babylon.2.0-alpha.debug.js 1.2 MB

12345678910111213141516171819202122232425262728293031323334353637383940414243444546474849505152535455565758596061626364656667686970717273747576777879808182838485868788899091929394959697989910010110210310410510610710810911011111211311411511611711811912012112212312412512612712812913013113213313413513613713813914014114214314414514614714814915015115215315415515615715815916016116216316416516616716816917017117217317417517617717817918018118218318418518618718818919019119219319419519619719819920020120220320420520620720820921021121221321421521621721821922022122222322422522622722822923023123223323423523623723823924024124224324424524624724824925025125225325425525625725825926026126226326426526626726826927027127227327427527627727827928028128228328428528628728828929029129229329429529629729829930030130230330430530630730830931031131231331431531631731831932032132232332432532632732832933033133233333433533633733833934034134234334434534634734834935035135235335435535635735835936036136236336436536636736836937037137237337437537637737837938038138238338438538638738838939039139239339439539639739839940040140240340440540640740840941041141241341441541641741841942042142242342442542642742842943043143243343443543643743843944044144244344444544644744844945045145245345445545645745845946046146246346446546646746846947047147247347447547647747847948048148248348448548648748848949049149249349449549649749849950050150250350450550650750850951051151251351451551651751851952052152252352452552652752852953053153253353453553653753853954054154254354454554654754854955055155255355455555655755855956056156256356456556656756856957057157257357457557657757857958058158258358458558658758858959059159259359459559659759859960060160260360460560660760860961061161261361461561661761861962062162262362462562662762862963063163263363463563663763863964064164264364464564664764864965065165265365465565665765865966066166266366466566666766866967067167267367467567667767867968068168268368468568668768868969069169269369469569669769869970070170270370470570670770870971071171271371471571671771871972072172272372472572672772872973073173273373473573673773873974074174274374474574674774874975075175275375475575675775875976076176276376476576676776876977077177277377477577677777877978078178278378478578678778878979079179279379479579679779879980080180280380480580680780880981081181281381481581681781881982082182282382482582682782882983083183283383483583683783883984084184284384484584684784884985085185285385485585685785885986086186286386486586686786886987087187287387487587687787887988088188288388488588688788888989089189289389489589689789889990090190290390490590690790890991091191291391491591691791891992092192292392492592692792892993093193293393493593693793893994094194294394494594694794894995095195295395495595695795895996096196296396496596696796896997097197297397497597697797897998098198298398498598698798898999099199299399499599699799899910001001100210031004100510061007100810091010101110121013101410151016101710181019102010211022102310241025102610271028102910301031103210331034103510361037103810391040104110421043104410451046104710481049105010511052105310541055105610571058105910601061106210631064106510661067106810691070107110721073107410751076107710781079108010811082108310841085108610871088108910901091109210931094109510961097109810991100110111021103110411051106110711081109111011111112111311141115111611171118111911201121112211231124112511261127112811291130113111321133113411351136113711381139114011411142114311441145114611471148114911501151115211531154115511561157115811591160116111621163116411651166116711681169117011711172117311741175117611771178117911801181118211831184118511861187118811891190119111921193119411951196119711981199120012011202120312041205120612071208120912101211121212131214121512161217121812191220122112221223122412251226122712281229123012311232123312341235123612371238123912401241124212431244124512461247124812491250125112521253125412551256125712581259126012611262126312641265126612671268126912701271127212731274127512761277127812791280128112821283128412851286128712881289129012911292129312941295129612971298129913001301130213031304130513061307130813091310131113121313131413151316131713181319132013211322132313241325132613271328132913301331133213331334133513361337133813391340134113421343134413451346134713481349135013511352135313541355135613571358135913601361136213631364136513661367136813691370137113721373137413751376137713781379138013811382138313841385138613871388138913901391139213931394139513961397139813991400140114021403140414051406140714081409141014111412141314141415141614171418141914201421142214231424142514261427142814291430143114321433143414351436143714381439144014411442144314441445144614471448144914501451145214531454145514561457145814591460146114621463146414651466146714681469147014711472147314741475147614771478147914801481148214831484148514861487148814891490149114921493149414951496149714981499150015011502150315041505150615071508150915101511151215131514151515161517151815191520152115221523152415251526152715281529153015311532153315341535153615371538153915401541154215431544154515461547154815491550155115521553155415551556155715581559156015611562156315641565156615671568156915701571157215731574157515761577157815791580158115821583158415851586158715881589159015911592159315941595159615971598159916001601160216031604160516061607160816091610161116121613161416151616161716181619162016211622162316241625162616271628162916301631163216331634163516361637163816391640164116421643164416451646164716481649165016511652165316541655165616571658165916601661166216631664166516661667166816691670167116721673167416751676167716781679168016811682168316841685168616871688168916901691169216931694169516961697169816991700170117021703170417051706170717081709171017111712171317141715171617171718171917201721172217231724172517261727172817291730173117321733173417351736173717381739174017411742174317441745174617471748174917501751175217531754175517561757175817591760176117621763176417651766176717681769177017711772177317741775177617771778177917801781178217831784178517861787178817891790179117921793179417951796179717981799180018011802180318041805180618071808180918101811181218131814181518161817181818191820182118221823182418251826182718281829183018311832183318341835183618371838183918401841184218431844184518461847184818491850185118521853185418551856185718581859186018611862186318641865186618671868186918701871187218731874187518761877187818791880188118821883188418851886188718881889189018911892189318941895189618971898189919001901190219031904190519061907190819091910191119121913191419151916191719181919192019211922192319241925192619271928192919301931193219331934193519361937193819391940194119421943194419451946194719481949195019511952195319541955195619571958195919601961196219631964196519661967196819691970197119721973197419751976197719781979198019811982198319841985198619871988198919901991199219931994199519961997199819992000200120022003200420052006200720082009201020112012201320142015201620172018201920202021202220232024202520262027202820292030203120322033203420352036203720382039204020412042204320442045204620472048204920502051205220532054205520562057205820592060206120622063206420652066206720682069207020712072207320742075207620772078207920802081208220832084208520862087208820892090209120922093209420952096209720982099210021012102210321042105210621072108210921102111211221132114211521162117211821192120212121222123212421252126212721282129213021312132213321342135213621372138213921402141214221432144214521462147214821492150215121522153215421552156215721582159216021612162216321642165216621672168216921702171217221732174217521762177217821792180218121822183218421852186218721882189219021912192219321942195219621972198219922002201220222032204220522062207220822092210221122122213221422152216221722182219222022212222222322242225222622272228222922302231223222332234223522362237223822392240224122422243224422452246224722482249225022512252225322542255225622572258225922602261226222632264226522662267226822692270227122722273227422752276227722782279228022812282228322842285228622872288228922902291229222932294229522962297229822992300230123022303230423052306230723082309231023112312231323142315231623172318231923202321232223232324232523262327232823292330233123322333233423352336233723382339234023412342234323442345234623472348234923502351235223532354235523562357235823592360236123622363236423652366236723682369237023712372237323742375237623772378237923802381238223832384238523862387238823892390239123922393239423952396239723982399240024012402240324042405240624072408240924102411241224132414241524162417241824192420242124222423242424252426242724282429243024312432243324342435243624372438243924402441244224432444244524462447244824492450245124522453245424552456245724582459246024612462246324642465246624672468246924702471247224732474247524762477247824792480248124822483248424852486248724882489249024912492249324942495249624972498249925002501250225032504250525062507250825092510251125122513251425152516251725182519252025212522252325242525252625272528252925302531253225332534253525362537253825392540254125422543254425452546254725482549255025512552255325542555255625572558255925602561256225632564256525662567256825692570257125722573257425752576257725782579258025812582258325842585258625872588258925902591259225932594259525962597259825992600260126022603260426052606260726082609261026112612261326142615261626172618261926202621262226232624262526262627262826292630263126322633263426352636263726382639264026412642264326442645264626472648264926502651265226532654265526562657265826592660266126622663266426652666266726682669267026712672267326742675267626772678267926802681268226832684268526862687268826892690269126922693269426952696269726982699270027012702270327042705270627072708270927102711271227132714271527162717271827192720272127222723272427252726272727282729273027312732273327342735273627372738273927402741274227432744274527462747274827492750275127522753275427552756275727582759276027612762276327642765276627672768276927702771277227732774277527762777277827792780278127822783278427852786278727882789279027912792279327942795279627972798279928002801280228032804280528062807280828092810281128122813281428152816281728182819282028212822282328242825282628272828282928302831283228332834283528362837283828392840284128422843284428452846284728482849285028512852285328542855285628572858285928602861286228632864286528662867286828692870287128722873287428752876287728782879288028812882288328842885288628872888288928902891289228932894289528962897289828992900290129022903290429052906290729082909291029112912291329142915291629172918291929202921292229232924292529262927292829292930293129322933293429352936293729382939294029412942294329442945294629472948294929502951295229532954295529562957295829592960296129622963296429652966296729682969297029712972297329742975297629772978297929802981298229832984298529862987298829892990299129922993299429952996299729982999300030013002300330043005300630073008300930103011301230133014301530163017301830193020302130223023302430253026302730283029303030313032303330343035303630373038303930403041304230433044304530463047304830493050305130523053305430553056305730583059306030613062306330643065306630673068306930703071307230733074307530763077307830793080308130823083308430853086308730883089309030913092309330943095309630973098309931003101310231033104310531063107310831093110311131123113311431153116311731183119312031213122312331243125312631273128312931303131313231333134313531363137313831393140314131423143314431453146314731483149315031513152315331543155315631573158315931603161316231633164316531663167316831693170317131723173317431753176317731783179318031813182318331843185318631873188318931903191319231933194319531963197319831993200320132023203320432053206320732083209321032113212321332143215321632173218321932203221322232233224322532263227322832293230323132323233323432353236323732383239324032413242324332443245324632473248324932503251325232533254325532563257325832593260326132623263326432653266326732683269327032713272327332743275327632773278327932803281328232833284328532863287328832893290329132923293329432953296329732983299330033013302330333043305330633073308330933103311331233133314331533163317331833193320332133223323332433253326332733283329333033313332333333343335333633373338333933403341334233433344334533463347334833493350335133523353335433553356335733583359336033613362336333643365336633673368336933703371337233733374337533763377337833793380338133823383338433853386338733883389339033913392339333943395339633973398339934003401340234033404340534063407340834093410341134123413341434153416341734183419342034213422342334243425342634273428342934303431343234333434343534363437343834393440344134423443344434453446344734483449345034513452345334543455345634573458345934603461346234633464346534663467346834693470347134723473347434753476347734783479348034813482348334843485348634873488348934903491349234933494349534963497349834993500350135023503350435053506350735083509351035113512351335143515351635173518351935203521352235233524352535263527352835293530353135323533353435353536353735383539354035413542354335443545354635473548354935503551355235533554355535563557355835593560356135623563356435653566356735683569357035713572357335743575357635773578357935803581358235833584358535863587358835893590359135923593359435953596359735983599360036013602360336043605360636073608360936103611361236133614361536163617361836193620362136223623362436253626362736283629363036313632363336343635363636373638363936403641364236433644364536463647364836493650365136523653365436553656365736583659366036613662366336643665366636673668366936703671367236733674367536763677367836793680368136823683368436853686368736883689369036913692369336943695369636973698369937003701370237033704370537063707370837093710371137123713371437153716371737183719372037213722372337243725372637273728372937303731373237333734373537363737373837393740374137423743374437453746374737483749375037513752375337543755375637573758375937603761376237633764376537663767376837693770377137723773377437753776377737783779378037813782378337843785378637873788378937903791379237933794379537963797379837993800380138023803380438053806380738083809381038113812381338143815381638173818381938203821382238233824382538263827382838293830383138323833383438353836383738383839384038413842384338443845384638473848384938503851385238533854385538563857385838593860386138623863386438653866386738683869387038713872387338743875387638773878387938803881388238833884388538863887388838893890389138923893389438953896389738983899390039013902390339043905390639073908390939103911391239133914391539163917391839193920392139223923392439253926392739283929393039313932393339343935393639373938393939403941394239433944394539463947394839493950395139523953395439553956395739583959396039613962396339643965396639673968396939703971397239733974397539763977397839793980398139823983398439853986398739883989399039913992399339943995399639973998399940004001400240034004400540064007400840094010401140124013401440154016401740184019402040214022402340244025402640274028402940304031403240334034403540364037403840394040404140424043404440454046404740484049405040514052405340544055405640574058405940604061406240634064406540664067406840694070407140724073407440754076407740784079408040814082408340844085408640874088408940904091409240934094409540964097409840994100410141024103410441054106410741084109411041114112411341144115411641174118411941204121412241234124412541264127412841294130413141324133413441354136413741384139414041414142414341444145414641474148414941504151415241534154415541564157415841594160416141624163416441654166416741684169417041714172417341744175417641774178417941804181418241834184418541864187418841894190419141924193419441954196419741984199420042014202420342044205420642074208420942104211421242134214421542164217421842194220422142224223422442254226422742284229423042314232423342344235423642374238423942404241424242434244424542464247424842494250425142524253425442554256425742584259426042614262426342644265426642674268426942704271427242734274427542764277427842794280428142824283428442854286428742884289429042914292429342944295429642974298429943004301430243034304430543064307430843094310431143124313431443154316431743184319432043214322432343244325432643274328432943304331433243334334433543364337433843394340434143424343434443454346434743484349435043514352435343544355435643574358435943604361436243634364436543664367436843694370437143724373437443754376437743784379438043814382438343844385438643874388438943904391439243934394439543964397439843994400440144024403440444054406440744084409441044114412441344144415441644174418441944204421442244234424442544264427442844294430443144324433443444354436443744384439444044414442444344444445444644474448444944504451445244534454445544564457445844594460446144624463446444654466446744684469447044714472447344744475447644774478447944804481448244834484448544864487448844894490449144924493449444954496449744984499450045014502450345044505450645074508450945104511451245134514451545164517451845194520452145224523452445254526452745284529453045314532453345344535453645374538453945404541454245434544454545464547454845494550455145524553455445554556455745584559456045614562456345644565456645674568456945704571457245734574457545764577457845794580458145824583458445854586458745884589459045914592459345944595459645974598459946004601460246034604460546064607460846094610461146124613461446154616461746184619462046214622462346244625462646274628462946304631463246334634463546364637463846394640464146424643464446454646464746484649465046514652465346544655465646574658465946604661466246634664466546664667466846694670467146724673467446754676467746784679468046814682468346844685468646874688468946904691469246934694469546964697469846994700470147024703470447054706470747084709471047114712471347144715471647174718471947204721472247234724472547264727472847294730473147324733473447354736473747384739474047414742474347444745474647474748474947504751475247534754475547564757475847594760476147624763476447654766476747684769477047714772477347744775477647774778477947804781478247834784478547864787478847894790479147924793479447954796479747984799480048014802480348044805480648074808480948104811481248134814481548164817481848194820482148224823482448254826482748284829483048314832483348344835483648374838483948404841484248434844484548464847484848494850485148524853485448554856485748584859486048614862486348644865486648674868486948704871487248734874487548764877487848794880488148824883488448854886488748884889489048914892489348944895489648974898489949004901490249034904490549064907490849094910491149124913491449154916491749184919492049214922492349244925492649274928492949304931493249334934493549364937493849394940494149424943494449454946494749484949495049514952495349544955495649574958495949604961496249634964496549664967496849694970497149724973497449754976497749784979498049814982498349844985498649874988498949904991499249934994499549964997499849995000500150025003500450055006500750085009501050115012501350145015501650175018501950205021502250235024502550265027502850295030503150325033503450355036503750385039504050415042504350445045504650475048504950505051505250535054505550565057505850595060506150625063506450655066506750685069507050715072507350745075507650775078507950805081508250835084508550865087508850895090509150925093509450955096509750985099510051015102510351045105510651075108510951105111511251135114511551165117511851195120512151225123512451255126512751285129513051315132513351345135513651375138513951405141514251435144514551465147514851495150515151525153515451555156515751585159516051615162516351645165516651675168516951705171517251735174517551765177517851795180518151825183518451855186518751885189519051915192519351945195519651975198519952005201520252035204520552065207520852095210521152125213521452155216521752185219522052215222522352245225522652275228522952305231523252335234523552365237523852395240524152425243524452455246524752485249525052515252525352545255525652575258525952605261526252635264526552665267526852695270527152725273527452755276527752785279528052815282528352845285528652875288528952905291529252935294529552965297529852995300530153025303530453055306530753085309531053115312531353145315531653175318531953205321532253235324532553265327532853295330533153325333533453355336533753385339534053415342534353445345534653475348534953505351535253535354535553565357535853595360536153625363536453655366536753685369537053715372537353745375537653775378537953805381538253835384538553865387538853895390539153925393539453955396539753985399540054015402540354045405540654075408540954105411541254135414541554165417541854195420542154225423542454255426542754285429543054315432543354345435543654375438543954405441544254435444544554465447544854495450545154525453545454555456545754585459546054615462546354645465546654675468546954705471547254735474547554765477547854795480548154825483548454855486548754885489549054915492549354945495549654975498549955005501550255035504550555065507550855095510551155125513551455155516551755185519552055215522552355245525552655275528552955305531553255335534553555365537553855395540554155425543554455455546554755485549555055515552555355545555555655575558555955605561556255635564556555665567556855695570557155725573557455755576557755785579558055815582558355845585558655875588558955905591559255935594559555965597559855995600560156025603560456055606560756085609561056115612561356145615561656175618561956205621562256235624562556265627562856295630563156325633563456355636563756385639564056415642564356445645564656475648564956505651565256535654565556565657565856595660566156625663566456655666566756685669567056715672567356745675567656775678567956805681568256835684568556865687568856895690569156925693569456955696569756985699570057015702570357045705570657075708570957105711571257135714571557165717571857195720572157225723572457255726572757285729573057315732573357345735573657375738573957405741574257435744574557465747574857495750575157525753575457555756575757585759576057615762576357645765576657675768576957705771577257735774577557765777577857795780578157825783578457855786578757885789579057915792579357945795579657975798579958005801580258035804580558065807580858095810581158125813581458155816581758185819582058215822582358245825582658275828582958305831583258335834583558365837583858395840584158425843584458455846584758485849585058515852585358545855585658575858585958605861586258635864586558665867586858695870587158725873587458755876587758785879588058815882588358845885588658875888588958905891589258935894589558965897589858995900590159025903590459055906590759085909591059115912591359145915591659175918591959205921592259235924592559265927592859295930593159325933593459355936593759385939594059415942594359445945594659475948594959505951595259535954595559565957595859595960596159625963596459655966596759685969597059715972597359745975597659775978597959805981598259835984598559865987598859895990599159925993599459955996599759985999600060016002600360046005600660076008600960106011601260136014601560166017601860196020602160226023602460256026602760286029603060316032603360346035603660376038603960406041604260436044604560466047604860496050605160526053605460556056605760586059606060616062606360646065606660676068606960706071607260736074607560766077607860796080608160826083608460856086608760886089609060916092609360946095609660976098609961006101610261036104610561066107610861096110611161126113611461156116611761186119612061216122612361246125612661276128612961306131613261336134613561366137613861396140614161426143614461456146614761486149615061516152615361546155615661576158615961606161616261636164616561666167616861696170617161726173617461756176617761786179618061816182618361846185618661876188618961906191619261936194619561966197619861996200620162026203620462056206620762086209621062116212621362146215621662176218621962206221622262236224622562266227622862296230623162326233623462356236623762386239624062416242624362446245624662476248624962506251625262536254625562566257625862596260626162626263626462656266626762686269627062716272627362746275627662776278627962806281628262836284628562866287628862896290629162926293629462956296629762986299630063016302630363046305630663076308630963106311631263136314631563166317631863196320632163226323632463256326632763286329633063316332633363346335633663376338633963406341634263436344634563466347634863496350635163526353635463556356635763586359636063616362636363646365636663676368636963706371637263736374637563766377637863796380638163826383638463856386638763886389639063916392639363946395639663976398639964006401640264036404640564066407640864096410641164126413641464156416641764186419642064216422642364246425642664276428642964306431643264336434643564366437643864396440644164426443644464456446644764486449645064516452645364546455645664576458645964606461646264636464646564666467646864696470647164726473647464756476647764786479648064816482648364846485648664876488648964906491649264936494649564966497649864996500650165026503650465056506650765086509651065116512651365146515651665176518651965206521652265236524652565266527652865296530653165326533653465356536653765386539654065416542654365446545654665476548654965506551655265536554655565566557655865596560656165626563656465656566656765686569657065716572657365746575657665776578657965806581658265836584658565866587658865896590659165926593659465956596659765986599660066016602660366046605660666076608660966106611661266136614661566166617661866196620662166226623662466256626662766286629663066316632663366346635663666376638663966406641664266436644664566466647664866496650665166526653665466556656665766586659666066616662666366646665666666676668666966706671667266736674667566766677667866796680668166826683668466856686668766886689669066916692669366946695669666976698669967006701670267036704670567066707670867096710671167126713671467156716671767186719672067216722672367246725672667276728672967306731673267336734673567366737673867396740674167426743674467456746674767486749675067516752675367546755675667576758675967606761676267636764676567666767676867696770677167726773677467756776677767786779678067816782678367846785678667876788678967906791679267936794679567966797679867996800680168026803680468056806680768086809681068116812681368146815681668176818681968206821682268236824682568266827682868296830683168326833683468356836683768386839684068416842684368446845684668476848684968506851685268536854685568566857685868596860686168626863686468656866686768686869687068716872687368746875687668776878687968806881688268836884688568866887688868896890689168926893689468956896689768986899690069016902690369046905690669076908690969106911691269136914691569166917691869196920692169226923692469256926692769286929693069316932693369346935693669376938693969406941694269436944694569466947694869496950695169526953695469556956695769586959696069616962696369646965696669676968696969706971697269736974697569766977697869796980698169826983698469856986698769886989699069916992699369946995699669976998699970007001700270037004700570067007700870097010701170127013701470157016701770187019702070217022702370247025702670277028702970307031703270337034703570367037703870397040704170427043704470457046704770487049705070517052705370547055705670577058705970607061706270637064706570667067706870697070707170727073707470757076707770787079708070817082708370847085708670877088708970907091709270937094709570967097709870997100710171027103710471057106710771087109711071117112711371147115711671177118711971207121712271237124712571267127712871297130713171327133713471357136713771387139714071417142714371447145714671477148714971507151715271537154715571567157715871597160716171627163716471657166716771687169717071717172717371747175717671777178717971807181718271837184718571867187718871897190719171927193719471957196719771987199720072017202720372047205720672077208720972107211721272137214721572167217721872197220722172227223722472257226722772287229723072317232723372347235723672377238723972407241724272437244724572467247724872497250725172527253725472557256725772587259726072617262726372647265726672677268726972707271727272737274727572767277727872797280728172827283728472857286728772887289729072917292729372947295729672977298729973007301730273037304730573067307730873097310731173127313731473157316731773187319732073217322732373247325732673277328732973307331733273337334733573367337733873397340734173427343734473457346734773487349735073517352735373547355735673577358735973607361736273637364736573667367736873697370737173727373737473757376737773787379738073817382738373847385738673877388738973907391739273937394739573967397739873997400740174027403740474057406740774087409741074117412741374147415741674177418741974207421742274237424742574267427742874297430743174327433743474357436743774387439744074417442744374447445744674477448744974507451745274537454745574567457745874597460746174627463746474657466746774687469747074717472747374747475747674777478747974807481748274837484748574867487748874897490749174927493749474957496749774987499750075017502750375047505750675077508750975107511751275137514751575167517751875197520752175227523752475257526752775287529753075317532753375347535753675377538753975407541754275437544754575467547754875497550755175527553755475557556755775587559756075617562756375647565756675677568756975707571757275737574757575767577757875797580758175827583758475857586758775887589759075917592759375947595759675977598759976007601760276037604760576067607760876097610761176127613761476157616761776187619762076217622762376247625762676277628762976307631763276337634763576367637763876397640764176427643764476457646764776487649765076517652765376547655765676577658765976607661766276637664766576667667766876697670767176727673767476757676767776787679768076817682768376847685768676877688768976907691769276937694769576967697769876997700770177027703770477057706770777087709771077117712771377147715771677177718771977207721772277237724772577267727772877297730773177327733773477357736773777387739774077417742774377447745774677477748774977507751775277537754775577567757775877597760776177627763776477657766776777687769777077717772777377747775777677777778777977807781778277837784778577867787778877897790779177927793779477957796779777987799780078017802780378047805780678077808780978107811781278137814781578167817781878197820782178227823782478257826782778287829783078317832783378347835783678377838783978407841784278437844784578467847784878497850785178527853785478557856785778587859786078617862786378647865786678677868786978707871787278737874787578767877787878797880788178827883788478857886788778887889789078917892789378947895789678977898789979007901790279037904790579067907790879097910791179127913791479157916791779187919792079217922792379247925792679277928792979307931793279337934793579367937793879397940794179427943794479457946794779487949795079517952795379547955795679577958795979607961796279637964796579667967796879697970797179727973797479757976797779787979798079817982798379847985798679877988798979907991799279937994799579967997799879998000800180028003800480058006800780088009801080118012801380148015801680178018801980208021802280238024802580268027802880298030803180328033803480358036803780388039804080418042804380448045804680478048804980508051805280538054805580568057805880598060806180628063806480658066806780688069807080718072807380748075807680778078807980808081808280838084808580868087808880898090809180928093809480958096809780988099810081018102810381048105810681078108810981108111811281138114811581168117811881198120812181228123812481258126812781288129813081318132813381348135813681378138813981408141814281438144814581468147814881498150815181528153815481558156815781588159816081618162816381648165816681678168816981708171817281738174817581768177817881798180818181828183818481858186818781888189819081918192819381948195819681978198819982008201820282038204820582068207820882098210821182128213821482158216821782188219822082218222822382248225822682278228822982308231823282338234823582368237823882398240824182428243824482458246824782488249825082518252825382548255825682578258825982608261826282638264826582668267826882698270827182728273827482758276827782788279828082818282828382848285828682878288828982908291829282938294829582968297829882998300830183028303830483058306830783088309831083118312831383148315831683178318831983208321832283238324832583268327832883298330833183328333833483358336833783388339834083418342834383448345834683478348834983508351835283538354835583568357835883598360836183628363836483658366836783688369837083718372837383748375837683778378837983808381838283838384838583868387838883898390839183928393839483958396839783988399840084018402840384048405840684078408840984108411841284138414841584168417841884198420842184228423842484258426842784288429843084318432843384348435843684378438843984408441844284438444844584468447844884498450845184528453845484558456845784588459846084618462846384648465846684678468846984708471847284738474847584768477847884798480848184828483848484858486848784888489849084918492849384948495849684978498849985008501850285038504850585068507850885098510851185128513851485158516851785188519852085218522852385248525852685278528852985308531853285338534853585368537853885398540854185428543854485458546854785488549855085518552855385548555855685578558855985608561856285638564856585668567856885698570857185728573857485758576857785788579858085818582858385848585858685878588858985908591859285938594859585968597859885998600860186028603860486058606860786088609861086118612861386148615861686178618861986208621862286238624862586268627862886298630863186328633863486358636863786388639864086418642864386448645864686478648864986508651865286538654865586568657865886598660866186628663866486658666866786688669867086718672867386748675867686778678867986808681868286838684868586868687868886898690869186928693869486958696869786988699870087018702870387048705870687078708870987108711871287138714871587168717871887198720872187228723872487258726872787288729873087318732873387348735873687378738873987408741874287438744874587468747874887498750875187528753875487558756875787588759876087618762876387648765876687678768876987708771877287738774877587768777877887798780878187828783878487858786878787888789879087918792879387948795879687978798879988008801880288038804880588068807880888098810881188128813881488158816881788188819882088218822882388248825882688278828882988308831883288338834883588368837883888398840884188428843884488458846884788488849885088518852885388548855885688578858885988608861886288638864886588668867886888698870887188728873887488758876887788788879888088818882888388848885888688878888888988908891889288938894889588968897889888998900890189028903890489058906890789088909891089118912891389148915891689178918891989208921892289238924892589268927892889298930893189328933893489358936893789388939894089418942894389448945894689478948894989508951895289538954895589568957895889598960896189628963896489658966896789688969897089718972897389748975897689778978897989808981898289838984898589868987898889898990899189928993899489958996899789988999900090019002900390049005900690079008900990109011901290139014901590169017901890199020902190229023902490259026902790289029903090319032903390349035903690379038903990409041904290439044904590469047904890499050905190529053905490559056905790589059906090619062906390649065906690679068906990709071907290739074907590769077907890799080908190829083908490859086908790889089909090919092909390949095909690979098909991009101910291039104910591069107910891099110911191129113911491159116911791189119912091219122912391249125912691279128912991309131913291339134913591369137913891399140914191429143914491459146914791489149915091519152915391549155915691579158915991609161916291639164916591669167916891699170917191729173917491759176917791789179918091819182918391849185918691879188918991909191919291939194919591969197919891999200920192029203920492059206920792089209921092119212921392149215921692179218921992209221922292239224922592269227922892299230923192329233923492359236923792389239924092419242924392449245924692479248924992509251925292539254925592569257925892599260926192629263926492659266926792689269927092719272927392749275927692779278927992809281928292839284928592869287928892899290929192929293929492959296929792989299930093019302930393049305930693079308930993109311931293139314931593169317931893199320932193229323932493259326932793289329933093319332933393349335933693379338933993409341934293439344934593469347934893499350935193529353935493559356935793589359936093619362936393649365936693679368936993709371937293739374937593769377937893799380938193829383938493859386938793889389939093919392939393949395939693979398939994009401940294039404940594069407940894099410941194129413941494159416941794189419942094219422942394249425942694279428942994309431943294339434943594369437943894399440944194429443944494459446944794489449945094519452945394549455945694579458945994609461946294639464946594669467946894699470947194729473947494759476947794789479948094819482948394849485948694879488948994909491949294939494949594969497949894999500950195029503950495059506950795089509951095119512951395149515951695179518951995209521952295239524952595269527952895299530953195329533953495359536953795389539954095419542954395449545954695479548954995509551955295539554955595569557955895599560956195629563956495659566956795689569957095719572957395749575957695779578957995809581958295839584958595869587958895899590959195929593959495959596959795989599960096019602960396049605960696079608960996109611961296139614961596169617961896199620962196229623962496259626962796289629963096319632963396349635963696379638963996409641964296439644964596469647964896499650965196529653965496559656965796589659966096619662966396649665966696679668966996709671967296739674967596769677967896799680968196829683968496859686968796889689969096919692969396949695969696979698969997009701970297039704970597069707970897099710971197129713971497159716971797189719972097219722972397249725972697279728972997309731973297339734973597369737973897399740974197429743974497459746974797489749975097519752975397549755975697579758975997609761976297639764976597669767976897699770977197729773977497759776977797789779978097819782978397849785978697879788978997909791979297939794979597969797979897999800980198029803980498059806980798089809981098119812981398149815981698179818981998209821982298239824982598269827982898299830983198329833983498359836983798389839984098419842984398449845984698479848984998509851985298539854985598569857985898599860986198629863986498659866986798689869987098719872987398749875987698779878987998809881988298839884988598869887988898899890989198929893989498959896989798989899990099019902990399049905990699079908990999109911991299139914991599169917991899199920992199229923992499259926992799289929993099319932993399349935993699379938993999409941994299439944994599469947994899499950995199529953995499559956995799589959996099619962996399649965996699679968996999709971997299739974997599769977997899799980998199829983998499859986998799889989999099919992999399949995999699979998999910000100011000210003100041000510006100071000810009100101001110012100131001410015100161001710018100191002010021100221002310024100251002610027100281002910030100311003210033100341003510036100371003810039100401004110042100431004410045100461004710048100491005010051100521005310054100551005610057100581005910060100611006210063100641006510066100671006810069100701007110072100731007410075100761007710078100791008010081100821008310084100851008610087100881008910090100911009210093100941009510096100971009810099101001010110102101031010410105101061010710108101091011010111101121011310114101151011610117101181011910120101211012210123101241012510126101271012810129101301013110132101331013410135101361013710138101391014010141101421014310144101451014610147101481014910150101511015210153101541015510156101571015810159101601016110162101631016410165101661016710168101691017010171101721017310174101751017610177101781017910180101811018210183101841018510186101871018810189101901019110192101931019410195101961019710198101991020010201102021020310204102051020610207102081020910210102111021210213102141021510216102171021810219102201022110222102231022410225102261022710228102291023010231102321023310234102351023610237102381023910240102411024210243102441024510246102471024810249102501025110252102531025410255102561025710258102591026010261102621026310264102651026610267102681026910270102711027210273102741027510276102771027810279102801028110282102831028410285102861028710288102891029010291102921029310294102951029610297102981029910300103011030210303103041030510306103071030810309103101031110312103131031410315103161031710318103191032010321103221032310324103251032610327103281032910330103311033210333103341033510336103371033810339103401034110342103431034410345103461034710348103491035010351103521035310354103551035610357103581035910360103611036210363103641036510366103671036810369103701037110372103731037410375103761037710378103791038010381103821038310384103851038610387103881038910390103911039210393103941039510396103971039810399104001040110402104031040410405104061040710408104091041010411104121041310414104151041610417104181041910420104211042210423104241042510426104271042810429104301043110432104331043410435104361043710438104391044010441104421044310444104451044610447104481044910450104511045210453104541045510456104571045810459104601046110462104631046410465104661046710468104691047010471104721047310474104751047610477104781047910480104811048210483104841048510486104871048810489104901049110492104931049410495104961049710498104991050010501105021050310504105051050610507105081050910510105111051210513105141051510516105171051810519105201052110522105231052410525105261052710528105291053010531105321053310534105351053610537105381053910540105411054210543105441054510546105471054810549105501055110552105531055410555105561055710558105591056010561105621056310564105651056610567105681056910570105711057210573105741057510576105771057810579105801058110582105831058410585105861058710588105891059010591105921059310594105951059610597105981059910600106011060210603106041060510606106071060810609106101061110612106131061410615106161061710618106191062010621106221062310624106251062610627106281062910630106311063210633106341063510636106371063810639106401064110642106431064410645106461064710648106491065010651106521065310654106551065610657106581065910660106611066210663106641066510666106671066810669106701067110672106731067410675106761067710678106791068010681106821068310684106851068610687106881068910690106911069210693106941069510696106971069810699107001070110702107031070410705107061070710708107091071010711107121071310714107151071610717107181071910720107211072210723107241072510726107271072810729107301073110732107331073410735107361073710738107391074010741107421074310744107451074610747107481074910750107511075210753107541075510756107571075810759107601076110762107631076410765107661076710768107691077010771107721077310774107751077610777107781077910780107811078210783107841078510786107871078810789107901079110792107931079410795107961079710798107991080010801108021080310804108051080610807108081080910810108111081210813108141081510816108171081810819108201082110822108231082410825108261082710828108291083010831108321083310834108351083610837108381083910840108411084210843108441084510846108471084810849108501085110852108531085410855108561085710858108591086010861108621086310864108651086610867108681086910870108711087210873108741087510876108771087810879108801088110882108831088410885108861088710888108891089010891108921089310894108951089610897108981089910900109011090210903109041090510906109071090810909109101091110912109131091410915109161091710918109191092010921109221092310924109251092610927109281092910930109311093210933109341093510936109371093810939109401094110942109431094410945109461094710948109491095010951109521095310954109551095610957109581095910960109611096210963109641096510966109671096810969109701097110972109731097410975109761097710978109791098010981109821098310984109851098610987109881098910990109911099210993109941099510996109971099810999110001100111002110031100411005110061100711008110091101011011110121101311014110151101611017110181101911020110211102211023110241102511026110271102811029110301103111032110331103411035110361103711038110391104011041110421104311044110451104611047110481104911050110511105211053110541105511056110571105811059110601106111062110631106411065110661106711068110691107011071110721107311074110751107611077110781107911080110811108211083110841108511086110871108811089110901109111092110931109411095110961109711098110991110011101111021110311104111051110611107111081110911110111111111211113111141111511116111171111811119111201112111122111231112411125111261112711128111291113011131111321113311134111351113611137111381113911140111411114211143111441114511146111471114811149111501115111152111531115411155111561115711158111591116011161111621116311164111651116611167111681116911170111711117211173111741117511176111771117811179111801118111182111831118411185111861118711188111891119011191111921119311194111951119611197111981119911200112011120211203112041120511206112071120811209112101121111212112131121411215112161121711218112191122011221112221122311224112251122611227112281122911230112311123211233112341123511236112371123811239112401124111242112431124411245112461124711248112491125011251112521125311254112551125611257112581125911260112611126211263112641126511266112671126811269112701127111272112731127411275112761127711278112791128011281112821128311284112851128611287112881128911290112911129211293112941129511296112971129811299113001130111302113031130411305113061130711308113091131011311113121131311314113151131611317113181131911320113211132211323113241132511326113271132811329113301133111332113331133411335113361133711338113391134011341113421134311344113451134611347113481134911350113511135211353113541135511356113571135811359113601136111362113631136411365113661136711368113691137011371113721137311374113751137611377113781137911380113811138211383113841138511386113871138811389113901139111392113931139411395113961139711398113991140011401114021140311404114051140611407114081140911410114111141211413114141141511416114171141811419114201142111422114231142411425114261142711428114291143011431114321143311434114351143611437114381143911440114411144211443114441144511446114471144811449114501145111452114531145411455114561145711458114591146011461114621146311464114651146611467114681146911470114711147211473114741147511476114771147811479114801148111482114831148411485114861148711488114891149011491114921149311494114951149611497114981149911500115011150211503115041150511506115071150811509115101151111512115131151411515115161151711518115191152011521115221152311524115251152611527115281152911530115311153211533115341153511536115371153811539115401154111542115431154411545115461154711548115491155011551115521155311554115551155611557115581155911560115611156211563115641156511566115671156811569115701157111572115731157411575115761157711578115791158011581115821158311584115851158611587115881158911590115911159211593115941159511596115971159811599116001160111602116031160411605116061160711608116091161011611116121161311614116151161611617116181161911620116211162211623116241162511626116271162811629116301163111632116331163411635116361163711638116391164011641116421164311644116451164611647116481164911650116511165211653116541165511656116571165811659116601166111662116631166411665116661166711668116691167011671116721167311674116751167611677116781167911680116811168211683116841168511686116871168811689116901169111692116931169411695116961169711698116991170011701117021170311704117051170611707117081170911710117111171211713117141171511716117171171811719117201172111722117231172411725117261172711728117291173011731117321173311734117351173611737117381173911740117411174211743117441174511746117471174811749117501175111752117531175411755117561175711758117591176011761117621176311764117651176611767117681176911770117711177211773117741177511776117771177811779117801178111782117831178411785117861178711788117891179011791117921179311794117951179611797117981179911800118011180211803118041180511806118071180811809118101181111812118131181411815118161181711818118191182011821118221182311824118251182611827118281182911830118311183211833118341183511836118371183811839118401184111842118431184411845118461184711848118491185011851118521185311854118551185611857118581185911860118611186211863118641186511866118671186811869118701187111872118731187411875118761187711878118791188011881118821188311884118851188611887118881188911890118911189211893118941189511896118971189811899119001190111902119031190411905119061190711908119091191011911119121191311914119151191611917119181191911920119211192211923119241192511926119271192811929119301193111932119331193411935119361193711938119391194011941119421194311944119451194611947119481194911950119511195211953119541195511956119571195811959119601196111962119631196411965119661196711968119691197011971119721197311974119751197611977119781197911980119811198211983119841198511986119871198811989119901199111992119931199411995119961199711998119991200012001120021200312004120051200612007120081200912010120111201212013120141201512016120171201812019120201202112022120231202412025120261202712028120291203012031120321203312034120351203612037120381203912040120411204212043120441204512046120471204812049120501205112052120531205412055120561205712058120591206012061120621206312064120651206612067120681206912070120711207212073120741207512076120771207812079120801208112082120831208412085120861208712088120891209012091120921209312094120951209612097120981209912100121011210212103121041210512106121071210812109121101211112112121131211412115121161211712118121191212012121121221212312124121251212612127121281212912130121311213212133121341213512136121371213812139121401214112142121431214412145121461214712148121491215012151121521215312154121551215612157121581215912160121611216212163121641216512166121671216812169121701217112172121731217412175121761217712178121791218012181121821218312184121851218612187121881218912190121911219212193121941219512196121971219812199122001220112202122031220412205122061220712208122091221012211122121221312214122151221612217122181221912220122211222212223122241222512226122271222812229122301223112232122331223412235122361223712238122391224012241122421224312244122451224612247122481224912250122511225212253122541225512256122571225812259122601226112262122631226412265122661226712268122691227012271122721227312274122751227612277122781227912280122811228212283122841228512286122871228812289122901229112292122931229412295122961229712298122991230012301123021230312304123051230612307123081230912310123111231212313123141231512316123171231812319123201232112322123231232412325123261232712328123291233012331123321233312334123351233612337123381233912340123411234212343123441234512346123471234812349123501235112352123531235412355123561235712358123591236012361123621236312364123651236612367123681236912370123711237212373123741237512376123771237812379123801238112382123831238412385123861238712388123891239012391123921239312394123951239612397123981239912400124011240212403124041240512406124071240812409124101241112412124131241412415124161241712418124191242012421124221242312424124251242612427124281242912430124311243212433124341243512436124371243812439124401244112442124431244412445124461244712448124491245012451124521245312454124551245612457124581245912460124611246212463124641246512466124671246812469124701247112472124731247412475124761247712478124791248012481124821248312484124851248612487124881248912490124911249212493124941249512496124971249812499125001250112502125031250412505125061250712508125091251012511125121251312514125151251612517125181251912520125211252212523125241252512526125271252812529125301253112532125331253412535125361253712538125391254012541125421254312544125451254612547125481254912550125511255212553125541255512556125571255812559125601256112562125631256412565125661256712568125691257012571125721257312574125751257612577125781257912580125811258212583125841258512586125871258812589125901259112592125931259412595125961259712598125991260012601126021260312604126051260612607126081260912610126111261212613126141261512616126171261812619126201262112622126231262412625126261262712628126291263012631126321263312634126351263612637126381263912640126411264212643126441264512646126471264812649126501265112652126531265412655126561265712658126591266012661126621266312664126651266612667126681266912670126711267212673126741267512676126771267812679126801268112682126831268412685126861268712688126891269012691126921269312694126951269612697126981269912700127011270212703127041270512706127071270812709127101271112712127131271412715127161271712718127191272012721127221272312724127251272612727127281272912730127311273212733127341273512736127371273812739127401274112742127431274412745127461274712748127491275012751127521275312754127551275612757127581275912760127611276212763127641276512766127671276812769127701277112772127731277412775127761277712778127791278012781127821278312784127851278612787127881278912790127911279212793127941279512796127971279812799128001280112802128031280412805128061280712808128091281012811128121281312814128151281612817128181281912820128211282212823128241282512826128271282812829128301283112832128331283412835128361283712838128391284012841128421284312844128451284612847128481284912850128511285212853128541285512856128571285812859128601286112862128631286412865128661286712868128691287012871128721287312874128751287612877128781287912880128811288212883128841288512886128871288812889128901289112892128931289412895128961289712898128991290012901129021290312904129051290612907129081290912910129111291212913129141291512916129171291812919129201292112922129231292412925129261292712928129291293012931129321293312934129351293612937129381293912940129411294212943129441294512946129471294812949129501295112952129531295412955129561295712958129591296012961129621296312964129651296612967129681296912970129711297212973129741297512976129771297812979129801298112982129831298412985129861298712988129891299012991129921299312994129951299612997129981299913000130011300213003130041300513006130071300813009130101301113012130131301413015130161301713018130191302013021130221302313024130251302613027130281302913030130311303213033130341303513036130371303813039130401304113042130431304413045130461304713048130491305013051130521305313054130551305613057130581305913060130611306213063130641306513066130671306813069130701307113072130731307413075130761307713078130791308013081130821308313084130851308613087130881308913090130911309213093130941309513096130971309813099131001310113102131031310413105131061310713108131091311013111131121311313114131151311613117131181311913120131211312213123131241312513126131271312813129131301313113132131331313413135131361313713138131391314013141131421314313144131451314613147131481314913150131511315213153131541315513156131571315813159131601316113162131631316413165131661316713168131691317013171131721317313174131751317613177131781317913180131811318213183131841318513186131871318813189131901319113192131931319413195131961319713198131991320013201132021320313204132051320613207132081320913210132111321213213132141321513216132171321813219132201322113222132231322413225132261322713228132291323013231132321323313234132351323613237132381323913240132411324213243132441324513246132471324813249132501325113252132531325413255132561325713258132591326013261132621326313264132651326613267132681326913270132711327213273132741327513276132771327813279132801328113282132831328413285132861328713288132891329013291132921329313294132951329613297132981329913300133011330213303133041330513306133071330813309133101331113312133131331413315133161331713318133191332013321133221332313324133251332613327133281332913330133311333213333133341333513336133371333813339133401334113342133431334413345133461334713348133491335013351133521335313354133551335613357133581335913360133611336213363133641336513366133671336813369133701337113372133731337413375133761337713378133791338013381133821338313384133851338613387133881338913390133911339213393133941339513396133971339813399134001340113402134031340413405134061340713408134091341013411134121341313414134151341613417134181341913420134211342213423134241342513426134271342813429134301343113432134331343413435134361343713438134391344013441134421344313444134451344613447134481344913450134511345213453134541345513456134571345813459134601346113462134631346413465134661346713468134691347013471134721347313474134751347613477134781347913480134811348213483134841348513486134871348813489134901349113492134931349413495134961349713498134991350013501135021350313504135051350613507135081350913510135111351213513135141351513516135171351813519135201352113522135231352413525135261352713528135291353013531135321353313534135351353613537135381353913540135411354213543135441354513546135471354813549135501355113552135531355413555135561355713558135591356013561135621356313564135651356613567135681356913570135711357213573135741357513576135771357813579135801358113582135831358413585135861358713588135891359013591135921359313594135951359613597135981359913600136011360213603136041360513606136071360813609136101361113612136131361413615136161361713618136191362013621136221362313624136251362613627136281362913630136311363213633136341363513636136371363813639136401364113642136431364413645136461364713648136491365013651136521365313654136551365613657136581365913660136611366213663136641366513666136671366813669136701367113672136731367413675136761367713678136791368013681136821368313684136851368613687136881368913690136911369213693136941369513696136971369813699137001370113702137031370413705137061370713708137091371013711137121371313714137151371613717137181371913720137211372213723137241372513726137271372813729137301373113732137331373413735137361373713738137391374013741137421374313744137451374613747137481374913750137511375213753137541375513756137571375813759137601376113762137631376413765137661376713768137691377013771137721377313774137751377613777137781377913780137811378213783137841378513786137871378813789137901379113792137931379413795137961379713798137991380013801138021380313804138051380613807138081380913810138111381213813138141381513816138171381813819138201382113822138231382413825138261382713828138291383013831138321383313834138351383613837138381383913840138411384213843138441384513846138471384813849138501385113852138531385413855138561385713858138591386013861138621386313864138651386613867138681386913870138711387213873138741387513876138771387813879138801388113882138831388413885138861388713888138891389013891138921389313894138951389613897138981389913900139011390213903139041390513906139071390813909139101391113912139131391413915139161391713918139191392013921139221392313924139251392613927139281392913930139311393213933139341393513936139371393813939139401394113942139431394413945139461394713948139491395013951139521395313954139551395613957139581395913960139611396213963139641396513966139671396813969139701397113972139731397413975139761397713978139791398013981139821398313984139851398613987139881398913990139911399213993139941399513996139971399813999140001400114002140031400414005140061400714008140091401014011140121401314014140151401614017140181401914020140211402214023140241402514026140271402814029140301403114032140331403414035140361403714038140391404014041140421404314044140451404614047140481404914050140511405214053140541405514056140571405814059140601406114062140631406414065140661406714068140691407014071140721407314074140751407614077140781407914080140811408214083140841408514086140871408814089140901409114092140931409414095140961409714098140991410014101141021410314104141051410614107141081410914110141111411214113141141411514116141171411814119141201412114122141231412414125141261412714128141291413014131141321413314134141351413614137141381413914140141411414214143141441414514146141471414814149141501415114152141531415414155141561415714158141591416014161141621416314164141651416614167141681416914170141711417214173141741417514176141771417814179141801418114182141831418414185141861418714188141891419014191141921419314194141951419614197141981419914200142011420214203142041420514206142071420814209142101421114212142131421414215142161421714218142191422014221142221422314224142251422614227142281422914230142311423214233142341423514236142371423814239142401424114242142431424414245142461424714248142491425014251142521425314254142551425614257142581425914260142611426214263142641426514266142671426814269142701427114272142731427414275142761427714278142791428014281142821428314284142851428614287142881428914290142911429214293142941429514296142971429814299143001430114302143031430414305143061430714308143091431014311143121431314314143151431614317143181431914320143211432214323143241432514326143271432814329143301433114332143331433414335143361433714338143391434014341143421434314344143451434614347143481434914350143511435214353143541435514356143571435814359143601436114362143631436414365143661436714368143691437014371143721437314374143751437614377143781437914380143811438214383143841438514386143871438814389143901439114392143931439414395143961439714398143991440014401144021440314404144051440614407144081440914410144111441214413144141441514416144171441814419144201442114422144231442414425144261442714428144291443014431144321443314434144351443614437144381443914440144411444214443144441444514446144471444814449144501445114452144531445414455144561445714458144591446014461144621446314464144651446614467144681446914470144711447214473144741447514476144771447814479144801448114482144831448414485144861448714488144891449014491144921449314494144951449614497144981449914500145011450214503145041450514506145071450814509145101451114512145131451414515145161451714518145191452014521145221452314524145251452614527145281452914530145311453214533145341453514536145371453814539145401454114542145431454414545145461454714548145491455014551145521455314554145551455614557145581455914560145611456214563145641456514566145671456814569145701457114572145731457414575145761457714578145791458014581145821458314584145851458614587145881458914590145911459214593145941459514596145971459814599146001460114602146031460414605146061460714608146091461014611146121461314614146151461614617146181461914620146211462214623146241462514626146271462814629146301463114632146331463414635146361463714638146391464014641146421464314644146451464614647146481464914650146511465214653146541465514656146571465814659146601466114662146631466414665146661466714668146691467014671146721467314674146751467614677146781467914680146811468214683146841468514686146871468814689146901469114692146931469414695146961469714698146991470014701147021470314704147051470614707147081470914710147111471214713147141471514716147171471814719147201472114722147231472414725147261472714728147291473014731147321473314734147351473614737147381473914740147411474214743147441474514746147471474814749147501475114752147531475414755147561475714758147591476014761147621476314764147651476614767147681476914770147711477214773147741477514776147771477814779147801478114782147831478414785147861478714788147891479014791147921479314794147951479614797147981479914800148011480214803148041480514806148071480814809148101481114812148131481414815148161481714818148191482014821148221482314824148251482614827148281482914830148311483214833148341483514836148371483814839148401484114842148431484414845148461484714848148491485014851148521485314854148551485614857148581485914860148611486214863148641486514866148671486814869148701487114872148731487414875148761487714878148791488014881148821488314884148851488614887148881488914890148911489214893148941489514896148971489814899149001490114902149031490414905149061490714908149091491014911149121491314914149151491614917149181491914920149211492214923149241492514926149271492814929149301493114932149331493414935149361493714938149391494014941149421494314944149451494614947149481494914950149511495214953149541495514956149571495814959149601496114962149631496414965149661496714968149691497014971149721497314974149751497614977149781497914980149811498214983149841498514986149871498814989149901499114992149931499414995149961499714998149991500015001150021500315004150051500615007150081500915010150111501215013150141501515016150171501815019150201502115022150231502415025150261502715028150291503015031150321503315034150351503615037150381503915040150411504215043150441504515046150471504815049150501505115052150531505415055150561505715058150591506015061150621506315064150651506615067150681506915070150711507215073150741507515076150771507815079150801508115082150831508415085150861508715088150891509015091150921509315094150951509615097150981509915100151011510215103151041510515106151071510815109151101511115112151131511415115151161511715118151191512015121151221512315124151251512615127151281512915130151311513215133151341513515136151371513815139151401514115142151431514415145151461514715148151491515015151151521515315154151551515615157151581515915160151611516215163151641516515166151671516815169151701517115172151731517415175151761517715178151791518015181151821518315184151851518615187151881518915190151911519215193151941519515196151971519815199152001520115202152031520415205152061520715208152091521015211152121521315214152151521615217152181521915220152211522215223152241522515226152271522815229152301523115232152331523415235152361523715238152391524015241152421524315244152451524615247152481524915250152511525215253152541525515256152571525815259152601526115262152631526415265152661526715268152691527015271152721527315274152751527615277152781527915280152811528215283152841528515286152871528815289152901529115292152931529415295152961529715298152991530015301153021530315304153051530615307153081530915310153111531215313153141531515316153171531815319153201532115322153231532415325153261532715328153291533015331153321533315334153351533615337153381533915340153411534215343153441534515346153471534815349153501535115352153531535415355153561535715358153591536015361153621536315364153651536615367153681536915370153711537215373153741537515376153771537815379153801538115382153831538415385153861538715388153891539015391153921539315394153951539615397153981539915400154011540215403154041540515406154071540815409154101541115412154131541415415154161541715418154191542015421154221542315424154251542615427154281542915430154311543215433154341543515436154371543815439154401544115442154431544415445154461544715448154491545015451154521545315454154551545615457154581545915460154611546215463154641546515466154671546815469154701547115472154731547415475154761547715478154791548015481154821548315484154851548615487154881548915490154911549215493154941549515496154971549815499155001550115502155031550415505155061550715508155091551015511155121551315514155151551615517155181551915520155211552215523155241552515526155271552815529155301553115532155331553415535155361553715538155391554015541155421554315544155451554615547155481554915550155511555215553155541555515556155571555815559155601556115562155631556415565155661556715568155691557015571155721557315574155751557615577155781557915580155811558215583155841558515586155871558815589155901559115592155931559415595155961559715598155991560015601156021560315604156051560615607156081560915610156111561215613156141561515616156171561815619156201562115622156231562415625156261562715628156291563015631156321563315634156351563615637156381563915640156411564215643156441564515646156471564815649156501565115652156531565415655156561565715658156591566015661156621566315664156651566615667156681566915670156711567215673156741567515676156771567815679156801568115682156831568415685156861568715688156891569015691156921569315694156951569615697156981569915700157011570215703157041570515706157071570815709157101571115712157131571415715157161571715718157191572015721157221572315724157251572615727157281572915730157311573215733157341573515736157371573815739157401574115742157431574415745157461574715748157491575015751157521575315754157551575615757157581575915760157611576215763157641576515766157671576815769157701577115772157731577415775157761577715778157791578015781157821578315784157851578615787157881578915790157911579215793157941579515796157971579815799158001580115802158031580415805158061580715808158091581015811158121581315814158151581615817158181581915820158211582215823158241582515826158271582815829158301583115832158331583415835158361583715838158391584015841158421584315844158451584615847158481584915850158511585215853158541585515856158571585815859158601586115862158631586415865158661586715868158691587015871158721587315874158751587615877158781587915880158811588215883158841588515886158871588815889158901589115892158931589415895158961589715898158991590015901159021590315904159051590615907159081590915910159111591215913159141591515916159171591815919159201592115922159231592415925159261592715928159291593015931159321593315934159351593615937159381593915940159411594215943159441594515946159471594815949159501595115952159531595415955159561595715958159591596015961159621596315964159651596615967159681596915970159711597215973159741597515976159771597815979159801598115982159831598415985159861598715988159891599015991159921599315994159951599615997159981599916000160011600216003160041600516006160071600816009160101601116012160131601416015160161601716018160191602016021160221602316024160251602616027160281602916030160311603216033160341603516036160371603816039160401604116042160431604416045160461604716048160491605016051160521605316054160551605616057160581605916060160611606216063160641606516066160671606816069160701607116072160731607416075160761607716078160791608016081160821608316084160851608616087160881608916090160911609216093160941609516096160971609816099161001610116102161031610416105161061610716108161091611016111161121611316114161151611616117161181611916120161211612216123161241612516126161271612816129161301613116132161331613416135161361613716138161391614016141161421614316144161451614616147161481614916150161511615216153161541615516156161571615816159161601616116162161631616416165161661616716168161691617016171161721617316174161751617616177161781617916180161811618216183161841618516186161871618816189161901619116192161931619416195161961619716198161991620016201162021620316204162051620616207162081620916210162111621216213162141621516216162171621816219162201622116222162231622416225162261622716228162291623016231162321623316234162351623616237162381623916240162411624216243162441624516246162471624816249162501625116252162531625416255162561625716258162591626016261162621626316264162651626616267162681626916270162711627216273162741627516276162771627816279162801628116282162831628416285162861628716288162891629016291162921629316294162951629616297162981629916300163011630216303163041630516306163071630816309163101631116312163131631416315163161631716318163191632016321163221632316324163251632616327163281632916330163311633216333163341633516336163371633816339163401634116342163431634416345163461634716348163491635016351163521635316354163551635616357163581635916360163611636216363163641636516366163671636816369163701637116372163731637416375163761637716378163791638016381163821638316384163851638616387163881638916390163911639216393163941639516396163971639816399164001640116402164031640416405164061640716408164091641016411164121641316414164151641616417164181641916420164211642216423164241642516426164271642816429164301643116432164331643416435164361643716438164391644016441164421644316444164451644616447164481644916450164511645216453164541645516456164571645816459164601646116462164631646416465164661646716468164691647016471164721647316474164751647616477164781647916480164811648216483164841648516486164871648816489164901649116492164931649416495164961649716498164991650016501165021650316504165051650616507165081650916510165111651216513165141651516516165171651816519165201652116522165231652416525165261652716528165291653016531165321653316534165351653616537165381653916540165411654216543165441654516546165471654816549165501655116552165531655416555165561655716558165591656016561165621656316564165651656616567165681656916570165711657216573165741657516576165771657816579165801658116582165831658416585165861658716588165891659016591165921659316594165951659616597165981659916600166011660216603166041660516606166071660816609166101661116612166131661416615166161661716618166191662016621166221662316624166251662616627166281662916630166311663216633166341663516636166371663816639166401664116642166431664416645166461664716648166491665016651166521665316