3 diffuseColor, vec3 specularColor, vec3 groundColor) {\nlightingInfo result;\n\nfloat ndl = dot(vNormal, lightData.xyz) * 0.5 + 0.5;\n\nvec3 angleW = normalize(viewDirectionW + lightData.xyz);\nfloat specComp = max(0., dot(vNormal, angleW));\nspecComp = pow(specComp, vSpecularColor.a);\n\nresult.diffuse = mix(groundColor, diffuseColor, ndl);\nresult.specular = specComp * specularColor;\n\nreturn result;\n}\n\nvoid main(void) {\n#ifdef CLIPPLANE\nif (fClipDistance > 0.0)\ndiscard;\n#endif\n\nvec3 viewDirectionW = normalize(vEyePosition - vPositionW);\n\nvec4 baseColor = vec4(1., 1., 1., 1.);\nvec3 diffuseColor = vDiffuseColor.rgb;\n\nfloat alpha = vDiffuseColor.a;\n\n#ifdef VERTEXCOLOR\nbaseColor.rgb *= vColor.rgb;\n#endif\n\n#ifdef DIFFUSE\nbaseColor = texture2D(diffuseSampler, vDiffuseUV);\n\n#ifdef ALPHATEST\nif (baseColor.a < 0.4)\ndiscard;\n#endif\n\n#ifdef ALPHAFROMDIFFUSE\nalpha *= baseColor.a;\n#endif\n\nbaseColor.rgb *= vDiffuseInfos.y;\n#endif\n\n#ifdef NORMAL\nvec3 normalW = normalize(vNormalW);\n#else\nvec3 normalW = vec3(1.0, 1.0, 1.0);\n#endif\n\n\n#ifdef BUMP\nnormalW = perturbNormal(viewDirectionW);\n#endif\n\n\nvec3 baseAmbientColor = vec3(1., 1., 1.);\n\n#ifdef AMBIENT\nbaseAmbientColor = texture2D(ambientSampler, vAmbientUV).rgb * vAmbientInfos.y;\n#endif\n\nvec3 diffuseBase = vec3(0., 0., 0.);\nvec3 specularBase = vec3(0., 0., 0.);\nfloat shadow = 1.;\n\n#ifdef LIGHT0\n#ifdef SPOTLIGHT0\nlightingInfo info = computeSpotLighting(viewDirectionW, normalW, vLightData0, vLightDirection0, vLightDiffuse0.rgb, vLightSpecular0, vLightDiffuse0.a);\n#endif\n#ifdef HEMILIGHT0\nlightingInfo info = computeHemisphericLighting(viewDirectionW, normalW, vLightData0, vLightDiffuse0.rgb, vLightSpecular0, vLightGround0);\n#endif\n#ifdef POINTDIRLIGHT0\nlightingInfo info = computeLighting(viewDirectionW, normalW, vLightData0, vLightDiffuse0.rgb, vLightSpecular0, vLightDiffuse0.a);\n#endif\n#ifdef SHADOW0\n#ifdef SHADOWVSM0\nshadow = computeShadowWithVSM(vPositionFromLight0, shadowSampler0, shadowsInfo0.z);\n#else\n#ifdef SHADOWPCF0\nshadow = computeShadowWithPCF(vPositionFromLight0, shadowSampler0, shadowsInfo0.y, shadowsInfo0.z);\n#else\nshadow = computeShadow(vPositionFromLight0, shadowSampler0, shadowsInfo0.x, shadowsInfo0.z);\n#endif\n#endif\n#else\nshadow = 1.;\n#endif\ndiffuseBase += info.diffuse * shadow;\nspecularBase += info.specular * shadow;\n#endif\n\n#ifdef LIGHT1\n#ifdef SPOTLIGHT1\ninfo = computeSpotLighting(viewDirectionW, normalW, vLightData1, vLightDirection1, vLightDiffuse1.rgb, vLightSpecular1, vLightDiffuse1.a);\n#endif\n#ifdef HEMILIGHT1\ninfo = computeHemisphericLighting(viewDirectionW, normalW, vLightData1, vLightDiffuse1.rgb, vLightSpecular1, vLightGround1);\n#endif\n#ifdef POINTDIRLIGHT1\ninfo = computeLighting(viewDirectionW, normalW, vLightData1, vLightDiffuse1.rgb, vLightSpecular1, vLightDiffuse1.a);\n#endif\n#ifdef SHADOW1\n#ifdef SHADOWVSM1\nshadow = computeShadowWithVSM(vPositionFromLight1, shadowSampler1, shadowsInfo1.z);\n#else\n#ifdef SHADOWPCF1\nshadow = computeShadowWithPCF(vPositionFromLight1, shadowSampler1, shadowsInfo1.y, shadowsInfo1.z);\n#else\nshadow = computeShadow(vPositionFromLight1, shadowSampler1, shadowsInfo1.x, shadowsInfo1.z);\n#endif\n#endif\n#else\nshadow = 1.;\n#endif\ndiffuseBase += info.diffuse * shadow;\nspecularBase += info.specular * shadow;\n#endif\n\n#ifdef LIGHT2\n#ifdef SPOTLIGHT2\ninfo = computeSpotLighting(viewDirectionW, normalW, vLightData2, vLightDirection2, vLightDiffuse2.rgb, vLightSpecular2, vLightDiffuse2.a);\n#endif\n#ifdef HEMILIGHT2\ninfo = computeHemisphericLighting(viewDirectionW, normalW, vLightData2, vLightDiffuse2.rgb, vLightSpecular2, vLightGround2);\n#endif\n#ifdef POINTDIRLIGHT2\ninfo = computeLighting(viewDirectionW, normalW, vLightData2, vLightDiffuse2.rgb, vLightSpecular2, vLightDiffuse2.a);\n#endif\n#ifdef SHADOW2\n#ifdef SHADOWVSM2\nshadow = computeShadowWithVSM(vPositionFromLight2, shadowSampler2, shadowsInfo2.z);\n#else\n#ifdef SHADOWPCF2\nshadow = computeShadowWithPCF(vPositionFromLight2, shadowSampler2, shadowsInfo2.y, shadowsInfo2.z);\n#else\nshadow = computeShadow(vPositionFromLight2, shadowSampler2, shadowsInfo2.x, shadowsInfo2.z);\n#endif\n#endif\n#else\nshadow = 1.;\n#endif\ndiffuseBase += info.diffuse * shadow;\nspecularBase += info.specular * shadow;\n#endif\n\n#ifdef LIGHT3\n#ifdef SPOTLIGHT3\ninfo = computeSpotLighting(viewDirectionW, normalW, vLightData3, vLightDirection3, vLightDiffuse3.rgb, vLightSpecular3, vLightDiffuse3.a);\n#endif\n#ifdef HEMILIGHT3\ninfo = computeHemisphericLighting(viewDirectionW, normalW, vLightData3, vLightDiffuse3.rgb, vLightSpecular3, vLightGround3);\n#endif\n#ifdef POINTDIRLIGHT3\ninfo = computeLighting(viewDirectionW, normalW, vLightData3, vLightDiffuse3.rgb, vLightSpecular3, vLightDiffuse3.a);\n#endif\n#ifdef SHADOW3\n#ifdef SHADOWVSM3\nshadow = computeShadowWithVSM(vPositionFromLight3, shadowSampler3, shadowsInfo3.z);\n#else\n#ifdef SHADOWPCF3\nshadow = computeShadowWithPCF(vPositionFromLight3, shadowSampler3, shadowsInfo3.y, shadowsInfo3.z);\n#else\nshadow = computeShadow(vPositionFromLight3, shadowSampler3, shadowsInfo3.x, shadowsInfo3.z);\n#endif\n#endif\n#else\nshadow = 1.;\n#endif\ndiffuseBase += info.diffuse * shadow;\nspecularBase += info.specular * shadow;\n#endif\n\nvec3 reflectionColor = vec3(0., 0., 0.);\n\n#ifdef REFLECTION\nvec3 vReflectionUVW = computeReflectionCoords(vReflectionInfos.x, vec4(vPositionW, 1.0), normalW);\n\nif (vReflectionInfos.z != 0.0)\n{\nreflectionColor = textureCube(reflectionCubeSampler, vReflectionUVW).rgb * vReflectionInfos.y * shadow;\n}\nelse\n{\nvec2 coords = vReflectionUVW.xy;\n\nif (vReflectionInfos.x == MAP_PROJECTION)\n{\ncoords /= vReflectionUVW.z;\n}\n\ncoords.y = 1.0 - coords.y;\n\nreflectionColor = texture2D(reflection2DSampler, coords).rgb * vReflectionInfos.y * shadow;\n}\n\n#ifdef REFLECTIONFRESNEL\nfloat reflectionFresnelTerm = computeFresnelTerm(viewDirectionW, normalW, reflectionRightColor.a, reflectionLeftColor.a);\n\nreflectionColor *= reflectionLeftColor.rgb * (1.0 - reflectionFresnelTerm) + reflectionFresnelTerm * reflectionRightColor.rgb;\n#endif\n#endif\n\n#ifdef OPACITY\nvec4 opacityMap = texture2D(opacitySampler, vOpacityUV);\n\n#ifdef OPACITYRGB\nopacityMap.rgb = opacityMap.rgb * vec3(0.3, 0.59, 0.11);\nalpha *= (opacityMap.x + opacityMap.y + opacityMap.z)* vOpacityInfos.y;\n#else\nalpha *= opacityMap.a * vOpacityInfos.y;\n#endif\n\n#endif\n\n#ifdef VERTEXALPHA\nalpha *= vColor.a;\n#endif\n\n#ifdef OPACITYFRESNEL\nfloat opacityFresnelTerm = computeFresnelTerm(viewDirectionW, normalW, opacityParts.z, opacityParts.w);\n\nalpha += opacityParts.x * (1.0 - opacityFresnelTerm) + opacityFresnelTerm * opacityParts.y;\n#endif\n\nvec3 emissiveColor = vEmissiveColor;\n#ifdef EMISSIVE\nemissiveColor += texture2D(emissiveSampler, vEmissiveUV).rgb * vEmissiveInfos.y;\n#endif\n\n#ifdef EMISSIVEFRESNEL\nfloat emissiveFresnelTerm = computeFresnelTerm(viewDirectionW, normalW, emissiveRightColor.a, emissiveLeftColor.a);\n\nemissiveColor *= emissiveLeftColor.rgb * (1.0 - emissiveFresnelTerm) + emissiveFresnelTerm * emissiveRightColor.rgb;\n#endif\n\nvec3 specularColor = vSpecularColor.rgb;\n#ifdef SPECULAR\nspecularColor = texture2D(specularSampler, vSpecularUV).rgb * vSpecularInfos.y;\n#endif\n\n#ifdef DIFFUSEFRESNEL\nfloat diffuseFresnelTerm = computeFresnelTerm(viewDirectionW, normalW, diffuseRightColor.a, diffuseLeftColor.a);\n\ndiffuseBase *= diffuseLeftColor.rgb * (1.0 - diffuseFresnelTerm) + diffuseFresnelTerm * diffuseRightColor.rgb;\n#endif\n\nvec3 finalDiffuse = clamp(diffuseBase * diffuseColor + emissiveColor + vAmbientColor, 0.0, 1.0) * baseColor.rgb;\nvec3 finalSpecular = specularBase * specularColor;\n\n#ifdef SPECULAROVERALPHA\nalpha = clamp(alpha + dot(finalSpecular, vec3(0.3, 0.59, 0.11)), 0., 1.);\n#endif\n\nvec4 color = vec4(finalDiffuse * baseAmbientColor + finalSpecular + reflectionColor, alpha);\n\n#ifdef FOG\nfloat fog = CalcFogFactor();\ncolor.rgb = fog * color.rgb + (1.0 - fog) * vFogColor;\n#endif\n\ngl_FragColor = color;\n}",
  14678. defaultVertexShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\nattribute vec3 position;\n#ifdef NORMAL\nattribute vec3 normal;\n#endif\n#ifdef UV1\nattribute vec2 uv;\n#endif\n#ifdef UV2\nattribute vec2 uv2;\n#endif\n#ifdef VERTEXCOLOR\nattribute vec4 color;\n#endif\n#ifdef BONES\nattribute vec4 matricesIndices;\nattribute vec4 matricesWeights;\n#endif\n\n\n#ifdef INSTANCES\nattribute vec4 world0;\nattribute vec4 world1;\nattribute vec4 world2;\nattribute vec4 world3;\n#else\nuniform mat4 world;\n#endif\n\nuniform mat4 view;\nuniform mat4 viewProjection;\n\n#ifdef DIFFUSE\nvarying vec2 vDiffuseUV;\nuniform mat4 diffuseMatrix;\nuniform vec2 vDiffuseInfos;\n#endif\n\n#ifdef AMBIENT\nvarying vec2 vAmbientUV;\nuniform mat4 ambientMatrix;\nuniform vec2 vAmbientInfos;\n#endif\n\n#ifdef OPACITY\nvarying vec2 vOpacityUV;\nuniform mat4 opacityMatrix;\nuniform vec2 vOpacityInfos;\n#endif\n\n#ifdef EMISSIVE\nvarying vec2 vEmissiveUV;\nuniform vec2 vEmissiveInfos;\nuniform mat4 emissiveMatrix;\n#endif\n\n#ifdef SPECULAR\nvarying vec2 vSpecularUV;\nuniform vec2 vSpecularInfos;\nuniform mat4 specularMatrix;\n#endif\n\n#ifdef BUMP\nvarying vec2 vBumpUV;\nuniform vec2 vBumpInfos;\nuniform mat4 bumpMatrix;\n#endif\n\n#ifdef BONES\nuniform mat4 mBones[BonesPerMesh];\n#endif\n\n#ifdef POINTSIZE\nuniform float pointSize;\n#endif\n\nvarying vec3 vPositionW;\n#ifdef NORMAL\nvarying vec3 vNormalW;\n#endif\n\n#ifdef VERTEXCOLOR\nvarying vec4 vColor;\n#endif\n\n#ifdef CLIPPLANE\nuniform vec4 vClipPlane;\nvarying float fClipDistance;\n#endif\n\n#ifdef FOG\nvarying float fFogDistance;\n#endif\n\n#ifdef SHADOWS\n#ifdef LIGHT0\nuniform mat4 lightMatrix0;\nvarying vec4 vPositionFromLight0;\n#endif\n#ifdef LIGHT1\nuniform mat4 lightMatrix1;\nvarying vec4 vPositionFromLight1;\n#endif\n#ifdef LIGHT2\nuniform mat4 lightMatrix2;\nvarying vec4 vPositionFromLight2;\n#endif\n#ifdef LIGHT3\nuniform mat4 lightMatrix3;\nvarying vec4 vPositionFromLight3;\n#endif\n#endif\n\n#ifdef REFLECTION\nvarying vec3 vPositionUVW;\n#endif\n\nvoid main(void) {\nmat4 finalWorld;\n\n#ifdef REFLECTION\nvPositionUVW = position;\n#endif\n\n#ifdef INSTANCES\nfinalWorld = mat4(world0, world1, world2, world3);\n#else\nfinalWorld = world;\n#endif\n\n#ifdef BONES\nmat4 m0 = mBones[int(matricesIndices.x)] * matricesWeights.x;\nmat4 m1 = mBones[int(matricesIndices.y)] * matricesWeights.y;\nmat4 m2 = mBones[int(matricesIndices.z)] * matricesWeights.z;\n\n#ifdef BONES4\nmat4 m3 = mBones[int(matricesIndices.w)] * matricesWeights.w;\nfinalWorld = finalWorld * (m0 + m1 + m2 + m3);\n#else\nfinalWorld = finalWorld * (m0 + m1 + m2);\n#endif\n\n#endif\ngl_Position = viewProjection * finalWorld * vec4(position, 1.0);\n\nvec4 worldPos = finalWorld * vec4(position, 1.0);\nvPositionW = vec3(worldPos);\n\n#ifdef NORMAL\nvNormalW = normalize(vec3(finalWorld * vec4(normal, 0.0)));\n#endif\n\n#ifndef UV1\nvec2 uv = vec2(0., 0.);\n#endif\n#ifndef UV2\nvec2 uv2 = vec2(0., 0.);\n#endif\n\n#ifdef DIFFUSE\nif (vDiffuseInfos.x == 0.)\n{\nvDiffuseUV = vec2(diffuseMatrix * vec4(uv, 1.0, 0.0));\n}\nelse\n{\nvDiffuseUV = vec2(diffuseMatrix * vec4(uv2, 1.0, 0.0));\n}\n#endif\n\n#ifdef AMBIENT\nif (vAmbientInfos.x == 0.)\n{\nvAmbientUV = vec2(ambientMatrix * vec4(uv, 1.0, 0.0));\n}\nelse\n{\nvAmbientUV = vec2(ambientMatrix * vec4(uv2, 1.0, 0.0));\n}\n#endif\n\n#ifdef OPACITY\nif (vOpacityInfos.x == 0.)\n{\nvOpacityUV = vec2(opacityMatrix * vec4(uv, 1.0, 0.0));\n}\nelse\n{\nvOpacityUV = vec2(opacityMatrix * vec4(uv2, 1.0, 0.0));\n}\n#endif\n\n#ifdef EMISSIVE\nif (vEmissiveInfos.x == 0.)\n{\nvEmissiveUV = vec2(emissiveMatrix * vec4(uv, 1.0, 0.0));\n}\nelse\n{\nvEmissiveUV = vec2(emissiveMatrix * vec4(uv2, 1.0, 0.0));\n}\n#endif\n\n#ifdef SPECULAR\nif (vSpecularInfos.x == 0.)\n{\nvSpecularUV = vec2(specularMatrix * vec4(uv, 1.0, 0.0));\n}\nelse\n{\nvSpecularUV = vec2(specularMatrix * vec4(uv2, 1.0, 0.0));\n}\n#endif\n\n#ifdef BUMP\nif (vBumpInfos.x == 0.)\n{\nvBumpUV = vec2(bumpMatrix * vec4(uv, 1.0, 0.0));\n}\nelse\n{\nvBumpUV = vec2(bumpMatrix * vec4(uv2, 1.0, 0.0));\n}\n#endif\n\n#ifdef CLIPPLANE\nfClipDistance = dot(worldPos, vClipPlane);\n#endif\n\n#ifdef FOG\nfFogDistance = (view * worldPos).z;\n#endif\n\n#ifdef SHADOWS\n#ifdef LIGHT0\nvPositionFromLight0 = lightMatrix0 * worldPos;\n#endif\n#ifdef LIGHT1\nvPositionFromLight1 = lightMatrix1 * worldPos;\n#endif\n#ifdef LIGHT2\nvPositionFromLight2 = lightMatrix2 * worldPos;\n#endif\n#ifdef LIGHT3\nvPositionFromLight3 = lightMatrix3 * worldPos;\n#endif\n#endif\n\n#ifdef VERTEXCOLOR\nvColor = color;\n#endif\n\n#ifdef POINTSIZE\ngl_PointSize = pointSize;\n#endif\n}",
  14679. depthPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n#ifdef ALPHATEST\nvarying vec2 vUV;\nuniform sampler2D diffuseSampler;\n#endif\n\nuniform float far;\n\nvoid main(void)\n{\n#ifdef ALPHATEST\nif (texture2D(diffuseSampler, vUV).a < 0.4)\ndiscard;\n#endif\n\nfloat depth = (gl_FragCoord.z / gl_FragCoord.w) / far;\ngl_FragColor = vec4(depth, depth * depth, 0.0, 1.0);\n}",
  14680. depthVertexShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\nattribute vec3 position;\n#ifdef BONES\nattribute vec4 matricesIndices;\nattribute vec4 matricesWeights;\n#endif\n\n#ifdef INSTANCES\nattribute vec4 world0;\nattribute vec4 world1;\nattribute vec4 world2;\nattribute vec4 world3;\n#else\nuniform mat4 world;\n#endif\n\nuniform mat4 viewProjection;\n#ifdef BONES\nuniform mat4 mBones[BonesPerMesh];\n#endif\n\n#if defined(ALPHATEST) || defined(NEED_UV)\nvarying vec2 vUV;\nuniform mat4 diffuseMatrix;\n#ifdef UV1\nattribute vec2 uv;\n#endif\n#ifdef UV2\nattribute vec2 uv2;\n#endif\n#endif\n\nvoid main(void)\n{\n#ifdef INSTANCES\nmat4 finalWorld = mat4(world0, world1, world2, world3);\n#else\nmat4 finalWorld = world;\n#endif\n\n#ifdef BONES\nmat4 m0 = mBones[int(matricesIndices.x)] * matricesWeights.x;\nmat4 m1 = mBones[int(matricesIndices.y)] * matricesWeights.y;\nmat4 m2 = mBones[int(matricesIndices.z)] * matricesWeights.z;\nmat4 m3 = mBones[int(matricesIndices.w)] * matricesWeights.w;\nfinalWorld = finalWorld * (m0 + m1 + m2 + m3);\ngl_Position = viewProjection * finalWorld * vec4(position, 1.0);\n#else\ngl_Position = viewProjection * finalWorld * vec4(position, 1.0);\n#endif\n\n#if defined(ALPHATEST) || defined(BASIC_RENDER)\n#ifdef UV1\nvUV = vec2(diffuseMatrix * vec4(uv, 1.0, 0.0));\n#endif\n#ifdef UV2\nvUV = vec2(diffuseMatrix * vec4(uv2, 1.0, 0.0));\n#endif\n#endif\n}",
  14681. depthBoxBlurPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\nvarying vec2 vUV;\nuniform sampler2D textureSampler;\n\nuniform vec2 screenSize;\n\nvoid main(void)\n{\nvec4 colorDepth = vec4(0.0);\n\nfor (int x = -OFFSET; x <= OFFSET; x++)\nfor (int y = -OFFSET; y <= OFFSET; y++)\ncolorDepth += texture2D(textureSampler, vUV + vec2(x, y) / screenSize);\n\ngl_FragColor = (colorDepth / float((OFFSET * 2 + 1) * (OFFSET * 2 + 1)));\n}",
  14682. depthOfFieldPixelShader:"\n#ifdef GL_ES\nprecision highp float;\n#endif\n\n\nuniform sampler2D textureSampler;\nuniform sampler2D highlightsSampler;\nuniform sampler2D depthSampler;\nuniform sampler2D grainSampler;\n\nuniform float grain_amount;\nuniform float maxZ;\nuniform bool blur_noise;\nuniform float screen_width;\nuniform float screen_height;\nuniform float distortion;\nuniform float focus_depth;\nuniform float aperture;\nuniform float edge_blur;\nuniform bool highlights;\n\nvarying vec2 vUV;\n\n#define PI 3.14159265\n\nvec2 centered_screen_pos;\nfloat radius2;\nfloat radius;\n\n\nvec2 getDistortedCoords(vec2 coords) {\n\nif (distortion == 0.0) { return coords; }\n\nvec2 direction = 1.0 * normalize(centered_screen_pos);\nvec2 dist_coords = vec2(0.5, 0.5);\ndist_coords.x = 0.5 + direction.x * radius2 * 1.0;\ndist_coords.y = 0.5 + direction.y * radius2 * 1.0;\nfloat dist_amount = clamp(distortion*0.23, 0.0, 1.0);\n\ndist_coords = mix(coords, dist_coords, dist_amount);\n\nreturn dist_coords;\n}\n\nvec4 getBlurColor(vec2 coords, float size) {\n\nvec4 col = texture2D(textureSampler, coords);\nif (size == 0.0) { return col; }\n\nfloat blur_level = min(3.0, ceil(size / 1.0));\n\nfloat w = (size / screen_width);\nfloat h = (size / screen_height);\nfloat total_weight = 1.0;\n\ncol += texture2D(textureSampler, coords + vec2(-0.53*w, 0.15*h))*0.93;\ncol += texture2D(textureSampler, coords + vec2(0.42*w, -0.69*h))*0.90;\ncol += texture2D(textureSampler, coords + vec2(0.20*w, 1.00*h))*0.87;\ncol += texture2D(textureSampler, coords + vec2(-0.97*w, -0.72*h))*0.85;\ncol += texture2D(textureSampler, coords + vec2(1.37*w, -0.14*h))*0.83;\ncol += texture2D(textureSampler, coords + vec2(-1.02*w, 1.16*h))*0.80;\ncol += texture2D(textureSampler, coords + vec2(-0.03*w, -1.69*h))*0.78;\ncol += texture2D(textureSampler, coords + vec2(1.27*w, 1.34*h))*0.76;\ncol += texture2D(textureSampler, coords + vec2(-1.98*w, -0.14*h))*0.74;\ncol += texture2D(textureSampler, coords + vec2(1.66*w, -1.32*h))*0.72;\ntotal_weight += 8.18;\n\nif (blur_level > 1.0) {\ncol += texture2D(textureSampler, coords + vec2(-0.35*w, 2.22*h))*0.70;\ncol += texture2D(textureSampler, coords + vec2(-1.31*w, -1.98*h))*0.67;\ncol += texture2D(textureSampler, coords + vec2(2.42*w, 0.61*h))*0.65;\ncol += texture2D(textureSampler, coords + vec2(-2.31*w, 1.25*h))*0.63;\ncol += texture2D(textureSampler, coords + vec2(0.90*w, -2.59*h))*0.61;\ncol += texture2D(textureSampler, coords + vec2(1.14*w, 2.62*h))*0.59;\ncol += texture2D(textureSampler, coords + vec2(-2.72*w, -1.21*h))*0.56;\ncol += texture2D(textureSampler, coords + vec2(2.93*w, -0.98*h))*0.54;\ncol += texture2D(textureSampler, coords + vec2(-1.56*w, 2.80*h))*0.52;\ncol += texture2D(textureSampler, coords + vec2(-0.77*w, -3.22*h))*0.49;\ntotal_weight += 5.96;\n}\n\nif (blur_level > 2.0) {\ncol += texture2D(textureSampler, coords + vec2(2.83*w, 1.92*h))*0.46;\ncol += texture2D(textureSampler, coords + vec2(-3.49*w, 0.51*h))*0.44;\ncol += texture2D(textureSampler, coords + vec2(2.30*w, -2.82*h))*0.41;\ncol += texture2D(textureSampler, coords + vec2(0.22*w, 3.74*h))*0.38;\ncol += texture2D(textureSampler, coords + vec2(-2.76*w, -2.68*h))*0.34;\ncol += texture2D(textureSampler, coords + vec2(3.95*w, 0.11*h))*0.31;\ncol += texture2D(textureSampler, coords + vec2(-3.07*w, 2.65*h))*0.26;\ncol += texture2D(textureSampler, coords + vec2(0.48*w, -4.13*h))*0.22;\ncol += texture2D(textureSampler, coords + vec2(2.49*w, 3.46*h))*0.15;\ntotal_weight += 2.97;\n}\n\ncol /= total_weight; // scales color according to weights\ncol.a = 1.0;\n\n\nreturn col;\n}\n\nvec2 rand(vec2 co)\n{\nfloat noise1 = (fract(sin(dot(co, vec2(12.9898, 78.233))) * 43758.5453));\nfloat noise2 = (fract(sin(dot(co, vec2(12.9898, 78.233)*2.0)) * 43758.5453));\nreturn clamp(vec2(noise1, noise2), 0.0, 1.0);\n}\n\nvoid main(void)\n{\n\ncentered_screen_pos = vec2(vUV.x - 0.5, vUV.y - 0.5);\nradius2 = centered_screen_pos.x*centered_screen_pos.x + centered_screen_pos.y*centered_screen_pos.y;\nradius = sqrt(radius2);\n\nvec4 final_color;\nvec2 distorted_coords = getDistortedCoords(vUV);\nvec2 texels_coords = vec2(vUV.x * screen_width, vUV.y * screen_height); // varies from 0 to SCREEN_WIDTH or _HEIGHT\n\nfloat dof_blur_amount = 0.0;\nfloat depth_bias = 0.0; // positive if the pixel is further than focus depth; negative if closer\nif (focus_depth != -1.0) {\nvec4 depth_sample = texture2D(depthSampler, distorted_coords);\nfloat depth = depth_sample.r;\ndepth_bias = depth - focus_depth;\n\nif (depth_bias > 0.0) { dof_blur_amount = depth_bias * aperture * 2.2; }\nelse { dof_blur_amount = depth_bias * depth_bias * aperture * 30.0; }\n\nif (dof_blur_amount < 0.05) { dof_blur_amount = 0.0; } // no blur at all\n}\n\nfloat edge_blur_amount = 0.0;\nif (edge_blur > 0.0) {\nedge_blur_amount = clamp((radius*2.0 - 1.0 + 0.15*edge_blur) * 1.5, 0.0, 1.0) * 1.3;\n}\n\nfloat blur_amount = max(edge_blur_amount, dof_blur_amount);\n\nif (blur_amount == 0.0) {\ngl_FragColor = texture2D(textureSampler, distorted_coords);\n}\nelse {\n\ngl_FragColor = getBlurColor(distorted_coords, blur_amount * 1.7);\n\nif (depth_bias > 0.0 && highlights) {\ngl_FragColor += clamp(dof_blur_amount, 0.0, 1.0)*texture2D(highlightsSampler, distorted_coords);\n}\n\nif (blur_noise) {\nvec2 noise = rand(distorted_coords) * 0.01 * blur_amount;\nvec2 blurred_coord = vec2(distorted_coords.x + noise.x, distorted_coords.y + noise.y);\ngl_FragColor = 0.04 * texture2D(textureSampler, blurred_coord) + 0.96 * gl_FragColor;\n}\n}\n\nif (grain_amount > 0.0) {\nvec4 grain_color = texture2D(grainSampler, texels_coords*0.003);\ngl_FragColor.rgb += (-0.5 + grain_color.rgb) * 0.20;\n}\n}",
  14683. displayPassPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\nvarying vec2 vUV;\nuniform sampler2D textureSampler;\nuniform sampler2D passSampler;\n\nvoid main(void)\n{\ngl_FragColor = texture2D(passSampler, vUV);\n}",
  14684. filterPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\nvarying vec2 vUV;\nuniform sampler2D textureSampler;\n\nuniform mat4 kernelMatrix;\n\nvoid main(void)\n{\nvec3 baseColor = texture2D(textureSampler, vUV).rgb;\nvec3 updatedColor = (kernelMatrix * vec4(baseColor, 1.0)).rgb;\n\ngl_FragColor = vec4(updatedColor, 1.0);\n}",
  14685. firePixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\nuniform float time;\nuniform vec3 c1;\nuniform vec3 c2;\nuniform vec3 c3;\nuniform vec3 c4;\nuniform vec3 c5;\nuniform vec3 c6;\nuniform vec2 speed;\nuniform float shift;\nuniform float alphaThreshold;\n\nvarying vec2 vUV;\n\nfloat rand(vec2 n) {\nreturn fract(cos(dot(n, vec2(12.9898, 4.1414))) * 43758.5453);\n}\n\nfloat noise(vec2 n) {\nconst vec2 d = vec2(0.0, 1.0);\nvec2 b = floor(n), f = smoothstep(vec2(0.0), vec2(1.0), fract(n));\nreturn mix(mix(rand(b), rand(b + d.yx), f.x), mix(rand(b + d.xy), rand(b + d.yy), f.x), f.y);\n}\n\nfloat fbm(vec2 n) {\nfloat total = 0.0, amplitude = 1.0;\nfor (int i = 0; i < 4; i++) {\ntotal += noise(n) * amplitude;\nn += n;\namplitude *= 0.5;\n}\nreturn total;\n}\n\nvoid main() {\nvec2 p = vUV * 8.0;\nfloat q = fbm(p - time * 0.1);\nvec2 r = vec2(fbm(p + q + time * speed.x - p.x - p.y), fbm(p + q - time * speed.y));\nvec3 c = mix(c1, c2, fbm(p + r)) + mix(c3, c4, r.x) - mix(c5, c6, r.y);\nvec3 color = c * cos(shift * vUV.y);\nfloat luminance = dot(color.rgb, vec3(0.3, 0.59, 0.11));\n\ngl_FragColor = vec4(color, luminance * alphaThreshold + (1.0 - alphaThreshold));\n}",
  14686. fxaaPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n#define FXAA_REDUCE_MIN (1.0/128.0)\n#define FXAA_REDUCE_MUL (1.0/8.0)\n#define FXAA_SPAN_MAX 8.0\n\nvarying vec2 vUV;\nuniform sampler2D textureSampler;\nuniform vec2 texelSize;\n\nvoid main(){\nvec2 localTexelSize = texelSize;\nvec4 rgbNW = texture2D(textureSampler, (vUV + vec2(-1.0, -1.0) * localTexelSize));\nvec4 rgbNE = texture2D(textureSampler, (vUV + vec2(1.0, -1.0) * localTexelSize));\nvec4 rgbSW = texture2D(textureSampler, (vUV + vec2(-1.0, 1.0) * localTexelSize));\nvec4 rgbSE = texture2D(textureSampler, (vUV + vec2(1.0, 1.0) * localTexelSize));\nvec4 rgbM = texture2D(textureSampler, vUV);\nvec4 luma = vec4(0.299, 0.587, 0.114, 1.0);\nfloat lumaNW = dot(rgbNW, luma);\nfloat lumaNE = dot(rgbNE, luma);\nfloat lumaSW = dot(rgbSW, luma);\nfloat lumaSE = dot(rgbSE, luma);\nfloat lumaM = dot(rgbM, luma);\nfloat lumaMin = min(lumaM, min(min(lumaNW, lumaNE), min(lumaSW, lumaSE)));\nfloat lumaMax = max(lumaM, max(max(lumaNW, lumaNE), max(lumaSW, lumaSE)));\n\nvec2 dir = vec2(-((lumaNW + lumaNE) - (lumaSW + lumaSE)), ((lumaNW + lumaSW) - (lumaNE + lumaSE)));\n\nfloat dirReduce = max(\n(lumaNW + lumaNE + lumaSW + lumaSE) * (0.25 * FXAA_REDUCE_MUL),\nFXAA_REDUCE_MIN);\n\nfloat rcpDirMin = 1.0 / (min(abs(dir.x), abs(dir.y)) + dirReduce);\ndir = min(vec2(FXAA_SPAN_MAX, FXAA_SPAN_MAX),\nmax(vec2(-FXAA_SPAN_MAX, -FXAA_SPAN_MAX),\ndir * rcpDirMin)) * localTexelSize;\n\nvec4 rgbA = 0.5 * (\ntexture2D(textureSampler, vUV + dir * (1.0 / 3.0 - 0.5)) +\ntexture2D(textureSampler, vUV + dir * (2.0 / 3.0 - 0.5)));\n\nvec4 rgbB = rgbA * 0.5 + 0.25 * (\ntexture2D(textureSampler, vUV + dir * -0.5) +\ntexture2D(textureSampler, vUV + dir * 0.5));\nfloat lumaB = dot(rgbB, luma);\nif ((lumaB < lumaMin) || (lumaB > lumaMax)) {\ngl_FragColor = rgbA;\n}\nelse {\ngl_FragColor = rgbB;\n}\n}",
  14687. grassPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\nvarying vec2 vPosition;\nvarying vec2 vUV;\n\nuniform vec3 herb1Color;\nuniform vec3 herb2Color;\nuniform vec3 herb3Color;\nuniform vec3 groundColor;\n\nfloat rand(vec2 n) {\nreturn fract(cos(dot(n, vec2(12.9898, 4.1414))) * 43758.5453);\n}\n\nfloat noise(vec2 n) {\nconst vec2 d = vec2(0.0, 1.0);\nvec2 b = floor(n), f = smoothstep(vec2(0.0), vec2(1.0), fract(n));\nreturn mix(mix(rand(b), rand(b + d.yx), f.x), mix(rand(b + d.xy), rand(b + d.yy), f.x), f.y);\n}\n\nfloat fbm(vec2 n) {\nfloat total = 0.0, amplitude = 1.0;\nfor (int i = 0; i < 4; i++) {\ntotal += noise(n) * amplitude;\nn += n;\namplitude *= 0.5;\n}\nreturn total;\n}\n\nvoid main(void) {\nvec3 color = mix(groundColor, herb1Color, rand(gl_FragCoord.xy * 4.0));\ncolor = mix(color, herb2Color, rand(gl_FragCoord.xy * 8.0));\ncolor = mix(color, herb3Color, rand(gl_FragCoord.xy));\ncolor = mix(color, herb1Color, fbm(gl_FragCoord.xy * 16.0));\ngl_FragColor = vec4(color, 1.0);\n}",
  14688. layerPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\nvarying vec2 vUV;\nuniform sampler2D textureSampler;\n\nuniform vec4 color;\n\nvoid main(void) {\nvec4 baseColor = texture2D(textureSampler, vUV);\n\ngl_FragColor = baseColor * color;\n}",
  14689. layerVertexShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\nattribute vec2 position;\n\nuniform mat4 textureMatrix;\n\nvarying vec2 vUV;\n\nconst vec2 madd = vec2(0.5, 0.5);\n\nvoid main(void) {\n\nvUV = vec2(textureMatrix * vec4(position * madd + madd, 1.0, 0.0));\ngl_Position = vec4(position, 0.0, 1.0);\n}",
  14690. legacydefaultPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n#define MAP_PROJECTION 4.\n\nuniform vec3 vEyePosition;\nuniform vec3 vAmbientColor;\nuniform vec4 vDiffuseColor;\nuniform vec4 vSpecularColor;\nuniform vec3 vEmissiveColor;\n\nvarying vec3 vPositionW;\nvarying vec3 vNormalW;\n\n#ifdef VERTEXCOLOR\nvarying vec4 vColor;\n#endif\n\n#ifdef LIGHT0\nuniform vec4 vLightData0;\nuniform vec4 vLightDiffuse0;\nuniform vec3 vLightSpecular0;\n#ifdef SHADOW0\nvarying vec4 vPositionFromLight0;\nuniform sampler2D shadowSampler0;\n#endif\n#ifdef SPOTLIGHT0\nuniform vec4 vLightDirection0;\n#endif\n#ifdef HEMILIGHT0\nuniform vec3 vLightGround0;\n#endif\n#endif\n\n#ifdef LIGHT1\nuniform vec4 vLightData1;\nuniform vec4 vLightDiffuse1;\nuniform vec3 vLightSpecular1;\n#ifdef SHADOW1\nvarying vec4 vPositionFromLight1;\nuniform sampler2D shadowSampler1;\n#endif\n#ifdef SPOTLIGHT1\nuniform vec4 vLightDirection1;\n#endif\n#ifdef HEMILIGHT1\nuniform vec3 vLightGround1;\n#endif\n#endif\n\n#ifdef LIGHT2\nuniform vec4 vLightData2;\nuniform vec4 vLightDiffuse2;\nuniform vec3 vLightSpecular2;\n#ifdef SHADOW2\nvarying vec4 vPositionFromLight2;\nuniform sampler2D shadowSampler2;\n#endif\n#ifdef SPOTLIGHT2\nuniform vec4 vLightDirection2;\n#endif\n#ifdef HEMILIGHT2\nuniform vec3 vLightGround2;\n#endif\n#endif\n\n#ifdef LIGHT3\nuniform vec4 vLightData3;\nuniform vec4 vLightDiffuse3;\nuniform vec3 vLightSpecular3;\n#ifdef SHADOW3\nvarying vec4 vPositionFromLight3;\nuniform sampler2D shadowSampler3;\n#endif\n#ifdef SPOTLIGHT3\nuniform vec4 vLightDirection3;\n#endif\n#ifdef HEMILIGHT3\nuniform vec3 vLightGround3;\n#endif\n#endif\n\n#ifdef DIFFUSE\nvarying vec2 vDiffuseUV;\nuniform sampler2D diffuseSampler;\nuniform vec2 vDiffuseInfos;\n#endif\n\n#ifdef AMBIENT\nvarying vec2 vAmbientUV;\nuniform sampler2D ambientSampler;\nuniform vec2 vAmbientInfos;\n#endif\n\n#ifdef OPACITY\nvarying vec2 vOpacityUV;\nuniform sampler2D opacitySampler;\nuniform vec2 vOpacityInfos;\n#endif\n\n#ifdef REFLECTION\nvarying vec3 vReflectionUVW;\nuniform samplerCube reflectionCubeSampler;\nuniform sampler2D reflection2DSampler;\nuniform vec3 vReflectionInfos;\n#endif\n\n#ifdef EMISSIVE\nvarying vec2 vEmissiveUV;\nuniform vec2 vEmissiveInfos;\nuniform sampler2D emissiveSampler;\n#endif\n\n#ifdef SPECULAR\nvarying vec2 vSpecularUV;\nuniform vec2 vSpecularInfos;\nuniform sampler2D specularSampler;\n#endif\n\n#ifdef FRESNEL\nfloat computeFresnelTerm(vec3 viewDirection, vec3 worldNormal, float bias, float power)\n{\nfloat fresnelTerm = pow(bias + abs(dot(viewDirection, worldNormal)), power);\nreturn clamp(fresnelTerm, 0., 1.);\n}\n#endif\n\n#ifdef DIFFUSEFRESNEL\nuniform vec4 diffuseLeftColor;\nuniform vec4 diffuseRightColor;\n#endif\n\n#ifdef OPACITYFRESNEL\nuniform vec4 opacityParts;\n#endif\n\n#ifdef REFLECTIONFRESNEL\nuniform vec4 reflectionLeftColor;\nuniform vec4 reflectionRightColor;\n#endif\n\n#ifdef EMISSIVEFRESNEL\nuniform vec4 emissiveLeftColor;\nuniform vec4 emissiveRightColor;\n#endif\n\n#ifdef SHADOWS\n\nfloat unpack(vec4 color)\n{\nconst vec4 bitShift = vec4(1. / (255. * 255. * 255.), 1. / (255. * 255.), 1. / 255., 1.);\nreturn dot(color, bitShift);\n}\n\nfloat unpackHalf(vec2 color)\n{\nreturn color.x + (color.y / 255.0);\n}\n\nfloat computeShadow(vec4 vPositionFromLight, sampler2D shadowSampler)\n{\nvec3 depth = vPositionFromLight.xyz / vPositionFromLight.w;\nvec2 uv = 0.5 * depth.xy + vec2(0.5, 0.5);\n\nif (uv.x < 0. || uv.x > 1.0 || uv.y < 0. || uv.y > 1.0)\n{\nreturn 1.0;\n}\n\nfloat shadow = unpack(texture2D(shadowSampler, uv));\n\nif (depth.z > shadow)\n{\nreturn 0.;\n}\nreturn 1.;\n}\n\nfloat ChebychevInequality(vec2 moments, float t)\n{\nif (t <= moments.x)\n{\nreturn 1.0;\n}\n\nfloat variance = moments.y - (moments.x * moments.x);\nvariance = max(variance, 0.);\n\nfloat d = t - moments.x;\nreturn variance / (variance + d * d);\n}\n\nfloat computeShadowWithVSM(vec4 vPositionFromLight, sampler2D shadowSampler)\n{\nvec3 depth = vPositionFromLight.xyz / vPositionFromLight.w;\nvec2 uv = 0.5 * depth.xy + vec2(0.5, 0.5);\n\nif (uv.x < 0. || uv.x > 1.0 || uv.y < 0. || uv.y > 1.0)\n{\nreturn 1.0;\n}\n\nvec4 texel = texture2D(shadowSampler, uv);\n\nvec2 moments = vec2(unpackHalf(texel.xy), unpackHalf(texel.zw));\nreturn clamp(1.3 - ChebychevInequality(moments, depth.z), 0., 1.0);\n}\n#endif\n\n#ifdef CLIPPLANE\nvarying float fClipDistance;\n#endif\n\n#ifdef FOG\n\n#define FOGMODE_NONE 0.\n#define FOGMODE_EXP 1.\n#define FOGMODE_EXP2 2.\n#define FOGMODE_LINEAR 3.\n#define E 2.71828\n\nuniform vec4 vFogInfos;\nuniform vec3 vFogColor;\nvarying float fFogDistance;\n\nfloat CalcFogFactor()\n{\nfloat fogCoeff = 1.0;\nfloat fogStart = vFogInfos.y;\nfloat fogEnd = vFogInfos.z;\nfloat fogDensity = vFogInfos.w;\n\nif (FOGMODE_LINEAR == vFogInfos.x)\n{\nfogCoeff = (fogEnd - fFogDistance) / (fogEnd - fogStart);\n}\nelse if (FOGMODE_EXP == vFogInfos.x)\n{\nfogCoeff = 1.0 / pow(E, fFogDistance * fogDensity);\n}\nelse if (FOGMODE_EXP2 == vFogInfos.x)\n{\nfogCoeff = 1.0 / pow(E, fFogDistance * fFogDistance * fogDensity * fogDensity);\n}\n\nreturn clamp(fogCoeff, 0.0, 1.0);\n}\n#endif\n\nmat3 computeLighting(vec3 viewDirectionW, vec3 vNormal, vec4 lightData, vec4 diffuseColor, vec3 specularColor) {\nmat3 result;\n\nvec3 lightVectorW;\nif (lightData.w == 0.)\n{\nlightVectorW = normalize(lightData.xyz - vPositionW);\n}\nelse\n{\nlightVectorW = normalize(-lightData.xyz);\n}\n\nfloat ndl = max(0., dot(vNormal, lightVectorW));\n\nvec3 angleW = normalize(viewDirectionW + lightVectorW);\nfloat specComp = max(0., dot(vNormal, angleW));\nspecComp = max(0., pow(specComp, max(1.0, vSpecularColor.a)));\n\nresult[0] = ndl * diffuseColor.rgb;\nresult[1] = specComp * specularColor;\nresult[2] = vec3(0.);\n\nreturn result;\n}\n\nmat3 computeSpotLighting(vec3 viewDirectionW, vec3 vNormal, vec4 lightData, vec4 lightDirection, vec4 diffuseColor, vec3 specularColor) {\nmat3 result;\n\nvec3 lightVectorW = normalize(lightData.xyz - vPositionW);\n\nfloat cosAngle = max(0., dot(-lightDirection.xyz, lightVectorW));\nfloat spotAtten = 0.0;\n\nif (cosAngle >= lightDirection.w)\n{\ncosAngle = max(0., pow(cosAngle, lightData.w));\nspotAtten = max(0., (cosAngle - lightDirection.w) / (1. - cosAngle));\n\nfloat ndl = max(0., dot(vNormal, -lightDirection.xyz));\n\nvec3 angleW = normalize(viewDirectionW - lightDirection.xyz);\nfloat specComp = max(0., dot(vNormal, angleW));\nspecComp = pow(specComp, vSpecularColor.a);\n\nresult[0] = ndl * spotAtten * diffuseColor.rgb;\nresult[1] = specComp * specularColor * spotAtten;\nresult[2] = vec3(0.);\n\nreturn result;\n}\n\nresult[0] = vec3(0.);\nresult[1] = vec3(0.);\nresult[2] = vec3(0.);\n\nreturn result;\n}\n\nmat3 computeHemisphericLighting(vec3 viewDirectionW, vec3 vNormal, vec4 lightData, vec4 diffuseColor, vec3 specularColor, vec3 groundColor) {\nmat3 result;\n\nfloat ndl = dot(vNormal, lightData.xyz) * 0.5 + 0.5;\n\nvec3 angleW = normalize(viewDirectionW + lightData.xyz);\nfloat specComp = max(0., dot(vNormal, angleW));\nspecComp = pow(specComp, vSpecularColor.a);\n\nresult[0] = mix(groundColor, diffuseColor.rgb, ndl);\nresult[1] = specComp * specularColor;\nresult[2] = vec3(0.);\n\nreturn result;\n}\n\nvoid main(void) {\n#ifdef CLIPPLANE\nif (fClipDistance > 0.0)\ndiscard;\n#endif\n\nvec3 viewDirectionW = normalize(vEyePosition - vPositionW);\n\nvec4 baseColor = vec4(1., 1., 1., 1.);\nvec3 diffuseColor = vDiffuseColor.rgb;\n\n#ifdef VERTEXCOLOR\nbaseColor.rgb *= vColor.rgb;\n#endif\n\n#ifdef DIFFUSE\nbaseColor = texture2D(diffuseSampler, vDiffuseUV);\n\n#ifdef ALPHATEST\nif (baseColor.a < 0.4)\ndiscard;\n#endif\n\nbaseColor.rgb *= vDiffuseInfos.y;\n#endif\n\nvec3 normalW = normalize(vNormalW);\n\nvec3 baseAmbientColor = vec3(1., 1., 1.);\n\n#ifdef AMBIENT\nbaseAmbientColor = texture2D(ambientSampler, vAmbientUV).rgb * vAmbientInfos.y;\n#endif\n\nvec3 diffuseBase = vec3(0., 0., 0.);\nvec3 specularBase = vec3(0., 0., 0.);\nfloat shadow = 1.;\n\n#ifdef LIGHT0\n#ifdef SPOTLIGHT0\nmat3 info = computeSpotLighting(viewDirectionW, normalW, vLightData0, vLightDirection0, vLightDiffuse0, vLightSpecular0);\n#endif\n#ifdef HEMILIGHT0\nmat3 info = computeHemisphericLighting(viewDirectionW, normalW, vLightData0, vLightDiffuse0, vLightSpecular0, vLightGround0);\n#endif\n#ifdef POINTDIRLIGHT0\nmat3 info = computeLighting(viewDirectionW, normalW, vLightData0, vLightDiffuse0, vLightSpecular0);\n#endif\n#ifdef SHADOW0\n#ifdef SHADOWVSM0\nshadow = computeShadowWithVSM(vPositionFromLight0, shadowSampler0);\n#else\nshadow = computeShadow(vPositionFromLight0, shadowSampler0);\n#endif\n#else\nshadow = 1.;\n#endif\ndiffuseBase += info[0] * shadow;\nspecularBase += info[1] * shadow;\n#endif\n\n#ifdef LIGHT1\n#ifdef SPOTLIGHT1\ninfo = computeSpotLighting(viewDirectionW, normalW, vLightData1, vLightDirection1, vLightDiffuse1, vLightSpecular1);\n#endif\n#ifdef HEMILIGHT1\ninfo = computeHemisphericLighting(viewDirectionW, normalW, vLightData1, vLightDiffuse1, vLightSpecular1, vLightGround1);\n#endif\n#ifdef POINTDIRLIGHT1\ninfo = computeLighting(viewDirectionW, normalW, vLightData1, vLightDiffuse1, vLightSpecular1);\n#endif\n#ifdef SHADOW1\n#ifdef SHADOWVSM1\nshadow = computeShadowWithVSM(vPositionFromLight1, shadowSampler1);\n#else\nshadow = computeShadow(vPositionFromLight1, shadowSampler1);\n#endif\n#else\nshadow = 1.;\n#endif\ndiffuseBase += info[0] * shadow;\nspecularBase += info[1] * shadow;\n#endif\n\n#ifdef LIGHT2\n#ifdef SPOTLIGHT2\ninfo = computeSpotLighting(viewDirectionW, normalW, vLightData2, vLightDirection2, vLightDiffuse2, vLightSpecular2);\n#endif\n#ifdef HEMILIGHT2\ninfo = computeHemisphericLighting(viewDirectionW, normalW, vLightData2, vLightDiffuse2, vLightSpecular2, vLightGround2);\n#endif\n#ifdef POINTDIRLIGHT2\ninfo = computeLighting(viewDirectionW, normalW, vLightData2, vLightDiffuse2, vLightSpecular2);\n#endif\n#ifdef SHADOW2\n#ifdef SHADOWVSM2\nshadow = computeShadowWithVSM(vPositionFromLight2, shadowSampler2);\n#else\nshadow = computeShadow(vPositionFromLight2, shadowSampler2);\n#endif\n#else\nshadow = 1.;\n#endif\ndiffuseBase += info[0] * shadow;\nspecularBase += info[1] * shadow;\n#endif\n\n#ifdef LIGHT3\n#ifdef SPOTLIGHT3\ninfo = computeSpotLighting(viewDirectionW, normalW, vLightData3, vLightDirection3, vLightDiffuse3, vLightSpecular3);\n#endif\n#ifdef HEMILIGHT3\ninfo = computeHemisphericLighting(viewDirectionW, normalW, vLightData3, vLightDiffuse3, vLightSpecular3, vLightGround3);\n#endif\n#ifdef POINTDIRLIGHT3\ninfo = computeLighting(viewDirectionW, normalW, vLightData3, vLightDiffuse3, vLightSpecular3);\n#endif\n#ifdef SHADOW3\n#ifdef SHADOWVSM3\nshadow = computeShadowWithVSM(vPositionFromLight3, shadowSampler3);\n#else\nshadow = computeShadow(vPositionFromLight3, shadowSampler3);\n#endif\n#else\nshadow = 1.;\n#endif\ndiffuseBase += info[0] * shadow;\nspecularBase += info[1] * shadow;\n#endif\n\nvec3 reflectionColor = vec3(0., 0., 0.);\n\n#ifdef REFLECTION\nif (vReflectionInfos.z != 0.0)\n{\nreflectionColor = textureCube(reflectionCubeSampler, vReflectionUVW).rgb * vReflectionInfos.y;\n}\nelse\n{\nvec2 coords = vReflectionUVW.xy;\n\nif (vReflectionInfos.x == MAP_PROJECTION)\n{\ncoords /= vReflectionUVW.z;\n}\n\ncoords.y = 1.0 - coords.y;\n\nreflectionColor = texture2D(reflection2DSampler, coords).rgb * vReflectionInfos.y;\n}\n\n#ifdef REFLECTIONFRESNEL\nfloat reflectionFresnelTerm = computeFresnelTerm(viewDirectionW, normalW, reflectionRightColor.a, reflectionLeftColor.a);\n\nreflectionColor *= reflectionLeftColor.rgb * (1.0 - reflectionFresnelTerm) + reflectionFresnelTerm * reflectionRightColor.rgb;\n#endif\n#endif\n\nfloat alpha = vDiffuseColor.a;\n\n#ifdef OPACITY\nvec4 opacityMap = texture2D(opacitySampler, vOpacityUV);\n#ifdef OPACITYRGB\nopacityMap.rgb = opacityMap.rgb * vec3(0.3, 0.59, 0.11);\nalpha *= (opacityMap.x + opacityMap.y + opacityMap.z)* vOpacityInfos.y;\n#else\nalpha *= opacityMap.a * vOpacityInfos.y;\n#endif\n#endif\n\n#ifdef VERTEXALPHA\nalpha *= vColor.a;\n#endif\n\n#ifdef OPACITYFRESNEL\nfloat opacityFresnelTerm = computeFresnelTerm(viewDirectionW, normalW, opacityParts.z, opacityParts.w);\n\nalpha += opacityParts.x * (1.0 - opacityFresnelTerm) + opacityFresnelTerm * opacityParts.y;\n#endif\n\nvec3 emissiveColor = vEmissiveColor;\n#ifdef EMISSIVE\nemissiveColor += texture2D(emissiveSampler, vEmissiveUV).rgb * vEmissiveInfos.y;\n#endif\n\n#ifdef EMISSIVEFRESNEL\nfloat emissiveFresnelTerm = computeFresnelTerm(viewDirectionW, normalW, emissiveRightColor.a, emissiveLeftColor.a);\n\nemissiveColor *= emissiveLeftColor.rgb * (1.0 - emissiveFresnelTerm) + emissiveFresnelTerm * emissiveRightColor.rgb;\n#endif\n\nvec3 specularColor = vSpecularColor.rgb;\n#ifdef SPECULAR\nspecularColor = texture2D(specularSampler, vSpecularUV).rgb * vSpecularInfos.y;\n#endif\n\n#ifdef DIFFUSEFRESNEL\nfloat diffuseFresnelTerm = computeFresnelTerm(viewDirectionW, normalW, diffuseRightColor.a, diffuseLeftColor.a);\n\ndiffuseBase *= diffuseLeftColor.rgb * (1.0 - diffuseFresnelTerm) + diffuseFresnelTerm * diffuseRightColor.rgb;\n#endif\n\nvec3 finalDiffuse = clamp(diffuseBase * diffuseColor + emissiveColor + vAmbientColor, 0.0, 1.0) * baseColor.rgb;\nvec3 finalSpecular = specularBase * specularColor;\n\nvec4 color = vec4(finalDiffuse * baseAmbientColor + finalSpecular + reflectionColor, alpha);\n\n#ifdef FOG\nfloat fog = CalcFogFactor();\ncolor.rgb = fog * color.rgb + (1.0 - fog) * vFogColor;\n#endif\n\ngl_FragColor = color;\n}",
  14691. legacydefaultVertexShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n#define MAP_EXPLICIT 0.\n#define MAP_SPHERICAL 1.\n#define MAP_PLANAR 2.\n#define MAP_CUBIC 3.\n#define MAP_PROJECTION 4.\n#define MAP_SKYBOX 5.\n\nattribute vec3 position;\nattribute vec3 normal;\n#ifdef UV1\nattribute vec2 uv;\n#endif\n#ifdef UV2\nattribute vec2 uv2;\n#endif\n#ifdef VERTEXCOLOR\nattribute vec4 color;\n#endif\n#ifdef BONES\nattribute vec4 matricesIndices;\nattribute vec4 matricesWeights;\n#endif\n\nuniform mat4 world;\nuniform mat4 view;\nuniform mat4 viewProjection;\n\n#ifdef DIFFUSE\nvarying vec2 vDiffuseUV;\nuniform mat4 diffuseMatrix;\nuniform vec2 vDiffuseInfos;\n#endif\n\n#ifdef AMBIENT\nvarying vec2 vAmbientUV;\nuniform mat4 ambientMatrix;\nuniform vec2 vAmbientInfos;\n#endif\n\n#ifdef OPACITY\nvarying vec2 vOpacityUV;\nuniform mat4 opacityMatrix;\nuniform vec2 vOpacityInfos;\n#endif\n\n#ifdef REFLECTION\nuniform vec3 vEyePosition;\nvarying vec3 vReflectionUVW;\nuniform vec3 vReflectionInfos;\nuniform mat4 reflectionMatrix;\n#endif\n\n#ifdef EMISSIVE\nvarying vec2 vEmissiveUV;\nuniform vec2 vEmissiveInfos;\nuniform mat4 emissiveMatrix;\n#endif\n\n#ifdef SPECULAR\nvarying vec2 vSpecularUV;\nuniform vec2 vSpecularInfos;\nuniform mat4 specularMatrix;\n#endif\n\n#ifdef BUMP\nvarying vec2 vBumpUV;\nuniform vec2 vBumpInfos;\nuniform mat4 bumpMatrix;\n#endif\n\n#ifdef BONES\nuniform mat4 mBones[BonesPerMesh];\n#endif\n\nvarying vec3 vPositionW;\nvarying vec3 vNormalW;\n\n#ifdef VERTEXCOLOR\nvarying vec4 vColor;\n#endif\n\n#ifdef CLIPPLANE\nuniform vec4 vClipPlane;\nvarying float fClipDistance;\n#endif\n\n#ifdef FOG\nvarying float fFogDistance;\n#endif\n\n#ifdef SHADOWS\n#ifdef LIGHT0\nuniform mat4 lightMatrix0;\nvarying vec4 vPositionFromLight0;\n#endif\n#ifdef LIGHT1\nuniform mat4 lightMatrix1;\nvarying vec4 vPositionFromLight1;\n#endif\n#ifdef LIGHT2\nuniform mat4 lightMatrix2;\nvarying vec4 vPositionFromLight2;\n#endif\n#ifdef LIGHT3\nuniform mat4 lightMatrix3;\nvarying vec4 vPositionFromLight3;\n#endif\n#endif\n\n#ifdef REFLECTION\nvec3 computeReflectionCoords(float mode, vec4 worldPos, vec3 worldNormal)\n{\nif (mode == MAP_SPHERICAL)\n{\nvec3 coords = vec3(view * vec4(worldNormal, 0.0));\n\nreturn vec3(reflectionMatrix * vec4(coords, 1.0));\n}\nelse if (mode == MAP_PLANAR)\n{\nvec3 viewDir = worldPos.xyz - vEyePosition;\nvec3 coords = normalize(reflect(viewDir, worldNormal));\n\nreturn vec3(reflectionMatrix * vec4(coords, 1));\n}\nelse if (mode == MAP_CUBIC)\n{\nvec3 viewDir = worldPos.xyz - vEyePosition;\nvec3 coords = reflect(viewDir, worldNormal);\n\nreturn vec3(reflectionMatrix * vec4(coords, 0));\n}\nelse if (mode == MAP_PROJECTION)\n{\nreturn vec3(reflectionMatrix * (view * worldPos));\n}\nelse if (mode == MAP_SKYBOX)\n{\nreturn position;\n}\n\nreturn vec3(0, 0, 0);\n}\n#endif\n\nvoid main(void) {\nmat4 finalWorld;\n\n#ifdef BONES\nmat4 m0 = mBones[int(matricesIndices.x)] * matricesWeights.x;\nmat4 m1 = mBones[int(matricesIndices.y)] * matricesWeights.y;\nmat4 m2 = mBones[int(matricesIndices.z)] * matricesWeights.z;\n\n#ifdef BONES4\nmat4 m3 = mBones[int(matricesIndices.w)] * matricesWeights.w;\nfinalWorld = world * (m0 + m1 + m2 + m3);\n#else\nfinalWorld = world * (m0 + m1 + m2);\n#endif\n\n#else\nfinalWorld = world;\n#endif\n\ngl_Position = viewProjection * finalWorld * vec4(position, 1.0);\n\nvec4 worldPos = finalWorld * vec4(position, 1.0);\nvPositionW = vec3(worldPos);\nvNormalW = normalize(vec3(finalWorld * vec4(normal, 0.0)));\n\n#ifndef UV1\nvec2 uv = vec2(0., 0.);\n#endif\n#ifndef UV2\nvec2 uv2 = vec2(0., 0.);\n#endif\n\n#ifdef DIFFUSE\nif (vDiffuseInfos.x == 0.)\n{\nvDiffuseUV = vec2(diffuseMatrix * vec4(uv, 1.0, 0.0));\n}\nelse\n{\nvDiffuseUV = vec2(diffuseMatrix * vec4(uv2, 1.0, 0.0));\n}\n#endif\n\n#ifdef AMBIENT\nif (vAmbientInfos.x == 0.)\n{\nvAmbientUV = vec2(ambientMatrix * vec4(uv, 1.0, 0.0));\n}\nelse\n{\nvAmbientUV = vec2(ambientMatrix * vec4(uv2, 1.0, 0.0));\n}\n#endif\n\n#ifdef OPACITY\nif (vOpacityInfos.x == 0.)\n{\nvOpacityUV = vec2(opacityMatrix * vec4(uv, 1.0, 0.0));\n}\nelse\n{\nvOpacityUV = vec2(opacityMatrix * vec4(uv2, 1.0, 0.0));\n}\n#endif\n\n#ifdef REFLECTION\nvReflectionUVW = computeReflectionCoords(vReflectionInfos.x, vec4(vPositionW, 1.0), vNormalW);\n#endif\n\n#ifdef EMISSIVE\nif (vEmissiveInfos.x == 0.)\n{\nvEmissiveUV = vec2(emissiveMatrix * vec4(uv, 1.0, 0.0));\n}\nelse\n{\nvEmissiveUV = vec2(emissiveMatrix * vec4(uv2, 1.0, 0.0));\n}\n#endif\n\n#ifdef SPECULAR\nif (vSpecularInfos.x == 0.)\n{\nvSpecularUV = vec2(specularMatrix * vec4(uv, 1.0, 0.0));\n}\nelse\n{\nvSpecularUV = vec2(specularMatrix * vec4(uv2, 1.0, 0.0));\n}\n#endif\n\n#ifdef BUMP\nif (vBumpInfos.x == 0.)\n{\nvBumpUV = vec2(bumpMatrix * vec4(uv, 1.0, 0.0));\n}\nelse\n{\nvBumpUV = vec2(bumpMatrix * vec4(uv2, 1.0, 0.0));\n}\n#endif\n\n#ifdef CLIPPLANE\nfClipDistance = dot(worldPos, vClipPlane);\n#endif\n\n#ifdef FOG\nfFogDistance = (view * worldPos).z;\n#endif\n\n#ifdef SHADOWS\n#ifdef LIGHT0\nvPositionFromLight0 = lightMatrix0 * worldPos;\n#endif\n#ifdef LIGHT1\nvPositionFromLight1 = lightMatrix1 * worldPos;\n#endif\n#ifdef LIGHT2\nvPositionFromLight2 = lightMatrix2 * worldPos;\n#endif\n#ifdef LIGHT3\nvPositionFromLight3 = lightMatrix3 * worldPos;\n#endif\n#endif\n\n#ifdef VERTEXCOLOR\nvColor = color;\n#endif\n}",
  14692. lensFlarePixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\nvarying vec2 vUV;\nuniform sampler2D textureSampler;\n\nuniform vec4 color;\n\nvoid main(void) {\nvec4 baseColor = texture2D(textureSampler, vUV);\n\ngl_FragColor = baseColor * color;\n}",
  14693. lensFlareVertexShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\nattribute vec2 position;\n\nuniform mat4 viewportMatrix;\n\nvarying vec2 vUV;\n\nconst vec2 madd = vec2(0.5, 0.5);\n\nvoid main(void) {\n\nvUV = position * madd + madd;\ngl_Position = viewportMatrix * vec4(position, 0.0, 1.0);\n}",
  14694. lensHighlightsPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\nuniform sampler2D textureSampler; // original color\n\nuniform float gain;\nuniform float threshold;\nuniform bool pentagon;\nuniform float screen_width;\nuniform float screen_height;\n\nvarying vec2 vUV;\n\nvec4 highlightColor(vec4 color) {\nvec4 highlight = color;\nfloat luminance = dot(highlight.rgb, vec3(0.2125, 0.7154, 0.0721));\nfloat lum_threshold;\nif (threshold > 1.0) { lum_threshold = 0.94 + 0.01 * threshold; }\nelse { lum_threshold = 0.5 + 0.44 * threshold; }\n\nluminance = clamp((luminance - lum_threshold) * (1.0 / (1.0 - lum_threshold)), 0.0, 1.0);\n\nhighlight *= luminance * gain;\nhighlight.a = 1.0;\n\nreturn highlight;\n}\n\nvoid main(void)\n{\nvec4 original = texture2D(textureSampler, vUV);\n\nif (gain == -1.0) {\ngl_FragColor = vec4(0.0, 0.0, 0.0, 1.0);\nreturn;\n}\n\nfloat w = 2.0 / screen_width;\nfloat h = 2.0 / screen_height;\n\nfloat weight = 1.0;\n\nvec4 blurred = vec4(0.0, 0.0, 0.0, 0.0);\n\nif (pentagon) {\nblurred += highlightColor(texture2D(textureSampler, vUV + vec2(-0.84*w, 0.43*h)));\nblurred += highlightColor(texture2D(textureSampler, vUV + vec2(0.48*w, -1.29*h)));\nblurred += highlightColor(texture2D(textureSampler, vUV + vec2(0.61*w, 1.51*h)));\nblurred += highlightColor(texture2D(textureSampler, vUV + vec2(-1.55*w, -0.74*h)));\nblurred += highlightColor(texture2D(textureSampler, vUV + vec2(1.71*w, -0.52*h)));\nblurred += highlightColor(texture2D(textureSampler, vUV + vec2(-0.94*w, 1.59*h)));\nblurred += highlightColor(texture2D(textureSampler, vUV + vec2(-0.40*w, -1.87*h)));\nblurred += highlightColor(texture2D(textureSampler, vUV + vec2(1.62*w, 1.16*h)));\nblurred += highlightColor(texture2D(textureSampler, vUV + vec2(-2.09*w, 0.25*h)));\nblurred += highlightColor(texture2D(textureSampler, vUV + vec2(1.46*w, -1.71*h)));\nblurred += highlightColor(texture2D(textureSampler, vUV + vec2(0.08*w, 2.42*h)));\nblurred += highlightColor(texture2D(textureSampler, vUV + vec2(-1.85*w, -1.89*h)));\nblurred += highlightColor(texture2D(textureSampler, vUV + vec2(2.89*w, 0.16*h)));\nblurred += highlightColor(texture2D(textureSampler, vUV + vec2(-2.29*w, 1.88*h)));\nblurred += highlightColor(texture2D(textureSampler, vUV + vec2(0.40*w, -2.81*h)));\nblurred += highlightColor(texture2D(textureSampler, vUV + vec2(1.54*w, 2.26*h)));\nblurred += highlightColor(texture2D(textureSampler, vUV + vec2(-2.60*w, -0.61*h)));\nblurred += highlightColor(texture2D(textureSampler, vUV + vec2(2.31*w, -1.30*h)));\nblurred += highlightColor(texture2D(textureSampler, vUV + vec2(-0.83*w, 2.53*h)));\nblurred += highlightColor(texture2D(textureSampler, vUV + vec2(-1.12*w, -2.48*h)));\nblurred += highlightColor(texture2D(textureSampler, vUV + vec2(2.60*w, 1.11*h)));\nblurred += highlightColor(texture2D(textureSampler, vUV + vec2(-2.82*w, 0.99*h)));\nblurred += highlightColor(texture2D(textureSampler, vUV + vec2(1.50*w, -2.81*h)));\nblurred += highlightColor(texture2D(textureSampler, vUV + vec2(0.85*w, 3.33*h)));\nblurred += highlightColor(texture2D(textureSampler, vUV + vec2(-2.94*w, -1.92*h)));\nblurred += highlightColor(texture2D(textureSampler, vUV + vec2(3.27*w, -0.53*h)));\nblurred += highlightColor(texture2D(textureSampler, vUV + vec2(-1.95*w, 2.48*h)));\nblurred += highlightColor(texture2D(textureSampler, vUV + vec2(-0.23*w, -3.04*h)));\nblurred += highlightColor(texture2D(textureSampler, vUV + vec2(2.17*w, 2.05*h)));\nblurred += highlightColor(texture2D(textureSampler, vUV + vec2(-2.97*w, -0.04*h)));\nblurred += highlightColor(texture2D(textureSampler, vUV + vec2(2.25*w, -2.00*h)));\nblurred += highlightColor(texture2D(textureSampler, vUV + vec2(-0.31*w, 3.08*h)));\nblurred += highlightColor(texture2D(textureSampler, vUV + vec2(-1.94*w, -2.59*h)));\nblurred += highlightColor(texture2D(textureSampler, vUV + vec2(3.37*w, 0.64*h)));\nblurred += highlightColor(texture2D(textureSampler, vUV + vec2(-3.13*w, 1.93*h)));\nblurred += highlightColor(texture2D(textureSampler, vUV + vec2(1.03*w, -3.65*h)));\nblurred += highlightColor(texture2D(textureSampler, vUV + vec2(1.60*w, 3.17*h)));\nblurred += highlightColor(texture2D(textureSampler, vUV + vec2(-3.14*w, -1.19*h)));\nblurred += highlightColor(texture2D(textureSampler, vUV + vec2(3.00*w, -1.19*h)));\n}\nelse {\nblurred += highlightColor(texture2D(textureSampler, vUV + vec2(-0.85*w, 0.36*h)));\nblurred += highlightColor(texture2D(textureSampler, vUV + vec2(0.52*w, -1.14*h)));\nblurred += highlightColor(texture2D(textureSampler, vUV + vec2(0.46*w, 1.42*h)));\nblurred += highlightColor(texture2D(textureSampler, vUV + vec2(-1.46*w, -0.83*h)));\nblurred += highlightColor(texture2D(textureSampler, vUV + vec2(1.79*w, -0.42*h)));\nblurred += highlightColor(texture2D(textureSampler, vUV + vec2(-1.11*w, 1.62*h)));\nblurred += highlightColor(texture2D(textureSampler, vUV + vec2(-0.29*w, -2.07*h)));\nblurred += highlightColor(texture2D(textureSampler, vUV + vec2(1.69*w, 1.39*h)));\nblurred += highlightColor(texture2D(textureSampler, vUV + vec2(-2.28*w, 0.12*h)));\nblurred += highlightColor(texture2D(textureSampler, vUV + vec2(1.65*w, -1.69*h)));\nblurred += highlightColor(texture2D(textureSampler, vUV + vec2(-0.08*w, 2.44*h)));\nblurred += highlightColor(texture2D(textureSampler, vUV + vec2(-1.63*w, -1.90*h)));\nblurred += highlightColor(texture2D(textureSampler, vUV + vec2(2.55*w, 0.31*h)));\nblurred += highlightColor(texture2D(textureSampler, vUV + vec2(-2.13*w, 1.52*h)));\nblurred += highlightColor(texture2D(textureSampler, vUV + vec2(0.56*w, -2.61*h)));\nblurred += highlightColor(texture2D(textureSampler, vUV + vec2(1.38*w, 2.34*h)));\nblurred += highlightColor(texture2D(textureSampler, vUV + vec2(-2.64*w, -0.81*h)));\nblurred += highlightColor(texture2D(textureSampler, vUV + vec2(2.53*w, -1.21*h)));\nblurred += highlightColor(texture2D(textureSampler, vUV + vec2(-1.06*w, 2.63*h)));\nblurred += highlightColor(texture2D(textureSampler, vUV + vec2(-1.00*w, -2.69*h)));\nblurred += highlightColor(texture2D(textureSampler, vUV + vec2(2.59*w, 1.32*h)));\nblurred += highlightColor(texture2D(textureSampler, vUV + vec2(-2.82*w, 0.78*h)));\nblurred += highlightColor(texture2D(textureSampler, vUV + vec2(1.57*w, -2.50*h)));\nblurred += highlightColor(texture2D(textureSampler, vUV + vec2(0.54*w, 2.93*h)));\nblurred += highlightColor(texture2D(textureSampler, vUV + vec2(-2.39*w, -1.81*h)));\nblurred += highlightColor(texture2D(textureSampler, vUV + vec2(3.01*w, -0.28*h)));\nblurred += highlightColor(texture2D(textureSampler, vUV + vec2(-2.04*w, 2.25*h)));\nblurred += highlightColor(texture2D(textureSampler, vUV + vec2(-0.02*w, -3.05*h)));\nblurred += highlightColor(texture2D(textureSampler, vUV + vec2(2.09*w, 2.25*h)));\nblurred += highlightColor(texture2D(textureSampler, vUV + vec2(-3.07*w, -0.25*h)));\nblurred += highlightColor(texture2D(textureSampler, vUV + vec2(2.44*w, -1.90*h)));\nblurred += highlightColor(texture2D(textureSampler, vUV + vec2(-0.52*w, 3.05*h)));\nblurred += highlightColor(texture2D(textureSampler, vUV + vec2(-1.68*w, -2.61*h)));\nblurred += highlightColor(texture2D(textureSampler, vUV + vec2(3.01*w, 0.79*h)));\nblurred += highlightColor(texture2D(textureSampler, vUV + vec2(-2.76*w, 1.46*h)));\nblurred += highlightColor(texture2D(textureSampler, vUV + vec2(1.05*w, -2.94*h)));\nblurred += highlightColor(texture2D(textureSampler, vUV + vec2(1.21*w, 2.88*h)));\nblurred += highlightColor(texture2D(textureSampler, vUV + vec2(-2.84*w, -1.30*h)));\nblurred += highlightColor(texture2D(textureSampler, vUV + vec2(2.98*w, -0.96*h)));\n}\n\nblurred /= 39.0;\n\ngl_FragColor = blurred;\n\n}",
  14695. marblePixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\nvarying vec2 vPosition;\nvarying vec2 vUV;\n\nuniform float numberOfTilesHeight;\nuniform float numberOfTilesWidth;\nuniform float amplitude;\nuniform vec3 brickColor;\nuniform vec3 jointColor;\n\nconst vec3 tileSize = vec3(1.1, 1.0, 1.1);\nconst vec3 tilePct = vec3(0.98, 1.0, 0.98);\n\nfloat rand(vec2 n) {\nreturn fract(cos(dot(n, vec2(12.9898, 4.1414))) * 43758.5453);\n}\n\nfloat noise(vec2 n) {\nconst vec2 d = vec2(0.0, 1.0);\nvec2 b = floor(n), f = smoothstep(vec2(0.0), vec2(1.0), fract(n));\nreturn mix(mix(rand(b), rand(b + d.yx), f.x), mix(rand(b + d.xy), rand(b + d.yy), f.x), f.y);\n}\n\nfloat turbulence(vec2 P)\n{\nfloat val = 0.0;\nfloat freq = 1.0;\nfor (int i = 0; i < 4; i++)\n{\nval += abs(noise(P*freq) / freq);\nfreq *= 2.07;\n}\nreturn val;\n}\n\nfloat round(float number){\nreturn sign(number)*floor(abs(number) + 0.5);\n}\n\nvec3 marble_color(float x)\n{\nvec3 col;\nx = 0.5*(x + 1.);\nx = sqrt(x);\nx = sqrt(x);\nx = sqrt(x);\ncol = vec3(.2 + .75*x);\ncol.b *= 0.95;\nreturn col;\n}\n\nvoid main()\n{\nfloat brickW = 1.0 / numberOfTilesWidth;\nfloat brickH = 1.0 / numberOfTilesHeight;\nfloat jointWPercentage = 0.01;\nfloat jointHPercentage = 0.01;\nvec3 color = brickColor;\nfloat yi = vUV.y / brickH;\nfloat nyi = round(yi);\nfloat xi = vUV.x / brickW;\n\nif (mod(floor(yi), 2.0) == 0.0){\nxi = xi - 0.5;\n}\n\nfloat nxi = round(xi);\nvec2 brickvUV = vec2((xi - floor(xi)) / brickH, (yi - floor(yi)) / brickW);\n\nif (yi < nyi + jointHPercentage && yi > nyi - jointHPercentage){\ncolor = mix(jointColor, vec3(0.37, 0.25, 0.25), (yi - nyi) / jointHPercentage + 0.2);\n}\nelse if (xi < nxi + jointWPercentage && xi > nxi - jointWPercentage){\ncolor = mix(jointColor, vec3(0.44, 0.44, 0.44), (xi - nxi) / jointWPercentage + 0.2);\n}\nelse {\nfloat t = 6.28 * brickvUV.x / (tileSize.x + noise(vec2(vUV)*6.0));\nt += amplitude * turbulence(brickvUV.xy);\nt = sin(t);\ncolor = marble_color(t);\n}\n\ngl_FragColor = vec4(color, 0.0);\n}",
  14696. oculusDistortionCorrectionPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\nvarying vec2 vUV;\nuniform sampler2D textureSampler;\nuniform vec2 LensCenter;\nuniform vec2 Scale;\nuniform vec2 ScaleIn;\nuniform vec4 HmdWarpParam;\n\nvec2 HmdWarp(vec2 in01) {\n\nvec2 theta = (in01 - LensCenter) * ScaleIn; // Scales to [-1, 1]\nfloat rSq = theta.x * theta.x + theta.y * theta.y;\nvec2 rvector = theta * (HmdWarpParam.x + HmdWarpParam.y * rSq + HmdWarpParam.z * rSq * rSq + HmdWarpParam.w * rSq * rSq * rSq);\nreturn LensCenter + Scale * rvector;\n}\n\nvoid main(void)\n{\nvec2 tc = HmdWarp(vUV);\nif (tc.x <0.0 || tc.x>1.0 || tc.y<0.0 || tc.y>1.0)\ngl_FragColor = vec4(0.0, 0.0, 0.0, 1.0);\nelse{\ngl_FragColor = vec4(texture2D(textureSampler, tc).rgb, 1.0);\n}\n}",
  14697. outlinePixelShader:"precision highp float;\n\nuniform vec4 color;\n\n#ifdef ALPHATEST\nvarying vec2 vUV;\nuniform sampler2D diffuseSampler;\n#endif\n\nvoid main(void) {\n#ifdef ALPHATEST\nif (texture2D(diffuseSampler, vUV).a < 0.4)\ndiscard;\n#endif\n\ngl_FragColor = color;\n}",
  14698. outlineVertexShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\nattribute vec3 position;\nattribute vec3 normal;\n\n#ifdef BONES\nattribute vec4 matricesIndices;\nattribute vec4 matricesWeights;\n#endif\n\nuniform float offset;\n\n#ifdef INSTANCES\nattribute vec4 world0;\nattribute vec4 world1;\nattribute vec4 world2;\nattribute vec4 world3;\n#else\nuniform mat4 world;\n#endif\n\nuniform mat4 viewProjection;\n#ifdef BONES\nuniform mat4 mBones[BonesPerMesh];\n#endif\n\n#ifdef ALPHATEST\nvarying vec2 vUV;\nuniform mat4 diffuseMatrix;\n#ifdef UV1\nattribute vec2 uv;\n#endif\n#ifdef UV2\nattribute vec2 uv2;\n#endif\n#endif\n\nvoid main(void)\n{\n#ifdef INSTANCES\nmat4 finalWorld = mat4(world0, world1, world2, world3);\n#else\nmat4 finalWorld = world;\n#endif\n\nvec3 offsetPosition = position + normal * offset;\n\n#ifdef BONES\nmat4 m0 = mBones[int(matricesIndices.x)] * matricesWeights.x;\nmat4 m1 = mBones[int(matricesIndices.y)] * matricesWeights.y;\nmat4 m2 = mBones[int(matricesIndices.z)] * matricesWeights.z;\nmat4 m3 = mBones[int(matricesIndices.w)] * matricesWeights.w;\nfinalWorld = finalWorld * (m0 + m1 + m2 + m3);\ngl_Position = viewProjection * finalWorld * vec4(offsetPosition, 1.0);\n#else\ngl_Position = viewProjection * finalWorld * vec4(offsetPosition, 1.0);\n#endif\n\n#ifdef ALPHATEST\n#ifdef UV1\nvUV = vec2(diffuseMatrix * vec4(uv, 1.0, 0.0));\n#endif\n#ifdef UV2\nvUV = vec2(diffuseMatrix * vec4(uv2, 1.0, 0.0));\n#endif\n#endif\n}",
  14699. particlesPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\nvarying vec2 vUV;\nvarying vec4 vColor;\nuniform vec4 textureMask;\nuniform sampler2D diffuseSampler;\n\n#ifdef CLIPPLANE\nvarying float fClipDistance;\n#endif\n\nvoid main(void) {\n#ifdef CLIPPLANE\nif (fClipDistance > 0.0)\ndiscard;\n#endif\nvec4 baseColor = texture2D(diffuseSampler, vUV);\n\ngl_FragColor = (baseColor * textureMask + (vec4(1., 1., 1., 1.) - textureMask)) * vColor;\n}",
  14700. particlesVertexShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\nattribute vec3 position;\nattribute vec4 color;\nattribute vec4 options;\n\nuniform mat4 view;\nuniform mat4 projection;\n\nvarying vec2 vUV;\nvarying vec4 vColor;\n\n#ifdef CLIPPLANE\nuniform vec4 vClipPlane;\nuniform mat4 invView;\nvarying float fClipDistance;\n#endif\n\nvoid main(void) {\nvec3 viewPos = (view * vec4(position, 1.0)).xyz;\nvec3 cornerPos;\nfloat size = options.y;\nfloat angle = options.x;\nvec2 offset = options.zw;\n\ncornerPos = vec3(offset.x - 0.5, offset.y - 0.5, 0.) * size;\n\nvec3 rotatedCorner;\nrotatedCorner.x = cornerPos.x * cos(angle) - cornerPos.y * sin(angle);\nrotatedCorner.y = cornerPos.x * sin(angle) + cornerPos.y * cos(angle);\nrotatedCorner.z = 0.;\n\nviewPos += rotatedCorner;\ngl_Position = projection * vec4(viewPos, 1.0);\n\nvColor = color;\nvUV = offset;\n\n#ifdef CLIPPLANE\nvec4 worldPos = invView * vec4(viewPos, 1.0);\nfClipDistance = dot(worldPos, vClipPlane);\n#endif\n}",
  14701. passPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\nvarying vec2 vUV;\nuniform sampler2D textureSampler;\n\nvoid main(void)\n{\ngl_FragColor = texture2D(textureSampler, vUV);\n}",
  14702. postprocessVertexShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\nattribute vec2 position;\n\nvarying vec2 vUV;\n\nconst vec2 madd = vec2(0.5, 0.5);\n\nvoid main(void) {\n\nvUV = position * madd + madd;\ngl_Position = vec4(position, 0.0, 1.0);\n}",
  14703. proceduralVertexShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\nattribute vec2 position;\n\nvarying vec2 vPosition;\nvarying vec2 vUV;\n\nconst vec2 madd = vec2(0.5, 0.5);\n\nvoid main(void) {\nvPosition = position;\nvUV = position * madd + madd;\ngl_Position = vec4(position, 0.0, 1.0);\n}",
  14704. refractionPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\nvarying vec2 vUV;\nuniform sampler2D textureSampler;\nuniform sampler2D refractionSampler;\n\nuniform vec3 baseColor;\nuniform float depth;\nuniform float colorLevel;\n\nvoid main() {\nfloat ref = 1.0 - texture2D(refractionSampler, vUV).r;\n\nvec2 uv = vUV - vec2(0.5);\nvec2 offset = uv * depth * ref;\nvec3 sourceColor = texture2D(textureSampler, vUV - offset).rgb;\n\ngl_FragColor = vec4(sourceColor + sourceColor * ref * colorLevel, 1.0);\n}",
  14705. roadPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\nvarying vec2 vUV;\nuniform vec3 roadColor;\n\nfloat rand(vec2 n) {\nreturn fract(cos(dot(n, vec2(12.9898, 4.1414))) * 43758.5453);\n}\n\nfloat noise(vec2 n) {\nconst vec2 d = vec2(0.0, 1.0);\nvec2 b = floor(n), f = smoothstep(vec2(0.0), vec2(1.0), fract(n));\nreturn mix(mix(rand(b), rand(b + d.yx), f.x), mix(rand(b + d.xy), rand(b + d.yy), f.x), f.y);\n}\n\nfloat fbm(vec2 n) {\nfloat total = 0.0, amplitude = 1.0;\nfor (int i = 0; i < 4; i++) {\ntotal += noise(n) * amplitude;\nn += n;\namplitude *= 0.5;\n}\nreturn total;\n}\n\nvoid main(void) {\nfloat ratioy = mod(gl_FragCoord.y * 100.0 , fbm(vUV * 2.0));\nvec3 color = roadColor * ratioy;\ngl_FragColor = vec4(color, 1.0);\n}",
  14706. shadowMapPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\nvec4 pack(float depth)\n{\nconst vec4 bit_shift = vec4(255.0 * 255.0 * 255.0, 255.0 * 255.0, 255.0, 1.0);\nconst vec4 bit_mask = vec4(0.0, 1.0 / 255.0, 1.0 / 255.0, 1.0 / 255.0);\n\nvec4 res = fract(depth * bit_shift);\nres -= res.xxyz * bit_mask;\n\nreturn res;\n}\n\nvec2 packHalf(float depth)\n{\nconst vec2 bitOffset = vec2(1.0 / 255., 0.);\nvec2 color = vec2(depth, fract(depth * 255.));\n\nreturn color - (color.yy * bitOffset);\n}\n\nvarying vec4 vPosition;\n\n#ifdef ALPHATEST\nvarying vec2 vUV;\nuniform sampler2D diffuseSampler;\n#endif\n\nvoid main(void)\n{\n#ifdef ALPHATEST\nif (texture2D(diffuseSampler, vUV).a < 0.4)\ndiscard;\n#endif\nfloat depth = vPosition.z / vPosition.w;\ndepth = depth * 0.5 + 0.5;\n\n#ifdef VSM\nfloat moment1 = depth;\nfloat moment2 = moment1 * moment1;\n\ngl_FragColor = vec4(packHalf(moment1), packHalf(moment2));\n#else\ngl_FragColor = pack(depth);\n#endif\n}",
  14707. shadowMapVertexShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\nattribute vec3 position;\n#ifdef BONES\nattribute vec4 matricesIndices;\nattribute vec4 matricesWeights;\n#endif\n\n#ifdef INSTANCES\nattribute vec4 world0;\nattribute vec4 world1;\nattribute vec4 world2;\nattribute vec4 world3;\n#else\nuniform mat4 world;\n#endif\n\nuniform mat4 viewProjection;\n#ifdef BONES\nuniform mat4 mBones[BonesPerMesh];\n#endif\n\nvarying vec4 vPosition;\n\n#ifdef ALPHATEST\nvarying vec2 vUV;\nuniform mat4 diffuseMatrix;\n#ifdef UV1\nattribute vec2 uv;\n#endif\n#ifdef UV2\nattribute vec2 uv2;\n#endif\n#endif\n\nvoid main(void)\n{\n#ifdef INSTANCES\nmat4 finalWorld = mat4(world0, world1, world2, world3);\n#else\nmat4 finalWorld = world;\n#endif\n\n#ifdef BONES\nmat4 m0 = mBones[int(matricesIndices.x)] * matricesWeights.x;\nmat4 m1 = mBones[int(matricesIndices.y)] * matricesWeights.y;\nmat4 m2 = mBones[int(matricesIndices.z)] * matricesWeights.z;\nmat4 m3 = mBones[int(matricesIndices.w)] * matricesWeights.w;\nfinalWorld = finalWorld * (m0 + m1 + m2 + m3);\n#endif\n\nvPosition = viewProjection * finalWorld * vec4(position, 1.0);\ngl_Position = vPosition;\n\n#ifdef ALPHATEST\n#ifdef UV1\nvUV = vec2(diffuseMatrix * vec4(uv, 1.0, 0.0));\n#endif\n#ifdef UV2\nvUV = vec2(diffuseMatrix * vec4(uv2, 1.0, 0.0));\n#endif\n#endif\n}",
  14708. spritesPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\nuniform bool alphaTest;\n\nvarying vec4 vColor;\n\nvarying vec2 vUV;\nuniform sampler2D diffuseSampler;\n\n#ifdef FOG\n\n#define FOGMODE_NONE 0.\n#define FOGMODE_EXP 1.\n#define FOGMODE_EXP2 2.\n#define FOGMODE_LINEAR 3.\n#define E 2.71828\n\nuniform vec4 vFogInfos;\nuniform vec3 vFogColor;\nvarying float fFogDistance;\n\nfloat CalcFogFactor()\n{\nfloat fogCoeff = 1.0;\nfloat fogStart = vFogInfos.y;\nfloat fogEnd = vFogInfos.z;\nfloat fogDensity = vFogInfos.w;\n\nif (FOGMODE_LINEAR == vFogInfos.x)\n{\nfogCoeff = (fogEnd - fFogDistance) / (fogEnd - fogStart);\n}\nelse if (FOGMODE_EXP == vFogInfos.x)\n{\nfogCoeff = 1.0 / pow(E, fFogDistance * fogDensity);\n}\nelse if (FOGMODE_EXP2 == vFogInfos.x)\n{\nfogCoeff = 1.0 / pow(E, fFogDistance * fFogDistance * fogDensity * fogDensity);\n}\n\nreturn min(1., max(0., fogCoeff));\n}\n#endif\n\n\nvoid main(void) {\nvec4 baseColor = texture2D(diffuseSampler, vUV);\n\nif (alphaTest)\n{\nif (baseColor.a < 0.95)\ndiscard;\n}\n\nbaseColor *= vColor;\n\n#ifdef FOG\nfloat fog = CalcFogFactor();\nbaseColor.rgb = fog * baseColor.rgb + (1.0 - fog) * vFogColor;\n#endif\n\ngl_FragColor = baseColor;\n}",
  14709. spritesVertexShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\nattribute vec4 position;\nattribute vec4 options;\nattribute vec4 cellInfo;\nattribute vec4 color;\n\nuniform vec2 textureInfos;\nuniform mat4 view;\nuniform mat4 projection;\n\nvarying vec2 vUV;\nvarying vec4 vColor;\n\n#ifdef FOG\nvarying float fFogDistance;\n#endif\n\nvoid main(void) {\nvec3 viewPos = (view * vec4(position.xyz, 1.0)).xyz;\nvec2 cornerPos;\n\nfloat angle = position.w;\nvec2 size = vec2(options.x, options.y);\nvec2 offset = options.zw;\nvec2 uvScale = textureInfos.xy;\n\ncornerPos = vec2(offset.x - 0.5, offset.y - 0.5) * size;\n\nvec3 rotatedCorner;\nrotatedCorner.x = cornerPos.x * cos(angle) - cornerPos.y * sin(angle);\nrotatedCorner.y = cornerPos.x * sin(angle) + cornerPos.y * cos(angle);\nrotatedCorner.z = 0.;\n\nviewPos += rotatedCorner;\ngl_Position = projection * vec4(viewPos, 1.0);\n\nvColor = color;\n\nvec2 uvOffset = vec2(abs(offset.x - cellInfo.x), 1.0 - abs(offset.y - cellInfo.y));\n\nvUV = (uvOffset + cellInfo.zw) * uvScale;\n\n#ifdef FOG\nfFogDistance = viewPos.z;\n#endif\n}",
  14710. ssaoPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n#define SAMPLES 16\n\nuniform sampler2D textureSampler;\nuniform sampler2D randomSampler;\n\nuniform float randTextureTiles;\nuniform float samplesFactor;\nuniform vec3 sampleSphere[16];\n\nuniform float totalStrength;\nuniform float radius;\nuniform float area;\nuniform float fallOff;\n\nvarying vec2 vUV;\n\nconst vec2 offset1 = vec2(0.0, 0.001);\nconst vec2 offset2 = vec2(0.001, 0.0);\n\nvec3 normalFromDepth(const float depth, const vec2 coords) {\nfloat depth1 = texture2D(textureSampler, coords + offset1).r;\nfloat depth2 = texture2D(textureSampler, coords + offset2).r;\n\nvec3 p1 = vec3(offset1, depth1 - depth);\nvec3 p2 = vec3(offset2, depth2 - depth);\n\nvec3 normal = cross(p1, p2);\nnormal.z = -normal.z;\n\nreturn normalize(normal);\n}\n\nvoid main(void)\n{\nconst float base = 0.2;\n\nvec3 random = texture2D(randomSampler, vUV * randTextureTiles).rgb;\nfloat depth = texture2D(textureSampler, vUV).r;\nvec3 position = vec3(vUV, depth);\nvec3 normal = normalFromDepth(depth, vUV);\nfloat radiusDepth = radius / depth;\nfloat occlusion = 0.0;\n\nvec3 ray;\nvec3 hemiRay;\nfloat occlusionDepth;\nfloat difference;\n\nfor (int i = 0; i < SAMPLES; i++)\n{\nray = radiusDepth * reflect(sampleSphere[i], random);\nhemiRay = position + sign(dot(ray, normal)) * ray;\n\nocclusionDepth = texture2D(textureSampler, clamp(hemiRay.xy, 0.0, 1.0)).r;\ndifference = depth - occlusionDepth;\n\nocclusion += step(fallOff, difference) * (1.0 - smoothstep(fallOff, area, difference));\n}\n\nfloat ao = 1.0 - totalStrength * occlusion * samplesFactor;\n\nfloat result = clamp(ao + base, 0.0, 1.0);\ngl_FragColor.r = result;\ngl_FragColor.g = result;\ngl_FragColor.b = result;\ngl_FragColor.a = 1.0;\n}",
  14711. ssaoCombinePixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\nuniform sampler2D textureSampler;\nuniform sampler2D originalColor;\n\nvarying vec2 vUV;\n\nvoid main(void) {\ngl_FragColor = texture2D(originalColor, vUV) * texture2D(textureSampler, vUV);\n}",
  14712. volumetricLightScatteringPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\nuniform sampler2D textureSampler;\nuniform sampler2D lightScatteringSampler;\n\nuniform float decay;\nuniform float exposure;\nuniform float weight;\nuniform float density;\nuniform vec2 meshPositionOnScreen;\n\nvarying vec2 vUV;\n\nvoid main(void) {\nvec2 tc = vUV;\nvec2 deltaTexCoord = (tc - meshPositionOnScreen.xy);\ndeltaTexCoord *= 1.0 / float(NUM_SAMPLES) * density;\n\nfloat illuminationDecay = 1.0;\n\nvec4 color = texture2D(lightScatteringSampler, tc) * 0.4;\n\nfor(int i=0; i < NUM_SAMPLES; i++) {\ntc -= deltaTexCoord;\nvec4 sample = texture2D(lightScatteringSampler, tc) * 0.4;\nsample *= illuminationDecay * weight;\ncolor += sample;\nilluminationDecay *= decay;\n}\n\nvec4 realColor = texture2D(textureSampler, vUV);\ngl_FragColor = ((vec4((vec3(color.r, color.g, color.b) * exposure), 1)) + (realColor * (1.5 - 0.4)));\n}",
  14713. volumetricLightScatteringPassPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n#if defined(ALPHATEST) || defined(BASIC_RENDER) || defined(OPACITY)\nvarying vec2 vUV;\n#endif\n\n#if defined(ALPHATEST) || defined(BASIC_RENDER)\nuniform sampler2D diffuseSampler;\n#endif\n\n#if defined(OPACITY)\nuniform sampler2D opacitySampler;\nuniform float opacityLevel;\n#endif\n\nvoid main(void)\n{\n#if defined(ALPHATEST) || defined(BASIC_RENDER)\nvec4 diffuseColor = texture2D(diffuseSampler, vUV);\n#endif\n\n#ifdef ALPHATEST\nif (diffuseColor.a < 0.4)\ndiscard;\n#endif\n\n#ifdef OPACITY\nvec4 opacityColor = texture2D(opacitySampler, vUV);\nfloat alpha = 1.0;\n\n#ifdef OPACITYRGB\nopacityColor.rgb = opacityColor.rgb * vec3(0.3, 0.59, 0.11);\nalpha *= (opacityColor.x + opacityColor.y + opacityColor.z) * opacityLevel;\n#else\nalpha *= opacityColor.a * opacityLevel;\n#endif\n\n#if defined(BASIC_RENDER)\ngl_FragColor = vec4(diffuseColor.rgb, alpha);\n#else\ngl_FragColor = vec4(0.0, 0.0, 0.0, alpha);\n#endif\n\ngl_FragColor.a = alpha;\n#else\n#ifndef BASIC_RENDER\ngl_FragColor = vec4(0.0, 0.0, 0.0, 1.0);\n#else\ngl_FragColor = diffuseColor;\n#endif\n#endif\n\n}",
  14714. woodPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\nvarying vec2 vPosition;\nvarying vec2 vUV;\n\nuniform float ampScale;\nuniform vec3 woodColor;\n\nfloat rand(vec2 n) {\nreturn fract(cos(dot(n, vec2(12.9898, 4.1414))) * 43758.5453);\n}\n\nfloat noise(vec2 n) {\nconst vec2 d = vec2(0.0, 1.0);\nvec2 b = floor(n), f = smoothstep(vec2(0.0), vec2(1.0), fract(n));\nreturn mix(mix(rand(b), rand(b + d.yx), f.x), mix(rand(b + d.xy), rand(b + d.yy), f.x), f.y);\n}\n\nfloat fbm(vec2 n) {\nfloat total = 0.0, amplitude = 1.0;\nfor (int i = 0; i < 4; i++) {\ntotal += noise(n) * amplitude;\nn += n;\namplitude *= 0.5;\n}\nreturn total;\n}\n\nvoid main(void) {\nfloat ratioy = mod(vUV.x * ampScale, 2.0 + fbm(vUV * 0.8));\nvec3 wood = woodColor * ratioy;\ngl_FragColor = vec4(wood, 1.0);\n}",
  14715. };
  14716. return Effect;
  14717. })();
  14718. BABYLON.Effect = Effect;
  14719. })(BABYLON || (BABYLON = {}));
  14720. //# sourceMappingURL=babylon.effect.js.mapvar BABYLON;
  14721. (function (BABYLON) {
  14722. var Material = (function () {
  14723. function Material(name, scene, doNotAdd) {
  14724. this.name = name;
  14725. this.checkReadyOnEveryCall = true;
  14726. this.checkReadyOnlyOnce = false;
  14727. this.state = "";
  14728. this.alpha = 1.0;
  14729. this.backFaceCulling = true;
  14730. this._wasPreviouslyReady = false;
  14731. this._fillMode = Material.TriangleFillMode;
  14732. this.pointSize = 1.0;
  14733. this.zOffset = 0;
  14734. this.id = name;
  14735. this._scene = scene;
  14736. if (!doNotAdd) {
  14737. scene.materials.push(this);
  14738. }
  14739. }
  14740. Object.defineProperty(Material, "TriangleFillMode", {
  14741. get: function () {
  14742. return Material._TriangleFillMode;
  14743. },
  14744. enumerable: true,
  14745. configurable: true
  14746. });
  14747. Object.defineProperty(Material, "WireFrameFillMode", {
  14748. get: function () {
  14749. return Material._WireFrameFillMode;
  14750. },
  14751. enumerable: true,
  14752. configurable: true
  14753. });
  14754. Object.defineProperty(Material, "PointFillMode", {
  14755. get: function () {
  14756. return Material._PointFillMode;
  14757. },
  14758. enumerable: true,
  14759. configurable: true
  14760. });
  14761. Object.defineProperty(Material.prototype, "wireframe", {
  14762. get: function () {
  14763. return this._fillMode === Material.WireFrameFillMode;
  14764. },
  14765. set: function (value) {
  14766. this._fillMode = (value ? Material.WireFrameFillMode : Material.TriangleFillMode);
  14767. },
  14768. enumerable: true,
  14769. configurable: true
  14770. });
  14771. Object.defineProperty(Material.prototype, "pointsCloud", {
  14772. get: function () {
  14773. return this._fillMode === Material.PointFillMode;
  14774. },
  14775. set: function (value) {
  14776. this._fillMode = (value ? Material.PointFillMode : Material.TriangleFillMode);
  14777. },
  14778. enumerable: true,
  14779. configurable: true
  14780. });
  14781. Object.defineProperty(Material.prototype, "fillMode", {
  14782. get: function () {
  14783. return this._fillMode;
  14784. },
  14785. set: function (value) {
  14786. this._fillMode = value;
  14787. },
  14788. enumerable: true,
  14789. configurable: true
  14790. });
  14791. Material.prototype.isReady = function (mesh, useInstances) {
  14792. return true;
  14793. };
  14794. Material.prototype.getEffect = function () {
  14795. return this._effect;
  14796. };
  14797. Material.prototype.getScene = function () {
  14798. return this._scene;
  14799. };
  14800. Material.prototype.needAlphaBlending = function () {
  14801. return (this.alpha < 1.0);
  14802. };
  14803. Material.prototype.needAlphaTesting = function () {
  14804. return false;
  14805. };
  14806. Material.prototype.getAlphaTestTexture = function () {
  14807. return null;
  14808. };
  14809. Material.prototype.trackCreation = function (onCompiled, onError) {
  14810. };
  14811. Material.prototype._preBind = function () {
  14812. var engine = this._scene.getEngine();
  14813. engine.enableEffect(this._effect);
  14814. engine.setState(this.backFaceCulling, this.zOffset);
  14815. };
  14816. Material.prototype.bind = function (world, mesh) {
  14817. this._scene._cachedMaterial = this;
  14818. if (this.onBind) {
  14819. this.onBind(this, mesh);
  14820. }
  14821. };
  14822. Material.prototype.bindOnlyWorldMatrix = function (world) {
  14823. };
  14824. Material.prototype.unbind = function () {
  14825. };
  14826. Material.prototype.dispose = function (forceDisposeEffect) {
  14827. // Remove from scene
  14828. var index = this._scene.materials.indexOf(this);
  14829. this._scene.materials.splice(index, 1);
  14830. // Shader are kept in cache for further use but we can get rid of this by using forceDisposeEffect
  14831. if (forceDisposeEffect && this._effect) {
  14832. this._scene.getEngine()._releaseEffect(this._effect);
  14833. this._effect = null;
  14834. }
  14835. // Callback
  14836. if (this.onDispose) {
  14837. this.onDispose();
  14838. }
  14839. };
  14840. Material._TriangleFillMode = 0;
  14841. Material._WireFrameFillMode = 1;
  14842. Material._PointFillMode = 2;
  14843. return Material;
  14844. })();
  14845. BABYLON.Material = Material;
  14846. })(BABYLON || (BABYLON = {}));
  14847. //# sourceMappingURL=babylon.material.js.map
  14848. var BABYLON;
  14849. (function (BABYLON) {
  14850. var maxSimultaneousLights = 4;
  14851. var FresnelParameters = (function () {
  14852. function FresnelParameters() {
  14853. this.isEnabled = true;
  14854. this.leftColor = BABYLON.Color3.White();
  14855. this.rightColor = BABYLON.Color3.Black();
  14856. this.bias = 0;
  14857. this.power = 1;
  14858. }
  14859. return FresnelParameters;
  14860. })();
  14861. BABYLON.FresnelParameters = FresnelParameters;
  14862. var StandardMaterial = (function (_super) {
  14863. __extends(StandardMaterial, _super);
  14864. function StandardMaterial(name, scene) {
  14865. var _this = this;
  14866. _super.call(this, name, scene);
  14867. this.ambientColor = new BABYLON.Color3(0, 0, 0);
  14868. this.diffuseColor = new BABYLON.Color3(1, 1, 1);
  14869. this.specularColor = new BABYLON.Color3(1, 1, 1);
  14870. this.specularPower = 64;
  14871. this.emissiveColor = new BABYLON.Color3(0, 0, 0);
  14872. this.useAlphaFromDiffuseTexture = false;
  14873. this.useSpecularOverAlpha = true;
  14874. this.fogEnabled = true;
  14875. this._cachedDefines = null;
  14876. this._renderTargets = new BABYLON.SmartArray(16);
  14877. this._worldViewProjectionMatrix = BABYLON.Matrix.Zero();
  14878. this._globalAmbientColor = new BABYLON.Color3(0, 0, 0);
  14879. this._scaledDiffuse = new BABYLON.Color3();
  14880. this._scaledSpecular = new BABYLON.Color3();
  14881. this.getRenderTargetTextures = function () {
  14882. _this._renderTargets.reset();
  14883. if (_this.reflectionTexture && _this.reflectionTexture.isRenderTarget) {
  14884. _this._renderTargets.push(_this.reflectionTexture);
  14885. }
  14886. return _this._renderTargets;
  14887. };
  14888. }
  14889. StandardMaterial.prototype.needAlphaBlending = function () {
  14890. return (this.alpha < 1.0) || (this.opacityTexture != null) || this._shouldUseAlphaFromDiffuseTexture() || this.opacityFresnelParameters && this.opacityFresnelParameters.isEnabled;
  14891. };
  14892. StandardMaterial.prototype.needAlphaTesting = function () {
  14893. return this.diffuseTexture != null && this.diffuseTexture.hasAlpha && !this.diffuseTexture.getAlphaFromRGB;
  14894. };
  14895. StandardMaterial.prototype._shouldUseAlphaFromDiffuseTexture = function () {
  14896. return this.diffuseTexture != null && this.diffuseTexture.hasAlpha && this.useAlphaFromDiffuseTexture;
  14897. };
  14898. StandardMaterial.prototype.getAlphaTestTexture = function () {
  14899. return this.diffuseTexture;
  14900. };
  14901. // Methods
  14902. StandardMaterial.prototype.isReady = function (mesh, useInstances) {
  14903. if (this.checkReadyOnlyOnce) {
  14904. if (this._wasPreviouslyReady) {
  14905. }
  14906. }
  14907. var scene = this.getScene();
  14908. if (!this.checkReadyOnEveryCall) {
  14909. if (this._renderId === scene.getRenderId()) {
  14910. }
  14911. }
  14912. var engine = scene.getEngine();
  14913. var defines = [];
  14914. var fallbacks = new BABYLON.EffectFallbacks();
  14915. var needNormals = false;
  14916. var needUVs = false;
  14917. // Textures
  14918. if (scene.texturesEnabled) {
  14919. if (this.diffuseTexture && StandardMaterial.DiffuseTextureEnabled) {
  14920. if (!this.diffuseTexture.isReady()) {
  14921. return false;
  14922. }
  14923. else {
  14924. needUVs = true;
  14925. defines.push("#define DIFFUSE");
  14926. }
  14927. }
  14928. if (this.ambientTexture && StandardMaterial.AmbientTextureEnabled) {
  14929. if (!this.ambientTexture.isReady()) {
  14930. return false;
  14931. }
  14932. else {
  14933. needUVs = true;
  14934. defines.push("#define AMBIENT");
  14935. }
  14936. }
  14937. if (this.opacityTexture && StandardMaterial.OpacityTextureEnabled) {
  14938. if (!this.opacityTexture.isReady()) {
  14939. return false;
  14940. }
  14941. else {
  14942. needUVs = true;
  14943. defines.push("#define OPACITY");
  14944. if (this.opacityTexture.getAlphaFromRGB) {
  14945. defines.push("#define OPACITYRGB");
  14946. }
  14947. }
  14948. }
  14949. if (this.reflectionTexture && StandardMaterial.ReflectionTextureEnabled) {
  14950. if (!this.reflectionTexture.isReady()) {
  14951. return false;
  14952. }
  14953. else {
  14954. needNormals = true;
  14955. needUVs = true;
  14956. defines.push("#define REFLECTION");
  14957. fallbacks.addFallback(0, "REFLECTION");
  14958. }
  14959. }
  14960. if (this.emissiveTexture && StandardMaterial.EmissiveTextureEnabled) {
  14961. if (!this.emissiveTexture.isReady()) {
  14962. return false;
  14963. }
  14964. else {
  14965. needUVs = true;
  14966. defines.push("#define EMISSIVE");
  14967. }
  14968. }
  14969. if (this.specularTexture && StandardMaterial.SpecularTextureEnabled) {
  14970. if (!this.specularTexture.isReady()) {
  14971. return false;
  14972. }
  14973. else {
  14974. needUVs = true;
  14975. defines.push("#define SPECULAR");
  14976. fallbacks.addFallback(0, "SPECULAR");
  14977. }
  14978. }
  14979. }
  14980. if (scene.getEngine().getCaps().standardDerivatives && this.bumpTexture && StandardMaterial.BumpTextureEnabled) {
  14981. if (!this.bumpTexture.isReady()) {
  14982. return false;
  14983. }
  14984. else {
  14985. needUVs = true;
  14986. defines.push("#define BUMP");
  14987. fallbacks.addFallback(0, "BUMP");
  14988. }
  14989. }
  14990. // Effect
  14991. if (this.useSpecularOverAlpha) {
  14992. defines.push("#define SPECULAROVERALPHA");
  14993. fallbacks.addFallback(0, "SPECULAROVERALPHA");
  14994. }
  14995. if (scene.clipPlane) {
  14996. defines.push("#define CLIPPLANE");
  14997. }
  14998. if (engine.getAlphaTesting()) {
  14999. defines.push("#define ALPHATEST");
  15000. }
  15001. if (this._shouldUseAlphaFromDiffuseTexture()) {
  15002. defines.push("#define ALPHAFROMDIFFUSE");
  15003. }
  15004. // Point size
  15005. if (this.pointsCloud || scene.forcePointsCloud) {
  15006. defines.push("#define POINTSIZE");
  15007. }
  15008. // Fog
  15009. if (scene.fogEnabled && mesh && mesh.applyFog && scene.fogMode !== BABYLON.Scene.FOGMODE_NONE && this.fogEnabled) {
  15010. defines.push("#define FOG");
  15011. fallbacks.addFallback(1, "FOG");
  15012. }
  15013. var shadowsActivated = false;
  15014. var lightIndex = 0;
  15015. if (scene.lightsEnabled) {
  15016. for (var index = 0; index < scene.lights.length; index++) {
  15017. var light = scene.lights[index];
  15018. if (!light.isEnabled()) {
  15019. continue;
  15020. }
  15021. // Excluded check
  15022. if (light._excludedMeshesIds.length > 0) {
  15023. for (var excludedIndex = 0; excludedIndex < light._excludedMeshesIds.length; excludedIndex++) {
  15024. var excludedMesh = scene.getMeshByID(light._excludedMeshesIds[excludedIndex]);
  15025. if (excludedMesh) {
  15026. light.excludedMeshes.push(excludedMesh);
  15027. }
  15028. }
  15029. light._excludedMeshesIds = [];
  15030. }
  15031. // Included check
  15032. if (light._includedOnlyMeshesIds.length > 0) {
  15033. for (var includedOnlyIndex = 0; includedOnlyIndex < light._includedOnlyMeshesIds.length; includedOnlyIndex++) {
  15034. var includedOnlyMesh = scene.getMeshByID(light._includedOnlyMeshesIds[includedOnlyIndex]);
  15035. if (includedOnlyMesh) {
  15036. light.includedOnlyMeshes.push(includedOnlyMesh);
  15037. }
  15038. }
  15039. light._includedOnlyMeshesIds = [];
  15040. }
  15041. if (!light.canAffectMesh(mesh)) {
  15042. continue;
  15043. }
  15044. needNormals = true;
  15045. defines.push("#define LIGHT" + lightIndex);
  15046. if (lightIndex > 0) {
  15047. fallbacks.addFallback(lightIndex, "LIGHT" + lightIndex);
  15048. }
  15049. var type;
  15050. if (light instanceof BABYLON.SpotLight) {
  15051. type = "#define SPOTLIGHT" + lightIndex;
  15052. }
  15053. else if (light instanceof BABYLON.HemisphericLight) {
  15054. type = "#define HEMILIGHT" + lightIndex;
  15055. }
  15056. else {
  15057. type = "#define POINTDIRLIGHT" + lightIndex;
  15058. }
  15059. defines.push(type);
  15060. if (lightIndex > 0) {
  15061. fallbacks.addFallback(lightIndex, type.replace("#define ", ""));
  15062. }
  15063. // Shadows
  15064. if (scene.shadowsEnabled) {
  15065. var shadowGenerator = light.getShadowGenerator();
  15066. if (mesh && mesh.receiveShadows && shadowGenerator) {
  15067. defines.push("#define SHADOW" + lightIndex);
  15068. fallbacks.addFallback(0, "SHADOW" + lightIndex);
  15069. if (!shadowsActivated) {
  15070. defines.push("#define SHADOWS");
  15071. shadowsActivated = true;
  15072. }
  15073. if (shadowGenerator.useVarianceShadowMap || shadowGenerator.useBlurVarianceShadowMap) {
  15074. defines.push("#define SHADOWVSM" + lightIndex);
  15075. if (lightIndex > 0) {
  15076. fallbacks.addFallback(0, "SHADOWVSM" + lightIndex);
  15077. }
  15078. }
  15079. if (shadowGenerator.usePoissonSampling) {
  15080. defines.push("#define SHADOWPCF" + lightIndex);
  15081. if (lightIndex > 0) {
  15082. fallbacks.addFallback(0, "SHADOWPCF" + lightIndex);
  15083. }
  15084. }
  15085. }
  15086. }
  15087. lightIndex++;
  15088. if (lightIndex === maxSimultaneousLights)
  15089. break;
  15090. }
  15091. }
  15092. if (StandardMaterial.FresnelEnabled) {
  15093. // Fresnel
  15094. if (this.diffuseFresnelParameters && this.diffuseFresnelParameters.isEnabled || this.opacityFresnelParameters && this.opacityFresnelParameters.isEnabled || this.emissiveFresnelParameters && this.emissiveFresnelParameters.isEnabled || this.reflectionFresnelParameters && this.reflectionFresnelParameters.isEnabled) {
  15095. var fresnelRank = 1;
  15096. if (this.diffuseFresnelParameters && this.diffuseFresnelParameters.isEnabled) {
  15097. defines.push("#define DIFFUSEFRESNEL");
  15098. fallbacks.addFallback(fresnelRank, "DIFFUSEFRESNEL");
  15099. fresnelRank++;
  15100. }
  15101. if (this.opacityFresnelParameters && this.opacityFresnelParameters.isEnabled) {
  15102. defines.push("#define OPACITYFRESNEL");
  15103. fallbacks.addFallback(fresnelRank, "OPACITYFRESNEL");
  15104. fresnelRank++;
  15105. }
  15106. if (this.reflectionFresnelParameters && this.reflectionFresnelParameters.isEnabled) {
  15107. defines.push("#define REFLECTIONFRESNEL");
  15108. fallbacks.addFallback(fresnelRank, "REFLECTIONFRESNEL");
  15109. fresnelRank++;
  15110. }
  15111. if (this.emissiveFresnelParameters && this.emissiveFresnelParameters.isEnabled) {
  15112. defines.push("#define EMISSIVEFRESNEL");
  15113. fallbacks.addFallback(fresnelRank, "EMISSIVEFRESNEL");
  15114. fresnelRank++;
  15115. }
  15116. needNormals = true;
  15117. defines.push("#define FRESNEL");
  15118. fallbacks.addFallback(fresnelRank - 1, "FRESNEL");
  15119. }
  15120. }
  15121. // Attribs
  15122. var attribs = [BABYLON.VertexBuffer.PositionKind];
  15123. if (mesh) {
  15124. if (needNormals && mesh.isVerticesDataPresent(BABYLON.VertexBuffer.NormalKind)) {
  15125. attribs.push(BABYLON.VertexBuffer.NormalKind);
  15126. defines.push("#define NORMAL");
  15127. }
  15128. if (needUVs) {
  15129. if (mesh.isVerticesDataPresent(BABYLON.VertexBuffer.UVKind)) {
  15130. attribs.push(BABYLON.VertexBuffer.UVKind);
  15131. defines.push("#define UV1");
  15132. }
  15133. if (mesh.isVerticesDataPresent(BABYLON.VertexBuffer.UV2Kind)) {
  15134. attribs.push(BABYLON.VertexBuffer.UV2Kind);
  15135. defines.push("#define UV2");
  15136. }
  15137. }
  15138. if (mesh.useVertexColors && mesh.isVerticesDataPresent(BABYLON.VertexBuffer.ColorKind)) {
  15139. attribs.push(BABYLON.VertexBuffer.ColorKind);
  15140. defines.push("#define VERTEXCOLOR");
  15141. if (mesh.hasVertexAlpha) {
  15142. defines.push("#define VERTEXALPHA");
  15143. }
  15144. }
  15145. if (mesh.useBones) {
  15146. attribs.push(BABYLON.VertexBuffer.MatricesIndicesKind);
  15147. attribs.push(BABYLON.VertexBuffer.MatricesWeightsKind);
  15148. defines.push("#define BONES");
  15149. defines.push("#define BonesPerMesh " + (mesh.skeleton.bones.length + 1));
  15150. defines.push("#define BONES4");
  15151. fallbacks.addFallback(0, "BONES4");
  15152. }
  15153. // Instances
  15154. if (useInstances) {
  15155. defines.push("#define INSTANCES");
  15156. attribs.push("world0");
  15157. attribs.push("world1");
  15158. attribs.push("world2");
  15159. attribs.push("world3");
  15160. }
  15161. }
  15162. // Get correct effect
  15163. var join = defines.join("\n");
  15164. if (this._cachedDefines !== join) {
  15165. this._cachedDefines = join;
  15166. scene.resetCachedMaterial();
  15167. // Legacy browser patch
  15168. var shaderName = "default";
  15169. if (!scene.getEngine().getCaps().standardDerivatives) {
  15170. shaderName = "legacydefault";
  15171. }
  15172. this._effect = scene.getEngine().createEffect(shaderName, attribs, ["world", "view", "viewProjection", "vEyePosition", "vLightsType", "vAmbientColor", "vDiffuseColor", "vSpecularColor", "vEmissiveColor", "vLightData0", "vLightDiffuse0", "vLightSpecular0", "vLightDirection0", "vLightGround0", "lightMatrix0", "vLightData1", "vLightDiffuse1", "vLightSpecular1", "vLightDirection1", "vLightGround1", "lightMatrix1", "vLightData2", "vLightDiffuse2", "vLightSpecular2", "vLightDirection2", "vLightGround2", "lightMatrix2", "vLightData3", "vLightDiffuse3", "vLightSpecular3", "vLightDirection3", "vLightGround3", "lightMatrix3", "vFogInfos", "vFogColor", "pointSize", "vDiffuseInfos", "vAmbientInfos", "vOpacityInfos", "vReflectionInfos", "vEmissiveInfos", "vSpecularInfos", "vBumpInfos", "mBones", "vClipPlane", "diffuseMatrix", "ambientMatrix", "opacityMatrix", "reflectionMatrix", "emissiveMatrix", "specularMatrix", "bumpMatrix", "shadowsInfo0", "shadowsInfo1", "shadowsInfo2", "shadowsInfo3", "diffuseLeftColor", "diffuseRightColor", "opacityParts", "reflectionLeftColor", "reflectionRightColor", "emissiveLeftColor", "emissiveRightColor"], ["diffuseSampler", "ambientSampler", "opacitySampler", "reflectionCubeSampler", "reflection2DSampler", "emissiveSampler", "specularSampler", "bumpSampler", "shadowSampler0", "shadowSampler1", "shadowSampler2", "shadowSampler3"], join, fallbacks, this.onCompiled, this.onError);
  15173. }
  15174. if (!this._effect.isReady()) {
  15175. return false;
  15176. }
  15177. this._renderId = scene.getRenderId();
  15178. this._wasPreviouslyReady = true;
  15179. return true;
  15180. };
  15181. StandardMaterial.prototype.unbind = function () {
  15182. if (this.reflectionTexture && this.reflectionTexture.isRenderTarget) {
  15183. this._effect.setTexture("reflection2DSampler", null);
  15184. }
  15185. };
  15186. StandardMaterial.prototype.bindOnlyWorldMatrix = function (world) {
  15187. this._effect.setMatrix("world", world);
  15188. };
  15189. StandardMaterial.prototype.bind = function (world, mesh) {
  15190. var scene = this.getScene();
  15191. // Matrices
  15192. this.bindOnlyWorldMatrix(world);
  15193. this._effect.setMatrix("viewProjection", scene.getTransformMatrix());
  15194. // Bones
  15195. if (mesh && mesh.useBones) {
  15196. this._effect.setMatrices("mBones", mesh.skeleton.getTransformMatrices());
  15197. }
  15198. if (scene.getCachedMaterial() !== this) {
  15199. if (StandardMaterial.FresnelEnabled) {
  15200. // Fresnel
  15201. if (this.diffuseFresnelParameters && this.diffuseFresnelParameters.isEnabled) {
  15202. this._effect.setColor4("diffuseLeftColor", this.diffuseFresnelParameters.leftColor, this.diffuseFresnelParameters.power);
  15203. this._effect.setColor4("diffuseRightColor", this.diffuseFresnelParameters.rightColor, this.diffuseFresnelParameters.bias);
  15204. }
  15205. if (this.opacityFresnelParameters && this.opacityFresnelParameters.isEnabled) {
  15206. this._effect.setColor4("opacityParts", new BABYLON.Color3(this.opacityFresnelParameters.leftColor.toLuminance(), this.opacityFresnelParameters.rightColor.toLuminance(), this.opacityFresnelParameters.bias), this.opacityFresnelParameters.power);
  15207. }
  15208. if (this.reflectionFresnelParameters && this.reflectionFresnelParameters.isEnabled) {
  15209. this._effect.setColor4("reflectionLeftColor", this.reflectionFresnelParameters.leftColor, this.reflectionFresnelParameters.power);
  15210. this._effect.setColor4("reflectionRightColor", this.reflectionFresnelParameters.rightColor, this.reflectionFresnelParameters.bias);
  15211. }
  15212. if (this.emissiveFresnelParameters && this.emissiveFresnelParameters.isEnabled) {
  15213. this._effect.setColor4("emissiveLeftColor", this.emissiveFresnelParameters.leftColor, this.emissiveFresnelParameters.power);
  15214. this._effect.setColor4("emissiveRightColor", this.emissiveFresnelParameters.rightColor, this.emissiveFresnelParameters.bias);
  15215. }
  15216. }
  15217. // Textures
  15218. if (this.diffuseTexture && StandardMaterial.DiffuseTextureEnabled) {
  15219. this._effect.setTexture("diffuseSampler", this.diffuseTexture);
  15220. this._effect.setFloat2("vDiffuseInfos", this.diffuseTexture.coordinatesIndex, this.diffuseTexture.level);
  15221. this._effect.setMatrix("diffuseMatrix", this.diffuseTexture.getTextureMatrix());
  15222. }
  15223. if (this.ambientTexture && StandardMaterial.AmbientTextureEnabled) {
  15224. this._effect.setTexture("ambientSampler", this.ambientTexture);
  15225. this._effect.setFloat2("vAmbientInfos", this.ambientTexture.coordinatesIndex, this.ambientTexture.level);
  15226. this._effect.setMatrix("ambientMatrix", this.ambientTexture.getTextureMatrix());
  15227. }
  15228. if (this.opacityTexture && StandardMaterial.OpacityTextureEnabled) {
  15229. this._effect.setTexture("opacitySampler", this.opacityTexture);
  15230. this._effect.setFloat2("vOpacityInfos", this.opacityTexture.coordinatesIndex, this.opacityTexture.level);
  15231. this._effect.setMatrix("opacityMatrix", this.opacityTexture.getTextureMatrix());
  15232. }
  15233. if (this.reflectionTexture && StandardMaterial.ReflectionTextureEnabled) {
  15234. if (this.reflectionTexture.isCube) {
  15235. this._effect.setTexture("reflectionCubeSampler", this.reflectionTexture);
  15236. }
  15237. else {
  15238. this._effect.setTexture("reflection2DSampler", this.reflectionTexture);
  15239. }
  15240. this._effect.setMatrix("reflectionMatrix", this.reflectionTexture.getReflectionTextureMatrix());
  15241. this._effect.setFloat3("vReflectionInfos", this.reflectionTexture.coordinatesMode, this.reflectionTexture.level, this.reflectionTexture.isCube ? 1 : 0);
  15242. }
  15243. if (this.emissiveTexture && StandardMaterial.EmissiveTextureEnabled) {
  15244. this._effect.setTexture("emissiveSampler", this.emissiveTexture);
  15245. this._effect.setFloat2("vEmissiveInfos", this.emissiveTexture.coordinatesIndex, this.emissiveTexture.level);
  15246. this._effect.setMatrix("emissiveMatrix", this.emissiveTexture.getTextureMatrix());
  15247. }
  15248. if (this.specularTexture && StandardMaterial.SpecularTextureEnabled) {
  15249. this._effect.setTexture("specularSampler", this.specularTexture);
  15250. this._effect.setFloat2("vSpecularInfos", this.specularTexture.coordinatesIndex, this.specularTexture.level);
  15251. this._effect.setMatrix("specularMatrix", this.specularTexture.getTextureMatrix());
  15252. }
  15253. if (this.bumpTexture && scene.getEngine().getCaps().standardDerivatives && StandardMaterial.BumpTextureEnabled) {
  15254. this._effect.setTexture("bumpSampler", this.bumpTexture);
  15255. this._effect.setFloat2("vBumpInfos", this.bumpTexture.coordinatesIndex, 1.0 / this.bumpTexture.level);
  15256. this._effect.setMatrix("bumpMatrix", this.bumpTexture.getTextureMatrix());
  15257. }
  15258. // Clip plane
  15259. if (scene.clipPlane) {
  15260. var clipPlane = scene.clipPlane;
  15261. this._effect.setFloat4("vClipPlane", clipPlane.normal.x, clipPlane.normal.y, clipPlane.normal.z, clipPlane.d);
  15262. }
  15263. // Point size
  15264. if (this.pointsCloud) {
  15265. this._effect.setFloat("pointSize", this.pointSize);
  15266. }
  15267. // Colors
  15268. scene.ambientColor.multiplyToRef(this.ambientColor, this._globalAmbientColor);
  15269. // Scaling down color according to emissive
  15270. this._scaledSpecular.r = this.specularColor.r * BABYLON.Tools.Clamp(1.0 - this.emissiveColor.r);
  15271. this._scaledSpecular.g = this.specularColor.g * BABYLON.Tools.Clamp(1.0 - this.emissiveColor.g);
  15272. this._scaledSpecular.b = this.specularColor.b * BABYLON.Tools.Clamp(1.0 - this.emissiveColor.b);
  15273. this._effect.setVector3("vEyePosition", scene.activeCamera.position);
  15274. this._effect.setColor3("vAmbientColor", this._globalAmbientColor);
  15275. this._effect.setColor4("vSpecularColor", this._scaledSpecular, this.specularPower);
  15276. this._effect.setColor3("vEmissiveColor", this.emissiveColor);
  15277. }
  15278. // Scaling down color according to emissive
  15279. this._scaledDiffuse.r = this.diffuseColor.r * BABYLON.Tools.Clamp(1.0 - this.emissiveColor.r);
  15280. this._scaledDiffuse.g = this.diffuseColor.g * BABYLON.Tools.Clamp(1.0 - this.emissiveColor.g);
  15281. this._scaledDiffuse.b = this.diffuseColor.b * BABYLON.Tools.Clamp(1.0 - this.emissiveColor.b);
  15282. this._effect.setColor4("vDiffuseColor", this._scaledDiffuse, this.alpha * mesh.visibility);
  15283. if (scene.lightsEnabled) {