654166551665616657166581665916660166611666216663166641666516666166671666816669166701667116672166731667416675166761667716678166791668016681166821668316684166851668616687166881668916690166911669216693166941669516696166971669816699167001670116702167031670416705167061670716708167091671016711167121671316714167151671616717167181671916720167211672216723167241672516726167271672816729167301673116732167331673416735167361673716738167391674016741167421674316744167451674616747167481674916750167511675216753167541675516756167571675816759167601676116762167631676416765167661676716768167691677016771167721677316774167751677616777167781677916780167811678216783167841678516786167871678816789167901679116792167931679416795167961679716798167991680016801168021680316804168051680616807168081680916810168111681216813168141681516816168171681816819168201682116822168231682416825168261682716828168291683016831168321683316834168351683616837168381683916840168411684216843168441684516846168471684816849168501685116852168531685416855168561685716858168591686016861168621686316864168651686616867168681686916870168711687216873168741687516876168771687816879168801688116882168831688416885168861688716888168891689016891168921689316894168951689616897168981689916900169011690216903169041690516906169071690816909169101691116912169131691416915169161691716918169191692016921169221692316924169251692616927169281692916930169311693216933169341693516936169371693816939169401694116942169431694416945169461694716948169491695016951169521695316954169551695616957169581695916960169611696216963169641696516966169671696816969169701697116972169731697416975169761697716978169791698016981169821698316984169851698616987169881698916990169911699216993169941699516996169971699816999170001700117002170031700417005170061700717008170091701017011170121701317014170151701617017170181701917020170211702217023170241702517026170271702817029170301703117032170331703417035170361703717038170391704017041170421704317044170451704617047170481704917050170511705217053170541705517056170571705817059170601706117062170631706417065170661706717068170691707017071170721707317074170751707617077170781707917080170811708217083170841708517086170871708817089170901709117092170931709417095170961709717098170991710017101171021710317104171051710617107171081710917110171111711217113171141711517116171171711817119171201712117122171231712417125171261712717128171291713017131171321713317134171351713617137171381713917140171411714217143171441714517146171471714817149171501715117152171531715417155171561715717158171591716017161171621716317164171651716617167171681716917170171711717217173171741717517176171771717817179171801718117182171831718417185171861718717188171891719017191171921719317194171951719617197171981719917200172011720217203172041720517206172071720817209172101721117212172131721417215172161721717218172191722017221172221722317224172251722617227172281722917230172311723217233172341723517236172371723817239172401724117242172431724417245172461724717248172491725017251172521725317254172551725617257172581725917260172611726217263172641726517266172671726817269172701727117272172731727417275172761727717278172791728017281172821728317284172851728617287172881728917290172911729217293172941729517296172971729817299173001730117302173031730417305173061730717308173091731017311173121731317314173151731617317173181731917320173211732217323173241732517326173271732817329173301733117332173331733417335173361733717338173391734017341173421734317344173451734617347173481734917350173511735217353173541735517356173571735817359173601736117362173631736417365173661736717368173691737017371173721737317374173751737617377173781737917380173811738217383173841738517386173871738817389173901739117392173931739417395173961739717398173991740017401174021740317404174051740617407174081740917410174111741217413174141741517416174171741817419174201742117422174231742417425174261742717428174291743017431174321743317434174351743617437174381743917440174411744217443174441744517446174471744817449174501745117452174531745417455174561745717458174591746017461174621746317464174651746617467174681746917470174711747217473174741747517476174771747817479174801748117482174831748417485174861748717488174891749017491174921749317494174951749617497174981749917500175011750217503175041750517506175071750817509175101751117512175131751417515175161751717518175191752017521175221752317524175251752617527175281752917530175311753217533175341753517536175371753817539175401754117542175431754417545175461754717548175491755017551175521755317554175551755617557175581755917560175611756217563175641756517566175671756817569175701757117572175731757417575175761757717578175791758017581175821758317584175851758617587175881758917590175911759217593175941759517596175971759817599176001760117602176031760417605176061760717608176091761017611176121761317614176151761617617176181761917620176211762217623176241762517626176271762817629176301763117632176331763417635176361763717638176391764017641176421764317644176451764617647176481764917650176511765217653176541765517656176571765817659176601766117662176631766417665176661766717668176691767017671176721767317674176751767617677176781767917680176811768217683176841768517686176871768817689176901769117692176931769417695176961769717698176991770017701177021770317704177051770617707177081770917710177111771217713177141771517716177171771817719177201772117722177231772417725177261772717728177291773017731177321773317734177351773617737177381773917740177411774217743177441774517746177471774817749177501775117752177531775417755177561775717758177591776017761177621776317764177651776617767177681776917770177711777217773177741777517776177771777817779177801778117782177831778417785177861778717788177891779017791177921779317794177951779617797177981779917800178011780217803178041780517806178071780817809178101781117812178131781417815178161781717818178191782017821178221782317824178251782617827178281782917830178311783217833178341783517836178371783817839178401784117842178431784417845178461784717848178491785017851178521785317854178551785617857178581785917860178611786217863178641786517866178671786817869178701787117872178731787417875178761787717878178791788017881178821788317884178851788617887178881788917890178911789217893178941789517896178971789817899179001790117902179031790417905179061790717908179091791017911179121791317914179151791617917179181791917920179211792217923179241792517926179271792817929179301793117932179331793417935179361793717938179391794017941179421794317944179451794617947179481794917950179511795217953179541795517956179571795817959179601796117962179631796417965179661796717968179691797017971179721797317974179751797617977179781797917980179811798217983179841798517986179871798817989179901799117992179931799417995179961799717998179991800018001180021800318004180051800618007180081800918010180111801218013180141801518016180171801818019180201802118022180231802418025180261802718028180291803018031180321803318034180351803618037180381803918040180411804218043180441804518046180471804818049180501805118052180531805418055180561805718058180591806018061180621806318064180651806618067180681806918070180711807218073180741807518076180771807818079180801808118082180831808418085180861808718088180891809018091180921809318094180951809618097180981809918100181011810218103181041810518106181071810818109181101811118112181131811418115181161811718118181191812018121181221812318124181251812618127181281812918130181311813218133181341813518136181371813818139181401814118142181431814418145181461814718148181491815018151181521815318154181551815618157181581815918160181611816218163181641816518166181671816818169181701817118172181731817418175181761817718178181791818018181181821818318184181851818618187181881818918190181911819218193181941819518196181971819818199182001820118202182031820418205182061820718208182091821018211182121821318214182151821618217182181821918220182211822218223182241822518226182271822818229182301823118232182331823418235182361823718238182391824018241182421824318244182451824618247182481824918250182511825218253182541825518256182571825818259182601826118262182631826418265182661826718268182691827018271182721827318274182751827618277182781827918280182811828218283182841828518286182871828818289182901829118292182931829418295182961829718298182991830018301183021830318304183051830618307183081830918310183111831218313183141831518316183171831818319183201832118322183231832418325183261832718328183291833018331183321833318334183351833618337183381833918340183411834218343183441834518346183471834818349183501835118352183531835418355183561835718358183591836018361183621836318364183651836618367183681836918370183711837218373183741837518376183771837818379183801838118382183831838418385183861838718388183891839018391183921839318394183951839618397183981839918400184011840218403184041840518406184071840818409184101841118412184131841418415184161841718418184191842018421184221842318424184251842618427184281842918430184311843218433184341843518436184371843818439184401844118442184431844418445184461844718448184491845018451184521845318454184551845618457184581845918460184611846218463184641846518466184671846818469184701847118472184731847418475184761847718478184791848018481184821848318484184851848618487184881848918490184911849218493184941849518496184971849818499185001850118502185031850418505185061850718508185091851018511185121851318514185151851618517185181851918520185211852218523185241852518526185271852818529185301853118532185331853418535185361853718538185391854018541185421854318544185451854618547185481854918550185511855218553185541855518556185571855818559185601856118562185631856418565185661856718568185691857018571185721857318574185751857618577185781857918580185811858218583185841858518586185871858818589185901859118592185931859418595185961859718598185991860018601186021860318604186051860618607186081860918610186111861218613186141861518616186171861818619186201862118622186231862418625186261862718628186291863018631186321863318634186351863618637186381863918640186411864218643186441864518646186471864818649186501865118652186531865418655186561865718658186591866018661186621866318664186651866618667186681866918670186711867218673186741867518676186771867818679186801868118682186831868418685186861868718688186891869018691186921869318694186951869618697186981869918700187011870218703187041870518706187071870818709187101871118712187131871418715187161871718718187191872018721187221872318724187251872618727187281872918730187311873218733187341873518736187371873818739187401874118742187431874418745187461874718748187491875018751187521875318754187551875618757187581875918760187611876218763187641876518766187671876818769187701877118772187731877418775187761877718778187791878018781187821878318784187851878618787187881878918790187911879218793187941879518796187971879818799188001880118802188031880418805188061880718808188091881018811188121881318814188151881618817188181881918820188211882218823188241882518826188271882818829188301883118832188331883418835188361883718838188391884018841188421884318844188451884618847188481884918850188511885218853188541885518856188571885818859188601886118862188631886418865188661886718868188691887018871188721887318874188751887618877188781887918880188811888218883188841888518886188871888818889188901889118892188931889418895188961889718898188991890018901189021890318904189051890618907189081890918910189111891218913189141891518916189171891818919189201892118922189231892418925189261892718928189291893018931189321893318934189351893618937189381893918940189411894218943189441894518946189471894818949189501895118952189531895418955189561895718958189591896018961189621896318964189651896618967189681896918970189711897218973189741897518976189771897818979189801898118982189831898418985189861898718988189891899018991189921899318994189951899618997189981899919000190011900219003190041900519006190071900819009190101901119012190131901419015190161901719018190191902019021190221902319024190251902619027190281902919030190311903219033190341903519036190371903819039190401904119042190431904419045190461904719048190491905019051190521905319054190551905619057190581905919060190611906219063190641906519066190671906819069190701907119072190731907419075190761907719078190791908019081190821908319084190851908619087190881908919090190911909219093190941909519096190971909819099191001910119102191031910419105191061910719108191091911019111191121911319114191151911619117191181911919120191211912219123191241912519126191271912819129191301913119132191331913419135191361913719138191391914019141191421914319144191451914619147191481914919150191511915219153191541915519156191571915819159191601916119162191631916419165191661916719168191691917019171191721917319174191751917619177191781917919180191811918219183191841918519186191871918819189191901919119192191931919419195191961919719198191991920019201192021920319204192051920619207192081920919210192111921219213192141921519216192171921819219192201922119222192231922419225192261922719228192291923019231192321923319234192351923619237192381923919240192411924219243192441924519246192471924819249192501925119252192531925419255192561925719258192591926019261192621926319264192651926619267192681926919270192711927219273192741927519276192771927819279192801928119282192831928419285192861928719288192891929019291192921929319294192951929619297192981929919300193011930219303193041930519306193071930819309193101931119312193131931419315193161931719318193191932019321193221932319324193251932619327193281932919330193311933219333193341933519336193371933819339193401934119342193431934419345193461934719348193491935019351193521935319354193551935619357193581935919360193611936219363193641936519366193671936819369193701937119372193731937419375193761937719378193791938019381193821938319384193851938619387193881938919390193911939219393193941939519396193971939819399194001940119402194031940419405194061940719408194091941019411194121941319414194151941619417194181941919420194211942219423194241942519426194271942819429194301943119432194331943419435194361943719438194391944019441194421944319444194451944619447194481944919450194511945219453194541945519456194571945819459194601946119462194631946419465194661946719468194691947019471194721947319474194751947619477194781947919480194811948219483194841948519486194871948819489194901949119492194931949419495194961949719498194991950019501195021950319504195051950619507195081950919510195111951219513195141951519516195171951819519195201952119522195231952419525195261952719528195291953019531195321953319534195351953619537195381953919540195411954219543195441954519546195471954819549195501955119552195531955419555195561955719558195591956019561195621956319564195651956619567195681956919570195711957219573195741957519576195771957819579195801958119582195831958419585195861958719588195891959019591195921959319594195951959619597195981959919600196011960219603196041960519606196071960819609196101961119612196131961419615196161961719618196191962019621196221962319624196251962619627196281962919630196311963219633196341963519636196371963819639196401964119642196431964419645196461964719648196491965019651196521965319654196551965619657196581965919660196611966219663196641966519666196671966819669196701967119672196731967419675196761967719678196791968019681196821968319684196851968619687196881968919690196911969219693196941969519696196971969819699197001970119702197031970419705197061970719708197091971019711197121971319714197151971619717197181971919720197211972219723197241972519726197271972819729197301973119732197331973419735197361973719738197391974019741197421974319744197451974619747197481974919750197511975219753197541975519756197571975819759197601976119762197631976419765197661976719768197691977019771197721977319774197751977619777197781977919780197811978219783197841978519786197871978819789197901979119792197931979419795197961979719798197991980019801198021980319804198051980619807198081980919810198111981219813198141981519816198171981819819198201982119822198231982419825198261982719828198291983019831198321983319834198351983619837198381983919840198411984219843198441984519846198471984819849198501985119852198531985419855198561985719858198591986019861198621986319864198651986619867198681986919870198711987219873198741987519876198771987819879198801988119882198831988419885198861988719888198891989019891198921989319894198951989619897198981989919900199011990219903199041990519906199071990819909199101991119912199131991419915199161991719918199191992019921199221992319924199251992619927199281992919930199311993219933199341993519936199371993819939199401994119942199431994419945199461994719948199491995019951199521995319954199551995619957199581995919960199611996219963199641996519966199671996819969199701997119972199731997419975199761997719978199791998019981199821998319984199851998619987199881998919990199911999219993199941999519996199971999819999200002000120002200032000420005200062000720008200092001020011200122001320014200152001620017200182001920020200212002220023200242002520026200272002820029200302003120032200332003420035200362003720038200392004020041200422004320044200452004620047200482004920050200512005220053200542005520056200572005820059200602006120062200632006420065200662006720068200692007020071200722007320074200752007620077200782007920080200812008220083200842008520086200872008820089200902009120092200932009420095200962009720098200992010020101201022010320104201052010620107201082010920110201112011220113201142011520116201172011820119201202012120122201232012420125201262012720128201292013020131201322013320134201352013620137201382013920140201412014220143201442014520146201472014820149201502015120152201532015420155201562015720158201592016020161201622016320164201652016620167201682016920170201712017220173201742017520176201772017820179201802018120182201832018420185201862018720188201892019020191201922019320194201952019620197201982019920200202012020220203202042020520206202072020820209202102021120212202132021420215202162021720218202192022020221202222022320224202252022620227202282022920230202312023220233202342023520236202372023820239202402024120242202432024420245202462024720248202492025020251202522025320254202552025620257202582025920260202612026220263202642026520266202672026820269202702027120272202732027420275202762027720278202792028020281202822028320284202852028620287202882028920290202912029220293202942029520296202972029820299203002030120302203032030420305203062030720308203092031020311203122031320314203152031620317203182031920320203212032220323203242032520326203272032820329203302033120332203332033420335203362033720338203392034020341203422034320344203452034620347203482034920350203512035220353203542035520356203572035820359203602036120362203632036420365203662036720368203692037020371203722037320374203752037620377203782037920380203812038220383203842038520386203872038820389203902039120392203932039420395203962039720398203992040020401204022040320404204052040620407204082040920410204112041220413204142041520416204172041820419204202042120422204232042420425204262042720428204292043020431204322043320434204352043620437204382043920440204412044220443204442044520446204472044820449204502045120452204532045420455204562045720458204592046020461204622046320464204652046620467204682046920470204712047220473204742047520476204772047820479204802048120482204832048420485204862048720488204892049020491204922049320494204952049620497204982049920500205012050220503205042050520506205072050820509205102051120512205132051420515205162051720518205192052020521205222052320524205252052620527205282052920530205312053220533205342053520536205372053820539205402054120542205432054420545205462054720548205492055020551205522055320554205552055620557205582055920560205612056220563205642056520566205672056820569205702057120572205732057420575205762057720578205792058020581205822058320584205852058620587205882058920590205912059220593205942059520596205972059820599206002060120602206032060420605206062060720608206092061020611206122061320614206152061620617206182061920620206212062220623206242062520626206272062820629206302063120632206332063420635206362063720638206392064020641206422064320644206452064620647206482064920650206512065220653206542065520656206572065820659206602066120662206632066420665206662066720668206692067020671206722067320674206752067620677206782067920680206812068220683206842068520686206872068820689206902069120692206932069420695206962069720698206992070020701207022070320704207052070620707207082070920710207112071220713207142071520716207172071820719207202072120722207232072420725207262072720728207292073020731207322073320734207352073620737207382073920740207412074220743207442074520746207472074820749207502075120752207532075420755207562075720758207592076020761207622076320764207652076620767207682076920770207712077220773207742077520776207772077820779207802078120782207832078420785207862078720788207892079020791207922079320794207952079620797207982079920800208012080220803208042080520806208072080820809208102081120812208132081420815208162081720818208192082020821208222082320824208252082620827208282082920830208312083220833208342083520836208372083820839208402084120842208432084420845208462084720848208492085020851208522085320854208552085620857208582085920860208612086220863208642086520866208672086820869208702087120872208732087420875208762087720878208792088020881208822088320884208852088620887208882088920890208912089220893208942089520896208972089820899209002090120902209032090420905209062090720908209092091020911209122091320914209152091620917209182091920920209212092220923209242092520926209272092820929209302093120932209332093420935209362093720938209392094020941209422094320944209452094620947209482094920950209512095220953209542095520956209572095820959209602096120962209632096420965209662096720968209692097020971209722097320974209752097620977209782097920980209812098220983209842098520986209872098820989209902099120992209932099420995209962099720998209992100021001210022100321004210052100621007210082100921010210112101221013210142101521016210172101821019210202102121022210232102421025210262102721028210292103021031210322103321034210352103621037210382103921040210412104221043210442104521046210472104821049210502105121052210532105421055210562105721058210592106021061210622106321064210652106621067210682106921070210712107221073210742107521076210772107821079210802108121082210832108421085210862108721088210892109021091210922109321094210952109621097210982109921100211012110221103211042110521106211072110821109211102111121112211132111421115211162111721118211192112021121211222112321124211252112621127211282112921130211312113221133211342113521136211372113821139211402114121142211432114421145211462114721148211492115021151211522115321154211552115621157211582115921160211612116221163211642116521166211672116821169211702117121172211732117421175211762117721178211792118021181211822118321184211852118621187211882118921190211912119221193211942119521196211972119821199212002120121202212032120421205212062120721208212092121021211212122121321214212152121621217212182121921220212212122221223212242122521226212272122821229212302123121232212332123421235212362123721238212392124021241212422124321244212452124621247212482124921250212512125221253212542125521256212572125821259212602126121262212632126421265212662126721268212692127021271212722127321274212752127621277212782127921280212812128221283212842128521286212872128821289212902129121292212932129421295212962129721298212992130021301213022130321304213052130621307213082130921310213112131221313213142131521316213172131821319213202132121322213232132421325213262132721328213292133021331213322133321334213352133621337213382133921340213412134221343213442134521346213472134821349213502135121352213532135421355213562135721358213592136021361213622136321364213652136621367213682136921370213712137221373213742137521376213772137821379213802138121382213832138421385213862138721388213892139021391213922139321394213952139621397213982139921400214012140221403214042140521406214072140821409214102141121412214132141421415214162141721418214192142021421214222142321424214252142621427214282142921430214312143221433214342143521436214372143821439214402144121442214432144421445214462144721448214492145021451214522145321454214552145621457214582145921460214612146221463214642146521466214672146821469214702147121472214732147421475214762147721478214792148021481214822148321484214852148621487214882148921490214912149221493214942149521496214972149821499215002150121502215032150421505215062150721508215092151021511215122151321514215152151621517215182151921520215212152221523215242152521526215272152821529215302153121532215332153421535215362153721538215392154021541215422154321544215452154621547215482154921550215512155221553215542155521556215572155821559215602156121562215632156421565215662156721568215692157021571215722157321574215752157621577215782157921580215812158221583215842158521586215872158821589215902159121592215932159421595215962159721598215992160021601216022160321604216052160621607216082160921610216112161221613216142161521616216172161821619216202162121622216232162421625216262162721628216292163021631216322163321634216352163621637216382163921640216412164221643216442164521646216472164821649216502165121652216532165421655216562165721658216592166021661216622166321664216652166621667216682166921670216712167221673216742167521676216772167821679216802168121682216832168421685216862168721688216892169021691216922169321694216952169621697216982169921700217012170221703217042170521706217072170821709217102171121712217132171421715217162171721718217192172021721217222172321724217252172621727217282172921730217312173221733217342173521736217372173821739217402174121742217432174421745217462174721748217492175021751217522175321754217552175621757217582175921760217612176221763217642176521766217672176821769217702177121772217732177421775217762177721778217792178021781217822178321784217852178621787217882178921790217912179221793217942179521796217972179821799218002180121802218032180421805218062180721808218092181021811218122181321814218152181621817218182181921820218212182221823218242182521826218272182821829218302183121832218332183421835218362183721838218392184021841218422184321844218452184621847218482184921850218512185221853218542185521856218572185821859218602186121862218632186421865218662186721868218692187021871218722187321874218752187621877218782187921880218812188221883218842188521886218872188821889218902189121892218932189421895218962189721898218992190021901219022190321904219052190621907219082190921910219112191221913219142191521916219172191821919219202192121922219232192421925219262192721928219292193021931219322193321934219352193621937219382193921940219412194221943219442194521946219472194821949219502195121952219532195421955219562195721958219592196021961219622196321964219652196621967219682196921970219712197221973219742197521976219772197821979219802198121982219832198421985219862198721988219892199021991219922199321994219952199621997219982199922000220012200222003220042200522006220072200822009220102201122012220132201422015220162201722018220192202022021220222202322024220252202622027220282202922030220312203222033220342203522036220372203822039220402204122042220432204422045220462204722048220492205022051220522205322054220552205622057220582205922060220612206222063220642206522066220672206822069220702207122072220732207422075220762207722078220792208022081220822208322084220852208622087220882208922090220912209222093220942209522096220972209822099221002210122102221032210422105221062210722108221092211022111221122211322114221152211622117221182211922120221212212222123221242212522126221272212822129221302213122132221332213422135221362213722138221392214022141221422214322144221452214622147221482214922150221512215222153221542215522156221572215822159221602216122162221632216422165221662216722168221692217022171221722217322174221752217622177221782217922180221812218222183221842218522186221872218822189221902219122192221932219422195221962219722198221992220022201222022220322204222052220622207222082220922210222112221222213222142221522216222172221822219222202222122222222232222422225222262222722228222292223022231222322223322234222352223622237222382223922240222412224222243222442224522246222472224822249222502225122252222532225422255222562225722258222592226022261222622226322264222652226622267222682226922270222712227222273222742227522276222772227822279222802228122282222832228422285222862228722288222892229022291222922229322294222952229622297222982229922300223012230222303223042230522306223072230822309223102231122312223132231422315223162231722318223192232022321223222232322324223252232622327223282232922330223312233222333223342233522336223372233822339223402234122342223432234422345223462234722348223492235022351223522235322354223552235622357223582235922360223612236222363223642236522366223672236822369223702237122372223732237422375223762237722378223792238022381223822238322384223852238622387223882238922390223912239222393223942239522396223972239822399224002240122402224032240422405224062240722408224092241022411224122241322414224152241622417224182241922420224212242222423224242242522426224272242822429224302243122432224332243422435224362243722438224392244022441224422244322444224452244622447224482244922450224512245222453224542245522456224572245822459224602246122462224632246422465224662246722468224692247022471224722247322474224752247622477224782247922480224812248222483224842248522486224872248822489224902249122492224932249422495224962249722498224992250022501225022250322504225052250622507225082250922510225112251222513225142251522516225172251822519225202252122522225232252422525225262252722528225292253022531225322253322534225352253622537225382253922540225412254222543225442254522546225472254822549225502255122552225532255422555225562255722558225592256022561225622256322564225652256622567225682256922570225712257222573225742257522576225772257822579225802258122582225832258422585225862258722588225892259022591225922259322594225952259622597225982259922600226012260222603226042260522606226072260822609226102261122612226132261422615226162261722618226192262022621226222262322624226252262622627226282262922630226312263222633226342263522636226372263822639226402264122642226432264422645226462264722648226492265022651226522265322654226552265622657226582265922660226612266222663226642266522666226672266822669226702267122672226732267422675226762267722678226792268022681226822268322684226852268622687226882268922690226912269222693226942269522696226972269822699227002270122702227032270422705227062270722708227092271022711227122271322714227152271622717227182271922720227212272222723227242272522726227272272822729227302273122732227332273422735227362273722738227392274022741227422274322744227452274622747227482274922750227512275222753227542275522756227572275822759227602276122762227632276422765227662276722768227692277022771227722277322774227752277622777227782277922780227812278222783227842278522786227872278822789227902279122792227932279422795227962279722798227992280022801228022280322804228052280622807228082280922810228112281222813228142281522816228172281822819228202282122822228232282422825228262282722828228292283022831228322283322834228352283622837228382283922840228412284222843228442284522846228472284822849228502285122852228532285422855228562285722858228592286022861228622286322864228652286622867228682286922870228712287222873228742287522876228772287822879228802288122882228832288422885228862288722888228892289022891228922289322894228952289622897228982289922900229012290222903229042290522906229072290822909229102291122912229132291422915229162291722918229192292022921229222292322924229252292622927229282292922930229312293222933229342293522936229372293822939229402294122942229432294422945229462294722948229492295022951229522295322954229552295622957229582295922960229612296222963229642296522966229672296822969229702297122972229732297422975229762297722978229792298022981229822298322984229852298622987229882298922990229912299222993229942299522996229972299822999230002300123002230032300423005230062300723008230092301023011230122301323014230152301623017230182301923020230212302223023230242302523026230272302823029230302303123032230332303423035230362303723038230392304023041230422304323044230452304623047230482304923050230512305223053230542305523056230572305823059230602306123062230632306423065230662306723068230692307023071230722307323074230752307623077230782307923080230812308223083230842308523086230872308823089230902309123092230932309423095230962309723098230992310023101231022310323104231052310623107231082310923110231112311223113231142311523116231172311823119231202312123122231232312423125231262312723128231292313023131231322313323134231352313623137231382313923140231412314223143231442314523146231472314823149231502315123152231532315423155231562315723158231592316023161231622316323164231652316623167231682316923170231712317223173231742317523176231772317823179231802318123182231832318423185231862318723188231892319023191231922319323194231952319623197231982319923200232012320223203232042320523206232072320823209232102321123212232132321423215232162321723218232192322023221232222322323224232252322623227232282322923230232312323223233232342323523236232372323823239232402324123242232432324423245232462324723248232492325023251232522325323254232552325623257232582325923260232612326223263232642326523266232672326823269232702327123272232732327423275232762327723278232792328023281232822328323284232852328623287232882328923290232912329223293232942329523296232972329823299233002330123302233032330423305233062330723308233092331023311233122331323314233152331623317233182331923320233212332223323233242332523326233272332823329233302333123332233332333423335233362333723338233392334023341233422334323344233452334623347233482334923350233512335223353233542335523356233572335823359233602336123362233632336423365233662336723368233692337023371233722337323374233752337623377233782337923380233812338223383233842338523386233872338823389233902339123392233932339423395233962339723398233992340023401234022340323404234052340623407234082340923410234112341223413234142341523416234172341823419234202342123422234232342423425234262342723428234292343023431234322343323434234352343623437234382343923440234412344223443234442344523446234472344823449234502345123452234532345423455234562345723458234592346023461234622346323464234652346623467234682346923470234712347223473234742347523476234772347823479234802348123482234832348423485234862348723488234892349023491234922349323494234952349623497234982349923500235012350223503235042350523506235072350823509235102351123512235132351423515235162351723518235192352023521235222352323524235252352623527235282352923530235312353223533235342353523536235372353823539235402354123542235432354423545235462354723548235492355023551235522355323554235552355623557235582355923560235612356223563235642356523566235672356823569235702357123572235732357423575235762357723578235792358023581235822358323584235852358623587235882358923590235912359223593235942359523596235972359823599236002360123602236032360423605236062360723608236092361023611236122361323614236152361623617236182361923620236212362223623236242362523626236272362823629236302363123632236332363423635236362363723638236392364023641236422364323644236452364623647236482364923650236512365223653236542365523656236572365823659236602366123662236632366423665236662366723668236692367023671236722367323674236752367623677236782367923680236812368223683236842368523686236872368823689236902369123692236932369423695236962369723698236992370023701237022370323704237052370623707237082370923710237112371223713237142371523716237172371823719237202372123722237232372423725237262372723728237292373023731237322373323734237352373623737237382373923740237412374223743237442374523746237472374823749237502375123752237532375423755237562375723758237592376023761237622376323764237652376623767237682376923770237712377223773237742377523776237772377823779237802378123782237832378423785237862378723788237892379023791237922379323794237952379623797237982379923800238012380223803238042380523806238072380823809238102381123812238132381423815238162381723818238192382023821238222382323824238252382623827238282382923830238312383223833238342383523836238372383823839238402384123842238432384423845238462384723848238492385023851238522385323854238552385623857238582385923860238612386223863238642386523866238672386823869238702387123872238732387423875238762387723878238792388023881238822388323884238852388623887238882388923890238912389223893238942389523896238972389823899239002390123902239032390423905239062390723908239092391023911239122391323914239152391623917239182391923920239212392223923239242392523926239272392823929239302393123932239332393423935239362393723938239392394023941239422394323944239452394623947239482394923950239512395223953239542395523956239572395823959239602396123962239632396423965239662396723968239692397023971239722397323974239752397623977239782397923980239812398223983239842398523986239872398823989239902399123992239932399423995239962399723998239992400024001240022400324004240052400624007240082400924010240112401224013240142401524016240172401824019240202402124022240232402424025240262402724028240292403024031240322403324034240352403624037240382403924040240412404224043240442404524046240472404824049240502405124052240532405424055240562405724058240592406024061240622406324064240652406624067240682406924070240712407224073240742407524076240772407824079240802408124082240832408424085240862408724088240892409024091240922409324094240952409624097240982409924100241012410224103241042410524106241072410824109241102411124112241132411424115241162411724118241192412024121241222412324124241252412624127241282412924130241312413224133241342413524136241372413824139241402414124142241432414424145241462414724148241492415024151241522415324154241552415624157241582415924160241612416224163241642416524166241672416824169241702417124172241732417424175241762417724178241792418024181241822418324184241852418624187241882418924190241912419224193241942419524196241972419824199242002420124202242032420424205242062420724208242092421024211242122421324214242152421624217242182421924220242212422224223242242422524226242272422824229242302423124232242332423424235242362423724238242392424024241242422424324244242452424624247242482424924250242512425224253242542425524256242572425824259242602426124262242632426424265242662426724268242692427024271242722427324274242752427624277242782427924280242812428224283242842428524286242872428824289242902429124292242932429424295242962429724298242992430024301243022430324304243052430624307243082430924310243112431224313243142431524316243172431824319243202432124322243232432424325243262432724328243292433024331243322433324334243352433624337243382433924340243412434224343243442434524346243472434824349243502435124352243532435424355243562435724358243592436024361243622436324364243652436624367243682436924370243712437224373243742437524376243772437824379243802438124382243832438424385243862438724388243892439024391243922439324394243952439624397243982439924400244012440224403244042440524406244072440824409244102441124412244132441424415244162441724418244192442024421244222442324424244252442624427244282442924430244312443224433244342443524436244372443824439244402444124442244432444424445244462444724448244492445024451244522445324454244552445624457244582445924460244612446224463244642446524466244672446824469244702447124472244732447424475244762447724478244792448024481244822448324484244852448624487244882448924490244912449224493244942449524496244972449824499245002450124502245032450424505245062450724508245092451024511245122451324514245152451624517245182451924520245212452224523245242452524526245272452824529245302453124532245332453424535245362453724538245392454024541245422454324544245452454624547245482454924550245512455224553245542455524556245572455824559245602456124562245632456424565245662456724568245692457024571245722457324574245752457624577245782457924580245812458224583245842458524586245872458824589245902459124592245932459424595245962459724598245992460024601246022460324604246052460624607246082460924610246112461224613246142461524616246172461824619246202462124622246232462424625246262462724628246292463024631246322463324634246352463624637246382463924640246412464224643246442464524646246472464824649246502465124652246532465424655246562465724658246592466024661246622466324664246652466624667246682466924670246712467224673246742467524676246772467824679246802468124682246832468424685246862468724688246892469024691246922469324694246952469624697246982469924700247012470224703247042470524706247072470824709247102471124712247132471424715247162471724718247192472024721247222472324724247252472624727247282472924730247312473224733247342473524736247372473824739247402474124742247432474424745247462474724748247492475024751247522475324754247552475624757247582475924760247612476224763247642476524766247672476824769247702477124772247732477424775247762477724778247792478024781247822478324784247852478624787247882478924790247912479224793247942479524796247972479824799248002480124802248032480424805248062480724808248092481024811248122481324814248152481624817248182481924820248212482224823248242482524826248272482824829248302483124832248332483424835248362483724838248392484024841248422484324844248452484624847248482484924850248512485224853248542485524856248572485824859248602486124862248632486424865248662486724868248692487024871248722487324874248752487624877248782487924880248812488224883248842488524886248872488824889248902489124892248932489424895248962489724898248992490024901249022490324904249052490624907249082490924910249112491224913249142491524916249172491824919249202492124922249232492424925249262492724928249292493024931249322493324934249352493624937249382493924940249412494224943249442494524946249472494824949249502495124952249532495424955249562495724958249592496024961249622496324964249652496624967249682496924970249712497224973249742497524976249772497824979249802498124982249832498424985249862498724988249892499024991249922499324994249952499624997249982499925000250012500225003250042500525006250072500825009250102501125012250132501425015250162501725018250192502025021250222502325024250252502625027250282502925030250312503225033250342503525036250372503825039250402504125042250432504425045250462504725048250492505025051250522505325054250552505625057250582505925060250612506225063250642506525066250672506825069250702507125072250732507425075250762507725078250792508025081250822508325084250852508625087250882508925090250912509225093250942509525096250972509825099251002510125102251032510425105251062510725108251092511025111251122511325114251152511625117251182511925120251212512225123251242512525126251272512825129251302513125132251332513425135251362513725138251392514025141251422514325144251452514625147251482514925150251512515225153251542515525156251572515825159251602516125162251632516425165251662516725168251692517025171251722517325174251752517625177251782517925180251812518225183251842518525186251872518825189251902519125192251932519425195251962519725198251992520025201252022520325204252052520625207252082520925210252112521225213252142521525216252172521825219252202522125222252232522425225252262522725228252292523025231252322523325234252352523625237252382523925240252412524225243252442524525246252472524825249252502525125252252532525425255252562525725258252592526025261252622526325264252652526625267252682526925270252712527225273252742527525276252772527825279252802528125282252832528425285252862528725288252892529025291252922529325294252952529625297252982529925300253012530225303253042530525306253072530825309253102531125312253132531425315253162531725318253192532025321253222532325324253252532625327253282532925330253312533225333253342533525336253372533825339253402534125342253432534425345253462534725348253492535025351253522535325354253552535625357253582535925360253612536225363253642536525366253672536825369253702537125372253732537425375253762537725378253792538025381253822538325384253852538625387253882538925390253912539225393253942539525396253972539825399254002540125402254032540425405254062540725408254092541025411254122541325414254152541625417254182541925420254212542225423254242542525426254272542825429254302543125432254332543425435254362543725438254392544025441254422544325444254452544625447254482544925450254512545225453254542545525456254572545825459254602546125462254632546425465254662546725468254692547025471254722547325474254752547625477254782547925480254812548225483254842548525486254872548825489254902549125492254932549425495254962549725498254992550025501255022550325504255052550625507255082550925510255112551225513255142551525516255172551825519255202552125522255232552425525255262552725528255292553025531255322553325534255352553625537255382553925540255412554225543255442554525546255472554825549255502555125552255532555425555255562555725558255592556025561255622556325564255652556625567255682556925570255712557225573255742557525576255772557825579255802558125582255832558425585255862558725588255892559025591255922559325594255952559625597255982559925600256012560225603256042560525606256072560825609256102561125612256132561425615256162561725618256192562025621256222562325624256252562625627256282562925630256312563225633256342563525636256372563825639256402564125642256432564425645256462564725648256492565025651256522565325654256552565625657256582565925660256612566225663256642566525666256672566825669256702567125672256732567425675256762567725678256792568025681256822568325684256852568625687256882568925690256912569225693256942569525696256972569825699257002570125702257032570425705257062570725708257092571025711257122571325714257152571625717257182571925720257212572225723257242572525726257272572825729257302573125732257332573425735257362573725738257392574025741257422574325744257452574625747257482574925750257512575225753257542575525756257572575825759257602576125762257632576425765257662576725768257692577025771257722577325774257752577625777257782577925780257812578225783257842578525786257872578825789257902579125792257932579425795257962579725798257992580025801258022580325804258052580625807258082580925810258112581225813258142581525816258172581825819258202582125822258232582425825258262582725828258292583025831258322583325834258352583625837258382583925840258412584225843258442584525846258472584825849258502585125852258532585425855258562585725858258592586025861258622586325864258652586625867258682586925870258712587225873258742587525876258772587825879258802588125882258832588425885258862588725888258892589025891258922589325894258952589625897258982589925900259012590225903259042590525906259072590825909259102591125912259132591425915259162591725918259192592025921259222592325924259252592625927259282592925930259312593225933259342593525936259372593825939259402594125942259432594425945259462594725948259492595025951259522595325954259552595625957259582595925960259612596225963259642596525966259672596825969259702597125972259732597425975259762597725978259792598025981259822598325984259852598625987259882598925990259912599225993259942599525996259972599825999260002600126002260032600426005260062600726008260092601026011260122601326014260152601626017260182601926020260212602226023260242602526026260272602826029260302603126032260332603426035260362603726038260392604026041260422604326044260452604626047260482604926050260512605226053260542605526056260572605826059260602606126062260632606426065260662606726068260692607026071260722607326074260752607626077260782607926080260812608226083260842608526086260872608826089260902609126092260932609426095260962609726098260992610026101261022610326104261052610626107261082610926110261112611226113261142611526116261172611826119261202612126122261232612426125261262612726128261292613026131261322613326134261352613626137261382613926140261412614226143261442614526146261472614826149261502615126152261532615426155261562615726158261592616026161261622616326164261652616626167261682616926170261712617226173261742617526176261772617826179261802618126182261832618426185261862618726188261892619026191261922619326194261952619626197261982619926200262012620226203262042620526206262072620826209262102621126212262132621426215262162621726218262192622026221262222622326224262252622626227262282622926230262312623226233262342623526236262372623826239262402624126242262432624426245262462624726248262492625026251262522625326254262552625626257262582625926260262612626226263262642626526266262672626826269262702627126272262732627426275262762627726278262792628026281262822628326284262852628626287262882628926290262912629226293262942629526296262972629826299263002630126302263032630426305263062630726308263092631026311263122631326314263152631626317263182631926320263212632226323263242632526326263272632826329263302633126332263332633426335263362633726338263392634026341263422634326344263452634626347263482634926350263512635226353263542635526356263572635826359263602636126362263632636426365263662636726368263692637026371263722637326374263752637626377263782637926380263812638226383263842638526386263872638826389263902639126392263932639426395263962639726398263992640026401264022640326404264052640626407264082640926410264112641226413264142641526416264172641826419264202642126422264232642426425264262642726428264292643026431264322643326434264352643626437264382643926440264412644226443264442644526446264472644826449264502645126452264532645426455264562645726458264592646026461264622646326464264652646626467264682646926470264712647226473264742647526476264772647826479264802648126482264832648426485264862648726488264892649026491264922649326494264952649626497264982649926500265012650226503265042650526506265072650826509265102651126512265132651426515265162651726518265192652026521265222652326524265252652626527265282652926530265312653226533265342653526536265372653826539265402654126542265432654426545265462654726548265492655026551265522655326554265552655626557265582655926560265612656226563265642656526566265672656826569265702657126572265732657426575265762657726578265792658026581265822658326584265852658626587265882658926590265912659226593265942659526596265972659826599266002660126602266032660426605266062660726608266092661026611266122661326614266152661626617266182661926620266212662226623266242662526626266272662826629266302663126632266332663426635266362663726638266392664026641266422664326644266452664626647266482664926650266512665226653266542665526656266572665826659266602666126662266632666426665266662666726668266692667026671266722667326674266752667626677266782667926680266812668226683266842668526686266872668826689266902669126692266932669426695266962669726698266992670026701267022670326704267052670626707267082670926710267112671226713267142671526716267172671826719267202672126722267232672426725267262672726728267292673026731267322673326734267352673626737267382673926740267412674226743267442674526746267472674826749267502675126752267532675426755267562675726758267592676026761267622676326764267652676626767267682676926770267712677226773267742677526776267772677826779267802678126782267832678426785267862678726788267892679026791267922679326794267952679626797267982679926800268012680226803268042680526806268072680826809268102681126812268132681426815268162681726818268192682026821268222682326824268252682626827268282682926830268312683226833268342683526836268372683826839268402684126842268432684426845268462684726848268492685026851268522685326854268552685626857268582685926860268612686226863268642686526866268672686826869268702687126872268732687426875268762687726878268792688026881268822688326884268852688626887268882688926890268912689226893268942689526896268972689826899269002690126902269032690426905269062690726908269092691026911269122691326914269152691626917269182691926920269212692226923269242692526926269272692826929269302693126932269332693426935269362693726938269392694026941269422694326944269452694626947269482694926950269512695226953269542695526956269572695826959269602696126962269632696426965269662696726968269692697026971269722697326974269752697626977269782697926980269812698226983269842698526986269872698826989269902699126992269932699426995269962699726998269992700027001270022700327004270052700627007270082700927010270112701227013270142701527016270172701827019270202702127022270232702427025270262702727028270292703027031270322703327034270352703627037270382703927040270412704227043270442704527046270472704827049270502705127052270532705427055270562705727058270592706027061270622706327064270652706627067270682706927070270712707227073270742707527076270772707827079270802708127082270832708427085270862708727088270892709027091270922709327094270952709627097270982709927100271012710227103271042710527106271072710827109271102711127112271132711427115271162711727118271192712027121271222712327124271252712627127271282712927130271312713227133271342713527136271372713827139271402714127142271432714427145271462714727148271492715027151271522715327154271552715627157271582715927160271612716227163271642716527166271672716827169271702717127172271732717427175271762717727178271792718027181271822718327184271852718627187271882718927190271912719227193271942719527196271972719827199272002720127202272032720427205272062720727208272092721027211272122721327214272152721627217272182721927220272212722227223272242722527226272272722827229272302723127232272332723427235272362723727238272392724027241272422724327244272452724627247272482724927250272512725227253272542725527256272572725827259272602726127262272632726427265272662726727268272692727027271272722727327274272752727627277272782727927280272812728227283272842728527286272872728827289272902729127292272932729427295272962729727298272992730027301273022730327304273052730627307273082730927310273112731227313273142731527316273172731827319273202732127322273232732427325273262732727328273292733027331273322733327334273352733627337273382733927340273412734227343273442734527346273472734827349273502735127352273532735427355273562735727358273592736027361273622736327364273652736627367273682736927370273712737227373273742737527376273772737827379273802738127382273832738427385273862738727388273892739027391273922739327394273952739627397273982739927400274012740227403274042740527406274072740827409274102741127412274132741427415274162741727418274192742027421274222742327424274252742627427274282742927430274312743227433274342743527436274372743827439274402744127442274432744427445274462744727448274492745027451274522745327454274552745627457274582745927460274612746227463274642746527466274672746827469274702747127472274732747427475274762747727478274792748027481274822748327484274852748627487274882748927490274912749227493274942749527496274972749827499275002750127502275032750427505275062750727508275092751027511275122751327514275152751627517275182751927520275212752227523275242752527526275272752827529275302753127532275332753427535275362753727538275392754027541275422754327544275452754627547275482754927550275512755227553275542755527556275572755827559275602756127562275632756427565275662756727568275692757027571275722757327574275752757627577275782757927580275812758227583275842758527586275872758827589275902759127592275932759427595275962759727598275992760027601276022760327604276052760627607276082760927610276112761227613276142761527616276172761827619276202762127622276232762427625276262762727628276292763027631276322763327634276352763627637276382763927640276412764227643276442764527646276472764827649276502765127652276532765427655276562765727658276592766027661276622766327664276652766627667276682766927670276712767227673276742767527676276772767827679276802768127682276832768427685276862768727688276892769027691276922769327694276952769627697276982769927700277012770227703277042770527706277072770827709277102771127712277132771427715277162771727718277192772027721277222772327724277252772627727277282772927730277312773227733277342773527736277372773827739277402774127742277432774427745277462774727748277492775027751277522775327754277552775627757277582775927760277612776227763277642776527766277672776827769277702777127772277732777427775277762777727778277792778027781277822778327784277852778627787277882778927790277912779227793277942779527796277972779827799278002780127802278032780427805278062780727808278092781027811278122781327814278152781627817278182781927820278212782227823278242782527826278272782827829278302783127832278332783427835278362783727838278392784027841278422784327844278452784627847278482784927850278512785227853278542785527856278572785827859278602786127862278632786427865278662786727868278692787027871278722787327874278752787627877278782787927880278812788227883278842788527886278872788827889278902789127892278932789427895278962789727898278992790027901279022790327904279052790627907279082790927910279112791227913279142791527916279172791827919279202792127922279232792427925279262792727928279292793027931279322793327934279352793627937279382793927940279412794227943279442794527946279472794827949279502795127952279532795427955279562795727958279592796027961279622796327964279652796627967279682796927970279712797227973279742797527976279772797827979279802798127982279832798427985279862798727988279892799027991279922799327994279952799627997279982799928000280012800228003280042800528006280072800828009280102801128012280132801428015280162801728018280192802028021280222802328024280252802628027280282802928030280312803228033280342803528036280372803828039280402804128042280432804428045280462804728048280492805028051280522805328054280552805628057280582805928060280612806228063280642806528066280672806828069280702807128072280732807428075280762807728078280792808028081280822808328084280852808628087280882808928090280912809228093280942809528096280972809828099281002810128102281032810428105281062810728108281092811028111281122811328114281152811628117281182811928120281212812228123281242812528126281272812828129281302813128132281332813428135281362813728138281392814028141281422814328144281452814628147281482814928150281512815228153281542815528156281572815828159281602816128162281632816428165281662816728168281692817028171281722817328174281752817628177281782817928180281812818228183281842818528186281872818828189281902819128192281932819428195281962819728198281992820028201282022820328204282052820628207282082820928210282112821228213282142821528216282172821828219282202822128222282232822428225282262822728228282292823028231282322823328234282352823628237282382823928240282412824228243282442824528246282472824828249282502825128252282532825428255282562825728258282592826028261282622826328264282652826628267282682826928270282712827228273282742827528276282772827828279282802828128282282832828428285282862828728288282892829028291282922829328294282952829628297282982829928300283012830228303283042830528306283072830828309283102831128312283132831428315283162831728318283192832028321283222832328324283252832628327283282832928330283312833228333283342833528336283372833828339283402834128342283432834428345283462834728348283492835028351283522835328354283552835628357283582835928360283612836228363283642836528366283672836828369283702837128372283732837428375283762837728378283792838028381283822838328384283852838628387283882838928390283912839228393283942839528396283972839828399284002840128402284032840428405284062840728408284092841028411284122841328414284152841628417284182841928420284212842228423284242842528426284272842828429284302843128432284332843428435284362843728438284392844028441284422844328444284452844628447284482844928450284512845228453284542845528456284572845828459284602846128462284632846428465284662846728468284692847028471284722847328474284752847628477284782847928480284812848228483284842848528486284872848828489284902849128492284932849428495284962849728498284992850028501285022850328504285052850628507285082850928510285112851228513285142851528516285172851828519285202852128522285232852428525285262852728528285292853028531285322853328534285352853628537285382853928540285412854228543285442854528546285472854828549285502855128552285532855428555285562855728558285592856028561285622856328564285652856628567285682856928570285712857228573285742857528576285772857828579285802858128582285832858428585285862858728588285892859028591285922859328594285952859628597285982859928600286012860228603286042860528606286072860828609286102861128612286132861428615286162861728618286192862028621286222862328624286252862628627286282862928630286312863228633286342863528636286372863828639286402864128642286432864428645286462864728648286492865028651286522865328654286552865628657286582865928660286612866228663286642866528666286672866828669286702867128672286732867428675286762867728678286792868028681286822868328684286852868628687286882868928690286912869228693286942869528696286972869828699287002870128702287032870428705287062870728708287092871028711287122871328714287152871628717287182871928720287212872228723287242872528726287272872828729287302873128732287332873428735287362873728738287392874028741287422874328744287452874628747287482874928750287512875228753287542875528756287572875828759287602876128762287632876428765287662876728768287692877028771287722877328774287752877628777287782877928780287812878228783287842878528786287872878828789287902879128792287932879428795287962879728798287992880028801288022880328804288052880628807288082880928810288112881228813288142881528816288172881828819288202882128822288232882428825288262882728828288292883028831288322883328834288352883628837288382883928840288412884228843288442884528846288472884828849288502885128852288532885428855288562885728858288592886028861288622886328864288652886628867288682886928870288712887228873288742887528876288772887828879288802888128882288832888428885288862888728888288892889028891288922889328894288952889628897288982889928900289012890228903289042890528906289072890828909289102891128912289132891428915289162891728918289192892028921289222892328924289252892628927289282892928930289312893228933289342893528936289372893828939289402894128942289432894428945289462894728948289492895028951289522895328954289552895628957289582895928960289612896228963289642896528966289672896828969289702897128972289732897428975289762897728978289792898028981289822898328984289852898628987289882898928990289912899228993289942899528996289972899828999290002900129002290032900429005290062900729008290092901029011290122901329014290152901629017290182901929020290212902229023290242902529026290272902829029290302903129032290332903429035290362903729038290392904029041290422904329044290452904629047290482904929050290512905229053290542905529056290572905829059290602906129062290632906429065290662906729068290692907029071290722907329074290752907629077290782907929080290812908229083290842908529086290872908829089290902909129092290932909429095290962909729098290992910029101291022910329104291052910629107291082910929110291112911229113291142911529116291172911829119291202912129122291232912429125291262912729128291292913029131291322913329134291352913629137291382913929140291412914229143291442914529146291472914829149291502915129152291532915429155291562915729158291592916029161291622916329164291652916629167291682916929170291712917229173291742917529176291772917829179291802918129182291832918429185291862918729188291892919029191291922919329194291952919629197291982919929200292012920229203292042920529206292072920829209292102921129212292132921429215292162921729218292192922029221292222922329224292252922629227292282922929230292312923229233292342923529236292372923829239292402924129242292432924429245292462924729248292492925029251292522925329254292552925629257292582925929260292612926229263292642926529266292672926829269292702927129272292732927429275292762927729278292792928029281292822928329284292852928629287292882928929290292912929229293292942929529296292972929829299293002930129302293032930429305293062930729308293092931029311293122931329314293152931629317293182931929320293212932229323293242932529326293272932829329293302933129332293332933429335293362933729338293392934029341293422934329344293452934629347293482934929350293512935229353293542935529356293572935829359293602936129362293632936429365293662936729368293692937029371293722937329374293752937629377293782937929380293812938229383293842938529386293872938829389293902939129392293932939429395293962939729398293992940029401294022940329404294052940629407294082940929410294112941229413294142941529416294172941829419294202942129422294232942429425294262942729428294292943029431294322943329434294352943629437294382943929440294412944229443294442944529446294472944829449294502945129452294532945429455294562945729458294592946029461294622946329464294652946629467294682946929470294712947229473294742947529476294772947829479294802948129482294832948429485294862948729488294892949029491294922949329494294952949629497294982949929500295012950229503295042950529506295072950829509295102951129512295132951429515295162951729518295192952029521295222952329524295252952629527295282952929530295312953229533295342953529536295372953829539295402954129542295432954429545295462954729548295492955029551295522955329554295552955629557295582955929560295612956229563295642956529566295672956829569295702957129572295732957429575295762957729578295792958029581295822958329584295852958629587295882958929590295912959229593295942959529596295972959829599296002960129602296032960429605296062960729608296092961029611296122961329614296152961629617296182961929620296212962229623296242962529626296272962829629296302963129632296332963429635296362963729638296392964029641296422964329644296452964629647296482964929650296512965229653296542965529656296572965829659
  1. var BABYLON;
  2. (function (BABYLON) {
  3. var Color3 = (function () {
  4. function Color3(r, g, b) {
  5. if (typeof r === "undefined") { r = 0; }
  6. if (typeof g === "undefined") { g = 0; }
  7. if (typeof b === "undefined") { b = 0; }
  8. this.r = r;
  9. this.g = g;
  10. this.b = b;
  11. }
  12. Color3.prototype.toString = function () {
  13. return "{R: " + this.r + " G:" + this.g + " B:" + this.b + "}";
  14. };
  15. Color3.prototype.toArray = function (array, index) {
  16. if (index === undefined) {
  17. index = 0;
  18. }
  19. array[index] = this.r;
  20. array[index + 1] = this.g;
  21. array[index + 2] = this.b;
  22. };
  23. Color3.prototype.toColor4 = function (alpha) {
  24. if (typeof alpha === "undefined") { alpha = 1; }
  25. return new Color4(this.r, this.g, this.b, alpha);
  26. };
  27. Color3.prototype.asArray = function () {
  28. var result = [];
  29. this.toArray(result, 0);
  30. return result;
  31. };
  32. Color3.prototype.toLuminance = function () {
  33. return this.r * 0.3 + this.g * 0.59 + this.b * 0.11;
  34. };
  35. Color3.prototype.multiply = function (otherColor) {
  36. return new Color3(this.r * otherColor.r, this.g * otherColor.g, this.b * otherColor.b);
  37. };
  38. Color3.prototype.multiplyToRef = function (otherColor, result) {
  39. result.r = this.r * otherColor.r;
  40. result.g = this.g * otherColor.g;
  41. result.b = this.b * otherColor.b;
  42. };
  43. Color3.prototype.equals = function (otherColor) {
  44. return otherColor && this.r === otherColor.r && this.g === otherColor.g && this.b === otherColor.b;
  45. };
  46. Color3.prototype.scale = function (scale) {
  47. return new Color3(this.r * scale, this.g * scale, this.b * scale);
  48. };
  49. Color3.prototype.scaleToRef = function (scale, result) {
  50. result.r = this.r * scale;
  51. result.g = this.g * scale;
  52. result.b = this.b * scale;
  53. };
  54. Color3.prototype.add = function (otherColor) {
  55. return new Color3(this.r + otherColor.r, this.g + otherColor.g, this.b + otherColor.b);
  56. };
  57. Color3.prototype.addToRef = function (otherColor, result) {
  58. result.r = this.r + otherColor.r;
  59. result.g = this.g + otherColor.g;
  60. result.b = this.b + otherColor.b;
  61. };
  62. Color3.prototype.subtract = function (otherColor) {
  63. return new Color3(this.r - otherColor.r, this.g - otherColor.g, this.b - otherColor.b);
  64. };
  65. Color3.prototype.subtractToRef = function (otherColor, result) {
  66. result.r = this.r - otherColor.r;
  67. result.g = this.g - otherColor.g;
  68. result.b = this.b - otherColor.b;
  69. };
  70. Color3.prototype.clone = function () {
  71. return new Color3(this.r, this.g, this.b);
  72. };
  73. Color3.prototype.copyFrom = function (source) {
  74. this.r = source.r;
  75. this.g = source.g;
  76. this.b = source.b;
  77. };
  78. Color3.prototype.copyFromFloats = function (r, g, b) {
  79. this.r = r;
  80. this.g = g;
  81. this.b = b;
  82. };
  83. Color3.FromArray = function (array) {
  84. return new Color3(array[0], array[1], array[2]);
  85. };
  86. Color3.FromInts = function (r, g, b) {
  87. return new Color3(r / 255.0, g / 255.0, b / 255.0);
  88. };
  89. Color3.Lerp = function (start, end, amount) {
  90. var r = start.r + ((end.r - start.r) * amount);
  91. var g = start.g + ((end.g - start.g) * amount);
  92. var b = start.b + ((end.b - start.b) * amount);
  93. return new Color3(r, g, b);
  94. };
  95. Color3.Red = function () {
  96. return new Color3(1, 0, 0);
  97. };
  98. Color3.Green = function () {
  99. return new Color3(0, 1, 0);
  100. };
  101. Color3.Blue = function () {
  102. return new Color3(0, 0, 1);
  103. };
  104. Color3.Black = function () {
  105. return new Color3(0, 0, 0);
  106. };
  107. Color3.White = function () {
  108. return new Color3(1, 1, 1);
  109. };
  110. Color3.Purple = function () {
  111. return new Color3(0.5, 0, 0.5);
  112. };
  113. Color3.Magenta = function () {
  114. return new Color3(1, 0, 1);
  115. };
  116. Color3.Yellow = function () {
  117. return new Color3(1, 1, 0);
  118. };
  119. Color3.Gray = function () {
  120. return new Color3(0.5, 0.5, 0.5);
  121. };
  122. return Color3;
  123. })();
  124. BABYLON.Color3 = Color3;
  125. var Color4 = (function () {
  126. function Color4(r, g, b, a) {
  127. this.r = r;
  128. this.g = g;
  129. this.b = b;
  130. this.a = a;
  131. }
  132. Color4.prototype.addInPlace = function (right) {
  133. this.r += right.r;
  134. this.g += right.g;
  135. this.b += right.b;
  136. this.a += right.a;
  137. };
  138. Color4.prototype.asArray = function () {
  139. var result = [];
  140. this.toArray(result, 0);
  141. return result;
  142. };
  143. Color4.prototype.toArray = function (array, index) {
  144. if (index === undefined) {
  145. index = 0;
  146. }
  147. array[index] = this.r;
  148. array[index + 1] = this.g;
  149. array[index + 2] = this.b;
  150. array[index + 3] = this.a;
  151. };
  152. Color4.prototype.add = function (right) {
  153. return new Color4(this.r + right.r, this.g + right.g, this.b + right.b, this.a + right.a);
  154. };
  155. Color4.prototype.subtract = function (right) {
  156. return new Color4(this.r - right.r, this.g - right.g, this.b - right.b, this.a - right.a);
  157. };
  158. Color4.prototype.subtractToRef = function (right, result) {
  159. result.r = this.r - right.r;
  160. result.g = this.g - right.g;
  161. result.b = this.b - right.b;
  162. result.a = this.a - right.a;
  163. };
  164. Color4.prototype.scale = function (scale) {
  165. return new Color4(this.r * scale, this.g * scale, this.b * scale, this.a * scale);
  166. };
  167. Color4.prototype.scaleToRef = function (scale, result) {
  168. result.r = this.r * scale;
  169. result.g = this.g * scale;
  170. result.b = this.b * scale;
  171. result.a = this.a * scale;
  172. };
  173. Color4.prototype.toString = function () {
  174. return "{R: " + this.r + " G:" + this.g + " B:" + this.b + " A:" + this.a + "}";
  175. };
  176. Color4.prototype.clone = function () {
  177. return new Color4(this.r, this.g, this.b, this.a);
  178. };
  179. Color4.Lerp = function (left, right, amount) {
  180. var result = new Color4(0, 0, 0, 0);
  181. BABYLON.Color4.LerpToRef(left, right, amount, result);
  182. return result;
  183. };
  184. Color4.LerpToRef = function (left, right, amount, result) {
  185. result.r = left.r + (right.r - left.r) * amount;
  186. result.g = left.g + (right.g - left.g) * amount;
  187. result.b = left.b + (right.b - left.b) * amount;
  188. result.a = left.a + (right.a - left.a) * amount;
  189. };
  190. Color4.FromArray = function (array, offset) {
  191. if (typeof offset === "undefined") { offset = 0; }
  192. return new Color4(array[offset], array[offset + 1], array[offset + 2], array[offset + 3]);
  193. };
  194. Color4.FromInts = function (r, g, b, a) {
  195. return new Color4(r / 255.0, g / 255.0, b / 255.0, a / 255.0);
  196. };
  197. return Color4;
  198. })();
  199. BABYLON.Color4 = Color4;
  200. var Vector2 = (function () {
  201. function Vector2(x, y) {
  202. this.x = x;
  203. this.y = y;
  204. }
  205. Vector2.prototype.toString = function () {
  206. return "{X: " + this.x + " Y:" + this.y + "}";
  207. };
  208. Vector2.prototype.toArray = function (array, index) {
  209. if (index === undefined) {
  210. index = 0;
  211. }
  212. array[index] = this.x;
  213. array[index + 1] = this.y;
  214. };
  215. Vector2.prototype.asArray = function () {
  216. var result = [];
  217. this.toArray(result, 0);
  218. return result;
  219. };
  220. Vector2.prototype.copyFrom = function (source) {
  221. this.x = source.x;
  222. this.y = source.y;
  223. };
  224. Vector2.prototype.copyFromFloats = function (x, y) {
  225. this.x = x;
  226. this.y = y;
  227. };
  228. Vector2.prototype.add = function (otherVector) {
  229. return new Vector2(this.x + otherVector.x, this.y + otherVector.y);
  230. };
  231. Vector2.prototype.addVector3 = function (otherVector) {
  232. return new Vector2(this.x + otherVector.x, this.y + otherVector.y);
  233. };
  234. Vector2.prototype.subtract = function (otherVector) {
  235. return new Vector2(this.x - otherVector.x, this.y - otherVector.y);
  236. };
  237. Vector2.prototype.subtractInPlace = function (otherVector) {
  238. this.x -= otherVector.x;
  239. this.y -= otherVector.y;
  240. };
  241. Vector2.prototype.multiplyInPlace = function (otherVector) {
  242. this.x *= otherVector.x;
  243. this.y *= otherVector.y;
  244. };
  245. Vector2.prototype.multiply = function (otherVector) {
  246. return new Vector2(this.x * otherVector.x, this.y * otherVector.y);
  247. };
  248. Vector2.prototype.multiplyToRef = function (otherVector, result) {
  249. result.x = this.x * otherVector.x;
  250. result.y = this.y * otherVector.y;
  251. };
  252. Vector2.prototype.multiplyByFloats = function (x, y) {
  253. return new Vector2(this.x * x, this.y * y);
  254. };
  255. Vector2.prototype.divide = function (otherVector) {
  256. return new Vector2(this.x / otherVector.x, this.y / otherVector.y);
  257. };
  258. Vector2.prototype.divideToRef = function (otherVector, result) {
  259. result.x = this.x / otherVector.x;
  260. result.y = this.y / otherVector.y;
  261. };
  262. Vector2.prototype.negate = function () {
  263. return new Vector2(-this.x, -this.y);
  264. };
  265. Vector2.prototype.scaleInPlace = function (scale) {
  266. this.x *= scale;
  267. this.y *= scale;
  268. return this;
  269. };
  270. Vector2.prototype.scale = function (scale) {
  271. return new Vector2(this.x * scale, this.y * scale);
  272. };
  273. Vector2.prototype.equals = function (otherVector) {
  274. return otherVector && this.x === otherVector.x && this.y === otherVector.y;
  275. };
  276. Vector2.prototype.length = function () {
  277. return Math.sqrt(this.x * this.x + this.y * this.y);
  278. };
  279. Vector2.prototype.lengthSquared = function () {
  280. return (this.x * this.x + this.y * this.y);
  281. };
  282. Vector2.prototype.normalize = function () {
  283. var len = this.length();
  284. if (len === 0)
  285. return this;
  286. var num = 1.0 / len;
  287. this.x *= num;
  288. this.y *= num;
  289. return this;
  290. };
  291. Vector2.prototype.clone = function () {
  292. return new Vector2(this.x, this.y);
  293. };
  294. Vector2.Zero = function () {
  295. return new Vector2(0, 0);
  296. };
  297. Vector2.FromArray = function (array, offset) {
  298. if (!offset) {
  299. offset = 0;
  300. }
  301. return new Vector2(array[offset], array[offset + 1]);
  302. };
  303. Vector2.FromArrayToRef = function (array, offset, result) {
  304. result.x = array[offset];
  305. result.y = array[offset + 1];
  306. };
  307. Vector2.CatmullRom = function (value1, value2, value3, value4, amount) {
  308. var squared = amount * amount;
  309. var cubed = amount * squared;
  310. var x = 0.5 * ((((2.0 * value2.x) + ((-value1.x + value3.x) * amount)) + (((((2.0 * value1.x) - (5.0 * value2.x)) + (4.0 * value3.x)) - value4.x) * squared)) + ((((-value1.x + (3.0 * value2.x)) - (3.0 * value3.x)) + value4.x) * cubed));
  311. var y = 0.5 * ((((2.0 * value2.y) + ((-value1.y + value3.y) * amount)) + (((((2.0 * value1.y) - (5.0 * value2.y)) + (4.0 * value3.y)) - value4.y) * squared)) + ((((-value1.y + (3.0 * value2.y)) - (3.0 * value3.y)) + value4.y) * cubed));
  312. return new Vector2(x, y);
  313. };
  314. Vector2.Clamp = function (value, min, max) {
  315. var x = value.x;
  316. x = (x > max.x) ? max.x : x;
  317. x = (x < min.x) ? min.x : x;
  318. var y = value.y;
  319. y = (y > max.y) ? max.y : y;
  320. y = (y < min.y) ? min.y : y;
  321. return new Vector2(x, y);
  322. };
  323. Vector2.Hermite = function (value1, tangent1, value2, tangent2, amount) {
  324. var squared = amount * amount;
  325. var cubed = amount * squared;
  326. var part1 = ((2.0 * cubed) - (3.0 * squared)) + 1.0;
  327. var part2 = (-2.0 * cubed) + (3.0 * squared);
  328. var part3 = (cubed - (2.0 * squared)) + amount;
  329. var part4 = cubed - squared;
  330. var x = (((value1.x * part1) + (value2.x * part2)) + (tangent1.x * part3)) + (tangent2.x * part4);
  331. var y = (((value1.y * part1) + (value2.y * part2)) + (tangent1.y * part3)) + (tangent2.y * part4);
  332. return new Vector2(x, y);
  333. };
  334. Vector2.Lerp = function (start, end, amount) {
  335. var x = start.x + ((end.x - start.x) * amount);
  336. var y = start.y + ((end.y - start.y) * amount);
  337. return new Vector2(x, y);
  338. };
  339. Vector2.Dot = function (left, right) {
  340. return left.x * right.x + left.y * right.y;
  341. };
  342. Vector2.Normalize = function (vector) {
  343. var newVector = vector.clone();
  344. newVector.normalize();
  345. return newVector;
  346. };
  347. Vector2.Minimize = function (left, right) {
  348. var x = (left.x < right.x) ? left.x : right.x;
  349. var y = (left.y < right.y) ? left.y : right.y;
  350. return new Vector2(x, y);
  351. };
  352. Vector2.Maximize = function (left, right) {
  353. var x = (left.x > right.x) ? left.x : right.x;
  354. var y = (left.y > right.y) ? left.y : right.y;
  355. return new Vector2(x, y);
  356. };
  357. Vector2.Transform = function (vector, transformation) {
  358. var x = (vector.x * transformation.m[0]) + (vector.y * transformation.m[4]);
  359. var y = (vector.x * transformation.m[1]) + (vector.y * transformation.m[5]);
  360. return new Vector2(x, y);
  361. };
  362. Vector2.Distance = function (value1, value2) {
  363. return Math.sqrt(Vector2.DistanceSquared(value1, value2));
  364. };
  365. Vector2.DistanceSquared = function (value1, value2) {
  366. var x = value1.x - value2.x;
  367. var y = value1.y - value2.y;
  368. return (x * x) + (y * y);
  369. };
  370. return Vector2;
  371. })();
  372. BABYLON.Vector2 = Vector2;
  373. var Vector3 = (function () {
  374. function Vector3(x, y, z) {
  375. this.x = x;
  376. this.y = y;
  377. this.z = z;
  378. }
  379. Vector3.prototype.toString = function () {
  380. return "{X: " + this.x + " Y:" + this.y + " Z:" + this.z + "}";
  381. };
  382. Vector3.prototype.asArray = function () {
  383. var result = [];
  384. this.toArray(result, 0);
  385. return result;
  386. };
  387. Vector3.prototype.toArray = function (array, index) {
  388. if (index === undefined) {
  389. index = 0;
  390. }
  391. array[index] = this.x;
  392. array[index + 1] = this.y;
  393. array[index + 2] = this.z;
  394. };
  395. Vector3.prototype.addInPlace = function (otherVector) {
  396. this.x += otherVector.x;
  397. this.y += otherVector.y;
  398. this.z += otherVector.z;
  399. };
  400. Vector3.prototype.add = function (otherVector) {
  401. return new Vector3(this.x + otherVector.x, this.y + otherVector.y, this.z + otherVector.z);
  402. };
  403. Vector3.prototype.addToRef = function (otherVector, result) {
  404. result.x = this.x + otherVector.x;
  405. result.y = this.y + otherVector.y;
  406. result.z = this.z + otherVector.z;
  407. };
  408. Vector3.prototype.subtractInPlace = function (otherVector) {
  409. this.x -= otherVector.x;
  410. this.y -= otherVector.y;
  411. this.z -= otherVector.z;
  412. };
  413. Vector3.prototype.subtract = function (otherVector) {
  414. return new Vector3(this.x - otherVector.x, this.y - otherVector.y, this.z - otherVector.z);
  415. };
  416. Vector3.prototype.subtractToRef = function (otherVector, result) {
  417. result.x = this.x - otherVector.x;
  418. result.y = this.y - otherVector.y;
  419. result.z = this.z - otherVector.z;
  420. };
  421. Vector3.prototype.subtractFromFloats = function (x, y, z) {
  422. return new Vector3(this.x - x, this.y - y, this.z - z);
  423. };
  424. Vector3.prototype.subtractFromFloatsToRef = function (x, y, z, result) {
  425. result.x = this.x - x;
  426. result.y = this.y - y;
  427. result.z = this.z - z;
  428. };
  429. Vector3.prototype.negate = function () {
  430. return new Vector3(-this.x, -this.y, -this.z);
  431. };
  432. Vector3.prototype.scaleInPlace = function (scale) {
  433. this.x *= scale;
  434. this.y *= scale;
  435. this.z *= scale;
  436. return this;
  437. };
  438. Vector3.prototype.scale = function (scale) {
  439. return new Vector3(this.x * scale, this.y * scale, this.z * scale);
  440. };
  441. Vector3.prototype.scaleToRef = function (scale, result) {
  442. result.x = this.x * scale;
  443. result.y = this.y * scale;
  444. result.z = this.z * scale;
  445. };
  446. Vector3.prototype.equals = function (otherVector) {
  447. return otherVector && this.x === otherVector.x && this.y === otherVector.y && this.z === otherVector.z;
  448. };
  449. Vector3.prototype.equalsWithEpsilon = function (otherVector) {
  450. return Math.abs(this.x - otherVector.x) < BABYLON.Engine.Epsilon && Math.abs(this.y - otherVector.y) < BABYLON.Engine.Epsilon && Math.abs(this.z - otherVector.z) < BABYLON.Engine.Epsilon;
  451. };
  452. Vector3.prototype.equalsToFloats = function (x, y, z) {
  453. return this.x === x && this.y === y && this.z === z;
  454. };
  455. Vector3.prototype.multiplyInPlace = function (otherVector) {
  456. this.x *= otherVector.x;
  457. this.y *= otherVector.y;
  458. this.z *= otherVector.z;
  459. };
  460. Vector3.prototype.multiply = function (otherVector) {
  461. return new Vector3(this.x * otherVector.x, this.y * otherVector.y, this.z * otherVector.z);
  462. };
  463. Vector3.prototype.multiplyToRef = function (otherVector, result) {
  464. result.x = this.x * otherVector.x;
  465. result.y = this.y * otherVector.y;
  466. result.z = this.z * otherVector.z;
  467. };
  468. Vector3.prototype.multiplyByFloats = function (x, y, z) {
  469. return new Vector3(this.x * x, this.y * y, this.z * z);
  470. };
  471. Vector3.prototype.divide = function (otherVector) {
  472. return new Vector3(this.x / otherVector.x, this.y / otherVector.y, this.z / otherVector.z);
  473. };
  474. Vector3.prototype.divideToRef = function (otherVector, result) {
  475. result.x = this.x / otherVector.x;
  476. result.y = this.y / otherVector.y;
  477. result.z = this.z / otherVector.z;
  478. };
  479. Vector3.prototype.MinimizeInPlace = function (other) {
  480. if (other.x < this.x)
  481. this.x = other.x;
  482. if (other.y < this.y)
  483. this.y = other.y;
  484. if (other.z < this.z)
  485. this.z = other.z;
  486. };
  487. Vector3.prototype.MaximizeInPlace = function (other) {
  488. if (other.x > this.x)
  489. this.x = other.x;
  490. if (other.y > this.y)
  491. this.y = other.y;
  492. if (other.z > this.z)
  493. this.z = other.z;
  494. };
  495. Vector3.prototype.length = function () {
  496. return Math.sqrt(this.x * this.x + this.y * this.y + this.z * this.z);
  497. };
  498. Vector3.prototype.lengthSquared = function () {
  499. return (this.x * this.x + this.y * this.y + this.z * this.z);
  500. };
  501. Vector3.prototype.normalize = function () {
  502. var len = this.length();
  503. if (len === 0)
  504. return this;
  505. var num = 1.0 / len;
  506. this.x *= num;
  507. this.y *= num;
  508. this.z *= num;
  509. return this;
  510. };
  511. Vector3.prototype.clone = function () {
  512. return new Vector3(this.x, this.y, this.z);
  513. };
  514. Vector3.prototype.copyFrom = function (source) {
  515. this.x = source.x;
  516. this.y = source.y;
  517. this.z = source.z;
  518. };
  519. Vector3.prototype.copyFromFloats = function (x, y, z) {
  520. this.x = x;
  521. this.y = y;
  522. this.z = z;
  523. };
  524. Vector3.FromArray = function (array, offset) {
  525. if (!offset) {
  526. offset = 0;
  527. }
  528. return new Vector3(array[offset], array[offset + 1], array[offset + 2]);
  529. };
  530. Vector3.FromArrayToRef = function (array, offset, result) {
  531. result.x = array[offset];
  532. result.y = array[offset + 1];
  533. result.z = array[offset + 2];
  534. };
  535. Vector3.FromFloatArrayToRef = function (array, offset, result) {
  536. result.x = array[offset];
  537. result.y = array[offset + 1];
  538. result.z = array[offset + 2];
  539. };
  540. Vector3.FromFloatsToRef = function (x, y, z, result) {
  541. result.x = x;
  542. result.y = y;
  543. result.z = z;
  544. };
  545. Vector3.Zero = function () {
  546. return new Vector3(0, 0, 0);
  547. };
  548. Vector3.Up = function () {
  549. return new Vector3(0, 1.0, 0);
  550. };
  551. Vector3.TransformCoordinates = function (vector, transformation) {
  552. var result = Vector3.Zero();
  553. Vector3.TransformCoordinatesToRef(vector, transformation, result);
  554. return result;
  555. };
  556. Vector3.TransformCoordinatesToRef = function (vector, transformation, result) {
  557. var x = (vector.x * transformation.m[0]) + (vector.y * transformation.m[4]) + (vector.z * transformation.m[8]) + transformation.m[12];
  558. var y = (vector.x * transformation.m[1]) + (vector.y * transformation.m[5]) + (vector.z * transformation.m[9]) + transformation.m[13];
  559. var z = (vector.x * transformation.m[2]) + (vector.y * transformation.m[6]) + (vector.z * transformation.m[10]) + transformation.m[14];
  560. var w = (vector.x * transformation.m[3]) + (vector.y * transformation.m[7]) + (vector.z * transformation.m[11]) + transformation.m[15];
  561. result.x = x / w;
  562. result.y = y / w;
  563. result.z = z / w;
  564. };
  565. Vector3.TransformCoordinatesFromFloatsToRef = function (x, y, z, transformation, result) {
  566. var rx = (x * transformation.m[0]) + (y * transformation.m[4]) + (z * transformation.m[8]) + transformation.m[12];
  567. var ry = (x * transformation.m[1]) + (y * transformation.m[5]) + (z * transformation.m[9]) + transformation.m[13];
  568. var rz = (x * transformation.m[2]) + (y * transformation.m[6]) + (z * transformation.m[10]) + transformation.m[14];
  569. var rw = (x * transformation.m[3]) + (y * transformation.m[7]) + (z * transformation.m[11]) + transformation.m[15];
  570. result.x = rx / rw;
  571. result.y = ry / rw;
  572. result.z = rz / rw;
  573. };
  574. Vector3.TransformNormal = function (vector, transformation) {
  575. var result = Vector3.Zero();
  576. Vector3.TransformNormalToRef(vector, transformation, result);
  577. return result;
  578. };
  579. Vector3.TransformNormalToRef = function (vector, transformation, result) {
  580. result.x = (vector.x * transformation.m[0]) + (vector.y * transformation.m[4]) + (vector.z * transformation.m[8]);
  581. result.y = (vector.x * transformation.m[1]) + (vector.y * transformation.m[5]) + (vector.z * transformation.m[9]);
  582. result.z = (vector.x * transformation.m[2]) + (vector.y * transformation.m[6]) + (vector.z * transformation.m[10]);
  583. };
  584. Vector3.TransformNormalFromFloatsToRef = function (x, y, z, transformation, result) {
  585. result.x = (x * transformation.m[0]) + (y * transformation.m[4]) + (z * transformation.m[8]);
  586. result.y = (x * transformation.m[1]) + (y * transformation.m[5]) + (z * transformation.m[9]);
  587. result.z = (x * transformation.m[2]) + (y * transformation.m[6]) + (z * transformation.m[10]);
  588. };
  589. Vector3.CatmullRom = function (value1, value2, value3, value4, amount) {
  590. var squared = amount * amount;
  591. var cubed = amount * squared;
  592. var x = 0.5 * ((((2.0 * value2.x) + ((-value1.x + value3.x) * amount)) + (((((2.0 * value1.x) - (5.0 * value2.x)) + (4.0 * value3.x)) - value4.x) * squared)) + ((((-value1.x + (3.0 * value2.x)) - (3.0 * value3.x)) + value4.x) * cubed));
  593. var y = 0.5 * ((((2.0 * value2.y) + ((-value1.y + value3.y) * amount)) + (((((2.0 * value1.y) - (5.0 * value2.y)) + (4.0 * value3.y)) - value4.y) * squared)) + ((((-value1.y + (3.0 * value2.y)) - (3.0 * value3.y)) + value4.y) * cubed));
  594. var z = 0.5 * ((((2.0 * value2.z) + ((-value1.z + value3.z) * amount)) + (((((2.0 * value1.z) - (5.0 * value2.z)) + (4.0 * value3.z)) - value4.z) * squared)) + ((((-value1.z + (3.0 * value2.z)) - (3.0 * value3.z)) + value4.z) * cubed));
  595. return new Vector3(x, y, z);
  596. };
  597. Vector3.Clamp = function (value, min, max) {
  598. var x = value.x;
  599. x = (x > max.x) ? max.x : x;
  600. x = (x < min.x) ? min.x : x;
  601. var y = value.y;
  602. y = (y > max.y) ? max.y : y;
  603. y = (y < min.y) ? min.y : y;
  604. var z = value.z;
  605. z = (z > max.z) ? max.z : z;
  606. z = (z < min.z) ? min.z : z;
  607. return new Vector3(x, y, z);
  608. };
  609. Vector3.Hermite = function (value1, tangent1, value2, tangent2, amount) {
  610. var squared = amount * amount;
  611. var cubed = amount * squared;
  612. var part1 = ((2.0 * cubed) - (3.0 * squared)) + 1.0;
  613. var part2 = (-2.0 * cubed) + (3.0 * squared);
  614. var part3 = (cubed - (2.0 * squared)) + amount;
  615. var part4 = cubed - squared;
  616. var x = (((value1.x * part1) + (value2.x * part2)) + (tangent1.x * part3)) + (tangent2.x * part4);
  617. var y = (((value1.y * part1) + (value2.y * part2)) + (tangent1.y * part3)) + (tangent2.y * part4);
  618. var z = (((value1.z * part1) + (value2.z * part2)) + (tangent1.z * part3)) + (tangent2.z * part4);
  619. return new Vector3(x, y, z);
  620. };
  621. Vector3.Lerp = function (start, end, amount) {
  622. var x = start.x + ((end.x - start.x) * amount);
  623. var y = start.y + ((end.y - start.y) * amount);
  624. var z = start.z + ((end.z - start.z) * amount);
  625. return new Vector3(x, y, z);
  626. };
  627. Vector3.Dot = function (left, right) {
  628. return (left.x * right.x + left.y * right.y + left.z * right.z);
  629. };
  630. Vector3.Cross = function (left, right) {
  631. var result = Vector3.Zero();
  632. Vector3.CrossToRef(left, right, result);
  633. return result;
  634. };
  635. Vector3.CrossToRef = function (left, right, result) {
  636. result.x = left.y * right.z - left.z * right.y;
  637. result.y = left.z * right.x - left.x * right.z;
  638. result.z = left.x * right.y - left.y * right.x;
  639. };
  640. Vector3.Normalize = function (vector) {
  641. var result = Vector3.Zero();
  642. Vector3.NormalizeToRef(vector, result);
  643. return result;
  644. };
  645. Vector3.NormalizeToRef = function (vector, result) {
  646. result.copyFrom(vector);
  647. result.normalize();
  648. };
  649. Vector3.Project = function (vector, world, transform, viewport) {
  650. var cw = viewport.width;
  651. var ch = viewport.height;
  652. var cx = viewport.x;
  653. var cy = viewport.y;
  654. var viewportMatrix = BABYLON.Matrix.FromValues(cw / 2.0, 0, 0, 0, 0, -ch / 2.0, 0, 0, 0, 0, 1, 0, cx + cw / 2.0, ch / 2.0 + cy, 0, 1);
  655. var finalMatrix = world.multiply(transform).multiply(viewportMatrix);
  656. return Vector3.TransformCoordinates(vector, finalMatrix);
  657. };
  658. Vector3.UnprojectFromTransform = function (source, viewportWidth, viewportHeight, world, transform) {
  659. var matrix = world.multiply(transform);
  660. matrix.invert();
  661. source.x = source.x / viewportWidth * 2 - 1;
  662. source.y = -(source.y / viewportHeight * 2 - 1);
  663. var vector = BABYLON.Vector3.TransformCoordinates(source, matrix);
  664. var num = source.x * matrix.m[3] + source.y * matrix.m[7] + source.z * matrix.m[11] + matrix.m[15];
  665. if (BABYLON.Tools.WithinEpsilon(num, 1.0)) {
  666. vector = vector.scale(1.0 / num);
  667. }
  668. return vector;
  669. };
  670. Vector3.Unproject = function (source, viewportWidth, viewportHeight, world, view, projection) {
  671. var matrix = world.multiply(view).multiply(projection);
  672. matrix.invert();
  673. source.x = source.x / viewportWidth * 2 - 1;
  674. source.y = -(source.y / viewportHeight * 2 - 1);
  675. var vector = BABYLON.Vector3.TransformCoordinates(source, matrix);
  676. var num = source.x * matrix.m[3] + source.y * matrix.m[7] + source.z * matrix.m[11] + matrix.m[15];
  677. if (BABYLON.Tools.WithinEpsilon(num, 1.0)) {
  678. vector = vector.scale(1.0 / num);
  679. }
  680. return vector;
  681. };
  682. Vector3.Minimize = function (left, right) {
  683. var min = left.clone();
  684. min.MinimizeInPlace(right);
  685. return min;
  686. };
  687. Vector3.Maximize = function (left, right) {
  688. var max = left.clone();
  689. max.MaximizeInPlace(right);
  690. return max;
  691. };
  692. Vector3.Distance = function (value1, value2) {
  693. return Math.sqrt(Vector3.DistanceSquared(value1, value2));
  694. };
  695. Vector3.DistanceSquared = function (value1, value2) {
  696. var x = value1.x - value2.x;
  697. var y = value1.y - value2.y;
  698. var z = value1.z - value2.z;
  699. return (x * x) + (y * y) + (z * z);
  700. };
  701. Vector3.Center = function (value1, value2) {
  702. var center = value1.add(value2);
  703. center.scaleInPlace(0.5);
  704. return center;
  705. };
  706. return Vector3;
  707. })();
  708. BABYLON.Vector3 = Vector3;
  709. var Vector4 = (function () {
  710. function Vector4(x, y, z, w) {
  711. this.x = x;
  712. this.y = y;
  713. this.z = z;
  714. this.w = w;
  715. }
  716. Vector4.prototype.toString = function () {
  717. return "{X: " + this.x + " Y:" + this.y + " Z:" + this.z + "W:" + this.w + "}";
  718. };
  719. Vector4.prototype.asArray = function () {
  720. var result = [];
  721. this.toArray(result, 0);
  722. return result;
  723. };
  724. Vector4.prototype.toArray = function (array, index) {
  725. if (index === undefined) {
  726. index = 0;
  727. }
  728. array[index] = this.x;
  729. array[index + 1] = this.y;
  730. array[index + 2] = this.z;
  731. array[index + 3] = this.w;
  732. };
  733. Vector4.prototype.addInPlace = function (otherVector) {
  734. this.x += otherVector.x;
  735. this.y += otherVector.y;
  736. this.z += otherVector.z;
  737. this.w += otherVector.w;
  738. };
  739. Vector4.prototype.add = function (otherVector) {
  740. return new Vector4(this.x + otherVector.x, this.y + otherVector.y, this.z + otherVector.z, this.w + otherVector.w);
  741. };
  742. Vector4.prototype.addToRef = function (otherVector, result) {
  743. result.x = this.x + otherVector.x;
  744. result.y = this.y + otherVector.y;
  745. result.z = this.z + otherVector.z;
  746. result.w = this.w + otherVector.w;
  747. };
  748. Vector4.prototype.subtractInPlace = function (otherVector) {
  749. this.x -= otherVector.x;
  750. this.y -= otherVector.y;
  751. this.z -= otherVector.z;
  752. this.w -= otherVector.w;
  753. };
  754. Vector4.prototype.subtract = function (otherVector) {
  755. return new Vector4(this.x - otherVector.x, this.y - otherVector.y, this.z - otherVector.z, this.w - otherVector.w);
  756. };
  757. Vector4.prototype.subtractToRef = function (otherVector, result) {
  758. result.x = this.x - otherVector.x;
  759. result.y = this.y - otherVector.y;
  760. result.z = this.z - otherVector.z;
  761. result.w = this.w - otherVector.w;
  762. };
  763. Vector4.prototype.subtractFromFloats = function (x, y, z, w) {
  764. return new Vector4(this.x - x, this.y - y, this.z - z, this.w - w);
  765. };
  766. Vector4.prototype.subtractFromFloatsToRef = function (x, y, z, w, result) {
  767. result.x = this.x - x;
  768. result.y = this.y - y;
  769. result.z = this.z - z;
  770. result.w = this.w - w;
  771. };
  772. Vector4.prototype.negate = function () {
  773. return new Vector4(-this.x, -this.y, -this.z, -this.w);
  774. };
  775. Vector4.prototype.scaleInPlace = function (scale) {
  776. this.x *= scale;
  777. this.y *= scale;
  778. this.z *= scale;
  779. this.w *= scale;
  780. return this;
  781. };
  782. Vector4.prototype.scale = function (scale) {
  783. return new Vector4(this.x * scale, this.y * scale, this.z * scale, this.w * scale);
  784. };
  785. Vector4.prototype.scaleToRef = function (scale, result) {
  786. result.x = this.x * scale;
  787. result.y = this.y * scale;
  788. result.z = this.z * scale;
  789. result.w = this.w * scale;
  790. };
  791. Vector4.prototype.equals = function (otherVector) {
  792. return otherVector && this.x === otherVector.x && this.y === otherVector.y && this.z === otherVector.z && this.w === otherVector.w;
  793. };
  794. Vector4.prototype.equalsWithEpsilon = function (otherVector) {
  795. return Math.abs(this.x - otherVector.x) < BABYLON.Engine.Epsilon && Math.abs(this.y - otherVector.y) < BABYLON.Engine.Epsilon && Math.abs(this.z - otherVector.z) < BABYLON.Engine.Epsilon && Math.abs(this.w - otherVector.w) < BABYLON.Engine.Epsilon;
  796. };
  797. Vector4.prototype.equalsToFloats = function (x, y, z, w) {
  798. return this.x === x && this.y === y && this.z === z && this.w === w;
  799. };
  800. Vector4.prototype.multiplyInPlace = function (otherVector) {
  801. this.x *= otherVector.x;
  802. this.y *= otherVector.y;
  803. this.z *= otherVector.z;
  804. this.w *= otherVector.w;
  805. };
  806. Vector4.prototype.multiply = function (otherVector) {
  807. return new Vector4(this.x * otherVector.x, this.y * otherVector.y, this.z * otherVector.z, this.w * otherVector.w);
  808. };
  809. Vector4.prototype.multiplyToRef = function (otherVector, result) {
  810. result.x = this.x * otherVector.x;
  811. result.y = this.y * otherVector.y;
  812. result.z = this.z * otherVector.z;
  813. result.w = this.w * otherVector.w;
  814. };
  815. Vector4.prototype.multiplyByFloats = function (x, y, z, w) {
  816. return new Vector4(this.x * x, this.y * y, this.z * z, this.w * w);
  817. };
  818. Vector4.prototype.divide = function (otherVector) {
  819. return new Vector4(this.x / otherVector.x, this.y / otherVector.y, this.z / otherVector.z, this.w / otherVector.w);
  820. };
  821. Vector4.prototype.divideToRef = function (otherVector, result) {
  822. result.x = this.x / otherVector.x;
  823. result.y = this.y / otherVector.y;
  824. result.z = this.z / otherVector.z;
  825. result.w = this.w / otherVector.w;
  826. };
  827. Vector4.prototype.MinimizeInPlace = function (other) {
  828. if (other.x < this.x)
  829. this.x = other.x;
  830. if (other.y < this.y)
  831. this.y = other.y;
  832. if (other.z < this.z)
  833. this.z = other.z;
  834. if (other.w < this.w)
  835. this.w = other.w;
  836. };
  837. Vector4.prototype.MaximizeInPlace = function (other) {
  838. if (other.x > this.x)
  839. this.x = other.x;
  840. if (other.y > this.y)
  841. this.y = other.y;
  842. if (other.z > this.z)
  843. this.z = other.z;
  844. if (other.w > this.w)
  845. this.w = other.w;
  846. };
  847. Vector4.prototype.length = function () {
  848. return Math.sqrt(this.x * this.x + this.y * this.y + this.z * this.z + this.w * this.w);
  849. };
  850. Vector4.prototype.lengthSquared = function () {
  851. return (this.x * this.x + this.y * this.y + this.z * this.z + this.w * this.w);
  852. };
  853. Vector4.prototype.normalize = function () {
  854. var len = this.length();
  855. if (len === 0)
  856. return this;
  857. var num = 1.0 / len;
  858. this.x *= num;
  859. this.y *= num;
  860. this.z *= num;
  861. this.w *= num;
  862. return this;
  863. };
  864. Vector4.prototype.clone = function () {
  865. return new Vector4(this.x, this.y, this.z, this.w);
  866. };
  867. Vector4.prototype.copyFrom = function (source) {
  868. this.x = source.x;
  869. this.y = source.y;
  870. this.z = source.z;
  871. this.w = source.w;
  872. };
  873. Vector4.prototype.copyFromFloats = function (x, y, z, w) {
  874. this.x = x;
  875. this.y = y;
  876. this.z = z;
  877. this.w = w;
  878. };
  879. Vector4.FromArray = function (array, offset) {
  880. if (!offset) {
  881. offset = 0;
  882. }
  883. return new Vector4(array[offset], array[offset + 1], array[offset + 2], array[offset + 3]);
  884. };
  885. Vector4.FromArrayToRef = function (array, offset, result) {
  886. result.x = array[offset];
  887. result.y = array[offset + 1];
  888. result.z = array[offset + 2];
  889. result.w = array[offset + 3];
  890. };
  891. Vector4.FromFloatArrayToRef = function (array, offset, result) {
  892. result.x = array[offset];
  893. result.y = array[offset + 1];
  894. result.z = array[offset + 2];
  895. result.w = array[offset + 3];
  896. };
  897. Vector4.FromFloatsToRef = function (x, y, z, w, result) {
  898. result.x = x;
  899. result.y = y;
  900. result.z = z;
  901. result.w = w;
  902. };
  903. Vector4.Zero = function () {
  904. return new Vector4(0, 0, 0, 0);
  905. };
  906. Vector4.Normalize = function (vector) {
  907. var result = Vector4.Zero();
  908. Vector4.NormalizeToRef(vector, result);
  909. return result;
  910. };
  911. Vector4.NormalizeToRef = function (vector, result) {
  912. result.copyFrom(vector);
  913. result.normalize();
  914. };
  915. Vector4.Minimize = function (left, right) {
  916. var min = left.clone();
  917. min.MinimizeInPlace(right);
  918. return min;
  919. };
  920. Vector4.Maximize = function (left, right) {
  921. var max = left.clone();
  922. max.MaximizeInPlace(right);
  923. return max;
  924. };
  925. Vector4.Distance = function (value1, value2) {
  926. return Math.sqrt(Vector4.DistanceSquared(value1, value2));
  927. };
  928. Vector4.DistanceSquared = function (value1, value2) {
  929. var x = value1.x - value2.x;
  930. var y = value1.y - value2.y;
  931. var z = value1.z - value2.z;
  932. var w = value1.w - value2.w;
  933. return (x * x) + (y * y) + (z * z) + (w * w);
  934. };
  935. Vector4.Center = function (value1, value2) {
  936. var center = value1.add(value2);
  937. center.scaleInPlace(0.5);
  938. return center;
  939. };
  940. return Vector4;
  941. })();
  942. BABYLON.Vector4 = Vector4;
  943. var Quaternion = (function () {
  944. function Quaternion(x, y, z, w) {
  945. if (typeof x === "undefined") { x = 0; }
  946. if (typeof y === "undefined") { y = 0; }
  947. if (typeof z === "undefined") { z = 0; }
  948. if (typeof w === "undefined") { w = 1; }
  949. this.x = x;
  950. this.y = y;
  951. this.z = z;
  952. this.w = w;
  953. }
  954. Quaternion.prototype.toString = function () {
  955. return "{X: " + this.x + " Y:" + this.y + " Z:" + this.z + " W:" + this.w + "}";
  956. };
  957. Quaternion.prototype.asArray = function () {
  958. return [this.x, this.y, this.z, this.w];
  959. };
  960. Quaternion.prototype.equals = function (otherQuaternion) {
  961. return otherQuaternion && this.x === otherQuaternion.x && this.y === otherQuaternion.y && this.z === otherQuaternion.z && this.w === otherQuaternion.w;
  962. };
  963. Quaternion.prototype.clone = function () {
  964. return new Quaternion(this.x, this.y, this.z, this.w);
  965. };
  966. Quaternion.prototype.copyFrom = function (other) {
  967. this.x = other.x;
  968. this.y = other.y;
  969. this.z = other.z;
  970. this.w = other.w;
  971. };
  972. Quaternion.prototype.copyFromFloats = function (x, y, z, w) {
  973. this.x = x;
  974. this.y = y;
  975. this.z = z;
  976. this.w = w;
  977. };
  978. Quaternion.prototype.add = function (other) {
  979. return new Quaternion(this.x + other.x, this.y + other.y, this.z + other.z, this.w + other.w);
  980. };
  981. Quaternion.prototype.subtract = function (other) {
  982. return new Quaternion(this.x - other.x, this.y - other.y, this.z - other.z, this.w - other.w);
  983. };
  984. Quaternion.prototype.scale = function (value) {
  985. return new Quaternion(this.x * value, this.y * value, this.z * value, this.w * value);
  986. };
  987. Quaternion.prototype.multiply = function (q1) {
  988. var result = new Quaternion(0, 0, 0, 1.0);
  989. this.multiplyToRef(q1, result);
  990. return result;
  991. };
  992. Quaternion.prototype.multiplyToRef = function (q1, result) {
  993. result.x = this.x * q1.w + this.y * q1.z - this.z * q1.y + this.w * q1.x;
  994. result.y = -this.x * q1.z + this.y * q1.w + this.z * q1.x + this.w * q1.y;
  995. result.z = this.x * q1.y - this.y * q1.x + this.z * q1.w + this.w * q1.z;
  996. result.w = -this.x * q1.x - this.y * q1.y - this.z * q1.z + this.w * q1.w;
  997. };
  998. Quaternion.prototype.length = function () {
  999. return Math.sqrt((this.x * this.x) + (this.y * this.y) + (this.z * this.z) + (this.w * this.w));
  1000. };
  1001. Quaternion.prototype.normalize = function () {
  1002. var length = 1.0 / this.length();
  1003. this.x *= length;
  1004. this.y *= length;
  1005. this.z *= length;
  1006. this.w *= length;
  1007. };
  1008. Quaternion.prototype.toEulerAngles = function () {
  1009. var result = Vector3.Zero();
  1010. this.toEulerAnglesToRef(result);
  1011. return result;
  1012. };
  1013. Quaternion.prototype.toEulerAnglesToRef = function (result) {
  1014. var qx = this.x;
  1015. var qy = this.y;
  1016. var qz = this.z;
  1017. var qw = this.w;
  1018. var qxy = qx * qy;
  1019. var qxz = qx * qz;
  1020. var qwy = qw * qy;
  1021. var qwz = qw * qz;
  1022. var qwx = qw * qx;
  1023. var qyz = qy * qz;
  1024. var sqx = qx * qx;
  1025. var sqy = qy * qy;
  1026. var determinant = sqx + sqy;
  1027. if (determinant != 0.000 && determinant != 1.000) {
  1028. result.x = Math.atan2(qxz + qwy, qwx - qyz);
  1029. result.y = Math.acos(1 - 2 * determinant);
  1030. result.z = Math.atan2(qxz - qwy, qwx + qyz);
  1031. } else {
  1032. if (determinant == 0.000) {
  1033. result.x = 0.0;
  1034. result.y = 0.0;
  1035. result.z = Math.atan2(qxy - qwz, 0.5 - sqy - qz * qz);
  1036. } else {
  1037. result.x = Math.atan2(qxy - qwz, 0.5 - sqy - qz * qz);
  1038. result.y = Math.PI;
  1039. result.z = 0.0;
  1040. }
  1041. }
  1042. };
  1043. Quaternion.prototype.toRotationMatrix = function (result) {
  1044. var xx = this.x * this.x;
  1045. var yy = this.y * this.y;
  1046. var zz = this.z * this.z;
  1047. var xy = this.x * this.y;
  1048. var zw = this.z * this.w;
  1049. var zx = this.z * this.x;
  1050. var yw = this.y * this.w;
  1051. var yz = this.y * this.z;
  1052. var xw = this.x * this.w;
  1053. result.m[0] = 1.0 - (2.0 * (yy + zz));
  1054. result.m[1] = 2.0 * (xy + zw);
  1055. result.m[2] = 2.0 * (zx - yw);
  1056. result.m[3] = 0;
  1057. result.m[4] = 2.0 * (xy - zw);
  1058. result.m[5] = 1.0 - (2.0 * (zz + xx));
  1059. result.m[6] = 2.0 * (yz + xw);
  1060. result.m[7] = 0;
  1061. result.m[8] = 2.0 * (zx + yw);
  1062. result.m[9] = 2.0 * (yz - xw);
  1063. result.m[10] = 1.0 - (2.0 * (yy + xx));
  1064. result.m[11] = 0;
  1065. result.m[12] = 0;
  1066. result.m[13] = 0;
  1067. result.m[14] = 0;
  1068. result.m[15] = 1.0;
  1069. };
  1070. Quaternion.prototype.fromRotationMatrix = function (matrix) {
  1071. var data = matrix.m;
  1072. var m11 = data[0], m12 = data[4], m13 = data[8];
  1073. var m21 = data[1], m22 = data[5], m23 = data[9];
  1074. var m31 = data[2], m32 = data[6], m33 = data[10];
  1075. var trace = m11 + m22 + m33;
  1076. var s;
  1077. if (trace > 0) {
  1078. s = 0.5 / Math.sqrt(trace + 1.0);
  1079. this.w = 0.25 / s;
  1080. this.x = (m32 - m23) * s;
  1081. this.y = (m13 - m31) * s;
  1082. this.z = (m21 - m12) * s;
  1083. return;
  1084. }
  1085. if (m11 > m22 && m11 > m33) {
  1086. s = 2.0 * Math.sqrt(1.0 + m11 - m22 - m33);
  1087. this.w = (m32 - m23) / s;
  1088. this.x = 0.25 * s;
  1089. this.y = (m12 + m21) / s;
  1090. this.z = (m13 + m31) / s;
  1091. return;
  1092. }
  1093. if (m22 > m33) {
  1094. s = 2.0 * Math.sqrt(1.0 + m22 - m11 - m33);
  1095. this.w = (m13 - m31) / s;
  1096. this.x = (m12 + m21) / s;
  1097. this.y = 0.25 * s;
  1098. this.z = (m23 + m32) / s;
  1099. return;
  1100. }
  1101. s = 2.0 * Math.sqrt(1.0 + m33 - m11 - m22);
  1102. this.w = (m21 - m12) / s;
  1103. this.x = (m13 + m31) / s;
  1104. this.y = (m23 + m32) / s;
  1105. this.z = 0.25 * s;
  1106. };
  1107. Quaternion.Inverse = function (q) {
  1108. return new Quaternion(-q.x, -q.y, -q.z, q.w);
  1109. };
  1110. Quaternion.RotationAxis = function (axis, angle) {
  1111. var result = new Quaternion();
  1112. var sin = Math.sin(angle / 2);
  1113. result.w = Math.cos(angle / 2);
  1114. result.x = axis.x * sin;
  1115. result.y = axis.y * sin;
  1116. result.z = axis.z * sin;
  1117. return result;
  1118. };
  1119. Quaternion.FromArray = function (array, offset) {
  1120. if (!offset) {
  1121. offset = 0;
  1122. }
  1123. return new Quaternion(array[offset], array[offset + 1], array[offset + 2], array[offset + 3]);
  1124. };
  1125. Quaternion.RotationYawPitchRoll = function (yaw, pitch, roll) {
  1126. var result = new Quaternion();
  1127. Quaternion.RotationYawPitchRollToRef(yaw, pitch, roll, result);
  1128. return result;
  1129. };
  1130. Quaternion.RotationYawPitchRollToRef = function (yaw, pitch, roll, result) {
  1131. var halfRoll = roll * 0.5;
  1132. var halfPitch = pitch * 0.5;
  1133. var halfYaw = yaw * 0.5;
  1134. var sinRoll = Math.sin(halfRoll);
  1135. var cosRoll = Math.cos(halfRoll);
  1136. var sinPitch = Math.sin(halfPitch);
  1137. var cosPitch = Math.cos(halfPitch);
  1138. var sinYaw = Math.sin(halfYaw);
  1139. var cosYaw = Math.cos(halfYaw);
  1140. result.x = (cosYaw * sinPitch * cosRoll) + (sinYaw * cosPitch * sinRoll);
  1141. result.y = (sinYaw * cosPitch * cosRoll) - (cosYaw * sinPitch * sinRoll);
  1142. result.z = (cosYaw * cosPitch * sinRoll) - (sinYaw * sinPitch * cosRoll);
  1143. result.w = (cosYaw * cosPitch * cosRoll) + (sinYaw * sinPitch * sinRoll);
  1144. };
  1145. Quaternion.Slerp = function (left, right, amount) {
  1146. var num2;
  1147. var num3;
  1148. var num = amount;
  1149. var num4 = (((left.x * right.x) + (left.y * right.y)) + (left.z * right.z)) + (left.w * right.w);
  1150. var flag = false;
  1151. if (num4 < 0) {
  1152. flag = true;
  1153. num4 = -num4;
  1154. }
  1155. if (num4 > 0.999999) {
  1156. num3 = 1 - num;
  1157. num2 = flag ? -num : num;
  1158. } else {
  1159. var num5 = Math.acos(num4);
  1160. var num6 = (1.0 / Math.sin(num5));
  1161. num3 = (Math.sin((1.0 - num) * num5)) * num6;
  1162. num2 = flag ? ((-Math.sin(num * num5)) * num6) : ((Math.sin(num * num5)) * num6);
  1163. }
  1164. return new Quaternion((num3 * left.x) + (num2 * right.x), (num3 * left.y) + (num2 * right.y), (num3 * left.z) + (num2 * right.z), (num3 * left.w) + (num2 * right.w));
  1165. };
  1166. return Quaternion;
  1167. })();
  1168. BABYLON.Quaternion = Quaternion;
  1169. var Matrix = (function () {
  1170. function Matrix() {
  1171. this.m = new Float32Array(16);
  1172. }
  1173. Matrix.prototype.isIdentity = function () {
  1174. if (this.m[0] != 1.0 || this.m[5] != 1.0 || this.m[10] != 1.0 || this.m[15] != 1.0)
  1175. return false;
  1176. if (this.m[1] != 0.0 || this.m[2] != 0.0 || this.m[3] != 0.0 || this.m[4] != 0.0 || this.m[6] != 0.0 || this.m[7] != 0.0 || this.m[8] != 0.0 || this.m[9] != 0.0 || this.m[11] != 0.0 || this.m[12] != 0.0 || this.m[13] != 0.0 || this.m[14] != 0.0)
  1177. return false;
  1178. return true;
  1179. };
  1180. Matrix.prototype.determinant = function () {
  1181. var temp1 = (this.m[10] * this.m[15]) - (this.m[11] * this.m[14]);
  1182. var temp2 = (this.m[9] * this.m[15]) - (this.m[11] * this.m[13]);
  1183. var temp3 = (this.m[9] * this.m[14]) - (this.m[10] * this.m[13]);
  1184. var temp4 = (this.m[8] * this.m[15]) - (this.m[11] * this.m[12]);
  1185. var temp5 = (this.m[8] * this.m[14]) - (this.m[10] * this.m[12]);
  1186. var temp6 = (this.m[8] * this.m[13]) - (this.m[9] * this.m[12]);
  1187. return ((((this.m[0] * (((this.m[5] * temp1) - (this.m[6] * temp2)) + (this.m[7] * temp3))) - (this.m[1] * (((this.m[4] * temp1) - (this.m[6] * temp4)) + (this.m[7] * temp5)))) + (this.m[2] * (((this.m[4] * temp2) - (this.m[5] * temp4)) + (this.m[7] * temp6)))) - (this.m[3] * (((this.m[4] * temp3) - (this.m[5] * temp5)) + (this.m[6] * temp6))));
  1188. };
  1189. Matrix.prototype.toArray = function () {
  1190. return this.m;
  1191. };
  1192. Matrix.prototype.asArray = function () {
  1193. return this.toArray();
  1194. };
  1195. Matrix.prototype.invert = function () {
  1196. this.invertToRef(this);
  1197. };
  1198. Matrix.prototype.invertToRef = function (other) {
  1199. var l1 = this.m[0];
  1200. var l2 = this.m[1];
  1201. var l3 = this.m[2];
  1202. var l4 = this.m[3];
  1203. var l5 = this.m[4];
  1204. var l6 = this.m[5];
  1205. var l7 = this.m[6];
  1206. var l8 = this.m[7];
  1207. var l9 = this.m[8];
  1208. var l10 = this.m[9];
  1209. var l11 = this.m[10];
  1210. var l12 = this.m[11];
  1211. var l13 = this.m[12];
  1212. var l14 = this.m[13];
  1213. var l15 = this.m[14];
  1214. var l16 = this.m[15];
  1215. var l17 = (l11 * l16) - (l12 * l15);
  1216. var l18 = (l10 * l16) - (l12 * l14);
  1217. var l19 = (l10 * l15) - (l11 * l14);
  1218. var l20 = (l9 * l16) - (l12 * l13);
  1219. var l21 = (l9 * l15) - (l11 * l13);
  1220. var l22 = (l9 * l14) - (l10 * l13);
  1221. var l23 = ((l6 * l17) - (l7 * l18)) + (l8 * l19);
  1222. var l24 = -(((l5 * l17) - (l7 * l20)) + (l8 * l21));
  1223. var l25 = ((l5 * l18) - (l6 * l20)) + (l8 * l22);
  1224. var l26 = -(((l5 * l19) - (l6 * l21)) + (l7 * l22));
  1225. var l27 = 1.0 / ((((l1 * l23) + (l2 * l24)) + (l3 * l25)) + (l4 * l26));
  1226. var l28 = (l7 * l16) - (l8 * l15);
  1227. var l29 = (l6 * l16) - (l8 * l14);
  1228. var l30 = (l6 * l15) - (l7 * l14);
  1229. var l31 = (l5 * l16) - (l8 * l13);
  1230. var l32 = (l5 * l15) - (l7 * l13);
  1231. var l33 = (l5 * l14) - (l6 * l13);
  1232. var l34 = (l7 * l12) - (l8 * l11);
  1233. var l35 = (l6 * l12) - (l8 * l10);
  1234. var l36 = (l6 * l11) - (l7 * l10);
  1235. var l37 = (l5 * l12) - (l8 * l9);
  1236. var l38 = (l5 * l11) - (l7 * l9);
  1237. var l39 = (l5 * l10) - (l6 * l9);
  1238. other.m[0] = l23 * l27;
  1239. other.m[4] = l24 * l27;
  1240. other.m[8] = l25 * l27;
  1241. other.m[12] = l26 * l27;
  1242. other.m[1] = -(((l2 * l17) - (l3 * l18)) + (l4 * l19)) * l27;
  1243. other.m[5] = (((l1 * l17) - (l3 * l20)) + (l4 * l21)) * l27;
  1244. other.m[9] = -(((l1 * l18) - (l2 * l20)) + (l4 * l22)) * l27;
  1245. other.m[13] = (((l1 * l19) - (l2 * l21)) + (l3 * l22)) * l27;
  1246. other.m[2] = (((l2 * l28) - (l3 * l29)) + (l4 * l30)) * l27;
  1247. other.m[6] = -(((l1 * l28) - (l3 * l31)) + (l4 * l32)) * l27;
  1248. other.m[10] = (((l1 * l29) - (l2 * l31)) + (l4 * l33)) * l27;
  1249. other.m[14] = -(((l1 * l30) - (l2 * l32)) + (l3 * l33)) * l27;
  1250. other.m[3] = -(((l2 * l34) - (l3 * l35)) + (l4 * l36)) * l27;
  1251. other.m[7] = (((l1 * l34) - (l3 * l37)) + (l4 * l38)) * l27;
  1252. other.m[11] = -(((l1 * l35) - (l2 * l37)) + (l4 * l39)) * l27;
  1253. other.m[15] = (((l1 * l36) - (l2 * l38)) + (l3 * l39)) * l27;
  1254. };
  1255. Matrix.prototype.setTranslation = function (vector3) {
  1256. this.m[12] = vector3.x;
  1257. this.m[13] = vector3.y;
  1258. this.m[14] = vector3.z;
  1259. };
  1260. Matrix.prototype.multiply = function (other) {
  1261. var result = new Matrix();
  1262. this.multiplyToRef(other, result);
  1263. return result;
  1264. };
  1265. Matrix.prototype.copyFrom = function (other) {
  1266. for (var index = 0; index < 16; index++) {
  1267. this.m[index] = other.m[index];
  1268. }
  1269. };
  1270. Matrix.prototype.copyToArray = function (array, offset) {
  1271. if (typeof offset === "undefined") { offset = 0; }
  1272. for (var index = 0; index < 16; index++) {
  1273. array[offset + index] = this.m[index];
  1274. }
  1275. };
  1276. Matrix.prototype.multiplyToRef = function (other, result) {
  1277. this.multiplyToArray(other, result.m, 0);
  1278. };
  1279. Matrix.prototype.multiplyToArray = function (other, result, offset) {
  1280. var tm0 = this.m[0];
  1281. var tm1 = this.m[1];
  1282. var tm2 = this.m[2];
  1283. var tm3 = this.m[3];
  1284. var tm4 = this.m[4];
  1285. var tm5 = this.m[5];
  1286. var tm6 = this.m[6];
  1287. var tm7 = this.m[7];
  1288. var tm8 = this.m[8];
  1289. var tm9 = this.m[9];
  1290. var tm10 = this.m[10];
  1291. var tm11 = this.m[11];
  1292. var tm12 = this.m[12];
  1293. var tm13 = this.m[13];
  1294. var tm14 = this.m[14];
  1295. var tm15 = this.m[15];
  1296. var om0 = other.m[0];
  1297. var om1 = other.m[1];
  1298. var om2 = other.m[2];
  1299. var om3 = other.m[3];
  1300. var om4 = other.m[4];
  1301. var om5 = other.m[5];
  1302. var om6 = other.m[6];
  1303. var om7 = other.m[7];
  1304. var om8 = other.m[8];
  1305. var om9 = other.m[9];
  1306. var om10 = other.m[10];
  1307. var om11 = other.m[11];
  1308. var om12 = other.m[12];
  1309. var om13 = other.m[13];
  1310. var om14 = other.m[14];
  1311. var om15 = other.m[15];
  1312. result[offset] = tm0 * om0 + tm1 * om4 + tm2 * om8 + tm3 * om12;
  1313. result[offset + 1] = tm0 * om1 + tm1 * om5 + tm2 * om9 + tm3 * om13;
  1314. result[offset + 2] = tm0 * om2 + tm1 * om6 + tm2 * om10 + tm3 * om14;
  1315. result[offset + 3] = tm0 * om3 + tm1 * om7 + tm2 * om11 + tm3 * om15;
  1316. result[offset + 4] = tm4 * om0 + tm5 * om4 + tm6 * om8 + tm7 * om12;
  1317. result[offset + 5] = tm4 * om1 + tm5 * om5 + tm6 * om9 + tm7 * om13;
  1318. result[offset + 6] = tm4 * om2 + tm5 * om6 + tm6 * om10 + tm7 * om14;
  1319. result[offset + 7] = tm4 * om3 + tm5 * om7 + tm6 * om11 + tm7 * om15;
  1320. result[offset + 8] = tm8 * om0 + tm9 * om4 + tm10 * om8 + tm11 * om12;
  1321. result[offset + 9] = tm8 * om1 + tm9 * om5 + tm10 * om9 + tm11 * om13;
  1322. result[offset + 10] = tm8 * om2 + tm9 * om6 + tm10 * om10 + tm11 * om14;
  1323. result[offset + 11] = tm8 * om3 + tm9 * om7 + tm10 * om11 + tm11 * om15;
  1324. result[offset + 12] = tm12 * om0 + tm13 * om4 + tm14 * om8 + tm15 * om12;
  1325. result[offset + 13] = tm12 * om1 + tm13 * om5 + tm14 * om9 + tm15 * om13;
  1326. result[offset + 14] = tm12 * om2 + tm13 * om6 + tm14 * om10 + tm15 * om14;
  1327. result[offset + 15] = tm12 * om3 + tm13 * om7 + tm14 * om11 + tm15 * om15;
  1328. };
  1329. Matrix.prototype.equals = function (value) {
  1330. return value && (this.m[0] === value.m[0] && this.m[1] === value.m[1] && this.m[2] === value.m[2] && this.m[3] === value.m[3] && this.m[4] === value.m[4] && this.m[5] === value.m[5] && this.m[6] === value.m[6] && this.m[7] === value.m[7] && this.m[8] === value.m[8] && this.m[9] === value.m[9] && this.m[10] === value.m[10] && this.m[11] === value.m[11] && this.m[12] === value.m[12] && this.m[13] === value.m[13] && this.m[14] === value.m[14] && this.m[15] === value.m[15]);
  1331. };
  1332. Matrix.prototype.clone = function () {
  1333. return Matrix.FromValues(this.m[0], this.m[1], this.m[2], this.m[3], this.m[4], this.m[5], this.m[6], this.m[7], this.m[8], this.m[9], this.m[10], this.m[11], this.m[12], this.m[13], this.m[14], this.m[15]);
  1334. };
  1335. Matrix.FromArray = function (array, offset) {
  1336. var result = new Matrix();
  1337. if (!offset) {
  1338. offset = 0;
  1339. }
  1340. Matrix.FromArrayToRef(array, offset, result);
  1341. return result;
  1342. };
  1343. Matrix.FromArrayToRef = function (array, offset, result) {
  1344. for (var index = 0; index < 16; index++) {
  1345. result.m[index] = array[index + offset];
  1346. }
  1347. };
  1348. Matrix.FromValuesToRef = function (initialM11, initialM12, initialM13, initialM14, initialM21, initialM22, initialM23, initialM24, initialM31, initialM32, initialM33, initialM34, initialM41, initialM42, initialM43, initialM44, result) {
  1349. result.m[0] = initialM11;
  1350. result.m[1] = initialM12;
  1351. result.m[2] = initialM13;
  1352. result.m[3] = initialM14;
  1353. result.m[4] = initialM21;
  1354. result.m[5] = initialM22;
  1355. result.m[6] = initialM23;
  1356. result.m[7] = initialM24;
  1357. result.m[8] = initialM31;
  1358. result.m[9] = initialM32;
  1359. result.m[10] = initialM33;
  1360. result.m[11] = initialM34;
  1361. result.m[12] = initialM41;
  1362. result.m[13] = initialM42;
  1363. result.m[14] = initialM43;
  1364. result.m[15] = initialM44;
  1365. };
  1366. Matrix.FromValues = function (initialM11, initialM12, initialM13, initialM14, initialM21, initialM22, initialM23, initialM24, initialM31, initialM32, initialM33, initialM34, initialM41, initialM42, initialM43, initialM44) {
  1367. var result = new Matrix();
  1368. result.m[0] = initialM11;
  1369. result.m[1] = initialM12;
  1370. result.m[2] = initialM13;
  1371. result.m[3] = initialM14;
  1372. result.m[4] = initialM21;
  1373. result.m[5] = initialM22;
  1374. result.m[6] = initialM23;
  1375. result.m[7] = initialM24;
  1376. result.m[8] = initialM31;
  1377. result.m[9] = initialM32;
  1378. result.m[10] = initialM33;
  1379. result.m[11] = initialM34;
  1380. result.m[12] = initialM41;
  1381. result.m[13] = initialM42;
  1382. result.m[14] = initialM43;
  1383. result.m[15] = initialM44;
  1384. return result;
  1385. };
  1386. Matrix.Identity = function () {
  1387. return Matrix.FromValues(1.0, 0, 0, 0, 0, 1.0, 0, 0, 0, 0, 1.0, 0, 0, 0, 0, 1.0);
  1388. };
  1389. Matrix.IdentityToRef = function (result) {
  1390. Matrix.FromValuesToRef(1.0, 0, 0, 0, 0, 1.0, 0, 0, 0, 0, 1.0, 0, 0, 0, 0, 1.0, result);
  1391. };
  1392. Matrix.Zero = function () {
  1393. return Matrix.FromValues(0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0);
  1394. };
  1395. Matrix.RotationX = function (angle) {
  1396. var result = new Matrix();
  1397. Matrix.RotationXToRef(angle, result);
  1398. return result;
  1399. };
  1400. Matrix.Invert = function (source) {
  1401. var result = new Matrix();
  1402. source.invertToRef(result);
  1403. return result;
  1404. };
  1405. Matrix.RotationXToRef = function (angle, result) {
  1406. var s = Math.sin(angle);
  1407. var c = Math.cos(angle);
  1408. result.m[0] = 1.0;
  1409. result.m[15] = 1.0;
  1410. result.m[5] = c;
  1411. result.m[10] = c;
  1412. result.m[9] = -s;
  1413. result.m[6] = s;
  1414. result.m[1] = 0;
  1415. result.m[2] = 0;
  1416. result.m[3] = 0;
  1417. result.m[4] = 0;
  1418. result.m[7] = 0;
  1419. result.m[8] = 0;
  1420. result.m[11] = 0;
  1421. result.m[12] = 0;
  1422. result.m[13] = 0;
  1423. result.m[14] = 0;
  1424. };
  1425. Matrix.RotationY = function (angle) {
  1426. var result = new Matrix();
  1427. Matrix.RotationYToRef(angle, result);
  1428. return result;
  1429. };
  1430. Matrix.RotationYToRef = function (angle, result) {
  1431. var s = Math.sin(angle);
  1432. var c = Math.cos(angle);
  1433. result.m[5] = 1.0;
  1434. result.m[15] = 1.0;
  1435. result.m[0] = c;
  1436. result.m[2] = -s;
  1437. result.m[8] = s;
  1438. result.m[10] = c;
  1439. result.m[1] = 0;
  1440. result.m[3] = 0;
  1441. result.m[4] = 0;
  1442. result.m[6] = 0;
  1443. result.m[7] = 0;
  1444. result.m[9] = 0;
  1445. result.m[11] = 0;
  1446. result.m[12] = 0;
  1447. result.m[13] = 0;
  1448. result.m[14] = 0;
  1449. };
  1450. Matrix.RotationZ = function (angle) {
  1451. var result = new Matrix();
  1452. Matrix.RotationZToRef(angle, result);
  1453. return result;
  1454. };
  1455. Matrix.RotationZToRef = function (angle, result) {
  1456. var s = Math.sin(angle);
  1457. var c = Math.cos(angle);
  1458. result.m[10] = 1.0;
  1459. result.m[15] = 1.0;
  1460. result.m[0] = c;
  1461. result.m[1] = s;
  1462. result.m[4] = -s;
  1463. result.m[5] = c;
  1464. result.m[2] = 0;
  1465. result.m[3] = 0;
  1466. result.m[6] = 0;
  1467. result.m[7] = 0;
  1468. result.m[8] = 0;
  1469. result.m[9] = 0;
  1470. result.m[11] = 0;
  1471. result.m[12] = 0;
  1472. result.m[13] = 0;
  1473. result.m[14] = 0;
  1474. };
  1475. Matrix.RotationAxis = function (axis, angle) {
  1476. var s = Math.sin(-angle);
  1477. var c = Math.cos(-angle);
  1478. var c1 = 1 - c;
  1479. axis.normalize();
  1480. var result = Matrix.Zero();
  1481. result.m[0] = (axis.x * axis.x) * c1 + c;
  1482. result.m[1] = (axis.x * axis.y) * c1 - (axis.z * s);
  1483. result.m[2] = (axis.x * axis.z) * c1 + (axis.y * s);
  1484. result.m[3] = 0.0;
  1485. result.m[4] = (axis.y * axis.x) * c1 + (axis.z * s);
  1486. result.m[5] = (axis.y * axis.y) * c1 + c;
  1487. result.m[6] = (axis.y * axis.z) * c1 - (axis.x * s);
  1488. result.m[7] = 0.0;
  1489. result.m[8] = (axis.z * axis.x) * c1 - (axis.y * s);
  1490. result.m[9] = (axis.z * axis.y) * c1 + (axis.x * s);
  1491. result.m[10] = (axis.z * axis.z) * c1 + c;
  1492. result.m[11] = 0.0;
  1493. result.m[15] = 1.0;
  1494. return result;
  1495. };
  1496. Matrix.RotationYawPitchRoll = function (yaw, pitch, roll) {
  1497. var result = new Matrix();
  1498. Matrix.RotationYawPitchRollToRef(yaw, pitch, roll, result);
  1499. return result;
  1500. };
  1501. Matrix.RotationYawPitchRollToRef = function (yaw, pitch, roll, result) {
  1502. Quaternion.RotationYawPitchRollToRef(yaw, pitch, roll, this._tempQuaternion);
  1503. this._tempQuaternion.toRotationMatrix(result);
  1504. };
  1505. Matrix.Scaling = function (x, y, z) {
  1506. var result = Matrix.Zero();
  1507. Matrix.ScalingToRef(x, y, z, result);
  1508. return result;
  1509. };
  1510. Matrix.ScalingToRef = function (x, y, z, result) {
  1511. result.m[0] = x;
  1512. result.m[1] = 0;
  1513. result.m[2] = 0;
  1514. result.m[3] = 0;
  1515. result.m[4] = 0;
  1516. result.m[5] = y;
  1517. result.m[6] = 0;
  1518. result.m[7] = 0;
  1519. result.m[8] = 0;
  1520. result.m[9] = 0;
  1521. result.m[10] = z;
  1522. result.m[11] = 0;
  1523. result.m[12] = 0;
  1524. result.m[13] = 0;
  1525. result.m[14] = 0;
  1526. result.m[15] = 1.0;
  1527. };
  1528. Matrix.Translation = function (x, y, z) {
  1529. var result = Matrix.Identity();
  1530. Matrix.TranslationToRef(x, y, z, result);
  1531. return result;
  1532. };
  1533. Matrix.TranslationToRef = function (x, y, z, result) {
  1534. Matrix.FromValuesToRef(1.0, 0, 0, 0, 0, 1.0, 0, 0, 0, 0, 1.0, 0, x, y, z, 1.0, result);
  1535. };
  1536. Matrix.LookAtLH = function (eye, target, up) {
  1537. var result = Matrix.Zero();
  1538. Matrix.LookAtLHToRef(eye, target, up, result);
  1539. return result;
  1540. };
  1541. Matrix.LookAtLHToRef = function (eye, target, up, result) {
  1542. target.subtractToRef(eye, this._zAxis);
  1543. this._zAxis.normalize();
  1544. Vector3.CrossToRef(up, this._zAxis, this._xAxis);
  1545. this._xAxis.normalize();
  1546. Vector3.CrossToRef(this._zAxis, this._xAxis, this._yAxis);
  1547. this._yAxis.normalize();
  1548. var ex = -Vector3.Dot(this._xAxis, eye);
  1549. var ey = -Vector3.Dot(this._yAxis, eye);
  1550. var ez = -Vector3.Dot(this._zAxis, eye);
  1551. return Matrix.FromValuesToRef(this._xAxis.x, this._yAxis.x, this._zAxis.x, 0, this._xAxis.y, this._yAxis.y, this._zAxis.y, 0, this._xAxis.z, this._yAxis.z, this._zAxis.z, 0, ex, ey, ez, 1, result);
  1552. };
  1553. Matrix.OrthoLH = function (width, height, znear, zfar) {
  1554. var hw = 2.0 / width;
  1555. var hh = 2.0 / height;
  1556. var id = 1.0 / (zfar - znear);
  1557. var nid = znear / (znear - zfar);
  1558. return Matrix.FromValues(hw, 0, 0, 0, 0, hh, 0, 0, 0, 0, id, 0, 0, 0, nid, 1);
  1559. };
  1560. Matrix.OrthoOffCenterLH = function (left, right, bottom, top, znear, zfar) {
  1561. var matrix = Matrix.Zero();
  1562. Matrix.OrthoOffCenterLHToRef(left, right, bottom, top, znear, zfar, matrix);
  1563. return matrix;
  1564. };
  1565. Matrix.OrthoOffCenterLHToRef = function (left, right, bottom, top, znear, zfar, result) {
  1566. result.m[0] = 2.0 / (right - left);
  1567. result.m[1] = result.m[2] = result.m[3] = 0;
  1568. result.m[5] = 2.0 / (top - bottom);
  1569. result.m[4] = result.m[6] = result.m[7] = 0;
  1570. result.m[10] = -1.0 / (znear - zfar);
  1571. result.m[8] = result.m[9] = result.m[11] = 0;
  1572. result.m[12] = (left + right) / (left - right);
  1573. result.m[13] = (top + bottom) / (bottom - top);
  1574. result.m[14] = znear / (znear - zfar);
  1575. result.m[15] = 1.0;
  1576. };
  1577. Matrix.PerspectiveLH = function (width, height, znear, zfar) {
  1578. var matrix = Matrix.Zero();
  1579. matrix.m[0] = (2.0 * znear) / width;
  1580. matrix.m[1] = matrix.m[2] = matrix.m[3] = 0.0;
  1581. matrix.m[5] = (2.0 * znear) / height;
  1582. matrix.m[4] = matrix.m[6] = matrix.m[7] = 0.0;
  1583. matrix.m[10] = -zfar / (znear - zfar);
  1584. matrix.m[8] = matrix.m[9] = 0.0;
  1585. matrix.m[11] = 1.0;
  1586. matrix.m[12] = matrix.m[13] = matrix.m[15] = 0.0;
  1587. matrix.m[14] = (znear * zfar) / (znear - zfar);
  1588. return matrix;
  1589. };
  1590. Matrix.PerspectiveFovLH = function (fov, aspect, znear, zfar) {
  1591. var matrix = Matrix.Zero();
  1592. Matrix.PerspectiveFovLHToRef(fov, aspect, znear, zfar, matrix);
  1593. return matrix;
  1594. };
  1595. Matrix.PerspectiveFovLHToRef = function (fov, aspect, znear, zfar, result) {
  1596. var tan = 1.0 / (Math.tan(fov * 0.5));
  1597. result.m[0] = tan / aspect;
  1598. result.m[1] = result.m[2] = result.m[3] = 0.0;
  1599. result.m[5] = tan;
  1600. result.m[4] = result.m[6] = result.m[7] = 0.0;
  1601. result.m[8] = result.m[9] = 0.0;
  1602. result.m[10] = -zfar / (znear - zfar);
  1603. result.m[11] = 1.0;
  1604. result.m[12] = result.m[13] = result.m[15] = 0.0;
  1605. result.m[14] = (znear * zfar) / (znear - zfar);
  1606. };
  1607. Matrix.GetFinalMatrix = function (viewport, world, view, projection, zmin, zmax) {
  1608. var cw = viewport.width;
  1609. var ch = viewport.height;
  1610. var cx = viewport.x;
  1611. var cy = viewport.y;
  1612. var viewportMatrix = Matrix.FromValues(cw / 2.0, 0, 0, 0, 0, -ch / 2.0, 0, 0, 0, 0, zmax - zmin, 0, cx + cw / 2.0, ch / 2.0 + cy, zmin, 1);
  1613. return world.multiply(view).multiply(projection).multiply(viewportMatrix);
  1614. };
  1615. Matrix.Transpose = function (matrix) {
  1616. var result = new Matrix();
  1617. result.m[0] = matrix.m[0];
  1618. result.m[1] = matrix.m[4];
  1619. result.m[2] = matrix.m[8];
  1620. result.m[3] = matrix.m[12];
  1621. result.m[4] = matrix.m[1];
  1622. result.m[5] = matrix.m[5];
  1623. result.m[6] = matrix.m[9];
  1624. result.m[7] = matrix.m[13];
  1625. result.m[8] = matrix.m[2];
  1626. result.m[9] = matrix.m[6];
  1627. result.m[10] = matrix.m[10];
  1628. result.m[11] = matrix.m[14];
  1629. result.m[12] = matrix.m[3];
  1630. result.m[13] = matrix.m[7];
  1631. result.m[14] = matrix.m[11];
  1632. result.m[15] = matrix.m[15];
  1633. return result;
  1634. };
  1635. Matrix.Reflection = function (plane) {
  1636. var matrix = new Matrix();
  1637. Matrix.ReflectionToRef(plane, matrix);
  1638. return matrix;
  1639. };
  1640. Matrix.ReflectionToRef = function (plane, result) {
  1641. plane.normalize();
  1642. var x = plane.normal.x;
  1643. var y = plane.normal.y;
  1644. var z = plane.normal.z;
  1645. var temp = -2 * x;
  1646. var temp2 = -2 * y;
  1647. var temp3 = -2 * z;
  1648. result.m[0] = (temp * x) + 1;
  1649. result.m[1] = temp2 * x;
  1650. result.m[2] = temp3 * x;
  1651. result.m[3] = 0.0;
  1652. result.m[4] = temp * y;
  1653. result.m[5] = (temp2 * y) + 1;
  1654. result.m[6] = temp3 * y;
  1655. result.m[7] = 0.0;
  1656. result.m[8] = temp * z;
  1657. result.m[9] = temp2 * z;
  1658. result.m[10] = (temp3 * z) + 1;
  1659. result.m[11] = 0.0;
  1660. result.m[12] = temp * plane.d;
  1661. result.m[13] = temp2 * plane.d;
  1662. result.m[14] = temp3 * plane.d;
  1663. result.m[15] = 1.0;
  1664. };
  1665. Matrix._tempQuaternion = new Quaternion();
  1666. Matrix._xAxis = Vector3.Zero();
  1667. Matrix._yAxis = Vector3.Zero();
  1668. Matrix._zAxis = Vector3.Zero();
  1669. return Matrix;
  1670. })();
  1671. BABYLON.Matrix = Matrix;
  1672. var Plane = (function () {
  1673. function Plane(a, b, c, d) {
  1674. this.normal = new Vector3(a, b, c);
  1675. this.d = d;
  1676. }
  1677. Plane.prototype.asArray = function () {
  1678. return [this.normal.x, this.normal.y, this.normal.z, this.d];
  1679. };
  1680. Plane.prototype.clone = function () {
  1681. return new Plane(this.normal.x, this.normal.y, this.normal.z, this.d);
  1682. };
  1683. Plane.prototype.normalize = function () {
  1684. var norm = (Math.sqrt((this.normal.x * this.normal.x) + (this.normal.y * this.normal.y) + (this.normal.z * this.normal.z)));
  1685. var magnitude = 0;
  1686. if (norm != 0) {
  1687. magnitude = 1.0 / norm;
  1688. }
  1689. this.normal.x *= magnitude;
  1690. this.normal.y *= magnitude;
  1691. this.normal.z *= magnitude;
  1692. this.d *= magnitude;
  1693. };
  1694. Plane.prototype.transform = function (transformation) {
  1695. var transposedMatrix = BABYLON.Matrix.Transpose(transformation);
  1696. var x = this.normal.x;
  1697. var y = this.normal.y;
  1698. var z = this.normal.z;
  1699. var d = this.d;
  1700. var normalX = (((x * transposedMatrix.m[0]) + (y * transposedMatrix.m[1])) + (z * transposedMatrix.m[2])) + (d * transposedMatrix.m[3]);
  1701. var normalY = (((x * transposedMatrix.m[4]) + (y * transposedMatrix.m[5])) + (z * transposedMatrix.m[6])) + (d * transposedMatrix.m[7]);
  1702. var normalZ = (((x * transposedMatrix.m[8]) + (y * transposedMatrix.m[9])) + (z * transposedMatrix.m[10])) + (d * transposedMatrix.m[11]);
  1703. var finalD = (((x * transposedMatrix.m[12]) + (y * transposedMatrix.m[13])) + (z * transposedMatrix.m[14])) + (d * transposedMatrix.m[15]);
  1704. return new BABYLON.Plane(normalX, normalY, normalZ, finalD);
  1705. };
  1706. Plane.prototype.dotCoordinate = function (point) {
  1707. return ((((this.normal.x * point.x) + (this.normal.y * point.y)) + (this.normal.z * point.z)) + this.d);
  1708. };
  1709. Plane.prototype.copyFromPoints = function (point1, point2, point3) {
  1710. var x1 = point2.x - point1.x;
  1711. var y1 = point2.y - point1.y;
  1712. var z1 = point2.z - point1.z;
  1713. var x2 = point3.x - point1.x;
  1714. var y2 = point3.y - point1.y;
  1715. var z2 = point3.z - point1.z;
  1716. var yz = (y1 * z2) - (z1 * y2);
  1717. var xz = (z1 * x2) - (x1 * z2);
  1718. var xy = (x1 * y2) - (y1 * x2);
  1719. var pyth = (Math.sqrt((yz * yz) + (xz * xz) + (xy * xy)));
  1720. var invPyth;
  1721. if (pyth != 0) {
  1722. invPyth = 1.0 / pyth;
  1723. } else {
  1724. invPyth = 0;
  1725. }
  1726. this.normal.x = yz * invPyth;
  1727. this.normal.y = xz * invPyth;
  1728. this.normal.z = xy * invPyth;
  1729. this.d = -((this.normal.x * point1.x) + (this.normal.y * point1.y) + (this.normal.z * point1.z));
  1730. };
  1731. Plane.prototype.isFrontFacingTo = function (direction, epsilon) {
  1732. var dot = Vector3.Dot(this.normal, direction);
  1733. return (dot <= epsilon);
  1734. };
  1735. Plane.prototype.signedDistanceTo = function (point) {
  1736. return Vector3.Dot(point, this.normal) + this.d;
  1737. };
  1738. Plane.FromArray = function (array) {
  1739. return new BABYLON.Plane(array[0], array[1], array[2], array[3]);
  1740. };
  1741. Plane.FromPoints = function (point1, point2, point3) {
  1742. var result = new BABYLON.Plane(0, 0, 0, 0);
  1743. result.copyFromPoints(point1, point2, point3);
  1744. return result;
  1745. };
  1746. Plane.FromPositionAndNormal = function (origin, normal) {
  1747. var result = new BABYLON.Plane(0, 0, 0, 0);
  1748. normal.normalize();
  1749. result.normal = normal;
  1750. result.d = -(normal.x * origin.x + normal.y * origin.y + normal.z * origin.z);
  1751. return result;
  1752. };
  1753. Plane.SignedDistanceToPlaneFromPositionAndNormal = function (origin, normal, point) {
  1754. var d = -(normal.x * origin.x + normal.y * origin.y + normal.z * origin.z);
  1755. return Vector3.Dot(point, normal) + d;
  1756. };
  1757. return Plane;
  1758. })();
  1759. BABYLON.Plane = Plane;
  1760. var Viewport = (function () {
  1761. function Viewport(x, y, width, height) {
  1762. this.x = x;
  1763. this.y = y;
  1764. this.width = width;
  1765. this.height = height;
  1766. }
  1767. Viewport.prototype.toGlobal = function (engine) {
  1768. var width = engine.getRenderWidth();
  1769. var height = engine.getRenderHeight();
  1770. return new Viewport(this.x * width, this.y * height, this.width * width, this.height * height);
  1771. };
  1772. return Viewport;
  1773. })();
  1774. BABYLON.Viewport = Viewport;
  1775. var Frustum = (function () {
  1776. function Frustum() {
  1777. }
  1778. Frustum.GetPlanes = function (transform) {
  1779. var frustumPlanes = [];
  1780. for (var index = 0; index < 6; index++) {
  1781. frustumPlanes.push(new Plane(0, 0, 0, 0));
  1782. }
  1783. Frustum.GetPlanesToRef(transform, frustumPlanes);
  1784. return frustumPlanes;
  1785. };
  1786. Frustum.GetPlanesToRef = function (transform, frustumPlanes) {
  1787. frustumPlanes[0].normal.x = transform.m[3] + transform.m[2];
  1788. frustumPlanes[0].normal.y = transform.m[7] + transform.m[6];
  1789. frustumPlanes[0].normal.z = transform.m[10] + transform.m[10];
  1790. frustumPlanes[0].d = transform.m[15] + transform.m[14];
  1791. frustumPlanes[0].normalize();
  1792. frustumPlanes[1].normal.x = transform.m[3] - transform.m[2];
  1793. frustumPlanes[1].normal.y = transform.m[7] - transform.m[6];
  1794. frustumPlanes[1].normal.z = transform.m[11] - transform.m[10];
  1795. frustumPlanes[1].d = transform.m[15] - transform.m[14];
  1796. frustumPlanes[1].normalize();
  1797. frustumPlanes[2].normal.x = transform.m[3] + transform.m[0];
  1798. frustumPlanes[2].normal.y = transform.m[7] + transform.m[4];
  1799. frustumPlanes[2].normal.z = transform.m[11] + transform.m[8];
  1800. frustumPlanes[2].d = transform.m[15] + transform.m[12];
  1801. frustumPlanes[2].normalize();
  1802. frustumPlanes[3].normal.x = transform.m[3] - transform.m[0];
  1803. frustumPlanes[3].normal.y = transform.m[7] - transform.m[4];
  1804. frustumPlanes[3].normal.z = transform.m[11] - transform.m[8];
  1805. frustumPlanes[3].d = transform.m[15] - transform.m[12];
  1806. frustumPlanes[3].normalize();
  1807. frustumPlanes[4].normal.x = transform.m[3] - transform.m[1];
  1808. frustumPlanes[4].normal.y = transform.m[7] - transform.m[5];
  1809. frustumPlanes[4].normal.z = transform.m[11] - transform.m[9];
  1810. frustumPlanes[4].d = transform.m[15] - transform.m[13];
  1811. frustumPlanes[4].normalize();
  1812. frustumPlanes[5].normal.x = transform.m[3] + transform.m[1];
  1813. frustumPlanes[5].normal.y = transform.m[7] + transform.m[5];
  1814. frustumPlanes[5].normal.z = transform.m[11] + transform.m[9];
  1815. frustumPlanes[5].d = transform.m[15] + transform.m[13];
  1816. frustumPlanes[5].normalize();
  1817. };
  1818. return Frustum;
  1819. })();
  1820. BABYLON.Frustum = Frustum;
  1821. var Ray = (function () {
  1822. function Ray(origin, direction, length) {
  1823. if (typeof length === "undefined") { length = Number.MAX_VALUE; }
  1824. this.origin = origin;
  1825. this.direction = direction;
  1826. this.length = length;
  1827. }
  1828. Ray.prototype.intersectsBoxMinMax = function (minimum, maximum) {
  1829. var d = 0.0;
  1830. var maxValue = Number.MAX_VALUE;
  1831. if (Math.abs(this.direction.x) < 0.0000001) {
  1832. if (this.origin.x < minimum.x || this.origin.x > maximum.x) {
  1833. return false;
  1834. }
  1835. } else {
  1836. var inv = 1.0 / this.direction.x;
  1837. var min = (minimum.x - this.origin.x) * inv;
  1838. var max = (maximum.x - this.origin.x) * inv;
  1839. if (max == -Infinity) {
  1840. max = Infinity;
  1841. }
  1842. if (min > max) {
  1843. var temp = min;
  1844. min = max;
  1845. max = temp;
  1846. }
  1847. d = Math.max(min, d);
  1848. maxValue = Math.min(max, maxValue);
  1849. if (d > maxValue) {
  1850. return false;
  1851. }
  1852. }
  1853. if (Math.abs(this.direction.y) < 0.0000001) {
  1854. if (this.origin.y < minimum.y || this.origin.y > maximum.y) {
  1855. return false;
  1856. }
  1857. } else {
  1858. inv = 1.0 / this.direction.y;
  1859. min = (minimum.y - this.origin.y) * inv;
  1860. max = (maximum.y - this.origin.y) * inv;
  1861. if (max == -Infinity) {
  1862. max = Infinity;
  1863. }
  1864. if (min > max) {
  1865. temp = min;
  1866. min = max;
  1867. max = temp;
  1868. }
  1869. d = Math.max(min, d);
  1870. maxValue = Math.min(max, maxValue);
  1871. if (d > maxValue) {
  1872. return false;
  1873. }
  1874. }
  1875. if (Math.abs(this.direction.z) < 0.0000001) {
  1876. if (this.origin.z < minimum.z || this.origin.z > maximum.z) {
  1877. return false;
  1878. }
  1879. } else {
  1880. inv = 1.0 / this.direction.z;
  1881. min = (minimum.z - this.origin.z) * inv;
  1882. max = (maximum.z - this.origin.z) * inv;
  1883. if (max == -Infinity) {
  1884. max = Infinity;
  1885. }
  1886. if (min > max) {
  1887. temp = min;
  1888. min = max;
  1889. max = temp;
  1890. }
  1891. d = Math.max(min, d);
  1892. maxValue = Math.min(max, maxValue);
  1893. if (d > maxValue) {
  1894. return false;
  1895. }
  1896. }
  1897. return true;
  1898. };
  1899. Ray.prototype.intersectsBox = function (box) {
  1900. return this.intersectsBoxMinMax(box.minimum, box.maximum);
  1901. };
  1902. Ray.prototype.intersectsSphere = function (sphere) {
  1903. var x = sphere.center.x - this.origin.x;
  1904. var y = sphere.center.y - this.origin.y;
  1905. var z = sphere.center.z - this.origin.z;
  1906. var pyth = (x * x) + (y * y) + (z * z);
  1907. var rr = sphere.radius * sphere.radius;
  1908. if (pyth <= rr) {
  1909. return true;
  1910. }
  1911. var dot = (x * this.direction.x) + (y * this.direction.y) + (z * this.direction.z);
  1912. if (dot < 0.0) {
  1913. return false;
  1914. }
  1915. var temp = pyth - (dot * dot);
  1916. return temp <= rr;
  1917. };
  1918. Ray.prototype.intersectsTriangle = function (vertex0, vertex1, vertex2) {
  1919. if (!this._edge1) {
  1920. this._edge1 = BABYLON.Vector3.Zero();
  1921. this._edge2 = BABYLON.Vector3.Zero();
  1922. this._pvec = BABYLON.Vector3.Zero();
  1923. this._tvec = BABYLON.Vector3.Zero();
  1924. this._qvec = BABYLON.Vector3.Zero();
  1925. }
  1926. vertex1.subtractToRef(vertex0, this._edge1);
  1927. vertex2.subtractToRef(vertex0, this._edge2);
  1928. BABYLON.Vector3.CrossToRef(this.direction, this._edge2, this._pvec);
  1929. var det = Vector3.Dot(this._edge1, this._pvec);
  1930. if (det === 0) {
  1931. return null;
  1932. }
  1933. var invdet = 1 / det;
  1934. this.origin.subtractToRef(vertex0, this._tvec);
  1935. var bu = Vector3.Dot(this._tvec, this._pvec) * invdet;
  1936. if (bu < 0 || bu > 1.0) {
  1937. return null;
  1938. }
  1939. Vector3.CrossToRef(this._tvec, this._edge1, this._qvec);
  1940. var bv = Vector3.Dot(this.direction, this._qvec) * invdet;
  1941. if (bv < 0 || bu + bv > 1.0) {
  1942. return null;
  1943. }
  1944. var distance = Vector3.Dot(this._edge2, this._qvec) * invdet;
  1945. if (distance > this.length) {
  1946. return null;
  1947. }
  1948. return new BABYLON.IntersectionInfo(bu, bv, distance);
  1949. };
  1950. Ray.CreateNew = function (x, y, viewportWidth, viewportHeight, world, view, projection) {
  1951. var start = BABYLON.Vector3.Unproject(new BABYLON.Vector3(x, y, 0), viewportWidth, viewportHeight, world, view, projection);
  1952. var end = BABYLON.Vector3.Unproject(new BABYLON.Vector3(x, y, 1), viewportWidth, viewportHeight, world, view, projection);
  1953. var direction = end.subtract(start);
  1954. direction.normalize();
  1955. return new Ray(start, direction);
  1956. };
  1957. /**
  1958. * Function will create a new transformed ray starting from origin and ending at the end point. Ray's length will be set, and ray will be
  1959. * transformed to the given world matrix.
  1960. * @param origin The origin point
  1961. * @param end The end point
  1962. * @param world a matrix to transform the ray to. Default is the identity matrix.