  15284. var lightIndex = 0;
  15285. for (var index = 0; index < scene.lights.length; index++) {
  15286. var light = scene.lights[index];
  15287. if (!light.isEnabled()) {
  15288. continue;
  15289. }
  15290. if (!light.canAffectMesh(mesh)) {
  15291. continue;
  15292. }
  15293. if (light instanceof BABYLON.PointLight) {
  15294. // Point Light
  15295. light.transferToEffect(this._effect, "vLightData" + lightIndex);
  15296. }
  15297. else if (light instanceof BABYLON.DirectionalLight) {
  15298. // Directional Light
  15299. light.transferToEffect(this._effect, "vLightData" + lightIndex);
  15300. }
  15301. else if (light instanceof BABYLON.SpotLight) {
  15302. // Spot Light
  15303. light.transferToEffect(this._effect, "vLightData" + lightIndex, "vLightDirection" + lightIndex);
  15304. }
  15305. else if (light instanceof BABYLON.HemisphericLight) {
  15306. // Hemispheric Light
  15307. light.transferToEffect(this._effect, "vLightData" + lightIndex, "vLightGround" + lightIndex);
  15308. }
  15309. light.diffuse.scaleToRef(light.intensity, this._scaledDiffuse);
  15310. light.specular.scaleToRef(light.intensity, this._scaledSpecular);
  15311. this._effect.setColor4("vLightDiffuse" + lightIndex, this._scaledDiffuse, light.range);
  15312. this._effect.setColor3("vLightSpecular" + lightIndex, this._scaledSpecular);
  15313. // Shadows
  15314. if (scene.shadowsEnabled) {
  15315. var shadowGenerator = light.getShadowGenerator();
  15316. if (mesh.receiveShadows && shadowGenerator) {
  15317. this._effect.setMatrix("lightMatrix" + lightIndex, shadowGenerator.getTransformMatrix());
  15318. this._effect.setTexture("shadowSampler" + lightIndex, shadowGenerator.getShadowMapForRendering());
  15319. this._effect.setFloat3("shadowsInfo" + lightIndex, shadowGenerator.getDarkness(), shadowGenerator.getShadowMap().getSize().width, shadowGenerator.bias);
  15320. }
  15321. }
  15322. lightIndex++;
  15323. if (lightIndex === maxSimultaneousLights)
  15324. break;
  15325. }
  15326. }
  15327. // View
  15328. if (scene.fogEnabled && mesh.applyFog && scene.fogMode !== BABYLON.Scene.FOGMODE_NONE || this.reflectionTexture) {
  15329. this._effect.setMatrix("view", scene.getViewMatrix());
  15330. }
  15331. // Fog
  15332. if (scene.fogEnabled && mesh.applyFog && scene.fogMode !== BABYLON.Scene.FOGMODE_NONE) {
  15333. this._effect.setFloat4("vFogInfos", scene.fogMode, scene.fogStart, scene.fogEnd, scene.fogDensity);
  15334. this._effect.setColor3("vFogColor", scene.fogColor);
  15335. }
  15336. _super.prototype.bind.call(this, world, mesh);
  15337. };
  15338. StandardMaterial.prototype.getAnimatables = function () {
  15339. var results = [];
  15340. if (this.diffuseTexture && this.diffuseTexture.animations && this.diffuseTexture.animations.length > 0) {
  15341. results.push(this.diffuseTexture);
  15342. }
  15343. if (this.ambientTexture && this.ambientTexture.animations && this.ambientTexture.animations.length > 0) {
  15344. results.push(this.ambientTexture);
  15345. }
  15346. if (this.opacityTexture && this.opacityTexture.animations && this.opacityTexture.animations.length > 0) {
  15347. results.push(this.opacityTexture);
  15348. }
  15349. if (this.reflectionTexture && this.reflectionTexture.animations && this.reflectionTexture.animations.length > 0) {
  15350. results.push(this.reflectionTexture);
  15351. }
  15352. if (this.emissiveTexture && this.emissiveTexture.animations && this.emissiveTexture.animations.length > 0) {
  15353. results.push(this.emissiveTexture);
  15354. }
  15355. if (this.specularTexture && this.specularTexture.animations && this.specularTexture.animations.length > 0) {
  15356. results.push(this.specularTexture);
  15357. }
  15358. if (this.bumpTexture && this.bumpTexture.animations && this.bumpTexture.animations.length > 0) {
  15359. results.push(this.bumpTexture);
  15360. }
  15361. return results;
  15362. };
  15363. StandardMaterial.prototype.dispose = function (forceDisposeEffect) {
  15364. if (this.diffuseTexture) {
  15365. this.diffuseTexture.dispose();
  15366. }
  15367. if (this.ambientTexture) {
  15368. this.ambientTexture.dispose();
  15369. }
  15370. if (this.opacityTexture) {
  15371. this.opacityTexture.dispose();
  15372. }
  15373. if (this.reflectionTexture) {
  15374. this.reflectionTexture.dispose();
  15375. }
  15376. if (this.emissiveTexture) {
  15377. this.emissiveTexture.dispose();
  15378. }
  15379. if (this.specularTexture) {
  15380. this.specularTexture.dispose();
  15381. }
  15382. if (this.bumpTexture) {
  15383. this.bumpTexture.dispose();
  15384. }
  15385. _super.prototype.dispose.call(this, forceDisposeEffect);
  15386. };
  15387. StandardMaterial.prototype.clone = function (name) {
  15388. var newStandardMaterial = new StandardMaterial(name, this.getScene());
  15389. // Base material
  15390. newStandardMaterial.checkReadyOnEveryCall = this.checkReadyOnEveryCall;
  15391. newStandardMaterial.alpha = this.alpha;
  15392. newStandardMaterial.fillMode = this.fillMode;
  15393. newStandardMaterial.backFaceCulling = this.backFaceCulling;
  15394. // Standard material
  15395. if (this.diffuseTexture && this.diffuseTexture.clone) {
  15396. newStandardMaterial.diffuseTexture = this.diffuseTexture.clone();
  15397. }
  15398. if (this.ambientTexture && this.ambientTexture.clone) {
  15399. newStandardMaterial.ambientTexture = this.ambientTexture.clone();
  15400. }
  15401. if (this.opacityTexture && this.opacityTexture.clone) {
  15402. newStandardMaterial.opacityTexture = this.opacityTexture.clone();
  15403. }
  15404. if (this.reflectionTexture && this.reflectionTexture.clone) {
  15405. newStandardMaterial.reflectionTexture = this.reflectionTexture.clone();
  15406. }
  15407. if (this.emissiveTexture && this.emissiveTexture.clone) {
  15408. newStandardMaterial.emissiveTexture = this.emissiveTexture.clone();
  15409. }
  15410. if (this.specularTexture && this.specularTexture.clone) {
  15411. newStandardMaterial.specularTexture = this.specularTexture.clone();
  15412. }
  15413. if (this.bumpTexture && this.bumpTexture.clone) {
  15414. newStandardMaterial.bumpTexture = this.bumpTexture.clone();
  15415. }
  15416. newStandardMaterial.ambientColor = this.ambientColor.clone();
  15417. newStandardMaterial.diffuseColor = this.diffuseColor.clone();
  15418. newStandardMaterial.specularColor = this.specularColor.clone();
  15419. newStandardMaterial.specularPower = this.specularPower;
  15420. newStandardMaterial.emissiveColor = this.emissiveColor.clone();
  15421. return newStandardMaterial;
  15422. };
  15423. // Statics
  15424. // Flags used to enable or disable a type of texture for all Standard Materials
  15425. StandardMaterial.DiffuseTextureEnabled = true;
  15426. StandardMaterial.AmbientTextureEnabled = true;
  15427. StandardMaterial.OpacityTextureEnabled = true;
  15428. StandardMaterial.ReflectionTextureEnabled = true;
  15429. StandardMaterial.EmissiveTextureEnabled = true;
  15430. StandardMaterial.SpecularTextureEnabled = true;
  15431. StandardMaterial.BumpTextureEnabled = true;
  15432. StandardMaterial.FresnelEnabled = true;
  15433. return StandardMaterial;
  15434. })(BABYLON.Material);
  15435. BABYLON.StandardMaterial = StandardMaterial;
  15436. })(BABYLON || (BABYLON = {}));
  15437. //# sourceMappingURL=babylon.standardMaterial.js.map
  15438. var BABYLON;
  15439. (function (BABYLON) {
  15440. var MultiMaterial = (function (_super) {
  15441. __extends(MultiMaterial, _super);
  15442. function MultiMaterial(name, scene) {
  15443. _super.call(this, name, scene, true);
  15444. this.subMaterials = new Array();
  15445. scene.multiMaterials.push(this);
  15446. }
  15447. // Properties
  15448. MultiMaterial.prototype.getSubMaterial = function (index) {
  15449. if (index < 0 || index >= this.subMaterials.length) {
  15450. return this.getScene().defaultMaterial;
  15451. }
  15452. return this.subMaterials[index];
  15453. };
  15454. // Methods
  15455. MultiMaterial.prototype.isReady = function (mesh) {
  15456. for (var index = 0; index < this.subMaterials.length; index++) {
  15457. var subMaterial = this.subMaterials[index];
  15458. if (subMaterial) {
  15459. if (!this.subMaterials[index].isReady(mesh)) {
  15460. return false;
  15461. }
  15462. }
  15463. }
  15464. return true;
  15465. };
  15466. return MultiMaterial;
  15467. })(BABYLON.Material);
  15468. BABYLON.MultiMaterial = MultiMaterial;
  15469. })(BABYLON || (BABYLON = {}));
  15470. //# sourceMappingURL=babylon.multiMaterial.js.mapvar BABYLON;
  15471. (function (BABYLON) {
  15472. var Database = (function () {
  15473. function Database(urlToScene, callbackManifestChecked) {
  15474. // Handling various flavors of prefixed version of IndexedDB
  15475. this.idbFactory = (window.indexedDB || window.mozIndexedDB || window.webkitIndexedDB || window.msIndexedDB);
  15476. this.callbackManifestChecked = callbackManifestChecked;
  15477. this.currentSceneUrl = BABYLON.Database.ReturnFullUrlLocation(urlToScene);
  15478. this.db = null;
  15479. this.enableSceneOffline = false;
  15480. this.enableTexturesOffline = false;
  15481. this.manifestVersionFound = 0;
  15482. this.mustUpdateRessources = false;
  15483. this.hasReachedQuota = false;
  15484. this.checkManifestFile();
  15485. }
  15486. Database.prototype.checkManifestFile = function () {
  15487. var _this = this;
  15488. function noManifestFile() {
  15489. //BABYLON.Tools.Log("Valid manifest file not found. Scene & textures will be loaded directly from the web server.");
  15490. that.enableSceneOffline = false;
  15491. that.enableTexturesOffline = false;
  15492. that.callbackManifestChecked(false);
  15493. }
  15494. var that = this;
  15495. var manifestURL = this.currentSceneUrl + ".manifest";
  15496. var xhr = new XMLHttpRequest();
  15497. var manifestURLTimeStamped = manifestURL + (manifestURL.match(/\?/) == null ? "?" : "&") + (new Date()).getTime();
  15498. xhr.open("GET", manifestURLTimeStamped, true);
  15499. xhr.addEventListener("load", function () {
  15500. if (xhr.status === 200 || BABYLON.Tools.ValidateXHRData(xhr, 1)) {
  15501. try {
  15502. var manifestFile = JSON.parse(xhr.response);
  15503. _this.enableSceneOffline = manifestFile.enableSceneOffline;
  15504. _this.enableTexturesOffline = manifestFile.enableTexturesOffline;
  15505. if (manifestFile.version && !isNaN(parseInt(manifestFile.version))) {
  15506. _this.manifestVersionFound = manifestFile.version;
  15507. }
  15508. if (_this.callbackManifestChecked) {
  15509. _this.callbackManifestChecked(true);
  15510. }
  15511. }
  15512. catch (ex) {
  15513. noManifestFile();
  15514. }
  15515. }
  15516. else {
  15517. noManifestFile();
  15518. }
  15519. }, false);
  15520. xhr.addEventListener("error", function (event) {
  15521. noManifestFile();
  15522. }, false);
  15523. try {
  15524. xhr.send();
  15525. }
  15526. catch (ex) {
  15527. BABYLON.Tools.Error("Error on XHR send request.");
  15528. that.callbackManifestChecked(false);
  15529. }
  15530. };
  15531. Database.prototype.openAsync = function (successCallback, errorCallback) {
  15532. var _this = this;
  15533. function handleError() {
  15534. that.isSupported = false;
  15535. if (errorCallback)
  15536. errorCallback();
  15537. }
  15538. var that = this;
  15539. if (!this.idbFactory || !(this.enableSceneOffline || this.enableTexturesOffline)) {
  15540. // Your browser doesn't support IndexedDB
  15541. this.isSupported = false;
  15542. if (errorCallback)
  15543. errorCallback();
  15544. }
  15545. else {
  15546. // If the DB hasn't been opened or created yet
  15547. if (!this.db) {
  15548. this.hasReachedQuota = false;
  15549. this.isSupported = true;
  15550. var request = this.idbFactory.open("babylonjs", 1);
  15551. // Could occur if user is blocking the quota for the DB and/or doesn't grant access to IndexedDB
  15552. request.onerror = function (event) {
  15553. handleError();
  15554. };
  15555. // executes when a version change transaction cannot complete due to other active transactions
  15556. request.onblocked = function (event) {
  15557. BABYLON.Tools.Error("IDB request blocked. Please reload the page.");
  15558. handleError();
  15559. };
  15560. // DB has been opened successfully
  15561. request.onsuccess = function (event) {
  15562. _this.db = request.result;
  15563. successCallback();
  15564. };
  15565. // Initialization of the DB. Creating Scenes & Textures stores
  15566. request.onupgradeneeded = function (event) {
  15567. _this.db = (event.target).result;
  15568. try {
  15569. var scenesStore = _this.db.createObjectStore("scenes", { keyPath: "sceneUrl" });
  15570. var versionsStore = _this.db.createObjectStore("versions", { keyPath: "sceneUrl" });
  15571. var texturesStore = _this.db.createObjectStore("textures", { keyPath: "textureUrl" });
  15572. }
  15573. catch (ex) {
  15574. BABYLON.Tools.Error("Error while creating object stores. Exception: " + ex.message);
  15575. handleError();
  15576. }
  15577. };
  15578. }
  15579. else {
  15580. if (successCallback)
  15581. successCallback();
  15582. }
  15583. }
  15584. };
  15585. Database.prototype.loadImageFromDB = function (url, image) {
  15586. var _this = this;
  15587. var completeURL = Database.ReturnFullUrlLocation(url);
  15588. var saveAndLoadImage = function () {
  15589. if (!_this.hasReachedQuota && _this.db !== null) {
  15590. // the texture is not yet in the DB, let's try to save it
  15591. _this._saveImageIntoDBAsync(completeURL, image);
  15592. }
  15593. else {
  15594. image.src = url;
  15595. }
  15596. };
  15597. if (!this.mustUpdateRessources) {
  15598. this._loadImageFromDBAsync(completeURL, image, saveAndLoadImage);
  15599. }
  15600. else {
  15601. saveAndLoadImage();
  15602. }
  15603. };
  15604. Database.prototype._loadImageFromDBAsync = function (url, image, notInDBCallback) {
  15605. if (this.isSupported && this.db !== null) {
  15606. var texture;
  15607. var transaction = this.db.transaction(["textures"]);
  15608. transaction.onabort = function (event) {
  15609. image.src = url;
  15610. };
  15611. transaction.oncomplete = function (event) {
  15612. var blobTextureURL;
  15613. if (texture) {
  15614. var URL = window.URL || window.webkitURL;
  15615. blobTextureURL = URL.createObjectURL(texture.data, { oneTimeOnly: true });
  15616. image.onerror = function () {
  15617. BABYLON.Tools.Error("Error loading image from blob URL: " + blobTextureURL + " switching back to web url: " + url);
  15618. image.src = url;
  15619. };
  15620. image.src = blobTextureURL;
  15621. }
  15622. else {
  15623. notInDBCallback();
  15624. }
  15625. };
  15626. var getRequest = transaction.objectStore("textures").get(url);
  15627. getRequest.onsuccess = function (event) {
  15628. texture = (event.target).result;
  15629. };
  15630. getRequest.onerror = function (event) {
  15631. BABYLON.Tools.Error("Error loading texture " + url + " from DB.");
  15632. image.src = url;
  15633. };
  15634. }
  15635. else {
  15636. BABYLON.Tools.Error("Error: IndexedDB not supported by your browser or BabylonJS Database is not open.");
  15637. image.src = url;
  15638. }
  15639. };
  15640. Database.prototype._saveImageIntoDBAsync = function (url, image) {
  15641. var _this = this;
  15642. if (this.isSupported) {
  15643. // In case of error (type not supported or quota exceeded), we're at least sending back XHR data to allow texture loading later on
  15644. var generateBlobUrl = function () {
  15645. var blobTextureURL;
  15646. if (blob) {
  15647. var URL = window.URL || window.webkitURL;
  15648. try {
  15649. blobTextureURL = URL.createObjectURL(blob, { oneTimeOnly: true });
  15650. }
  15651. catch (ex) {
  15652. blobTextureURL = URL.createObjectURL(blob);
  15653. }
  15654. }
  15655. image.src = blobTextureURL;
  15656. };
  15657. if (Database.isUASupportingBlobStorage) {
  15658. var xhr = new XMLHttpRequest(), blob;
  15659. xhr.open("GET", url, true);
  15660. xhr.responseType = "blob";
  15661. xhr.addEventListener("load", function () {
  15662. if (xhr.status === 200) {
  15663. // Blob as response (XHR2)
  15664. blob = xhr.response;
  15665. var transaction = _this.db.transaction(["textures"], "readwrite");
  15666. // the transaction could abort because of a QuotaExceededError error
  15667. transaction.onabort = function (event) {
  15668. try {
  15669. //backwards compatibility with ts 1.0, srcElement doesn't have an "error" according to ts 1.3
  15670. if (event.srcElement['error'] && event.srcElement['error'].name === "QuotaExceededError") {
  15671. this.hasReachedQuota = true;
  15672. }
  15673. }
  15674. catch (ex) {
  15675. }
  15676. generateBlobUrl();
  15677. };
  15678. transaction.oncomplete = function (event) {
  15679. generateBlobUrl();
  15680. };
  15681. var newTexture = { textureUrl: url, data: blob };
  15682. try {
  15683. // Put the blob into the dabase
  15684. var addRequest = transaction.objectStore("textures").put(newTexture);
  15685. addRequest.onsuccess = function (event) {
  15686. };
  15687. addRequest.onerror = function (event) {
  15688. generateBlobUrl();
  15689. };
  15690. }
  15691. catch (ex) {
  15692. // "DataCloneError" generated by Chrome when you try to inject blob into IndexedDB
  15693. if (ex.code === 25) {
  15694. Database.isUASupportingBlobStorage = false;
  15695. }
  15696. image.src = url;
  15697. }
  15698. }
  15699. else {
  15700. image.src = url;
  15701. }
  15702. }, false);
  15703. xhr.addEventListener("error", function (event) {
  15704. BABYLON.Tools.Error("Error in XHR request in BABYLON.Database.");
  15705. image.src = url;
  15706. }, false);
  15707. xhr.send();
  15708. }
  15709. else {
  15710. image.src = url;
  15711. }
  15712. }
  15713. else {
  15714. BABYLON.Tools.Error("Error: IndexedDB not supported by your browser or BabylonJS Database is not open.");
  15715. image.src = url;
  15716. }
  15717. };
  15718. Database.prototype._checkVersionFromDB = function (url, versionLoaded) {
  15719. var _this = this;
  15720. var updateVersion = function (event) {
  15721. // the version is not yet in the DB or we need to update it
  15722. _this._saveVersionIntoDBAsync(url, versionLoaded);
  15723. };
  15724. this._loadVersionFromDBAsync(url, versionLoaded, updateVersion);
  15725. };
  15726. Database.prototype._loadVersionFromDBAsync = function (url, callback, updateInDBCallback) {
  15727. var _this = this;
  15728. if (this.isSupported) {
  15729. var version;
  15730. try {
  15731. var transaction = this.db.transaction(["versions"]);
  15732. transaction.oncomplete = function (event) {
  15733. if (version) {
  15734. // If the version in the JSON file is > than the version in DB
  15735. if (_this.manifestVersionFound > version.data) {
  15736. _this.mustUpdateRessources = true;
  15737. updateInDBCallback();
  15738. }
  15739. else {
  15740. callback(version.data);
  15741. }
  15742. }
  15743. else {
  15744. _this.mustUpdateRessources = true;
  15745. updateInDBCallback();
  15746. }
  15747. };
  15748. transaction.onabort = function (event) {
  15749. callback(-1);
  15750. };
  15751. var getRequest = transaction.objectStore("versions").get(url);
  15752. getRequest.onsuccess = function (event) {
  15753. version = (event.target).result;
  15754. };
  15755. getRequest.onerror = function (event) {
  15756. BABYLON.Tools.Error("Error loading version for scene " + url + " from DB.");
  15757. callback(-1);
  15758. };
  15759. }
  15760. catch (ex) {
  15761. BABYLON.Tools.Error("Error while accessing 'versions' object store (READ OP). Exception: " + ex.message);
  15762. callback(-1);
  15763. }
  15764. }
  15765. else {
  15766. BABYLON.Tools.Error("Error: IndexedDB not supported by your browser or BabylonJS Database is not open.");
  15767. callback(-1);
  15768. }
  15769. };
  15770. Database.prototype._saveVersionIntoDBAsync = function (url, callback) {
  15771. var _this = this;
  15772. if (this.isSupported && !this.hasReachedQuota) {
  15773. try {
  15774. // Open a transaction to the database
  15775. var transaction = this.db.transaction(["versions"], "readwrite");
  15776. // the transaction could abort because of a QuotaExceededError error
  15777. transaction.onabort = function (event) {
  15778. try {
  15779. if (event.srcElement['error'] && event.srcElement['error'].name === "QuotaExceededError") {
  15780. _this.hasReachedQuota = true;
  15781. }
  15782. }
  15783. catch (ex) {
  15784. }
  15785. callback(-1);
  15786. };
  15787. transaction.oncomplete = function (event) {
  15788. callback(_this.manifestVersionFound);
  15789. };
  15790. var newVersion = { sceneUrl: url, data: this.manifestVersionFound };
  15791. // Put the scene into the database
  15792. var addRequest = transaction.objectStore("versions").put(newVersion);
  15793. addRequest.onsuccess = function (event) {
  15794. };
  15795. addRequest.onerror = function (event) {
  15796. BABYLON.Tools.Error("Error in DB add version request in BABYLON.Database.");
  15797. };
  15798. }
  15799. catch (ex) {
  15800. BABYLON.Tools.Error("Error while accessing 'versions' object store (WRITE OP). Exception: " + ex.message);
  15801. callback(-1);
  15802. }
  15803. }
  15804. else {
  15805. callback(-1);
  15806. }
  15807. };
  15808. Database.prototype.loadFileFromDB = function (url, sceneLoaded, progressCallBack, errorCallback, useArrayBuffer) {
  15809. var _this = this;
  15810. var completeUrl = Database.ReturnFullUrlLocation(url);
  15811. var saveAndLoadFile = function (event) {
  15812. // the scene is not yet in the DB, let's try to save it
  15813. _this._saveFileIntoDBAsync(completeUrl, sceneLoaded, progressCallBack);
  15814. };
  15815. this._checkVersionFromDB(completeUrl, function (version) {
  15816. if (version !== -1) {
  15817. if (!_this.mustUpdateRessources) {
  15818. _this._loadFileFromDBAsync(completeUrl, sceneLoaded, saveAndLoadFile, useArrayBuffer);
  15819. }
  15820. else {
  15821. _this._saveFileIntoDBAsync(completeUrl, sceneLoaded, progressCallBack, useArrayBuffer);
  15822. }
  15823. }
  15824. else {
  15825. errorCallback();
  15826. }
  15827. });
  15828. };
  15829. Database.prototype._loadFileFromDBAsync = function (url, callback, notInDBCallback, useArrayBuffer) {
  15830. if (this.isSupported) {
  15831. var targetStore;
  15832. if (url.indexOf(".babylon") !== -1) {
  15833. targetStore = "scenes";
  15834. }
  15835. else {
  15836. targetStore = "textures";
  15837. }
  15838. var file;
  15839. var transaction = this.db.transaction([targetStore]);
  15840. transaction.oncomplete = function (event) {
  15841. if (file) {
  15842. callback(file.data);
  15843. }
  15844. else {
  15845. notInDBCallback();
  15846. }
  15847. };
  15848. transaction.onabort = function (event) {
  15849. notInDBCallback();
  15850. };
  15851. var getRequest = transaction.objectStore(targetStore).get(url);
  15852. getRequest.onsuccess = function (event) {
  15853. file = (event.target).result;
  15854. };
  15855. getRequest.onerror = function (event) {
  15856. BABYLON.Tools.Error("Error loading file " + url + " from DB.");
  15857. notInDBCallback();
  15858. };
  15859. }
  15860. else {
  15861. BABYLON.Tools.Error("Error: IndexedDB not supported by your browser or BabylonJS Database is not open.");
  15862. callback();
  15863. }
  15864. };
  15865. Database.prototype._saveFileIntoDBAsync = function (url, callback, progressCallback, useArrayBuffer) {
  15866. var _this = this;
  15867. if (this.isSupported) {
  15868. var targetStore;
  15869. if (url.indexOf(".babylon") !== -1) {
  15870. targetStore = "scenes";
  15871. }
  15872. else {
  15873. targetStore = "textures";
  15874. }
  15875. // Create XHR
  15876. var xhr = new XMLHttpRequest(), fileData;
  15877. xhr.open("GET", url, true);
  15878. if (useArrayBuffer) {
  15879. xhr.responseType = "arraybuffer";
  15880. }
  15881. xhr.onprogress = progressCallback;
  15882. xhr.addEventListener("load", function () {
  15883. if (xhr.status === 200 || BABYLON.Tools.ValidateXHRData(xhr, !useArrayBuffer ? 1 : 6)) {
  15884. // Blob as response (XHR2)
  15885. //fileData = xhr.responseText;
  15886. fileData = !useArrayBuffer ? xhr.responseText : xhr.response;
  15887. if (!_this.hasReachedQuota) {
  15888. // Open a transaction to the database
  15889. var transaction = _this.db.transaction([targetStore], "readwrite");
  15890. // the transaction could abort because of a QuotaExceededError error
  15891. transaction.onabort = function (event) {
  15892. try {
  15893. //backwards compatibility with ts 1.0, srcElement doesn't have an "error" according to ts 1.3
  15894. if (event.srcElement['error'] && event.srcElement['error'].name === "QuotaExceededError") {
  15895. this.hasReachedQuota = true;
  15896. }
  15897. }
  15898. catch (ex) {
  15899. }
  15900. callback(fileData);
  15901. };
  15902. transaction.oncomplete = function (event) {
  15903. callback(fileData);
  15904. };
  15905. var newFile;
  15906. if (targetStore === "scenes") {
  15907. newFile = { sceneUrl: url, data: fileData, version: _this.manifestVersionFound };
  15908. }
  15909. else {
  15910. newFile = { textureUrl: url, data: fileData };
  15911. }
  15912. try {
  15913. // Put the scene into the database
  15914. var addRequest = transaction.objectStore(targetStore).put(newFile);
  15915. addRequest.onsuccess = function (event) {
  15916. };
  15917. addRequest.onerror = function (event) {
  15918. BABYLON.Tools.Error("Error in DB add file request in BABYLON.Database.");
  15919. };
  15920. }
  15921. catch (ex) {
  15922. callback(fileData);
  15923. }
  15924. }
  15925. else {
  15926. callback(fileData);
  15927. }
  15928. }
  15929. else {
  15930. callback();
  15931. }
  15932. }, false);
  15933. xhr.addEventListener("error", function (event) {
  15934. BABYLON.Tools.Error("error on XHR request.");
  15935. callback();
  15936. }, false);
  15937. xhr.send();
  15938. }
  15939. else {
  15940. BABYLON.Tools.Error("Error: IndexedDB not supported by your browser or BabylonJS Database is not open.");
  15941. callback();
  15942. }
  15943. };
  15944. Database.isUASupportingBlobStorage = true;
  15945. Database.parseURL = function (url) {
  15946. var a = document.createElement('a');
  15947. a.href = url;
  15948. var urlWithoutHash = url.substring(0, url.lastIndexOf("#"));
  15949. var fileName = url.substring(urlWithoutHash.lastIndexOf("/") + 1, url.length);
  15950. var absLocation = url.substring(0, url.indexOf(fileName, 0));
  15951. return absLocation;
  15952. };
  15953. Database.ReturnFullUrlLocation = function (url) {
  15954. if (url.indexOf("http:/") === -1) {
  15955. return (BABYLON.Database.parseURL(window.location.href) + url);
  15956. }
  15957. else {
  15958. return url;
  15959. }
  15960. };
  15961. return Database;
  15962. })();
  15963. BABYLON.Database = Database;
  15964. })(BABYLON || (BABYLON = {}));
  15965. //# sourceMappingURL=babylon.database.js.mapvar BABYLON;
  15966. (function (BABYLON) {
  15967. var SpriteManager = (function () {
  15968. function SpriteManager(name, imgUrl, capacity, cellSize, scene, epsilon, samplingMode) {
  15969. if (samplingMode === void 0) { samplingMode = BABYLON.Texture.TRILINEAR_SAMPLINGMODE; }
  15970. this.name = name;
  15971. this.cellSize = cellSize;
  15972. this.sprites = new Array();
  15973. this.renderingGroupId = 0;
  15974. this.fogEnabled = true;
  15975. this._vertexDeclaration = [4, 4, 4, 4];
  15976. this._vertexStrideSize = 16 * 4; // 15 floats per sprite (x, y, z, angle, sizeX, sizeY, offsetX, offsetY, invertU, invertV, cellIndexX, cellIndexY, color)
  15977. this._capacity = capacity;
  15978. this._spriteTexture = new BABYLON.Texture(imgUrl, scene, true, false, samplingMode);
  15979. this._spriteTexture.wrapU = BABYLON.Texture.CLAMP_ADDRESSMODE;
  15980. this._spriteTexture.wrapV = BABYLON.Texture.CLAMP_ADDRESSMODE;
  15981. this._epsilon = epsilon === undefined ? 0.01 : epsilon;
  15982. this._scene = scene;
  15983. this._scene.spriteManagers.push(this);
  15984. // VBO
  15985. this._vertexBuffer = scene.getEngine().createDynamicVertexBuffer(capacity * this._vertexStrideSize * 4);
  15986. var indices = [];
  15987. var index = 0;
  15988. for (var count = 0; count < capacity; count++) {
  15989. indices.push(index);
  15990. indices.push(index + 1);
  15991. indices.push(index + 2);
  15992. indices.push(index);
  15993. indices.push(index + 2);
  15994. indices.push(index + 3);
  15995. index += 4;
  15996. }
  15997. this._indexBuffer = scene.getEngine().createIndexBuffer(indices);
  15998. this._vertices = new Float32Array(capacity * this._vertexStrideSize);
  15999. // Effects
  16000. this._effectBase = this._scene.getEngine().createEffect("sprites", ["position", "options", "cellInfo", "color"], ["view", "projection", "textureInfos", "alphaTest"], ["diffuseSampler"], "");
  16001. this._effectFog = this._scene.getEngine().createEffect("sprites", ["position", "options", "cellInfo", "color"], ["view", "projection", "textureInfos", "alphaTest", "vFogInfos", "vFogColor"], ["diffuseSampler"], "#define FOG");
  16002. }
  16003. SpriteManager.prototype._appendSpriteVertex = function (index, sprite, offsetX, offsetY, rowSize) {
  16004. var arrayOffset = index * 16;
  16005. if (offsetX === 0)
  16006. offsetX = this._epsilon;
  16007. else if (offsetX === 1)
  16008. offsetX = 1 - this._epsilon;
  16009. if (offsetY === 0)
  16010. offsetY = this._epsilon;
  16011. else if (offsetY === 1)
  16012. offsetY = 1 - this._epsilon;
  16013. this._vertices[arrayOffset] = sprite.position.x;
  16014. this._vertices[arrayOffset + 1] = sprite.position.y;
  16015. this._vertices[arrayOffset + 2] = sprite.position.z;
  16016. this._vertices[arrayOffset + 3] = sprite.angle;
  16017. this._vertices[arrayOffset + 4] = sprite.width;
  16018. this._vertices[arrayOffset + 5] = sprite.height;
  16019. this._vertices[arrayOffset + 6] = offsetX;
  16020. this._vertices[arrayOffset + 7] = offsetY;
  16021. this._vertices[arrayOffset + 8] = sprite.invertU ? 1 : 0;
  16022. this._vertices[arrayOffset + 9] = sprite.invertV ? 1 : 0;
  16023. var offset = (sprite.cellIndex / rowSize) >> 0;
  16024. this._vertices[arrayOffset + 10] = sprite.cellIndex - offset * rowSize;
  16025. this._vertices[arrayOffset + 11] = offset;
  16026. // Color
  16027. this._vertices[arrayOffset + 12] = sprite.color.r;
  16028. this._vertices[arrayOffset + 13] = sprite.color.g;
  16029. this._vertices[arrayOffset + 14] = sprite.color.b;
  16030. this._vertices[arrayOffset + 15] = sprite.color.a;
  16031. };
  16032. SpriteManager.prototype.render = function () {
  16033. // Check
  16034. if (!this._effectBase.isReady() || !this._effectFog.isReady() || !this._spriteTexture || !this._spriteTexture.isReady())
  16035. return;
  16036. var engine = this._scene.getEngine();
  16037. var baseSize = this._spriteTexture.getBaseSize();
  16038. // Sprites
  16039. var deltaTime = engine.getDeltaTime();
  16040. var max = Math.min(this._capacity, this.sprites.length);
  16041. var rowSize = baseSize.width / this.cellSize;
  16042. var offset = 0;
  16043. for (var index = 0; index < max; index++) {
  16044. var sprite = this.sprites[index];
  16045. if (!sprite) {
  16046. continue;
  16047. }
  16048. sprite._animate(deltaTime);
  16049. this._appendSpriteVertex(offset++, sprite, 0, 0, rowSize);
  16050. this._appendSpriteVertex(offset++, sprite, 1, 0, rowSize);
  16051. this._appendSpriteVertex(offset++, sprite, 1, 1, rowSize);
  16052. this._appendSpriteVertex(offset++, sprite, 0, 1, rowSize);
  16053. }
  16054. engine.updateDynamicVertexBuffer(this._vertexBuffer, this._vertices);
  16055. // Render
  16056. var effect = this._effectBase;
  16057. if (this._scene.fogEnabled && this._scene.fogMode !== BABYLON.Scene.FOGMODE_NONE && this.fogEnabled) {
  16058. effect = this._effectFog;
  16059. }
  16060. engine.enableEffect(effect);
  16061. var viewMatrix = this._scene.getViewMatrix();
  16062. effect.setTexture("diffuseSampler", this._spriteTexture);
  16063. effect.setMatrix("view", viewMatrix);
  16064. effect.setMatrix("projection", this._scene.getProjectionMatrix());
  16065. effect.setFloat2("textureInfos", this.cellSize / baseSize.width, this.cellSize / baseSize.height);
  16066. // Fog
  16067. if (this._scene.fogEnabled && this._scene.fogMode !== BABYLON.Scene.FOGMODE_NONE && this.fogEnabled) {
  16068. effect.setFloat4("vFogInfos", this._scene.fogMode, this._scene.fogStart, this._scene.fogEnd, this._scene.fogDensity);
  16069. effect.setColor3("vFogColor", this._scene.fogColor);
  16070. }
  16071. // VBOs
  16072. engine.bindBuffers(this._vertexBuffer, this._indexBuffer, this._vertexDeclaration, this._vertexStrideSize, effect);
  16073. // Draw order
  16074. engine.setDepthFunctionToLessOrEqual();
  16075. effect.setBool("alphaTest", true);
  16076. engine.setColorWrite(false);
  16077. engine.draw(true, 0, max * 6);
  16078. engine.setColorWrite(true);
  16079. effect.setBool("alphaTest", false);
  16080. engine.setAlphaMode(BABYLON.Engine.ALPHA_COMBINE);
  16081. engine.draw(true, 0, max * 6);
  16082. engine.setAlphaMode(BABYLON.Engine.ALPHA_DISABLE);
  16083. };
  16084. SpriteManager.prototype.dispose = function () {
  16085. if (this._vertexBuffer) {
  16086. this._scene.getEngine()._releaseBuffer(this._vertexBuffer);
  16087. this._vertexBuffer = null;
  16088. }
  16089. if (this._indexBuffer) {
  16090. this._scene.getEngine()._releaseBuffer(this._indexBuffer);
  16091. this._indexBuffer = null;
  16092. }
  16093. if (this._spriteTexture) {
  16094. this._spriteTexture.dispose();
  16095. this._spriteTexture = null;
  16096. }
  16097. // Remove from scene
  16098. var index = this._scene.spriteManagers.indexOf(this);
  16099. this._scene.spriteManagers.splice(index, 1);
  16100. // Callback
  16101. if (this.onDispose) {
  16102. this.onDispose();
  16103. }
  16104. };
  16105. return SpriteManager;
  16106. })();
  16107. BABYLON.SpriteManager = SpriteManager;
  16108. })(BABYLON || (BABYLON = {}));
  16109. //# sourceMappingURL=babylon.spriteManager.js.mapvar BABYLON;
  16110. (function (BABYLON) {
  16111. var Sprite = (function () {
  16112. function Sprite(name, manager) {
  16113. this.name = name;
  16114. this.color = new BABYLON.Color4(1.0, 1.0, 1.0, 1.0);
  16115. this.width = 1.0;
  16116. this.height = 1.0;
  16117. this.angle = 0;
  16118. this.cellIndex = 0;
  16119. this.invertU = 0;
  16120. this.invertV = 0;
  16121. this.animations = new Array();
  16122. this._animationStarted = false;
  16123. this._loopAnimation = false;
  16124. this._fromIndex = 0;
  16125. this._toIndex = 0;
  16126. this._delay = 0;
  16127. this._direction = 1;
  16128. this._frameCount = 0;
  16129. this._time = 0;
  16130. this._manager = manager;
  16131. this._manager.sprites.push(this);
  16132. this.position = BABYLON.Vector3.Zero();
  16133. }
  16134. Object.defineProperty(Sprite.prototype, "size", {
  16135. get: function () {
  16136. return this.width;
  16137. },
  16138. set: function (value) {
  16139. this.width = value;
  16140. this.height = value;
  16141. },
  16142. enumerable: true,
  16143. configurable: true
  16144. });
  16145. Sprite.prototype.playAnimation = function (from, to, loop, delay) {
  16146. this._fromIndex = from;
  16147. this._toIndex = to;
  16148. this._loopAnimation = loop;
  16149. this._delay = delay;
  16150. this._animationStarted = true;
  16151. this._direction = from < to ? 1 : -1;
  16152. this.cellIndex = from;
  16153. this._time = 0;
  16154. };
  16155. Sprite.prototype.stopAnimation = function () {
  16156. this._animationStarted = false;
  16157. };
  16158. Sprite.prototype._animate = function (deltaTime) {
  16159. if (!this._animationStarted)
  16160. return;
  16161. this._time += deltaTime;
  16162. if (this._time > this._delay) {
  16163. this._time = this._time % this._delay;
  16164. this.cellIndex += this._direction;
  16165. if (this.cellIndex == this._toIndex) {
  16166. if (this._loopAnimation) {
  16167. this.cellIndex = this._fromIndex;
  16168. }
  16169. else {
  16170. this._animationStarted = false;
  16171. if (this.disposeWhenFinishedAnimating) {
  16172. this.dispose();
  16173. }
  16174. }
  16175. }
  16176. }
  16177. };
  16178. Sprite.prototype.dispose = function () {
  16179. for (var i = 0; i < this._manager.sprites.length; i++) {
  16180. if (this._manager.sprites[i] == this) {
  16181. this._manager.sprites.splice(i, 1);
  16182. }
  16183. }
  16184. };
  16185. return Sprite;
  16186. })();
  16187. BABYLON.Sprite = Sprite;
  16188. })(BABYLON || (BABYLON = {}));
  16189. //# sourceMappingURL=babylon.sprite.js.mapvar BABYLON;
  16190. (function (BABYLON) {
  16191. var Layer = (function () {
  16192. function Layer(name, imgUrl, scene, isBackground, color) {
  16193. this.name = name;
  16194. this._vertexDeclaration = [2];
  16195. this._vertexStrideSize = 2 * 4;
  16196. this.texture = imgUrl ? new BABYLON.Texture(imgUrl, scene, true) : null;
  16197. this.isBackground = isBackground === undefined ? true : isBackground;
  16198. this.color = color === undefined ? new BABYLON.Color4(1, 1, 1, 1) : color;
  16199. this._scene = scene;
  16200. this._scene.layers.push(this);
  16201. // VBO
  16202. var vertices = [];
  16203. vertices.push(1, 1);
  16204. vertices.push(-1, 1);
  16205. vertices.push(-1, -1);
  16206. vertices.push(1, -1);
  16207. this._vertexBuffer = scene.getEngine().createVertexBuffer(vertices);
  16208. // Indices
  16209. var indices = [];
  16210. indices.push(0);
  16211. indices.push(1);
  16212. indices.push(2);
  16213. indices.push(0);
  16214. indices.push(2);
  16215. indices.push(3);
  16216. this._indexBuffer = scene.getEngine().createIndexBuffer(indices);
  16217. // Effects
  16218. this._effect = this._scene.getEngine().createEffect("layer", ["position"], ["textureMatrix", "color"], ["textureSampler"], "");
  16219. }
  16220. Layer.prototype.render = function () {
  16221. // Check
  16222. if (!this._effect.isReady() || !this.texture || !this.texture.isReady())
  16223. return;
  16224. var engine = this._scene.getEngine();
  16225. // Render
  16226. engine.enableEffect(this._effect);
  16227. engine.setState(false);
  16228. // Texture
  16229. this._effect.setTexture("textureSampler", this.texture);
  16230. this._effect.setMatrix("textureMatrix", this.texture.getTextureMatrix());
  16231. // Color
  16232. this._effect.setFloat4("color", this.color.r, this.color.g, this.color.b, this.color.a);
  16233. // VBOs
  16234. engine.bindBuffers(this._vertexBuffer, this._indexBuffer, this._vertexDeclaration, this._vertexStrideSize, this._effect);
  16235. // Draw order
  16236. engine.setAlphaMode(BABYLON.Engine.ALPHA_COMBINE);
  16237. engine.draw(true, 0, 6);
  16238. engine.setAlphaMode(BABYLON.Engine.ALPHA_DISABLE);
  16239. };
  16240. Layer.prototype.dispose = function () {
  16241. if (this._vertexBuffer) {
  16242. this._scene.getEngine()._releaseBuffer(this._vertexBuffer);
  16243. this._vertexBuffer = null;
  16244. }
  16245. if (this._indexBuffer) {
  16246. this._scene.getEngine()._releaseBuffer(this._indexBuffer);
  16247. this._indexBuffer = null;
  16248. }
  16249. if (this.texture) {
  16250. this.texture.dispose();
  16251. this.texture = null;
  16252. }
  16253. // Remove from scene
  16254. var index = this._scene.layers.indexOf(this);
  16255. this._scene.layers.splice(index, 1);
  16256. // Callback
  16257. if (this.onDispose) {
  16258. this.onDispose();
  16259. }
  16260. };
  16261. return Layer;
  16262. })();
  16263. BABYLON.Layer = Layer;
  16264. })(BABYLON || (BABYLON = {}));
  16265. //# sourceMappingURL=babylon.layer.js.mapvar BABYLON;
  16266. (function (BABYLON) {
  16267. var Particle = (function () {
  16268. function Particle() {
  16269. this.position = BABYLON.Vector3.Zero();
  16270. this.direction = BABYLON.Vector3.Zero();
  16271. this.color = new BABYLON.Color4(0, 0, 0, 0);
  16272. this.colorStep = new BABYLON.Color4(0, 0, 0, 0);
  16273. this.lifeTime = 1.0;
  16274. this.age = 0;
  16275. this.size = 0;
  16276. this.angle = 0;
  16277. this.angularSpeed = 0;
  16278. }
  16279. Particle.prototype.copyTo = function (other) {
  16280. other.position.copyFrom(this.position);
  16281. other.direction.copyFrom(this.direction);
  16282. other.color.copyFrom(this.color);
  16283. other.colorStep.copyFrom(this.colorStep);
  16284. other.lifeTime = this.lifeTime;
  16285. other.age = this.age;
  16286. other.size = this.size;
  16287. other.angle = this.angle;
  16288. other.angularSpeed = this.angularSpeed;
  16289. };
  16290. return Particle;
  16291. })();
  16292. BABYLON.Particle = Particle;
  16293. })(BABYLON || (BABYLON = {}));
  16294. //# sourceMappingURL=babylon.particle.js.mapvar BABYLON;
  16295. (function (BABYLON) {
  16296. var randomNumber = function (min, max) {
  16297. if (min === max) {
  16298. return (min);
  16299. }
  16300. var random = Math.random();
  16301. return ((random * (max - min)) + min);
  16302. };
  16303. var ParticleSystem = (function () {
  16304. function ParticleSystem(name, capacity, scene, customEffect) {
  16305. var _this = this;
  16306. this.name = name;
  16307. this.renderingGroupId = 0;
  16308. this.emitter = null;
  16309. this.emitRate = 10;
  16310. this.manualEmitCount = -1;
  16311. this.updateSpeed = 0.01;
  16312. this.targetStopDuration = 0;
  16313. this.disposeOnStop = false;
  16314. this.minEmitPower = 1;
  16315. this.maxEmitPower = 1;
  16316. this.minLifeTime = 1;
  16317. this.maxLifeTime = 1;
  16318. this.minSize = 1;
  16319. this.maxSize = 1;
  16320. this.minAngularSpeed = 0;
  16321. this.maxAngularSpeed = 0;
  16322. this.blendMode = ParticleSystem.BLENDMODE_ONEONE;
  16323. this.forceDepthWrite = false;
  16324. this.gravity = BABYLON.Vector3.Zero();
  16325. this.direction1 = new BABYLON.Vector3(0, 1.0, 0);
  16326. this.direction2 = new BABYLON.Vector3(0, 1.0, 0);
  16327. this.minEmitBox = new BABYLON.Vector3(-0.5, -0.5, -0.5);
  16328. this.maxEmitBox = new BABYLON.Vector3(0.5, 0.5, 0.5);
  16329. this.color1 = new BABYLON.Color4(1.0, 1.0, 1.0, 1.0);
  16330. this.color2 = new BABYLON.Color4(1.0, 1.0, 1.0, 1.0);
  16331. this.colorDead = new BABYLON.Color4(0, 0, 0, 1.0);
  16332. this.textureMask = new BABYLON.Color4(1.0, 1.0, 1.0, 1.0);
  16333. this.particles = new Array();
  16334. this._vertexDeclaration = [3, 4, 4];
  16335. this._vertexStrideSize = 11 * 4; // 11 floats per particle (x, y, z, r, g, b, a, angle, size, offsetX, offsetY)
  16336. this._stockParticles = new Array();
  16337. this._newPartsExcess = 0;
  16338. this._scaledColorStep = new BABYLON.Color4(0, 0, 0, 0);
  16339. this._colorDiff = new BABYLON.Color4(0, 0, 0, 0);
  16340. this._scaledDirection = BABYLON.Vector3.Zero();
  16341. this._scaledGravity = BABYLON.Vector3.Zero();
  16342. this._currentRenderId = -1;
  16343. this._started = false;
  16344. this._stopped = false;
  16345. this._actualFrame = 0;
  16346. this.id = name;
  16347. this._capacity = capacity;
  16348. this._scene = scene;
  16349. this._customEffect = customEffect;
  16350. scene.particleSystems.push(this);
  16351. // VBO
  16352. this._vertexBuffer = scene.getEngine().createDynamicVertexBuffer(capacity * this._vertexStrideSize * 4);
  16353. var indices = [];
  16354. var index = 0;
  16355. for (var count = 0; count < capacity; count++) {
  16356. indices.push(index);
  16357. indices.push(index + 1);
  16358. indices.push(index + 2);
  16359. indices.push(index);
  16360. indices.push(index + 2);
  16361. indices.push(index + 3);
  16362. index += 4;
  16363. }
  16364. this._indexBuffer = scene.getEngine().createIndexBuffer(indices);
  16365. this._vertices = new Float32Array(capacity * this._vertexStrideSize);
  16366. // Default behaviors
  16367. this.startDirectionFunction = function (emitPower, worldMatrix, directionToUpdate) {
  16368. var randX = randomNumber(_this.direction1.x, _this.direction2.x);
  16369. var randY = randomNumber(_this.direction1.y, _this.direction2.y);
  16370. var randZ = randomNumber(_this.direction1.z, _this.direction2.z);
  16371. BABYLON.Vector3.TransformNormalFromFloatsToRef(randX * emitPower, randY * emitPower, randZ * emitPower, worldMatrix, directionToUpdate);
  16372. };
  16373. this.startPositionFunction = function (worldMatrix, positionToUpdate) {
  16374. var randX = randomNumber(_this.minEmitBox.x, _this.maxEmitBox.x);
  16375. var randY = randomNumber(_this.minEmitBox.y, _this.maxEmitBox.y);
  16376. var randZ = randomNumber(_this.minEmitBox.z, _this.maxEmitBox.z);
  16377. BABYLON.Vector3.TransformCoordinatesFromFloatsToRef(randX, randY, randZ, worldMatrix, positionToUpdate);
  16378. };
  16379. this.updateFunction = function (particles) {
  16380. for (var index = 0; index < particles.length; index++) {
  16381. var particle = particles[index];
  16382. particle.age += _this._scaledUpdateSpeed;
  16383. if (particle.age >= particle.lifeTime) {
  16384. _this.recycleParticle(particle);
  16385. index--;
  16386. continue;
  16387. }
  16388. else {
  16389. particle.colorStep.scaleToRef(_this._scaledUpdateSpeed, _this._scaledColorStep);
  16390. particle.color.addInPlace(_this._scaledColorStep);
  16391. if (particle.color.a < 0)
  16392. particle.color.a = 0;
  16393. particle.angle += particle.angularSpeed * _this._scaledUpdateSpeed;
  16394. particle.direction.scaleToRef(_this._scaledUpdateSpeed, _this._scaledDirection);
  16395. particle.position.addInPlace(_this._scaledDirection);
  16396. _this.gravity.scaleToRef(_this._scaledUpdateSpeed, _this._scaledGravity);
  16397. particle.direction.addInPlace(_this._scaledGravity);
  16398. }
  16399. }
  16400. };
  16401. }
  16402. ParticleSystem.prototype.recycleParticle = function (particle) {
  16403. var lastParticle = this.particles.pop();
  16404. if (lastParticle !== particle) {
  16405. lastParticle.copyTo(particle);
  16406. this._stockParticles.push(lastParticle);
  16407. }
  16408. };
  16409. ParticleSystem.prototype.getCapacity = function () {
  16410. return this._capacity;
  16411. };
  16412. ParticleSystem.prototype.isAlive = function () {
  16413. return this._alive;
  16414. };
  16415. ParticleSystem.prototype.isStarted = function () {
  16416. return this._started;
  16417. };
  16418. ParticleSystem.prototype.start = function () {
  16419. this._started = true;
  16420. this._stopped = false;
  16421. this._actualFrame = 0;
  16422. };
  16423. ParticleSystem.prototype.stop = function () {
  16424. this._stopped = true;
  16425. };
  16426. ParticleSystem.prototype._appendParticleVertex = function (index, particle, offsetX, offsetY) {
  16427. var offset = index * 11;
  16428. this._vertices[offset] = particle.position.x;
  16429. this._vertices[offset + 1] = particle.position.y;
  16430. this._vertices[offset + 2] = particle.position.z;
  16431. this._vertices[offset + 3] = particle.color.r;
  16432. this._vertices[offset + 4] = particle.color.g;
  16433. this._vertices[offset + 5] = particle.color.b;
  16434. this._vertices[offset + 6] = particle.color.a;
  16435. this._vertices[offset + 7] = particle.angle;
  16436. this._vertices[offset + 8] = particle.size;
  16437. this._vertices[offset + 9] = offsetX;
  16438. this._vertices[offset + 10] = offsetY;
  16439. };
  16440. ParticleSystem.prototype._update = function (newParticles) {
  16441. // Update current
  16442. this._alive = this.particles.length > 0;
  16443. this.updateFunction(this.particles);
  16444. // Add new ones
  16445. var worldMatrix;
  16446. if (this.emitter.position) {
  16447. worldMatrix = this.emitter.getWorldMatrix();
  16448. }
  16449. else {
  16450. worldMatrix = BABYLON.Matrix.Translation(this.emitter.x, this.emitter.y, this.emitter.z);
  16451. }
  16452. for (var index = 0; index < newParticles; index++) {
  16453. if (this.particles.length === this._capacity) {
  16454. break;
  16455. }
  16456. if (this._stockParticles.length !== 0) {
  16457. var particle = this._stockParticles.pop();
  16458. particle.age = 0;
  16459. }
  16460. else {
  16461. particle = new BABYLON.Particle();
  16462. }
  16463. this.particles.push(particle);
  16464. var emitPower = randomNumber(this.minEmitPower, this.maxEmitPower);
  16465. this.startDirectionFunction(emitPower, worldMatrix, particle.direction);
  16466. particle.lifeTime = randomNumber(this.minLifeTime, this.maxLifeTime);
  16467. particle.size = randomNumber(this.minSize, this.maxSize);
  16468. particle.angularSpeed = randomNumber(this.minAngularSpeed, this.maxAngularSpeed);
  16469. this.startPositionFunction(worldMatrix, particle.position);
  16470. var step = randomNumber(0, 1.0);
  16471. BABYLON.Color4.LerpToRef(this.color1, this.color2, step, particle.color);
  16472. this.colorDead.subtractToRef(particle.color, this._colorDiff);
  16473. this._colorDiff.scaleToRef(1.0 / particle.lifeTime, particle.colorStep);
  16474. }
  16475. };
  16476. ParticleSystem.prototype._getEffect = function () {
  16477. if (this._customEffect) {
  16478. return this._customEffect;
  16479. }
  16480. ;
  16481. var defines = [];
  16482. if (this._scene.clipPlane) {
  16483. defines.push("#define CLIPPLANE");
  16484. }
  16485. // Effect
  16486. var join = defines.join("\n");
  16487. if (this._cachedDefines !== join) {
  16488. this._cachedDefines = join;
  16489. this._effect = this._scene.getEngine().createEffect("particles", ["position", "color", "options"], ["invView", "view", "projection", "vClipPlane", "textureMask"], ["diffuseSampler"], join);
  16490. }
  16491. return this._effect;
  16492. };
  16493. ParticleSystem.prototype.animate = function () {
  16494. if (!this._started)
  16495. return;
  16496. var effect = this._getEffect();
  16497. // Check
  16498. if (!this.emitter || !effect.isReady() || !this.particleTexture || !this.particleTexture.isReady())
  16499. return;
  16500. if (this._currentRenderId === this._scene.getRenderId()) {
  16501. return;
  16502. }
  16503. this._currentRenderId = this._scene.getRenderId();
  16504. this._scaledUpdateSpeed = this.updateSpeed * this._scene.getAnimationRatio();
  16505. // determine the number of particles we need to create
  16506. var emitCout;
  16507. if (this.manualEmitCount > -1) {
  16508. emitCout = this.manualEmitCount;
  16509. this.manualEmitCount = 0;
  16510. }
  16511. else {
  16512. emitCout = this.emitRate;
  16513. }
  16514. var newParticles = ((emitCout * this._scaledUpdateSpeed) >> 0);
  16515. this._newPartsExcess += emitCout * this._scaledUpdateSpeed - newParticles;
  16516. if (this._newPartsExcess > 1.0) {
  16517. newParticles += this._newPartsExcess >> 0;
  16518. this._newPartsExcess -= this._newPartsExcess >> 0;
  16519. }
  16520. this._alive = false;
  16521. if (!this._stopped) {
  16522. this._actualFrame += this._scaledUpdateSpeed;
  16523. if (this.targetStopDuration && this._actualFrame >= this.targetStopDuration)
  16524. this.stop();
  16525. }
  16526. else {
  16527. newParticles = 0;
  16528. }
  16529. this._update(newParticles);
  16530. // Stopped?
  16531. if (this._stopped) {
  16532. if (!this._alive) {
  16533. this._started = false;
  16534. if (this.disposeOnStop) {
  16535. this._scene._toBeDisposed.push(this);
  16536. }
  16537. }
  16538. }
  16539. // Update VBO
  16540. var offset = 0;
  16541. for (var index = 0; index < this.particles.length; index++) {
  16542. var particle = this.particles[index];
  16543. this._appendParticleVertex(offset++, particle, 0, 0);
  16544. this._appendParticleVertex(offset++, particle, 1, 0);
  16545. this._appendParticleVertex(offset++, particle, 1, 1);
  16546. this._appendParticleVertex(offset++, particle, 0, 1);
  16547. }
  16548. var engine = this._scene.getEngine();
  16549. engine.updateDynamicVertexBuffer(this._vertexBuffer, this._vertices);
  16550. };
  16551. ParticleSystem.prototype.render = function () {
  16552. var effect = this._getEffect();
  16553. // Check
  16554. if (!this.emitter || !effect.isReady() || !this.particleTexture || !this.particleTexture.isReady() || !this.particles.length)
  16555. return 0;
  16556. var engine = this._scene.getEngine();
  16557. // Render
  16558. engine.enableEffect(effect);
  16559. engine.setState(false);
  16560. var viewMatrix = this._scene.getViewMatrix();
  16561. effect.setTexture("diffuseSampler", this.particleTexture);
  16562. effect.setMatrix("view", viewMatrix);
  16563. effect.setMatrix("projection", this._scene.getProjectionMatrix());
  16564. effect.setFloat4("textureMask", this.textureMask.r, this.textureMask.g, this.textureMask.b, this.textureMask.a);
  16565. if (this._scene.clipPlane) {
  16566. var clipPlane = this._scene.clipPlane;
  16567. var invView = viewMatrix.clone();
  16568. invView.invert();
  16569. effect.setMatrix("invView", invView);
  16570. effect.setFloat4("vClipPlane", clipPlane.normal.x, clipPlane.normal.y, clipPlane.normal.z, clipPlane.d);
  16571. }
  16572. // VBOs
  16573. engine.bindBuffers(this._vertexBuffer, this._indexBuffer, this._vertexDeclaration, this._vertexStrideSize, effect);
  16574. // Draw order
  16575. if (this.blendMode === ParticleSystem.BLENDMODE_ONEONE) {
  16576. engine.setAlphaMode(BABYLON.Engine.ALPHA_ADD);
  16577. }
  16578. else {
  16579. engine.setAlphaMode(BABYLON.Engine.ALPHA_COMBINE);
  16580. }
  16581. if (this.forceDepthWrite) {
  16582. engine.setDepthWrite(true);
  16583. }
  16584. engine.draw(true, 0, this.particles.length * 6);
  16585. engine.setAlphaMode(BABYLON.Engine.ALPHA_DISABLE);
  16586. return this.particles.length;
  16587. };
  16588. ParticleSystem.prototype.dispose = function () {
  16589. if (this._vertexBuffer) {
  16590. this._scene.getEngine()._releaseBuffer(this._vertexBuffer);
  16591. this._vertexBuffer = null;
  16592. }
  16593. if (this._indexBuffer) {
  16594. this._scene.getEngine()._releaseBuffer(this._indexBuffer);
  16595. this._indexBuffer = null;
  16596. }
  16597. if (this.particleTexture) {
  16598. this.particleTexture.dispose();
  16599. this.particleTexture = null;
  16600. }
  16601. // Remove from scene
  16602. var index = this._scene.particleSystems.indexOf(this);
  16603. this._scene.particleSystems.splice(index, 1);
  16604. // Callback
  16605. if (this.onDispose) {
  16606. this.onDispose();
  16607. }
  16608. };
  16609. // Clone
  16610. ParticleSystem.prototype.clone = function (name, newEmitter) {
  16611. var result = new ParticleSystem(name, this._capacity, this._scene);
  16612. BABYLON.Tools.DeepCopy(this, result, ["particles"], ["_vertexDeclaration", "_vertexStrideSize"]);
  16613. if (newEmitter === undefined) {
  16614. newEmitter = this.emitter;
  16615. }
  16616. result.emitter = newEmitter;
  16617. if (this.particleTexture) {
  16618. result.particleTexture = new BABYLON.Texture(this.particleTexture.url, this._scene);
  16619. }
  16620. result.start();
  16621. return result;
  16622. };
  16623. // Statics
  16624. ParticleSystem.BLENDMODE_ONEONE = 0;
  16625. ParticleSystem.BLENDMODE_STANDARD = 1;
  16626. return ParticleSystem;
  16627. })();
  16628. BABYLON.ParticleSystem = ParticleSystem;
  16629. })(BABYLON || (BABYLON = {}));
  16630. //# sourceMappingURL=babylon.particleSystem.js.mapvar BABYLON;
  16631. (function (BABYLON) {
  16632. var Animation = (function () {
  16633. function Animation(name, targetProperty, framePerSecond, dataType, loopMode) {
  16634. this.name = name;
  16635. this.targetProperty = targetProperty;
  16636. this.framePerSecond = framePerSecond;
  16637. this.dataType = dataType;
  16638. this.loopMode = loopMode;
  16639. this._offsetsCache = {};
  16640. this._highLimitsCache = {};
  16641. this._stopped = false;
  16642. this.targetPropertyPath = targetProperty.split(".");
  16643. this.dataType = dataType;
  16644. this.loopMode = loopMode === undefined ? Animation.ANIMATIONLOOPMODE_CYCLE : loopMode;
  16645. }
  16646. Animation.CreateAndStartAnimation = function (name, mesh, tartgetProperty, framePerSecond, totalFrame, from, to, loopMode) {
  16647. var dataType = undefined;
  16648. if (!isNaN(parseFloat(from)) && isFinite(from)) {
  16649. dataType = Animation.ANIMATIONTYPE_FLOAT;
  16650. }
  16651. else if (from instanceof BABYLON.Quaternion) {
  16652. dataType = Animation.ANIMATIONTYPE_QUATERNION;
  16653. }
  16654. else if (from instanceof BABYLON.Vector3) {
  16655. dataType = Animation.ANIMATIONTYPE_VECTOR3;
  16656. }
  16657. else if (from instanceof BABYLON.Vector2) {
  16658. dataType = Animation.ANIMATIONTYPE_VECTOR2;
  16659. }
  16660. else if (from instanceof BABYLON.Color3) {
  16661. dataType = Animation.ANIMATIONTYPE_COLOR3;
  16662. }
  16663. if (dataType == undefined) {
  16664. return null;
  16665. }
  16666. var animation = new Animation(name, tartgetProperty, framePerSecond, dataType, loopMode);
  16667. var keys = [];
  16668. keys.push({ frame: 0, value: from });
  16669. keys.push({ frame: totalFrame, value: to });
  16670. animation.setKeys(keys);
  16671. mesh.animations.push(animation);
  16672. return mesh.getScene().beginAnimation(mesh, 0, totalFrame, (animation.loopMode === 1));
  16673. };
  16674. // Methods
  16675. Animation.prototype.isStopped = function () {
  16676. return this._stopped;
  16677. };
  16678. Animation.prototype.getKeys = function () {
  16679. return this._keys;
  16680. };
  16681. Animation.prototype.getEasingFunction = function () {
  16682. return this._easingFunction;
  16683. };
  16684. Animation.prototype.setEasingFunction = function (easingFunction) {
  16685. this._easingFunction = easingFunction;
  16686. };
  16687. Animation.prototype.floatInterpolateFunction = function (startValue, endValue, gradient) {
  16688. return startValue + (endValue - startValue) * gradient;
  16689. };
  16690. Animation.prototype.quaternionInterpolateFunction = function (startValue, endValue, gradient) {
  16691. return BABYLON.Quaternion.Slerp(startValue, endValue, gradient);
  16692. };
  16693. Animation.prototype.vector3InterpolateFunction = function (startValue, endValue, gradient) {
  16694. return BABYLON.Vector3.Lerp(startValue, endValue, gradient);
  16695. };
  16696. Animation.prototype.vector2InterpolateFunction = function (startValue, endValue, gradient) {
  16697. return BABYLON.Vector2.Lerp(startValue, endValue, gradient);
  16698. };
  16699. Animation.prototype.color3InterpolateFunction = function (startValue, endValue, gradient) {
  16700. return BABYLON.Color3.Lerp(startValue, endValue, gradient);
  16701. };
  16702. Animation.prototype.matrixInterpolateFunction = function (startValue, endValue, gradient) {
  16703. var startScale = new BABYLON.Vector3(0, 0, 0);
  16704. var startRotation = new BABYLON.Quaternion();
  16705. var startTranslation = new BABYLON.Vector3(0, 0, 0);
  16706. startValue.decompose(startScale, startRotation, startTranslation);
  16707. var endScale = new BABYLON.Vector3(0, 0, 0);
  16708. var endRotation = new BABYLON.Quaternion();
  16709. var endTranslation = new BABYLON.Vector3(0, 0, 0);
  16710. endValue.decompose(endScale, endRotation, endTranslation);
  16711. var resultScale = this.vector3InterpolateFunction(startScale, endScale, gradient);
  16712. var resultRotation = this.quaternionInterpolateFunction(startRotation, endRotation, gradient);
  16713. var resultTranslation = this.vector3InterpolateFunction(startTranslation, endTranslation, gradient);
  16714. var result = BABYLON.Matrix.Compose(resultScale, resultRotation, resultTranslation);
  16715. return result;
  16716. };
  16717. Animation.prototype.clone = function () {
  16718. var clone = new Animation(this.name, this.targetPropertyPath.join("."), this.framePerSecond, this.dataType, this.loopMode);
  16719. clone.setKeys(this._keys);
  16720. return clone;
  16721. };
  16722. Animation.prototype.setKeys = function (values) {
  16723. this._keys = values.slice(0);
  16724. this._offsetsCache = {};
  16725. this._highLimitsCache = {};
  16726. };
  16727. Animation.prototype._getKeyValue = function (value) {
  16728. if (typeof value === "function") {
  16729. return value();
  16730. }
  16731. return value;
  16732. };
  16733. Animation.prototype._interpolate = function (currentFrame, repeatCount, loopMode, offsetValue, highLimitValue) {
  16734. if (loopMode === Animation.ANIMATIONLOOPMODE_CONSTANT && repeatCount > 0) {
  16735. return highLimitValue.clone ? highLimitValue.clone() : highLimitValue;
  16736. }
  16737. this.currentFrame = currentFrame;
  16738. // Try to get a hash to find the right key
  16739. var startKey = Math.max(0, Math.min(this._keys.length - 1, Math.floor(this._keys.length * (currentFrame - this._keys[0].frame) / (this._keys[this._keys.length - 1].frame - this._keys[0].frame)) - 1));
  16740. if (this._keys[startKey].frame >= currentFrame) {
  16741. while (startKey - 1 >= 0 && this._keys[startKey].frame >= currentFrame) {
  16742. startKey--;
  16743. }
  16744. }
  16745. for (var key = startKey; key < this._keys.length; key++) {
  16746. if (this._keys[key + 1].frame >= currentFrame) {
  16747. var startValue = this._getKeyValue(this._keys[key].value);
  16748. var endValue = this._getKeyValue(this._keys[key + 1].value);
  16749. // gradient : percent of currentFrame between the frame inf and the frame sup
  16750. var gradient = (currentFrame - this._keys[key].frame) / (this._keys[key + 1].frame - this._keys[key].frame);
  16751. // check for easingFunction and correction of gradient
  16752. if (this._easingFunction != null) {
  16753. gradient = this._easingFunction.ease(gradient);
  16754. }
  16755. switch (this.dataType) {
  16756. case Animation.ANIMATIONTYPE_FLOAT:
  16757. switch (loopMode) {
  16758. case Animation.ANIMATIONLOOPMODE_CYCLE:
  16759. case Animation.ANIMATIONLOOPMODE_CONSTANT:
  16760. return this.floatInterpolateFunction(startValue, endValue, gradient);
  16761. case Animation.ANIMATIONLOOPMODE_RELATIVE:
  16762. return offsetValue * repeatCount + this.floatInterpolateFunction(startValue, endValue, gradient);
  16763. }
  16764. break;
  16765. case Animation.ANIMATIONTYPE_QUATERNION:
  16766. var quaternion = null;
  16767. switch (loopMode) {
  16768. case Animation.ANIMATIONLOOPMODE_CYCLE:
  16769. case Animation.ANIMATIONLOOPMODE_CONSTANT:
  16770. quaternion = this.quaternionInterpolateFunction(startValue, endValue, gradient);
  16771. break;
  16772. case Animation.ANIMATIONLOOPMODE_RELATIVE:
  16773. quaternion = this.quaternionInterpolateFunction(startValue, endValue, gradient).add(offsetValue.scale(repeatCount));
  16774. break;
  16775. }
  16776. return quaternion;
  16777. case Animation.ANIMATIONTYPE_VECTOR3:
  16778. switch (loopMode) {
  16779. case Animation.ANIMATIONLOOPMODE_CYCLE:
  16780. case Animation.ANIMATIONLOOPMODE_CONSTANT:
  16781. return this.vector3InterpolateFunction(startValue, endValue, gradient);
  16782. case Animation.ANIMATIONLOOPMODE_RELATIVE:
  16783. return this.vector3InterpolateFunction(startValue, endValue, gradient).add(offsetValue.scale(repeatCount));
  16784. }
  16785. case Animation.ANIMATIONTYPE_VECTOR2:
  16786. switch (loopMode) {
  16787. case Animation.ANIMATIONLOOPMODE_CYCLE:
  16788. case Animation.ANIMATIONLOOPMODE_CONSTANT:
  16789. return this.vector2InterpolateFunction(startValue, endValue, gradient);
  16790. case Animation.ANIMATIONLOOPMODE_RELATIVE:
  16791. return this.vector2InterpolateFunction(startValue, endValue, gradient).add(offsetValue.scale(repeatCount));
  16792. }
  16793. case Animation.ANIMATIONTYPE_COLOR3:
  16794. switch (loopMode) {
  16795. case Animation.ANIMATIONLOOPMODE_CYCLE:
  16796. case Animation.ANIMATIONLOOPMODE_CONSTANT:
  16797. return this.color3InterpolateFunction(startValue, endValue, gradient);
  16798. case Animation.ANIMATIONLOOPMODE_RELATIVE:
  16799. return this.color3InterpolateFunction(startValue, endValue, gradient).add(offsetValue.scale(repeatCount));
  16800. }
  16801. case Animation.ANIMATIONTYPE_MATRIX:
  16802. switch (loopMode) {
  16803. case Animation.ANIMATIONLOOPMODE_CYCLE:
  16804. case Animation.ANIMATIONLOOPMODE_CONSTANT:
  16805. case Animation.ANIMATIONLOOPMODE_RELATIVE:
  16806. return startValue;
  16807. }
  16808. default:
  16809. break;
  16810. }
  16811. break;
  16812. }
  16813. }
  16814. return this._getKeyValue(this._keys[this._keys.length - 1].value);
  16815. };
  16816. Animation.prototype.animate = function (delay, from, to, loop, speedRatio) {
  16817. if (!this.targetPropertyPath || this.targetPropertyPath.length < 1) {
  16818. this._stopped = true;
  16819. return false;
  16820. }
  16821. var returnValue = true;
  16822. // Adding a start key at frame 0 if missing
  16823. if (this._keys[0].frame !== 0) {
  16824. var newKey = { frame: 0, value: this._keys[0].value };
  16825. this._keys.splice(0, 0, newKey);
  16826. }
  16827. // Check limits
  16828. if (from < this._keys[0].frame || from > this._keys[this._keys.length - 1].frame) {
  16829. from = this._keys[0].frame;
  16830. }
  16831. if (to < this._keys[0].frame || to > this._keys[this._keys.length - 1].frame) {
  16832. to = this._keys[this._keys.length - 1].frame;
  16833. }
  16834. // Compute ratio
  16835. var range = to - from;
  16836. var offsetValue;
  16837. // ratio represents the frame delta between from and to
  16838. var ratio = delay * (this.framePerSecond * speedRatio) / 1000.0;
  16839. var highLimitValue = 0;
  16840. if (ratio > range && !loop) {
  16841. returnValue = false;
  16842. highLimitValue = this._getKeyValue(this._keys[this._keys.length - 1].value);
  16843. }
  16844. else {
  16845. // Get max value if required
  16846. if (this.loopMode !== Animation.ANIMATIONLOOPMODE_CYCLE) {
  16847. var keyOffset = to.toString() + from.toString();
  16848. if (!this._offsetsCache[keyOffset]) {
  16849. var fromValue = this._interpolate(from, 0, Animation.ANIMATIONLOOPMODE_CYCLE);
  16850. var toValue = this._interpolate(to, 0, Animation.ANIMATIONLOOPMODE_CYCLE);
  16851. switch (this.dataType) {
  16852. case Animation.ANIMATIONTYPE_FLOAT:
  16853. this._offsetsCache[keyOffset] = toValue - fromValue;
  16854. break;
  16855. case Animation.ANIMATIONTYPE_QUATERNION:
  16856. this._offsetsCache[keyOffset] = toValue.subtract(fromValue);
  16857. break;
  16858. case Animation.ANIMATIONTYPE_VECTOR3:
  16859. this._offsetsCache[keyOffset] = toValue.subtract(fromValue);
  16860. case Animation.ANIMATIONTYPE_VECTOR2:
  16861. this._offsetsCache[keyOffset] = toValue.subtract(fromValue);
  16862. case Animation.ANIMATIONTYPE_COLOR3:
  16863. this._offsetsCache[keyOffset] = toValue.subtract(fromValue);
  16864. default:
  16865. break;
  16866. }
  16867. this._highLimitsCache[keyOffset] = toValue;
  16868. }
  16869. highLimitValue = this._highLimitsCache[keyOffset];
  16870. offsetValue = this._offsetsCache[keyOffset];
  16871. }
  16872. }
  16873. if (offsetValue === undefined) {
  16874. switch (this.dataType) {
  16875. case Animation.ANIMATIONTYPE_FLOAT:
  16876. offsetValue = 0;
  16877. break;
  16878. case Animation.ANIMATIONTYPE_QUATERNION:
  16879. offsetValue = new BABYLON.Quaternion(0, 0, 0, 0);
  16880. break;
  16881. case Animation.ANIMATIONTYPE_VECTOR3:
  16882. offsetValue = BABYLON.Vector3.Zero();
  16883. break;
  16884. case Animation.ANIMATIONTYPE_VECTOR2:
  16885. offsetValue = BABYLON.Vector2.Zero();
  16886. break;
  16887. case Animation.ANIMATIONTYPE_COLOR3:
  16888. offsetValue = BABYLON.Color3.Black();
  16889. }
  16890. }
  16891. // Compute value
  16892. var repeatCount = (ratio / range) >> 0;
  16893. var currentFrame = returnValue ? from + ratio % range : to;
  16894. var currentValue = this._interpolate(currentFrame, repeatCount, this.loopMode, offsetValue, highLimitValue);
  16895. // Set value
  16896. if (this.targetPropertyPath.length > 1) {
  16897. var property = this._target[this.targetPropertyPath[0]];
  16898. for (var index = 1; index < this.targetPropertyPath.length - 1; index++) {
  16899. property = property[this.targetPropertyPath[index]];
  16900. }
  16901. property[this.targetPropertyPath[this.targetPropertyPath.length - 1]] = currentValue;
  16902. }
  16903. else {
  16904. this._target[this.targetPropertyPath[0]] = currentValue;
  16905. }
  16906. if (this._target.markAsDirty) {
  16907. this._target.markAsDirty(this.targetProperty);
  16908. }
  16909. if (!returnValue) {
  16910. this._stopped = true;
  16911. }
  16912. return returnValue;
  16913. };
  16914. Object.defineProperty(Animation, "ANIMATIONTYPE_FLOAT", {
  16915. get: function () {
  16916. return Animation._ANIMATIONTYPE_FLOAT;
  16917. },
  16918. enumerable: true,
  16919. configurable: true
  16920. });
  16921. Object.defineProperty(Animation, "ANIMATIONTYPE_VECTOR3", {
  16922. get: function () {
  16923. return Animation._ANIMATIONTYPE_VECTOR3;
  16924. },
  16925. enumerable: true,
  16926. configurable: true
  16927. });
  16928. Object.defineProperty(Animation, "ANIMATIONTYPE_VECTOR2", {
  16929. get: function () {
  16930. return Animation._ANIMATIONTYPE_VECTOR2;
  16931. },
  16932. enumerable: true,
  16933. configurable: true
  16934. });
  16935. Object.defineProperty(Animation, "ANIMATIONTYPE_QUATERNION", {
  16936. get: function () {
  16937. return Animation._ANIMATIONTYPE_QUATERNION;
  16938. },
  16939. enumerable: true,
  16940. configurable: true
  16941. });
  16942. Object.defineProperty(Animation, "ANIMATIONTYPE_MATRIX", {
  16943. get: function () {
  16944. return Animation._ANIMATIONTYPE_MATRIX;
  16945. },
  16946. enumerable: true,
  16947. configurable: true
  16948. });
  16949. Object.defineProperty(Animation, "ANIMATIONTYPE_COLOR3", {
  16950. get: function () {
  16951. return Animation._ANIMATIONTYPE_COLOR3;
  16952. },
  16953. enumerable: true,
  16954. configurable: true
  16955. });
  16956. Object.defineProperty(Animation, "ANIMATIONLOOPMODE_RELATIVE", {
  16957. get: function () {
  16958. return Animation._ANIMATIONLOOPMODE_RELATIVE;
  16959. },
  16960. enumerable: true,
  16961. configurable: true
  16962. });
  16963. Object.defineProperty(Animation, "ANIMATIONLOOPMODE_CYCLE", {
  16964. get: function () {
  16965. return Animation._ANIMATIONLOOPMODE_CYCLE;
  16966. },
  16967. enumerable: true,
  16968. configurable: true
  16969. });
  16970. Object.defineProperty(Animation, "ANIMATIONLOOPMODE_CONSTANT", {
  16971. get: function () {
  16972. return Animation._ANIMATIONLOOPMODE_CONSTANT;
  16973. },
  16974. enumerable: true,
  16975. configurable: true
  16976. });
  16977. // Statics
  16978. Animation._ANIMATIONTYPE_FLOAT = 0;
  16979. Animation._ANIMATIONTYPE_VECTOR3 = 1;
  16980. Animation._ANIMATIONTYPE_QUATERNION = 2;
  16981. Animation._ANIMATIONTYPE_MATRIX = 3;
  16982. Animation._ANIMATIONTYPE_COLOR3 = 4;
  16983. Animation._ANIMATIONTYPE_VECTOR2 = 5;
  16984. Animation._ANIMATIONLOOPMODE_RELATIVE = 0;
  16985. Animation._ANIMATIONLOOPMODE_CYCLE = 1;
  16986. Animation._ANIMATIONLOOPMODE_CONSTANT = 2;
  16987. return Animation;
  16988. })();
  16989. BABYLON.Animation = Animation;
  16990. })(BABYLON || (BABYLON = {}));
  16991. //# sourceMappingURL=babylon.animation.js.mapvar BABYLON;
  16992. (function (BABYLON) {
  16993. var Animatable = (function () {
  16994. function Animatable(scene, target, fromFrame, toFrame, loopAnimation, speedRatio, onAnimationEnd, animations) {
  16995. if (fromFrame === void 0) { fromFrame = 0; }
  16996. if (toFrame === void 0) { toFrame = 100; }
  16997. if (loopAnimation === void 0) { loopAnimation = false; }
  16998. if (speedRatio === void 0) { speedRatio = 1.0; }
  16999. this.target = target;
  17000. this.fromFrame = fromFrame;
  17001. this.toFrame = toFrame;
  17002. this.loopAnimation = loopAnimation;
  17003. this.speedRatio = speedRatio;
  17004. this.onAnimationEnd = onAnimationEnd;
  17005. this._animations = new Array();
  17006. this._paused = false;
  17007. this.animationStarted = false;
  17008. if (animations) {
  17009. this.appendAnimations(target, animations);
  17010. }
  17011. this._scene = scene;
  17012. scene._activeAnimatables.push(this);
  17013. }
  17014. // Methods
  17015. Animatable.prototype.appendAnimations = function (target, animations) {
  17016. for (var index = 0; index < animations.length; index++) {
  17017. var animation = animations[index];
  17018. animation._target = target;
  17019. this._animations.push(animation);
  17020. }
  17021. };
  17022. Animatable.prototype.getAnimationByTargetProperty = function (property) {
  17023. var animations = this._animations;
  17024. for (var index = 0; index < animations.length; index++) {
  17025. if (animations[index].targetProperty === property) {
  17026. return animations[index];
  17027. }
  17028. }
  17029. return null;
  17030. };
  17031. Animatable.prototype.pause = function () {
  17032. if (this._paused) {
  17033. return;
  17034. }
  17035. this._paused = true;
  17036. };
  17037. Animatable.prototype.restart = function () {
  17038. this._paused = false;
  17039. };
  17040. Animatable.prototype.stop = function () {
  17041. var index = this._scene._activeAnimatables.indexOf(this);
  17042. if (index > -1) {
  17043. this._scene._activeAnimatables.splice(index, 1);
  17044. }
  17045. if (this.onAnimationEnd) {
  17046. this.onAnimationEnd();
  17047. }
  17048. };
  17049. Animatable.prototype._animate = function (delay) {
  17050. if (this._paused) {
  17051. if (!this._pausedDelay) {
  17052. this._pausedDelay = delay;
  17053. }
  17054. return true;
  17055. }
  17056. if (!this._localDelayOffset) {
  17057. this._localDelayOffset = delay;
  17058. }
  17059. else if (this._pausedDelay) {
  17060. this._localDelayOffset += delay - this._pausedDelay;
  17061. this._pausedDelay = null;
  17062. }
  17063. // Animating
  17064. var running = false;
  17065. var animations = this._animations;
  17066. for (var index = 0; index < animations.length; index++) {
  17067. var animation = animations[index];
  17068. var isRunning = animation.animate(delay - this._localDelayOffset, this.fromFrame, this.toFrame, this.loopAnimation, this.speedRatio);
  17069. running = running || isRunning;
  17070. }
  17071. if (!running) {
  17072. // Remove from active animatables
  17073. index = this._scene._activeAnimatables.indexOf(this);
  17074. this._scene._activeAnimatables.splice(index, 1);
  17075. }
  17076. if (!running && this.onAnimationEnd) {
  17077. this.onAnimationEnd();
  17078. }
  17079. return running;
  17080. };
  17081. return Animatable;
  17082. })();
  17083. BABYLON.Animatable = Animatable;
  17084. })(BABYLON || (BABYLON = {}));
  17085. //# sourceMappingURL=babylon.animatable.js.map
  17086. var BABYLON;
  17087. (function (BABYLON) {
  17088. var EasingFunction = (function () {
  17089. function EasingFunction() {
  17090. // Properties
  17091. this._easingMode = EasingFunction.EASINGMODE_EASEIN;
  17092. }
  17093. Object.defineProperty(EasingFunction, "EASINGMODE_EASEIN", {
  17094. get: function () {
  17095. return EasingFunction._EASINGMODE_EASEIN;
  17096. },
  17097. enumerable: true,
  17098. configurable: true
  17099. });
  17100. Object.defineProperty(EasingFunction, "EASINGMODE_EASEOUT", {
  17101. get: function () {
  17102. return EasingFunction._EASINGMODE_EASEOUT;
  17103. },
  17104. enumerable: true,
  17105. configurable: true
  17106. });
  17107. Object.defineProperty(EasingFunction, "EASINGMODE_EASEINOUT", {
  17108. get: function () {
  17109. return EasingFunction._EASINGMODE_EASEINOUT;
  17110. },
  17111. enumerable: true,
  17112. configurable: true
  17113. });
  17114. EasingFunction.prototype.setEasingMode = function (easingMode) {
  17115. var n = Math.min(Math.max(easingMode, 0), 2);
  17116. this._easingMode = n;
  17117. };
  17118. EasingFunction.prototype.getEasingMode = function () {
  17119. return this._easingMode;
  17120. };
  17121. EasingFunction.prototype.easeInCore = function (gradient) {
  17122. throw new Error('You must implement this method');
  17123. };
  17124. EasingFunction.prototype.ease = function (gradient) {
  17125. switch (this._easingMode) {
  17126. case EasingFunction.EASINGMODE_EASEIN:
  17127. return this.easeInCore(gradient);
  17128. case EasingFunction.EASINGMODE_EASEOUT:
  17129. return (1 - this.easeInCore(1 - gradient));
  17130. }
  17131. if (gradient >= 0.5) {
  17132. return (((1 - this.easeInCore((1 - gradient) * 2)) * 0.5) + 0.5);
  17133. }
  17134. return (this.easeInCore(gradient * 2) * 0.5);
  17135. };
  17136. //Statics
  17137. EasingFunction._EASINGMODE_EASEIN = 0;
  17138. EasingFunction._EASINGMODE_EASEOUT = 1;
  17139. EasingFunction._EASINGMODE_EASEINOUT = 2;
  17140. return EasingFunction;
  17141. })();
  17142. BABYLON.EasingFunction = EasingFunction;
  17143. var CircleEase = (function (_super) {
  17144. __extends(CircleEase, _super);
  17145. function CircleEase() {
  17146. _super.apply(this, arguments);
  17147. }
  17148. CircleEase.prototype.easeInCore = function (gradient) {
  17149. gradient = Math.max(0, Math.min(1, gradient));
  17150. return (1.0 - Math.sqrt(1.0 - (gradient * gradient)));
  17151. };
  17152. return CircleEase;
  17153. })(EasingFunction);
  17154. BABYLON.CircleEase = CircleEase;
  17155. var BackEase = (function (_super) {
  17156. __extends(BackEase, _super);
  17157. function BackEase(amplitude) {
  17158. if (amplitude === void 0) { amplitude = 1; }
  17159. _super.call(this);
  17160. this.amplitude = amplitude;
  17161. }
  17162. BackEase.prototype.easeInCore = function (gradient) {
  17163. var num = Math.max(0, this.amplitude);
  17164. return (Math.pow(gradient, 3.0) - ((gradient * num) * Math.sin(3.1415926535897931 * gradient)));
  17165. };
  17166. return BackEase;
  17167. })(EasingFunction);
  17168. BABYLON.BackEase = BackEase;
  17169. var BounceEase = (function (_super) {
  17170. __extends(BounceEase, _super);
  17171. function BounceEase(bounces, bounciness) {
  17172. if (bounces === void 0) { bounces = 3; }
  17173. if (bounciness === void 0) { bounciness = 2; }
  17174. _super.call(this);
  17175. this.bounces = bounces;
  17176. this.bounciness = bounciness;
  17177. }
  17178. BounceEase.prototype.easeInCore = function (gradient) {
  17179. var y = Math.max(0.0, this.bounces);
  17180. var bounciness = this.bounciness;
  17181. if (bounciness <= 1.0) {
  17182. bounciness = 1.001;
  17183. }
  17184. var num9 = Math.pow(bounciness, y);
  17185. var num5 = 1.0 - bounciness;
  17186. var num4 = ((1.0 - num9) / num5) + (num9 * 0.5);
  17187. var num15 = gradient * num4;
  17188. var num65 = Math.log((-num15 * (1.0 - bounciness)) + 1.0) / Math.log(bounciness);
  17189. var num3 = Math.floor(num65);
  17190. var num13 = num3 + 1.0;
  17191. var num8 = (1.0 - Math.pow(bounciness, num3)) / (num5 * num4);
  17192. var num12 = (1.0 - Math.pow(bounciness, num13)) / (num5 * num4);
  17193. var num7 = (num8 + num12) * 0.5;
  17194. var num6 = gradient - num7;
  17195. var num2 = num7 - num8;
  17196. return (((-Math.pow(1.0 / bounciness, y - num3) / (num2 * num2)) * (num6 - num2)) * (num6 + num2));
  17197. };
  17198. return BounceEase;
  17199. })(EasingFunction);
  17200. BABYLON.BounceEase = BounceEase;
  17201. var CubicEase = (function (_super) {
  17202. __extends(CubicEase, _super);
  17203. function CubicEase() {
  17204. _super.apply(this, arguments);
  17205. }
  17206. CubicEase.prototype.easeInCore = function (gradient) {
  17207. return (gradient * gradient * gradient);
  17208. };
  17209. return CubicEase;
  17210. })(EasingFunction);
  17211. BABYLON.CubicEase = CubicEase;
  17212. var ElasticEase = (function (_super) {
  17213. __extends(ElasticEase, _super);
  17214. function ElasticEase(oscillations, springiness) {
  17215. if (oscillations === void 0) { oscillations = 3; }
  17216. if (springiness === void 0) { springiness = 3; }
  17217. _super.call(this);
  17218. this.oscillations = oscillations;
  17219. this.springiness = springiness;
  17220. }
  17221. ElasticEase.prototype.easeInCore = function (gradient) {
  17222. var num2;
  17223. var num3 = Math.max(0.0, this.oscillations);
  17224. var num = Math.max(0.0, this.springiness);
  17225. if (num == 0) {
  17226. num2 = gradient;
  17227. }
  17228. else {
  17229. num2 = (Math.exp(num * gradient) - 1.0) / (Math.exp(num) - 1.0);
  17230. }
  17231. return (num2 * Math.sin(((6.2831853071795862 * num3) + 1.5707963267948966) * gradient));
  17232. };
  17233. return ElasticEase;
  17234. })(EasingFunction);
  17235. BABYLON.ElasticEase = ElasticEase;
  17236. var ExponentialEase = (function (_super) {
  17237. __extends(ExponentialEase, _super);
  17238. function ExponentialEase(exponent) {
  17239. if (exponent === void 0) { exponent = 2; }
  17240. _super.call(this);
  17241. this.exponent = exponent;
  17242. }
  17243. ExponentialEase.prototype.easeInCore = function (gradient) {
  17244. if (this.exponent <= 0) {
  17245. return gradient;
  17246. }
  17247. return ((Math.exp(this.exponent * gradient) - 1.0) / (Math.exp(this.exponent) - 1.0));
  17248. };
  17249. return ExponentialEase;
  17250. })(EasingFunction);
  17251. BABYLON.ExponentialEase = ExponentialEase;
  17252. var PowerEase = (function (_super) {
  17253. __extends(PowerEase, _super);
  17254. function PowerEase(power) {
  17255. if (power === void 0) { power = 2; }
  17256. _super.call(this);
  17257. this.power = power;
  17258. }
  17259. PowerEase.prototype.easeInCore = function (gradient) {
  17260. var y = Math.max(0.0, this.power);
  17261. return Math.pow(gradient, y);
  17262. };
  17263. return PowerEase;
  17264. })(EasingFunction);
  17265. BABYLON.PowerEase = PowerEase;
  17266. var QuadraticEase = (function (_super) {
  17267. __extends(QuadraticEase, _super);
  17268. function QuadraticEase() {
  17269. _super.apply(this, arguments);
  17270. }
  17271. QuadraticEase.prototype.easeInCore = function (gradient) {
  17272. return (gradient * gradient);
  17273. };
  17274. return QuadraticEase;
  17275. })(EasingFunction);
  17276. BABYLON.QuadraticEase = QuadraticEase;
  17277. var QuarticEase = (function (_super) {
  17278. __extends(QuarticEase, _super);
  17279. function QuarticEase() {
  17280. _super.apply(this, arguments);
  17281. }
  17282. QuarticEase.prototype.easeInCore = function (gradient) {
  17283. return (gradient * gradient * gradient * gradient);
  17284. };
  17285. return QuarticEase;
  17286. })(EasingFunction);
  17287. BABYLON.QuarticEase = QuarticEase;
  17288. var QuinticEase = (function (_super) {
  17289. __extends(QuinticEase, _super);
  17290. function QuinticEase() {
  17291. _super.apply(this, arguments);
  17292. }
  17293. QuinticEase.prototype.easeInCore = function (gradient) {
  17294. return (gradient * gradient * gradient * gradient * gradient);
  17295. };
  17296. return QuinticEase;
  17297. })(EasingFunction);
  17298. BABYLON.QuinticEase = QuinticEase;
  17299. var SineEase = (function (_super) {
  17300. __extends(SineEase, _super);
  17301. function SineEase() {
  17302. _super.apply(this, arguments);
  17303. }
  17304. SineEase.prototype.easeInCore = function (gradient) {
  17305. return (1.0 - Math.sin(1.5707963267948966 * (1.0 - gradient)));
  17306. };
  17307. return SineEase;
  17308. })(EasingFunction);
  17309. BABYLON.SineEase = SineEase;
  17310. var BezierCurveEase = (function (_super) {
  17311. __extends(BezierCurveEase, _super);
  17312. function BezierCurveEase(x1, y1, x2, y2) {
  17313. if (x1 === void 0) { x1 = 0; }
  17314. if (y1 === void 0) { y1 = 0; }
  17315. if (x2 === void 0) { x2 = 1; }
  17316. if (y2 === void 0) { y2 = 1; }
  17317. _super.call(this);
  17318. this.x1 = x1;
  17319. this.y1 = y1;
  17320. this.x2 = x2;
  17321. this.y2 = y2;
  17322. }
  17323. BezierCurveEase.prototype.easeInCore = function (gradient) {
  17324. return BABYLON.BezierCurve.interpolate(gradient, this.x1, this.y1, this.x2, this.y2);
  17325. };
  17326. return BezierCurveEase;
  17327. })(EasingFunction);
  17328. BABYLON.BezierCurveEase = BezierCurveEase;
  17329. })(BABYLON || (BABYLON = {}));
  17330. //# sourceMappingURL=babylon.easing.js.mapvar BABYLON;
  17331. (function (BABYLON) {
  17332. var Octree = (function () {
  17333. function Octree(creationFunc, maxBlockCapacity, maxDepth) {
  17334. if (maxDepth === void 0) { maxDepth = 2; }
  17335. this.maxDepth = maxDepth;
  17336. this.dynamicContent = new Array();
  17337. this._maxBlockCapacity = maxBlockCapacity || 64;
  17338. this._selectionContent = new BABYLON.SmartArray(1024);
  17339. this._creationFunc = creationFunc;
  17340. }
  17341. // Methods
  17342. Octree.prototype.update = function (worldMin, worldMax, entries) {
  17343. Octree._CreateBlocks(worldMin, worldMax, entries, this._maxBlockCapacity, 0, this.maxDepth, this, this._creationFunc);
  17344. };
  17345. Octree.prototype.addMesh = function (entry) {
  17346. for (var index = 0; index < this.blocks.length; index++) {
  17347. var block = this.blocks[index];
  17348. block.addEntry(entry);
  17349. }
  17350. };
  17351. Octree.prototype.select = function (frustumPlanes, allowDuplicate) {
  17352. this._selectionContent.reset();
  17353. for (var index = 0; index < this.blocks.length; index++) {
  17354. var block = this.blocks[index];
  17355. block.select(frustumPlanes, this._selectionContent, allowDuplicate);
  17356. }
  17357. if (allowDuplicate) {
  17358. this._selectionContent.concat(this.dynamicContent);
  17359. }
  17360. else {
  17361. this._selectionContent.concatWithNoDuplicate(this.dynamicContent);
  17362. }
  17363. return this._selectionContent;
  17364. };
  17365. Octree.prototype.intersects = function (sphereCenter, sphereRadius, allowDuplicate) {
  17366. this._selectionContent.reset();
  17367. for (var index = 0; index < this.blocks.length; index++) {
  17368. var block = this.blocks[index];
  17369. block.intersects(sphereCenter, sphereRadius, this._selectionContent, allowDuplicate);
  17370. }
  17371. if (allowDuplicate) {
  17372. this._selectionContent.concat(this.dynamicContent);
  17373. }
  17374. else {
  17375. this._selectionContent.concatWithNoDuplicate(this.dynamicContent);
  17376. }
  17377. return this._selectionContent;
  17378. };
  17379. Octree.prototype.intersectsRay = function (ray) {
  17380. this._selectionContent.reset();
  17381. for (var index = 0; index < this.blocks.length; index++) {
  17382. var block = this.blocks[index];
  17383. block.intersectsRay(ray, this._selectionContent);
  17384. }
  17385. this._selectionContent.concatWithNoDuplicate(this.dynamicContent);
  17386. return this._selectionContent;
  17387. };
  17388. Octree._CreateBlocks = function (worldMin, worldMax, entries, maxBlockCapacity, currentDepth, maxDepth, target, creationFunc) {
  17389. target.blocks = new Array();
  17390. var blockSize = new BABYLON.Vector3((worldMax.x - worldMin.x) / 2, (worldMax.y - worldMin.y) / 2, (worldMax.z - worldMin.z) / 2);
  17391. for (var x = 0; x < 2; x++) {
  17392. for (var y = 0; y < 2; y++) {
  17393. for (var z = 0; z < 2; z++) {
  17394. var localMin = worldMin.add(blockSize.multiplyByFloats(x, y, z));
  17395. var localMax = worldMin.add(blockSize.multiplyByFloats(x + 1, y + 1, z + 1));
  17396. var block = new BABYLON.OctreeBlock(localMin, localMax, maxBlockCapacity, currentDepth + 1, maxDepth, creationFunc);
  17397. block.addEntries(entries);
  17398. target.blocks.push(block);
  17399. }
  17400. }
  17401. }
  17402. };
  17403. Octree.CreationFuncForMeshes = function (entry, block) {
  17404. if (!entry.isBlocked && entry.getBoundingInfo().boundingBox.intersectsMinMax(block.minPoint, block.maxPoint)) {
  17405. block.entries.push(entry);
  17406. }
  17407. };
  17408. Octree.CreationFuncForSubMeshes = function (entry, block) {
  17409. if (entry.getBoundingInfo().boundingBox.intersectsMinMax(block.minPoint, block.maxPoint)) {
  17410. block.entries.push(entry);
  17411. }
  17412. };
  17413. return Octree;
  17414. })();
  17415. BABYLON.Octree = Octree;
  17416. })(BABYLON || (BABYLON = {}));
  17417. //# sourceMappingURL=babylon.octree.js.mapvar BABYLON;
  17418. (function (BABYLON) {
  17419. var OctreeBlock = (function () {
  17420. function OctreeBlock(minPoint, maxPoint, capacity, depth, maxDepth, creationFunc) {
  17421. this.entries = new Array();
  17422. this._boundingVectors = new Array();
  17423. this._capacity = capacity;
  17424. this._depth = depth;
  17425. this._maxDepth = maxDepth;
  17426. this._creationFunc = creationFunc;
  17427. this._minPoint = minPoint;
  17428. this._maxPoint = maxPoint;
  17429. this._boundingVectors.push(minPoint.clone());
  17430. this._boundingVectors.push(maxPoint.clone());
  17431. this._boundingVectors.push(minPoint.clone());
  17432. this._boundingVectors[2].x = maxPoint.x;
  17433. this._boundingVectors.push(minPoint.clone());
  17434. this._boundingVectors[3].y = maxPoint.y;
  17435. this._boundingVectors.push(minPoint.clone());
  17436. this._boundingVectors[4].z = maxPoint.z;
  17437. this._boundingVectors.push(maxPoint.clone());
  17438. this._boundingVectors[5].z = minPoint.z;
  17439. this._boundingVectors.push(maxPoint.clone());
  17440. this._boundingVectors[6].x = minPoint.x;
  17441. this._boundingVectors.push(maxPoint.clone());
  17442. this._boundingVectors[7].y = minPoint.y;
  17443. }
  17444. Object.defineProperty(OctreeBlock.prototype, "capacity", {
  17445. // Property
  17446. get: function () {
  17447. return this._capacity;
  17448. },
  17449. enumerable: true,
  17450. configurable: true
  17451. });
  17452. Object.defineProperty(OctreeBlock.prototype, "minPoint", {
  17453. get: function () {
  17454. return this._minPoint;
  17455. },
  17456. enumerable: true,
  17457. configurable: true
  17458. });
  17459. Object.defineProperty(OctreeBlock.prototype, "maxPoint", {
  17460. get: function () {
  17461. return this._maxPoint;
  17462. },
  17463. enumerable: true,
  17464. configurable: true
  17465. });
  17466. // Methods
  17467. OctreeBlock.prototype.addEntry = function (entry) {
  17468. if (this.blocks) {
  17469. for (var index = 0; index < this.blocks.length; index++) {
  17470. var block = this.blocks[index];
  17471. block.addEntry(entry);
  17472. }
  17473. return;
  17474. }
  17475. this._creationFunc(entry, this);
  17476. if (this.entries.length > this.capacity && this._depth < this._maxDepth) {
  17477. this.createInnerBlocks();
  17478. }
  17479. };
  17480. OctreeBlock.prototype.addEntries = function (entries) {
  17481. for (var index = 0; index < entries.length; index++) {
  17482. var mesh = entries[index];
  17483. this.addEntry(mesh);
  17484. }
  17485. };
  17486. OctreeBlock.prototype.select = function (frustumPlanes, selection, allowDuplicate) {
  17487. if (BABYLON.BoundingBox.IsInFrustum(this._boundingVectors, frustumPlanes)) {
  17488. if (this.blocks) {
  17489. for (var index = 0; index < this.blocks.length; index++) {
  17490. var block = this.blocks[index];
  17491. block.select(frustumPlanes, selection, allowDuplicate);
  17492. }
  17493. return;
  17494. }
  17495. if (allowDuplicate) {
  17496. selection.concat(this.entries);
  17497. }
  17498. else {
  17499. selection.concatWithNoDuplicate(this.entries);
  17500. }
  17501. }
  17502. };
  17503. OctreeBlock.prototype.intersects = function (sphereCenter, sphereRadius, selection, allowDuplicate) {
  17504. if (BABYLON.BoundingBox.IntersectsSphere(this._minPoint, this._maxPoint, sphereCenter, sphereRadius)) {
  17505. if (this.blocks) {
  17506. for (var index = 0; index < this.blocks.length; index++) {
  17507. var block = this.blocks[index];
  17508. block.intersects(sphereCenter, sphereRadius, selection, allowDuplicate);
  17509. }
  17510. return;
  17511. }
  17512. if (allowDuplicate) {
  17513. selection.concat(this.entries);
  17514. }
  17515. else {
  17516. selection.concatWithNoDuplicate(this.entries);
  17517. }
  17518. }
  17519. };
  17520. OctreeBlock.prototype.intersectsRay = function (ray, selection) {
  17521. if (ray.intersectsBoxMinMax(this._minPoint, this._maxPoint)) {
  17522. if (this.blocks) {
  17523. for (var index = 0; index < this.blocks.length; index++) {
  17524. var block = this.blocks[index];
  17525. block.intersectsRay(ray, selection);
  17526. }
  17527. return;
  17528. }
  17529. selection.concatWithNoDuplicate(this.entries);
  17530. }
  17531. };
  17532. OctreeBlock.prototype.createInnerBlocks = function () {
  17533. BABYLON.Octree._CreateBlocks(this._minPoint, this._maxPoint, this.entries, this._capacity, this._depth, this._maxDepth, this, this._creationFunc);
  17534. };
  17535. return OctreeBlock;
  17536. })();
  17537. BABYLON.OctreeBlock = OctreeBlock;
  17538. })(BABYLON || (BABYLON = {}));
  17539. //# sourceMappingURL=babylon.octreeBlock.js.mapvar BABYLON;
  17540. (function (BABYLON) {
  17541. var Bone = (function () {
  17542. function Bone(name, skeleton, parentBone, matrix) {
  17543. this.name = name;
  17544. this.children = new Array();
  17545. this.animations = new Array();
  17546. this._worldTransform = new BABYLON.Matrix();
  17547. this._absoluteTransform = new BABYLON.Matrix();
  17548. this._invertedAbsoluteTransform = new BABYLON.Matrix();
  17549. this._skeleton = skeleton;
  17550. this._matrix = matrix;
  17551. this._baseMatrix = matrix;
  17552. skeleton.bones.push(this);
  17553. if (parentBone) {
  17554. this._parent = parentBone;
  17555. parentBone.children.push(this);
  17556. }
  17557. else {
  17558. this._parent = null;
  17559. }
  17560. this._updateDifferenceMatrix();
  17561. }
  17562. // Members
  17563. Bone.prototype.getParent = function () {
  17564. return this._parent;
  17565. };
  17566. Bone.prototype.getLocalMatrix = function () {
  17567. return this._matrix;
  17568. };
  17569. Bone.prototype.getBaseMatrix = function () {
  17570. return this._baseMatrix;
  17571. };
  17572. Bone.prototype.getWorldMatrix = function () {
  17573. return this._worldTransform;
  17574. };
  17575. Bone.prototype.getInvertedAbsoluteTransform = function () {
  17576. return this._invertedAbsoluteTransform;
  17577. };
  17578. Bone.prototype.getAbsoluteMatrix = function () {
  17579. var matrix = this._matrix.clone();
  17580. var parent = this._parent;
  17581. while (parent) {
  17582. matrix = matrix.multiply(parent.getLocalMatrix());
  17583. parent = parent.getParent();
  17584. }
  17585. return matrix;
  17586. };
  17587. // Methods
  17588. Bone.prototype.updateMatrix = function (matrix) {
  17589. this._matrix = matrix;
  17590. this._skeleton._markAsDirty();
  17591. this._updateDifferenceMatrix();
  17592. };
  17593. Bone.prototype._updateDifferenceMatrix = function () {
  17594. if (this._parent) {
  17595. this._matrix.multiplyToRef(this._parent._absoluteTransform, this._absoluteTransform);
  17596. }
  17597. else {
  17598. this._absoluteTransform.copyFrom(this._matrix);
  17599. }
  17600. this._absoluteTransform.invertToRef(this._invertedAbsoluteTransform);
  17601. for (var index = 0; index < this.children.length; index++) {
  17602. this.children[index]._updateDifferenceMatrix();
  17603. }
  17604. };
  17605. Bone.prototype.markAsDirty = function () {
  17606. this._skeleton._markAsDirty();
  17607. };
  17608. return Bone;
  17609. })();
  17610. BABYLON.Bone = Bone;
  17611. })(BABYLON || (BABYLON = {}));
  17612. //# sourceMappingURL=babylon.bone.js.mapvar BABYLON;
  17613. (function (BABYLON) {
  17614. var Skeleton = (function () {
  17615. function Skeleton(name, id, scene) {
  17616. this.name = name;
  17617. this.id = id;
  17618. this.bones = new Array();
  17619. this._isDirty = true;
  17620. this._identity = BABYLON.Matrix.Identity();
  17621. this.bones = [];
  17622. this._scene = scene;
  17623. scene.skeletons.push(this);
  17624. this.prepare();
  17625. //make sure it will recalculate the matrix next time prepare is called.