  1963. */
  1964. Ray.CreateNewFromTo = function (origin, end, world) {
  1965. if (typeof world === "undefined") { world = BABYLON.Matrix.Identity(); }
  1966. var direction = end.subtract(origin);
  1967. var length = Math.sqrt((direction.x * direction.x) + (direction.y * direction.y) + (direction.z * direction.z));
  1968. direction.normalize();
  1969. return Ray.Transform(new Ray(origin, direction, length), world);
  1970. };
  1971. Ray.Transform = function (ray, matrix) {
  1972. var newOrigin = BABYLON.Vector3.TransformCoordinates(ray.origin, matrix);
  1973. var newDirection = BABYLON.Vector3.TransformNormal(ray.direction, matrix);
  1974. return new Ray(newOrigin, newDirection, ray.length);
  1975. };
  1976. return Ray;
  1977. })();
  1978. BABYLON.Ray = Ray;
  1979. (function (Space) {
  1980. Space[Space["LOCAL"] = 0] = "LOCAL";
  1981. Space[Space["WORLD"] = 1] = "WORLD";
  1982. })(BABYLON.Space || (BABYLON.Space = {}));
  1983. var Space = BABYLON.Space;
  1984. var Axis = (function () {
  1985. function Axis() {
  1986. }
  1987. Axis.X = new BABYLON.Vector3(1, 0, 0);
  1988. Axis.Y = new BABYLON.Vector3(0, 1, 0);
  1989. Axis.Z = new BABYLON.Vector3(0, 0, 1);
  1990. return Axis;
  1991. })();
  1992. BABYLON.Axis = Axis;
  1993. ;
  1994. var BezierCurve = (function () {
  1995. function BezierCurve() {
  1996. }
  1997. BezierCurve.interpolate = function (t, x1, y1, x2, y2) {
  1998. var f0 = 1 - 3 * x2 + 3 * x1;
  1999. var f1 = 3 * x2 - 6 * x1;
  2000. var f2 = 3 * x1;
  2001. var refinedT = t;
  2002. for (var i = 0; i < 5; i++) {
  2003. var refinedT2 = refinedT * refinedT;
  2004. var refinedT3 = refinedT2 * refinedT;
  2005. var x = f0 * refinedT3 + f1 * refinedT2 + f2 * refinedT;
  2006. var slope = 1.0 / (3.0 * f0 * refinedT2 + 2.0 * f1 * refinedT + f2);
  2007. refinedT -= (x - t) * slope;
  2008. refinedT = Math.min(1, Math.max(0, refinedT));
  2009. }
  2010. return 3 * Math.pow(1 - refinedT, 2) * refinedT * y1 + 3 * (1 - refinedT) * Math.pow(refinedT, 2) * y2 + Math.pow(refinedT, 3);
  2011. };
  2012. return BezierCurve;
  2013. })();
  2014. BABYLON.BezierCurve = BezierCurve;
  2015. })(BABYLON || (BABYLON = {}));
  2016. var BABYLON;
  2017. (function (BABYLON) {
  2018. var screenshotCanvas;
  2019. var fpsRange = 60;
  2020. var previousFramesDuration = [];
  2021. var fps = 60;
  2022. var deltaTime = 0;
  2023. var cloneValue = function (source, destinationObject) {
  2024. if (!source)
  2025. return null;
  2026. if (source instanceof BABYLON.Mesh) {
  2027. return null;
  2028. }
  2029. if (source instanceof BABYLON.SubMesh) {
  2030. return source.clone(destinationObject);
  2031. } else if (source.clone) {
  2032. return source.clone();
  2033. }
  2034. return null;
  2035. };
  2036. var Tools = (function () {
  2037. function Tools() {
  2038. }
  2039. Tools.GetFilename = function (path) {
  2040. var index = path.lastIndexOf("/");
  2041. if (index < 0)
  2042. return path;
  2043. return path.substring(index + 1);
  2044. };
  2045. Tools.GetDOMTextContent = function (element) {
  2046. var result = "";
  2047. var child = element.firstChild;
  2048. while (child) {
  2049. if (child.nodeType == 3) {
  2050. result += child.textContent;
  2051. }
  2052. child = child.nextSibling;
  2053. }
  2054. return result;
  2055. };
  2056. Tools.ToDegrees = function (angle) {
  2057. return angle * 180 / Math.PI;
  2058. };
  2059. Tools.ToRadians = function (angle) {
  2060. return angle * Math.PI / 180;
  2061. };
  2062. Tools.ExtractMinAndMaxIndexed = function (positions, indices, indexStart, indexCount) {
  2063. var minimum = new BABYLON.Vector3(Number.MAX_VALUE, Number.MAX_VALUE, Number.MAX_VALUE);
  2064. var maximum = new BABYLON.Vector3(-Number.MAX_VALUE, -Number.MAX_VALUE, -Number.MAX_VALUE);
  2065. for (var index = indexStart; index < indexStart + indexCount; index++) {
  2066. var current = new BABYLON.Vector3(positions[indices[index] * 3], positions[indices[index] * 3 + 1], positions[indices[index] * 3 + 2]);
  2067. minimum = BABYLON.Vector3.Minimize(current, minimum);
  2068. maximum = BABYLON.Vector3.Maximize(current, maximum);
  2069. }
  2070. return {
  2071. minimum: minimum,
  2072. maximum: maximum
  2073. };
  2074. };
  2075. Tools.ExtractMinAndMax = function (positions, start, count) {
  2076. var minimum = new BABYLON.Vector3(Number.MAX_VALUE, Number.MAX_VALUE, Number.MAX_VALUE);
  2077. var maximum = new BABYLON.Vector3(-Number.MAX_VALUE, -Number.MAX_VALUE, -Number.MAX_VALUE);
  2078. for (var index = start; index < start + count; index++) {
  2079. var current = new BABYLON.Vector3(positions[index * 3], positions[index * 3 + 1], positions[index * 3 + 2]);
  2080. minimum = BABYLON.Vector3.Minimize(current, minimum);
  2081. maximum = BABYLON.Vector3.Maximize(current, maximum);
  2082. }
  2083. return {
  2084. minimum: minimum,
  2085. maximum: maximum
  2086. };
  2087. };
  2088. Tools.MakeArray = function (obj, allowsNullUndefined) {
  2089. if (allowsNullUndefined !== true && (obj === undefined || obj == null))
  2090. return undefined;
  2091. return Array.isArray(obj) ? obj : [obj];
  2092. };
  2093. Tools.GetPointerPrefix = function () {
  2094. var eventPrefix = "pointer";
  2095. if (!navigator.pointerEnabled) {
  2096. eventPrefix = "mouse";
  2097. }
  2098. return eventPrefix;
  2099. };
  2100. Tools.QueueNewFrame = function (func) {
  2101. if (window.requestAnimationFrame)
  2102. window.requestAnimationFrame(func);
  2103. else if (window.msRequestAnimationFrame)
  2104. window.msRequestAnimationFrame(func);
  2105. else if (window.webkitRequestAnimationFrame)
  2106. window.webkitRequestAnimationFrame(func);
  2107. else if (window.mozRequestAnimationFrame)
  2108. window.mozRequestAnimationFrame(func);
  2109. else if (window.oRequestAnimationFrame)
  2110. window.oRequestAnimationFrame(func);
  2111. else {
  2112. window.setTimeout(func, 16);
  2113. }
  2114. };
  2115. Tools.RequestFullscreen = function (element) {
  2116. if (element.requestFullscreen)
  2117. element.requestFullscreen();
  2118. else if (element.msRequestFullscreen)
  2119. element.msRequestFullscreen();
  2120. else if (element.webkitRequestFullscreen)
  2121. element.webkitRequestFullscreen();
  2122. else if (element.mozRequestFullScreen)
  2123. element.mozRequestFullScreen();
  2124. };
  2125. Tools.ExitFullscreen = function () {
  2126. if (document.exitFullscreen) {
  2127. document.exitFullscreen();
  2128. } else if (document.mozCancelFullScreen) {
  2129. document.mozCancelFullScreen();
  2130. } else if (document.webkitCancelFullScreen) {
  2131. document.webkitCancelFullScreen();
  2132. } else if (document.msCancelFullScreen) {
  2133. document.msCancelFullScreen();
  2134. }
  2135. };
  2136. Tools.CleanUrl = function (url) {
  2137. url = url.replace(/#/mg, "%23");
  2138. return url;
  2139. };
  2140. Tools.LoadImage = function (url, onload, onerror, database) {
  2141. url = Tools.CleanUrl(url);
  2142. var img = new Image();
  2143. if (url.substr(0, 5) != "data:")
  2144. img.crossOrigin = 'anonymous';
  2145. img.onload = function () {
  2146. onload(img);
  2147. };
  2148. img.onerror = function (err) {
  2149. onerror(img, err);
  2150. };
  2151. var noIndexedDB = function () {
  2152. img.src = url;
  2153. };
  2154. var loadFromIndexedDB = function () {
  2155. database.loadImageFromDB(url, img);
  2156. };
  2157. if (database && database.enableTexturesOffline && BABYLON.Database.isUASupportingBlobStorage) {
  2158. database.openAsync(loadFromIndexedDB, noIndexedDB);
  2159. } else {
  2160. if (url.indexOf("file:") === -1) {
  2161. noIndexedDB();
  2162. } else {
  2163. try {
  2164. var textureName = url.substring(5);
  2165. var blobURL;
  2166. try {
  2167. blobURL = URL.createObjectURL(BABYLON.FilesInput.FilesTextures[textureName], { oneTimeOnly: true });
  2168. } catch (ex) {
  2169. blobURL = URL.createObjectURL(BABYLON.FilesInput.FilesTextures[textureName]);
  2170. }
  2171. img.src = blobURL;
  2172. } catch (e) {
  2173. Tools.Log("Error while trying to load texture: " + textureName);
  2174. img.src = null;
  2175. }
  2176. }
  2177. }
  2178. return img;
  2179. };
  2180. Tools.LoadFile = function (url, callback, progressCallBack, database, useArrayBuffer, onError) {
  2181. url = Tools.CleanUrl(url);
  2182. var noIndexedDB = function () {
  2183. var request = new XMLHttpRequest();
  2184. var loadUrl = Tools.BaseUrl + url;
  2185. request.open('GET', loadUrl, true);
  2186. if (useArrayBuffer) {
  2187. request.responseType = "arraybuffer";
  2188. }
  2189. request.onprogress = progressCallBack;
  2190. request.onreadystatechange = function () {
  2191. if (request.readyState == 4) {
  2192. if (request.status == 200 || BABYLON.Tools.ValidateXHRData(request, !useArrayBuffer ? 1 : 6)) {
  2193. callback(!useArrayBuffer ? request.responseText : request.response);
  2194. } else {
  2195. if (onError) {
  2196. onError();
  2197. } else {
  2198. throw new Error("Error status: " + request.status + " - Unable to load " + loadUrl);
  2199. }
  2200. }
  2201. }
  2202. };
  2203. request.send(null);
  2204. };
  2205. var loadFromIndexedDB = function () {
  2206. database.loadFileFromDB(url, callback, progressCallBack, noIndexedDB, useArrayBuffer);
  2207. };
  2208. if (url.indexOf("file:") !== -1) {
  2209. var fileName = url.substring(5);
  2210. BABYLON.Tools.ReadFile(BABYLON.FilesInput.FilesToLoad[fileName], callback, progressCallBack, true);
  2211. } else {
  2212. if (database && database.enableSceneOffline) {
  2213. database.openAsync(loadFromIndexedDB, noIndexedDB);
  2214. } else {
  2215. noIndexedDB();
  2216. }
  2217. }
  2218. };
  2219. Tools.ReadFileAsDataURL = function (fileToLoad, callback, progressCallback) {
  2220. var reader = new FileReader();
  2221. reader.onload = function (e) {
  2222. callback(e.target.result);
  2223. };
  2224. reader.onprogress = progressCallback;
  2225. reader.readAsDataURL(fileToLoad);
  2226. };
  2227. Tools.ReadFile = function (fileToLoad, callback, progressCallBack, useArrayBuffer) {
  2228. var reader = new FileReader();
  2229. reader.onload = function (e) {
  2230. callback(e.target.result);
  2231. };
  2232. reader.onprogress = progressCallBack;
  2233. if (!useArrayBuffer) {
  2234. reader.readAsText(fileToLoad);
  2235. } else {
  2236. reader.readAsArrayBuffer(fileToLoad);
  2237. }
  2238. };
  2239. Tools.Clamp = function (value, min, max) {
  2240. if (typeof min === "undefined") { min = 0; }
  2241. if (typeof max === "undefined") { max = 1; }
  2242. return Math.min(max, Math.max(min, value));
  2243. };
  2244. Tools.Format = function (value, decimals) {
  2245. if (typeof decimals === "undefined") { decimals = 2; }
  2246. return value.toFixed(decimals);
  2247. };
  2248. Tools.CheckExtends = function (v, min, max) {
  2249. if (v.x < min.x)
  2250. min.x = v.x;
  2251. if (v.y < min.y)
  2252. min.y = v.y;
  2253. if (v.z < min.z)
  2254. min.z = v.z;
  2255. if (v.x > max.x)
  2256. max.x = v.x;
  2257. if (v.y > max.y)
  2258. max.y = v.y;
  2259. if (v.z > max.z)
  2260. max.z = v.z;
  2261. };
  2262. Tools.WithinEpsilon = function (a, b) {
  2263. var num = a - b;
  2264. return -1.401298E-45 <= num && num <= 1.401298E-45;
  2265. };
  2266. Tools.DeepCopy = function (source, destination, doNotCopyList, mustCopyList) {
  2267. for (var prop in source) {
  2268. if (prop[0] === "_" && (!mustCopyList || mustCopyList.indexOf(prop) === -1)) {
  2269. continue;
  2270. }
  2271. if (doNotCopyList && doNotCopyList.indexOf(prop) !== -1) {
  2272. continue;
  2273. }
  2274. var sourceValue = source[prop];
  2275. var typeOfSourceValue = typeof sourceValue;
  2276. if (typeOfSourceValue == "function") {
  2277. continue;
  2278. }
  2279. if (typeOfSourceValue == "object") {
  2280. if (sourceValue instanceof Array) {
  2281. destination[prop] = [];
  2282. if (sourceValue.length > 0) {
  2283. if (typeof sourceValue[0] == "object") {
  2284. for (var index = 0; index < sourceValue.length; index++) {
  2285. var clonedValue = cloneValue(sourceValue[index], destination);
  2286. if (destination[prop].indexOf(clonedValue) === -1) {
  2287. destination[prop].push(clonedValue);
  2288. }
  2289. }
  2290. } else {
  2291. destination[prop] = sourceValue.slice(0);
  2292. }
  2293. }
  2294. } else {
  2295. destination[prop] = cloneValue(sourceValue, destination);
  2296. }
  2297. } else {
  2298. destination[prop] = sourceValue;
  2299. }
  2300. }
  2301. };
  2302. Tools.IsEmpty = function (obj) {
  2303. for (var i in obj) {
  2304. return false;
  2305. }
  2306. return true;
  2307. };
  2308. Tools.RegisterTopRootEvents = function (events) {
  2309. for (var index = 0; index < events.length; index++) {
  2310. var event = events[index];
  2311. window.addEventListener(event.name, event.handler, false);
  2312. try {
  2313. if (window.parent) {
  2314. window.parent.addEventListener(event.name, event.handler, false);
  2315. }
  2316. } catch (e) {
  2317. }
  2318. }
  2319. };
  2320. Tools.UnregisterTopRootEvents = function (events) {
  2321. for (var index = 0; index < events.length; index++) {
  2322. var event = events[index];
  2323. window.removeEventListener(event.name, event.handler);
  2324. try {
  2325. if (window.parent) {
  2326. window.parent.removeEventListener(event.name, event.handler);
  2327. }
  2328. } catch (e) {
  2329. }
  2330. }
  2331. };
  2332. Tools.GetFps = function () {
  2333. return fps;
  2334. };
  2335. Tools.GetDeltaTime = function () {
  2336. return deltaTime;
  2337. };
  2338. Tools._MeasureFps = function () {
  2339. previousFramesDuration.push(Tools.Now);
  2340. var length = previousFramesDuration.length;
  2341. if (length >= 2) {
  2342. deltaTime = previousFramesDuration[length - 1] - previousFramesDuration[length - 2];
  2343. }
  2344. if (length >= fpsRange) {
  2345. if (length > fpsRange) {
  2346. previousFramesDuration.splice(0, 1);
  2347. length = previousFramesDuration.length;
  2348. }
  2349. var sum = 0;
  2350. for (var id = 0; id < length - 1; id++) {
  2351. sum += previousFramesDuration[id + 1] - previousFramesDuration[id];
  2352. }
  2353. fps = 1000.0 / (sum / (length - 1));
  2354. }
  2355. };
  2356. Tools.CreateScreenshot = function (engine, camera, size) {
  2357. var width;
  2358. var height;
  2359. var scene = camera.getScene();
  2360. var previousCamera = null;
  2361. if (scene.activeCamera !== camera) {
  2362. previousCamera = scene.activeCamera;
  2363. scene.activeCamera = camera;
  2364. }
  2365. if (size.precision) {
  2366. width = Math.round(engine.getRenderWidth() * size.precision);
  2367. height = Math.round(width / engine.getAspectRatio(camera));
  2368. size = { width: width, height: height };
  2369. } else if (size.width && size.height) {
  2370. width = size.width;
  2371. height = size.height;
  2372. } else if (size.width && !size.height) {
  2373. width = size.width;
  2374. height = Math.round(width / engine.getAspectRatio(camera));
  2375. size = { width: width, height: height };
  2376. } else if (size.height && !size.width) {
  2377. height = size.height;
  2378. width = Math.round(height * engine.getAspectRatio(camera));
  2379. size = { width: width, height: height };
  2380. } else if (!isNaN(size)) {
  2381. height = size;
  2382. width = size;
  2383. } else {
  2384. Tools.Error("Invalid 'size' parameter !");
  2385. return;
  2386. }
  2387. var texture = new BABYLON.RenderTargetTexture("screenShot", size, engine.scenes[0], false, false);
  2388. texture.renderList = engine.scenes[0].meshes;
  2389. texture.onAfterRender = function () {
  2390. var numberOfChannelsByLine = width * 4;
  2391. var halfHeight = height / 2;
  2392. var data = engine.readPixels(0, 0, width, height);
  2393. for (var i = 0; i < halfHeight; i++) {
  2394. for (var j = 0; j < numberOfChannelsByLine; j++) {
  2395. var currentCell = j + i * numberOfChannelsByLine;
  2396. var targetLine = height - i - 1;
  2397. var targetCell = j + targetLine * numberOfChannelsByLine;
  2398. var temp = data[currentCell];
  2399. data[currentCell] = data[targetCell];
  2400. data[targetCell] = temp;
  2401. }
  2402. }
  2403. if (!screenshotCanvas) {
  2404. screenshotCanvas = document.createElement('canvas');
  2405. }
  2406. screenshotCanvas.width = width;
  2407. screenshotCanvas.height = height;
  2408. var context = screenshotCanvas.getContext('2d');
  2409. var imageData = context.createImageData(width, height);
  2410. imageData.data.set(data);
  2411. context.putImageData(imageData, 0, 0);
  2412. var base64Image = screenshotCanvas.toDataURL();
  2413. if (("download" in document.createElement("a"))) {
  2414. var a = window.document.createElement("a");
  2415. a.href = base64Image;
  2416. var date = new Date();
  2417. var stringDate = date.getFullYear() + "/" + date.getMonth() + "/" + date.getDate() + "-" + date.getHours() + ":" + date.getMinutes();
  2418. a.setAttribute("download", "screenshot-" + stringDate + ".png");
  2419. window.document.body.appendChild(a);
  2420. a.addEventListener("click", function () {
  2421. a.parentElement.removeChild(a);
  2422. });
  2423. a.click();
  2424. } else {
  2425. var newWindow = window.open("");
  2426. var img = newWindow.document.createElement("img");
  2427. img.src = base64Image;
  2428. newWindow.document.body.appendChild(img);
  2429. }
  2430. };
  2431. texture.render(true);
  2432. texture.dispose();
  2433. if (previousCamera) {
  2434. scene.activeCamera = previousCamera;
  2435. }
  2436. };
  2437. Tools.ValidateXHRData = function (xhr, dataType) {
  2438. if (typeof dataType === "undefined") { dataType = 7; }
  2439. try {
  2440. if (dataType & 1) {
  2441. if (xhr.responseText && xhr.responseText.length > 0) {
  2442. return true;
  2443. } else if (dataType === 1) {
  2444. return false;
  2445. }
  2446. }
  2447. if (dataType & 2) {
  2448. var tgaHeader = BABYLON.Internals.TGATools.GetTGAHeader(xhr.response);
  2449. if (tgaHeader.width && tgaHeader.height && tgaHeader.width > 0 && tgaHeader.height > 0) {
  2450. return true;
  2451. } else if (dataType === 2) {
  2452. return false;
  2453. }
  2454. }
  2455. if (dataType & 4) {
  2456. var ddsHeader = new Uint8Array(xhr.response, 0, 3);
  2457. if (ddsHeader[0] == 68 && ddsHeader[1] == 68 && ddsHeader[2] == 83) {
  2458. return true;
  2459. } else {
  2460. return false;
  2461. }
  2462. }
  2463. } catch (e) {
  2464. }
  2465. return false;
  2466. };
  2467. Object.defineProperty(Tools, "NoneLogLevel", {
  2468. get: function () {
  2469. return Tools._NoneLogLevel;
  2470. },
  2471. enumerable: true,
  2472. configurable: true
  2473. });
  2474. Object.defineProperty(Tools, "MessageLogLevel", {
  2475. get: function () {
  2476. return Tools._MessageLogLevel;
  2477. },
  2478. enumerable: true,
  2479. configurable: true
  2480. });
  2481. Object.defineProperty(Tools, "WarningLogLevel", {
  2482. get: function () {
  2483. return Tools._WarningLogLevel;
  2484. },
  2485. enumerable: true,
  2486. configurable: true
  2487. });
  2488. Object.defineProperty(Tools, "ErrorLogLevel", {
  2489. get: function () {
  2490. return Tools._ErrorLogLevel;
  2491. },
  2492. enumerable: true,
  2493. configurable: true
  2494. });
  2495. Object.defineProperty(Tools, "AllLogLevel", {
  2496. get: function () {
  2497. return Tools._MessageLogLevel | Tools._WarningLogLevel | Tools._ErrorLogLevel;
  2498. },
  2499. enumerable: true,
  2500. configurable: true
  2501. });
  2502. Tools._AddLogEntry = function (entry) {
  2503. Tools._LogCache = entry + Tools._LogCache;
  2504. if (Tools.OnNewCacheEntry) {
  2505. Tools.OnNewCacheEntry(entry);
  2506. }
  2507. };
  2508. Tools._FormatMessage = function (message) {
  2509. var padStr = function (i) {
  2510. return (i < 10) ? "0" + i : "" + i;
  2511. };
  2512. var date = new Date();
  2513. return "[" + padStr(date.getHours()) + ":" + padStr(date.getMinutes()) + ":" + padStr(date.getSeconds()) + "]: " + message;
  2514. };
  2515. Tools._LogDisabled = function (message) {
  2516. };
  2517. Tools._LogEnabled = function (message) {
  2518. var formattedMessage = Tools._FormatMessage(message);
  2519. console.log("BJS - " + formattedMessage);
  2520. var entry = "<div style='color:white'>" + formattedMessage + "</div><br>";
  2521. Tools._AddLogEntry(entry);
  2522. };
  2523. Tools._WarnDisabled = function (message) {
  2524. };
  2525. Tools._WarnEnabled = function (message) {
  2526. var formattedMessage = Tools._FormatMessage(message);
  2527. console.warn("BJS - " + formattedMessage);
  2528. var entry = "<div style='color:orange'>" + formattedMessage + "</div><br>";
  2529. Tools._AddLogEntry(entry);
  2530. };
  2531. Tools._ErrorDisabled = function (message) {
  2532. };
  2533. Tools._ErrorEnabled = function (message) {
  2534. var formattedMessage = Tools._FormatMessage(message);
  2535. console.error("BJS - " + formattedMessage);
  2536. var entry = "<div style='color:red'>" + formattedMessage + "</div><br>";
  2537. Tools._AddLogEntry(entry);
  2538. };
  2539. Object.defineProperty(Tools, "LogCache", {
  2540. get: function () {
  2541. return Tools._LogCache;
  2542. },
  2543. enumerable: true,
  2544. configurable: true
  2545. });
  2546. Object.defineProperty(Tools, "LogLevels", {
  2547. set: function (level) {
  2548. if ((level & Tools.MessageLogLevel) === Tools.MessageLogLevel) {
  2549. Tools.Log = Tools._LogEnabled;
  2550. } else {
  2551. Tools.Log = Tools._LogDisabled;
  2552. }
  2553. if ((level & Tools.WarningLogLevel) === Tools.WarningLogLevel) {
  2554. Tools.Warn = Tools._WarnEnabled;
  2555. } else {
  2556. Tools.Warn = Tools._WarnDisabled;
  2557. }
  2558. if ((level & Tools.ErrorLogLevel) === Tools.ErrorLogLevel) {
  2559. Tools.Error = Tools._ErrorEnabled;
  2560. } else {
  2561. Tools.Error = Tools._ErrorDisabled;
  2562. }
  2563. },
  2564. enumerable: true,
  2565. configurable: true
  2566. });
  2567. Object.defineProperty(Tools, "PerformanceNoneLogLevel", {
  2568. get: function () {
  2569. return Tools._PerformanceNoneLogLevel;
  2570. },
  2571. enumerable: true,
  2572. configurable: true
  2573. });
  2574. Object.defineProperty(Tools, "PerformanceUserMarkLogLevel", {
  2575. get: function () {
  2576. return Tools._PerformanceUserMarkLogLevel;
  2577. },
  2578. enumerable: true,
  2579. configurable: true
  2580. });
  2581. Object.defineProperty(Tools, "PerformanceConsoleLogLevel", {
  2582. get: function () {
  2583. return Tools._PerformanceConsoleLogLevel;
  2584. },
  2585. enumerable: true,
  2586. configurable: true
  2587. });
  2588. Object.defineProperty(Tools, "PerformanceLogLevel", {
  2589. set: function (level) {
  2590. if ((level & Tools.PerformanceUserMarkLogLevel) === Tools.PerformanceUserMarkLogLevel) {
  2591. Tools.StartPerformanceCounter = Tools._StartUserMark;
  2592. Tools.EndPerformanceCounter = Tools._EndUserMark;
  2593. return;
  2594. }
  2595. if ((level & Tools.PerformanceConsoleLogLevel) === Tools.PerformanceConsoleLogLevel) {
  2596. Tools.StartPerformanceCounter = Tools._StartPerformanceConsole;
  2597. Tools.EndPerformanceCounter = Tools._EndPerformanceConsole;
  2598. return;
  2599. }
  2600. Tools.StartPerformanceCounter = Tools._StartPerformanceCounterDisabled;
  2601. Tools.EndPerformanceCounter = Tools._EndPerformanceCounterDisabled;
  2602. },
  2603. enumerable: true,
  2604. configurable: true
  2605. });
  2606. Tools._StartPerformanceCounterDisabled = function (counterName, condition) {
  2607. };
  2608. Tools._EndPerformanceCounterDisabled = function (counterName, condition) {
  2609. };
  2610. Tools._StartUserMark = function (counterName, condition) {
  2611. if (typeof condition === "undefined") { condition = true; }
  2612. if (!condition || !Tools._performance.mark) {
  2613. return;
  2614. }
  2615. Tools._performance.mark(counterName + "-Begin");
  2616. };
  2617. Tools._EndUserMark = function (counterName, condition) {
  2618. if (typeof condition === "undefined") { condition = true; }
  2619. if (!condition || !Tools._performance.mark) {
  2620. return;
  2621. }
  2622. Tools._performance.mark(counterName + "-End");
  2623. Tools._performance.measure(counterName, counterName + "-Begin", counterName + "-End");
  2624. };
  2625. Tools._StartPerformanceConsole = function (counterName, condition) {
  2626. if (typeof condition === "undefined") { condition = true; }
  2627. if (!condition) {
  2628. return;
  2629. }
  2630. Tools._StartUserMark(counterName, condition);
  2631. if (console.time) {
  2632. console.time(counterName);
  2633. }
  2634. };
  2635. Tools._EndPerformanceConsole = function (counterName, condition) {
  2636. if (typeof condition === "undefined") { condition = true; }
  2637. if (!condition) {
  2638. return;
  2639. }
  2640. Tools._EndUserMark(counterName, condition);
  2641. if (console.time) {
  2642. console.timeEnd(counterName);
  2643. }
  2644. };
  2645. Object.defineProperty(Tools, "Now", {
  2646. get: function () {
  2647. if (window.performance && window.performance.now) {
  2648. return window.performance.now();
  2649. }
  2650. return new Date().getTime();
  2651. },
  2652. enumerable: true,
  2653. configurable: true
  2654. });
  2655. Tools.BaseUrl = "";
  2656. Tools.GetExponantOfTwo = function (value, max) {
  2657. var count = 1;
  2658. do {
  2659. count *= 2;
  2660. } while(count < value);
  2661. if (count > max)
  2662. count = max;
  2663. return count;
  2664. };
  2665. Tools._NoneLogLevel = 0;
  2666. Tools._MessageLogLevel = 1;
  2667. Tools._WarningLogLevel = 2;
  2668. Tools._ErrorLogLevel = 4;
  2669. Tools._LogCache = "";
  2670. Tools.Log = Tools._LogEnabled;
  2671. Tools.Warn = Tools._WarnEnabled;
  2672. Tools.Error = Tools._ErrorEnabled;
  2673. Tools._PerformanceNoneLogLevel = 0;
  2674. Tools._PerformanceUserMarkLogLevel = 1;
  2675. Tools._PerformanceConsoleLogLevel = 2;
  2676. Tools._performance = window.performance;
  2677. Tools.StartPerformanceCounter = Tools._StartPerformanceCounterDisabled;
  2678. Tools.EndPerformanceCounter = Tools._EndPerformanceCounterDisabled;
  2679. return Tools;
  2680. })();
  2681. BABYLON.Tools = Tools;
  2682. })(BABYLON || (BABYLON = {}));
  2683. var BABYLON;
  2684. (function (BABYLON) {
  2685. var _DepthCullingState = (function () {
  2686. function _DepthCullingState() {
  2687. this._isDepthTestDirty = false;
  2688. this._isDepthMaskDirty = false;
  2689. this._isDepthFuncDirty = false;
  2690. this._isCullFaceDirty = false;
  2691. this._isCullDirty = false;
  2692. }
  2693. Object.defineProperty(_DepthCullingState.prototype, "isDirty", {
  2694. get: function () {
  2695. return this._isDepthFuncDirty || this._isDepthTestDirty || this._isDepthMaskDirty || this._isCullFaceDirty || this._isCullDirty;
  2696. },
  2697. enumerable: true,
  2698. configurable: true
  2699. });
  2700. Object.defineProperty(_DepthCullingState.prototype, "cullFace", {
  2701. get: function () {
  2702. return this._cullFace;
  2703. },
  2704. set: function (value) {
  2705. if (this._cullFace === value) {
  2706. return;
  2707. }
  2708. this._cullFace = value;
  2709. this._isCullFaceDirty = true;
  2710. },
  2711. enumerable: true,
  2712. configurable: true
  2713. });
  2714. Object.defineProperty(_DepthCullingState.prototype, "cull", {
  2715. get: function () {
  2716. return this._cull;
  2717. },
  2718. set: function (value) {
  2719. if (this._cull === value) {
  2720. return;
  2721. }
  2722. this._cull = value;
  2723. this._isCullDirty = true;
  2724. },
  2725. enumerable: true,
  2726. configurable: true
  2727. });
  2728. Object.defineProperty(_DepthCullingState.prototype, "depthFunc", {
  2729. get: function () {
  2730. return this._depthFunc;
  2731. },
  2732. set: function (value) {
  2733. if (this._depthFunc === value) {
  2734. return;
  2735. }
  2736. this._depthFunc = value;
  2737. this._isDepthFuncDirty = true;
  2738. },
  2739. enumerable: true,
  2740. configurable: true
  2741. });
  2742. Object.defineProperty(_DepthCullingState.prototype, "depthMask", {
  2743. get: function () {
  2744. return this._depthMask;
  2745. },
  2746. set: function (value) {
  2747. if (this._depthMask === value) {
  2748. return;
  2749. }
  2750. this._depthMask = value;
  2751. this._isDepthMaskDirty = true;
  2752. },
  2753. enumerable: true,
  2754. configurable: true
  2755. });
  2756. Object.defineProperty(_DepthCullingState.prototype, "depthTest", {
  2757. get: function () {
  2758. return this._depthTest;
  2759. },
  2760. set: function (value) {
  2761. if (this._depthTest === value) {
  2762. return;
  2763. }
  2764. this._depthTest = value;
  2765. this._isDepthTestDirty = true;
  2766. },
  2767. enumerable: true,
  2768. configurable: true
  2769. });
  2770. _DepthCullingState.prototype.reset = function () {
  2771. this._depthMask = true;
  2772. this._depthTest = true;
  2773. this._depthFunc = null;
  2774. this._cull = null;
  2775. this._cullFace = null;
  2776. this._isDepthTestDirty = true;
  2777. this._isDepthMaskDirty = true;
  2778. this._isDepthFuncDirty = false;
  2779. this._isCullFaceDirty = false;
  2780. this._isCullDirty = false;
  2781. };
  2782. _DepthCullingState.prototype.apply = function (gl) {
  2783. if (!this.isDirty) {
  2784. return;
  2785. }
  2786. if (this._isCullDirty) {
  2787. if (this.cull === true) {
  2788. gl.enable(gl.CULL_FACE);
  2789. } else if (this.cull === false) {
  2790. gl.disable(gl.CULL_FACE);
  2791. }
  2792. this._isCullDirty = false;
  2793. }
  2794. if (this._isCullFaceDirty) {
  2795. gl.cullFace(this.cullFace);
  2796. this._isCullFaceDirty = false;
  2797. }
  2798. if (this._isDepthMaskDirty) {
  2799. gl.depthMask(this.depthMask);
  2800. this._isDepthMaskDirty = false;
  2801. }
  2802. if (this._isDepthTestDirty) {
  2803. if (this.depthTest === true) {
  2804. gl.enable(gl.DEPTH_TEST);
  2805. } else if (this.depthTest === false) {
  2806. gl.disable(gl.DEPTH_TEST);
  2807. }
  2808. this._isDepthTestDirty = false;
  2809. }
  2810. if (this._isDepthFuncDirty) {
  2811. gl.depthFunc(this.depthFunc);
  2812. this._isDepthFuncDirty = false;
  2813. }
  2814. };
  2815. return _DepthCullingState;
  2816. })();
  2817. BABYLON._DepthCullingState = _DepthCullingState;
  2818. var _AlphaState = (function () {
  2819. function _AlphaState() {
  2820. this._isAlphaBlendDirty = false;
  2821. this._isBlendFunctionParametersDirty = false;
  2822. this._alphaBlend = false;
  2823. this._blendFunctionParameters = new Array(4);
  2824. }
  2825. Object.defineProperty(_AlphaState.prototype, "isDirty", {
  2826. get: function () {
  2827. return this._isAlphaBlendDirty || this._isBlendFunctionParametersDirty;
  2828. },
  2829. enumerable: true,
  2830. configurable: true
  2831. });
  2832. Object.defineProperty(_AlphaState.prototype, "alphaBlend", {
  2833. get: function () {
  2834. return this._alphaBlend;
  2835. },
  2836. set: function (value) {
  2837. if (this._alphaBlend === value) {
  2838. return;
  2839. }
  2840. this._alphaBlend = value;
  2841. this._isAlphaBlendDirty = true;
  2842. },
  2843. enumerable: true,
  2844. configurable: true
  2845. });
  2846. _AlphaState.prototype.setAlphaBlendFunctionParameters = function (value0, value1, value2, value3) {
  2847. if (this._blendFunctionParameters[0] === value0 && this._blendFunctionParameters[1] === value1 && this._blendFunctionParameters[2] === value2 && this._blendFunctionParameters[3] === value3) {
  2848. return;
  2849. }
  2850. this._blendFunctionParameters[0] = value0;
  2851. this._blendFunctionParameters[1] = value1;
  2852. this._blendFunctionParameters[2] = value2;
  2853. this._blendFunctionParameters[3] = value3;
  2854. this._isBlendFunctionParametersDirty = true;
  2855. };
  2856. _AlphaState.prototype.reset = function () {
  2857. this._alphaBlend = false;
  2858. this._blendFunctionParameters[0] = null;
  2859. this._blendFunctionParameters[1] = null;
  2860. this._blendFunctionParameters[2] = null;
  2861. this._blendFunctionParameters[3] = null;
  2862. this._isAlphaBlendDirty = true;
  2863. this._isBlendFunctionParametersDirty = false;
  2864. };
  2865. _AlphaState.prototype.apply = function (gl) {
  2866. if (!this.isDirty) {
  2867. return;
  2868. }
  2869. if (this._isAlphaBlendDirty) {
  2870. if (this._alphaBlend === true) {
  2871. gl.enable(gl.BLEND);
  2872. } else if (this._alphaBlend === false) {
  2873. gl.disable(gl.BLEND);
  2874. }
  2875. this._isAlphaBlendDirty = false;
  2876. }
  2877. if (this._isBlendFunctionParametersDirty) {
  2878. gl.blendFuncSeparate(this._blendFunctionParameters[0], this._blendFunctionParameters[1], this._blendFunctionParameters[2], this._blendFunctionParameters[3]);
  2879. this._isBlendFunctionParametersDirty = false;
  2880. }
  2881. };
  2882. return _AlphaState;
  2883. })();
  2884. BABYLON._AlphaState = _AlphaState;
  2885. var compileShader = function (gl, source, type, defines) {
  2886. var shader = gl.createShader(type === "vertex" ? gl.VERTEX_SHADER : gl.FRAGMENT_SHADER);
  2887. gl.shaderSource(shader, (defines ? defines + "\n" : "") + source);
  2888. gl.compileShader(shader);
  2889. if (!gl.getShaderParameter(shader, gl.COMPILE_STATUS)) {
  2890. throw new Error(gl.getShaderInfoLog(shader));
  2891. }
  2892. return shader;
  2893. };
  2894. var getSamplingParameters = function (samplingMode, generateMipMaps, gl) {
  2895. var magFilter = gl.NEAREST;
  2896. var minFilter = gl.NEAREST;
  2897. if (samplingMode === BABYLON.Texture.BILINEAR_SAMPLINGMODE) {
  2898. magFilter = gl.LINEAR;
  2899. if (generateMipMaps) {
  2900. minFilter = gl.LINEAR_MIPMAP_NEAREST;
  2901. } else {
  2902. minFilter = gl.LINEAR;
  2903. }
  2904. } else if (samplingMode === BABYLON.Texture.TRILINEAR_SAMPLINGMODE) {
  2905. magFilter = gl.LINEAR;
  2906. if (generateMipMaps) {
  2907. minFilter = gl.LINEAR_MIPMAP_LINEAR;
  2908. } else {
  2909. minFilter = gl.LINEAR;
  2910. }
  2911. } else if (samplingMode === BABYLON.Texture.NEAREST_SAMPLINGMODE) {
  2912. magFilter = gl.NEAREST;
  2913. if (generateMipMaps) {
  2914. minFilter = gl.NEAREST_MIPMAP_LINEAR;
  2915. } else {
  2916. minFilter = gl.NEAREST;
  2917. }
  2918. }
  2919. return {
  2920. min: minFilter,
  2921. mag: magFilter
  2922. };
  2923. };
  2924. var prepareWebGLTexture = function (texture, gl, scene, width, height, invertY, noMipmap, isCompressed, processFunction, samplingMode) {
  2925. if (typeof samplingMode === "undefined") { samplingMode = BABYLON.Texture.TRILINEAR_SAMPLINGMODE; }
  2926. var engine = scene.getEngine();
  2927. var potWidth = BABYLON.Tools.GetExponantOfTwo(width, engine.getCaps().maxTextureSize);
  2928. var potHeight = BABYLON.Tools.GetExponantOfTwo(height, engine.getCaps().maxTextureSize);
  2929. gl.bindTexture(gl.TEXTURE_2D, texture);
  2930. gl.pixelStorei(gl.UNPACK_FLIP_Y_WEBGL, invertY === undefined ? 1 : (invertY ? 1 : 0));
  2931. processFunction(potWidth, potHeight);
  2932. var filters = getSamplingParameters(samplingMode, !noMipmap, gl);
  2933. gl.texParameteri(gl.TEXTURE_2D, gl.TEXTURE_MAG_FILTER, filters.mag);
  2934. gl.texParameteri(gl.TEXTURE_2D, gl.TEXTURE_MIN_FILTER, filters.min);
  2935. if (!noMipmap && !isCompressed) {
  2936. gl.generateMipmap(gl.TEXTURE_2D);
  2937. }
  2938. gl.bindTexture(gl.TEXTURE_2D, null);
  2939. engine._activeTexturesCache = [];
  2940. texture._baseWidth = width;
  2941. texture._baseHeight = height;
  2942. texture._width = potWidth;
  2943. texture._height = potHeight;
  2944. texture.isReady = true;
  2945. scene._removePendingData(texture);
  2946. };
  2947. var partialLoad = function (url, index, loadedImages, scene, onfinish) {
  2948. var img;
  2949. var onload = function () {
  2950. loadedImages[index] = img;
  2951. loadedImages._internalCount++;
  2952. scene._removePendingData(img);
  2953. if (loadedImages._internalCount == 6) {
  2954. onfinish(loadedImages);
  2955. }
  2956. };
  2957. var onerror = function () {
  2958. scene._removePendingData(img);
  2959. };
  2960. img = BABYLON.Tools.LoadImage(url, onload, onerror, scene.database);
  2961. scene._addPendingData(img);
  2962. };
  2963. var cascadeLoad = function (rootUrl, scene, onfinish, extensions) {
  2964. var loadedImages = [];
  2965. loadedImages._internalCount = 0;
  2966. for (var index = 0; index < 6; index++) {
  2967. partialLoad(rootUrl + extensions[index], index, loadedImages, scene, onfinish);
  2968. }
  2969. };
  2970. var EngineCapabilities = (function () {
  2971. function EngineCapabilities() {
  2972. }
  2973. return EngineCapabilities;
  2974. })();
  2975. BABYLON.EngineCapabilities = EngineCapabilities;
  2976. var Engine = (function () {
  2977. function Engine(canvas, antialias, options) {
  2978. var _this = this;
  2979. this.isFullscreen = false;
  2980. this.isPointerLock = false;
  2981. this.cullBackFaces = true;
  2982. this.renderEvenInBackground = true;
  2983. this.scenes = new Array();
  2984. this._windowIsBackground = false;
  2985. this._runningLoop = false;
  2986. this._loadingDivBackgroundColor = "black";
  2987. this._drawCalls = 0;
  2988. this._depthCullingState = new _DepthCullingState();
  2989. this._alphaState = new _AlphaState();
  2990. this._alphaMode = Engine.ALPHA_DISABLE;
  2991. this._loadedTexturesCache = new Array();
  2992. this._activeTexturesCache = new Array();
  2993. this._compiledEffects = {};
  2994. this._uintIndicesCurrentlySet = false;
  2995. this._renderingCanvas = canvas;
  2996. this._canvasClientRect = this._renderingCanvas.getBoundingClientRect();
  2997. options = options || {};
  2998. options.antialias = antialias;
  2999. try {
  3000. this._gl = canvas.getContext("webgl", options) || canvas.getContext("experimental-webgl", options);
  3001. } catch (e) {
  3002. throw new Error("WebGL not supported");
  3003. }
  3004. if (!this._gl) {
  3005. throw new Error("WebGL not supported");
  3006. }
  3007. this._onBlur = function () {
  3008. _this._windowIsBackground = true;
  3009. };
  3010. this._onFocus = function () {
  3011. _this._windowIsBackground = false;
  3012. };
  3013. window.addEventListener("blur", this._onBlur);
  3014. window.addEventListener("focus", this._onFocus);
  3015. this._workingCanvas = document.createElement("canvas");
  3016. this._workingContext = this._workingCanvas.getContext("2d");
  3017. this._hardwareScalingLevel = 1.0 / (window.devicePixelRatio || 1.0);
  3018. this.resize();
  3019. this._caps = new EngineCapabilities();
  3020. this._caps.maxTexturesImageUnits = this._gl.getParameter(this._gl.MAX_TEXTURE_IMAGE_UNITS);
  3021. this._caps.maxTextureSize = this._gl.getParameter(this._gl.MAX_TEXTURE_SIZE);
  3022. this._caps.maxCubemapTextureSize = this._gl.getParameter(this._gl.MAX_CUBE_MAP_TEXTURE_SIZE);
  3023. this._caps.maxRenderTextureSize = this._gl.getParameter(this._gl.MAX_RENDERBUFFER_SIZE);
  3024. this._caps.standardDerivatives = (this._gl.getExtension('OES_standard_derivatives') !== null);
  3025. this._caps.s3tc = this._gl.getExtension('WEBGL_compressed_texture_s3tc');
  3026. this._caps.textureFloat = (this._gl.getExtension('OES_texture_float') !== null);
  3027. this._caps.textureAnisotropicFilterExtension = this._gl.getExtension('EXT_texture_filter_anisotropic') || this._gl.getExtension('WEBKIT_EXT_texture_filter_anisotropic') || this._gl.getExtension('MOZ_EXT_texture_filter_anisotropic');
  3028. this._caps.maxAnisotropy = this._caps.textureAnisotropicFilterExtension ? this._gl.getParameter(this._caps.textureAnisotropicFilterExtension.MAX_TEXTURE_MAX_ANISOTROPY_EXT) : 0;
  3029. this._caps.instancedArrays = this._gl.getExtension('ANGLE_instanced_arrays');
  3030. this._caps.uintIndices = this._gl.getExtension('OES_element_index_uint') !== null;
  3031. this.setDepthBuffer(true);
  3032. this.setDepthFunctionToLessOrEqual();
  3033. this.setDepthWrite(true);
  3034. this._onFullscreenChange = function () {
  3035. if (document.fullscreen !== undefined) {
  3036. _this.isFullscreen = document.fullscreen;
  3037. } else if (document.mozFullScreen !== undefined) {
  3038. _this.isFullscreen = document.mozFullScreen;
  3039. } else if (document.webkitIsFullScreen !== undefined) {
  3040. _this.isFullscreen = document.webkitIsFullScreen;
  3041. } else if (document.msIsFullScreen !== undefined) {
  3042. _this.isFullscreen = document.msIsFullScreen;
  3043. }
  3044. if (_this.isFullscreen && _this._pointerLockRequested) {
  3045. canvas.requestPointerLock = canvas.requestPointerLock || canvas.msRequestPointerLock || canvas.mozRequestPointerLock || canvas.webkitRequestPointerLock;
  3046. if (canvas.requestPointerLock) {
  3047. canvas.requestPointerLock();
  3048. }
  3049. }
  3050. };
  3051. document.addEventListener("fullscreenchange", this._onFullscreenChange, false);
  3052. document.addEventListener("mozfullscreenchange", this._onFullscreenChange, false);
  3053. document.addEventListener("webkitfullscreenchange", this._onFullscreenChange, false);
  3054. document.addEventListener("msfullscreenchange", this._onFullscreenChange, false);
  3055. this._onPointerLockChange = function () {
  3056. _this.isPointerLock = (document.mozPointerLockElement === canvas || document.webkitPointerLockElement === canvas || document.msPointerLockElement === canvas || document.pointerLockElement === canvas);
  3057. };
  3058. document.addEventListener("pointerlockchange", this._onPointerLockChange, false);
  3059. document.addEventListener("mspointerlockchange", this._onPointerLockChange, false);
  3060. document.addEventListener("mozpointerlockchange", this._onPointerLockChange, false);
  3061. document.addEventListener("webkitpointerlockchange", this._onPointerLockChange, false);
  3062. this._audioEngine = new BABYLON.AudioEngine();
  3063. BABYLON.Tools.Log("Babylon.js engine (v" + Engine.Version + ") launched");
  3064. }
  3065. Object.defineProperty(Engine, "ALPHA_DISABLE", {
  3066. get: function () {
  3067. return Engine._ALPHA_DISABLE;
  3068. },
  3069. enumerable: true,
  3070. configurable: true
  3071. });
  3072. Object.defineProperty(Engine, "ALPHA_ADD", {
  3073. get: function () {
  3074. return Engine._ALPHA_ADD;
  3075. },
  3076. enumerable: true,
  3077. configurable: true
  3078. });
  3079. Object.defineProperty(Engine, "ALPHA_COMBINE", {
  3080. get: function () {
  3081. return Engine._ALPHA_COMBINE;
  3082. },
  3083. enumerable: true,
  3084. configurable: true
  3085. });
  3086. Object.defineProperty(Engine, "DELAYLOADSTATE_NONE", {
  3087. get: function () {
  3088. return Engine._DELAYLOADSTATE_NONE;
  3089. },
  3090. enumerable: true,
  3091. configurable: true
  3092. });
  3093. Object.defineProperty(Engine, "DELAYLOADSTATE_LOADED", {
  3094. get: function () {
  3095. return Engine._DELAYLOADSTATE_LOADED;
  3096. },
  3097. enumerable: true,
  3098. configurable: true
  3099. });
  3100. Object.defineProperty(Engine, "DELAYLOADSTATE_LOADING", {
  3101. get: function () {
  3102. return Engine._DELAYLOADSTATE_LOADING;
  3103. },
  3104. enumerable: true,
  3105. configurable: true
  3106. });
  3107. Object.defineProperty(Engine, "DELAYLOADSTATE_NOTLOADED", {
  3108. get: function () {
  3109. return Engine._DELAYLOADSTATE_NOTLOADED;
  3110. },
  3111. enumerable: true,
  3112. configurable: true
  3113. });
  3114. Object.defineProperty(Engine, "Version", {
  3115. get: function () {
  3116. return "2.0.0";
  3117. },
  3118. enumerable: true,
  3119. configurable: true
  3120. });
  3121. Engine.prototype.getAudioEngine = function () {
  3122. return this._audioEngine;
  3123. };
  3124. Engine.prototype.getAspectRatio = function (camera) {
  3125. var viewport = camera.viewport;
  3126. return (this.getRenderWidth() * viewport.width) / (this.getRenderHeight() * viewport.height);
  3127. };
  3128. Engine.prototype.getRenderWidth = function () {
  3129. if (this._currentRenderTarget) {
  3130. return this._currentRenderTarget._width;
  3131. }
  3132. return this._renderingCanvas.width;
  3133. };
  3134. Engine.prototype.getRenderHeight = function () {
  3135. if (this._currentRenderTarget) {
  3136. return this._currentRenderTarget._height;
  3137. }
  3138. return this._renderingCanvas.height;
  3139. };
  3140. Engine.prototype.getRenderingCanvas = function () {
  3141. return this._renderingCanvas;
  3142. };
  3143. Engine.prototype.getRenderingCanvasClientRect = function () {
  3144. return this._renderingCanvas.getBoundingClientRect();
  3145. };
  3146. Engine.prototype.setHardwareScalingLevel = function (level) {
  3147. this._hardwareScalingLevel = level;
  3148. this.resize();
  3149. };
  3150. Engine.prototype.getHardwareScalingLevel = function () {
  3151. return this._hardwareScalingLevel;
  3152. };
  3153. Engine.prototype.getLoadedTexturesCache = function () {
  3154. return this._loadedTexturesCache;
  3155. };
  3156. Engine.prototype.getCaps = function () {
  3157. return this._caps;
  3158. };
  3159. Object.defineProperty(Engine.prototype, "drawCalls", {
  3160. get: function () {
  3161. return this._drawCalls;
  3162. },
  3163. enumerable: true,
  3164. configurable: true
  3165. });
  3166. Engine.prototype.resetDrawCalls = function () {
  3167. this._drawCalls = 0;
  3168. };
  3169. Engine.prototype.setDepthFunctionToGreater = function () {
  3170. this._depthCullingState.depthFunc = this._gl.GREATER;
  3171. };
  3172. Engine.prototype.setDepthFunctionToGreaterOrEqual = function () {
  3173. this._depthCullingState.depthFunc = this._gl.GEQUAL;
  3174. };
  3175. Engine.prototype.setDepthFunctionToLess = function () {
  3176. this._depthCullingState.depthFunc = this._gl.LESS;
  3177. };
  3178. Engine.prototype.setDepthFunctionToLessOrEqual = function () {
  3179. this._depthCullingState.depthFunc = this._gl.LEQUAL;
  3180. };
  3181. Engine.prototype.stopRenderLoop = function () {
  3182. this._renderFunction = null;
  3183. this._runningLoop = false;
  3184. };
  3185. Engine.prototype._renderLoop = function () {
  3186. var _this = this;
  3187. var shouldRender = true;
  3188. if (!this.renderEvenInBackground && this._windowIsBackground) {
  3189. shouldRender = false;
  3190. }
  3191. if (shouldRender) {
  3192. this.beginFrame();
  3193. if (this._renderFunction) {
  3194. this._renderFunction();
  3195. }
  3196. this.endFrame();
  3197. }
  3198. if (this._runningLoop) {
  3199. BABYLON.Tools.QueueNewFrame(function () {
  3200. _this._renderLoop();
  3201. });
  3202. }
  3203. };
  3204. Engine.prototype.runRenderLoop = function (renderFunction) {
  3205. var _this = this;
  3206. this._runningLoop = true;
  3207. this._renderFunction = renderFunction;
  3208. BABYLON.Tools.QueueNewFrame(function () {
  3209. _this._renderLoop();
  3210. });
  3211. };
  3212. Engine.prototype.switchFullscreen = function (requestPointerLock) {
  3213. if (this.isFullscreen) {
  3214. BABYLON.Tools.ExitFullscreen();
  3215. } else {
  3216. this._pointerLockRequested = requestPointerLock;
  3217. BABYLON.Tools.RequestFullscreen(this._renderingCanvas);
  3218. }
  3219. };
  3220. Engine.prototype.clear = function (color, backBuffer, depthStencil) {
  3221. this.applyStates();
  3222. this._gl.clearColor(color.r, color.g, color.b, color.a !== undefined ? color.a : 1.0);
  3223. if (this._depthCullingState.depthMask) {
  3224. this._gl.clearDepth(1.0);
  3225. }
  3226. var mode = 0;
  3227. if (backBuffer)
  3228. mode |= this._gl.COLOR_BUFFER_BIT;
  3229. if (depthStencil && this._depthCullingState.depthMask)
  3230. mode |= this._gl.DEPTH_BUFFER_BIT;
  3231. this._gl.clear(mode);
  3232. };
  3233. Engine.prototype.setViewport = function (viewport, requiredWidth, requiredHeight) {
  3234. var width = requiredWidth || this._renderingCanvas.width;
  3235. var height = requiredHeight || this._renderingCanvas.height;
  3236. var x = viewport.x || 0;
  3237. var y = viewport.y || 0;
  3238. this._cachedViewport = viewport;
  3239. this._gl.viewport(x * width, y * height, width * viewport.width, height * viewport.height);
  3240. };
  3241. Engine.prototype.setDirectViewport = function (x, y, width, height) {
  3242. this._cachedViewport = null;
  3243. this._gl.viewport(x, y, width, height);
  3244. };
  3245. Engine.prototype.beginFrame = function () {
  3246. BABYLON.Tools._MeasureFps();
  3247. };
  3248. Engine.prototype.endFrame = function () {
  3249. this.flushFramebuffer();
  3250. };
  3251. Engine.prototype.resize = function () {
  3252. this.setSize(this._renderingCanvas.clientWidth / this._hardwareScalingLevel, this._renderingCanvas.clientHeight / this._hardwareScalingLevel);
  3253. };
  3254. Engine.prototype.setSize = function (width, height) {
  3255. this._renderingCanvas.width = width;
  3256. this._renderingCanvas.height = height;
  3257. this._canvasClientRect = this._renderingCanvas.getBoundingClientRect();
  3258. };
  3259. Engine.prototype.bindFramebuffer = function (texture) {
  3260. this._currentRenderTarget = texture;
  3261. var gl = this._gl;
  3262. gl.bindFramebuffer(gl.FRAMEBUFFER, texture._framebuffer);
  3263. this._gl.viewport(0, 0, texture._width, texture._height);
  3264. this.wipeCaches();
  3265. };
  3266. Engine.prototype.unBindFramebuffer = function (texture) {
  3267. this._currentRenderTarget = null;
  3268. if (texture.generateMipMaps) {
  3269. var gl = this._gl;
  3270. gl.bindTexture(gl.TEXTURE_2D, texture);
  3271. gl.generateMipmap(gl.TEXTURE_2D);
  3272. gl.bindTexture(gl.TEXTURE_2D, null);
  3273. }
  3274. this._gl.bindFramebuffer(this._gl.FRAMEBUFFER, null);
  3275. };
  3276. Engine.prototype.flushFramebuffer = function () {
  3277. };
  3278. Engine.prototype.restoreDefaultFramebuffer = function () {
  3279. this._currentRenderTarget = null;
  3280. this._gl.bindFramebuffer(this._gl.FRAMEBUFFER, null);
  3281. this.setViewport(this._cachedViewport);
  3282. this.wipeCaches();
  3283. };
  3284. Engine.prototype._resetVertexBufferBinding = function () {
  3285. this._gl.bindBuffer(this._gl.ARRAY_BUFFER, null);
  3286. this._cachedVertexBuffers = null;
  3287. };
  3288. Engine.prototype.createVertexBuffer = function (vertices) {
  3289. var vbo = this._gl.createBuffer();
  3290. this._gl.bindBuffer(this._gl.ARRAY_BUFFER, vbo);
  3291. this._gl.bufferData(this._gl.ARRAY_BUFFER, new Float32Array(vertices), this._gl.STATIC_DRAW);
  3292. this._resetVertexBufferBinding();
  3293. vbo.references = 1;
  3294. return vbo;
  3295. };
  3296. Engine.prototype.createDynamicVertexBuffer = function (capacity) {
  3297. var vbo = this._gl.createBuffer();
  3298. this._gl.bindBuffer(this._gl.ARRAY_BUFFER, vbo);
  3299. this._gl.bufferData(this._gl.ARRAY_BUFFER, capacity, this._gl.DYNAMIC_DRAW);
  3300. this._resetVertexBufferBinding();
  3301. vbo.references = 1;
  3302. return vbo;
  3303. };
  3304. Engine.prototype.updateDynamicVertexBuffer = function (vertexBuffer, vertices, length) {
  3305. this._gl.bindBuffer(this._gl.ARRAY_BUFFER, vertexBuffer);
  3306. if (vertices instanceof Float32Array) {
  3307. this._gl.bufferSubData(this._gl.ARRAY_BUFFER, 0, vertices);
  3308. } else {
  3309. this._gl.bufferSubData(this._gl.ARRAY_BUFFER, 0, new Float32Array(vertices));
  3310. }
  3311. this._resetVertexBufferBinding();
  3312. };
  3313. Engine.prototype._resetIndexBufferBinding = function () {
  3314. this._gl.bindBuffer(this._gl.ELEMENT_ARRAY_BUFFER, null);
  3315. this._cachedIndexBuffer = null;
  3316. };
  3317. Engine.prototype.createIndexBuffer = function (indices) {
  3318. var vbo = this._gl.createBuffer();
  3319. this._gl.bindBuffer(this._gl.ELEMENT_ARRAY_BUFFER, vbo);
  3320. var arrayBuffer;
  3321. var need32Bits = false;
  3322. if (this._caps.uintIndices) {
  3323. for (var index = 0; index < indices.length; index++) {
  3324. if (indices[index] > 65535) {
  3325. need32Bits = true;
  3326. break;
  3327. }
  3328. }
  3329. arrayBuffer = need32Bits ? new Uint32Array(indices) : new Uint16Array(indices);
  3330. } else {
  3331. arrayBuffer = new Uint16Array(indices);
  3332. }
  3333. this._gl.bufferData(this._gl.ELEMENT_ARRAY_BUFFER, arrayBuffer, this._gl.STATIC_DRAW);
  3334. this._resetIndexBufferBinding();
  3335. vbo.references = 1;
  3336. vbo.is32Bits = need32Bits;
  3337. return vbo;
  3338. };
  3339. Engine.prototype.bindBuffers = function (vertexBuffer, indexBuffer, vertexDeclaration, vertexStrideSize, effect) {
  3340. if (this._cachedVertexBuffers !== vertexBuffer || this._cachedEffectForVertexBuffers !== effect) {
  3341. this._cachedVertexBuffers = vertexBuffer;
  3342. this._cachedEffectForVertexBuffers = effect;
  3343. this._gl.bindBuffer(this._gl.ARRAY_BUFFER, vertexBuffer);
  3344. var offset = 0;
  3345. for (var index = 0; index < vertexDeclaration.length; index++) {
  3346. var order = effect.getAttributeLocation(index);
  3347. if (order >= 0) {
  3348. this._gl.vertexAttribPointer(order, vertexDeclaration[index], this._gl.FLOAT, false, vertexStrideSize, offset);
  3349. }
  3350. offset += vertexDeclaration[index] * 4;
  3351. }
  3352. }
  3353. if (this._cachedIndexBuffer !== indexBuffer) {
  3354. this._cachedIndexBuffer = indexBuffer;
  3355. this._gl.bindBuffer(this._gl.ELEMENT_ARRAY_BUFFER, indexBuffer);
  3356. this._uintIndicesCurrentlySet = indexBuffer.is32Bits;
  3357. }
  3358. };
  3359. Engine.prototype.bindMultiBuffers = function (vertexBuffers, indexBuffer, effect) {
  3360. if (this._cachedVertexBuffers !== vertexBuffers || this._cachedEffectForVertexBuffers !== effect) {
  3361. this._cachedVertexBuffers = vertexBuffers;
  3362. this._cachedEffectForVertexBuffers = effect;
  3363. var attributes = effect.getAttributesNames();
  3364. for (var index = 0; index < attributes.length; index++) {
  3365. var order = effect.getAttributeLocation(index);
  3366. if (order >= 0) {
  3367. var vertexBuffer = vertexBuffers[attributes[index]];
  3368. if (!vertexBuffer) {
  3369. continue;
  3370. }
  3371. var stride = vertexBuffer.getStrideSize();
  3372. this._gl.bindBuffer(this._gl.ARRAY_BUFFER, vertexBuffer.getBuffer());
  3373. this._gl.vertexAttribPointer(order, stride, this._gl.FLOAT, false, stride * 4, 0);
  3374. }
  3375. }
  3376. }
  3377. if (indexBuffer != null && this._cachedIndexBuffer !== indexBuffer) {
  3378. this._cachedIndexBuffer = indexBuffer;
  3379. this._gl.bindBuffer(this._gl.ELEMENT_ARRAY_BUFFER, indexBuffer);
  3380. this._uintIndicesCurrentlySet = indexBuffer.is32Bits;
  3381. }
  3382. };
  3383. Engine.prototype._releaseBuffer = function (buffer) {
  3384. buffer.references--;
  3385. if (buffer.references === 0) {
  3386. this._gl.deleteBuffer(buffer);
  3387. return true;
  3388. }
  3389. return false;
  3390. };
  3391. Engine.prototype.createInstancesBuffer = function (capacity) {
  3392. var buffer = this._gl.createBuffer();
  3393. buffer.capacity = capacity;
  3394. this._gl.bindBuffer(this._gl.ARRAY_BUFFER, buffer);
  3395. this._gl.bufferData(this._gl.ARRAY_BUFFER, capacity, this._gl.DYNAMIC_DRAW);
  3396. return buffer;
  3397. };
  3398. Engine.prototype.deleteInstancesBuffer = function (buffer) {
  3399. this._gl.deleteBuffer(buffer);
  3400. };
  3401. Engine.prototype.updateAndBindInstancesBuffer = function (instancesBuffer, data, offsetLocations) {
  3402. this._gl.bindBuffer(this._gl.ARRAY_BUFFER, instancesBuffer);
  3403. this._gl.bufferSubData(this._gl.ARRAY_BUFFER, 0, data);
  3404. for (var index = 0; index < 4; index++) {
  3405. var offsetLocation = offsetLocations[index];
  3406. this._gl.enableVertexAttribArray(offsetLocation);
  3407. this._gl.vertexAttribPointer(offsetLocation, 4, this._gl.FLOAT, false, 64, index * 16);
  3408. this._caps.instancedArrays.vertexAttribDivisorANGLE(offsetLocation, 1);
  3409. }
  3410. };
  3411. Engine.prototype.unBindInstancesBuffer = function (instancesBuffer, offsetLocations) {
  3412. this._gl.bindBuffer(this._gl.ARRAY_BUFFER, instancesBuffer);
  3413. for (var index = 0; index < 4; index++) {
  3414. var offsetLocation = offsetLocations[index];
  3415. this._gl.disableVertexAttribArray(offsetLocation);
  3416. this._caps.instancedArrays.vertexAttribDivisorANGLE(offsetLocation, 0);
  3417. }
  3418. };
  3419. Engine.prototype.applyStates = function () {
  3420. this._depthCullingState.apply(this._gl);
  3421. this._alphaState.apply(this._gl);
  3422. };
  3423. Engine.prototype.draw = function (useTriangles, indexStart, indexCount, instancesCount) {
  3424. this.applyStates();
  3425. var indexFormat = this._uintIndicesCurrentlySet ? this._gl.UNSIGNED_INT : this._gl.UNSIGNED_SHORT;
  3426. if (instancesCount) {
  3427. this._caps.instancedArrays.drawElementsInstancedANGLE(useTriangles ? this._gl.TRIANGLES : this._gl.LINES, indexCount, indexFormat, indexStart * 2, instancesCount);
  3428. return;
  3429. }
  3430. this._gl.drawElements(useTriangles ? this._gl.TRIANGLES : this._gl.LINES, indexCount, indexFormat, indexStart * 2);
  3431. this._drawCalls++;
  3432. };
  3433. Engine.prototype.drawPointClouds = function (verticesStart, verticesCount, instancesCount) {
  3434. this.applyStates();
  3435. if (instancesCount) {
  3436. this._caps.instancedArrays.drawArraysInstancedANGLE(this._gl.POINTS, verticesStart, verticesCount, instancesCount);
  3437. return;
  3438. }
  3439. this._gl.drawArrays(this._gl.POINTS, verticesStart, verticesCount);
  3440. this._drawCalls++;
  3441. };
  3442. Engine.prototype._releaseEffect = function (effect) {
  3443. if (this._compiledEffects[effect._key]) {
  3444. delete this._compiledEffects[effect._key];
  3445. if (effect.getProgram()) {
  3446. this._gl.deleteProgram(effect.getProgram());
  3447. }
  3448. }
  3449. };
  3450. Engine.prototype.createEffect = function (baseName, attributesNames, uniformsNames, samplers, defines, fallbacks, onCompiled, onError) {
  3451. var vertex = baseName.vertexElement || baseName.vertex || baseName;
  3452. var fragment = baseName.fragmentElement || baseName.fragment || baseName;
  3453. var name = vertex + "+" + fragment + "@" + defines;
  3454. if (this._compiledEffects[name]) {
  3455. return this._compiledEffects[name];
  3456. }
  3457. var effect = new BABYLON.Effect(baseName, attributesNames, uniformsNames, samplers, this, defines, fallbacks, onCompiled, onError);
  3458. effect._key = name;
  3459. this._compiledEffects[name] = effect;
  3460. return effect;
  3461. };
  3462. Engine.prototype.createEffectForParticles = function (fragmentName, uniformsNames, samplers, defines, fallbacks, onCompiled, onError) {
  3463. if (typeof uniformsNames === "undefined") { uniformsNames = []; }
  3464. if (typeof samplers === "undefined") { samplers = []; }
  3465. if (typeof defines === "undefined") { defines = ""; }
  3466. return this.createEffect({
  3467. vertex: "particles",
  3468. fragmentElement: fragmentName
  3469. }, ["position", "color", "options"], ["view", "projection"].concat(uniformsNames), ["diffuseSampler"].concat(samplers), defines, fallbacks, onCompiled, onError);
  3470. };
  3471. Engine.prototype.createShaderProgram = function (vertexCode, fragmentCode, defines) {
  3472. var vertexShader = compileShader(this._gl, vertexCode, "vertex", defines);
  3473. var fragmentShader = compileShader(this._gl, fragmentCode, "fragment", defines);
  3474. var shaderProgram = this._gl.createProgram();
  3475. this._gl.attachShader(shaderProgram, vertexShader);
  3476. this._gl.attachShader(shaderProgram, fragmentShader);
  3477. this._gl.linkProgram(shaderProgram);