  17626. this._isDirty = true;
  17627. }
  17628. // Members
  17629. Skeleton.prototype.getTransformMatrices = function () {
  17630. return this._transformMatrices;
  17631. };
  17632. // Methods
  17633. Skeleton.prototype._markAsDirty = function () {
  17634. this._isDirty = true;
  17635. };
  17636. Skeleton.prototype.prepare = function () {
  17637. if (!this._isDirty) {
  17638. return;
  17639. }
  17640. if (!this._transformMatrices || this._transformMatrices.length !== 16 * (this.bones.length + 1)) {
  17641. this._transformMatrices = new Float32Array(16 * (this.bones.length + 1));
  17642. }
  17643. for (var index = 0; index < this.bones.length; index++) {
  17644. var bone = this.bones[index];
  17645. var parentBone = bone.getParent();
  17646. if (parentBone) {
  17647. bone.getLocalMatrix().multiplyToRef(parentBone.getWorldMatrix(), bone.getWorldMatrix());
  17648. }
  17649. else {
  17650. bone.getWorldMatrix().copyFrom(bone.getLocalMatrix());
  17651. }
  17652. bone.getInvertedAbsoluteTransform().multiplyToArray(bone.getWorldMatrix(), this._transformMatrices, index * 16);
  17653. }
  17654. this._identity.copyToArray(this._transformMatrices, this.bones.length * 16);
  17655. this._isDirty = false;
  17656. this._scene._activeBones += this.bones.length;
  17657. };
  17658. Skeleton.prototype.getAnimatables = function () {
  17659. if (!this._animatables || this._animatables.length !== this.bones.length) {
  17660. this._animatables = [];
  17661. for (var index = 0; index < this.bones.length; index++) {
  17662. this._animatables.push(this.bones[index]);
  17663. }
  17664. }
  17665. return this._animatables;
  17666. };
  17667. Skeleton.prototype.clone = function (name, id) {
  17668. var result = new Skeleton(name, id || name, this._scene);
  17669. for (var index = 0; index < this.bones.length; index++) {
  17670. var source = this.bones[index];
  17671. var parentBone = null;
  17672. if (source.getParent()) {
  17673. var parentIndex = this.bones.indexOf(source.getParent());
  17674. parentBone = result.bones[parentIndex];
  17675. }
  17676. var bone = new BABYLON.Bone(source.name, result, parentBone, source.getBaseMatrix());
  17677. BABYLON.Tools.DeepCopy(source.animations, bone.animations);
  17678. }
  17679. return result;
  17680. };
  17681. return Skeleton;
  17682. })();
  17683. BABYLON.Skeleton = Skeleton;
  17684. })(BABYLON || (BABYLON = {}));
  17685. //# sourceMappingURL=babylon.skeleton.js.mapvar BABYLON;
  17686. (function (BABYLON) {
  17687. var PostProcess = (function () {
  17688. function PostProcess(name, fragmentUrl, parameters, samplers, ratio, camera, samplingMode, engine, reusable, defines) {
  17689. if (samplingMode === void 0) { samplingMode = BABYLON.Texture.NEAREST_SAMPLINGMODE; }
  17690. this.name = name;
  17691. this.width = -1;
  17692. this.height = -1;
  17693. this._reusable = false;
  17694. this._textures = new BABYLON.SmartArray(2);
  17695. this._currentRenderTextureInd = 0;
  17696. if (camera != null) {
  17697. this._camera = camera;
  17698. this._scene = camera.getScene();
  17699. camera.attachPostProcess(this);
  17700. this._engine = this._scene.getEngine();
  17701. }
  17702. else {
  17703. this._engine = engine;
  17704. }
  17705. this._renderRatio = ratio;
  17706. this.renderTargetSamplingMode = samplingMode ? samplingMode : BABYLON.Texture.NEAREST_SAMPLINGMODE;
  17707. this._reusable = reusable || false;
  17708. samplers = samplers || [];
  17709. samplers.push("textureSampler");
  17710. this._effect = this._engine.createEffect({ vertex: "postprocess", fragment: fragmentUrl }, ["position"], parameters || [], samplers, defines !== undefined ? defines : "");
  17711. }
  17712. PostProcess.prototype.isReusable = function () {
  17713. return this._reusable;
  17714. };
  17715. PostProcess.prototype.activate = function (camera, sourceTexture) {
  17716. camera = camera || this._camera;
  17717. var scene = camera.getScene();
  17718. var maxSize = camera.getEngine().getCaps().maxTextureSize;
  17719. var desiredWidth = ((sourceTexture ? sourceTexture._width : this._engine.getRenderingCanvas().width) * this._renderRatio) | 0;
  17720. var desiredHeight = ((sourceTexture ? sourceTexture._height : this._engine.getRenderingCanvas().height) * this._renderRatio) | 0;
  17721. desiredWidth = BABYLON.Tools.GetExponantOfTwo(desiredWidth, maxSize);
  17722. desiredHeight = BABYLON.Tools.GetExponantOfTwo(desiredHeight, maxSize);
  17723. if (this.width !== desiredWidth || this.height !== desiredHeight) {
  17724. if (this._textures.length > 0) {
  17725. for (var i = 0; i < this._textures.length; i++) {
  17726. this._engine._releaseTexture(this._textures.data[i]);
  17727. }
  17728. this._textures.reset();
  17729. }
  17730. this.width = desiredWidth;
  17731. this.height = desiredHeight;
  17732. this._textures.push(this._engine.createRenderTargetTexture({ width: this.width, height: this.height }, { generateMipMaps: false, generateDepthBuffer: camera._postProcesses.indexOf(this) === camera._postProcessesTakenIndices[0], samplingMode: this.renderTargetSamplingMode }));
  17733. if (this._reusable) {
  17734. this._textures.push(this._engine.createRenderTargetTexture({ width: this.width, height: this.height }, { generateMipMaps: false, generateDepthBuffer: camera._postProcesses.indexOf(this) === camera._postProcessesTakenIndices[0], samplingMode: this.renderTargetSamplingMode }));
  17735. }
  17736. if (this.onSizeChanged) {
  17737. this.onSizeChanged();
  17738. }
  17739. }
  17740. this._engine.bindFramebuffer(this._textures.data[this._currentRenderTextureInd]);
  17741. if (this.onActivate) {
  17742. this.onActivate(camera);
  17743. }
  17744. // Clear
  17745. if (this.clearColor) {
  17746. this._engine.clear(this.clearColor, true, true);
  17747. }
  17748. else {
  17749. this._engine.clear(scene.clearColor, scene.autoClear || scene.forceWireframe, true);
  17750. }
  17751. if (this._reusable) {
  17752. this._currentRenderTextureInd = (this._currentRenderTextureInd + 1) % 2;
  17753. }
  17754. };
  17755. PostProcess.prototype.apply = function () {
  17756. // Check
  17757. if (!this._effect.isReady())
  17758. return null;
  17759. // States
  17760. this._engine.enableEffect(this._effect);
  17761. this._engine.setState(false);
  17762. this._engine.setAlphaMode(BABYLON.Engine.ALPHA_DISABLE);
  17763. this._engine.setDepthBuffer(false);
  17764. this._engine.setDepthWrite(false);
  17765. // Texture
  17766. this._effect._bindTexture("textureSampler", this._textures.data[this._currentRenderTextureInd]);
  17767. // Parameters
  17768. if (this.onApply) {
  17769. this.onApply(this._effect);
  17770. }
  17771. return this._effect;
  17772. };
  17773. PostProcess.prototype.dispose = function (camera) {
  17774. camera = camera || this._camera;
  17775. if (this._textures.length > 0) {
  17776. for (var i = 0; i < this._textures.length; i++) {
  17777. this._engine._releaseTexture(this._textures.data[i]);
  17778. }
  17779. this._textures.reset();
  17780. }
  17781. if (!camera) {
  17782. return;
  17783. }
  17784. camera.detachPostProcess(this);
  17785. var index = camera._postProcesses.indexOf(this);
  17786. if (index === camera._postProcessesTakenIndices[0] && camera._postProcessesTakenIndices.length > 0) {
  17787. this._camera._postProcesses[camera._postProcessesTakenIndices[0]].width = -1; // invalidate frameBuffer to hint the postprocess to create a depth buffer
  17788. }
  17789. };
  17790. return PostProcess;
  17791. })();
  17792. BABYLON.PostProcess = PostProcess;
  17793. })(BABYLON || (BABYLON = {}));
  17794. //# sourceMappingURL=babylon.postProcess.js.mapvar BABYLON;
  17795. (function (BABYLON) {
  17796. var PostProcessManager = (function () {
  17797. function PostProcessManager(scene) {
  17798. this._vertexDeclaration = [2];
  17799. this._vertexStrideSize = 2 * 4;
  17800. this._scene = scene;
  17801. }
  17802. PostProcessManager.prototype._prepareBuffers = function () {
  17803. if (this._vertexBuffer) {
  17804. return;
  17805. }
  17806. // VBO
  17807. var vertices = [];
  17808. vertices.push(1, 1);
  17809. vertices.push(-1, 1);
  17810. vertices.push(-1, -1);
  17811. vertices.push(1, -1);
  17812. this._vertexBuffer = this._scene.getEngine().createVertexBuffer(vertices);
  17813. // Indices
  17814. var indices = [];
  17815. indices.push(0);
  17816. indices.push(1);
  17817. indices.push(2);
  17818. indices.push(0);
  17819. indices.push(2);
  17820. indices.push(3);
  17821. this._indexBuffer = this._scene.getEngine().createIndexBuffer(indices);
  17822. };
  17823. // Methods
  17824. PostProcessManager.prototype._prepareFrame = function (sourceTexture) {
  17825. var postProcesses = this._scene.activeCamera._postProcesses;
  17826. var postProcessesTakenIndices = this._scene.activeCamera._postProcessesTakenIndices;
  17827. if (postProcessesTakenIndices.length === 0 || !this._scene.postProcessesEnabled) {
  17828. return false;
  17829. }
  17830. postProcesses[this._scene.activeCamera._postProcessesTakenIndices[0]].activate(this._scene.activeCamera, sourceTexture);
  17831. return true;
  17832. };
  17833. PostProcessManager.prototype.directRender = function (postProcesses, targetTexture) {
  17834. var engine = this._scene.getEngine();
  17835. for (var index = 0; index < postProcesses.length; index++) {
  17836. if (index < postProcesses.length - 1) {
  17837. postProcesses[index + 1].activate(this._scene.activeCamera, targetTexture);
  17838. }
  17839. else {
  17840. if (targetTexture) {
  17841. engine.bindFramebuffer(targetTexture);
  17842. }
  17843. else {
  17844. engine.restoreDefaultFramebuffer();
  17845. }
  17846. }
  17847. var pp = postProcesses[index];
  17848. var effect = pp.apply();
  17849. if (effect) {
  17850. if (pp.onBeforeRender) {
  17851. pp.onBeforeRender(effect);
  17852. }
  17853. // VBOs
  17854. this._prepareBuffers();
  17855. engine.bindBuffers(this._vertexBuffer, this._indexBuffer, this._vertexDeclaration, this._vertexStrideSize, effect);
  17856. // Draw order
  17857. engine.draw(true, 0, 6);
  17858. }
  17859. }
  17860. // Restore depth buffer
  17861. engine.setDepthBuffer(true);
  17862. engine.setDepthWrite(true);
  17863. };
  17864. PostProcessManager.prototype._finalizeFrame = function (doNotPresent, targetTexture, postProcesses) {
  17865. postProcesses = postProcesses || this._scene.activeCamera._postProcesses;
  17866. var postProcessesTakenIndices = this._scene.activeCamera._postProcessesTakenIndices;
  17867. if (postProcessesTakenIndices.length === 0 || !this._scene.postProcessesEnabled) {
  17868. return;
  17869. }
  17870. var engine = this._scene.getEngine();
  17871. for (var index = 0; index < postProcessesTakenIndices.length; index++) {
  17872. if (index < postProcessesTakenIndices.length - 1) {
  17873. postProcesses[postProcessesTakenIndices[index + 1]].activate(this._scene.activeCamera);
  17874. }
  17875. else {
  17876. if (targetTexture) {
  17877. engine.bindFramebuffer(targetTexture);
  17878. }
  17879. else {
  17880. engine.restoreDefaultFramebuffer();
  17881. }
  17882. }
  17883. if (doNotPresent) {
  17884. break;
  17885. }
  17886. var pp = postProcesses[postProcessesTakenIndices[index]];
  17887. var effect = pp.apply();
  17888. if (effect) {
  17889. if (pp.onBeforeRender) {
  17890. pp.onBeforeRender(effect);
  17891. }
  17892. // VBOs
  17893. this._prepareBuffers();
  17894. engine.bindBuffers(this._vertexBuffer, this._indexBuffer, this._vertexDeclaration, this._vertexStrideSize, effect);
  17895. // Draw order
  17896. engine.draw(true, 0, 6);
  17897. }
  17898. }
  17899. // Restore depth buffer
  17900. engine.setDepthBuffer(true);
  17901. engine.setDepthWrite(true);
  17902. };
  17903. PostProcessManager.prototype.dispose = function () {
  17904. if (this._vertexBuffer) {
  17905. this._scene.getEngine()._releaseBuffer(this._vertexBuffer);
  17906. this._vertexBuffer = null;
  17907. }
  17908. if (this._indexBuffer) {
  17909. this._scene.getEngine()._releaseBuffer(this._indexBuffer);
  17910. this._indexBuffer = null;
  17911. }
  17912. };
  17913. return PostProcessManager;
  17914. })();
  17915. BABYLON.PostProcessManager = PostProcessManager;
  17916. })(BABYLON || (BABYLON = {}));
  17917. //# sourceMappingURL=babylon.postProcessManager.js.map
  17918. var BABYLON;
  17919. (function (BABYLON) {
  17920. var PassPostProcess = (function (_super) {
  17921. __extends(PassPostProcess, _super);
  17922. function PassPostProcess(name, ratio, camera, samplingMode, engine, reusable) {
  17923. _super.call(this, name, "pass", null, null, ratio, camera, samplingMode, engine, reusable);
  17924. }
  17925. return PassPostProcess;
  17926. })(BABYLON.PostProcess);
  17927. BABYLON.PassPostProcess = PassPostProcess;
  17928. })(BABYLON || (BABYLON = {}));
  17929. //# sourceMappingURL=babylon.passPostProcess.js.map
  17930. var BABYLON;
  17931. (function (BABYLON) {
  17932. var BlurPostProcess = (function (_super) {
  17933. __extends(BlurPostProcess, _super);
  17934. function BlurPostProcess(name, direction, blurWidth, ratio, camera, samplingMode, engine, reusable) {
  17935. var _this = this;
  17936. if (samplingMode === void 0) { samplingMode = BABYLON.Texture.BILINEAR_SAMPLINGMODE; }
  17937. _super.call(this, name, "blur", ["screenSize", "direction", "blurWidth"], null, ratio, camera, samplingMode, engine, reusable);
  17938. this.direction = direction;
  17939. this.blurWidth = blurWidth;
  17940. this.onApply = function (effect) {
  17941. effect.setFloat2("screenSize", _this.width, _this.height);
  17942. effect.setVector2("direction", _this.direction);
  17943. effect.setFloat("blurWidth", _this.blurWidth);
  17944. };
  17945. }
  17946. return BlurPostProcess;
  17947. })(BABYLON.PostProcess);
  17948. BABYLON.BlurPostProcess = BlurPostProcess;
  17949. })(BABYLON || (BABYLON = {}));
  17950. //# sourceMappingURL=babylon.blurPostProcess.js.map
  17951. var BABYLON;
  17952. (function (BABYLON) {
  17953. var FilterPostProcess = (function (_super) {
  17954. __extends(FilterPostProcess, _super);
  17955. function FilterPostProcess(name, kernelMatrix, ratio, camera, samplingMode, engine, reusable) {
  17956. var _this = this;
  17957. _super.call(this, name, "filter", ["kernelMatrix"], null, ratio, camera, samplingMode, engine, reusable);
  17958. this.kernelMatrix = kernelMatrix;
  17959. this.onApply = function (effect) {
  17960. effect.setMatrix("kernelMatrix", _this.kernelMatrix);
  17961. };
  17962. }
  17963. return FilterPostProcess;
  17964. })(BABYLON.PostProcess);
  17965. BABYLON.FilterPostProcess = FilterPostProcess;
  17966. })(BABYLON || (BABYLON = {}));
  17967. //# sourceMappingURL=babylon.filterPostProcess.js.map
  17968. var BABYLON;
  17969. (function (BABYLON) {
  17970. var RefractionPostProcess = (function (_super) {
  17971. __extends(RefractionPostProcess, _super);
  17972. function RefractionPostProcess(name, refractionTextureUrl, color, depth, colorLevel, ratio, camera, samplingMode, engine, reusable) {
  17973. var _this = this;
  17974. _super.call(this, name, "refraction", ["baseColor", "depth", "colorLevel"], ["refractionSampler"], ratio, camera, samplingMode, engine, reusable);
  17975. this.color = color;
  17976. this.depth = depth;
  17977. this.colorLevel = colorLevel;
  17978. this.onActivate = function (cam) {
  17979. _this._refRexture = _this._refRexture || new BABYLON.Texture(refractionTextureUrl, cam.getScene());
  17980. };
  17981. this.onApply = function (effect) {
  17982. effect.setColor3("baseColor", _this.color);
  17983. effect.setFloat("depth", _this.depth);
  17984. effect.setFloat("colorLevel", _this.colorLevel);
  17985. effect.setTexture("refractionSampler", _this._refRexture);
  17986. };
  17987. }
  17988. // Methods
  17989. RefractionPostProcess.prototype.dispose = function (camera) {
  17990. if (this._refRexture) {
  17991. this._refRexture.dispose();
  17992. }
  17993. _super.prototype.dispose.call(this, camera);
  17994. };
  17995. return RefractionPostProcess;
  17996. })(BABYLON.PostProcess);
  17997. BABYLON.RefractionPostProcess = RefractionPostProcess;
  17998. })(BABYLON || (BABYLON = {}));
  17999. //# sourceMappingURL=babylon.refractionPostProcess.js.map
  18000. var BABYLON;
  18001. (function (BABYLON) {
  18002. var BlackAndWhitePostProcess = (function (_super) {
  18003. __extends(BlackAndWhitePostProcess, _super);
  18004. function BlackAndWhitePostProcess(name, ratio, camera, samplingMode, engine, reusable) {
  18005. _super.call(this, name, "blackAndWhite", null, null, ratio, camera, samplingMode, engine, reusable);
  18006. }
  18007. return BlackAndWhitePostProcess;
  18008. })(BABYLON.PostProcess);
  18009. BABYLON.BlackAndWhitePostProcess = BlackAndWhitePostProcess;
  18010. })(BABYLON || (BABYLON = {}));
  18011. //# sourceMappingURL=babylon.blackAndWhitePostProcess.js.map
  18012. var BABYLON;
  18013. (function (BABYLON) {
  18014. var ConvolutionPostProcess = (function (_super) {
  18015. __extends(ConvolutionPostProcess, _super);
  18016. function ConvolutionPostProcess(name, kernel, ratio, camera, samplingMode, engine, reusable) {
  18017. var _this = this;
  18018. _super.call(this, name, "convolution", ["kernel", "screenSize"], null, ratio, camera, samplingMode, engine, reusable);
  18019. this.kernel = kernel;
  18020. this.onApply = function (effect) {
  18021. effect.setFloat2("screenSize", _this.width, _this.height);
  18022. effect.setArray("kernel", _this.kernel);
  18023. };
  18024. }
  18025. // Statics
  18026. // Based on http://en.wikipedia.org/wiki/Kernel_(image_processing)
  18027. ConvolutionPostProcess.EdgeDetect0Kernel = [1, 0, -1, 0, 0, 0, -1, 0, 1];
  18028. ConvolutionPostProcess.EdgeDetect1Kernel = [0, 1, 0, 1, -4, 1, 0, 1, 0];
  18029. ConvolutionPostProcess.EdgeDetect2Kernel = [-1, -1, -1, -1, 8, -1, -1, -1, -1];
  18030. ConvolutionPostProcess.SharpenKernel = [0, -1, 0, -1, 5, -1, 0, -1, 0];
  18031. ConvolutionPostProcess.EmbossKernel = [-2, -1, 0, -1, 1, 1, 0, 1, 2];
  18032. ConvolutionPostProcess.GaussianKernel = [0, 1, 0, 1, 1, 1, 0, 1, 0];
  18033. return ConvolutionPostProcess;
  18034. })(BABYLON.PostProcess);
  18035. BABYLON.ConvolutionPostProcess = ConvolutionPostProcess;
  18036. })(BABYLON || (BABYLON = {}));
  18037. //# sourceMappingURL=babylon.convolutionPostProcess.js.map
  18038. var BABYLON;
  18039. (function (BABYLON) {
  18040. var FxaaPostProcess = (function (_super) {
  18041. __extends(FxaaPostProcess, _super);
  18042. function FxaaPostProcess(name, ratio, camera, samplingMode, engine, reusable) {
  18043. var _this = this;
  18044. _super.call(this, name, "fxaa", ["texelSize"], null, ratio, camera, samplingMode, engine, reusable);
  18045. this.onSizeChanged = function () {
  18046. _this.texelWidth = 1.0 / _this.width;
  18047. _this.texelHeight = 1.0 / _this.height;
  18048. };
  18049. this.onApply = function (effect) {
  18050. effect.setFloat2("texelSize", _this.texelWidth, _this.texelHeight);
  18051. };
  18052. }
  18053. return FxaaPostProcess;
  18054. })(BABYLON.PostProcess);
  18055. BABYLON.FxaaPostProcess = FxaaPostProcess;
  18056. })(BABYLON || (BABYLON = {}));
  18057. //# sourceMappingURL=babylon.fxaaPostProcess.js.mapvar BABYLON;
  18058. (function (BABYLON) {
  18059. var LensFlare = (function () {
  18060. function LensFlare(size, position, color, imgUrl, system) {
  18061. this.size = size;
  18062. this.position = position;
  18063. this.dispose = function () {
  18064. if (this.texture) {
  18065. this.texture.dispose();
  18066. }
  18067. // Remove from scene
  18068. var index = this._system.lensFlares.indexOf(this);
  18069. this._system.lensFlares.splice(index, 1);
  18070. };
  18071. this.color = color || new BABYLON.Color3(1, 1, 1);
  18072. this.texture = imgUrl ? new BABYLON.Texture(imgUrl, system.getScene(), true) : null;
  18073. this._system = system;
  18074. system.lensFlares.push(this);
  18075. }
  18076. return LensFlare;
  18077. })();
  18078. BABYLON.LensFlare = LensFlare;
  18079. })(BABYLON || (BABYLON = {}));
  18080. //# sourceMappingURL=babylon.lensFlare.js.mapvar BABYLON;
  18081. (function (BABYLON) {
  18082. var LensFlareSystem = (function () {
  18083. function LensFlareSystem(name, emitter, scene) {
  18084. this.name = name;
  18085. this.lensFlares = new Array();
  18086. this.borderLimit = 300;
  18087. this._vertexDeclaration = [2];
  18088. this._vertexStrideSize = 2 * 4;
  18089. this._isEnabled = true;
  18090. this._scene = scene;
  18091. this._emitter = emitter;
  18092. scene.lensFlareSystems.push(this);
  18093. this.meshesSelectionPredicate = function (m) { return m.material && m.isVisible && m.isEnabled() && m.isBlocker && ((m.layerMask & scene.activeCamera.layerMask) != 0); };
  18094. // VBO
  18095. var vertices = [];
  18096. vertices.push(1, 1);
  18097. vertices.push(-1, 1);
  18098. vertices.push(-1, -1);
  18099. vertices.push(1, -1);
  18100. this._vertexBuffer = scene.getEngine().createVertexBuffer(vertices);
  18101. // Indices
  18102. var indices = [];
  18103. indices.push(0);
  18104. indices.push(1);
  18105. indices.push(2);
  18106. indices.push(0);
  18107. indices.push(2);
  18108. indices.push(3);
  18109. this._indexBuffer = scene.getEngine().createIndexBuffer(indices);
  18110. // Effects
  18111. this._effect = this._scene.getEngine().createEffect("lensFlare", ["position"], ["color", "viewportMatrix"], ["textureSampler"], "");
  18112. }
  18113. Object.defineProperty(LensFlareSystem.prototype, "isEnabled", {
  18114. get: function () {
  18115. return this._isEnabled;
  18116. },
  18117. set: function (value) {
  18118. this._isEnabled = value;
  18119. },
  18120. enumerable: true,
  18121. configurable: true
  18122. });
  18123. LensFlareSystem.prototype.getScene = function () {
  18124. return this._scene;
  18125. };
  18126. LensFlareSystem.prototype.getEmitter = function () {
  18127. return this._emitter;
  18128. };
  18129. LensFlareSystem.prototype.getEmitterPosition = function () {
  18130. return this._emitter.getAbsolutePosition ? this._emitter.getAbsolutePosition() : this._emitter.position;
  18131. };
  18132. LensFlareSystem.prototype.computeEffectivePosition = function (globalViewport) {
  18133. var position = this.getEmitterPosition();
  18134. position = BABYLON.Vector3.Project(position, BABYLON.Matrix.Identity(), this._scene.getTransformMatrix(), globalViewport);
  18135. this._positionX = position.x;
  18136. this._positionY = position.y;
  18137. position = BABYLON.Vector3.TransformCoordinates(this.getEmitterPosition(), this._scene.getViewMatrix());
  18138. if (position.z > 0) {
  18139. if ((this._positionX > globalViewport.x) && (this._positionX < globalViewport.x + globalViewport.width)) {
  18140. if ((this._positionY > globalViewport.y) && (this._positionY < globalViewport.y + globalViewport.height))
  18141. return true;
  18142. }
  18143. }
  18144. return false;
  18145. };
  18146. LensFlareSystem.prototype._isVisible = function () {
  18147. if (!this._isEnabled) {
  18148. return false;
  18149. }
  18150. var emitterPosition = this.getEmitterPosition();
  18151. var direction = emitterPosition.subtract(this._scene.activeCamera.position);
  18152. var distance = direction.length();
  18153. direction.normalize();
  18154. var ray = new BABYLON.Ray(this._scene.activeCamera.position, direction);
  18155. var pickInfo = this._scene.pickWithRay(ray, this.meshesSelectionPredicate, true);
  18156. return !pickInfo.hit || pickInfo.distance > distance;
  18157. };
  18158. LensFlareSystem.prototype.render = function () {
  18159. if (!this._effect.isReady())
  18160. return false;
  18161. var engine = this._scene.getEngine();
  18162. var viewport = this._scene.activeCamera.viewport;
  18163. var globalViewport = viewport.toGlobal(engine);
  18164. // Position
  18165. if (!this.computeEffectivePosition(globalViewport)) {
  18166. return false;
  18167. }
  18168. // Visibility
  18169. if (!this._isVisible()) {
  18170. return false;
  18171. }
  18172. // Intensity
  18173. var awayX;
  18174. var awayY;
  18175. if (this._positionX < this.borderLimit + globalViewport.x) {
  18176. awayX = this.borderLimit + globalViewport.x - this._positionX;
  18177. }
  18178. else if (this._positionX > globalViewport.x + globalViewport.width - this.borderLimit) {
  18179. awayX = this._positionX - globalViewport.x - globalViewport.width + this.borderLimit;
  18180. }
  18181. else {
  18182. awayX = 0;
  18183. }
  18184. if (this._positionY < this.borderLimit + globalViewport.y) {
  18185. awayY = this.borderLimit + globalViewport.y - this._positionY;
  18186. }
  18187. else if (this._positionY > globalViewport.y + globalViewport.height - this.borderLimit) {
  18188. awayY = this._positionY - globalViewport.y - globalViewport.height + this.borderLimit;
  18189. }
  18190. else {
  18191. awayY = 0;
  18192. }
  18193. var away = (awayX > awayY) ? awayX : awayY;
  18194. if (away > this.borderLimit) {
  18195. away = this.borderLimit;
  18196. }
  18197. var intensity = 1.0 - (away / this.borderLimit);
  18198. if (intensity < 0) {
  18199. return false;
  18200. }
  18201. if (intensity > 1.0) {
  18202. intensity = 1.0;
  18203. }
  18204. // Position
  18205. var centerX = globalViewport.x + globalViewport.width / 2;
  18206. var centerY = globalViewport.y + globalViewport.height / 2;
  18207. var distX = centerX - this._positionX;
  18208. var distY = centerY - this._positionY;
  18209. // Effects
  18210. engine.enableEffect(this._effect);
  18211. engine.setState(false);
  18212. engine.setDepthBuffer(false);
  18213. engine.setAlphaMode(BABYLON.Engine.ALPHA_ADD);
  18214. // VBOs
  18215. engine.bindBuffers(this._vertexBuffer, this._indexBuffer, this._vertexDeclaration, this._vertexStrideSize, this._effect);
  18216. for (var index = 0; index < this.lensFlares.length; index++) {
  18217. var flare = this.lensFlares[index];
  18218. var x = centerX - (distX * flare.position);
  18219. var y = centerY - (distY * flare.position);
  18220. var cw = flare.size;
  18221. var ch = flare.size * engine.getAspectRatio(this._scene.activeCamera);
  18222. var cx = 2 * (x / globalViewport.width) - 1.0;
  18223. var cy = 1.0 - 2 * (y / globalViewport.height);
  18224. var viewportMatrix = BABYLON.Matrix.FromValues(cw / 2, 0, 0, 0, 0, ch / 2, 0, 0, 0, 0, 1, 0, cx, cy, 0, 1);
  18225. this._effect.setMatrix("viewportMatrix", viewportMatrix);
  18226. // Texture
  18227. this._effect.setTexture("textureSampler", flare.texture);
  18228. // Color
  18229. this._effect.setFloat4("color", flare.color.r * intensity, flare.color.g * intensity, flare.color.b * intensity, 1.0);
  18230. // Draw order
  18231. engine.draw(true, 0, 6);
  18232. }
  18233. engine.setDepthBuffer(true);
  18234. engine.setAlphaMode(BABYLON.Engine.ALPHA_DISABLE);
  18235. return true;
  18236. };
  18237. LensFlareSystem.prototype.dispose = function () {
  18238. if (this._vertexBuffer) {
  18239. this._scene.getEngine()._releaseBuffer(this._vertexBuffer);
  18240. this._vertexBuffer = null;
  18241. }
  18242. if (this._indexBuffer) {
  18243. this._scene.getEngine()._releaseBuffer(this._indexBuffer);
  18244. this._indexBuffer = null;
  18245. }
  18246. while (this.lensFlares.length) {
  18247. this.lensFlares[0].dispose();
  18248. }
  18249. // Remove from scene
  18250. var index = this._scene.lensFlareSystems.indexOf(this);
  18251. this._scene.lensFlareSystems.splice(index, 1);
  18252. };
  18253. return LensFlareSystem;
  18254. })();
  18255. BABYLON.LensFlareSystem = LensFlareSystem;
  18256. })(BABYLON || (BABYLON = {}));
  18257. //# sourceMappingURL=babylon.lensFlareSystem.js.mapvar BABYLON;
  18258. (function (BABYLON) {
  18259. var IntersectionInfo = (function () {
  18260. function IntersectionInfo(bu, bv, distance) {
  18261. this.bu = bu;
  18262. this.bv = bv;
  18263. this.distance = distance;
  18264. this.faceId = 0;
  18265. this.subMeshId = 0;
  18266. }
  18267. return IntersectionInfo;
  18268. })();
  18269. BABYLON.IntersectionInfo = IntersectionInfo;
  18270. var PickingInfo = (function () {
  18271. function PickingInfo() {
  18272. this.hit = false;
  18273. this.distance = 0;
  18274. this.pickedPoint = null;
  18275. this.pickedMesh = null;
  18276. this.bu = 0;
  18277. this.bv = 0;
  18278. this.faceId = -1;
  18279. this.subMeshId = 0;
  18280. }
  18281. // Methods
  18282. PickingInfo.prototype.getNormal = function (useWorldCoordinates) {
  18283. if (useWorldCoordinates === void 0) { useWorldCoordinates = false; }
  18284. if (!this.pickedMesh || !this.pickedMesh.isVerticesDataPresent(BABYLON.VertexBuffer.NormalKind)) {
  18285. return null;
  18286. }
  18287. var indices = this.pickedMesh.getIndices();
  18288. var normals = this.pickedMesh.getVerticesData(BABYLON.VertexBuffer.NormalKind);
  18289. var normal0 = BABYLON.Vector3.FromArray(normals, indices[this.faceId * 3] * 3);
  18290. var normal1 = BABYLON.Vector3.FromArray(normals, indices[this.faceId * 3 + 1] * 3);
  18291. var normal2 = BABYLON.Vector3.FromArray(normals, indices[this.faceId * 3 + 2] * 3);
  18292. normal0 = normal0.scale(this.bu);
  18293. normal1 = normal1.scale(this.bv);
  18294. normal2 = normal2.scale(1.0 - this.bu - this.bv);
  18295. var result = new BABYLON.Vector3(normal0.x + normal1.x + normal2.x, normal0.y + normal1.y + normal2.y, normal0.z + normal1.z + normal2.z);
  18296. if (useWorldCoordinates) {
  18297. result = BABYLON.Vector3.TransformNormal(result, this.pickedMesh.getWorldMatrix());
  18298. }
  18299. return result;
  18300. };
  18301. PickingInfo.prototype.getTextureCoordinates = function () {
  18302. if (!this.pickedMesh || !this.pickedMesh.isVerticesDataPresent(BABYLON.VertexBuffer.UVKind)) {
  18303. return null;
  18304. }
  18305. var indices = this.pickedMesh.getIndices();
  18306. var uvs = this.pickedMesh.getVerticesData(BABYLON.VertexBuffer.UVKind);
  18307. var uv0 = BABYLON.Vector2.FromArray(uvs, indices[this.faceId * 3] * 2);
  18308. var uv1 = BABYLON.Vector2.FromArray(uvs, indices[this.faceId * 3 + 1] * 2);
  18309. var uv2 = BABYLON.Vector2.FromArray(uvs, indices[this.faceId * 3 + 2] * 2);
  18310. uv0 = uv0.scale(this.bu);
  18311. uv1 = uv1.scale(this.bv);
  18312. uv2 = uv2.scale(1.0 - this.bu - this.bv);
  18313. return new BABYLON.Vector2(uv0.x + uv1.x + uv2.x, uv0.y + uv1.y + uv2.y);
  18314. };
  18315. return PickingInfo;
  18316. })();
  18317. BABYLON.PickingInfo = PickingInfo;
  18318. })(BABYLON || (BABYLON = {}));
  18319. //# sourceMappingURL=babylon.pickingInfo.js.mapvar BABYLON;
  18320. (function (BABYLON) {
  18321. var FilesInput = (function () {
  18322. /// Register to core BabylonJS object: engine, scene, rendering canvas, callback function when the scene will be loaded,
  18323. /// loading progress callback and optionnal addionnal logic to call in the rendering loop
  18324. function FilesInput(p_engine, p_scene, p_canvas, p_sceneLoadedCallback, p_progressCallback, p_additionnalRenderLoopLogicCallback, p_textureLoadingCallback, p_startingProcessingFilesCallback) {
  18325. this._engine = p_engine;
  18326. this._canvas = p_canvas;
  18327. this._currentScene = p_scene;
  18328. this._sceneLoadedCallback = p_sceneLoadedCallback;
  18329. this._progressCallback = p_progressCallback;
  18330. this._additionnalRenderLoopLogicCallback = p_additionnalRenderLoopLogicCallback;
  18331. this._textureLoadingCallback = p_textureLoadingCallback;
  18332. this._startingProcessingFilesCallback = p_startingProcessingFilesCallback;
  18333. }
  18334. FilesInput.prototype.monitorElementForDragNDrop = function (p_elementToMonitor) {
  18335. var _this = this;
  18336. if (p_elementToMonitor) {
  18337. this._elementToMonitor = p_elementToMonitor;
  18338. this._elementToMonitor.addEventListener("dragenter", function (e) {
  18339. _this.drag(e);
  18340. }, false);
  18341. this._elementToMonitor.addEventListener("dragover", function (e) {
  18342. _this.drag(e);
  18343. }, false);
  18344. this._elementToMonitor.addEventListener("drop", function (e) {
  18345. _this.drop(e);
  18346. }, false);
  18347. }
  18348. };
  18349. FilesInput.prototype.renderFunction = function () {
  18350. if (this._additionnalRenderLoopLogicCallback) {
  18351. this._additionnalRenderLoopLogicCallback();
  18352. }
  18353. if (this._currentScene) {
  18354. if (this._textureLoadingCallback) {
  18355. var remaining = this._currentScene.getWaitingItemsCount();
  18356. if (remaining > 0) {
  18357. this._textureLoadingCallback(remaining);
  18358. }
  18359. }
  18360. this._currentScene.render();
  18361. }
  18362. };
  18363. FilesInput.prototype.drag = function (e) {
  18364. e.stopPropagation();
  18365. e.preventDefault();
  18366. };
  18367. FilesInput.prototype.drop = function (eventDrop) {
  18368. eventDrop.stopPropagation();
  18369. eventDrop.preventDefault();
  18370. this.loadFiles(eventDrop);
  18371. };
  18372. FilesInput.prototype.loadFiles = function (event) {
  18373. if (this._startingProcessingFilesCallback)
  18374. this._startingProcessingFilesCallback();
  18375. // Handling data transfer via drag'n'drop
  18376. if (event && event.dataTransfer && event.dataTransfer.files) {
  18377. this._filesToLoad = event.dataTransfer.files;
  18378. }
  18379. // Handling files from input files
  18380. if (event && event.target && event.target.files) {
  18381. this._filesToLoad = event.target.files;
  18382. }
  18383. if (this._filesToLoad && this._filesToLoad.length > 0) {
  18384. for (var i = 0; i < this._filesToLoad.length; i++) {
  18385. switch (this._filesToLoad[i].type) {
  18386. case "image/jpeg":
  18387. case "image/png":
  18388. case "image/bmp":
  18389. FilesInput.FilesTextures[this._filesToLoad[i].name] = this._filesToLoad[i];
  18390. break;
  18391. case "image/targa":
  18392. case "image/vnd.ms-dds":
  18393. case "audio/wav":
  18394. case "audio/x-wav":
  18395. case "audio/mp3":
  18396. case "audio/mpeg":
  18397. case "audio/mpeg3":
  18398. case "audio/x-mpeg-3":
  18399. case "audio/ogg":
  18400. FilesInput.FilesToLoad[this._filesToLoad[i].name] = this._filesToLoad[i];
  18401. break;
  18402. default:
  18403. if (this._filesToLoad[i].name.indexOf(".babylon") !== -1 && this._filesToLoad[i].name.indexOf(".manifest") === -1 && this._filesToLoad[i].name.indexOf(".incremental") === -1 && this._filesToLoad[i].name.indexOf(".babylonmeshdata") === -1 && this._filesToLoad[i].name.indexOf(".babylongeometrydata") === -1) {
  18404. this._sceneFileToLoad = this._filesToLoad[i];
  18405. }
  18406. break;
  18407. }
  18408. }
  18409. this.reload();
  18410. }
  18411. };
  18412. FilesInput.prototype.reload = function () {
  18413. var _this = this;
  18414. var that = this;
  18415. // If a ".babylon" file has been provided
  18416. if (this._sceneFileToLoad) {
  18417. if (this._currentScene) {
  18418. this._engine.stopRenderLoop();
  18419. this._currentScene.dispose();
  18420. }
  18421. BABYLON.SceneLoader.Load("file:", this._sceneFileToLoad, this._engine, function (newScene) {
  18422. that._currentScene = newScene;
  18423. // Wait for textures and shaders to be ready
  18424. that._currentScene.executeWhenReady(function () {
  18425. // Attach camera to canvas inputs
  18426. if (!that._currentScene.activeCamera || that._currentScene.lights.length === 0) {
  18427. that._currentScene.createDefaultCameraOrLight();
  18428. }
  18429. that._currentScene.activeCamera.attachControl(that._canvas);
  18430. if (that._sceneLoadedCallback) {
  18431. that._sceneLoadedCallback(_this._sceneFileToLoad, that._currentScene);
  18432. }
  18433. that._engine.runRenderLoop(function () {
  18434. that.renderFunction();
  18435. });
  18436. });
  18437. }, function (progress) {
  18438. if (_this._progressCallback) {
  18439. _this._progressCallback(progress);
  18440. }
  18441. });
  18442. }
  18443. else {
  18444. BABYLON.Tools.Error("Please provide a valid .babylon file.");
  18445. }
  18446. };
  18447. FilesInput.FilesTextures = new Array();
  18448. FilesInput.FilesToLoad = new Array();
  18449. return FilesInput;
  18450. })();
  18451. BABYLON.FilesInput = FilesInput;
  18452. })(BABYLON || (BABYLON = {}));
  18453. //# sourceMappingURL=babylon.filesInput.js.mapvar BABYLON;
  18454. (function (BABYLON) {
  18455. var OimoJSPlugin = (function () {
  18456. function OimoJSPlugin() {
  18457. this._registeredMeshes = [];
  18458. /**
  18459. * Update the body position according to the mesh position
  18460. * @param mesh
  18461. */
  18462. this.updateBodyPosition = function (mesh) {
  18463. for (var index = 0; index < this._registeredMeshes.length; index++) {
  18464. var registeredMesh = this._registeredMeshes[index];
  18465. if (registeredMesh.mesh === mesh || registeredMesh.mesh === mesh.parent) {
  18466. var body = registeredMesh.body.body;
  18467. mesh.computeWorldMatrix(true);
  18468. var center = mesh.getBoundingInfo().boundingBox.center;
  18469. body.setPosition(center.x, center.y, center.z);
  18470. body.setRotation(mesh.rotation.x, mesh.rotation.y, mesh.rotation.z);
  18471. return;
  18472. }
  18473. // Case where the parent has been updated
  18474. if (registeredMesh.mesh.parent === mesh) {
  18475. mesh.computeWorldMatrix(true);
  18476. registeredMesh.mesh.computeWorldMatrix(true);
  18477. var absolutePosition = registeredMesh.mesh.getAbsolutePosition();
  18478. var absoluteRotation = mesh.rotation;
  18479. body = registeredMesh.body.body;
  18480. body.setPosition(absolutePosition.x, absolutePosition.y, absolutePosition.z);
  18481. body.setRotation(absoluteRotation.x, absoluteRotation.y, absoluteRotation.z);
  18482. return;
  18483. }
  18484. }
  18485. };
  18486. }
  18487. OimoJSPlugin.prototype._checkWithEpsilon = function (value) {
  18488. return value < BABYLON.PhysicsEngine.Epsilon ? BABYLON.PhysicsEngine.Epsilon : value;
  18489. };
  18490. OimoJSPlugin.prototype.initialize = function (iterations) {
  18491. this._world = new OIMO.World();
  18492. this._world.clear();
  18493. };
  18494. OimoJSPlugin.prototype.setGravity = function (gravity) {
  18495. this._world.gravity = gravity;
  18496. };
  18497. OimoJSPlugin.prototype.registerMesh = function (mesh, impostor, options) {
  18498. var body = null;
  18499. this.unregisterMesh(mesh);
  18500. mesh.computeWorldMatrix(true);
  18501. var initialRotation = null;
  18502. if (mesh.rotationQuaternion) {
  18503. initialRotation = mesh.rotationQuaternion.clone();
  18504. mesh.rotationQuaternion = new BABYLON.Quaternion(0, 0, 0, 1);
  18505. mesh.computeWorldMatrix(true);
  18506. }
  18507. var bbox = mesh.getBoundingInfo().boundingBox;
  18508. // The delta between the mesh position and the mesh bounding box center
  18509. var deltaPosition = mesh.position.subtract(bbox.center);
  18510. // Transform delta position with the rotation
  18511. if (initialRotation) {
  18512. var m = new BABYLON.Matrix();
  18513. initialRotation.toRotationMatrix(m);
  18514. deltaPosition = BABYLON.Vector3.TransformCoordinates(deltaPosition, m);
  18515. }
  18516. switch (impostor) {
  18517. case BABYLON.PhysicsEngine.SphereImpostor:
  18518. var radiusX = bbox.maximumWorld.x - bbox.minimumWorld.x;
  18519. var radiusY = bbox.maximumWorld.y - bbox.minimumWorld.y;
  18520. var radiusZ = bbox.maximumWorld.z - bbox.minimumWorld.z;
  18521. var size = Math.max(this._checkWithEpsilon(radiusX), this._checkWithEpsilon(radiusY), this._checkWithEpsilon(radiusZ)) / 2;
  18522. body = new OIMO.Body({
  18523. type: 'sphere',
  18524. size: [size],
  18525. pos: [bbox.center.x, bbox.center.y, bbox.center.z],
  18526. rot: [mesh.rotation.x / OIMO.TO_RAD, mesh.rotation.y / OIMO.TO_RAD, mesh.rotation.z / OIMO.TO_RAD],
  18527. move: options.mass != 0,
  18528. config: [options.mass, options.friction, options.restitution],
  18529. world: this._world
  18530. });
  18531. break;
  18532. case BABYLON.PhysicsEngine.PlaneImpostor:
  18533. case BABYLON.PhysicsEngine.CylinderImpostor:
  18534. case BABYLON.PhysicsEngine.BoxImpostor:
  18535. var min = bbox.minimumWorld;
  18536. var max = bbox.maximumWorld;
  18537. var box = max.subtract(min);
  18538. var sizeX = this._checkWithEpsilon(box.x);
  18539. var sizeY = this._checkWithEpsilon(box.y);
  18540. var sizeZ = this._checkWithEpsilon(box.z);
  18541. body = new OIMO.Body({
  18542. type: 'box',
  18543. size: [sizeX, sizeY, sizeZ],
  18544. pos: [bbox.center.x, bbox.center.y, bbox.center.z],
  18545. rot: [mesh.rotation.x / OIMO.TO_RAD, mesh.rotation.y / OIMO.TO_RAD, mesh.rotation.z / OIMO.TO_RAD],
  18546. move: options.mass != 0,
  18547. config: [options.mass, options.friction, options.restitution],
  18548. world: this._world
  18549. });
  18550. break;
  18551. }
  18552. //If quaternion was set as the rotation of the object
  18553. if (initialRotation) {
  18554. //We have to access the rigid body's properties to set the quaternion.
  18555. //The setQuaternion function of Oimo only sets the newOrientation that is only set after an impulse is given or a collision.
  18556. body.body.orientation = new OIMO.Quat(initialRotation.w, initialRotation.x, initialRotation.y, initialRotation.z);
  18557. //update the internal rotation matrix
  18558. body.body.syncShapes();
  18559. }
  18560. this._registeredMeshes.push({
  18561. mesh: mesh,
  18562. body: body,
  18563. delta: deltaPosition
  18564. });
  18565. return body;
  18566. };
  18567. OimoJSPlugin.prototype.registerMeshesAsCompound = function (parts, options) {
  18568. var types = [], sizes = [], positions = [], rotations = [];
  18569. var initialMesh = parts[0].mesh;
  18570. for (var index = 0; index < parts.length; index++) {
  18571. var part = parts[index];
  18572. var bodyParameters = this._createBodyAsCompound(part, options, initialMesh);
  18573. types.push(bodyParameters.type);
  18574. sizes.push.apply(sizes, bodyParameters.size);
  18575. positions.push.apply(positions, bodyParameters.pos);
  18576. rotations.push.apply(rotations, bodyParameters.rot);
  18577. }
  18578. var body = new OIMO.Body({
  18579. type: types,
  18580. size: sizes,
  18581. pos: positions,
  18582. rot: rotations,
  18583. move: options.mass != 0,
  18584. config: [options.mass, options.friction, options.restitution],
  18585. world: this._world
  18586. });
  18587. this._registeredMeshes.push({
  18588. mesh: initialMesh,
  18589. body: body
  18590. });
  18591. return body;
  18592. };
  18593. OimoJSPlugin.prototype._createBodyAsCompound = function (part, options, initialMesh) {
  18594. var bodyParameters = null;
  18595. var mesh = part.mesh;
  18596. // We need the bounding box/sphere info to compute the physics body
  18597. mesh.computeWorldMatrix();
  18598. switch (part.impostor) {
  18599. case BABYLON.PhysicsEngine.SphereImpostor:
  18600. var bbox = mesh.getBoundingInfo().boundingBox;
  18601. var radiusX = bbox.maximumWorld.x - bbox.minimumWorld.x;
  18602. var radiusY = bbox.maximumWorld.y - bbox.minimumWorld.y;
  18603. var radiusZ = bbox.maximumWorld.z - bbox.minimumWorld.z;
  18604. var size = Math.max(this._checkWithEpsilon(radiusX), this._checkWithEpsilon(radiusY), this._checkWithEpsilon(radiusZ)) / 2;
  18605. bodyParameters = {
  18606. type: 'sphere',
  18607. /* bug with oimo : sphere needs 3 sizes in this case */
  18608. size: [size, -1, -1],
  18609. pos: [mesh.position.x, mesh.position.y, mesh.position.z],
  18610. rot: [mesh.rotation.x / OIMO.TO_RAD, mesh.rotation.y / OIMO.TO_RAD, mesh.rotation.z / OIMO.TO_RAD]
  18611. };
  18612. break;
  18613. case BABYLON.PhysicsEngine.PlaneImpostor:
  18614. case BABYLON.PhysicsEngine.BoxImpostor:
  18615. bbox = mesh.getBoundingInfo().boundingBox;
  18616. var min = bbox.minimumWorld;
  18617. var max = bbox.maximumWorld;
  18618. var box = max.subtract(min);
  18619. var sizeX = this._checkWithEpsilon(box.x);
  18620. var sizeY = this._checkWithEpsilon(box.y);
  18621. var sizeZ = this._checkWithEpsilon(box.z);
  18622. var relativePosition = mesh.position;
  18623. bodyParameters = {
  18624. type: 'box',
  18625. size: [sizeX, sizeY, sizeZ],
  18626. pos: [relativePosition.x, relativePosition.y, relativePosition.z],
  18627. rot: [mesh.rotation.x / OIMO.TO_RAD, mesh.rotation.y / OIMO.TO_RAD, mesh.rotation.z / OIMO.TO_RAD]
  18628. };
  18629. break;
  18630. }
  18631. return bodyParameters;
  18632. };
  18633. OimoJSPlugin.prototype.unregisterMesh = function (mesh) {
  18634. for (var index = 0; index < this._registeredMeshes.length; index++) {
  18635. var registeredMesh = this._registeredMeshes[index];
  18636. if (registeredMesh.mesh === mesh || registeredMesh.mesh === mesh.parent) {
  18637. if (registeredMesh.body) {
  18638. this._world.removeRigidBody(registeredMesh.body.body);
  18639. this._unbindBody(registeredMesh.body);
  18640. }
  18641. this._registeredMeshes.splice(index, 1);
  18642. return;
  18643. }
  18644. }
  18645. };
  18646. OimoJSPlugin.prototype._unbindBody = function (body) {
  18647. for (var index = 0; index < this._registeredMeshes.length; index++) {
  18648. var registeredMesh = this._registeredMeshes[index];
  18649. if (registeredMesh.body === body) {
  18650. registeredMesh.body = null;
  18651. }
  18652. }
  18653. };
  18654. OimoJSPlugin.prototype.applyImpulse = function (mesh, force, contactPoint) {
  18655. for (var index = 0; index < this._registeredMeshes.length; index++) {
  18656. var registeredMesh = this._registeredMeshes[index];
  18657. if (registeredMesh.mesh === mesh || registeredMesh.mesh === mesh.parent) {
  18658. // Get object mass to have a behaviour similar to cannon.js
  18659. var mass = registeredMesh.body.body.massInfo.mass;
  18660. // The force is scaled with the mass of object
  18661. registeredMesh.body.body.applyImpulse(contactPoint.scale(OIMO.INV_SCALE), force.scale(OIMO.INV_SCALE * mass));
  18662. return;
  18663. }
  18664. }
  18665. };
  18666. OimoJSPlugin.prototype.createLink = function (mesh1, mesh2, pivot1, pivot2, options) {
  18667. var body1 = null, body2 = null;
  18668. for (var index = 0; index < this._registeredMeshes.length; index++) {
  18669. var registeredMesh = this._registeredMeshes[index];
  18670. if (registeredMesh.mesh === mesh1) {
  18671. body1 = registeredMesh.body.body;
  18672. }
  18673. else if (registeredMesh.mesh === mesh2) {
  18674. body2 = registeredMesh.body.body;
  18675. }
  18676. }
  18677. if (!body1 || !body2) {
  18678. return false;
  18679. }
  18680. if (!options) {
  18681. options = {};
  18682. }
  18683. new OIMO.Link({
  18684. type: options.type,
  18685. body1: body1,
  18686. body2: body2,
  18687. min: options.min,
  18688. max: options.max,
  18689. axe1: options.axe1,
  18690. axe2: options.axe2,
  18691. pos1: [pivot1.x, pivot1.y, pivot1.z],
  18692. pos2: [pivot2.x, pivot2.y, pivot2.z],
  18693. collision: options.collision,
  18694. spring: options.spring,
  18695. world: this._world
  18696. });
  18697. return true;
  18698. };
  18699. OimoJSPlugin.prototype.dispose = function () {
  18700. this._world.clear();
  18701. while (this._registeredMeshes.length) {
  18702. this.unregisterMesh(this._registeredMeshes[0].mesh);
  18703. }
  18704. };
  18705. OimoJSPlugin.prototype.isSupported = function () {
  18706. return OIMO !== undefined;
  18707. };
  18708. OimoJSPlugin.prototype._getLastShape = function (body) {
  18709. var lastShape = body.shapes;
  18710. while (lastShape.next) {
  18711. lastShape = lastShape.next;
  18712. }
  18713. return lastShape;
  18714. };
  18715. OimoJSPlugin.prototype.runOneStep = function (time) {
  18716. this._world.step();
  18717. // Update the position of all registered meshes
  18718. var i = this._registeredMeshes.length;
  18719. var m;
  18720. while (i--) {
  18721. var body = this._registeredMeshes[i].body.body;
  18722. var mesh = this._registeredMeshes[i].mesh;
  18723. var delta = this._registeredMeshes[i].delta;
  18724. if (!body.sleeping) {
  18725. if (body.shapes.next) {
  18726. var parentShape = this._getLastShape(body);
  18727. mesh.position.x = parentShape.position.x * OIMO.WORLD_SCALE;
  18728. mesh.position.y = parentShape.position.y * OIMO.WORLD_SCALE;
  18729. mesh.position.z = parentShape.position.z * OIMO.WORLD_SCALE;
  18730. var mtx = BABYLON.Matrix.FromArray(body.getMatrix());
  18731. if (!mesh.rotationQuaternion) {
  18732. mesh.rotationQuaternion = new BABYLON.Quaternion(0, 0, 0, 1);
  18733. }
  18734. mesh.rotationQuaternion.fromRotationMatrix(mtx);
  18735. mesh.computeWorldMatrix();
  18736. }
  18737. else {
  18738. m = body.getMatrix();
  18739. mtx = BABYLON.Matrix.FromArray(m);
  18740. // Body position
  18741. var bodyX = mtx.m[12], bodyY = mtx.m[13], bodyZ = mtx.m[14];
  18742. if (!delta) {
  18743. mesh.position.x = bodyX;
  18744. mesh.position.y = bodyY;
  18745. mesh.position.z = bodyZ;
  18746. }
  18747. else {
  18748. mesh.position.x = bodyX + delta.x;
  18749. mesh.position.y = bodyY + delta.y;
  18750. mesh.position.z = bodyZ + delta.z;
  18751. }
  18752. if (!mesh.rotationQuaternion) {
  18753. mesh.rotationQuaternion = new BABYLON.Quaternion(0, 0, 0, 1);
  18754. }
  18755. BABYLON.Quaternion.FromRotationMatrixToRef(mtx, mesh.rotationQuaternion);
  18756. mesh.computeWorldMatrix();
  18757. }
  18758. }
  18759. }
  18760. };
  18761. return OimoJSPlugin;
  18762. })();
  18763. BABYLON.OimoJSPlugin = OimoJSPlugin;
  18764. })(BABYLON || (BABYLON = {}));
  18765. //# sourceMappingURL=babylon.oimoJSPlugin.js.mapvar BABYLON;
  18766. (function (BABYLON) {
  18767. var PhysicsEngine = (function () {
  18768. function PhysicsEngine(plugin) {
  18769. this._currentPlugin = plugin || new BABYLON.OimoJSPlugin();
  18770. }
  18771. PhysicsEngine.prototype._initialize = function (gravity) {
  18772. this._currentPlugin.initialize();
  18773. this._setGravity(gravity);
  18774. };
  18775. PhysicsEngine.prototype._runOneStep = function (delta) {
  18776. if (delta > 0.1) {
  18777. delta = 0.1;
  18778. }
  18779. else if (delta <= 0) {
  18780. delta = 1.0 / 60.0;
  18781. }
  18782. this._currentPlugin.runOneStep(delta);
  18783. };
  18784. PhysicsEngine.prototype._setGravity = function (gravity) {
  18785. this.gravity = gravity || new BABYLON.Vector3(0, -9.82, 0);
  18786. this._currentPlugin.setGravity(this.gravity);
  18787. };
  18788. PhysicsEngine.prototype._registerMesh = function (mesh, impostor, options) {
  18789. return this._currentPlugin.registerMesh(mesh, impostor, options);
  18790. };
  18791. PhysicsEngine.prototype._registerMeshesAsCompound = function (parts, options) {
  18792. return this._currentPlugin.registerMeshesAsCompound(parts, options);
  18793. };
  18794. PhysicsEngine.prototype._unregisterMesh = function (mesh) {
  18795. this._currentPlugin.unregisterMesh(mesh);
  18796. };
  18797. PhysicsEngine.prototype._applyImpulse = function (mesh, force, contactPoint) {
  18798. this._currentPlugin.applyImpulse(mesh, force, contactPoint);
  18799. };
  18800. PhysicsEngine.prototype._createLink = function (mesh1, mesh2, pivot1, pivot2, options) {
  18801. return this._currentPlugin.createLink(mesh1, mesh2, pivot1, pivot2, options);
  18802. };
  18803. PhysicsEngine.prototype._updateBodyPosition = function (mesh) {
  18804. this._currentPlugin.updateBodyPosition(mesh);
  18805. };
  18806. PhysicsEngine.prototype.dispose = function () {
  18807. this._currentPlugin.dispose();
  18808. };
  18809. PhysicsEngine.prototype.isSupported = function () {
  18810. return this._currentPlugin.isSupported();
  18811. };
  18812. // Statics
  18813. PhysicsEngine.NoImpostor = 0;
  18814. PhysicsEngine.SphereImpostor = 1;
  18815. PhysicsEngine.BoxImpostor = 2;
  18816. PhysicsEngine.PlaneImpostor = 3;
  18817. PhysicsEngine.MeshImpostor = 4;
  18818. PhysicsEngine.CapsuleImpostor = 5;
  18819. PhysicsEngine.ConeImpostor = 6;
  18820. PhysicsEngine.CylinderImpostor = 7;
  18821. PhysicsEngine.ConvexHullImpostor = 8;
  18822. PhysicsEngine.Epsilon = 0.001;
  18823. return PhysicsEngine;
  18824. })();
  18825. BABYLON.PhysicsEngine = PhysicsEngine;
  18826. })(BABYLON || (BABYLON = {}));
  18827. //# sourceMappingURL=babylon.physicsEngine.js.mapvar BABYLON;
  18828. (function (BABYLON) {
  18829. var serializeLight = function (light) {
  18830. var serializationObject = {};
  18831. serializationObject.name = light.name;
  18832. serializationObject.id = light.id;
  18833. serializationObject.tags = BABYLON.Tags.GetTags(light);
  18834. if (light instanceof BABYLON.PointLight) {
  18835. serializationObject.type = 0;
  18836. serializationObject.position = light.position.asArray();
  18837. }
  18838. else if (light instanceof BABYLON.DirectionalLight) {
  18839. serializationObject.type = 1;
  18840. var directionalLight = light;
  18841. serializationObject.position = directionalLight.position.asArray();
  18842. serializationObject.direction = directionalLight.direction.asArray();
  18843. }
  18844. else if (light instanceof BABYLON.SpotLight) {
  18845. serializationObject.type = 2;
  18846. var spotLight = light;
  18847. serializationObject.position = spotLight.position.asArray();
  18848. serializationObject.direction = spotLight.position.asArray();
  18849. serializationObject.angle = spotLight.angle;
  18850. serializationObject.exponent = spotLight.exponent;
  18851. }
  18852. else if (light instanceof BABYLON.HemisphericLight) {
  18853. serializationObject.type = 3;
  18854. var hemisphericLight = light;
  18855. serializationObject.direction = hemisphericLight.direction.asArray();
  18856. serializationObject.groundColor = hemisphericLight.groundColor.asArray();
  18857. }
  18858. if (light.intensity) {
  18859. serializationObject.intensity = light.intensity;
  18860. }
  18861. serializationObject.range = light.range;
  18862. serializationObject.diffuse = light.diffuse.asArray();
  18863. serializationObject.specular = light.specular.asArray();
  18864. return serializationObject;
  18865. };
  18866. var serializeFresnelParameter = function (fresnelParameter) {
  18867. var serializationObject = {};
  18868. serializationObject.isEnabled = fresnelParameter.isEnabled;
  18869. serializationObject.leftColor = fresnelParameter.leftColor;
  18870. serializationObject.rightColor = fresnelParameter.rightColor;
  18871. serializationObject.bias = fresnelParameter.bias;
  18872. serializationObject.power = fresnelParameter.power;
  18873. return serializationObject;
  18874. };
  18875. var appendAnimations = function (source, destination) {
  18876. if (source.animations) {
  18877. destination.animations = [];
  18878. for (var animationIndex = 0; animationIndex < source.animations.length; animationIndex++) {
  18879. var animation = source.animations[animationIndex];
  18880. destination.animations.push(serializeAnimation(animation));
  18881. }
  18882. }
  18883. };
  18884. var serializeCamera = function (camera) {
  18885. var serializationObject = {};
  18886. serializationObject.name = camera.name;
  18887. serializationObject.tags = BABYLON.Tags.GetTags(camera);
  18888. serializationObject.id = camera.id;
  18889. serializationObject.position = camera.position.asArray();
  18890. // Parent
  18891. if (camera.parent) {
  18892. serializationObject.parentId = camera.parent.id;
  18893. }
  18894. serializationObject.fov = camera.fov;
  18895. serializationObject.minZ = camera.minZ;
  18896. serializationObject.maxZ = camera.maxZ;
  18897. serializationObject.inertia = camera.inertia;
  18898. //setting the type
  18899. if (camera instanceof BABYLON.FreeCamera) {
  18900. serializationObject.type = "FreeCamera";
  18901. }
  18902. else if (camera instanceof BABYLON.ArcRotateCamera) {
  18903. serializationObject.type = "ArcRotateCamera";
  18904. }
  18905. else if (camera instanceof BABYLON.AnaglyphArcRotateCamera) {
  18906. serializationObject.type = "AnaglyphArcRotateCamera";
  18907. }
  18908. else if (camera instanceof BABYLON.GamepadCamera) {
  18909. serializationObject.type = "GamepadCamera";
  18910. }
  18911. else if (camera instanceof BABYLON.AnaglyphFreeCamera) {
  18912. serializationObject.type = "AnaglyphFreeCamera";
  18913. }
  18914. else if (camera instanceof BABYLON.DeviceOrientationCamera) {
  18915. serializationObject.type = "DeviceOrientationCamera";
  18916. }
  18917. else if (camera instanceof BABYLON.FollowCamera) {
  18918. serializationObject.type = "FollowCamera";
  18919. }
  18920. else if (camera instanceof BABYLON.OculusCamera) {
  18921. serializationObject.type = "OculusCamera";
  18922. }
  18923. else if (camera instanceof BABYLON.OculusGamepadCamera) {
  18924. serializationObject.type = "OculusGamepadCamera";
  18925. }
  18926. else if (camera instanceof BABYLON.TouchCamera) {
  18927. serializationObject.type = "TouchCamera";
  18928. }
  18929. else if (camera instanceof BABYLON.VirtualJoysticksCamera) {
  18930. serializationObject.type = "VirtualJoysticksCamera";
  18931. }
  18932. else if (camera instanceof BABYLON.WebVRCamera) {
  18933. serializationObject.type = "WebVRCamera";
  18934. }
  18935. else if (camera instanceof BABYLON.VRDeviceOrientationCamera) {
  18936. serializationObject.type = "VRDeviceOrientationCamera";
  18937. }
  18938. //special properties of specific cameras
  18939. if (camera instanceof BABYLON.ArcRotateCamera || camera instanceof BABYLON.AnaglyphArcRotateCamera) {
  18940. var arcCamera = camera;
  18941. serializationObject.alpha = arcCamera.alpha;
  18942. serializationObject.beta = arcCamera.beta;
  18943. serializationObject.radius = arcCamera.radius;
  18944. if (arcCamera.target && arcCamera.target.id) {
  18945. serializationObject.lockedTargetId = arcCamera.target.id;
  18946. }
  18947. }
  18948. else if (camera instanceof BABYLON.FollowCamera) {
  18949. var followCam = camera;
  18950. serializationObject.radius = followCam.radius;
  18951. serializationObject.heightOffset = followCam.heightOffset;
  18952. serializationObject.rotationOffset = followCam.rotationOffset;
  18953. }
  18954. else if (camera instanceof BABYLON.AnaglyphFreeCamera || camera instanceof BABYLON.AnaglyphArcRotateCamera) {
  18955. //eye space is a private member and can only be access like this. Without changing the implementation this is the best way to get it.
  18956. if (camera['_eyeSpace'] !== undefined) {
  18957. serializationObject.eye_space = BABYLON.Tools.ToDegrees(camera['_eyeSpace']);
  18958. }
  18959. }
  18960. //general properties that not all cameras have. The [] is due to typescript's type safety
  18961. if (camera['speed'] !== undefined) {
  18962. serializationObject.speed = camera['speed'];
  18963. }
  18964. if (camera['target'] && camera['target'] instanceof BABYLON.Vector3) {
  18965. serializationObject.target = camera['target'].asArray();
  18966. }
  18967. // Target
  18968. if (camera['rotation'] && camera['rotation'] instanceof BABYLON.Vector3) {
  18969. serializationObject.rotation = camera['rotation'].asArray();
  18970. }
  18971. // Locked target
  18972. if (camera['lockedTarget'] && camera['lockedTarget'].id) {
  18973. serializationObject.lockedTargetId = camera['lockedTarget'].id;
  18974. }
  18975. serializationObject.checkCollisions = camera['checkCollisions'] || false;
  18976. serializationObject.applyGravity = camera['applyGravity'] || false;
  18977. if (camera['ellipsoid']) {
  18978. serializationObject.ellipsoid = camera['ellipsoid'].asArray();
  18979. }
  18980. // Animations
  18981. appendAnimations(camera, serializationObject);
  18982. // Layer mask
  18983. serializationObject.layerMask = camera.layerMask;
  18984. return serializationObject;
  18985. };
  18986. var serializeAnimation = function (animation) {
  18987. var serializationObject = {};
  18988. serializationObject.name = animation.name;
  18989. serializationObject.property = animation.targetProperty;
  18990. serializationObject.framePerSecond = animation.framePerSecond;
  18991. serializationObject.dataType = animation.dataType;
  18992. serializationObject.loopBehavior = animation.loopMode;
  18993. var dataType = animation.dataType;
  18994. serializationObject.keys = [];
  18995. var keys = animation.getKeys();
  18996. for (var index = 0; index < keys.length; index++) {
  18997. var animationKey = keys[index];
  18998. var key = {};
  18999. key.frame = animationKey.frame;
  19000. switch (dataType) {
  19001. case BABYLON.Animation.ANIMATIONTYPE_FLOAT:
  19002. key.values = [animationKey.value];
  19003. break;
  19004. case BABYLON.Animation.ANIMATIONTYPE_QUATERNION:
  19005. case BABYLON.Animation.ANIMATIONTYPE_MATRIX:
  19006. case BABYLON.Animation.ANIMATIONTYPE_VECTOR3:
  19007. key.values = animationKey.value.asArray();
  19008. break;
  19009. }
  19010. serializationObject.keys.push(key);
  19011. }
  19012. return serializationObject;
  19013. };
  19014. var serializeMultiMaterial = function (material) {
  19015. var serializationObject = {};
  19016. serializationObject.name = material.name;
  19017. serializationObject.id = material.id;
  19018. serializationObject.tags = BABYLON.Tags.GetTags(material);
  19019. serializationObject.materials = [];
  19020. for (var matIndex = 0; matIndex < material.subMaterials.length; matIndex++) {
  19021. var subMat = material.subMaterials[matIndex];
  19022. if (subMat) {
  19023. serializationObject.materials.push(subMat.id);
  19024. }
  19025. else {
  19026. serializationObject.materials.push(null);
  19027. }
  19028. }
  19029. return serializationObject;
  19030. };
  19031. var serializeMaterial = function (material) {
  19032. var serializationObject = {};
  19033. serializationObject.name = material.name;
  19034. serializationObject.ambient = material.ambientColor.asArray();
  19035. serializationObject.diffuse = material.diffuseColor.asArray();
  19036. serializationObject.specular = material.specularColor.asArray();
  19037. serializationObject.specularPower = material.specularPower;
  19038. serializationObject.emissive = material.emissiveColor.asArray();
  19039. serializationObject.alpha = material.alpha;
  19040. serializationObject.id = material.id;
  19041. serializationObject.tags = BABYLON.Tags.GetTags(material);
  19042. serializationObject.backFaceCulling = material.backFaceCulling;
  19043. if (material.diffuseTexture) {
  19044. serializationObject.diffuseTexture = serializeTexture(material.diffuseTexture);
  19045. }
  19046. if (material.diffuseFresnelParameters) {
  19047. serializationObject.diffuseFresnelParameters = serializeFresnelParameter(material.diffuseFresnelParameters);
  19048. }
  19049. if (material.ambientTexture) {
  19050. serializationObject.ambientTexture = serializeTexture(material.ambientTexture);
  19051. }
  19052. if (material.opacityTexture) {
  19053. serializationObject.opacityTexture = serializeTexture(material.opacityTexture);
  19054. }
  19055. if (material.opacityFresnelParameters) {
  19056. serializationObject.opacityFresnelParameters = serializeFresnelParameter(material.opacityFresnelParameters);
  19057. }
  19058. if (material.reflectionTexture) {
  19059. serializationObject.reflectionTexture = serializeTexture(material.reflectionTexture);
  19060. }
  19061. if (material.reflectionFresnelParameters) {
  19062. serializationObject.reflectionFresnelParameters = serializeFresnelParameter(material.reflectionFresnelParameters);
  19063. }
  19064. if (material.emissiveTexture) {
  19065. serializationObject.emissiveTexture = serializeTexture(material.emissiveTexture);
  19066. }
  19067. if (material.emissiveFresnelParameters) {
  19068. serializationObject.emissiveFresnelParameters = serializeFresnelParameter(material.emissiveFresnelParameters);
  19069. }
  19070. if (material.specularTexture) {
  19071. serializationObject.specularTexture = serializeTexture(material.specularTexture);
  19072. }
  19073. if (material.bumpTexture) {
  19074. serializationObject.bumpTexture = serializeTexture(material.bumpTexture);
  19075. }
  19076. return serializationObject;
  19077. };
  19078. var serializeTexture = function (texture) {
  19079. var serializationObject = {};
  19080. if (!texture.name) {
  19081. return null;
  19082. }
  19083. if (texture instanceof BABYLON.CubeTexture) {
  19084. serializationObject.name = texture.name;
  19085. serializationObject.hasAlpha = texture.hasAlpha;
  19086. serializationObject.level = texture.level;
  19087. serializationObject.coordinatesMode = texture.coordinatesMode;
  19088. return serializationObject;
  19089. }
  19090. if (texture instanceof BABYLON.MirrorTexture) {
  19091. var mirrorTexture = texture;
  19092. serializationObject.renderTargetSize = mirrorTexture.getRenderSize();
  19093. serializationObject.renderList = [];
  19094. for (var index = 0; index < mirrorTexture.renderList.length; index++) {
  19095. serializationObject.renderList.push(mirrorTexture.renderList[index].id);
  19096. }
  19097. serializationObject.mirrorPlane = mirrorTexture.mirrorPlane.asArray();
  19098. }
  19099. else if (texture instanceof BABYLON.RenderTargetTexture) {
  19100. var renderTargetTexture = texture;
  19101. serializationObject.renderTargetSize = renderTargetTexture.getRenderSize();
  19102. serializationObject.renderList = [];
  19103. for (index = 0; index < renderTargetTexture.renderList.length; index++) {
  19104. serializationObject.renderList.push(renderTargetTexture.renderList[index].id);
  19105. }
  19106. }
  19107. var regularTexture = texture;
  19108. serializationObject.name = texture.name;
  19109. serializationObject.hasAlpha = texture.hasAlpha;
  19110. serializationObject.level = texture.level;
  19111. serializationObject.coordinatesIndex = texture.coordinatesIndex;
  19112. serializationObject.coordinatesMode = texture.coordinatesMode;
  19113. serializationObject.uOffset = regularTexture.uOffset;
  19114. serializationObject.vOffset = regularTexture.vOffset;
  19115. serializationObject.uScale = regularTexture.uScale;
  19116. serializationObject.vScale = regularTexture.vScale;
  19117. serializationObject.uAng = regularTexture.uAng;
  19118. serializationObject.vAng = regularTexture.vAng;
  19119. serializationObject.wAng = regularTexture.wAng;
  19120. serializationObject.wrapU = texture.wrapU;
  19121. serializationObject.wrapV = texture.wrapV;
  19122. // Animations
  19123. appendAnimations(texture, serializationObject);
  19124. return serializationObject;
  19125. };
  19126. var serializeSkeleton = function (skeleton) {
  19127. var serializationObject = {};
  19128. serializationObject.name = skeleton.name;
  19129. serializationObject.id = skeleton.id;
  19130. serializationObject.bones = [];
  19131. for (var index = 0; index < skeleton.bones.length; index++) {
  19132. var bone = skeleton.bones[index];
  19133. var serializedBone = {
  19134. parentBoneIndex: bone.getParent() ? skeleton.bones.indexOf(bone.getParent()) : -1,
  19135. name: bone.name,
  19136. matrix: bone.getLocalMatrix().toArray()
  19137. };
  19138. serializationObject.bones.push(serializedBone);
  19139. if (bone.animations && bone.animations.length > 0) {
  19140. serializedBone.animation = serializeAnimation(bone.animations[0]);
  19141. }
  19142. }
  19143. return serializationObject;
  19144. };
  19145. var serializeParticleSystem = function (particleSystem) {
  19146. var serializationObject = {};
  19147. serializationObject.emitterId = particleSystem.emitter.id;
  19148. serializationObject.capacity = particleSystem.getCapacity();
  19149. if (particleSystem.particleTexture) {
  19150. serializationObject.textureName = particleSystem.particleTexture.name;
  19151. }
  19152. serializationObject.minAngularSpeed = particleSystem.minAngularSpeed;
  19153. serializationObject.maxAngularSpeed = particleSystem.maxAngularSpeed;
  19154. serializationObject.minSize = particleSystem.minSize;
  19155. serializationObject.maxSize = particleSystem.maxSize;
  19156. serializationObject.minLifeTime = particleSystem.minLifeTime;
  19157. serializationObject.maxLifeTime = particleSystem.maxLifeTime;
  19158. serializationObject.emitRate = particleSystem.emitRate;
  19159. serializationObject.minEmitBox = particleSystem.minEmitBox.asArray();
  19160. serializationObject.maxEmitBox = particleSystem.maxEmitBox.asArray();
  19161. serializationObject.gravity = particleSystem.gravity.asArray();
  19162. serializationObject.direction1 = particleSystem.direction1.asArray();
  19163. serializationObject.direction2 = particleSystem.direction2.asArray();
  19164. serializationObject.color1 = particleSystem.color1.asArray();
  19165. serializationObject.color2 = particleSystem.color2.asArray();
  19166. serializationObject.colorDead = particleSystem.colorDead.asArray();
  19167. serializationObject.updateSpeed = particleSystem.updateSpeed;
  19168. serializationObject.targetStopDuration = particleSystem.targetStopDuration;
  19169. serializationObject.textureMask = particleSystem.textureMask.asArray();
  19170. serializationObject.blendMode = particleSystem.blendMode;
  19171. return serializationObject;
  19172. };
  19173. var serializeLensFlareSystem = function (lensFlareSystem) {
  19174. var serializationObject = {};
  19175. serializationObject.emitterId = lensFlareSystem.getEmitter().id;
  19176. serializationObject.borderLimit = lensFlareSystem.borderLimit;
  19177. serializationObject.flares = [];
  19178. for (var index = 0; index < lensFlareSystem.lensFlares.length; index++) {
  19179. var flare = lensFlareSystem.lensFlares[index];
  19180. serializationObject.flares.push({
  19181. size: flare.size,
  19182. position: flare.position,
  19183. color: flare.color.asArray(),
  19184. textureName: BABYLON.Tools.GetFilename(flare.texture.name)
  19185. });
  19186. }
  19187. return serializationObject;
  19188. };
  19189. var serializeShadowGenerator = function (light) {
  19190. var serializationObject = {};
  19191. var shadowGenerator = light.getShadowGenerator();
  19192. serializationObject.lightId = light.id;
  19193. serializationObject.mapSize = shadowGenerator.getShadowMap().getRenderSize();
  19194. serializationObject.useVarianceShadowMap = shadowGenerator.useVarianceShadowMap;
  19195. serializationObject.usePoissonSampling = shadowGenerator.usePoissonSampling;
  19196. serializationObject.renderList = [];
  19197. for (var meshIndex = 0; meshIndex < shadowGenerator.getShadowMap().renderList.length; meshIndex++) {
  19198. var mesh = shadowGenerator.getShadowMap().renderList[meshIndex];
  19199. serializationObject.renderList.push(mesh.id);
  19200. }
  19201. return serializationObject;
  19202. };
  19203. var serializedGeometries = [];
  19204. var serializeGeometry = function (geometry, serializationGeometries) {
  19205. if (serializedGeometries[geometry.id]) {
  19206. return;
  19207. }
  19208. if (geometry instanceof BABYLON.Geometry.Primitives.Box) {
  19209. serializationGeometries.boxes.push(serializeBox(geometry));
  19210. }
  19211. else if (geometry instanceof BABYLON.Geometry.Primitives.Sphere) {
  19212. serializationGeometries.spheres.push(serializeSphere(geometry));
  19213. }
  19214. else if (geometry instanceof BABYLON.Geometry.Primitives.Cylinder) {
  19215. serializationGeometries.cylinders.push(serializeCylinder(geometry));
  19216. }
  19217. else if (geometry instanceof BABYLON.Geometry.Primitives.Torus) {
  19218. serializationGeometries.toruses.push(serializeTorus(geometry));
  19219. }
  19220. else if (geometry instanceof BABYLON.Geometry.Primitives.Ground) {
  19221. serializationGeometries.grounds.push(serializeGround(geometry));
  19222. }
  19223. else if (geometry instanceof BABYLON.Geometry.Primitives.Plane) {
  19224. serializationGeometries.planes.push(serializePlane(geometry));
  19225. }
  19226. else if (geometry instanceof BABYLON.Geometry.Primitives.TorusKnot) {
  19227. serializationGeometries.torusKnots.push(serializeTorusKnot(geometry));
  19228. }
  19229. else if (geometry instanceof BABYLON.Geometry.Primitives._Primitive) {
  19230. throw new Error("Unknow primitive type");
  19231. }
  19232. else {
  19233. serializationGeometries.vertexData.push(serializeVertexData(geometry));
  19234. }
  19235. serializedGeometries[geometry.id] = true;
  19236. };
  19237. var serializeGeometryBase = function (geometry) {
  19238. var serializationObject = {};
  19239. serializationObject.id = geometry.id;
  19240. if (BABYLON.Tags.HasTags(geometry)) {
  19241. serializationObject.tags = BABYLON.Tags.GetTags(geometry);
  19242. }
  19243. return serializationObject;
  19244. };
  19245. var serializeVertexData = function (vertexData) {
  19246. var serializationObject = serializeGeometryBase(vertexData);
  19247. if (vertexData.isVerticesDataPresent(BABYLON.VertexBuffer.PositionKind)) {
  19248. serializationObject.positions = vertexData.getVerticesData(BABYLON.VertexBuffer.PositionKind);
  19249. }
  19250. if (vertexData.isVerticesDataPresent(BABYLON.VertexBuffer.NormalKind)) {
  19251. serializationObject.normals = vertexData.getVerticesData(BABYLON.VertexBuffer.NormalKind);
  19252. }
  19253. if (vertexData.isVerticesDataPresent(BABYLON.VertexBuffer.UVKind)) {
  19254. serializationObject.uvs = vertexData.getVerticesData(BABYLON.VertexBuffer.UVKind);
  19255. }
  19256. if (vertexData.isVerticesDataPresent(BABYLON.VertexBuffer.UV2Kind)) {
  19257. serializationObject.uvs2 = vertexData.getVerticesData(BABYLON.VertexBuffer.UV2Kind);
  19258. }
  19259. if (vertexData.isVerticesDataPresent(BABYLON.VertexBuffer.ColorKind)) {
  19260. serializationObject.colors = vertexData.getVerticesData(BABYLON.VertexBuffer.ColorKind);
  19261. }
  19262. if (vertexData.isVerticesDataPresent(BABYLON.VertexBuffer.MatricesIndicesKind)) {
  19263. serializationObject.matricesIndices = vertexData.getVerticesData(BABYLON.VertexBuffer.MatricesIndicesKind);
  19264. serializationObject.matricesIndices._isExpanded = true;
  19265. }
  19266. if (vertexData.isVerticesDataPresent(BABYLON.VertexBuffer.MatricesWeightsKind)) {
  19267. serializationObject.matricesWeights = vertexData.getVerticesData(BABYLON.VertexBuffer.MatricesWeightsKind);
  19268. }
  19269. serializationObject.indices = vertexData.getIndices();
  19270. return serializationObject;
  19271. };
  19272. var serializePrimitive = function (primitive) {
  19273. var serializationObject = serializeGeometryBase(primitive);
  19274. serializationObject.canBeRegenerated = primitive.canBeRegenerated();
  19275. return serializationObject;
  19276. };
  19277. var serializeBox = function (box) {
  19278. var serializationObject = serializePrimitive(box);
  19279. serializationObject.size = box.size;
  19280. return serializationObject;
  19281. };
  19282. var serializeSphere = function (sphere) {
  19283. var serializationObject = serializePrimitive(sphere);
  19284. serializationObject.segments = sphere.segments;
  19285. serializationObject.diameter = sphere.diameter;
  19286. return serializationObject;
  19287. };
  19288. var serializeCylinder = function (cylinder) {
  19289. var serializationObject = serializePrimitive(cylinder);
  19290. serializationObject.height = cylinder.height;
  19291. serializationObject.diameterTop = cylinder.diameterTop;
  19292. serializationObject.diameterBottom = cylinder.diameterBottom;
  19293. serializationObject.tessellation = cylinder.tessellation;
  19294. return serializationObject;
  19295. };
  19296. var serializeTorus = function (torus) {
  19297. var serializationObject = serializePrimitive(torus);
  19298. serializationObject.diameter = torus.diameter;
  19299. serializationObject.thickness = torus.thickness;
  19300. serializationObject.tessellation = torus.tessellation;
  19301. return serializationObject;
  19302. };
  19303. var serializeGround = function (ground) {
  19304. var serializationObject = serializePrimitive(ground);
  19305. serializationObject.width = ground.width;
  19306. serializationObject.height = ground.height;
  19307. serializationObject.subdivisions = ground.subdivisions;
  19308. return serializationObject;
  19309. };
  19310. var serializePlane = function (plane) {
  19311. var serializationObject = serializePrimitive(plane);
  19312. serializationObject.size = plane.size;
  19313. return serializationObject;
  19314. };
  19315. var serializeTorusKnot = function (torusKnot) {
  19316. var serializationObject = serializePrimitive(torusKnot);
  19317. serializationObject.radius = torusKnot.radius;
  19318. serializationObject.tube = torusKnot.tube;
  19319. serializationObject.radialSegments = torusKnot.radialSegments;
  19320. serializationObject.tubularSegments = torusKnot.tubularSegments;
  19321. serializationObject.p = torusKnot.p;
  19322. serializationObject.q = torusKnot.q;
  19323. return serializationObject;
  19324. };
  19325. var serializeMesh = function (mesh, serializationScene) {
  19326. var serializationObject = {};
  19327. serializationObject.name = mesh.name;
  19328. serializationObject.id = mesh.id;
  19329. if (BABYLON.Tags.HasTags(mesh)) {
  19330. serializationObject.tags = BABYLON.Tags.GetTags(mesh);
  19331. }
  19332. serializationObject.position = mesh.position.asArray();
  19333. if (mesh.rotationQuaternion) {
  19334. serializationObject.rotationQuaternion = mesh.rotationQuaternion.asArray();
  19335. }
  19336. else if (mesh.rotation) {
  19337. serializationObject.rotation = mesh.rotation.asArray();
  19338. }
  19339. serializationObject.scaling = mesh.scaling.asArray();
  19340. serializationObject.localMatrix = mesh.getPivotMatrix().asArray();
  19341. serializationObject.isEnabled = mesh.isEnabled();
  19342. serializationObject.isVisible = mesh.isVisible;
  19343. serializationObject.infiniteDistance = mesh.infiniteDistance;
  19344. serializationObject.pickable = mesh.isPickable;
  19345. serializationObject.receiveShadows = mesh.receiveShadows;
  19346. serializationObject.billboardMode = mesh.billboardMode;
  19347. serializationObject.visibility = mesh.visibility;
  19348. serializationObject.checkCollisions = mesh.checkCollisions;
  19349. // Parent
  19350. if (mesh.parent) {
  19351. serializationObject.parentId = mesh.parent.id;
  19352. }
  19353. // Geometry
  19354. var geometry = mesh._geometry;
  19355. if (geometry) {
  19356. var geometryId = geometry.id;
  19357. serializationObject.geometryId = geometryId;
  19358. if (!mesh.getScene().getGeometryByID(geometryId)) {
  19359. // geometry was in the memory but not added to the scene, nevertheless it's better to serialize too be able to reload the mesh with its geometry
  19360. serializeGeometry(geometry, serializationScene.geometries);
  19361. }
  19362. // SubMeshes
  19363. serializationObject.subMeshes = [];
  19364. for (var subIndex = 0; subIndex < mesh.subMeshes.length; subIndex++) {
  19365. var subMesh = mesh.subMeshes[subIndex];
  19366. serializationObject.subMeshes.push({
  19367. materialIndex: subMesh.materialIndex,
  19368. verticesStart: subMesh.verticesStart,
  19369. verticesCount: subMesh.verticesCount,
  19370. indexStart: subMesh.indexStart,
  19371. indexCount: subMesh.indexCount
  19372. });
  19373. }
  19374. }
  19375. // Material
  19376. if (mesh.material) {
  19377. serializationObject.materialId = mesh.material.id;
  19378. }
  19379. else {
  19380. mesh.material = null;
  19381. }
  19382. // Skeleton
  19383. if (mesh.skeleton) {
  19384. serializationObject.skeletonId = mesh.skeleton.id;
  19385. }
  19386. // Physics
  19387. if (mesh.getPhysicsImpostor() !== BABYLON.PhysicsEngine.NoImpostor) {
  19388. serializationObject.physicsMass = mesh.getPhysicsMass();
  19389. serializationObject.physicsFriction = mesh.getPhysicsFriction();
  19390. serializationObject.physicsRestitution = mesh.getPhysicsRestitution();
  19391. switch (mesh.getPhysicsImpostor()) {
  19392. case BABYLON.PhysicsEngine.BoxImpostor:
  19393. serializationObject.physicsImpostor = 1;
  19394. break;
  19395. case BABYLON.PhysicsEngine.SphereImpostor:
  19396. serializationObject.physicsImpostor = 2;
  19397. break;
  19398. }
  19399. }
  19400. // Instances
  19401. serializationObject.instances = [];
  19402. for (var index = 0; index < mesh.instances.length; index++) {
  19403. var instance = mesh.instances[index];
  19404. var serializationInstance = {
  19405. name: instance.name,
  19406. position: instance.position,
  19407. rotation: instance.rotation,
  19408. rotationQuaternion: instance.rotationQuaternion,
  19409. scaling: instance.scaling
  19410. };
  19411. serializationObject.instances.push(serializationInstance);
  19412. // Animations
  19413. appendAnimations(instance, serializationInstance);
  19414. }
  19415. // Animations
  19416. appendAnimations(mesh, serializationObject);
  19417. // Layer mask
  19418. serializationObject.layerMask = mesh.layerMask;
  19419. return serializationObject;
  19420. };
  19421. var SceneSerializer = (function () {
  19422. function SceneSerializer() {
  19423. }
  19424. SceneSerializer.Serialize = function (scene) {
  19425. var serializationObject = {};
  19426. // Scene
  19427. serializationObject.useDelayedTextureLoading = scene.useDelayedTextureLoading;
  19428. serializationObject.autoClear = scene.autoClear;
  19429. serializationObject.clearColor = scene.clearColor.asArray();
  19430. serializationObject.ambientColor = scene.ambientColor.asArray();
  19431. serializationObject.gravity = scene.gravity.asArray();
  19432. // Fog
  19433. if (scene.fogMode && scene.fogMode !== 0) {
  19434. serializationObject.fogMode = scene.fogMode;
  19435. serializationObject.fogColor = scene.fogColor.asArray();
  19436. serializationObject.fogStart = scene.fogStart;
  19437. serializationObject.fogEnd = scene.fogEnd;
  19438. serializationObject.fogDensity = scene.fogDensity;
  19439. }
  19440. // Lights
  19441. serializationObject.lights = [];
  19442. for (var index = 0; index < scene.lights.length; index++) {
  19443. var light = scene.lights[index];
  19444. serializationObject.lights.push(serializeLight(light));
  19445. }
  19446. // Cameras
  19447. serializationObject.cameras = [];
  19448. for (index = 0; index < scene.cameras.length; index++) {
  19449. var camera = scene.cameras[index];
  19450. serializationObject.cameras.push(serializeCamera(camera));
  19451. }
  19452. if (scene.activeCamera) {
  19453. serializationObject.activeCameraID = scene.activeCamera.id;
  19454. }
  19455. // Materials
  19456. serializationObject.materials = [];
  19457. serializationObject.multiMaterials = [];
  19458. for (index = 0; index < scene.materials.length; index++) {
  19459. var material = scene.materials[index];
  19460. if (material instanceof BABYLON.StandardMaterial) {
  19461. serializationObject.materials.push(serializeMaterial(material));
  19462. }
  19463. else if (material instanceof BABYLON.MultiMaterial) {
  19464. serializationObject.multiMaterials.push(serializeMultiMaterial(material));
  19465. }
  19466. }
  19467. // Skeletons
  19468. serializationObject.skeletons = [];
  19469. for (index = 0; index < scene.skeletons.length; index++) {
  19470. serializationObject.skeletons.push(serializeSkeleton(scene.skeletons[index]));
  19471. }
  19472. // Geometries
  19473. serializationObject.geometries = {};
  19474. serializationObject.geometries.boxes = [];
  19475. serializationObject.geometries.spheres = [];
  19476. serializationObject.geometries.cylinders = [];
  19477. serializationObject.geometries.toruses = [];
  19478. serializationObject.geometries.grounds = [];
  19479. serializationObject.geometries.planes = [];
  19480. serializationObject.geometries.torusKnots = [];
  19481. serializationObject.geometries.vertexData = [];
  19482. serializedGeometries = [];
  19483. var geometries = scene.getGeometries();
  19484. for (index = 0; index < geometries.length; index++) {
  19485. var geometry = geometries[index];
  19486. if (geometry.isReady()) {
  19487. serializeGeometry(geometry, serializationObject.geometries);
  19488. }
  19489. }
  19490. // Meshes
  19491. serializationObject.meshes = [];
  19492. for (index = 0; index < scene.meshes.length; index++) {
  19493. var abstractMesh = scene.meshes[index];
  19494. if (abstractMesh instanceof BABYLON.Mesh) {
  19495. var mesh = abstractMesh;
  19496. if (mesh.delayLoadState === BABYLON.Engine.DELAYLOADSTATE_LOADED || mesh.delayLoadState === BABYLON.Engine.DELAYLOADSTATE_NONE) {
  19497. serializationObject.meshes.push(serializeMesh(mesh, serializationObject));
  19498. }
  19499. }
  19500. }
  19501. // Particles Systems
  19502. serializationObject.particleSystems = [];
  19503. for (index = 0; index < scene.particleSystems.length; index++) {
  19504. serializationObject.particleSystems.push(serializeParticleSystem(scene.particleSystems[index]));
  19505. }
  19506. // Lens flares
  19507. serializationObject.lensFlareSystems = [];
  19508. for (index = 0; index < scene.lensFlareSystems.length; index++) {
  19509. serializationObject.lensFlareSystems.push(serializeLensFlareSystem(scene.lensFlareSystems[index]));
  19510. }
  19511. // Shadows
  19512. serializationObject.shadowGenerators = [];
  19513. for (index = 0; index < scene.lights.length; index++) {
  19514. light = scene.lights[index];
  19515. if (light.getShadowGenerator()) {
  19516. serializationObject.shadowGenerators.push(serializeShadowGenerator(light));
  19517. }
  19518. }
  19519. return serializationObject;
  19520. };
  19521. return SceneSerializer;
  19522. })();
  19523. BABYLON.SceneSerializer = SceneSerializer;
  19524. })(BABYLON || (BABYLON = {}));
  19525. //# sourceMappingURL=babylon.sceneSerializer.js.mapvar BABYLON;
  19526. (function (BABYLON) {
  19527. var SceneLoader = (function () {
  19528. function SceneLoader() {
  19529. }
  19530. Object.defineProperty(SceneLoader, "ForceFullSceneLoadingForIncremental", {
  19531. get: function () {
  19532. return SceneLoader._ForceFullSceneLoadingForIncremental;
  19533. },
  19534. set: function (value) {
  19535. SceneLoader._ForceFullSceneLoadingForIncremental = value;
  19536. },
  19537. enumerable: true,
  19538. configurable: true
  19539. });
  19540. Object.defineProperty(SceneLoader, "ShowLoadingScreen", {
  19541. get: function () {
  19542. return SceneLoader._ShowLoadingScreen;
  19543. },
  19544. set: function (value) {
  19545. SceneLoader._ShowLoadingScreen = value;
  19546. },
  19547. enumerable: true,
  19548. configurable: true
  19549. });
  19550. SceneLoader._getPluginForFilename = function (sceneFilename) {
  19551. var dotPosition = sceneFilename.lastIndexOf(".");
  19552. var queryStringPosition = sceneFilename.indexOf("?");
  19553. if (queryStringPosition === -1) {
  19554. queryStringPosition = sceneFilename.length;
  19555. }
  19556. var extension = sceneFilename.substring(dotPosition, queryStringPosition).toLowerCase();
  19557. for (var index = 0; index < this._registeredPlugins.length; index++) {
  19558. var plugin = this._registeredPlugins[index];
  19559. if (plugin.extensions.indexOf(extension) !== -1) {
  19560. return plugin;
  19561. }
  19562. }
  19563. return this._registeredPlugins[this._registeredPlugins.length - 1];
  19564. };
  19565. // Public functions
  19566. SceneLoader.RegisterPlugin = function (plugin) {
  19567. plugin.extensions = plugin.extensions.toLowerCase();
  19568. SceneLoader._registeredPlugins.push(plugin);
  19569. };
  19570. SceneLoader.ImportMesh = function (meshesNames, rootUrl, sceneFilename, scene, onsuccess, progressCallBack, onerror) {
  19571. if (sceneFilename.substr && sceneFilename.substr(0, 1) === "/") {
  19572. BABYLON.Tools.Error("Wrong sceneFilename parameter");
  19573. return;
  19574. }
  19575. var manifestChecked = function (success) {
  19576. scene.database = database;
  19577. var plugin = SceneLoader._getPluginForFilename(sceneFilename);
  19578. var importMeshFromData = function (data) {
  19579. var meshes = [];
  19580. var particleSystems = [];
  19581. var skeletons = [];
  19582. try {
  19583. if (!plugin.importMesh(meshesNames, scene, data, rootUrl, meshes, particleSystems, skeletons)) {
  19584. if (onerror) {
  19585. onerror(scene, 'unable to load the scene');
  19586. }
  19587. return;
  19588. }
  19589. }
  19590. catch (e) {
  19591. if (onerror) {
  19592. onerror(scene, e);
  19593. }
  19594. return;
  19595. }
  19596. if (onsuccess) {
  19597. scene.importedMeshesFiles.push(rootUrl + sceneFilename);
  19598. onsuccess(meshes, particleSystems, skeletons);
  19599. }
  19600. };
  19601. if (sceneFilename.substr && sceneFilename.substr(0, 5) === "data:") {
  19602. // Direct load
  19603. importMeshFromData(sceneFilename.substr(5));
  19604. return;
  19605. }
  19606. BABYLON.Tools.LoadFile(rootUrl + sceneFilename, function (data) {
  19607. importMeshFromData(data);
  19608. }, progressCallBack, database);
  19609. };
  19610. // Checking if a manifest file has been set for this scene and if offline mode has been requested
  19611. var database = new BABYLON.Database(rootUrl + sceneFilename, manifestChecked);
  19612. };
  19613. /**
  19614. * Load a scene
  19615. * @param rootUrl a string that defines the root url for scene and resources
  19616. * @param sceneFilename a string that defines the name of the scene file. can start with "data:" following by the stringified version of the scene
  19617. * @param engine is the instance of BABYLON.Engine to use to create the scene
  19618. */
  19619. SceneLoader.Load = function (rootUrl, sceneFilename, engine, onsuccess, progressCallBack, onerror) {
  19620. SceneLoader.Append(rootUrl, sceneFilename, new BABYLON.Scene(engine), onsuccess, progressCallBack, onerror);
  19621. };
  19622. /**
  19623. * Append a scene
  19624. * @param rootUrl a string that defines the root url for scene and resources
  19625. * @param sceneFilename a string that defines the name of the scene file. can start with "data:" following by the stringified version of the scene
  19626. * @param scene is the instance of BABYLON.Scene to append to
  19627. */
  19628. SceneLoader.Append = function (rootUrl, sceneFilename, scene, onsuccess, progressCallBack, onerror) {
  19629. if (sceneFilename.substr && sceneFilename.substr(0, 1) === "/") {
  19630. BABYLON.Tools.Error("Wrong sceneFilename parameter");
  19631. return;
  19632. }
  19633. var plugin = this._getPluginForFilename(sceneFilename.name || sceneFilename);
  19634. var database;
  19635. if (SceneLoader.ShowLoadingScreen) {
  19636. scene.getEngine().displayLoadingUI();
  19637. }
  19638. var loadSceneFromData = function (data) {
  19639. scene.database = database;
  19640. if (!plugin.load(scene, data, rootUrl)) {
  19641. if (onerror) {
  19642. onerror(scene);
  19643. }
  19644. scene.getEngine().hideLoadingUI();
  19645. return;
  19646. }
  19647. if (onsuccess) {
  19648. onsuccess(scene);
  19649. }
  19650. if (SceneLoader.ShowLoadingScreen) {
  19651. scene.executeWhenReady(function () {
  19652. scene.getEngine().hideLoadingUI();
  19653. });
  19654. }
  19655. };
  19656. var manifestChecked = function (success) {
  19657. BABYLON.Tools.LoadFile(rootUrl + sceneFilename, loadSceneFromData, progressCallBack, database);
  19658. };
  19659. if (sceneFilename.substr && sceneFilename.substr(0, 5) === "data:") {
  19660. // Direct load
  19661. loadSceneFromData(sceneFilename.substr(5));
  19662. return;
  19663. }
  19664. if (rootUrl.indexOf("file:") === -1) {
  19665. // Checking if a manifest file has been set for this scene and if offline mode has been requested
  19666. database = new BABYLON.Database(rootUrl + sceneFilename, manifestChecked);
  19667. }
  19668. else {
  19669. BABYLON.Tools.ReadFile(sceneFilename, loadSceneFromData, progressCallBack);
  19670. }
  19671. };
  19672. // Flags
  19673. SceneLoader._ForceFullSceneLoadingForIncremental = false;
  19674. SceneLoader._ShowLoadingScreen = true;
  19675. // Members
  19676. SceneLoader._registeredPlugins = new Array();
  19677. return SceneLoader;
  19678. })();
  19679. BABYLON.SceneLoader = SceneLoader;
  19680. ;
  19681. })(BABYLON || (BABYLON = {}));
  19682. //# sourceMappingURL=babylon.sceneLoader.js.mapvar BABYLON;
  19683. (function (BABYLON) {
  19684. var Internals;
  19685. (function (Internals) {
  19686. var checkColors4 = function (colors, count) {
  19687. // Check if color3 was used
  19688. if (colors.length === count * 3) {
  19689. var colors4 = [];
  19690. for (var index = 0; index < colors.length; index += 3) {
  19691. var newIndex = (index / 3) * 4;
  19692. colors4[newIndex] = colors[index];
  19693. colors4[newIndex + 1] = colors[index + 1];
  19694. colors4[newIndex + 2] = colors[index + 2];
  19695. colors4[newIndex + 3] = 1.0;
  19696. }
  19697. return colors4;
  19698. }
  19699. return colors;
  19700. };
  19701. var loadCubeTexture = function (rootUrl, parsedTexture, scene) {
  19702. var texture = new BABYLON.CubeTexture(rootUrl + parsedTexture.name, scene);
  19703. texture.name = parsedTexture.name;
  19704. texture.hasAlpha = parsedTexture.hasAlpha;
  19705. texture.level = parsedTexture.level;
  19706. texture.coordinatesMode = parsedTexture.coordinatesMode;
  19707. return texture;
  19708. };
  19709. var loadTexture = function (rootUrl, parsedTexture, scene) {
  19710. if (!parsedTexture.name && !parsedTexture.isRenderTarget) {
  19711. return null;
  19712. }
  19713. if (parsedTexture.isCube) {
  19714. return loadCubeTexture(rootUrl, parsedTexture, scene);
  19715. }
  19716. var texture;
  19717. if (parsedTexture.mirrorPlane) {
  19718. texture = new BABYLON.MirrorTexture(parsedTexture.name, parsedTexture.renderTargetSize, scene);
  19719. texture._waitingRenderList = parsedTexture.renderList;
  19720. texture.mirrorPlane = BABYLON.Plane.FromArray(parsedTexture.mirrorPlane);
  19721. }
  19722. else if (parsedTexture.isRenderTarget) {
  19723. texture = new BABYLON.RenderTargetTexture(parsedTexture.name, parsedTexture.renderTargetSize, scene);
  19724. texture._waitingRenderList = parsedTexture.renderList;
  19725. }
  19726. else {
  19727. texture = new BABYLON.Texture(rootUrl + parsedTexture.name, scene);
  19728. }
  19729. texture.name = parsedTexture.name;
  19730. texture.hasAlpha = parsedTexture.hasAlpha;
  19731. texture.getAlphaFromRGB = parsedTexture.getAlphaFromRGB;
  19732. texture.level = parsedTexture.level;
  19733. texture.coordinatesIndex = parsedTexture.coordinatesIndex;
  19734. texture.coordinatesMode = parsedTexture.coordinatesMode;
  19735. texture.uOffset = parsedTexture.uOffset;
  19736. texture.vOffset = parsedTexture.vOffset;
  19737. texture.uScale = parsedTexture.uScale;
  19738. texture.vScale = parsedTexture.vScale;
  19739. texture.uAng = parsedTexture.uAng;
  19740. texture.vAng = parsedTexture.vAng;
  19741. texture.wAng = parsedTexture.wAng;
  19742. texture.wrapU = parsedTexture.wrapU;
  19743. texture.wrapV = parsedTexture.wrapV;
  19744. // Animations
  19745. if (parsedTexture.animations) {
  19746. for (var animationIndex = 0; animationIndex < parsedTexture.animations.length; animationIndex++) {
  19747. var parsedAnimation = parsedTexture.animations[animationIndex];
  19748. texture.animations.push(parseAnimation(parsedAnimation));
  19749. }
  19750. }
  19751. return texture;
  19752. };
  19753. var parseSkeleton = function (parsedSkeleton, scene) {
  19754. var skeleton = new BABYLON.Skeleton(parsedSkeleton.name, parsedSkeleton.id, scene);
  19755. for (var index = 0; index < parsedSkeleton.bones.length; index++) {
  19756. var parsedBone = parsedSkeleton.bones[index];
  19757. var parentBone = null;
  19758. if (parsedBone.parentBoneIndex > -1) {
  19759. parentBone = skeleton.bones[parsedBone.parentBoneIndex];
  19760. }
  19761. var bone = new BABYLON.Bone(parsedBone.name, skeleton, parentBone, BABYLON.Matrix.FromArray(parsedBone.matrix));
  19762. if (parsedBone.animation) {
  19763. bone.animations.push(parseAnimation(parsedBone.animation));
  19764. }
  19765. }
  19766. return skeleton;
  19767. };
  19768. var parseFresnelParameters = function (parsedFresnelParameters) {
  19769. var fresnelParameters = new BABYLON.FresnelParameters();
  19770. fresnelParameters.isEnabled = parsedFresnelParameters.isEnabled;
  19771. fresnelParameters.leftColor = BABYLON.Color3.FromArray(parsedFresnelParameters.leftColor);
  19772. fresnelParameters.rightColor = BABYLON.Color3.FromArray(parsedFresnelParameters.rightColor);
  19773. fresnelParameters.bias = parsedFresnelParameters.bias;
  19774. fresnelParameters.power = parsedFresnelParameters.power || 1.0;
  19775. return fresnelParameters;
  19776. };
  19777. var parseMaterial = function (parsedMaterial, scene, rootUrl) {
  19778. var material;
  19779. material = new BABYLON.StandardMaterial(parsedMaterial.name, scene);
  19780. material.ambientColor = BABYLON.Color3.FromArray(parsedMaterial.ambient);
  19781. material.diffuseColor = BABYLON.Color3.FromArray(parsedMaterial.diffuse);
  19782. material.specularColor = BABYLON.Color3.FromArray(parsedMaterial.specular);
  19783. material.specularPower = parsedMaterial.specularPower;
  19784. material.emissiveColor = BABYLON.Color3.FromArray(parsedMaterial.emissive);
  19785. material.alpha = parsedMaterial.alpha;
  19786. material.id = parsedMaterial.id;
  19787. BABYLON.Tags.AddTagsTo(material, parsedMaterial.tags);
  19788. material.backFaceCulling = parsedMaterial.backFaceCulling;
  19789. material.wireframe = parsedMaterial.wireframe;
  19790. if (parsedMaterial.diffuseTexture) {
  19791. material.diffuseTexture = loadTexture(rootUrl, parsedMaterial.diffuseTexture, scene);
  19792. }
  19793. if (parsedMaterial.diffuseFresnelParameters) {
  19794. material.diffuseFresnelParameters = parseFresnelParameters(parsedMaterial.diffuseFresnelParameters);
  19795. }
  19796. if (parsedMaterial.ambientTexture) {
  19797. material.ambientTexture = loadTexture(rootUrl, parsedMaterial.ambientTexture, scene);
  19798. }
  19799. if (parsedMaterial.opacityTexture) {
  19800. material.opacityTexture = loadTexture(rootUrl, parsedMaterial.opacityTexture, scene);
  19801. }
  19802. if (parsedMaterial.opacityFresnelParameters) {
  19803. material.opacityFresnelParameters = parseFresnelParameters(parsedMaterial.opacityFresnelParameters);
  19804. }
  19805. if (parsedMaterial.reflectionTexture) {
  19806. material.reflectionTexture = loadTexture(rootUrl, parsedMaterial.reflectionTexture, scene);
  19807. }
  19808. if (parsedMaterial.reflectionFresnelParameters) {
  19809. material.reflectionFresnelParameters = parseFresnelParameters(parsedMaterial.reflectionFresnelParameters);
  19810. }
  19811. if (parsedMaterial.emissiveTexture) {
  19812. material.emissiveTexture = loadTexture(rootUrl, parsedMaterial.emissiveTexture, scene);
  19813. }
  19814. if (parsedMaterial.emissiveFresnelParameters) {
  19815. material.emissiveFresnelParameters = parseFresnelParameters(parsedMaterial.emissiveFresnelParameters);
  19816. }
  19817. if (parsedMaterial.specularTexture) {
  19818. material.specularTexture = loadTexture(rootUrl, parsedMaterial.specularTexture, scene);
  19819. }
  19820. if (parsedMaterial.bumpTexture) {
  19821. material.bumpTexture = loadTexture(rootUrl, parsedMaterial.bumpTexture, scene);
  19822. }
  19823. return material;
  19824. };
  19825. var parseMaterialById = function (id, parsedData, scene, rootUrl) {
  19826. for (var index = 0; index < parsedData.materials.length; index++) {
  19827. var parsedMaterial = parsedData.materials[index];
  19828. if (parsedMaterial.id === id) {
  19829. return parseMaterial(parsedMaterial, scene, rootUrl);
  19830. }
  19831. }
  19832. return null;
  19833. };
  19834. var parseMultiMaterial = function (parsedMultiMaterial, scene) {
  19835. var multiMaterial = new BABYLON.MultiMaterial(parsedMultiMaterial.name, scene);
  19836. multiMaterial.id = parsedMultiMaterial.id;
  19837. BABYLON.Tags.AddTagsTo(multiMaterial, parsedMultiMaterial.tags);
  19838. for (var matIndex = 0; matIndex < parsedMultiMaterial.materials.length; matIndex++) {
  19839. var subMatId = parsedMultiMaterial.materials[matIndex];
  19840. if (subMatId) {
  19841. multiMaterial.subMaterials.push(scene.getMaterialByID(subMatId));
  19842. }
  19843. else {
  19844. multiMaterial.subMaterials.push(null);
  19845. }
  19846. }
  19847. return multiMaterial;
  19848. };
  19849. var parseLensFlareSystem = function (parsedLensFlareSystem, scene, rootUrl) {
  19850. var emitter = scene.getLastEntryByID(parsedLensFlareSystem.emitterId);
  19851. var lensFlareSystem = new BABYLON.LensFlareSystem("lensFlareSystem#" + parsedLensFlareSystem.emitterId, emitter, scene);
  19852. lensFlareSystem.borderLimit = parsedLensFlareSystem.borderLimit;
  19853. for (var index = 0; index < parsedLensFlareSystem.flares.length; index++) {
  19854. var parsedFlare = parsedLensFlareSystem.flares[index];
  19855. var flare = new BABYLON.LensFlare(parsedFlare.size, parsedFlare.position, BABYLON.Color3.FromArray(parsedFlare.color), rootUrl + parsedFlare.textureName, lensFlareSystem);
  19856. }
  19857. return lensFlareSystem;
  19858. };
  19859. var parseParticleSystem = function (parsedParticleSystem, scene, rootUrl) {
  19860. var emitter = scene.getLastMeshByID(parsedParticleSystem.emitterId);
  19861. var particleSystem = new BABYLON.ParticleSystem("particles#" + emitter.name, parsedParticleSystem.capacity, scene);
  19862. if (parsedParticleSystem.textureName) {
  19863. particleSystem.particleTexture = new BABYLON.Texture(rootUrl + parsedParticleSystem.textureName, scene);
  19864. particleSystem.particleTexture.name = parsedParticleSystem.textureName;
  19865. }
  19866. particleSystem.minAngularSpeed = parsedParticleSystem.minAngularSpeed;
  19867. particleSystem.maxAngularSpeed = parsedParticleSystem.maxAngularSpeed;
  19868. particleSystem.minSize = parsedParticleSystem.minSize;
  19869. particleSystem.maxSize = parsedParticleSystem.maxSize;
  19870. particleSystem.minLifeTime = parsedParticleSystem.minLifeTime;
  19871. particleSystem.maxLifeTime = parsedParticleSystem.maxLifeTime;
  19872. particleSystem.emitter = emitter;
  19873. particleSystem.emitRate = parsedParticleSystem.emitRate;
  19874. particleSystem.minEmitBox = BABYLON.Vector3.FromArray(parsedParticleSystem.minEmitBox);
  19875. particleSystem.maxEmitBox = BABYLON.Vector3.FromArray(parsedParticleSystem.maxEmitBox);
  19876. particleSystem.gravity = BABYLON.Vector3.FromArray(parsedParticleSystem.gravity);
  19877. particleSystem.direction1 = BABYLON.Vector3.FromArray(parsedParticleSystem.direction1);
  19878. particleSystem.direction2 = BABYLON.Vector3.FromArray(parsedParticleSystem.direction2);
  19879. particleSystem.color1 = BABYLON.Color4.FromArray(parsedParticleSystem.color1);
  19880. particleSystem.color2 = BABYLON.Color4.FromArray(parsedParticleSystem.color2);
  19881. particleSystem.colorDead = BABYLON.Color4.FromArray(parsedParticleSystem.colorDead);
  19882. particleSystem.updateSpeed = parsedParticleSystem.updateSpeed;
  19883. particleSystem.targetStopDuration = parsedParticleSystem.targetStopFrame;
  19884. particleSystem.textureMask = BABYLON.Color4.FromArray(parsedParticleSystem.textureMask);
  19885. particleSystem.blendMode = parsedParticleSystem.blendMode;
  19886. particleSystem.start();
  19887. return particleSystem;
  19888. };
  19889. var parseShadowGenerator = function (parsedShadowGenerator, scene) {
  19890. var light = scene.getLightByID(parsedShadowGenerator.lightId);
  19891. var shadowGenerator = new BABYLON.ShadowGenerator(parsedShadowGenerator.mapSize, light);
  19892. for (var meshIndex = 0; meshIndex < parsedShadowGenerator.renderList.length; meshIndex++) {
  19893. var mesh = scene.getMeshByID(parsedShadowGenerator.renderList[meshIndex]);
  19894. shadowGenerator.getShadowMap().renderList.push(mesh);
  19895. }
  19896. if (parsedShadowGenerator.usePoissonSampling) {
  19897. shadowGenerator.usePoissonSampling = true;
  19898. }
  19899. else if (parsedShadowGenerator.useVarianceShadowMap) {
  19900. shadowGenerator.useVarianceShadowMap = true;
  19901. }
  19902. else if (parsedShadowGenerator.useBlurVarianceShadowMap) {
  19903. shadowGenerator.useBlurVarianceShadowMap = true;
  19904. if (parsedShadowGenerator.blurScale) {
  19905. shadowGenerator.blurScale = parsedShadowGenerator.blurScale;
  19906. }
  19907. if (parsedShadowGenerator.blurBoxOffset) {
  19908. shadowGenerator.blurBoxOffset = parsedShadowGenerator.blurBoxOffset;
  19909. }
  19910. }
  19911. if (parsedShadowGenerator.bias !== undefined) {
  19912. shadowGenerator.bias = parsedShadowGenerator.bias;
  19913. }
  19914. return shadowGenerator;
  19915. };
  19916. var parseAnimation = function (parsedAnimation) {
  19917. var animation = new BABYLON.Animation(parsedAnimation.name, parsedAnimation.property, parsedAnimation.framePerSecond, parsedAnimation.dataType, parsedAnimation.loopBehavior);
  19918. var dataType = parsedAnimation.dataType;
  19919. var keys = [];
  19920. for (var index = 0; index < parsedAnimation.keys.length; index++) {
  19921. var key = parsedAnimation.keys[index];
  19922. var data;
  19923. switch (dataType) {
  19924. case BABYLON.Animation.ANIMATIONTYPE_FLOAT:
  19925. data = key.values[0];
  19926. break;
  19927. case BABYLON.Animation.ANIMATIONTYPE_QUATERNION:
  19928. data = BABYLON.Quaternion.FromArray(key.values);
  19929. break;
  19930. case BABYLON.Animation.ANIMATIONTYPE_MATRIX:
  19931. data = BABYLON.Matrix.FromArray(key.values);
  19932. break;
  19933. case BABYLON.Animation.ANIMATIONTYPE_VECTOR3:
  19934. default:
  19935. data = BABYLON.Vector3.FromArray(key.values);
  19936. break;
  19937. }
  19938. keys.push({
  19939. frame: key.frame,
  19940. value: data
  19941. });
  19942. }
  19943. animation.setKeys(keys);
  19944. return animation;
  19945. };
  19946. var parseLight = function (parsedLight, scene) {
  19947. var light;
  19948. switch (parsedLight.type) {
  19949. case 0:
  19950. light = new BABYLON.PointLight(parsedLight.name, BABYLON.Vector3.FromArray(parsedLight.position), scene);
  19951. break;
  19952. case 1:
  19953. light = new BABYLON.DirectionalLight(parsedLight.name, BABYLON.Vector3.FromArray(parsedLight.direction), scene);
  19954. light.position = BABYLON.Vector3.FromArray(parsedLight.position);
  19955. break;
  19956. case 2:
  19957. light = new BABYLON.SpotLight(parsedLight.name, BABYLON.Vector3.FromArray(parsedLight.position), BABYLON.Vector3.FromArray(parsedLight.direction), parsedLight.angle, parsedLight.exponent, scene);
  19958. break;
  19959. case 3:
  19960. light = new BABYLON.HemisphericLight(parsedLight.name, BABYLON.Vector3.FromArray(parsedLight.direction), scene);
  19961. light.groundColor = BABYLON.Color3.FromArray(parsedLight.groundColor);
  19962. break;
  19963. }
  19964. light.id = parsedLight.id;
  19965. BABYLON.Tags.AddTagsTo(light, parsedLight.tags);
  19966. if (parsedLight.intensity !== undefined) {
  19967. light.intensity = parsedLight.intensity;
  19968. }
  19969. if (parsedLight.range) {
  19970. light.range = parsedLight.range;
  19971. }
  19972. light.diffuse = BABYLON.Color3.FromArray(parsedLight.diffuse);
  19973. light.specular = BABYLON.Color3.FromArray(parsedLight.specular);
  19974. if (parsedLight.excludedMeshesIds) {
  19975. light._excludedMeshesIds = parsedLight.excludedMeshesIds;
  19976. }
  19977. // Parent
  19978. if (parsedLight.parentId) {
  19979. light._waitingParentId = parsedLight.parentId;
  19980. }
  19981. if (parsedLight.includedOnlyMeshesIds) {
  19982. light._includedOnlyMeshesIds = parsedLight.includedOnlyMeshesIds;
  19983. }
  19984. // Animations
  19985. if (parsedLight.animations) {
  19986. for (var animationIndex = 0; animationIndex < parsedLight.animations.length; animationIndex++) {
  19987. var parsedAnimation = parsedLight.animations[animationIndex];
  19988. light.animations.push(parseAnimation(parsedAnimation));
  19989. }
  19990. }
  19991. if (parsedLight.autoAnimate) {
  19992. scene.beginAnimation(light, parsedLight.autoAnimateFrom, parsedLight.autoAnimateTo, parsedLight.autoAnimateLoop, 1.0);
  19993. }
  19994. };
  19995. var parseCamera = function (parsedCamera, scene) {
  19996. var camera;
  19997. var position = BABYLON.Vector3.FromArray(parsedCamera.position);
  19998. var lockedTargetMesh = (parsedCamera.lockedTargetId) ? scene.getLastMeshByID(parsedCamera.lockedTargetId) : null;
  19999. if (parsedCamera.type === "AnaglyphArcRotateCamera" || parsedCamera.type === "ArcRotateCamera") {
  20000. var alpha = parsedCamera.alpha;
  20001. var beta = parsedCamera.beta;
  20002. var radius = parsedCamera.radius;
  20003. if (parsedCamera.type === "AnaglyphArcRotateCamera") {
  20004. var eye_space = parsedCamera.eye_space;
  20005. camera = new BABYLON.AnaglyphArcRotateCamera(parsedCamera.name, alpha, beta, radius, lockedTargetMesh, eye_space, scene);
  20006. }
  20007. else {
  20008. camera = new BABYLON.ArcRotateCamera(parsedCamera.name, alpha, beta, radius, lockedTargetMesh, scene);
  20009. }
  20010. }
  20011. else if (parsedCamera.type === "AnaglyphFreeCamera") {
  20012. eye_space = parsedCamera.eye_space;
  20013. camera = new BABYLON.AnaglyphFreeCamera(parsedCamera.name, position, eye_space, scene);
  20014. }
  20015. else if (parsedCamera.type === "DeviceOrientationCamera") {
  20016. camera = new BABYLON.DeviceOrientationCamera(parsedCamera.name, position, scene);
  20017. }
  20018. else if (parsedCamera.type === "FollowCamera") {
  20019. camera = new BABYLON.FollowCamera(parsedCamera.name, position, scene);
  20020. camera.heightOffset = parsedCamera.heightOffset;
  20021. camera.radius = parsedCamera.radius;
  20022. camera.rotationOffset = parsedCamera.rotationOffset;
  20023. if (lockedTargetMesh)
  20024. camera.target = lockedTargetMesh;
  20025. }
  20026. else if (parsedCamera.type === "GamepadCamera") {
  20027. camera = new BABYLON.GamepadCamera(parsedCamera.name, position, scene);
  20028. }
  20029. else if (parsedCamera.type === "OculusCamera") {
  20030. camera = new BABYLON.OculusCamera(parsedCamera.name, position, scene);
  20031. }
  20032. else if (parsedCamera.type === "OculusGamepadCamera") {
  20033. camera = new BABYLON.OculusGamepadCamera(parsedCamera.name, position, scene);
  20034. }
  20035. else if (parsedCamera.type === "TouchCamera") {
  20036. camera = new BABYLON.TouchCamera(parsedCamera.name, position, scene);
  20037. }
  20038. else if (parsedCamera.type === "VirtualJoysticksCamera") {
  20039. camera = new BABYLON.VirtualJoysticksCamera(parsedCamera.name, position, scene);
  20040. }
  20041. else if (parsedCamera.type === "WebVRCamera") {
  20042. camera = new BABYLON.WebVRCamera(parsedCamera.name, position, scene);
  20043. }
  20044. else if (parsedCamera.type === "VRDeviceOrientationCamera") {
  20045. camera = new BABYLON.VRDeviceOrientationCamera(parsedCamera.name, position, scene);
  20046. }
  20047. else {
  20048. // Free Camera is the default value
  20049. camera = new BABYLON.FreeCamera(parsedCamera.name, position, scene);
  20050. }
  20051. // Test for lockedTargetMesh & FreeCamera outside of if-else-if nest, since things like GamepadCamera extend FreeCamera
  20052. if (lockedTargetMesh && camera instanceof BABYLON.FreeCamera) {
  20053. camera.lockedTarget = lockedTargetMesh;
  20054. }
  20055. camera.id = parsedCamera.id;
  20056. BABYLON.Tags.AddTagsTo(camera, parsedCamera.tags);
  20057. // Parent
  20058. if (parsedCamera.parentId) {
  20059. camera._waitingParentId = parsedCamera.parentId;
  20060. }
  20061. // Target
  20062. if (parsedCamera.target) {
  20063. if (camera.setTarget) {
  20064. camera.setTarget(BABYLON.Vector3.FromArray(parsedCamera.target));
  20065. }
  20066. else {
  20067. //For ArcRotate
  20068. camera.target = BABYLON.Vector3.FromArray(parsedCamera.target);
  20069. }
  20070. }
  20071. else {
  20072. camera.rotation = BABYLON.Vector3.FromArray(parsedCamera.rotation);
  20073. }
  20074. camera.fov = parsedCamera.fov;
  20075. camera.minZ = parsedCamera.minZ;
  20076. camera.maxZ = parsedCamera.maxZ;
  20077. camera.speed = parsedCamera.speed;
  20078. camera.inertia = parsedCamera.inertia;
  20079. camera.checkCollisions = parsedCamera.checkCollisions;
  20080. camera.applyGravity = parsedCamera.applyGravity;
  20081. if (parsedCamera.ellipsoid) {
  20082. camera.ellipsoid = BABYLON.Vector3.FromArray(parsedCamera.ellipsoid);
  20083. }
  20084. // Animations
  20085. if (parsedCamera.animations) {
  20086. for (var animationIndex = 0; animationIndex < parsedCamera.animations.length; animationIndex++) {
  20087. var parsedAnimation = parsedCamera.animations[animationIndex];
  20088. camera.animations.push(parseAnimation(parsedAnimation));
  20089. }
  20090. }
  20091. if (parsedCamera.autoAnimate) {
  20092. scene.beginAnimation(camera, parsedCamera.autoAnimateFrom, parsedCamera.autoAnimateTo, parsedCamera.autoAnimateLoop, 1.0);
  20093. }
  20094. // Layer Mask
  20095. if (parsedCamera.layerMask && (!isNaN(parsedCamera.layerMask))) {
  20096. camera.layerMask = Math.abs(parseInt(parsedCamera.layerMask));
  20097. }
  20098. else {
  20099. camera.layerMask = 0xFFFFFFFF;
  20100. }
  20101. return camera;
  20102. };
  20103. var parseGeometry = function (parsedGeometry, scene) {
  20104. var id = parsedGeometry.id;
  20105. return scene.getGeometryByID(id);
  20106. };
  20107. var parseBox = function (parsedBox, scene) {
  20108. if (parseGeometry(parsedBox, scene)) {
  20109. return null; // null since geometry could be something else than a box...
  20110. }
  20111. var box = new BABYLON.Geometry.Primitives.Box(parsedBox.id, scene, parsedBox.size, parsedBox.canBeRegenerated, null);
  20112. BABYLON.Tags.AddTagsTo(box, parsedBox.tags);
  20113. scene.pushGeometry(box, true);
  20114. return box;
  20115. };
  20116. var parseSphere = function (parsedSphere, scene) {
  20117. if (parseGeometry(parsedSphere, scene)) {
  20118. return null; // null since geometry could be something else than a sphere...
  20119. }
  20120. var sphere = new BABYLON.Geometry.Primitives.Sphere(parsedSphere.id, scene, parsedSphere.segments, parsedSphere.diameter, parsedSphere.canBeRegenerated, null);
  20121. BABYLON.Tags.AddTagsTo(sphere, parsedSphere.tags);
  20122. scene.pushGeometry(sphere, true);
  20123. return sphere;
  20124. };
  20125. var parseCylinder = function (parsedCylinder, scene) {
  20126. if (parseGeometry(parsedCylinder, scene)) {
  20127. return null; // null since geometry could be something else than a cylinder...
  20128. }
  20129. var cylinder = new BABYLON.Geometry.Primitives.Cylinder(parsedCylinder.id, scene, parsedCylinder.height, parsedCylinder.diameterTop, parsedCylinder.diameterBottom, parsedCylinder.tessellation, parsedCylinder.subdivisions, parsedCylinder.canBeRegenerated, null);
  20130. BABYLON.Tags.AddTagsTo(cylinder, parsedCylinder.tags);
  20131. scene.pushGeometry(cylinder, true);
  20132. return cylinder;
  20133. };
  20134. var parseTorus = function (parsedTorus, scene) {
  20135. if (parseGeometry(parsedTorus, scene)) {
  20136. return null; // null since geometry could be something else than a torus...
  20137. }
  20138. var torus = new BABYLON.Geometry.Primitives.Torus(parsedTorus.id, scene, parsedTorus.diameter, parsedTorus.thickness, parsedTorus.tessellation, parsedTorus.canBeRegenerated, null);
  20139. BABYLON.Tags.AddTagsTo(torus, parsedTorus.tags);
  20140. scene.pushGeometry(torus, true);
  20141. return torus;
  20142. };
  20143. var parseGround = function (parsedGround, scene) {
  20144. if (parseGeometry(parsedGround, scene)) {
  20145. return null; // null since geometry could be something else than a ground...
  20146. }
  20147. var ground = new BABYLON.Geometry.Primitives.Ground(parsedGround.id, scene, parsedGround.width, parsedGround.height, parsedGround.subdivisions, parsedGround.canBeRegenerated, null);
  20148. BABYLON.Tags.AddTagsTo(ground, parsedGround.tags);
  20149. scene.pushGeometry(ground, true);
  20150. return ground;
  20151. };
  20152. var parsePlane = function (parsedPlane, scene) {
  20153. if (parseGeometry(parsedPlane, scene)) {
  20154. return null; // null since geometry could be something else than a plane...
  20155. }
  20156. var plane = new BABYLON.Geometry.Primitives.Plane(parsedPlane.id, scene, parsedPlane.size, parsedPlane.canBeRegenerated, null);
  20157. BABYLON.Tags.AddTagsTo(plane, parsedPlane.tags);
  20158. scene.pushGeometry(plane, true);
  20159. return plane;
  20160. };
  20161. var parseTorusKnot = function (parsedTorusKnot, scene) {
  20162. if (parseGeometry(parsedTorusKnot, scene)) {
  20163. return null; // null since geometry could be something else than a torusKnot...
  20164. }
  20165. var torusKnot = new BABYLON.Geometry.Primitives.TorusKnot(parsedTorusKnot.id, scene, parsedTorusKnot.radius, parsedTorusKnot.tube, parsedTorusKnot.radialSegments, parsedTorusKnot.tubularSegments, parsedTorusKnot.p, parsedTorusKnot.q, parsedTorusKnot.canBeRegenerated, null);
  20166. BABYLON.Tags.AddTagsTo(torusKnot, parsedTorusKnot.tags);
  20167. scene.pushGeometry(torusKnot, true);
  20168. return torusKnot;
  20169. };
  20170. var parseVertexData = function (parsedVertexData, scene, rootUrl) {
  20171. if (parseGeometry(parsedVertexData, scene)) {
  20172. return null; // null since geometry could be a primitive
  20173. }
  20174. var geometry = new BABYLON.Geometry(parsedVertexData.id, scene);
  20175. BABYLON.Tags.AddTagsTo(geometry, parsedVertexData.tags);
  20176. if (parsedVertexData.delayLoadingFile) {
  20177. geometry.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_NOTLOADED;
  20178. geometry.delayLoadingFile = rootUrl + parsedVertexData.delayLoadingFile;
  20179. geometry._boundingInfo = new BABYLON.BoundingInfo(BABYLON.Vector3.FromArray(parsedVertexData.boundingBoxMinimum), BABYLON.Vector3.FromArray(parsedVertexData.boundingBoxMaximum));
  20180. geometry._delayInfo = [];
  20181. if (parsedVertexData.hasUVs) {
  20182. geometry._delayInfo.push(BABYLON.VertexBuffer.UVKind);
  20183. }
  20184. if (parsedVertexData.hasUVs2) {
  20185. geometry._delayInfo.push(BABYLON.VertexBuffer.UV2Kind);
  20186. }
  20187. if (parsedVertexData.hasColors) {
  20188. geometry._delayInfo.push(BABYLON.VertexBuffer.ColorKind);
  20189. }
  20190. if (parsedVertexData.hasMatricesIndices) {
  20191. geometry._delayInfo.push(BABYLON.VertexBuffer.MatricesIndicesKind);
  20192. }
  20193. if (parsedVertexData.hasMatricesWeights) {
  20194. geometry._delayInfo.push(BABYLON.VertexBuffer.MatricesWeightsKind);
  20195. }
  20196. geometry._delayLoadingFunction = importVertexData;
  20197. }
  20198. else {
  20199. importVertexData(parsedVertexData, geometry);
  20200. }
  20201. scene.pushGeometry(geometry, true);
  20202. return geometry;
  20203. };
  20204. var parseMesh = function (parsedMesh, scene, rootUrl) {
  20205. var mesh = new BABYLON.Mesh(parsedMesh.name, scene);
  20206. mesh.id = parsedMesh.id;
  20207. BABYLON.Tags.AddTagsTo(mesh, parsedMesh.tags);
  20208. mesh.position = BABYLON.Vector3.FromArray(parsedMesh.position);
  20209. if (parsedMesh.rotationQuaternion) {
  20210. mesh.rotationQuaternion = BABYLON.Quaternion.FromArray(parsedMesh.rotationQuaternion);
  20211. }
  20212. else if (parsedMesh.rotation) {
  20213. mesh.rotation = BABYLON.Vector3.FromArray(parsedMesh.rotation);
  20214. }
  20215. mesh.scaling = BABYLON.Vector3.FromArray(parsedMesh.scaling);
  20216. if (parsedMesh.localMatrix) {
  20217. mesh.setPivotMatrix(BABYLON.Matrix.FromArray(parsedMesh.localMatrix));
  20218. }
  20219. else if (parsedMesh.pivotMatrix) {
  20220. mesh.setPivotMatrix(BABYLON.Matrix.FromArray(parsedMesh.pivotMatrix));
  20221. }
  20222. mesh.setEnabled(parsedMesh.isEnabled);
  20223. mesh.isVisible = parsedMesh.isVisible;
  20224. mesh.infiniteDistance = parsedMesh.infiniteDistance;
  20225. mesh.showBoundingBox = parsedMesh.showBoundingBox;
  20226. mesh.showSubMeshesBoundingBox = parsedMesh.showSubMeshesBoundingBox;
  20227. if (parsedMesh.applyFog !== undefined) {
  20228. mesh.applyFog = parsedMesh.applyFog;
  20229. }
  20230. if (parsedMesh.pickable !== undefined) {
  20231. mesh.isPickable = parsedMesh.pickable;
  20232. }
  20233. if (parsedMesh.alphaIndex !== undefined) {
  20234. mesh.alphaIndex = parsedMesh.alphaIndex;
  20235. }
  20236. mesh.receiveShadows = parsedMesh.receiveShadows;
  20237. mesh.billboardMode = parsedMesh.billboardMode;
  20238. if (parsedMesh.visibility !== undefined) {
  20239. mesh.visibility = parsedMesh.visibility;
  20240. }
  20241. mesh.checkCollisions = parsedMesh.checkCollisions;
  20242. mesh._shouldGenerateFlatShading = parsedMesh.useFlatShading;
  20243. // Parent
  20244. if (parsedMesh.parentId) {
  20245. mesh._waitingParentId = parsedMesh.parentId;
  20246. }
  20247. // Actions
  20248. if (parsedMesh.actions !== undefined) {
  20249. mesh._waitingActions = parsedMesh.actions;
  20250. }
  20251. // Geometry
  20252. mesh.hasVertexAlpha = parsedMesh.hasVertexAlpha;
  20253. if (parsedMesh.delayLoadingFile) {
  20254. mesh.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_NOTLOADED;
  20255. mesh.delayLoadingFile = rootUrl + parsedMesh.delayLoadingFile;
  20256. mesh._boundingInfo = new BABYLON.BoundingInfo(BABYLON.Vector3.FromArray(parsedMesh.boundingBoxMinimum), BABYLON.Vector3.FromArray(parsedMesh.boundingBoxMaximum));
  20257. if (parsedMesh._binaryInfo) {
  20258. mesh._binaryInfo = parsedMesh._binaryInfo;
  20259. }
  20260. mesh._delayInfo = [];
  20261. if (parsedMesh.hasUVs) {
  20262. mesh._delayInfo.push(BABYLON.VertexBuffer.UVKind);
  20263. }
  20264. if (parsedMesh.hasUVs2) {
  20265. mesh._delayInfo.push(BABYLON.VertexBuffer.UV2Kind);
  20266. }
  20267. if (parsedMesh.hasColors) {
  20268. mesh._delayInfo.push(BABYLON.VertexBuffer.ColorKind);
  20269. }
  20270. if (parsedMesh.hasMatricesIndices) {
  20271. mesh._delayInfo.push(BABYLON.VertexBuffer.MatricesIndicesKind);
  20272. }
  20273. if (parsedMesh.hasMatricesWeights) {
  20274. mesh._delayInfo.push(BABYLON.VertexBuffer.MatricesWeightsKind);
  20275. }
  20276. mesh._delayLoadingFunction = importGeometry;
  20277. if (BABYLON.SceneLoader.ForceFullSceneLoadingForIncremental) {
  20278. mesh._checkDelayState();
  20279. }
  20280. }
  20281. else {
  20282. importGeometry(parsedMesh, mesh);
  20283. }
  20284. // Material
  20285. if (parsedMesh.materialId) {
  20286. mesh.setMaterialByID(parsedMesh.materialId);
  20287. }
  20288. else {
  20289. mesh.material = null;
  20290. }
  20291. // Skeleton
  20292. if (parsedMesh.skeletonId > -1) {
  20293. mesh.skeleton = scene.getLastSkeletonByID(parsedMesh.skeletonId);
  20294. }
  20295. // Physics
  20296. if (parsedMesh.physicsImpostor) {
  20297. if (!scene.isPhysicsEnabled()) {
  20298. scene.enablePhysics();
  20299. }
  20300. mesh.setPhysicsState({ impostor: parsedMesh.physicsImpostor, mass: parsedMesh.physicsMass, friction: parsedMesh.physicsFriction, restitution: parsedMesh.physicsRestitution });
  20301. }
  20302. // Animations
  20303. if (parsedMesh.animations) {
  20304. for (var animationIndex = 0; animationIndex < parsedMesh.animations.length; animationIndex++) {
  20305. var parsedAnimation = parsedMesh.animations[animationIndex];
  20306. mesh.animations.push(parseAnimation(parsedAnimation));
  20307. }
  20308. }
  20309. if (parsedMesh.autoAnimate) {
  20310. scene.beginAnimation(mesh, parsedMesh.autoAnimateFrom, parsedMesh.autoAnimateTo, parsedMesh.autoAnimateLoop, 1.0);
  20311. }
  20312. // Layer Mask
  20313. if (parsedMesh.layerMask && (!isNaN(parsedMesh.layerMask))) {
  20314. mesh.layerMask = Math.abs(parseInt(parsedMesh.layerMask));
  20315. }
  20316. else {
  20317. mesh.layerMask = 0xFFFFFFFF;
  20318. }
  20319. // Instances
  20320. if (parsedMesh.instances) {
  20321. for (var index = 0; index < parsedMesh.instances.length; index++) {
  20322. var parsedInstance = parsedMesh.instances[index];
  20323. var instance = mesh.createInstance(parsedInstance.name);
  20324. BABYLON.Tags.AddTagsTo(instance, parsedInstance.tags);
  20325. instance.position = BABYLON.Vector3.FromArray(parsedInstance.position);
  20326. if (parsedInstance.rotationQuaternion) {
  20327. instance.rotationQuaternion = BABYLON.Quaternion.FromArray(parsedInstance.rotationQuaternion);
  20328. }
  20329. else if (parsedInstance.rotation) {
  20330. instance.rotation = BABYLON.Vector3.FromArray(parsedInstance.rotation);
  20331. }
  20332. instance.scaling = BABYLON.Vector3.FromArray(parsedInstance.scaling);
  20333. instance.checkCollisions = mesh.checkCollisions;
  20334. if (parsedMesh.animations) {
  20335. for (animationIndex = 0; animationIndex < parsedMesh.animations.length; animationIndex++) {
  20336. parsedAnimation = parsedMesh.animations[animationIndex];
  20337. instance.animations.push(parseAnimation(parsedAnimation));
  20338. }
  20339. }
  20340. }
  20341. }
  20342. return mesh;
  20343. };
  20344. var parseActions = function (parsedActions, object, scene) {
  20345. var actionManager = new BABYLON.ActionManager(scene);
  20346. if (object === null)
  20347. scene.actionManager = actionManager;
  20348. else
  20349. object.actionManager = actionManager;
  20350. // instanciate a new object
  20351. var instanciate = function (name, params) {
  20352. var newInstance = Object.create(BABYLON[name].prototype);
  20353. newInstance.constructor.apply(newInstance, params);
  20354. return newInstance;
  20355. };
  20356. var parseParameter = function (name, value, target, propertyPath) {
  20357. if (propertyPath === null) {
  20358. // String, boolean or float
  20359. var floatValue = parseFloat(value);
  20360. if (value === "true" || value === "false")
  20361. return value === "true";
  20362. else
  20363. return isNaN(floatValue) ? value : floatValue;
  20364. }
  20365. var effectiveTarget = propertyPath.split(".");
  20366. var values = value.split(",");
  20367. for (var i = 0; i < effectiveTarget.length; i++) {
  20368. target = target[effectiveTarget[i]];
  20369. }
  20370. // Return appropriate value with its type
  20371. if (typeof (target) === "boolean")
  20372. return values[0] === "true";
  20373. if (typeof (target) === "string")
  20374. return values[0];
  20375. // Parameters with multiple values such as Vector3 etc.
  20376. var split = new Array();
  20377. for (var i = 0; i < values.length; i++)
  20378. split.push(parseFloat(values[i]));
  20379. if (target instanceof BABYLON.Vector3)
  20380. return BABYLON.Vector3.FromArray(split);
  20381. if (target instanceof BABYLON.Vector4)
  20382. return BABYLON.Vector4.FromArray(split);
  20383. if (target instanceof BABYLON.Color3)
  20384. return BABYLON.Color3.FromArray(split);
  20385. if (target instanceof BABYLON.Color4)
  20386. return BABYLON.Color4.FromArray(split);
  20387. return parseFloat(values[0]);
  20388. };
  20389. // traverse graph per trigger
  20390. var traverse = function (parsedAction, trigger, condition, action, combineArray) {
  20391. if (combineArray === void 0) { combineArray = null; }
  20392. if (parsedAction.detached)
  20393. return;
  20394. var parameters = new Array();
  20395. var target = null;
  20396. var propertyPath = null;
  20397. var combine = parsedAction.combine && parsedAction.combine.length > 0;
  20398. // Parameters
  20399. if (parsedAction.type === 2)
  20400. parameters.push(actionManager);
  20401. else
  20402. parameters.push(trigger);
  20403. if (combine) {
  20404. var actions = new Array();
  20405. for (var j = 0; j < parsedAction.combine.length; j++) {
  20406. traverse(parsedAction.combine[j], BABYLON.ActionManager.NothingTrigger, condition, action, actions);
  20407. }
  20408. parameters.push(actions);
  20409. }
  20410. else {
  20411. for (var i = 0; i < parsedAction.properties.length; i++) {
  20412. var value = parsedAction.properties[i].value;
  20413. var name = parsedAction.properties[i].name;
  20414. var targetType = parsedAction.properties[i].targetType;
  20415. if (name === "target")
  20416. if (targetType != null && targetType === "SceneProperties")
  20417. value = target = scene;
  20418. else
  20419. value = target = scene.getNodeByName(value);
  20420. else if (name === "parent")
  20421. value = scene.getNodeByName(value);
  20422. else if (name === "sound")
  20423. value = scene.getSoundByName(value);
  20424. else if (name !== "propertyPath") {
  20425. if (parsedAction.type === 2 && name === "operator")
  20426. value = BABYLON.ValueCondition[value];
  20427. else
  20428. value = parseParameter(name, value, target, name === "value" ? propertyPath : null);
  20429. }
  20430. else {
  20431. propertyPath = value;
  20432. }
  20433. parameters.push(value);
  20434. }
  20435. }
  20436. if (combineArray === null) {
  20437. parameters.push(condition);
  20438. }
  20439. else {
  20440. parameters.push(null);
  20441. }
  20442. // If interpolate value action
  20443. if (parsedAction.name === "InterpolateValueAction") {
  20444. var param = parameters[parameters.length - 2];
  20445. parameters[parameters.length - 1] = param;
  20446. parameters[parameters.length - 2] = condition;
  20447. }
  20448. // Action or condition(s) and not CombineAction
  20449. var newAction = instanciate(parsedAction.name, parameters);
  20450. if (combineArray === null) {
  20451. if (newAction instanceof BABYLON.Condition) {
  20452. condition = newAction;
  20453. newAction = action;
  20454. }
  20455. else {
  20456. condition = null;
  20457. if (action)
  20458. action.then(newAction);
  20459. else
  20460. actionManager.registerAction(newAction);
  20461. }
  20462. }
  20463. else {
  20464. combineArray.push(newAction);
  20465. }
  20466. for (var i = 0; i < parsedAction.children.length; i++)
  20467. traverse(parsedAction.children[i], trigger, condition, newAction, null);
  20468. };
  20469. for (var i = 0; i < parsedActions.children.length; i++) {
  20470. var triggerParams;
  20471. var trigger = parsedActions.children[i];
  20472. if (trigger.properties.length > 0) {
  20473. var param = trigger.properties[0].value;
  20474. var value = trigger.properties[0].targetType === null ? param : scene.getMeshByName(param);
  20475. triggerParams = { trigger: BABYLON.ActionManager[trigger.name], parameter: value };
  20476. }
  20477. else
  20478. triggerParams = BABYLON.ActionManager[trigger.name];
  20479. for (var j = 0; j < trigger.children.length; j++) {
  20480. if (!trigger.detached)
  20481. traverse(trigger.children[j], triggerParams, null, null);
  20482. }
  20483. }
  20484. };
  20485. var parseSound = function (parsedSound, scene, rootUrl) {
  20486. var soundName = parsedSound.name;
  20487. var soundUrl = rootUrl + soundName;
  20488. var options = {
  20489. autoplay: parsedSound.autoplay,
  20490. loop: parsedSound.loop,
  20491. volume: parsedSound.volume,
  20492. spatialSound: parsedSound.spatialSound,
  20493. maxDistance: parsedSound.maxDistance,
  20494. rolloffFactor: parsedSound.rolloffFactor,
  20495. refDistance: parsedSound.refDistance,
  20496. distanceModel: parsedSound.distanceModel,
  20497. playbackRate: parsedSound.playbackRate
  20498. };
  20499. var newSound = new BABYLON.Sound(soundName, soundUrl, scene, function () {
  20500. scene._removePendingData(newSound);
  20501. }, options);
  20502. scene._addPendingData(newSound);
  20503. if (parsedSound.position) {
  20504. var soundPosition = BABYLON.Vector3.FromArray(parsedSound.position);
  20505. newSound.setPosition(soundPosition);
  20506. }
  20507. if (parsedSound.isDirectional) {
  20508. newSound.setDirectionalCone(parsedSound.coneInnerAngle || 360, parsedSound.coneOuterAngle || 360, parsedSound.coneOuterGain || 0);
  20509. if (parsedSound.localDirectionToMesh) {
  20510. var localDirectionToMesh = BABYLON.Vector3.FromArray(parsedSound.localDirectionToMesh);
  20511. newSound.setLocalDirectionToMesh(localDirectionToMesh);
  20512. }
  20513. }
  20514. if (parsedSound.connectedMeshId) {
  20515. var connectedMesh = scene.getMeshByID(parsedSound.connectedMeshId);
  20516. if (connectedMesh) {
  20517. newSound.attachToMesh(connectedMesh);
  20518. }
  20519. }
  20520. };
  20521. var isDescendantOf = function (mesh, names, hierarchyIds) {
  20522. names = (names instanceof Array) ? names : [names];
  20523. for (var i in names) {
  20524. if (mesh.name === names[i]) {
  20525. hierarchyIds.push(mesh.id);
  20526. return true;
  20527. }
  20528. }
  20529. if (mesh.parentId && hierarchyIds.indexOf(mesh.parentId) !== -1) {
  20530. hierarchyIds.push(mesh.id);
  20531. return true;
  20532. }
  20533. return false;
  20534. };
  20535. var importVertexData = function (parsedVertexData, geometry) {
  20536. var vertexData = new BABYLON.VertexData();
  20537. // positions
  20538. var positions = parsedVertexData.positions;
  20539. if (positions) {
  20540. vertexData.set(positions, BABYLON.VertexBuffer.PositionKind);
  20541. }
  20542. // normals
  20543. var normals = parsedVertexData.normals;
  20544. if (normals) {
  20545. vertexData.set(normals, BABYLON.VertexBuffer.NormalKind);
  20546. }
  20547. // uvs
  20548. var uvs = parsedVertexData.uvs;
  20549. if (uvs) {
  20550. vertexData.set(uvs, BABYLON.VertexBuffer.UVKind);
  20551. }
  20552. // uv2s
  20553. var uv2s = parsedVertexData.uv2s;
  20554. if (uv2s) {
  20555. vertexData.set(uv2s, BABYLON.VertexBuffer.UV2Kind);
  20556. }
  20557. // colors
  20558. var colors = parsedVertexData.colors;
  20559. if (colors) {
  20560. vertexData.set(checkColors4(colors, positions.length / 3), BABYLON.VertexBuffer.ColorKind);
  20561. }
  20562. // matricesIndices
  20563. var matricesIndices = parsedVertexData.matricesIndices;
  20564. if (matricesIndices) {
  20565. vertexData.set(matricesIndices, BABYLON.VertexBuffer.MatricesIndicesKind);
  20566. }
  20567. // matricesWeights
  20568. var matricesWeights = parsedVertexData.matricesWeights;
  20569. if (matricesWeights) {
  20570. vertexData.set(matricesWeights, BABYLON.VertexBuffer.MatricesWeightsKind);
  20571. }
  20572. // indices
  20573. var indices = parsedVertexData.indices;
  20574. if (indices) {
  20575. vertexData.indices = indices;
  20576. }
  20577. geometry.setAllVerticesData(vertexData, parsedVertexData.updatable);
  20578. };
  20579. var importGeometry = function (parsedGeometry, mesh) {
  20580. var scene = mesh.getScene();
  20581. // Geometry
  20582. var geometryId = parsedGeometry.geometryId;
  20583. if (geometryId) {
  20584. var geometry = scene.getGeometryByID(geometryId);
  20585. if (geometry) {
  20586. geometry.applyToMesh(mesh);
  20587. }
  20588. }
  20589. else if (parsedGeometry instanceof ArrayBuffer) {
  20590. var binaryInfo = mesh._binaryInfo;
  20591. if (binaryInfo.positionsAttrDesc && binaryInfo.positionsAttrDesc.count > 0) {
  20592. var positionsData = new Float32Array(parsedGeometry, binaryInfo.positionsAttrDesc.offset, binaryInfo.positionsAttrDesc.count);
  20593. mesh.setVerticesData(BABYLON.VertexBuffer.PositionKind, positionsData, false);
  20594. }
  20595. if (binaryInfo.normalsAttrDesc && binaryInfo.normalsAttrDesc.count > 0) {
  20596. var normalsData = new Float32Array(parsedGeometry, binaryInfo.normalsAttrDesc.offset, binaryInfo.normalsAttrDesc.count);
  20597. mesh.setVerticesData(BABYLON.VertexBuffer.NormalKind, normalsData, false);
  20598. }
  20599. if (binaryInfo.uvsAttrDesc && binaryInfo.uvsAttrDesc.count > 0) {
  20600. var uvsData = new Float32Array(parsedGeometry, binaryInfo.uvsAttrDesc.offset, binaryInfo.uvsAttrDesc.count);
  20601. mesh.setVerticesData(BABYLON.VertexBuffer.UVKind, uvsData, false);
  20602. }
  20603. if (binaryInfo.uvs2AttrDesc && binaryInfo.uvs2AttrDesc.count > 0) {
  20604. var uvs2Data = new Float32Array(parsedGeometry, binaryInfo.uvs2AttrDesc.offset, binaryInfo.uvs2AttrDesc.count);
  20605. mesh.setVerticesData(BABYLON.VertexBuffer.UV2Kind, uvs2Data, false);
  20606. }
  20607. if (binaryInfo.colorsAttrDesc && binaryInfo.colorsAttrDesc.count > 0) {
  20608. var colorsData = new Float32Array(parsedGeometry, binaryInfo.colorsAttrDesc.offset, binaryInfo.colorsAttrDesc.count);
  20609. mesh.setVerticesData(BABYLON.VertexBuffer.ColorKind, colorsData, false);
  20610. }
  20611. if (binaryInfo.matricesIndicesAttrDesc && binaryInfo.matricesIndicesAttrDesc.count > 0) {
  20612. var matricesIndicesData = new Int32Array(parsedGeometry, binaryInfo.matricesIndicesAttrDesc.offset, binaryInfo.matricesIndicesAttrDesc.count);
  20613. mesh.setVerticesData(BABYLON.VertexBuffer.MatricesIndicesKind, matricesIndicesData, false);
  20614. }
  20615. if (binaryInfo.matricesWeightsAttrDesc && binaryInfo.matricesWeightsAttrDesc.count > 0) {
  20616. var matricesWeightsData = new Float32Array(parsedGeometry, binaryInfo.matricesWeightsAttrDesc.offset, binaryInfo.matricesWeightsAttrDesc.count);
  20617. mesh.setVerticesData(BABYLON.VertexBuffer.MatricesWeightsKind, matricesWeightsData, false);
  20618. }
  20619. if (binaryInfo.indicesAttrDesc && binaryInfo.indicesAttrDesc.count > 0) {
  20620. var indicesData = new Int32Array(parsedGeometry, binaryInfo.indicesAttrDesc.offset, binaryInfo.indicesAttrDesc.count);
  20621. mesh.setIndices(indicesData);
  20622. }
  20623. if (binaryInfo.subMeshesAttrDesc && binaryInfo.subMeshesAttrDesc.count > 0) {
  20624. var subMeshesData = new Int32Array(parsedGeometry, binaryInfo.subMeshesAttrDesc.offset, binaryInfo.subMeshesAttrDesc.count * 5);
  20625. mesh.subMeshes = [];
  20626. for (var i = 0; i < binaryInfo.subMeshesAttrDesc.count; i++) {
  20627. var materialIndex = subMeshesData[(i * 5) + 0];
  20628. var verticesStart = subMeshesData[(i * 5) + 1];
  20629. var verticesCount = subMeshesData[(i * 5) + 2];
  20630. var indexStart = subMeshesData[(i * 5) + 3];
  20631. var indexCount = subMeshesData[(i * 5) + 4];
  20632. var subMesh = new BABYLON.SubMesh(materialIndex, verticesStart, verticesCount, indexStart, indexCount, mesh);
  20633. }
  20634. }
  20635. }
  20636. else if (parsedGeometry.positions && parsedGeometry.normals && parsedGeometry.indices) {
  20637. mesh.setVerticesData(BABYLON.VertexBuffer.PositionKind, parsedGeometry.positions, false);
  20638. mesh.setVerticesData(BABYLON.VertexBuffer.NormalKind, parsedGeometry.normals, false);
  20639. if (parsedGeometry.uvs) {
  20640. mesh.setVerticesData(BABYLON.VertexBuffer.UVKind, parsedGeometry.uvs, false);
  20641. }
  20642. if (parsedGeometry.uvs2) {
  20643. mesh.setVerticesData(BABYLON.VertexBuffer.UV2Kind, parsedGeometry.uvs2, false);
  20644. }
  20645. if (parsedGeometry.colors) {
  20646. mesh.setVerticesData(BABYLON.VertexBuffer.ColorKind, checkColors4(parsedGeometry.colors, parsedGeometry.positions.length / 3), false);
  20647. }
  20648. if (parsedGeometry.matricesIndices) {
  20649. if (!parsedGeometry.matricesIndices._isExpanded) {
  20650. var floatIndices = [];
  20651. for (var i = 0; i < parsedGeometry.matricesIndices.length; i++) {
  20652. var matricesIndex = parsedGeometry.matricesIndices[i];
  20653. floatIndices.push(matricesIndex & 0x000000FF);
  20654. floatIndices.push((matricesIndex & 0x0000FF00) >> 8);
  20655. floatIndices.push((matricesIndex & 0x00FF0000) >> 16);
  20656. floatIndices.push(matricesIndex >> 24);
  20657. }
  20658. mesh.setVerticesData(BABYLON.VertexBuffer.MatricesIndicesKind, floatIndices, false);
  20659. }
  20660. else {
  20661. delete parsedGeometry.matricesIndices._isExpanded;
  20662. mesh.setVerticesData(BABYLON.VertexBuffer.MatricesIndicesKind, parsedGeometry.matricesIndices, false);
  20663. }
  20664. }
  20665. if (parsedGeometry.matricesWeights) {
  20666. mesh.setVerticesData(BABYLON.VertexBuffer.MatricesWeightsKind, parsedGeometry.matricesWeights, false);
  20667. }
  20668. mesh.setIndices(parsedGeometry.indices);
  20669. // SubMeshes
  20670. if (parsedGeometry.subMeshes) {
  20671. mesh.subMeshes = [];
  20672. for (var subIndex = 0; subIndex < parsedGeometry.subMeshes.length; subIndex++) {
  20673. var parsedSubMesh = parsedGeometry.subMeshes[subIndex];
  20674. var subMesh = new BABYLON.SubMesh(parsedSubMesh.materialIndex, parsedSubMesh.verticesStart, parsedSubMesh.verticesCount, parsedSubMesh.indexStart, parsedSubMesh.indexCount, mesh);
  20675. }
  20676. }
  20677. }
  20678. // Flat shading
  20679. if (mesh._shouldGenerateFlatShading) {
  20680. mesh.convertToFlatShadedMesh();
  20681. delete mesh._shouldGenerateFlatShading;
  20682. }
  20683. // Update
  20684. mesh.computeWorldMatrix(true);
  20685. // Octree
  20686. if (scene._selectionOctree) {
  20687. scene._selectionOctree.addMesh(mesh);
  20688. }
  20689. };
  20690. BABYLON.SceneLoader.RegisterPlugin({
  20691. extensions: ".babylon",
  20692. importMesh: function (meshesNames, scene, data, rootUrl, meshes, particleSystems, skeletons) {
  20693. var parsedData = JSON.parse(data);
  20694. var loadedSkeletonsIds = [];
  20695. var loadedMaterialsIds = [];
  20696. var hierarchyIds = [];
  20697. for (var index = 0; index < parsedData.meshes.length; index++) {
  20698. var parsedMesh = parsedData.meshes[index];
  20699. if (!meshesNames || isDescendantOf(parsedMesh, meshesNames, hierarchyIds)) {
  20700. if (meshesNames instanceof Array) {
  20701. // Remove found mesh name from list.
  20702. delete meshesNames[meshesNames.indexOf(parsedMesh.name)];
  20703. }
  20704. // Material ?
  20705. if (parsedMesh.materialId) {
  20706. var materialFound = (loadedMaterialsIds.indexOf(parsedMesh.materialId) !== -1);
  20707. if (!materialFound) {
  20708. for (var multimatIndex = 0; multimatIndex < parsedData.multiMaterials.length; multimatIndex++) {
  20709. var parsedMultiMaterial = parsedData.multiMaterials[multimatIndex];
  20710. if (parsedMultiMaterial.id == parsedMesh.materialId) {
  20711. for (var matIndex = 0; matIndex < parsedMultiMaterial.materials.length; matIndex++) {
  20712. var subMatId = parsedMultiMaterial.materials[matIndex];
  20713. loadedMaterialsIds.push(subMatId);
  20714. parseMaterialById(subMatId, parsedData, scene, rootUrl);
  20715. }
  20716. loadedMaterialsIds.push(parsedMultiMaterial.id);
  20717. parseMultiMaterial(parsedMultiMaterial, scene);
  20718. materialFound = true;
  20719. break;
  20720. }
  20721. }
  20722. }
  20723. if (!materialFound) {
  20724. loadedMaterialsIds.push(parsedMesh.materialId);
  20725. parseMaterialById(parsedMesh.materialId, parsedData, scene, rootUrl);
  20726. }
  20727. }
  20728. // Skeleton ?
  20729. if (parsedMesh.skeletonId > -1 && scene.skeletons) {
  20730. var skeletonAlreadyLoaded = (loadedSkeletonsIds.indexOf(parsedMesh.skeletonId) > -1);
  20731. if (!skeletonAlreadyLoaded) {
  20732. for (var skeletonIndex = 0; skeletonIndex < parsedData.skeletons.length; skeletonIndex++) {
  20733. var parsedSkeleton = parsedData.skeletons[skeletonIndex];
  20734. if (parsedSkeleton.id === parsedMesh.skeletonId) {
  20735. skeletons.push(parseSkeleton(parsedSkeleton, scene));
  20736. loadedSkeletonsIds.push(parsedSkeleton.id);
  20737. }
  20738. }
  20739. }
  20740. }
  20741. var mesh = parseMesh(parsedMesh, scene, rootUrl);
  20742. meshes.push(mesh);
  20743. }
  20744. }
  20745. for (index = 0; index < scene.meshes.length; index++) {
  20746. var currentMesh = scene.meshes[index];
  20747. if (currentMesh._waitingParentId) {
  20748. currentMesh.parent = scene.getLastEntryByID(currentMesh._waitingParentId);
  20749. currentMesh._waitingParentId = undefined;
  20750. }
  20751. }
  20752. // Particles
  20753. if (parsedData.particleSystems) {
  20754. for (index = 0; index < parsedData.particleSystems.length; index++) {
  20755. var parsedParticleSystem = parsedData.particleSystems[index];
  20756. if (hierarchyIds.indexOf(parsedParticleSystem.emitterId) !== -1) {
  20757. particleSystems.push(parseParticleSystem(parsedParticleSystem, scene, rootUrl));
  20758. }
  20759. }
  20760. }
  20761. return true;
  20762. },
  20763. load: function (scene, data, rootUrl) {
  20764. var parsedData = JSON.parse(data);
  20765. // Scene
  20766. scene.useDelayedTextureLoading = parsedData.useDelayedTextureLoading && !BABYLON.SceneLoader.ForceFullSceneLoadingForIncremental;
  20767. scene.autoClear = parsedData.autoClear;
  20768. scene.clearColor = BABYLON.Color3.FromArray(parsedData.clearColor);
  20769. scene.ambientColor = BABYLON.Color3.FromArray(parsedData.ambientColor);
  20770. scene.gravity = BABYLON.Vector3.FromArray(parsedData.gravity);
  20771. // Fog
  20772. if (parsedData.fogMode && parsedData.fogMode !== 0) {
  20773. scene.fogMode = parsedData.fogMode;
  20774. scene.fogColor = BABYLON.Color3.FromArray(parsedData.fogColor);
  20775. scene.fogStart = parsedData.fogStart;
  20776. scene.fogEnd = parsedData.fogEnd;
  20777. scene.fogDensity = parsedData.fogDensity;
  20778. }
  20779. for (var index = 0; index < parsedData.lights.length; index++) {
  20780. var parsedLight = parsedData.lights[index];
  20781. parseLight(parsedLight, scene);
  20782. }
  20783. // Materials
  20784. if (parsedData.materials) {
  20785. for (index = 0; index < parsedData.materials.length; index++) {
  20786. var parsedMaterial = parsedData.materials[index];
  20787. parseMaterial(parsedMaterial, scene, rootUrl);
  20788. }
  20789. }
  20790. if (parsedData.multiMaterials) {
  20791. for (index = 0; index < parsedData.multiMaterials.length; index++) {
  20792. var parsedMultiMaterial = parsedData.multiMaterials[index];
  20793. parseMultiMaterial(parsedMultiMaterial, scene);
  20794. }
  20795. }
  20796. // Skeletons
  20797. if (parsedData.skeletons) {
  20798. for (index = 0; index < parsedData.skeletons.length; index++) {
  20799. var parsedSkeleton = parsedData.skeletons[index];
  20800. parseSkeleton(parsedSkeleton, scene);
  20801. }
  20802. }
  20803. // Geometries
  20804. var geometries = parsedData.geometries;
  20805. if (geometries) {
  20806. // Boxes
  20807. var boxes = geometries.boxes;
  20808. if (boxes) {
  20809. for (index = 0; index < boxes.length; index++) {
  20810. var parsedBox = boxes[index];
  20811. parseBox(parsedBox, scene);
  20812. }
  20813. }
  20814. // Spheres
  20815. var spheres = geometries.spheres;
  20816. if (spheres) {
  20817. for (index = 0; index < spheres.length; index++) {
  20818. var parsedSphere = spheres[index];
  20819. parseSphere(parsedSphere, scene);
  20820. }
  20821. }
  20822. // Cylinders
  20823. var cylinders = geometries.cylinders;
  20824. if (cylinders) {
  20825. for (index = 0; index < cylinders.length; index++) {
  20826. var parsedCylinder = cylinders[index];
  20827. parseCylinder(parsedCylinder, scene);
  20828. }
  20829. }
  20830. // Toruses
  20831. var toruses = geometries.toruses;
  20832. if (toruses) {
  20833. for (index = 0; index < toruses.length; index++) {
  20834. var parsedTorus = toruses[index];
  20835. parseTorus(parsedTorus, scene);
  20836. }
  20837. }
  20838. // Grounds
  20839. var grounds = geometries.grounds;
  20840. if (grounds) {
  20841. for (index = 0; index < grounds.length; index++) {
  20842. var parsedGround = grounds[index];
  20843. parseGround(parsedGround, scene);
  20844. }
  20845. }
  20846. // Planes
  20847. var planes = geometries.planes;
  20848. if (planes) {
  20849. for (index = 0; index < planes.length; index++) {
  20850. var parsedPlane = planes[index];
  20851. parsePlane(parsedPlane, scene);
  20852. }
  20853. }
  20854. // TorusKnots
  20855. var torusKnots = geometries.torusKnots;
  20856. if (torusKnots) {
  20857. for (index = 0; index < torusKnots.length; index++) {
  20858. var parsedTorusKnot = torusKnots[index];
  20859. parseTorusKnot(parsedTorusKnot, scene);
  20860. }
  20861. }
  20862. // VertexData
  20863. var vertexData = geometries.vertexData;
  20864. if (vertexData) {
  20865. for (index = 0; index < vertexData.length; index++) {
  20866. var parsedVertexData = vertexData[index];
  20867. parseVertexData(parsedVertexData, scene, rootUrl);
  20868. }
  20869. }
  20870. }
  20871. for (index = 0; index < parsedData.meshes.length; index++) {
  20872. var parsedMesh = parsedData.meshes[index];
  20873. parseMesh(parsedMesh, scene, rootUrl);
  20874. }
  20875. for (index = 0; index < parsedData.cameras.length; index++) {
  20876. var parsedCamera = parsedData.cameras[index];
  20877. parseCamera(parsedCamera, scene);
  20878. }
  20879. if (parsedData.activeCameraID) {
  20880. scene.setActiveCameraByID(parsedData.activeCameraID);
  20881. }
  20882. for (index = 0; index < scene.cameras.length; index++) {
  20883. var camera = scene.cameras[index];
  20884. if (camera._waitingParentId) {
  20885. camera.parent = scene.getLastEntryByID(camera._waitingParentId);
  20886. camera._waitingParentId = undefined;
  20887. }
  20888. }
  20889. for (index = 0; index < scene.lights.length; index++) {
  20890. var light = scene.lights[index];
  20891. if (light._waitingParentId) {
  20892. light.parent = scene.getLastEntryByID(light._waitingParentId);
  20893. light._waitingParentId = undefined;
  20894. }
  20895. }
  20896. // Sounds
  20897. if (parsedData.sounds) {
  20898. for (index = 0; index < parsedData.sounds.length; index++) {
  20899. var parsedSound = parsedData.sounds[index];
  20900. if (BABYLON.Engine.audioEngine.canUseWebAudio) {
  20901. parseSound(parsedSound, scene, rootUrl);
  20902. }
  20903. else {
  20904. var emptySound = new BABYLON.Sound(parsedSound.name, null, scene);
  20905. }
  20906. }
  20907. }
  20908. for (index = 0; index < scene.meshes.length; index++) {
  20909. var mesh = scene.meshes[index];
  20910. if (mesh._waitingParentId) {
  20911. mesh.parent = scene.getLastEntryByID(mesh._waitingParentId);
  20912. mesh._waitingParentId = undefined;
  20913. }
  20914. if (mesh._waitingActions) {
  20915. parseActions(mesh._waitingActions, mesh, scene);
  20916. mesh._waitingActions = undefined;
  20917. }
  20918. }
  20919. // Particles Systems
  20920. if (parsedData.particleSystems) {
  20921. for (index = 0; index < parsedData.particleSystems.length; index++) {
  20922. var parsedParticleSystem = parsedData.particleSystems[index];
  20923. parseParticleSystem(parsedParticleSystem, scene, rootUrl);
  20924. }
  20925. }
  20926. // Lens flares
  20927. if (parsedData.lensFlareSystems) {
  20928. for (index = 0; index < parsedData.lensFlareSystems.length; index++) {
  20929. var parsedLensFlareSystem = parsedData.lensFlareSystems[index];
  20930. parseLensFlareSystem(parsedLensFlareSystem, scene, rootUrl);
  20931. }
  20932. }
  20933. // Shadows
  20934. if (parsedData.shadowGenerators) {
  20935. for (index = 0; index < parsedData.shadowGenerators.length; index++) {
  20936. var parsedShadowGenerator = parsedData.shadowGenerators[index];
  20937. parseShadowGenerator(parsedShadowGenerator, scene);
  20938. }
  20939. }
  20940. // Actions (scene)
  20941. if (parsedData.actions) {
  20942. parseActions(parsedData.actions, null, scene);
  20943. }
  20944. // Finish
  20945. return true;
  20946. }
  20947. });
  20948. })(Internals = BABYLON.Internals || (BABYLON.Internals = {}));
  20949. })(BABYLON || (BABYLON = {}));
  20950. //# sourceMappingURL=babylon.babylonFileLoader.js.mapvar BABYLON;
  20951. (function (BABYLON) {
  20952. // Unique ID when we import meshes from Babylon to CSG
  20953. var currentCSGMeshId = 0;
  20954. // # class Vertex
  20955. // Represents a vertex of a polygon. Use your own vertex class instead of this
  20956. // one to provide additional features like texture coordinates and vertex
  20957. // colors. Custom vertex classes need to provide a `pos` property and `clone()`,
  20958. // `flip()`, and `interpolate()` methods that behave analogous to the ones
  20959. // defined by `BABYLON.CSG.Vertex`. This class provides `normal` so convenience
  20960. // functions like `BABYLON.CSG.sphere()` can return a smooth vertex normal, but `normal`
  20961. // is not used anywhere else.
  20962. // Same goes for uv, it allows to keep the original vertex uv coordinates of the 2 meshes
  20963. var Vertex = (function () {
  20964. function Vertex(pos, normal, uv) {
  20965. this.pos = pos;
  20966. this.normal = normal;
  20967. this.uv = uv;
  20968. }
  20969. Vertex.prototype.clone = function () {
  20970. return new Vertex(this.pos.clone(), this.normal.clone(), this.uv.clone());
  20971. };
  20972. // Invert all orientation-specific data (e.g. vertex normal). Called when the
  20973. // orientation of a polygon is flipped.
  20974. Vertex.prototype.flip = function () {
  20975. this.normal = this.normal.scale(-1);
  20976. };
  20977. // Create a new vertex between this vertex and `other` by linearly
  20978. // interpolating all properties using a parameter of `t`. Subclasses should
  20979. // override this to interpolate additional properties.
  20980. Vertex.prototype.interpolate = function (other, t) {
  20981. return new Vertex(BABYLON.Vector3.Lerp(this.pos, other.pos, t), BABYLON.Vector3.Lerp(this.normal, other.normal, t), BABYLON.Vector2.Lerp(this.uv, other.uv, t));
  20982. };
  20983. return Vertex;
  20984. })();
  20985. // # class Plane
  20986. // Represents a plane in 3D space.
  20987. var Plane = (function () {
  20988. function Plane(normal, w) {
  20989. this.normal = normal;
  20990. this.w = w;
  20991. }
  20992. Plane.FromPoints = function (a, b, c) {
  20993. var v0 = c.subtract(a);
  20994. var v1 = b.subtract(a);
  20995. if (v0.lengthSquared() === 0 || v1.lengthSquared() === 0) {
  20996. return null;
  20997. }
  20998. var n = BABYLON.Vector3.Normalize(BABYLON.Vector3.Cross(v0, v1));
  20999. return new Plane(n, BABYLON.Vector3.Dot(n, a));
  21000. };
  21001. Plane.prototype.clone = function () {
  21002. return new Plane(this.normal.clone(), this.w);
  21003. };
  21004. Plane.prototype.flip = function () {
  21005. this.normal.scaleInPlace(-1);
  21006. this.w = -this.w;
  21007. };
  21008. // Split `polygon` by this plane if needed, then put the polygon or polygon
  21009. // fragments in the appropriate lists. Coplanar polygons go into either
  21010. // `coplanarFront` or `coplanarBack` depending on their orientation with
  21011. // respect to this plane. Polygons in front or in back of this plane go into
  21012. // either `front` or `back`.
  21013. Plane.prototype.splitPolygon = function (polygon, coplanarFront, coplanarBack, front, back) {
  21014. var COPLANAR = 0;
  21015. var FRONT = 1;
  21016. var BACK = 2;
  21017. var SPANNING = 3;
  21018. // Classify each point as well as the entire polygon into one of the above
  21019. // four classes.
  21020. var polygonType = 0;
  21021. var types = [];
  21022. for (var i = 0; i < polygon.vertices.length; i++) {
  21023. var t = BABYLON.Vector3.Dot(this.normal, polygon.vertices[i].pos) - this.w;
  21024. var type = (t < -Plane.EPSILON) ? BACK : (t > Plane.EPSILON) ? FRONT : COPLANAR;
  21025. polygonType |= type;
  21026. types.push(type);
  21027. }
  21028. switch (polygonType) {
  21029. case COPLANAR:
  21030. (BABYLON.Vector3.Dot(this.normal, polygon.plane.normal) > 0 ? coplanarFront : coplanarBack).push(polygon);
  21031. break;
  21032. case FRONT:
  21033. front.push(polygon);
  21034. break;
  21035. case BACK:
  21036. back.push(polygon);
  21037. break;
  21038. case SPANNING:
  21039. var f = [], b = [];
  21040. for (i = 0; i < polygon.vertices.length; i++) {
  21041. var j = (i + 1) % polygon.vertices.length;
  21042. var ti = types[i], tj = types[j];
  21043. var vi = polygon.vertices[i], vj = polygon.vertices[j];
  21044. if (ti != BACK)
  21045. f.push(vi);
  21046. if (ti != FRONT)
  21047. b.push(ti != BACK ? vi.clone() : vi);
  21048. if ((ti | tj) == SPANNING) {
  21049. t = (this.w - BABYLON.Vector3.Dot(this.normal, vi.pos)) / BABYLON.Vector3.Dot(this.normal, vj.pos.subtract(vi.pos));
  21050. var v = vi.interpolate(vj, t);
  21051. f.push(v);
  21052. b.push(v.clone());
  21053. }
  21054. }
  21055. if (f.length >= 3) {
  21056. var poly = new Polygon(f, polygon.shared);
  21057. if (poly.plane)
  21058. front.push(poly);
  21059. }
  21060. if (b.length >= 3) {
  21061. poly = new Polygon(b, polygon.shared);
  21062. if (poly.plane)
  21063. back.push(poly);
  21064. }
  21065. break;
  21066. }
  21067. };
  21068. // `BABYLON.CSG.Plane.EPSILON` is the tolerance used by `splitPolygon()` to decide if a
  21069. // point is on the plane.
  21070. Plane.EPSILON = 1e-5;
  21071. return Plane;
  21072. })();
  21073. // # class Polygon
  21074. // Represents a convex polygon. The vertices used to initialize a polygon must
  21075. // be coplanar and form a convex loop.
  21076. //
  21077. // Each convex polygon has a `shared` property, which is shared between all
  21078. // polygons that are clones of each other or were split from the same polygon.
  21079. // This can be used to define per-polygon properties (such as surface color).
  21080. var Polygon = (function () {
  21081. function Polygon(vertices, shared) {
  21082. this.vertices = vertices;
  21083. this.shared = shared;
  21084. this.plane = Plane.FromPoints(vertices[0].pos, vertices[1].pos, vertices[2].pos);
  21085. }
  21086. Polygon.prototype.clone = function () {
  21087. var vertices = this.vertices.map(function (v) { return v.clone(); });
  21088. return new Polygon(vertices, this.shared);
  21089. };
  21090. Polygon.prototype.flip = function () {
  21091. this.vertices.reverse().map(function (v) {
  21092. v.flip();
  21093. });
  21094. this.plane.flip();
  21095. };
  21096. return Polygon;
  21097. })();
  21098. // # class Node
  21099. // Holds a node in a BSP tree. A BSP tree is built from a collection of polygons
  21100. // by picking a polygon to split along. That polygon (and all other coplanar
  21101. // polygons) are added directly to that node and the other polygons are added to
  21102. // the front and/or back subtrees. This is not a leafy BSP tree since there is
  21103. // no distinction between internal and leaf nodes.
  21104. var Node = (function () {
  21105. function Node(polygons) {
  21106. this.plane = null;
  21107. this.front = null;
  21108. this.back = null;
  21109. this.polygons = [];
  21110. if (polygons) {
  21111. this.build(polygons);
  21112. }
  21113. }
  21114. Node.prototype.clone = function () {
  21115. var node = new Node();
  21116. node.plane = this.plane && this.plane.clone();
  21117. node.front = this.front && this.front.clone();
  21118. node.back = this.back && this.back.clone();
  21119. node.polygons = this.polygons.map(function (p) { return p.clone(); });
  21120. return node;
  21121. };
  21122. // Convert solid space to empty space and empty space to solid space.
  21123. Node.prototype.invert = function () {
  21124. for (var i = 0; i < this.polygons.length; i++) {
  21125. this.polygons[i].flip();
  21126. }
  21127. if (this.plane) {
  21128. this.plane.flip();
  21129. }
  21130. if (this.front) {
  21131. this.front.invert();
  21132. }
  21133. if (this.back) {
  21134. this.back.invert();
  21135. }
  21136. var temp = this.front;
  21137. this.front = this.back;
  21138. this.back = temp;
  21139. };
  21140. // Recursively remove all polygons in `polygons` that are inside this BSP
  21141. // tree.
  21142. Node.prototype.clipPolygons = function (polygons) {
  21143. if (!this.plane)
  21144. return polygons.slice();
  21145. var front = [], back = [];
  21146. for (var i = 0; i < polygons.length; i++) {
  21147. this.plane.splitPolygon(polygons[i], front, back, front, back);
  21148. }
  21149. if (this.front) {
  21150. front = this.front.clipPolygons(front);
  21151. }
  21152. if (this.back) {
  21153. back = this.back.clipPolygons(back);
  21154. }
  21155. else {
  21156. back = [];
  21157. }
  21158. return front.concat(back);
  21159. };
  21160. // Remove all polygons in this BSP tree that are inside the other BSP tree
  21161. // `bsp`.
  21162. Node.prototype.clipTo = function (bsp) {
  21163. this.polygons = bsp.clipPolygons(this.polygons);
  21164. if (this.front)
  21165. this.front.clipTo(bsp);
  21166. if (this.back)
  21167. this.back.clipTo(bsp);
  21168. };
  21169. // Return a list of all polygons in this BSP tree.
  21170. Node.prototype.allPolygons = function () {
  21171. var polygons = this.polygons.slice();
  21172. if (this.front)
  21173. polygons = polygons.concat(this.front.allPolygons());
  21174. if (this.back)
  21175. polygons = polygons.concat(this.back.allPolygons());
  21176. return polygons;
  21177. };
  21178. // Build a BSP tree out of `polygons`. When called on an existing tree, the
  21179. // new polygons are filtered down to the bottom of the tree and become new
  21180. // nodes there. Each set of polygons is partitioned using the first polygon
  21181. // (no heuristic is used to pick a good split).
  21182. Node.prototype.build = function (polygons) {
  21183. if (!polygons.length)
  21184. return;
  21185. if (!this.plane)
  21186. this.plane = polygons[0].plane.clone();
  21187. var front = [], back = [];
  21188. for (var i = 0; i < polygons.length; i++) {
  21189. this.plane.splitPolygon(polygons[i], this.polygons, this.polygons, front, back);
  21190. }
  21191. if (front.length) {
  21192. if (!this.front)
  21193. this.front = new Node();
  21194. this.front.build(front);
  21195. }
  21196. if (back.length) {
  21197. if (!this.back)
  21198. this.back = new Node();
  21199. this.back.build(back);
  21200. }
  21201. };
  21202. return Node;
  21203. })();
  21204. var CSG = (function () {
  21205. function CSG() {
  21206. this.polygons = new Array();
  21207. }
  21208. // Convert BABYLON.Mesh to BABYLON.CSG
  21209. CSG.FromMesh = function (mesh) {
  21210. var vertex, normal, uv, position, polygon, polygons = [], vertices;
  21211. if (mesh instanceof BABYLON.Mesh) {
  21212. mesh.computeWorldMatrix(true);
  21213. var matrix = mesh.getWorldMatrix();
  21214. var meshPosition = mesh.position.clone();
  21215. var meshRotation = mesh.rotation.clone();
  21216. var meshScaling = mesh.scaling.clone();
  21217. }
  21218. else {
  21219. throw 'BABYLON.CSG: Wrong Mesh type, must be BABYLON.Mesh';
  21220. }
  21221. var indices = mesh.getIndices(), positions = mesh.getVerticesData(BABYLON.VertexBuffer.PositionKind), normals = mesh.getVerticesData(BABYLON.VertexBuffer.NormalKind), uvs = mesh.getVerticesData(BABYLON.VertexBuffer.UVKind);
  21222. var subMeshes = mesh.subMeshes;
  21223. for (var sm = 0, sml = subMeshes.length; sm < sml; sm++) {
  21224. for (var i = subMeshes[sm].indexStart, il = subMeshes[sm].indexCount + subMeshes[sm].indexStart; i < il; i += 3) {
  21225. vertices = [];
  21226. for (var j = 0; j < 3; j++) {
  21227. var sourceNormal = new BABYLON.Vector3(normals[indices[i + j] * 3], normals[indices[i + j] * 3 + 1], normals[indices[i + j] * 3 + 2]);
  21228. uv = new BABYLON.Vector2(uvs[indices[i + j] * 2], uvs[indices[i + j] * 2 + 1]);
  21229. var sourcePosition = new BABYLON.Vector3(positions[indices[i + j] * 3], positions[indices[i + j] * 3 + 1], positions[indices[i + j] * 3 + 2]);
  21230. position = BABYLON.Vector3.TransformCoordinates(sourcePosition, matrix);
  21231. normal = BABYLON.Vector3.TransformNormal(sourceNormal, matrix);
  21232. vertex = new Vertex(position, normal, uv);
  21233. vertices.push(vertex);
  21234. }
  21235. polygon = new Polygon(vertices, { subMeshId: sm, meshId: currentCSGMeshId, materialIndex: subMeshes[sm].materialIndex });
  21236. // To handle the case of degenerated triangle
  21237. // polygon.plane == null <=> the polygon does not represent 1 single plane <=> the triangle is degenerated
  21238. if (polygon.plane)
  21239. polygons.push(polygon);
  21240. }
  21241. }
  21242. var csg = CSG.FromPolygons(polygons);
  21243. csg.matrix = matrix;
  21244. csg.position = meshPosition;
  21245. csg.rotation = meshRotation;
  21246. csg.scaling = meshScaling;
  21247. currentCSGMeshId++;
  21248. return csg;
  21249. };
  21250. // Construct a BABYLON.CSG solid from a list of `BABYLON.CSG.Polygon` instances.
  21251. CSG.FromPolygons = function (polygons) {
  21252. var csg = new BABYLON.CSG();
  21253. csg.polygons = polygons;
  21254. return csg;
  21255. };
  21256. CSG.prototype.clone = function () {
  21257. var csg = new BABYLON.CSG();
  21258. csg.polygons = this.polygons.map(function (p) { return p.clone(); });
  21259. csg.copyTransformAttributes(this);
  21260. return csg;
  21261. };
  21262. CSG.prototype.toPolygons = function () {
  21263. return this.polygons;
  21264. };
  21265. CSG.prototype.union = function (csg) {
  21266. var a = new Node(this.clone().polygons);
  21267. var b = new Node(csg.clone().polygons);
  21268. a.clipTo(b);
  21269. b.clipTo(a);
  21270. b.invert();
  21271. b.clipTo(a);
  21272. b.invert();
  21273. a.build(b.allPolygons());
  21274. return CSG.FromPolygons(a.allPolygons()).copyTransformAttributes(this);
  21275. };
  21276. CSG.prototype.unionInPlace = function (csg) {
  21277. var a = new Node(this.polygons);
  21278. var b = new Node(csg.polygons);
  21279. a.clipTo(b);
  21280. b.clipTo(a);
  21281. b.invert();
  21282. b.clipTo(a);
  21283. b.invert();
  21284. a.build(b.allPolygons());
  21285. this.polygons = a.allPolygons();
  21286. };
  21287. CSG.prototype.subtract = function (csg) {
  21288. var a = new Node(this.clone().polygons);
  21289. var b = new Node(csg.clone().polygons);
  21290. a.invert();
  21291. a.clipTo(b);
  21292. b.clipTo(a);
  21293. b.invert();
  21294. b.clipTo(a);
  21295. b.invert();
  21296. a.build(b.allPolygons());
  21297. a.invert();
  21298. return CSG.FromPolygons(a.allPolygons()).copyTransformAttributes(this);
  21299. };
  21300. CSG.prototype.subtractInPlace = function (csg) {
  21301. var a = new Node(this.polygons);
  21302. var b = new Node(csg.polygons);
  21303. a.invert();
  21304. a.clipTo(b);
  21305. b.clipTo(a);
  21306. b.invert();
  21307. b.clipTo(a);
  21308. b.invert();
  21309. a.build(b.allPolygons());
  21310. a.invert();
  21311. this.polygons = a.allPolygons();
  21312. };
  21313. CSG.prototype.intersect = function (csg) {
  21314. var a = new Node(this.clone().polygons);
  21315. var b = new Node(csg.clone().polygons);
  21316. a.invert();
  21317. b.clipTo(a);
  21318. b.invert();
  21319. a.clipTo(b);
  21320. b.clipTo(a);
  21321. a.build(b.allPolygons());
  21322. a.invert();
  21323. return CSG.FromPolygons(a.allPolygons()).copyTransformAttributes(this);
  21324. };
  21325. CSG.prototype.intersectInPlace = function (csg) {
  21326. var a = new Node(this.polygons);
  21327. var b = new Node(csg.polygons);
  21328. a.invert();
  21329. b.clipTo(a);
  21330. b.invert();
  21331. a.clipTo(b);
  21332. b.clipTo(a);
  21333. a.build(b.allPolygons());
  21334. a.invert();
  21335. this.polygons = a.allPolygons();
  21336. };
  21337. // Return a new BABYLON.CSG solid with solid and empty space switched. This solid is
  21338. // not modified.