  3478. var linked = this._gl.getProgramParameter(shaderProgram, this._gl.LINK_STATUS);
  3479. if (!linked) {
  3480. var error = this._gl.getProgramInfoLog(shaderProgram);
  3481. if (error) {
  3482. throw new Error(error);
  3483. }
  3484. }
  3485. this._gl.deleteShader(vertexShader);
  3486. this._gl.deleteShader(fragmentShader);
  3487. return shaderProgram;
  3488. };
  3489. Engine.prototype.getUniforms = function (shaderProgram, uniformsNames) {
  3490. var results = [];
  3491. for (var index = 0; index < uniformsNames.length; index++) {
  3492. results.push(this._gl.getUniformLocation(shaderProgram, uniformsNames[index]));
  3493. }
  3494. return results;
  3495. };
  3496. Engine.prototype.getAttributes = function (shaderProgram, attributesNames) {
  3497. var results = [];
  3498. for (var index = 0; index < attributesNames.length; index++) {
  3499. try {
  3500. results.push(this._gl.getAttribLocation(shaderProgram, attributesNames[index]));
  3501. } catch (e) {
  3502. results.push(-1);
  3503. }
  3504. }
  3505. return results;
  3506. };
  3507. Engine.prototype.enableEffect = function (effect) {
  3508. if (!effect || !effect.getAttributesCount() || this._currentEffect === effect) {
  3509. if (effect && effect.onBind) {
  3510. effect.onBind(effect);
  3511. }
  3512. return;
  3513. }
  3514. this._vertexAttribArrays = this._vertexAttribArrays || [];
  3515. this._gl.useProgram(effect.getProgram());
  3516. for (var i in this._vertexAttribArrays) {
  3517. if (i > this._gl.VERTEX_ATTRIB_ARRAY_ENABLED || !this._vertexAttribArrays[i]) {
  3518. continue;
  3519. }
  3520. this._vertexAttribArrays[i] = false;
  3521. this._gl.disableVertexAttribArray(i);
  3522. }
  3523. var attributesCount = effect.getAttributesCount();
  3524. for (var index = 0; index < attributesCount; index++) {
  3525. var order = effect.getAttributeLocation(index);
  3526. if (order >= 0) {
  3527. this._vertexAttribArrays[order] = true;
  3528. this._gl.enableVertexAttribArray(order);
  3529. }
  3530. }
  3531. this._currentEffect = effect;
  3532. if (effect.onBind) {
  3533. effect.onBind(effect);
  3534. }
  3535. };
  3536. Engine.prototype.setArray = function (uniform, array) {
  3537. if (!uniform)
  3538. return;
  3539. this._gl.uniform1fv(uniform, array);
  3540. };
  3541. Engine.prototype.setMatrices = function (uniform, matrices) {
  3542. if (!uniform)
  3543. return;
  3544. this._gl.uniformMatrix4fv(uniform, false, matrices);
  3545. };
  3546. Engine.prototype.setMatrix = function (uniform, matrix) {
  3547. if (!uniform)
  3548. return;
  3549. this._gl.uniformMatrix4fv(uniform, false, matrix.toArray());
  3550. };
  3551. Engine.prototype.setFloat = function (uniform, value) {
  3552. if (!uniform)
  3553. return;
  3554. this._gl.uniform1f(uniform, value);
  3555. };
  3556. Engine.prototype.setFloat2 = function (uniform, x, y) {
  3557. if (!uniform)
  3558. return;
  3559. this._gl.uniform2f(uniform, x, y);
  3560. };
  3561. Engine.prototype.setFloat3 = function (uniform, x, y, z) {
  3562. if (!uniform)
  3563. return;
  3564. this._gl.uniform3f(uniform, x, y, z);
  3565. };
  3566. Engine.prototype.setBool = function (uniform, bool) {
  3567. if (!uniform)
  3568. return;
  3569. this._gl.uniform1i(uniform, bool);
  3570. };
  3571. Engine.prototype.setFloat4 = function (uniform, x, y, z, w) {
  3572. if (!uniform)
  3573. return;
  3574. this._gl.uniform4f(uniform, x, y, z, w);
  3575. };
  3576. Engine.prototype.setColor3 = function (uniform, color3) {
  3577. if (!uniform)
  3578. return;
  3579. this._gl.uniform3f(uniform, color3.r, color3.g, color3.b);
  3580. };
  3581. Engine.prototype.setColor4 = function (uniform, color3, alpha) {
  3582. if (!uniform)
  3583. return;
  3584. this._gl.uniform4f(uniform, color3.r, color3.g, color3.b, alpha);
  3585. };
  3586. Engine.prototype.setState = function (culling, force) {
  3587. if (this._depthCullingState.cull !== culling || force) {
  3588. if (culling) {
  3589. this._depthCullingState.cullFace = this.cullBackFaces ? this._gl.BACK : this._gl.FRONT;
  3590. this._depthCullingState.cull = true;
  3591. } else {
  3592. this._depthCullingState.cull = false;
  3593. }
  3594. }
  3595. };
  3596. Engine.prototype.setDepthBuffer = function (enable) {
  3597. this._depthCullingState.depthTest = enable;
  3598. };
  3599. Engine.prototype.getDepthWrite = function () {
  3600. return this._depthCullingState.depthMask;
  3601. };
  3602. Engine.prototype.setDepthWrite = function (enable) {
  3603. this._depthCullingState.depthMask = enable;
  3604. };
  3605. Engine.prototype.setColorWrite = function (enable) {
  3606. this._gl.colorMask(enable, enable, enable, enable);
  3607. };
  3608. Engine.prototype.setAlphaMode = function (mode) {
  3609. switch (mode) {
  3610. case BABYLON.Engine.ALPHA_DISABLE:
  3611. this.setDepthWrite(true);
  3612. this._alphaState.alphaBlend = false;
  3613. break;
  3614. case BABYLON.Engine.ALPHA_COMBINE:
  3615. this.setDepthWrite(false);
  3616. this._alphaState.setAlphaBlendFunctionParameters(this._gl.SRC_ALPHA, this._gl.ONE_MINUS_SRC_ALPHA, this._gl.ONE, this._gl.ONE);
  3617. this._alphaState.alphaBlend = true;
  3618. break;
  3619. case BABYLON.Engine.ALPHA_ADD:
  3620. this.setDepthWrite(false);
  3621. this._alphaState.setAlphaBlendFunctionParameters(this._gl.ONE, this._gl.ONE, this._gl.ZERO, this._gl.ONE);
  3622. this._alphaState.alphaBlend = true;
  3623. break;
  3624. }
  3625. this._alphaMode = mode;
  3626. };
  3627. Engine.prototype.getAlphaMode = function () {
  3628. return this._alphaMode;
  3629. };
  3630. Engine.prototype.setAlphaTesting = function (enable) {
  3631. this._alphaTest = enable;
  3632. };
  3633. Engine.prototype.getAlphaTesting = function () {
  3634. return this._alphaTest;
  3635. };
  3636. Engine.prototype.wipeCaches = function () {
  3637. this._activeTexturesCache = [];
  3638. this._currentEffect = null;
  3639. this._depthCullingState.reset();
  3640. this._alphaState.reset();
  3641. this._cachedVertexBuffers = null;
  3642. this._cachedIndexBuffer = null;
  3643. this._cachedEffectForVertexBuffers = null;
  3644. };
  3645. Engine.prototype.setSamplingMode = function (texture, samplingMode) {
  3646. var gl = this._gl;
  3647. gl.bindTexture(gl.TEXTURE_2D, texture);
  3648. var magFilter = gl.NEAREST;
  3649. var minFilter = gl.NEAREST;
  3650. if (samplingMode === BABYLON.Texture.BILINEAR_SAMPLINGMODE) {
  3651. magFilter = gl.LINEAR;
  3652. minFilter = gl.LINEAR;
  3653. } else if (samplingMode === BABYLON.Texture.TRILINEAR_SAMPLINGMODE) {
  3654. magFilter = gl.LINEAR;
  3655. minFilter = gl.LINEAR_MIPMAP_LINEAR;
  3656. }
  3657. gl.texParameteri(gl.TEXTURE_2D, gl.TEXTURE_MAG_FILTER, magFilter);
  3658. gl.texParameteri(gl.TEXTURE_2D, gl.TEXTURE_MIN_FILTER, minFilter);
  3659. gl.bindTexture(gl.TEXTURE_2D, null);
  3660. };
  3661. Engine.prototype.createTexture = function (url, noMipmap, invertY, scene, samplingMode, onLoad, onError, buffer) {
  3662. var _this = this;
  3663. if (typeof samplingMode === "undefined") { samplingMode = BABYLON.Texture.TRILINEAR_SAMPLINGMODE; }
  3664. if (typeof onLoad === "undefined") { onLoad = null; }
  3665. if (typeof onError === "undefined") { onError = null; }
  3666. if (typeof buffer === "undefined") { buffer = null; }
  3667. var texture = this._gl.createTexture();
  3668. var extension;
  3669. var fromData = false;
  3670. if (url.substr(0, 5) === "data:") {
  3671. fromData = true;
  3672. }
  3673. if (!fromData)
  3674. extension = url.substr(url.length - 4, 4).toLowerCase();
  3675. else {
  3676. var oldUrl = url;
  3677. fromData = oldUrl.split(':');
  3678. url = oldUrl;
  3679. extension = fromData[1].substr(fromData[1].length - 4, 4).toLowerCase();
  3680. }
  3681. var isDDS = this.getCaps().s3tc && (extension === ".dds");
  3682. var isTGA = (extension === ".tga");
  3683. scene._addPendingData(texture);
  3684. texture.url = url;
  3685. texture.noMipmap = noMipmap;
  3686. texture.references = 1;
  3687. this._loadedTexturesCache.push(texture);
  3688. var onerror = function () {
  3689. scene._removePendingData(texture);
  3690. if (onError) {
  3691. onError();
  3692. }
  3693. };
  3694. if (isTGA) {
  3695. var callback = function (arrayBuffer) {
  3696. var data = new Uint8Array(arrayBuffer);
  3697. var header = BABYLON.Internals.TGATools.GetTGAHeader(data);
  3698. prepareWebGLTexture(texture, _this._gl, scene, header.width, header.height, invertY, noMipmap, false, function () {
  3699. BABYLON.Internals.TGATools.UploadContent(_this._gl, data);
  3700. if (onLoad) {
  3701. onLoad();
  3702. }
  3703. }, samplingMode);
  3704. };
  3705. if (!(fromData instanceof Array))
  3706. BABYLON.Tools.LoadFile(url, function (arrayBuffer) {
  3707. callback(arrayBuffer);
  3708. }, onerror, scene.database, true);
  3709. else
  3710. callback(buffer);
  3711. } else if (isDDS) {
  3712. callback = function (data) {
  3713. var info = BABYLON.Internals.DDSTools.GetDDSInfo(data);
  3714. var loadMipmap = (info.isRGB || info.isLuminance || info.mipmapCount > 1) && !noMipmap && ((info.width >> (info.mipmapCount - 1)) == 1);
  3715. prepareWebGLTexture(texture, _this._gl, scene, info.width, info.height, invertY, !loadMipmap, info.isFourCC, function () {
  3716. BABYLON.Internals.DDSTools.UploadDDSLevels(_this._gl, _this.getCaps().s3tc, data, info, loadMipmap, 1);
  3717. if (onLoad) {
  3718. onLoad();
  3719. }
  3720. }, samplingMode);
  3721. };
  3722. if (!(fromData instanceof Array))
  3723. BABYLON.Tools.LoadFile(url, function (data) {
  3724. callback(data);
  3725. }, onerror, scene.database, true);
  3726. else
  3727. callback(buffer);
  3728. } else {
  3729. var onload = function (img) {
  3730. prepareWebGLTexture(texture, _this._gl, scene, img.width, img.height, invertY, noMipmap, false, function (potWidth, potHeight) {
  3731. var isPot = (img.width == potWidth && img.height == potHeight);
  3732. if (!isPot) {
  3733. _this._workingCanvas.width = potWidth;
  3734. _this._workingCanvas.height = potHeight;
  3735. _this._workingContext.drawImage(img, 0, 0, img.width, img.height, 0, 0, potWidth, potHeight);
  3736. }
  3737. _this._gl.texImage2D(_this._gl.TEXTURE_2D, 0, _this._gl.RGBA, _this._gl.RGBA, _this._gl.UNSIGNED_BYTE, isPot ? img : _this._workingCanvas);
  3738. if (onLoad) {
  3739. onLoad();
  3740. }
  3741. }, samplingMode);
  3742. };
  3743. if (!(fromData instanceof Array))
  3744. BABYLON.Tools.LoadImage(url, onload, onerror, scene.database);
  3745. else
  3746. BABYLON.Tools.LoadImage(buffer, onload, onerror, scene.database);
  3747. }
  3748. return texture;
  3749. };
  3750. Engine.prototype.createDynamicTexture = function (width, height, generateMipMaps, samplingMode) {
  3751. var texture = this._gl.createTexture();
  3752. width = BABYLON.Tools.GetExponantOfTwo(width, this._caps.maxTextureSize);
  3753. height = BABYLON.Tools.GetExponantOfTwo(height, this._caps.maxTextureSize);
  3754. this._gl.bindTexture(this._gl.TEXTURE_2D, texture);
  3755. var filters = getSamplingParameters(samplingMode, generateMipMaps, this._gl);
  3756. this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_MAG_FILTER, filters.mag);
  3757. this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_MIN_FILTER, filters.min);
  3758. this._gl.bindTexture(this._gl.TEXTURE_2D, null);
  3759. this._activeTexturesCache = [];
  3760. texture._baseWidth = width;
  3761. texture._baseHeight = height;
  3762. texture._width = width;
  3763. texture._height = height;
  3764. texture.isReady = false;
  3765. texture.generateMipMaps = generateMipMaps;
  3766. texture.references = 1;
  3767. this._loadedTexturesCache.push(texture);
  3768. return texture;
  3769. };
  3770. Engine.prototype.updateDynamicTexture = function (texture, canvas, invertY) {
  3771. this._gl.bindTexture(this._gl.TEXTURE_2D, texture);
  3772. this._gl.pixelStorei(this._gl.UNPACK_FLIP_Y_WEBGL, invertY ? 1 : 0);
  3773. this._gl.texImage2D(this._gl.TEXTURE_2D, 0, this._gl.RGBA, this._gl.RGBA, this._gl.UNSIGNED_BYTE, canvas);
  3774. if (texture.generateMipMaps) {
  3775. this._gl.generateMipmap(this._gl.TEXTURE_2D);
  3776. }
  3777. this._gl.bindTexture(this._gl.TEXTURE_2D, null);
  3778. this._activeTexturesCache = [];
  3779. texture.isReady = true;
  3780. };
  3781. Engine.prototype.updateVideoTexture = function (texture, video, invertY) {
  3782. this._gl.bindTexture(this._gl.TEXTURE_2D, texture);
  3783. this._gl.pixelStorei(this._gl.UNPACK_FLIP_Y_WEBGL, invertY ? 0 : 1);
  3784. if (video.videoWidth !== texture._width || video.videoHeight !== texture._height) {
  3785. if (!texture._workingCanvas) {
  3786. texture._workingCanvas = document.createElement("canvas");
  3787. texture._workingContext = texture._workingCanvas.getContext("2d");
  3788. texture._workingCanvas.width = texture._width;
  3789. texture._workingCanvas.height = texture._height;
  3790. }
  3791. texture._workingContext.drawImage(video, 0, 0, video.videoWidth, video.videoHeight, 0, 0, texture._width, texture._height);
  3792. this._gl.texImage2D(this._gl.TEXTURE_2D, 0, this._gl.RGBA, this._gl.RGBA, this._gl.UNSIGNED_BYTE, texture._workingCanvas);
  3793. } else {
  3794. this._gl.texImage2D(this._gl.TEXTURE_2D, 0, this._gl.RGBA, this._gl.RGBA, this._gl.UNSIGNED_BYTE, video);
  3795. }
  3796. if (texture.generateMipMaps) {
  3797. this._gl.generateMipmap(this._gl.TEXTURE_2D);
  3798. }
  3799. this._gl.bindTexture(this._gl.TEXTURE_2D, null);
  3800. this._activeTexturesCache = [];
  3801. texture.isReady = true;
  3802. };
  3803. Engine.prototype.createRenderTargetTexture = function (size, options) {
  3804. var generateMipMaps = false;
  3805. var generateDepthBuffer = true;
  3806. var samplingMode = BABYLON.Texture.TRILINEAR_SAMPLINGMODE;
  3807. if (options !== undefined) {
  3808. generateMipMaps = options.generateMipMaps === undefined ? options : options.generateMipmaps;
  3809. generateDepthBuffer = options.generateDepthBuffer === undefined ? true : options.generateDepthBuffer;
  3810. if (options.samplingMode !== undefined) {
  3811. samplingMode = options.samplingMode;
  3812. }
  3813. }
  3814. var gl = this._gl;
  3815. var texture = gl.createTexture();
  3816. gl.bindTexture(gl.TEXTURE_2D, texture);
  3817. var width = size.width || size;
  3818. var height = size.height || size;
  3819. var filters = getSamplingParameters(samplingMode, generateMipMaps, gl);
  3820. gl.texParameteri(gl.TEXTURE_2D, gl.TEXTURE_MAG_FILTER, filters.mag);
  3821. gl.texParameteri(gl.TEXTURE_2D, gl.TEXTURE_MIN_FILTER, filters.min);
  3822. gl.texParameteri(gl.TEXTURE_2D, gl.TEXTURE_WRAP_S, gl.CLAMP_TO_EDGE);
  3823. gl.texParameteri(gl.TEXTURE_2D, gl.TEXTURE_WRAP_T, gl.CLAMP_TO_EDGE);
  3824. gl.texImage2D(gl.TEXTURE_2D, 0, gl.RGBA, width, height, 0, gl.RGBA, gl.UNSIGNED_BYTE, null);
  3825. var depthBuffer;
  3826. if (generateDepthBuffer) {
  3827. depthBuffer = gl.createRenderbuffer();
  3828. gl.bindRenderbuffer(gl.RENDERBUFFER, depthBuffer);
  3829. gl.renderbufferStorage(gl.RENDERBUFFER, gl.DEPTH_COMPONENT16, width, height);
  3830. }
  3831. var framebuffer = gl.createFramebuffer();
  3832. gl.bindFramebuffer(gl.FRAMEBUFFER, framebuffer);
  3833. gl.framebufferTexture2D(gl.FRAMEBUFFER, gl.COLOR_ATTACHMENT0, gl.TEXTURE_2D, texture, 0);
  3834. if (generateDepthBuffer) {
  3835. gl.framebufferRenderbuffer(gl.FRAMEBUFFER, gl.DEPTH_ATTACHMENT, gl.RENDERBUFFER, depthBuffer);
  3836. }
  3837. gl.bindTexture(gl.TEXTURE_2D, null);
  3838. gl.bindRenderbuffer(gl.RENDERBUFFER, null);
  3839. gl.bindFramebuffer(gl.FRAMEBUFFER, null);
  3840. texture._framebuffer = framebuffer;
  3841. if (generateDepthBuffer) {
  3842. texture._depthBuffer = depthBuffer;
  3843. }
  3844. texture._width = width;
  3845. texture._height = height;
  3846. texture.isReady = true;
  3847. texture.generateMipMaps = generateMipMaps;
  3848. texture.references = 1;
  3849. this._activeTexturesCache = [];
  3850. this._loadedTexturesCache.push(texture);
  3851. return texture;
  3852. };
  3853. Engine.prototype.createCubeTexture = function (rootUrl, scene, extensions, noMipmap) {
  3854. var _this = this;
  3855. var gl = this._gl;
  3856. var texture = gl.createTexture();
  3857. texture.isCube = true;
  3858. texture.url = rootUrl;
  3859. texture.references = 1;
  3860. this._loadedTexturesCache.push(texture);
  3861. var extension = rootUrl.substr(rootUrl.length - 4, 4).toLowerCase();
  3862. var isDDS = this.getCaps().s3tc && (extension === ".dds");
  3863. if (isDDS) {
  3864. BABYLON.Tools.LoadFile(rootUrl, function (data) {
  3865. var info = BABYLON.Internals.DDSTools.GetDDSInfo(data);
  3866. var loadMipmap = (info.isRGB || info.isLuminance || info.mipmapCount > 1) && !noMipmap;
  3867. gl.bindTexture(gl.TEXTURE_CUBE_MAP, texture);
  3868. gl.pixelStorei(gl.UNPACK_FLIP_Y_WEBGL, 1);
  3869. BABYLON.Internals.DDSTools.UploadDDSLevels(_this._gl, _this.getCaps().s3tc, data, info, loadMipmap, 6);
  3870. if (!noMipmap && !info.isFourCC && info.mipmapCount == 1) {
  3871. gl.generateMipmap(gl.TEXTURE_CUBE_MAP);
  3872. }
  3873. gl.texParameteri(gl.TEXTURE_CUBE_MAP, gl.TEXTURE_MAG_FILTER, gl.LINEAR);
  3874. gl.texParameteri(gl.TEXTURE_CUBE_MAP, gl.TEXTURE_MIN_FILTER, loadMipmap ? gl.LINEAR_MIPMAP_LINEAR : gl.LINEAR);
  3875. gl.texParameteri(gl.TEXTURE_CUBE_MAP, gl.TEXTURE_WRAP_S, gl.CLAMP_TO_EDGE);
  3876. gl.texParameteri(gl.TEXTURE_CUBE_MAP, gl.TEXTURE_WRAP_T, gl.CLAMP_TO_EDGE);
  3877. gl.bindTexture(gl.TEXTURE_CUBE_MAP, null);
  3878. _this._activeTexturesCache = [];
  3879. texture._width = info.width;
  3880. texture._height = info.height;
  3881. texture.isReady = true;
  3882. }, null, null, true);
  3883. } else {
  3884. cascadeLoad(rootUrl, scene, function (imgs) {
  3885. var width = BABYLON.Tools.GetExponantOfTwo(imgs[0].width, _this._caps.maxCubemapTextureSize);
  3886. var height = width;
  3887. _this._workingCanvas.width = width;
  3888. _this._workingCanvas.height = height;
  3889. var faces = [
  3890. gl.TEXTURE_CUBE_MAP_POSITIVE_X, gl.TEXTURE_CUBE_MAP_POSITIVE_Y, gl.TEXTURE_CUBE_MAP_POSITIVE_Z,
  3891. gl.TEXTURE_CUBE_MAP_NEGATIVE_X, gl.TEXTURE_CUBE_MAP_NEGATIVE_Y, gl.TEXTURE_CUBE_MAP_NEGATIVE_Z
  3892. ];
  3893. gl.bindTexture(gl.TEXTURE_CUBE_MAP, texture);
  3894. gl.pixelStorei(gl.UNPACK_FLIP_Y_WEBGL, 0);
  3895. for (var index = 0; index < faces.length; index++) {
  3896. _this._workingContext.drawImage(imgs[index], 0, 0, imgs[index].width, imgs[index].height, 0, 0, width, height);
  3897. gl.texImage2D(faces[index], 0, gl.RGBA, gl.RGBA, gl.UNSIGNED_BYTE, _this._workingCanvas);
  3898. }
  3899. if (!noMipmap) {
  3900. gl.generateMipmap(gl.TEXTURE_CUBE_MAP);
  3901. }
  3902. gl.texParameteri(gl.TEXTURE_CUBE_MAP, gl.TEXTURE_MAG_FILTER, gl.LINEAR);
  3903. gl.texParameteri(gl.TEXTURE_CUBE_MAP, gl.TEXTURE_MIN_FILTER, noMipmap ? gl.LINEAR : gl.LINEAR_MIPMAP_LINEAR);
  3904. gl.texParameteri(gl.TEXTURE_CUBE_MAP, gl.TEXTURE_WRAP_S, gl.CLAMP_TO_EDGE);
  3905. gl.texParameteri(gl.TEXTURE_CUBE_MAP, gl.TEXTURE_WRAP_T, gl.CLAMP_TO_EDGE);
  3906. gl.bindTexture(gl.TEXTURE_CUBE_MAP, null);
  3907. _this._activeTexturesCache = [];
  3908. texture._width = width;
  3909. texture._height = height;
  3910. texture.isReady = true;
  3911. }, extensions);
  3912. }
  3913. return texture;
  3914. };
  3915. Engine.prototype._releaseTexture = function (texture) {
  3916. var gl = this._gl;
  3917. if (texture._framebuffer) {
  3918. gl.deleteFramebuffer(texture._framebuffer);
  3919. }
  3920. if (texture._depthBuffer) {
  3921. gl.deleteRenderbuffer(texture._depthBuffer);
  3922. }
  3923. gl.deleteTexture(texture);
  3924. for (var channel = 0; channel < this._caps.maxTexturesImageUnits; channel++) {
  3925. this._gl.activeTexture(this._gl["TEXTURE" + channel]);
  3926. this._gl.bindTexture(this._gl.TEXTURE_2D, null);
  3927. this._gl.bindTexture(this._gl.TEXTURE_CUBE_MAP, null);
  3928. this._activeTexturesCache[channel] = null;
  3929. }
  3930. var index = this._loadedTexturesCache.indexOf(texture);
  3931. if (index !== -1) {
  3932. this._loadedTexturesCache.splice(index, 1);
  3933. }
  3934. };
  3935. Engine.prototype.bindSamplers = function (effect) {
  3936. this._gl.useProgram(effect.getProgram());
  3937. var samplers = effect.getSamplers();
  3938. for (var index = 0; index < samplers.length; index++) {
  3939. var uniform = effect.getUniform(samplers[index]);
  3940. this._gl.uniform1i(uniform, index);
  3941. }
  3942. this._currentEffect = null;
  3943. };
  3944. Engine.prototype._bindTexture = function (channel, texture) {
  3945. this._gl.activeTexture(this._gl["TEXTURE" + channel]);
  3946. this._gl.bindTexture(this._gl.TEXTURE_2D, texture);
  3947. this._activeTexturesCache[channel] = null;
  3948. };
  3949. Engine.prototype.setTextureFromPostProcess = function (channel, postProcess) {
  3950. this._bindTexture(channel, postProcess._textures.data[postProcess._currentRenderTextureInd]);
  3951. };
  3952. Engine.prototype.setTexture = function (channel, texture) {
  3953. if (channel < 0) {
  3954. return;
  3955. }
  3956. if (!texture || !texture.isReady()) {
  3957. if (this._activeTexturesCache[channel] != null) {
  3958. this._gl.activeTexture(this._gl["TEXTURE" + channel]);
  3959. this._gl.bindTexture(this._gl.TEXTURE_2D, null);
  3960. this._gl.bindTexture(this._gl.TEXTURE_CUBE_MAP, null);
  3961. this._activeTexturesCache[channel] = null;
  3962. }
  3963. return;
  3964. }
  3965. if (texture instanceof BABYLON.VideoTexture) {
  3966. if (texture.update()) {
  3967. this._activeTexturesCache[channel] = null;
  3968. }
  3969. } else if (texture.delayLoadState == BABYLON.Engine.DELAYLOADSTATE_NOTLOADED) {
  3970. texture.delayLoad();
  3971. return;
  3972. }
  3973. if (this._activeTexturesCache[channel] == texture) {
  3974. return;
  3975. }
  3976. this._activeTexturesCache[channel] = texture;
  3977. var internalTexture = texture.getInternalTexture();
  3978. this._gl.activeTexture(this._gl["TEXTURE" + channel]);
  3979. if (internalTexture.isCube) {
  3980. this._gl.bindTexture(this._gl.TEXTURE_CUBE_MAP, internalTexture);
  3981. if (internalTexture._cachedCoordinatesMode !== texture.coordinatesMode) {
  3982. internalTexture._cachedCoordinatesMode = texture.coordinatesMode;
  3983. var textureWrapMode = (texture.coordinatesMode !== BABYLON.Texture.CUBIC_MODE && texture.coordinatesMode !== BABYLON.Texture.SKYBOX_MODE) ? this._gl.REPEAT : this._gl.CLAMP_TO_EDGE;
  3984. this._gl.texParameteri(this._gl.TEXTURE_CUBE_MAP, this._gl.TEXTURE_WRAP_S, textureWrapMode);
  3985. this._gl.texParameteri(this._gl.TEXTURE_CUBE_MAP, this._gl.TEXTURE_WRAP_T, textureWrapMode);
  3986. }
  3987. this._setAnisotropicLevel(this._gl.TEXTURE_CUBE_MAP, texture);
  3988. } else {
  3989. this._gl.bindTexture(this._gl.TEXTURE_2D, internalTexture);
  3990. if (internalTexture._cachedWrapU !== texture.wrapU) {
  3991. internalTexture._cachedWrapU = texture.wrapU;
  3992. switch (texture.wrapU) {
  3993. case BABYLON.Texture.WRAP_ADDRESSMODE:
  3994. this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_WRAP_S, this._gl.REPEAT);
  3995. break;
  3996. case BABYLON.Texture.CLAMP_ADDRESSMODE:
  3997. this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_WRAP_S, this._gl.CLAMP_TO_EDGE);
  3998. break;
  3999. case BABYLON.Texture.MIRROR_ADDRESSMODE:
  4000. this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_WRAP_S, this._gl.MIRRORED_REPEAT);
  4001. break;
  4002. }
  4003. }
  4004. if (internalTexture._cachedWrapV !== texture.wrapV) {
  4005. internalTexture._cachedWrapV = texture.wrapV;
  4006. switch (texture.wrapV) {
  4007. case BABYLON.Texture.WRAP_ADDRESSMODE:
  4008. this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_WRAP_T, this._gl.REPEAT);
  4009. break;
  4010. case BABYLON.Texture.CLAMP_ADDRESSMODE:
  4011. this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_WRAP_T, this._gl.CLAMP_TO_EDGE);
  4012. break;
  4013. case BABYLON.Texture.MIRROR_ADDRESSMODE:
  4014. this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_WRAP_T, this._gl.MIRRORED_REPEAT);
  4015. break;
  4016. }
  4017. }
  4018. this._setAnisotropicLevel(this._gl.TEXTURE_2D, texture);
  4019. }
  4020. };
  4021. Engine.prototype._setAnisotropicLevel = function (key, texture) {
  4022. var anisotropicFilterExtension = this._caps.textureAnisotropicFilterExtension;
  4023. if (anisotropicFilterExtension && texture._cachedAnisotropicFilteringLevel !== texture.anisotropicFilteringLevel) {
  4024. this._gl.texParameterf(key, anisotropicFilterExtension.TEXTURE_MAX_ANISOTROPY_EXT, Math.min(texture.anisotropicFilteringLevel, this._caps.maxAnisotropy));
  4025. texture._cachedAnisotropicFilteringLevel = texture.anisotropicFilteringLevel;
  4026. }
  4027. };
  4028. Engine.prototype.readPixels = function (x, y, width, height) {
  4029. var data = new Uint8Array(height * width * 4);
  4030. this._gl.readPixels(0, 0, width, height, this._gl.RGBA, this._gl.UNSIGNED_BYTE, data);
  4031. return data;
  4032. };
  4033. Engine.prototype.dispose = function () {
  4034. this.hideLoadingUI();
  4035. this.stopRenderLoop();
  4036. while (this.scenes.length) {
  4037. this.scenes[0].dispose();
  4038. }
  4039. for (var name in this._compiledEffects) {
  4040. this._gl.deleteProgram(this._compiledEffects[name]._program);
  4041. }
  4042. for (var i in this._vertexAttribArrays) {
  4043. if (i > this._gl.VERTEX_ATTRIB_ARRAY_ENABLED || !this._vertexAttribArrays[i]) {
  4044. continue;
  4045. }
  4046. this._gl.disableVertexAttribArray(i);
  4047. }
  4048. window.removeEventListener("blur", this._onBlur);
  4049. window.removeEventListener("focus", this._onFocus);
  4050. document.removeEventListener("fullscreenchange", this._onFullscreenChange);
  4051. document.removeEventListener("mozfullscreenchange", this._onFullscreenChange);
  4052. document.removeEventListener("webkitfullscreenchange", this._onFullscreenChange);
  4053. document.removeEventListener("msfullscreenchange", this._onFullscreenChange);
  4054. document.removeEventListener("pointerlockchange", this._onPointerLockChange);
  4055. document.removeEventListener("mspointerlockchange", this._onPointerLockChange);
  4056. document.removeEventListener("mozpointerlockchange", this._onPointerLockChange);
  4057. document.removeEventListener("webkitpointerlockchange", this._onPointerLockChange);
  4058. };
  4059. Engine.prototype.displayLoadingUI = function () {
  4060. var _this = this;
  4061. this._loadingDiv = document.createElement("div");
  4062. this._loadingDiv.style.opacity = "0";
  4063. this._loadingDiv.style.transition = "opacity 1.5s ease";
  4064. this._loadingTextDiv = document.createElement("div");
  4065. this._loadingTextDiv.style.position = "absolute";
  4066. this._loadingTextDiv.style.left = "0";
  4067. this._loadingTextDiv.style.top = "50%";
  4068. this._loadingTextDiv.style.marginTop = "80px";
  4069. this._loadingTextDiv.style.width = "100%";
  4070. this._loadingTextDiv.style.height = "20px";
  4071. this._loadingTextDiv.style.fontFamily = "Arial";
  4072. this._loadingTextDiv.style.fontSize = "14px";
  4073. this._loadingTextDiv.style.color = "white";
  4074. this._loadingTextDiv.style.textAlign = "center";
  4075. this._loadingTextDiv.innerHTML = "Loading";
  4076. this._loadingDiv.appendChild(this._loadingTextDiv);
  4077. var imgBack = new Image();
  4078. imgBack.src = "data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAGQAAABkCAYAAABw4pVUAAAAAXNSR0IArs4c6QAAAARnQU1BAACxjwv8YQUAAAAJcEhZcwAADsMAAA7DAcdvqGQAAAAYdEVYdFNvZnR3YXJlAHBhaW50Lm5ldCA0LjAuM4zml1AAAARbSURBVHhe7Z09aFNRFMc716kuLrq4FdyLq4Wi4CAoRQcR0UJBUBdRiuLSIYMo6CA4FF2sgw6CFAdFUOpSQYcWO4hD26UQCfXrIQrx/JJzw1OSWq3NPeL/B4Fy+0jg/HO+7j3vpUcI8b/Q39+/49ihfWdPHT94Yf/e3Se3bd263f8lus218TPn6vV6Ya8Wi/MzNRNmj18iusX9W1evmP1/EKNEIVG6CMbG6E3bt+fT++pHha8NoHdT72bLE8NDg7tGU64gLLndV4Wc4m8j/pS+vr4tGB/DT16v3Fyr8dvBe/jbit8BL0AES9LX1iPAz+BR/hFiLVCynj95dPzNy6fv3IZ/k4L3948Sq7FzYGBg4vLFGxitabuOFCbWNKGrMnbiUuo18KaV6tIHv6YtvL9/nOgE31jCktmrY7k6+/zhE4yP4Vf7hiNqh/BWWEl8mzDol4p22Lf7cIdvdUMEvv0Y2S9fE5S1hLzpqTsPkiep//gFGPnR3Yl7GL5p/xYFBrTwM+iXio3GqpwDGL5p/xYNIX7XG8Q6IJRgdIzf1KBBgafII7oMidhyQtVFaMA2Bt7il4huQRhaXphbcR2g4RXqBzKAGHiCCwGFVUAj/m/RTRDj29cvn10I0PZ3LghH5f4CL1EFlQmqqXK3jDDKFxmhQ3Yt6oQseUZGKmMnTpsOqc8o1F9kBOMjQlOLeqEeIyOc6JV6jYLJD/+XyIFvnzdgl9aXRQ5I2qZDK1SpospMqaoqON/wZZGDciLnMMiXRS7IF4hhqMTNTdk7CFu+LHLhR7BQqBvPDJUUQqCGvCMATHUgBmhWNgApmdOda9YpM+VwRYfuyyIXDK8hBlilNerLIheMZCKGwlUAyru6GlwOgPUbRxADdJ9FAChxXY864viyyEXqPxhc0M2TAfAbatSdRyHtXymhByEdRnE3ky+JnHAIhSA0h74kckETmHoQbSgGwJrCIRMEPSRIBCRIMAhZaYhaggQhJXUJEoRU9mofKwh+F22dLRRfEjlJM7w6KQwCoQpBOKTyJZETjmwRxKqtGV8SOSkNOGjKPQppBEgDDkFgpxdBVGkFgaYQQXRIFQSObk0P5ZFIpAZRHXsQ0r0hCluBWKkuvVbYCkQaCdL5ehBScudJP4yY+rLISdps1NBDEJKXMMmoSfggWC4ZQRR17oFYXph7hSiquIKQ+hJGTX1J5MYSPD/GVdNzsgLBwZVCVyAQAkF0ohiI/c1fS6tNXq9UfEnkhudmIQolsS+J3Hh/UtNDzQLhj42VKJFInqLwFYiUU5ToA+HdfI0JevUpQUAIn+vSz2lHIuUV/dJOIHhOY/IWVWGBIHQtzs88s9zyWBuTgcBLzGOmeNnfF/QslSDgMeQW85i3DOQxuipxAkCyZ8SIm4Omp+7MMlCB59j6sKZcMoM4iIEoeI2J9AKxrFobZx0v4vYInuHFS4J1GQRCAGaLEYQXfyMML5XSQgghhBBCCCH+cXp6vgNhKpSKX/XdOAAAAABJRU5ErkJggg==";
  4079. imgBack.style.position = "absolute";
  4080. imgBack.style.left = "50%";
  4081. imgBack.style.top = "50%";
  4082. imgBack.style.marginLeft = "-50px";
  4083. imgBack.style.marginTop = "-50px";
  4084. imgBack.style.transition = "transform 1.0s ease";
  4085. imgBack.style.webkitTransition = "-webkit-transform 1.0s ease";
  4086. var deg = 360;
  4087. var onTransitionEnd = function () {
  4088. deg += 360;
  4089. imgBack.style.transform = "rotateZ(" + deg + "deg)";
  4090. imgBack.style.webkitTransform = "rotateZ(" + deg + "deg)";
  4091. };
  4092. imgBack.addEventListener("transitionend", onTransitionEnd);
  4093. imgBack.addEventListener("webkitTransitionEnd", onTransitionEnd);
  4094. this._loadingDiv.appendChild(imgBack);
  4095. var imgFront = new Image();
  4096. imgFront.src = "data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAGQAAABkCAYAAABw4pVUAAAAAXNSR0IArs4c6QAAAARnQU1BAACxjwv8YQUAAAAJcEhZcwAADsMAAA7DAcdvqGQAAAAYdEVYdFNvZnR3YXJlAHBhaW50Lm5ldCA0LjAuM4zml1AAAAYJSURBVHhe7Zy/qx1FFMff/2Av2Nvbi4WFiiAEY/OQ2IgQsbCJQoqkCAgpFLXyoZURLfwBIiIpgqZJoYQYlWelNsIrNOxDJcrzfHe+G97dnTl75u7euzv7zgcWHrlnZmfOmXPmzI/NjuM4juM4juM4juM4juM4juM4juM4juM45fPic08/uHf5/CvffH7lnT8PfrtxdHS0n3p+/fHGl5+89/prr5599iEWd8bg0rkXHoFyqehKnlxQpjYSDHTm9JMPsGrHylOPPXofvICKXMcIGtXdf/76AYbm6xyNW9e/eAtKC7rbKLXnvHHx5Sf4auc4Ek7OQkFU1Dap/vv37k/wSjblZANFiFIGzw98hhizwqBgs04mCBdQRNCHidoAEtY+lLIvtSdoGFeyql2ZH57HBH4sE7O+o/r9l+8/ZXUni68+2jsHBQQ9qNRGeP/tSxdSYQX/roUcpL4/f3vtM9TD+jTq92n1LQ7jxF1hhGPtwWL3gGccy8JuS1r8sVWBGXNVdSKMYjBGPUJjCzooiGuSpnwlnnOGP2dhHRSLNgpHp2oMKIriK8TmG4Qh/rwW8D6pps9b9im+LDDipXOqMVJrAngBfg9i98gevWKA+/nnCod3Dr5GfaHaDgidVym6HKRjGIkpqthcAVKGxNqBImbEo66kjCih8AOpNmkUmbMuUrR8kEqiU6FvHZLGAPJ71JCYSyhiBqmwFE2GoD6jLGIfDHtG6EzoU4dK21PCqIRMEF0FGRjFzGDtIkXVAdATvsqfT9CJ0JcOFdYiFIsiMlqYy1YOFpQo2OddqBtyEaq9y+efoVh5oPHoROjLKn0j3JIE5Ka8UqZRtGrMnneX6yVofOhDh94MSbznTcpqmDOt1vyQzOgaJAF4F3JBfIXesrNEGWWmjIX7UBZ6jRJbBMLg/DmJiKUGVHleIpnVNTa+jakzkAviJqLhi4MC9XQGBrZeKJZESSrKy7ik0VGFWhQBRDTHIACKQ5l9nAjy75gya4a2w+Jhs0FJdc0xX/GwUbAqFBkZi7QpJ2w16WUbjFyK9MJF3KaoEM74KhVtLrQOrsmRxkbdHEqmSC/c+EuGnIFkjW7Ih2Kr4CCMIvNG2hrrgLpCjiFloooYCjyYrzCRyvhyBthkIPuQtsZGdnbMTezyDiU71KTC5zr7aVsHbsz2tllrEkS5UHwU1tq1HbtPW4UbeB0O7xx8R5EsMJql+BheUmHjkNVmIRP7LutoM3+D4O4tG7vCkNO9ESZ4lL3J6rKRMPx4qKbD/A0icf8CG7tC7kTahnMTwleuYSrsS7GatRAvfZh1tTm5BmmQCdZ8a0Sefe28xUrRBkmFLKy8KTIKUDRX0Y1xagPgwbaIdeFnQULmKak3xvwNMkVGgok/N5XNoehJvejRlCDl9escI28dJU0tZ++nBTJE9mEF647x5Ehbo4s5hDOKFIU0PdofeA5F5k1q63zIWmQqNI/P3ZubjFTqKxQ3jyjHAOX0RdlgVO9hzRFpczRcjZ3Gbxxpc7Qj6+5pTYF2OFXawNI+yDGf1k2NcvOlzBQeDQ/t7zD7DsEDpJ2xATXaNtDWUS4IzP4DS2ljajAVu57SUkYw245ptxZxA5JiZaJ0DswudGn3kYUy54426EjoT4dZfYbccxC2nI92cDkZHQr96jD4AGkMDKeSy/COBsRe6VTSKFN6irLeaCh3IteQjt1E5+oudsG/b/2DfZ5AqsYo8vMDK9LB1HzSsLWvlGThdxXvC6+NsqyPPWP0pMINtbdsajfVeC6f/GZ+cdAofQoB1d+Hf9waY98I7+RXWab3Lt4zYkjHtTnlOLXHYMsCh1zWeQYehu1zfNPOOiys/d91LAKEBSgh6MJMbSA82AaHofDgAIwbgvVvlLNS11nModMm4UZergLHZBZrodmBuA3lBB1thdorSjkOmATMDwg/UBQVtglqQyx6fbEJ+H3IWIapjYAjAfeIgeCMHldueJvFaqDaAHhwf8qNsEEQ1iQbOoUUGIbCLRc8+Bvfp4jyd2FEijuO4ziO4ziO4ziO4ziO4ziO4ziO4ziOUzw7O/8D0P7rcZ/GEboAAAAASUVORK5CYII=";
  4097. imgFront.style.position = "absolute";
  4098. imgFront.style.left = "50%";
  4099. imgFront.style.top = "50%";
  4100. imgFront.style.marginLeft = "-50px";
  4101. imgFront.style.marginTop = "-50px";
  4102. this._loadingDiv.appendChild(imgFront);
  4103. this._resizeLoadingUI = function () {
  4104. var canvasRect = _this.getRenderingCanvasClientRect();
  4105. _this._loadingDiv.style.position = "absolute";
  4106. _this._loadingDiv.style.left = canvasRect.left + "px";
  4107. _this._loadingDiv.style.top = canvasRect.top + "px";
  4108. _this._loadingDiv.style.width = canvasRect.width + "px";
  4109. _this._loadingDiv.style.height = canvasRect.height + "px";
  4110. };
  4111. this._resizeLoadingUI();
  4112. window.addEventListener("resize", this._resizeLoadingUI);
  4113. this._loadingDiv.style.backgroundColor = this._loadingDivBackgroundColor;
  4114. document.body.appendChild(this._loadingDiv);
  4115. setTimeout(function () {
  4116. _this._loadingDiv.style.opacity = "1";
  4117. imgBack.style.transform = "rotateZ(360deg)";
  4118. imgBack.style.webkitTransform = "rotateZ(360deg)";
  4119. }, 0);
  4120. };
  4121. Object.defineProperty(Engine.prototype, "loadingUIText", {
  4122. set: function (text) {
  4123. if (!this._loadingDiv) {
  4124. return;
  4125. }
  4126. this._loadingTextDiv.innerHTML = text;
  4127. },
  4128. enumerable: true,
  4129. configurable: true
  4130. });
  4131. Object.defineProperty(Engine.prototype, "loadingUIBackgroundColor", {
  4132. get: function () {
  4133. return this._loadingDivBackgroundColor;
  4134. },
  4135. set: function (color) {
  4136. this._loadingDivBackgroundColor = color;
  4137. if (!this._loadingDiv) {
  4138. return;
  4139. }
  4140. this._loadingDiv.style.backgroundColor = this._loadingDivBackgroundColor;
  4141. },
  4142. enumerable: true,
  4143. configurable: true
  4144. });
  4145. Engine.prototype.hideLoadingUI = function () {
  4146. var _this = this;
  4147. if (!this._loadingDiv) {
  4148. return;
  4149. }
  4150. var onTransitionEnd = function () {
  4151. if (!_this._loadingDiv) {
  4152. return;
  4153. }
  4154. document.body.removeChild(_this._loadingDiv);
  4155. window.removeEventListener("resize", _this._resizeLoadingUI);
  4156. _this._loadingDiv = null;
  4157. };
  4158. this._loadingDiv.style.opacity = "0";
  4159. this._loadingDiv.addEventListener("transitionend", onTransitionEnd);
  4160. };
  4161. Engine.isSupported = function () {
  4162. try {
  4163. if (navigator.isCocoonJS) {
  4164. return true;
  4165. }
  4166. var tempcanvas = document.createElement("canvas");
  4167. var gl = tempcanvas.getContext("webgl") || tempcanvas.getContext("experimental-webgl");
  4168. return gl != null && !!window.WebGLRenderingContext;
  4169. } catch (e) {
  4170. return false;
  4171. }
  4172. };
  4173. Engine._ALPHA_DISABLE = 0;
  4174. Engine._ALPHA_ADD = 1;
  4175. Engine._ALPHA_COMBINE = 2;
  4176. Engine._DELAYLOADSTATE_NONE = 0;
  4177. Engine._DELAYLOADSTATE_LOADED = 1;
  4178. Engine._DELAYLOADSTATE_LOADING = 2;
  4179. Engine._DELAYLOADSTATE_NOTLOADED = 4;
  4180. Engine.Epsilon = 0.001;
  4181. Engine.CollisionsEpsilon = 0.001;
  4182. Engine.ShadersRepository = "Babylon/Shaders/";
  4183. return Engine;
  4184. })();
  4185. BABYLON.Engine = Engine;
  4186. })(BABYLON || (BABYLON = {}));
  4187. var BABYLON;
  4188. (function (BABYLON) {
  4189. var Node = (function () {
  4190. function Node(name, scene) {
  4191. this.state = "";
  4192. this.animations = new Array();
  4193. this._childrenFlag = -1;
  4194. this._isEnabled = true;
  4195. this._isReady = true;
  4196. this._currentRenderId = -1;
  4197. this.name = name;
  4198. this.id = name;
  4199. this._scene = scene;
  4200. this._initCache();
  4201. }
  4202. Node.prototype.getScene = function () {
  4203. return this._scene;
  4204. };
  4205. Node.prototype.getEngine = function () {
  4206. return this._scene.getEngine();
  4207. };
  4208. Node.prototype.getWorldMatrix = function () {
  4209. return BABYLON.Matrix.Identity();
  4210. };
  4211. Node.prototype._initCache = function () {
  4212. this._cache = {};
  4213. this._cache.parent = undefined;
  4214. };
  4215. Node.prototype.updateCache = function (force) {
  4216. if (!force && this.isSynchronized())
  4217. return;
  4218. this._cache.parent = this.parent;
  4219. this._updateCache();
  4220. };
  4221. Node.prototype._updateCache = function (ignoreParentClass) {
  4222. };
  4223. Node.prototype._isSynchronized = function () {
  4224. return true;
  4225. };
  4226. Node.prototype.isSynchronizedWithParent = function () {
  4227. return this.parent ? this.parent._currentRenderId <= this._currentRenderId : true;
  4228. };
  4229. Node.prototype.isSynchronized = function (updateCache) {
  4230. var check = this.hasNewParent();
  4231. check = check || !this.isSynchronizedWithParent();
  4232. check = check || !this._isSynchronized();
  4233. if (updateCache)
  4234. this.updateCache(true);
  4235. return !check;
  4236. };
  4237. Node.prototype.hasNewParent = function (update) {
  4238. if (this._cache.parent === this.parent)
  4239. return false;
  4240. if (update)
  4241. this._cache.parent = this.parent;
  4242. return true;
  4243. };
  4244. Node.prototype.isReady = function () {
  4245. return this._isReady;
  4246. };
  4247. Node.prototype.isEnabled = function () {
  4248. if (!this._isEnabled) {
  4249. return false;
  4250. }
  4251. if (this.parent) {
  4252. return this.parent.isEnabled();
  4253. }
  4254. return true;
  4255. };
  4256. Node.prototype.setEnabled = function (value) {
  4257. this._isEnabled = value;
  4258. };
  4259. Node.prototype.isDescendantOf = function (ancestor) {
  4260. if (this.parent) {
  4261. if (this.parent === ancestor) {
  4262. return true;
  4263. }
  4264. return this.parent.isDescendantOf(ancestor);
  4265. }
  4266. return false;
  4267. };
  4268. Node.prototype._getDescendants = function (list, results) {
  4269. for (var index = 0; index < list.length; index++) {
  4270. var item = list[index];
  4271. if (item.isDescendantOf(this)) {
  4272. results.push(item);
  4273. }
  4274. }
  4275. };
  4276. Node.prototype.getDescendants = function () {
  4277. var results = [];
  4278. this._getDescendants(this._scene.meshes, results);
  4279. this._getDescendants(this._scene.lights, results);
  4280. this._getDescendants(this._scene.cameras, results);
  4281. return results;
  4282. };
  4283. Node.prototype._setReady = function (state) {
  4284. if (state == this._isReady) {
  4285. return;
  4286. }
  4287. if (!state) {
  4288. this._isReady = false;
  4289. return;
  4290. }
  4291. this._isReady = true;
  4292. if (this.onReady) {
  4293. this.onReady(this);
  4294. }
  4295. };
  4296. return Node;
  4297. })();
  4298. BABYLON.Node = Node;
  4299. })(BABYLON || (BABYLON = {}));
  4300. var BABYLON;
  4301. (function (BABYLON) {
  4302. var BoundingSphere = (function () {
  4303. function BoundingSphere(minimum, maximum) {
  4304. this.minimum = minimum;
  4305. this.maximum = maximum;
  4306. this._tempRadiusVector = BABYLON.Vector3.Zero();
  4307. var distance = BABYLON.Vector3.Distance(minimum, maximum);
  4308. this.center = BABYLON.Vector3.Lerp(minimum, maximum, 0.5);
  4309. this.radius = distance * 0.5;
  4310. this.centerWorld = BABYLON.Vector3.Zero();
  4311. this._update(BABYLON.Matrix.Identity());
  4312. }
  4313. BoundingSphere.prototype._update = function (world) {
  4314. BABYLON.Vector3.TransformCoordinatesToRef(this.center, world, this.centerWorld);
  4315. BABYLON.Vector3.TransformNormalFromFloatsToRef(1.0, 1.0, 1.0, world, this._tempRadiusVector);
  4316. this.radiusWorld = Math.max(Math.abs(this._tempRadiusVector.x), Math.abs(this._tempRadiusVector.y), Math.abs(this._tempRadiusVector.z)) * this.radius;
  4317. };
  4318. BoundingSphere.prototype.isInFrustum = function (frustumPlanes) {
  4319. for (var i = 0; i < 6; i++) {
  4320. if (frustumPlanes[i].dotCoordinate(this.centerWorld) <= -this.radiusWorld)
  4321. return false;
  4322. }
  4323. return true;
  4324. };
  4325. BoundingSphere.prototype.intersectsPoint = function (point) {
  4326. var x = this.centerWorld.x - point.x;
  4327. var y = this.centerWorld.y - point.y;
  4328. var z = this.centerWorld.z - point.z;
  4329. var distance = Math.sqrt((x * x) + (y * y) + (z * z));
  4330. if (Math.abs(this.radiusWorld - distance) < BABYLON.Engine.Epsilon)
  4331. return false;
  4332. return true;
  4333. };
  4334. BoundingSphere.Intersects = function (sphere0, sphere1) {
  4335. var x = sphere0.centerWorld.x - sphere1.centerWorld.x;
  4336. var y = sphere0.centerWorld.y - sphere1.centerWorld.y;
  4337. var z = sphere0.centerWorld.z - sphere1.centerWorld.z;
  4338. var distance = Math.sqrt((x * x) + (y * y) + (z * z));
  4339. if (sphere0.radiusWorld + sphere1.radiusWorld < distance)
  4340. return false;
  4341. return true;
  4342. };
  4343. return BoundingSphere;
  4344. })();
  4345. BABYLON.BoundingSphere = BoundingSphere;
  4346. })(BABYLON || (BABYLON = {}));
  4347. var BABYLON;
  4348. (function (BABYLON) {
  4349. var BoundingBox = (function () {
  4350. function BoundingBox(minimum, maximum) {
  4351. this.minimum = minimum;
  4352. this.maximum = maximum;
  4353. this.vectors = new Array();
  4354. this.vectorsWorld = new Array();
  4355. this.vectors.push(this.minimum.clone());
  4356. this.vectors.push(this.maximum.clone());
  4357. this.vectors.push(this.minimum.clone());
  4358. this.vectors[2].x = this.maximum.x;
  4359. this.vectors.push(this.minimum.clone());
  4360. this.vectors[3].y = this.maximum.y;
  4361. this.vectors.push(this.minimum.clone());
  4362. this.vectors[4].z = this.maximum.z;
  4363. this.vectors.push(this.maximum.clone());
  4364. this.vectors[5].z = this.minimum.z;
  4365. this.vectors.push(this.maximum.clone());
  4366. this.vectors[6].x = this.minimum.x;
  4367. this.vectors.push(this.maximum.clone());
  4368. this.vectors[7].y = this.minimum.y;
  4369. this.center = this.maximum.add(this.minimum).scale(0.5);
  4370. this.extendSize = this.maximum.subtract(this.minimum).scale(0.5);
  4371. this.directions = [BABYLON.Vector3.Zero(), BABYLON.Vector3.Zero(), BABYLON.Vector3.Zero()];
  4372. for (var index = 0; index < this.vectors.length; index++) {
  4373. this.vectorsWorld[index] = BABYLON.Vector3.Zero();
  4374. }
  4375. this.minimumWorld = BABYLON.Vector3.Zero();
  4376. this.maximumWorld = BABYLON.Vector3.Zero();
  4377. this._update(BABYLON.Matrix.Identity());
  4378. }
  4379. BoundingBox.prototype.getWorldMatrix = function () {
  4380. return this._worldMatrix;
  4381. };
  4382. BoundingBox.prototype._update = function (world) {
  4383. BABYLON.Vector3.FromFloatsToRef(Number.MAX_VALUE, Number.MAX_VALUE, Number.MAX_VALUE, this.minimumWorld);
  4384. BABYLON.Vector3.FromFloatsToRef(-Number.MAX_VALUE, -Number.MAX_VALUE, -Number.MAX_VALUE, this.maximumWorld);
  4385. for (var index = 0; index < this.vectors.length; index++) {
  4386. var v = this.vectorsWorld[index];
  4387. BABYLON.Vector3.TransformCoordinatesToRef(this.vectors[index], world, v);
  4388. if (v.x < this.minimumWorld.x)
  4389. this.minimumWorld.x = v.x;
  4390. if (v.y < this.minimumWorld.y)
  4391. this.minimumWorld.y = v.y;
  4392. if (v.z < this.minimumWorld.z)
  4393. this.minimumWorld.z = v.z;
  4394. if (v.x > this.maximumWorld.x)
  4395. this.maximumWorld.x = v.x;
  4396. if (v.y > this.maximumWorld.y)
  4397. this.maximumWorld.y = v.y;
  4398. if (v.z > this.maximumWorld.z)
  4399. this.maximumWorld.z = v.z;
  4400. }
  4401. this.maximumWorld.addToRef(this.minimumWorld, this.center);
  4402. this.center.scaleInPlace(0.5);
  4403. BABYLON.Vector3.FromFloatArrayToRef(world.m, 0, this.directions[0]);
  4404. BABYLON.Vector3.FromFloatArrayToRef(world.m, 4, this.directions[1]);
  4405. BABYLON.Vector3.FromFloatArrayToRef(world.m, 8, this.directions[2]);
  4406. this._worldMatrix = world;
  4407. };
  4408. BoundingBox.prototype.isInFrustum = function (frustumPlanes) {
  4409. return BoundingBox.IsInFrustum(this.vectorsWorld, frustumPlanes);
  4410. };
  4411. BoundingBox.prototype.isCompletelyInFrustum = function (frustumPlanes) {
  4412. return BoundingBox.IsCompletelyInFrustum(this.vectorsWorld, frustumPlanes);
  4413. };
  4414. BoundingBox.prototype.intersectsPoint = function (point) {
  4415. var delta = BABYLON.Engine.Epsilon;
  4416. if (this.maximumWorld.x - point.x < delta || delta > point.x - this.minimumWorld.x)
  4417. return false;
  4418. if (this.maximumWorld.y - point.y < delta || delta > point.y - this.minimumWorld.y)
  4419. return false;
  4420. if (this.maximumWorld.z - point.z < delta || delta > point.z - this.minimumWorld.z)
  4421. return false;
  4422. return true;
  4423. };
  4424. BoundingBox.prototype.intersectsSphere = function (sphere) {
  4425. return BoundingBox.IntersectsSphere(this.minimumWorld, this.maximumWorld, sphere.centerWorld, sphere.radiusWorld);
  4426. };
  4427. BoundingBox.prototype.intersectsMinMax = function (min, max) {
  4428. if (this.maximumWorld.x < min.x || this.minimumWorld.x > max.x)
  4429. return false;
  4430. if (this.maximumWorld.y < min.y || this.minimumWorld.y > max.y)
  4431. return false;
  4432. if (this.maximumWorld.z < min.z || this.minimumWorld.z > max.z)
  4433. return false;
  4434. return true;
  4435. };
  4436. BoundingBox.Intersects = function (box0, box1) {
  4437. if (box0.maximumWorld.x < box1.minimumWorld.x || box0.minimumWorld.x > box1.maximumWorld.x)
  4438. return false;
  4439. if (box0.maximumWorld.y < box1.minimumWorld.y || box0.minimumWorld.y > box1.maximumWorld.y)
  4440. return false;
  4441. if (box0.maximumWorld.z < box1.minimumWorld.z || box0.minimumWorld.z > box1.maximumWorld.z)
  4442. return false;
  4443. return true;
  4444. };
  4445. BoundingBox.IntersectsSphere = function (minPoint, maxPoint, sphereCenter, sphereRadius) {
  4446. var vector = BABYLON.Vector3.Clamp(sphereCenter, minPoint, maxPoint);
  4447. var num = BABYLON.Vector3.DistanceSquared(sphereCenter, vector);
  4448. return (num <= (sphereRadius * sphereRadius));
  4449. };
  4450. BoundingBox.IsCompletelyInFrustum = function (boundingVectors, frustumPlanes) {
  4451. for (var p = 0; p < 6; p++) {
  4452. for (var i = 0; i < 8; i++) {
  4453. if (frustumPlanes[p].dotCoordinate(boundingVectors[i]) < 0) {
  4454. return false;
  4455. }
  4456. }
  4457. }
  4458. return true;
  4459. };
  4460. BoundingBox.IsInFrustum = function (boundingVectors, frustumPlanes) {
  4461. for (var p = 0; p < 6; p++) {
  4462. var inCount = 8;
  4463. for (var i = 0; i < 8; i++) {
  4464. if (frustumPlanes[p].dotCoordinate(boundingVectors[i]) < 0) {
  4465. --inCount;
  4466. } else {
  4467. break;
  4468. }
  4469. }
  4470. if (inCount == 0)
  4471. return false;
  4472. }
  4473. return true;
  4474. };
  4475. return BoundingBox;
  4476. })();
  4477. BABYLON.BoundingBox = BoundingBox;
  4478. })(BABYLON || (BABYLON = {}));
  4479. var BABYLON;
  4480. (function (BABYLON) {
  4481. var computeBoxExtents = function (axis, box) {
  4482. var p = BABYLON.Vector3.Dot(box.center, axis);
  4483. var r0 = Math.abs(BABYLON.Vector3.Dot(box.directions[0], axis)) * box.extendSize.x;
  4484. var r1 = Math.abs(BABYLON.Vector3.Dot(box.directions[1], axis)) * box.extendSize.y;
  4485. var r2 = Math.abs(BABYLON.Vector3.Dot(box.directions[2], axis)) * box.extendSize.z;
  4486. var r = r0 + r1 + r2;
  4487. return {
  4488. min: p - r,
  4489. max: p + r
  4490. };
  4491. };
  4492. var extentsOverlap = function (min0, max0, min1, max1) {
  4493. return !(min0 > max1 || min1 > max0);
  4494. };
  4495. var axisOverlap = function (axis, box0, box1) {
  4496. var result0 = computeBoxExtents(axis, box0);
  4497. var result1 = computeBoxExtents(axis, box1);
  4498. return extentsOverlap(result0.min, result0.max, result1.min, result1.max);
  4499. };
  4500. var BoundingInfo = (function () {
  4501. function BoundingInfo(minimum, maximum) {
  4502. this.minimum = minimum;
  4503. this.maximum = maximum;
  4504. this.boundingBox = new BABYLON.BoundingBox(minimum, maximum);
  4505. this.boundingSphere = new BABYLON.BoundingSphere(minimum, maximum);
  4506. }
  4507. BoundingInfo.prototype._update = function (world) {
  4508. this.boundingBox._update(world);
  4509. this.boundingSphere._update(world);
  4510. };
  4511. BoundingInfo.prototype.isInFrustum = function (frustumPlanes) {
  4512. if (!this.boundingSphere.isInFrustum(frustumPlanes))
  4513. return false;
  4514. return this.boundingBox.isInFrustum(frustumPlanes);
  4515. };
  4516. BoundingInfo.prototype.isCompletelyInFrustum = function (frustumPlanes) {
  4517. return this.boundingBox.isCompletelyInFrustum(frustumPlanes);
  4518. };
  4519. BoundingInfo.prototype._checkCollision = function (collider) {
  4520. return collider._canDoCollision(this.boundingSphere.centerWorld, this.boundingSphere.radiusWorld, this.boundingBox.minimumWorld, this.boundingBox.maximumWorld);
  4521. };
  4522. BoundingInfo.prototype.intersectsPoint = function (point) {
  4523. if (!this.boundingSphere.centerWorld) {
  4524. return false;
  4525. }
  4526. if (!this.boundingSphere.intersectsPoint(point)) {
  4527. return false;
  4528. }
  4529. if (!this.boundingBox.intersectsPoint(point)) {
  4530. return false;
  4531. }
  4532. return true;
  4533. };
  4534. BoundingInfo.prototype.intersects = function (boundingInfo, precise) {
  4535. if (!this.boundingSphere.centerWorld || !boundingInfo.boundingSphere.centerWorld) {
  4536. return false;
  4537. }
  4538. if (!BABYLON.BoundingSphere.Intersects(this.boundingSphere, boundingInfo.boundingSphere)) {
  4539. return false;
  4540. }
  4541. if (!BABYLON.BoundingBox.Intersects(this.boundingBox, boundingInfo.boundingBox)) {
  4542. return false;
  4543. }
  4544. if (!precise) {
  4545. return true;
  4546. }
  4547. var box0 = this.boundingBox;
  4548. var box1 = boundingInfo.boundingBox;
  4549. if (!axisOverlap(box0.directions[0], box0, box1))
  4550. return false;
  4551. if (!axisOverlap(box0.directions[1], box0, box1))
  4552. return false;
  4553. if (!axisOverlap(box0.directions[2], box0, box1))
  4554. return false;
  4555. if (!axisOverlap(box1.directions[0], box0, box1))
  4556. return false;
  4557. if (!axisOverlap(box1.directions[1], box0, box1))
  4558. return false;
  4559. if (!axisOverlap(box1.directions[2], box0, box1))
  4560. return false;
  4561. if (!axisOverlap(BABYLON.Vector3.Cross(box0.directions[0], box1.directions[0]), box0, box1))
  4562. return false;
  4563. if (!axisOverlap(BABYLON.Vector3.Cross(box0.directions[0], box1.directions[1]), box0, box1))
  4564. return false;
  4565. if (!axisOverlap(BABYLON.Vector3.Cross(box0.directions[0], box1.directions[2]), box0, box1))
  4566. return false;
  4567. if (!axisOverlap(BABYLON.Vector3.Cross(box0.directions[1], box1.directions[0]), box0, box1))
  4568. return false;
  4569. if (!axisOverlap(BABYLON.Vector3.Cross(box0.directions[1], box1.directions[1]), box0, box1))
  4570. return false;
  4571. if (!axisOverlap(BABYLON.Vector3.Cross(box0.directions[1], box1.directions[2]), box0, box1))
  4572. return false;
  4573. if (!axisOverlap(BABYLON.Vector3.Cross(box0.directions[2], box1.directions[0]), box0, box1))
  4574. return false;
  4575. if (!axisOverlap(BABYLON.Vector3.Cross(box0.directions[2], box1.directions[1]), box0, box1))
  4576. return false;
  4577. if (!axisOverlap(BABYLON.Vector3.Cross(box0.directions[2], box1.directions[2]), box0, box1))
  4578. return false;
  4579. return true;
  4580. };
  4581. return BoundingInfo;
  4582. })();
  4583. BABYLON.BoundingInfo = BoundingInfo;
  4584. })(BABYLON || (BABYLON = {}));
  4585. var __extends = this.__extends || function (d, b) {
  4586. for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p];
  4587. function __() { this.constructor = d; }
  4588. __.prototype = b.prototype;
  4589. d.prototype = new __();
  4590. };
  4591. var BABYLON;
  4592. (function (BABYLON) {
  4593. var Light = (function (_super) {
  4594. __extends(Light, _super);
  4595. function Light(name, scene) {
  4596. _super.call(this, name, scene);
  4597. this.diffuse = new BABYLON.Color3(1.0, 1.0, 1.0);
  4598. this.specular = new BABYLON.Color3(1.0, 1.0, 1.0);
  4599. this.intensity = 1.0;
  4600. this.range = Number.MAX_VALUE;
  4601. this.includedOnlyMeshes = new Array();
  4602. this.excludedMeshes = new Array();
  4603. this._excludedMeshesIds = new Array();
  4604. this._includedOnlyMeshesIds = new Array();
  4605. scene.lights.push(this);
  4606. }
  4607. Light.prototype.getShadowGenerator = function () {
  4608. return this._shadowGenerator;
  4609. };
  4610. Light.prototype.transferToEffect = function (effect, uniformName0, uniformName1) {
  4611. };
  4612. Light.prototype._getWorldMatrix = function () {
  4613. return BABYLON.Matrix.Identity();
  4614. };
  4615. Light.prototype.canAffectMesh = function (mesh) {
  4616. if (!mesh) {
  4617. return true;
  4618. }
  4619. if (this.includedOnlyMeshes.length > 0 && this.includedOnlyMeshes.indexOf(mesh) === -1) {
  4620. return false;
  4621. }
  4622. if (this.excludedMeshes.length > 0 && this.excludedMeshes.indexOf(mesh) !== -1) {
  4623. return false;
  4624. }
  4625. return true;
  4626. };
  4627. Light.prototype.getWorldMatrix = function () {
  4628. this._currentRenderId = this.getScene().getRenderId();
  4629. var worldMatrix = this._getWorldMatrix();
  4630. if (this.parent && this.parent.getWorldMatrix) {
  4631. if (!this._parentedWorldMatrix) {
  4632. this._parentedWorldMatrix = BABYLON.Matrix.Identity();
  4633. }
  4634. worldMatrix.multiplyToRef(this.parent.getWorldMatrix(), this._parentedWorldMatrix);
  4635. return this._parentedWorldMatrix;
  4636. }
  4637. return worldMatrix;
  4638. };
  4639. Light.prototype.dispose = function () {
  4640. if (this._shadowGenerator) {
  4641. this._shadowGenerator.dispose();
  4642. this._shadowGenerator = null;
  4643. }
  4644. var index = this.getScene().lights.indexOf(this);
  4645. this.getScene().lights.splice(index, 1);
  4646. };
  4647. return Light;
  4648. })(BABYLON.Node);
  4649. BABYLON.Light = Light;
  4650. })(BABYLON || (BABYLON = {}));
  4651. var __extends = this.__extends || function (d, b) {
  4652. for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p];
  4653. function __() { this.constructor = d; }
  4654. __.prototype = b.prototype;
  4655. d.prototype = new __();
  4656. };
  4657. var BABYLON;
  4658. (function (BABYLON) {
  4659. var PointLight = (function (_super) {
  4660. __extends(PointLight, _super);
  4661. function PointLight(name, position, scene) {
  4662. _super.call(this, name, scene);
  4663. this.position = position;
  4664. }
  4665. PointLight.prototype.transferToEffect = function (effect, positionUniformName) {
  4666. if (this.parent && this.parent.getWorldMatrix) {
  4667. if (!this._transformedPosition) {
  4668. this._transformedPosition = BABYLON.Vector3.Zero();
  4669. }
  4670. BABYLON.Vector3.TransformCoordinatesToRef(this.position, this.parent.getWorldMatrix(), this._transformedPosition);
  4671. effect.setFloat4(positionUniformName, this._transformedPosition.x, this._transformedPosition.y, this._transformedPosition.z, 0);
  4672. return;
  4673. }
  4674. effect.setFloat4(positionUniformName, this.position.x, this.position.y, this.position.z, 0);
  4675. };
  4676. PointLight.prototype.getShadowGenerator = function () {
  4677. return null;
  4678. };
  4679. PointLight.prototype._getWorldMatrix = function () {
  4680. if (!this._worldMatrix) {
  4681. this._worldMatrix = BABYLON.Matrix.Identity();
  4682. }
  4683. BABYLON.Matrix.TranslationToRef(this.position.x, this.position.y, this.position.z, this._worldMatrix);
  4684. return this._worldMatrix;
  4685. };
  4686. return PointLight;
  4687. })(BABYLON.Light);
  4688. BABYLON.PointLight = PointLight;
  4689. })(BABYLON || (BABYLON = {}));
  4690. var __extends = this.__extends || function (d, b) {
  4691. for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p];
  4692. function __() { this.constructor = d; }
  4693. __.prototype = b.prototype;
  4694. d.prototype = new __();
  4695. };
  4696. var BABYLON;
  4697. (function (BABYLON) {
  4698. var SpotLight = (function (_super) {
  4699. __extends(SpotLight, _super);
  4700. function SpotLight(name, position, direction, angle, exponent, scene) {
  4701. _super.call(this, name, scene);
  4702. this.position = position;
  4703. this.direction = direction;
  4704. this.angle = angle;
  4705. this.exponent = exponent;
  4706. }
  4707. SpotLight.prototype.setDirectionToTarget = function (target) {
  4708. this.direction = BABYLON.Vector3.Normalize(target.subtract(this.position));
  4709. return this.direction;
  4710. };
  4711. SpotLight.prototype.transferToEffect = function (effect, positionUniformName, directionUniformName) {
  4712. var normalizeDirection;
  4713. if (this.parent && this.parent.getWorldMatrix) {
  4714. if (!this._transformedDirection) {
  4715. this._transformedDirection = BABYLON.Vector3.Zero();
  4716. }
  4717. if (!this._transformedPosition) {
  4718. this._transformedPosition = BABYLON.Vector3.Zero();
  4719. }
  4720. var parentWorldMatrix = this.parent.getWorldMatrix();
  4721. BABYLON.Vector3.TransformCoordinatesToRef(this.position, parentWorldMatrix, this._transformedPosition);
  4722. BABYLON.Vector3.TransformNormalToRef(this.direction, parentWorldMatrix, this._transformedDirection);
  4723. effect.setFloat4(positionUniformName, this._transformedPosition.x, this._transformedPosition.y, this._transformedPosition.z, this.exponent);
  4724. normalizeDirection = BABYLON.Vector3.Normalize(this._transformedDirection);
  4725. } else {
  4726. effect.setFloat4(positionUniformName, this.position.x, this.position.y, this.position.z, this.exponent);
  4727. normalizeDirection = BABYLON.Vector3.Normalize(this.direction);
  4728. }
  4729. effect.setFloat4(directionUniformName, normalizeDirection.x, normalizeDirection.y, normalizeDirection.z, Math.cos(this.angle * 0.5));
  4730. };
  4731. SpotLight.prototype._getWorldMatrix = function () {
  4732. if (!this._worldMatrix) {
  4733. this._worldMatrix = BABYLON.Matrix.Identity();
  4734. }
  4735. BABYLON.Matrix.TranslationToRef(this.position.x, this.position.y, this.position.z, this._worldMatrix);
  4736. return this._worldMatrix;
  4737. };
  4738. return SpotLight;
  4739. })(BABYLON.Light);
  4740. BABYLON.SpotLight = SpotLight;
  4741. })(BABYLON || (BABYLON = {}));
  4742. var __extends = this.__extends || function (d, b) {
  4743. for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p];
  4744. function __() { this.constructor = d; }
  4745. __.prototype = b.prototype;
  4746. d.prototype = new __();
  4747. };
  4748. var BABYLON;
  4749. (function (BABYLON) {
  4750. var DirectionalLight = (function (_super) {
  4751. __extends(DirectionalLight, _super);
  4752. function DirectionalLight(name, direction, scene) {
  4753. _super.call(this, name, scene);
  4754. this.direction = direction;
  4755. this.position = direction.scale(-1);
  4756. }
  4757. DirectionalLight.prototype.setDirectionToTarget = function (target) {
  4758. this.direction = BABYLON.Vector3.Normalize(target.subtract(this.position));
  4759. return this.direction;
  4760. };
  4761. DirectionalLight.prototype._computeTransformedPosition = function () {
  4762. if (this.parent && this.parent.getWorldMatrix) {
  4763. if (!this._transformedPosition) {
  4764. this._transformedPosition = BABYLON.Vector3.Zero();
  4765. }
  4766. BABYLON.Vector3.TransformCoordinatesToRef(this.position, this.parent.getWorldMatrix(), this._transformedPosition);
  4767. return true;
  4768. }
  4769. return false;
  4770. };
  4771. DirectionalLight.prototype.transferToEffect = function (effect, directionUniformName) {
  4772. if (this.parent && this.parent.getWorldMatrix) {
  4773. if (!this._transformedDirection) {
  4774. this._transformedDirection = BABYLON.Vector3.Zero();
  4775. }
  4776. BABYLON.Vector3.TransformNormalToRef(this.direction, this.parent.getWorldMatrix(), this._transformedDirection);
  4777. effect.setFloat4(directionUniformName, this._transformedDirection.x, this._transformedDirection.y, this._transformedDirection.z, 1);
  4778. return;
  4779. }
  4780. effect.setFloat4(directionUniformName, this.direction.x, this.direction.y, this.direction.z, 1);
  4781. };
  4782. DirectionalLight.prototype._getWorldMatrix = function () {
  4783. if (!this._worldMatrix) {
  4784. this._worldMatrix = BABYLON.Matrix.Identity();
  4785. }
  4786. BABYLON.Matrix.TranslationToRef(this.position.x, this.position.y, this.position.z, this._worldMatrix);
  4787. return this._worldMatrix;
  4788. };
  4789. return DirectionalLight;
  4790. })(BABYLON.Light);
  4791. BABYLON.DirectionalLight = DirectionalLight;
  4792. })(BABYLON || (BABYLON = {}));
  4793. var BABYLON;
  4794. (function (BABYLON) {
  4795. var ShadowGenerator = (function () {
  4796. function ShadowGenerator(mapSize, light) {
  4797. var _this = this;
  4798. this.filter = ShadowGenerator.FILTER_VARIANCESHADOWMAP;
  4799. this._darkness = 0;
  4800. this._transparencyShadow = false;
  4801. this._viewMatrix = BABYLON.Matrix.Zero();
  4802. this._projectionMatrix = BABYLON.Matrix.Zero();
  4803. this._transformMatrix = BABYLON.Matrix.Zero();
  4804. this._worldViewProjection = BABYLON.Matrix.Zero();
  4805. this._light = light;
  4806. this._scene = light.getScene();
  4807. light._shadowGenerator = this;
  4808. this._shadowMap = new BABYLON.RenderTargetTexture(light.name + "_shadowMap", mapSize, this._scene, false);
  4809. this._shadowMap.wrapU = BABYLON.Texture.CLAMP_ADDRESSMODE;
  4810. this._shadowMap.wrapV = BABYLON.Texture.CLAMP_ADDRESSMODE;
  4811. this._shadowMap.renderParticles = false;
  4812. var renderSubMesh = function (subMesh) {
  4813. var mesh = subMesh.getRenderingMesh();
  4814. var scene = _this._scene;
  4815. var engine = scene.getEngine();
  4816. engine.setState(subMesh.getMaterial().backFaceCulling);
  4817. var batch = mesh._getInstancesRenderList(subMesh._id);
  4818. if (batch.mustReturn) {
  4819. return;
  4820. }
  4821. var hardwareInstancedRendering = (engine.getCaps().instancedArrays !== null) && (batch.visibleInstances[subMesh._id] !== null);
  4822. if (_this.isReady(subMesh, hardwareInstancedRendering)) {
  4823. engine.enableEffect(_this._effect);
  4824. mesh._bind(subMesh, _this._effect, BABYLON.Material.TriangleFillMode);
  4825. var material = subMesh.getMaterial();
  4826. _this._effect.setMatrix("viewProjection", _this.getTransformMatrix());
  4827. if (material && material.needAlphaTesting()) {
  4828. var alphaTexture = material.getAlphaTestTexture();
  4829. _this._effect.setTexture("diffuseSampler", alphaTexture);
  4830. _this._effect.setMatrix("diffuseMatrix", alphaTexture.getTextureMatrix());
  4831. }
  4832. var useBones = mesh.skeleton && mesh.isVerticesDataPresent(BABYLON.VertexBuffer.MatricesIndicesKind) && mesh.isVerticesDataPresent(BABYLON.VertexBuffer.MatricesWeightsKind);
  4833. if (useBones) {
  4834. _this._effect.setMatrices("mBones", mesh.skeleton.getTransformMatrices());
  4835. }
  4836. if (hardwareInstancedRendering) {
  4837. mesh._renderWithInstances(subMesh, BABYLON.Material.TriangleFillMode, batch, _this._effect, engine);
  4838. } else {
  4839. if (batch.renderSelf[subMesh._id]) {
  4840. _this._effect.setMatrix("world", mesh.getWorldMatrix());
  4841. mesh._draw(subMesh, BABYLON.Material.TriangleFillMode);
  4842. }
  4843. if (batch.visibleInstances[subMesh._id]) {
  4844. for (var instanceIndex = 0; instanceIndex < batch.visibleInstances[subMesh._id].length; instanceIndex++) {
  4845. var instance = batch.visibleInstances[subMesh._id][instanceIndex];
  4846. _this._effect.setMatrix("world", instance.getWorldMatrix());
  4847. mesh._draw(subMesh, BABYLON.Material.TriangleFillMode);
  4848. }
  4849. }
  4850. }
  4851. } else {
  4852. _this._shadowMap.resetRefreshCounter();
  4853. }
  4854. };
  4855. this._shadowMap.customRenderFunction = function (opaqueSubMeshes, alphaTestSubMeshes, transparentSubMeshes) {
  4856. var index;
  4857. for (index = 0; index < opaqueSubMeshes.length; index++) {
  4858. renderSubMesh(opaqueSubMeshes.data[index]);
  4859. }
  4860. for (index = 0; index < alphaTestSubMeshes.length; index++) {
  4861. renderSubMesh(alphaTestSubMeshes.data[index]);
  4862. }
  4863. if (_this._transparencyShadow) {
  4864. for (index = 0; index < transparentSubMeshes.length; index++) {
  4865. renderSubMesh(transparentSubMeshes.data[index]);
  4866. }
  4867. }
  4868. };
  4869. }
  4870. Object.defineProperty(ShadowGenerator, "FILTER_NONE", {
  4871. get: function () {
  4872. return ShadowGenerator._FILTER_NONE;
  4873. },
  4874. enumerable: true,
  4875. configurable: true
  4876. });
  4877. Object.defineProperty(ShadowGenerator, "FILTER_VARIANCESHADOWMAP", {
  4878. get: function () {
  4879. return ShadowGenerator._FILTER_VARIANCESHADOWMAP;
  4880. },
  4881. enumerable: true,
  4882. configurable: true
  4883. });
  4884. Object.defineProperty(ShadowGenerator, "FILTER_POISSONSAMPLING", {
  4885. get: function () {
  4886. return ShadowGenerator._FILTER_POISSONSAMPLING;
  4887. },
  4888. enumerable: true,
  4889. configurable: true
  4890. });
  4891. Object.defineProperty(ShadowGenerator.prototype, "useVarianceShadowMap", {
  4892. get: function () {
  4893. return this.filter === ShadowGenerator.FILTER_VARIANCESHADOWMAP;
  4894. },
  4895. set: function (value) {
  4896. this.filter = (value ? ShadowGenerator.FILTER_VARIANCESHADOWMAP : ShadowGenerator.FILTER_NONE);
  4897. },
  4898. enumerable: true,
  4899. configurable: true
  4900. });
  4901. Object.defineProperty(ShadowGenerator.prototype, "usePoissonSampling", {
  4902. get: function () {
  4903. return this.filter === ShadowGenerator.FILTER_POISSONSAMPLING;
  4904. },
  4905. set: function (value) {
  4906. this.filter = (value ? ShadowGenerator.FILTER_POISSONSAMPLING : ShadowGenerator.FILTER_NONE);
  4907. },
  4908. enumerable: true,
  4909. configurable: true
  4910. });
  4911. ShadowGenerator.prototype.isReady = function (subMesh, useInstances) {
  4912. var defines = [];
  4913. if (this.useVarianceShadowMap) {
  4914. defines.push("#define VSM");
  4915. }
  4916. var attribs = [BABYLON.VertexBuffer.PositionKind];
  4917. var mesh = subMesh.getMesh();
  4918. var material = subMesh.getMaterial();
  4919. if (material && material.needAlphaTesting()) {
  4920. defines.push("#define ALPHATEST");
  4921. if (mesh.isVerticesDataPresent(BABYLON.VertexBuffer.UVKind)) {
  4922. attribs.push(BABYLON.VertexBuffer.UVKind);
  4923. defines.push("#define UV1");
  4924. }
  4925. if (mesh.isVerticesDataPresent(BABYLON.VertexBuffer.UV2Kind)) {
  4926. attribs.push(BABYLON.VertexBuffer.UV2Kind);
  4927. defines.push("#define UV2");
  4928. }
  4929. }
  4930. if (mesh.skeleton && mesh.isVerticesDataPresent(BABYLON.VertexBuffer.MatricesIndicesKind) && mesh.isVerticesDataPresent(BABYLON.VertexBuffer.MatricesWeightsKind)) {
  4931. attribs.push(BABYLON.VertexBuffer.MatricesIndicesKind);
  4932. attribs.push(BABYLON.VertexBuffer.MatricesWeightsKind);
  4933. defines.push("#define BONES");
  4934. defines.push("#define BonesPerMesh " + (mesh.skeleton.bones.length + 1));
  4935. }
  4936. if (useInstances) {
  4937. defines.push("#define INSTANCES");
  4938. attribs.push("world0");
  4939. attribs.push("world1");
  4940. attribs.push("world2");
  4941. attribs.push("world3");
  4942. }
  4943. var join = defines.join("\n");
  4944. if (this._cachedDefines != join) {
  4945. this._cachedDefines = join;
  4946. this._effect = this._scene.getEngine().createEffect("shadowMap", attribs, ["world", "mBones", "viewProjection", "diffuseMatrix"], ["diffuseSampler"], join);
  4947. }
  4948. return this._effect.isReady();
  4949. };
  4950. ShadowGenerator.prototype.getShadowMap = function () {
  4951. return this._shadowMap;
  4952. };
  4953. ShadowGenerator.prototype.getLight = function () {
  4954. return this._light;
  4955. };
  4956. ShadowGenerator.prototype.getTransformMatrix = function () {
  4957. var lightPosition = this._light.position;
  4958. var lightDirection = this._light.direction;
  4959. if (this._light._computeTransformedPosition()) {
  4960. lightPosition = this._light._transformedPosition;
  4961. }
  4962. if (!this._cachedPosition || !this._cachedDirection || !lightPosition.equals(this._cachedPosition) || !lightDirection.equals(this._cachedDirection)) {
  4963. this._cachedPosition = lightPosition.clone();
  4964. this._cachedDirection = lightDirection.clone();
  4965. var activeCamera = this._scene.activeCamera;
  4966. BABYLON.Matrix.LookAtLHToRef(lightPosition, this._light.position.add(lightDirection), BABYLON.Vector3.Up(), this._viewMatrix);
  4967. BABYLON.Matrix.PerspectiveFovLHToRef(Math.PI / 2.0, 1.0, activeCamera.minZ, activeCamera.maxZ, this._projectionMatrix);
  4968. this._viewMatrix.multiplyToRef(this._projectionMatrix, this._transformMatrix);
  4969. }
  4970. return this._transformMatrix;
  4971. };
  4972. ShadowGenerator.prototype.getDarkness = function () {
  4973. return this._darkness;
  4974. };
  4975. ShadowGenerator.prototype.setDarkness = function (darkness) {
  4976. if (darkness >= 1.0)
  4977. this._darkness = 1.0;
  4978. else if (darkness <= 0.0)
  4979. this._darkness = 0.0;
  4980. else
  4981. this._darkness = darkness;
  4982. };
  4983. ShadowGenerator.prototype.setTransparencyShadow = function (hasShadow) {
  4984. this._transparencyShadow = hasShadow;
  4985. };
  4986. ShadowGenerator.prototype.dispose = function () {
  4987. this._shadowMap.dispose();
  4988. };
  4989. ShadowGenerator._FILTER_NONE = 0;
  4990. ShadowGenerator._FILTER_VARIANCESHADOWMAP = 1;
  4991. ShadowGenerator._FILTER_POISSONSAMPLING = 2;
  4992. return ShadowGenerator;
  4993. })();
  4994. BABYLON.ShadowGenerator = ShadowGenerator;
  4995. })(BABYLON || (BABYLON = {}));
  4996. var __extends = this.__extends || function (d, b) {
  4997. for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p];
  4998. function __() { this.constructor = d; }
  4999. __.prototype = b.prototype;
  5000. d.prototype = new __();
  5001. };
  5002. var BABYLON;
  5003. (function (BABYLON) {
  5004. var HemisphericLight = (function (_super) {
  5005. __extends(HemisphericLight, _super);
  5006. function HemisphericLight(name, direction, scene) {
  5007. _super.call(this, name, scene);
  5008. this.direction = direction;
  5009. this.groundColor = new BABYLON.Color3(0.0, 0.0, 0.0);
  5010. }
  5011. HemisphericLight.prototype.setDirectionToTarget = function (target) {
  5012. this.direction = BABYLON.Vector3.Normalize(target.subtract(BABYLON.Vector3.Zero()));
  5013. return this.direction;
  5014. };
  5015. HemisphericLight.prototype.getShadowGenerator = function () {
  5016. return null;
  5017. };
  5018. HemisphericLight.prototype.transferToEffect = function (effect, directionUniformName, groundColorUniformName) {
  5019. var normalizeDirection = BABYLON.Vector3.Normalize(this.direction);
  5020. effect.setFloat4(directionUniformName, normalizeDirection.x, normalizeDirection.y, normalizeDirection.z, 0);
  5021. effect.setColor3(groundColorUniformName, this.groundColor.scale(this.intensity));
  5022. };
  5023. HemisphericLight.prototype._getWorldMatrix = function () {
  5024. if (!this._worldMatrix) {
  5025. this._worldMatrix = BABYLON.Matrix.Identity();
  5026. }
  5027. return this._worldMatrix;
  5028. };
  5029. return HemisphericLight;
  5030. })(BABYLON.Light);
  5031. BABYLON.HemisphericLight = HemisphericLight;
  5032. })(BABYLON || (BABYLON = {}));
  5033. var BABYLON;
  5034. (function (BABYLON) {
  5035. var intersectBoxAASphere = function (boxMin, boxMax, sphereCenter, sphereRadius) {
  5036. if (boxMin.x > sphereCenter.x + sphereRadius)
  5037. return false;
  5038. if (sphereCenter.x - sphereRadius > boxMax.x)
  5039. return false;
  5040. if (boxMin.y > sphereCenter.y + sphereRadius)
  5041. return false;
  5042. if (sphereCenter.y - sphereRadius > boxMax.y)
  5043. return false;
  5044. if (boxMin.z > sphereCenter.z + sphereRadius)
  5045. return false;
  5046. if (sphereCenter.z - sphereRadius > boxMax.z)
  5047. return false;
  5048. return true;
  5049. };
  5050. var getLowestRoot = function (a, b, c, maxR) {
  5051. var determinant = b * b - 4.0 * a * c;
  5052. var result = { root: 0, found: false };
  5053. if (determinant < 0)
  5054. return result;
  5055. var sqrtD = Math.sqrt(determinant);
  5056. var r1 = (-b - sqrtD) / (2.0 * a);
  5057. var r2 = (-b + sqrtD) / (2.0 * a);
  5058. if (r1 > r2) {
  5059. var temp = r2;
  5060. r2 = r1;
  5061. r1 = temp;
  5062. }
  5063. if (r1 > 0 && r1 < maxR) {
  5064. result.root = r1;
  5065. result.found = true;
  5066. return result;
  5067. }
  5068. if (r2 > 0 && r2 < maxR) {
  5069. result.root = r2;
  5070. result.found = true;
  5071. return result;
  5072. }
  5073. return result;
  5074. };
  5075. var Collider = (function () {
  5076. function Collider() {
  5077. this.radius = new BABYLON.Vector3(1, 1, 1);
  5078. this.retry = 0;
  5079. this.basePointWorld = BABYLON.Vector3.Zero();
  5080. this.velocityWorld = BABYLON.Vector3.Zero();
  5081. this.normalizedVelocity = BABYLON.Vector3.Zero();
  5082. this._collisionPoint = BABYLON.Vector3.Zero();
  5083. this._planeIntersectionPoint = BABYLON.Vector3.Zero();
  5084. this._tempVector = BABYLON.Vector3.Zero();
  5085. this._tempVector2 = BABYLON.Vector3.Zero();
  5086. this._tempVector3 = BABYLON.Vector3.Zero();
  5087. this._tempVector4 = BABYLON.Vector3.Zero();
  5088. this._edge = BABYLON.Vector3.Zero();
  5089. this._baseToVertex = BABYLON.Vector3.Zero();
  5090. this._destinationPoint = BABYLON.Vector3.Zero();
  5091. this._slidePlaneNormal = BABYLON.Vector3.Zero();
  5092. this._displacementVector = BABYLON.Vector3.Zero();
  5093. }
  5094. Collider.prototype._initialize = function (source, dir, e) {
  5095. this.velocity = dir;
  5096. BABYLON.Vector3.NormalizeToRef(dir, this.normalizedVelocity);
  5097. this.basePoint = source;
  5098. source.multiplyToRef(this.radius, this.basePointWorld);
  5099. dir.multiplyToRef(this.radius, this.velocityWorld);
  5100. this.velocityWorldLength = this.velocityWorld.length();
  5101. this.epsilon = e;
  5102. this.collisionFound = false;
  5103. };
  5104. Collider.prototype._checkPointInTriangle = function (point, pa, pb, pc, n) {
  5105. pa.subtractToRef(point, this._tempVector);
  5106. pb.subtractToRef(point, this._tempVector2);
  5107. BABYLON.Vector3.CrossToRef(this._tempVector, this._tempVector2, this._tempVector4);
  5108. var d = BABYLON.Vector3.Dot(this._tempVector4, n);
  5109. if (d < 0)
  5110. return false;
  5111. pc.subtractToRef(point, this._tempVector3);
  5112. BABYLON.Vector3.CrossToRef(this._tempVector2, this._tempVector3, this._tempVector4);
  5113. d = BABYLON.Vector3.Dot(this._tempVector4, n);
  5114. if (d < 0)
  5115. return false;
  5116. BABYLON.Vector3.CrossToRef(this._tempVector3, this._tempVector, this._tempVector4);
  5117. d = BABYLON.Vector3.Dot(this._tempVector4, n);
  5118. return d >= 0;
  5119. };
  5120. Collider.prototype._canDoCollision = function (sphereCenter, sphereRadius, vecMin, vecMax) {
  5121. var distance = BABYLON.Vector3.Distance(this.basePointWorld, sphereCenter);
  5122. var max = Math.max(this.radius.x, this.radius.y, this.radius.z);
  5123. if (distance > this.velocityWorldLength + max + sphereRadius) {
  5124. return false;
  5125. }
  5126. if (!intersectBoxAASphere(vecMin, vecMax, this.basePointWorld, this.velocityWorldLength + max))
  5127. return false;
  5128. return true;
  5129. };
  5130. Collider.prototype._testTriangle = function (faceIndex, subMesh, p1, p2, p3) {
  5131. var t0;
  5132. var embeddedInPlane = false;
  5133. if (!subMesh._trianglePlanes) {
  5134. subMesh._trianglePlanes = [];
  5135. }
  5136. if (!subMesh._trianglePlanes[faceIndex]) {
  5137. subMesh._trianglePlanes[faceIndex] = new BABYLON.Plane(0, 0, 0, 0);
  5138. subMesh._trianglePlanes[faceIndex].copyFromPoints(p1, p2, p3);
  5139. }
  5140. var trianglePlane = subMesh._trianglePlanes[faceIndex];
  5141. if ((!subMesh.getMaterial()) && !trianglePlane.isFrontFacingTo(this.normalizedVelocity, 0))
  5142. return;
  5143. var signedDistToTrianglePlane = trianglePlane.signedDistanceTo(this.basePoint);
  5144. var normalDotVelocity = BABYLON.Vector3.Dot(trianglePlane.normal, this.velocity);
  5145. if (normalDotVelocity == 0) {
  5146. if (Math.abs(signedDistToTrianglePlane) >= 1.0)
  5147. return;
  5148. embeddedInPlane = true;
  5149. t0 = 0;
  5150. } else {
  5151. t0 = (-1.0 - signedDistToTrianglePlane) / normalDotVelocity;
  5152. var t1 = (1.0 - signedDistToTrianglePlane) / normalDotVelocity;
  5153. if (t0 > t1) {
  5154. var temp = t1;
  5155. t1 = t0;
  5156. t0 = temp;
  5157. }
  5158. if (t0 > 1.0 || t1 < 0.0)
  5159. return;
  5160. if (t0 < 0)
  5161. t0 = 0;
  5162. if (t0 > 1.0)
  5163. t0 = 1.0;
  5164. }
  5165. this._collisionPoint.copyFromFloats(0, 0, 0);
  5166. var found = false;
  5167. var t = 1.0;
  5168. if (!embeddedInPlane) {
  5169. this.basePoint.subtractToRef(trianglePlane.normal, this._planeIntersectionPoint);
  5170. this.velocity.scaleToRef(t0, this._tempVector);
  5171. this._planeIntersectionPoint.addInPlace(this._tempVector);
  5172. if (this._checkPointInTriangle(this._planeIntersectionPoint, p1, p2, p3, trianglePlane.normal)) {
  5173. found = true;
  5174. t = t0;
  5175. this._collisionPoint.copyFrom(this._planeIntersectionPoint);
  5176. }
  5177. }
  5178. if (!found) {
  5179. var velocitySquaredLength = this.velocity.lengthSquared();
  5180. var a = velocitySquaredLength;
  5181. this.basePoint.subtractToRef(p1, this._tempVector);
  5182. var b = 2.0 * (BABYLON.Vector3.Dot(this.velocity, this._tempVector));
  5183. var c = this._tempVector.lengthSquared() - 1.0;
  5184. var lowestRoot = getLowestRoot(a, b, c, t);
  5185. if (lowestRoot.found) {
  5186. t = lowestRoot.root;
  5187. found = true;
  5188. this._collisionPoint.copyFrom(p1);
  5189. }
  5190. this.basePoint.subtractToRef(p2, this._tempVector);
  5191. b = 2.0 * (BABYLON.Vector3.Dot(this.velocity, this._tempVector));
  5192. c = this._tempVector.lengthSquared() - 1.0;
  5193. lowestRoot = getLowestRoot(a, b, c, t);
  5194. if (lowestRoot.found) {
  5195. t = lowestRoot.root;
  5196. found = true;
  5197. this._collisionPoint.copyFrom(p2);
  5198. }
  5199. this.basePoint.subtractToRef(p3, this._tempVector);
  5200. b = 2.0 * (BABYLON.Vector3.Dot(this.velocity, this._tempVector));
  5201. c = this._tempVector.lengthSquared() - 1.0;
  5202. lowestRoot = getLowestRoot(a, b, c, t);
  5203. if (lowestRoot.found) {
  5204. t = lowestRoot.root;
  5205. found = true;
  5206. this._collisionPoint.copyFrom(p3);
  5207. }
  5208. p2.subtractToRef(p1, this._edge);
  5209. p1.subtractToRef(this.basePoint, this._baseToVertex);
  5210. var edgeSquaredLength = this._edge.lengthSquared();
  5211. var edgeDotVelocity = BABYLON.Vector3.Dot(this._edge, this.velocity);
  5212. var edgeDotBaseToVertex = BABYLON.Vector3.Dot(this._edge, this._baseToVertex);
  5213. a = edgeSquaredLength * (-velocitySquaredLength) + edgeDotVelocity * edgeDotVelocity;
  5214. b = edgeSquaredLength * (2.0 * BABYLON.Vector3.Dot(this.velocity, this._baseToVertex)) - 2.0 * edgeDotVelocity * edgeDotBaseToVertex;
  5215. c = edgeSquaredLength * (1.0 - this._baseToVertex.lengthSquared()) + edgeDotBaseToVertex * edgeDotBaseToVertex;
  5216. lowestRoot = getLowestRoot(a, b, c, t);
  5217. if (lowestRoot.found) {
  5218. var f = (edgeDotVelocity * lowestRoot.root - edgeDotBaseToVertex) / edgeSquaredLength;
  5219. if (f >= 0.0 && f <= 1.0) {
  5220. t = lowestRoot.root;
  5221. found = true;
  5222. this._edge.scaleInPlace(f);
  5223. p1.addToRef(this._edge, this._collisionPoint);
  5224. }
  5225. }
  5226. p3.subtractToRef(p2, this._edge);
  5227. p2.subtractToRef(this.basePoint, this._baseToVertex);
  5228. edgeSquaredLength = this._edge.lengthSquared();
  5229. edgeDotVelocity = BABYLON.Vector3.Dot(this._edge, this.velocity);
  5230. edgeDotBaseToVertex = BABYLON.Vector3.Dot(this._edge, this._baseToVertex);
  5231. a = edgeSquaredLength * (-velocitySquaredLength) + edgeDotVelocity * edgeDotVelocity;
  5232. b = edgeSquaredLength * (2.0 * BABYLON.Vector3.Dot(this.velocity, this._baseToVertex)) - 2.0 * edgeDotVelocity * edgeDotBaseToVertex;
  5233. c = edgeSquaredLength * (1.0 - this._baseToVertex.lengthSquared()) + edgeDotBaseToVertex * edgeDotBaseToVertex;
  5234. lowestRoot = getLowestRoot(a, b, c, t);
  5235. if (lowestRoot.found) {
  5236. f = (edgeDotVelocity * lowestRoot.root - edgeDotBaseToVertex) / edgeSquaredLength;
  5237. if (f >= 0.0 && f <= 1.0) {
  5238. t = lowestRoot.root;
  5239. found = true;
  5240. this._edge.scaleInPlace(f);
  5241. p2.addToRef(this._edge, this._collisionPoint);
  5242. }
  5243. }
  5244. p1.subtractToRef(p3, this._edge);
  5245. p3.subtractToRef(this.basePoint, this._baseToVertex);
  5246. edgeSquaredLength = this._edge.lengthSquared();
  5247. edgeDotVelocity = BABYLON.Vector3.Dot(this._edge, this.velocity);
  5248. edgeDotBaseToVertex = BABYLON.Vector3.Dot(this._edge, this._baseToVertex);
  5249. a = edgeSquaredLength * (-velocitySquaredLength) + edgeDotVelocity * edgeDotVelocity;
  5250. b = edgeSquaredLength * (2.0 * BABYLON.Vector3.Dot(this.velocity, this._baseToVertex)) - 2.0 * edgeDotVelocity * edgeDotBaseToVertex;
  5251. c = edgeSquaredLength * (1.0 - this._baseToVertex.lengthSquared()) + edgeDotBaseToVertex * edgeDotBaseToVertex;
  5252. lowestRoot = getLowestRoot(a, b, c, t);
  5253. if (lowestRoot.found) {
  5254. f = (edgeDotVelocity * lowestRoot.root - edgeDotBaseToVertex) / edgeSquaredLength;
  5255. if (f >= 0.0 && f <= 1.0) {
  5256. t = lowestRoot.root;
  5257. found = true;
  5258. this._edge.scaleInPlace(f);
  5259. p3.addToRef(this._edge, this._collisionPoint);
  5260. }
  5261. }
  5262. }
  5263. if (found) {
  5264. var distToCollision = t * this.velocity.length();
  5265. if (!this.collisionFound || distToCollision < this.nearestDistance) {
  5266. if (!this.intersectionPoint) {
  5267. this.intersectionPoint = this._collisionPoint.clone();
  5268. } else {
  5269. this.intersectionPoint.copyFrom(this._collisionPoint);
  5270. }
  5271. this.nearestDistance = distToCollision;
  5272. this.collisionFound = true;
  5273. this.collidedMesh = subMesh.getMesh();
  5274. }
  5275. }
  5276. };
  5277. Collider.prototype._collide = function (subMesh, pts, indices, indexStart, indexEnd, decal) {
  5278. for (var i = indexStart; i < indexEnd; i += 3) {
  5279. var p1 = pts[indices[i] - decal];
  5280. var p2 = pts[indices[i + 1] - decal];
  5281. var p3 = pts[indices[i + 2] - decal];
  5282. this._testTriangle(i, subMesh, p3, p2, p1);
  5283. }
  5284. };
  5285. Collider.prototype._getResponse = function (pos, vel) {
  5286. pos.addToRef(vel, this._destinationPoint);
  5287. vel.scaleInPlace((this.nearestDistance / vel.length()));
  5288. this.basePoint.addToRef(vel, pos);
  5289. pos.subtractToRef(this.intersectionPoint, this._slidePlaneNormal);
  5290. this._slidePlaneNormal.normalize();
  5291. this._slidePlaneNormal.scaleToRef(this.epsilon, this._displacementVector);
  5292. pos.addInPlace(this._displacementVector);
  5293. this.intersectionPoint.addInPlace(this._displacementVector);
  5294. this._slidePlaneNormal.scaleInPlace(BABYLON.Plane.SignedDistanceToPlaneFromPositionAndNormal(this.intersectionPoint, this._slidePlaneNormal, this._destinationPoint));
  5295. this._destinationPoint.subtractInPlace(this._slidePlaneNormal);
  5296. this._destinationPoint.subtractToRef(this.intersectionPoint, vel);
  5297. };
  5298. return Collider;
  5299. })();
  5300. BABYLON.Collider = Collider;
  5301. })(BABYLON || (BABYLON = {}));
  5302. var __extends = this.__extends || function (d, b) {
  5303. for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p];
  5304. function __() { this.constructor = d; }
  5305. __.prototype = b.prototype;
  5306. d.prototype = new __();
  5307. };
  5308. var BABYLON;
  5309. (function (BABYLON) {
  5310. var Camera = (function (_super) {
  5311. __extends(Camera, _super);
  5312. function Camera(name, position, scene) {
  5313. _super.call(this, name, scene);
  5314. this.position = position;
  5315. this.upVector = BABYLON.Vector3.Up();
  5316. this.orthoLeft = null;
  5317. this.orthoRight = null;
  5318. this.orthoBottom = null;
  5319. this.orthoTop = null;
  5320. this.fov = 0.8;
  5321. this.minZ = 1.0;
  5322. this.maxZ = 10000.0;
  5323. this.inertia = 0.9;
  5324. this.mode = Camera.PERSPECTIVE_CAMERA;
  5325. this.isIntermediate = false;
  5326. this.viewport = new BABYLON.Viewport(0, 0, 1.0, 1.0);
  5327. this.subCameras = [];
  5328. this.layerMask = 0xFFFFFFFF;
  5329. this._computedViewMatrix = BABYLON.Matrix.Identity();
  5330. this._projectionMatrix = new BABYLON.Matrix();
  5331. this._postProcesses = new Array();
  5332. this._postProcessesTakenIndices = [];
  5333. scene.cameras.push(this);
  5334. if (!scene.activeCamera) {
  5335. scene.activeCamera = this;
  5336. }
  5337. }
  5338. Camera.prototype._initCache = function () {
  5339. _super.prototype._initCache.call(this);
  5340. this._cache.position = new BABYLON.Vector3(Number.MAX_VALUE, Number.MAX_VALUE, Number.MAX_VALUE);
  5341. this._cache.upVector = new BABYLON.Vector3(Number.MAX_VALUE, Number.MAX_VALUE, Number.MAX_VALUE);
  5342. this._cache.mode = undefined;
  5343. this._cache.minZ = undefined;
  5344. this._cache.maxZ = undefined;
  5345. this._cache.fov = undefined;
  5346. this._cache.aspectRatio = undefined;
  5347. this._cache.orthoLeft = undefined;
  5348. this._cache.orthoRight = undefined;
  5349. this._cache.orthoBottom = undefined;
  5350. this._cache.orthoTop = undefined;
  5351. this._cache.renderWidth = undefined;
  5352. this._cache.renderHeight = undefined;
  5353. };
  5354. Camera.prototype._updateCache = function (ignoreParentClass) {
  5355. if (!ignoreParentClass) {
  5356. _super.prototype._updateCache.call(this);
  5357. }
  5358. var engine = this.getEngine();
  5359. this._cache.position.copyFrom(this.position);
  5360. this._cache.upVector.copyFrom(this.upVector);
  5361. this._cache.mode = this.mode;
  5362. this._cache.minZ = this.minZ;
  5363. this._cache.maxZ = this.maxZ;
  5364. this._cache.fov = this.fov;
  5365. this._cache.aspectRatio = engine.getAspectRatio(this);
  5366. this._cache.orthoLeft = this.orthoLeft;
  5367. this._cache.orthoRight = this.orthoRight;
  5368. this._cache.orthoBottom = this.orthoBottom;
  5369. this._cache.orthoTop = this.orthoTop;
  5370. this._cache.renderWidth = engine.getRenderWidth();
  5371. this._cache.renderHeight = engine.getRenderHeight();
  5372. };
  5373. Camera.prototype._updateFromScene = function () {
  5374. this.updateCache();
  5375. this._update();
  5376. };
  5377. Camera.prototype._isSynchronized = function () {
  5378. return this._isSynchronizedViewMatrix() && this._isSynchronizedProjectionMatrix();
  5379. };
  5380. Camera.prototype._isSynchronizedViewMatrix = function () {
  5381. if (!_super.prototype._isSynchronized.call(this))
  5382. return false;
  5383. return this._cache.position.equals(this.position) && this._cache.upVector.equals(this.upVector) && this.isSynchronizedWithParent();
  5384. };
  5385. Camera.prototype._isSynchronizedProjectionMatrix = function () {
  5386. var check = this._cache.mode === this.mode && this._cache.minZ === this.minZ && this._cache.maxZ === this.maxZ;
  5387. if (!check) {
  5388. return false;
  5389. }
  5390. var engine = this.getEngine();
  5391. if (this.mode === BABYLON.Camera.PERSPECTIVE_CAMERA) {
  5392. check = this._cache.fov === this.fov && this._cache.aspectRatio === engine.getAspectRatio(this);
  5393. } else {
  5394. check = this._cache.orthoLeft === this.orthoLeft && this._cache.orthoRight === this.orthoRight && this._cache.orthoBottom === this.orthoBottom && this._cache.orthoTop === this.orthoTop && this._cache.renderWidth === engine.getRenderWidth() && this._cache.renderHeight === engine.getRenderHeight();
  5395. }
  5396. return check;
  5397. };
  5398. Camera.prototype.attachControl = function (element) {
  5399. };
  5400. Camera.prototype.detachControl = function (element) {
  5401. };
  5402. Camera.prototype._update = function () {
  5403. };
  5404. Camera.prototype.attachPostProcess = function (postProcess, insertAt) {
  5405. if (typeof insertAt === "undefined") { insertAt = null; }
  5406. if (!postProcess.isReusable() && this._postProcesses.indexOf(postProcess) > -1) {
  5407. BABYLON.Tools.Error("You're trying to reuse a post process not defined as reusable.");
  5408. return 0;
  5409. }
  5410. if (insertAt == null || insertAt < 0) {
  5411. this._postProcesses.push(postProcess);
  5412. this._postProcessesTakenIndices.push(this._postProcesses.length - 1);
  5413. return this._postProcesses.length - 1;
  5414. }
  5415. var add = 0;
  5416. if (this._postProcesses[insertAt]) {
  5417. var start = this._postProcesses.length - 1;
  5418. for (var i = start; i >= insertAt + 1; --i) {
  5419. this._postProcesses[i + 1] = this._postProcesses[i];
  5420. }
  5421. add = 1;
  5422. }
  5423. for (i = 0; i < this._postProcessesTakenIndices.length; ++i) {
  5424. if (this._postProcessesTakenIndices[i] < insertAt) {
  5425. continue;
  5426. }
  5427. start = this._postProcessesTakenIndices.length - 1;
  5428. for (var j = start; j >= i; --j) {
  5429. this._postProcessesTakenIndices[j + 1] = this._postProcessesTakenIndices[j] + add;
  5430. }
  5431. this._postProcessesTakenIndices[i] = insertAt;
  5432. break;
  5433. }
  5434. if (!add && this._postProcessesTakenIndices.indexOf(insertAt) == -1) {
  5435. this._postProcessesTakenIndices.push(insertAt);
  5436. }
  5437. var result = insertAt + add;
  5438. this._postProcesses[result] = postProcess;
  5439. return result;
  5440. };
  5441. Camera.prototype.detachPostProcess = function (postProcess, atIndices) {
  5442. if (typeof atIndices === "undefined") { atIndices = null; }
  5443. var result = [];
  5444. if (!atIndices) {
  5445. var length = this._postProcesses.length;
  5446. for (var i = 0; i < length; i++) {
  5447. if (this._postProcesses[i] !== postProcess) {
  5448. continue;
  5449. }
  5450. delete this._postProcesses[i];
  5451. var index = this._postProcessesTakenIndices.indexOf(i);
  5452. this._postProcessesTakenIndices.splice(index, 1);
  5453. }
  5454. } else {
  5455. atIndices = (atIndices instanceof Array) ? atIndices : [atIndices];
  5456. for (i = 0; i < atIndices.length; i++) {
  5457. var foundPostProcess = this._postProcesses[atIndices[i]];
  5458. if (foundPostProcess !== postProcess) {
  5459. result.push(i);
  5460. continue;
  5461. }
  5462. delete this._postProcesses[atIndices[i]];
  5463. index = this._postProcessesTakenIndices.indexOf(atIndices[i]);
  5464. this._postProcessesTakenIndices.splice(index, 1);
  5465. }
  5466. }
  5467. return result;
  5468. };
  5469. Camera.prototype.getWorldMatrix = function () {
  5470. if (!this._worldMatrix) {
  5471. this._worldMatrix = BABYLON.Matrix.Identity();
  5472. }
  5473. var viewMatrix = this.getViewMatrix();
  5474. viewMatrix.invertToRef(this._worldMatrix);
  5475. return this._worldMatrix;
  5476. };
  5477. Camera.prototype._getViewMatrix = function () {
  5478. return BABYLON.Matrix.Identity();
  5479. };
  5480. Camera.prototype.getViewMatrix = function () {
  5481. this._computedViewMatrix = this._computeViewMatrix();
  5482. if (!this.parent || !this.parent.getWorldMatrix || this.isSynchronized()) {
  5483. return this._computedViewMatrix;
  5484. }
  5485. if (!this._worldMatrix) {
  5486. this._worldMatrix = BABYLON.Matrix.Identity();
  5487. }
  5488. this._computedViewMatrix.invertToRef(this._worldMatrix);
  5489. this._worldMatrix.multiplyToRef(this.parent.getWorldMatrix(), this._computedViewMatrix);
  5490. this._computedViewMatrix.invert();
  5491. this._currentRenderId = this.getScene().getRenderId();
  5492. return this._computedViewMatrix;
  5493. };
  5494. Camera.prototype._computeViewMatrix = function (force) {
  5495. if (!force && this._isSynchronizedViewMatrix()) {
  5496. return this._computedViewMatrix;
  5497. }
  5498. this._computedViewMatrix = this._getViewMatrix();
  5499. if (!this.parent || !this.parent.getWorldMatrix) {
  5500. this._currentRenderId = this.getScene().getRenderId();
  5501. }
  5502. return this._computedViewMatrix;
  5503. };
  5504. Camera.prototype.getProjectionMatrix = function (force) {
  5505. if (!force && this._isSynchronizedProjectionMatrix()) {
  5506. return this._projectionMatrix;
  5507. }
  5508. var engine = this.getEngine();
  5509. if (this.mode === BABYLON.Camera.PERSPECTIVE_CAMERA) {
  5510. if (this.minZ <= 0) {
  5511. this.minZ = 0.1;
  5512. }
  5513. BABYLON.Matrix.PerspectiveFovLHToRef(this.fov, engine.getAspectRatio(this), this.minZ, this.maxZ, this._projectionMatrix);
  5514. return this._projectionMatrix;
  5515. }
  5516. var halfWidth = engine.getRenderWidth() / 2.0;
  5517. var halfHeight = engine.getRenderHeight() / 2.0;
  5518. BABYLON.Matrix.OrthoOffCenterLHToRef(this.orthoLeft || -halfWidth, this.orthoRight || halfWidth, this.orthoBottom || -halfHeight, this.orthoTop || halfHeight, this.minZ, this.maxZ, this._projectionMatrix);
  5519. return this._projectionMatrix;
  5520. };
  5521. Camera.prototype.dispose = function () {
  5522. var index = this.getScene().cameras.indexOf(this);
  5523. this.getScene().cameras.splice(index, 1);
  5524. for (var i = 0; i < this._postProcessesTakenIndices.length; ++i) {
  5525. this._postProcesses[this._postProcessesTakenIndices[i]].dispose(this);
  5526. }
  5527. };
  5528. Camera.PERSPECTIVE_CAMERA = 0;
  5529. Camera.ORTHOGRAPHIC_CAMERA = 1;
  5530. return Camera;
  5531. })(BABYLON.Node);
  5532. BABYLON.Camera = Camera;
  5533. })(BABYLON || (BABYLON = {}));
  5534. var __extends = this.__extends || function (d, b) {
  5535. for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p];
  5536. function __() { this.constructor = d; }
  5537. __.prototype = b.prototype;
  5538. d.prototype = new __();
  5539. };
  5540. var BABYLON;
  5541. (function (BABYLON) {
  5542. var TargetCamera = (function (_super) {
  5543. __extends(TargetCamera, _super);
  5544. function TargetCamera(name, position, scene) {
  5545. _super.call(this, name, position, scene);
  5546. this.cameraDirection = new BABYLON.Vector3(0, 0, 0);
  5547. this.cameraRotation = new BABYLON.Vector2(0, 0);
  5548. this.rotation = new BABYLON.Vector3(0, 0, 0);
  5549. this.speed = 2.0;
  5550. this.noRotationConstraint = false;
  5551. this.lockedTarget = null;
  5552. this._currentTarget = BABYLON.Vector3.Zero();
  5553. this._viewMatrix = BABYLON.Matrix.Zero();
  5554. this._camMatrix = BABYLON.Matrix.Zero();
  5555. this._cameraTransformMatrix = BABYLON.Matrix.Zero();
  5556. this._cameraRotationMatrix = BABYLON.Matrix.Zero();
  5557. this._referencePoint = new BABYLON.Vector3(0, 0, 1);
  5558. this._transformedReferencePoint = BABYLON.Vector3.Zero();
  5559. this._lookAtTemp = BABYLON.Matrix.Zero();
  5560. this._tempMatrix = BABYLON.Matrix.Zero();
  5561. }
  5562. TargetCamera.prototype._getLockedTargetPosition = function () {
  5563. if (!this.lockedTarget) {
  5564. return null;
  5565. }
  5566. return this.lockedTarget.position || this.lockedTarget;
  5567. };
  5568. TargetCamera.prototype._initCache = function () {
  5569. _super.prototype._initCache.call(this);
  5570. this._cache.lockedTarget = new BABYLON.Vector3(Number.MAX_VALUE, Number.MAX_VALUE, Number.MAX_VALUE);
  5571. this._cache.rotation = new BABYLON.Vector3(Number.MAX_VALUE, Number.MAX_VALUE, Number.MAX_VALUE);
  5572. };
  5573. TargetCamera.prototype._updateCache = function (ignoreParentClass) {
  5574. if (!ignoreParentClass) {
  5575. _super.prototype._updateCache.call(this);
  5576. }
  5577. var lockedTargetPosition = this._getLockedTargetPosition();
  5578. if (!lockedTargetPosition) {
  5579. this._cache.lockedTarget = null;
  5580. } else {
  5581. if (!this._cache.lockedTarget) {
  5582. this._cache.lockedTarget = lockedTargetPosition.clone();
  5583. } else {
  5584. this._cache.lockedTarget.copyFrom(lockedTargetPosition);
  5585. }
  5586. }
  5587. this._cache.rotation.copyFrom(this.rotation);
  5588. };
  5589. TargetCamera.prototype._isSynchronizedViewMatrix = function () {
  5590. if (!_super.prototype._isSynchronizedViewMatrix.call(this)) {
  5591. return false;
  5592. }
  5593. var lockedTargetPosition = this._getLockedTargetPosition();
  5594. return (this._cache.lockedTarget ? this._cache.lockedTarget.equals(lockedTargetPosition) : !lockedTargetPosition) && this._cache.rotation.equals(this.rotation);
  5595. };
  5596. TargetCamera.prototype._computeLocalCameraSpeed = function () {
  5597. return this.speed * ((BABYLON.Tools.GetDeltaTime() / (BABYLON.Tools.GetFps() * 10.0)));
  5598. };
  5599. TargetCamera.prototype.setTarget = function (target) {
  5600. this.upVector.normalize();
  5601. BABYLON.Matrix.LookAtLHToRef(this.position, target, this.upVector, this._camMatrix);
  5602. this._camMatrix.invert();
  5603. this.rotation.x = Math.atan(this._camMatrix.m[6] / this._camMatrix.m[10]);
  5604. var vDir = target.subtract(this.position);
  5605. if (vDir.x >= 0.0) {
  5606. this.rotation.y = (-Math.atan(vDir.z / vDir.x) + Math.PI / 2.0);
  5607. } else {
  5608. this.rotation.y = (-Math.atan(vDir.z / vDir.x) - Math.PI / 2.0);
  5609. }
  5610. this.rotation.z = -Math.acos(BABYLON.Vector3.Dot(new BABYLON.Vector3(0, 1.0, 0), this.upVector));
  5611. if (isNaN(this.rotation.x)) {
  5612. this.rotation.x = 0;
  5613. }
  5614. if (isNaN(this.rotation.y)) {
  5615. this.rotation.y = 0;
  5616. }
  5617. if (isNaN(this.rotation.z)) {
  5618. this.rotation.z = 0;
  5619. }
  5620. };
  5621. TargetCamera.prototype.getTarget = function () {
  5622. return this._currentTarget;
  5623. };
  5624. TargetCamera.prototype._decideIfNeedsToMove = function () {
  5625. return Math.abs(this.cameraDirection.x) > 0 || Math.abs(this.cameraDirection.y) > 0 || Math.abs(this.cameraDirection.z) > 0;
  5626. };
  5627. TargetCamera.prototype._updatePosition = function () {
  5628. this.position.addInPlace(this.cameraDirection);
  5629. };
  5630. TargetCamera.prototype._update = function () {
  5631. var needToMove = this._decideIfNeedsToMove();
  5632. var needToRotate = Math.abs(this.cameraRotation.x) > 0 || Math.abs(this.cameraRotation.y) > 0;
  5633. if (needToMove) {
  5634. this._updatePosition();
  5635. }
  5636. if (needToRotate) {
  5637. this.rotation.x += this.cameraRotation.x;
  5638. this.rotation.y += this.cameraRotation.y;
  5639. if (!this.noRotationConstraint) {
  5640. var limit = (Math.PI / 2) * 0.95;
  5641. if (this.rotation.x > limit)
  5642. this.rotation.x = limit;
  5643. if (this.rotation.x < -limit)
  5644. this.rotation.x = -limit;
  5645. }
  5646. }
  5647. if (needToMove) {
  5648. if (Math.abs(this.cameraDirection.x) < BABYLON.Engine.Epsilon) {
  5649. this.cameraDirection.x = 0;
  5650. }
  5651. if (Math.abs(this.cameraDirection.y) < BABYLON.Engine.Epsilon) {
  5652. this.cameraDirection.y = 0;
  5653. }
  5654. if (Math.abs(this.cameraDirection.z) < BABYLON.Engine.Epsilon) {
  5655. this.cameraDirection.z = 0;
  5656. }
  5657. this.cameraDirection.scaleInPlace(this.inertia);
  5658. }
  5659. if (needToRotate) {
  5660. if (Math.abs(this.cameraRotation.x) < BABYLON.Engine.Epsilon) {
  5661. this.cameraRotation.x = 0;
  5662. }
  5663. if (Math.abs(this.cameraRotation.y) < BABYLON.Engine.Epsilon) {
  5664. this.cameraRotation.y = 0;
  5665. }
  5666. this.cameraRotation.scaleInPlace(this.inertia);
  5667. }
  5668. };
  5669. TargetCamera.prototype._getViewMatrix = function () {
  5670. if (!this.lockedTarget) {
  5671. if (this.upVector.x != 0 || this.upVector.y != 1.0 || this.upVector.z != 0) {
  5672. BABYLON.Matrix.LookAtLHToRef(BABYLON.Vector3.Zero(), this._referencePoint, this.upVector, this._lookAtTemp);
  5673. BABYLON.Matrix.RotationYawPitchRollToRef(this.rotation.y, this.rotation.x, this.rotation.z, this._cameraRotationMatrix);
  5674. this._lookAtTemp.multiplyToRef(this._cameraRotationMatrix, this._tempMatrix);
  5675. this._lookAtTemp.invert();
  5676. this._tempMatrix.multiplyToRef(this._lookAtTemp, this._cameraRotationMatrix);
  5677. } else {
  5678. BABYLON.Matrix.RotationYawPitchRollToRef(this.rotation.y, this.rotation.x, this.rotation.z, this._cameraRotationMatrix);
  5679. }
  5680. BABYLON.Vector3.TransformCoordinatesToRef(this._referencePoint, this._cameraRotationMatrix, this._transformedReferencePoint);
  5681. this.position.addToRef(this._transformedReferencePoint, this._currentTarget);
  5682. } else {
  5683. this._currentTarget.copyFrom(this._getLockedTargetPosition());
  5684. }
  5685. BABYLON.Matrix.LookAtLHToRef(this.position, this._currentTarget, this.upVector, this._viewMatrix);
  5686. return this._viewMatrix;
  5687. };
  5688. return TargetCamera;
  5689. })(BABYLON.Camera);
  5690. BABYLON.TargetCamera = TargetCamera;
  5691. })(BABYLON || (BABYLON = {}));
  5692. var __extends = this.__extends || function (d, b) {
  5693. for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p];
  5694. function __() { this.constructor = d; }
  5695. __.prototype = b.prototype;
  5696. d.prototype = new __();
  5697. };
  5698. var BABYLON;
  5699. (function (BABYLON) {
  5700. var FollowCamera = (function (_super) {
  5701. __extends(FollowCamera, _super);
  5702. function FollowCamera(name, position, scene) {
  5703. _super.call(this, name, position, scene);
  5704. this.radius = 12;
  5705. this.rotationOffset = 0;
  5706. this.heightOffset = 4;
  5707. this.cameraAcceleration = 0.05;
  5708. this.maxCameraSpeed = 20;
  5709. }
  5710. FollowCamera.prototype.getRadians = function (degrees) {
  5711. return degrees * Math.PI / 180;
  5712. };
  5713. FollowCamera.prototype.follow = function (cameraTarget) {
  5714. if (!cameraTarget)
  5715. return;
  5716. var radians = this.getRadians(this.rotationOffset) + cameraTarget.rotation.y;
  5717. var targetX = cameraTarget.position.x + Math.sin(radians) * this.radius;
  5718. var targetZ = cameraTarget.position.z + Math.cos(radians) * this.radius;
  5719. var dx = targetX - this.position.x;
  5720. var dy = (cameraTarget.position.y + this.heightOffset) - this.position.y;
  5721. var dz = (targetZ) - this.position.z;
  5722. var vx = dx * this.cameraAcceleration * 2;
  5723. var vy = dy * this.cameraAcceleration;
  5724. var vz = dz * this.cameraAcceleration * 2;
  5725. if (vx > this.maxCameraSpeed || vx < -this.maxCameraSpeed) {
  5726. vx = vx < 1 ? -this.maxCameraSpeed : this.maxCameraSpeed;
  5727. }
  5728. if (vy > this.maxCameraSpeed || vy < -this.maxCameraSpeed) {
  5729. vy = vy < 1 ? -this.maxCameraSpeed : this.maxCameraSpeed;
  5730. }
  5731. if (vz > this.maxCameraSpeed || vz < -this.maxCameraSpeed) {
  5732. vz = vz < 1 ? -this.maxCameraSpeed : this.maxCameraSpeed;
  5733. }
  5734. this.position = new BABYLON.Vector3(this.position.x + vx, this.position.y + vy, this.position.z + vz);
  5735. this.setTarget(cameraTarget.position);
  5736. };
  5737. FollowCamera.prototype._update = function () {
  5738. _super.prototype._update.call(this);
  5739. this.follow(this.target);
  5740. };
  5741. return FollowCamera;
  5742. })(BABYLON.TargetCamera);
  5743. BABYLON.FollowCamera = FollowCamera;
  5744. })(BABYLON || (BABYLON = {}));
  5745. var __extends = this.__extends || function (d, b) {
  5746. for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p];
  5747. function __() { this.constructor = d; }
  5748. __.prototype = b.prototype;
  5749. d.prototype = new __();
  5750. };
  5751. var BABYLON;
  5752. (function (BABYLON) {
  5753. var FreeCamera = (function (_super) {
  5754. __extends(FreeCamera, _super);
  5755. function FreeCamera(name, position, scene) {
  5756. _super.call(this, name, position, scene);
  5757. this.ellipsoid = new BABYLON.Vector3(0.5, 1, 0.5);
  5758. this.keysUp = [38];
  5759. this.keysDown = [40];
  5760. this.keysLeft = [37];
  5761. this.keysRight = [39];
  5762. this.checkCollisions = false;
  5763. this.applyGravity = false;
  5764. this.angularSensibility = 2000.0;
  5765. this._keys = [];
  5766. this._collider = new BABYLON.Collider();
  5767. this._needMoveForGravity = true;
  5768. this._oldPosition = BABYLON.Vector3.Zero();
  5769. this._diffPosition = BABYLON.Vector3.Zero();
  5770. this._newPosition = BABYLON.Vector3.Zero();
  5771. }
  5772. FreeCamera.prototype.attachControl = function (element, noPreventDefault) {
  5773. var _this = this;
  5774. var previousPosition;
  5775. var engine = this.getEngine();
  5776. if (this._attachedElement) {
  5777. return;
  5778. }
  5779. this._attachedElement = element;
  5780. if (this._onMouseDown === undefined) {
  5781. this._onMouseDown = function (evt) {
  5782. previousPosition = {
  5783. x: evt.clientX,
  5784. y: evt.clientY
  5785. };
  5786. if (!noPreventDefault) {
  5787. evt.preventDefault();
  5788. }
  5789. };
  5790. this._onMouseUp = function (evt) {
  5791. previousPosition = null;
  5792. if (!noPreventDefault) {
  5793. evt.preventDefault();
  5794. }
  5795. };
  5796. this._onMouseOut = function (evt) {
  5797. previousPosition = null;
  5798. _this._keys = [];
  5799. if (!noPreventDefault) {
  5800. evt.preventDefault();
  5801. }
  5802. };
  5803. this._onMouseMove = function (evt) {
  5804. if (!previousPosition && !engine.isPointerLock) {
  5805. return;
  5806. }
  5807. var offsetX;
  5808. var offsetY;
  5809. if (!engine.isPointerLock) {
  5810. offsetX = evt.clientX - previousPosition.x;
  5811. offsetY = evt.clientY - previousPosition.y;
  5812. } else {
  5813. offsetX = evt.movementX || evt.mozMovementX || evt.webkitMovementX || evt.msMovementX || 0;
  5814. offsetY = evt.movementY || evt.mozMovementY || evt.webkitMovementY || evt.msMovementY || 0;
  5815. }
  5816. _this.cameraRotation.y += offsetX / _this.angularSensibility;
  5817. _this.cameraRotation.x += offsetY / _this.angularSensibility;
  5818. previousPosition = {
  5819. x: evt.clientX,
  5820. y: evt.clientY
  5821. };
  5822. if (!noPreventDefault) {
  5823. evt.preventDefault();
  5824. }
  5825. };
  5826. this._onKeyDown = function (evt) {
  5827. if (_this.keysUp.indexOf(evt.keyCode) !== -1 || _this.keysDown.indexOf(evt.keyCode) !== -1 || _this.keysLeft.indexOf(evt.keyCode) !== -1 || _this.keysRight.indexOf(evt.keyCode) !== -1) {
  5828. var index = _this._keys.indexOf(evt.keyCode);
  5829. if (index === -1) {
  5830. _this._keys.push(evt.keyCode);
  5831. }
  5832. if (!noPreventDefault) {
  5833. evt.preventDefault();
  5834. }
  5835. }
  5836. };
  5837. this._onKeyUp = function (evt) {
  5838. if (_this.keysUp.indexOf(evt.keyCode) !== -1 || _this.keysDown.indexOf(evt.keyCode) !== -1 || _this.keysLeft.indexOf(evt.keyCode) !== -1 || _this.keysRight.indexOf(evt.keyCode) !== -1) {
  5839. var index = _this._keys.indexOf(evt.keyCode);
  5840. if (index >= 0) {
  5841. _this._keys.splice(index, 1);
  5842. }
  5843. if (!noPreventDefault) {
  5844. evt.preventDefault();
  5845. }
  5846. }
  5847. };
  5848. this._onLostFocus = function () {
  5849. _this._keys = [];
  5850. };
  5851. this._reset = function () {
  5852. _this._keys = [];
  5853. previousPosition = null;
  5854. _this.cameraDirection = new BABYLON.Vector3(0, 0, 0);
  5855. _this.cameraRotation = new BABYLON.Vector2(0, 0);
  5856. };
  5857. }
  5858. element.addEventListener("mousedown", this._onMouseDown, false);
  5859. element.addEventListener("mouseup", this._onMouseUp, false);
  5860. element.addEventListener("mouseout", this._onMouseOut, false);
  5861. element.addEventListener("mousemove", this._onMouseMove, false);
  5862. BABYLON.Tools.RegisterTopRootEvents([
  5863. { name: "keydown", handler: this._onKeyDown },
  5864. { name: "keyup", handler: this._onKeyUp },
  5865. { name: "blur", handler: this._onLostFocus }
  5866. ]);
  5867. };
  5868. FreeCamera.prototype.detachControl = function (element) {
  5869. if (this._attachedElement != element) {
  5870. return;
  5871. }
  5872. element.removeEventListener("mousedown", this._onMouseDown);
  5873. element.removeEventListener("mouseup", this._onMouseUp);
  5874. element.removeEventListener("mouseout", this._onMouseOut);
  5875. element.removeEventListener("mousemove", this._onMouseMove);
  5876. BABYLON.Tools.UnregisterTopRootEvents([
  5877. { name: "keydown", handler: this._onKeyDown },
  5878. { name: "keyup", handler: this._onKeyUp },
  5879. { name: "blur", handler: this._onLostFocus }
  5880. ]);
  5881. this._attachedElement = null;
  5882. if (this._reset) {
  5883. this._reset();
  5884. }
  5885. };
  5886. FreeCamera.prototype._collideWithWorld = function (velocity) {
  5887. var globalPosition;
  5888. if (this.parent) {
  5889. globalPosition = BABYLON.Vector3.TransformCoordinates(this.position, this.parent.getWorldMatrix());
  5890. } else {
  5891. globalPosition = this.position;
  5892. }
  5893. globalPosition.subtractFromFloatsToRef(0, this.ellipsoid.y, 0, this._oldPosition);
  5894. this._collider.radius = this.ellipsoid;
  5895. this.getScene()._getNewPosition(this._oldPosition, velocity, this._collider, 3, this._newPosition);
  5896. this._newPosition.subtractToRef(this._oldPosition, this._diffPosition);
  5897. if (this._diffPosition.length() > BABYLON.Engine.CollisionsEpsilon) {
  5898. this.position.addInPlace(this._diffPosition);
  5899. if (this.onCollide) {
  5900. this.onCollide(this._collider.collidedMesh);
  5901. }
  5902. }
  5903. };
  5904. FreeCamera.prototype._checkInputs = function () {
  5905. if (!this._localDirection) {
  5906. this._localDirection = BABYLON.Vector3.Zero();
  5907. this._transformedDirection = BABYLON.Vector3.Zero();
  5908. }
  5909. for (var index = 0; index < this._keys.length; index++) {
  5910. var keyCode = this._keys[index];
  5911. var speed = this._computeLocalCameraSpeed();
  5912. if (this.keysLeft.indexOf(keyCode) !== -1) {
  5913. this._localDirection.copyFromFloats(-speed, 0, 0);
  5914. } else if (this.keysUp.indexOf(keyCode) !== -1) {
  5915. this._localDirection.copyFromFloats(0, 0, speed);
  5916. } else if (this.keysRight.indexOf(keyCode) !== -1) {
  5917. this._localDirection.copyFromFloats(speed, 0, 0);
  5918. } else if (this.keysDown.indexOf(keyCode) !== -1) {
  5919. this._localDirection.copyFromFloats(0, 0, -speed);
  5920. }
  5921. this.getViewMatrix().invertToRef(this._cameraTransformMatrix);
  5922. BABYLON.Vector3.TransformNormalToRef(this._localDirection, this._cameraTransformMatrix, this._transformedDirection);
  5923. this.cameraDirection.addInPlace(this._transformedDirection);
  5924. }
  5925. };
  5926. FreeCamera.prototype._decideIfNeedsToMove = function () {
  5927. return this._needMoveForGravity || Math.abs(this.cameraDirection.x) > 0 || Math.abs(this.cameraDirection.y) > 0 || Math.abs(this.cameraDirection.z) > 0;
  5928. };
  5929. FreeCamera.prototype._updatePosition = function () {
  5930. if (this.checkCollisions && this.getScene().collisionsEnabled) {
  5931. this._collideWithWorld(this.cameraDirection);
  5932. if (this.applyGravity) {
  5933. var oldPosition = this.position;
  5934. this._collideWithWorld(this.getScene().gravity);
  5935. this._needMoveForGravity = (BABYLON.Vector3.DistanceSquared(oldPosition, this.position) != 0);
  5936. }
  5937. } else {
  5938. this.position.addInPlace(this.cameraDirection);
  5939. }
  5940. };
  5941. FreeCamera.prototype._update = function () {
  5942. this._checkInputs();
  5943. _super.prototype._update.call(this);
  5944. };
  5945. return FreeCamera;
  5946. })(BABYLON.TargetCamera);
  5947. BABYLON.FreeCamera = FreeCamera;
  5948. })(BABYLON || (BABYLON = {}));
  5949. var __extends = this.__extends || function (d, b) {
  5950. for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p];
  5951. function __() { this.constructor = d; }
  5952. __.prototype = b.prototype;
  5953. d.prototype = new __();
  5954. };
  5955. var BABYLON;
  5956. (function (BABYLON) {
  5957. var TouchCamera = (function (_super) {
  5958. __extends(TouchCamera, _super);
  5959. function TouchCamera(name, position, scene) {
  5960. _super.call(this, name, position, scene);
  5961. this._offsetX = null;
  5962. this._offsetY = null;
  5963. this._pointerCount = 0;
  5964. this._pointerPressed = [];
  5965. this.angularSensibility = 200000.0;
  5966. this.moveSensibility = 500.0;
  5967. }
  5968. TouchCamera.prototype.attachControl = function (canvas, noPreventDefault) {
  5969. var _this = this;
  5970. var previousPosition;
  5971. if (this._attachedCanvas) {
  5972. return;
  5973. }
  5974. this._attachedCanvas = canvas;
  5975. if (this._onPointerDown === undefined) {
  5976. this._onPointerDown = function (evt) {
  5977. if (!noPreventDefault) {
  5978. evt.preventDefault();
  5979. }
  5980. _this._pointerPressed.push(evt.pointerId);
  5981. if (_this._pointerPressed.length !== 1) {
  5982. return;
  5983. }
  5984. previousPosition = {
  5985. x: evt.clientX,
  5986. y: evt.clientY
  5987. };
  5988. };
  5989. this._onPointerUp = function (evt) {
  5990. if (!noPreventDefault) {
  5991. evt.preventDefault();
  5992. }
  5993. var index = _this._pointerPressed.indexOf(evt.pointerId);
  5994. if (index === -1) {
  5995. return;
  5996. }
  5997. _this._pointerPressed.splice(index, 1);
  5998. if (index != 0) {
  5999. return;
  6000. }
  6001. previousPosition = null;
  6002. _this._offsetX = null;
  6003. _this._offsetY = null;
  6004. };
  6005. this._onPointerMove = function (evt) {
  6006. if (!noPreventDefault) {
  6007. evt.preventDefault();
  6008. }
  6009. if (!previousPosition) {
  6010. return;
  6011. }
  6012. var index = _this._pointerPressed.indexOf(evt.pointerId);
  6013. if (index != 0) {
  6014. return;
  6015. }
  6016. _this._offsetX = evt.clientX - previousPosition.x;
  6017. _this._offsetY = -(evt.clientY - previousPosition.y);
  6018. };
  6019. this._onLostFocus = function () {
  6020. _this._offsetX = null;
  6021. _this._offsetY = null;
  6022. };
  6023. }
  6024. canvas.addEventListener("pointerdown", this._onPointerDown);
  6025. canvas.addEventListener("pointerup", this._onPointerUp);
  6026. canvas.addEventListener("pointerout", this._onPointerUp);
  6027. canvas.addEventListener("pointermove", this._onPointerMove);
  6028. BABYLON.Tools.RegisterTopRootEvents([
  6029. { name: "blur", handler: this._onLostFocus }
  6030. ]);
  6031. };
  6032. TouchCamera.prototype.detachControl = function (canvas) {
  6033. if (this._attachedCanvas != canvas) {
  6034. return;
  6035. }
  6036. canvas.removeEventListener("pointerdown", this._onPointerDown);
  6037. canvas.removeEventListener("pointerup", this._onPointerUp);
  6038. canvas.removeEventListener("pointerout", this._onPointerUp);
  6039. canvas.removeEventListener("pointermove", this._onPointerMove);
  6040. BABYLON.Tools.UnregisterTopRootEvents([
  6041. { name: "blur", handler: this._onLostFocus }
  6042. ]);
  6043. this._attachedCanvas = null;
  6044. };
  6045. TouchCamera.prototype._checkInputs = function () {
  6046. if (!this._offsetX) {
  6047. return;
  6048. }
  6049. this.cameraRotation.y += this._offsetX / this.angularSensibility;
  6050. if (this._pointerPressed.length > 1) {
  6051. this.cameraRotation.x += -this._offsetY / this.angularSensibility;
  6052. } else {
  6053. var speed = this._computeLocalCameraSpeed();
  6054. var direction = new BABYLON.Vector3(0, 0, speed * this._offsetY / this.moveSensibility);
  6055. BABYLON.Matrix.RotationYawPitchRollToRef(this.rotation.y, this.rotation.x, 0, this._cameraRotationMatrix);
  6056. this.cameraDirection.addInPlace(BABYLON.Vector3.TransformCoordinates(direction, this._cameraRotationMatrix));
  6057. }
  6058. };
  6059. return TouchCamera;
  6060. })(BABYLON.FreeCamera);
  6061. BABYLON.TouchCamera = TouchCamera;
  6062. })(BABYLON || (BABYLON = {}));
  6063. var __extends = this.__extends || function (d, b) {
  6064. for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p];
  6065. function __() { this.constructor = d; }
  6066. __.prototype = b.prototype;
  6067. d.prototype = new __();
  6068. };
  6069. var BABYLON;
  6070. (function (BABYLON) {
  6071. var DeviceOrientationCamera = (function (_super) {
  6072. __extends(DeviceOrientationCamera, _super);
  6073. function DeviceOrientationCamera(name, position, scene) {
  6074. var _this = this;
  6075. _super.call(this, name, position, scene);
  6076. this._offsetX = null;
  6077. this._offsetY = null;
  6078. this._orientationGamma = 0;
  6079. this._orientationBeta = 0;
  6080. this._initialOrientationGamma = 0;
  6081. this._initialOrientationBeta = 0;
  6082. this.angularSensibility = 10000.0;
  6083. this.moveSensibility = 50.0;
  6084. window.addEventListener("resize", function () {
  6085. _this._initialOrientationGamma = null;
  6086. }, false);
  6087. }
  6088. DeviceOrientationCamera.prototype.attachControl = function (canvas, noPreventDefault) {
  6089. var _this = this;
  6090. if (this._attachedCanvas) {
  6091. return;
  6092. }
  6093. this._attachedCanvas = canvas;
  6094. if (!this._orientationChanged) {
  6095. this._orientationChanged = function (evt) {
  6096. if (!_this._initialOrientationGamma) {
  6097. _this._initialOrientationGamma = evt.gamma;
  6098. _this._initialOrientationBeta = evt.beta;
  6099. }
  6100. _this._orientationGamma = evt.gamma;
  6101. _this._orientationBeta = evt.beta;
  6102. _this._offsetY = (_this._initialOrientationBeta - _this._orientationBeta);
  6103. _this._offsetX = (_this._initialOrientationGamma - _this._orientationGamma);
  6104. };
  6105. }
  6106. window.addEventListener("deviceorientation", this._orientationChanged);
  6107. };
  6108. DeviceOrientationCamera.prototype.detachControl = function (canvas) {
  6109. if (this._attachedCanvas != canvas) {
  6110. return;
  6111. }
  6112. window.removeEventListener("deviceorientation", this._orientationChanged);
  6113. this._attachedCanvas = null;
  6114. this._orientationGamma = 0;
  6115. this._orientationBeta = 0;
  6116. this._initialOrientationGamma = 0;
  6117. this._initialOrientationBeta = 0;
  6118. };
  6119. DeviceOrientationCamera.prototype._checkInputs = function () {
  6120. if (!this._offsetX) {
  6121. return;
  6122. }
  6123. this.cameraRotation.y -= this._offsetX / this.angularSensibility;
  6124. var speed = this._computeLocalCameraSpeed();
  6125. var direction = new BABYLON.Vector3(0, 0, speed * this._offsetY / this.moveSensibility);
  6126. BABYLON.Matrix.RotationYawPitchRollToRef(this.rotation.y, this.rotation.x, 0, this._cameraRotationMatrix);
  6127. this.cameraDirection.addInPlace(BABYLON.Vector3.TransformCoordinates(direction, this._cameraRotationMatrix));
  6128. };