  21339. CSG.prototype.inverse = function () {
  21340. var csg = this.clone();
  21341. csg.inverseInPlace();
  21342. return csg;
  21343. };
  21344. CSG.prototype.inverseInPlace = function () {
  21345. this.polygons.map(function (p) {
  21346. p.flip();
  21347. });
  21348. };
  21349. // This is used to keep meshes transformations so they can be restored
  21350. // when we build back a Babylon Mesh
  21351. // NB : All CSG operations are performed in world coordinates
  21352. CSG.prototype.copyTransformAttributes = function (csg) {
  21353. this.matrix = csg.matrix;
  21354. this.position = csg.position;
  21355. this.rotation = csg.rotation;
  21356. this.scaling = csg.scaling;
  21357. return this;
  21358. };
  21359. // Build Raw mesh from CSG
  21360. // Coordinates here are in world space
  21361. CSG.prototype.buildMeshGeometry = function (name, scene, keepSubMeshes) {
  21362. var matrix = this.matrix.clone();
  21363. matrix.invert();
  21364. var mesh = new BABYLON.Mesh(name, scene), vertices = [], indices = [], normals = [], uvs = [], vertex = BABYLON.Vector3.Zero(), normal = BABYLON.Vector3.Zero(), uv = BABYLON.Vector2.Zero(), polygons = this.polygons, polygonIndices = [0, 0, 0], polygon, vertice_dict = {}, vertex_idx, currentIndex = 0, subMesh_dict = {}, subMesh_obj;
  21365. if (keepSubMeshes) {
  21366. // Sort Polygons, since subMeshes are indices range
  21367. polygons.sort(function (a, b) {
  21368. if (a.shared.meshId === b.shared.meshId) {
  21369. return a.shared.subMeshId - b.shared.subMeshId;
  21370. }
  21371. else {
  21372. return a.shared.meshId - b.shared.meshId;
  21373. }
  21374. });
  21375. }
  21376. for (var i = 0, il = polygons.length; i < il; i++) {
  21377. polygon = polygons[i];
  21378. // Building SubMeshes
  21379. if (!subMesh_dict[polygon.shared.meshId]) {
  21380. subMesh_dict[polygon.shared.meshId] = {};
  21381. }
  21382. if (!subMesh_dict[polygon.shared.meshId][polygon.shared.subMeshId]) {
  21383. subMesh_dict[polygon.shared.meshId][polygon.shared.subMeshId] = {
  21384. indexStart: +Infinity,
  21385. indexEnd: -Infinity,
  21386. materialIndex: polygon.shared.materialIndex
  21387. };
  21388. }
  21389. subMesh_obj = subMesh_dict[polygon.shared.meshId][polygon.shared.subMeshId];
  21390. for (var j = 2, jl = polygon.vertices.length; j < jl; j++) {
  21391. polygonIndices[0] = 0;
  21392. polygonIndices[1] = j - 1;
  21393. polygonIndices[2] = j;
  21394. for (var k = 0; k < 3; k++) {
  21395. vertex.copyFrom(polygon.vertices[polygonIndices[k]].pos);
  21396. normal.copyFrom(polygon.vertices[polygonIndices[k]].normal);
  21397. uv.copyFrom(polygon.vertices[polygonIndices[k]].uv);
  21398. var localVertex = BABYLON.Vector3.TransformCoordinates(vertex, matrix);
  21399. var localNormal = BABYLON.Vector3.TransformNormal(normal, matrix);
  21400. vertex_idx = vertice_dict[localVertex.x + ',' + localVertex.y + ',' + localVertex.z];
  21401. // Check if 2 points can be merged
  21402. if (!(typeof vertex_idx !== 'undefined' && normals[vertex_idx * 3] === localNormal.x && normals[vertex_idx * 3 + 1] === localNormal.y && normals[vertex_idx * 3 + 2] === localNormal.z && uvs[vertex_idx * 2] === uv.x && uvs[vertex_idx * 2 + 1] === uv.y)) {
  21403. vertices.push(localVertex.x, localVertex.y, localVertex.z);
  21404. uvs.push(uv.x, uv.y);
  21405. normals.push(normal.x, normal.y, normal.z);
  21406. vertex_idx = vertice_dict[localVertex.x + ',' + localVertex.y + ',' + localVertex.z] = (vertices.length / 3) - 1;
  21407. }
  21408. indices.push(vertex_idx);
  21409. subMesh_obj.indexStart = Math.min(currentIndex, subMesh_obj.indexStart);
  21410. subMesh_obj.indexEnd = Math.max(currentIndex, subMesh_obj.indexEnd);
  21411. currentIndex++;
  21412. }
  21413. }
  21414. }
  21415. mesh.setVerticesData(BABYLON.VertexBuffer.PositionKind, vertices);
  21416. mesh.setVerticesData(BABYLON.VertexBuffer.NormalKind, normals);
  21417. mesh.setVerticesData(BABYLON.VertexBuffer.UVKind, uvs);
  21418. mesh.setIndices(indices);
  21419. if (keepSubMeshes) {
  21420. // We offset the materialIndex by the previous number of materials in the CSG mixed meshes
  21421. var materialIndexOffset = 0, materialMaxIndex;
  21422. mesh.subMeshes.length = 0;
  21423. for (var m in subMesh_dict) {
  21424. materialMaxIndex = -1;
  21425. for (var sm in subMesh_dict[m]) {
  21426. subMesh_obj = subMesh_dict[m][sm];
  21427. BABYLON.SubMesh.CreateFromIndices(subMesh_obj.materialIndex + materialIndexOffset, subMesh_obj.indexStart, subMesh_obj.indexEnd - subMesh_obj.indexStart + 1, mesh);
  21428. materialMaxIndex = Math.max(subMesh_obj.materialIndex, materialMaxIndex);
  21429. }
  21430. materialIndexOffset += ++materialMaxIndex;
  21431. }
  21432. }
  21433. return mesh;
  21434. };
  21435. // Build Mesh from CSG taking material and transforms into account
  21436. CSG.prototype.toMesh = function (name, material, scene, keepSubMeshes) {
  21437. var mesh = this.buildMeshGeometry(name, scene, keepSubMeshes);
  21438. mesh.material = material;
  21439. mesh.position.copyFrom(this.position);
  21440. mesh.rotation.copyFrom(this.rotation);
  21441. mesh.scaling.copyFrom(this.scaling);
  21442. mesh.computeWorldMatrix(true);
  21443. return mesh;
  21444. };
  21445. return CSG;
  21446. })();
  21447. BABYLON.CSG = CSG;
  21448. })(BABYLON || (BABYLON = {}));
  21449. //# sourceMappingURL=babylon.csg.js.map
  21450. var BABYLON;
  21451. (function (BABYLON) {
  21452. var OculusDistortionCorrectionPostProcess = (function (_super) {
  21453. __extends(OculusDistortionCorrectionPostProcess, _super);
  21454. //ANY
  21455. function OculusDistortionCorrectionPostProcess(name, camera, isRightEye, cameraSettings) {
  21456. var _this = this;
  21457. _super.call(this, name, "oculusDistortionCorrection", [
  21458. 'LensCenter',
  21459. 'Scale',
  21460. 'ScaleIn',
  21461. 'HmdWarpParam'
  21462. ], null, cameraSettings.PostProcessScaleFactor, camera, BABYLON.Texture.BILINEAR_SAMPLINGMODE, null, null);
  21463. this._isRightEye = isRightEye;
  21464. this._distortionFactors = cameraSettings.DistortionK;
  21465. this._postProcessScaleFactor = cameraSettings.PostProcessScaleFactor;
  21466. this._lensCenterOffset = cameraSettings.LensCenterOffset;
  21467. this.onSizeChanged = function () {
  21468. _this.aspectRatio = _this.width * .5 / _this.height;
  21469. _this._scaleIn = new BABYLON.Vector2(2, 2 / _this.aspectRatio);
  21470. _this._scaleFactor = new BABYLON.Vector2(.5 * (1 / _this._postProcessScaleFactor), .5 * (1 / _this._postProcessScaleFactor) * _this.aspectRatio);
  21471. _this._lensCenter = new BABYLON.Vector2(_this._isRightEye ? 0.5 - _this._lensCenterOffset * 0.5 : 0.5 + _this._lensCenterOffset * 0.5, 0.5);
  21472. };
  21473. this.onApply = function (effect) {
  21474. effect.setFloat2("LensCenter", _this._lensCenter.x, _this._lensCenter.y);
  21475. effect.setFloat2("Scale", _this._scaleFactor.x, _this._scaleFactor.y);
  21476. effect.setFloat2("ScaleIn", _this._scaleIn.x, _this._scaleIn.y);
  21477. effect.setFloat4("HmdWarpParam", _this._distortionFactors[0], _this._distortionFactors[1], _this._distortionFactors[2], _this._distortionFactors[3]);
  21478. };
  21479. }
  21480. return OculusDistortionCorrectionPostProcess;
  21481. })(BABYLON.PostProcess);
  21482. BABYLON.OculusDistortionCorrectionPostProcess = OculusDistortionCorrectionPostProcess;
  21483. })(BABYLON || (BABYLON = {}));
  21484. //# sourceMappingURL=babylon.oculusDistortionCorrectionPostProcess.js.map// Mainly based on these 2 articles :
  21485. // Creating an universal virtual touch joystick working for all Touch models thanks to Hand.JS : http://blogs.msdn.com/b/davrous/archive/2013/02/22/creating-an-universal-virtual-touch-joystick-working-for-all-touch-models-thanks-to-hand-js.aspx
  21486. // & on Seb Lee-Delisle original work: http://seb.ly/2011/04/multi-touch-game-controller-in-javascripthtml5-for-ipad/
  21487. var BABYLON;
  21488. (function (BABYLON) {
  21489. (function (JoystickAxis) {
  21490. JoystickAxis[JoystickAxis["X"] = 0] = "X";
  21491. JoystickAxis[JoystickAxis["Y"] = 1] = "Y";
  21492. JoystickAxis[JoystickAxis["Z"] = 2] = "Z";
  21493. })(BABYLON.JoystickAxis || (BABYLON.JoystickAxis = {}));
  21494. var JoystickAxis = BABYLON.JoystickAxis;
  21495. var VirtualJoystick = (function () {
  21496. function VirtualJoystick(leftJoystick) {
  21497. var _this = this;
  21498. if (leftJoystick) {
  21499. this._leftJoystick = true;
  21500. }
  21501. else {
  21502. this._leftJoystick = false;
  21503. }
  21504. this._joystickIndex = VirtualJoystick._globalJoystickIndex;
  21505. VirtualJoystick._globalJoystickIndex++;
  21506. // By default left & right arrow keys are moving the X
  21507. // and up & down keys are moving the Y
  21508. this._axisTargetedByLeftAndRight = 0 /* X */;
  21509. this._axisTargetedByUpAndDown = 1 /* Y */;
  21510. this.reverseLeftRight = false;
  21511. this.reverseUpDown = false;
  21512. // collections of pointers
  21513. this._touches = new BABYLON.SmartCollection();
  21514. this.deltaPosition = BABYLON.Vector3.Zero();
  21515. this._joystickSensibility = 25;
  21516. this._inversedSensibility = 1 / (this._joystickSensibility / 1000);
  21517. this._rotationSpeed = 25;
  21518. this._inverseRotationSpeed = 1 / (this._rotationSpeed / 1000);
  21519. this._rotateOnAxisRelativeToMesh = false;
  21520. // injecting a canvas element on top of the canvas 3D game
  21521. if (!VirtualJoystick.vjCanvas) {
  21522. window.addEventListener("resize", function () {
  21523. VirtualJoystick.vjCanvasWidth = window.innerWidth;
  21524. VirtualJoystick.vjCanvasHeight = window.innerHeight;
  21525. VirtualJoystick.vjCanvas.width = VirtualJoystick.vjCanvasWidth;
  21526. VirtualJoystick.vjCanvas.height = VirtualJoystick.vjCanvasHeight;
  21527. VirtualJoystick.halfWidth = VirtualJoystick.vjCanvasWidth / 2;
  21528. VirtualJoystick.halfHeight = VirtualJoystick.vjCanvasHeight / 2;
  21529. }, false);
  21530. VirtualJoystick.vjCanvas = document.createElement("canvas");
  21531. VirtualJoystick.vjCanvasWidth = window.innerWidth;
  21532. VirtualJoystick.vjCanvasHeight = window.innerHeight;
  21533. VirtualJoystick.vjCanvas.width = window.innerWidth;
  21534. VirtualJoystick.vjCanvas.height = window.innerHeight;
  21535. VirtualJoystick.vjCanvas.style.width = "100%";
  21536. VirtualJoystick.vjCanvas.style.height = "100%";
  21537. VirtualJoystick.vjCanvas.style.position = "absolute";
  21538. VirtualJoystick.vjCanvas.style.backgroundColor = "transparent";
  21539. VirtualJoystick.vjCanvas.style.top = "0px";
  21540. VirtualJoystick.vjCanvas.style.left = "0px";
  21541. VirtualJoystick.vjCanvas.style.zIndex = "5";
  21542. VirtualJoystick.vjCanvas.style.msTouchAction = "none";
  21543. VirtualJoystick.vjCanvasContext = VirtualJoystick.vjCanvas.getContext('2d');
  21544. VirtualJoystick.vjCanvasContext.strokeStyle = "#ffffff";
  21545. VirtualJoystick.vjCanvasContext.lineWidth = 2;
  21546. document.body.appendChild(VirtualJoystick.vjCanvas);
  21547. }
  21548. VirtualJoystick.halfWidth = VirtualJoystick.vjCanvas.width / 2;
  21549. VirtualJoystick.halfHeight = VirtualJoystick.vjCanvas.height / 2;
  21550. this.pressed = false;
  21551. // default joystick color
  21552. this._joystickColor = "cyan";
  21553. this._joystickPointerID = -1;
  21554. // current joystick position
  21555. this._joystickPointerPos = new BABYLON.Vector2(0, 0);
  21556. // origin joystick position
  21557. this._joystickPointerStartPos = new BABYLON.Vector2(0, 0);
  21558. this._deltaJoystickVector = new BABYLON.Vector2(0, 0);
  21559. VirtualJoystick.vjCanvas.addEventListener('pointerdown', function (evt) {
  21560. _this._onPointerDown(evt);
  21561. }, false);
  21562. VirtualJoystick.vjCanvas.addEventListener('pointermove', function (evt) {
  21563. _this._onPointerMove(evt);
  21564. }, false);
  21565. VirtualJoystick.vjCanvas.addEventListener('pointerup', function (evt) {
  21566. _this._onPointerUp(evt);
  21567. }, false);
  21568. VirtualJoystick.vjCanvas.addEventListener('pointerout', function (evt) {
  21569. _this._onPointerUp(evt);
  21570. }, false);
  21571. VirtualJoystick.vjCanvas.addEventListener("contextmenu", function (evt) {
  21572. evt.preventDefault(); // Disables system menu
  21573. }, false);
  21574. requestAnimationFrame(function () {
  21575. _this._drawVirtualJoystick();
  21576. });
  21577. }
  21578. VirtualJoystick.prototype.setJoystickSensibility = function (newJoystickSensibility) {
  21579. this._joystickSensibility = newJoystickSensibility;
  21580. this._inversedSensibility = 1 / (this._joystickSensibility / 1000);
  21581. };
  21582. VirtualJoystick.prototype._onPointerDown = function (e) {
  21583. var positionOnScreenCondition;
  21584. e.preventDefault();
  21585. if (this._leftJoystick === true) {
  21586. positionOnScreenCondition = (e.clientX < VirtualJoystick.halfWidth);
  21587. }
  21588. else {
  21589. positionOnScreenCondition = (e.clientX > VirtualJoystick.halfWidth);
  21590. }
  21591. if (positionOnScreenCondition && this._joystickPointerID < 0) {
  21592. // First contact will be dedicated to the virtual joystick
  21593. this._joystickPointerID = e.pointerId;
  21594. this._joystickPointerStartPos.x = e.clientX;
  21595. this._joystickPointerStartPos.y = e.clientY;
  21596. this._joystickPointerPos = this._joystickPointerStartPos.clone();
  21597. this._deltaJoystickVector.x = 0;
  21598. this._deltaJoystickVector.y = 0;
  21599. this.pressed = true;
  21600. this._touches.add(e.pointerId.toString(), e);
  21601. }
  21602. else {
  21603. // You can only trigger the action buttons with a joystick declared
  21604. if (VirtualJoystick._globalJoystickIndex < 2 && this._action) {
  21605. this._action();
  21606. this._touches.add(e.pointerId.toString(), e);
  21607. }
  21608. }
  21609. };
  21610. VirtualJoystick.prototype._onPointerMove = function (e) {
  21611. // If the current pointer is the one associated to the joystick (first touch contact)
  21612. if (this._joystickPointerID == e.pointerId) {
  21613. this._joystickPointerPos.x = e.clientX;
  21614. this._joystickPointerPos.y = e.clientY;
  21615. this._deltaJoystickVector = this._joystickPointerPos.clone();
  21616. this._deltaJoystickVector = this._deltaJoystickVector.subtract(this._joystickPointerStartPos);
  21617. var directionLeftRight = this.reverseLeftRight ? -1 : 1;
  21618. var deltaJoystickX = directionLeftRight * this._deltaJoystickVector.x / this._inversedSensibility;
  21619. switch (this._axisTargetedByLeftAndRight) {
  21620. case 0 /* X */:
  21621. this.deltaPosition.x = Math.min(1, Math.max(-1, deltaJoystickX));
  21622. break;
  21623. case 1 /* Y */:
  21624. this.deltaPosition.y = Math.min(1, Math.max(-1, deltaJoystickX));
  21625. break;
  21626. case 2 /* Z */:
  21627. this.deltaPosition.z = Math.min(1, Math.max(-1, deltaJoystickX));
  21628. break;
  21629. }
  21630. var directionUpDown = this.reverseUpDown ? 1 : -1;
  21631. var deltaJoystickY = directionUpDown * this._deltaJoystickVector.y / this._inversedSensibility;
  21632. switch (this._axisTargetedByUpAndDown) {
  21633. case 0 /* X */:
  21634. this.deltaPosition.x = Math.min(1, Math.max(-1, deltaJoystickY));
  21635. break;
  21636. case 1 /* Y */:
  21637. this.deltaPosition.y = Math.min(1, Math.max(-1, deltaJoystickY));
  21638. break;
  21639. case 2 /* Z */:
  21640. this.deltaPosition.z = Math.min(1, Math.max(-1, deltaJoystickY));
  21641. break;
  21642. }
  21643. }
  21644. else {
  21645. if (this._touches.item(e.pointerId.toString())) {
  21646. this._touches.item(e.pointerId.toString()).x = e.clientX;
  21647. this._touches.item(e.pointerId.toString()).y = e.clientY;
  21648. }
  21649. }
  21650. };
  21651. VirtualJoystick.prototype._onPointerUp = function (e) {
  21652. this._clearCanvas();
  21653. if (this._joystickPointerID == e.pointerId) {
  21654. this._joystickPointerID = -1;
  21655. this.pressed = false;
  21656. }
  21657. this._deltaJoystickVector.x = 0;
  21658. this._deltaJoystickVector.y = 0;
  21659. this._touches.remove(e.pointerId.toString());
  21660. };
  21661. /**
  21662. * Change the color of the virtual joystick
  21663. * @param newColor a string that must be a CSS color value (like "red") or the hexa value (like "#FF0000")
  21664. */
  21665. VirtualJoystick.prototype.setJoystickColor = function (newColor) {
  21666. this._joystickColor = newColor;
  21667. };
  21668. VirtualJoystick.prototype.setActionOnTouch = function (action) {
  21669. this._action = action;
  21670. };
  21671. // Define which axis you'd like to control for left & right
  21672. VirtualJoystick.prototype.setAxisForLeftRight = function (axis) {
  21673. switch (axis) {
  21674. case 0 /* X */:
  21675. case 1 /* Y */:
  21676. case 2 /* Z */:
  21677. this._axisTargetedByLeftAndRight = axis;
  21678. break;
  21679. default:
  21680. this._axisTargetedByLeftAndRight = 0 /* X */;
  21681. break;
  21682. }
  21683. };
  21684. // Define which axis you'd like to control for up & down
  21685. VirtualJoystick.prototype.setAxisForUpDown = function (axis) {
  21686. switch (axis) {
  21687. case 0 /* X */:
  21688. case 1 /* Y */:
  21689. case 2 /* Z */:
  21690. this._axisTargetedByUpAndDown = axis;
  21691. break;
  21692. default:
  21693. this._axisTargetedByUpAndDown = 1 /* Y */;
  21694. break;
  21695. }
  21696. };
  21697. VirtualJoystick.prototype._clearCanvas = function () {
  21698. if (this._leftJoystick) {
  21699. VirtualJoystick.vjCanvasContext.clearRect(0, 0, VirtualJoystick.vjCanvasWidth / 2, VirtualJoystick.vjCanvasHeight);
  21700. }
  21701. else {
  21702. VirtualJoystick.vjCanvasContext.clearRect(VirtualJoystick.vjCanvasWidth / 2, 0, VirtualJoystick.vjCanvasWidth, VirtualJoystick.vjCanvasHeight);
  21703. }
  21704. };
  21705. VirtualJoystick.prototype._drawVirtualJoystick = function () {
  21706. var _this = this;
  21707. if (this.pressed) {
  21708. this._clearCanvas();
  21709. this._touches.forEach(function (touch) {
  21710. if (touch.pointerId === _this._joystickPointerID) {
  21711. VirtualJoystick.vjCanvasContext.beginPath();
  21712. VirtualJoystick.vjCanvasContext.strokeStyle = _this._joystickColor;
  21713. VirtualJoystick.vjCanvasContext.lineWidth = 6;
  21714. VirtualJoystick.vjCanvasContext.arc(_this._joystickPointerStartPos.x, _this._joystickPointerStartPos.y, 40, 0, Math.PI * 2, true);
  21715. VirtualJoystick.vjCanvasContext.stroke();
  21716. VirtualJoystick.vjCanvasContext.beginPath();
  21717. VirtualJoystick.vjCanvasContext.strokeStyle = _this._joystickColor;
  21718. VirtualJoystick.vjCanvasContext.lineWidth = 2;
  21719. VirtualJoystick.vjCanvasContext.arc(_this._joystickPointerStartPos.x, _this._joystickPointerStartPos.y, 60, 0, Math.PI * 2, true);
  21720. VirtualJoystick.vjCanvasContext.stroke();
  21721. VirtualJoystick.vjCanvasContext.beginPath();
  21722. VirtualJoystick.vjCanvasContext.strokeStyle = _this._joystickColor;
  21723. VirtualJoystick.vjCanvasContext.arc(_this._joystickPointerPos.x, _this._joystickPointerPos.y, 40, 0, Math.PI * 2, true);
  21724. VirtualJoystick.vjCanvasContext.stroke();
  21725. }
  21726. else {
  21727. VirtualJoystick.vjCanvasContext.beginPath();
  21728. VirtualJoystick.vjCanvasContext.fillStyle = "white";
  21729. VirtualJoystick.vjCanvasContext.beginPath();
  21730. VirtualJoystick.vjCanvasContext.strokeStyle = "red";
  21731. VirtualJoystick.vjCanvasContext.lineWidth = 6;
  21732. VirtualJoystick.vjCanvasContext.arc(touch.x, touch.y, 40, 0, Math.PI * 2, true);
  21733. VirtualJoystick.vjCanvasContext.stroke();
  21734. }
  21735. ;
  21736. });
  21737. }
  21738. requestAnimationFrame(function () {
  21739. _this._drawVirtualJoystick();
  21740. });
  21741. };
  21742. VirtualJoystick.prototype.releaseCanvas = function () {
  21743. if (VirtualJoystick.vjCanvas) {
  21744. document.body.removeChild(VirtualJoystick.vjCanvas);
  21745. VirtualJoystick.vjCanvas = null;
  21746. }
  21747. };
  21748. // Used to draw the virtual joystick inside a 2D canvas on top of the WebGL rendering canvas
  21749. VirtualJoystick._globalJoystickIndex = 0;
  21750. return VirtualJoystick;
  21751. })();
  21752. BABYLON.VirtualJoystick = VirtualJoystick;
  21753. })(BABYLON || (BABYLON = {}));
  21754. //# sourceMappingURL=babylon.virtualJoystick.js.map
  21755. var BABYLON;
  21756. (function (BABYLON) {
  21757. var OculusRiftDevKit2013_Metric = {
  21758. HResolution: 1280,
  21759. VResolution: 800,
  21760. HScreenSize: 0.149759993,
  21761. VScreenSize: 0.0935999975,
  21762. VScreenCenter: 0.0467999987,
  21763. EyeToScreenDistance: 0.0410000011,
  21764. LensSeparationDistance: 0.0635000020,
  21765. InterpupillaryDistance: 0.0640000030,
  21766. DistortionK: [1.0, 0.219999999, 0.239999995, 0.0],
  21767. ChromaAbCorrection: [0.995999992, -0.00400000019, 1.01400006, 0.0],
  21768. PostProcessScaleFactor: 1.714605507808412,
  21769. LensCenterOffset: 0.151976421
  21770. };
  21771. var _OculusInnerCamera = (function (_super) {
  21772. __extends(_OculusInnerCamera, _super);
  21773. function _OculusInnerCamera(name, position, scene, isLeftEye) {
  21774. _super.call(this, name, position, scene);
  21775. this._workMatrix = new BABYLON.Matrix();
  21776. this._actualUp = new BABYLON.Vector3(0, 0, 0);
  21777. // Constants
  21778. this._aspectRatioAspectRatio = OculusRiftDevKit2013_Metric.HResolution / (2 * OculusRiftDevKit2013_Metric.VResolution);
  21779. this._aspectRatioFov = (2 * Math.atan((OculusRiftDevKit2013_Metric.PostProcessScaleFactor * OculusRiftDevKit2013_Metric.VScreenSize) / (2 * OculusRiftDevKit2013_Metric.EyeToScreenDistance)));
  21780. var hMeters = (OculusRiftDevKit2013_Metric.HScreenSize / 4) - (OculusRiftDevKit2013_Metric.LensSeparationDistance / 2);
  21781. var h = (4 * hMeters) / OculusRiftDevKit2013_Metric.HScreenSize;
  21782. this._hMatrix = BABYLON.Matrix.Translation(isLeftEye ? h : -h, 0, 0);
  21783. this.viewport = new BABYLON.Viewport(isLeftEye ? 0 : 0.5, 0, 0.5, 1.0);
  21784. this._preViewMatrix = BABYLON.Matrix.Translation(isLeftEye ? .5 * OculusRiftDevKit2013_Metric.InterpupillaryDistance : -.5 * OculusRiftDevKit2013_Metric.InterpupillaryDistance, 0, 0);
  21785. // Postprocess
  21786. var postProcess = new BABYLON.OculusDistortionCorrectionPostProcess("Oculus Distortion", this, !isLeftEye, OculusRiftDevKit2013_Metric);
  21787. }
  21788. _OculusInnerCamera.prototype.getProjectionMatrix = function () {
  21789. BABYLON.Matrix.PerspectiveFovLHToRef(this._aspectRatioFov, this._aspectRatioAspectRatio, this.minZ, this.maxZ, this._workMatrix);
  21790. this._workMatrix.multiplyToRef(this._hMatrix, this._projectionMatrix);
  21791. return this._projectionMatrix;
  21792. };
  21793. _OculusInnerCamera.prototype._getViewMatrix = function () {
  21794. BABYLON.Matrix.RotationYawPitchRollToRef(this.rotation.y, this.rotation.x, this.rotation.z, this._cameraRotationMatrix);
  21795. BABYLON.Vector3.TransformCoordinatesToRef(this._referencePoint, this._cameraRotationMatrix, this._transformedReferencePoint);
  21796. BABYLON.Vector3.TransformNormalToRef(this.upVector, this._cameraRotationMatrix, this._actualUp);
  21797. // Computing target and final matrix
  21798. this.position.addToRef(this._transformedReferencePoint, this._currentTarget);
  21799. BABYLON.Matrix.LookAtLHToRef(this.position, this._currentTarget, this._actualUp, this._workMatrix);
  21800. this._workMatrix.multiplyToRef(this._preViewMatrix, this._viewMatrix);
  21801. return this._viewMatrix;
  21802. };
  21803. return _OculusInnerCamera;
  21804. })(BABYLON.FreeCamera);
  21805. var OculusCamera = (function (_super) {
  21806. __extends(OculusCamera, _super);
  21807. function OculusCamera(name, position, scene) {
  21808. _super.call(this, name, position, scene);
  21809. this._leftCamera = new _OculusInnerCamera(name + "_left", position.clone(), scene, true);
  21810. this._rightCamera = new _OculusInnerCamera(name + "_right", position.clone(), scene, false);
  21811. this.subCameras.push(this._leftCamera);
  21812. this.subCameras.push(this._rightCamera);
  21813. this._deviceOrientationHandler = this._onOrientationEvent.bind(this);
  21814. }
  21815. OculusCamera.prototype._update = function () {
  21816. this._leftCamera.position.copyFrom(this.position);
  21817. this._rightCamera.position.copyFrom(this.position);
  21818. this._updateCamera(this._leftCamera);
  21819. this._updateCamera(this._rightCamera);
  21820. _super.prototype._update.call(this);
  21821. };
  21822. OculusCamera.prototype._updateCamera = function (camera) {
  21823. camera.minZ = this.minZ;
  21824. camera.maxZ = this.maxZ;
  21825. camera.rotation.x = this.rotation.x;
  21826. camera.rotation.y = this.rotation.y;
  21827. camera.rotation.z = this.rotation.z;
  21828. };
  21829. // Oculus events
  21830. OculusCamera.prototype._onOrientationEvent = function (evt) {
  21831. var yaw = evt.alpha / 180 * Math.PI;
  21832. var pitch = evt.beta / 180 * Math.PI;
  21833. var roll = evt.gamma / 180 * Math.PI;
  21834. if (!this._offsetOrientation) {
  21835. this._offsetOrientation = {
  21836. yaw: yaw,
  21837. pitch: pitch,
  21838. roll: roll
  21839. };
  21840. return;
  21841. }
  21842. else {
  21843. this.rotation.y += yaw - this._offsetOrientation.yaw;
  21844. this.rotation.x += pitch - this._offsetOrientation.pitch;
  21845. this.rotation.z += this._offsetOrientation.roll - roll;
  21846. this._offsetOrientation.yaw = yaw;
  21847. this._offsetOrientation.pitch = pitch;
  21848. this._offsetOrientation.roll = roll;
  21849. }
  21850. };
  21851. OculusCamera.prototype.attachControl = function (element, noPreventDefault) {
  21852. _super.prototype.attachControl.call(this, element, noPreventDefault);
  21853. window.addEventListener("deviceorientation", this._deviceOrientationHandler);
  21854. };
  21855. OculusCamera.prototype.detachControl = function (element) {
  21856. _super.prototype.detachControl.call(this, element);
  21857. window.removeEventListener("deviceorientation", this._deviceOrientationHandler);
  21858. };
  21859. return OculusCamera;
  21860. })(BABYLON.FreeCamera);
  21861. BABYLON.OculusCamera = OculusCamera;
  21862. })(BABYLON || (BABYLON = {}));
  21863. //# sourceMappingURL=babylon.oculusCamera.js.map
  21864. var BABYLON;
  21865. (function (BABYLON) {
  21866. var OculusRiftDevKit2013_Metric = {
  21867. HResolution: 1280,
  21868. VResolution: 800,
  21869. HScreenSize: 0.149759993,
  21870. VScreenSize: 0.0935999975,
  21871. VScreenCenter: 0.0467999987,
  21872. EyeToScreenDistance: 0.0410000011,
  21873. LensSeparationDistance: 0.0635000020,
  21874. InterpupillaryDistance: 0.0640000030,
  21875. DistortionK: [1.0, 0.219999999, 0.239999995, 0.0],
  21876. ChromaAbCorrection: [0.995999992, -0.00400000019, 1.01400006, 0.0],
  21877. PostProcessScaleFactor: 1.714605507808412,
  21878. LensCenterOffset: 0.151976421
  21879. };
  21880. var _OculusInnerGamepadCamera = (function (_super) {
  21881. __extends(_OculusInnerGamepadCamera, _super);
  21882. function _OculusInnerGamepadCamera(name, position, scene, isLeftEye) {
  21883. _super.call(this, name, position, scene);
  21884. this._workMatrix = new BABYLON.Matrix();
  21885. this._actualUp = new BABYLON.Vector3(0, 0, 0);
  21886. // Constants
  21887. this._aspectRatioAspectRatio = OculusRiftDevKit2013_Metric.HResolution / (2 * OculusRiftDevKit2013_Metric.VResolution);
  21888. this._aspectRatioFov = (2 * Math.atan((OculusRiftDevKit2013_Metric.PostProcessScaleFactor * OculusRiftDevKit2013_Metric.VScreenSize) / (2 * OculusRiftDevKit2013_Metric.EyeToScreenDistance)));
  21889. var hMeters = (OculusRiftDevKit2013_Metric.HScreenSize / 4) - (OculusRiftDevKit2013_Metric.LensSeparationDistance / 2);
  21890. var h = (4 * hMeters) / OculusRiftDevKit2013_Metric.HScreenSize;
  21891. this._hMatrix = BABYLON.Matrix.Translation(isLeftEye ? h : -h, 0, 0);
  21892. this.viewport = new BABYLON.Viewport(isLeftEye ? 0 : 0.5, 0, 0.5, 1.0);
  21893. this._preViewMatrix = BABYLON.Matrix.Translation(isLeftEye ? .5 * OculusRiftDevKit2013_Metric.InterpupillaryDistance : -.5 * OculusRiftDevKit2013_Metric.InterpupillaryDistance, 0, 0);
  21894. // Postprocess
  21895. var postProcess = new BABYLON.OculusDistortionCorrectionPostProcess("Oculus Distortion", this, !isLeftEye, OculusRiftDevKit2013_Metric);
  21896. }
  21897. _OculusInnerGamepadCamera.prototype.getProjectionMatrix = function () {
  21898. BABYLON.Matrix.PerspectiveFovLHToRef(this._aspectRatioFov, this._aspectRatioAspectRatio, this.minZ, this.maxZ, this._workMatrix);
  21899. this._workMatrix.multiplyToRef(this._hMatrix, this._projectionMatrix);
  21900. return this._projectionMatrix;
  21901. };
  21902. _OculusInnerGamepadCamera.prototype._getViewMatrix = function () {
  21903. BABYLON.Matrix.RotationYawPitchRollToRef(this.rotation.y, this.rotation.x, this.rotation.z, this._cameraRotationMatrix);
  21904. BABYLON.Vector3.TransformCoordinatesToRef(this._referencePoint, this._cameraRotationMatrix, this._transformedReferencePoint);
  21905. BABYLON.Vector3.TransformNormalToRef(this.upVector, this._cameraRotationMatrix, this._actualUp);
  21906. // Computing target and final matrix
  21907. this.position.addToRef(this._transformedReferencePoint, this._currentTarget);
  21908. BABYLON.Matrix.LookAtLHToRef(this.position, this._currentTarget, this._actualUp, this._workMatrix);
  21909. this._workMatrix.multiplyToRef(this._preViewMatrix, this._viewMatrix);
  21910. return this._viewMatrix;
  21911. };
  21912. return _OculusInnerGamepadCamera;
  21913. })(BABYLON.FreeCamera);
  21914. var OculusGamepadCamera = (function (_super) {
  21915. __extends(OculusGamepadCamera, _super);
  21916. function OculusGamepadCamera(name, position, scene) {
  21917. var _this = this;
  21918. _super.call(this, name, position, scene);
  21919. this.angularSensibility = 200;
  21920. this.moveSensibility = 75;
  21921. this._leftCamera = new _OculusInnerGamepadCamera(name + "_left", position.clone(), scene, true);
  21922. this._rightCamera = new _OculusInnerGamepadCamera(name + "_right", position.clone(), scene, false);
  21923. this.subCameras.push(this._leftCamera);
  21924. this.subCameras.push(this._rightCamera);
  21925. this._deviceOrientationHandler = this._onOrientationEvent.bind(this);
  21926. this._gamepads = new BABYLON.Gamepads(function (gamepad) {
  21927. _this._onNewGameConnected(gamepad);
  21928. });
  21929. }
  21930. OculusGamepadCamera.prototype._onNewGameConnected = function (gamepad) {
  21931. // Only the first gamepad can control the camera
  21932. if (gamepad.index === 0) {
  21933. this._gamepad = gamepad;
  21934. }
  21935. };
  21936. OculusGamepadCamera.prototype._update = function () {
  21937. this._leftCamera.position.copyFrom(this.position);
  21938. this._rightCamera.position.copyFrom(this.position);
  21939. this._updateCamera(this._leftCamera);
  21940. this._updateCamera(this._rightCamera);
  21941. _super.prototype._update.call(this);
  21942. };
  21943. OculusGamepadCamera.prototype._checkInputs = function () {
  21944. if (!this._gamepad) {
  21945. return;
  21946. }
  21947. var LSValues = this._gamepad.leftStick;
  21948. var normalizedLX = LSValues.x / this.moveSensibility;
  21949. var normalizedLY = LSValues.y / this.moveSensibility;
  21950. LSValues.x = Math.abs(normalizedLX) > 0.005 ? 0 + normalizedLX : 0;
  21951. LSValues.y = Math.abs(normalizedLY) > 0.005 ? 0 + normalizedLY : 0;
  21952. var cameraTransform = BABYLON.Matrix.RotationYawPitchRoll(this.rotation.y, this.rotation.x, 0);
  21953. var deltaTransform = BABYLON.Vector3.TransformCoordinates(new BABYLON.Vector3(LSValues.x, 0, -LSValues.y), cameraTransform);
  21954. this.cameraDirection = this.cameraDirection.add(deltaTransform);
  21955. };
  21956. OculusGamepadCamera.prototype._updateCamera = function (camera) {
  21957. camera.minZ = this.minZ;
  21958. camera.maxZ = this.maxZ;
  21959. camera.rotation.x = this.rotation.x;
  21960. camera.rotation.y = this.rotation.y;
  21961. camera.rotation.z = this.rotation.z;
  21962. };
  21963. // Oculus events
  21964. OculusGamepadCamera.prototype._onOrientationEvent = function (evt) {
  21965. var yaw = evt.alpha / 180 * Math.PI;
  21966. var pitch = evt.beta / 180 * Math.PI;
  21967. var roll = evt.gamma / 180 * Math.PI;
  21968. if (!this._offsetOrientation) {
  21969. this._offsetOrientation = {
  21970. yaw: yaw,
  21971. pitch: pitch,
  21972. roll: roll
  21973. };
  21974. return;
  21975. }
  21976. else {
  21977. this.rotation.y += yaw - this._offsetOrientation.yaw;
  21978. this.rotation.x += pitch - this._offsetOrientation.pitch;
  21979. this.rotation.z += this._offsetOrientation.roll - roll;
  21980. this._offsetOrientation.yaw = yaw;
  21981. this._offsetOrientation.pitch = pitch;
  21982. this._offsetOrientation.roll = roll;
  21983. }
  21984. };
  21985. OculusGamepadCamera.prototype.attachControl = function (element, noPreventDefault) {
  21986. _super.prototype.attachControl.call(this, element, noPreventDefault);
  21987. window.addEventListener("deviceorientation", this._deviceOrientationHandler);
  21988. };
  21989. OculusGamepadCamera.prototype.detachControl = function (element) {
  21990. _super.prototype.detachControl.call(this, element);
  21991. window.removeEventListener("deviceorientation", this._deviceOrientationHandler);
  21992. };
  21993. OculusGamepadCamera.prototype.dispose = function () {
  21994. this._gamepads.dispose();
  21995. _super.prototype.dispose.call(this);
  21996. };
  21997. return OculusGamepadCamera;
  21998. })(BABYLON.FreeCamera);
  21999. BABYLON.OculusGamepadCamera = OculusGamepadCamera;
  22000. })(BABYLON || (BABYLON = {}));
  22001. //# sourceMappingURL=babylon.oculusGamepadCamera.js.map
  22002. var BABYLON;
  22003. (function (BABYLON) {
  22004. // We're mainly based on the logic defined into the FreeCamera code
  22005. var VirtualJoysticksCamera = (function (_super) {
  22006. __extends(VirtualJoysticksCamera, _super);
  22007. function VirtualJoysticksCamera(name, position, scene) {
  22008. _super.call(this, name, position, scene);
  22009. this._leftjoystick = new BABYLON.VirtualJoystick(true);
  22010. this._leftjoystick.setAxisForUpDown(2 /* Z */);
  22011. this._leftjoystick.setAxisForLeftRight(0 /* X */);
  22012. this._leftjoystick.setJoystickSensibility(0.15);
  22013. this._rightjoystick = new BABYLON.VirtualJoystick(false);
  22014. this._rightjoystick.setAxisForUpDown(0 /* X */);
  22015. this._rightjoystick.setAxisForLeftRight(1 /* Y */);
  22016. this._rightjoystick.reverseUpDown = true;
  22017. this._rightjoystick.setJoystickSensibility(0.05);
  22018. this._rightjoystick.setJoystickColor("yellow");
  22019. }
  22020. VirtualJoysticksCamera.prototype._checkInputs = function () {
  22021. var cameraTransform = BABYLON.Matrix.RotationYawPitchRoll(this.rotation.y, this.rotation.x, 0);
  22022. var deltaTransform = BABYLON.Vector3.TransformCoordinates(this._leftjoystick.deltaPosition, cameraTransform);
  22023. this.cameraDirection = this.cameraDirection.add(deltaTransform);
  22024. this.cameraRotation = this.cameraRotation.addVector3(this._rightjoystick.deltaPosition);
  22025. if (!this._leftjoystick.pressed) {
  22026. this._leftjoystick.deltaPosition = this._leftjoystick.deltaPosition.scale(0.9);
  22027. }
  22028. if (!this._rightjoystick.pressed) {
  22029. this._rightjoystick.deltaPosition = this._rightjoystick.deltaPosition.scale(0.9);
  22030. }
  22031. };
  22032. VirtualJoysticksCamera.prototype.dispose = function () {
  22033. this._leftjoystick.releaseCanvas();
  22034. _super.prototype.dispose.call(this);
  22035. };
  22036. return VirtualJoysticksCamera;
  22037. })(BABYLON.FreeCamera);
  22038. BABYLON.VirtualJoysticksCamera = VirtualJoysticksCamera;
  22039. })(BABYLON || (BABYLON = {}));
  22040. //# sourceMappingURL=babylon.virtualJoysticksCamera.js.map
  22041. var BABYLON;
  22042. (function (BABYLON) {
  22043. var ShaderMaterial = (function (_super) {
  22044. __extends(ShaderMaterial, _super);
  22045. function ShaderMaterial(name, scene, shaderPath, options) {
  22046. _super.call(this, name, scene);
  22047. this._textures = new Array();
  22048. this._floats = new Array();
  22049. this._floatsArrays = {};
  22050. this._colors3 = new Array();
  22051. this._colors4 = new Array();
  22052. this._vectors2 = new Array();
  22053. this._vectors3 = new Array();
  22054. this._matrices = new Array();
  22055. this._cachedWorldViewMatrix = new BABYLON.Matrix();
  22056. this._shaderPath = shaderPath;
  22057. options.needAlphaBlending = options.needAlphaBlending || false;
  22058. options.needAlphaTesting = options.needAlphaTesting || false;
  22059. options.attributes = options.attributes || ["position", "normal", "uv"];
  22060. options.uniforms = options.uniforms || ["worldViewProjection"];
  22061. options.samplers = options.samplers || [];
  22062. this._options = options;
  22063. }
  22064. ShaderMaterial.prototype.needAlphaBlending = function () {
  22065. return this._options.needAlphaBlending;
  22066. };
  22067. ShaderMaterial.prototype.needAlphaTesting = function () {
  22068. return this._options.needAlphaTesting;
  22069. };
  22070. ShaderMaterial.prototype._checkUniform = function (uniformName) {
  22071. if (this._options.uniforms.indexOf(uniformName) === -1) {
  22072. this._options.uniforms.push(uniformName);
  22073. }
  22074. };
  22075. ShaderMaterial.prototype.setTexture = function (name, texture) {
  22076. if (this._options.samplers.indexOf(name) === -1) {
  22077. this._options.samplers.push(name);
  22078. }
  22079. this._textures[name] = texture;
  22080. return this;
  22081. };
  22082. ShaderMaterial.prototype.setFloat = function (name, value) {
  22083. this._checkUniform(name);
  22084. this._floats[name] = value;
  22085. return this;
  22086. };
  22087. ShaderMaterial.prototype.setFloats = function (name, value) {
  22088. this._checkUniform(name);
  22089. this._floatsArrays[name] = value;
  22090. return this;
  22091. };
  22092. ShaderMaterial.prototype.setColor3 = function (name, value) {
  22093. this._checkUniform(name);
  22094. this._colors3[name] = value;
  22095. return this;
  22096. };
  22097. ShaderMaterial.prototype.setColor4 = function (name, value) {
  22098. this._checkUniform(name);
  22099. this._colors4[name] = value;
  22100. return this;
  22101. };
  22102. ShaderMaterial.prototype.setVector2 = function (name, value) {
  22103. this._checkUniform(name);
  22104. this._vectors2[name] = value;
  22105. return this;
  22106. };
  22107. ShaderMaterial.prototype.setVector3 = function (name, value) {
  22108. this._checkUniform(name);
  22109. this._vectors3[name] = value;
  22110. return this;
  22111. };
  22112. ShaderMaterial.prototype.setMatrix = function (name, value) {
  22113. this._checkUniform(name);
  22114. this._matrices[name] = value;
  22115. return this;
  22116. };
  22117. ShaderMaterial.prototype.isReady = function (mesh, useInstances) {
  22118. var scene = this.getScene();
  22119. var engine = scene.getEngine();
  22120. if (!this.checkReadyOnEveryCall) {
  22121. if (this._renderId === scene.getRenderId()) {
  22122. return true;
  22123. }
  22124. }
  22125. // Instances
  22126. var defines = [];
  22127. var fallbacks = new BABYLON.EffectFallbacks();
  22128. if (useInstances) {
  22129. defines.push("#define INSTANCES");
  22130. }
  22131. // Bones
  22132. if (mesh && mesh.useBones) {
  22133. defines.push("#define BONES");
  22134. defines.push("#define BonesPerMesh " + (mesh.skeleton.bones.length + 1));
  22135. defines.push("#define BONES4");
  22136. fallbacks.addFallback(0, "BONES4");
  22137. }
  22138. // Alpha test
  22139. if (engine.getAlphaTesting()) {
  22140. defines.push("#define ALPHATEST");
  22141. }
  22142. var previousEffect = this._effect;
  22143. var join = defines.join("\n");
  22144. this._effect = engine.createEffect(this._shaderPath, this._options.attributes, this._options.uniforms, this._options.samplers, join, fallbacks, this.onCompiled, this.onError);
  22145. if (!this._effect.isReady()) {
  22146. return false;
  22147. }
  22148. if (previousEffect !== this._effect) {
  22149. scene.resetCachedMaterial();
  22150. }
  22151. this._renderId = scene.getRenderId();
  22152. return true;
  22153. };
  22154. ShaderMaterial.prototype.bindOnlyWorldMatrix = function (world) {
  22155. var scene = this.getScene();
  22156. if (this._options.uniforms.indexOf("world") !== -1) {
  22157. this._effect.setMatrix("world", world);
  22158. }
  22159. if (this._options.uniforms.indexOf("worldView") !== -1) {
  22160. world.multiplyToRef(scene.getViewMatrix(), this._cachedWorldViewMatrix);
  22161. this._effect.setMatrix("worldView", this._cachedWorldViewMatrix);
  22162. }
  22163. if (this._options.uniforms.indexOf("worldViewProjection") !== -1) {
  22164. this._effect.setMatrix("worldViewProjection", world.multiply(scene.getTransformMatrix()));
  22165. }
  22166. };
  22167. ShaderMaterial.prototype.bind = function (world, mesh) {
  22168. // Std values
  22169. this.bindOnlyWorldMatrix(world);
  22170. if (this.getScene().getCachedMaterial() !== this) {
  22171. if (this._options.uniforms.indexOf("view") !== -1) {
  22172. this._effect.setMatrix("view", this.getScene().getViewMatrix());
  22173. }
  22174. if (this._options.uniforms.indexOf("projection") !== -1) {
  22175. this._effect.setMatrix("projection", this.getScene().getProjectionMatrix());
  22176. }
  22177. if (this._options.uniforms.indexOf("viewProjection") !== -1) {
  22178. this._effect.setMatrix("viewProjection", this.getScene().getTransformMatrix());
  22179. }
  22180. // Bones
  22181. if (mesh && mesh.useBones) {
  22182. this._effect.setMatrices("mBones", mesh.skeleton.getTransformMatrices());
  22183. }
  22184. for (var name in this._textures) {
  22185. this._effect.setTexture(name, this._textures[name]);
  22186. }
  22187. for (name in this._floats) {
  22188. this._effect.setFloat(name, this._floats[name]);
  22189. }
  22190. for (name in this._floatsArrays) {
  22191. this._effect.setArray(name, this._floatsArrays[name]);
  22192. }
  22193. for (name in this._colors3) {
  22194. this._effect.setColor3(name, this._colors3[name]);
  22195. }
  22196. for (name in this._colors4) {
  22197. var color = this._colors4[name];
  22198. this._effect.setFloat4(name, color.r, color.g, color.b, color.a);
  22199. }
  22200. for (name in this._vectors2) {
  22201. this._effect.setVector2(name, this._vectors2[name]);
  22202. }
  22203. for (name in this._vectors3) {
  22204. this._effect.setVector3(name, this._vectors3[name]);
  22205. }
  22206. for (name in this._matrices) {
  22207. this._effect.setMatrix(name, this._matrices[name]);
  22208. }
  22209. }
  22210. _super.prototype.bind.call(this, world, mesh);
  22211. };
  22212. ShaderMaterial.prototype.dispose = function (forceDisposeEffect) {
  22213. for (var name in this._textures) {
  22214. this._textures[name].dispose();
  22215. }
  22216. this._textures = [];
  22217. _super.prototype.dispose.call(this, forceDisposeEffect);
  22218. };
  22219. return ShaderMaterial;
  22220. })(BABYLON.Material);
  22221. BABYLON.ShaderMaterial = ShaderMaterial;
  22222. })(BABYLON || (BABYLON = {}));
  22223. //# sourceMappingURL=babylon.shaderMaterial.js.mapvar BABYLON;
  22224. (function (BABYLON) {
  22225. var VertexData = (function () {
  22226. function VertexData() {
  22227. }
  22228. VertexData.prototype.set = function (data, kind) {
  22229. switch (kind) {
  22230. case BABYLON.VertexBuffer.PositionKind:
  22231. this.positions = data;
  22232. break;
  22233. case BABYLON.VertexBuffer.NormalKind:
  22234. this.normals = data;
  22235. break;
  22236. case BABYLON.VertexBuffer.UVKind:
  22237. this.uvs = data;
  22238. break;
  22239. case BABYLON.VertexBuffer.UV2Kind:
  22240. this.uv2s = data;
  22241. break;
  22242. case BABYLON.VertexBuffer.ColorKind:
  22243. this.colors = data;
  22244. break;
  22245. case BABYLON.VertexBuffer.MatricesIndicesKind:
  22246. this.matricesIndices = data;
  22247. break;
  22248. case BABYLON.VertexBuffer.MatricesWeightsKind:
  22249. this.matricesWeights = data;
  22250. break;
  22251. }
  22252. };
  22253. VertexData.prototype.applyToMesh = function (mesh, updatable) {
  22254. this._applyTo(mesh, updatable);
  22255. };
  22256. VertexData.prototype.applyToGeometry = function (geometry, updatable) {
  22257. this._applyTo(geometry, updatable);
  22258. };
  22259. VertexData.prototype.updateMesh = function (mesh, updateExtends, makeItUnique) {
  22260. this._update(mesh);
  22261. };
  22262. VertexData.prototype.updateGeometry = function (geometry, updateExtends, makeItUnique) {
  22263. this._update(geometry);
  22264. };
  22265. VertexData.prototype._applyTo = function (meshOrGeometry, updatable) {
  22266. if (this.positions) {
  22267. meshOrGeometry.setVerticesData(BABYLON.VertexBuffer.PositionKind, this.positions, updatable);
  22268. }
  22269. if (this.normals) {
  22270. meshOrGeometry.setVerticesData(BABYLON.VertexBuffer.NormalKind, this.normals, updatable);
  22271. }
  22272. if (this.uvs) {
  22273. meshOrGeometry.setVerticesData(BABYLON.VertexBuffer.UVKind, this.uvs, updatable);
  22274. }
  22275. if (this.uv2s) {
  22276. meshOrGeometry.setVerticesData(BABYLON.VertexBuffer.UV2Kind, this.uv2s, updatable);
  22277. }
  22278. if (this.colors) {
  22279. meshOrGeometry.setVerticesData(BABYLON.VertexBuffer.ColorKind, this.colors, updatable);
  22280. }
  22281. if (this.matricesIndices) {
  22282. meshOrGeometry.setVerticesData(BABYLON.VertexBuffer.MatricesIndicesKind, this.matricesIndices, updatable);
  22283. }
  22284. if (this.matricesWeights) {
  22285. meshOrGeometry.setVerticesData(BABYLON.VertexBuffer.MatricesWeightsKind, this.matricesWeights, updatable);
  22286. }
  22287. if (this.indices) {
  22288. meshOrGeometry.setIndices(this.indices);
  22289. }
  22290. };
  22291. VertexData.prototype._update = function (meshOrGeometry, updateExtends, makeItUnique) {
  22292. if (this.positions) {
  22293. meshOrGeometry.updateVerticesData(BABYLON.VertexBuffer.PositionKind, this.positions, updateExtends, makeItUnique);
  22294. }
  22295. if (this.normals) {
  22296. meshOrGeometry.updateVerticesData(BABYLON.VertexBuffer.NormalKind, this.normals, updateExtends, makeItUnique);
  22297. }
  22298. if (this.uvs) {
  22299. meshOrGeometry.updateVerticesData(BABYLON.VertexBuffer.UVKind, this.uvs, updateExtends, makeItUnique);
  22300. }
  22301. if (this.uv2s) {
  22302. meshOrGeometry.updateVerticesData(BABYLON.VertexBuffer.UV2Kind, this.uv2s, updateExtends, makeItUnique);
  22303. }
  22304. if (this.colors) {
  22305. meshOrGeometry.updateVerticesData(BABYLON.VertexBuffer.ColorKind, this.colors, updateExtends, makeItUnique);
  22306. }
  22307. if (this.matricesIndices) {
  22308. meshOrGeometry.updateVerticesData(BABYLON.VertexBuffer.MatricesIndicesKind, this.matricesIndices, updateExtends, makeItUnique);
  22309. }
  22310. if (this.matricesWeights) {
  22311. meshOrGeometry.updateVerticesData(BABYLON.VertexBuffer.MatricesWeightsKind, this.matricesWeights, updateExtends, makeItUnique);
  22312. }
  22313. if (this.indices) {
  22314. meshOrGeometry.setIndices(this.indices);
  22315. }
  22316. };
  22317. VertexData.prototype.transform = function (matrix) {
  22318. var transformed = BABYLON.Vector3.Zero();
  22319. if (this.positions) {
  22320. var position = BABYLON.Vector3.Zero();
  22321. for (var index = 0; index < this.positions.length; index += 3) {
  22322. BABYLON.Vector3.FromArrayToRef(this.positions, index, position);
  22323. BABYLON.Vector3.TransformCoordinatesToRef(position, matrix, transformed);
  22324. this.positions[index] = transformed.x;
  22325. this.positions[index + 1] = transformed.y;
  22326. this.positions[index + 2] = transformed.z;
  22327. }
  22328. }
  22329. if (this.normals) {
  22330. var normal = BABYLON.Vector3.Zero();
  22331. for (index = 0; index < this.normals.length; index += 3) {
  22332. BABYLON.Vector3.FromArrayToRef(this.normals, index, normal);
  22333. BABYLON.Vector3.TransformNormalToRef(normal, matrix, transformed);
  22334. this.normals[index] = transformed.x;
  22335. this.normals[index + 1] = transformed.y;
  22336. this.normals[index + 2] = transformed.z;
  22337. }
  22338. }
  22339. };
  22340. VertexData.prototype.merge = function (other) {
  22341. if (other.indices) {
  22342. if (!this.indices) {
  22343. this.indices = [];
  22344. }
  22345. var offset = this.positions ? this.positions.length / 3 : 0;
  22346. for (var index = 0; index < other.indices.length; index++) {
  22347. this.indices.push(other.indices[index] + offset);
  22348. }
  22349. }
  22350. if (other.positions) {
  22351. if (!this.positions) {
  22352. this.positions = [];
  22353. }
  22354. for (index = 0; index < other.positions.length; index++) {
  22355. this.positions.push(other.positions[index]);
  22356. }
  22357. }
  22358. if (other.normals) {
  22359. if (!this.normals) {
  22360. this.normals = [];
  22361. }
  22362. for (index = 0; index < other.normals.length; index++) {
  22363. this.normals.push(other.normals[index]);
  22364. }
  22365. }
  22366. if (other.uvs) {
  22367. if (!this.uvs) {
  22368. this.uvs = [];
  22369. }
  22370. for (index = 0; index < other.uvs.length; index++) {
  22371. this.uvs.push(other.uvs[index]);
  22372. }
  22373. }
  22374. if (other.uv2s) {
  22375. if (!this.uv2s) {
  22376. this.uv2s = [];
  22377. }
  22378. for (index = 0; index < other.uv2s.length; index++) {
  22379. this.uv2s.push(other.uv2s[index]);
  22380. }
  22381. }
  22382. if (other.matricesIndices) {
  22383. if (!this.matricesIndices) {
  22384. this.matricesIndices = [];
  22385. }
  22386. for (index = 0; index < other.matricesIndices.length; index++) {
  22387. this.matricesIndices.push(other.matricesIndices[index]);
  22388. }
  22389. }
  22390. if (other.matricesWeights) {
  22391. if (!this.matricesWeights) {
  22392. this.matricesWeights = [];
  22393. }
  22394. for (index = 0; index < other.matricesWeights.length; index++) {
  22395. this.matricesWeights.push(other.matricesWeights[index]);
  22396. }
  22397. }
  22398. if (other.colors) {
  22399. if (!this.colors) {
  22400. this.colors = [];
  22401. }
  22402. for (index = 0; index < other.colors.length; index++) {
  22403. this.colors.push(other.colors[index]);
  22404. }
  22405. }
  22406. };
  22407. // Statics
  22408. VertexData.ExtractFromMesh = function (mesh) {
  22409. return VertexData._ExtractFrom(mesh);
  22410. };
  22411. VertexData.ExtractFromGeometry = function (geometry) {
  22412. return VertexData._ExtractFrom(geometry);
  22413. };
  22414. VertexData._ExtractFrom = function (meshOrGeometry) {
  22415. var result = new VertexData();
  22416. if (meshOrGeometry.isVerticesDataPresent(BABYLON.VertexBuffer.PositionKind)) {
  22417. result.positions = meshOrGeometry.getVerticesData(BABYLON.VertexBuffer.PositionKind);
  22418. }
  22419. if (meshOrGeometry.isVerticesDataPresent(BABYLON.VertexBuffer.NormalKind)) {
  22420. result.normals = meshOrGeometry.getVerticesData(BABYLON.VertexBuffer.NormalKind);
  22421. }
  22422. if (meshOrGeometry.isVerticesDataPresent(BABYLON.VertexBuffer.UVKind)) {
  22423. result.uvs = meshOrGeometry.getVerticesData(BABYLON.VertexBuffer.UVKind);
  22424. }
  22425. if (meshOrGeometry.isVerticesDataPresent(BABYLON.VertexBuffer.UV2Kind)) {
  22426. result.uv2s = meshOrGeometry.getVerticesData(BABYLON.VertexBuffer.UV2Kind);
  22427. }
  22428. if (meshOrGeometry.isVerticesDataPresent(BABYLON.VertexBuffer.ColorKind)) {
  22429. result.colors = meshOrGeometry.getVerticesData(BABYLON.VertexBuffer.ColorKind);
  22430. }
  22431. if (meshOrGeometry.isVerticesDataPresent(BABYLON.VertexBuffer.MatricesIndicesKind)) {
  22432. result.matricesIndices = meshOrGeometry.getVerticesData(BABYLON.VertexBuffer.MatricesIndicesKind);
  22433. }
  22434. if (meshOrGeometry.isVerticesDataPresent(BABYLON.VertexBuffer.MatricesWeightsKind)) {
  22435. result.matricesWeights = meshOrGeometry.getVerticesData(BABYLON.VertexBuffer.MatricesWeightsKind);
  22436. }
  22437. result.indices = meshOrGeometry.getIndices();
  22438. return result;
  22439. };
  22440. VertexData.CreateRibbon = function (pathArray, closeArray, closePath, offset, sideOrientation) {
  22441. if (sideOrientation === void 0) { sideOrientation = BABYLON.Mesh.DEFAULTSIDE; }
  22442. closeArray = closeArray || false;
  22443. closePath = closePath || false;
  22444. var defaultOffset = Math.floor(pathArray[0].length / 2);
  22445. offset = offset || defaultOffset;
  22446. offset = offset > defaultOffset ? defaultOffset : Math.floor(offset); // offset max allowed : defaultOffset
  22447. var positions = [];
  22448. var indices = [];
  22449. var normals = [];
  22450. var uvs = [];
  22451. var us = []; // us[path_id] = [uDist1, uDist2, uDist3 ... ] distances between points on path path_id
  22452. var vs = []; // vs[i] = [vDist1, vDist2, vDist3, ... ] distances between points i of consecutives paths from pathArray
  22453. var uTotalDistance = []; // uTotalDistance[p] : total distance of path p
  22454. var vTotalDistance = []; // vTotalDistance[i] : total distance between points i of first and last path from pathArray
  22455. var minlg; // minimal length among all paths from pathArray
  22456. var lg = []; // array of path lengths : nb of vertex per path
  22457. var idx = []; // array of path indexes : index of each path (first vertex) in positions array
  22458. var p; // path iterator
  22459. var i; // point iterator
  22460. var j; // point iterator
  22461. // if single path in pathArray
  22462. if (pathArray.length < 2) {
  22463. var ar1 = [];
  22464. var ar2 = [];
  22465. for (i = 0; i < pathArray[0].length - offset; i++) {
  22466. ar1.push(pathArray[0][i]);
  22467. ar2.push(pathArray[0][i + offset]);
  22468. }
  22469. pathArray = [ar1, ar2];
  22470. }
  22471. // positions and horizontal distances (u)
  22472. var idc = 0;
  22473. minlg = pathArray[0].length;
  22474. for (p = 0; p < pathArray.length; p++) {
  22475. uTotalDistance[p] = 0;
  22476. us[p] = [0];
  22477. var path = pathArray[p];
  22478. var l = path.length;
  22479. minlg = (minlg < l) ? minlg : l;
  22480. lg[p] = l;
  22481. idx[p] = idc;
  22482. j = 0;
  22483. while (j < l) {
  22484. positions.push(path[j].x, path[j].y, path[j].z);
  22485. if (j > 0) {
  22486. var vectlg = path[j].subtract(path[j - 1]).length();
  22487. var dist = vectlg + uTotalDistance[p];
  22488. us[p].push(dist);
  22489. uTotalDistance[p] = dist;
  22490. }
  22491. j++;
  22492. }
  22493. if (closePath) {
  22494. vectlg = path[0].subtract(path[j - 1]).length();
  22495. dist = vectlg + uTotalDistance[p];
  22496. uTotalDistance[p] = dist;
  22497. }
  22498. idc += l;
  22499. }
  22500. for (i = 0; i < minlg; i++) {
  22501. vTotalDistance[i] = 0;
  22502. vs[i] = [0];
  22503. var path1;
  22504. var path2;
  22505. for (p = 0; p < pathArray.length - 1; p++) {
  22506. path1 = pathArray[p];
  22507. path2 = pathArray[p + 1];
  22508. vectlg = path2[i].subtract(path1[i]).length();
  22509. dist = vectlg + vTotalDistance[i];
  22510. vs[i].push(dist);
  22511. vTotalDistance[i] = dist;
  22512. }
  22513. if (closeArray) {
  22514. path1 = pathArray[p];
  22515. path2 = pathArray[0];
  22516. vectlg = path2[i].subtract(path1[i]).length();
  22517. dist = vectlg + vTotalDistance[i];
  22518. vTotalDistance[i] = dist;
  22519. }
  22520. }
  22521. // uvs
  22522. var u;
  22523. var v;
  22524. for (p = 0; p < pathArray.length; p++) {
  22525. for (i = 0; i < minlg; i++) {
  22526. u = us[p][i] / uTotalDistance[p];
  22527. v = vs[i][p] / vTotalDistance[i];
  22528. uvs.push(u, v);
  22529. }
  22530. }
  22531. // indices
  22532. p = 0; // path index
  22533. var pi = 0; // positions array index
  22534. var l1 = lg[p] - 1; // path1 length
  22535. var l2 = lg[p + 1] - 1; // path2 length
  22536. var min = (l1 < l2) ? l1 : l2; // current path stop index
  22537. var shft = idx[1] - idx[0]; // shift
  22538. var path1nb = closeArray ? lg.length : lg.length - 1; // number of path1 to iterate
  22539. var t1; // two consecutive triangles, so 4 points : point1
  22540. var t2; // point2
  22541. var t3; // point3
  22542. var t4; // point4
  22543. while (pi <= min && p < path1nb) {
  22544. // draw two triangles between path1 (p1) and path2 (p2) : (p1.pi, p2.pi, p1.pi+1) and (p2.pi+1, p1.pi+1, p2.pi) clockwise
  22545. t1 = pi;
  22546. t2 = pi + shft;
  22547. t3 = pi + 1;
  22548. t4 = pi + shft + 1;
  22549. indices.push(pi, pi + shft, pi + 1);
  22550. indices.push(pi + shft + 1, pi + 1, pi + shft);
  22551. pi += 1;
  22552. if (pi === min) {
  22553. if (closePath) {
  22554. indices.push(pi, pi + shft, idx[p]);
  22555. indices.push(idx[p] + shft, idx[p], pi + shft);
  22556. t3 = idx[p];
  22557. t4 = idx[p] + shft;
  22558. }
  22559. p++;
  22560. if (p === lg.length - 1) {
  22561. shft = idx[0] - idx[p];
  22562. l1 = lg[p] - 1;
  22563. l2 = lg[0] - 1;
  22564. }
  22565. else {
  22566. shft = idx[p + 1] - idx[p];
  22567. l1 = lg[p] - 1;
  22568. l2 = lg[p + 1] - 1;
  22569. }
  22570. pi = idx[p];
  22571. min = (l1 < l2) ? l1 + pi : l2 + pi;
  22572. }
  22573. }
  22574. // normals
  22575. VertexData.ComputeNormals(positions, indices, normals);
  22576. // sides
  22577. VertexData._ComputeSides(sideOrientation, positions, indices, normals, uvs);
  22578. // Result
  22579. var vertexData = new VertexData();
  22580. vertexData.indices = indices;
  22581. vertexData.positions = positions;
  22582. vertexData.normals = normals;
  22583. vertexData.uvs = uvs;
  22584. return vertexData;
  22585. };
  22586. VertexData.CreateBox = function (size, sideOrientation) {
  22587. if (sideOrientation === void 0) { sideOrientation = BABYLON.Mesh.DEFAULTSIDE; }
  22588. var normalsSource = [
  22589. new BABYLON.Vector3(0, 0, 1),
  22590. new BABYLON.Vector3(0, 0, -1),
  22591. new BABYLON.Vector3(1, 0, 0),
  22592. new BABYLON.Vector3(-1, 0, 0),
  22593. new BABYLON.Vector3(0, 1, 0),
  22594. new BABYLON.Vector3(0, -1, 0)
  22595. ];
  22596. var indices = [];
  22597. var positions = [];
  22598. var normals = [];
  22599. var uvs = [];
  22600. size = size || 1;
  22601. for (var index = 0; index < normalsSource.length; index++) {
  22602. var normal = normalsSource[index];
  22603. // Get two vectors perpendicular to the face normal and to each other.
  22604. var side1 = new BABYLON.Vector3(normal.y, normal.z, normal.x);
  22605. var side2 = BABYLON.Vector3.Cross(normal, side1);
  22606. // Six indices (two triangles) per face.
  22607. var verticesLength = positions.length / 3;
  22608. indices.push(verticesLength);
  22609. indices.push(verticesLength + 1);
  22610. indices.push(verticesLength + 2);
  22611. indices.push(verticesLength);
  22612. indices.push(verticesLength + 2);
  22613. indices.push(verticesLength + 3);
  22614. // Four vertices per face.
  22615. var vertex = normal.subtract(side1).subtract(side2).scale(size / 2);
  22616. positions.push(vertex.x, vertex.y, vertex.z);
  22617. normals.push(normal.x, normal.y, normal.z);
  22618. uvs.push(1.0, 1.0);
  22619. vertex = normal.subtract(side1).add(side2).scale(size / 2);
  22620. positions.push(vertex.x, vertex.y, vertex.z);
  22621. normals.push(normal.x, normal.y, normal.z);
  22622. uvs.push(0.0, 1.0);
  22623. vertex = normal.add(side1).add(side2).scale(size / 2);
  22624. positions.push(vertex.x, vertex.y, vertex.z);
  22625. normals.push(normal.x, normal.y, normal.z);
  22626. uvs.push(0.0, 0.0);
  22627. vertex = normal.add(side1).subtract(side2).scale(size / 2);
  22628. positions.push(vertex.x, vertex.y, vertex.z);
  22629. normals.push(normal.x, normal.y, normal.z);
  22630. uvs.push(1.0, 0.0);
  22631. }
  22632. // sides
  22633. VertexData._ComputeSides(sideOrientation, positions, indices, normals, uvs);
  22634. // Result
  22635. var vertexData = new VertexData();
  22636. vertexData.indices = indices;
  22637. vertexData.positions = positions;
  22638. vertexData.normals = normals;
  22639. vertexData.uvs = uvs;
  22640. return vertexData;
  22641. };
  22642. VertexData.CreateSphere = function (segments, diameter, sideOrientation) {
  22643. if (sideOrientation === void 0) { sideOrientation = BABYLON.Mesh.DEFAULTSIDE; }
  22644. segments = segments || 32;
  22645. diameter = diameter || 1;
  22646. var radius = diameter / 2;
  22647. var totalZRotationSteps = 2 + segments;
  22648. var totalYRotationSteps = 2 * totalZRotationSteps;
  22649. var indices = [];
  22650. var positions = [];
  22651. var normals = [];
  22652. var uvs = [];
  22653. for (var zRotationStep = 0; zRotationStep <= totalZRotationSteps; zRotationStep++) {
  22654. var normalizedZ = zRotationStep / totalZRotationSteps;
  22655. var angleZ = (normalizedZ * Math.PI);
  22656. for (var yRotationStep = 0; yRotationStep <= totalYRotationSteps; yRotationStep++) {
  22657. var normalizedY = yRotationStep / totalYRotationSteps;
  22658. var angleY = normalizedY * Math.PI * 2;
  22659. var rotationZ = BABYLON.Matrix.RotationZ(-angleZ);
  22660. var rotationY = BABYLON.Matrix.RotationY(angleY);
  22661. var afterRotZ = BABYLON.Vector3.TransformCoordinates(BABYLON.Vector3.Up(), rotationZ);
  22662. var complete = BABYLON.Vector3.TransformCoordinates(afterRotZ, rotationY);
  22663. var vertex = complete.scale(radius);
  22664. var normal = BABYLON.Vector3.Normalize(vertex);
  22665. positions.push(vertex.x, vertex.y, vertex.z);
  22666. normals.push(normal.x, normal.y, normal.z);
  22667. uvs.push(normalizedZ, normalizedY);
  22668. }
  22669. if (zRotationStep > 0) {
  22670. var verticesCount = positions.length / 3;
  22671. for (var firstIndex = verticesCount - 2 * (totalYRotationSteps + 1); (firstIndex + totalYRotationSteps + 2) < verticesCount; firstIndex++) {
  22672. indices.push((firstIndex));
  22673. indices.push((firstIndex + 1));
  22674. indices.push(firstIndex + totalYRotationSteps + 1);
  22675. indices.push((firstIndex + totalYRotationSteps + 1));
  22676. indices.push((firstIndex + 1));
  22677. indices.push((firstIndex + totalYRotationSteps + 2));
  22678. }
  22679. }
  22680. }
  22681. // Sides
  22682. VertexData._ComputeSides(sideOrientation, positions, indices, normals, uvs);
  22683. // Result
  22684. var vertexData = new VertexData();
  22685. vertexData.indices = indices;
  22686. vertexData.positions = positions;
  22687. vertexData.normals = normals;
  22688. vertexData.uvs = uvs;
  22689. return vertexData;
  22690. };
  22691. VertexData.CreateCylinder = function (height, diameterTop, diameterBottom, tessellation, subdivisions, sideOrientation) {
  22692. if (subdivisions === void 0) { subdivisions = 1; }
  22693. if (sideOrientation === void 0) { sideOrientation = BABYLON.Mesh.DEFAULTSIDE; }
  22694. var radiusTop = diameterTop / 2;
  22695. var radiusBottom = diameterBottom / 2;
  22696. var indices = [];
  22697. var positions = [];
  22698. var normals = [];
  22699. var uvs = [];
  22700. height = height || 1;
  22701. diameterTop = diameterTop || 0.5;
  22702. diameterBottom = diameterBottom || 1;
  22703. tessellation = tessellation || 16;
  22704. subdivisions = subdivisions || 1;
  22705. subdivisions = (subdivisions < 1) ? 1 : subdivisions;
  22706. var getCircleVector = function (i) {
  22707. var angle = (i * 2.0 * Math.PI / tessellation);
  22708. var dx = Math.cos(angle);
  22709. var dz = Math.sin(angle);
  22710. return new BABYLON.Vector3(dx, 0, dz);
  22711. };
  22712. var createCylinderCap = function (isTop) {
  22713. var radius = isTop ? radiusTop : radiusBottom;
  22714. if (radius === 0) {
  22715. return;
  22716. }
  22717. var vbase = positions.length / 3;
  22718. var offset = new BABYLON.Vector3(0, height / 2, 0);
  22719. var textureScale = new BABYLON.Vector2(0.5, 0.5);
  22720. if (!isTop) {
  22721. offset.scaleInPlace(-1);
  22722. textureScale.x = -textureScale.x;
  22723. }
  22724. for (var i = 0; i < tessellation; i++) {
  22725. var circleVector = getCircleVector(i);
  22726. var position = circleVector.scale(radius).add(offset);
  22727. var textureCoordinate = new BABYLON.Vector2(circleVector.x * textureScale.x + 0.5, circleVector.z * textureScale.y + 0.5);
  22728. positions.push(position.x, position.y, position.z);
  22729. uvs.push(textureCoordinate.x, textureCoordinate.y);
  22730. }
  22731. for (i = 0; i < tessellation - 2; i++) {
  22732. if (!isTop) {
  22733. indices.push(vbase);
  22734. indices.push(vbase + (i + 2) % tessellation);
  22735. indices.push(vbase + (i + 1) % tessellation);
  22736. }
  22737. else {
  22738. indices.push(vbase);
  22739. indices.push(vbase + (i + 1) % tessellation);
  22740. indices.push(vbase + (i + 2) % tessellation);
  22741. }
  22742. }
  22743. };
  22744. var base = new BABYLON.Vector3(0, -1, 0).scale(height / 2);
  22745. var offset = new BABYLON.Vector3(0, 1, 0).scale(height / subdivisions);
  22746. var stride = tessellation + 1;
  22747. for (var i = 0; i <= tessellation; i++) {
  22748. var circleVector = getCircleVector(i);
  22749. var textureCoordinate = new BABYLON.Vector2(i / tessellation, 0);
  22750. var position, radius = radiusBottom;
  22751. for (var s = 0; s <= subdivisions; s++) {
  22752. // Update variables
  22753. position = circleVector.scale(radius);
  22754. position.addInPlace(base.add(offset.scale(s)));
  22755. textureCoordinate.y += 1 / subdivisions;
  22756. radius += (radiusTop - radiusBottom) / subdivisions;
  22757. // Push in arrays
  22758. positions.push(position.x, position.y, position.z);
  22759. uvs.push(textureCoordinate.x, textureCoordinate.y);
  22760. }
  22761. }
  22762. subdivisions += 1;
  22763. for (s = 0; s < subdivisions - 1; s++) {
  22764. for (i = 0; i <= tessellation; i++) {
  22765. indices.push(i * subdivisions + s);
  22766. indices.push((i * subdivisions + (s + subdivisions)) % (stride * subdivisions));
  22767. indices.push(i * subdivisions + (s + 1));
  22768. indices.push(i * subdivisions + (s + 1));
  22769. indices.push((i * subdivisions + (s + subdivisions)) % (stride * subdivisions));
  22770. indices.push((i * subdivisions + (s + subdivisions + 1)) % (stride * subdivisions));
  22771. }
  22772. }
  22773. // Create flat triangle fan caps to seal the top and bottom.
  22774. createCylinderCap(true);
  22775. createCylinderCap(false);
  22776. // Normals
  22777. VertexData.ComputeNormals(positions, indices, normals);
  22778. // Sides
  22779. VertexData._ComputeSides(sideOrientation, positions, indices, normals, uvs);
  22780. // Result
  22781. var vertexData = new VertexData();
  22782. vertexData.indices = indices;
  22783. vertexData.positions = positions;
  22784. vertexData.normals = normals;
  22785. vertexData.uvs = uvs;
  22786. return vertexData;
  22787. };
  22788. VertexData.CreateTorus = function (diameter, thickness, tessellation, sideOrientation) {
  22789. if (sideOrientation === void 0) { sideOrientation = BABYLON.Mesh.DEFAULTSIDE; }
  22790. var indices = [];
  22791. var positions = [];
  22792. var normals = [];
  22793. var uvs = [];
  22794. diameter = diameter || 1;
  22795. thickness = thickness || 0.5;
  22796. tessellation = tessellation || 16;
  22797. var stride = tessellation + 1;
  22798. for (var i = 0; i <= tessellation; i++) {
  22799. var u = i / tessellation;
  22800. var outerAngle = i * Math.PI * 2.0 / tessellation - Math.PI / 2.0;
  22801. var transform = BABYLON.Matrix.Translation(diameter / 2.0, 0, 0).multiply(BABYLON.Matrix.RotationY(outerAngle));
  22802. for (var j = 0; j <= tessellation; j++) {
  22803. var v = 1 - j / tessellation;
  22804. var innerAngle = j * Math.PI * 2.0 / tessellation + Math.PI;
  22805. var dx = Math.cos(innerAngle);
  22806. var dy = Math.sin(innerAngle);
  22807. // Create a vertex.
  22808. var normal = new BABYLON.Vector3(dx, dy, 0);
  22809. var position = normal.scale(thickness / 2);
  22810. var textureCoordinate = new BABYLON.Vector2(u, v);
  22811. position = BABYLON.Vector3.TransformCoordinates(position, transform);
  22812. normal = BABYLON.Vector3.TransformNormal(normal, transform);
  22813. positions.push(position.x, position.y, position.z);
  22814. normals.push(normal.x, normal.y, normal.z);
  22815. uvs.push(textureCoordinate.x, textureCoordinate.y);
  22816. // And create indices for two triangles.
  22817. var nextI = (i + 1) % stride;
  22818. var nextJ = (j + 1) % stride;
  22819. indices.push(i * stride + j);
  22820. indices.push(i * stride + nextJ);
  22821. indices.push(nextI * stride + j);
  22822. indices.push(i * stride + nextJ);
  22823. indices.push(nextI * stride + nextJ);
  22824. indices.push(nextI * stride + j);
  22825. }
  22826. }
  22827. // Sides
  22828. VertexData._ComputeSides(sideOrientation, positions, indices, normals, uvs);
  22829. // Result
  22830. var vertexData = new VertexData();
  22831. vertexData.indices = indices;
  22832. vertexData.positions = positions;
  22833. vertexData.normals = normals;
  22834. vertexData.uvs = uvs;
  22835. return vertexData;
  22836. };
  22837. VertexData.CreateLines = function (points) {
  22838. var indices = [];
  22839. var positions = [];
  22840. for (var index = 0; index < points.length; index++) {
  22841. positions.push(points[index].x, points[index].y, points[index].z);
  22842. if (index > 0) {
  22843. indices.push(index - 1);
  22844. indices.push(index);
  22845. }
  22846. }
  22847. // Result
  22848. var vertexData = new VertexData();
  22849. vertexData.indices = indices;
  22850. vertexData.positions = positions;
  22851. return vertexData;
  22852. };
  22853. VertexData.CreateGround = function (width, height, subdivisions) {
  22854. var indices = [];
  22855. var positions = [];
  22856. var normals = [];
  22857. var uvs = [];
  22858. var row, col;
  22859. width = width || 1;
  22860. height = height || 1;
  22861. subdivisions = subdivisions || 1;
  22862. for (row = 0; row <= subdivisions; row++) {
  22863. for (col = 0; col <= subdivisions; col++) {
  22864. var position = new BABYLON.Vector3((col * width) / subdivisions - (width / 2.0), 0, ((subdivisions - row) * height) / subdivisions - (height / 2.0));
  22865. var normal = new BABYLON.Vector3(0, 1.0, 0);
  22866. positions.push(position.x, position.y, position.z);
  22867. normals.push(normal.x, normal.y, normal.z);
  22868. uvs.push(col / subdivisions, 1.0 - row / subdivisions);
  22869. }
  22870. }
  22871. for (row = 0; row < subdivisions; row++) {
  22872. for (col = 0; col < subdivisions; col++) {
  22873. indices.push(col + 1 + (row + 1) * (subdivisions + 1));
  22874. indices.push(col + 1 + row * (subdivisions + 1));
  22875. indices.push(col + row * (subdivisions + 1));
  22876. indices.push(col + (row + 1) * (subdivisions + 1));
  22877. indices.push(col + 1 + (row + 1) * (subdivisions + 1));
  22878. indices.push(col + row * (subdivisions + 1));
  22879. }
  22880. }
  22881. // Result
  22882. var vertexData = new VertexData();
  22883. vertexData.indices = indices;
  22884. vertexData.positions = positions;
  22885. vertexData.normals = normals;
  22886. vertexData.uvs = uvs;
  22887. return vertexData;
  22888. };
  22889. VertexData.CreateTiledGround = function (xmin, zmin, xmax, zmax, subdivisions, precision) {
  22890. if (subdivisions === void 0) { subdivisions = { w: 1, h: 1 }; }
  22891. if (precision === void 0) { precision = { w: 1, h: 1 }; }
  22892. var indices = [];
  22893. var positions = [];
  22894. var normals = [];
  22895. var uvs = [];
  22896. var row, col, tileRow, tileCol;
  22897. subdivisions.h = (subdivisions.w < 1) ? 1 : subdivisions.h;
  22898. subdivisions.w = (subdivisions.w < 1) ? 1 : subdivisions.w;
  22899. precision.w = (precision.w < 1) ? 1 : precision.w;
  22900. precision.h = (precision.h < 1) ? 1 : precision.h;
  22901. var tileSize = {
  22902. 'w': (xmax - xmin) / subdivisions.w,
  22903. 'h': (zmax - zmin) / subdivisions.h
  22904. };
  22905. function applyTile(xTileMin, zTileMin, xTileMax, zTileMax) {
  22906. // Indices
  22907. var base = positions.length / 3;
  22908. var rowLength = precision.w + 1;
  22909. for (row = 0; row < precision.h; row++) {
  22910. for (col = 0; col < precision.w; col++) {
  22911. var square = [
  22912. base + col + row * rowLength,
  22913. base + (col + 1) + row * rowLength,
  22914. base + (col + 1) + (row + 1) * rowLength,
  22915. base + col + (row + 1) * rowLength
  22916. ];
  22917. indices.push(square[1]);
  22918. indices.push(square[2]);
  22919. indices.push(square[3]);
  22920. indices.push(square[0]);
  22921. indices.push(square[1]);
  22922. indices.push(square[3]);
  22923. }
  22924. }
  22925. // Position, normals and uvs
  22926. var position = BABYLON.Vector3.Zero();
  22927. var normal = new BABYLON.Vector3(0, 1.0, 0);
  22928. for (row = 0; row <= precision.h; row++) {
  22929. position.z = (row * (zTileMax - zTileMin)) / precision.h + zTileMin;
  22930. for (col = 0; col <= precision.w; col++) {
  22931. position.x = (col * (xTileMax - xTileMin)) / precision.w + xTileMin;
  22932. position.y = 0;
  22933. positions.push(position.x, position.y, position.z);
  22934. normals.push(normal.x, normal.y, normal.z);
  22935. uvs.push(col / precision.w, row / precision.h);
  22936. }
  22937. }
  22938. }
  22939. for (tileRow = 0; tileRow < subdivisions.h; tileRow++) {
  22940. for (tileCol = 0; tileCol < subdivisions.w; tileCol++) {
  22941. applyTile(xmin + tileCol * tileSize.w, zmin + tileRow * tileSize.h, xmin + (tileCol + 1) * tileSize.w, zmin + (tileRow + 1) * tileSize.h);
  22942. }
  22943. }
  22944. // Result
  22945. var vertexData = new VertexData();
  22946. vertexData.indices = indices;
  22947. vertexData.positions = positions;
  22948. vertexData.normals = normals;
  22949. vertexData.uvs = uvs;
  22950. return vertexData;
  22951. };
  22952. VertexData.CreateGroundFromHeightMap = function (width, height, subdivisions, minHeight, maxHeight, buffer, bufferWidth, bufferHeight) {
  22953. var indices = [];
  22954. var positions = [];
  22955. var normals = [];
  22956. var uvs = [];
  22957. var row, col;
  22958. for (row = 0; row <= subdivisions; row++) {
  22959. for (col = 0; col <= subdivisions; col++) {
  22960. var position = new BABYLON.Vector3((col * width) / subdivisions - (width / 2.0), 0, ((subdivisions - row) * height) / subdivisions - (height / 2.0));
  22961. // Compute height
  22962. var heightMapX = (((position.x + width / 2) / width) * (bufferWidth - 1)) | 0;
  22963. var heightMapY = ((1.0 - (position.z + height / 2) / height) * (bufferHeight - 1)) | 0;
  22964. var pos = (heightMapX + heightMapY * bufferWidth) * 4;
  22965. var r = buffer[pos] / 255.0;
  22966. var g = buffer[pos + 1] / 255.0;
  22967. var b = buffer[pos + 2] / 255.0;
  22968. var gradient = r * 0.3 + g * 0.59 + b * 0.11;
  22969. position.y = minHeight + (maxHeight - minHeight) * gradient;
  22970. // Add vertex
  22971. positions.push(position.x, position.y, position.z);
  22972. normals.push(0, 0, 0);
  22973. uvs.push(col / subdivisions, 1.0 - row / subdivisions);
  22974. }
  22975. }
  22976. for (row = 0; row < subdivisions; row++) {
  22977. for (col = 0; col < subdivisions; col++) {
  22978. indices.push(col + 1 + (row + 1) * (subdivisions + 1));
  22979. indices.push(col + 1 + row * (subdivisions + 1));
  22980. indices.push(col + row * (subdivisions + 1));
  22981. indices.push(col + (row + 1) * (subdivisions + 1));
  22982. indices.push(col + 1 + (row + 1) * (subdivisions + 1));
  22983. indices.push(col + row * (subdivisions + 1));
  22984. }
  22985. }
  22986. // Normals
  22987. VertexData.ComputeNormals(positions, indices, normals);
  22988. // Result
  22989. var vertexData = new VertexData();
  22990. vertexData.indices = indices;
  22991. vertexData.positions = positions;
  22992. vertexData.normals = normals;
  22993. vertexData.uvs = uvs;
  22994. return vertexData;
  22995. };
  22996. VertexData.CreatePlane = function (size, sideOrientation) {
  22997. if (sideOrientation === void 0) { sideOrientation = BABYLON.Mesh.DEFAULTSIDE; }
  22998. var indices = [];
  22999. var positions = [];
  23000. var normals = [];
  23001. var uvs = [];
  23002. size = size || 1;
  23003. // Vertices
  23004. var halfSize = size / 2.0;
  23005. positions.push(-halfSize, -halfSize, 0);
  23006. normals.push(0, 0, -1.0);
  23007. uvs.push(0.0, 0.0);
  23008. positions.push(halfSize, -halfSize, 0);
  23009. normals.push(0, 0, -1.0);
  23010. uvs.push(1.0, 0.0);
  23011. positions.push(halfSize, halfSize, 0);
  23012. normals.push(0, 0, -1.0);
  23013. uvs.push(1.0, 1.0);
  23014. positions.push(-halfSize, halfSize, 0);
  23015. normals.push(0, 0, -1.0);
  23016. uvs.push(0.0, 1.0);
  23017. // Indices
  23018. indices.push(0);
  23019. indices.push(1);
  23020. indices.push(2);
  23021. indices.push(0);
  23022. indices.push(2);
  23023. indices.push(3);
  23024. // Sides
  23025. VertexData._ComputeSides(sideOrientation, positions, indices, normals, uvs);
  23026. // Result
  23027. var vertexData = new VertexData();
  23028. vertexData.indices = indices;
  23029. vertexData.positions = positions;
  23030. vertexData.normals = normals;
  23031. vertexData.uvs = uvs;
  23032. return vertexData;
  23033. };
  23034. VertexData.CreateDisc = function (radius, tessellation, sideOrientation) {
  23035. if (sideOrientation === void 0) { sideOrientation = BABYLON.Mesh.DEFAULTSIDE; }
  23036. var positions = [];
  23037. var indices = [];
  23038. var normals = [];
  23039. var uvs = [];
  23040. // positions and uvs
  23041. positions.push(0, 0, 0); // disc center first
  23042. uvs.push(0.5, 0.5);
  23043. var step = Math.PI * 2 / tessellation;
  23044. for (var a = 0; a < Math.PI * 2; a += step) {
  23045. var x = Math.cos(a);
  23046. var y = Math.sin(a);
  23047. var u = (x + 1) / 2;
  23048. var v = (1 - y) / 2;
  23049. positions.push(radius * x, radius * y, 0);
  23050. uvs.push(u, v);
  23051. }
  23052. positions.push(positions[3], positions[4], positions[5]); // close the circle
  23053. uvs.push(uvs[2], uvs[3]);
  23054. //indices
  23055. var vertexNb = positions.length / 3;
  23056. for (var i = 1; i < vertexNb - 1; i++) {
  23057. indices.push(i + 1, 0, i);
  23058. }
  23059. // result
  23060. VertexData.ComputeNormals(positions, indices, normals);
  23061. VertexData._ComputeSides(sideOrientation, positions, indices, normals, uvs);
  23062. var vertexData = new VertexData();
  23063. vertexData.indices = indices;
  23064. vertexData.positions = positions;
  23065. vertexData.normals = normals;
  23066. vertexData.uvs = uvs;
  23067. return vertexData;
  23068. };
  23069. // based on http://code.google.com/p/away3d/source/browse/trunk/fp10/Away3D/src/away3d/primitives/TorusKnot.as?spec=svn2473&r=2473
  23070. VertexData.CreateTorusKnot = function (radius, tube, radialSegments, tubularSegments, p, q, sideOrientation) {
  23071. if (sideOrientation === void 0) { sideOrientation = BABYLON.Mesh.DEFAULTSIDE; }
  23072. var indices = [];
  23073. var positions = [];
  23074. var normals = [];
  23075. var uvs = [];
  23076. radius = radius || 2;
  23077. tube = tube || 0.5;
  23078. radialSegments = radialSegments || 32;
  23079. tubularSegments = tubularSegments || 32;
  23080. p = p || 2;
  23081. q = q || 3;
  23082. // Helper
  23083. var getPos = function (angle) {
  23084. var cu = Math.cos(angle);
  23085. var su = Math.sin(angle);
  23086. var quOverP = q / p * angle;
  23087. var cs = Math.cos(quOverP);
  23088. var tx = radius * (2 + cs) * 0.5 * cu;
  23089. var ty = radius * (2 + cs) * su * 0.5;
  23090. var tz = radius * Math.sin(quOverP) * 0.5;
  23091. return new BABYLON.Vector3(tx, ty, tz);
  23092. };
  23093. for (var i = 0; i <= radialSegments; i++) {
  23094. var modI = i % radialSegments;
  23095. var u = modI / radialSegments * 2 * p * Math.PI;
  23096. var p1 = getPos(u);
  23097. var p2 = getPos(u + 0.01);
  23098. var tang = p2.subtract(p1);
  23099. var n = p2.add(p1);
  23100. var bitan = BABYLON.Vector3.Cross(tang, n);
  23101. n = BABYLON.Vector3.Cross(bitan, tang);
  23102. bitan.normalize();
  23103. n.normalize();
  23104. for (var j = 0; j < tubularSegments; j++) {
  23105. var modJ = j % tubularSegments;
  23106. var v = modJ / tubularSegments * 2 * Math.PI;
  23107. var cx = -tube * Math.cos(v);
  23108. var cy = tube * Math.sin(v);
  23109. positions.push(p1.x + cx * n.x + cy * bitan.x);
  23110. positions.push(p1.y + cx * n.y + cy * bitan.y);
  23111. positions.push(p1.z + cx * n.z + cy * bitan.z);
  23112. uvs.push(i / radialSegments);
  23113. uvs.push(j / tubularSegments);
  23114. }
  23115. }
  23116. for (i = 0; i < radialSegments; i++) {
  23117. for (j = 0; j < tubularSegments; j++) {
  23118. var jNext = (j + 1) % tubularSegments;
  23119. var a = i * tubularSegments + j;
  23120. var b = (i + 1) * tubularSegments + j;
  23121. var c = (i + 1) * tubularSegments + jNext;
  23122. var d = i * tubularSegments + jNext;
  23123. indices.push(d);
  23124. indices.push(b);
  23125. indices.push(a);
  23126. indices.push(d);
  23127. indices.push(c);
  23128. indices.push(b);
  23129. }
  23130. }
  23131. // Normals
  23132. VertexData.ComputeNormals(positions, indices, normals);
  23133. // Sides
  23134. VertexData._ComputeSides(sideOrientation, positions, indices, normals, uvs);
  23135. // Result
  23136. var vertexData = new VertexData();
  23137. vertexData.indices = indices;
  23138. vertexData.positions = positions;
  23139. vertexData.normals = normals;
  23140. vertexData.uvs = uvs;
  23141. return vertexData;
  23142. };
  23143. // Tools
  23144. /**
  23145. * @param {any} - positions (number[] or Float32Array)
  23146. * @param {any} - indices (number[] or Uint16Array)
  23147. * @param {any} - normals (number[] or Float32Array)
  23148. */
  23149. VertexData.ComputeNormals = function (positions, indices, normals) {
  23150. var positionVectors = [];
  23151. var facesOfVertices = [];
  23152. var index;
  23153. for (index = 0; index < positions.length; index += 3) {
  23154. var vector3 = new BABYLON.Vector3(positions[index], positions[index + 1], positions[index + 2]);
  23155. positionVectors.push(vector3);
  23156. facesOfVertices.push([]);
  23157. }
  23158. // Compute normals
  23159. var facesNormals = [];
  23160. for (index = 0; index < indices.length / 3; index++) {
  23161. var i1 = indices[index * 3];
  23162. var i2 = indices[index * 3 + 1];
  23163. var i3 = indices[index * 3 + 2];
  23164. var p1 = positionVectors[i1];
  23165. var p2 = positionVectors[i2];
  23166. var p3 = positionVectors[i3];
  23167. var p1p2 = p1.subtract(p2);
  23168. var p3p2 = p3.subtract(p2);
  23169. facesNormals[index] = BABYLON.Vector3.Normalize(BABYLON.Vector3.Cross(p1p2, p3p2));
  23170. facesOfVertices[i1].push(index);
  23171. facesOfVertices[i2].push(index);
  23172. facesOfVertices[i3].push(index);
  23173. }
  23174. for (index = 0; index < positionVectors.length; index++) {
  23175. var faces = facesOfVertices[index];
  23176. var normal = BABYLON.Vector3.Zero();
  23177. for (var faceIndex = 0; faceIndex < faces.length; faceIndex++) {
  23178. normal.addInPlace(facesNormals[faces[faceIndex]]);
  23179. }
  23180. normal = BABYLON.Vector3.Normalize(normal.scale(1.0 / faces.length));
  23181. normals[index * 3] = normal.x;
  23182. normals[index * 3 + 1] = normal.y;
  23183. normals[index * 3 + 2] = normal.z;
  23184. }
  23185. };
  23186. VertexData._ComputeSides = function (sideOrientation, positions, indices, normals, uvs) {
  23187. var li = indices.length;
  23188. var ln = normals.length;
  23189. var i;
  23190. var n;
  23191. sideOrientation = sideOrientation || BABYLON.Mesh.DEFAULTSIDE;
  23192. switch (sideOrientation) {
  23193. case BABYLON.Mesh.FRONTSIDE:
  23194. break;
  23195. case BABYLON.Mesh.BACKSIDE:
  23196. var tmp;
  23197. for (i = 0; i < li; i += 3) {
  23198. tmp = indices[i];
  23199. indices[i] = indices[i + 2];
  23200. indices[i + 2] = tmp;
  23201. }
  23202. for (n = 0; n < ln; n++) {
  23203. normals[n] = -normals[n];
  23204. }
  23205. break;
  23206. case BABYLON.Mesh.DOUBLESIDE:
  23207. // positions
  23208. var lp = positions.length;
  23209. var l = lp / 3;
  23210. for (var p = 0; p < lp; p++) {
  23211. positions[lp + p] = positions[p];
  23212. }
  23213. for (i = 0; i < li; i += 3) {
  23214. indices[i + li] = indices[i + 2] + l;
  23215. indices[i + 1 + li] = indices[i + 1] + l;
  23216. indices[i + 2 + li] = indices[i] + l;
  23217. }
  23218. for (n = 0; n < ln; n++) {
  23219. normals[ln + n] = -normals[n];
  23220. }
  23221. // uvs
  23222. var lu = uvs.length;
  23223. for (var u = 0; u < lu; u++) {
  23224. uvs[u + lu] = uvs[u];
  23225. }
  23226. break;
  23227. }
  23228. };
  23229. return VertexData;
  23230. })();
  23231. BABYLON.VertexData = VertexData;
  23232. })(BABYLON || (BABYLON = {}));
  23233. //# sourceMappingURL=babylon.mesh.vertexData.js.map
  23234. var BABYLON;
  23235. (function (BABYLON) {
  23236. var buildCamera = function (that, name) {
  23237. that._leftCamera.isIntermediate = true;
  23238. that.subCameras.push(that._leftCamera);
  23239. that.subCameras.push(that._rightCamera);
  23240. that._leftTexture = new BABYLON.PassPostProcess(name + "_leftTexture", 1.0, that._leftCamera);
  23241. that._anaglyphPostProcess = new BABYLON.AnaglyphPostProcess(name + "_anaglyph", 1.0, that._rightCamera);
  23242. that._anaglyphPostProcess.onApply = function (effect) {
  23243. effect.setTextureFromPostProcess("leftSampler", that._leftTexture);
  23244. };
  23245. that._update();
  23246. };
  23247. var AnaglyphArcRotateCamera = (function (_super) {
  23248. __extends(AnaglyphArcRotateCamera, _super);
  23249. // ANY
  23250. function AnaglyphArcRotateCamera(name, alpha, beta, radius, target, eyeSpace, scene) {
  23251. _super.call(this, name, alpha, beta, radius, target, scene);
  23252. this._eyeSpace = BABYLON.Tools.ToRadians(eyeSpace);
  23253. this._leftCamera = new BABYLON.ArcRotateCamera(name + "_left", alpha - this._eyeSpace, beta, radius, target, scene);
  23254. this._rightCamera = new BABYLON.ArcRotateCamera(name + "_right", alpha + this._eyeSpace, beta, radius, target, scene);
  23255. buildCamera(this, name);
  23256. }
  23257. AnaglyphArcRotateCamera.prototype._update = function () {
  23258. this._updateCamera(this._leftCamera);
  23259. this._updateCamera(this._rightCamera);
  23260. this._leftCamera.alpha = this.alpha - this._eyeSpace;
  23261. this._rightCamera.alpha = this.alpha + this._eyeSpace;
  23262. _super.prototype._update.call(this);
  23263. };
  23264. AnaglyphArcRotateCamera.prototype._updateCamera = function (camera) {
  23265. camera.beta = this.beta;
  23266. camera.radius = this.radius;
  23267. camera.minZ = this.minZ;
  23268. camera.maxZ = this.maxZ;
  23269. camera.fov = this.fov;
  23270. camera.target = this.target;
  23271. };
  23272. return AnaglyphArcRotateCamera;
  23273. })(BABYLON.ArcRotateCamera);
  23274. BABYLON.AnaglyphArcRotateCamera = AnaglyphArcRotateCamera;
  23275. var AnaglyphFreeCamera = (function (_super) {
  23276. __extends(AnaglyphFreeCamera, _super);
  23277. function AnaglyphFreeCamera(name, position, eyeSpace, scene) {
  23278. _super.call(this, name, position, scene);
  23279. this._eyeSpace = BABYLON.Tools.ToRadians(eyeSpace);
  23280. this._transformMatrix = new BABYLON.Matrix();
  23281. this._leftCamera = new BABYLON.FreeCamera(name + "_left", position.clone(), scene);
  23282. this._rightCamera = new BABYLON.FreeCamera(name + "_right", position.clone(), scene);
  23283. buildCamera(this, name);
  23284. }
  23285. AnaglyphFreeCamera.prototype._getSubCameraPosition = function (eyeSpace, result) {
  23286. var target = this.getTarget();
  23287. BABYLON.Matrix.Translation(-target.x, -target.y, -target.z).multiplyToRef(BABYLON.Matrix.RotationY(eyeSpace), this._transformMatrix);
  23288. this._transformMatrix = this._transformMatrix.multiply(BABYLON.Matrix.Translation(target.x, target.y, target.z));
  23289. BABYLON.Vector3.TransformCoordinatesToRef(this.position, this._transformMatrix, result);
  23290. };
  23291. AnaglyphFreeCamera.prototype._update = function () {
  23292. this._getSubCameraPosition(-this._eyeSpace, this._leftCamera.position);
  23293. this._getSubCameraPosition(this._eyeSpace, this._rightCamera.position);
  23294. this._updateCamera(this._leftCamera);
  23295. this._updateCamera(this._rightCamera);
  23296. _super.prototype._update.call(this);
  23297. };
  23298. AnaglyphFreeCamera.prototype._updateCamera = function (camera) {
  23299. camera.minZ = this.minZ;
  23300. camera.maxZ = this.maxZ;
  23301. camera.fov = this.fov;
  23302. camera.viewport = this.viewport;
  23303. camera.setTarget(this.getTarget());
  23304. };
  23305. return AnaglyphFreeCamera;
  23306. })(BABYLON.FreeCamera);
  23307. BABYLON.AnaglyphFreeCamera = AnaglyphFreeCamera;
  23308. })(BABYLON || (BABYLON = {}));
  23309. //# sourceMappingURL=babylon.anaglyphCamera.js.map
  23310. var BABYLON;
  23311. (function (BABYLON) {
  23312. var AnaglyphPostProcess = (function (_super) {
  23313. __extends(AnaglyphPostProcess, _super);
  23314. function AnaglyphPostProcess(name, ratio, camera, samplingMode, engine, reusable) {
  23315. _super.call(this, name, "anaglyph", null, ["leftSampler"], ratio, camera, samplingMode, engine, reusable);
  23316. }
  23317. return AnaglyphPostProcess;
  23318. })(BABYLON.PostProcess);
  23319. BABYLON.AnaglyphPostProcess = AnaglyphPostProcess;
  23320. })(BABYLON || (BABYLON = {}));
  23321. //# sourceMappingURL=babylon.anaglyphPostProcess.js.mapvar BABYLON;
  23322. (function (BABYLON) {
  23323. var Tags = (function () {
  23324. function Tags() {
  23325. }
  23326. Tags.EnableFor = function (obj) {
  23327. obj._tags = obj._tags || {};
  23328. obj.hasTags = function () {
  23329. return Tags.HasTags(obj);
  23330. };
  23331. obj.addTags = function (tagsString) {
  23332. return Tags.AddTagsTo(obj, tagsString);
  23333. };
  23334. obj.removeTags = function (tagsString) {
  23335. return Tags.RemoveTagsFrom(obj, tagsString);
  23336. };
  23337. obj.matchesTagsQuery = function (tagsQuery) {
  23338. return Tags.MatchesQuery(obj, tagsQuery);
  23339. };
  23340. };
  23341. Tags.DisableFor = function (obj) {
  23342. delete obj._tags;
  23343. delete obj.hasTags;
  23344. delete obj.addTags;
  23345. delete obj.removeTags;
  23346. delete obj.matchesTagsQuery;
  23347. };
  23348. Tags.HasTags = function (obj) {
  23349. if (!obj._tags) {
  23350. return false;
  23351. }
  23352. return !BABYLON.Tools.IsEmpty(obj._tags);
  23353. };
  23354. Tags.GetTags = function (obj) {
  23355. if (!obj._tags) {
  23356. return null;
  23357. }
  23358. return obj._tags;
  23359. };
  23360. // the tags 'true' and 'false' are reserved and cannot be used as tags
  23361. // a tag cannot start with '||', '&&', and '!'
  23362. // it cannot contain whitespaces
  23363. Tags.AddTagsTo = function (obj, tagsString) {
  23364. if (!tagsString) {
  23365. return;
  23366. }
  23367. var tags = tagsString.split(" ");
  23368. for (var t in tags) {
  23369. Tags._AddTagTo(obj, tags[t]);
  23370. }
  23371. };
  23372. Tags._AddTagTo = function (obj, tag) {
  23373. tag = tag.trim();
  23374. if (tag === "" || tag === "true" || tag === "false") {
  23375. return;
  23376. }
  23377. if (tag.match(/[\s]/) || tag.match(/^([!]|([|]|[&]){2})/)) {
  23378. return;
  23379. }
  23380. Tags.EnableFor(obj);
  23381. obj._tags[tag] = true;
  23382. };
  23383. Tags.RemoveTagsFrom = function (obj, tagsString) {
  23384. if (!Tags.HasTags(obj)) {
  23385. return;
  23386. }
  23387. var tags = tagsString.split(" ");
  23388. for (var t in tags) {
  23389. Tags._RemoveTagFrom(obj, tags[t]);
  23390. }
  23391. };
  23392. Tags._RemoveTagFrom = function (obj, tag) {
  23393. delete obj._tags[tag];
  23394. };
  23395. Tags.MatchesQuery = function (obj, tagsQuery) {
  23396. if (tagsQuery === undefined) {
  23397. return true;
  23398. }
  23399. if (tagsQuery === "") {
  23400. return Tags.HasTags(obj);
  23401. }
  23402. return BABYLON.Internals.AndOrNotEvaluator.Eval(tagsQuery, function (r) { return Tags.HasTags(obj) && obj._tags[r]; });
  23403. };
  23404. return Tags;
  23405. })();
  23406. BABYLON.Tags = Tags;
  23407. })(BABYLON || (BABYLON = {}));
  23408. //# sourceMappingURL=babylon.tags.js.mapvar BABYLON;
  23409. (function (BABYLON) {
  23410. var Internals;
  23411. (function (Internals) {
  23412. var AndOrNotEvaluator = (function () {
  23413. function AndOrNotEvaluator() {
  23414. }
  23415. AndOrNotEvaluator.Eval = function (query, evaluateCallback) {
  23416. if (!query.match(/\([^\(\)]*\)/g)) {
  23417. query = AndOrNotEvaluator._HandleParenthesisContent(query, evaluateCallback);
  23418. }
  23419. else {
  23420. query = query.replace(/\([^\(\)]*\)/g, function (r) {
  23421. // remove parenthesis
  23422. r = r.slice(1, r.length - 1);
  23423. return AndOrNotEvaluator._HandleParenthesisContent(r, evaluateCallback);
  23424. });
  23425. }
  23426. if (query === "true") {
  23427. return true;
  23428. }
  23429. if (query === "false") {
  23430. return false;
  23431. }
  23432. return AndOrNotEvaluator.Eval(query, evaluateCallback);
  23433. };
  23434. AndOrNotEvaluator._HandleParenthesisContent = function (parenthesisContent, evaluateCallback) {
  23435. evaluateCallback = evaluateCallback || (function (r) {
  23436. return r === "true" ? true : false;
  23437. });
  23438. var result;
  23439. var or = parenthesisContent.split("||");
  23440. for (var i in or) {
  23441. var ori = AndOrNotEvaluator._SimplifyNegation(or[i].trim());
  23442. var and = ori.split("&&");
  23443. if (and.length > 1) {
  23444. for (var j = 0; j < and.length; ++j) {
  23445. var andj = AndOrNotEvaluator._SimplifyNegation(and[j].trim());
  23446. if (andj !== "true" && andj !== "false") {
  23447. if (andj[0] === "!") {
  23448. result = !evaluateCallback(andj.substring(1));
  23449. }
  23450. else {
  23451. result = evaluateCallback(andj);
  23452. }
  23453. }
  23454. else {
  23455. result = andj === "true" ? true : false;
  23456. }
  23457. if (!result) {
  23458. ori = "false";
  23459. break;
  23460. }
  23461. }
  23462. }
  23463. if (result || ori === "true") {
  23464. result = true;
  23465. break;
  23466. }
  23467. // result equals false (or undefined)
  23468. if (ori !== "true" && ori !== "false") {
  23469. if (ori[0] === "!") {
  23470. result = !evaluateCallback(ori.substring(1));
  23471. }
  23472. else {
  23473. result = evaluateCallback(ori);
  23474. }
  23475. }
  23476. else {
  23477. result = ori === "true" ? true : false;
  23478. }
  23479. }
  23480. // the whole parenthesis scope is replaced by 'true' or 'false'
  23481. return result ? "true" : "false";
  23482. };
  23483. AndOrNotEvaluator._SimplifyNegation = function (booleanString) {
  23484. booleanString = booleanString.replace(/^[\s!]+/, function (r) {
  23485. // remove whitespaces
  23486. r = r.replace(/[\s]/g, function () { return ""; });
  23487. return r.length % 2 ? "!" : "";
  23488. });
  23489. booleanString = booleanString.trim();
  23490. if (booleanString === "!true") {
  23491. booleanString = "false";
  23492. }
  23493. else if (booleanString === "!false") {
  23494. booleanString = "true";
  23495. }
  23496. return booleanString;
  23497. };
  23498. return AndOrNotEvaluator;
  23499. })();
  23500. Internals.AndOrNotEvaluator = AndOrNotEvaluator;
  23501. })(Internals = BABYLON.Internals || (BABYLON.Internals = {}));
  23502. })(BABYLON || (BABYLON = {}));
  23503. //# sourceMappingURL=babylon.andOrNotEvaluator.js.mapvar BABYLON;
  23504. (function (BABYLON) {
  23505. var PostProcessRenderPass = (function () {
  23506. function PostProcessRenderPass(scene, name, size, renderList, beforeRender, afterRender) {
  23507. this._enabled = true;
  23508. this._refCount = 0;
  23509. this._name = name;
  23510. this._renderTexture = new BABYLON.RenderTargetTexture(name, size, scene);
  23511. this.setRenderList(renderList);
  23512. this._renderTexture.onBeforeRender = beforeRender;
  23513. this._renderTexture.onAfterRender = afterRender;
  23514. this._scene = scene;
  23515. this._renderList = renderList;
  23516. }
  23517. // private
  23518. PostProcessRenderPass.prototype._incRefCount = function () {
  23519. if (this._refCount === 0) {
  23520. this._scene.customRenderTargets.push(this._renderTexture);
  23521. }
  23522. return ++this._refCount;
  23523. };
  23524. PostProcessRenderPass.prototype._decRefCount = function () {
  23525. this._refCount--;
  23526. if (this._refCount <= 0) {
  23527. this._scene.customRenderTargets.splice(this._scene.customRenderTargets.indexOf(this._renderTexture), 1);
  23528. }
  23529. return this._refCount;
  23530. };
  23531. PostProcessRenderPass.prototype._update = function () {
  23532. this.setRenderList(this._renderList);
  23533. };
  23534. // public
  23535. PostProcessRenderPass.prototype.setRenderList = function (renderList) {
  23536. this._renderTexture.renderList = renderList;
  23537. };
  23538. PostProcessRenderPass.prototype.getRenderTexture = function () {
  23539. return this._renderTexture;
  23540. };
  23541. return PostProcessRenderPass;
  23542. })();
  23543. BABYLON.PostProcessRenderPass = PostProcessRenderPass;
  23544. })(BABYLON || (BABYLON = {}));
  23545. //# sourceMappingURL=babylon.postProcessRenderPass.js.mapvar BABYLON;
  23546. (function (BABYLON) {
  23547. var PostProcessRenderEffect = (function () {
  23548. function PostProcessRenderEffect(engine, name, getPostProcess, singleInstance) {
  23549. this._engine = engine;
  23550. this._name = name;
  23551. this._singleInstance = singleInstance || true;
  23552. this._getPostProcess = getPostProcess;
  23553. this._cameras = [];
  23554. this._indicesForCamera = [];
  23555. this._postProcesses = {};
  23556. this._renderPasses = {};
  23557. this._renderEffectAsPasses = {};
  23558. }
  23559. PostProcessRenderEffect.prototype._update = function () {
  23560. for (var renderPassName in this._renderPasses) {
  23561. this._renderPasses[renderPassName]._update();
  23562. }
  23563. };
  23564. PostProcessRenderEffect.prototype.addPass = function (renderPass) {
  23565. this._renderPasses[renderPass._name] = renderPass;
  23566. this._linkParameters();
  23567. };
  23568. PostProcessRenderEffect.prototype.removePass = function (renderPass) {
  23569. delete this._renderPasses[renderPass._name];
  23570. this._linkParameters();
  23571. };
  23572. PostProcessRenderEffect.prototype.addRenderEffectAsPass = function (renderEffect) {
  23573. this._renderEffectAsPasses[renderEffect._name] = renderEffect;
  23574. this._linkParameters();
  23575. };
  23576. PostProcessRenderEffect.prototype.getPass = function (passName) {
  23577. for (var renderPassName in this._renderPasses) {
  23578. if (renderPassName === passName) {
  23579. return this._renderPasses[passName];
  23580. }
  23581. }
  23582. };
  23583. PostProcessRenderEffect.prototype.emptyPasses = function () {
  23584. this._renderPasses = {};
  23585. this._linkParameters();
  23586. };
  23587. PostProcessRenderEffect.prototype._attachCameras = function (cameras) {
  23588. var cameraKey;
  23589. var _cam = BABYLON.Tools.MakeArray(cameras || this._cameras);
  23590. for (var i = 0; i < _cam.length; i++) {
  23591. var camera = _cam[i];
  23592. var cameraName = camera.name;
  23593. if (this._singleInstance) {
  23594. cameraKey = 0;
  23595. }
  23596. else {
  23597. cameraKey = cameraName;
  23598. }
  23599. this._postProcesses[cameraKey] = this._postProcesses[cameraKey] || this._getPostProcess();
  23600. var index = camera.attachPostProcess(this._postProcesses[cameraKey]);
  23601. if (!this._indicesForCamera[cameraName]) {
  23602. this._indicesForCamera[cameraName] = [];
  23603. }
  23604. this._indicesForCamera[cameraName].push(index);
  23605. if (this._cameras.indexOf(camera) === -1) {
  23606. this._cameras[cameraName] = camera;
  23607. }
  23608. for (var passName in this._renderPasses) {
  23609. this._renderPasses[passName]._incRefCount();
  23610. }
  23611. }
  23612. this._linkParameters();
  23613. };
  23614. PostProcessRenderEffect.prototype._detachCameras = function (cameras) {
  23615. var _cam = BABYLON.Tools.MakeArray(cameras || this._cameras);
  23616. for (var i = 0; i < _cam.length; i++) {
  23617. var camera = _cam[i];
  23618. var cameraName = camera.name;
  23619. camera.detachPostProcess(this._postProcesses[this._singleInstance ? 0 : cameraName], this._indicesForCamera[cameraName]);
  23620. var index = this._cameras.indexOf(cameraName);
  23621. this._indicesForCamera.splice(index, 1);
  23622. this._cameras.splice(index, 1);
  23623. for (var passName in this._renderPasses) {
  23624. this._renderPasses[passName]._decRefCount();
  23625. }
  23626. }
  23627. };
  23628. PostProcessRenderEffect.prototype._enable = function (cameras) {
  23629. var _cam = BABYLON.Tools.MakeArray(cameras || this._cameras);
  23630. for (var i = 0; i < _cam.length; i++) {
  23631. var camera = _cam[i];
  23632. var cameraName = camera.name;
  23633. for (var j = 0; j < this._indicesForCamera[cameraName].length; j++) {
  23634. if (camera._postProcesses[this._indicesForCamera[cameraName][j]] === undefined) {
  23635. cameras[i].attachPostProcess(this._postProcesses[this._singleInstance ? 0 : cameraName], this._indicesForCamera[cameraName][j]);
  23636. }
  23637. }
  23638. for (var passName in this._renderPasses) {
  23639. this._renderPasses[passName]._incRefCount();
  23640. }
  23641. }
  23642. };
  23643. PostProcessRenderEffect.prototype._disable = function (cameras) {
  23644. var _cam = BABYLON.Tools.MakeArray(cameras || this._cameras);
  23645. for (var i = 0; i < _cam.length; i++) {
  23646. var camera = _cam[i];
  23647. var cameraName = camera.Name;
  23648. camera.detachPostProcess(this._postProcesses[this._singleInstance ? 0 : cameraName], this._indicesForCamera[cameraName]);
  23649. for (var passName in this._renderPasses) {
  23650. this._renderPasses[passName]._decRefCount();
  23651. }
  23652. }
  23653. };
  23654. PostProcessRenderEffect.prototype.getPostProcess = function (camera) {
  23655. if (this._singleInstance) {
  23656. return this._postProcesses[0];
  23657. }
  23658. else {
  23659. return this._postProcesses[camera.name];
  23660. }
  23661. };
  23662. PostProcessRenderEffect.prototype._linkParameters = function () {
  23663. var _this = this;
  23664. for (var index in this._postProcesses) {
  23665. if (this.applyParameters) {
  23666. this.applyParameters(this._postProcesses[index]);
  23667. }
  23668. this._postProcesses[index].onBeforeRender = function (effect) {
  23669. _this._linkTextures(effect);
  23670. };
  23671. }
  23672. };
  23673. PostProcessRenderEffect.prototype._linkTextures = function (effect) {
  23674. for (var renderPassName in this._renderPasses) {
  23675. effect.setTexture(renderPassName, this._renderPasses[renderPassName].getRenderTexture());
  23676. }
  23677. for (var renderEffectName in this._renderEffectAsPasses) {
  23678. effect.setTextureFromPostProcess(renderEffectName + "Sampler", this._renderEffectAsPasses[renderEffectName].getPostProcess());
  23679. }
  23680. };
  23681. return PostProcessRenderEffect;
  23682. })();
  23683. BABYLON.PostProcessRenderEffect = PostProcessRenderEffect;
  23684. })(BABYLON || (BABYLON = {}));
  23685. //# sourceMappingURL=babylon.postProcessRenderEffect.js.mapvar BABYLON;
  23686. (function (BABYLON) {
  23687. var PostProcessRenderPipeline = (function () {
  23688. function PostProcessRenderPipeline(engine, name) {
  23689. this._engine = engine;
  23690. this._name = name;
  23691. this._renderEffects = {};
  23692. this._renderEffectsForIsolatedPass = {};
  23693. this._cameras = [];
  23694. }
  23695. PostProcessRenderPipeline.prototype.addEffect = function (renderEffect) {
  23696. this._renderEffects[renderEffect._name] = renderEffect;
  23697. };
  23698. PostProcessRenderPipeline.prototype._enableEffect = function (renderEffectName, cameras) {
  23699. var renderEffects = this._renderEffects[renderEffectName];
  23700. if (!renderEffects) {
  23701. return;
  23702. }
  23703. renderEffects._enable(BABYLON.Tools.MakeArray(cameras || this._cameras));
  23704. };
  23705. PostProcessRenderPipeline.prototype._disableEffect = function (renderEffectName, cameras) {
  23706. var renderEffects = this._renderEffects[renderEffectName];
  23707. if (!renderEffects) {
  23708. return;
  23709. }
  23710. renderEffects._disable(BABYLON.Tools.MakeArray(cameras || this._cameras));
  23711. };
  23712. PostProcessRenderPipeline.prototype._attachCameras = function (cameras, unique) {
  23713. var _cam = BABYLON.Tools.MakeArray(cameras || this._cameras);
  23714. var indicesToDelete = [];
  23715. for (var i = 0; i < _cam.length; i++) {
  23716. var camera = _cam[i];
  23717. var cameraName = camera.name;
  23718. if (this._cameras.indexOf(camera) === -1) {
  23719. this._cameras[cameraName] = camera;
  23720. }
  23721. else if (unique) {
  23722. indicesToDelete.push(i);
  23723. }
  23724. }
  23725. for (var i = 0; i < indicesToDelete.length; i++) {
  23726. cameras.splice(indicesToDelete[i], 1);
  23727. }
  23728. for (var renderEffectName in this._renderEffects) {
  23729. this._renderEffects[renderEffectName]._attachCameras(_cam);
  23730. }
  23731. };
  23732. PostProcessRenderPipeline.prototype._detachCameras = function (cameras) {
  23733. var _cam = BABYLON.Tools.MakeArray(cameras || this._cameras);
  23734. for (var renderEffectName in this._renderEffects) {
  23735. this._renderEffects[renderEffectName]._detachCameras(_cam);
  23736. }
  23737. for (var i = 0; i < _cam.length; i++) {
  23738. this._cameras.splice(this._cameras.indexOf(_cam[i]), 1);
  23739. }
  23740. };
  23741. PostProcessRenderPipeline.prototype._enableDisplayOnlyPass = function (passName, cameras) {
  23742. var _this = this;
  23743. var _cam = BABYLON.Tools.MakeArray(cameras || this._cameras);
  23744. var pass = null;
  23745. for (var renderEffectName in this._renderEffects) {
  23746. pass = this._renderEffects[renderEffectName].getPass(passName);
  23747. if (pass != null) {
  23748. break;
  23749. }
  23750. }
  23751. if (pass === null) {
  23752. return;
  23753. }
  23754. for (var renderEffectName in this._renderEffects) {
  23755. this._renderEffects[renderEffectName]._disable(_cam);
  23756. }
  23757. pass._name = PostProcessRenderPipeline.PASS_SAMPLER_NAME;
  23758. for (var i = 0; i < _cam.length; i++) {
  23759. var camera = _cam[i];
  23760. var cameraName = camera.name;
  23761. this._renderEffectsForIsolatedPass[cameraName] = this._renderEffectsForIsolatedPass[cameraName] || new BABYLON.PostProcessRenderEffect(this._engine, PostProcessRenderPipeline.PASS_EFFECT_NAME, function () {
  23762. return new BABYLON.DisplayPassPostProcess(PostProcessRenderPipeline.PASS_EFFECT_NAME, 1.0, null, null, _this._engine, true);
  23763. });
  23764. this._renderEffectsForIsolatedPass[cameraName].emptyPasses();
  23765. this._renderEffectsForIsolatedPass[cameraName].addPass(pass);
  23766. this._renderEffectsForIsolatedPass[cameraName]._attachCameras(camera);
  23767. }
  23768. };
  23769. PostProcessRenderPipeline.prototype._disableDisplayOnlyPass = function (cameras) {
  23770. var _this = this;
  23771. var _cam = BABYLON.Tools.MakeArray(cameras || this._cameras);
  23772. for (var i = 0; i < _cam.length; i++) {
  23773. var camera = _cam[i];
  23774. var cameraName = camera.name;
  23775. this._renderEffectsForIsolatedPass[cameraName] = this._renderEffectsForIsolatedPass[cameraName] || new BABYLON.PostProcessRenderEffect(this._engine, PostProcessRenderPipeline.PASS_EFFECT_NAME, function () {
  23776. return new BABYLON.DisplayPassPostProcess(PostProcessRenderPipeline.PASS_EFFECT_NAME, 1.0, null, null, _this._engine, true);
  23777. });
  23778. this._renderEffectsForIsolatedPass[cameraName]._disable(camera);
  23779. }
  23780. for (var renderEffectName in this._renderEffects) {
  23781. this._renderEffects[renderEffectName]._enable(_cam);
  23782. }
  23783. };
  23784. PostProcessRenderPipeline.prototype._update = function () {
  23785. for (var renderEffectName in this._renderEffects) {
  23786. this._renderEffects[renderEffectName]._update();
  23787. }
  23788. for (var i = 0; i < this._cameras.length; i++) {
  23789. var cameraName = this._cameras[i].name;
  23790. if (this._renderEffectsForIsolatedPass[cameraName]) {
  23791. this._renderEffectsForIsolatedPass[cameraName]._update();
  23792. }
  23793. }
  23794. };
  23795. PostProcessRenderPipeline.PASS_EFFECT_NAME = "passEffect";
  23796. PostProcessRenderPipeline.PASS_SAMPLER_NAME = "passSampler";
  23797. return PostProcessRenderPipeline;
  23798. })();
  23799. BABYLON.PostProcessRenderPipeline = PostProcessRenderPipeline;
  23800. })(BABYLON || (BABYLON = {}));
  23801. //# sourceMappingURL=babylon.postProcessRenderPipeline.js.mapvar BABYLON;
  23802. (function (BABYLON) {
  23803. var PostProcessRenderPipelineManager = (function () {
  23804. function PostProcessRenderPipelineManager() {
  23805. this._renderPipelines = {};
  23806. }
  23807. PostProcessRenderPipelineManager.prototype.addPipeline = function (renderPipeline) {
  23808. this._renderPipelines[renderPipeline._name] = renderPipeline;
  23809. };
  23810. PostProcessRenderPipelineManager.prototype.attachCamerasToRenderPipeline = function (renderPipelineName, cameras, unique) {
  23811. var renderPipeline = this._renderPipelines[renderPipelineName];
  23812. if (!renderPipeline) {
  23813. return;
  23814. }
  23815. renderPipeline._attachCameras(cameras, unique);
  23816. };
  23817. PostProcessRenderPipelineManager.prototype.detachCamerasFromRenderPipeline = function (renderPipelineName, cameras) {
  23818. var renderPipeline = this._renderPipelines[renderPipelineName];
  23819. if (!renderPipeline) {
  23820. return;
  23821. }
  23822. renderPipeline._detachCameras(cameras);
  23823. };
  23824. PostProcessRenderPipelineManager.prototype.enableEffectInPipeline = function (renderPipelineName, renderEffectName, cameras) {
  23825. var renderPipeline = this._renderPipelines[renderPipelineName];
  23826. if (!renderPipeline) {
  23827. return;
  23828. }
  23829. renderPipeline._enableEffect(renderEffectName, cameras);
  23830. };
  23831. PostProcessRenderPipelineManager.prototype.disableEffectInPipeline = function (renderPipelineName, renderEffectName, cameras) {
  23832. var renderPipeline = this._renderPipelines[renderPipelineName];
  23833. if (!renderPipeline) {
  23834. return;
  23835. }
  23836. renderPipeline._disableEffect(renderEffectName, cameras);
  23837. };
  23838. PostProcessRenderPipelineManager.prototype.enableDisplayOnlyPassInPipeline = function (renderPipelineName, passName, cameras) {
  23839. var renderPipeline = this._renderPipelines[renderPipelineName];
  23840. if (!renderPipeline) {
  23841. return;
  23842. }
  23843. renderPipeline._enableDisplayOnlyPass(passName, cameras);
  23844. };
  23845. PostProcessRenderPipelineManager.prototype.disableDisplayOnlyPassInPipeline = function (renderPipelineName, cameras) {
  23846. var renderPipeline = this._renderPipelines[renderPipelineName];
  23847. if (!renderPipeline) {
  23848. return;
  23849. }
  23850. renderPipeline._disableDisplayOnlyPass(cameras);
  23851. };
  23852. PostProcessRenderPipelineManager.prototype.update = function () {
  23853. for (var renderPipelineName in this._renderPipelines) {
  23854. this._renderPipelines[renderPipelineName]._update();
  23855. }
  23856. };
  23857. return PostProcessRenderPipelineManager;
  23858. })();
  23859. BABYLON.PostProcessRenderPipelineManager = PostProcessRenderPipelineManager;
  23860. })(BABYLON || (BABYLON = {}));
  23861. //# sourceMappingURL=babylon.postProcessRenderPipelineManager.js.map
  23862. var BABYLON;
  23863. (function (BABYLON) {
  23864. var DisplayPassPostProcess = (function (_super) {
  23865. __extends(DisplayPassPostProcess, _super);
  23866. function DisplayPassPostProcess(name, ratio, camera, samplingMode, engine, reusable) {
  23867. _super.call(this, name, "displayPass", ["passSampler"], ["passSampler"], ratio, camera, samplingMode, engine, reusable);
  23868. }
  23869. return DisplayPassPostProcess;
  23870. })(BABYLON.PostProcess);
  23871. BABYLON.DisplayPassPostProcess = DisplayPassPostProcess;
  23872. })(BABYLON || (BABYLON = {}));
  23873. //# sourceMappingURL=babylon.displayPassPostProcess.js.mapvar BABYLON;
  23874. (function (BABYLON) {
  23875. var BoundingBoxRenderer = (function () {
  23876. function BoundingBoxRenderer(scene) {
  23877. this.frontColor = new BABYLON.Color3(1, 1, 1);
  23878. this.backColor = new BABYLON.Color3(0.1, 0.1, 0.1);
  23879. this.showBackLines = true;
  23880. this.renderList = new BABYLON.SmartArray(32);
  23881. this._scene = scene;
  23882. }
  23883. BoundingBoxRenderer.prototype._prepareRessources = function () {
  23884. if (this._colorShader) {
  23885. return;
  23886. }
  23887. this._colorShader = new BABYLON.ShaderMaterial("colorShader", this._scene, "color", {
  23888. attributes: ["position"],
  23889. uniforms: ["worldViewProjection", "color"]
  23890. });
  23891. var engine = this._scene.getEngine();
  23892. var boxdata = BABYLON.VertexData.CreateBox(1.0);
  23893. this._vb = new BABYLON.VertexBuffer(engine, boxdata.positions, BABYLON.VertexBuffer.PositionKind, false);
  23894. this._ib = engine.createIndexBuffer([0, 1, 1, 2, 2, 3, 3, 0, 4, 5, 5, 6, 6, 7, 7, 4, 0, 7, 1, 6, 2, 5, 3, 4]);
  23895. };
  23896. BoundingBoxRenderer.prototype.reset = function () {
  23897. this.renderList.reset();
  23898. };
  23899. BoundingBoxRenderer.prototype.render = function () {
  23900. if (this.renderList.length === 0) {
  23901. return;
  23902. }
  23903. this._prepareRessources();
  23904. if (!this._colorShader.isReady()) {
  23905. return;
  23906. }
  23907. var engine = this._scene.getEngine();
  23908. engine.setDepthWrite(false);
  23909. this._colorShader._preBind();
  23910. for (var boundingBoxIndex = 0; boundingBoxIndex < this.renderList.length; boundingBoxIndex++) {
  23911. var boundingBox = this.renderList.data[boundingBoxIndex];
  23912. var min = boundingBox.minimum;
  23913. var max = boundingBox.maximum;
  23914. var diff = max.subtract(min);
  23915. var median = min.add(diff.scale(0.5));
  23916. var worldMatrix = BABYLON.Matrix.Scaling(diff.x, diff.y, diff.z).multiply(BABYLON.Matrix.Translation(median.x, median.y, median.z)).multiply(boundingBox.getWorldMatrix());
  23917. // VBOs
  23918. engine.bindBuffers(this._vb.getBuffer(), this._ib, [3], 3 * 4, this._colorShader.getEffect());
  23919. if (this.showBackLines) {
  23920. // Back
  23921. engine.setDepthFunctionToGreaterOrEqual();
  23922. this._scene.resetCachedMaterial();
  23923. this._colorShader.setColor4("color", this.backColor.toColor4());
  23924. this._colorShader.bind(worldMatrix);
  23925. // Draw order
  23926. engine.draw(false, 0, 24);
  23927. }
  23928. // Front
  23929. engine.setDepthFunctionToLess();
  23930. this._scene.resetCachedMaterial();
  23931. this._colorShader.setColor4("color", this.frontColor.toColor4());
  23932. this._colorShader.bind(worldMatrix);
  23933. // Draw order
  23934. engine.draw(false, 0, 24);
  23935. }
  23936. this._colorShader.unbind();
  23937. engine.setDepthFunctionToLessOrEqual();
  23938. engine.setDepthWrite(true);
  23939. };
  23940. BoundingBoxRenderer.prototype.dispose = function () {
  23941. if (!this._colorShader) {
  23942. return;
  23943. }
  23944. this._colorShader.dispose();
  23945. this._vb.dispose();
  23946. this._scene.getEngine()._releaseBuffer(this._ib);
  23947. };
  23948. return BoundingBoxRenderer;
  23949. })();
  23950. BABYLON.BoundingBoxRenderer = BoundingBoxRenderer;
  23951. })(BABYLON || (BABYLON = {}));
  23952. //# sourceMappingURL=babylon.boundingBoxRenderer.js.mapvar BABYLON;
  23953. (function (BABYLON) {
  23954. var Internals;
  23955. (function (Internals) {
  23956. /*
  23957. * Based on jsTGALoader - Javascript loader for TGA file
  23958. * By Vincent Thibault
  23959. * @blog http://blog.robrowser.com/javascript-tga-loader.html
  23960. */
  23961. var TGATools = (function () {
  23962. function TGATools() {
  23963. }
  23964. TGATools.GetTGAHeader = function (data) {
  23965. var offset = 0;
  23966. var header = {
  23967. id_length: data[offset++],
  23968. colormap_type: data[offset++],
  23969. image_type: data[offset++],
  23970. colormap_index: data[offset++] | data[offset++] << 8,
  23971. colormap_length: data[offset++] | data[offset++] << 8,
  23972. colormap_size: data[offset++],
  23973. origin: [
  23974. data[offset++] | data[offset++] << 8,
  23975. data[offset++] | data[offset++] << 8
  23976. ],
  23977. width: data[offset++] | data[offset++] << 8,
  23978. height: data[offset++] | data[offset++] << 8,
  23979. pixel_size: data[offset++],
  23980. flags: data[offset++]
  23981. };
  23982. return header;
  23983. };
  23984. TGATools.UploadContent = function (gl, data) {
  23985. // Not enough data to contain header ?