  6129. return DeviceOrientationCamera;
  6130. })(BABYLON.FreeCamera);
  6131. BABYLON.DeviceOrientationCamera = DeviceOrientationCamera;
  6132. })(BABYLON || (BABYLON = {}));
  6133. var __extends = this.__extends || function (d, b) {
  6134. for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p];
  6135. function __() { this.constructor = d; }
  6136. __.prototype = b.prototype;
  6137. d.prototype = new __();
  6138. };
  6139. var BABYLON;
  6140. (function (BABYLON) {
  6141. var eventPrefix = BABYLON.Tools.GetPointerPrefix();
  6142. var ArcRotateCamera = (function (_super) {
  6143. __extends(ArcRotateCamera, _super);
  6144. function ArcRotateCamera(name, alpha, beta, radius, target, scene) {
  6145. _super.call(this, name, BABYLON.Vector3.Zero(), scene);
  6146. this.alpha = alpha;
  6147. this.beta = beta;
  6148. this.radius = radius;
  6149. this.target = target;
  6150. this.inertialAlphaOffset = 0;
  6151. this.inertialBetaOffset = 0;
  6152. this.inertialRadiusOffset = 0;
  6153. this.lowerAlphaLimit = null;
  6154. this.upperAlphaLimit = null;
  6155. this.lowerBetaLimit = 0.01;
  6156. this.upperBetaLimit = Math.PI;
  6157. this.lowerRadiusLimit = null;
  6158. this.upperRadiusLimit = null;
  6159. this.angularSensibility = 1000.0;
  6160. this.wheelPrecision = 3.0;
  6161. this.keysUp = [38];
  6162. this.keysDown = [40];
  6163. this.keysLeft = [37];
  6164. this.keysRight = [39];
  6165. this.zoomOnFactor = 1;
  6166. this.targetScreenOffset = BABYLON.Vector2.Zero();
  6167. this._keys = [];
  6168. this._viewMatrix = new BABYLON.Matrix();
  6169. this.checkCollisions = false;
  6170. this.collisionRadius = new BABYLON.Vector3(0.5, 0.5, 0.5);
  6171. this._collider = new BABYLON.Collider();
  6172. this._previousPosition = BABYLON.Vector3.Zero();
  6173. this._collisionVelocity = BABYLON.Vector3.Zero();
  6174. this._newPosition = BABYLON.Vector3.Zero();
  6175. this.pinchPrecision = 20;
  6176. this.getViewMatrix();
  6177. }
  6178. ArcRotateCamera.prototype._getTargetPosition = function () {
  6179. return this.target.position || this.target;
  6180. };
  6181. ArcRotateCamera.prototype._initCache = function () {
  6182. _super.prototype._initCache.call(this);
  6183. this._cache.target = new BABYLON.Vector3(Number.MAX_VALUE, Number.MAX_VALUE, Number.MAX_VALUE);
  6184. this._cache.alpha = undefined;
  6185. this._cache.beta = undefined;
  6186. this._cache.radius = undefined;
  6187. this._cache.targetScreenOffset = undefined;
  6188. };
  6189. ArcRotateCamera.prototype._updateCache = function (ignoreParentClass) {
  6190. if (!ignoreParentClass) {
  6191. _super.prototype._updateCache.call(this);
  6192. }
  6193. this._cache.target.copyFrom(this._getTargetPosition());
  6194. this._cache.alpha = this.alpha;
  6195. this._cache.beta = this.beta;
  6196. this._cache.radius = this.radius;
  6197. this._cache.targetScreenOffset = this.targetScreenOffset.clone();
  6198. };
  6199. ArcRotateCamera.prototype._isSynchronizedViewMatrix = function () {
  6200. if (!_super.prototype._isSynchronizedViewMatrix.call(this))
  6201. return false;
  6202. return this._cache.target.equals(this._getTargetPosition()) && this._cache.alpha === this.alpha && this._cache.beta === this.beta && this._cache.radius === this.radius && this._cache.targetScreenOffset.equals(this.targetScreenOffset);
  6203. };
  6204. ArcRotateCamera.prototype.attachControl = function (element, noPreventDefault) {
  6205. var _this = this;
  6206. var previousPosition;
  6207. var pointerId;
  6208. var pinchStarted = false;
  6209. var pinchPointX1, pinchPointX2;
  6210. if (this._attachedElement) {
  6211. return;
  6212. }
  6213. this._attachedElement = element;
  6214. var engine = this.getEngine();
  6215. if (this._onPointerDown === undefined) {
  6216. this._onPointerDown = function (evt) {
  6217. if (pointerId) {
  6218. return;
  6219. }
  6220. pointerId = evt.pointerId;
  6221. previousPosition = {
  6222. x: evt.clientX,
  6223. y: evt.clientY
  6224. };
  6225. if (!noPreventDefault) {
  6226. evt.preventDefault();
  6227. }
  6228. };
  6229. this._onPointerUp = function (evt) {
  6230. previousPosition = null;
  6231. pointerId = null;
  6232. if (!noPreventDefault) {
  6233. evt.preventDefault();
  6234. }
  6235. };
  6236. this._onPointerMove = function (evt) {
  6237. if (!previousPosition) {
  6238. return;
  6239. }
  6240. if (pointerId !== evt.pointerId) {
  6241. return;
  6242. }
  6243. if (pinchStarted) {
  6244. return;
  6245. }
  6246. var offsetX = evt.clientX - previousPosition.x;
  6247. var offsetY = evt.clientY - previousPosition.y;
  6248. _this.inertialAlphaOffset -= offsetX / _this.angularSensibility;
  6249. _this.inertialBetaOffset -= offsetY / _this.angularSensibility;
  6250. previousPosition = {
  6251. x: evt.clientX,
  6252. y: evt.clientY
  6253. };
  6254. if (!noPreventDefault) {
  6255. evt.preventDefault();
  6256. }
  6257. };
  6258. this._onMouseMove = function (evt) {
  6259. if (!engine.isPointerLock) {
  6260. return;
  6261. }
  6262. if (pinchStarted) {
  6263. return;
  6264. }
  6265. var offsetX = evt.movementX || evt.mozMovementX || evt.webkitMovementX || evt.msMovementX || 0;
  6266. var offsetY = evt.movementY || evt.mozMovementY || evt.webkitMovementY || evt.msMovementY || 0;
  6267. _this.inertialAlphaOffset -= offsetX / _this.angularSensibility;
  6268. _this.inertialBetaOffset -= offsetY / _this.angularSensibility;
  6269. if (!noPreventDefault) {
  6270. evt.preventDefault();
  6271. }
  6272. };
  6273. this._wheel = function (event) {
  6274. var delta = 0;
  6275. if (event.wheelDelta) {
  6276. delta = event.wheelDelta / (_this.wheelPrecision * 40);
  6277. } else if (event.detail) {
  6278. delta = -event.detail / _this.wheelPrecision;
  6279. }
  6280. if (delta)
  6281. _this.inertialRadiusOffset += delta;
  6282. if (event.preventDefault) {
  6283. if (!noPreventDefault) {
  6284. event.preventDefault();
  6285. }
  6286. }
  6287. };
  6288. this._onKeyDown = function (evt) {
  6289. if (_this.keysUp.indexOf(evt.keyCode) !== -1 || _this.keysDown.indexOf(evt.keyCode) !== -1 || _this.keysLeft.indexOf(evt.keyCode) !== -1 || _this.keysRight.indexOf(evt.keyCode) !== -1) {
  6290. var index = _this._keys.indexOf(evt.keyCode);
  6291. if (index === -1) {
  6292. _this._keys.push(evt.keyCode);
  6293. }
  6294. if (evt.preventDefault) {
  6295. if (!noPreventDefault) {
  6296. evt.preventDefault();
  6297. }
  6298. }
  6299. }
  6300. };
  6301. this._onKeyUp = function (evt) {
  6302. if (_this.keysUp.indexOf(evt.keyCode) !== -1 || _this.keysDown.indexOf(evt.keyCode) !== -1 || _this.keysLeft.indexOf(evt.keyCode) !== -1 || _this.keysRight.indexOf(evt.keyCode) !== -1) {
  6303. var index = _this._keys.indexOf(evt.keyCode);
  6304. if (index >= 0) {
  6305. _this._keys.splice(index, 1);
  6306. }
  6307. if (evt.preventDefault) {
  6308. if (!noPreventDefault) {
  6309. evt.preventDefault();
  6310. }
  6311. }
  6312. }
  6313. };
  6314. this._onLostFocus = function () {
  6315. _this._keys = [];
  6316. pointerId = null;
  6317. };
  6318. this._onGestureStart = function (e) {
  6319. if (window.MSGesture === undefined) {
  6320. return;
  6321. }
  6322. if (!_this._MSGestureHandler) {
  6323. _this._MSGestureHandler = new MSGesture();
  6324. _this._MSGestureHandler.target = element;
  6325. }
  6326. _this._MSGestureHandler.addPointer(e.pointerId);
  6327. };
  6328. this._onGesture = function (e) {
  6329. _this.radius *= e.scale;
  6330. if (e.preventDefault) {
  6331. if (!noPreventDefault) {
  6332. e.stopPropagation();
  6333. e.preventDefault();
  6334. }
  6335. }
  6336. };
  6337. this._reset = function () {
  6338. _this._keys = [];
  6339. _this.inertialAlphaOffset = 0;
  6340. _this.inertialBetaOffset = 0;
  6341. _this.inertialRadiusOffset = 0;
  6342. previousPosition = null;
  6343. pointerId = null;
  6344. };
  6345. this._touchStart = function (event) {
  6346. if (event.touches.length == 2) {
  6347. pinchStarted = true;
  6348. _this._pinchStart(event);
  6349. }
  6350. };
  6351. this._touchMove = function (event) {
  6352. if (pinchStarted) {
  6353. _this._pinchMove(event);
  6354. }
  6355. };
  6356. this._touchEnd = function (event) {
  6357. if (pinchStarted) {
  6358. _this._pinchEnd(event);
  6359. }
  6360. };
  6361. this._pinchStart = function (event) {
  6362. pinchPointX1 = event.touches[0].clientX;
  6363. pinchPointX2 = event.touches[1].clientX;
  6364. pinchStarted = true;
  6365. };
  6366. this._pinchMove = function (event) {
  6367. var delta = 0;
  6368. var direction = 1;
  6369. var distanceXOrigine, distanceXNow;
  6370. if (event.touches.length != 2)
  6371. return;
  6372. distanceXOrigine = Math.abs(pinchPointX1 - pinchPointX2);
  6373. distanceXNow = Math.abs(event.touches[0].clientX - event.touches[1].clientX);
  6374. if (distanceXNow < distanceXOrigine) {
  6375. direction = -1;
  6376. }
  6377. delta = (_this.pinchPrecision / (_this.wheelPrecision * 40)) * direction;
  6378. _this.inertialRadiusOffset += delta;
  6379. pinchPointX1 = event.touches[0].clientX;
  6380. pinchPointX2 = event.touches[1].clientX;
  6381. };
  6382. this._pinchEnd = function (event) {
  6383. pinchStarted = false;
  6384. };
  6385. }
  6386. element.addEventListener(eventPrefix + "down", this._onPointerDown, false);
  6387. element.addEventListener(eventPrefix + "up", this._onPointerUp, false);
  6388. element.addEventListener(eventPrefix + "out", this._onPointerUp, false);
  6389. element.addEventListener(eventPrefix + "move", this._onPointerMove, false);
  6390. element.addEventListener("mousemove", this._onMouseMove, false);
  6391. element.addEventListener("MSPointerDown", this._onGestureStart, false);
  6392. element.addEventListener("MSGestureChange", this._onGesture, false);
  6393. element.addEventListener('mousewheel', this._wheel, false);
  6394. element.addEventListener('DOMMouseScroll', this._wheel, false);
  6395. element.addEventListener('touchstart', this._touchStart, false);
  6396. element.addEventListener('touchmove', this._touchMove, false);
  6397. element.addEventListener('touchend', this._touchEnd, false);
  6398. BABYLON.Tools.RegisterTopRootEvents([
  6399. { name: "keydown", handler: this._onKeyDown },
  6400. { name: "keyup", handler: this._onKeyUp },
  6401. { name: "blur", handler: this._onLostFocus }
  6402. ]);
  6403. };
  6404. ArcRotateCamera.prototype.detachControl = function (element) {
  6405. if (this._attachedElement != element) {
  6406. return;
  6407. }
  6408. element.removeEventListener(eventPrefix + "down", this._onPointerDown);
  6409. element.removeEventListener(eventPrefix + "up", this._onPointerUp);
  6410. element.removeEventListener(eventPrefix + "out", this._onPointerUp);
  6411. element.removeEventListener(eventPrefix + "move", this._onPointerMove);
  6412. element.removeEventListener("mousemove", this._onMouseMove);
  6413. element.removeEventListener("MSPointerDown", this._onGestureStart);
  6414. element.removeEventListener("MSGestureChange", this._onGesture);
  6415. element.removeEventListener('mousewheel', this._wheel);
  6416. element.removeEventListener('DOMMouseScroll', this._wheel);
  6417. element.removeEventListener('touchstart', this._touchStart);
  6418. element.removeEventListener('touchmove', this._touchMove);
  6419. element.removeEventListener('touchend', this._touchEnd);
  6420. BABYLON.Tools.UnregisterTopRootEvents([
  6421. { name: "keydown", handler: this._onKeyDown },
  6422. { name: "keyup", handler: this._onKeyUp },
  6423. { name: "blur", handler: this._onLostFocus }
  6424. ]);
  6425. this._MSGestureHandler = null;
  6426. this._attachedElement = null;
  6427. if (this._reset) {
  6428. this._reset();
  6429. }
  6430. };
  6431. ArcRotateCamera.prototype._update = function () {
  6432. for (var index = 0; index < this._keys.length; index++) {
  6433. var keyCode = this._keys[index];
  6434. if (this.keysLeft.indexOf(keyCode) !== -1) {
  6435. this.inertialAlphaOffset -= 0.01;
  6436. } else if (this.keysUp.indexOf(keyCode) !== -1) {
  6437. this.inertialBetaOffset -= 0.01;
  6438. } else if (this.keysRight.indexOf(keyCode) !== -1) {
  6439. this.inertialAlphaOffset += 0.01;
  6440. } else if (this.keysDown.indexOf(keyCode) !== -1) {
  6441. this.inertialBetaOffset += 0.01;
  6442. }
  6443. }
  6444. if (this.inertialAlphaOffset != 0 || this.inertialBetaOffset != 0 || this.inertialRadiusOffset != 0) {
  6445. this.alpha += this.inertialAlphaOffset;
  6446. this.beta += this.inertialBetaOffset;
  6447. this.radius -= this.inertialRadiusOffset;
  6448. this.inertialAlphaOffset *= this.inertia;
  6449. this.inertialBetaOffset *= this.inertia;
  6450. this.inertialRadiusOffset *= this.inertia;
  6451. if (Math.abs(this.inertialAlphaOffset) < BABYLON.Engine.Epsilon)
  6452. this.inertialAlphaOffset = 0;
  6453. if (Math.abs(this.inertialBetaOffset) < BABYLON.Engine.Epsilon)
  6454. this.inertialBetaOffset = 0;
  6455. if (Math.abs(this.inertialRadiusOffset) < BABYLON.Engine.Epsilon)
  6456. this.inertialRadiusOffset = 0;
  6457. }
  6458. if (this.lowerAlphaLimit && this.alpha < this.lowerAlphaLimit) {
  6459. this.alpha = this.lowerAlphaLimit;
  6460. }
  6461. if (this.upperAlphaLimit && this.alpha > this.upperAlphaLimit) {
  6462. this.alpha = this.upperAlphaLimit;
  6463. }
  6464. if (this.lowerBetaLimit && this.beta < this.lowerBetaLimit) {
  6465. this.beta = this.lowerBetaLimit;
  6466. }
  6467. if (this.upperBetaLimit && this.beta > this.upperBetaLimit) {
  6468. this.beta = this.upperBetaLimit;
  6469. }
  6470. if (this.lowerRadiusLimit && this.radius < this.lowerRadiusLimit) {
  6471. this.radius = this.lowerRadiusLimit;
  6472. }
  6473. if (this.upperRadiusLimit && this.radius > this.upperRadiusLimit) {
  6474. this.radius = this.upperRadiusLimit;
  6475. }
  6476. };
  6477. ArcRotateCamera.prototype.setPosition = function (position) {
  6478. var radiusv3 = position.subtract(this._getTargetPosition());
  6479. this.radius = radiusv3.length();
  6480. this.alpha = Math.acos(radiusv3.x / Math.sqrt(Math.pow(radiusv3.x, 2) + Math.pow(radiusv3.z, 2)));
  6481. if (radiusv3.z < 0) {
  6482. this.alpha = 2 * Math.PI - this.alpha;
  6483. }
  6484. this.beta = Math.acos(radiusv3.y / this.radius);
  6485. };
  6486. ArcRotateCamera.prototype._getViewMatrix = function () {
  6487. var cosa = Math.cos(this.alpha);
  6488. var sina = Math.sin(this.alpha);
  6489. var cosb = Math.cos(this.beta);
  6490. var sinb = Math.sin(this.beta);
  6491. var target = this._getTargetPosition();
  6492. target.addToRef(new BABYLON.Vector3(this.radius * cosa * sinb, this.radius * cosb, this.radius * sina * sinb), this.position);
  6493. if (this.checkCollisions) {
  6494. this._collider.radius = this.collisionRadius;
  6495. this.position.subtractToRef(this._previousPosition, this._collisionVelocity);
  6496. this.getScene()._getNewPosition(this._previousPosition, this._collisionVelocity, this._collider, 3, this._newPosition);
  6497. if (!this._newPosition.equalsWithEpsilon(this.position)) {
  6498. this.position.copyFrom(this._previousPosition);
  6499. this.alpha = this._previousAlpha;
  6500. this.beta = this._previousBeta;
  6501. this.radius = this._previousRadius;
  6502. if (this.onCollide) {
  6503. this.onCollide(this._collider.collidedMesh);
  6504. }
  6505. }
  6506. }
  6507. BABYLON.Matrix.LookAtLHToRef(this.position, target, this.upVector, this._viewMatrix);
  6508. this._previousAlpha = this.alpha;
  6509. this._previousBeta = this.beta;
  6510. this._previousRadius = this.radius;
  6511. this._previousPosition.copyFrom(this.position);
  6512. this._viewMatrix.m[12] += this.targetScreenOffset.x;
  6513. this._viewMatrix.m[13] += this.targetScreenOffset.y;
  6514. return this._viewMatrix;
  6515. };
  6516. ArcRotateCamera.prototype.zoomOn = function (meshes) {
  6517. meshes = meshes || this.getScene().meshes;
  6518. var minMaxVector = BABYLON.Mesh.MinMax(meshes);
  6519. var distance = BABYLON.Vector3.Distance(minMaxVector.min, minMaxVector.max);
  6520. this.radius = distance * this.zoomOnFactor;
  6521. this.focusOn({ min: minMaxVector.min, max: minMaxVector.max, distance: distance });
  6522. };
  6523. ArcRotateCamera.prototype.focusOn = function (meshesOrMinMaxVectorAndDistance) {
  6524. var meshesOrMinMaxVector;
  6525. var distance;
  6526. if (meshesOrMinMaxVectorAndDistance.min === undefined) {
  6527. meshesOrMinMaxVector = meshesOrMinMaxVectorAndDistance || this.getScene().meshes;
  6528. meshesOrMinMaxVector = BABYLON.Mesh.MinMax(meshesOrMinMaxVector);
  6529. distance = BABYLON.Vector3.Distance(meshesOrMinMaxVector.min, meshesOrMinMaxVector.max);
  6530. } else {
  6531. meshesOrMinMaxVector = meshesOrMinMaxVectorAndDistance;
  6532. distance = meshesOrMinMaxVectorAndDistance.distance;
  6533. }
  6534. this.target = BABYLON.Mesh.Center(meshesOrMinMaxVector);
  6535. this.maxZ = distance * 2;
  6536. };
  6537. return ArcRotateCamera;
  6538. })(BABYLON.Camera);
  6539. BABYLON.ArcRotateCamera = ArcRotateCamera;
  6540. })(BABYLON || (BABYLON = {}));
  6541. var BABYLON;
  6542. (function (BABYLON) {
  6543. var Scene = (function () {
  6544. function Scene(engine) {
  6545. this.autoClear = true;
  6546. this.clearColor = new BABYLON.Color3(0.2, 0.2, 0.3);
  6547. this.ambientColor = new BABYLON.Color3(0, 0, 0);
  6548. this.forceWireframe = false;
  6549. this.forceShowBoundingBoxes = false;
  6550. this.cameraToUseForPointers = null;
  6551. this.fogMode = BABYLON.Scene.FOGMODE_NONE;
  6552. this.fogColor = new BABYLON.Color3(0.2, 0.2, 0.3);
  6553. this.fogDensity = 0.1;
  6554. this.fogStart = 0;
  6555. this.fogEnd = 1000.0;
  6556. this.shadowsEnabled = true;
  6557. this.lightsEnabled = true;
  6558. this.lights = new Array();
  6559. this.cameras = new Array();
  6560. this.activeCameras = new Array();
  6561. this.meshes = new Array();
  6562. this._geometries = new Array();
  6563. this.materials = new Array();
  6564. this.multiMaterials = new Array();
  6565. this.defaultMaterial = new BABYLON.StandardMaterial("default material", this);
  6566. this.texturesEnabled = true;
  6567. this.textures = new Array();
  6568. this.particlesEnabled = true;
  6569. this.particleSystems = new Array();
  6570. this.spriteManagers = new Array();
  6571. this.layers = new Array();
  6572. this.skeletons = new Array();
  6573. this.lensFlaresEnabled = true;
  6574. this.lensFlareSystems = new Array();
  6575. this.collisionsEnabled = true;
  6576. this.gravity = new BABYLON.Vector3(0, -9.0, 0);
  6577. this.postProcessesEnabled = true;
  6578. this.renderTargetsEnabled = true;
  6579. this.customRenderTargets = new Array();
  6580. this.importedMeshesFiles = new Array();
  6581. this._actionManagers = new Array();
  6582. this._meshesForIntersections = new BABYLON.SmartArray(256);
  6583. this.proceduralTexturesEnabled = true;
  6584. this._proceduralTextures = new Array();
  6585. this._totalVertices = 0;
  6586. this._activeVertices = 0;
  6587. this._activeParticles = 0;
  6588. this._lastFrameDuration = 0;
  6589. this._evaluateActiveMeshesDuration = 0;
  6590. this._renderTargetsDuration = 0;
  6591. this._particlesDuration = 0;
  6592. this._renderDuration = 0;
  6593. this._spritesDuration = 0;
  6594. this._animationRatio = 0;
  6595. this._renderId = 0;
  6596. this._executeWhenReadyTimeoutId = -1;
  6597. this._toBeDisposed = new BABYLON.SmartArray(256);
  6598. this._onReadyCallbacks = new Array();
  6599. this._pendingData = [];
  6600. this._onBeforeRenderCallbacks = new Array();
  6601. this._onAfterRenderCallbacks = new Array();
  6602. this._activeMeshes = new BABYLON.SmartArray(256);
  6603. this._processedMaterials = new BABYLON.SmartArray(256);
  6604. this._renderTargets = new BABYLON.SmartArray(256);
  6605. this._activeParticleSystems = new BABYLON.SmartArray(256);
  6606. this._activeSkeletons = new BABYLON.SmartArray(32);
  6607. this._activeAnimatables = new Array();
  6608. this._transformMatrix = BABYLON.Matrix.Zero();
  6609. this._scaledPosition = BABYLON.Vector3.Zero();
  6610. this._scaledVelocity = BABYLON.Vector3.Zero();
  6611. this._engine = engine;
  6612. engine.scenes.push(this);
  6613. this._renderingManager = new BABYLON.RenderingManager(this);
  6614. this.postProcessManager = new BABYLON.PostProcessManager(this);
  6615. this.postProcessRenderPipelineManager = new BABYLON.PostProcessRenderPipelineManager();
  6616. this._boundingBoxRenderer = new BABYLON.BoundingBoxRenderer(this);
  6617. this._outlineRenderer = new BABYLON.OutlineRenderer(this);
  6618. this.attachControl();
  6619. this._debugLayer = new BABYLON.DebugLayer(this);
  6620. }
  6621. Object.defineProperty(Scene.prototype, "debugLayer", {
  6622. get: function () {
  6623. return this._debugLayer;
  6624. },
  6625. enumerable: true,
  6626. configurable: true
  6627. });
  6628. Object.defineProperty(Scene.prototype, "meshUnderPointer", {
  6629. get: function () {
  6630. return this._meshUnderPointer;
  6631. },
  6632. enumerable: true,
  6633. configurable: true
  6634. });
  6635. Object.defineProperty(Scene.prototype, "pointerX", {
  6636. get: function () {
  6637. return this._pointerX;
  6638. },
  6639. enumerable: true,
  6640. configurable: true
  6641. });
  6642. Object.defineProperty(Scene.prototype, "pointerY", {
  6643. get: function () {
  6644. return this._pointerY;
  6645. },
  6646. enumerable: true,
  6647. configurable: true
  6648. });
  6649. Scene.prototype.getBoundingBoxRenderer = function () {
  6650. return this._boundingBoxRenderer;
  6651. };
  6652. Scene.prototype.getOutlineRenderer = function () {
  6653. return this._outlineRenderer;
  6654. };
  6655. Scene.prototype.getEngine = function () {
  6656. return this._engine;
  6657. };
  6658. Scene.prototype.getTotalVertices = function () {
  6659. return this._totalVertices;
  6660. };
  6661. Scene.prototype.getActiveVertices = function () {
  6662. return this._activeVertices;
  6663. };
  6664. Scene.prototype.getActiveParticles = function () {
  6665. return this._activeParticles;
  6666. };
  6667. Scene.prototype.getLastFrameDuration = function () {
  6668. return this._lastFrameDuration;
  6669. };
  6670. Scene.prototype.getEvaluateActiveMeshesDuration = function () {
  6671. return this._evaluateActiveMeshesDuration;
  6672. };
  6673. Scene.prototype.getActiveMeshes = function () {
  6674. return this._activeMeshes;
  6675. };
  6676. Scene.prototype.getRenderTargetsDuration = function () {
  6677. return this._renderTargetsDuration;
  6678. };
  6679. Scene.prototype.getRenderDuration = function () {
  6680. return this._renderDuration;
  6681. };
  6682. Scene.prototype.getParticlesDuration = function () {
  6683. return this._particlesDuration;
  6684. };
  6685. Scene.prototype.getSpritesDuration = function () {
  6686. return this._spritesDuration;
  6687. };
  6688. Scene.prototype.getAnimationRatio = function () {
  6689. return this._animationRatio;
  6690. };
  6691. Scene.prototype.getRenderId = function () {
  6692. return this._renderId;
  6693. };
  6694. Scene.prototype._updatePointerPosition = function (evt) {
  6695. var canvasRect = this._engine.getRenderingCanvasClientRect();
  6696. this._pointerX = evt.clientX - canvasRect.left;
  6697. this._pointerY = evt.clientY - canvasRect.top;
  6698. if (this.cameraToUseForPointers) {
  6699. this._pointerX = this._pointerX - this.cameraToUseForPointers.viewport.x * this._engine.getRenderWidth();
  6700. this._pointerY = this._pointerY - this.cameraToUseForPointers.viewport.y * this._engine.getRenderHeight();
  6701. }
  6702. };
  6703. Scene.prototype.attachControl = function () {
  6704. var _this = this;
  6705. this._onPointerMove = function (evt) {
  6706. var canvas = _this._engine.getRenderingCanvas();
  6707. _this._updatePointerPosition(evt);
  6708. var pickResult = _this.pick(_this._pointerX, _this._pointerY, function (mesh) {
  6709. return mesh.isPickable && mesh.isVisible && mesh.isReady() && mesh.actionManager && mesh.actionManager.hasPointerTriggers;
  6710. }, false, _this.cameraToUseForPointers);
  6711. if (pickResult.hit) {
  6712. _this._meshUnderPointer = pickResult.pickedMesh;
  6713. _this.setPointerOverMesh(pickResult.pickedMesh);
  6714. canvas.style.cursor = "pointer";
  6715. } else {
  6716. _this.setPointerOverMesh(null);
  6717. canvas.style.cursor = "";
  6718. _this._meshUnderPointer = null;
  6719. }
  6720. };
  6721. this._onPointerDown = function (evt) {
  6722. var predicate = null;
  6723. if (!_this.onPointerDown) {
  6724. predicate = function (mesh) {
  6725. return mesh.isPickable && mesh.isVisible && mesh.isReady() && mesh.actionManager && mesh.actionManager.hasPickTriggers;
  6726. };
  6727. }
  6728. _this._updatePointerPosition(evt);
  6729. var pickResult = _this.pick(_this._pointerX, _this._pointerY, predicate, false, _this.cameraToUseForPointers);
  6730. if (pickResult.hit) {
  6731. if (pickResult.pickedMesh.actionManager) {
  6732. switch (evt.button) {
  6733. case 0:
  6734. pickResult.pickedMesh.actionManager.processTrigger(BABYLON.ActionManager.OnLeftPickTrigger, BABYLON.ActionEvent.CreateNew(pickResult.pickedMesh));
  6735. break;
  6736. case 1:
  6737. pickResult.pickedMesh.actionManager.processTrigger(BABYLON.ActionManager.OnCenterPickTrigger, BABYLON.ActionEvent.CreateNew(pickResult.pickedMesh));
  6738. break;
  6739. case 2:
  6740. pickResult.pickedMesh.actionManager.processTrigger(BABYLON.ActionManager.OnRightPickTrigger, BABYLON.ActionEvent.CreateNew(pickResult.pickedMesh));
  6741. break;
  6742. }
  6743. pickResult.pickedMesh.actionManager.processTrigger(BABYLON.ActionManager.OnPickTrigger, BABYLON.ActionEvent.CreateNew(pickResult.pickedMesh));
  6744. }
  6745. }
  6746. if (_this.onPointerDown) {
  6747. _this.onPointerDown(evt, pickResult);
  6748. }
  6749. };
  6750. this._onKeyDown = function (evt) {
  6751. if (_this.actionManager) {
  6752. _this.actionManager.processTrigger(BABYLON.ActionManager.OnKeyDownTrigger, BABYLON.ActionEvent.CreateNewFromScene(_this, evt));
  6753. }
  6754. };
  6755. this._onKeyUp = function (evt) {
  6756. if (_this.actionManager) {
  6757. _this.actionManager.processTrigger(BABYLON.ActionManager.OnKeyUpTrigger, BABYLON.ActionEvent.CreateNewFromScene(_this, evt));
  6758. }
  6759. };
  6760. var eventPrefix = BABYLON.Tools.GetPointerPrefix();
  6761. this._engine.getRenderingCanvas().addEventListener(eventPrefix + "move", this._onPointerMove, false);
  6762. this._engine.getRenderingCanvas().addEventListener(eventPrefix + "down", this._onPointerDown, false);
  6763. window.addEventListener("keydown", this._onKeyDown, false);
  6764. window.addEventListener("keyup", this._onKeyUp, false);
  6765. };
  6766. Scene.prototype.detachControl = function () {
  6767. var eventPrefix = BABYLON.Tools.GetPointerPrefix();
  6768. this._engine.getRenderingCanvas().removeEventListener(eventPrefix + "move", this._onPointerMove);
  6769. this._engine.getRenderingCanvas().removeEventListener(eventPrefix + "down", this._onPointerDown);
  6770. window.removeEventListener("keydown", this._onKeyDown);
  6771. window.removeEventListener("keyup", this._onKeyUp);
  6772. };
  6773. Scene.prototype.isReady = function () {
  6774. if (this._pendingData.length > 0) {
  6775. return false;
  6776. }
  6777. for (var index = 0; index < this._geometries.length; index++) {
  6778. var geometry = this._geometries[index];
  6779. if (geometry.delayLoadState === BABYLON.Engine.DELAYLOADSTATE_LOADING) {
  6780. return false;
  6781. }
  6782. }
  6783. for (index = 0; index < this.meshes.length; index++) {
  6784. var mesh = this.meshes[index];
  6785. if (!mesh.isReady()) {
  6786. return false;
  6787. }
  6788. var mat = mesh.material;
  6789. if (mat) {
  6790. if (!mat.isReady(mesh)) {
  6791. return false;
  6792. }
  6793. }
  6794. }
  6795. return true;
  6796. };
  6797. Scene.prototype.registerBeforeRender = function (func) {
  6798. this._onBeforeRenderCallbacks.push(func);
  6799. };
  6800. Scene.prototype.unregisterBeforeRender = function (func) {
  6801. var index = this._onBeforeRenderCallbacks.indexOf(func);
  6802. if (index > -1) {
  6803. this._onBeforeRenderCallbacks.splice(index, 1);
  6804. }
  6805. };
  6806. Scene.prototype.registerAfterRender = function (func) {
  6807. this._onAfterRenderCallbacks.push(func);
  6808. };
  6809. Scene.prototype.unregisterAfterRender = function (func) {
  6810. var index = this._onAfterRenderCallbacks.indexOf(func);
  6811. if (index > -1) {
  6812. this._onAfterRenderCallbacks.splice(index, 1);
  6813. }
  6814. };
  6815. Scene.prototype._addPendingData = function (data) {
  6816. this._pendingData.push(data);
  6817. };
  6818. Scene.prototype._removePendingData = function (data) {
  6819. var index = this._pendingData.indexOf(data);
  6820. if (index !== -1) {
  6821. this._pendingData.splice(index, 1);
  6822. }
  6823. };
  6824. Scene.prototype.getWaitingItemsCount = function () {
  6825. return this._pendingData.length;
  6826. };
  6827. Scene.prototype.executeWhenReady = function (func) {
  6828. var _this = this;
  6829. this._onReadyCallbacks.push(func);
  6830. if (this._executeWhenReadyTimeoutId !== -1) {
  6831. return;
  6832. }
  6833. this._executeWhenReadyTimeoutId = setTimeout(function () {
  6834. _this._checkIsReady();
  6835. }, 150);
  6836. };
  6837. Scene.prototype._checkIsReady = function () {
  6838. var _this = this;
  6839. if (this.isReady()) {
  6840. this._onReadyCallbacks.forEach(function (func) {
  6841. func();
  6842. });
  6843. this._onReadyCallbacks = [];
  6844. this._executeWhenReadyTimeoutId = -1;
  6845. return;
  6846. }
  6847. this._executeWhenReadyTimeoutId = setTimeout(function () {
  6848. _this._checkIsReady();
  6849. }, 150);
  6850. };
  6851. Scene.prototype.beginAnimation = function (target, from, to, loop, speedRatio, onAnimationEnd, animatable) {
  6852. if (speedRatio === undefined) {
  6853. speedRatio = 1.0;
  6854. }
  6855. this.stopAnimation(target);
  6856. if (!animatable) {
  6857. animatable = new BABYLON.Animatable(this, target, from, to, loop, speedRatio, onAnimationEnd);
  6858. }
  6859. if (target.animations) {
  6860. animatable.appendAnimations(target, target.animations);
  6861. }
  6862. if (target.getAnimatables) {
  6863. var animatables = target.getAnimatables();
  6864. for (var index = 0; index < animatables.length; index++) {
  6865. this.beginAnimation(animatables[index], from, to, loop, speedRatio, onAnimationEnd, animatable);
  6866. }
  6867. }
  6868. return animatable;
  6869. };
  6870. Scene.prototype.beginDirectAnimation = function (target, animations, from, to, loop, speedRatio, onAnimationEnd) {
  6871. if (speedRatio === undefined) {
  6872. speedRatio = 1.0;
  6873. }
  6874. var animatable = new BABYLON.Animatable(this, target, from, to, loop, speedRatio, onAnimationEnd, animations);
  6875. return animatable;
  6876. };
  6877. Scene.prototype.getAnimatableByTarget = function (target) {
  6878. for (var index = 0; index < this._activeAnimatables.length; index++) {
  6879. if (this._activeAnimatables[index].target === target) {
  6880. return this._activeAnimatables[index];
  6881. }
  6882. }
  6883. return null;
  6884. };
  6885. Scene.prototype.stopAnimation = function (target) {
  6886. var animatable = this.getAnimatableByTarget(target);
  6887. if (animatable) {
  6888. animatable.stop();
  6889. }
  6890. };
  6891. Scene.prototype._animate = function () {
  6892. if (!this._animationStartDate) {
  6893. this._animationStartDate = BABYLON.Tools.Now;
  6894. }
  6895. var now = BABYLON.Tools.Now;
  6896. var delay = now - this._animationStartDate;
  6897. for (var index = 0; index < this._activeAnimatables.length; index++) {
  6898. if (!this._activeAnimatables[index]._animate(delay)) {
  6899. this._activeAnimatables.splice(index, 1);
  6900. index--;
  6901. }
  6902. }
  6903. };
  6904. Scene.prototype.getViewMatrix = function () {
  6905. return this._viewMatrix;
  6906. };
  6907. Scene.prototype.getProjectionMatrix = function () {
  6908. return this._projectionMatrix;
  6909. };
  6910. Scene.prototype.getTransformMatrix = function () {
  6911. return this._transformMatrix;
  6912. };
  6913. Scene.prototype.setTransformMatrix = function (view, projection) {
  6914. this._viewMatrix = view;
  6915. this._projectionMatrix = projection;
  6916. this._viewMatrix.multiplyToRef(this._projectionMatrix, this._transformMatrix);
  6917. };
  6918. Scene.prototype.setActiveCameraByID = function (id) {
  6919. var camera = this.getCameraByID(id);
  6920. if (camera) {
  6921. this.activeCamera = camera;
  6922. return camera;
  6923. }
  6924. return null;
  6925. };
  6926. Scene.prototype.setActiveCameraByName = function (name) {
  6927. var camera = this.getCameraByName(name);
  6928. if (camera) {
  6929. this.activeCamera = camera;
  6930. return camera;
  6931. }
  6932. return null;
  6933. };
  6934. Scene.prototype.getMaterialByID = function (id) {
  6935. for (var index = 0; index < this.materials.length; index++) {
  6936. if (this.materials[index].id === id) {
  6937. return this.materials[index];
  6938. }
  6939. }
  6940. return null;
  6941. };
  6942. Scene.prototype.getMaterialByName = function (name) {
  6943. for (var index = 0; index < this.materials.length; index++) {
  6944. if (this.materials[index].name === name) {
  6945. return this.materials[index];
  6946. }
  6947. }
  6948. return null;
  6949. };
  6950. Scene.prototype.getCameraByID = function (id) {
  6951. for (var index = 0; index < this.cameras.length; index++) {
  6952. if (this.cameras[index].id === id) {
  6953. return this.cameras[index];
  6954. }
  6955. }
  6956. return null;
  6957. };
  6958. Scene.prototype.getCameraByName = function (name) {
  6959. for (var index = 0; index < this.cameras.length; index++) {
  6960. if (this.cameras[index].name === name) {
  6961. return this.cameras[index];
  6962. }
  6963. }
  6964. return null;
  6965. };
  6966. Scene.prototype.getLightByName = function (name) {
  6967. for (var index = 0; index < this.lights.length; index++) {
  6968. if (this.lights[index].name === name) {
  6969. return this.lights[index];
  6970. }
  6971. }
  6972. return null;
  6973. };
  6974. Scene.prototype.getLightByID = function (id) {
  6975. for (var index = 0; index < this.lights.length; index++) {
  6976. if (this.lights[index].id === id) {
  6977. return this.lights[index];
  6978. }
  6979. }
  6980. return null;
  6981. };
  6982. Scene.prototype.getGeometryByID = function (id) {
  6983. for (var index = 0; index < this._geometries.length; index++) {
  6984. if (this._geometries[index].id === id) {
  6985. return this._geometries[index];
  6986. }
  6987. }
  6988. return null;
  6989. };
  6990. Scene.prototype.pushGeometry = function (geometry, force) {
  6991. if (!force && this.getGeometryByID(geometry.id)) {
  6992. return false;
  6993. }
  6994. this._geometries.push(geometry);
  6995. return true;
  6996. };
  6997. Scene.prototype.getGeometries = function () {
  6998. return this._geometries;
  6999. };
  7000. Scene.prototype.getMeshByID = function (id) {
  7001. for (var index = 0; index < this.meshes.length; index++) {
  7002. if (this.meshes[index].id === id) {
  7003. return this.meshes[index];
  7004. }
  7005. }
  7006. return null;
  7007. };
  7008. Scene.prototype.getLastMeshByID = function (id) {
  7009. for (var index = this.meshes.length - 1; index >= 0; index--) {
  7010. if (this.meshes[index].id === id) {
  7011. return this.meshes[index];
  7012. }
  7013. }
  7014. return null;
  7015. };
  7016. Scene.prototype.getLastEntryByID = function (id) {
  7017. for (var index = this.meshes.length - 1; index >= 0; index--) {
  7018. if (this.meshes[index].id === id) {
  7019. return this.meshes[index];
  7020. }
  7021. }
  7022. for (index = this.cameras.length - 1; index >= 0; index--) {
  7023. if (this.cameras[index].id === id) {
  7024. return this.cameras[index];
  7025. }
  7026. }
  7027. for (index = this.lights.length - 1; index >= 0; index--) {
  7028. if (this.lights[index].id === id) {
  7029. return this.lights[index];
  7030. }
  7031. }
  7032. return null;
  7033. };
  7034. Scene.prototype.getMeshByName = function (name) {
  7035. for (var index = 0; index < this.meshes.length; index++) {
  7036. if (this.meshes[index].name === name) {
  7037. return this.meshes[index];
  7038. }
  7039. }
  7040. return null;
  7041. };
  7042. Scene.prototype.getLastSkeletonByID = function (id) {
  7043. for (var index = this.skeletons.length - 1; index >= 0; index--) {
  7044. if (this.skeletons[index].id === id) {
  7045. return this.skeletons[index];
  7046. }
  7047. }
  7048. return null;
  7049. };
  7050. Scene.prototype.getSkeletonById = function (id) {
  7051. for (var index = 0; index < this.skeletons.length; index++) {
  7052. if (this.skeletons[index].id === id) {
  7053. return this.skeletons[index];
  7054. }
  7055. }
  7056. return null;
  7057. };
  7058. Scene.prototype.getSkeletonByName = function (name) {
  7059. for (var index = 0; index < this.skeletons.length; index++) {
  7060. if (this.skeletons[index].name === name) {
  7061. return this.skeletons[index];
  7062. }
  7063. }
  7064. return null;
  7065. };
  7066. Scene.prototype.isActiveMesh = function (mesh) {
  7067. return (this._activeMeshes.indexOf(mesh) !== -1);
  7068. };
  7069. Scene.prototype._evaluateSubMesh = function (subMesh, mesh) {
  7070. if (mesh.subMeshes.length == 1 || subMesh.isInFrustum(this._frustumPlanes)) {
  7071. var material = subMesh.getMaterial();
  7072. if (mesh.showSubMeshesBoundingBox) {
  7073. this._boundingBoxRenderer.renderList.push(subMesh.getBoundingInfo().boundingBox);
  7074. }
  7075. if (material) {
  7076. if (material.getRenderTargetTextures) {
  7077. if (this._processedMaterials.indexOf(material) === -1) {
  7078. this._processedMaterials.push(material);
  7079. this._renderTargets.concat(material.getRenderTargetTextures());
  7080. }
  7081. }
  7082. this._activeVertices += subMesh.verticesCount;
  7083. this._renderingManager.dispatch(subMesh);
  7084. }
  7085. }
  7086. };
  7087. Scene.prototype._evaluateActiveMeshes = function () {
  7088. this._activeMeshes.reset();
  7089. this._renderingManager.reset();
  7090. this._processedMaterials.reset();
  7091. this._activeParticleSystems.reset();
  7092. this._activeSkeletons.reset();
  7093. this._boundingBoxRenderer.reset();
  7094. if (!this._frustumPlanes) {
  7095. this._frustumPlanes = BABYLON.Frustum.GetPlanes(this._transformMatrix);
  7096. } else {
  7097. BABYLON.Frustum.GetPlanesToRef(this._transformMatrix, this._frustumPlanes);
  7098. }
  7099. var meshes;
  7100. var len;
  7101. if (this._selectionOctree) {
  7102. var selection = this._selectionOctree.select(this._frustumPlanes);
  7103. meshes = selection.data;
  7104. len = selection.length;
  7105. } else {
  7106. len = this.meshes.length;
  7107. meshes = this.meshes;
  7108. }
  7109. for (var meshIndex = 0; meshIndex < len; meshIndex++) {
  7110. var mesh = meshes[meshIndex];
  7111. if (mesh.isBlocked) {
  7112. continue;
  7113. }
  7114. this._totalVertices += mesh.getTotalVertices();
  7115. if (!mesh.isReady()) {
  7116. continue;
  7117. }
  7118. mesh.computeWorldMatrix();
  7119. if (mesh.actionManager && mesh.actionManager.hasSpecificTriggers([BABYLON.ActionManager.OnIntersectionEnterTrigger, BABYLON.ActionManager.OnIntersectionExitTrigger])) {
  7120. this._meshesForIntersections.pushNoDuplicate(mesh);
  7121. }
  7122. var meshLOD = mesh.getLOD(this.activeCamera);
  7123. if (!meshLOD) {
  7124. continue;
  7125. }
  7126. mesh._preActivate();
  7127. if (mesh.isEnabled() && mesh.isVisible && mesh.visibility > 0 && ((mesh.layerMask & this.activeCamera.layerMask) != 0) && mesh.isInFrustum(this._frustumPlanes)) {
  7128. this._activeMeshes.push(mesh);
  7129. mesh._activate(this._renderId);
  7130. this._activeMesh(meshLOD);
  7131. }
  7132. }
  7133. var beforeParticlesDate = BABYLON.Tools.Now;
  7134. if (this.particlesEnabled) {
  7135. BABYLON.Tools.StartPerformanceCounter("Particles", this.particleSystems.length > 0);
  7136. for (var particleIndex = 0; particleIndex < this.particleSystems.length; particleIndex++) {
  7137. var particleSystem = this.particleSystems[particleIndex];
  7138. if (!particleSystem.isStarted()) {
  7139. continue;
  7140. }
  7141. if (!particleSystem.emitter.position || (particleSystem.emitter && particleSystem.emitter.isEnabled())) {
  7142. this._activeParticleSystems.push(particleSystem);
  7143. particleSystem.animate();
  7144. }
  7145. }
  7146. BABYLON.Tools.EndPerformanceCounter("Particles", this.particleSystems.length > 0);
  7147. }
  7148. this._particlesDuration += BABYLON.Tools.Now - beforeParticlesDate;
  7149. };
  7150. Scene.prototype._activeMesh = function (mesh) {
  7151. if (mesh.skeleton) {
  7152. this._activeSkeletons.pushNoDuplicate(mesh.skeleton);
  7153. }
  7154. if (mesh.showBoundingBox || this.forceShowBoundingBoxes) {
  7155. this._boundingBoxRenderer.renderList.push(mesh.getBoundingInfo().boundingBox);
  7156. }
  7157. if (mesh && mesh.subMeshes) {
  7158. var len;
  7159. var subMeshes;
  7160. if (mesh._submeshesOctree && mesh.useOctreeForRenderingSelection) {
  7161. var intersections = mesh._submeshesOctree.select(this._frustumPlanes);
  7162. len = intersections.length;
  7163. subMeshes = intersections.data;
  7164. } else {
  7165. subMeshes = mesh.subMeshes;
  7166. len = subMeshes.length;
  7167. }
  7168. for (var subIndex = 0; subIndex < len; subIndex++) {
  7169. var subMesh = subMeshes[subIndex];
  7170. this._evaluateSubMesh(subMesh, mesh);
  7171. }
  7172. }
  7173. };
  7174. Scene.prototype.updateTransformMatrix = function (force) {
  7175. this.setTransformMatrix(this.activeCamera.getViewMatrix(), this.activeCamera.getProjectionMatrix(force));
  7176. };
  7177. Scene.prototype._renderForCamera = function (camera) {
  7178. var engine = this._engine;
  7179. this.activeCamera = camera;
  7180. if (!this.activeCamera)
  7181. throw new Error("Active camera not set");
  7182. BABYLON.Tools.StartPerformanceCounter("Rendering camera " + this.activeCamera.name);
  7183. engine.setViewport(this.activeCamera.viewport);
  7184. this._renderId++;
  7185. this.updateTransformMatrix();
  7186. if (this.beforeCameraRender) {
  7187. this.beforeCameraRender(this.activeCamera);
  7188. }
  7189. var beforeEvaluateActiveMeshesDate = BABYLON.Tools.Now;
  7190. BABYLON.Tools.StartPerformanceCounter("Active meshes evaluation");
  7191. this._evaluateActiveMeshes();
  7192. this._evaluateActiveMeshesDuration += BABYLON.Tools.Now - beforeEvaluateActiveMeshesDate;
  7193. BABYLON.Tools.EndPerformanceCounter("Active meshes evaluation");
  7194. for (var skeletonIndex = 0; skeletonIndex < this._activeSkeletons.length; skeletonIndex++) {
  7195. var skeleton = this._activeSkeletons.data[skeletonIndex];
  7196. skeleton.prepare();
  7197. }
  7198. var beforeRenderTargetDate = BABYLON.Tools.Now;
  7199. if (this.renderTargetsEnabled) {
  7200. BABYLON.Tools.StartPerformanceCounter("Render targets", this._renderTargets.length > 0);
  7201. for (var renderIndex = 0; renderIndex < this._renderTargets.length; renderIndex++) {
  7202. var renderTarget = this._renderTargets.data[renderIndex];
  7203. if (renderTarget._shouldRender()) {
  7204. this._renderId++;
  7205. renderTarget.render();
  7206. }
  7207. }
  7208. BABYLON.Tools.EndPerformanceCounter("Render targets", this._renderTargets.length > 0);
  7209. this._renderId++;
  7210. }
  7211. if (this._renderTargets.length > 0) {
  7212. engine.restoreDefaultFramebuffer();
  7213. }
  7214. this._renderTargetsDuration += BABYLON.Tools.Now - beforeRenderTargetDate;
  7215. this.postProcessManager._prepareFrame();
  7216. var beforeRenderDate = BABYLON.Tools.Now;
  7217. if (this.layers.length) {
  7218. engine.setDepthBuffer(false);
  7219. var layerIndex;
  7220. var layer;
  7221. for (layerIndex = 0; layerIndex < this.layers.length; layerIndex++) {
  7222. layer = this.layers[layerIndex];
  7223. if (layer.isBackground) {
  7224. layer.render();
  7225. }
  7226. }
  7227. engine.setDepthBuffer(true);
  7228. }
  7229. BABYLON.Tools.StartPerformanceCounter("Main render");
  7230. this._renderingManager.render(null, null, true, true);
  7231. BABYLON.Tools.EndPerformanceCounter("Main render");
  7232. this._boundingBoxRenderer.render();
  7233. if (this.lensFlaresEnabled) {
  7234. BABYLON.Tools.StartPerformanceCounter("Lens flares", this.lensFlareSystems.length > 0);
  7235. for (var lensFlareSystemIndex = 0; lensFlareSystemIndex < this.lensFlareSystems.length; lensFlareSystemIndex++) {
  7236. this.lensFlareSystems[lensFlareSystemIndex].render();
  7237. }
  7238. BABYLON.Tools.EndPerformanceCounter("Lens flares", this.lensFlareSystems.length > 0);
  7239. }
  7240. if (this.layers.length) {
  7241. engine.setDepthBuffer(false);
  7242. for (layerIndex = 0; layerIndex < this.layers.length; layerIndex++) {
  7243. layer = this.layers[layerIndex];
  7244. if (!layer.isBackground) {
  7245. layer.render();
  7246. }
  7247. }
  7248. engine.setDepthBuffer(true);
  7249. }
  7250. this._renderDuration += BABYLON.Tools.Now - beforeRenderDate;
  7251. this.postProcessManager._finalizeFrame(camera.isIntermediate);
  7252. this.activeCamera._updateFromScene();
  7253. this._renderTargets.reset();
  7254. if (this.afterCameraRender) {
  7255. this.afterCameraRender(this.activeCamera);
  7256. }
  7257. BABYLON.Tools.EndPerformanceCounter("Rendering camera " + this.activeCamera.name);
  7258. };
  7259. Scene.prototype._processSubCameras = function (camera) {
  7260. if (camera.subCameras.length == 0) {
  7261. this._renderForCamera(camera);
  7262. return;
  7263. }
  7264. for (var index = 0; index < camera.subCameras.length; index++) {
  7265. this._renderForCamera(camera.subCameras[index]);
  7266. }
  7267. this.activeCamera = camera;
  7268. this.setTransformMatrix(this.activeCamera.getViewMatrix(), this.activeCamera.getProjectionMatrix());
  7269. this.activeCamera._updateFromScene();
  7270. };
  7271. Scene.prototype._checkIntersections = function () {
  7272. for (var index = 0; index < this._meshesForIntersections.length; index++) {
  7273. var sourceMesh = this._meshesForIntersections.data[index];
  7274. for (var actionIndex = 0; actionIndex < sourceMesh.actionManager.actions.length; actionIndex++) {
  7275. var action = sourceMesh.actionManager.actions[actionIndex];
  7276. if (action.trigger == BABYLON.ActionManager.OnIntersectionEnterTrigger || action.trigger == BABYLON.ActionManager.OnIntersectionExitTrigger) {
  7277. var otherMesh = action.getTriggerParameter();
  7278. var areIntersecting = otherMesh.intersectsMesh(sourceMesh, false);
  7279. var currentIntersectionInProgress = sourceMesh._intersectionsInProgress.indexOf(otherMesh);
  7280. if (areIntersecting && currentIntersectionInProgress === -1 && action.trigger == BABYLON.ActionManager.OnIntersectionEnterTrigger) {
  7281. sourceMesh.actionManager.processTrigger(BABYLON.ActionManager.OnIntersectionEnterTrigger, BABYLON.ActionEvent.CreateNew(sourceMesh));
  7282. sourceMesh._intersectionsInProgress.push(otherMesh);
  7283. } else if (!areIntersecting && currentIntersectionInProgress > -1 && action.trigger == BABYLON.ActionManager.OnIntersectionExitTrigger) {
  7284. sourceMesh.actionManager.processTrigger(BABYLON.ActionManager.OnIntersectionExitTrigger, BABYLON.ActionEvent.CreateNew(sourceMesh));
  7285. var indexOfOther = sourceMesh._intersectionsInProgress.indexOf(otherMesh);
  7286. if (indexOfOther > -1) {
  7287. sourceMesh._intersectionsInProgress.splice(indexOfOther, 1);
  7288. }
  7289. }
  7290. }
  7291. }
  7292. }
  7293. };
  7294. Scene.prototype.render = function () {
  7295. var startDate = BABYLON.Tools.Now;
  7296. this._particlesDuration = 0;
  7297. this._spritesDuration = 0;
  7298. this._activeParticles = 0;
  7299. this._renderDuration = 0;
  7300. this._renderTargetsDuration = 0;
  7301. this._evaluateActiveMeshesDuration = 0;
  7302. this._totalVertices = 0;
  7303. this._activeVertices = 0;
  7304. this.getEngine().resetDrawCalls();
  7305. this._meshesForIntersections.reset();
  7306. BABYLON.Tools.StartPerformanceCounter("Scene rendering");
  7307. if (this.actionManager) {
  7308. this.actionManager.processTrigger(BABYLON.ActionManager.OnEveryFrameTrigger, null);
  7309. }
  7310. if (this.beforeRender) {
  7311. this.beforeRender();
  7312. }
  7313. for (var callbackIndex = 0; callbackIndex < this._onBeforeRenderCallbacks.length; callbackIndex++) {
  7314. this._onBeforeRenderCallbacks[callbackIndex]();
  7315. }
  7316. var deltaTime = Math.max(Scene.MinDeltaTime, Math.min(BABYLON.Tools.GetDeltaTime(), Scene.MaxDeltaTime));
  7317. this._animationRatio = deltaTime * (60.0 / 1000.0);
  7318. this._animate();
  7319. if (this._physicsEngine) {
  7320. BABYLON.Tools.StartPerformanceCounter("Physics");
  7321. this._physicsEngine._runOneStep(deltaTime / 1000.0);
  7322. BABYLON.Tools.EndPerformanceCounter("Physics");
  7323. }
  7324. var beforeRenderTargetDate = BABYLON.Tools.Now;
  7325. var engine = this.getEngine();
  7326. if (this.renderTargetsEnabled) {
  7327. BABYLON.Tools.StartPerformanceCounter("Custom render targets", this.customRenderTargets.length > 0);
  7328. for (var customIndex = 0; customIndex < this.customRenderTargets.length; customIndex++) {
  7329. var renderTarget = this.customRenderTargets[customIndex];
  7330. if (renderTarget._shouldRender()) {
  7331. this._renderId++;
  7332. this.activeCamera = renderTarget.activeCamera || this.activeCamera;
  7333. if (!this.activeCamera)
  7334. throw new Error("Active camera not set");
  7335. engine.setViewport(this.activeCamera.viewport);
  7336. this.updateTransformMatrix();
  7337. renderTarget.render();
  7338. }
  7339. }
  7340. BABYLON.Tools.EndPerformanceCounter("Custom render targets", this.customRenderTargets.length > 0);
  7341. this._renderId++;
  7342. }
  7343. if (this.customRenderTargets.length > 0) {
  7344. engine.restoreDefaultFramebuffer();
  7345. }
  7346. this._renderTargetsDuration += BABYLON.Tools.Now - beforeRenderTargetDate;
  7347. if (this.proceduralTexturesEnabled) {
  7348. BABYLON.Tools.StartPerformanceCounter("Procedural textures", this._proceduralTextures.length > 0);
  7349. for (var proceduralIndex = 0; proceduralIndex < this._proceduralTextures.length; proceduralIndex++) {
  7350. var proceduralTexture = this._proceduralTextures[proceduralIndex];
  7351. if (proceduralTexture._shouldRender()) {
  7352. proceduralTexture.render();
  7353. }
  7354. }
  7355. BABYLON.Tools.EndPerformanceCounter("Procedural textures", this._proceduralTextures.length > 0);
  7356. }
  7357. this._engine.clear(this.clearColor, this.autoClear || this.forceWireframe, true);
  7358. if (this.shadowsEnabled) {
  7359. for (var lightIndex = 0; lightIndex < this.lights.length; lightIndex++) {
  7360. var light = this.lights[lightIndex];
  7361. var shadowGenerator = light.getShadowGenerator();
  7362. if (light.isEnabled() && shadowGenerator && shadowGenerator.getShadowMap().getScene().textures.indexOf(shadowGenerator.getShadowMap()) !== -1) {
  7363. this._renderTargets.push(shadowGenerator.getShadowMap());
  7364. }
  7365. }
  7366. }
  7367. this.postProcessRenderPipelineManager.update();
  7368. if (this.activeCameras.length > 0) {
  7369. var currentRenderId = this._renderId;
  7370. for (var cameraIndex = 0; cameraIndex < this.activeCameras.length; cameraIndex++) {
  7371. this._renderId = currentRenderId;
  7372. this._processSubCameras(this.activeCameras[cameraIndex]);
  7373. }
  7374. } else {
  7375. if (!this.activeCamera) {
  7376. throw new Error("No camera defined");
  7377. }
  7378. this._processSubCameras(this.activeCamera);
  7379. }
  7380. this._checkIntersections();
  7381. this._updateAudioParameters();
  7382. if (this.afterRender) {
  7383. this.afterRender();
  7384. }
  7385. for (callbackIndex = 0; callbackIndex < this._onAfterRenderCallbacks.length; callbackIndex++) {
  7386. this._onAfterRenderCallbacks[callbackIndex]();
  7387. }
  7388. for (var index = 0; index < this._toBeDisposed.length; index++) {
  7389. this._toBeDisposed.data[index].dispose();
  7390. this._toBeDisposed[index] = null;
  7391. }
  7392. this._toBeDisposed.reset();
  7393. BABYLON.Tools.EndPerformanceCounter("Scene rendering");
  7394. this._lastFrameDuration = BABYLON.Tools.Now - startDate;
  7395. };
  7396. Scene.prototype._updateAudioParameters = function () {
  7397. var listeningCamera;
  7398. var audioEngine = this._engine.getAudioEngine();
  7399. if (this.activeCameras.length > 0) {
  7400. listeningCamera = this.activeCameras[0];
  7401. } else {
  7402. listeningCamera = this.activeCamera;
  7403. }
  7404. if (listeningCamera && audioEngine.canUseWebAudio) {
  7405. audioEngine.audioContext.listener.setPosition(listeningCamera.position.x, listeningCamera.position.y, listeningCamera.position.z);
  7406. var mat = BABYLON.Matrix.Invert(listeningCamera.getViewMatrix());
  7407. var cameraDirection = BABYLON.Vector3.TransformNormal(new BABYLON.Vector3(0, 0, -1), mat);
  7408. cameraDirection.normalize();
  7409. audioEngine.audioContext.listener.setOrientation(cameraDirection.x, cameraDirection.y, cameraDirection.z, 0, 1, 0);
  7410. }
  7411. };
  7412. Scene.prototype.dispose = function () {
  7413. this.beforeRender = null;
  7414. this.afterRender = null;
  7415. this.skeletons = [];
  7416. this._boundingBoxRenderer.dispose();
  7417. this.debugLayer.enabled = false;
  7418. if (this.onDispose) {
  7419. this.onDispose();
  7420. }
  7421. this._onBeforeRenderCallbacks = [];
  7422. this._onAfterRenderCallbacks = [];
  7423. this.detachControl();
  7424. var canvas = this._engine.getRenderingCanvas();
  7425. var index;
  7426. for (index = 0; index < this.cameras.length; index++) {
  7427. this.cameras[index].detachControl(canvas);
  7428. }
  7429. while (this.lights.length) {
  7430. this.lights[0].dispose();
  7431. }
  7432. while (this.meshes.length) {
  7433. this.meshes[0].dispose(true);
  7434. }
  7435. while (this.cameras.length) {
  7436. this.cameras[0].dispose();
  7437. }
  7438. while (this.materials.length) {
  7439. this.materials[0].dispose();
  7440. }
  7441. while (this.particleSystems.length) {
  7442. this.particleSystems[0].dispose();
  7443. }
  7444. while (this.spriteManagers.length) {
  7445. this.spriteManagers[0].dispose();
  7446. }
  7447. while (this.layers.length) {
  7448. this.layers[0].dispose();
  7449. }
  7450. while (this.textures.length) {
  7451. this.textures[0].dispose();
  7452. }
  7453. this.postProcessManager.dispose();
  7454. if (this._physicsEngine) {
  7455. this.disablePhysicsEngine();
  7456. }
  7457. index = this._engine.scenes.indexOf(this);
  7458. if (index > -1) {
  7459. this._engine.scenes.splice(index, 1);
  7460. }
  7461. this._engine.wipeCaches();
  7462. };
  7463. Scene.prototype._getNewPosition = function (position, velocity, collider, maximumRetry, finalPosition, excludedMesh) {
  7464. if (typeof excludedMesh === "undefined") { excludedMesh = null; }
  7465. position.divideToRef(collider.radius, this._scaledPosition);
  7466. velocity.divideToRef(collider.radius, this._scaledVelocity);
  7467. collider.retry = 0;
  7468. collider.initialVelocity = this._scaledVelocity;
  7469. collider.initialPosition = this._scaledPosition;
  7470. this._collideWithWorld(this._scaledPosition, this._scaledVelocity, collider, maximumRetry, finalPosition, excludedMesh);
  7471. finalPosition.multiplyInPlace(collider.radius);
  7472. };
  7473. Scene.prototype._collideWithWorld = function (position, velocity, collider, maximumRetry, finalPosition, excludedMesh) {
  7474. if (typeof excludedMesh === "undefined") { excludedMesh = null; }
  7475. var closeDistance = BABYLON.Engine.CollisionsEpsilon * 10.0;
  7476. if (collider.retry >= maximumRetry) {
  7477. finalPosition.copyFrom(position);
  7478. return;
  7479. }
  7480. collider._initialize(position, velocity, closeDistance);
  7481. for (var index = 0; index < this.meshes.length; index++) {
  7482. var mesh = this.meshes[index];
  7483. if (mesh.isEnabled() && mesh.checkCollisions && mesh.subMeshes && mesh !== excludedMesh) {
  7484. mesh._checkCollision(collider);
  7485. }
  7486. }
  7487. if (!collider.collisionFound) {
  7488. position.addToRef(velocity, finalPosition);
  7489. return;
  7490. }
  7491. if (velocity.x != 0 || velocity.y != 0 || velocity.z != 0) {
  7492. collider._getResponse(position, velocity);
  7493. }
  7494. if (velocity.length() <= closeDistance) {
  7495. finalPosition.copyFrom(position);
  7496. return;
  7497. }
  7498. collider.retry++;
  7499. this._collideWithWorld(position, velocity, collider, maximumRetry, finalPosition, excludedMesh);
  7500. };
  7501. Scene.prototype.createOrUpdateSelectionOctree = function (maxCapacity, maxDepth) {
  7502. if (typeof maxCapacity === "undefined") { maxCapacity = 64; }
  7503. if (typeof maxDepth === "undefined") { maxDepth = 2; }
  7504. if (!this._selectionOctree) {
  7505. this._selectionOctree = new BABYLON.Octree(BABYLON.Octree.CreationFuncForMeshes, maxCapacity, maxDepth);
  7506. }
  7507. var min = new BABYLON.Vector3(Number.MAX_VALUE, Number.MAX_VALUE, Number.MAX_VALUE);
  7508. var max = new BABYLON.Vector3(-Number.MAX_VALUE, -Number.MAX_VALUE, -Number.MAX_VALUE);
  7509. for (var index = 0; index < this.meshes.length; index++) {
  7510. var mesh = this.meshes[index];
  7511. mesh.computeWorldMatrix(true);
  7512. var minBox = mesh.getBoundingInfo().boundingBox.minimumWorld;
  7513. var maxBox = mesh.getBoundingInfo().boundingBox.maximumWorld;
  7514. BABYLON.Tools.CheckExtends(minBox, min, max);
  7515. BABYLON.Tools.CheckExtends(maxBox, min, max);
  7516. }
  7517. this._selectionOctree.update(min, max, this.meshes);
  7518. return this._selectionOctree;
  7519. };
  7520. Scene.prototype.createPickingRay = function (x, y, world, camera) {
  7521. var engine = this._engine;
  7522. if (!camera) {
  7523. if (!this.activeCamera)
  7524. throw new Error("Active camera not set");
  7525. camera = this.activeCamera;
  7526. }
  7527. var cameraViewport = camera.viewport;
  7528. var viewport = cameraViewport.toGlobal(engine);
  7529. x = x / this._engine.getHardwareScalingLevel() - viewport.x;
  7530. y = y / this._engine.getHardwareScalingLevel() - (this._engine.getRenderHeight() - viewport.y - viewport.height);
  7531. return BABYLON.Ray.CreateNew(x, y, viewport.width, viewport.height, world ? world : BABYLON.Matrix.Identity(), camera.getViewMatrix(), camera.getProjectionMatrix());
  7532. };
  7533. Scene.prototype._internalPick = function (rayFunction, predicate, fastCheck) {
  7534. var pickingInfo = null;
  7535. for (var meshIndex = 0; meshIndex < this.meshes.length; meshIndex++) {
  7536. var mesh = this.meshes[meshIndex];
  7537. if (predicate) {
  7538. if (!predicate(mesh)) {
  7539. continue;
  7540. }
  7541. } else if (!mesh.isEnabled() || !mesh.isVisible || !mesh.isPickable) {
  7542. continue;
  7543. }
  7544. var world = mesh.getWorldMatrix();
  7545. var ray = rayFunction(world);
  7546. var result = mesh.intersects(ray, fastCheck);
  7547. if (!result || !result.hit)
  7548. continue;
  7549. if (!fastCheck && pickingInfo != null && result.distance >= pickingInfo.distance)
  7550. continue;
  7551. pickingInfo = result;