  23986. if (data.length < 19) {
  23987. BABYLON.Tools.Error("Unable to load TGA file - Not enough data to contain header");
  23988. return;
  23989. }
  23990. // Read Header
  23991. var offset = 18;
  23992. var header = TGATools.GetTGAHeader(data);
  23993. // Assume it's a valid Targa file.
  23994. if (header.id_length + offset > data.length) {
  23995. BABYLON.Tools.Error("Unable to load TGA file - Not enough data");
  23996. return;
  23997. }
  23998. // Skip not needed data
  23999. offset += header.id_length;
  24000. var use_rle = false;
  24001. var use_pal = false;
  24002. var use_rgb = false;
  24003. var use_grey = false;
  24004. switch (header.image_type) {
  24005. case TGATools._TYPE_RLE_INDEXED:
  24006. use_rle = true;
  24007. case TGATools._TYPE_INDEXED:
  24008. use_pal = true;
  24009. break;
  24010. case TGATools._TYPE_RLE_RGB:
  24011. use_rle = true;
  24012. case TGATools._TYPE_RGB:
  24013. use_rgb = true;
  24014. break;
  24015. case TGATools._TYPE_RLE_GREY:
  24016. use_rle = true;
  24017. case TGATools._TYPE_GREY:
  24018. use_grey = true;
  24019. break;
  24020. }
  24021. var pixel_data;
  24022. var numAlphaBits = header.flags & 0xf;
  24023. var pixel_size = header.pixel_size >> 3;
  24024. var pixel_total = header.width * header.height * pixel_size;
  24025. // Read palettes
  24026. var palettes;
  24027. if (use_pal) {
  24028. palettes = data.subarray(offset, offset += header.colormap_length * (header.colormap_size >> 3));
  24029. }
  24030. // Read LRE
  24031. if (use_rle) {
  24032. pixel_data = new Uint8Array(pixel_total);
  24033. var c, count, i;
  24034. var localOffset = 0;
  24035. var pixels = new Uint8Array(pixel_size);
  24036. while (offset < pixel_total && localOffset < pixel_total) {
  24037. c = data[offset++];
  24038. count = (c & 0x7f) + 1;
  24039. // RLE pixels
  24040. if (c & 0x80) {
  24041. for (i = 0; i < pixel_size; ++i) {
  24042. pixels[i] = data[offset++];
  24043. }
  24044. for (i = 0; i < count; ++i) {
  24045. pixel_data.set(pixels, localOffset + i * pixel_size);
  24046. }
  24047. localOffset += pixel_size * count;
  24048. }
  24049. else {
  24050. count *= pixel_size;
  24051. for (i = 0; i < count; ++i) {
  24052. pixel_data[localOffset + i] = data[offset++];
  24053. }
  24054. localOffset += count;
  24055. }
  24056. }
  24057. }
  24058. else {
  24059. pixel_data = data.subarray(offset, offset += (use_pal ? header.width * header.height : pixel_total));
  24060. }
  24061. // Load to texture
  24062. var x_start, y_start, x_step, y_step, y_end, x_end;
  24063. switch ((header.flags & TGATools._ORIGIN_MASK) >> TGATools._ORIGIN_SHIFT) {
  24064. default:
  24065. case TGATools._ORIGIN_UL:
  24066. x_start = 0;
  24067. x_step = 1;
  24068. x_end = header.width;
  24069. y_start = 0;
  24070. y_step = 1;
  24071. y_end = header.height;
  24072. break;
  24073. case TGATools._ORIGIN_BL:
  24074. x_start = 0;
  24075. x_step = 1;
  24076. x_end = header.width;
  24077. y_start = header.height - 1;
  24078. y_step = -1;
  24079. y_end = -1;
  24080. break;
  24081. case TGATools._ORIGIN_UR:
  24082. x_start = header.width - 1;
  24083. x_step = -1;
  24084. x_end = -1;
  24085. y_start = 0;
  24086. y_step = 1;
  24087. y_end = header.height;
  24088. break;
  24089. case TGATools._ORIGIN_BR:
  24090. x_start = header.width - 1;
  24091. x_step = -1;
  24092. x_end = -1;
  24093. y_start = header.height - 1;
  24094. y_step = -1;
  24095. y_end = -1;
  24096. break;
  24097. }
  24098. // Load the specify method
  24099. var func = '_getImageData' + (use_grey ? 'Grey' : '') + (header.pixel_size) + 'bits';
  24100. var imageData = TGATools[func](header, palettes, pixel_data, y_start, y_step, y_end, x_start, x_step, x_end);
  24101. gl.texImage2D(gl.TEXTURE_2D, 0, gl.RGBA, header.width, header.height, 0, gl.RGBA, gl.UNSIGNED_BYTE, imageData);
  24102. };
  24103. TGATools._getImageData8bits = function (header, palettes, pixel_data, y_start, y_step, y_end, x_start, x_step, x_end) {
  24104. var image = pixel_data, colormap = palettes;
  24105. var width = header.width, height = header.height;
  24106. var color, i = 0, x, y;
  24107. var imageData = new Uint8Array(width * height * 4);
  24108. for (y = y_start; y !== y_end; y += y_step) {
  24109. for (x = x_start; x !== x_end; x += x_step, i++) {
  24110. color = image[i];
  24111. imageData[(x + width * y) * 4 + 3] = 255;
  24112. imageData[(x + width * y) * 4 + 2] = colormap[(color * 3) + 0];
  24113. imageData[(x + width * y) * 4 + 1] = colormap[(color * 3) + 1];
  24114. imageData[(x + width * y) * 4 + 0] = colormap[(color * 3) + 2];
  24115. }
  24116. }
  24117. return imageData;
  24118. };
  24119. TGATools._getImageData16bits = function (header, palettes, pixel_data, y_start, y_step, y_end, x_start, x_step, x_end) {
  24120. var image = pixel_data;
  24121. var width = header.width, height = header.height;
  24122. var color, i = 0, x, y;
  24123. var imageData = new Uint8Array(width * height * 4);
  24124. for (y = y_start; y !== y_end; y += y_step) {
  24125. for (x = x_start; x !== x_end; x += x_step, i += 2) {
  24126. color = image[i + 0] + (image[i + 1] << 8); // Inversed ?
  24127. imageData[(x + width * y) * 4 + 0] = (color & 0x7C00) >> 7;
  24128. imageData[(x + width * y) * 4 + 1] = (color & 0x03E0) >> 2;
  24129. imageData[(x + width * y) * 4 + 2] = (color & 0x001F) >> 3;
  24130. imageData[(x + width * y) * 4 + 3] = (color & 0x8000) ? 0 : 255;
  24131. }
  24132. }
  24133. return imageData;
  24134. };
  24135. TGATools._getImageData24bits = function (header, palettes, pixel_data, y_start, y_step, y_end, x_start, x_step, x_end) {
  24136. var image = pixel_data;
  24137. var width = header.width, height = header.height;
  24138. var i = 0, x, y;
  24139. var imageData = new Uint8Array(width * height * 4);
  24140. for (y = y_start; y !== y_end; y += y_step) {
  24141. for (x = x_start; x !== x_end; x += x_step, i += 3) {
  24142. imageData[(x + width * y) * 4 + 3] = 255;
  24143. imageData[(x + width * y) * 4 + 2] = image[i + 0];
  24144. imageData[(x + width * y) * 4 + 1] = image[i + 1];
  24145. imageData[(x + width * y) * 4 + 0] = image[i + 2];
  24146. }
  24147. }
  24148. return imageData;
  24149. };
  24150. TGATools._getImageData32bits = function (header, palettes, pixel_data, y_start, y_step, y_end, x_start, x_step, x_end) {
  24151. var image = pixel_data;
  24152. var width = header.width, height = header.height;
  24153. var i = 0, x, y;
  24154. var imageData = new Uint8Array(width * height * 4);
  24155. for (y = y_start; y !== y_end; y += y_step) {
  24156. for (x = x_start; x !== x_end; x += x_step, i += 4) {
  24157. imageData[(x + width * y) * 4 + 2] = image[i + 0];
  24158. imageData[(x + width * y) * 4 + 1] = image[i + 1];
  24159. imageData[(x + width * y) * 4 + 0] = image[i + 2];
  24160. imageData[(x + width * y) * 4 + 3] = image[i + 3];
  24161. }
  24162. }
  24163. return imageData;
  24164. };
  24165. TGATools._getImageDataGrey8bits = function (header, palettes, pixel_data, y_start, y_step, y_end, x_start, x_step, x_end) {
  24166. var image = pixel_data;
  24167. var width = header.width, height = header.height;
  24168. var color, i = 0, x, y;
  24169. var imageData = new Uint8Array(width * height * 4);
  24170. for (y = y_start; y !== y_end; y += y_step) {
  24171. for (x = x_start; x !== x_end; x += x_step, i++) {
  24172. color = image[i];
  24173. imageData[(x + width * y) * 4 + 0] = color;
  24174. imageData[(x + width * y) * 4 + 1] = color;
  24175. imageData[(x + width * y) * 4 + 2] = color;
  24176. imageData[(x + width * y) * 4 + 3] = 255;
  24177. }
  24178. }
  24179. return imageData;
  24180. };
  24181. TGATools._getImageDataGrey16bits = function (header, palettes, pixel_data, y_start, y_step, y_end, x_start, x_step, x_end) {
  24182. var image = pixel_data;
  24183. var width = header.width, height = header.height;
  24184. var i = 0, x, y;
  24185. var imageData = new Uint8Array(width * height * 4);
  24186. for (y = y_start; y !== y_end; y += y_step) {
  24187. for (x = x_start; x !== x_end; x += x_step, i += 2) {
  24188. imageData[(x + width * y) * 4 + 0] = image[i + 0];
  24189. imageData[(x + width * y) * 4 + 1] = image[i + 0];
  24190. imageData[(x + width * y) * 4 + 2] = image[i + 0];
  24191. imageData[(x + width * y) * 4 + 3] = image[i + 1];
  24192. }
  24193. }
  24194. return imageData;
  24195. };
  24196. TGATools._TYPE_NO_DATA = 0;
  24197. TGATools._TYPE_INDEXED = 1;
  24198. TGATools._TYPE_RGB = 2;
  24199. TGATools._TYPE_GREY = 3;
  24200. TGATools._TYPE_RLE_INDEXED = 9;
  24201. TGATools._TYPE_RLE_RGB = 10;
  24202. TGATools._TYPE_RLE_GREY = 11;
  24203. TGATools._ORIGIN_MASK = 0x30;
  24204. TGATools._ORIGIN_SHIFT = 0x04;
  24205. TGATools._ORIGIN_BL = 0x00;
  24206. TGATools._ORIGIN_BR = 0x01;
  24207. TGATools._ORIGIN_UL = 0x02;
  24208. TGATools._ORIGIN_UR = 0x03;
  24209. return TGATools;
  24210. })();
  24211. Internals.TGATools = TGATools;
  24212. })(Internals = BABYLON.Internals || (BABYLON.Internals = {}));
  24213. })(BABYLON || (BABYLON = {}));
  24214. //# sourceMappingURL=babylon.tools.tga.js.mapvar BABYLON;
  24215. (function (BABYLON) {
  24216. var Internals;
  24217. (function (Internals) {
  24218. // Based on demo done by Brandon Jones - http://media.tojicode.com/webgl-samples/dds.html
  24219. // All values and structures referenced from:
  24220. // http://msdn.microsoft.com/en-us/library/bb943991.aspx/
  24221. var DDS_MAGIC = 0x20534444;
  24222. var DDSD_CAPS = 0x1, DDSD_HEIGHT = 0x2, DDSD_WIDTH = 0x4, DDSD_PITCH = 0x8, DDSD_PIXELFORMAT = 0x1000, DDSD_MIPMAPCOUNT = 0x20000, DDSD_LINEARSIZE = 0x80000, DDSD_DEPTH = 0x800000;
  24223. var DDSCAPS_COMPLEX = 0x8, DDSCAPS_MIPMAP = 0x400000, DDSCAPS_TEXTURE = 0x1000;
  24224. var DDSCAPS2_CUBEMAP = 0x200, DDSCAPS2_CUBEMAP_POSITIVEX = 0x400, DDSCAPS2_CUBEMAP_NEGATIVEX = 0x800, DDSCAPS2_CUBEMAP_POSITIVEY = 0x1000, DDSCAPS2_CUBEMAP_NEGATIVEY = 0x2000, DDSCAPS2_CUBEMAP_POSITIVEZ = 0x4000, DDSCAPS2_CUBEMAP_NEGATIVEZ = 0x8000, DDSCAPS2_VOLUME = 0x200000;
  24225. var DDPF_ALPHAPIXELS = 0x1, DDPF_ALPHA = 0x2, DDPF_FOURCC = 0x4, DDPF_RGB = 0x40, DDPF_YUV = 0x200, DDPF_LUMINANCE = 0x20000;
  24226. function FourCCToInt32(value) {
  24227. return value.charCodeAt(0) + (value.charCodeAt(1) << 8) + (value.charCodeAt(2) << 16) + (value.charCodeAt(3) << 24);
  24228. }
  24229. function Int32ToFourCC(value) {
  24230. return String.fromCharCode(value & 0xff, (value >> 8) & 0xff, (value >> 16) & 0xff, (value >> 24) & 0xff);
  24231. }
  24232. var FOURCC_DXT1 = FourCCToInt32("DXT1");
  24233. var FOURCC_DXT3 = FourCCToInt32("DXT3");
  24234. var FOURCC_DXT5 = FourCCToInt32("DXT5");
  24235. var headerLengthInt = 31; // The header length in 32 bit ints
  24236. // Offsets into the header array
  24237. var off_magic = 0;
  24238. var off_size = 1;
  24239. var off_flags = 2;
  24240. var off_height = 3;
  24241. var off_width = 4;
  24242. var off_mipmapCount = 7;
  24243. var off_pfFlags = 20;
  24244. var off_pfFourCC = 21;
  24245. var off_RGBbpp = 22;
  24246. var off_RMask = 23;
  24247. var off_GMask = 24;
  24248. var off_BMask = 25;
  24249. var off_AMask = 26;
  24250. var off_caps1 = 27;
  24251. var off_caps2 = 28;
  24252. ;
  24253. var DDSTools = (function () {
  24254. function DDSTools() {
  24255. }
  24256. DDSTools.GetDDSInfo = function (arrayBuffer) {
  24257. var header = new Int32Array(arrayBuffer, 0, headerLengthInt);
  24258. var mipmapCount = 1;
  24259. if (header[off_flags] & DDSD_MIPMAPCOUNT) {
  24260. mipmapCount = Math.max(1, header[off_mipmapCount]);
  24261. }
  24262. return {
  24263. width: header[off_width],
  24264. height: header[off_height],
  24265. mipmapCount: mipmapCount,
  24266. isFourCC: (header[off_pfFlags] & DDPF_FOURCC) === DDPF_FOURCC,
  24267. isRGB: (header[off_pfFlags] & DDPF_RGB) === DDPF_RGB,
  24268. isLuminance: (header[off_pfFlags] & DDPF_LUMINANCE) === DDPF_LUMINANCE,
  24269. isCube: (header[off_caps2] & DDSCAPS2_CUBEMAP) === DDSCAPS2_CUBEMAP
  24270. };
  24271. };
  24272. DDSTools.GetRGBAArrayBuffer = function (width, height, dataOffset, dataLength, arrayBuffer) {
  24273. var byteArray = new Uint8Array(dataLength);
  24274. var srcData = new Uint8Array(arrayBuffer);
  24275. var index = 0;
  24276. for (var y = height - 1; y >= 0; y--) {
  24277. for (var x = 0; x < width; x++) {
  24278. var srcPos = dataOffset + (x + y * width) * 4;
  24279. byteArray[index + 2] = srcData[srcPos];
  24280. byteArray[index + 1] = srcData[srcPos + 1];
  24281. byteArray[index] = srcData[srcPos + 2];
  24282. byteArray[index + 3] = srcData[srcPos + 3];
  24283. index += 4;
  24284. }
  24285. }
  24286. return byteArray;
  24287. };
  24288. DDSTools.GetRGBArrayBuffer = function (width, height, dataOffset, dataLength, arrayBuffer) {
  24289. var byteArray = new Uint8Array(dataLength);
  24290. var srcData = new Uint8Array(arrayBuffer);
  24291. var index = 0;
  24292. for (var y = height - 1; y >= 0; y--) {
  24293. for (var x = 0; x < width; x++) {
  24294. var srcPos = dataOffset + (x + y * width) * 3;
  24295. byteArray[index + 2] = srcData[srcPos];
  24296. byteArray[index + 1] = srcData[srcPos + 1];
  24297. byteArray[index] = srcData[srcPos + 2];
  24298. index += 3;
  24299. }
  24300. }
  24301. return byteArray;
  24302. };
  24303. DDSTools.GetLuminanceArrayBuffer = function (width, height, dataOffset, dataLength, arrayBuffer) {
  24304. var byteArray = new Uint8Array(dataLength);
  24305. var srcData = new Uint8Array(arrayBuffer);
  24306. var index = 0;
  24307. for (var y = height - 1; y >= 0; y--) {
  24308. for (var x = 0; x < width; x++) {
  24309. var srcPos = dataOffset + (x + y * width);
  24310. byteArray[index] = srcData[srcPos];
  24311. index++;
  24312. }
  24313. }
  24314. return byteArray;
  24315. };
  24316. DDSTools.UploadDDSLevels = function (gl, ext, arrayBuffer, info, loadMipmaps, faces) {
  24317. var header = new Int32Array(arrayBuffer, 0, headerLengthInt), fourCC, blockBytes, internalFormat, width, height, dataLength, dataOffset, byteArray, mipmapCount, i;
  24318. if (header[off_magic] != DDS_MAGIC) {
  24319. BABYLON.Tools.Error("Invalid magic number in DDS header");
  24320. return;
  24321. }
  24322. if (!info.isFourCC && !info.isRGB && !info.isLuminance) {
  24323. BABYLON.Tools.Error("Unsupported format, must contain a FourCC, RGB or LUMINANCE code");
  24324. return;
  24325. }
  24326. if (info.isFourCC) {
  24327. fourCC = header[off_pfFourCC];
  24328. switch (fourCC) {
  24329. case FOURCC_DXT1:
  24330. blockBytes = 8;
  24331. internalFormat = ext.COMPRESSED_RGBA_S3TC_DXT1_EXT;
  24332. break;
  24333. case FOURCC_DXT3:
  24334. blockBytes = 16;
  24335. internalFormat = ext.COMPRESSED_RGBA_S3TC_DXT3_EXT;
  24336. break;
  24337. case FOURCC_DXT5:
  24338. blockBytes = 16;
  24339. internalFormat = ext.COMPRESSED_RGBA_S3TC_DXT5_EXT;
  24340. break;
  24341. default:
  24342. console.error("Unsupported FourCC code:", Int32ToFourCC(fourCC));
  24343. return;
  24344. }
  24345. }
  24346. mipmapCount = 1;
  24347. if (header[off_flags] & DDSD_MIPMAPCOUNT && loadMipmaps !== false) {
  24348. mipmapCount = Math.max(1, header[off_mipmapCount]);
  24349. }
  24350. var bpp = header[off_RGBbpp];
  24351. for (var face = 0; face < faces; face++) {
  24352. var sampler = faces == 1 ? gl.TEXTURE_2D : (gl.TEXTURE_CUBE_MAP_POSITIVE_X + face);
  24353. width = header[off_width];
  24354. height = header[off_height];
  24355. dataOffset = header[off_size] + 4;
  24356. for (i = 0; i < mipmapCount; ++i) {
  24357. if (info.isRGB) {
  24358. if (bpp == 24) {
  24359. dataLength = width * height * 3;
  24360. byteArray = DDSTools.GetRGBArrayBuffer(width, height, dataOffset, dataLength, arrayBuffer);
  24361. gl.texImage2D(sampler, i, gl.RGB, width, height, 0, gl.RGB, gl.UNSIGNED_BYTE, byteArray);
  24362. }
  24363. else {
  24364. dataLength = width * height * 4;
  24365. byteArray = DDSTools.GetRGBAArrayBuffer(width, height, dataOffset, dataLength, arrayBuffer);
  24366. gl.texImage2D(sampler, i, gl.RGBA, width, height, 0, gl.RGBA, gl.UNSIGNED_BYTE, byteArray);
  24367. }
  24368. }
  24369. else if (info.isLuminance) {
  24370. var unpackAlignment = gl.getParameter(gl.UNPACK_ALIGNMENT);
  24371. var unpaddedRowSize = width;
  24372. var paddedRowSize = Math.floor((width + unpackAlignment - 1) / unpackAlignment) * unpackAlignment;
  24373. dataLength = paddedRowSize * (height - 1) + unpaddedRowSize;
  24374. byteArray = DDSTools.GetLuminanceArrayBuffer(width, height, dataOffset, dataLength, arrayBuffer);
  24375. gl.texImage2D(sampler, i, gl.LUMINANCE, width, height, 0, gl.LUMINANCE, gl.UNSIGNED_BYTE, byteArray);
  24376. }
  24377. else {
  24378. dataLength = Math.max(4, width) / 4 * Math.max(4, height) / 4 * blockBytes;
  24379. byteArray = new Uint8Array(arrayBuffer, dataOffset, dataLength);
  24380. gl.compressedTexImage2D(sampler, i, internalFormat, width, height, 0, byteArray);
  24381. }
  24382. dataOffset += dataLength;
  24383. width *= 0.5;
  24384. height *= 0.5;
  24385. width = Math.max(1.0, width);
  24386. height = Math.max(1.0, height);
  24387. }
  24388. }
  24389. };
  24390. return DDSTools;
  24391. })();
  24392. Internals.DDSTools = DDSTools;
  24393. })(Internals = BABYLON.Internals || (BABYLON.Internals = {}));
  24394. })(BABYLON || (BABYLON = {}));
  24395. //# sourceMappingURL=babylon.tools.dds.js.mapvar BABYLON;
  24396. (function (BABYLON) {
  24397. var SmartArray = (function () {
  24398. function SmartArray(capacity) {
  24399. this.length = 0;
  24400. this._duplicateId = 0;
  24401. this.data = new Array(capacity);
  24402. this._id = SmartArray._GlobalId++;
  24403. }
  24404. SmartArray.prototype.push = function (value) {
  24405. this.data[this.length++] = value;
  24406. if (this.length > this.data.length) {
  24407. this.data.length *= 2;
  24408. }
  24409. if (!value.__smartArrayFlags) {
  24410. value.__smartArrayFlags = {};
  24411. }
  24412. value.__smartArrayFlags[this._id] = this._duplicateId;
  24413. };
  24414. SmartArray.prototype.pushNoDuplicate = function (value) {
  24415. if (value.__smartArrayFlags && value.__smartArrayFlags[this._id] === this._duplicateId) {
  24416. return;
  24417. }
  24418. this.push(value);
  24419. };
  24420. SmartArray.prototype.sort = function (compareFn) {
  24421. this.data.sort(compareFn);
  24422. };
  24423. SmartArray.prototype.reset = function () {
  24424. this.length = 0;
  24425. this._duplicateId++;
  24426. };
  24427. SmartArray.prototype.concat = function (array) {
  24428. if (array.length === 0) {
  24429. return;
  24430. }
  24431. if (this.length + array.length > this.data.length) {
  24432. this.data.length = (this.length + array.length) * 2;
  24433. }
  24434. for (var index = 0; index < array.length; index++) {
  24435. this.data[this.length++] = (array.data || array)[index];
  24436. }
  24437. };
  24438. SmartArray.prototype.concatWithNoDuplicate = function (array) {
  24439. if (array.length === 0) {
  24440. return;
  24441. }
  24442. if (this.length + array.length > this.data.length) {
  24443. this.data.length = (this.length + array.length) * 2;
  24444. }
  24445. for (var index = 0; index < array.length; index++) {
  24446. var item = (array.data || array)[index];
  24447. this.pushNoDuplicate(item);
  24448. }
  24449. };
  24450. SmartArray.prototype.indexOf = function (value) {
  24451. var position = this.data.indexOf(value);
  24452. if (position >= this.length) {
  24453. return -1;
  24454. }
  24455. return position;
  24456. };
  24457. // Statics
  24458. SmartArray._GlobalId = 0;
  24459. return SmartArray;
  24460. })();
  24461. BABYLON.SmartArray = SmartArray;
  24462. })(BABYLON || (BABYLON = {}));
  24463. //# sourceMappingURL=babylon.smartArray.js.mapvar BABYLON;
  24464. (function (BABYLON) {
  24465. var CannonJSPlugin = (function () {
  24466. function CannonJSPlugin() {
  24467. this._registeredMeshes = [];
  24468. this._physicsMaterials = [];
  24469. this.updateBodyPosition = function (mesh) {
  24470. for (var index = 0; index < this._registeredMeshes.length; index++) {
  24471. var registeredMesh = this._registeredMeshes[index];
  24472. if (registeredMesh.mesh === mesh || registeredMesh.mesh === mesh.parent) {
  24473. var body = registeredMesh.body;
  24474. var center = mesh.getBoundingInfo().boundingBox.center;
  24475. body.position.set(center.x, center.z, center.y);
  24476. body.quaternion.x = mesh.rotationQuaternion.x;
  24477. body.quaternion.z = mesh.rotationQuaternion.y;
  24478. body.quaternion.y = mesh.rotationQuaternion.z;
  24479. body.quaternion.w = -mesh.rotationQuaternion.w;
  24480. return;
  24481. }
  24482. }
  24483. };
  24484. }
  24485. CannonJSPlugin.prototype.initialize = function (iterations) {
  24486. if (iterations === void 0) { iterations = 10; }
  24487. this._world = new CANNON.World();
  24488. this._world.broadphase = new CANNON.NaiveBroadphase();
  24489. this._world.solver.iterations = iterations;
  24490. };
  24491. CannonJSPlugin.prototype._checkWithEpsilon = function (value) {
  24492. return value < BABYLON.PhysicsEngine.Epsilon ? BABYLON.PhysicsEngine.Epsilon : value;
  24493. };
  24494. CannonJSPlugin.prototype.runOneStep = function (delta) {
  24495. this._world.step(delta);
  24496. for (var index = 0; index < this._registeredMeshes.length; index++) {
  24497. var registeredMesh = this._registeredMeshes[index];
  24498. if (registeredMesh.isChild) {
  24499. continue;
  24500. }
  24501. // Body position
  24502. var bodyX = registeredMesh.body.position.x, bodyY = registeredMesh.body.position.y, bodyZ = registeredMesh.body.position.z;
  24503. var deltaPos = registeredMesh.delta;
  24504. if (deltaPos) {
  24505. registeredMesh.mesh.position.x = bodyX + deltaPos.x;
  24506. registeredMesh.mesh.position.y = bodyZ + deltaPos.y;
  24507. registeredMesh.mesh.position.z = bodyY + deltaPos.z;
  24508. }
  24509. else {
  24510. registeredMesh.mesh.position.x = bodyX;
  24511. registeredMesh.mesh.position.y = bodyZ;
  24512. registeredMesh.mesh.position.z = bodyY;
  24513. }
  24514. if (!registeredMesh.mesh.rotationQuaternion) {
  24515. registeredMesh.mesh.rotationQuaternion = new BABYLON.Quaternion(0, 0, 0, 1);
  24516. }
  24517. registeredMesh.mesh.rotationQuaternion.x = registeredMesh.body.quaternion.x;
  24518. registeredMesh.mesh.rotationQuaternion.y = registeredMesh.body.quaternion.z;
  24519. registeredMesh.mesh.rotationQuaternion.z = registeredMesh.body.quaternion.y;
  24520. registeredMesh.mesh.rotationQuaternion.w = -registeredMesh.body.quaternion.w;
  24521. }
  24522. };
  24523. CannonJSPlugin.prototype.setGravity = function (gravity) {
  24524. this._world.gravity.set(gravity.x, gravity.z, gravity.y);
  24525. };
  24526. CannonJSPlugin.prototype.registerMesh = function (mesh, impostor, options) {
  24527. this.unregisterMesh(mesh);
  24528. mesh.computeWorldMatrix(true);
  24529. switch (impostor) {
  24530. case BABYLON.PhysicsEngine.SphereImpostor:
  24531. var bbox = mesh.getBoundingInfo().boundingBox;
  24532. var radiusX = bbox.maximumWorld.x - bbox.minimumWorld.x;
  24533. var radiusY = bbox.maximumWorld.y - bbox.minimumWorld.y;
  24534. var radiusZ = bbox.maximumWorld.z - bbox.minimumWorld.z;
  24535. return this._createSphere(Math.max(this._checkWithEpsilon(radiusX), this._checkWithEpsilon(radiusY), this._checkWithEpsilon(radiusZ)) / 2, mesh, options);
  24536. case BABYLON.PhysicsEngine.BoxImpostor:
  24537. bbox = mesh.getBoundingInfo().boundingBox;
  24538. var min = bbox.minimumWorld;
  24539. var max = bbox.maximumWorld;
  24540. var box = max.subtract(min).scale(0.5);
  24541. return this._createBox(this._checkWithEpsilon(box.x), this._checkWithEpsilon(box.y), this._checkWithEpsilon(box.z), mesh, options);
  24542. case BABYLON.PhysicsEngine.PlaneImpostor:
  24543. return this._createPlane(mesh, options);
  24544. case BABYLON.PhysicsEngine.MeshImpostor:
  24545. var rawVerts = mesh.getVerticesData(BABYLON.VertexBuffer.PositionKind);
  24546. var rawFaces = mesh.getIndices();
  24547. return this._createConvexPolyhedron(rawVerts, rawFaces, mesh, options);
  24548. }
  24549. return null;
  24550. };
  24551. CannonJSPlugin.prototype._createSphere = function (radius, mesh, options) {
  24552. var shape = new CANNON.Sphere(radius);
  24553. if (!options) {
  24554. return shape;
  24555. }
  24556. return this._createRigidBodyFromShape(shape, mesh, options.mass, options.friction, options.restitution);
  24557. };
  24558. CannonJSPlugin.prototype._createBox = function (x, y, z, mesh, options) {
  24559. var shape = new CANNON.Box(new CANNON.Vec3(x, z, y));
  24560. if (!options) {
  24561. return shape;
  24562. }
  24563. return this._createRigidBodyFromShape(shape, mesh, options.mass, options.friction, options.restitution);
  24564. };
  24565. CannonJSPlugin.prototype._createPlane = function (mesh, options) {
  24566. var shape = new CANNON.Plane();
  24567. if (!options) {
  24568. return shape;
  24569. }
  24570. return this._createRigidBodyFromShape(shape, mesh, options.mass, options.friction, options.restitution);
  24571. };
  24572. CannonJSPlugin.prototype._createConvexPolyhedron = function (rawVerts, rawFaces, mesh, options) {
  24573. var verts = [], faces = [];
  24574. mesh.computeWorldMatrix(true);
  24575. for (var i = 0; i < rawVerts.length; i += 3) {
  24576. var transformed = BABYLON.Vector3.Zero();
  24577. BABYLON.Vector3.TransformNormalFromFloatsToRef(rawVerts[i], rawVerts[i + 1], rawVerts[i + 2], mesh.getWorldMatrix(), transformed);
  24578. verts.push(new CANNON.Vec3(transformed.x, transformed.z, transformed.y));
  24579. }
  24580. for (var j = 0; j < rawFaces.length; j += 3) {
  24581. faces.push([rawFaces[j], rawFaces[j + 2], rawFaces[j + 1]]);
  24582. }
  24583. var shape = new CANNON.ConvexPolyhedron(verts, faces);
  24584. if (!options) {
  24585. return shape;
  24586. }
  24587. return this._createRigidBodyFromShape(shape, mesh, options.mass, options.friction, options.restitution);
  24588. };
  24589. CannonJSPlugin.prototype._addMaterial = function (friction, restitution) {
  24590. var index;
  24591. var mat;
  24592. for (index = 0; index < this._physicsMaterials.length; index++) {
  24593. mat = this._physicsMaterials[index];
  24594. if (mat.friction === friction && mat.restitution === restitution) {
  24595. return mat;
  24596. }
  24597. }
  24598. var currentMat = new CANNON.Material();
  24599. currentMat.friction = friction;
  24600. currentMat.restitution = restitution;
  24601. this._physicsMaterials.push(currentMat);
  24602. for (index = 0; index < this._physicsMaterials.length; index++) {
  24603. mat = this._physicsMaterials[index];
  24604. var contactMaterial = new CANNON.ContactMaterial(mat, currentMat, mat.friction * currentMat.friction, mat.restitution * currentMat.restitution);
  24605. contactMaterial.contactEquationStiffness = 1e10;
  24606. contactMaterial.contactEquationRegularizationTime = 10;
  24607. this._world.addContactMaterial(contactMaterial);
  24608. }
  24609. return currentMat;
  24610. };
  24611. CannonJSPlugin.prototype._createRigidBodyFromShape = function (shape, mesh, mass, friction, restitution) {
  24612. var initialRotation = null;
  24613. if (mesh.rotationQuaternion) {
  24614. initialRotation = mesh.rotationQuaternion.clone();
  24615. mesh.rotationQuaternion = new BABYLON.Quaternion(0, 0, 0, 1);
  24616. }
  24617. // The delta between the mesh position and the mesh bounding box center
  24618. var bbox = mesh.getBoundingInfo().boundingBox;
  24619. var deltaPosition = mesh.position.subtract(bbox.center);
  24620. var material = this._addMaterial(friction, restitution);
  24621. var body = new CANNON.RigidBody(mass, shape, material);
  24622. if (initialRotation) {
  24623. body.quaternion.x = initialRotation.x;
  24624. body.quaternion.z = initialRotation.y;
  24625. body.quaternion.y = initialRotation.z;
  24626. body.quaternion.w = -initialRotation.w;
  24627. }
  24628. body.position.set(bbox.center.x, bbox.center.z, bbox.center.y);
  24629. this._world.add(body);
  24630. this._registeredMeshes.push({ mesh: mesh, body: body, material: material, delta: deltaPosition });
  24631. return body;
  24632. };
  24633. CannonJSPlugin.prototype.registerMeshesAsCompound = function (parts, options) {
  24634. var compoundShape = new CANNON.Compound();
  24635. for (var index = 0; index < parts.length; index++) {
  24636. var mesh = parts[index].mesh;
  24637. var shape = this.registerMesh(mesh, parts[index].impostor);
  24638. if (index == 0) {
  24639. compoundShape.addChild(shape, new CANNON.Vec3(0, 0, 0));
  24640. }
  24641. else {
  24642. compoundShape.addChild(shape, new CANNON.Vec3(mesh.position.x, mesh.position.z, mesh.position.y));
  24643. }
  24644. }
  24645. var initialMesh = parts[0].mesh;
  24646. var body = this._createRigidBodyFromShape(compoundShape, initialMesh, options.mass, options.friction, options.restitution);
  24647. body.parts = parts;
  24648. return body;
  24649. };
  24650. CannonJSPlugin.prototype._unbindBody = function (body) {
  24651. for (var index = 0; index < this._registeredMeshes.length; index++) {
  24652. var registeredMesh = this._registeredMeshes[index];
  24653. if (registeredMesh.body === body) {
  24654. registeredMesh.body = null;
  24655. registeredMesh.delta = 0;
  24656. }
  24657. }
  24658. };
  24659. CannonJSPlugin.prototype.unregisterMesh = function (mesh) {
  24660. for (var index = 0; index < this._registeredMeshes.length; index++) {
  24661. var registeredMesh = this._registeredMeshes[index];
  24662. if (registeredMesh.mesh === mesh) {
  24663. // Remove body
  24664. if (registeredMesh.body) {
  24665. this._world.remove(registeredMesh.body);
  24666. this._unbindBody(registeredMesh.body);
  24667. }
  24668. this._registeredMeshes.splice(index, 1);
  24669. return;
  24670. }
  24671. }
  24672. };
  24673. CannonJSPlugin.prototype.applyImpulse = function (mesh, force, contactPoint) {
  24674. var worldPoint = new CANNON.Vec3(contactPoint.x, contactPoint.z, contactPoint.y);
  24675. var impulse = new CANNON.Vec3(force.x, force.z, force.y);
  24676. for (var index = 0; index < this._registeredMeshes.length; index++) {
  24677. var registeredMesh = this._registeredMeshes[index];
  24678. if (registeredMesh.mesh === mesh) {
  24679. registeredMesh.body.applyImpulse(impulse, worldPoint);
  24680. return;
  24681. }
  24682. }
  24683. };
  24684. CannonJSPlugin.prototype.createLink = function (mesh1, mesh2, pivot1, pivot2) {
  24685. var body1 = null, body2 = null;
  24686. for (var index = 0; index < this._registeredMeshes.length; index++) {
  24687. var registeredMesh = this._registeredMeshes[index];
  24688. if (registeredMesh.mesh === mesh1) {
  24689. body1 = registeredMesh.body;
  24690. }
  24691. else if (registeredMesh.mesh === mesh2) {
  24692. body2 = registeredMesh.body;
  24693. }
  24694. }
  24695. if (!body1 || !body2) {
  24696. return false;
  24697. }
  24698. var constraint = new CANNON.PointToPointConstraint(body1, new CANNON.Vec3(pivot1.x, pivot1.z, pivot1.y), body2, new CANNON.Vec3(pivot2.x, pivot2.z, pivot2.y));
  24699. this._world.addConstraint(constraint);
  24700. return true;
  24701. };
  24702. CannonJSPlugin.prototype.dispose = function () {
  24703. while (this._registeredMeshes.length) {
  24704. this.unregisterMesh(this._registeredMeshes[0].mesh);
  24705. }
  24706. };
  24707. CannonJSPlugin.prototype.isSupported = function () {
  24708. return window.CANNON !== undefined;
  24709. };
  24710. return CannonJSPlugin;
  24711. })();
  24712. BABYLON.CannonJSPlugin = CannonJSPlugin;
  24713. })(BABYLON || (BABYLON = {}));
  24714. //# sourceMappingURL=babylon.cannonJSPlugin.js.map
  24715. var BABYLON;
  24716. (function (BABYLON) {
  24717. var Condition = (function () {
  24718. function Condition(actionManager) {
  24719. this._actionManager = actionManager;
  24720. }
  24721. Condition.prototype.isValid = function () {
  24722. return true;
  24723. };
  24724. Condition.prototype._getProperty = function (propertyPath) {
  24725. return this._actionManager._getProperty(propertyPath);
  24726. };
  24727. Condition.prototype._getEffectiveTarget = function (target, propertyPath) {
  24728. return this._actionManager._getEffectiveTarget(target, propertyPath);
  24729. };
  24730. return Condition;
  24731. })();
  24732. BABYLON.Condition = Condition;
  24733. var ValueCondition = (function (_super) {
  24734. __extends(ValueCondition, _super);
  24735. function ValueCondition(actionManager, target, propertyPath, value, operator) {
  24736. if (operator === void 0) { operator = ValueCondition.IsEqual; }
  24737. _super.call(this, actionManager);
  24738. this.propertyPath = propertyPath;
  24739. this.value = value;
  24740. this.operator = operator;
  24741. this._target = this._getEffectiveTarget(target, this.propertyPath);
  24742. this._property = this._getProperty(this.propertyPath);
  24743. }
  24744. Object.defineProperty(ValueCondition, "IsEqual", {
  24745. get: function () {
  24746. return ValueCondition._IsEqual;
  24747. },
  24748. enumerable: true,
  24749. configurable: true
  24750. });
  24751. Object.defineProperty(ValueCondition, "IsDifferent", {
  24752. get: function () {
  24753. return ValueCondition._IsDifferent;
  24754. },
  24755. enumerable: true,
  24756. configurable: true
  24757. });
  24758. Object.defineProperty(ValueCondition, "IsGreater", {
  24759. get: function () {
  24760. return ValueCondition._IsGreater;
  24761. },
  24762. enumerable: true,
  24763. configurable: true
  24764. });
  24765. Object.defineProperty(ValueCondition, "IsLesser", {
  24766. get: function () {
  24767. return ValueCondition._IsLesser;
  24768. },
  24769. enumerable: true,
  24770. configurable: true
  24771. });
  24772. // Methods
  24773. ValueCondition.prototype.isValid = function () {
  24774. switch (this.operator) {
  24775. case ValueCondition.IsGreater:
  24776. return this._target[this._property] > this.value;
  24777. case ValueCondition.IsLesser:
  24778. return this._target[this._property] < this.value;
  24779. case ValueCondition.IsEqual:
  24780. case ValueCondition.IsDifferent:
  24781. var check;
  24782. if (this.value.equals) {
  24783. check = this.value.equals(this._target[this._property]);
  24784. }
  24785. else {
  24786. check = this.value === this._target[this._property];
  24787. }
  24788. return this.operator === ValueCondition.IsEqual ? check : !check;
  24789. }
  24790. return false;
  24791. };
  24792. // Statics
  24793. ValueCondition._IsEqual = 0;
  24794. ValueCondition._IsDifferent = 1;
  24795. ValueCondition._IsGreater = 2;
  24796. ValueCondition._IsLesser = 3;
  24797. return ValueCondition;
  24798. })(Condition);
  24799. BABYLON.ValueCondition = ValueCondition;
  24800. var PredicateCondition = (function (_super) {
  24801. __extends(PredicateCondition, _super);
  24802. function PredicateCondition(actionManager, predicate) {
  24803. _super.call(this, actionManager);
  24804. this.predicate = predicate;
  24805. }
  24806. PredicateCondition.prototype.isValid = function () {
  24807. return this.predicate();
  24808. };
  24809. return PredicateCondition;
  24810. })(Condition);
  24811. BABYLON.PredicateCondition = PredicateCondition;
  24812. var StateCondition = (function (_super) {
  24813. __extends(StateCondition, _super);
  24814. function StateCondition(actionManager, target, value) {
  24815. _super.call(this, actionManager);
  24816. this.value = value;
  24817. this._target = target;
  24818. }
  24819. // Methods
  24820. StateCondition.prototype.isValid = function () {
  24821. return this._target.state === this.value;
  24822. };
  24823. return StateCondition;
  24824. })(Condition);
  24825. BABYLON.StateCondition = StateCondition;
  24826. })(BABYLON || (BABYLON = {}));
  24827. //# sourceMappingURL=babylon.condition.js.mapvar BABYLON;
  24828. (function (BABYLON) {
  24829. var Action = (function () {
  24830. function Action(triggerOptions, condition) {
  24831. this.triggerOptions = triggerOptions;
  24832. if (triggerOptions.parameter) {
  24833. this.trigger = triggerOptions.trigger;
  24834. this._triggerParameter = triggerOptions.parameter;
  24835. }
  24836. else {
  24837. this.trigger = triggerOptions;
  24838. }
  24839. this._nextActiveAction = this;
  24840. this._condition = condition;
  24841. }
  24842. // Methods
  24843. Action.prototype._prepare = function () {
  24844. };
  24845. Action.prototype.getTriggerParameter = function () {
  24846. return this._triggerParameter;
  24847. };
  24848. Action.prototype._executeCurrent = function (evt) {
  24849. if (this._nextActiveAction._condition) {
  24850. var condition = this._nextActiveAction._condition;
  24851. var currentRenderId = this._actionManager.getScene().getRenderId();
  24852. // We cache the current evaluation for the current frame
  24853. if (condition._evaluationId === currentRenderId) {
  24854. if (!condition._currentResult) {
  24855. return;
  24856. }
  24857. }
  24858. else {
  24859. condition._evaluationId = currentRenderId;
  24860. if (!condition.isValid()) {
  24861. condition._currentResult = false;
  24862. return;
  24863. }
  24864. condition._currentResult = true;
  24865. }
  24866. }
  24867. this._nextActiveAction.execute(evt);
  24868. if (this._nextActiveAction._child) {
  24869. if (!this._nextActiveAction._child._actionManager) {
  24870. this._nextActiveAction._child._actionManager = this._actionManager;
  24871. }
  24872. this._nextActiveAction = this._nextActiveAction._child;
  24873. }
  24874. else {
  24875. this._nextActiveAction = this;
  24876. }
  24877. };
  24878. Action.prototype.execute = function (evt) {
  24879. };
  24880. Action.prototype.then = function (action) {
  24881. this._child = action;
  24882. action._actionManager = this._actionManager;
  24883. action._prepare();
  24884. return action;
  24885. };
  24886. Action.prototype._getProperty = function (propertyPath) {
  24887. return this._actionManager._getProperty(propertyPath);
  24888. };
  24889. Action.prototype._getEffectiveTarget = function (target, propertyPath) {
  24890. return this._actionManager._getEffectiveTarget(target, propertyPath);
  24891. };
  24892. return Action;
  24893. })();
  24894. BABYLON.Action = Action;
  24895. })(BABYLON || (BABYLON = {}));
  24896. //# sourceMappingURL=babylon.action.js.mapvar BABYLON;
  24897. (function (BABYLON) {
  24898. /**
  24899. * ActionEvent is the event beint sent when an action is triggered.
  24900. */
  24901. var ActionEvent = (function () {
  24902. /**
  24903. * @constructor
  24904. * @param source The mesh that triggered the action.
  24905. * @param pointerX the X mouse cursor position at the time of the event
  24906. * @param pointerY the Y mouse cursor position at the time of the event
  24907. * @param meshUnderPointer The mesh that is currently pointed at (can be null)
  24908. * @param sourceEvent the original (browser) event that triggered the ActionEvent
  24909. */
  24910. function ActionEvent(source, pointerX, pointerY, meshUnderPointer, sourceEvent) {
  24911. this.source = source;
  24912. this.pointerX = pointerX;
  24913. this.pointerY = pointerY;
  24914. this.meshUnderPointer = meshUnderPointer;
  24915. this.sourceEvent = sourceEvent;
  24916. }
  24917. /**
  24918. * Helper function to auto-create an ActionEvent from a source mesh.
  24919. * @param source the source mesh that triggered the event
  24920. * @param evt {Event} The original (browser) event
  24921. */
  24922. ActionEvent.CreateNew = function (source, evt) {
  24923. var scene = source.getScene();
  24924. return new ActionEvent(source, scene.pointerX, scene.pointerY, scene.meshUnderPointer, evt);
  24925. };
  24926. /**
  24927. * Helper function to auto-create an ActionEvent from a scene. If triggered by a mesh use ActionEvent.CreateNew
  24928. * @param scene the scene where the event occurred
  24929. * @param evt {Event} The original (browser) event
  24930. */
  24931. ActionEvent.CreateNewFromScene = function (scene, evt) {
  24932. return new ActionEvent(null, scene.pointerX, scene.pointerY, scene.meshUnderPointer, evt);
  24933. };
  24934. return ActionEvent;
  24935. })();
  24936. BABYLON.ActionEvent = ActionEvent;
  24937. /**
  24938. * Action Manager manages all events to be triggered on a given mesh or the global scene.
  24939. * A single scene can have many Action Managers to handle predefined actions on specific meshes.
  24940. */
  24941. var ActionManager = (function () {
  24942. function ActionManager(scene) {
  24943. // Members
  24944. this.actions = new Array();
  24945. this._scene = scene;
  24946. scene._actionManagers.push(this);
  24947. }
  24948. Object.defineProperty(ActionManager, "NothingTrigger", {
  24949. get: function () {
  24950. return ActionManager._NothingTrigger;
  24951. },
  24952. enumerable: true,
  24953. configurable: true
  24954. });
  24955. Object.defineProperty(ActionManager, "OnPickTrigger", {
  24956. get: function () {
  24957. return ActionManager._OnPickTrigger;
  24958. },
  24959. enumerable: true,
  24960. configurable: true
  24961. });
  24962. Object.defineProperty(ActionManager, "OnLeftPickTrigger", {
  24963. get: function () {
  24964. return ActionManager._OnLeftPickTrigger;
  24965. },
  24966. enumerable: true,
  24967. configurable: true
  24968. });
  24969. Object.defineProperty(ActionManager, "OnRightPickTrigger", {
  24970. get: function () {
  24971. return ActionManager._OnRightPickTrigger;
  24972. },
  24973. enumerable: true,
  24974. configurable: true
  24975. });
  24976. Object.defineProperty(ActionManager, "OnCenterPickTrigger", {
  24977. get: function () {
  24978. return ActionManager._OnCenterPickTrigger;
  24979. },
  24980. enumerable: true,
  24981. configurable: true
  24982. });
  24983. Object.defineProperty(ActionManager, "OnPointerOverTrigger", {
  24984. get: function () {
  24985. return ActionManager._OnPointerOverTrigger;
  24986. },
  24987. enumerable: true,
  24988. configurable: true
  24989. });
  24990. Object.defineProperty(ActionManager, "OnPointerOutTrigger", {
  24991. get: function () {
  24992. return ActionManager._OnPointerOutTrigger;
  24993. },
  24994. enumerable: true,
  24995. configurable: true
  24996. });
  24997. Object.defineProperty(ActionManager, "OnEveryFrameTrigger", {
  24998. get: function () {
  24999. return ActionManager._OnEveryFrameTrigger;
  25000. },
  25001. enumerable: true,
  25002. configurable: true
  25003. });
  25004. Object.defineProperty(ActionManager, "OnIntersectionEnterTrigger", {
  25005. get: function () {
  25006. return ActionManager._OnIntersectionEnterTrigger;
  25007. },
  25008. enumerable: true,
  25009. configurable: true
  25010. });
  25011. Object.defineProperty(ActionManager, "OnIntersectionExitTrigger", {
  25012. get: function () {
  25013. return ActionManager._OnIntersectionExitTrigger;
  25014. },
  25015. enumerable: true,
  25016. configurable: true
  25017. });
  25018. Object.defineProperty(ActionManager, "OnKeyDownTrigger", {
  25019. get: function () {
  25020. return ActionManager._OnKeyDownTrigger;
  25021. },
  25022. enumerable: true,
  25023. configurable: true
  25024. });
  25025. Object.defineProperty(ActionManager, "OnKeyUpTrigger", {
  25026. get: function () {
  25027. return ActionManager._OnKeyUpTrigger;
  25028. },
  25029. enumerable: true,
  25030. configurable: true
  25031. });
  25032. // Methods
  25033. ActionManager.prototype.dispose = function () {
  25034. var index = this._scene._actionManagers.indexOf(this);
  25035. if (index > -1) {
  25036. this._scene._actionManagers.splice(index, 1);
  25037. }
  25038. };
  25039. ActionManager.prototype.getScene = function () {
  25040. return this._scene;
  25041. };
  25042. /**
  25043. * Does this action manager handles actions of any of the given triggers
  25044. * @param {number[]} triggers - the triggers to be tested
  25045. * @return {boolean} whether one (or more) of the triggers is handeled
  25046. */
  25047. ActionManager.prototype.hasSpecificTriggers = function (triggers) {
  25048. for (var index = 0; index < this.actions.length; index++) {
  25049. var action = this.actions[index];
  25050. if (triggers.indexOf(action.trigger) > -1) {
  25051. return true;
  25052. }
  25053. }
  25054. return false;
  25055. };
  25056. Object.defineProperty(ActionManager.prototype, "hasPointerTriggers", {
  25057. /**
  25058. * Does this action manager has pointer triggers
  25059. * @return {boolean} whether or not it has pointer triggers
  25060. */
  25061. get: function () {
  25062. for (var index = 0; index < this.actions.length; index++) {
  25063. var action = this.actions[index];
  25064. if (action.trigger >= ActionManager._OnPickTrigger && action.trigger <= ActionManager._OnPointerOutTrigger) {
  25065. return true;
  25066. }
  25067. }
  25068. return false;
  25069. },
  25070. enumerable: true,
  25071. configurable: true
  25072. });
  25073. Object.defineProperty(ActionManager.prototype, "hasPickTriggers", {
  25074. /**
  25075. * Does this action manager has pick triggers
  25076. * @return {boolean} whether or not it has pick triggers
  25077. */
  25078. get: function () {
  25079. for (var index = 0; index < this.actions.length; index++) {
  25080. var action = this.actions[index];
  25081. if (action.trigger >= ActionManager._OnPickTrigger && action.trigger <= ActionManager._OnCenterPickTrigger) {
  25082. return true;
  25083. }
  25084. }
  25085. return false;
  25086. },
  25087. enumerable: true,
  25088. configurable: true
  25089. });
  25090. /**
  25091. * Registers an action to this action manager
  25092. * @param {BABYLON.Action} action - the action to be registered
  25093. * @return {BABYLON.Action} the action amended (prepared) after registration
  25094. */
  25095. ActionManager.prototype.registerAction = function (action) {
  25096. if (action.trigger === ActionManager.OnEveryFrameTrigger) {
  25097. if (this.getScene().actionManager !== this) {
  25098. BABYLON.Tools.Warn("OnEveryFrameTrigger can only be used with scene.actionManager");
  25099. return null;
  25100. }
  25101. }
  25102. this.actions.push(action);
  25103. action._actionManager = this;
  25104. action._prepare();
  25105. return action;
  25106. };
  25107. /**
  25108. * Process a specific trigger
  25109. * @param {number} trigger - the trigger to process
  25110. * @param evt {BABYLON.ActionEvent} the event details to be processed
  25111. */
  25112. ActionManager.prototype.processTrigger = function (trigger, evt) {
  25113. for (var index = 0; index < this.actions.length; index++) {
  25114. var action = this.actions[index];
  25115. if (action.trigger === trigger) {
  25116. if (trigger === ActionManager.OnKeyUpTrigger || trigger === ActionManager.OnKeyDownTrigger) {
  25117. var parameter = action.getTriggerParameter();
  25118. if (parameter) {
  25119. var unicode = evt.sourceEvent.charCode ? evt.sourceEvent.charCode : evt.sourceEvent.keyCode;
  25120. var actualkey = String.fromCharCode(unicode).toLowerCase();
  25121. if (actualkey !== parameter.toLowerCase()) {
  25122. continue;
  25123. }
  25124. }
  25125. }
  25126. action._executeCurrent(evt);
  25127. }
  25128. }
  25129. };
  25130. ActionManager.prototype._getEffectiveTarget = function (target, propertyPath) {
  25131. var properties = propertyPath.split(".");
  25132. for (var index = 0; index < properties.length - 1; index++) {
  25133. target = target[properties[index]];
  25134. }
  25135. return target;
  25136. };
  25137. ActionManager.prototype._getProperty = function (propertyPath) {
  25138. var properties = propertyPath.split(".");
  25139. return properties[properties.length - 1];
  25140. };
  25141. // Statics
  25142. ActionManager._NothingTrigger = 0;
  25143. ActionManager._OnPickTrigger = 1;
  25144. ActionManager._OnLeftPickTrigger = 2;
  25145. ActionManager._OnRightPickTrigger = 3;
  25146. ActionManager._OnCenterPickTrigger = 4;
  25147. ActionManager._OnPointerOverTrigger = 5;
  25148. ActionManager._OnPointerOutTrigger = 6;
  25149. ActionManager._OnEveryFrameTrigger = 7;
  25150. ActionManager._OnIntersectionEnterTrigger = 8;
  25151. ActionManager._OnIntersectionExitTrigger = 9;
  25152. ActionManager._OnKeyDownTrigger = 10;
  25153. ActionManager._OnKeyUpTrigger = 11;
  25154. return ActionManager;
  25155. })();
  25156. BABYLON.ActionManager = ActionManager;
  25157. })(BABYLON || (BABYLON = {}));
  25158. //# sourceMappingURL=babylon.actionManager.js.map
  25159. var BABYLON;
  25160. (function (BABYLON) {
  25161. var InterpolateValueAction = (function (_super) {
  25162. __extends(InterpolateValueAction, _super);
  25163. function InterpolateValueAction(triggerOptions, target, propertyPath, value, duration, condition, stopOtherAnimations) {
  25164. if (duration === void 0) { duration = 1000; }
  25165. _super.call(this, triggerOptions, condition);
  25166. this.propertyPath = propertyPath;
  25167. this.value = value;
  25168. this.duration = duration;
  25169. this.stopOtherAnimations = stopOtherAnimations;
  25170. this._target = target;
  25171. }
  25172. InterpolateValueAction.prototype._prepare = function () {
  25173. this._target = this._getEffectiveTarget(this._target, this.propertyPath);
  25174. this._property = this._getProperty(this.propertyPath);
  25175. };
  25176. InterpolateValueAction.prototype.execute = function () {
  25177. var scene = this._actionManager.getScene();
  25178. var keys = [
  25179. {
  25180. frame: 0,
  25181. value: this._target[this._property]
  25182. },
  25183. {
  25184. frame: 100,
  25185. value: this.value
  25186. }
  25187. ];
  25188. var dataType;
  25189. if (typeof this.value === "number") {
  25190. dataType = BABYLON.Animation.ANIMATIONTYPE_FLOAT;
  25191. }
  25192. else if (this.value instanceof BABYLON.Color3) {
  25193. dataType = BABYLON.Animation.ANIMATIONTYPE_COLOR3;
  25194. }
  25195. else if (this.value instanceof BABYLON.Vector3) {
  25196. dataType = BABYLON.Animation.ANIMATIONTYPE_VECTOR3;
  25197. }
  25198. else if (this.value instanceof BABYLON.Matrix) {
  25199. dataType = BABYLON.Animation.ANIMATIONTYPE_MATRIX;
  25200. }
  25201. else if (this.value instanceof BABYLON.Quaternion) {
  25202. dataType = BABYLON.Animation.ANIMATIONTYPE_QUATERNION;
  25203. }
  25204. else {
  25205. BABYLON.Tools.Warn("InterpolateValueAction: Unsupported type (" + typeof this.value + ")");
  25206. return;
  25207. }
  25208. var animation = new BABYLON.Animation("InterpolateValueAction", this._property, 100 * (1000.0 / this.duration), dataType, BABYLON.Animation.ANIMATIONLOOPMODE_CONSTANT);
  25209. animation.setKeys(keys);
  25210. if (this.stopOtherAnimations) {
  25211. scene.stopAnimation(this._target);
  25212. }
  25213. scene.beginDirectAnimation(this._target, [animation], 0, 100);
  25214. };
  25215. return InterpolateValueAction;
  25216. })(BABYLON.Action);
  25217. BABYLON.InterpolateValueAction = InterpolateValueAction;
  25218. })(BABYLON || (BABYLON = {}));
  25219. //# sourceMappingURL=babylon.interpolateValueAction.js.map
  25220. var BABYLON;
  25221. (function (BABYLON) {
  25222. var SwitchBooleanAction = (function (_super) {
  25223. __extends(SwitchBooleanAction, _super);
  25224. function SwitchBooleanAction(triggerOptions, target, propertyPath, condition) {
  25225. _super.call(this, triggerOptions, condition);
  25226. this.propertyPath = propertyPath;
  25227. this._target = target;
  25228. }
  25229. SwitchBooleanAction.prototype._prepare = function () {
  25230. this._target = this._getEffectiveTarget(this._target, this.propertyPath);
  25231. this._property = this._getProperty(this.propertyPath);
  25232. };
  25233. SwitchBooleanAction.prototype.execute = function () {
  25234. this._target[this._property] = !this._target[this._property];
  25235. };
  25236. return SwitchBooleanAction;
  25237. })(BABYLON.Action);
  25238. BABYLON.SwitchBooleanAction = SwitchBooleanAction;
  25239. var SetStateAction = (function (_super) {
  25240. __extends(SetStateAction, _super);
  25241. function SetStateAction(triggerOptions, target, value, condition) {
  25242. _super.call(this, triggerOptions, condition);
  25243. this.value = value;
  25244. this._target = target;
  25245. }
  25246. SetStateAction.prototype.execute = function () {
  25247. this._target.state = this.value;
  25248. };
  25249. return SetStateAction;
  25250. })(BABYLON.Action);
  25251. BABYLON.SetStateAction = SetStateAction;
  25252. var SetValueAction = (function (_super) {
  25253. __extends(SetValueAction, _super);
  25254. function SetValueAction(triggerOptions, target, propertyPath, value, condition) {
  25255. _super.call(this, triggerOptions, condition);
  25256. this.propertyPath = propertyPath;
  25257. this.value = value;
  25258. this._target = target;
  25259. }
  25260. SetValueAction.prototype._prepare = function () {
  25261. this._target = this._getEffectiveTarget(this._target, this.propertyPath);
  25262. this._property = this._getProperty(this.propertyPath);
  25263. };
  25264. SetValueAction.prototype.execute = function () {
  25265. this._target[this._property] = this.value;
  25266. };
  25267. return SetValueAction;
  25268. })(BABYLON.Action);
  25269. BABYLON.SetValueAction = SetValueAction;
  25270. var IncrementValueAction = (function (_super) {
  25271. __extends(IncrementValueAction, _super);
  25272. function IncrementValueAction(triggerOptions, target, propertyPath, value, condition) {
  25273. _super.call(this, triggerOptions, condition);
  25274. this.propertyPath = propertyPath;
  25275. this.value = value;
  25276. this._target = target;
  25277. }
  25278. IncrementValueAction.prototype._prepare = function () {
  25279. this._target = this._getEffectiveTarget(this._target, this.propertyPath);
  25280. this._property = this._getProperty(this.propertyPath);
  25281. if (typeof this._target[this._property] !== "number") {
  25282. BABYLON.Tools.Warn("Warning: IncrementValueAction can only be used with number values");
  25283. }
  25284. };
  25285. IncrementValueAction.prototype.execute = function () {
  25286. this._target[this._property] += this.value;
  25287. };
  25288. return IncrementValueAction;
  25289. })(BABYLON.Action);
  25290. BABYLON.IncrementValueAction = IncrementValueAction;
  25291. var PlayAnimationAction = (function (_super) {
  25292. __extends(PlayAnimationAction, _super);
  25293. function PlayAnimationAction(triggerOptions, target, from, to, loop, condition) {
  25294. _super.call(this, triggerOptions, condition);
  25295. this.from = from;
  25296. this.to = to;
  25297. this.loop = loop;
  25298. this._target = target;
  25299. }
  25300. PlayAnimationAction.prototype._prepare = function () {
  25301. };
  25302. PlayAnimationAction.prototype.execute = function () {
  25303. var scene = this._actionManager.getScene();
  25304. scene.beginAnimation(this._target, this.from, this.to, this.loop);
  25305. };
  25306. return PlayAnimationAction;
  25307. })(BABYLON.Action);
  25308. BABYLON.PlayAnimationAction = PlayAnimationAction;
  25309. var StopAnimationAction = (function (_super) {
  25310. __extends(StopAnimationAction, _super);
  25311. function StopAnimationAction(triggerOptions, target, condition) {
  25312. _super.call(this, triggerOptions, condition);
  25313. this._target = target;
  25314. }
  25315. StopAnimationAction.prototype._prepare = function () {
  25316. };
  25317. StopAnimationAction.prototype.execute = function () {
  25318. var scene = this._actionManager.getScene();
  25319. scene.stopAnimation(this._target);
  25320. };
  25321. return StopAnimationAction;
  25322. })(BABYLON.Action);
  25323. BABYLON.StopAnimationAction = StopAnimationAction;
  25324. var DoNothingAction = (function (_super) {
  25325. __extends(DoNothingAction, _super);
  25326. function DoNothingAction(triggerOptions, condition) {
  25327. if (triggerOptions === void 0) { triggerOptions = BABYLON.ActionManager.NothingTrigger; }
  25328. _super.call(this, triggerOptions, condition);
  25329. }
  25330. DoNothingAction.prototype.execute = function () {
  25331. };
  25332. return DoNothingAction;
  25333. })(BABYLON.Action);
  25334. BABYLON.DoNothingAction = DoNothingAction;
  25335. var CombineAction = (function (_super) {
  25336. __extends(CombineAction, _super);
  25337. function CombineAction(triggerOptions, children, condition) {
  25338. _super.call(this, triggerOptions, condition);
  25339. this.children = children;
  25340. }
  25341. CombineAction.prototype._prepare = function () {
  25342. for (var index = 0; index < this.children.length; index++) {
  25343. this.children[index]._actionManager = this._actionManager;
  25344. this.children[index]._prepare();
  25345. }
  25346. };
  25347. CombineAction.prototype.execute = function (evt) {
  25348. for (var index = 0; index < this.children.length; index++) {
  25349. this.children[index].execute(evt);
  25350. }
  25351. };
  25352. return CombineAction;
  25353. })(BABYLON.Action);
  25354. BABYLON.CombineAction = CombineAction;
  25355. var ExecuteCodeAction = (function (_super) {
  25356. __extends(ExecuteCodeAction, _super);
  25357. function ExecuteCodeAction(triggerOptions, func, condition) {
  25358. _super.call(this, triggerOptions, condition);
  25359. this.func = func;
  25360. }
  25361. ExecuteCodeAction.prototype.execute = function (evt) {
  25362. this.func(evt);
  25363. };
  25364. return ExecuteCodeAction;
  25365. })(BABYLON.Action);
  25366. BABYLON.ExecuteCodeAction = ExecuteCodeAction;
  25367. var SetParentAction = (function (_super) {
  25368. __extends(SetParentAction, _super);
  25369. function SetParentAction(triggerOptions, target, parent, condition) {
  25370. _super.call(this, triggerOptions, condition);
  25371. this._target = target;
  25372. this._parent = parent;
  25373. }
  25374. SetParentAction.prototype._prepare = function () {
  25375. };
  25376. SetParentAction.prototype.execute = function () {
  25377. if (this._target.parent === this._parent) {
  25378. return;
  25379. }
  25380. var invertParentWorldMatrix = this._parent.getWorldMatrix().clone();
  25381. invertParentWorldMatrix.invert();
  25382. this._target.position = BABYLON.Vector3.TransformCoordinates(this._target.position, invertParentWorldMatrix);
  25383. this._target.parent = this._parent;
  25384. };
  25385. return SetParentAction;
  25386. })(BABYLON.Action);
  25387. BABYLON.SetParentAction = SetParentAction;
  25388. var PlaySoundAction = (function (_super) {
  25389. __extends(PlaySoundAction, _super);
  25390. function PlaySoundAction(triggerOptions, sound, condition) {
  25391. _super.call(this, triggerOptions, condition);
  25392. this._sound = sound;
  25393. }
  25394. PlaySoundAction.prototype._prepare = function () {
  25395. };
  25396. PlaySoundAction.prototype.execute = function () {
  25397. if (this._sound !== undefined)
  25398. this._sound.play();
  25399. };
  25400. return PlaySoundAction;
  25401. })(BABYLON.Action);
  25402. BABYLON.PlaySoundAction = PlaySoundAction;
  25403. var StopSoundAction = (function (_super) {
  25404. __extends(StopSoundAction, _super);
  25405. function StopSoundAction(triggerOptions, sound, condition) {
  25406. _super.call(this, triggerOptions, condition);
  25407. this._sound = sound;
  25408. }
  25409. StopSoundAction.prototype._prepare = function () {
  25410. };
  25411. StopSoundAction.prototype.execute = function () {
  25412. if (this._sound !== undefined)
  25413. this._sound.stop();
  25414. };
  25415. return StopSoundAction;
  25416. })(BABYLON.Action);
  25417. BABYLON.StopSoundAction = StopSoundAction;
  25418. })(BABYLON || (BABYLON = {}));
  25419. //# sourceMappingURL=babylon.directActions.js.map
  25420. var BABYLON;
  25421. (function (BABYLON) {
  25422. var Geometry = (function () {
  25423. function Geometry(id, scene, vertexData, updatable, mesh) {
  25424. this.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_NONE;
  25425. this._totalVertices = 0;
  25426. this._indices = [];
  25427. this._isDisposed = false;
  25428. this.id = id;
  25429. this._engine = scene.getEngine();
  25430. this._meshes = [];
  25431. this._scene = scene;
  25432. // vertexData
  25433. if (vertexData) {
  25434. this.setAllVerticesData(vertexData, updatable);
  25435. }
  25436. else {
  25437. this._totalVertices = 0;
  25438. this._indices = [];
  25439. }
  25440. // applyToMesh
  25441. if (mesh) {
  25442. this.applyToMesh(mesh);
  25443. mesh.computeWorldMatrix(true);
  25444. }
  25445. }
  25446. Geometry.prototype.getScene = function () {
  25447. return this._scene;
  25448. };
  25449. Geometry.prototype.getEngine = function () {
  25450. return this._engine;
  25451. };
  25452. Geometry.prototype.isReady = function () {
  25453. return this.delayLoadState === BABYLON.Engine.DELAYLOADSTATE_LOADED || this.delayLoadState === BABYLON.Engine.DELAYLOADSTATE_NONE;
  25454. };
  25455. Geometry.prototype.setAllVerticesData = function (vertexData, updatable) {
  25456. vertexData.applyToGeometry(this, updatable);
  25457. this.notifyUpdate();
  25458. };
  25459. Geometry.prototype.setVerticesData = function (kind, data, updatable, stride) {
  25460. this._vertexBuffers = this._vertexBuffers || {};
  25461. if (this._vertexBuffers[kind]) {
  25462. this._vertexBuffers[kind].dispose();
  25463. }
  25464. this._vertexBuffers[kind] = new BABYLON.VertexBuffer(this._engine, data, kind, updatable, this._meshes.length === 0, stride);
  25465. if (kind === BABYLON.VertexBuffer.PositionKind) {
  25466. stride = this._vertexBuffers[kind].getStrideSize();
  25467. this._totalVertices = data.length / stride;
  25468. var extend = BABYLON.Tools.ExtractMinAndMax(data, 0, this._totalVertices);
  25469. var meshes = this._meshes;
  25470. var numOfMeshes = meshes.length;
  25471. for (var index = 0; index < numOfMeshes; index++) {
  25472. var mesh = meshes[index];
  25473. mesh._resetPointsArrayCache();
  25474. mesh._boundingInfo = new BABYLON.BoundingInfo(extend.minimum, extend.maximum);
  25475. mesh._createGlobalSubMesh();
  25476. mesh.computeWorldMatrix(true);
  25477. }
  25478. }
  25479. this.notifyUpdate(kind);
  25480. };
  25481. Geometry.prototype.updateVerticesDataDirectly = function (kind, data, offset) {
  25482. var vertexBuffer = this.getVertexBuffer(kind);
  25483. if (!vertexBuffer) {
  25484. return;
  25485. }
  25486. vertexBuffer.updateDirectly(data, offset);
  25487. this.notifyUpdate(kind);
  25488. };
  25489. Geometry.prototype.updateVerticesData = function (kind, data, updateExtends) {
  25490. var vertexBuffer = this.getVertexBuffer(kind);
  25491. if (!vertexBuffer) {
  25492. return;
  25493. }
  25494. vertexBuffer.update(data);
  25495. if (kind === BABYLON.VertexBuffer.PositionKind) {
  25496. var extend;
  25497. var stride = vertexBuffer.getStrideSize();
  25498. this._totalVertices = data.length / stride;
  25499. if (updateExtends) {
  25500. extend = BABYLON.Tools.ExtractMinAndMax(data, 0, this._totalVertices);
  25501. }
  25502. var meshes = this._meshes;
  25503. var numOfMeshes = meshes.length;
  25504. for (var index = 0; index < numOfMeshes; index++) {
  25505. var mesh = meshes[index];
  25506. mesh._resetPointsArrayCache();
  25507. if (updateExtends) {
  25508. mesh._boundingInfo = new BABYLON.BoundingInfo(extend.minimum, extend.maximum);
  25509. for (var subIndex = 0; subIndex < mesh.subMeshes.length; subIndex++) {
  25510. var subMesh = mesh.subMeshes[subIndex];
  25511. subMesh.refreshBoundingInfo();
  25512. }
  25513. }
  25514. }
  25515. }
  25516. this.notifyUpdate(kind);
  25517. };
  25518. Geometry.prototype.getTotalVertices = function () {
  25519. if (!this.isReady()) {
  25520. return 0;
  25521. }
  25522. return this._totalVertices;
  25523. };
  25524. Geometry.prototype.getVerticesData = function (kind) {
  25525. var vertexBuffer = this.getVertexBuffer(kind);
  25526. if (!vertexBuffer) {
  25527. return null;
  25528. }
  25529. return vertexBuffer.getData();
  25530. };
  25531. Geometry.prototype.getVertexBuffer = function (kind) {
  25532. if (!this.isReady()) {
  25533. return null;
  25534. }
  25535. return this._vertexBuffers[kind];
  25536. };
  25537. Geometry.prototype.getVertexBuffers = function () {
  25538. if (!this.isReady()) {
  25539. return null;
  25540. }
  25541. return this._vertexBuffers;
  25542. };
  25543. Geometry.prototype.isVerticesDataPresent = function (kind) {
  25544. if (!this._vertexBuffers) {
  25545. if (this._delayInfo) {
  25546. return this._delayInfo.indexOf(kind) !== -1;
  25547. }
  25548. return false;
  25549. }
  25550. return this._vertexBuffers[kind] !== undefined;
  25551. };
  25552. Geometry.prototype.getVerticesDataKinds = function () {
  25553. var result = [];
  25554. if (!this._vertexBuffers && this._delayInfo) {
  25555. for (var kind in this._delayInfo) {
  25556. result.push(kind);
  25557. }
  25558. }
  25559. else {
  25560. for (kind in this._vertexBuffers) {
  25561. result.push(kind);
  25562. }
  25563. }
  25564. return result;
  25565. };
  25566. Geometry.prototype.setIndices = function (indices, totalVertices) {
  25567. if (this._indexBuffer) {
  25568. this._engine._releaseBuffer(this._indexBuffer);
  25569. }
  25570. this._indices = indices;
  25571. if (this._meshes.length !== 0 && this._indices) {
  25572. this._indexBuffer = this._engine.createIndexBuffer(this._indices);
  25573. }
  25574. if (totalVertices !== undefined) {
  25575. this._totalVertices = totalVertices;
  25576. }
  25577. var meshes = this._meshes;
  25578. var numOfMeshes = meshes.length;
  25579. for (var index = 0; index < numOfMeshes; index++) {
  25580. meshes[index]._createGlobalSubMesh();
  25581. }
  25582. this.notifyUpdate();
  25583. };
  25584. Geometry.prototype.getTotalIndices = function () {
  25585. if (!this.isReady()) {
  25586. return 0;
  25587. }
  25588. return this._indices.length;
  25589. };
  25590. Geometry.prototype.getIndices = function () {
  25591. if (!this.isReady()) {
  25592. return null;
  25593. }
  25594. return this._indices;
  25595. };
  25596. Geometry.prototype.getIndexBuffer = function () {
  25597. if (!this.isReady()) {
  25598. return null;
  25599. }
  25600. return this._indexBuffer;
  25601. };
  25602. Geometry.prototype.releaseForMesh = function (mesh, shouldDispose) {
  25603. var meshes = this._meshes;
  25604. var index = meshes.indexOf(mesh);
  25605. if (index === -1) {
  25606. return;
  25607. }
  25608. for (var kind in this._vertexBuffers) {
  25609. this._vertexBuffers[kind].dispose();
  25610. }
  25611. if (this._indexBuffer && this._engine._releaseBuffer(this._indexBuffer)) {
  25612. this._indexBuffer = null;
  25613. }
  25614. meshes.splice(index, 1);
  25615. mesh._geometry = null;
  25616. if (meshes.length === 0 && shouldDispose) {
  25617. this.dispose();
  25618. }
  25619. };
  25620. Geometry.prototype.applyToMesh = function (mesh) {
  25621. if (mesh._geometry === this) {
  25622. return;
  25623. }
  25624. var previousGeometry = mesh._geometry;
  25625. if (previousGeometry) {
  25626. previousGeometry.releaseForMesh(mesh);
  25627. }
  25628. var meshes = this._meshes;
  25629. // must be done before setting vertexBuffers because of mesh._createGlobalSubMesh()
  25630. mesh._geometry = this;
  25631. this._scene.pushGeometry(this);
  25632. meshes.push(mesh);
  25633. if (this.isReady()) {
  25634. this._applyToMesh(mesh);
  25635. }
  25636. else {
  25637. mesh._boundingInfo = this._boundingInfo;
  25638. }
  25639. };
  25640. Geometry.prototype._applyToMesh = function (mesh) {
  25641. var numOfMeshes = this._meshes.length;
  25642. for (var kind in this._vertexBuffers) {
  25643. if (numOfMeshes === 1) {
  25644. this._vertexBuffers[kind].create();
  25645. }
  25646. this._vertexBuffers[kind]._buffer.references = numOfMeshes;
  25647. if (kind === BABYLON.VertexBuffer.PositionKind) {
  25648. mesh._resetPointsArrayCache();
  25649. var extend = BABYLON.Tools.ExtractMinAndMax(this._vertexBuffers[kind].getData(), 0, this._totalVertices);
  25650. mesh._boundingInfo = new BABYLON.BoundingInfo(extend.minimum, extend.maximum);
  25651. mesh._createGlobalSubMesh();
  25652. //bounding info was just created again, world matrix should be applied again.
  25653. mesh._updateBoundingInfo();
  25654. }
  25655. }
  25656. // indexBuffer
  25657. if (numOfMeshes === 1 && this._indices) {
  25658. this._indexBuffer = this._engine.createIndexBuffer(this._indices);
  25659. }
  25660. if (this._indexBuffer) {
  25661. this._indexBuffer.references = numOfMeshes;
  25662. }
  25663. };
  25664. Geometry.prototype.notifyUpdate = function (kind) {
  25665. if (this.onGeometryUpdated) {
  25666. this.onGeometryUpdated(this, kind);
  25667. }
  25668. };
  25669. Geometry.prototype.load = function (scene, onLoaded) {
  25670. var _this = this;
  25671. if (this.delayLoadState === BABYLON.Engine.DELAYLOADSTATE_LOADING) {
  25672. return;
  25673. }
  25674. if (this.isReady()) {
  25675. if (onLoaded) {
  25676. onLoaded();
  25677. }
  25678. return;
  25679. }
  25680. this.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_LOADING;
  25681. scene._addPendingData(this);
  25682. BABYLON.Tools.LoadFile(this.delayLoadingFile, function (data) {
  25683. _this._delayLoadingFunction(JSON.parse(data), _this);
  25684. _this.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_LOADED;
  25685. _this._delayInfo = [];
  25686. scene._removePendingData(_this);
  25687. var meshes = _this._meshes;
  25688. var numOfMeshes = meshes.length;
  25689. for (var index = 0; index < numOfMeshes; index++) {
  25690. _this._applyToMesh(meshes[index]);
  25691. }
  25692. if (onLoaded) {
  25693. onLoaded();
  25694. }
  25695. }, function () {
  25696. }, scene.database);
  25697. };
  25698. Geometry.prototype.isDisposed = function () {
  25699. return this._isDisposed;
  25700. };
  25701. Geometry.prototype.dispose = function () {
  25702. var meshes = this._meshes;
  25703. var numOfMeshes = meshes.length;
  25704. var index;
  25705. for (index = 0; index < numOfMeshes; index++) {
  25706. this.releaseForMesh(meshes[index]);
  25707. }
  25708. this._meshes = [];
  25709. for (var kind in this._vertexBuffers) {
  25710. this._vertexBuffers[kind].dispose();
  25711. }
  25712. this._vertexBuffers = [];
  25713. this._totalVertices = 0;
  25714. if (this._indexBuffer) {
  25715. this._engine._releaseBuffer(this._indexBuffer);
  25716. }
  25717. this._indexBuffer = null;
  25718. this._indices = [];
  25719. this.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_NONE;
  25720. this.delayLoadingFile = null;
  25721. this._delayLoadingFunction = null;
  25722. this._delayInfo = [];
  25723. this._boundingInfo = null; // todo: .dispose()
  25724. this._scene.removeGeometry(this);
  25725. this._isDisposed = true;
  25726. };
  25727. Geometry.prototype.copy = function (id) {
  25728. var vertexData = new BABYLON.VertexData();
  25729. vertexData.indices = [];
  25730. var indices = this.getIndices();
  25731. for (var index = 0; index < indices.length; index++) {
  25732. vertexData.indices.push(indices[index]);
  25733. }
  25734. var updatable = false;
  25735. var stopChecking = false;
  25736. for (var kind in this._vertexBuffers) {
  25737. // using slice() to make a copy of the array and not just reference it
  25738. vertexData.set(this.getVerticesData(kind).slice(0), kind);
  25739. if (!stopChecking) {
  25740. updatable = this.getVertexBuffer(kind).isUpdatable();
  25741. stopChecking = !updatable;
  25742. }
  25743. }
  25744. var geometry = new Geometry(id, this._scene, vertexData, updatable, null);
  25745. geometry.delayLoadState = this.delayLoadState;
  25746. geometry.delayLoadingFile = this.delayLoadingFile;
  25747. geometry._delayLoadingFunction = this._delayLoadingFunction;
  25748. for (kind in this._delayInfo) {
  25749. geometry._delayInfo = geometry._delayInfo || [];
  25750. geometry._delayInfo.push(kind);
  25751. }
  25752. // Bounding info
  25753. var extend = BABYLON.Tools.ExtractMinAndMax(this.getVerticesData(BABYLON.VertexBuffer.PositionKind), 0, this.getTotalVertices());
  25754. geometry._boundingInfo = new BABYLON.BoundingInfo(extend.minimum, extend.maximum);
  25755. return geometry;
  25756. };
  25757. // Statics
  25758. Geometry.ExtractFromMesh = function (mesh, id) {
  25759. var geometry = mesh._geometry;
  25760. if (!geometry) {
  25761. return null;
  25762. }
  25763. return geometry.copy(id);
  25764. };
  25765. // from http://stackoverflow.com/questions/105034/how-to-create-a-guid-uuid-in-javascript/2117523#answer-2117523
  25766. // be aware Math.random() could cause collisions
  25767. Geometry.RandomId = function () {
  25768. return 'xxxxxxxx-xxxx-4xxx-yxxx-xxxxxxxxxxxx'.replace(/[xy]/g, function (c) {
  25769. var r = Math.random() * 16 | 0, v = c === 'x' ? r : (r & 0x3 | 0x8);
  25770. return v.toString(16);
  25771. });
  25772. };
  25773. return Geometry;
  25774. })();
  25775. BABYLON.Geometry = Geometry;
  25776. /////// Primitives //////////////////////////////////////////////
  25777. var Geometry;
  25778. (function (Geometry) {
  25779. var Primitives;
  25780. (function (Primitives) {
  25781. /// Abstract class
  25782. var _Primitive = (function (_super) {
  25783. __extends(_Primitive, _super);
  25784. function _Primitive(id, scene, vertexData, canBeRegenerated, mesh) {
  25785. this._beingRegenerated = true;
  25786. this._canBeRegenerated = canBeRegenerated;
  25787. _super.call(this, id, scene, vertexData, false, mesh); // updatable = false to be sure not to update vertices
  25788. this._beingRegenerated = false;
  25789. }
  25790. _Primitive.prototype.canBeRegenerated = function () {
  25791. return this._canBeRegenerated;
  25792. };
  25793. _Primitive.prototype.regenerate = function () {
  25794. if (!this._canBeRegenerated) {
  25795. return;
  25796. }
  25797. this._beingRegenerated = true;
  25798. this.setAllVerticesData(this._regenerateVertexData(), false);
  25799. this._beingRegenerated = false;
  25800. };
  25801. _Primitive.prototype.asNewGeometry = function (id) {
  25802. return _super.prototype.copy.call(this, id);
  25803. };
  25804. // overrides
  25805. _Primitive.prototype.setAllVerticesData = function (vertexData, updatable) {
  25806. if (!this._beingRegenerated) {
  25807. return;
  25808. }
  25809. _super.prototype.setAllVerticesData.call(this, vertexData, false);
  25810. };
  25811. _Primitive.prototype.setVerticesData = function (kind, data, updatable) {
  25812. if (!this._beingRegenerated) {
  25813. return;
  25814. }
  25815. _super.prototype.setVerticesData.call(this, kind, data, false);
  25816. };
  25817. // to override
  25818. // protected
  25819. _Primitive.prototype._regenerateVertexData = function () {
  25820. throw new Error("Abstract method");
  25821. };
  25822. _Primitive.prototype.copy = function (id) {
  25823. throw new Error("Must be overriden in sub-classes.");
  25824. };
  25825. return _Primitive;
  25826. })(Geometry);
  25827. Primitives._Primitive = _Primitive;
  25828. var Ribbon = (function (_super) {
  25829. __extends(Ribbon, _super);
  25830. function Ribbon(id, scene, pathArray, closeArray, closePath, offset, canBeRegenerated, mesh, side) {
  25831. if (side === void 0) { side = BABYLON.Mesh.DEFAULTSIDE; }
  25832. this.pathArray = pathArray;
  25833. this.closeArray = closeArray;
  25834. this.closePath = closePath;
  25835. this.offset = offset;
  25836. this.side = side;
  25837. _super.call(this, id, scene, this._regenerateVertexData(), canBeRegenerated, mesh);
  25838. }
  25839. Ribbon.prototype._regenerateVertexData = function () {
  25840. return BABYLON.VertexData.CreateRibbon(this.pathArray, this.closeArray, this.closePath, this.offset, this.side);
  25841. };
  25842. Ribbon.prototype.copy = function (id) {
  25843. return new Ribbon(id, this.getScene(), this.pathArray, this.closeArray, this.closePath, this.offset, this.canBeRegenerated(), null, this.side);
  25844. };
  25845. return Ribbon;
  25846. })(_Primitive);
  25847. Primitives.Ribbon = Ribbon;
  25848. var Box = (function (_super) {
  25849. __extends(Box, _super);
  25850. function Box(id, scene, size, canBeRegenerated, mesh, side) {
  25851. if (side === void 0) { side = BABYLON.Mesh.DEFAULTSIDE; }
  25852. this.size = size;
  25853. this.side = side;
  25854. _super.call(this, id, scene, this._regenerateVertexData(), canBeRegenerated, mesh);
  25855. }
  25856. Box.prototype._regenerateVertexData = function () {
  25857. return BABYLON.VertexData.CreateBox(this.size, this.side);
  25858. };
  25859. Box.prototype.copy = function (id) {
  25860. return new Box(id, this.getScene(), this.size, this.canBeRegenerated(), null, this.side);
  25861. };
  25862. return Box;
  25863. })(_Primitive);
  25864. Primitives.Box = Box;
  25865. var Sphere = (function (_super) {
  25866. __extends(Sphere, _super);
  25867. function Sphere(id, scene, segments, diameter, canBeRegenerated, mesh, side) {
  25868. if (side === void 0) { side = BABYLON.Mesh.DEFAULTSIDE; }
  25869. this.segments = segments;
  25870. this.diameter = diameter;
  25871. this.side = side;
  25872. _super.call(this, id, scene, this._regenerateVertexData(), canBeRegenerated, mesh);
  25873. }
  25874. Sphere.prototype._regenerateVertexData = function () {
  25875. return BABYLON.VertexData.CreateSphere(this.segments, this.diameter, this.side);
  25876. };
  25877. Sphere.prototype.copy = function (id) {
  25878. return new Sphere(id, this.getScene(), this.segments, this.diameter, this.canBeRegenerated(), null, this.side);
  25879. };
  25880. return Sphere;
  25881. })(_Primitive);
  25882. Primitives.Sphere = Sphere;
  25883. var Cylinder = (function (_super) {
  25884. __extends(Cylinder, _super);
  25885. function Cylinder(id, scene, height, diameterTop, diameterBottom, tessellation, subdivisions, canBeRegenerated, mesh, side) {
  25886. if (subdivisions === void 0) { subdivisions = 1; }
  25887. if (side === void 0) { side = BABYLON.Mesh.DEFAULTSIDE; }
  25888. this.height = height;
  25889. this.diameterTop = diameterTop;
  25890. this.diameterBottom = diameterBottom;
  25891. this.tessellation = tessellation;
  25892. this.subdivisions = subdivisions;
  25893. this.side = side;
  25894. _super.call(this, id, scene, this._regenerateVertexData(), canBeRegenerated, mesh);
  25895. }
  25896. Cylinder.prototype._regenerateVertexData = function () {
  25897. return BABYLON.VertexData.CreateCylinder(this.height, this.diameterTop, this.diameterBottom, this.tessellation, this.subdivisions, this.side);
  25898. };
  25899. Cylinder.prototype.copy = function (id) {
  25900. return new Cylinder(id, this.getScene(), this.height, this.diameterTop, this.diameterBottom, this.tessellation, this.subdivisions, this.canBeRegenerated(), null, this.side);
  25901. };
  25902. return Cylinder;
  25903. })(_Primitive);
  25904. Primitives.Cylinder = Cylinder;
  25905. var Torus = (function (_super) {
  25906. __extends(Torus, _super);
  25907. function Torus(id, scene, diameter, thickness, tessellation, canBeRegenerated, mesh, side) {
  25908. if (side === void 0) { side = BABYLON.Mesh.DEFAULTSIDE; }
  25909. this.diameter = diameter;
  25910. this.thickness = thickness;
  25911. this.tessellation = tessellation;
  25912. this.side = side;
  25913. _super.call(this, id, scene, this._regenerateVertexData(), canBeRegenerated, mesh);
  25914. }
  25915. Torus.prototype._regenerateVertexData = function () {
  25916. return BABYLON.VertexData.CreateTorus(this.diameter, this.thickness, this.tessellation, this.side);
  25917. };
  25918. Torus.prototype.copy = function (id) {
  25919. return new Torus(id, this.getScene(), this.diameter, this.thickness, this.tessellation, this.canBeRegenerated(), null, this.side);
  25920. };
  25921. return Torus;
  25922. })(_Primitive);
  25923. Primitives.Torus = Torus;
  25924. var Ground = (function (_super) {
  25925. __extends(Ground, _super);
  25926. function Ground(id, scene, width, height, subdivisions, canBeRegenerated, mesh) {
  25927. this.width = width;
  25928. this.height = height;
  25929. this.subdivisions = subdivisions;
  25930. _super.call(this, id, scene, this._regenerateVertexData(), canBeRegenerated, mesh);
  25931. }
  25932. Ground.prototype._regenerateVertexData = function () {
  25933. return BABYLON.VertexData.CreateGround(this.width, this.height, this.subdivisions);
  25934. };
  25935. Ground.prototype.copy = function (id) {
  25936. return new Ground(id, this.getScene(), this.width, this.height, this.subdivisions, this.canBeRegenerated(), null);
  25937. };
  25938. return Ground;
  25939. })(_Primitive);
  25940. Primitives.Ground = Ground;
  25941. var TiledGround = (function (_super) {
  25942. __extends(TiledGround, _super);
  25943. function TiledGround(id, scene, xmin, zmin, xmax, zmax, subdivisions, precision, canBeRegenerated, mesh) {
  25944. this.xmin = xmin;
  25945. this.zmin = zmin;
  25946. this.xmax = xmax;
  25947. this.zmax = zmax;
  25948. this.subdivisions = subdivisions;
  25949. this.precision = precision;
  25950. _super.call(this, id, scene, this._regenerateVertexData(), canBeRegenerated, mesh);
  25951. }
  25952. TiledGround.prototype._regenerateVertexData = function () {
  25953. return BABYLON.VertexData.CreateTiledGround(this.xmin, this.zmin, this.xmax, this.zmax, this.subdivisions, this.precision);
  25954. };
  25955. TiledGround.prototype.copy = function (id) {
  25956. return new TiledGround(id, this.getScene(), this.xmin, this.zmin, this.xmax, this.zmax, this.subdivisions, this.precision, this.canBeRegenerated(), null);
  25957. };
  25958. return TiledGround;
  25959. })(_Primitive);
  25960. Primitives.TiledGround = TiledGround;
  25961. var Plane = (function (_super) {
  25962. __extends(Plane, _super);
  25963. function Plane(id, scene, size, canBeRegenerated, mesh, side) {
  25964. if (side === void 0) { side = BABYLON.Mesh.DEFAULTSIDE; }
  25965. this.size = size;
  25966. this.side = side;
  25967. _super.call(this, id, scene, this._regenerateVertexData(), canBeRegenerated, mesh);
  25968. }
  25969. Plane.prototype._regenerateVertexData = function () {
  25970. return BABYLON.VertexData.CreatePlane(this.size, this.side);
  25971. };
  25972. Plane.prototype.copy = function (id) {
  25973. return new Plane(id, this.getScene(), this.size, this.canBeRegenerated(), null, this.side);
  25974. };
  25975. return Plane;
  25976. })(_Primitive);
  25977. Primitives.Plane = Plane;
  25978. var TorusKnot = (function (_super) {
  25979. __extends(TorusKnot, _super);
  25980. function TorusKnot(id, scene, radius, tube, radialSegments, tubularSegments, p, q, canBeRegenerated, mesh, side) {
  25981. if (side === void 0) { side = BABYLON.Mesh.DEFAULTSIDE; }
  25982. this.radius = radius;
  25983. this.tube = tube;
  25984. this.radialSegments = radialSegments;
  25985. this.tubularSegments = tubularSegments;
  25986. this.p = p;
  25987. this.q = q;
  25988. this.side = side;
  25989. _super.call(this, id, scene, this._regenerateVertexData(), canBeRegenerated, mesh);
  25990. }
  25991. TorusKnot.prototype._regenerateVertexData = function () {
  25992. return BABYLON.VertexData.CreateTorusKnot(this.radius, this.tube, this.radialSegments, this.tubularSegments, this.p, this.q, this.side);
  25993. };
  25994. TorusKnot.prototype.copy = function (id) {
  25995. return new TorusKnot(id, this.getScene(), this.radius, this.tube, this.radialSegments, this.tubularSegments, this.p, this.q, this.canBeRegenerated(), null, this.side);
  25996. };
  25997. return TorusKnot;
  25998. })(_Primitive);
  25999. Primitives.TorusKnot = TorusKnot;
  26000. })(Primitives = Geometry.Primitives || (Geometry.Primitives = {}));
  26001. })(Geometry = BABYLON.Geometry || (BABYLON.Geometry = {}));
  26002. })(BABYLON || (BABYLON = {}));
  26003. //# sourceMappingURL=babylon.geometry.js.map
  26004. var BABYLON;
  26005. (function (BABYLON) {
  26006. var Gamepads = (function () {
  26007. function Gamepads(ongamedpadconnected) {
  26008. var _this = this;
  26009. this.babylonGamepads = [];
  26010. this.oneGamepadConnected = false;
  26011. this.isMonitoring = false;
  26012. this.gamepadEventSupported = 'GamepadEvent' in window;
  26013. this.gamepadSupportAvailable = (navigator.getGamepads || !!navigator.webkitGetGamepads || !!navigator.msGetGamepads || !!navigator.webkitGamepads);
  26014. this.buttonADataURL = "data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAEAAAABACAYAAACqaXHeAAAABGdBTUEAAK/INwWK6QAAABl0RVh0U29mdHdhcmUAQWRvYmUgSW1hZ2VSZWFkeXHJZTwAAA9aSURBVHja7FtpbBzneX7m3otcihSpm9Z9UJalxPKhVLZlp6ktNzEaxE0CtAnQAgnSoPWPBi3syuiPwordFi5Qt2haFygCoylSV4Vby6os1I3kOLYrS65kXXQoypJJSaFEUTyXy925+rzfzC6HFFlL1kpAIe7i5czO7H7zPs97ft8MtTAMcSu/dNzirxkCZgiYIWCGgBkCZgi4hV/mDR5fSxAt+0ZiX0ucDxMSTJLK+f83BFSA6TFgK75OclshouKBFbA+xaV4k7Z+fD6sNRlmjYFXQMu4NiUVS/oHe5/ecnHo3MYxd7QthN9UcsdW6FqEPwgDOFbqpAajL2VlTrTULzj4Ow8+s4+nipSxWMoxIUkyrl/pGswFtIR7WzHgDCX77K7vfHNkbOA+AryjYZadb27OIJdzCNZBKmXw4kbk35qPsTEfJbeEkZESentHMdBfGtY142gu1bDvqV/925f4tQJlNCaj4hXX7RHXS0AFuJEAXvfHr/zmk67vPjir0V68aFEe8xtuQ6O1FHlrEXLmHBiaDUtzYBlpNYjrF+GFZfhhCcPeBQy53ehzT+H8QBe6uwfRf7l8xjKsvX/y5X98jl8fThDhJ4i46QQkrS5I6v7oX7/++77vPtLUlFnZtnIRlubvxRxnHbJmE79sxD/SqG0oZk8MFarRqufUkQAFrxcXSkfx0eB+nOggKX2jHYZhvf79r/z4L2IiipO84aYRkASfefnAX695p3P3c9mM/UufuaMVdzRvxVx7A0xaWdOMqVULJ6Z3TZv6KmHo0ztK6CkfxpHe3Th0pAuF0fLbn1u+9cmv3vW77bE3fGoSPi0BVfAvvPEHm9rPv//iooWz5m9Z/wCWZx+Go9UrN48QTD9IGMZ1cJIzTPisRQclPMrhME4W9mDfB2+i+2z/+TXz7/z2E7/85+9OIuGGE6BV3H77zm/d33nx6Ktr18zFg2t+DQude2n1tLJ8tcJ90vDhpG5Am7qTkJAQErywiLOld7G3/d9xvL0Hy1vWPbbtS3//00Q4hDeaAFXintrx1fu7+jp2r13bgofX/gaazbVkJQdLT9P6VqRFDSu2hIgXlBUBLgtCr3cce47/CMePX0Rr08qtzz7+8k8TpfKGtcKq1jPZre7oObyjdWkGd628l7AXwvMCeL7HjO6qrS8S1E5kTE9tfbiur665ccU9EB1EF9Ep0WXesEZIJb9j5/b/XUtzNrt29Rw0og2lchmBVqLo8LSAHlCixbTpddGm8Y7pjkttCCUP+JQy3FiatNuxdvUx9F4ayopO/OL9sQeEN4oA/eHn577oWPbGVes11PsrUBxjDafze1Te1VzouqnK2TgmLQljQqmrnAsT+iaPVb5b2co7EC+QhBgUeM1R1AcrsGp9Jy6+4W8U3fZ8r+e3EnOI2uaAX3l+zgNB4O9rW5/B8tY5WGo9BtOrJ4uMfUl+uj0B8HTmPXj8Pex86xVEnTDBBSE2r78fX9i09RPyZfT2A5ceIMSPwDOH8JH7Kk5+fAHtR0Zh6MZ9e7534Wc3wgO0sXLhD9OpFOa0egjGMhguD8BgTJooMfPbV1h/umz25ondcFP90IzY2iTgrfY9uH31aqSc9CeSEHkBEyITv28M8XMGc2/z0HGCpWCs8BS/9sWrDYOrJuCBZ+vu5sUfXbicia5kYGzUw4DWTwJKbApSjHuTBBjT2H68zg0MD4KlEwabZi0Y7wd85u/3O9/B6sVrPlEXeiF9nMmRxPt6Qf4y/HyIbh3HwkdF1zefGt5fUwK8wP2WAGwh02MFE/5ogYr3Qg/STL0W3d8aB1ppa+Pw0uI2Tz6/134Mg+UoIGZlZ2HMLaJYHkPICr6//RBamvPj/UA4dYKsegGrXqAXMaqNsDT6SreOY5Gu/FptCeBFN+caAphGiKFiGaOjA3AJHoGt6r7GgNbjqjo5yQkBUVHQ8PaJExjiaZ2yue12nO27gCNdHSptvf/xGdw11I2UZSmvCIJgQiJMhoEfeqpNDvUSRvUB5hMX9fUecg0aBi+Hm2uaAz633bmbm1VN8+h07LfKJdkOkQB2fL4BTlsj8No4YLG2putMSjwjp3QNvZdH8YsiExV501isFjU30lpF7D8dVfCA8sFHp7BuWYtaIwiCsCrCSDVhh9IX8k0CoHsoMQ84FrfFAE3zQAK0VaLzO9tK79XKAxSj+aYALt3XLfNipZD1v492YexrE/sP0zBgUIQIoYaflAXbz16CzyY6YKqYl8uheTarRioD7xAxCQHUpv18L1Yud+Iloujtk4zQo9WZcKURqjbHclzKvj0Gvcw8UA6oY2WqonSuGQGb5I+TJgEFEsB4daXzc0eopabcX13W0BXwgAnRZL4Q62s8ppnR/pFz/QjF+tRvxeIsY/cizGwRt83P4czACL8HdA1JUivCNGVogvdkNkgaGDNe4CvXFyJ8n+B5XGLJ1FmJXJ53AzjZKgGbatkKL5c/liNWIPO8uM/4VO2uKCQZjLmBqQAGJ4EmI8NMabDTOuyUobYXmPlCEpiqA1IkYdWSBpjpEDl6wsrF9aAjqHNOPXDyXAGprAknY5B0btOGGk/GlfE1taqofCNuuYNIJ+omOiZ1rpUHtEYWjkpWoP5EWV2sb5isA7aIQTHHxaIniNADui8PIs0Eb6SY/Z0UQc+j+mXYuoM7Vy/Age7zkBUyCZGLhRLSOYcWpfXFA1wPhqup8JNKq5UkKeoqSHxPLSoqnUQtw5ioc60IyE/VkOji8mYE2nZELNgCXLaOkGDFJBg4OzCMDEcxCfAzS1pQX5fHSNDLClLGwmwzls6vQ09hGFJYegdZ1hha2bqIBNelB5Qjog02TzpFNVEquYpMuTSYr/lcQPKPJHoRQ8W1GYO3lDgpO9pPWTEZEQGnuodg5Hyk66Lyd8fKOQQ6gqyWict7GeuWz8HQyWEFw+bB7ksF3Nk2V1nfpZTLQqSLslzXlDmHpsQ1osVoy/Solwf/GpdErpaAQUqjWxL2GWcWaSfAMIis7RBwiuCdtD1OgmNHBJCg7r4uZBnbdjaaq+3YewB+USYicY8juYPnMtloqdCjG3f39eO+3JKIAFadSiiZigBdgdcqItMxsmZbIbvUIKlzzQjoEgLGRjU2KTp8AjRCkzEnAG0mtQh8Ku0oAqok8JzP+Lw0MkB3jpKjKpapaL5WKZxafDdBqoC6O8LtyMAQhoZdzG7MwLU8FUYKPINcl+qimismRj26v2I71I3jDxfdpM41I6CTsmG4X0djKyc8RYu9t0Vl2QJbBJ5xFPiICJIg1hdhR3fs5HnWeldleZXABLA98b7Y5HtjkgwNEtbTN4iFC5oI3I1CTsAbsfVjAizJB3Qbx9HphRp6eqr3TDprSYA0FI/3ntOxbpUNM2OjpEcE6HYEWkhIKw+ICeBxi+T09F1WZU+iJq2n8fRDf4Ymu3XSrcOIgg8H9uOFn31fNUVC0oddZ7B5YxtDwlTgo66SEici2fokwCJjju0hw7J54WypQsB7tSRAza+H+nld30Y+m2b7SS+Qn9PKFl1egRciHIfWpxC8x+7tdA97+3zUcNyWX4Ci/THOoD2x/hmlQTox+3gDjWYeg/4gmF853xjBpUsjaGnJR24fu36FNzX5pmfY7EPStlSLIgb6gwk616QRYk8tS88/l/2PT/loyqbQkEmhPpNGNp1CmvtieQHvONGtL4sdy9Hjp5kkpTWmSzM7L529hErHs0cCpt2qW00BymDV3JXSU8HkAXKIjtNnedxS48m4Mr5cR9YlMrx+XTqNRmbP2ZkMOjvHKir/PNa5pouiitFjH44iZ6YwO5tFAy+eo6SdpOUJyhBQTJR+HT9HYLJaFve0PqQmTQLaVOCdmIRIWE+wrmWTzG8iAugF7qgWjSWkGbYa32EjJQTkGFv5dBZNJKCeHdb77UPXZP1rWhKLZ4Rqjv2Fz86lLMNlpusCY9BnqTNUIyTgrVhhs7rVq2KoW2TSxWlXLOCqWX4svmpzZdEjWvgQcdVWPnu+i4ClUS+HyLIFnsVf/9eBduw8eKYy2D1XMxO8Jg+IB9wl+3s/uAC3qKMpXY88m/ecnUHaSis3Na8Ab1UtaCh3j1y+sm8m9o0J+9Fv9MR4Zhw6DufTWasOebsOs+xZKHJOtvtQtertulrwV+0BtH5yWvyW7CxubsCTX9+KUQZ4ga7qmdGUFmrya8QWHwcxlReMF8Mw4QETrR8oy7tq2ivH5Tvya8n8aXZMGc4An/nRDpy52FfR8b5KCJCImt8YkYF/KDtnegfwz3sPodGajQajCTk9z/4mQ6iphMWv9AA9IeMWdyYdn+gBkVc5amwHWV6lHvVaI2YZzfinN95Ngv/htcT/p31CRNbdV8l8e++xD5HPNeHxhx5Bgf18kTN5T1kvjBfEjGjBJCai4gnjHqAnlvqS8e9NeujEjEul/NokDbai4V/2voafHD1S0evdWLeb8ojMNyly5fS//ffbcD0L33j4K4RX4rtMh/UUGLXmr6BWXN9MEFAhYfzmZ6hcXI+TpISRH8061Ui68gTWGUJP4aU9P8ZrB39S+Xkx1ummPSMkbebnJcxU1jm4D5eGhvB7j32HJcpUJHhxLIfxTZpxwGa8eKrHC51a9Tmp+N5P1RsQ01cJAwEflHw8/+pfYn/HgaQ+n7/a1vd6k+BUS2XvVD401TXhu488gQ0r71QUuLJsrWT8mSYtfkBMm0BAmFhNrgDX4oRqqeaJMw4c6TyIv/qPP0Xf8KUJ6sXuP1XluuEEyGsD5TXKgsqBNQvW4RtbnkDb4ttJQlGt/IQqLMJE7tWqOSBZCSrL6dFSqq3AnzhzDC/tewHt5w4nr3suvgN0+P8o3TeegFe3vYDHtj+xhLt/Q3kkeW5d693YuuHXsWHZPcixW4tCwo+trVU9QEs8G6HFqW5kdBiHTu3H64dfxpGuK8r665Tv7tz2D6e/tP23cT0E1OA5QR2iiIbs1i9u/9qTPPC12CtwlIofjZVvW/BZ3LVsC5bPW4u5DQuxaPay2NpRIuy61IkLA+dw8hdHceDUPpw49z9TXUysvWPXtl3bQ4yQtMJ1a18DAsbvRO/atvM5DXXPPbp9yzP8+GXBXTkngKYBdTWvE5RXdm87+HQEfLh2T57UIAdM95Js9+04LKSDbLzG31+Omxpx9xfxKR6AukkhMP0aKuUHsag5VEzE3fGSddsUVu6KFzIE+H/iJry0mX+bu8VfMwTMEDBDwAwBMwTMEHALv/5XgAEASpR5N6rB30UAAAAASUVORK5CYII=";
  26015. this._callbackGamepadConnected = ongamedpadconnected;
  26016. if (this.gamepadSupportAvailable) {
  26017. // Checking if the gamepad connected event is supported (like in Firefox)
  26018. if (this.gamepadEventSupported) {
  26019. window.addEventListener('gamepadconnected', function (evt) {
  26020. _this._onGamepadConnected(evt);
  26021. }, false);
  26022. window.addEventListener('gamepaddisconnected', function (evt) {
  26023. _this._onGamepadDisconnected(evt);
  26024. }, false);
  26025. }
  26026. else {
  26027. this._startMonitoringGamepads();
  26028. }
  26029. if (!this.oneGamepadConnected) {
  26030. this._insertGamepadDOMInstructions();
  26031. }
  26032. }
  26033. else {
  26034. this._insertGamepadDOMNotSupported();
  26035. }
  26036. }
  26037. Gamepads.prototype._insertGamepadDOMInstructions = function () {
  26038. Gamepads.gamepadDOMInfo = document.createElement("div");
  26039. var buttonAImage = document.createElement("img");
  26040. buttonAImage.src = this.buttonADataURL;
  26041. var spanMessage = document.createElement("span");
  26042. spanMessage.innerHTML = "<strong>to activate gamepad</strong>";
  26043. Gamepads.gamepadDOMInfo.appendChild(buttonAImage);
  26044. Gamepads.gamepadDOMInfo.appendChild(spanMessage);
  26045. Gamepads.gamepadDOMInfo.style.position = "absolute";
  26046. Gamepads.gamepadDOMInfo.style.width = "100%";
  26047. Gamepads.gamepadDOMInfo.style.height = "48px";
  26048. Gamepads.gamepadDOMInfo.style.bottom = "0px";
  26049. Gamepads.gamepadDOMInfo.style.backgroundColor = "rgba(1, 1, 1, 0.15)";
  26050. Gamepads.gamepadDOMInfo.style.textAlign = "center";
  26051. Gamepads.gamepadDOMInfo.style.zIndex = "10";
  26052. buttonAImage.style.position = "relative";
  26053. buttonAImage.style.bottom = "8px";
  26054. spanMessage.style.position = "relative";
  26055. spanMessage.style.fontSize = "32px";
  26056. spanMessage.style.bottom = "32px";
  26057. spanMessage.style.color = "green";
  26058. document.body.appendChild(Gamepads.gamepadDOMInfo);
  26059. };
  26060. Gamepads.prototype._insertGamepadDOMNotSupported = function () {
  26061. Gamepads.gamepadDOMInfo = document.createElement("div");
  26062. var spanMessage = document.createElement("span");
  26063. spanMessage.innerHTML = "<strong>gamepad not supported</strong>";
  26064. Gamepads.gamepadDOMInfo.appendChild(spanMessage);
  26065. Gamepads.gamepadDOMInfo.style.position = "absolute";
  26066. Gamepads.gamepadDOMInfo.style.width = "100%";
  26067. Gamepads.gamepadDOMInfo.style.height = "40px";
  26068. Gamepads.gamepadDOMInfo.style.bottom = "0px";
  26069. Gamepads.gamepadDOMInfo.style.backgroundColor = "rgba(1, 1, 1, 0.15)";
  26070. Gamepads.gamepadDOMInfo.style.textAlign = "center";
  26071. Gamepads.gamepadDOMInfo.style.zIndex = "10";
  26072. spanMessage.style.position = "relative";
  26073. spanMessage.style.fontSize = "32px";
  26074. spanMessage.style.color = "red";
  26075. document.body.appendChild(Gamepads.gamepadDOMInfo);
  26076. };
  26077. Gamepads.prototype.dispose = function () {
  26078. if (Gamepads.gamepadDOMInfo) {
  26079. document.body.removeChild(Gamepads.gamepadDOMInfo);
  26080. }
  26081. };
  26082. Gamepads.prototype._onGamepadConnected = function (evt) {
  26083. var newGamepad = this._addNewGamepad(evt.gamepad);
  26084. if (this._callbackGamepadConnected)
  26085. this._callbackGamepadConnected(newGamepad);
  26086. this._startMonitoringGamepads();
  26087. };
  26088. Gamepads.prototype._addNewGamepad = function (gamepad) {
  26089. if (!this.oneGamepadConnected) {
  26090. this.oneGamepadConnected = true;
  26091. if (Gamepads.gamepadDOMInfo) {
  26092. document.body.removeChild(Gamepads.gamepadDOMInfo);
  26093. Gamepads.gamepadDOMInfo = null;
  26094. }
  26095. }
  26096. var newGamepad;
  26097. if (gamepad.id.search("Xbox 360") !== -1 || gamepad.id.search("xinput") !== -1) {
  26098. newGamepad = new BABYLON.Xbox360Pad(gamepad.id, gamepad.index, gamepad);
  26099. }
  26100. else {
  26101. newGamepad = new BABYLON.GenericPad(gamepad.id, gamepad.index, gamepad);
  26102. }
  26103. this.babylonGamepads.push(newGamepad);
  26104. return newGamepad;
  26105. };
  26106. Gamepads.prototype._onGamepadDisconnected = function (evt) {
  26107. for (var i in this.babylonGamepads) {
  26108. if (this.babylonGamepads[i].index == evt.gamepad.index) {
  26109. this.babylonGamepads.splice(i, 1);
  26110. break;
  26111. }
  26112. }
  26113. // If no gamepads are left, stop the polling loop.
  26114. if (this.babylonGamepads.length == 0) {
  26115. this._stopMonitoringGamepads();
  26116. }
  26117. };
  26118. Gamepads.prototype._startMonitoringGamepads = function () {
  26119. if (!this.isMonitoring) {
  26120. this.isMonitoring = true;
  26121. this._checkGamepadsStatus();
  26122. }
  26123. };
  26124. Gamepads.prototype._stopMonitoringGamepads = function () {
  26125. this.isMonitoring = false;
  26126. };
  26127. Gamepads.prototype._checkGamepadsStatus = function () {
  26128. var _this = this;
  26129. // updating gamepad objects
  26130. this._updateGamepadObjects();
  26131. for (var i in this.babylonGamepads) {
  26132. this.babylonGamepads[i].update();
  26133. }
  26134. if (this.isMonitoring) {
  26135. if (window.requestAnimationFrame) {
  26136. window.requestAnimationFrame(function () {
  26137. _this._checkGamepadsStatus();
  26138. });
  26139. }
  26140. else if (window.mozRequestAnimationFrame) {
  26141. window.mozRequestAnimationFrame(function () {
  26142. _this._checkGamepadsStatus();
  26143. });
  26144. }
  26145. else if (window.webkitRequestAnimationFrame) {
  26146. window.webkitRequestAnimationFrame(function () {
  26147. _this._checkGamepadsStatus();
  26148. });
  26149. }
  26150. }
  26151. };
  26152. // This function is called only on Chrome, which does not yet support
  26153. // connection/disconnection events, but requires you to monitor
  26154. // an array for changes.
  26155. Gamepads.prototype._updateGamepadObjects = function () {
  26156. var gamepads = navigator.getGamepads ? navigator.getGamepads() : (navigator.webkitGetGamepads ? navigator.webkitGetGamepads() : []);
  26157. for (var i = 0; i < gamepads.length; i++) {
  26158. if (gamepads[i]) {
  26159. if (!(gamepads[i].index in this.babylonGamepads)) {
  26160. var newGamepad = this._addNewGamepad(gamepads[i]);
  26161. if (this._callbackGamepadConnected) {
  26162. this._callbackGamepadConnected(newGamepad);
  26163. }
  26164. }
  26165. else {
  26166. this.babylonGamepads[i].browserGamepad = gamepads[i];
  26167. }
  26168. }
  26169. }
  26170. };
  26171. return Gamepads;
  26172. })();
  26173. BABYLON.Gamepads = Gamepads;
  26174. var StickValues = (function () {
  26175. function StickValues(x, y) {
  26176. this.x = x;
  26177. this.y = y;
  26178. }
  26179. return StickValues;
  26180. })();
  26181. BABYLON.StickValues = StickValues;
  26182. var Gamepad = (function () {
  26183. function Gamepad(id, index, browserGamepad) {
  26184. this.id = id;
  26185. this.index = index;
  26186. this.browserGamepad = browserGamepad;
  26187. if (this.browserGamepad.axes.length >= 2) {
  26188. this._leftStick = { x: this.browserGamepad.axes[0], y: this.browserGamepad.axes[1] };
  26189. }
  26190. if (this.browserGamepad.axes.length >= 4) {
  26191. this._rightStick = { x: this.browserGamepad.axes[2], y: this.browserGamepad.axes[3] };
  26192. }
  26193. }
  26194. Gamepad.prototype.onleftstickchanged = function (callback) {
  26195. this._onleftstickchanged = callback;
  26196. };
  26197. Gamepad.prototype.onrightstickchanged = function (callback) {
  26198. this._onrightstickchanged = callback;
  26199. };
  26200. Object.defineProperty(Gamepad.prototype, "leftStick", {
  26201. get: function () {
  26202. return this._leftStick;
  26203. },
  26204. set: function (newValues) {
  26205. if (this._onleftstickchanged && (this._leftStick.x !== newValues.x || this._leftStick.y !== newValues.y)) {
  26206. this._onleftstickchanged(newValues);
  26207. }
  26208. this._leftStick = newValues;
  26209. },
  26210. enumerable: true,
  26211. configurable: true
  26212. });
  26213. Object.defineProperty(Gamepad.prototype, "rightStick", {
  26214. get: function () {
  26215. return this._rightStick;
  26216. },
  26217. set: function (newValues) {
  26218. if (this._onrightstickchanged && (this._rightStick.x !== newValues.x || this._rightStick.y !== newValues.y)) {
  26219. this._onrightstickchanged(newValues);
  26220. }
  26221. this._rightStick = newValues;
  26222. },
  26223. enumerable: true,
  26224. configurable: true
  26225. });
  26226. Gamepad.prototype.update = function () {
  26227. if (this._leftStick) {
  26228. this.leftStick = { x: this.browserGamepad.axes[0], y: this.browserGamepad.axes[1] };
  26229. }
  26230. if (this._rightStick) {
  26231. this.rightStick = { x: this.browserGamepad.axes[2], y: this.browserGamepad.axes[3] };
  26232. }
  26233. };
  26234. return Gamepad;
  26235. })();
  26236. BABYLON.Gamepad = Gamepad;
  26237. var GenericPad = (function (_super) {
  26238. __extends(GenericPad, _super);
  26239. function GenericPad(id, index, gamepad) {
  26240. _super.call(this, id, index, gamepad);
  26241. this.id = id;
  26242. this.index = index;
  26243. this.gamepad = gamepad;
  26244. this._buttons = new Array(gamepad.buttons.length);
  26245. }
  26246. GenericPad.prototype.onbuttondown = function (callback) {
  26247. this._onbuttondown = callback;
  26248. };
  26249. GenericPad.prototype.onbuttonup = function (callback) {
  26250. this._onbuttonup = callback;
  26251. };
  26252. GenericPad.prototype._setButtonValue = function (newValue, currentValue, buttonIndex) {
  26253. if (newValue !== currentValue) {
  26254. if (this._onbuttondown && newValue === 1) {
  26255. this._onbuttondown(buttonIndex);
  26256. }
  26257. if (this._onbuttonup && newValue === 0) {
  26258. this._onbuttonup(buttonIndex);
  26259. }
  26260. }
  26261. return newValue;
  26262. };
  26263. GenericPad.prototype.update = function () {
  26264. _super.prototype.update.call(this);
  26265. for (var index = 0; index < this._buttons.length; index++) {
  26266. this._buttons[index] = this._setButtonValue(this.gamepad.buttons[index].value, this._buttons[index], index);
  26267. }
  26268. };
  26269. return GenericPad;
  26270. })(Gamepad);
  26271. BABYLON.GenericPad = GenericPad;
  26272. (function (Xbox360Button) {
  26273. Xbox360Button[Xbox360Button["A"] = 0] = "A";
  26274. Xbox360Button[Xbox360Button["B"] = 1] = "B";
  26275. Xbox360Button[Xbox360Button["X"] = 2] = "X";
  26276. Xbox360Button[Xbox360Button["Y"] = 3] = "Y";
  26277. Xbox360Button[Xbox360Button["Start"] = 4] = "Start";
  26278. Xbox360Button[Xbox360Button["Back"] = 5] = "Back";
  26279. Xbox360Button[Xbox360Button["LB"] = 6] = "LB";
  26280. Xbox360Button[Xbox360Button["RB"] = 7] = "RB";
  26281. Xbox360Button[Xbox360Button["LeftStick"] = 8] = "LeftStick";
  26282. Xbox360Button[Xbox360Button["RightStick"] = 9] = "RightStick";
  26283. })(BABYLON.Xbox360Button || (BABYLON.Xbox360Button = {}));
  26284. var Xbox360Button = BABYLON.Xbox360Button;
  26285. (function (Xbox360Dpad) {
  26286. Xbox360Dpad[Xbox360Dpad["Up"] = 0] = "Up";
  26287. Xbox360Dpad[Xbox360Dpad["Down"] = 1] = "Down";
  26288. Xbox360Dpad[Xbox360Dpad["Left"] = 2] = "Left";
  26289. Xbox360Dpad[Xbox360Dpad["Right"] = 3] = "Right";
  26290. })(BABYLON.Xbox360Dpad || (BABYLON.Xbox360Dpad = {}));
  26291. var Xbox360Dpad = BABYLON.Xbox360Dpad;
  26292. var Xbox360Pad = (function (_super) {
  26293. __extends(Xbox360Pad, _super);
  26294. function Xbox360Pad() {
  26295. _super.apply(this, arguments);
  26296. this._leftTrigger = 0;
  26297. this._rightTrigger = 0;
  26298. this._buttonA = 0;
  26299. this._buttonB = 0;
  26300. this._buttonX = 0;
  26301. this._buttonY = 0;
  26302. this._buttonBack = 0;
  26303. this._buttonStart = 0;
  26304. this._buttonLB = 0;
  26305. this._buttonRB = 0;
  26306. this._buttonLeftStick = 0;
  26307. this._buttonRightStick = 0;
  26308. this._dPadUp = 0;
  26309. this._dPadDown = 0;
  26310. this._dPadLeft = 0;
  26311. this._dPadRight = 0;
  26312. }
  26313. Xbox360Pad.prototype.onlefttriggerchanged = function (callback) {
  26314. this._onlefttriggerchanged = callback;
  26315. };
  26316. Xbox360Pad.prototype.onrighttriggerchanged = function (callback) {
  26317. this._onrighttriggerchanged = callback;
  26318. };
  26319. Object.defineProperty(Xbox360Pad.prototype, "leftTrigger", {
  26320. get: function () {
  26321. return this._leftTrigger;
  26322. },
  26323. set: function (newValue) {
  26324. if (this._onlefttriggerchanged && this._leftTrigger !== newValue) {
  26325. this._onlefttriggerchanged(newValue);
  26326. }
  26327. this._leftTrigger = newValue;
  26328. },
  26329. enumerable: true,
  26330. configurable: true
  26331. });
  26332. Object.defineProperty(Xbox360Pad.prototype, "rightTrigger", {
  26333. get: function () {
  26334. return this._rightTrigger;
  26335. },
  26336. set: function (newValue) {
  26337. if (this._onrighttriggerchanged && this._rightTrigger !== newValue) {
  26338. this._onrighttriggerchanged(newValue);
  26339. }
  26340. this._rightTrigger = newValue;
  26341. },
  26342. enumerable: true,
  26343. configurable: true
  26344. });
  26345. Xbox360Pad.prototype.onbuttondown = function (callback) {
  26346. this._onbuttondown = callback;
  26347. };
  26348. Xbox360Pad.prototype.onbuttonup = function (callback) {
  26349. this._onbuttonup = callback;
  26350. };
  26351. Xbox360Pad.prototype.ondpaddown = function (callback) {
  26352. this._ondpaddown = callback;
  26353. };
  26354. Xbox360Pad.prototype.ondpadup = function (callback) {
  26355. this._ondpadup = callback;
  26356. };
  26357. Xbox360Pad.prototype._setButtonValue = function (newValue, currentValue, buttonType) {
  26358. if (newValue !== currentValue) {
  26359. if (this._onbuttondown && newValue === 1) {
  26360. this._onbuttondown(buttonType);
  26361. }
  26362. if (this._onbuttonup && newValue === 0) {
  26363. this._onbuttonup(buttonType);
  26364. }
  26365. }
  26366. return newValue;
  26367. };
  26368. Xbox360Pad.prototype._setDPadValue = function (newValue, currentValue, buttonType) {
  26369. if (newValue !== currentValue) {
  26370. if (this._ondpaddown && newValue === 1) {
  26371. this._ondpaddown(buttonType);
  26372. }
  26373. if (this._ondpadup && newValue === 0) {
  26374. this._ondpadup(buttonType);
  26375. }
  26376. }
  26377. return newValue;
  26378. };
  26379. Object.defineProperty(Xbox360Pad.prototype, "buttonA", {
  26380. get: function () {
  26381. return this._buttonA;
  26382. },
  26383. set: function (value) {
  26384. this._buttonA = this._setButtonValue(value, this._buttonA, 0 /* A */);
  26385. },
  26386. enumerable: true,
  26387. configurable: true
  26388. });
  26389. Object.defineProperty(Xbox360Pad.prototype, "buttonB", {
  26390. get: function () {
  26391. return this._buttonB;
  26392. },
  26393. set: function (value) {
  26394. this._buttonB = this._setButtonValue(value, this._buttonB, 1 /* B */);
  26395. },
  26396. enumerable: true,
  26397. configurable: true
  26398. });
  26399. Object.defineProperty(Xbox360Pad.prototype, "buttonX", {
  26400. get: function () {
  26401. return this._buttonX;
  26402. },
  26403. set: function (value) {
  26404. this._buttonX = this._setButtonValue(value, this._buttonX, 2 /* X */);
  26405. },
  26406. enumerable: true,
  26407. configurable: true
  26408. });
  26409. Object.defineProperty(Xbox360Pad.prototype, "buttonY", {
  26410. get: function () {
  26411. return this._buttonY;
  26412. },
  26413. set: function (value) {
  26414. this._buttonY = this._setButtonValue(value, this._buttonY, 3 /* Y */);
  26415. },
  26416. enumerable: true,
  26417. configurable: true
  26418. });
  26419. Object.defineProperty(Xbox360Pad.prototype, "buttonStart", {
  26420. get: function () {
  26421. return this._buttonStart;
  26422. },
  26423. set: function (value) {
  26424. this._buttonStart = this._setButtonValue(value, this._buttonStart, 4 /* Start */);
  26425. },
  26426. enumerable: true,
  26427. configurable: true
  26428. });
  26429. Object.defineProperty(Xbox360Pad.prototype, "buttonBack", {
  26430. get: function () {
  26431. return this._buttonBack;
  26432. },
  26433. set: function (value) {
  26434. this._buttonBack = this._setButtonValue(value, this._buttonBack, 5 /* Back */);
  26435. },
  26436. enumerable: true,
  26437. configurable: true
  26438. });
  26439. Object.defineProperty(Xbox360Pad.prototype, "buttonLB", {
  26440. get: function () {
  26441. return this._buttonLB;
  26442. },
  26443. set: function (value) {
  26444. this._buttonLB = this._setButtonValue(value, this._buttonLB, 6 /* LB */);
  26445. },
  26446. enumerable: true,
  26447. configurable: true
  26448. });
  26449. Object.defineProperty(Xbox360Pad.prototype, "buttonRB", {
  26450. get: function () {
  26451. return this._buttonRB;
  26452. },
  26453. set: function (value) {
  26454. this._buttonRB = this._setButtonValue(value, this._buttonRB, 7 /* RB */);
  26455. },
  26456. enumerable: true,
  26457. configurable: true
  26458. });
  26459. Object.defineProperty(Xbox360Pad.prototype, "buttonLeftStick", {
  26460. get: function () {
  26461. return this._buttonLeftStick;
  26462. },
  26463. set: function (value) {
  26464. this._buttonLeftStick = this._setButtonValue(value, this._buttonLeftStick, 8 /* LeftStick */);
  26465. },
  26466. enumerable: true,
  26467. configurable: true
  26468. });
  26469. Object.defineProperty(Xbox360Pad.prototype, "buttonRightStick", {
  26470. get: function () {
  26471. return this._buttonRightStick;
  26472. },
  26473. set: function (value) {
  26474. this._buttonRightStick = this._setButtonValue(value, this._buttonRightStick, 9 /* RightStick */);
  26475. },
  26476. enumerable: true,
  26477. configurable: true
  26478. });
  26479. Object.defineProperty(Xbox360Pad.prototype, "dPadUp", {
  26480. get: function () {
  26481. return this._dPadUp;
  26482. },
  26483. set: function (value) {
  26484. this._dPadUp = this._setDPadValue(value, this._dPadUp, 0 /* Up */);
  26485. },
  26486. enumerable: true,
  26487. configurable: true
  26488. });
  26489. Object.defineProperty(Xbox360Pad.prototype, "dPadDown", {
  26490. get: function () {
  26491. return this._dPadDown;
  26492. },
  26493. set: function (value) {
  26494. this._dPadDown = this._setDPadValue(value, this._dPadDown, 1 /* Down */);
  26495. },
  26496. enumerable: true,
  26497. configurable: true
  26498. });
  26499. Object.defineProperty(Xbox360Pad.prototype, "dPadLeft", {
  26500. get: function () {
  26501. return this._dPadLeft;
  26502. },
  26503. set: function (value) {
  26504. this._dPadLeft = this._setDPadValue(value, this._dPadLeft, 2 /* Left */);
  26505. },
  26506. enumerable: true,
  26507. configurable: true
  26508. });
  26509. Object.defineProperty(Xbox360Pad.prototype, "dPadRight", {
  26510. get: function () {
  26511. return this._dPadRight;
  26512. },
  26513. set: function (value) {
  26514. this._dPadRight = this._setDPadValue(value, this._dPadRight, 3 /* Right */);
  26515. },
  26516. enumerable: true,
  26517. configurable: true
  26518. });
  26519. Xbox360Pad.prototype.update = function () {
  26520. _super.prototype.update.call(this);
  26521. this.buttonA = this.browserGamepad.buttons[0].value;
  26522. this.buttonB = this.browserGamepad.buttons[1].value;
  26523. this.buttonX = this.browserGamepad.buttons[2].value;
  26524. this.buttonY = this.browserGamepad.buttons[3].value;
  26525. this.buttonLB = this.browserGamepad.buttons[4].value;
  26526. this.buttonRB = this.browserGamepad.buttons[5].value;
  26527. this.leftTrigger = this.browserGamepad.buttons[6].value;
  26528. this.rightTrigger = this.browserGamepad.buttons[7].value;
  26529. this.buttonBack = this.browserGamepad.buttons[8].value;
  26530. this.buttonStart = this.browserGamepad.buttons[9].value;
  26531. this.buttonLeftStick = this.browserGamepad.buttons[10].value;
  26532. this.buttonRightStick = this.browserGamepad.buttons[11].value;
  26533. this.dPadUp = this.browserGamepad.buttons[12].value;
  26534. this.dPadDown = this.browserGamepad.buttons[13].value;
  26535. this.dPadLeft = this.browserGamepad.buttons[14].value;
  26536. this.dPadRight = this.browserGamepad.buttons[15].value;
  26537. };
  26538. return Xbox360Pad;
  26539. })(Gamepad);
  26540. BABYLON.Xbox360Pad = Xbox360Pad;
  26541. })(BABYLON || (BABYLON = {}));
  26542. //# sourceMappingURL=babylon.gamepads.js.map
  26543. var BABYLON;
  26544. (function (BABYLON) {
  26545. // We're mainly based on the logic defined into the FreeCamera code
  26546. var GamepadCamera = (function (_super) {
  26547. __extends(GamepadCamera, _super);
  26548. function GamepadCamera(name, position, scene) {
  26549. var _this = this;
  26550. _super.call(this, name, position, scene);
  26551. this.angularSensibility = 200;
  26552. this.moveSensibility = 75;
  26553. this._gamepads = new BABYLON.Gamepads(function (gamepad) {
  26554. _this._onNewGameConnected(gamepad);
  26555. });
  26556. }
  26557. GamepadCamera.prototype._onNewGameConnected = function (gamepad) {
  26558. // Only the first gamepad can control the camera
  26559. if (gamepad.index === 0) {
  26560. this._gamepad = gamepad;
  26561. }
  26562. };
  26563. GamepadCamera.prototype._checkInputs = function () {
  26564. if (!this._gamepad) {
  26565. return;
  26566. }
  26567. var LSValues = this._gamepad.leftStick;
  26568. var normalizedLX = LSValues.x / this.moveSensibility;
  26569. var normalizedLY = LSValues.y / this.moveSensibility;
  26570. LSValues.x = Math.abs(normalizedLX) > 0.005 ? 0 + normalizedLX : 0;
  26571. LSValues.y = Math.abs(normalizedLY) > 0.005 ? 0 + normalizedLY : 0;
  26572. var RSValues = this._gamepad.rightStick;
  26573. var normalizedRX = RSValues.x / this.angularSensibility;
  26574. var normalizedRY = RSValues.y / this.angularSensibility;
  26575. RSValues.x = Math.abs(normalizedRX) > 0.001 ? 0 + normalizedRX : 0;
  26576. RSValues.y = Math.abs(normalizedRY) > 0.001 ? 0 + normalizedRY : 0;
  26577. ;
  26578. var cameraTransform = BABYLON.Matrix.RotationYawPitchRoll(this.rotation.y, this.rotation.x, 0);
  26579. var speed = this._computeLocalCameraSpeed() * 50.0;
  26580. var deltaTransform = BABYLON.Vector3.TransformCoordinates(new BABYLON.Vector3(LSValues.x * speed, 0, -LSValues.y * speed), cameraTransform);
  26581. this.cameraDirection = this.cameraDirection.add(deltaTransform);
  26582. this.cameraRotation = this.cameraRotation.add(new BABYLON.Vector2(RSValues.y, RSValues.x));
  26583. };
  26584. GamepadCamera.prototype.dispose = function () {
  26585. this._gamepads.dispose();
  26586. _super.prototype.dispose.call(this);
  26587. };
  26588. return GamepadCamera;
  26589. })(BABYLON.FreeCamera);
  26590. BABYLON.GamepadCamera = GamepadCamera;
  26591. })(BABYLON || (BABYLON = {}));
  26592. //# sourceMappingURL=babylon.gamepadCamera.js.map
  26593. var BABYLON;
  26594. (function (BABYLON) {
  26595. var LinesMesh = (function (_super) {
  26596. __extends(LinesMesh, _super);
  26597. function LinesMesh(name, scene, updatable) {
  26598. if (updatable === void 0) { updatable = false; }
  26599. _super.call(this, name, scene);
  26600. this.color = new BABYLON.Color3(1, 1, 1);
  26601. this.alpha = 1;
  26602. this._indices = new Array();
  26603. this._colorShader = new BABYLON.ShaderMaterial("colorShader", scene, "color", {
  26604. attributes: ["position"],
  26605. uniforms: ["worldViewProjection", "color"],
  26606. needAlphaBlending: true
  26607. });
  26608. }
  26609. Object.defineProperty(LinesMesh.prototype, "material", {
  26610. get: function () {
  26611. return this._colorShader;
  26612. },
  26613. enumerable: true,
  26614. configurable: true
  26615. });
  26616. Object.defineProperty(LinesMesh.prototype, "isPickable", {
  26617. get: function () {
  26618. return false;
  26619. },
  26620. enumerable: true,
  26621. configurable: true
  26622. });
  26623. Object.defineProperty(LinesMesh.prototype, "checkCollisions", {
  26624. get: function () {
  26625. return false;
  26626. },
  26627. enumerable: true,
  26628. configurable: true
  26629. });
  26630. LinesMesh.prototype._bind = function (subMesh, effect, fillMode) {
  26631. var engine = this.getScene().getEngine();
  26632. var indexToBind = this._geometry.getIndexBuffer();
  26633. // VBOs
  26634. engine.bindBuffers(this._geometry.getVertexBuffer(BABYLON.VertexBuffer.PositionKind).getBuffer(), indexToBind, [3], 3 * 4, this._colorShader.getEffect());
  26635. // Color
  26636. this._colorShader.setColor4("color", this.color.toColor4(this.alpha));
  26637. };
  26638. LinesMesh.prototype._draw = function (subMesh, fillMode, instancesCount) {
  26639. if (!this._geometry || !this._geometry.getVertexBuffers() || !this._geometry.getIndexBuffer()) {
  26640. return;
  26641. }
  26642. var engine = this.getScene().getEngine();
  26643. // Draw order
  26644. engine.draw(false, subMesh.indexStart, subMesh.indexCount);
  26645. };
  26646. LinesMesh.prototype.intersects = function (ray, fastCheck) {
  26647. return null;
  26648. };
  26649. LinesMesh.prototype.dispose = function (doNotRecurse) {
  26650. this._colorShader.dispose();
  26651. _super.prototype.dispose.call(this, doNotRecurse);
  26652. };
  26653. return LinesMesh;
  26654. })(BABYLON.Mesh);
  26655. BABYLON.LinesMesh = LinesMesh;
  26656. })(BABYLON || (BABYLON = {}));
  26657. //# sourceMappingURL=babylon.linesMesh.js.mapvar BABYLON;
  26658. (function (BABYLON) {
  26659. var OutlineRenderer = (function () {
  26660. function OutlineRenderer(scene) {
  26661. this._scene = scene;
  26662. }
  26663. OutlineRenderer.prototype.render = function (subMesh, batch, useOverlay) {
  26664. var _this = this;
  26665. if (useOverlay === void 0) { useOverlay = false; }
  26666. var scene = this._scene;
  26667. var engine = this._scene.getEngine();
  26668. var hardwareInstancedRendering = (engine.getCaps().instancedArrays !== null) && (batch.visibleInstances[subMesh._id] !== null) && (batch.visibleInstances[subMesh._id] !== undefined);
  26669. if (!this.isReady(subMesh, hardwareInstancedRendering)) {
  26670. return;
  26671. }
  26672. var mesh = subMesh.getRenderingMesh();
  26673. var material = subMesh.getMaterial();
  26674. engine.enableEffect(this._effect);
  26675. this._effect.setFloat("offset", useOverlay ? 0 : mesh.outlineWidth);
  26676. this._effect.setColor4("color", useOverlay ? mesh.overlayColor : mesh.outlineColor, useOverlay ? mesh.overlayAlpha : 1.0);
  26677. this._effect.setMatrix("viewProjection", scene.getTransformMatrix());
  26678. // Bones
  26679. if (mesh.useBones) {
  26680. this._effect.setMatrices("mBones", mesh.skeleton.getTransformMatrices());
  26681. }
  26682. mesh._bind(subMesh, this._effect, BABYLON.Material.TriangleFillMode);
  26683. // Alpha test
  26684. if (material && material.needAlphaTesting()) {
  26685. var alphaTexture = material.getAlphaTestTexture();
  26686. this._effect.setTexture("diffuseSampler", alphaTexture);
  26687. this._effect.setMatrix("diffuseMatrix", alphaTexture.getTextureMatrix());
  26688. }
  26689. mesh._processRendering(subMesh, this._effect, BABYLON.Material.TriangleFillMode, batch, hardwareInstancedRendering, function (isInstance, world) {
  26690. _this._effect.setMatrix("world", world);
  26691. });
  26692. };
  26693. OutlineRenderer.prototype.isReady = function (subMesh, useInstances) {
  26694. var defines = [];
  26695. var attribs = [BABYLON.VertexBuffer.PositionKind, BABYLON.VertexBuffer.NormalKind];
  26696. var mesh = subMesh.getMesh();
  26697. var material = subMesh.getMaterial();
  26698. // Alpha test
  26699. if (material && material.needAlphaTesting()) {
  26700. defines.push("#define ALPHATEST");
  26701. if (mesh.isVerticesDataPresent(BABYLON.VertexBuffer.UVKind)) {
  26702. attribs.push(BABYLON.VertexBuffer.UVKind);
  26703. defines.push("#define UV1");
  26704. }
  26705. if (mesh.isVerticesDataPresent(BABYLON.VertexBuffer.UV2Kind)) {
  26706. attribs.push(BABYLON.VertexBuffer.UV2Kind);
  26707. defines.push("#define UV2");
  26708. }
  26709. }
  26710. // Bones
  26711. if (mesh.useBones) {
  26712. attribs.push(BABYLON.VertexBuffer.MatricesIndicesKind);
  26713. attribs.push(BABYLON.VertexBuffer.MatricesWeightsKind);
  26714. defines.push("#define BONES");
  26715. defines.push("#define BonesPerMesh " + (mesh.skeleton.bones.length + 1));
  26716. }
  26717. // Instances
  26718. if (useInstances) {
  26719. defines.push("#define INSTANCES");
  26720. attribs.push("world0");
  26721. attribs.push("world1");
  26722. attribs.push("world2");
  26723. attribs.push("world3");
  26724. }
  26725. // Get correct effect
  26726. var join = defines.join("\n");
  26727. if (this._cachedDefines !== join) {
  26728. this._cachedDefines = join;
  26729. this._effect = this._scene.getEngine().createEffect("outline", attribs, ["world", "mBones", "viewProjection", "diffuseMatrix", "offset", "color"], ["diffuseSampler"], join);
  26730. }
  26731. return this._effect.isReady();
  26732. };
  26733. return OutlineRenderer;
  26734. })();
  26735. BABYLON.OutlineRenderer = OutlineRenderer;
  26736. })(BABYLON || (BABYLON = {}));
  26737. //# sourceMappingURL=babylon.outlineRenderer.js.mapvar BABYLON;
  26738. (function (BABYLON) {
  26739. var MeshAssetTask = (function () {
  26740. function MeshAssetTask(name, meshesNames, rootUrl, sceneFilename) {
  26741. this.name = name;
  26742. this.meshesNames = meshesNames;
  26743. this.rootUrl = rootUrl;
  26744. this.sceneFilename = sceneFilename;
  26745. this.isCompleted = false;
  26746. }
  26747. MeshAssetTask.prototype.run = function (scene, onSuccess, onError) {
  26748. var _this = this;
  26749. BABYLON.SceneLoader.ImportMesh(this.meshesNames, this.rootUrl, this.sceneFilename, scene, function (meshes, particleSystems, skeletons) {
  26750. _this.loadedMeshes = meshes;
  26751. _this.loadedParticleSystems = particleSystems;
  26752. _this.loadedSkeletons = skeletons;
  26753. _this.isCompleted = true;
  26754. if (_this.onSuccess) {
  26755. _this.onSuccess(_this);
  26756. }
  26757. onSuccess();
  26758. }, null, function () {
  26759. if (_this.onError) {
  26760. _this.onError(_this);
  26761. }
  26762. onError();
  26763. });
  26764. };
  26765. return MeshAssetTask;
  26766. })();
  26767. BABYLON.MeshAssetTask = MeshAssetTask;
  26768. var TextFileAssetTask = (function () {
  26769. function TextFileAssetTask(name, url) {
  26770. this.name = name;
  26771. this.url = url;
  26772. this.isCompleted = false;
  26773. }
  26774. TextFileAssetTask.prototype.run = function (scene, onSuccess, onError) {
  26775. var _this = this;
  26776. BABYLON.Tools.LoadFile(this.url, function (data) {
  26777. _this.text = data;
  26778. _this.isCompleted = true;
  26779. if (_this.onSuccess) {
  26780. _this.onSuccess(_this);
  26781. }
  26782. onSuccess();
  26783. }, null, scene.database, false, function () {
  26784. if (_this.onError) {
  26785. _this.onError(_this);
  26786. }
  26787. onError();
  26788. });
  26789. };
  26790. return TextFileAssetTask;
  26791. })();
  26792. BABYLON.TextFileAssetTask = TextFileAssetTask;
  26793. var BinaryFileAssetTask = (function () {
  26794. function BinaryFileAssetTask(name, url) {
  26795. this.name = name;
  26796. this.url = url;
  26797. this.isCompleted = false;
  26798. }
  26799. BinaryFileAssetTask.prototype.run = function (scene, onSuccess, onError) {
  26800. var _this = this;
  26801. BABYLON.Tools.LoadFile(this.url, function (data) {
  26802. _this.data = data;
  26803. _this.isCompleted = true;
  26804. if (_this.onSuccess) {
  26805. _this.onSuccess(_this);
  26806. }
  26807. onSuccess();
  26808. }, null, scene.database, true, function () {
  26809. if (_this.onError) {
  26810. _this.onError(_this);
  26811. }
  26812. onError();
  26813. });
  26814. };
  26815. return BinaryFileAssetTask;
  26816. })();
  26817. BABYLON.BinaryFileAssetTask = BinaryFileAssetTask;
  26818. var ImageAssetTask = (function () {
  26819. function ImageAssetTask(name, url) {
  26820. this.name = name;
  26821. this.url = url;
  26822. this.isCompleted = false;
  26823. }
  26824. ImageAssetTask.prototype.run = function (scene, onSuccess, onError) {
  26825. var _this = this;
  26826. var img = new Image();
  26827. img.onload = function () {
  26828. _this.image = img;
  26829. _this.isCompleted = true;
  26830. if (_this.onSuccess) {
  26831. _this.onSuccess(_this);
  26832. }
  26833. onSuccess();
  26834. };
  26835. img.onerror = function () {
  26836. if (_this.onError) {
  26837. _this.onError(_this);
  26838. }
  26839. onError();
  26840. };
  26841. img.src = this.url;
  26842. };
  26843. return ImageAssetTask;
  26844. })();
  26845. BABYLON.ImageAssetTask = ImageAssetTask;
  26846. var TextureAssetTask = (function () {
  26847. function TextureAssetTask(name, url, noMipmap, invertY, samplingMode) {
  26848. if (samplingMode === void 0) { samplingMode = BABYLON.Texture.TRILINEAR_SAMPLINGMODE; }
  26849. this.name = name;
  26850. this.url = url;
  26851. this.noMipmap = noMipmap;
  26852. this.invertY = invertY;
  26853. this.samplingMode = samplingMode;
  26854. this.isCompleted = false;
  26855. }
  26856. TextureAssetTask.prototype.run = function (scene, onSuccess, onError) {
  26857. var _this = this;
  26858. var onload = function () {
  26859. _this.isCompleted = true;
  26860. if (_this.onSuccess) {
  26861. _this.onSuccess(_this);
  26862. }
  26863. onSuccess();
  26864. };
  26865. var onerror = function () {
  26866. if (_this.onError) {
  26867. _this.onError(_this);
  26868. }
  26869. onError();
  26870. };
  26871. this.texture = new BABYLON.Texture(this.url, scene, this.noMipmap, this.invertY, this.samplingMode, onload, onError);
  26872. };
  26873. return TextureAssetTask;
  26874. })();
  26875. BABYLON.TextureAssetTask = TextureAssetTask;
  26876. var AssetsManager = (function () {
  26877. function AssetsManager(scene) {
  26878. this._tasks = new Array();
  26879. this._waitingTasksCount = 0;
  26880. this.useDefaultLoadingScreen = true;
  26881. this._scene = scene;
  26882. }
  26883. AssetsManager.prototype.addMeshTask = function (taskName, meshesNames, rootUrl, sceneFilename) {
  26884. var task = new MeshAssetTask(taskName, meshesNames, rootUrl, sceneFilename);
  26885. this._tasks.push(task);
  26886. return task;
  26887. };
  26888. AssetsManager.prototype.addTextFileTask = function (taskName, url) {
  26889. var task = new TextFileAssetTask(taskName, url);
  26890. this._tasks.push(task);
  26891. return task;
  26892. };
  26893. AssetsManager.prototype.addBinaryFileTask = function (taskName, url) {
  26894. var task = new BinaryFileAssetTask(taskName, url);
  26895. this._tasks.push(task);
  26896. return task;
  26897. };
  26898. AssetsManager.prototype.addImageTask = function (taskName, url) {
  26899. var task = new ImageAssetTask(taskName, url);
  26900. this._tasks.push(task);
  26901. return task;
  26902. };
  26903. AssetsManager.prototype.addTextureTask = function (taskName, url, noMipmap, invertY, samplingMode) {
  26904. if (samplingMode === void 0) { samplingMode = BABYLON.Texture.TRILINEAR_SAMPLINGMODE; }
  26905. var task = new TextureAssetTask(taskName, url, noMipmap, invertY, samplingMode);
  26906. this._tasks.push(task);
  26907. return task;
  26908. };
  26909. AssetsManager.prototype._decreaseWaitingTasksCount = function () {
  26910. this._waitingTasksCount--;
  26911. if (this._waitingTasksCount === 0) {
  26912. if (this.onFinish) {
  26913. this.onFinish(this._tasks);
  26914. }
  26915. this._scene.getEngine().hideLoadingUI();
  26916. }
  26917. };
  26918. AssetsManager.prototype._runTask = function (task) {
  26919. var _this = this;
  26920. task.run(this._scene, function () {
  26921. if (_this.onTaskSuccess) {
  26922. _this.onTaskSuccess(task);
  26923. }
  26924. _this._decreaseWaitingTasksCount();
  26925. }, function () {
  26926. if (_this.onTaskError) {
  26927. _this.onTaskError(task);
  26928. }
  26929. _this._decreaseWaitingTasksCount();
  26930. });
  26931. };
  26932. AssetsManager.prototype.reset = function () {
  26933. this._tasks = new Array();
  26934. return this;
  26935. };
  26936. AssetsManager.prototype.load = function () {
  26937. this._waitingTasksCount = this._tasks.length;
  26938. if (this._waitingTasksCount === 0) {
  26939. if (this.onFinish) {
  26940. this.onFinish(this._tasks);
  26941. }
  26942. return this;
  26943. }
  26944. if (this.useDefaultLoadingScreen) {
  26945. this._scene.getEngine().displayLoadingUI();
  26946. }
  26947. for (var index = 0; index < this._tasks.length; index++) {
  26948. var task = this._tasks[index];
  26949. this._runTask(task);
  26950. }
  26951. return this;
  26952. };
  26953. return AssetsManager;
  26954. })();
  26955. BABYLON.AssetsManager = AssetsManager;
  26956. })(BABYLON || (BABYLON = {}));
  26957. //# sourceMappingURL=babylon.assetsManager.js.map
  26958. var BABYLON;
  26959. (function (BABYLON) {
  26960. var VRDeviceOrientationCamera = (function (_super) {
  26961. __extends(VRDeviceOrientationCamera, _super);
  26962. function VRDeviceOrientationCamera(name, position, scene) {
  26963. _super.call(this, name, position, scene);
  26964. this._alpha = 0;
  26965. this._beta = 0;
  26966. this._gamma = 0;
  26967. }
  26968. VRDeviceOrientationCamera.prototype._onOrientationEvent = function (evt) {
  26969. this._alpha = +evt.alpha | 0;
  26970. this._beta = +evt.beta | 0;
  26971. this._gamma = +evt.gamma | 0;
  26972. if (this._gamma < 0) {
  26973. this._gamma = 90 + this._gamma;
  26974. }
  26975. else {
  26976. // Incline it in the correct angle.
  26977. this._gamma = 270 - this._gamma;
  26978. }
  26979. this.rotation.x = this._gamma / 180.0 * Math.PI;
  26980. this.rotation.y = -this._alpha / 180.0 * Math.PI;
  26981. this.rotation.z = this._beta / 180.0 * Math.PI;
  26982. };
  26983. return VRDeviceOrientationCamera;
  26984. })(BABYLON.OculusCamera);
  26985. BABYLON.VRDeviceOrientationCamera = VRDeviceOrientationCamera;
  26986. })(BABYLON || (BABYLON = {}));
  26987. //# sourceMappingURL=babylon.vrDeviceOrientationCamera.js.map
  26988. var BABYLON;
  26989. (function (BABYLON) {
  26990. var WebVRCamera = (function (_super) {
  26991. __extends(WebVRCamera, _super);
  26992. function WebVRCamera(name, position, scene) {
  26993. _super.call(this, name, position, scene);
  26994. this._hmdDevice = null;
  26995. this._sensorDevice = null;
  26996. this._cacheState = null;
  26997. this._cacheQuaternion = new BABYLON.Quaternion();
  26998. this._cacheRotation = BABYLON.Vector3.Zero();
  26999. this._vrEnabled = false;
  27000. this._getWebVRDevices = this._getWebVRDevices.bind(this);
  27001. }
  27002. WebVRCamera.prototype._getWebVRDevices = function (devices) {
  27003. var size = devices.length;
  27004. var i = 0;
  27005. // Reset devices.
  27006. this._sensorDevice = null;
  27007. this._hmdDevice = null;
  27008. while (i < size && this._hmdDevice === null) {
  27009. if (devices[i] instanceof HMDVRDevice) {
  27010. this._hmdDevice = devices[i];
  27011. }
  27012. i++;
  27013. }
  27014. i = 0;
  27015. while (i < size && this._sensorDevice === null) {
  27016. if (devices[i] instanceof PositionSensorVRDevice && (!this._hmdDevice || devices[i].hardwareUnitId === this._hmdDevice.hardwareUnitId)) {
  27017. this._sensorDevice = devices[i];
  27018. }
  27019. i++;
  27020. }
  27021. this._vrEnabled = this._sensorDevice && this._hmdDevice ? true : false;
  27022. };
  27023. WebVRCamera.prototype._update = function () {
  27024. if (this._vrEnabled) {
  27025. this._cacheState = this._sensorDevice.getState();
  27026. this._cacheQuaternion.copyFromFloats(this._cacheState.orientation.x, this._cacheState.orientation.y, this._cacheState.orientation.z, this._cacheState.orientation.w);
  27027. this._cacheQuaternion.toEulerAnglesToRef(this._cacheRotation);
  27028. this.rotation.x = -this._cacheRotation.z;
  27029. this.rotation.y = -this._cacheRotation.y;
  27030. this.rotation.z = this._cacheRotation.x;
  27031. }
  27032. _super.prototype._update.call(this);
  27033. };
  27034. WebVRCamera.prototype.attachControl = function (element, noPreventDefault) {
  27035. _super.prototype.attachControl.call(this, element, noPreventDefault);
  27036. if (navigator.getVRDevices) {
  27037. navigator.getVRDevices().then(this._getWebVRDevices);
  27038. }
  27039. else if (navigator.mozGetVRDevices) {
  27040. navigator.mozGetVRDevices(this._getWebVRDevices);
  27041. }
  27042. };
  27043. WebVRCamera.prototype.detachControl = function (element) {
  27044. _super.prototype.detachControl.call(this, element);
  27045. this._vrEnabled = false;
  27046. };
  27047. return WebVRCamera;
  27048. })(BABYLON.OculusCamera);
  27049. BABYLON.WebVRCamera = WebVRCamera;
  27050. })(BABYLON || (BABYLON = {}));
  27051. //# sourceMappingURL=babylon.webVRCamera.js.map
  27052. var BABYLON;
  27053. (function (BABYLON) {
  27054. // Standard optimizations
  27055. var SceneOptimization = (function () {
  27056. function SceneOptimization(priority) {
  27057. if (priority === void 0) { priority = 0; }
  27058. this.priority = priority;
  27059. this.apply = function (scene) {
  27060. return true; // Return true if everything that can be done was applied
  27061. };
  27062. }
  27063. return SceneOptimization;
  27064. })();
  27065. BABYLON.SceneOptimization = SceneOptimization;
  27066. var TextureOptimization = (function (_super) {
  27067. __extends(TextureOptimization, _super);
  27068. function TextureOptimization(priority, maximumSize) {
  27069. var _this = this;
  27070. if (priority === void 0) { priority = 0; }
  27071. if (maximumSize === void 0) { maximumSize = 1024; }
  27072. _super.call(this, priority);
  27073. this.priority = priority;
  27074. this.maximumSize = maximumSize;
  27075. this.apply = function (scene) {
  27076. var allDone = true;
  27077. for (var index = 0; index < scene.textures.length; index++) {
  27078. var texture = scene.textures[index];
  27079. if (!texture.canRescale) {
  27080. continue;
  27081. }
  27082. var currentSize = texture.getSize();
  27083. var maxDimension = Math.max(currentSize.width, currentSize.height);
  27084. if (maxDimension > _this.maximumSize) {
  27085. texture.scale(0.5);
  27086. allDone = false;
  27087. }
  27088. }
  27089. return allDone;
  27090. };
  27091. }
  27092. return TextureOptimization;
  27093. })(SceneOptimization);
  27094. BABYLON.TextureOptimization = TextureOptimization;
  27095. var HardwareScalingOptimization = (function (_super) {
  27096. __extends(HardwareScalingOptimization, _super);
  27097. function HardwareScalingOptimization(priority, maximumScale) {
  27098. var _this = this;
  27099. if (priority === void 0) { priority = 0; }
  27100. if (maximumScale === void 0) { maximumScale = 2; }
  27101. _super.call(this, priority);
  27102. this.priority = priority;
  27103. this.maximumScale = maximumScale;
  27104. this._currentScale = 1;
  27105. this.apply = function (scene) {
  27106. _this._currentScale++;
  27107. scene.getEngine().setHardwareScalingLevel(_this._currentScale);
  27108. return _this._currentScale >= _this.maximumScale;
  27109. };
  27110. }
  27111. return HardwareScalingOptimization;
  27112. })(SceneOptimization);
  27113. BABYLON.HardwareScalingOptimization = HardwareScalingOptimization;
  27114. var ShadowsOptimization = (function (_super) {
  27115. __extends(ShadowsOptimization, _super);
  27116. function ShadowsOptimization() {
  27117. _super.apply(this, arguments);
  27118. this.apply = function (scene) {
  27119. scene.shadowsEnabled = false;
  27120. return true;
  27121. };
  27122. }
  27123. return ShadowsOptimization;
  27124. })(SceneOptimization);
  27125. BABYLON.ShadowsOptimization = ShadowsOptimization;
  27126. var PostProcessesOptimization = (function (_super) {
  27127. __extends(PostProcessesOptimization, _super);
  27128. function PostProcessesOptimization() {
  27129. _super.apply(this, arguments);
  27130. this.apply = function (scene) {
  27131. scene.postProcessesEnabled = false;
  27132. return true;
  27133. };
  27134. }
  27135. return PostProcessesOptimization;
  27136. })(SceneOptimization);
  27137. BABYLON.PostProcessesOptimization = PostProcessesOptimization;
  27138. var LensFlaresOptimization = (function (_super) {
  27139. __extends(LensFlaresOptimization, _super);
  27140. function LensFlaresOptimization() {
  27141. _super.apply(this, arguments);
  27142. this.apply = function (scene) {
  27143. scene.lensFlaresEnabled = false;
  27144. return true;
  27145. };
  27146. }
  27147. return LensFlaresOptimization;
  27148. })(SceneOptimization);
  27149. BABYLON.LensFlaresOptimization = LensFlaresOptimization;
  27150. var ParticlesOptimization = (function (_super) {
  27151. __extends(ParticlesOptimization, _super);
  27152. function ParticlesOptimization() {
  27153. _super.apply(this, arguments);
  27154. this.apply = function (scene) {
  27155. scene.particlesEnabled = false;
  27156. return true;
  27157. };
  27158. }
  27159. return ParticlesOptimization;
  27160. })(SceneOptimization);
  27161. BABYLON.ParticlesOptimization = ParticlesOptimization;
  27162. var RenderTargetsOptimization = (function (_super) {
  27163. __extends(RenderTargetsOptimization, _super);
  27164. function RenderTargetsOptimization() {
  27165. _super.apply(this, arguments);
  27166. this.apply = function (scene) {
  27167. scene.renderTargetsEnabled = false;
  27168. return true;
  27169. };
  27170. }
  27171. return RenderTargetsOptimization;
  27172. })(SceneOptimization);
  27173. BABYLON.RenderTargetsOptimization = RenderTargetsOptimization;
  27174. var MergeMeshesOptimization = (function (_super) {
  27175. __extends(MergeMeshesOptimization, _super);
  27176. function MergeMeshesOptimization() {
  27177. var _this = this;
  27178. _super.apply(this, arguments);
  27179. this._canBeMerged = function (abstractMesh) {
  27180. if (!(abstractMesh instanceof BABYLON.Mesh)) {
  27181. return false;
  27182. }
  27183. var mesh = abstractMesh;
  27184. if (!mesh.isVisible || !mesh.isEnabled()) {
  27185. return false;
  27186. }
  27187. if (mesh.instances.length > 0) {
  27188. return false;
  27189. }
  27190. if (mesh.skeleton || mesh.hasLODLevels) {
  27191. return false;
  27192. }
  27193. return true;
  27194. };
  27195. this.apply = function (scene) {
  27196. var globalPool = scene.meshes.slice(0);
  27197. var globalLength = globalPool.length;
  27198. for (var index = 0; index < globalLength; index++) {
  27199. var currentPool = new Array();
  27200. var current = globalPool[index];
  27201. // Checks
  27202. if (!_this._canBeMerged(current)) {
  27203. continue;
  27204. }
  27205. currentPool.push(current);
  27206. for (var subIndex = index + 1; subIndex < globalLength; subIndex++) {
  27207. var otherMesh = globalPool[subIndex];
  27208. if (!_this._canBeMerged(otherMesh)) {
  27209. continue;
  27210. }
  27211. if (otherMesh.material !== current.material) {
  27212. continue;
  27213. }
  27214. if (otherMesh.checkCollisions !== current.checkCollisions) {
  27215. continue;
  27216. }
  27217. currentPool.push(otherMesh);
  27218. globalLength--;
  27219. globalPool.splice(subIndex, 1);
  27220. subIndex--;
  27221. }
  27222. if (currentPool.length < 2) {
  27223. continue;
  27224. }
  27225. // Merge meshes
  27226. BABYLON.Mesh.MergeMeshes(currentPool);
  27227. }
  27228. return true;
  27229. };
  27230. }
  27231. return MergeMeshesOptimization;
  27232. })(SceneOptimization);
  27233. BABYLON.MergeMeshesOptimization = MergeMeshesOptimization;
  27234. // Options
  27235. var SceneOptimizerOptions = (function () {
  27236. function SceneOptimizerOptions(targetFrameRate, trackerDuration) {
  27237. if (targetFrameRate === void 0) { targetFrameRate = 60; }
  27238. if (trackerDuration === void 0) { trackerDuration = 2000; }
  27239. this.targetFrameRate = targetFrameRate;
  27240. this.trackerDuration = trackerDuration;
  27241. this.optimizations = new Array();
  27242. }
  27243. SceneOptimizerOptions.LowDegradationAllowed = function (targetFrameRate) {
  27244. var result = new SceneOptimizerOptions(targetFrameRate);
  27245. var priority = 0;
  27246. result.optimizations.push(new MergeMeshesOptimization(priority));
  27247. result.optimizations.push(new ShadowsOptimization(priority));
  27248. result.optimizations.push(new LensFlaresOptimization(priority));
  27249. // Next priority
  27250. priority++;
  27251. result.optimizations.push(new PostProcessesOptimization(priority));
  27252. result.optimizations.push(new ParticlesOptimization(priority));
  27253. // Next priority
  27254. priority++;
  27255. result.optimizations.push(new TextureOptimization(priority, 1024));
  27256. return result;
  27257. };
  27258. SceneOptimizerOptions.ModerateDegradationAllowed = function (targetFrameRate) {
  27259. var result = new SceneOptimizerOptions(targetFrameRate);
  27260. var priority = 0;
  27261. result.optimizations.push(new MergeMeshesOptimization(priority));
  27262. result.optimizations.push(new ShadowsOptimization(priority));
  27263. result.optimizations.push(new LensFlaresOptimization(priority));
  27264. // Next priority
  27265. priority++;
  27266. result.optimizations.push(new PostProcessesOptimization(priority));
  27267. result.optimizations.push(new ParticlesOptimization(priority));
  27268. // Next priority
  27269. priority++;
  27270. result.optimizations.push(new TextureOptimization(priority, 512));
  27271. // Next priority
  27272. priority++;
  27273. result.optimizations.push(new RenderTargetsOptimization(priority));
  27274. // Next priority
  27275. priority++;
  27276. result.optimizations.push(new HardwareScalingOptimization(priority, 2));
  27277. return result;
  27278. };
  27279. SceneOptimizerOptions.HighDegradationAllowed = function (targetFrameRate) {
  27280. var result = new SceneOptimizerOptions(targetFrameRate);
  27281. var priority = 0;
  27282. result.optimizations.push(new MergeMeshesOptimization(priority));
  27283. result.optimizations.push(new ShadowsOptimization(priority));
  27284. result.optimizations.push(new LensFlaresOptimization(priority));
  27285. // Next priority
  27286. priority++;
  27287. result.optimizations.push(new PostProcessesOptimization(priority));
  27288. result.optimizations.push(new ParticlesOptimization(priority));
  27289. // Next priority
  27290. priority++;
  27291. result.optimizations.push(new TextureOptimization(priority, 256));
  27292. // Next priority
  27293. priority++;
  27294. result.optimizations.push(new RenderTargetsOptimization(priority));
  27295. // Next priority
  27296. priority++;
  27297. result.optimizations.push(new HardwareScalingOptimization(priority, 4));
  27298. return result;
  27299. };
  27300. return SceneOptimizerOptions;
  27301. })();
  27302. BABYLON.SceneOptimizerOptions = SceneOptimizerOptions;
  27303. // Scene optimizer tool
  27304. var SceneOptimizer = (function () {
  27305. function SceneOptimizer() {
  27306. }
  27307. SceneOptimizer._CheckCurrentState = function (scene, options, currentPriorityLevel, onSuccess, onFailure) {
  27308. // TODO: add an epsilon
  27309. if (scene.getEngine().getFps() >= options.targetFrameRate) {
  27310. if (onSuccess) {
  27311. onSuccess();
  27312. }
  27313. return;
  27314. }
  27315. // Apply current level of optimizations
  27316. var allDone = true;
  27317. var noOptimizationApplied = true;
  27318. for (var index = 0; index < options.optimizations.length; index++) {
  27319. var optimization = options.optimizations[index];
  27320. if (optimization.priority === currentPriorityLevel) {
  27321. noOptimizationApplied = false;
  27322. allDone = allDone && optimization.apply(scene);
  27323. }
  27324. }
  27325. // If no optimization was applied, this is a failure :(
  27326. if (noOptimizationApplied) {
  27327. if (onFailure) {
  27328. onFailure();
  27329. }
  27330. return;
  27331. }
  27332. // If all optimizations were done, move to next level
  27333. if (allDone) {
  27334. currentPriorityLevel++;
  27335. }
  27336. // Let's the system running for a specific amount of time before checking FPS
  27337. scene.executeWhenReady(function () {
  27338. setTimeout(function () {
  27339. SceneOptimizer._CheckCurrentState(scene, options, currentPriorityLevel, onSuccess, onFailure);
  27340. }, options.trackerDuration);
  27341. });
  27342. };
  27343. SceneOptimizer.OptimizeAsync = function (scene, options, onSuccess, onFailure) {
  27344. if (!options) {
  27345. options = SceneOptimizerOptions.ModerateDegradationAllowed();
  27346. }
  27347. // Let's the system running for a specific amount of time before checking FPS
  27348. scene.executeWhenReady(function () {
  27349. setTimeout(function () {
  27350. SceneOptimizer._CheckCurrentState(scene, options, 0, onSuccess, onFailure);
  27351. }, options.trackerDuration);
  27352. });
  27353. };
  27354. return SceneOptimizer;
  27355. })();
  27356. BABYLON.SceneOptimizer = SceneOptimizer;
  27357. })(BABYLON || (BABYLON = {}));
  27358. //# sourceMappingURL=babylon.sceneOptimizer.js.mapvar BABYLON;
  27359. (function (BABYLON) {
  27360. var Internals;
  27361. (function (Internals) {
  27362. var MeshLODLevel = (function () {
  27363. function MeshLODLevel(distance, mesh) {
  27364. this.distance = distance;
  27365. this.mesh = mesh;
  27366. }
  27367. return MeshLODLevel;
  27368. })();
  27369. Internals.MeshLODLevel = MeshLODLevel;
  27370. })(Internals = BABYLON.Internals || (BABYLON.Internals = {}));
  27371. })(BABYLON || (BABYLON = {}));
  27372. //# sourceMappingURL=babylon.meshLODLevel.js.mapvar BABYLON;
  27373. (function (BABYLON) {
  27374. var AudioEngine = (function () {
  27375. function AudioEngine() {
  27376. this._audioContext = null;
  27377. this._audioContextInitialized = false;
  27378. this.canUseWebAudio = false;
  27379. this.WarnedWebAudioUnsupported = false;
  27380. if (typeof AudioContext !== 'undefined' || typeof webkitAudioContext !== 'undefined') {
  27381. window.AudioContext = window.AudioContext || window.webkitAudioContext;
  27382. this.canUseWebAudio = true;
  27383. }
  27384. }
  27385. Object.defineProperty(AudioEngine.prototype, "audioContext", {
  27386. get: function () {
  27387. if (!this._audioContextInitialized) {
  27388. this._initializeAudioContext();
  27389. }
  27390. return this._audioContext;
  27391. },
  27392. enumerable: true,
  27393. configurable: true
  27394. });
  27395. AudioEngine.prototype._initializeAudioContext = function () {
  27396. try {
  27397. if (this.canUseWebAudio) {
  27398. this._audioContext = new AudioContext();
  27399. // create a global volume gain node
  27400. this.masterGain = this._audioContext.createGain();
  27401. this.masterGain.gain.value = 1;
  27402. this.masterGain.connect(this._audioContext.destination);
  27403. this._audioContextInitialized = true;
  27404. }
  27405. }
  27406. catch (e) {
  27407. this.canUseWebAudio = false;
  27408. BABYLON.Tools.Error("Web Audio: " + e.message);
  27409. }
  27410. };
  27411. AudioEngine.prototype.dispose = function () {
  27412. if (this.canUseWebAudio && this._audioContextInitialized) {
  27413. if (this._connectedAnalyser) {
  27414. this._connectedAnalyser.stopDebugCanvas();
  27415. this._connectedAnalyser.dispose();
  27416. this.masterGain.disconnect();
  27417. this.masterGain.connect(this._audioContext.destination);
  27418. this._connectedAnalyser = null;
  27419. }
  27420. this.masterGain.gain.value = 1;
  27421. }
  27422. this.WarnedWebAudioUnsupported = false;
  27423. };
  27424. AudioEngine.prototype.getGlobalVolume = function () {
  27425. if (this.canUseWebAudio && this._audioContextInitialized) {
  27426. return this.masterGain.gain.value;
  27427. }
  27428. else {
  27429. return -1;
  27430. }
  27431. };
  27432. AudioEngine.prototype.setGlobalVolume = function (newVolume) {
  27433. if (this.canUseWebAudio && this._audioContextInitialized) {
  27434. this.masterGain.gain.value = newVolume;
  27435. }
  27436. };
  27437. AudioEngine.prototype.connectToAnalyser = function (analyser) {
  27438. if (this._connectedAnalyser) {
  27439. this._connectedAnalyser.stopDebugCanvas();
  27440. }
  27441. if (this.canUseWebAudio && this._audioContextInitialized) {
  27442. this._connectedAnalyser = analyser;
  27443. this.masterGain.disconnect();
  27444. this._connectedAnalyser.connectAudioNodes(this.masterGain, this._audioContext.destination);
  27445. }
  27446. };
  27447. return AudioEngine;
  27448. })();
  27449. BABYLON.AudioEngine = AudioEngine;
  27450. })(BABYLON || (BABYLON = {}));
  27451. //# sourceMappingURL=babylon.audioEngine.js.mapvar BABYLON;
  27452. (function (BABYLON) {
  27453. var Sound = (function () {
  27454. /**
  27455. * Create a sound and attach it to a scene
  27456. * @param name Name of your sound
  27457. * @param urlOrArrayBuffer Url to the sound to load async or ArrayBuffer
  27458. * @param readyToPlayCallback Provide a callback function if you'd like to load your code once the sound is ready to be played
  27459. * @param options Objects to provide with the current available options: autoplay, loop, volume, spatialSound, maxDistance, rolloffFactor, refDistance, distanceModel, panningModel
  27460. */
  27461. function Sound(name, urlOrArrayBuffer, scene, readyToPlayCallback, options) {
  27462. var _this = this;
  27463. this.autoplay = false;
  27464. this.loop = false;
  27465. this.useCustomAttenuation = false;
  27466. this.spatialSound = false;
  27467. this.refDistance = 1;
  27468. this.rolloffFactor = 1;
  27469. this.maxDistance = 100;
  27470. this.distanceModel = "linear";
  27471. this._panningModel = "equalpower";
  27472. this._playbackRate = 1;
  27473. this._startTime = 0;
  27474. this._startOffset = 0;
  27475. this._position = BABYLON.Vector3.Zero();
  27476. this._localDirection = new BABYLON.Vector3(1, 0, 0);
  27477. this._volume = 1;
  27478. this._isLoaded = false;
  27479. this._isReadyToPlay = false;
  27480. this.isPlaying = false;
  27481. this.isPaused = false;
  27482. this._isDirectional = false;
  27483. // Used if you'd like to create a directional sound.
  27484. // If not set, the sound will be omnidirectional
  27485. this._coneInnerAngle = 360;
  27486. this._coneOuterAngle = 360;
  27487. this._coneOuterGain = 0;
  27488. this.name = name;
  27489. this._scene = scene;
  27490. this._readyToPlayCallback = readyToPlayCallback;
  27491. // Default custom attenuation function is a linear attenuation
  27492. this._customAttenuationFunction = function (currentVolume, currentDistance, maxDistance, refDistance, rolloffFactor) {
  27493. if (currentDistance < maxDistance) {
  27494. return currentVolume * (1 - currentDistance / maxDistance);
  27495. }
  27496. else {
  27497. return 0;
  27498. }
  27499. };
  27500. if (options) {
  27501. this.autoplay = options.autoplay || false;
  27502. this.loop = options.loop || false;
  27503. // if volume === 0, we need another way to check this option
  27504. if (options.volume !== undefined) {
  27505. this._volume = options.volume;
  27506. }
  27507. this.spatialSound = options.spatialSound || false;
  27508. this.maxDistance = options.maxDistance || 100;
  27509. this.useCustomAttenuation = options.useCustomAttenuation || false;
  27510. this.rolloffFactor = options.rolloffFactor || 1;
  27511. this.refDistance = options.refDistance || 1;
  27512. this.distanceModel = options.distanceModel || "linear";
  27513. this._playbackRate = options.playbackRate || 1;
  27514. }
  27515. if (BABYLON.Engine.audioEngine.canUseWebAudio) {
  27516. this._soundGain = BABYLON.Engine.audioEngine.audioContext.createGain();
  27517. this._soundGain.gain.value = this._volume;
  27518. this._inputAudioNode = this._soundGain;
  27519. this._ouputAudioNode = this._soundGain;
  27520. if (this.spatialSound) {
  27521. this._createSpatialParameters();
  27522. }
  27523. this._scene.mainSoundTrack.AddSound(this);
  27524. // if no parameter is passed, you need to call setAudioBuffer yourself to prepare the sound
  27525. if (urlOrArrayBuffer) {
  27526. // If it's an URL
  27527. if (typeof (urlOrArrayBuffer) === "string") {
  27528. BABYLON.Tools.LoadFile(urlOrArrayBuffer, function (data) {
  27529. _this._soundLoaded(data);
  27530. }, null, null, true);
  27531. }
  27532. else {
  27533. if (urlOrArrayBuffer instanceof ArrayBuffer) {
  27534. this._soundLoaded(urlOrArrayBuffer);
  27535. }
  27536. else {
  27537. BABYLON.Tools.Error("Parameter must be a URL to the sound or an ArrayBuffer of the sound.");
  27538. }
  27539. }
  27540. }
  27541. }
  27542. else {
  27543. // Adding an empty sound to avoid breaking audio calls for non Web Audio browsers
  27544. this._scene.mainSoundTrack.AddSound(this);
  27545. if (!BABYLON.Engine.audioEngine.WarnedWebAudioUnsupported) {
  27546. BABYLON.Tools.Error("Web Audio is not supported by your browser.");
  27547. BABYLON.Engine.audioEngine.WarnedWebAudioUnsupported = true;
  27548. }
  27549. // Simulating a ready to play event to avoid breaking code for non web audio browsers
  27550. if (this._readyToPlayCallback) {
  27551. window.setTimeout(function () {
  27552. _this._readyToPlayCallback();
  27553. }, 1000);
  27554. }
  27555. }
  27556. }
  27557. Sound.prototype.dispose = function () {
  27558. if (BABYLON.Engine.audioEngine.canUseWebAudio && this._isReadyToPlay) {
  27559. if (this.isPlaying) {
  27560. this.stop();
  27561. }
  27562. this._isReadyToPlay = false;
  27563. if (this.soundTrackId === -1) {
  27564. this._scene.mainSoundTrack.RemoveSound(this);
  27565. }
  27566. else {
  27567. this._scene.soundTracks[this.soundTrackId].RemoveSound(this);
  27568. }
  27569. if (this._soundGain) {
  27570. this._soundGain.disconnect();
  27571. this._soundGain = null;
  27572. }
  27573. if (this._soundPanner) {
  27574. this._soundPanner.disconnect();
  27575. this._soundPanner = null;
  27576. }
  27577. if (this._soundSource) {
  27578. this._soundSource.disconnect();
  27579. this._soundSource = null;
  27580. }
  27581. this._audioBuffer = null;
  27582. if (this._connectedMesh) {
  27583. this._connectedMesh.unregisterAfterWorldMatrixUpdate(this._registerFunc);
  27584. this._connectedMesh = null;
  27585. }
  27586. }
  27587. };
  27588. Sound.prototype._soundLoaded = function (audioData) {
  27589. var _this = this;
  27590. this._isLoaded = true;
  27591. BABYLON.Engine.audioEngine.audioContext.decodeAudioData(audioData, function (buffer) {
  27592. _this._audioBuffer = buffer;
  27593. _this._isReadyToPlay = true;
  27594. if (_this.autoplay) {
  27595. _this.play();
  27596. }
  27597. if (_this._readyToPlayCallback) {
  27598. _this._readyToPlayCallback();
  27599. }
  27600. }, function (error) {
  27601. BABYLON.Tools.Error("Error while decoding audio data: " + error.err);
  27602. });
  27603. };
  27604. Sound.prototype.setAudioBuffer = function (audioBuffer) {
  27605. if (BABYLON.Engine.audioEngine.canUseWebAudio) {
  27606. this._audioBuffer = audioBuffer;
  27607. this._isReadyToPlay = true;
  27608. }
  27609. };
  27610. Sound.prototype.updateOptions = function (options) {
  27611. if (options) {
  27612. this.loop = options.loop || this.loop;
  27613. this.maxDistance = options.maxDistance || this.maxDistance;
  27614. this.useCustomAttenuation = options.useCustomAttenuation || this.useCustomAttenuation;
  27615. this.rolloffFactor = options.rolloffFactor || this.rolloffFactor;
  27616. this.refDistance = options.refDistance || this.refDistance;
  27617. this.distanceModel = options.distanceModel || this.distanceModel;
  27618. this._playbackRate = options.playbackRate || this._playbackRate;
  27619. }
  27620. };
  27621. Sound.prototype._createSpatialParameters = function () {
  27622. if (BABYLON.Engine.audioEngine.canUseWebAudio) {
  27623. if (this._scene.headphone) {
  27624. this._panningModel = "HRTF";
  27625. }
  27626. this._soundPanner = BABYLON.Engine.audioEngine.audioContext.createPanner();
  27627. if (this.useCustomAttenuation) {
  27628. // Tricks to disable in a way embedded Web Audio attenuation
  27629. this._soundPanner.distanceModel = "linear";
  27630. this._soundPanner.maxDistance = Number.MAX_VALUE;
  27631. this._soundPanner.refDistance = 1;
  27632. this._soundPanner.rolloffFactor = 1;
  27633. this._soundPanner.panningModel = this._panningModel;
  27634. }
  27635. else {
  27636. this._soundPanner.distanceModel = this.distanceModel;
  27637. this._soundPanner.maxDistance = this.maxDistance;
  27638. this._soundPanner.refDistance = this.refDistance;
  27639. this._soundPanner.rolloffFactor = this.rolloffFactor;
  27640. this._soundPanner.panningModel = this._panningModel;
  27641. }
  27642. this._soundPanner.connect(this._ouputAudioNode);
  27643. this._inputAudioNode = this._soundPanner;
  27644. }
  27645. };
  27646. Sound.prototype.switchPanningModelToHRTF = function () {
  27647. this._panningModel = "HRTF";
  27648. this._switchPanningModel();
  27649. };
  27650. Sound.prototype.switchPanningModelToEqualPower = function () {
  27651. this._panningModel = "equalpower";
  27652. this._switchPanningModel();
  27653. };
  27654. Sound.prototype._switchPanningModel = function () {
  27655. if (BABYLON.Engine.audioEngine.canUseWebAudio && this.spatialSound) {
  27656. this._soundPanner.panningModel = this._panningModel;
  27657. }
  27658. };
  27659. Sound.prototype.connectToSoundTrackAudioNode = function (soundTrackAudioNode) {
  27660. if (BABYLON.Engine.audioEngine.canUseWebAudio) {
  27661. this._ouputAudioNode.disconnect();
  27662. this._ouputAudioNode.connect(soundTrackAudioNode);
  27663. }
  27664. };
  27665. /**
  27666. * Transform this sound into a directional source
  27667. * @param coneInnerAngle Size of the inner cone in degree
  27668. * @param coneOuterAngle Size of the outer cone in degree
  27669. * @param coneOuterGain Volume of the sound outside the outer cone (between 0.0 and 1.0)
  27670. */
  27671. Sound.prototype.setDirectionalCone = function (coneInnerAngle, coneOuterAngle, coneOuterGain) {
  27672. if (coneOuterAngle < coneInnerAngle) {
  27673. BABYLON.Tools.Error("setDirectionalCone(): outer angle of the cone must be superior or equal to the inner angle.");
  27674. return;
  27675. }
  27676. this._coneInnerAngle = coneInnerAngle;
  27677. this._coneOuterAngle = coneOuterAngle;
  27678. this._coneOuterGain = coneOuterGain;
  27679. this._isDirectional = true;
  27680. if (this.isPlaying && this.loop) {
  27681. this.stop();
  27682. this.play();
  27683. }
  27684. };
  27685. Sound.prototype.setPosition = function (newPosition) {
  27686. this._position = newPosition;
  27687. if (BABYLON.Engine.audioEngine.canUseWebAudio && this.spatialSound) {
  27688. this._soundPanner.setPosition(this._position.x, this._position.y, this._position.z);
  27689. }
  27690. };
  27691. Sound.prototype.setLocalDirectionToMesh = function (newLocalDirection) {
  27692. this._localDirection = newLocalDirection;
  27693. if (BABYLON.Engine.audioEngine.canUseWebAudio && this._connectedMesh && this.isPlaying) {
  27694. this._updateDirection();
  27695. }
  27696. };
  27697. Sound.prototype._updateDirection = function () {
  27698. var mat = this._connectedMesh.getWorldMatrix();
  27699. var direction = BABYLON.Vector3.TransformNormal(this._localDirection, mat);
  27700. direction.normalize();
  27701. this._soundPanner.setOrientation(direction.x, direction.y, direction.z);
  27702. };
  27703. Sound.prototype.updateDistanceFromListener = function () {
  27704. if (BABYLON.Engine.audioEngine.canUseWebAudio && this._connectedMesh && this.useCustomAttenuation) {
  27705. var distance = this._connectedMesh.getDistanceToCamera(this._scene.activeCamera);
  27706. this._soundGain.gain.value = this._customAttenuationFunction(this._volume, distance, this.maxDistance, this.refDistance, this.rolloffFactor);
  27707. }
  27708. };
  27709. Sound.prototype.setAttenuationFunction = function (callback) {
  27710. this._customAttenuationFunction = callback;
  27711. };
  27712. /**
  27713. * Play the sound
  27714. * @param time (optional) Start the sound after X seconds. Start immediately (0) by default.
  27715. */
  27716. Sound.prototype.play = function (time) {
  27717. var _this = this;
  27718. if (this._isReadyToPlay && this._scene.audioEnabled) {
  27719. try {
  27720. var startTime = time ? BABYLON.Engine.audioEngine.audioContext.currentTime + time : BABYLON.Engine.audioEngine.audioContext.currentTime;
  27721. if (!this._soundSource) {
  27722. if (this.spatialSound) {
  27723. this._soundPanner.setPosition(this._position.x, this._position.y, this._position.z);
  27724. if (this._isDirectional) {
  27725. this._soundPanner.coneInnerAngle = this._coneInnerAngle;
  27726. this._soundPanner.coneOuterAngle = this._coneOuterAngle;
  27727. this._soundPanner.coneOuterGain = this._coneOuterGain;
  27728. if (this._connectedMesh) {
  27729. this._updateDirection();
  27730. }
  27731. else {
  27732. this._soundPanner.setOrientation(this._localDirection.x, this._localDirection.y, this._localDirection.z);
  27733. }
  27734. }
  27735. }
  27736. }
  27737. this._soundSource = BABYLON.Engine.audioEngine.audioContext.createBufferSource();
  27738. this._soundSource.buffer = this._audioBuffer;
  27739. this._soundSource.connect(this._inputAudioNode);
  27740. this._soundSource.loop = this.loop;
  27741. this._soundSource.playbackRate.value = this._playbackRate;
  27742. this._startTime = startTime;
  27743. this._soundSource.onended = function () {
  27744. _this._onended();
  27745. };
  27746. this._soundSource.start(this._startTime, this.isPaused ? this._startOffset % this._soundSource.buffer.duration : 0);
  27747. this.isPlaying = true;
  27748. this.isPaused = false;
  27749. }
  27750. catch (ex) {
  27751. BABYLON.Tools.Error("Error while trying to play audio: " + this.name + ", " + ex.message);
  27752. }
  27753. }
  27754. };
  27755. Sound.prototype._onended = function () {
  27756. this.isPlaying = false;
  27757. if (this.onended) {
  27758. this.onended();
  27759. }
  27760. };
  27761. /**
  27762. * Stop the sound
  27763. * @param time (optional) Stop the sound after X seconds. Stop immediately (0) by default.
  27764. */
  27765. Sound.prototype.stop = function (time) {
  27766. if (this.isPlaying) {
  27767. var stopTime = time ? BABYLON.Engine.audioEngine.audioContext.currentTime + time : BABYLON.Engine.audioEngine.audioContext.currentTime;
  27768. this._soundSource.stop(stopTime);
  27769. this.isPlaying = false;
  27770. }
  27771. };
  27772. Sound.prototype.pause = function () {
  27773. if (this.isPlaying) {
  27774. this.stop(0);
  27775. this._startOffset += BABYLON.Engine.audioEngine.audioContext.currentTime - this._startTime;
  27776. this.isPaused = true;
  27777. }
  27778. };
  27779. Sound.prototype.setVolume = function (newVolume, time) {
  27780. if (BABYLON.Engine.audioEngine.canUseWebAudio && !this.spatialSound) {
  27781. if (time) {
  27782. this._soundGain.gain.linearRampToValueAtTime(this._volume, BABYLON.Engine.audioEngine.audioContext.currentTime);
  27783. this._soundGain.gain.linearRampToValueAtTime(newVolume, time);
  27784. }
  27785. else {
  27786. this._soundGain.gain.value = newVolume;
  27787. }
  27788. }
  27789. this._volume = newVolume;
  27790. };
  27791. Sound.prototype.setPlaybackRate = function (newPlaybackRate) {
  27792. this._playbackRate = newPlaybackRate;
  27793. if (this.isPlaying) {
  27794. this._soundSource.playbackRate.value = this._playbackRate;
  27795. }
  27796. };
  27797. Sound.prototype.getVolume = function () {
  27798. return this._volume;
  27799. };
  27800. Sound.prototype.attachToMesh = function (meshToConnectTo) {
  27801. var _this = this;
  27802. this._connectedMesh = meshToConnectTo;
  27803. if (!this.spatialSound) {
  27804. this._createSpatialParameters();
  27805. this.spatialSound = true;
  27806. if (this.isPlaying && this.loop) {
  27807. this.stop();
  27808. this.play();
  27809. }
  27810. }
  27811. this._onRegisterAfterWorldMatrixUpdate(this._connectedMesh);
  27812. this._registerFunc = function (connectedMesh) { return _this._onRegisterAfterWorldMatrixUpdate(connectedMesh); };
  27813. meshToConnectTo.registerAfterWorldMatrixUpdate(this._registerFunc);
  27814. };
  27815. Sound.prototype._onRegisterAfterWorldMatrixUpdate = function (connectedMesh) {
  27816. this.setPosition(connectedMesh.getBoundingInfo().boundingSphere.centerWorld);
  27817. if (BABYLON.Engine.audioEngine.canUseWebAudio && this._isDirectional && this.isPlaying) {
  27818. this._updateDirection();
  27819. }
  27820. };
  27821. return Sound;
  27822. })();
  27823. BABYLON.Sound = Sound;
  27824. })(BABYLON || (BABYLON = {}));
  27825. //# sourceMappingURL=babylon.sound.js.mapvar BABYLON;
  27826. (function (BABYLON) {
  27827. var SoundTrack = (function () {
  27828. function SoundTrack(scene, options) {
  27829. this.id = -1;
  27830. this._isMainTrack = false;
  27831. this._scene = scene;
  27832. this._audioEngine = BABYLON.Engine.audioEngine;
  27833. this.soundCollection = new Array();
  27834. if (this._audioEngine.canUseWebAudio) {
  27835. this._trackGain = this._audioEngine.audioContext.createGain();
  27836. this._trackGain.connect(this._audioEngine.masterGain);
  27837. if (options) {
  27838. if (options.volume) {
  27839. this._trackGain.gain.value = options.volume;
  27840. }
  27841. if (options.mainTrack) {
  27842. this._isMainTrack = options.mainTrack;
  27843. }
  27844. }
  27845. }
  27846. if (!this._isMainTrack) {
  27847. this._scene.soundTracks.push(this);
  27848. this.id = this._scene.soundTracks.length - 1;
  27849. }
  27850. }
  27851. SoundTrack.prototype.dispose = function () {
  27852. if (this._audioEngine.canUseWebAudio) {
  27853. if (this._connectedAnalyser) {
  27854. this._connectedAnalyser.stopDebugCanvas();
  27855. }
  27856. while (this.soundCollection.length) {
  27857. this.soundCollection[0].dispose();
  27858. }
  27859. this._trackGain.disconnect();
  27860. this._trackGain = null;
  27861. }
  27862. };
  27863. SoundTrack.prototype.AddSound = function (sound) {
  27864. if (BABYLON.Engine.audioEngine.canUseWebAudio) {
  27865. sound.connectToSoundTrackAudioNode(this._trackGain);
  27866. }
  27867. if (sound.soundTrackId) {
  27868. if (sound.soundTrackId === -1) {
  27869. this._scene.mainSoundTrack.RemoveSound(sound);
  27870. }
  27871. else {
  27872. this._scene.soundTracks[sound.soundTrackId].RemoveSound(sound);
  27873. }
  27874. }
  27875. this.soundCollection.push(sound);
  27876. sound.soundTrackId = this.id;
  27877. };
  27878. SoundTrack.prototype.RemoveSound = function (sound) {
  27879. var index = this.soundCollection.indexOf(sound);
  27880. if (index !== -1) {
  27881. this.soundCollection.splice(index, 1);
  27882. }
  27883. };
  27884. SoundTrack.prototype.setVolume = function (newVolume) {
  27885. if (this._audioEngine.canUseWebAudio) {
  27886. this._trackGain.gain.value = newVolume;
  27887. }
  27888. };
  27889. SoundTrack.prototype.switchPanningModelToHRTF = function () {
  27890. if (BABYLON.Engine.audioEngine.canUseWebAudio) {
  27891. for (var i = 0; i < this.soundCollection.length; i++) {
  27892. this.soundCollection[i].switchPanningModelToHRTF();
  27893. }
  27894. }
  27895. };
  27896. SoundTrack.prototype.switchPanningModelToEqualPower = function () {
  27897. if (BABYLON.Engine.audioEngine.canUseWebAudio) {
  27898. for (var i = 0; i < this.soundCollection.length; i++) {
  27899. this.soundCollection[i].switchPanningModelToEqualPower();
  27900. }
  27901. }
  27902. };
  27903. SoundTrack.prototype.connectToAnalyser = function (analyser) {
  27904. if (this._connectedAnalyser) {
  27905. this._connectedAnalyser.stopDebugCanvas();
  27906. }
  27907. this._connectedAnalyser = analyser;
  27908. if (this._audioEngine.canUseWebAudio) {
  27909. this._trackGain.disconnect();
  27910. this._connectedAnalyser.connectAudioNodes(this._trackGain, this._audioEngine.masterGain);
  27911. }
  27912. };
  27913. return SoundTrack;
  27914. })();
  27915. BABYLON.SoundTrack = SoundTrack;
  27916. })(BABYLON || (BABYLON = {}));
  27917. //# sourceMappingURL=babylon.soundtrack.js.mapvar BABYLON;
  27918. (function (BABYLON) {
  27919. var DebugLayer = (function () {
  27920. function DebugLayer(scene) {
  27921. var _this = this;
  27922. this._transformationMatrix = BABYLON.Matrix.Identity();
  27923. this._enabled = false;
  27924. this._labelsEnabled = false;
  27925. this._displayStatistics = true;
  27926. this._displayTree = false;
  27927. this._displayLogs = false;
  27928. this._identityMatrix = BABYLON.Matrix.Identity();
  27929. this.axisRatio = 0.02;
  27930. this.accentColor = "orange";
  27931. this._scene = scene;
  27932. this._syncPositions = function () {
  27933. var engine = _this._scene.getEngine();
  27934. var canvasRect = engine.getRenderingCanvasClientRect();
  27935. if (_this._showUI) {
  27936. _this._statsDiv.style.left = (canvasRect.width - 410) + "px";
  27937. _this._statsDiv.style.top = (canvasRect.height - 290) + "px";
  27938. _this._statsDiv.style.width = "400px";
  27939. _this._statsDiv.style.height = "auto";
  27940. _this._statsSubsetDiv.style.maxHeight = "240px";
  27941. _this._optionsDiv.style.left = "0px";
  27942. _this._optionsDiv.style.top = "10px";
  27943. _this._optionsDiv.style.width = "200px";
  27944. _this._optionsDiv.style.height = "auto";
  27945. _this._optionsSubsetDiv.style.maxHeight = (canvasRect.height - 225) + "px";
  27946. _this._logDiv.style.left = "0px";
  27947. _this._logDiv.style.top = (canvasRect.height - 170) + "px";
  27948. _this._logDiv.style.width = "600px";
  27949. _this._logDiv.style.height = "160px";
  27950. _this._treeDiv.style.left = (canvasRect.width - 310) + "px";
  27951. _this._treeDiv.style.top = "10px";
  27952. _this._treeDiv.style.width = "300px";
  27953. _this._treeDiv.style.height = "auto";
  27954. _this._treeSubsetDiv.style.maxHeight = (canvasRect.height - 340) + "px";
  27955. }
  27956. _this._globalDiv.style.left = canvasRect.left + "px";
  27957. _this._globalDiv.style.top = canvasRect.top + "px";
  27958. _this._drawingCanvas.style.left = "0px";
  27959. _this._drawingCanvas.style.top = "0px";
  27960. _this._drawingCanvas.style.width = engine.getRenderWidth() + "px";
  27961. _this._drawingCanvas.style.height = engine.getRenderHeight() + "px";
  27962. var devicePixelRatio = window.devicePixelRatio || 1;
  27963. var context = _this._drawingContext;
  27964. var backingStoreRatio = context.webkitBackingStorePixelRatio || context.mozBackingStorePixelRatio || context.msBackingStorePixelRatio || context.oBackingStorePixelRatio || context.backingStorePixelRatio || 1;
  27965. _this._ratio = devicePixelRatio / backingStoreRatio;
  27966. _this._drawingCanvas.width = engine.getRenderWidth() * _this._ratio;
  27967. _this._drawingCanvas.height = engine.getRenderHeight() * _this._ratio;
  27968. };
  27969. this._onCanvasClick = function (evt) {
  27970. _this._clickPosition = {
  27971. x: evt.clientX * _this._ratio,
  27972. y: evt.clientY * _this._ratio
  27973. };
  27974. };
  27975. this._syncUI = function () {
  27976. if (_this._showUI) {
  27977. if (_this._displayStatistics) {
  27978. _this._displayStats();
  27979. _this._statsDiv.style.display = "";
  27980. }
  27981. else {
  27982. _this._statsDiv.style.display = "none";
  27983. }
  27984. if (_this._displayLogs) {
  27985. _this._logDiv.style.display = "";
  27986. }
  27987. else {
  27988. _this._logDiv.style.display = "none";
  27989. }
  27990. if (_this._displayTree) {
  27991. _this._treeDiv.style.display = "";
  27992. if (_this._needToRefreshMeshesTree) {
  27993. _this._needToRefreshMeshesTree = false;
  27994. _this._refreshMeshesTreeContent();
  27995. }
  27996. }
  27997. else {
  27998. _this._treeDiv.style.display = "none";
  27999. }
  28000. }
  28001. };
  28002. this._syncData = function () {
  28003. if (_this._labelsEnabled || !_this._showUI) {
  28004. _this._camera.getViewMatrix().multiplyToRef(_this._camera.getProjectionMatrix(), _this._transformationMatrix);
  28005. _this._drawingContext.clearRect(0, 0, _this._drawingCanvas.width, _this._drawingCanvas.height);
  28006. var engine = _this._scene.getEngine();
  28007. var viewport = _this._camera.viewport;
  28008. var globalViewport = viewport.toGlobal(engine);
  28009. // Meshes
  28010. var meshes = _this._camera.getActiveMeshes();
  28011. for (var index = 0; index < meshes.length; index++) {
  28012. var mesh = meshes.data[index];
  28013. var position = mesh.getBoundingInfo().boundingSphere.center;
  28014. var projectedPosition = BABYLON.Vector3.Project(position, mesh.getWorldMatrix(), _this._transformationMatrix, globalViewport);
  28015. if (mesh.renderOverlay || _this.shouldDisplayAxis && _this.shouldDisplayAxis(mesh)) {
  28016. _this._renderAxis(projectedPosition, mesh, globalViewport);
  28017. }
  28018. if (!_this.shouldDisplayLabel || _this.shouldDisplayLabel(mesh)) {
  28019. _this._renderLabel(mesh.name, projectedPosition, 12, function () {
  28020. mesh.renderOverlay = !mesh.renderOverlay;
  28021. }, function () {
  28022. return mesh.renderOverlay ? 'red' : 'black';
  28023. });
  28024. }
  28025. }
  28026. // Cameras
  28027. var cameras = _this._scene.cameras;
  28028. for (index = 0; index < cameras.length; index++) {
  28029. var camera = cameras[index];
  28030. if (camera === _this._camera) {
  28031. continue;
  28032. }
  28033. projectedPosition = BABYLON.Vector3.Project(BABYLON.Vector3.Zero(), camera.getWorldMatrix(), _this._transformationMatrix, globalViewport);
  28034. if (!_this.shouldDisplayLabel || _this.shouldDisplayLabel(camera)) {
  28035. _this._renderLabel(camera.name, projectedPosition, 12, function () {
  28036. _this._camera.detachControl(engine.getRenderingCanvas());
  28037. _this._camera = camera;
  28038. _this._camera.attachControl(engine.getRenderingCanvas());
  28039. }, function () {
  28040. return "purple";
  28041. });
  28042. }
  28043. }
  28044. // Lights
  28045. var lights = _this._scene.lights;
  28046. for (index = 0; index < lights.length; index++) {
  28047. var light = lights[index];
  28048. if (light.position) {
  28049. projectedPosition = BABYLON.Vector3.Project(light.getAbsolutePosition(), _this._identityMatrix, _this._transformationMatrix, globalViewport);
  28050. if (!_this.shouldDisplayLabel || _this.shouldDisplayLabel(light)) {
  28051. _this._renderLabel(light.name, projectedPosition, -20, function () {
  28052. light.setEnabled(!light.isEnabled());
  28053. }, function () {
  28054. return light.isEnabled() ? "orange" : "gray";
  28055. });
  28056. }
  28057. }
  28058. }
  28059. }
  28060. _this._clickPosition = undefined;
  28061. };
  28062. }
  28063. DebugLayer.prototype._refreshMeshesTreeContent = function () {
  28064. while (this._treeSubsetDiv.hasChildNodes()) {
  28065. this._treeSubsetDiv.removeChild(this._treeSubsetDiv.lastChild);
  28066. }
  28067. // Add meshes
  28068. var sortedArray = this._scene.meshes.slice(0, this._scene.meshes.length);
  28069. sortedArray.sort(function (a, b) {
  28070. if (a.name === b.name) {
  28071. return 0;
  28072. }
  28073. return (a.name > b.name) ? 1 : -1;
  28074. });
  28075. for (var index = 0; index < sortedArray.length; index++) {
  28076. var mesh = sortedArray[index];
  28077. if (!mesh.isEnabled()) {
  28078. continue;
  28079. }
  28080. this._generateAdvancedCheckBox(this._treeSubsetDiv, mesh.name, mesh.getTotalVertices() + " verts", mesh.isVisible, function (element, m) {
  28081. m.isVisible = element.checked;
  28082. }, mesh);
  28083. }
  28084. };
  28085. DebugLayer.prototype._renderSingleAxis = function (zero, unit, unitText, label, color) {
  28086. this._drawingContext.beginPath();
  28087. this._drawingContext.moveTo(zero.x, zero.y);
  28088. this._drawingContext.lineTo(unit.x, unit.y);
  28089. this._drawingContext.strokeStyle = color;
  28090. this._drawingContext.lineWidth = 4;
  28091. this._drawingContext.stroke();
  28092. this._drawingContext.font = "normal 14px Segoe UI";
  28093. this._drawingContext.fillStyle = color;
  28094. this._drawingContext.fillText(label, unitText.x, unitText.y);
  28095. };
  28096. DebugLayer.prototype._renderAxis = function (projectedPosition, mesh, globalViewport) {
  28097. var position = mesh.getBoundingInfo().boundingSphere.center;
  28098. var worldMatrix = mesh.getWorldMatrix();
  28099. var unprojectedVector = BABYLON.Vector3.UnprojectFromTransform(projectedPosition.add(new BABYLON.Vector3(this._drawingCanvas.width * this.axisRatio, 0, 0)), globalViewport.width, globalViewport.height, worldMatrix, this._transformationMatrix);
  28100. var unit = (unprojectedVector.subtract(position)).length();
  28101. var xAxis = BABYLON.Vector3.Project(position.add(new BABYLON.Vector3(unit, 0, 0)), worldMatrix, this._transformationMatrix, globalViewport);
  28102. var xAxisText = BABYLON.Vector3.Project(position.add(new BABYLON.Vector3(unit * 1.5, 0, 0)), worldMatrix, this._transformationMatrix, globalViewport);
  28103. this._renderSingleAxis(projectedPosition, xAxis, xAxisText, "x", "#FF0000");
  28104. var yAxis = BABYLON.Vector3.Project(position.add(new BABYLON.Vector3(0, unit, 0)), worldMatrix, this._transformationMatrix, globalViewport);
  28105. var yAxisText = BABYLON.Vector3.Project(position.add(new BABYLON.Vector3(0, unit * 1.5, 0)), worldMatrix, this._transformationMatrix, globalViewport);
  28106. this._renderSingleAxis(projectedPosition, yAxis, yAxisText, "y", "#00FF00");
  28107. var zAxis = BABYLON.Vector3.Project(position.add(new BABYLON.Vector3(0, 0, unit)), worldMatrix, this._transformationMatrix, globalViewport);
  28108. var zAxisText = BABYLON.Vector3.Project(position.add(new BABYLON.Vector3(0, 0, unit * 1.5)), worldMatrix, this._transformationMatrix, globalViewport);
  28109. this._renderSingleAxis(projectedPosition, zAxis, zAxisText, "z", "#0000FF");
  28110. };
  28111. DebugLayer.prototype._renderLabel = function (text, projectedPosition, labelOffset, onClick, getFillStyle) {
  28112. if (projectedPosition.z > 0 && projectedPosition.z < 1.0) {
  28113. this._drawingContext.font = "normal 12px Segoe UI";
  28114. var textMetrics = this._drawingContext.measureText(text);
  28115. var centerX = projectedPosition.x - textMetrics.width / 2;
  28116. var centerY = projectedPosition.y;
  28117. var clientRect = this._drawingCanvas.getBoundingClientRect();
  28118. if (this._showUI && this._isClickInsideRect(clientRect.left * this._ratio + centerX - 5, clientRect.top * this._ratio + centerY - labelOffset - 12, textMetrics.width + 10, 17)) {
  28119. onClick();
  28120. }
  28121. this._drawingContext.beginPath();
  28122. this._drawingContext.rect(centerX - 5, centerY - labelOffset - 12, textMetrics.width + 10, 17);
  28123. this._drawingContext.fillStyle = getFillStyle();
  28124. this._drawingContext.globalAlpha = 0.5;
  28125. this._drawingContext.fill();
  28126. this._drawingContext.globalAlpha = 1.0;
  28127. this._drawingContext.strokeStyle = '#FFFFFF';
  28128. this._drawingContext.lineWidth = 1;
  28129. this._drawingContext.stroke();
  28130. this._drawingContext.fillStyle = "#FFFFFF";
  28131. this._drawingContext.fillText(text, centerX, centerY - labelOffset);
  28132. this._drawingContext.beginPath();
  28133. this._drawingContext.arc(projectedPosition.x, centerY, 5, 0, 2 * Math.PI, false);
  28134. this._drawingContext.fill();
  28135. }
  28136. };
  28137. DebugLayer.prototype._isClickInsideRect = function (x, y, width, height) {
  28138. if (!this._clickPosition) {
  28139. return false;
  28140. }
  28141. if (this._clickPosition.x < x || this._clickPosition.x > x + width) {
  28142. return false;
  28143. }
  28144. if (this._clickPosition.y < y || this._clickPosition.y > y + height) {
  28145. return false;
  28146. }
  28147. return true;
  28148. };
  28149. DebugLayer.prototype.isVisible = function () {
  28150. return this._enabled;
  28151. };
  28152. DebugLayer.prototype.hide = function () {
  28153. if (!this._enabled) {
  28154. return;
  28155. }
  28156. this._enabled = false;
  28157. var engine = this._scene.getEngine();
  28158. this._scene.unregisterBeforeRender(this._syncData);
  28159. this._scene.unregisterAfterRender(this._syncUI);
  28160. document.body.removeChild(this._globalDiv);
  28161. window.removeEventListener("resize", this._syncPositions);
  28162. this._scene.forceShowBoundingBoxes = false;
  28163. this._scene.forceWireframe = false;
  28164. BABYLON.StandardMaterial.DiffuseTextureEnabled = true;
  28165. BABYLON.StandardMaterial.AmbientTextureEnabled = true;
  28166. BABYLON.StandardMaterial.SpecularTextureEnabled = true;
  28167. BABYLON.StandardMaterial.EmissiveTextureEnabled = true;
  28168. BABYLON.StandardMaterial.BumpTextureEnabled = true;
  28169. BABYLON.StandardMaterial.OpacityTextureEnabled = true;
  28170. BABYLON.StandardMaterial.ReflectionTextureEnabled = true;
  28171. this._scene.shadowsEnabled = true;
  28172. this._scene.particlesEnabled = true;
  28173. this._scene.postProcessesEnabled = true;
  28174. this._scene.collisionsEnabled = true;
  28175. this._scene.lightsEnabled = true;
  28176. this._scene.texturesEnabled = true;
  28177. this._scene.lensFlaresEnabled = true;
  28178. this._scene.proceduralTexturesEnabled = true;
  28179. this._scene.renderTargetsEnabled = true;
  28180. engine.getRenderingCanvas().removeEventListener("click", this._onCanvasClick);
  28181. };
  28182. DebugLayer.prototype.show = function (showUI, camera) {
  28183. if (showUI === void 0) { showUI = true; }
  28184. if (camera === void 0) { camera = null; }
  28185. if (this._enabled) {
  28186. return;
  28187. }
  28188. this._enabled = true;
  28189. if (camera) {
  28190. this._camera = camera;
  28191. }
  28192. else {
  28193. this._camera = this._scene.activeCamera;
  28194. }
  28195. this._showUI = showUI;
  28196. var engine = this._scene.getEngine();
  28197. this._globalDiv = document.createElement("div");
  28198. document.body.appendChild(this._globalDiv);
  28199. this._generateDOMelements();
  28200. window.addEventListener("resize", this._syncPositions);
  28201. engine.getRenderingCanvas().addEventListener("click", this._onCanvasClick);
  28202. this._syncPositions();
  28203. this._scene.registerBeforeRender(this._syncData);
  28204. this._scene.registerAfterRender(this._syncUI);
  28205. };
  28206. DebugLayer.prototype._clearLabels = function () {
  28207. this._drawingContext.clearRect(0, 0, this._drawingCanvas.width, this._drawingCanvas.height);
  28208. for (var index = 0; index < this._scene.meshes.length; index++) {
  28209. var mesh = this._scene.meshes[index];
  28210. mesh.renderOverlay = false;
  28211. }
  28212. };
  28213. DebugLayer.prototype._generateheader = function (root, text) {
  28214. var header = document.createElement("div");
  28215. header.innerHTML = text + "&nbsp;";
  28216. header.style.textAlign = "right";
  28217. header.style.width = "100%";
  28218. header.style.color = "white";
  28219. header.style.backgroundColor = "Black";
  28220. header.style.padding = "5px 5px 4px 0px";
  28221. header.style.marginLeft = "-5px";
  28222. header.style.fontWeight = "bold";
  28223. root.appendChild(header);
  28224. };
  28225. DebugLayer.prototype._generateTexBox = function (root, title, color) {
  28226. var label = document.createElement("label");
  28227. label.innerHTML = title;
  28228. label.style.color = color;
  28229. root.appendChild(label);
  28230. root.appendChild(document.createElement("br"));
  28231. };
  28232. DebugLayer.prototype._generateAdvancedCheckBox = function (root, leftTitle, rightTitle, initialState, task, tag) {
  28233. if (tag === void 0) { tag = null; }
  28234. var label = document.createElement("label");
  28235. var boundingBoxesCheckbox = document.createElement("input");
  28236. boundingBoxesCheckbox.type = "checkbox";
  28237. boundingBoxesCheckbox.checked = initialState;
  28238. boundingBoxesCheckbox.addEventListener("change", function (evt) {
  28239. task(evt.target, tag);
  28240. });
  28241. label.appendChild(boundingBoxesCheckbox);
  28242. var container = document.createElement("span");
  28243. var leftPart = document.createElement("span");
  28244. var rightPart = document.createElement("span");
  28245. rightPart.style.cssFloat = "right";
  28246. leftPart.innerHTML = leftTitle;
  28247. rightPart.innerHTML = rightTitle;
  28248. rightPart.style.fontSize = "12px";
  28249. rightPart.style.maxWidth = "200px";
  28250. container.appendChild(leftPart);
  28251. container.appendChild(rightPart);
  28252. label.appendChild(container);
  28253. root.appendChild(label);
  28254. root.appendChild(document.createElement("br"));
  28255. };
  28256. DebugLayer.prototype._generateCheckBox = function (root, title, initialState, task, tag) {
  28257. if (tag === void 0) { tag = null; }
  28258. var label = document.createElement("label");
  28259. var checkBox = document.createElement("input");
  28260. checkBox.type = "checkbox";
  28261. checkBox.checked = initialState;
  28262. checkBox.addEventListener("change", function (evt) {
  28263. task(evt.target, tag);
  28264. });
  28265. label.appendChild(checkBox);
  28266. label.appendChild(document.createTextNode(title));
  28267. root.appendChild(label);
  28268. root.appendChild(document.createElement("br"));
  28269. };
  28270. DebugLayer.prototype._generateButton = function (root, title, task, tag) {
  28271. if (tag === void 0) { tag = null; }
  28272. var button = document.createElement("button");
  28273. button.innerHTML = title;
  28274. button.style.height = "24px";
  28275. button.style.color = "#444444";
  28276. button.style.border = "1px solid white";
  28277. button.className = "debugLayerButton";
  28278. button.addEventListener("click", function (evt) {
  28279. task(evt.target, tag);
  28280. });
  28281. root.appendChild(button);
  28282. root.appendChild(document.createElement("br"));
  28283. };
  28284. DebugLayer.prototype._generateRadio = function (root, title, name, initialState, task, tag) {
  28285. if (tag === void 0) { tag = null; }
  28286. var label = document.createElement("label");
  28287. var boundingBoxesRadio = document.createElement("input");
  28288. boundingBoxesRadio.type = "radio";
  28289. boundingBoxesRadio.name = name;
  28290. boundingBoxesRadio.checked = initialState;
  28291. boundingBoxesRadio.addEventListener("change", function (evt) {
  28292. task(evt.target, tag);
  28293. });
  28294. label.appendChild(boundingBoxesRadio);
  28295. label.appendChild(document.createTextNode(title));
  28296. root.appendChild(label);
  28297. root.appendChild(document.createElement("br"));
  28298. };
  28299. DebugLayer.prototype._generateDOMelements = function () {
  28300. var _this = this;
  28301. this._globalDiv.id = "DebugLayer";
  28302. this._globalDiv.style.position = "absolute";
  28303. this._globalDiv.style.fontFamily = "Segoe UI, Arial";
  28304. this._globalDiv.style.fontSize = "14px";
  28305. this._globalDiv.style.color = "white";
  28306. // Drawing canvas
  28307. this._drawingCanvas = document.createElement("canvas");
  28308. this._drawingCanvas.id = "DebugLayerDrawingCanvas";
  28309. this._drawingCanvas.style.position = "absolute";
  28310. this._drawingCanvas.style.pointerEvents = "none";
  28311. this._drawingContext = this._drawingCanvas.getContext("2d");
  28312. this._globalDiv.appendChild(this._drawingCanvas);
  28313. if (this._showUI) {
  28314. var background = "rgba(128, 128, 128, 0.4)";
  28315. var border = "rgb(180, 180, 180) solid 1px";
  28316. // Stats
  28317. this._statsDiv = document.createElement("div");
  28318. this._statsDiv.id = "DebugLayerStats";
  28319. this._statsDiv.style.border = border;
  28320. this._statsDiv.style.position = "absolute";
  28321. this._statsDiv.style.background = background;
  28322. this._statsDiv.style.padding = "0px 0px 0px 5px";
  28323. this._generateheader(this._statsDiv, "STATISTICS");
  28324. this._statsSubsetDiv = document.createElement("div");
  28325. this._statsSubsetDiv.style.paddingTop = "5px";
  28326. this._statsSubsetDiv.style.paddingBottom = "5px";
  28327. this._statsSubsetDiv.style.overflowY = "auto";
  28328. this._statsDiv.appendChild(this._statsSubsetDiv);
  28329. // Tree
  28330. this._treeDiv = document.createElement("div");
  28331. this._treeDiv.id = "DebugLayerTree";
  28332. this._treeDiv.style.border = border;
  28333. this._treeDiv.style.position = "absolute";
  28334. this._treeDiv.style.background = background;
  28335. this._treeDiv.style.padding = "0px 0px 0px 5px";
  28336. this._treeDiv.style.display = "none";
  28337. this._generateheader(this._treeDiv, "MESHES TREE");
  28338. this._treeSubsetDiv = document.createElement("div");
  28339. this._treeSubsetDiv.style.paddingTop = "5px";
  28340. this._treeSubsetDiv.style.paddingRight = "5px";
  28341. this._treeSubsetDiv.style.overflowY = "auto";
  28342. this._treeSubsetDiv.style.maxHeight = "300px";
  28343. this._treeDiv.appendChild(this._treeSubsetDiv);
  28344. this._needToRefreshMeshesTree = true;
  28345. // Logs
  28346. this._logDiv = document.createElement("div");
  28347. this._logDiv.style.border = border;
  28348. this._logDiv.id = "DebugLayerLogs";
  28349. this._logDiv.style.position = "absolute";
  28350. this._logDiv.style.background = background;
  28351. this._logDiv.style.padding = "0px 0px 0px 5px";
  28352. this._logDiv.style.display = "none";
  28353. this._generateheader(this._logDiv, "LOGS");
  28354. this._logSubsetDiv = document.createElement("div");
  28355. this._logSubsetDiv.style.height = "127px";
  28356. this._logSubsetDiv.style.paddingTop = "5px";
  28357. this._logSubsetDiv.style.overflowY = "auto";
  28358. this._logSubsetDiv.style.fontSize = "12px";
  28359. this._logSubsetDiv.style.fontFamily = "consolas";
  28360. this._logSubsetDiv.innerHTML = BABYLON.Tools.LogCache;
  28361. this._logDiv.appendChild(this._logSubsetDiv);
  28362. BABYLON.Tools.OnNewCacheEntry = function (entry) {
  28363. _this._logSubsetDiv.innerHTML = entry + _this._logSubsetDiv.innerHTML;
  28364. };
  28365. // Options
  28366. this._optionsDiv = document.createElement("div");
  28367. this._optionsDiv.id = "DebugLayerOptions";
  28368. this._optionsDiv.style.border = border;
  28369. this._optionsDiv.style.position = "absolute";
  28370. this._optionsDiv.style.background = background;
  28371. this._optionsDiv.style.padding = "0px 0px 0px 5px";
  28372. this._optionsDiv.style.overflowY = "auto";
  28373. this._generateheader(this._optionsDiv, "OPTIONS");
  28374. this._optionsSubsetDiv = document.createElement("div");
  28375. this._optionsSubsetDiv.style.paddingTop = "5px";
  28376. this._optionsSubsetDiv.style.paddingBottom = "5px";
  28377. this._optionsSubsetDiv.style.overflowY = "auto";
  28378. this._optionsSubsetDiv.style.maxHeight = "200px";
  28379. this._optionsDiv.appendChild(this._optionsSubsetDiv);
  28380. this._generateTexBox(this._optionsSubsetDiv, "<b>Windows:</b>", this.accentColor);
  28381. this._generateCheckBox(this._optionsSubsetDiv, "Statistics", this._displayStatistics, function (element) {
  28382. _this._displayStatistics = element.checked;
  28383. });
  28384. this._generateCheckBox(this._optionsSubsetDiv, "Logs", this._displayLogs, function (element) {
  28385. _this._displayLogs = element.checked;
  28386. });
  28387. this._generateCheckBox(this._optionsSubsetDiv, "Meshes tree", this._displayTree, function (element) {
  28388. _this._displayTree = element.checked;
  28389. _this._needToRefreshMeshesTree = true;
  28390. });
  28391. this._optionsSubsetDiv.appendChild(document.createElement("br"));
  28392. this._generateTexBox(this._optionsSubsetDiv, "<b>General:</b>", this.accentColor);
  28393. this._generateCheckBox(this._optionsSubsetDiv, "Bounding boxes", this._scene.forceShowBoundingBoxes, function (element) {
  28394. _this._scene.forceShowBoundingBoxes = element.checked;
  28395. });
  28396. this._generateCheckBox(this._optionsSubsetDiv, "Clickable labels", this._labelsEnabled, function (element) {
  28397. _this._labelsEnabled = element.checked;
  28398. if (!_this._labelsEnabled) {
  28399. _this._clearLabels();
  28400. }
  28401. });
  28402. this._generateCheckBox(this._optionsSubsetDiv, "Generate user marks (F12)", BABYLON.Tools.PerformanceLogLevel === BABYLON.Tools.PerformanceUserMarkLogLevel, function (element) {
  28403. if (element.checked) {
  28404. BABYLON.Tools.PerformanceLogLevel = BABYLON.Tools.PerformanceUserMarkLogLevel;
  28405. }
  28406. else {
  28407. BABYLON.Tools.PerformanceLogLevel = BABYLON.Tools.PerformanceNoneLogLevel;
  28408. }
  28409. });
  28410. ;
  28411. this._optionsSubsetDiv.appendChild(document.createElement("br"));
  28412. this._generateTexBox(this._optionsSubsetDiv, "<b>Rendering mode:</b>", this.accentColor);
  28413. this._generateRadio(this._optionsSubsetDiv, "Solid", "renderMode", !this._scene.forceWireframe && !this._scene.forcePointsCloud, function (element) {
  28414. if (element.checked) {
  28415. _this._scene.forceWireframe = false;
  28416. _this._scene.forcePointsCloud = false;
  28417. }
  28418. });
  28419. this._generateRadio(this._optionsSubsetDiv, "Wireframe", "renderMode", this._scene.forceWireframe, function (element) {
  28420. if (element.checked) {
  28421. _this._scene.forceWireframe = true;
  28422. _this._scene.forcePointsCloud = false;
  28423. }
  28424. });
  28425. this._generateRadio(this._optionsSubsetDiv, "Point", "renderMode", this._scene.forcePointsCloud, function (element) {
  28426. if (element.checked) {
  28427. _this._scene.forceWireframe = false;
  28428. _this._scene.forcePointsCloud = true;
  28429. }
  28430. });
  28431. this._optionsSubsetDiv.appendChild(document.createElement("br"));
  28432. this._generateTexBox(this._optionsSubsetDiv, "<b>Texture channels:</b>", this.accentColor);
  28433. this._generateCheckBox(this._optionsSubsetDiv, "Diffuse", BABYLON.StandardMaterial.DiffuseTextureEnabled, function (element) {
  28434. BABYLON.StandardMaterial.DiffuseTextureEnabled = element.checked;
  28435. });
  28436. this._generateCheckBox(this._optionsSubsetDiv, "Ambient", BABYLON.StandardMaterial.AmbientTextureEnabled, function (element) {
  28437. BABYLON.StandardMaterial.AmbientTextureEnabled = element.checked;
  28438. });
  28439. this._generateCheckBox(this._optionsSubsetDiv, "Specular", BABYLON.StandardMaterial.SpecularTextureEnabled, function (element) {
  28440. BABYLON.StandardMaterial.SpecularTextureEnabled = element.checked;
  28441. });
  28442. this._generateCheckBox(this._optionsSubsetDiv, "Emissive", BABYLON.StandardMaterial.EmissiveTextureEnabled, function (element) {
  28443. BABYLON.StandardMaterial.EmissiveTextureEnabled = element.checked;
  28444. });
  28445. this._generateCheckBox(this._optionsSubsetDiv, "Bump", BABYLON.StandardMaterial.BumpTextureEnabled, function (element) {
  28446. BABYLON.StandardMaterial.BumpTextureEnabled = element.checked;
  28447. });
  28448. this._generateCheckBox(this._optionsSubsetDiv, "Opacity", BABYLON.StandardMaterial.OpacityTextureEnabled, function (element) {
  28449. BABYLON.StandardMaterial.OpacityTextureEnabled = element.checked;
  28450. });
  28451. this._generateCheckBox(this._optionsSubsetDiv, "Reflection", BABYLON.StandardMaterial.ReflectionTextureEnabled, function (element) {
  28452. BABYLON.StandardMaterial.ReflectionTextureEnabled = element.checked;
  28453. });
  28454. this._generateCheckBox(this._optionsSubsetDiv, "Fresnel", BABYLON.StandardMaterial.FresnelEnabled, function (element) {
  28455. BABYLON.StandardMaterial.FresnelEnabled = element.checked;
  28456. });
  28457. this._optionsSubsetDiv.appendChild(document.createElement("br"));
  28458. this._generateTexBox(this._optionsSubsetDiv, "<b>Options:</b>", this.accentColor);
  28459. this._generateCheckBox(this._optionsSubsetDiv, "Animations", this._scene.animationsEnabled, function (element) {
  28460. _this._scene.animationsEnabled = element.checked;
  28461. });
  28462. this._generateCheckBox(this._optionsSubsetDiv, "Collisions", this._scene.collisionsEnabled, function (element) {
  28463. _this._scene.collisionsEnabled = element.checked;
  28464. });
  28465. this._generateCheckBox(this._optionsSubsetDiv, "Fog", this._scene.fogEnabled, function (element) {
  28466. _this._scene.fogEnabled = element.checked;
  28467. });
  28468. this._generateCheckBox(this._optionsSubsetDiv, "Lens flares", this._scene.lensFlaresEnabled, function (element) {
  28469. _this._scene.lensFlaresEnabled = element.checked;
  28470. });
  28471. this._generateCheckBox(this._optionsSubsetDiv, "Lights", this._scene.lightsEnabled, function (element) {
  28472. _this._scene.lightsEnabled = element.checked;
  28473. });
  28474. this._generateCheckBox(this._optionsSubsetDiv, "Particles", this._scene.particlesEnabled, function (element) {
  28475. _this._scene.particlesEnabled = element.checked;
  28476. });
  28477. this._generateCheckBox(this._optionsSubsetDiv, "Post-processes", this._scene.postProcessesEnabled, function (element) {
  28478. _this._scene.postProcessesEnabled = element.checked;
  28479. });
  28480. this._generateCheckBox(this._optionsSubsetDiv, "Procedural textures", this._scene.proceduralTexturesEnabled, function (element) {
  28481. _this._scene.proceduralTexturesEnabled = element.checked;
  28482. });
  28483. this._generateCheckBox(this._optionsSubsetDiv, "Render targets", this._scene.renderTargetsEnabled, function (element) {
  28484. _this._scene.renderTargetsEnabled = element.checked;
  28485. });
  28486. this._generateCheckBox(this._optionsSubsetDiv, "Shadows", this._scene.shadowsEnabled, function (element) {
  28487. _this._scene.shadowsEnabled = element.checked;
  28488. });
  28489. this._generateCheckBox(this._optionsSubsetDiv, "Skeletons", this._scene.skeletonsEnabled, function (element) {
  28490. _this._scene.skeletonsEnabled = element.checked;
  28491. });
  28492. this._generateCheckBox(this._optionsSubsetDiv, "Sprites", this._scene.spritesEnabled, function (element) {
  28493. _this._scene.spritesEnabled = element.checked;
  28494. });
  28495. this._generateCheckBox(this._optionsSubsetDiv, "Textures", this._scene.texturesEnabled, function (element) {
  28496. _this._scene.texturesEnabled = element.checked;
  28497. });
  28498. if (BABYLON.Engine.audioEngine.canUseWebAudio) {
  28499. this._optionsSubsetDiv.appendChild(document.createElement("br"));
  28500. this._generateTexBox(this._optionsSubsetDiv, "<b>Audio:</b>", this.accentColor);
  28501. this._generateRadio(this._optionsSubsetDiv, "Headphones", "panningModel", this._scene.headphone, function (element) {
  28502. if (element.checked) {
  28503. _this._scene.headphone = true;
  28504. }
  28505. });
  28506. this._generateRadio(this._optionsSubsetDiv, "Normal Speakers", "panningModel", !this._scene.headphone, function (element) {
  28507. if (element.checked) {
  28508. _this._scene.headphone = false;
  28509. }
  28510. });
  28511. this._generateCheckBox(this._optionsSubsetDiv, "Disable audio", !this._scene.audioEnabled, function (element) {
  28512. _this._scene.audioEnabled = !element.checked;
  28513. });
  28514. }
  28515. this._optionsSubsetDiv.appendChild(document.createElement("br"));
  28516. this._generateTexBox(this._optionsSubsetDiv, "<b>Tools:</b>", this.accentColor);
  28517. this._generateButton(this._optionsSubsetDiv, "Dump rendertargets", function (element) {
  28518. _this._scene.dumpNextRenderTargets = true;
  28519. });
  28520. this._optionsSubsetDiv.appendChild(document.createElement("br"));
  28521. this._globalDiv.appendChild(this._statsDiv);
  28522. this._globalDiv.appendChild(this._logDiv);
  28523. this._globalDiv.appendChild(this._optionsDiv);
  28524. this._globalDiv.appendChild(this._treeDiv);
  28525. }
  28526. };
  28527. DebugLayer.prototype._displayStats = function () {
  28528. var scene = this._scene;
  28529. var engine = scene.getEngine();
  28530. var glInfo = engine.getGlInfo();
  28531. this._statsSubsetDiv.innerHTML = "Babylon.js v" + BABYLON.Engine.Version + " - <b>" + BABYLON.Tools.Format(engine.getFps(), 0) + " fps</b><br><br>" + "<div style='column-count: 2;-moz-column-count:2;-webkit-column-count:2'>" + "<b>Count</b><br>" + "Total meshes: " + scene.meshes.length + "<br>" + "Total vertices: " + scene.getTotalVertices() + "<br>" + "Total materials: " + scene.materials.length + "<br>" + "Total textures: " + scene.textures.length + "<br>" + "Active meshes: " + scene.getActiveMeshes().length + "<br>" + "Active indices: " + scene.getActiveIndices() + "<br>" + "Active bones: " + scene.getActiveBones() + "<br>" + "Active particles: " + scene.getActiveParticles() + "<br>" + "<b>Draw calls: " + engine.drawCalls + "</b><br><br>" + "<b>Duration</b><br>" + "Meshes selection:</i> " + BABYLON.Tools.Format(scene.getEvaluateActiveMeshesDuration()) + " ms<br>" + "Render Targets: " + BABYLON.Tools.Format(scene.getRenderTargetsDuration()) + " ms<br>" + "Particles: " + BABYLON.Tools.Format(scene.getParticlesDuration()) + " ms<br>" + "Sprites: " + BABYLON.Tools.Format(scene.getSpritesDuration()) + " ms<br><br>" + "Render: <b>" + BABYLON.Tools.Format(scene.getRenderDuration()) + " ms</b><br>" + "Frame: " + BABYLON.Tools.Format(scene.getLastFrameDuration()) + " ms<br>" + "Potential FPS: " + BABYLON.Tools.Format(1000.0 / scene.getLastFrameDuration(), 0) + "<br><br>" + "</div>" + "<div style='column-count: 2;-moz-column-count:2;-webkit-column-count:2'>" + "<b>Extensions</b><br>" + "Std derivatives: " + (engine.getCaps().standardDerivatives ? "Yes" : "No") + "<br>" + "Compressed textures: " + (engine.getCaps().s3tc ? "Yes" : "No") + "<br>" + "Hardware instances: " + (engine.getCaps().instancedArrays ? "Yes" : "No") + "<br>" + "Texture float: " + (engine.getCaps().textureFloat ? "Yes" : "No") + "<br>" + "32bits indices: " + (engine.getCaps().uintIndices ? "Yes" : "No") + "<br>" + "<b>Caps.</b><br>" + "Max textures units: " + engine.getCaps().maxTexturesImageUnits + "<br>" + "Max textures size: " + engine.getCaps().maxTextureSize + "<br>" + "Max anisotropy: " + engine.getCaps().maxAnisotropy + "<br><br><br>" + "</div><br>" + "<b>Info</b><br>" + glInfo.version + "<br>" + glInfo.renderer + "<br>";
  28532. if (this.customStatsFunction) {
  28533. this._statsSubsetDiv.innerHTML += this._statsSubsetDiv.innerHTML;
  28534. }
  28535. };
  28536. return DebugLayer;
  28537. })();
  28538. BABYLON.DebugLayer = DebugLayer;
  28539. })(BABYLON || (BABYLON = {}));
  28540. //# sourceMappingURL=babylon.debugLayer.js.map
  28541. var BABYLON;
  28542. (function (BABYLON) {
  28543. var RawTexture = (function (_super) {
  28544. __extends(RawTexture, _super);
  28545. function RawTexture(data, width, height, format, scene, generateMipMaps, invertY, samplingMode) {
  28546. if (generateMipMaps === void 0) { generateMipMaps = true; }
  28547. if (invertY === void 0) { invertY = false; }
  28548. if (samplingMode === void 0) { samplingMode = BABYLON.Texture.TRILINEAR_SAMPLINGMODE; }
  28549. _super.call(this, null, scene, !generateMipMaps, invertY);
  28550. this._texture = scene.getEngine().createRawTexture(data, width, height, format, generateMipMaps, invertY, samplingMode);
  28551. this.wrapU = BABYLON.Texture.CLAMP_ADDRESSMODE;
  28552. this.wrapV = BABYLON.Texture.CLAMP_ADDRESSMODE;
  28553. }
  28554. // Statics
  28555. RawTexture.CreateLuminanceTexture = function (data, width, height, scene, generateMipMaps, invertY, samplingMode) {
  28556. if (generateMipMaps === void 0) { generateMipMaps = true; }
  28557. if (invertY === void 0) { invertY = false; }
  28558. if (samplingMode === void 0) { samplingMode = BABYLON.Texture.TRILINEAR_SAMPLINGMODE; }
  28559. return new RawTexture(data, width, height, BABYLON.Engine.TEXTUREFORMAT_LUMINANCE, scene, generateMipMaps, invertY, samplingMode);
  28560. };
  28561. RawTexture.CreateLuminanceAlphaTexture = function (data, width, height, scene, generateMipMaps, invertY, samplingMode) {
  28562. if (generateMipMaps === void 0) { generateMipMaps = true; }
  28563. if (invertY === void 0) { invertY = false; }
  28564. if (samplingMode === void 0) { samplingMode = BABYLON.Texture.TRILINEAR_SAMPLINGMODE; }
  28565. return new RawTexture(data, width, height, BABYLON.Engine.TEXTUREFORMAT_LUMINANCE_ALPHA, scene, generateMipMaps, invertY, samplingMode);
  28566. };
  28567. RawTexture.CreateAlphaTexture = function (data, width, height, scene, generateMipMaps, invertY, samplingMode) {
  28568. if (generateMipMaps === void 0) { generateMipMaps = true; }
  28569. if (invertY === void 0) { invertY = false; }
  28570. if (samplingMode === void 0) { samplingMode = BABYLON.Texture.TRILINEAR_SAMPLINGMODE; }
  28571. return new RawTexture(data, width, height, BABYLON.Engine.TEXTUREFORMAT_ALPHA, scene, generateMipMaps, invertY, samplingMode);
  28572. };
  28573. RawTexture.CreateRGBTexture = function (data, width, height, scene, generateMipMaps, invertY, samplingMode) {
  28574. if (generateMipMaps === void 0) { generateMipMaps = true; }
  28575. if (invertY === void 0) { invertY = false; }
  28576. if (samplingMode === void 0) { samplingMode = BABYLON.Texture.TRILINEAR_SAMPLINGMODE; }
  28577. return new RawTexture(data, width, height, BABYLON.Engine.TEXTUREFORMAT_RGB, scene, generateMipMaps, invertY, samplingMode);
  28578. };
  28579. RawTexture.CreateRGBATexture = function (data, width, height, scene, generateMipMaps, invertY, samplingMode) {
  28580. if (generateMipMaps === void 0) { generateMipMaps = true; }
  28581. if (invertY === void 0) { invertY = false; }
  28582. if (samplingMode === void 0) { samplingMode = BABYLON.Texture.TRILINEAR_SAMPLINGMODE; }
  28583. return new RawTexture(data, width, height, BABYLON.Engine.TEXTUREFORMAT_RGBA, scene, generateMipMaps, invertY, samplingMode);
  28584. };
  28585. return RawTexture;
  28586. })(BABYLON.Texture);
  28587. BABYLON.RawTexture = RawTexture;
  28588. })(BABYLON || (BABYLON = {}));
  28589. //# sourceMappingURL=babylon.rawTexture.js.map
  28590. var BABYLON;
  28591. (function (BABYLON) {
  28592. var IndexedVector2 = (function (_super) {
  28593. __extends(IndexedVector2, _super);
  28594. function IndexedVector2(original, index) {
  28595. _super.call(this, original.x, original.y);
  28596. this.index = index;
  28597. }
  28598. return IndexedVector2;
  28599. })(BABYLON.Vector2);
  28600. var PolygonPoints = (function () {
  28601. function PolygonPoints() {
  28602. this.elements = new Array();
  28603. }
  28604. PolygonPoints.prototype.add = function (originalPoints) {
  28605. var _this = this;
  28606. var result = new Array();
  28607. originalPoints.forEach(function (point) {
  28608. if (result.length === 0 || !(BABYLON.Tools.WithinEpsilon(point.x, result[0].x, 0.00001) && BABYLON.Tools.WithinEpsilon(point.y, result[0].y, 0.00001))) {
  28609. var newPoint = new IndexedVector2(point, _this.elements.length);
  28610. result.push(newPoint);
  28611. _this.elements.push(newPoint);
  28612. }
  28613. });
  28614. return result;
  28615. };
  28616. PolygonPoints.prototype.computeBounds = function () {
  28617. var lmin = new BABYLON.Vector2(this.elements[0].x, this.elements[0].y);
  28618. var lmax = new BABYLON.Vector2(this.elements[0].x, this.elements[0].y);
  28619. this.elements.forEach(function (point) {
  28620. // x
  28621. if (point.x < lmin.x) {
  28622. lmin.x = point.x;
  28623. }
  28624. else if (point.x > lmax.x) {
  28625. lmax.x = point.x;
  28626. }
  28627. // y
  28628. if (point.y < lmin.y) {
  28629. lmin.y = point.y;
  28630. }
  28631. else if (point.y > lmax.y) {
  28632. lmax.y = point.y;
  28633. }
  28634. });
  28635. return {
  28636. min: lmin,
  28637. max: lmax,
  28638. width: lmax.x - lmin.x,
  28639. height: lmax.y - lmin.y
  28640. };
  28641. };
  28642. return PolygonPoints;
  28643. })();
  28644. var Polygon = (function () {
  28645. function Polygon() {
  28646. }
  28647. Polygon.Rectangle = function (xmin, ymin, xmax, ymax) {
  28648. return [
  28649. new BABYLON.Vector2(xmin, ymin),
  28650. new BABYLON.Vector2(xmax, ymin),
  28651. new BABYLON.Vector2(xmax, ymax),
  28652. new BABYLON.Vector2(xmin, ymax)
  28653. ];
  28654. };
  28655. Polygon.Circle = function (radius, cx, cy, numberOfSides) {
  28656. if (cx === void 0) { cx = 0; }
  28657. if (cy === void 0) { cy = 0; }
  28658. if (numberOfSides === void 0) { numberOfSides = 32; }
  28659. var result = new Array();
  28660. var angle = 0;
  28661. var increment = (Math.PI * 2) / numberOfSides;
  28662. for (var i = 0; i < numberOfSides; i++) {
  28663. result.push(new BABYLON.Vector2(cx + Math.cos(angle) * radius, cy + Math.sin(angle) * radius));
  28664. angle -= increment;
  28665. }
  28666. return result;
  28667. };
  28668. Polygon.Parse = function (input) {
  28669. var floats = input.split(/[^-+eE\.\d]+/).map(parseFloat).filter(function (val) { return (!isNaN(val)); });
  28670. var i, result = [];
  28671. for (i = 0; i < (floats.length & 0x7FFFFFFE); i += 2) {
  28672. result.push(new poly2tri.Point(floats[i], floats[i + 1]));
  28673. }
  28674. return result;
  28675. };
  28676. Polygon.StartingAt = function (x, y) {
  28677. return BABYLON.Path2.StartingAt(x, y);
  28678. };
  28679. return Polygon;
  28680. })();
  28681. BABYLON.Polygon = Polygon;
  28682. var PolygonMeshBuilder = (function () {
  28683. function PolygonMeshBuilder(name, contours, scene) {
  28684. this._points = new PolygonPoints();
  28685. if (!("poly2tri" in window)) {
  28686. throw "PolygonMeshBuilder cannot be used because poly2tri is not referenced";
  28687. }
  28688. this._name = name;
  28689. this._scene = scene;
  28690. var points;
  28691. if (contours instanceof BABYLON.Path2) {
  28692. points = contours.getPoints();
  28693. }
  28694. else {
  28695. points = contours;
  28696. }
  28697. this._swctx = new poly2tri.SweepContext(this._points.add(points));
  28698. }
  28699. PolygonMeshBuilder.prototype.addHole = function (hole) {
  28700. this._swctx.addHole(this._points.add(hole));
  28701. return this;
  28702. };
  28703. PolygonMeshBuilder.prototype.build = function (updatable) {
  28704. if (updatable === void 0) { updatable = false; }
  28705. var result = new BABYLON.Mesh(this._name, this._scene);
  28706. var normals = [];
  28707. var positions = [];
  28708. var uvs = [];
  28709. var bounds = this._points.computeBounds();
  28710. this._points.elements.forEach(function (p) {
  28711. normals.push(0, 1.0, 0);
  28712. positions.push(p.x, 0, p.y);
  28713. uvs.push((p.x - bounds.min.x) / bounds.width, (p.y - bounds.min.y) / bounds.height);
  28714. });
  28715. var indices = [];
  28716. this._swctx.triangulate();
  28717. this._swctx.getTriangles().forEach(function (triangle) {
  28718. triangle.getPoints().forEach(function (point) {
  28719. indices.push(point.index);
  28720. });
  28721. });
  28722. result.setVerticesData(positions, BABYLON.VertexBuffer.PositionKind, updatable);
  28723. result.setVerticesData(normals, BABYLON.VertexBuffer.NormalKind, updatable);
  28724. result.setVerticesData(uvs, BABYLON.VertexBuffer.UVKind, updatable);
  28725. result.setIndices(indices);
  28726. return result;
  28727. };
  28728. return PolygonMeshBuilder;
  28729. })();
  28730. BABYLON.PolygonMeshBuilder = PolygonMeshBuilder;
  28731. })(BABYLON || (BABYLON = {}));
  28732. //# sourceMappingURL=babylon.polygonMesh.js.mapvar BABYLON;
  28733. (function (BABYLON) {
  28734. var SimplificationSettings = (function () {
  28735. function SimplificationSettings(quality, distance, optimizeMesh) {
  28736. this.quality = quality;
  28737. this.distance = distance;
  28738. this.optimizeMesh = optimizeMesh;
  28739. }
  28740. return SimplificationSettings;
  28741. })();
  28742. BABYLON.SimplificationSettings = SimplificationSettings;
  28743. var SimplificationQueue = (function () {
  28744. function SimplificationQueue() {
  28745. this.running = false;
  28746. this._simplificationArray = [];
  28747. }
  28748. SimplificationQueue.prototype.addTask = function (task) {
  28749. this._simplificationArray.push(task);
  28750. };
  28751. SimplificationQueue.prototype.executeNext = function () {
  28752. var task = this._simplificationArray.pop();
  28753. if (task) {
  28754. this.running = true;
  28755. this.runSimplification(task);
  28756. }
  28757. else {
  28758. this.running = false;
  28759. }
  28760. };
  28761. SimplificationQueue.prototype.runSimplification = function (task) {
  28762. var _this = this;
  28763. if (task.parallelProcessing) {
  28764. //parallel simplifier
  28765. task.settings.forEach(function (setting) {
  28766. var simplifier = _this.getSimplifier(task);
  28767. simplifier.simplify(setting, function (newMesh) {
  28768. task.mesh.addLODLevel(setting.distance, newMesh);
  28769. newMesh.isVisible = true;
  28770. //check if it is the last
  28771. if (setting.quality === task.settings[task.settings.length - 1].quality && task.successCallback) {
  28772. //all done, run the success callback.
  28773. task.successCallback();
  28774. }
  28775. _this.executeNext();
  28776. });
  28777. });
  28778. }
  28779. else {
  28780. //single simplifier.
  28781. var simplifier = this.getSimplifier(task);
  28782. var runDecimation = function (setting, callback) {
  28783. simplifier.simplify(setting, function (newMesh) {
  28784. task.mesh.addLODLevel(setting.distance, newMesh);
  28785. newMesh.isVisible = true;
  28786. //run the next quality level
  28787. callback();
  28788. });
  28789. };
  28790. BABYLON.AsyncLoop.Run(task.settings.length, function (loop) {
  28791. runDecimation(task.settings[loop.index], function () {
  28792. loop.executeNext();
  28793. });
  28794. }, function () {
  28795. //execution ended, run the success callback.
  28796. if (task.successCallback) {
  28797. task.successCallback();
  28798. }
  28799. _this.executeNext();
  28800. });
  28801. }
  28802. };
  28803. SimplificationQueue.prototype.getSimplifier = function (task) {
  28804. switch (task.simplificationType) {
  28805. case 0 /* QUADRATIC */:
  28806. default:
  28807. return new QuadraticErrorSimplification(task.mesh);
  28808. }
  28809. };
  28810. return SimplificationQueue;
  28811. })();
  28812. BABYLON.SimplificationQueue = SimplificationQueue;
  28813. /**
  28814. * The implemented types of simplification.
  28815. * At the moment only Quadratic Error Decimation is implemented.
  28816. */
  28817. (function (SimplificationType) {
  28818. SimplificationType[SimplificationType["QUADRATIC"] = 0] = "QUADRATIC";
  28819. })(BABYLON.SimplificationType || (BABYLON.SimplificationType = {}));
  28820. var SimplificationType = BABYLON.SimplificationType;
  28821. var DecimationTriangle = (function () {
  28822. function DecimationTriangle(vertices) {
  28823. this.vertices = vertices;
  28824. this.error = new Array(4);
  28825. this.deleted = false;
  28826. this.isDirty = false;
  28827. this.deletePending = false;
  28828. this.borderFactor = 0;
  28829. }
  28830. return DecimationTriangle;
  28831. })();
  28832. BABYLON.DecimationTriangle = DecimationTriangle;
  28833. var DecimationVertex = (function () {
  28834. function DecimationVertex(position, id) {
  28835. this.position = position;
  28836. this.id = id;
  28837. this.isBorder = true;
  28838. this.q = new QuadraticMatrix();
  28839. this.triangleCount = 0;
  28840. this.triangleStart = 0;
  28841. this.originalOffsets = [];
  28842. }
  28843. DecimationVertex.prototype.updatePosition = function (newPosition) {
  28844. this.position.copyFrom(newPosition);
  28845. };
  28846. return DecimationVertex;
  28847. })();
  28848. BABYLON.DecimationVertex = DecimationVertex;
  28849. var QuadraticMatrix = (function () {
  28850. function QuadraticMatrix(data) {
  28851. this.data = new Array(10);
  28852. for (var i = 0; i < 10; ++i) {
  28853. if (data && data[i]) {
  28854. this.data[i] = data[i];
  28855. }
  28856. else {
  28857. this.data[i] = 0;
  28858. }
  28859. }
  28860. }
  28861. QuadraticMatrix.prototype.det = function (a11, a12, a13, a21, a22, a23, a31, a32, a33) {
  28862. var det = this.data[a11] * this.data[a22] * this.data[a33] + this.data[a13] * this.data[a21] * this.data[a32] + this.data[a12] * this.data[a23] * this.data[a31] - this.data[a13] * this.data[a22] * this.data[a31] - this.data[a11] * this.data[a23] * this.data[a32] - this.data[a12] * this.data[a21] * this.data[a33];
  28863. return det;
  28864. };
  28865. QuadraticMatrix.prototype.addInPlace = function (matrix) {
  28866. for (var i = 0; i < 10; ++i) {
  28867. this.data[i] += matrix.data[i];
  28868. }
  28869. };
  28870. QuadraticMatrix.prototype.addArrayInPlace = function (data) {
  28871. for (var i = 0; i < 10; ++i) {
  28872. this.data[i] += data[i];
  28873. }
  28874. };
  28875. QuadraticMatrix.prototype.add = function (matrix) {
  28876. var m = new QuadraticMatrix();
  28877. for (var i = 0; i < 10; ++i) {
  28878. m.data[i] = this.data[i] + matrix.data[i];
  28879. }
  28880. return m;
  28881. };
  28882. QuadraticMatrix.FromData = function (a, b, c, d) {
  28883. return new QuadraticMatrix(QuadraticMatrix.DataFromNumbers(a, b, c, d));
  28884. };
  28885. //returning an array to avoid garbage collection
  28886. QuadraticMatrix.DataFromNumbers = function (a, b, c, d) {
  28887. return [a * a, a * b, a * c, a * d, b * b, b * c, b * d, c * c, c * d, d * d];
  28888. };
  28889. return QuadraticMatrix;
  28890. })();
  28891. BABYLON.QuadraticMatrix = QuadraticMatrix;
  28892. var Reference = (function () {
  28893. function Reference(vertexId, triangleId) {
  28894. this.vertexId = vertexId;
  28895. this.triangleId = triangleId;
  28896. }
  28897. return Reference;
  28898. })();
  28899. BABYLON.Reference = Reference;
  28900. /**
  28901. * An implementation of the Quadratic Error simplification algorithm.
  28902. * Original paper : http://www1.cs.columbia.edu/~cs4162/html05s/garland97.pdf
  28903. * Ported mostly from QSlim and http://voxels.blogspot.de/2014/05/quadric-mesh-simplification-with-source.html to babylon JS
  28904. * @author RaananW
  28905. */
  28906. var QuadraticErrorSimplification = (function () {
  28907. function QuadraticErrorSimplification(_mesh) {
  28908. this._mesh = _mesh;
  28909. this.initialized = false;
  28910. this.syncIterations = 5000;
  28911. this.aggressiveness = 7;
  28912. this.decimationIterations = 100;
  28913. this.boundingBoxEpsilon = BABYLON.Engine.Epsilon;
  28914. }
  28915. QuadraticErrorSimplification.prototype.simplify = function (settings, successCallback) {
  28916. var _this = this;
  28917. this.initDecimatedMesh();
  28918. //iterating through the submeshes array, one after the other.
  28919. BABYLON.AsyncLoop.Run(this._mesh.subMeshes.length, function (loop) {
  28920. _this.initWithMesh(loop.index, function () {
  28921. _this.runDecimation(settings, loop.index, function () {
  28922. loop.executeNext();
  28923. });
  28924. }, settings.optimizeMesh);
  28925. }, function () {
  28926. setTimeout(function () {
  28927. successCallback(_this._reconstructedMesh);
  28928. }, 0);
  28929. });
  28930. };
  28931. QuadraticErrorSimplification.prototype.isTriangleOnBoundingBox = function (triangle) {
  28932. var _this = this;
  28933. var gCount = 0;
  28934. triangle.vertices.forEach(function (vertex) {
  28935. var count = 0;
  28936. var vPos = vertex.position;
  28937. var bbox = _this._mesh.getBoundingInfo().boundingBox;
  28938. if (bbox.maximum.x - vPos.x < _this.boundingBoxEpsilon || vPos.x - bbox.minimum.x > _this.boundingBoxEpsilon)
  28939. ++count;
  28940. if (bbox.maximum.y == vPos.y || vPos.y == bbox.minimum.y)
  28941. ++count;
  28942. if (bbox.maximum.z == vPos.z || vPos.z == bbox.minimum.z)
  28943. ++count;
  28944. if (count > 1) {
  28945. ++gCount;
  28946. }
  28947. ;
  28948. });
  28949. if (gCount > 1) {
  28950. console.log(triangle, gCount);
  28951. }
  28952. return gCount > 1;
  28953. };
  28954. QuadraticErrorSimplification.prototype.runDecimation = function (settings, submeshIndex, successCallback) {
  28955. var _this = this;
  28956. var targetCount = ~~(this.triangles.length * settings.quality);
  28957. var deletedTriangles = 0;
  28958. var triangleCount = this.triangles.length;
  28959. var iterationFunction = function (iteration, callback) {
  28960. setTimeout(function () {
  28961. if (iteration % 5 === 0) {
  28962. _this.updateMesh(iteration === 0);
  28963. }
  28964. for (var i = 0; i < _this.triangles.length; ++i) {
  28965. _this.triangles[i].isDirty = false;
  28966. }
  28967. var threshold = 0.000000001 * Math.pow((iteration + 3), _this.aggressiveness);
  28968. var trianglesIterator = function (i) {
  28969. var tIdx = ~~(((_this.triangles.length / 2) + i) % _this.triangles.length);
  28970. var t = _this.triangles[tIdx];
  28971. if (!t)
  28972. return;
  28973. if (t.error[3] > threshold || t.deleted || t.isDirty) {
  28974. return;
  28975. }
  28976. for (var j = 0; j < 3; ++j) {
  28977. if (t.error[j] < threshold) {
  28978. var deleted0 = [];
  28979. var deleted1 = [];
  28980. var v0 = t.vertices[j];
  28981. var v1 = t.vertices[(j + 1) % 3];
  28982. if (v0.isBorder !== v1.isBorder)
  28983. continue;
  28984. var p = BABYLON.Vector3.Zero();
  28985. var n = BABYLON.Vector3.Zero();
  28986. var uv = BABYLON.Vector2.Zero();
  28987. var color = new BABYLON.Color4(0, 0, 0, 1);
  28988. _this.calculateError(v0, v1, p, n, uv, color);
  28989. var delTr = [];
  28990. if (_this.isFlipped(v0, v1, p, deleted0, t.borderFactor, delTr))
  28991. continue;
  28992. if (_this.isFlipped(v1, v0, p, deleted1, t.borderFactor, delTr))
  28993. continue;
  28994. if (deleted0.indexOf(true) < 0 || deleted1.indexOf(true) < 0)
  28995. continue;
  28996. var uniqueArray = [];
  28997. delTr.forEach(function (deletedT) {
  28998. if (uniqueArray.indexOf(deletedT) === -1) {
  28999. deletedT.deletePending = true;
  29000. uniqueArray.push(deletedT);
  29001. }
  29002. });
  29003. if (uniqueArray.length % 2 != 0) {
  29004. continue;
  29005. }
  29006. v0.q = v1.q.add(v0.q);
  29007. v0.updatePosition(p);
  29008. var tStart = _this.references.length;
  29009. deletedTriangles = _this.updateTriangles(v0, v0, deleted0, deletedTriangles);
  29010. deletedTriangles = _this.updateTriangles(v0, v1, deleted1, deletedTriangles);
  29011. var tCount = _this.references.length - tStart;
  29012. if (tCount <= v0.triangleCount) {
  29013. if (tCount) {
  29014. for (var c = 0; c < tCount; c++) {
  29015. _this.references[v0.triangleStart + c] = _this.references[tStart + c];
  29016. }
  29017. }
  29018. }
  29019. else {
  29020. v0.triangleStart = tStart;
  29021. }
  29022. v0.triangleCount = tCount;
  29023. break;
  29024. }
  29025. }
  29026. };
  29027. BABYLON.AsyncLoop.SyncAsyncForLoop(_this.triangles.length, _this.syncIterations, trianglesIterator, callback, function () {
  29028. return (triangleCount - deletedTriangles <= targetCount);
  29029. });
  29030. }, 0);
  29031. };
  29032. BABYLON.AsyncLoop.Run(this.decimationIterations, function (loop) {
  29033. if (triangleCount - deletedTriangles <= targetCount)
  29034. loop.breakLoop();
  29035. else {
  29036. iterationFunction(loop.index, function () {
  29037. loop.executeNext();
  29038. });
  29039. }
  29040. }, function () {
  29041. setTimeout(function () {
  29042. //reconstruct this part of the mesh
  29043. _this.reconstructMesh(submeshIndex);
  29044. successCallback();
  29045. }, 0);
  29046. });
  29047. };
  29048. QuadraticErrorSimplification.prototype.initWithMesh = function (submeshIndex, callback, optimizeMesh) {
  29049. var _this = this;
  29050. this.vertices = [];
  29051. this.triangles = [];
  29052. var positionData = this._mesh.getVerticesData(BABYLON.VertexBuffer.PositionKind);
  29053. var indices = this._mesh.getIndices();
  29054. var submesh = this._mesh.subMeshes[submeshIndex];
  29055. var findInVertices = function (positionToSearch) {
  29056. if (optimizeMesh) {
  29057. for (var ii = 0; ii < _this.vertices.length; ++ii) {
  29058. if (_this.vertices[ii].position.equals(positionToSearch)) {
  29059. return _this.vertices[ii];
  29060. }
  29061. }
  29062. }
  29063. return null;
  29064. };
  29065. var vertexReferences = [];
  29066. var vertexInit = function (i) {
  29067. var offset = i + submesh.verticesStart;
  29068. var position = BABYLON.Vector3.FromArray(positionData, offset * 3);
  29069. var vertex = findInVertices(position) || new DecimationVertex(position, _this.vertices.length);
  29070. vertex.originalOffsets.push(offset);
  29071. if (vertex.id == _this.vertices.length) {
  29072. _this.vertices.push(vertex);
  29073. }
  29074. vertexReferences.push(vertex.id);
  29075. };
  29076. //var totalVertices = mesh.getTotalVertices();
  29077. var totalVertices = submesh.verticesCount;
  29078. BABYLON.AsyncLoop.SyncAsyncForLoop(totalVertices, (this.syncIterations / 4) >> 0, vertexInit, function () {
  29079. var indicesInit = function (i) {
  29080. var offset = (submesh.indexStart / 3) + i;
  29081. var pos = (offset * 3);
  29082. var i0 = indices[pos + 0];
  29083. var i1 = indices[pos + 1];
  29084. var i2 = indices[pos + 2];
  29085. var v0 = _this.vertices[vertexReferences[i0 - submesh.verticesStart]];
  29086. var v1 = _this.vertices[vertexReferences[i1 - submesh.verticesStart]];
  29087. var v2 = _this.vertices[vertexReferences[i2 - submesh.verticesStart]];
  29088. var triangle = new DecimationTriangle([v0, v1, v2]);
  29089. triangle.originalOffset = pos;
  29090. _this.triangles.push(triangle);
  29091. };
  29092. BABYLON.AsyncLoop.SyncAsyncForLoop(submesh.indexCount / 3, _this.syncIterations, indicesInit, function () {
  29093. _this.init(callback);
  29094. });
  29095. });
  29096. };
  29097. QuadraticErrorSimplification.prototype.init = function (callback) {
  29098. var _this = this;
  29099. var triangleInit1 = function (i) {
  29100. var t = _this.triangles[i];
  29101. t.normal = BABYLON.Vector3.Cross(t.vertices[1].position.subtract(t.vertices[0].position), t.vertices[2].position.subtract(t.vertices[0].position)).normalize();
  29102. for (var j = 0; j < 3; j++) {
  29103. t.vertices[j].q.addArrayInPlace(QuadraticMatrix.DataFromNumbers(t.normal.x, t.normal.y, t.normal.z, -(BABYLON.Vector3.Dot(t.normal, t.vertices[0].position))));
  29104. }
  29105. };
  29106. BABYLON.AsyncLoop.SyncAsyncForLoop(this.triangles.length, this.syncIterations, triangleInit1, function () {
  29107. var triangleInit2 = function (i) {
  29108. var t = _this.triangles[i];
  29109. for (var j = 0; j < 3; ++j) {
  29110. t.error[j] = _this.calculateError(t.vertices[j], t.vertices[(j + 1) % 3]);
  29111. }
  29112. t.error[3] = Math.min(t.error[0], t.error[1], t.error[2]);
  29113. };
  29114. BABYLON.AsyncLoop.SyncAsyncForLoop(_this.triangles.length, _this.syncIterations, triangleInit2, function () {
  29115. _this.initialized = true;
  29116. callback();
  29117. });
  29118. });
  29119. };
  29120. QuadraticErrorSimplification.prototype.reconstructMesh = function (submeshIndex) {
  29121. var newTriangles = [];
  29122. var i;
  29123. for (i = 0; i < this.vertices.length; ++i) {
  29124. this.vertices[i].triangleCount = 0;
  29125. }
  29126. var t;
  29127. var j;
  29128. for (i = 0; i < this.triangles.length; ++i) {
  29129. if (!this.triangles[i].deleted) {
  29130. t = this.triangles[i];
  29131. for (j = 0; j < 3; ++j) {
  29132. t.vertices[j].triangleCount = 1;
  29133. }
  29134. newTriangles.push(t);
  29135. }
  29136. }
  29137. var newPositionData = this._reconstructedMesh.getVerticesData(BABYLON.VertexBuffer.PositionKind) || [];
  29138. var newNormalData = this._reconstructedMesh.getVerticesData(BABYLON.VertexBuffer.NormalKind) || [];
  29139. var newUVsData = this._reconstructedMesh.getVerticesData(BABYLON.VertexBuffer.UVKind) || [];
  29140. var newColorsData = this._reconstructedMesh.getVerticesData(BABYLON.VertexBuffer.ColorKind) || [];
  29141. var normalData = this._mesh.getVerticesData(BABYLON.VertexBuffer.NormalKind);
  29142. var uvs = this._mesh.getVerticesData(BABYLON.VertexBuffer.UVKind);
  29143. var colorsData = this._mesh.getVerticesData(BABYLON.VertexBuffer.ColorKind);
  29144. var vertexCount = 0;
  29145. for (i = 0; i < this.vertices.length; ++i) {
  29146. var vertex = this.vertices[i];
  29147. vertex.id = vertexCount;
  29148. if (vertex.triangleCount) {
  29149. vertex.originalOffsets.forEach(function (originalOffset) {
  29150. newPositionData.push(vertex.position.x);
  29151. newPositionData.push(vertex.position.y);
  29152. newPositionData.push(vertex.position.z);
  29153. newNormalData.push(normalData[originalOffset * 3]);
  29154. newNormalData.push(normalData[(originalOffset * 3) + 1]);
  29155. newNormalData.push(normalData[(originalOffset * 3) + 2]);
  29156. if (uvs && uvs.length) {
  29157. newUVsData.push(uvs[(originalOffset * 2)]);
  29158. newUVsData.push(uvs[(originalOffset * 2) + 1]);
  29159. }
  29160. else if (colorsData && colorsData.length) {
  29161. newColorsData.push(colorsData[(originalOffset * 4)]);
  29162. newColorsData.push(colorsData[(originalOffset * 4) + 1]);
  29163. newColorsData.push(colorsData[(originalOffset * 4) + 2]);
  29164. newColorsData.push(colorsData[(originalOffset * 4) + 3]);
  29165. }
  29166. ++vertexCount;
  29167. });
  29168. }
  29169. }
  29170. var startingIndex = this._reconstructedMesh.getTotalIndices();
  29171. var startingVertex = this._reconstructedMesh.getTotalVertices();
  29172. var submeshesArray = this._reconstructedMesh.subMeshes;
  29173. this._reconstructedMesh.subMeshes = [];
  29174. var newIndicesArray = this._reconstructedMesh.getIndices(); //[];
  29175. var originalIndices = this._mesh.getIndices();
  29176. for (i = 0; i < newTriangles.length; ++i) {
  29177. var t = newTriangles[i];
  29178. //now get the new referencing point for each vertex
  29179. [0, 1, 2].forEach(function (idx) {
  29180. var id = originalIndices[t.originalOffset + idx];
  29181. var offset = t.vertices[idx].originalOffsets.indexOf(id);
  29182. if (offset < 0)
  29183. offset = 0;
  29184. newIndicesArray.push(t.vertices[idx].id + offset + startingVertex);
  29185. });
  29186. }
  29187. //overwriting the old vertex buffers and indices.
  29188. this._reconstructedMesh.setIndices(newIndicesArray);
  29189. this._reconstructedMesh.setVerticesData(BABYLON.VertexBuffer.PositionKind, newPositionData);
  29190. this._reconstructedMesh.setVerticesData(BABYLON.VertexBuffer.NormalKind, newNormalData);
  29191. if (newUVsData.length > 0)
  29192. this._reconstructedMesh.setVerticesData(BABYLON.VertexBuffer.UVKind, newUVsData);
  29193. if (newColorsData.length > 0)
  29194. this._reconstructedMesh.setVerticesData(BABYLON.VertexBuffer.ColorKind, newColorsData);
  29195. //create submesh
  29196. var originalSubmesh = this._mesh.subMeshes[submeshIndex];
  29197. if (submeshIndex > 0) {
  29198. this._reconstructedMesh.subMeshes = [];
  29199. submeshesArray.forEach(function (submesh) {
  29200. new BABYLON.SubMesh(submesh.materialIndex, submesh.verticesStart, submesh.verticesCount, submesh.indexStart, submesh.indexCount, submesh.getMesh());
  29201. });
  29202. var newSubmesh = new BABYLON.SubMesh(originalSubmesh.materialIndex, startingVertex, vertexCount, startingIndex, newTriangles.length * 3, this._reconstructedMesh);
  29203. }
  29204. };
  29205. QuadraticErrorSimplification.prototype.initDecimatedMesh = function () {
  29206. this._reconstructedMesh = new BABYLON.Mesh(this._mesh.name + "Decimated", this._mesh.getScene());
  29207. this._reconstructedMesh.material = this._mesh.material;
  29208. this._reconstructedMesh.parent = this._mesh.parent;
  29209. this._reconstructedMesh.isVisible = false;
  29210. };
  29211. QuadraticErrorSimplification.prototype.isFlipped = function (vertex1, vertex2, point, deletedArray, borderFactor, delTr) {
  29212. for (var i = 0; i < vertex1.triangleCount; ++i) {
  29213. var t = this.triangles[this.references[vertex1.triangleStart + i].triangleId];
  29214. if (t.deleted)
  29215. continue;
  29216. var s = this.references[vertex1.triangleStart + i].vertexId;
  29217. var v1 = t.vertices[(s + 1) % 3];
  29218. var v2 = t.vertices[(s + 2) % 3];
  29219. if ((v1 === vertex2 || v2 === vertex2)) {
  29220. deletedArray[i] = true;
  29221. delTr.push(t);
  29222. continue;
  29223. }
  29224. var d1 = v1.position.subtract(point);
  29225. d1 = d1.normalize();
  29226. var d2 = v2.position.subtract(point);
  29227. d2 = d2.normalize();
  29228. if (Math.abs(BABYLON.Vector3.Dot(d1, d2)) > 0.999)
  29229. return true;
  29230. var normal = BABYLON.Vector3.Cross(d1, d2).normalize();
  29231. deletedArray[i] = false;
  29232. if (BABYLON.Vector3.Dot(normal, t.normal) < 0.2)
  29233. return true;
  29234. }
  29235. return false;
  29236. };
  29237. QuadraticErrorSimplification.prototype.updateTriangles = function (origVertex, vertex, deletedArray, deletedTriangles) {
  29238. var newDeleted = deletedTriangles;
  29239. for (var i = 0; i < vertex.triangleCount; ++i) {
  29240. var ref = this.references[vertex.triangleStart + i];
  29241. var t = this.triangles[ref.triangleId];
  29242. if (t.deleted)
  29243. continue;
  29244. if (deletedArray[i] && t.deletePending) {
  29245. t.deleted = true;
  29246. newDeleted++;
  29247. continue;
  29248. }
  29249. t.vertices[ref.vertexId] = origVertex;
  29250. t.isDirty = true;
  29251. t.error[0] = this.calculateError(t.vertices[0], t.vertices[1]) + (t.borderFactor / 2);
  29252. t.error[1] = this.calculateError(t.vertices[1], t.vertices[2]) + (t.borderFactor / 2);
  29253. t.error[2] = this.calculateError(t.vertices[2], t.vertices[0]) + (t.borderFactor / 2);
  29254. t.error[3] = Math.min(t.error[0], t.error[1], t.error[2]);
  29255. this.references.push(ref);
  29256. }
  29257. return newDeleted;
  29258. };
  29259. QuadraticErrorSimplification.prototype.identifyBorder = function () {
  29260. for (var i = 0; i < this.vertices.length; ++i) {
  29261. var vCount = [];
  29262. var vId = [];
  29263. var v = this.vertices[i];
  29264. var j;
  29265. for (j = 0; j < v.triangleCount; ++j) {
  29266. var triangle = this.triangles[this.references[v.triangleStart + j].triangleId];
  29267. for (var ii = 0; ii < 3; ii++) {
  29268. var ofs = 0;
  29269. var vv = triangle.vertices[ii];
  29270. while (ofs < vCount.length) {
  29271. if (vId[ofs] === vv.id)
  29272. break;
  29273. ++ofs;
  29274. }
  29275. if (ofs === vCount.length) {
  29276. vCount.push(1);
  29277. vId.push(vv.id);
  29278. }
  29279. else {
  29280. vCount[ofs]++;
  29281. }
  29282. }
  29283. }
  29284. for (j = 0; j < vCount.length; ++j) {
  29285. if (vCount[j] === 1) {
  29286. this.vertices[vId[j]].isBorder = true;
  29287. }
  29288. else {
  29289. this.vertices[vId[j]].isBorder = false;
  29290. }
  29291. }
  29292. }
  29293. };
  29294. QuadraticErrorSimplification.prototype.updateMesh = function (identifyBorders) {
  29295. if (identifyBorders === void 0) { identifyBorders = false; }
  29296. var i;
  29297. if (!identifyBorders) {
  29298. var newTrianglesVector = [];
  29299. for (i = 0; i < this.triangles.length; ++i) {
  29300. if (!this.triangles[i].deleted) {
  29301. newTrianglesVector.push(this.triangles[i]);
  29302. }
  29303. }
  29304. this.triangles = newTrianglesVector;
  29305. }
  29306. for (i = 0; i < this.vertices.length; ++i) {
  29307. this.vertices[i].triangleCount = 0;
  29308. this.vertices[i].triangleStart = 0;
  29309. }
  29310. var t;
  29311. var j;
  29312. var v;
  29313. for (i = 0; i < this.triangles.length; ++i) {
  29314. t = this.triangles[i];
  29315. for (j = 0; j < 3; ++j) {
  29316. v = t.vertices[j];
  29317. v.triangleCount++;
  29318. }
  29319. }
  29320. var tStart = 0;
  29321. for (i = 0; i < this.vertices.length; ++i) {
  29322. this.vertices[i].triangleStart = tStart;
  29323. tStart += this.vertices[i].triangleCount;
  29324. this.vertices[i].triangleCount = 0;
  29325. }
  29326. var newReferences = new Array(this.triangles.length * 3);
  29327. for (i = 0; i < this.triangles.length; ++i) {
  29328. t = this.triangles[i];
  29329. for (j = 0; j < 3; ++j) {
  29330. v = t.vertices[j];
  29331. newReferences[v.triangleStart + v.triangleCount] = new Reference(j, i);
  29332. v.triangleCount++;
  29333. }
  29334. }
  29335. this.references = newReferences;
  29336. if (identifyBorders) {
  29337. this.identifyBorder();
  29338. }
  29339. };
  29340. QuadraticErrorSimplification.prototype.vertexError = function (q, point) {
  29341. var x = point.x;
  29342. var y = point.y;
  29343. var z = point.z;
  29344. return q.data[0] * x * x + 2 * q.data[1] * x * y + 2 * q.data[2] * x * z + 2 * q.data[3] * x + q.data[4] * y * y + 2 * q.data[5] * y * z + 2 * q.data[6] * y + q.data[7] * z * z + 2 * q.data[8] * z + q.data[9];
  29345. };
  29346. QuadraticErrorSimplification.prototype.calculateError = function (vertex1, vertex2, pointResult, normalResult, uvResult, colorResult) {
  29347. var q = vertex1.q.add(vertex2.q);
  29348. var border = vertex1.isBorder && vertex2.isBorder;
  29349. var error = 0;
  29350. var qDet = q.det(0, 1, 2, 1, 4, 5, 2, 5, 7);
  29351. if (qDet !== 0 && !border) {
  29352. if (!pointResult) {
  29353. pointResult = BABYLON.Vector3.Zero();
  29354. }
  29355. pointResult.x = -1 / qDet * (q.det(1, 2, 3, 4, 5, 6, 5, 7, 8));
  29356. pointResult.y = 1 / qDet * (q.det(0, 2, 3, 1, 5, 6, 2, 7, 8));
  29357. pointResult.z = -1 / qDet * (q.det(0, 1, 3, 1, 4, 6, 2, 5, 8));
  29358. error = this.vertexError(q, pointResult);
  29359. }
  29360. else {
  29361. var p3 = (vertex1.position.add(vertex2.position)).divide(new BABYLON.Vector3(2, 2, 2));
  29362. //var norm3 = (vertex1.normal.add(vertex2.normal)).divide(new Vector3(2, 2, 2)).normalize();
  29363. var error1 = this.vertexError(q, vertex1.position);
  29364. var error2 = this.vertexError(q, vertex2.position);
  29365. var error3 = this.vertexError(q, p3);
  29366. error = Math.min(error1, error2, error3);
  29367. if (error === error1) {
  29368. if (pointResult) {
  29369. pointResult.copyFrom(vertex1.position);
  29370. }
  29371. }
  29372. else if (error === error2) {
  29373. if (pointResult) {
  29374. pointResult.copyFrom(vertex2.position);
  29375. }
  29376. }
  29377. else {
  29378. if (pointResult) {
  29379. pointResult.copyFrom(p3);
  29380. }
  29381. }
  29382. }
  29383. return error;
  29384. };
  29385. return QuadraticErrorSimplification;
  29386. })();
  29387. BABYLON.QuadraticErrorSimplification = QuadraticErrorSimplification;
  29388. })(BABYLON || (BABYLON = {}));
  29389. //# sourceMappingURL=babylon.meshSimplification.js.mapvar BABYLON;
  29390. (function (BABYLON) {
  29391. var Analyser = (function () {
  29392. function Analyser(scene) {
  29393. this.SMOOTHING = 0.75;
  29394. this.FFT_SIZE = 512;
  29395. this.BARGRAPHAMPLITUDE = 256;
  29396. this.DEBUGCANVASPOS = { x: 20, y: 20 };
  29397. this.DEBUGCANVASSIZE = { width: 320, height: 200 };
  29398. this._scene = scene;
  29399. this._audioEngine = BABYLON.Engine.audioEngine;
  29400. if (this._audioEngine.canUseWebAudio) {
  29401. this._webAudioAnalyser = this._audioEngine.audioContext.createAnalyser();
  29402. this._webAudioAnalyser.minDecibels = -140;
  29403. this._webAudioAnalyser.maxDecibels = 0;
  29404. this._byteFreqs = new Uint8Array(this._webAudioAnalyser.frequencyBinCount);
  29405. this._byteTime = new Uint8Array(this._webAudioAnalyser.frequencyBinCount);
  29406. this._floatFreqs = new Float32Array(this._webAudioAnalyser.frequencyBinCount);
  29407. }
  29408. }
  29409. Analyser.prototype.getFrequencyBinCount = function () {
  29410. if (this._audioEngine.canUseWebAudio) {
  29411. return this._webAudioAnalyser.frequencyBinCount;
  29412. }
  29413. else {
  29414. return 0;
  29415. }
  29416. };
  29417. Analyser.prototype.getByteFrequencyData = function () {
  29418. if (this._audioEngine.canUseWebAudio) {
  29419. this._webAudioAnalyser.smoothingTimeConstant = this.SMOOTHING;
  29420. this._webAudioAnalyser.fftSize = this.FFT_SIZE;
  29421. this._webAudioAnalyser.getByteFrequencyData(this._byteFreqs);
  29422. }
  29423. return this._byteFreqs;
  29424. };
  29425. Analyser.prototype.getByteTimeDomainData = function () {
  29426. if (this._audioEngine.canUseWebAudio) {
  29427. this._webAudioAnalyser.smoothingTimeConstant = this.SMOOTHING;
  29428. this._webAudioAnalyser.fftSize = this.FFT_SIZE;
  29429. this._webAudioAnalyser.getByteTimeDomainData(this._byteTime);
  29430. }
  29431. return this._byteTime;
  29432. };
  29433. Analyser.prototype.getFloatFrequencyData = function () {
  29434. if (this._audioEngine.canUseWebAudio) {
  29435. this._webAudioAnalyser.smoothingTimeConstant = this.SMOOTHING;
  29436. this._webAudioAnalyser.fftSize = this.FFT_SIZE;
  29437. this._webAudioAnalyser.getFloatFrequencyData(this._floatFreqs);
  29438. }
  29439. return this._floatFreqs;
  29440. };
  29441. Analyser.prototype.drawDebugCanvas = function () {
  29442. var _this = this;
  29443. if (this._audioEngine.canUseWebAudio) {
  29444. if (!this._debugCanvas) {
  29445. this._debugCanvas = document.createElement("canvas");
  29446. this._debugCanvas.width = this.DEBUGCANVASSIZE.width;
  29447. this._debugCanvas.height = this.DEBUGCANVASSIZE.height;
  29448. this._debugCanvas.style.position = "absolute";
  29449. this._debugCanvas.style.top = this.DEBUGCANVASPOS.y + "px";
  29450. this._debugCanvas.style.left = this.DEBUGCANVASPOS.x + "px";
  29451. this._debugCanvasContext = this._debugCanvas.getContext("2d");
  29452. document.body.appendChild(this._debugCanvas);
  29453. this._registerFunc = function () {
  29454. _this.drawDebugCanvas();
  29455. };
  29456. this._scene.registerBeforeRender(this._registerFunc);
  29457. }
  29458. if (this._registerFunc) {
  29459. var workingArray = this.getByteFrequencyData();
  29460. this._debugCanvasContext.fillStyle = 'rgb(0, 0, 0)';
  29461. this._debugCanvasContext.fillRect(0, 0, this.DEBUGCANVASSIZE.width, this.DEBUGCANVASSIZE.height);
  29462. for (var i = 0; i < this.getFrequencyBinCount(); i++) {
  29463. var value = workingArray[i];
  29464. var percent = value / this.BARGRAPHAMPLITUDE;
  29465. var height = this.DEBUGCANVASSIZE.height * percent;
  29466. var offset = this.DEBUGCANVASSIZE.height - height - 1;
  29467. var barWidth = this.DEBUGCANVASSIZE.width / this.getFrequencyBinCount();
  29468. var hue = i / this.getFrequencyBinCount() * 360;
  29469. this._debugCanvasContext.fillStyle = 'hsl(' + hue + ', 100%, 50%)';
  29470. this._debugCanvasContext.fillRect(i * barWidth, offset, barWidth, height);
  29471. }
  29472. }
  29473. }
  29474. };
  29475. Analyser.prototype.stopDebugCanvas = function () {
  29476. if (this._debugCanvas) {
  29477. this._scene.unregisterBeforeRender(this._registerFunc);
  29478. this._registerFunc = null;
  29479. document.body.removeChild(this._debugCanvas);
  29480. this._debugCanvas = null;
  29481. this._debugCanvasContext = null;
  29482. }
  29483. };
  29484. Analyser.prototype.connectAudioNodes = function (inputAudioNode, outputAudioNode) {
  29485. if (this._audioEngine.canUseWebAudio) {
  29486. inputAudioNode.connect(this._webAudioAnalyser);
  29487. this._webAudioAnalyser.connect(outputAudioNode);
  29488. }
  29489. };
  29490. Analyser.prototype.dispose = function () {
  29491. if (this._audioEngine.canUseWebAudio) {
  29492. this._webAudioAnalyser.disconnect();
  29493. }
  29494. };
  29495. return Analyser;
  29496. })();
  29497. BABYLON.Analyser = Analyser;
  29498. })(BABYLON || (BABYLON = {}));
  29499. //# sourceMappingURL=babylon.analyser.js.mapvar BABYLON;
  29500. (function (BABYLON) {
  29501. var DepthRenderer = (function () {
  29502. function DepthRenderer(scene, type) {
  29503. var _this = this;
  29504. if (type === void 0) { type = BABYLON.Engine.TEXTURETYPE_FLOAT; }
  29505. this._viewMatrix = BABYLON.Matrix.Zero();
  29506. this._projectionMatrix = BABYLON.Matrix.Zero();
  29507. this._transformMatrix = BABYLON.Matrix.Zero();
  29508. this._worldViewProjection = BABYLON.Matrix.Zero();
  29509. this._scene = scene;
  29510. var engine = scene.getEngine();
  29511. // Render target
  29512. this._depthMap = new BABYLON.RenderTargetTexture("depthMap", { width: engine.getRenderWidth(), height: engine.getRenderHeight() }, this._scene, false, true, type);
  29513. this._depthMap.wrapU = BABYLON.Texture.CLAMP_ADDRESSMODE;
  29514. this._depthMap.wrapV = BABYLON.Texture.CLAMP_ADDRESSMODE;
  29515. this._depthMap.refreshRate = 1;
  29516. this._depthMap.renderParticles = false;
  29517. this._depthMap.renderList = null;
  29518. // Custom render function
  29519. var renderSubMesh = function (subMesh) {
  29520. var mesh = subMesh.getRenderingMesh();
  29521. var scene = _this._scene;
  29522. var engine = scene.getEngine();
  29523. // Culling
  29524. engine.setState(subMesh.getMaterial().backFaceCulling);
  29525. // Managing instances
  29526. var batch = mesh._getInstancesRenderList(subMesh._id);
  29527. if (batch.mustReturn) {
  29528. return;
  29529. }
  29530. var hardwareInstancedRendering = (engine.getCaps().instancedArrays !== null) && (batch.visibleInstances[subMesh._id] !== null);
  29531. if (_this.isReady(subMesh, hardwareInstancedRendering)) {
  29532. engine.enableEffect(_this._effect);
  29533. mesh._bind(subMesh, _this._effect, BABYLON.Material.TriangleFillMode);
  29534. var material = subMesh.getMaterial();
  29535. _this._effect.setMatrix("viewProjection", scene.getTransformMatrix());
  29536. _this._effect.setFloat("far", scene.activeCamera.maxZ);
  29537. // Alpha test
  29538. if (material && material.needAlphaTesting()) {
  29539. var alphaTexture = material.getAlphaTestTexture();
  29540. _this._effect.setTexture("diffuseSampler", alphaTexture);
  29541. _this._effect.setMatrix("diffuseMatrix", alphaTexture.getTextureMatrix());
  29542. }
  29543. // Bones
  29544. if (mesh.useBones) {
  29545. _this._effect.setMatrices("mBones", mesh.skeleton.getTransformMatrices());
  29546. }
  29547. // Draw
  29548. mesh._processRendering(subMesh, _this._effect, BABYLON.Material.TriangleFillMode, batch, hardwareInstancedRendering, function (isInstance, world) { return _this._effect.setMatrix("world", world); });
  29549. }
  29550. };
  29551. this._depthMap.customRenderFunction = function (opaqueSubMeshes, alphaTestSubMeshes) {
  29552. var index;
  29553. for (index = 0; index < opaqueSubMeshes.length; index++) {
  29554. renderSubMesh(opaqueSubMeshes.data[index]);
  29555. }
  29556. for (index = 0; index < alphaTestSubMeshes.length; index++) {
  29557. renderSubMesh(alphaTestSubMeshes.data[index]);
  29558. }
  29559. };
  29560. }
  29561. DepthRenderer.prototype.isReady = function (subMesh, useInstances) {
  29562. var defines = [];
  29563. var attribs = [BABYLON.VertexBuffer.PositionKind];
  29564. var mesh = subMesh.getMesh();
  29565. var scene = mesh.getScene();
  29566. var material = subMesh.getMaterial();
  29567. // Alpha test
  29568. if (material && material.needAlphaTesting()) {
  29569. defines.push("#define ALPHATEST");
  29570. if (mesh.isVerticesDataPresent(BABYLON.VertexBuffer.UVKind)) {
  29571. attribs.push(BABYLON.VertexBuffer.UVKind);
  29572. defines.push("#define UV1");
  29573. }
  29574. if (mesh.isVerticesDataPresent(BABYLON.VertexBuffer.UV2Kind)) {
  29575. attribs.push(BABYLON.VertexBuffer.UV2Kind);
  29576. defines.push("#define UV2");
  29577. }
  29578. }
  29579. // Bones
  29580. if (mesh.useBones) {
  29581. attribs.push(BABYLON.VertexBuffer.MatricesIndicesKind);
  29582. attribs.push(BABYLON.VertexBuffer.MatricesWeightsKind);
  29583. defines.push("#define BONES");
  29584. defines.push("#define BonesPerMesh " + (mesh.skeleton.bones.length + 1));
  29585. }
  29586. // Instances
  29587. if (useInstances) {
  29588. defines.push("#define INSTANCES");
  29589. attribs.push("world0");
  29590. attribs.push("world1");
  29591. attribs.push("world2");
  29592. attribs.push("world3");
  29593. }
  29594. // Get correct effect
  29595. var join = defines.join("\n");
  29596. if (this._cachedDefines !== join) {
  29597. this._cachedDefines = join;
  29598. this._effect = this._scene.getEngine().createEffect("depth", attribs, ["world", "mBones", "viewProjection", "diffuseMatrix", "far"], ["diffuseSampler"], join);
  29599. }
  29600. return this._effect.isReady();
  29601. };
  29602. DepthRenderer.prototype.getDepthMap = function () {
  29603. return this._depthMap;
  29604. };
  29605. // Methods
  29606. DepthRenderer.prototype.dispose = function () {
  29607. this._depthMap.dispose();
  29608. };
  29609. return DepthRenderer;
  29610. })();
  29611. BABYLON.DepthRenderer = DepthRenderer;
  29612. })(BABYLON || (BABYLON = {}));
  29613. //# sourceMappingURL=babylon.depthRenderer.js.map
  29614. var BABYLON;
  29615. (function (BABYLON) {
  29616. var SSAORenderingPipeline = (function (_super) {
  29617. __extends(SSAORenderingPipeline, _super);
  29618. /**
  29619. * @constructor
  29620. * @param {string} name - The rendering pipeline name
  29621. * @param {BABYLON.Scene} scene - The scene linked to this pipeline
  29622. * @param {any} ratio - The size of the postprocesses. Can be a number shared between passes or an object for more precision: { ssaoRatio: 0.5, combineRatio: 1.0 }
  29623. * @param {BABYLON.Camera[]} cameras - The array of cameras that the rendering pipeline will be attached to
  29624. */
  29625. function SSAORenderingPipeline(name, scene, ratio, cameras) {
  29626. var _this = this;
  29627. _super.call(this, scene.getEngine(), name);
  29628. // Members
  29629. /**
  29630. * The PassPostProcess id in the pipeline that contains the original scene color
  29631. * @type {string}
  29632. */
  29633. this.SSAOOriginalSceneColorEffect = "SSAOOriginalSceneColorEffect";
  29634. /**
  29635. * The SSAO PostProcess id in the pipeline
  29636. * @type {string}
  29637. */
  29638. this.SSAORenderEffect = "SSAORenderEffect";
  29639. /**
  29640. * The horizontal blur PostProcess id in the pipeline
  29641. * @type {string}
  29642. */
  29643. this.SSAOBlurHRenderEffect = "SSAOBlurHRenderEffect";
  29644. /**
  29645. * The vertical blur PostProcess id in the pipeline
  29646. * @type {string}
  29647. */
  29648. this.SSAOBlurVRenderEffect = "SSAOBlurVRenderEffect";
  29649. /**
  29650. * The PostProcess id in the pipeline that combines the SSAO-Blur output with the original scene color (SSAOOriginalSceneColorEffect)
  29651. * @type {string}
  29652. */
  29653. this.SSAOCombineRenderEffect = "SSAOCombineRenderEffect";
  29654. /**
  29655. * The output strength of the SSAO post-process. Default value is 1.0.
  29656. * @type {number}
  29657. */
  29658. this.totalStrength = 1.0;
  29659. /**
  29660. * The radius around the analyzed pixel used by the SSAO post-process. Default value is 0.0002
  29661. * @type {number}
  29662. */
  29663. this.radius = 0.0002;
  29664. /**
  29665. * Related to fallOff, used to interpolate SSAO samples (first interpolate function input) based on the occlusion difference of each pixel
  29666. * Must not be equal to fallOff and superior to fallOff.
  29667. * Default value is 0.0075
  29668. * @type {number}
  29669. */
  29670. this.area = 0.0075;
  29671. /**
  29672. * Related to area, used to interpolate SSAO samples (second interpolate function input) based on the occlusion difference of each pixel
  29673. * Must not be equal to area and inferior to area.
  29674. * Default value is 0.0002
  29675. * @type {number}
  29676. */
  29677. this.fallOff = 0.0002;
  29678. this._firstUpdate = true;
  29679. this._scene = scene;
  29680. // Set up assets
  29681. this._createRandomTexture();
  29682. this._depthTexture = scene.enableDepthRenderer().getDepthMap(); // Force depth renderer "on"
  29683. var ssaoRatio = ratio.ssaoRatio || ratio;
  29684. var combineRatio = ratio.combineRatio || ratio;
  29685. this._originalColorPostProcess = new BABYLON.PassPostProcess("SSAOOriginalSceneColor", combineRatio, null, BABYLON.Texture.BILINEAR_SAMPLINGMODE, scene.getEngine(), false);
  29686. this._createSSAOPostProcess(ssaoRatio);
  29687. this._blurHPostProcess = new BABYLON.BlurPostProcess("SSAOBlurH", new BABYLON.Vector2(2.0, 0.0), 2.0, ssaoRatio, null, BABYLON.Texture.BILINEAR_SAMPLINGMODE, scene.getEngine(), false);
  29688. this._blurVPostProcess = new BABYLON.BlurPostProcess("SSAOBlurV", new BABYLON.Vector2(0.0, 2.0), 2.0, ssaoRatio, null, BABYLON.Texture.BILINEAR_SAMPLINGMODE, scene.getEngine(), false);
  29689. this._createSSAOCombinePostProcess(combineRatio);
  29690. // Set up pipeline
  29691. this.addEffect(new BABYLON.PostProcessRenderEffect(scene.getEngine(), this.SSAOOriginalSceneColorEffect, function () {
  29692. return _this._originalColorPostProcess;
  29693. }, true));
  29694. this.addEffect(new BABYLON.PostProcessRenderEffect(scene.getEngine(), this.SSAORenderEffect, function () {
  29695. return _this._ssaoPostProcess;
  29696. }, true));
  29697. this.addEffect(new BABYLON.PostProcessRenderEffect(scene.getEngine(), this.SSAOBlurHRenderEffect, function () {
  29698. return _this._blurHPostProcess;
  29699. }, true));
  29700. this.addEffect(new BABYLON.PostProcessRenderEffect(scene.getEngine(), this.SSAOBlurVRenderEffect, function () {
  29701. return _this._blurVPostProcess;
  29702. }, true));
  29703. this.addEffect(new BABYLON.PostProcessRenderEffect(scene.getEngine(), this.SSAOCombineRenderEffect, function () {
  29704. return _this._ssaoCombinePostProcess;
  29705. }, true));
  29706. // Finish
  29707. scene.postProcessRenderPipelineManager.addPipeline(this);
  29708. if (cameras)
  29709. scene.postProcessRenderPipelineManager.attachCamerasToRenderPipeline(name, cameras);
  29710. }
  29711. // Public Methods
  29712. /**
  29713. * Returns the horizontal blur PostProcess
  29714. * @return {BABYLON.BlurPostProcess} The horizontal blur post-process
  29715. */
  29716. SSAORenderingPipeline.prototype.getBlurHPostProcess = function () {
  29717. return this._blurHPostProcess;
  29718. };
  29719. /**
  29720. * Returns the vertical blur PostProcess
  29721. * @return {BABYLON.BlurPostProcess} The vertical blur post-process
  29722. */
  29723. SSAORenderingPipeline.prototype.getBlurVPostProcess = function () {
  29724. return this._blurVPostProcess;
  29725. };
  29726. /**
  29727. * Removes the internal pipeline assets and detatches the pipeline from the scene cameras
  29728. */
  29729. SSAORenderingPipeline.prototype.dispose = function (disableDepthRender) {
  29730. if (disableDepthRender === void 0) { disableDepthRender = false; }
  29731. this._scene.postProcessRenderPipelineManager.detachCamerasFromRenderPipeline(this._name, this._scene.cameras);
  29732. this._originalColorPostProcess = undefined;
  29733. this._ssaoPostProcess = undefined;
  29734. this._blurHPostProcess = undefined;
  29735. this._blurVPostProcess = undefined;
  29736. this._ssaoCombinePostProcess = undefined;
  29737. this._randomTexture.dispose();
  29738. if (disableDepthRender)
  29739. this._scene.disableDepthRenderer();
  29740. };
  29741. // Private Methods
  29742. SSAORenderingPipeline.prototype._createSSAOPostProcess = function (ratio) {
  29743. var _this = this;
  29744. var sampleSphere = [
  29745. 0.5381,
  29746. 0.1856,
  29747. -0.4319,
  29748. 0.1379,
  29749. 0.2486,
  29750. 0.4430,
  29751. 0.3371,
  29752. 0.5679,
  29753. -0.0057,
  29754. -0.6999,
  29755. -0.0451,
  29756. -0.0019,
  29757. 0.0689,
  29758. -0.1598,
  29759. -0.8547,
  29760. 0.0560,
  29761. 0.0069,
  29762. -0.1843,
  29763. -0.0146,
  29764. 0.1402,
  29765. 0.0762,
  29766. 0.0100,
  29767. -0.1924,
  29768. -0.0344,
  29769. -0.3577,
  29770. -0.5301,
  29771. -0.4358,
  29772. -0.3169,
  29773. 0.1063,
  29774. 0.0158,
  29775. 0.0103,
  29776. -0.5869,
  29777. 0.0046,
  29778. -0.0897,
  29779. -0.4940,
  29780. 0.3287,
  29781. 0.7119,
  29782. -0.0154,
  29783. -0.0918,
  29784. -0.0533,
  29785. 0.0596,
  29786. -0.5411,
  29787. 0.0352,
  29788. -0.0631,
  29789. 0.5460,
  29790. -0.4776,
  29791. 0.2847,
  29792. -0.0271
  29793. ];
  29794. var samplesFactor = 1.0 / 16.0;
  29795. this._ssaoPostProcess = new BABYLON.PostProcess("ssao", "ssao", ["sampleSphere", "samplesFactor", "randTextureTiles", "totalStrength", "radius", "area", "fallOff"], ["randomSampler"], ratio, null, BABYLON.Texture.BILINEAR_SAMPLINGMODE, this._scene.getEngine(), false);
  29796. this._ssaoPostProcess.onApply = function (effect) {
  29797. if (_this._firstUpdate) {
  29798. effect.setArray3("sampleSphere", sampleSphere);
  29799. effect.setFloat("samplesFactor", samplesFactor);
  29800. effect.setFloat("randTextureTiles", 4.0 / ratio);
  29801. _this._firstUpdate = false;
  29802. }
  29803. effect.setFloat("totalStrength", _this.totalStrength);
  29804. effect.setFloat("radius", _this.radius);
  29805. effect.setFloat("area", _this.area);
  29806. effect.setFloat("fallOff", _this.fallOff);
  29807. effect.setTexture("textureSampler", _this._depthTexture);
  29808. effect.setTexture("randomSampler", _this._randomTexture);
  29809. };
  29810. };
  29811. SSAORenderingPipeline.prototype._createSSAOCombinePostProcess = function (ratio) {
  29812. var _this = this;
  29813. this._ssaoCombinePostProcess = new BABYLON.PostProcess("ssaoCombine", "ssaoCombine", [], ["originalColor"], ratio, null, BABYLON.Texture.BILINEAR_SAMPLINGMODE, this._scene.getEngine(), false);
  29814. this._ssaoCombinePostProcess.onApply = function (effect) {
  29815. effect.setTextureFromPostProcess("originalColor", _this._originalColorPostProcess);
  29816. };
  29817. };
  29818. SSAORenderingPipeline.prototype._createRandomTexture = function () {
  29819. var size = 512;
  29820. this._randomTexture = new BABYLON.DynamicTexture("SSAORandomTexture", size, this._scene, false, BABYLON.Texture.BILINEAR_SAMPLINGMODE);
  29821. this._randomTexture.wrapU = BABYLON.Texture.WRAP_ADDRESSMODE;
  29822. this._randomTexture.wrapV = BABYLON.Texture.WRAP_ADDRESSMODE;
  29823. var context = this._randomTexture.getContext();
  29824. var rand = function (min, max) {
  29825. return Math.random() * (max - min) + min;
  29826. };
  29827. for (var x = 0; x < size; x++) {
  29828. for (var y = 0; y < size; y++) {
  29829. var randVector = BABYLON.Vector3.Zero();
  29830. randVector.x = Math.floor(rand(0.0, 1.0) * 255);
  29831. randVector.y = Math.floor(rand(0.0, 1.0) * 255);
  29832. randVector.z = Math.floor(rand(0.0, 1.0) * 255);
  29833. context.fillStyle = 'rgb(' + randVector.x + ', ' + randVector.y + ', ' + randVector.z + ')';
  29834. context.fillRect(x, y, 1, 1);
  29835. }
  29836. }
  29837. this._randomTexture.update(false);
  29838. };
  29839. return SSAORenderingPipeline;
  29840. })(BABYLON.PostProcessRenderPipeline);
  29841. BABYLON.SSAORenderingPipeline = SSAORenderingPipeline;
  29842. })(BABYLON || (BABYLON = {}));
  29843. //# sourceMappingURL=babylon.ssaoRenderingPipeline.js.map
  29844. var BABYLON;
  29845. (function (BABYLON) {
  29846. // Inspired by http://http.developer.nvidia.com/GPUGems3/gpugems3_ch13.html
  29847. var VolumetricLightScatteringPostProcess = (function (_super) {
  29848. __extends(VolumetricLightScatteringPostProcess, _super);
  29849. /**
  29850. * @constructor
  29851. * @param {string} name - The post-process name
  29852. * @param {any} ratio - The size of the post-process and/or internal pass (0.5 means that your postprocess will have a width = canvas.width 0.5 and a height = canvas.height 0.5)
  29853. * @param {BABYLON.Camera} camera - The camera that the post-process will be attached to
  29854. * @param {BABYLON.Mesh} mesh - The mesh used to create the light scattering
  29855. * @param {number} samples - The post-process quality, default 100
  29856. * @param {number} samplingMode - The post-process filtering mode
  29857. * @param {BABYLON.Engine} engine - The babylon engine
  29858. * @param {boolean} reusable - If the post-process is reusable
  29859. */
  29860. function VolumetricLightScatteringPostProcess(name, ratio, camera, mesh, samples, samplingMode, engine, reusable) {
  29861. var _this = this;
  29862. if (samples === void 0) { samples = 100; }
  29863. if (samplingMode === void 0) { samplingMode = BABYLON.Texture.BILINEAR_SAMPLINGMODE; }
  29864. _super.call(this, name, "volumetricLightScattering", ["decay", "exposure", "weight", "meshPositionOnScreen", "density"], ["lightScatteringSampler"], ratio.postProcessRatio || ratio, camera, samplingMode, engine, reusable, "#define NUM_SAMPLES " + samples);
  29865. this._screenCoordinates = BABYLON.Vector2.Zero();
  29866. /**
  29867. * Set if the post-process should use a custom position for the light source (true) or the internal mesh position (false)
  29868. * @type {boolean}
  29869. */
  29870. this.useCustomMeshPosition = false;
  29871. /**
  29872. * If the post-process should inverse the light scattering direction
  29873. * @type {boolean}
  29874. */
  29875. this.invert = true;
  29876. /**
  29877. * Array containing the excluded meshes not rendered in the internal pass
  29878. */
  29879. this.excludedMeshes = new Array();
  29880. this.exposure = 0.3;
  29881. this.decay = 0.96815;
  29882. this.weight = 0.58767;
  29883. this.density = 0.926;
  29884. var scene = camera.getScene();
  29885. this._viewPort = new BABYLON.Viewport(0, 0, 1, 1).toGlobal(scene.getEngine());
  29886. // Configure mesh
  29887. this.mesh = (mesh !== null) ? mesh : VolumetricLightScatteringPostProcess.CreateDefaultMesh("VolumetricLightScatteringMesh", scene);
  29888. // Configure
  29889. this._createPass(scene, ratio.passRatio || ratio);
  29890. this.onApply = function (effect) {
  29891. _this._updateMeshScreenCoordinates(scene);
  29892. effect.setTexture("lightScatteringSampler", _this._volumetricLightScatteringRTT);
  29893. effect.setFloat("exposure", _this.exposure);
  29894. effect.setFloat("decay", _this.decay);
  29895. effect.setFloat("weight", _this.weight);
  29896. effect.setFloat("density", _this.density);
  29897. effect.setVector2("meshPositionOnScreen", _this._screenCoordinates);
  29898. };
  29899. }
  29900. VolumetricLightScatteringPostProcess.prototype.isReady = function (subMesh, useInstances) {
  29901. var mesh = subMesh.getMesh();
  29902. var defines = [];
  29903. var attribs = [BABYLON.VertexBuffer.PositionKind];
  29904. var material = subMesh.getMaterial();
  29905. var needUV = false;
  29906. // Render this.mesh as default
  29907. if (mesh === this.mesh) {
  29908. defines.push("#define BASIC_RENDER");
  29909. defines.push("#define NEED_UV");
  29910. needUV = true;
  29911. }
  29912. // Alpha test
  29913. if (material) {
  29914. if (material.needAlphaTesting() || mesh === this.mesh)
  29915. defines.push("#define ALPHATEST");
  29916. if (material.opacityTexture !== undefined) {
  29917. defines.push("#define OPACITY");
  29918. if (material.opacityTexture.getAlphaFromRGB)
  29919. defines.push("#define OPACITYRGB");
  29920. if (!needUV)
  29921. defines.push("#define NEED_UV");
  29922. }
  29923. if (mesh.isVerticesDataPresent(BABYLON.VertexBuffer.UVKind)) {
  29924. attribs.push(BABYLON.VertexBuffer.UVKind);
  29925. defines.push("#define UV1");
  29926. }
  29927. if (mesh.isVerticesDataPresent(BABYLON.VertexBuffer.UV2Kind)) {
  29928. attribs.push(BABYLON.VertexBuffer.UV2Kind);
  29929. defines.push("#define UV2");
  29930. }
  29931. }
  29932. // Bones
  29933. if (mesh.useBones) {
  29934. attribs.push(BABYLON.VertexBuffer.MatricesIndicesKind);
  29935. attribs.push(BABYLON.VertexBuffer.MatricesWeightsKind);
  29936. defines.push("#define BONES");
  29937. defines.push("#define BonesPerMesh " + (mesh.skeleton.bones.length + 1));
  29938. }
  29939. // Instances
  29940. if (useInstances) {
  29941. defines.push("#define INSTANCES");
  29942. attribs.push("world0");
  29943. attribs.push("world1");
  29944. attribs.push("world2");
  29945. attribs.push("world3");
  29946. }
  29947. // Get correct effect
  29948. var join = defines.join("\n");
  29949. if (this._cachedDefines !== join) {
  29950. this._cachedDefines = join;
  29951. this._volumetricLightScatteringPass = mesh.getScene().getEngine().createEffect({ vertexElement: "depth", fragmentElement: "volumetricLightScatteringPass" }, attribs, ["world", "mBones", "viewProjection", "diffuseMatrix", "opacityLevel"], ["diffuseSampler", "opacitySampler"], join);
  29952. }
  29953. return this._volumetricLightScatteringPass.isReady();
  29954. };
  29955. /**
  29956. * Sets the new light position for light scattering effect
  29957. * @param {BABYLON.Vector3} The new custom light position
  29958. */
  29959. VolumetricLightScatteringPostProcess.prototype.setCustomMeshPosition = function (position) {
  29960. this._customMeshPosition = position;
  29961. };
  29962. /**
  29963. * Returns the light position for light scattering effect
  29964. * @return {BABYLON.Vector3} The custom light position
  29965. */
  29966. VolumetricLightScatteringPostProcess.prototype.getCustomMeshPosition = function () {
  29967. return this._customMeshPosition;
  29968. };
  29969. /**
  29970. * Disposes the internal assets and detaches the post-process from the camera
  29971. */
  29972. VolumetricLightScatteringPostProcess.prototype.dispose = function (camera) {
  29973. var rttIndex = camera.getScene().customRenderTargets.indexOf(this._volumetricLightScatteringRTT);
  29974. if (rttIndex !== -1) {
  29975. camera.getScene().customRenderTargets.splice(rttIndex, 1);
  29976. }
  29977. this._volumetricLightScatteringRTT.dispose();
  29978. _super.prototype.dispose.call(this, camera);
  29979. };
  29980. /**
  29981. * Returns the render target texture used by the post-process
  29982. * @return {BABYLON.RenderTargetTexture} The render target texture used by the post-process
  29983. */
  29984. VolumetricLightScatteringPostProcess.prototype.getPass = function () {
  29985. return this._volumetricLightScatteringRTT;
  29986. };
  29987. // Private methods
  29988. VolumetricLightScatteringPostProcess.prototype._meshExcluded = function (mesh) {
  29989. if (this.excludedMeshes.length > 0 && this.excludedMeshes.indexOf(mesh) !== -1) {
  29990. return true;
  29991. }
  29992. return false;
  29993. };
  29994. VolumetricLightScatteringPostProcess.prototype._createPass = function (scene, ratio) {
  29995. var _this = this;
  29996. var engine = scene.getEngine();
  29997. this._volumetricLightScatteringRTT = new BABYLON.RenderTargetTexture("volumetricLightScatteringMap", { width: engine.getRenderWidth() * ratio, height: engine.getRenderHeight() * ratio }, scene, false, true, BABYLON.Engine.TEXTURETYPE_UNSIGNED_INT);
  29998. this._volumetricLightScatteringRTT.wrapU = BABYLON.Texture.CLAMP_ADDRESSMODE;
  29999. this._volumetricLightScatteringRTT.wrapV = BABYLON.Texture.CLAMP_ADDRESSMODE;
  30000. this._volumetricLightScatteringRTT.renderList = null;
  30001. this._volumetricLightScatteringRTT.renderParticles = false;
  30002. scene.customRenderTargets.push(this._volumetricLightScatteringRTT);
  30003. // Custom render function for submeshes
  30004. var renderSubMesh = function (subMesh) {
  30005. var mesh = subMesh.getRenderingMesh();
  30006. if (_this._meshExcluded(mesh)) {
  30007. return;
  30008. }
  30009. var scene = mesh.getScene();
  30010. var engine = scene.getEngine();
  30011. // Culling
  30012. engine.setState(subMesh.getMaterial().backFaceCulling);
  30013. // Managing instances
  30014. var batch = mesh._getInstancesRenderList(subMesh._id);
  30015. if (batch.mustReturn) {
  30016. return;
  30017. }
  30018. var hardwareInstancedRendering = (engine.getCaps().instancedArrays !== null) && (batch.visibleInstances[subMesh._id] !== null);
  30019. if (_this.isReady(subMesh, hardwareInstancedRendering)) {
  30020. engine.enableEffect(_this._volumetricLightScatteringPass);
  30021. mesh._bind(subMesh, _this._volumetricLightScatteringPass, BABYLON.Material.TriangleFillMode);
  30022. var material = subMesh.getMaterial();
  30023. _this._volumetricLightScatteringPass.setMatrix("viewProjection", scene.getTransformMatrix());
  30024. // Alpha test
  30025. if (material && (mesh === _this.mesh || material.needAlphaTesting() || material.opacityTexture !== undefined)) {
  30026. var alphaTexture = material.getAlphaTestTexture();
  30027. _this._volumetricLightScatteringPass.setTexture("diffuseSampler", alphaTexture);
  30028. if (alphaTexture) {
  30029. _this._volumetricLightScatteringPass.setMatrix("diffuseMatrix", alphaTexture.getTextureMatrix());
  30030. }
  30031. if (material.opacityTexture !== undefined) {
  30032. _this._volumetricLightScatteringPass.setTexture("opacitySampler", material.opacityTexture);
  30033. _this._volumetricLightScatteringPass.setFloat("opacityLevel", material.opacityTexture.level);
  30034. }
  30035. }
  30036. // Bones
  30037. if (mesh.useBones) {
  30038. _this._volumetricLightScatteringPass.setMatrices("mBones", mesh.skeleton.getTransformMatrices());
  30039. }
  30040. // Draw
  30041. mesh._processRendering(subMesh, _this._volumetricLightScatteringPass, BABYLON.Material.TriangleFillMode, batch, hardwareInstancedRendering, function (isInstance, world) { return _this._volumetricLightScatteringPass.setMatrix("world", world); });
  30042. }
  30043. };
  30044. // Render target texture callbacks
  30045. var savedSceneClearColor;
  30046. var sceneClearColor = new BABYLON.Color4(0.0, 0.0, 0.0, 1.0);
  30047. this._volumetricLightScatteringRTT.onBeforeRender = function () {
  30048. savedSceneClearColor = scene.clearColor;
  30049. scene.clearColor = sceneClearColor;
  30050. };
  30051. this._volumetricLightScatteringRTT.onAfterRender = function () {
  30052. scene.clearColor = savedSceneClearColor;
  30053. };
  30054. this._volumetricLightScatteringRTT.customRenderFunction = function (opaqueSubMeshes, alphaTestSubMeshes, transparentSubMeshes) {
  30055. var engine = scene.getEngine();
  30056. var index;
  30057. for (index = 0; index < opaqueSubMeshes.length; index++) {
  30058. renderSubMesh(opaqueSubMeshes.data[index]);
  30059. }
  30060. engine.setAlphaTesting(true);
  30061. for (index = 0; index < alphaTestSubMeshes.length; index++) {
  30062. renderSubMesh(alphaTestSubMeshes.data[index]);
  30063. }
  30064. engine.setAlphaTesting(false);
  30065. if (transparentSubMeshes.length) {
  30066. for (index = 0; index < transparentSubMeshes.length; index++) {
  30067. var submesh = transparentSubMeshes.data[index];
  30068. submesh._alphaIndex = submesh.getMesh().alphaIndex;
  30069. submesh._distanceToCamera = submesh.getBoundingInfo().boundingSphere.centerWorld.subtract(scene.activeCamera.position).length();
  30070. }
  30071. var sortedArray = transparentSubMeshes.data.slice(0, transparentSubMeshes.length);
  30072. sortedArray.sort(function (a, b) {
  30073. // Alpha index first
  30074. if (a._alphaIndex > b._alphaIndex) {
  30075. return 1;
  30076. }
  30077. if (a._alphaIndex < b._alphaIndex) {
  30078. return -1;
  30079. }
  30080. // Then distance to camera
  30081. if (a._distanceToCamera < b._distanceToCamera) {
  30082. return 1;
  30083. }
  30084. if (a._distanceToCamera > b._distanceToCamera) {
  30085. return -1;
  30086. }
  30087. return 0;
  30088. });
  30089. // Render sub meshes
  30090. engine.setAlphaMode(BABYLON.Engine.ALPHA_COMBINE);
  30091. for (index = 0; index < sortedArray.length; index++) {
  30092. renderSubMesh(sortedArray[index]);
  30093. }
  30094. engine.setAlphaMode(BABYLON.Engine.ALPHA_DISABLE);
  30095. }
  30096. };
  30097. };
  30098. VolumetricLightScatteringPostProcess.prototype._updateMeshScreenCoordinates = function (scene) {
  30099. var transform = scene.getTransformMatrix();
  30100. var pos = BABYLON.Vector3.Project(this.useCustomMeshPosition ? this._customMeshPosition : this.mesh.position, BABYLON.Matrix.Identity(), transform, this._viewPort);
  30101. this._screenCoordinates.x = pos.x / this._viewPort.width;
  30102. this._screenCoordinates.y = pos.y / this._viewPort.height;
  30103. if (this.invert)
  30104. this._screenCoordinates.y = 1.0 - this._screenCoordinates.y;
  30105. };
  30106. // Static methods
  30107. /**
  30108. * Creates a default mesh for the Volumeric Light Scattering post-process
  30109. * @param {string} The mesh name
  30110. * @param {BABYLON.Scene} The scene where to create the mesh
  30111. * @return {BABYLON.Mesh} the default mesh
  30112. */
  30113. VolumetricLightScatteringPostProcess.CreateDefaultMesh = function (name, scene) {
  30114. var mesh = BABYLON.Mesh.CreatePlane(name, 1, scene);
  30115. mesh.billboardMode = BABYLON.AbstractMesh.BILLBOARDMODE_ALL;
  30116. mesh.material = new BABYLON.StandardMaterial(name + "Material", scene);
  30117. return mesh;
  30118. };
  30119. return VolumetricLightScatteringPostProcess;
  30120. })(BABYLON.PostProcess);
  30121. BABYLON.VolumetricLightScatteringPostProcess = VolumetricLightScatteringPostProcess;
  30122. })(BABYLON || (BABYLON = {}));
  30123. //# sourceMappingURL=babylon.volumetricLightScatteringPostProcess.js.map
  30124. var BABYLON;
  30125. (function (BABYLON) {
  30126. var LensRenderingPipeline = (function (_super) {
  30127. __extends(LensRenderingPipeline, _super);
  30128. /**
  30129. * @constructor
  30130. *
  30131. * Effect parameters are as follow:
  30132. * {
  30133. * chromatic_aberration: number; // from 0 to x (1 for realism)
  30134. * edge_blur: number; // from 0 to x (1 for realism)
  30135. * distortion: number; // from 0 to x (1 for realism)
  30136. * grain_amount: number; // from 0 to 1
  30137. * grain_texture: BABYLON.Texture; // texture to use for grain effect; if unset, use random B&W noise
  30138. * dof_focus_depth: number; // depth-of-field: focus depth; unset to disable (disabled by default)
  30139. * dof_aperture: number; // depth-of-field: focus blur bias (default: 1)
  30140. * dof_pentagon: boolean; // depth-of-field: makes a pentagon-like "bokeh" effect
  30141. * dof_gain: number; // depth-of-field: depthOfField gain; unset to disable (disabled by default)
  30142. * dof_threshold: number; // depth-of-field: depthOfField threshold (default: 1)
  30143. * blur_noise: boolean; // add a little bit of noise to the blur (default: true)
  30144. * }
  30145. * Note: if an effect parameter is unset, effect is disabled
  30146. *
  30147. * @param {string} name - The rendering pipeline name
  30148. * @param {object} parameters - An object containing all parameters (see above)
  30149. * @param {BABYLON.Scene} scene - The scene linked to this pipeline
  30150. * @param {number} ratio - The size of the postprocesses (0.5 means that your postprocess will have a width = canvas.width 0.5 and a height = canvas.height 0.5)
  30151. * @param {BABYLON.Camera[]} cameras - The array of cameras that the rendering pipeline will be attached to
  30152. */
  30153. function LensRenderingPipeline(name, parameters, scene, ratio, cameras) {
  30154. var _this = this;
  30155. if (ratio === void 0) { ratio = 1.0; }
  30156. _super.call(this, scene.getEngine(), name);
  30157. // Lens effects can be of the following:
  30158. // - chromatic aberration (slight shift of RGB colors)
  30159. // - blur on the edge of the lens
  30160. // - lens distortion
  30161. // - depth-of-field blur & highlights enhancing
  30162. // - depth-of-field 'bokeh' effect (shapes appearing in blurred areas)
  30163. // - grain effect (noise or custom texture)
  30164. // Two additional texture samplers are needed:
  30165. // - depth map (for depth-of-field)
  30166. // - grain texture
  30167. /**
  30168. * The chromatic aberration PostProcess id in the pipeline
  30169. * @type {string}
  30170. */
  30171. this.LensChromaticAberrationEffect = "LensChromaticAberrationEffect";
  30172. /**
  30173. * The highlights enhancing PostProcess id in the pipeline
  30174. * @type {string}
  30175. */
  30176. this.HighlightsEnhancingEffect = "HighlightsEnhancingEffect";
  30177. /**
  30178. * The depth-of-field PostProcess id in the pipeline
  30179. * @type {string}
  30180. */
  30181. this.LensDepthOfFieldEffect = "LensDepthOfFieldEffect";
  30182. this._scene = scene;
  30183. // Fetch texture samplers
  30184. this._depthTexture = scene.enableDepthRenderer().getDepthMap(); // Force depth renderer "on"
  30185. if (parameters.grain_texture) {
  30186. this._grainTexture = parameters.grain_texture;
  30187. }
  30188. else {
  30189. this._createGrainTexture();
  30190. }
  30191. // save parameters
  30192. this._edgeBlur = parameters.edge_blur ? parameters.edge_blur : 0;
  30193. this._grainAmount = parameters.grain_amount ? parameters.grain_amount : 0;
  30194. this._chromaticAberration = parameters.chromatic_aberration ? parameters.chromatic_aberration : 0;
  30195. this._distortion = parameters.distortion ? parameters.distortion : 0;
  30196. this._highlightsGain = parameters.dof_gain !== undefined ? parameters.dof_gain : -1;
  30197. this._highlightsThreshold = parameters.dof_threshold ? parameters.dof_threshold : 1;
  30198. this._dofDepth = parameters.dof_focus_depth !== undefined ? parameters.dof_focus_depth : -1;
  30199. this._dofAperture = parameters.dof_aperture ? parameters.dof_aperture : 1;
  30200. this._dofPentagon = parameters.dof_pentagon !== undefined ? parameters.dof_pentagon : true;
  30201. this._blurNoise = parameters.blur_noise !== undefined ? parameters.blur_noise : true;
  30202. // Create effects
  30203. this._createChromaticAberrationPostProcess(ratio);
  30204. this._createHighlightsPostProcess(ratio);
  30205. this._createDepthOfFieldPostProcess(ratio);
  30206. // Set up pipeline
  30207. this.addEffect(new BABYLON.PostProcessRenderEffect(scene.getEngine(), this.LensChromaticAberrationEffect, function () {
  30208. return _this._chromaticAberrationPostProcess;
  30209. }, true));
  30210. this.addEffect(new BABYLON.PostProcessRenderEffect(scene.getEngine(), this.HighlightsEnhancingEffect, function () {
  30211. return _this._highlightsPostProcess;
  30212. }, true));
  30213. this.addEffect(new BABYLON.PostProcessRenderEffect(scene.getEngine(), this.LensDepthOfFieldEffect, function () {
  30214. return _this._depthOfFieldPostProcess;
  30215. }, true));
  30216. if (this._highlightsGain == -1) {
  30217. this._disableEffect(this.HighlightsEnhancingEffect, null);
  30218. }
  30219. // Finish
  30220. scene.postProcessRenderPipelineManager.addPipeline(this);
  30221. if (cameras) {
  30222. scene.postProcessRenderPipelineManager.attachCamerasToRenderPipeline(name, cameras);
  30223. }
  30224. }
  30225. // public methods (self explanatory)
  30226. LensRenderingPipeline.prototype.setEdgeBlur = function (amount) {
  30227. this._edgeBlur = amount;
  30228. };
  30229. LensRenderingPipeline.prototype.disableEdgeBlur = function () {
  30230. this._edgeBlur = 0;
  30231. };
  30232. LensRenderingPipeline.prototype.setGrainAmount = function (amount) {
  30233. this._grainAmount = amount;
  30234. };
  30235. LensRenderingPipeline.prototype.disableGrain = function () {
  30236. this._grainAmount = 0;
  30237. };
  30238. LensRenderingPipeline.prototype.setChromaticAberration = function (amount) {
  30239. this._chromaticAberration = amount;
  30240. };
  30241. LensRenderingPipeline.prototype.disableChromaticAberration = function () {
  30242. this._chromaticAberration = 0;
  30243. };
  30244. LensRenderingPipeline.prototype.setEdgeDistortion = function (amount) {
  30245. this._distortion = amount;
  30246. };
  30247. LensRenderingPipeline.prototype.disableEdgeDistortion = function () {
  30248. this._distortion = 0;
  30249. };
  30250. LensRenderingPipeline.prototype.setFocusDepth = function (amount) {
  30251. this._dofDepth = amount;
  30252. };
  30253. LensRenderingPipeline.prototype.disableDepthOfField = function () {
  30254. this._dofDepth = -1;
  30255. };
  30256. LensRenderingPipeline.prototype.setAperture = function (amount) {
  30257. this._dofAperture = amount;
  30258. };
  30259. LensRenderingPipeline.prototype.enablePentagonBokeh = function () {
  30260. this._dofPentagon = true;
  30261. };
  30262. LensRenderingPipeline.prototype.disablePentagonBokeh = function () {
  30263. this._dofPentagon = false;
  30264. };
  30265. LensRenderingPipeline.prototype.enableNoiseBlur = function () {
  30266. this._blurNoise = true;
  30267. };
  30268. LensRenderingPipeline.prototype.disableNoiseBlur = function () {
  30269. this._blurNoise = false;
  30270. };
  30271. LensRenderingPipeline.prototype.setHighlightsGain = function (amount) {
  30272. this._highlightsGain = amount;
  30273. };
  30274. LensRenderingPipeline.prototype.setHighlightsThreshold = function (amount) {
  30275. if (this._highlightsGain == -1) {
  30276. this._highlightsGain = 1.0;
  30277. }
  30278. this._highlightsThreshold = amount;
  30279. };
  30280. LensRenderingPipeline.prototype.disableHighlights = function () {
  30281. this._highlightsGain = -1;
  30282. };
  30283. /**
  30284. * Removes the internal pipeline assets and detaches the pipeline from the scene cameras
  30285. */
  30286. LensRenderingPipeline.prototype.dispose = function (disableDepthRender) {
  30287. if (disableDepthRender === void 0) { disableDepthRender = false; }
  30288. this._scene.postProcessRenderPipelineManager.detachCamerasFromRenderPipeline(this._name, this._scene.cameras);
  30289. this._chromaticAberrationPostProcess = undefined;
  30290. this._highlightsPostProcess = undefined;
  30291. this._depthOfFieldPostProcess = undefined;
  30292. this._grainTexture.dispose();
  30293. if (disableDepthRender)
  30294. this._scene.disableDepthRenderer();
  30295. };
  30296. // colors shifting and distortion
  30297. LensRenderingPipeline.prototype._createChromaticAberrationPostProcess = function (ratio) {
  30298. var _this = this;
  30299. this._chromaticAberrationPostProcess = new BABYLON.PostProcess("LensChromaticAberration", "chromaticAberration", ["chromatic_aberration", "screen_width", "screen_height"], [], ratio, null, BABYLON.Texture.TRILINEAR_SAMPLINGMODE, this._scene.getEngine(), false);
  30300. this._chromaticAberrationPostProcess.onApply = function (effect) {
  30301. effect.setFloat('chromatic_aberration', _this._chromaticAberration);
  30302. effect.setFloat('screen_width', _this._scene.getEngine().getRenderingCanvas().width);
  30303. effect.setFloat('screen_height', _this._scene.getEngine().getRenderingCanvas().height);
  30304. };
  30305. };
  30306. // highlights enhancing
  30307. LensRenderingPipeline.prototype._createHighlightsPostProcess = function (ratio) {
  30308. var _this = this;
  30309. this._highlightsPostProcess = new BABYLON.PostProcess("LensHighlights", "lensHighlights", ["pentagon", "gain", "threshold", "screen_width", "screen_height"], [], ratio, null, BABYLON.Texture.TRILINEAR_SAMPLINGMODE, this._scene.getEngine(), false);
  30310. this._highlightsPostProcess.onApply = function (effect) {
  30311. effect.setFloat('gain', _this._highlightsGain);
  30312. effect.setFloat('threshold', _this._highlightsThreshold);
  30313. effect.setBool('pentagon', _this._dofPentagon);
  30314. effect.setTextureFromPostProcess("textureSampler", _this._chromaticAberrationPostProcess);
  30315. effect.setFloat('screen_width', _this._scene.getEngine().getRenderingCanvas().width);
  30316. effect.setFloat('screen_height', _this._scene.getEngine().getRenderingCanvas().height);
  30317. };
  30318. };
  30319. // colors shifting and distortion
  30320. LensRenderingPipeline.prototype._createDepthOfFieldPostProcess = function (ratio) {
  30321. var _this = this;
  30322. this._depthOfFieldPostProcess = new BABYLON.PostProcess("LensDepthOfField", "depthOfField", [
  30323. "focus_depth",
  30324. "aperture",
  30325. "pentagon",
  30326. "maxZ",
  30327. "edge_blur",
  30328. "chromatic_aberration",
  30329. "distortion",
  30330. "blur_noise",
  30331. "grain_amount",
  30332. "screen_width",
  30333. "screen_height",
  30334. "highlights"
  30335. ], ["depthSampler", "grainSampler", "highlightsSampler"], ratio, null, BABYLON.Texture.TRILINEAR_SAMPLINGMODE, this._scene.getEngine(), false);
  30336. this._depthOfFieldPostProcess.onApply = function (effect) {
  30337. effect.setBool('blur_noise', _this._blurNoise);
  30338. effect.setFloat('maxZ', _this._scene.activeCamera.maxZ);
  30339. effect.setFloat('grain_amount', _this._grainAmount);
  30340. effect.setTexture("depthSampler", _this._depthTexture);
  30341. effect.setTexture("grainSampler", _this._grainTexture);
  30342. effect.setTextureFromPostProcess("textureSampler", _this._highlightsPostProcess);
  30343. effect.setTextureFromPostProcess("highlightsSampler", _this._depthOfFieldPostProcess);
  30344. effect.setFloat('screen_width', _this._scene.getEngine().getRenderingCanvas().width);
  30345. effect.setFloat('screen_height', _this._scene.getEngine().getRenderingCanvas().height);
  30346. effect.setFloat('distortion', _this._distortion);
  30347. effect.setFloat('focus_depth', _this._dofDepth);
  30348. effect.setFloat('aperture', _this._dofAperture);
  30349. effect.setFloat('edge_blur', _this._edgeBlur);
  30350. effect.setBool('highlights', (_this._highlightsGain != -1));
  30351. };
  30352. };
  30353. // creates a black and white random noise texture, 512x512
  30354. LensRenderingPipeline.prototype._createGrainTexture = function () {
  30355. var size = 512;
  30356. this._grainTexture = new BABYLON.DynamicTexture("LensNoiseTexture", size, this._scene, false, BABYLON.Texture.BILINEAR_SAMPLINGMODE);
  30357. this._grainTexture.wrapU = BABYLON.Texture.WRAP_ADDRESSMODE;
  30358. this._grainTexture.wrapV = BABYLON.Texture.WRAP_ADDRESSMODE;
  30359. var context = this._grainTexture.getContext();
  30360. var rand = function (min, max) {
  30361. return Math.random() * (max - min) + min;
  30362. };
  30363. var value;
  30364. for (var x = 0; x < size; x++) {
  30365. for (var y = 0; y < size; y++) {
  30366. value = Math.floor(rand(0.42, 0.58) * 255);
  30367. context.fillStyle = 'rgb(' + value + ', ' + value + ', ' + value + ')';
  30368. context.fillRect(x, y, 1, 1);
  30369. }
  30370. }
  30371. this._grainTexture.update(false);
  30372. };
  30373. return LensRenderingPipeline;
  30374. })(BABYLON.PostProcessRenderPipeline);
  30375. BABYLON.LensRenderingPipeline = LensRenderingPipeline;
  30376. })(BABYLON || (BABYLON = {}));
  30377. //# sourceMappingURL=babylon.lensRenderingPipeline.js.map//
  30378. // This post-process allows the modification of rendered colors by using
  30379. // a 'look-up table' (LUT). This effect is also called Color Grading.
  30380. //
  30381. // The object needs to be provided an url to a texture containing the color
  30382. // look-up table: the texture must be 256 pixels wide and 16 pixels high.
  30383. // Use an image editing software to tweak the LUT to match your needs.
  30384. //
  30385. // For an example of a color LUT, see here:
  30386. // http://udn.epicgames.com/Three/rsrc/Three/ColorGrading/RGBTable16x1.png
  30387. // For explanations on color grading, see here:
  30388. // http://udn.epicgames.com/Three/ColorGrading.html
  30389. //
  30390. var BABYLON;
  30391. (function (BABYLON) {
  30392. var ColorCorrectionPostProcess = (function (_super) {
  30393. __extends(ColorCorrectionPostProcess, _super);
  30394. function ColorCorrectionPostProcess(name, colorTableUrl, ratio, camera, samplingMode, engine, reusable) {
  30395. var _this = this;
  30396. _super.call(this, name, 'colorCorrection', null, ['colorTable'], ratio, camera, samplingMode, engine, reusable);
  30397. this._colorTableTexture = new BABYLON.Texture(colorTableUrl, camera.getScene(), true, false, BABYLON.Texture.TRILINEAR_SAMPLINGMODE);
  30398. this._colorTableTexture.anisotropicFilteringLevel = 1;
  30399. this._colorTableTexture.wrapU = BABYLON.Texture.CLAMP_ADDRESSMODE;
  30400. this._colorTableTexture.wrapV = BABYLON.Texture.CLAMP_ADDRESSMODE;
  30401. this.onApply = function (effect) {
  30402. effect.setTexture("colorTable", _this._colorTableTexture);
  30403. };
  30404. }
  30405. return ColorCorrectionPostProcess;
  30406. })(BABYLON.PostProcess);
  30407. BABYLON.ColorCorrectionPostProcess = ColorCorrectionPostProcess;
  30408. })(BABYLON || (BABYLON = {}));
  30409. //# sourceMappingURL=babylon.colorCorrectionPostProcess.js.mapvar BABYLON;
  30410. (function (BABYLON) {
  30411. var SmartCollection = (function () {
  30412. function SmartCollection(capacity) {
  30413. if (capacity === void 0) { capacity = 10; }
  30414. this.count = 0;
  30415. this._initialCapacity = capacity;
  30416. this.items = {};
  30417. this._keys = new Array(this._initialCapacity);
  30418. }
  30419. SmartCollection.prototype.add = function (key, item) {
  30420. if (this.items[key] != undefined) {
  30421. return -1;
  30422. }
  30423. this.items[key] = item;
  30424. //literal keys are always strings, but we keep source type of key in _keys array
  30425. this._keys[this.count++] = key;
  30426. if (this.count > this._keys.length) {
  30427. this._keys.length *= 2;
  30428. }
  30429. return this.count;
  30430. };
  30431. SmartCollection.prototype.remove = function (key) {
  30432. if (this.items[key] == undefined) {
  30433. return -1;
  30434. }
  30435. return this.removeItemOfIndex(this.indexOf(key));
  30436. };
  30437. SmartCollection.prototype.removeItemOfIndex = function (index) {
  30438. if (index < this.count && index > -1) {
  30439. delete this.items[this._keys[index]];
  30440. while (index < this.count) {
  30441. this._keys[index] = this._keys[index + 1];
  30442. index++;
  30443. }
  30444. }
  30445. else {
  30446. return -1;
  30447. }
  30448. return --this.count;
  30449. };
  30450. SmartCollection.prototype.indexOf = function (key) {
  30451. for (var i = 0; i !== this.count; i++) {
  30452. if (this._keys[i] === key) {
  30453. return i;
  30454. }
  30455. }
  30456. return -1;
  30457. };
  30458. SmartCollection.prototype.item = function (key) {
  30459. return this.items[key];
  30460. };
  30461. SmartCollection.prototype.getAllKeys = function () {
  30462. if (this.count > 0) {
  30463. var keys = new Array(this.count);
  30464. for (var i = 0; i < this.count; i++) {
  30465. keys[i] = this._keys[i];
  30466. }
  30467. return keys;
  30468. }
  30469. else {
  30470. return undefined;
  30471. }
  30472. };
  30473. SmartCollection.prototype.getKeyByIndex = function (index) {
  30474. if (index < this.count && index > -1) {
  30475. return this._keys[index];
  30476. }
  30477. else {
  30478. return undefined;
  30479. }
  30480. };
  30481. SmartCollection.prototype.getItemByIndex = function (index) {
  30482. if (index < this.count && index > -1) {
  30483. return this.items[this._keys[index]];
  30484. }
  30485. else {
  30486. return undefined;
  30487. }
  30488. };
  30489. SmartCollection.prototype.empty = function () {
  30490. if (this.count > 0) {
  30491. this.count = 0;
  30492. this.items = {};
  30493. this._keys = new Array(this._initialCapacity);
  30494. }
  30495. };
  30496. SmartCollection.prototype.forEach = function (block) {
  30497. var key;
  30498. for (key in this.items) {
  30499. if (this.items.hasOwnProperty(key)) {
  30500. block(this.items[key]);
  30501. }
  30502. }
  30503. };
  30504. return SmartCollection;
  30505. })();
  30506. BABYLON.SmartCollection = SmartCollection;
  30507. })(BABYLON || (BABYLON = {}));
  30508. //# sourceMappingURL=babylon.smartCollection.js.map