  7552. if (fastCheck) {
  7553. break;
  7554. }
  7555. }
  7556. return pickingInfo || new BABYLON.PickingInfo();
  7557. };
  7558. Scene.prototype.pick = function (x, y, predicate, fastCheck, camera) {
  7559. var _this = this;
  7560. return this._internalPick(function (world) {
  7561. return _this.createPickingRay(x, y, world, camera);
  7562. }, predicate, fastCheck);
  7563. };
  7564. Scene.prototype.pickWithRay = function (ray, predicate, fastCheck) {
  7565. var _this = this;
  7566. return this._internalPick(function (world) {
  7567. if (!_this._pickWithRayInverseMatrix) {
  7568. _this._pickWithRayInverseMatrix = BABYLON.Matrix.Identity();
  7569. }
  7570. world.invertToRef(_this._pickWithRayInverseMatrix);
  7571. return BABYLON.Ray.Transform(ray, _this._pickWithRayInverseMatrix);
  7572. }, predicate, fastCheck);
  7573. };
  7574. Scene.prototype.setPointerOverMesh = function (mesh) {
  7575. if (this._pointerOverMesh === mesh) {
  7576. return;
  7577. }
  7578. if (this._pointerOverMesh && this._pointerOverMesh.actionManager) {
  7579. this._pointerOverMesh.actionManager.processTrigger(BABYLON.ActionManager.OnPointerOutTrigger, BABYLON.ActionEvent.CreateNew(this._pointerOverMesh));
  7580. }
  7581. this._pointerOverMesh = mesh;
  7582. if (this._pointerOverMesh && this._pointerOverMesh.actionManager) {
  7583. this._pointerOverMesh.actionManager.processTrigger(BABYLON.ActionManager.OnPointerOverTrigger, BABYLON.ActionEvent.CreateNew(this._pointerOverMesh));
  7584. }
  7585. };
  7586. Scene.prototype.getPointerOverMesh = function () {
  7587. return this._pointerOverMesh;
  7588. };
  7589. Scene.prototype.getPhysicsEngine = function () {
  7590. return this._physicsEngine;
  7591. };
  7592. Scene.prototype.enablePhysics = function (gravity, plugin) {
  7593. if (this._physicsEngine) {
  7594. return true;
  7595. }
  7596. this._physicsEngine = new BABYLON.PhysicsEngine(plugin);
  7597. if (!this._physicsEngine.isSupported()) {
  7598. this._physicsEngine = null;
  7599. return false;
  7600. }
  7601. this._physicsEngine._initialize(gravity);
  7602. return true;
  7603. };
  7604. Scene.prototype.disablePhysicsEngine = function () {
  7605. if (!this._physicsEngine) {
  7606. return;
  7607. }
  7608. this._physicsEngine.dispose();
  7609. this._physicsEngine = undefined;
  7610. };
  7611. Scene.prototype.isPhysicsEnabled = function () {
  7612. return this._physicsEngine !== undefined;
  7613. };
  7614. Scene.prototype.setGravity = function (gravity) {
  7615. if (!this._physicsEngine) {
  7616. return;
  7617. }
  7618. this._physicsEngine._setGravity(gravity);
  7619. };
  7620. Scene.prototype.createCompoundImpostor = function (parts, options) {
  7621. if (parts.parts) {
  7622. options = parts;
  7623. parts = parts.parts;
  7624. }
  7625. if (!this._physicsEngine) {
  7626. return null;
  7627. }
  7628. for (var index = 0; index < parts.length; index++) {
  7629. var mesh = parts[index].mesh;
  7630. mesh._physicImpostor = parts[index].impostor;
  7631. mesh._physicsMass = options.mass / parts.length;
  7632. mesh._physicsFriction = options.friction;
  7633. mesh._physicRestitution = options.restitution;
  7634. }
  7635. return this._physicsEngine._registerMeshesAsCompound(parts, options);
  7636. };
  7637. Scene.prototype.deleteCompoundImpostor = function (compound) {
  7638. for (var index = 0; index < compound.parts.length; index++) {
  7639. var mesh = compound.parts[index].mesh;
  7640. mesh._physicImpostor = BABYLON.PhysicsEngine.NoImpostor;
  7641. this._physicsEngine._unregisterMesh(mesh);
  7642. }
  7643. };
  7644. Scene.prototype._getByTags = function (list, tagsQuery) {
  7645. if (tagsQuery === undefined) {
  7646. return list;
  7647. }
  7648. var listByTags = [];
  7649. for (var i in list) {
  7650. var item = list[i];
  7651. if (BABYLON.Tags.MatchesQuery(item, tagsQuery)) {
  7652. listByTags.push(item);
  7653. }
  7654. }
  7655. return listByTags;
  7656. };
  7657. Scene.prototype.getMeshesByTags = function (tagsQuery) {
  7658. return this._getByTags(this.meshes, tagsQuery);
  7659. };
  7660. Scene.prototype.getCamerasByTags = function (tagsQuery) {
  7661. return this._getByTags(this.cameras, tagsQuery);
  7662. };
  7663. Scene.prototype.getLightsByTags = function (tagsQuery) {
  7664. return this._getByTags(this.lights, tagsQuery);
  7665. };
  7666. Scene.prototype.getMaterialByTags = function (tagsQuery) {
  7667. return this._getByTags(this.materials, tagsQuery).concat(this._getByTags(this.multiMaterials, tagsQuery));
  7668. };
  7669. Scene.FOGMODE_NONE = 0;
  7670. Scene.FOGMODE_EXP = 1;
  7671. Scene.FOGMODE_EXP2 = 2;
  7672. Scene.FOGMODE_LINEAR = 3;
  7673. Scene.MinDeltaTime = 1.0;
  7674. Scene.MaxDeltaTime = 1000.0;
  7675. return Scene;
  7676. })();
  7677. BABYLON.Scene = Scene;
  7678. })(BABYLON || (BABYLON = {}));
  7679. var BABYLON;
  7680. (function (BABYLON) {
  7681. var VertexBuffer = (function () {
  7682. function VertexBuffer(engine, data, kind, updatable, postponeInternalCreation, stride) {
  7683. if (engine instanceof BABYLON.Mesh) {
  7684. this._engine = engine.getScene().getEngine();
  7685. } else {
  7686. this._engine = engine;
  7687. }
  7688. this._updatable = updatable;
  7689. this._data = data;
  7690. if (!postponeInternalCreation) {
  7691. this.create();
  7692. }
  7693. this._kind = kind;
  7694. if (stride) {
  7695. this._strideSize = stride;
  7696. return;
  7697. }
  7698. switch (kind) {
  7699. case VertexBuffer.PositionKind:
  7700. this._strideSize = 3;
  7701. break;
  7702. case VertexBuffer.NormalKind:
  7703. this._strideSize = 3;
  7704. break;
  7705. case VertexBuffer.UVKind:
  7706. this._strideSize = 2;
  7707. break;
  7708. case VertexBuffer.UV2Kind:
  7709. this._strideSize = 2;
  7710. break;
  7711. case VertexBuffer.ColorKind:
  7712. this._strideSize = 4;
  7713. break;
  7714. case VertexBuffer.MatricesIndicesKind:
  7715. this._strideSize = 4;
  7716. break;
  7717. case VertexBuffer.MatricesWeightsKind:
  7718. this._strideSize = 4;
  7719. break;
  7720. }
  7721. }
  7722. VertexBuffer.prototype.isUpdatable = function () {
  7723. return this._updatable;
  7724. };
  7725. VertexBuffer.prototype.getData = function () {
  7726. return this._data;
  7727. };
  7728. VertexBuffer.prototype.getBuffer = function () {
  7729. return this._buffer;
  7730. };
  7731. VertexBuffer.prototype.getStrideSize = function () {
  7732. return this._strideSize;
  7733. };
  7734. VertexBuffer.prototype.create = function (data) {
  7735. if (!data && this._buffer) {
  7736. return;
  7737. }
  7738. data = data || this._data;
  7739. if (!this._buffer) {
  7740. if (this._updatable) {
  7741. this._buffer = this._engine.createDynamicVertexBuffer(data.length * 4);
  7742. } else {
  7743. this._buffer = this._engine.createVertexBuffer(data);
  7744. }
  7745. }
  7746. if (this._updatable) {
  7747. this._engine.updateDynamicVertexBuffer(this._buffer, data);
  7748. this._data = data;
  7749. }
  7750. };
  7751. VertexBuffer.prototype.update = function (data) {
  7752. this.create(data);
  7753. };
  7754. VertexBuffer.prototype.updateDirectly = function (data) {
  7755. if (!this._buffer) {
  7756. return;
  7757. }
  7758. if (this._updatable) {
  7759. this._engine.updateDynamicVertexBuffer(this._buffer, data);
  7760. this._data = null;
  7761. }
  7762. };
  7763. VertexBuffer.prototype.dispose = function () {
  7764. if (!this._buffer) {
  7765. return;
  7766. }
  7767. if (this._engine._releaseBuffer(this._buffer)) {
  7768. this._buffer = null;
  7769. }
  7770. };
  7771. Object.defineProperty(VertexBuffer, "PositionKind", {
  7772. get: function () {
  7773. return VertexBuffer._PositionKind;
  7774. },
  7775. enumerable: true,
  7776. configurable: true
  7777. });
  7778. Object.defineProperty(VertexBuffer, "NormalKind", {
  7779. get: function () {
  7780. return VertexBuffer._NormalKind;
  7781. },
  7782. enumerable: true,
  7783. configurable: true
  7784. });
  7785. Object.defineProperty(VertexBuffer, "UVKind", {
  7786. get: function () {
  7787. return VertexBuffer._UVKind;
  7788. },
  7789. enumerable: true,
  7790. configurable: true
  7791. });
  7792. Object.defineProperty(VertexBuffer, "UV2Kind", {
  7793. get: function () {
  7794. return VertexBuffer._UV2Kind;
  7795. },
  7796. enumerable: true,
  7797. configurable: true
  7798. });
  7799. Object.defineProperty(VertexBuffer, "ColorKind", {
  7800. get: function () {
  7801. return VertexBuffer._ColorKind;
  7802. },
  7803. enumerable: true,
  7804. configurable: true
  7805. });
  7806. Object.defineProperty(VertexBuffer, "MatricesIndicesKind", {
  7807. get: function () {
  7808. return VertexBuffer._MatricesIndicesKind;
  7809. },
  7810. enumerable: true,
  7811. configurable: true
  7812. });
  7813. Object.defineProperty(VertexBuffer, "MatricesWeightsKind", {
  7814. get: function () {
  7815. return VertexBuffer._MatricesWeightsKind;
  7816. },
  7817. enumerable: true,
  7818. configurable: true
  7819. });
  7820. VertexBuffer._PositionKind = "position";
  7821. VertexBuffer._NormalKind = "normal";
  7822. VertexBuffer._UVKind = "uv";
  7823. VertexBuffer._UV2Kind = "uv2";
  7824. VertexBuffer._ColorKind = "color";
  7825. VertexBuffer._MatricesIndicesKind = "matricesIndices";
  7826. VertexBuffer._MatricesWeightsKind = "matricesWeights";
  7827. return VertexBuffer;
  7828. })();
  7829. BABYLON.VertexBuffer = VertexBuffer;
  7830. })(BABYLON || (BABYLON = {}));
  7831. var __extends = this.__extends || function (d, b) {
  7832. for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p];
  7833. function __() { this.constructor = d; }
  7834. __.prototype = b.prototype;
  7835. d.prototype = new __();
  7836. };
  7837. var BABYLON;
  7838. (function (BABYLON) {
  7839. var AbstractMesh = (function (_super) {
  7840. __extends(AbstractMesh, _super);
  7841. function AbstractMesh(name, scene) {
  7842. _super.call(this, name, scene);
  7843. this.position = new BABYLON.Vector3(0, 0, 0);
  7844. this.rotation = new BABYLON.Vector3(0, 0, 0);
  7845. this.scaling = new BABYLON.Vector3(1, 1, 1);
  7846. this.billboardMode = BABYLON.AbstractMesh.BILLBOARDMODE_NONE;
  7847. this.visibility = 1.0;
  7848. this.alphaLayer = Number.MAX_VALUE;
  7849. this.infiniteDistance = false;
  7850. this.isVisible = true;
  7851. this.isPickable = true;
  7852. this.showBoundingBox = false;
  7853. this.showSubMeshesBoundingBox = false;
  7854. this.onDispose = null;
  7855. this.checkCollisions = false;
  7856. this.isBlocker = false;
  7857. this.renderingGroupId = 0;
  7858. this.receiveShadows = false;
  7859. this.renderOutline = false;
  7860. this.outlineColor = BABYLON.Color3.Red();
  7861. this.outlineWidth = 0.02;
  7862. this.renderOverlay = false;
  7863. this.overlayColor = BABYLON.Color3.Red();
  7864. this.overlayAlpha = 0.5;
  7865. this.hasVertexAlpha = false;
  7866. this.useVertexColors = true;
  7867. this.applyFog = true;
  7868. this.useOctreeForRenderingSelection = true;
  7869. this.useOctreeForPicking = true;
  7870. this.useOctreeForCollisions = true;
  7871. this.layerMask = 0xFFFFFFFF;
  7872. this._physicImpostor = BABYLON.PhysicsEngine.NoImpostor;
  7873. this.ellipsoid = new BABYLON.Vector3(0.5, 1, 0.5);
  7874. this.ellipsoidOffset = new BABYLON.Vector3(0, 0, 0);
  7875. this._collider = new BABYLON.Collider();
  7876. this._oldPositionForCollisions = new BABYLON.Vector3(0, 0, 0);
  7877. this._diffPositionForCollisions = new BABYLON.Vector3(0, 0, 0);
  7878. this._newPositionForCollisions = new BABYLON.Vector3(0, 0, 0);
  7879. this._localScaling = BABYLON.Matrix.Zero();
  7880. this._localRotation = BABYLON.Matrix.Zero();
  7881. this._localTranslation = BABYLON.Matrix.Zero();
  7882. this._localBillboard = BABYLON.Matrix.Zero();
  7883. this._localPivotScaling = BABYLON.Matrix.Zero();
  7884. this._localPivotScalingRotation = BABYLON.Matrix.Zero();
  7885. this._localWorld = BABYLON.Matrix.Zero();
  7886. this._worldMatrix = BABYLON.Matrix.Zero();
  7887. this._rotateYByPI = BABYLON.Matrix.RotationY(Math.PI);
  7888. this._absolutePosition = BABYLON.Vector3.Zero();
  7889. this._collisionsTransformMatrix = BABYLON.Matrix.Zero();
  7890. this._collisionsScalingMatrix = BABYLON.Matrix.Zero();
  7891. this._isDirty = false;
  7892. this._pivotMatrix = BABYLON.Matrix.Identity();
  7893. this._isDisposed = false;
  7894. this._renderId = 0;
  7895. this._intersectionsInProgress = new Array();
  7896. this._onAfterWorldMatrixUpdate = new Array();
  7897. scene.meshes.push(this);
  7898. }
  7899. Object.defineProperty(AbstractMesh, "BILLBOARDMODE_NONE", {
  7900. get: function () {
  7901. return AbstractMesh._BILLBOARDMODE_NONE;
  7902. },
  7903. enumerable: true,
  7904. configurable: true
  7905. });
  7906. Object.defineProperty(AbstractMesh, "BILLBOARDMODE_X", {
  7907. get: function () {
  7908. return AbstractMesh._BILLBOARDMODE_X;
  7909. },
  7910. enumerable: true,
  7911. configurable: true
  7912. });
  7913. Object.defineProperty(AbstractMesh, "BILLBOARDMODE_Y", {
  7914. get: function () {
  7915. return AbstractMesh._BILLBOARDMODE_Y;
  7916. },
  7917. enumerable: true,
  7918. configurable: true
  7919. });
  7920. Object.defineProperty(AbstractMesh, "BILLBOARDMODE_Z", {
  7921. get: function () {
  7922. return AbstractMesh._BILLBOARDMODE_Z;
  7923. },
  7924. enumerable: true,
  7925. configurable: true
  7926. });
  7927. Object.defineProperty(AbstractMesh, "BILLBOARDMODE_ALL", {
  7928. get: function () {
  7929. return AbstractMesh._BILLBOARDMODE_ALL;
  7930. },
  7931. enumerable: true,
  7932. configurable: true
  7933. });
  7934. Object.defineProperty(AbstractMesh.prototype, "isBlocked", {
  7935. get: function () {
  7936. return false;
  7937. },
  7938. enumerable: true,
  7939. configurable: true
  7940. });
  7941. AbstractMesh.prototype.getLOD = function (camera) {
  7942. return this;
  7943. };
  7944. AbstractMesh.prototype.getTotalVertices = function () {
  7945. return 0;
  7946. };
  7947. AbstractMesh.prototype.getIndices = function () {
  7948. return null;
  7949. };
  7950. AbstractMesh.prototype.getVerticesData = function (kind) {
  7951. return null;
  7952. };
  7953. AbstractMesh.prototype.isVerticesDataPresent = function (kind) {
  7954. return false;
  7955. };
  7956. AbstractMesh.prototype.getBoundingInfo = function () {
  7957. if (this._masterMesh) {
  7958. return this._masterMesh.getBoundingInfo();
  7959. }
  7960. if (!this._boundingInfo) {
  7961. this._updateBoundingInfo();
  7962. }
  7963. return this._boundingInfo;
  7964. };
  7965. AbstractMesh.prototype._preActivate = function () {
  7966. };
  7967. AbstractMesh.prototype._activate = function (renderId) {
  7968. this._renderId = renderId;
  7969. };
  7970. AbstractMesh.prototype.getWorldMatrix = function () {
  7971. if (this._masterMesh) {
  7972. return this._masterMesh.getWorldMatrix();
  7973. }
  7974. if (this._currentRenderId !== this.getScene().getRenderId()) {
  7975. this.computeWorldMatrix();
  7976. }
  7977. return this._worldMatrix;
  7978. };
  7979. Object.defineProperty(AbstractMesh.prototype, "worldMatrixFromCache", {
  7980. get: function () {
  7981. return this._worldMatrix;
  7982. },
  7983. enumerable: true,
  7984. configurable: true
  7985. });
  7986. Object.defineProperty(AbstractMesh.prototype, "absolutePosition", {
  7987. get: function () {
  7988. return this._absolutePosition;
  7989. },
  7990. enumerable: true,
  7991. configurable: true
  7992. });
  7993. AbstractMesh.prototype.rotate = function (axis, amount, space) {
  7994. if (!this.rotationQuaternion) {
  7995. this.rotationQuaternion = BABYLON.Quaternion.RotationYawPitchRoll(this.rotation.y, this.rotation.x, this.rotation.z);
  7996. this.rotation = BABYLON.Vector3.Zero();
  7997. }
  7998. if (!space || space == 0 /* LOCAL */) {
  7999. var rotationQuaternion = BABYLON.Quaternion.RotationAxis(axis, amount);
  8000. this.rotationQuaternion = this.rotationQuaternion.multiply(rotationQuaternion);
  8001. } else {
  8002. if (this.parent) {
  8003. var invertParentWorldMatrix = this.parent.getWorldMatrix().clone();
  8004. invertParentWorldMatrix.invert();
  8005. axis = BABYLON.Vector3.TransformNormal(axis, invertParentWorldMatrix);
  8006. }
  8007. rotationQuaternion = BABYLON.Quaternion.RotationAxis(axis, amount);
  8008. this.rotationQuaternion = rotationQuaternion.multiply(this.rotationQuaternion);
  8009. }
  8010. };
  8011. AbstractMesh.prototype.translate = function (axis, distance, space) {
  8012. var displacementVector = axis.scale(distance);
  8013. if (!space || space == 0 /* LOCAL */) {
  8014. var tempV3 = this.getPositionExpressedInLocalSpace().add(displacementVector);
  8015. this.setPositionWithLocalVector(tempV3);
  8016. } else {
  8017. this.setAbsolutePosition(this.getAbsolutePosition().add(displacementVector));
  8018. }
  8019. };
  8020. AbstractMesh.prototype.getAbsolutePosition = function () {
  8021. this.computeWorldMatrix();
  8022. return this._absolutePosition;
  8023. };
  8024. AbstractMesh.prototype.setAbsolutePosition = function (absolutePosition) {
  8025. if (!absolutePosition) {
  8026. return;
  8027. }
  8028. var absolutePositionX;
  8029. var absolutePositionY;
  8030. var absolutePositionZ;
  8031. if (absolutePosition.x === undefined) {
  8032. if (arguments.length < 3) {
  8033. return;
  8034. }
  8035. absolutePositionX = arguments[0];
  8036. absolutePositionY = arguments[1];
  8037. absolutePositionZ = arguments[2];
  8038. } else {
  8039. absolutePositionX = absolutePosition.x;
  8040. absolutePositionY = absolutePosition.y;
  8041. absolutePositionZ = absolutePosition.z;
  8042. }
  8043. if (this.parent) {
  8044. var invertParentWorldMatrix = this.parent.getWorldMatrix().clone();
  8045. invertParentWorldMatrix.invert();
  8046. var worldPosition = new BABYLON.Vector3(absolutePositionX, absolutePositionY, absolutePositionZ);
  8047. this.position = BABYLON.Vector3.TransformCoordinates(worldPosition, invertParentWorldMatrix);
  8048. } else {
  8049. this.position.x = absolutePositionX;
  8050. this.position.y = absolutePositionY;
  8051. this.position.z = absolutePositionZ;
  8052. }
  8053. };
  8054. AbstractMesh.prototype.setPivotMatrix = function (matrix) {
  8055. this._pivotMatrix = matrix;
  8056. this._cache.pivotMatrixUpdated = true;
  8057. };
  8058. AbstractMesh.prototype.getPivotMatrix = function () {
  8059. return this._pivotMatrix;
  8060. };
  8061. AbstractMesh.prototype._isSynchronized = function () {
  8062. if (this._isDirty) {
  8063. return false;
  8064. }
  8065. if (this.billboardMode !== AbstractMesh.BILLBOARDMODE_NONE)
  8066. return false;
  8067. if (this._cache.pivotMatrixUpdated) {
  8068. return false;
  8069. }
  8070. if (this.infiniteDistance) {
  8071. return false;
  8072. }
  8073. if (!this._cache.position.equals(this.position))
  8074. return false;
  8075. if (this.rotationQuaternion) {
  8076. if (!this._cache.rotationQuaternion.equals(this.rotationQuaternion))
  8077. return false;
  8078. } else {
  8079. if (!this._cache.rotation.equals(this.rotation))
  8080. return false;
  8081. }
  8082. if (!this._cache.scaling.equals(this.scaling))
  8083. return false;
  8084. return true;
  8085. };
  8086. AbstractMesh.prototype._initCache = function () {
  8087. _super.prototype._initCache.call(this);
  8088. this._cache.localMatrixUpdated = false;
  8089. this._cache.position = BABYLON.Vector3.Zero();
  8090. this._cache.scaling = BABYLON.Vector3.Zero();
  8091. this._cache.rotation = BABYLON.Vector3.Zero();
  8092. this._cache.rotationQuaternion = new BABYLON.Quaternion(0, 0, 0, 0);
  8093. };
  8094. AbstractMesh.prototype.markAsDirty = function (property) {
  8095. if (property === "rotation") {
  8096. this.rotationQuaternion = null;
  8097. }
  8098. this._currentRenderId = Number.MAX_VALUE;
  8099. this._isDirty = true;
  8100. };
  8101. AbstractMesh.prototype._updateBoundingInfo = function () {
  8102. this._boundingInfo = this._boundingInfo || new BABYLON.BoundingInfo(this.absolutePosition, this.absolutePosition);
  8103. this._boundingInfo._update(this.worldMatrixFromCache);
  8104. this._updateSubMeshesBoundingInfo(this.worldMatrixFromCache);
  8105. };
  8106. AbstractMesh.prototype._updateSubMeshesBoundingInfo = function (matrix) {
  8107. if (!this.subMeshes) {
  8108. return;
  8109. }
  8110. for (var subIndex = 0; subIndex < this.subMeshes.length; subIndex++) {
  8111. var subMesh = this.subMeshes[subIndex];
  8112. subMesh.updateBoundingInfo(matrix);
  8113. }
  8114. };
  8115. AbstractMesh.prototype.computeWorldMatrix = function (force) {
  8116. if (!force && (this._currentRenderId == this.getScene().getRenderId() || this.isSynchronized(true))) {
  8117. return this._worldMatrix;
  8118. }
  8119. this._cache.position.copyFrom(this.position);
  8120. this._cache.scaling.copyFrom(this.scaling);
  8121. this._cache.pivotMatrixUpdated = false;
  8122. this._currentRenderId = this.getScene().getRenderId();
  8123. this._isDirty = false;
  8124. BABYLON.Matrix.ScalingToRef(this.scaling.x, this.scaling.y, this.scaling.z, this._localScaling);
  8125. if (this.rotationQuaternion) {
  8126. this.rotationQuaternion.toRotationMatrix(this._localRotation);
  8127. this._cache.rotationQuaternion.copyFrom(this.rotationQuaternion);
  8128. } else {
  8129. BABYLON.Matrix.RotationYawPitchRollToRef(this.rotation.y, this.rotation.x, this.rotation.z, this._localRotation);
  8130. this._cache.rotation.copyFrom(this.rotation);
  8131. }
  8132. if (this.infiniteDistance && !this.parent) {
  8133. var camera = this.getScene().activeCamera;
  8134. var cameraWorldMatrix = camera.getWorldMatrix();
  8135. var cameraGlobalPosition = new BABYLON.Vector3(cameraWorldMatrix.m[12], cameraWorldMatrix.m[13], cameraWorldMatrix.m[14]);
  8136. BABYLON.Matrix.TranslationToRef(this.position.x + cameraGlobalPosition.x, this.position.y + cameraGlobalPosition.y, this.position.z + cameraGlobalPosition.z, this._localTranslation);
  8137. } else {
  8138. BABYLON.Matrix.TranslationToRef(this.position.x, this.position.y, this.position.z, this._localTranslation);
  8139. }
  8140. this._pivotMatrix.multiplyToRef(this._localScaling, this._localPivotScaling);
  8141. this._localPivotScaling.multiplyToRef(this._localRotation, this._localPivotScalingRotation);
  8142. if (this.billboardMode !== AbstractMesh.BILLBOARDMODE_NONE && this.getScene().activeCamera) {
  8143. var localPosition = this.position.clone();
  8144. var zero = this.getScene().activeCamera.position.clone();
  8145. if (this.parent && this.parent.position) {
  8146. localPosition.addInPlace(this.parent.position);
  8147. BABYLON.Matrix.TranslationToRef(localPosition.x, localPosition.y, localPosition.z, this._localTranslation);
  8148. }
  8149. if ((this.billboardMode & AbstractMesh.BILLBOARDMODE_ALL) === AbstractMesh.BILLBOARDMODE_ALL) {
  8150. zero = this.getScene().activeCamera.position;
  8151. } else {
  8152. if (this.billboardMode & BABYLON.AbstractMesh.BILLBOARDMODE_X)
  8153. zero.x = localPosition.x + BABYLON.Engine.Epsilon;
  8154. if (this.billboardMode & BABYLON.AbstractMesh.BILLBOARDMODE_Y)
  8155. zero.y = localPosition.y + 0.001;
  8156. if (this.billboardMode & BABYLON.AbstractMesh.BILLBOARDMODE_Z)
  8157. zero.z = localPosition.z + 0.001;
  8158. }
  8159. BABYLON.Matrix.LookAtLHToRef(localPosition, zero, BABYLON.Vector3.Up(), this._localBillboard);
  8160. this._localBillboard.m[12] = this._localBillboard.m[13] = this._localBillboard.m[14] = 0;
  8161. this._localBillboard.invert();
  8162. this._localPivotScalingRotation.multiplyToRef(this._localBillboard, this._localWorld);
  8163. this._rotateYByPI.multiplyToRef(this._localWorld, this._localPivotScalingRotation);
  8164. }
  8165. this._localPivotScalingRotation.multiplyToRef(this._localTranslation, this._localWorld);
  8166. if (this.parent && this.parent.getWorldMatrix && this.billboardMode === BABYLON.AbstractMesh.BILLBOARDMODE_NONE) {
  8167. this._localWorld.multiplyToRef(this.parent.getWorldMatrix(), this._worldMatrix);
  8168. } else {
  8169. this._worldMatrix.copyFrom(this._localWorld);
  8170. }
  8171. this._updateBoundingInfo();
  8172. this._absolutePosition.copyFromFloats(this._worldMatrix.m[12], this._worldMatrix.m[13], this._worldMatrix.m[14]);
  8173. for (var callbackIndex = 0; callbackIndex < this._onAfterWorldMatrixUpdate.length; callbackIndex++) {
  8174. this._onAfterWorldMatrixUpdate[callbackIndex](this);
  8175. }
  8176. return this._worldMatrix;
  8177. };
  8178. /**
  8179. * If you'd like to be callbacked after the mesh position, rotation or scaling has been updated
  8180. * @param func: callback function to add
  8181. */
  8182. AbstractMesh.prototype.registerAfterWorldMatrixUpdate = function (func) {
  8183. this._onAfterWorldMatrixUpdate.push(func);
  8184. };
  8185. AbstractMesh.prototype.unregisterAfterWorldMatrixUpdate = function (func) {
  8186. var index = this._onAfterWorldMatrixUpdate.indexOf(func);
  8187. if (index > -1) {
  8188. this._onAfterWorldMatrixUpdate.splice(index, 1);
  8189. }
  8190. };
  8191. AbstractMesh.prototype.setPositionWithLocalVector = function (vector3) {
  8192. this.computeWorldMatrix();
  8193. this.position = BABYLON.Vector3.TransformNormal(vector3, this._localWorld);
  8194. };
  8195. AbstractMesh.prototype.getPositionExpressedInLocalSpace = function () {
  8196. this.computeWorldMatrix();
  8197. var invLocalWorldMatrix = this._localWorld.clone();
  8198. invLocalWorldMatrix.invert();
  8199. return BABYLON.Vector3.TransformNormal(this.position, invLocalWorldMatrix);
  8200. };
  8201. AbstractMesh.prototype.locallyTranslate = function (vector3) {
  8202. this.computeWorldMatrix();
  8203. this.position = BABYLON.Vector3.TransformCoordinates(vector3, this._localWorld);
  8204. };
  8205. AbstractMesh.prototype.lookAt = function (targetPoint, yawCor, pitchCor, rollCor) {
  8206. yawCor = yawCor || 0;
  8207. pitchCor = pitchCor || 0;
  8208. rollCor = rollCor || 0;
  8209. var dv = targetPoint.subtract(this.position);
  8210. var yaw = -Math.atan2(dv.z, dv.x) - Math.PI / 2;
  8211. var len = Math.sqrt(dv.x * dv.x + dv.z * dv.z);
  8212. var pitch = Math.atan2(dv.y, len);
  8213. this.rotationQuaternion = BABYLON.Quaternion.RotationYawPitchRoll(yaw + yawCor, pitch + pitchCor, rollCor);
  8214. };
  8215. AbstractMesh.prototype.isInFrustum = function (frustumPlanes) {
  8216. if (!this._boundingInfo.isInFrustum(frustumPlanes)) {
  8217. return false;
  8218. }
  8219. return true;
  8220. };
  8221. AbstractMesh.prototype.isCompletelyInFrustum = function (camera) {
  8222. if (!camera) {
  8223. camera = this.getScene().activeCamera;
  8224. }
  8225. var transformMatrix = camera.getViewMatrix().multiply(camera.getProjectionMatrix());
  8226. if (!this._boundingInfo.isCompletelyInFrustum(BABYLON.Frustum.GetPlanes(transformMatrix))) {
  8227. return false;
  8228. }
  8229. return true;
  8230. };
  8231. AbstractMesh.prototype.intersectsMesh = function (mesh, precise) {
  8232. if (!this._boundingInfo || !mesh._boundingInfo) {
  8233. return false;
  8234. }
  8235. return this._boundingInfo.intersects(mesh._boundingInfo, precise);
  8236. };
  8237. AbstractMesh.prototype.intersectsPoint = function (point) {
  8238. if (!this._boundingInfo) {
  8239. return false;
  8240. }
  8241. return this._boundingInfo.intersectsPoint(point);
  8242. };
  8243. AbstractMesh.prototype.setPhysicsState = function (impostor, options) {
  8244. var physicsEngine = this.getScene().getPhysicsEngine();
  8245. if (!physicsEngine) {
  8246. return;
  8247. }
  8248. if (impostor.impostor) {
  8249. options = impostor;
  8250. impostor = impostor.impostor;
  8251. }
  8252. impostor = impostor || BABYLON.PhysicsEngine.NoImpostor;
  8253. if (impostor === BABYLON.PhysicsEngine.NoImpostor) {
  8254. physicsEngine._unregisterMesh(this);
  8255. return;
  8256. }
  8257. options.mass = options.mass || 0;
  8258. options.friction = options.friction || 0.2;
  8259. options.restitution = options.restitution || 0.2;
  8260. this._physicImpostor = impostor;
  8261. this._physicsMass = options.mass;
  8262. this._physicsFriction = options.friction;
  8263. this._physicRestitution = options.restitution;
  8264. physicsEngine._registerMesh(this, impostor, options);
  8265. };
  8266. AbstractMesh.prototype.getPhysicsImpostor = function () {
  8267. if (!this._physicImpostor) {
  8268. return BABYLON.PhysicsEngine.NoImpostor;
  8269. }
  8270. return this._physicImpostor;
  8271. };
  8272. AbstractMesh.prototype.getPhysicsMass = function () {
  8273. if (!this._physicsMass) {
  8274. return 0;
  8275. }
  8276. return this._physicsMass;
  8277. };
  8278. AbstractMesh.prototype.getPhysicsFriction = function () {
  8279. if (!this._physicsFriction) {
  8280. return 0;
  8281. }
  8282. return this._physicsFriction;
  8283. };
  8284. AbstractMesh.prototype.getPhysicsRestitution = function () {
  8285. if (!this._physicRestitution) {
  8286. return 0;
  8287. }
  8288. return this._physicRestitution;
  8289. };
  8290. AbstractMesh.prototype.getPositionInCameraSpace = function (camera) {
  8291. if (!camera) {
  8292. camera = this.getScene().activeCamera;
  8293. }
  8294. return BABYLON.Vector3.TransformCoordinates(this.absolutePosition, camera.getViewMatrix());
  8295. };
  8296. AbstractMesh.prototype.getDistanceToCamera = function (camera) {
  8297. if (!camera) {
  8298. camera = this.getScene().activeCamera;
  8299. }
  8300. return this.absolutePosition.subtract(camera.position);
  8301. };
  8302. AbstractMesh.prototype.applyImpulse = function (force, contactPoint) {
  8303. if (!this._physicImpostor) {
  8304. return;
  8305. }
  8306. this.getScene().getPhysicsEngine()._applyImpulse(this, force, contactPoint);
  8307. };
  8308. AbstractMesh.prototype.setPhysicsLinkWith = function (otherMesh, pivot1, pivot2, options) {
  8309. if (!this._physicImpostor) {
  8310. return;
  8311. }
  8312. this.getScene().getPhysicsEngine()._createLink(this, otherMesh, pivot1, pivot2, options);
  8313. };
  8314. AbstractMesh.prototype.updatePhysicsBodyPosition = function () {
  8315. if (!this._physicImpostor) {
  8316. return;
  8317. }
  8318. this.getScene().getPhysicsEngine()._updateBodyPosition(this);
  8319. };
  8320. AbstractMesh.prototype.moveWithCollisions = function (velocity) {
  8321. var globalPosition = this.getAbsolutePosition();
  8322. globalPosition.subtractFromFloatsToRef(0, this.ellipsoid.y, 0, this._oldPositionForCollisions);
  8323. this._oldPositionForCollisions.addInPlace(this.ellipsoidOffset);
  8324. this._collider.radius = this.ellipsoid;
  8325. this.getScene()._getNewPosition(this._oldPositionForCollisions, velocity, this._collider, 3, this._newPositionForCollisions, this);
  8326. this._newPositionForCollisions.subtractToRef(this._oldPositionForCollisions, this._diffPositionForCollisions);
  8327. if (this._diffPositionForCollisions.length() > BABYLON.Engine.CollisionsEpsilon) {
  8328. this.position.addInPlace(this._diffPositionForCollisions);
  8329. }
  8330. };
  8331. /**
  8332. * This function will create an octree to help select the right submeshes for rendering, picking and collisions
  8333. * Please note that you must have a decent number of submeshes to get performance improvements when using octree
  8334. */
  8335. AbstractMesh.prototype.createOrUpdateSubmeshesOctree = function (maxCapacity, maxDepth) {
  8336. if (typeof maxCapacity === "undefined") { maxCapacity = 64; }
  8337. if (typeof maxDepth === "undefined") { maxDepth = 2; }
  8338. if (!this._submeshesOctree) {
  8339. this._submeshesOctree = new BABYLON.Octree(BABYLON.Octree.CreationFuncForSubMeshes, maxCapacity, maxDepth);
  8340. }
  8341. this.computeWorldMatrix(true);
  8342. var bbox = this.getBoundingInfo().boundingBox;
  8343. this._submeshesOctree.update(bbox.minimumWorld, bbox.maximumWorld, this.subMeshes);
  8344. return this._submeshesOctree;
  8345. };
  8346. AbstractMesh.prototype._collideForSubMesh = function (subMesh, transformMatrix, collider) {
  8347. this._generatePointsArray();
  8348. if (!subMesh._lastColliderWorldVertices || !subMesh._lastColliderTransformMatrix.equals(transformMatrix)) {
  8349. subMesh._lastColliderTransformMatrix = transformMatrix.clone();
  8350. subMesh._lastColliderWorldVertices = [];
  8351. subMesh._trianglePlanes = [];
  8352. var start = subMesh.verticesStart;
  8353. var end = (subMesh.verticesStart + subMesh.verticesCount);
  8354. for (var i = start; i < end; i++) {
  8355. subMesh._lastColliderWorldVertices.push(BABYLON.Vector3.TransformCoordinates(this._positions[i], transformMatrix));
  8356. }
  8357. }
  8358. collider._collide(subMesh, subMesh._lastColliderWorldVertices, this.getIndices(), subMesh.indexStart, subMesh.indexStart + subMesh.indexCount, subMesh.verticesStart);
  8359. };
  8360. AbstractMesh.prototype._processCollisionsForSubMeshes = function (collider, transformMatrix) {
  8361. var subMeshes;
  8362. var len;
  8363. if (this._submeshesOctree && this.useOctreeForCollisions) {
  8364. var radius = collider.velocityWorldLength + Math.max(collider.radius.x, collider.radius.y, collider.radius.z);
  8365. var intersections = this._submeshesOctree.intersects(collider.basePointWorld, radius);
  8366. len = intersections.length;
  8367. subMeshes = intersections.data;
  8368. } else {
  8369. subMeshes = this.subMeshes;
  8370. len = subMeshes.length;
  8371. }
  8372. for (var index = 0; index < len; index++) {
  8373. var subMesh = subMeshes[index];
  8374. if (len > 1 && !subMesh._checkCollision(collider))
  8375. continue;
  8376. this._collideForSubMesh(subMesh, transformMatrix, collider);
  8377. }
  8378. };
  8379. AbstractMesh.prototype._checkCollision = function (collider) {
  8380. if (!this._boundingInfo._checkCollision(collider))
  8381. return;
  8382. BABYLON.Matrix.ScalingToRef(1.0 / collider.radius.x, 1.0 / collider.radius.y, 1.0 / collider.radius.z, this._collisionsScalingMatrix);
  8383. this.worldMatrixFromCache.multiplyToRef(this._collisionsScalingMatrix, this._collisionsTransformMatrix);
  8384. this._processCollisionsForSubMeshes(collider, this._collisionsTransformMatrix);
  8385. };
  8386. AbstractMesh.prototype._generatePointsArray = function () {
  8387. return false;
  8388. };
  8389. AbstractMesh.prototype.intersects = function (ray, fastCheck) {
  8390. var pickingInfo = new BABYLON.PickingInfo();
  8391. if (!this.subMeshes || !this._boundingInfo || !ray.intersectsSphere(this._boundingInfo.boundingSphere) || !ray.intersectsBox(this._boundingInfo.boundingBox)) {
  8392. return pickingInfo;
  8393. }
  8394. if (!this._generatePointsArray()) {
  8395. return pickingInfo;
  8396. }
  8397. var intersectInfo = null;
  8398. var subMeshes;
  8399. var len;
  8400. if (this._submeshesOctree && this.useOctreeForPicking) {
  8401. var worldRay = BABYLON.Ray.Transform(ray, this.getWorldMatrix());
  8402. var intersections = this._submeshesOctree.intersectsRay(worldRay);
  8403. len = intersections.length;
  8404. subMeshes = intersections.data;
  8405. } else {
  8406. subMeshes = this.subMeshes;
  8407. len = subMeshes.length;
  8408. }
  8409. for (var index = 0; index < len; index++) {
  8410. var subMesh = subMeshes[index];
  8411. if (len > 1 && !subMesh.canIntersects(ray))
  8412. continue;
  8413. var currentIntersectInfo = subMesh.intersects(ray, this._positions, this.getIndices(), fastCheck);
  8414. if (currentIntersectInfo) {
  8415. if (fastCheck || !intersectInfo || currentIntersectInfo.distance < intersectInfo.distance) {
  8416. intersectInfo = currentIntersectInfo;
  8417. if (fastCheck) {
  8418. break;
  8419. }
  8420. }
  8421. }
  8422. }
  8423. if (intersectInfo) {
  8424. var world = this.getWorldMatrix();
  8425. var worldOrigin = BABYLON.Vector3.TransformCoordinates(ray.origin, world);
  8426. var direction = ray.direction.clone();
  8427. direction.normalize();
  8428. direction = direction.scale(intersectInfo.distance);
  8429. var worldDirection = BABYLON.Vector3.TransformNormal(direction, world);
  8430. var pickedPoint = worldOrigin.add(worldDirection);
  8431. pickingInfo.hit = true;
  8432. pickingInfo.distance = BABYLON.Vector3.Distance(worldOrigin, pickedPoint);
  8433. pickingInfo.pickedPoint = pickedPoint;
  8434. pickingInfo.pickedMesh = this;
  8435. pickingInfo.bu = intersectInfo.bu;
  8436. pickingInfo.bv = intersectInfo.bv;
  8437. pickingInfo.faceId = intersectInfo.faceId;
  8438. return pickingInfo;
  8439. }
  8440. return pickingInfo;
  8441. };
  8442. AbstractMesh.prototype.clone = function (name, newParent, doNotCloneChildren) {
  8443. return null;
  8444. };
  8445. AbstractMesh.prototype.releaseSubMeshes = function () {
  8446. if (this.subMeshes) {
  8447. while (this.subMeshes.length) {
  8448. this.subMeshes[0].dispose();
  8449. }
  8450. } else {
  8451. this.subMeshes = new Array();
  8452. }
  8453. };
  8454. AbstractMesh.prototype.dispose = function (doNotRecurse) {
  8455. if (this.getPhysicsImpostor() != BABYLON.PhysicsEngine.NoImpostor) {
  8456. this.setPhysicsState(BABYLON.PhysicsEngine.NoImpostor);
  8457. }
  8458. for (index = 0; index < this._intersectionsInProgress.length; index++) {
  8459. var other = this._intersectionsInProgress[index];
  8460. var pos = other._intersectionsInProgress.indexOf(this);
  8461. other._intersectionsInProgress.splice(pos, 1);
  8462. }
  8463. this._intersectionsInProgress = [];
  8464. this.releaseSubMeshes();
  8465. var index = this.getScene().meshes.indexOf(this);
  8466. if (index != -1) {
  8467. this.getScene().meshes.splice(index, 1);
  8468. }
  8469. if (!doNotRecurse) {
  8470. for (index = 0; index < this.getScene().particleSystems.length; index++) {
  8471. if (this.getScene().particleSystems[index].emitter == this) {
  8472. this.getScene().particleSystems[index].dispose();
  8473. index--;
  8474. }
  8475. }
  8476. var objects = this.getScene().meshes.slice(0);
  8477. for (index = 0; index < objects.length; index++) {
  8478. if (objects[index].parent == this) {
  8479. objects[index].dispose();
  8480. }
  8481. }
  8482. } else {
  8483. for (index = 0; index < this.getScene().meshes.length; index++) {
  8484. var obj = this.getScene().meshes[index];
  8485. if (obj.parent === this) {
  8486. obj.parent = null;
  8487. obj.computeWorldMatrix(true);
  8488. }
  8489. }
  8490. }
  8491. this._onAfterWorldMatrixUpdate = [];
  8492. this._isDisposed = true;
  8493. if (this.onDispose) {
  8494. this.onDispose();
  8495. }
  8496. };
  8497. AbstractMesh._BILLBOARDMODE_NONE = 0;
  8498. AbstractMesh._BILLBOARDMODE_X = 1;
  8499. AbstractMesh._BILLBOARDMODE_Y = 2;
  8500. AbstractMesh._BILLBOARDMODE_Z = 4;
  8501. AbstractMesh._BILLBOARDMODE_ALL = 7;
  8502. return AbstractMesh;
  8503. })(BABYLON.Node);
  8504. BABYLON.AbstractMesh = AbstractMesh;
  8505. })(BABYLON || (BABYLON = {}));
  8506. var __extends = this.__extends || function (d, b) {
  8507. for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p];
  8508. function __() { this.constructor = d; }
  8509. __.prototype = b.prototype;
  8510. d.prototype = new __();
  8511. };
  8512. var BABYLON;
  8513. (function (BABYLON) {
  8514. var _InstancesBatch = (function () {
  8515. function _InstancesBatch() {
  8516. this.mustReturn = false;
  8517. this.visibleInstances = new Array();
  8518. this.renderSelf = new Array();
  8519. }
  8520. return _InstancesBatch;
  8521. })();
  8522. BABYLON._InstancesBatch = _InstancesBatch;
  8523. var Mesh = (function (_super) {
  8524. __extends(Mesh, _super);
  8525. function Mesh(name, scene) {
  8526. _super.call(this, name, scene);
  8527. this.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_NONE;
  8528. this.instances = new Array();
  8529. this._LODLevels = new Array();
  8530. this._onBeforeRenderCallbacks = new Array();
  8531. this._onAfterRenderCallbacks = new Array();
  8532. this._visibleInstances = {};
  8533. this._renderIdForInstances = new Array();
  8534. this._batchCache = new _InstancesBatch();
  8535. this._instancesBufferSize = 32 * 16 * 4;
  8536. }
  8537. Object.defineProperty(Mesh.prototype, "hasLODLevels", {
  8538. get: function () {
  8539. return this._LODLevels.length > 0;
  8540. },
  8541. enumerable: true,
  8542. configurable: true
  8543. });
  8544. Mesh.prototype._sortLODLevels = function () {
  8545. this._LODLevels.sort(function (a, b) {
  8546. if (a.distance < b.distance) {
  8547. return 1;
  8548. }
  8549. if (a.distance > b.distance) {
  8550. return -1;
  8551. }
  8552. return 0;
  8553. });
  8554. };
  8555. Mesh.prototype.addLODLevel = function (distance, mesh) {
  8556. if (mesh && mesh._masterMesh) {
  8557. BABYLON.Tools.Warn("You cannot use a mesh as LOD level twice");
  8558. return this;
  8559. }
  8560. var level = new BABYLON.Internals.MeshLODLevel(distance, mesh);
  8561. this._LODLevels.push(level);
  8562. if (mesh) {
  8563. mesh._masterMesh = this;
  8564. }
  8565. this._sortLODLevels();
  8566. return this;
  8567. };
  8568. Mesh.prototype.removeLODLevel = function (mesh) {
  8569. for (var index = 0; index < this._LODLevels.length; index++) {
  8570. if (this._LODLevels[index].mesh === mesh) {
  8571. this._LODLevels.splice(index, 1);
  8572. if (mesh) {
  8573. mesh._masterMesh = null;
  8574. }
  8575. }
  8576. }
  8577. this._sortLODLevels();
  8578. return this;
  8579. };
  8580. Mesh.prototype.getLOD = function (camera, boundingSphere) {
  8581. if (!this._LODLevels || this._LODLevels.length === 0) {
  8582. return this;
  8583. }
  8584. var distanceToCamera = (boundingSphere ? boundingSphere : this.getBoundingInfo().boundingSphere).centerWorld.subtract(camera.position).length();
  8585. if (this._LODLevels[this._LODLevels.length - 1].distance > distanceToCamera) {
  8586. return this;
  8587. }
  8588. for (var index = 0; index < this._LODLevels.length; index++) {
  8589. var level = this._LODLevels[index];
  8590. if (level.distance < distanceToCamera) {
  8591. if (level.mesh) {
  8592. level.mesh._preActivate();
  8593. level.mesh._updateSubMeshesBoundingInfo(this.worldMatrixFromCache);
  8594. }
  8595. return level.mesh;
  8596. }
  8597. }
  8598. return this;
  8599. };
  8600. Object.defineProperty(Mesh.prototype, "geometry", {
  8601. get: function () {
  8602. return this._geometry;
  8603. },
  8604. enumerable: true,
  8605. configurable: true
  8606. });
  8607. Mesh.prototype.getTotalVertices = function () {
  8608. if (!this._geometry) {
  8609. return 0;
  8610. }
  8611. return this._geometry.getTotalVertices();
  8612. };
  8613. Mesh.prototype.getVerticesData = function (kind) {
  8614. if (!this._geometry) {
  8615. return null;
  8616. }
  8617. return this._geometry.getVerticesData(kind);
  8618. };
  8619. Mesh.prototype.getVertexBuffer = function (kind) {
  8620. if (!this._geometry) {
  8621. return undefined;
  8622. }
  8623. return this._geometry.getVertexBuffer(kind);
  8624. };
  8625. Mesh.prototype.isVerticesDataPresent = function (kind) {
  8626. if (!this._geometry) {
  8627. if (this._delayInfo) {
  8628. return this._delayInfo.indexOf(kind) !== -1;
  8629. }
  8630. return false;
  8631. }
  8632. return this._geometry.isVerticesDataPresent(kind);
  8633. };
  8634. Mesh.prototype.getVerticesDataKinds = function () {
  8635. if (!this._geometry) {
  8636. var result = [];
  8637. if (this._delayInfo) {
  8638. for (var kind in this._delayInfo) {
  8639. result.push(kind);
  8640. }
  8641. }
  8642. return result;
  8643. }
  8644. return this._geometry.getVerticesDataKinds();
  8645. };
  8646. Mesh.prototype.getTotalIndices = function () {
  8647. if (!this._geometry) {
  8648. return 0;
  8649. }
  8650. return this._geometry.getTotalIndices();
  8651. };
  8652. Mesh.prototype.getIndices = function () {
  8653. if (!this._geometry) {
  8654. return [];
  8655. }
  8656. return this._geometry.getIndices();
  8657. };
  8658. Object.defineProperty(Mesh.prototype, "isBlocked", {
  8659. get: function () {
  8660. return this._masterMesh !== null && this._masterMesh !== undefined;
  8661. },
  8662. enumerable: true,
  8663. configurable: true
  8664. });
  8665. Mesh.prototype.isReady = function () {
  8666. if (this.delayLoadState === BABYLON.Engine.DELAYLOADSTATE_LOADING) {
  8667. return false;
  8668. }
  8669. return _super.prototype.isReady.call(this);
  8670. };
  8671. Mesh.prototype.isDisposed = function () {
  8672. return this._isDisposed;
  8673. };
  8674. Mesh.prototype._preActivate = function () {
  8675. var sceneRenderId = this.getScene().getRenderId();
  8676. if (this._preActivateId == sceneRenderId) {
  8677. return;
  8678. }
  8679. this._preActivateId = sceneRenderId;
  8680. this._visibleInstances = null;
  8681. };
  8682. Mesh.prototype._registerInstanceForRenderId = function (instance, renderId) {
  8683. if (!this._visibleInstances) {
  8684. this._visibleInstances = {};
  8685. this._visibleInstances.defaultRenderId = renderId;
  8686. this._visibleInstances.selfDefaultRenderId = this._renderId;
  8687. }
  8688. if (!this._visibleInstances[renderId]) {
  8689. this._visibleInstances[renderId] = new Array();
  8690. }
  8691. this._visibleInstances[renderId].push(instance);
  8692. };
  8693. Mesh.prototype.refreshBoundingInfo = function () {
  8694. var data = this.getVerticesData(BABYLON.VertexBuffer.PositionKind);
  8695. if (data) {
  8696. var extend = BABYLON.Tools.ExtractMinAndMax(data, 0, this.getTotalVertices());
  8697. this._boundingInfo = new BABYLON.BoundingInfo(extend.minimum, extend.maximum);
  8698. }
  8699. if (this.subMeshes) {
  8700. for (var index = 0; index < this.subMeshes.length; index++) {
  8701. this.subMeshes[index].refreshBoundingInfo();
  8702. }
  8703. }
  8704. this._updateBoundingInfo();
  8705. };
  8706. Mesh.prototype._createGlobalSubMesh = function () {
  8707. var totalVertices = this.getTotalVertices();
  8708. if (!totalVertices || !this.getIndices()) {
  8709. return null;
  8710. }
  8711. this.releaseSubMeshes();
  8712. return new BABYLON.SubMesh(0, 0, totalVertices, 0, this.getTotalIndices(), this);
  8713. };
  8714. Mesh.prototype.subdivide = function (count) {
  8715. if (count < 1) {
  8716. return;
  8717. }
  8718. var totalIndices = this.getTotalIndices();
  8719. var subdivisionSize = (totalIndices / count) | 0;
  8720. var offset = 0;
  8721. while (subdivisionSize % 3 != 0) {
  8722. subdivisionSize++;
  8723. }
  8724. this.releaseSubMeshes();
  8725. for (var index = 0; index < count; index++) {
  8726. if (offset >= totalIndices) {
  8727. break;
  8728. }
  8729. BABYLON.SubMesh.CreateFromIndices(0, offset, Math.min(subdivisionSize, totalIndices - offset), this);
  8730. offset += subdivisionSize;
  8731. }
  8732. this.synchronizeInstances();
  8733. };
  8734. Mesh.prototype.setVerticesData = function (kind, data, updatable, stride) {
  8735. if (kind instanceof Array) {
  8736. var temp = data;
  8737. data = kind;
  8738. kind = temp;
  8739. BABYLON.Tools.Warn("Deprecated usage of setVerticesData detected (since v1.12). Current signature is setVerticesData(kind, data, updatable).");
  8740. }
  8741. if (!this._geometry) {
  8742. var vertexData = new BABYLON.VertexData();
  8743. vertexData.set(data, kind);
  8744. var scene = this.getScene();
  8745. new BABYLON.Geometry(BABYLON.Geometry.RandomId(), scene, vertexData, updatable, this);
  8746. } else {
  8747. this._geometry.setVerticesData(kind, data, updatable, stride);
  8748. }
  8749. };
  8750. Mesh.prototype.updateVerticesData = function (kind, data, updateExtends, makeItUnique) {
  8751. if (!this._geometry) {
  8752. return;
  8753. }
  8754. if (!makeItUnique) {
  8755. this._geometry.updateVerticesData(kind, data, updateExtends);
  8756. } else {
  8757. this.makeGeometryUnique();
  8758. this.updateVerticesData(kind, data, updateExtends, false);
  8759. }
  8760. };
  8761. Mesh.prototype.updateVerticesDataDirectly = function (kind, data, makeItUnique) {
  8762. if (!this._geometry) {
  8763. return;
  8764. }
  8765. if (!makeItUnique) {
  8766. this._geometry.updateVerticesDataDirectly(kind, data);
  8767. } else {
  8768. this.makeGeometryUnique();
  8769. this.updateVerticesDataDirectly(kind, data, false);
  8770. }
  8771. };
  8772. Mesh.prototype.makeGeometryUnique = function () {
  8773. if (!this._geometry) {
  8774. return;
  8775. }
  8776. var geometry = this._geometry.copy(BABYLON.Geometry.RandomId());
  8777. geometry.applyToMesh(this);
  8778. };
  8779. Mesh.prototype.setIndices = function (indices) {
  8780. if (!this._geometry) {
  8781. var vertexData = new BABYLON.VertexData();
  8782. vertexData.indices = indices;
  8783. var scene = this.getScene();
  8784. new BABYLON.Geometry(BABYLON.Geometry.RandomId(), scene, vertexData, false, this);
  8785. } else {
  8786. this._geometry.setIndices(indices);
  8787. }
  8788. };
  8789. Mesh.prototype._bind = function (subMesh, effect, fillMode) {
  8790. var engine = this.getScene().getEngine();
  8791. var indexToBind;
  8792. switch (fillMode) {
  8793. case BABYLON.Material.PointFillMode:
  8794. indexToBind = null;
  8795. break;
  8796. case BABYLON.Material.WireFrameFillMode:
  8797. indexToBind = subMesh.getLinesIndexBuffer(this.getIndices(), engine);
  8798. break;
  8799. default:
  8800. case BABYLON.Material.TriangleFillMode:
  8801. indexToBind = this._geometry.getIndexBuffer();
  8802. break;
  8803. }
  8804. engine.bindMultiBuffers(this._geometry.getVertexBuffers(), indexToBind, effect);
  8805. };
  8806. Mesh.prototype._draw = function (subMesh, fillMode, instancesCount) {
  8807. if (!this._geometry || !this._geometry.getVertexBuffers() || !this._geometry.getIndexBuffer()) {
  8808. return;
  8809. }
  8810. var engine = this.getScene().getEngine();
  8811. switch (fillMode) {
  8812. case BABYLON.Material.PointFillMode:
  8813. engine.drawPointClouds(subMesh.verticesStart, subMesh.verticesCount, instancesCount);
  8814. break;
  8815. case BABYLON.Material.WireFrameFillMode:
  8816. engine.draw(false, 0, subMesh.linesIndexCount, instancesCount);
  8817. break;
  8818. default:
  8819. engine.draw(true, subMesh.indexStart, subMesh.indexCount, instancesCount);
  8820. }
  8821. };
  8822. Mesh.prototype.registerBeforeRender = function (func) {
  8823. this._onBeforeRenderCallbacks.push(func);
  8824. };
  8825. Mesh.prototype.unregisterBeforeRender = function (func) {
  8826. var index = this._onBeforeRenderCallbacks.indexOf(func);
  8827. if (index > -1) {
  8828. this._onBeforeRenderCallbacks.splice(index, 1);
  8829. }
  8830. };
  8831. Mesh.prototype.registerAfterRender = function (func) {
  8832. this._onAfterRenderCallbacks.push(func);
  8833. };
  8834. Mesh.prototype.unregisterAfterRender = function (func) {
  8835. var index = this._onAfterRenderCallbacks.indexOf(func);
  8836. if (index > -1) {
  8837. this._onAfterRenderCallbacks.splice(index, 1);
  8838. }
  8839. };
  8840. Mesh.prototype._getInstancesRenderList = function (subMeshId) {
  8841. var scene = this.getScene();
  8842. this._batchCache.mustReturn = false;
  8843. this._batchCache.renderSelf[subMeshId] = this.isEnabled() && this.isVisible;
  8844. this._batchCache.visibleInstances[subMeshId] = null;
  8845. if (this._visibleInstances) {
  8846. var currentRenderId = scene.getRenderId();
  8847. this._batchCache.visibleInstances[subMeshId] = this._visibleInstances[currentRenderId];
  8848. var selfRenderId = this._renderId;
  8849. if (!this._batchCache.visibleInstances[subMeshId] && this._visibleInstances.defaultRenderId) {
  8850. this._batchCache.visibleInstances[subMeshId] = this._visibleInstances[this._visibleInstances.defaultRenderId];
  8851. currentRenderId = this._visibleInstances.defaultRenderId;
  8852. selfRenderId = this._visibleInstances.selfDefaultRenderId;
  8853. }
  8854. if (this._batchCache.visibleInstances[subMeshId] && this._batchCache.visibleInstances[subMeshId].length) {
  8855. if (this._renderIdForInstances[subMeshId] === currentRenderId) {
  8856. this._batchCache.mustReturn = true;
  8857. return this._batchCache;
  8858. }
  8859. if (currentRenderId !== selfRenderId) {
  8860. this._batchCache.renderSelf[subMeshId] = false;
  8861. }
  8862. }
  8863. this._renderIdForInstances[subMeshId] = currentRenderId;
  8864. }
  8865. return this._batchCache;
  8866. };
  8867. Mesh.prototype._renderWithInstances = function (subMesh, fillMode, batch, effect, engine) {
  8868. var visibleInstances = batch.visibleInstances[subMesh._id];
  8869. var matricesCount = visibleInstances.length + 1;
  8870. var bufferSize = matricesCount * 16 * 4;
  8871. while (this._instancesBufferSize < bufferSize) {
  8872. this._instancesBufferSize *= 2;
  8873. }
  8874. if (!this._worldMatricesInstancesBuffer || this._worldMatricesInstancesBuffer.capacity < this._instancesBufferSize) {
  8875. if (this._worldMatricesInstancesBuffer) {
  8876. engine.deleteInstancesBuffer(this._worldMatricesInstancesBuffer);
  8877. }
  8878. this._worldMatricesInstancesBuffer = engine.createInstancesBuffer(this._instancesBufferSize);
  8879. this._worldMatricesInstancesArray = new Float32Array(this._instancesBufferSize / 4);
  8880. }
  8881. var offset = 0;
  8882. var instancesCount = 0;
  8883. var world = this.getWorldMatrix();
  8884. if (batch.renderSelf[subMesh._id]) {
  8885. world.copyToArray(this._worldMatricesInstancesArray, offset);
  8886. offset += 16;
  8887. instancesCount++;
  8888. }
  8889. if (visibleInstances) {
  8890. for (var instanceIndex = 0; instanceIndex < visibleInstances.length; instanceIndex++) {
  8891. var instance = visibleInstances[instanceIndex];
  8892. instance.getWorldMatrix().copyToArray(this._worldMatricesInstancesArray, offset);
  8893. offset += 16;
  8894. instancesCount++;
  8895. }
  8896. }
  8897. var offsetLocation0 = effect.getAttributeLocationByName("world0");
  8898. var offsetLocation1 = effect.getAttributeLocationByName("world1");
  8899. var offsetLocation2 = effect.getAttributeLocationByName("world2");
  8900. var offsetLocation3 = effect.getAttributeLocationByName("world3");
  8901. var offsetLocations = [offsetLocation0, offsetLocation1, offsetLocation2, offsetLocation3];
  8902. engine.updateAndBindInstancesBuffer(this._worldMatricesInstancesBuffer, this._worldMatricesInstancesArray, offsetLocations);
  8903. this._draw(subMesh, fillMode, instancesCount);
  8904. engine.unBindInstancesBuffer(this._worldMatricesInstancesBuffer, offsetLocations);
  8905. };
  8906. Mesh.prototype.render = function (subMesh) {
  8907. var scene = this.getScene();
  8908. var batch = this._getInstancesRenderList(subMesh._id);
  8909. if (batch.mustReturn) {
  8910. return;
  8911. }
  8912. if (!this._geometry || !this._geometry.getVertexBuffers() || !this._geometry.getIndexBuffer()) {
  8913. return;
  8914. }
  8915. for (var callbackIndex = 0; callbackIndex < this._onBeforeRenderCallbacks.length; callbackIndex++) {
  8916. this._onBeforeRenderCallbacks[callbackIndex]();
  8917. }
  8918. var engine = scene.getEngine();
  8919. var hardwareInstancedRendering = (engine.getCaps().instancedArrays !== null) && (batch.visibleInstances[subMesh._id] !== null) && (batch.visibleInstances[subMesh._id] !== undefined);
  8920. var effectiveMaterial = subMesh.getMaterial();
  8921. if (!effectiveMaterial || !effectiveMaterial.isReady(this, hardwareInstancedRendering)) {
  8922. return;
  8923. }
  8924. var savedDepthWrite = engine.getDepthWrite();
  8925. if (this.renderOutline) {
  8926. engine.setDepthWrite(false);
  8927. scene.getOutlineRenderer().render(subMesh, batch);
  8928. engine.setDepthWrite(savedDepthWrite);
  8929. }
  8930. effectiveMaterial._preBind();
  8931. var effect = effectiveMaterial.getEffect();
  8932. var fillMode = scene.forceWireframe ? BABYLON.Material.WireFrameFillMode : effectiveMaterial.fillMode;
  8933. this._bind(subMesh, effect, fillMode);
  8934. var world = this.getWorldMatrix();
  8935. effectiveMaterial.bind(world, this);
  8936. if (hardwareInstancedRendering) {
  8937. this._renderWithInstances(subMesh, fillMode, batch, effect, engine);
  8938. } else {
  8939. if (batch.renderSelf[subMesh._id]) {
  8940. this._draw(subMesh, fillMode);
  8941. }
  8942. if (batch.visibleInstances[subMesh._id]) {
  8943. for (var instanceIndex = 0; instanceIndex < batch.visibleInstances[subMesh._id].length; instanceIndex++) {
  8944. var instance = batch.visibleInstances[subMesh._id][instanceIndex];
  8945. world = instance.getWorldMatrix();
  8946. effectiveMaterial.bindOnlyWorldMatrix(world);
  8947. this._draw(subMesh, fillMode);
  8948. }
  8949. }
  8950. }
  8951. effectiveMaterial.unbind();
  8952. if (this.renderOutline && savedDepthWrite) {
  8953. engine.setDepthWrite(true);
  8954. engine.setColorWrite(false);
  8955. scene.getOutlineRenderer().render(subMesh, batch);
  8956. engine.setColorWrite(true);
  8957. }
  8958. if (this.renderOverlay) {
  8959. var currentMode = engine.getAlphaMode();
  8960. engine.setAlphaMode(BABYLON.Engine.ALPHA_COMBINE);
  8961. scene.getOutlineRenderer().render(subMesh, batch, true);
  8962. engine.setAlphaMode(currentMode);
  8963. }
  8964. for (callbackIndex = 0; callbackIndex < this._onAfterRenderCallbacks.length; callbackIndex++) {
  8965. this._onAfterRenderCallbacks[callbackIndex]();
  8966. }
  8967. };
  8968. Mesh.prototype.getEmittedParticleSystems = function () {
  8969. var results = new Array();
  8970. for (var index = 0; index < this.getScene().particleSystems.length; index++) {
  8971. var particleSystem = this.getScene().particleSystems[index];
  8972. if (particleSystem.emitter === this) {
  8973. results.push(particleSystem);
  8974. }
  8975. }
  8976. return results;
  8977. };
  8978. Mesh.prototype.getHierarchyEmittedParticleSystems = function () {
  8979. var results = new Array();
  8980. var descendants = this.getDescendants();
  8981. descendants.push(this);
  8982. for (var index = 0; index < this.getScene().particleSystems.length; index++) {
  8983. var particleSystem = this.getScene().particleSystems[index];
  8984. if (descendants.indexOf(particleSystem.emitter) !== -1) {
  8985. results.push(particleSystem);
  8986. }
  8987. }
  8988. return results;
  8989. };
  8990. Mesh.prototype.getChildren = function () {
  8991. var results = [];
  8992. for (var index = 0; index < this.getScene().meshes.length; index++) {
  8993. var mesh = this.getScene().meshes[index];
  8994. if (mesh.parent == this) {
  8995. results.push(mesh);
  8996. }
  8997. }
  8998. return results;
  8999. };
  9000. Mesh.prototype._checkDelayState = function () {
  9001. var _this = this;
  9002. var that = this;
  9003. var scene = this.getScene();
  9004. if (this._geometry) {
  9005. this._geometry.load(scene);
  9006. } else if (that.delayLoadState === BABYLON.Engine.DELAYLOADSTATE_NOTLOADED) {
  9007. that.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_LOADING;
  9008. scene._addPendingData(that);
  9009. var getBinaryData = (this.delayLoadingFile.indexOf(".babylonbinarymeshdata") !== -1) ? true : false;
  9010. BABYLON.Tools.LoadFile(this.delayLoadingFile, function (data) {
  9011. if (data instanceof ArrayBuffer) {
  9012. _this._delayLoadingFunction(data, _this);
  9013. } else {
  9014. _this._delayLoadingFunction(JSON.parse(data), _this);
  9015. }
  9016. _this.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_LOADED;
  9017. scene._removePendingData(_this);
  9018. }, function () {
  9019. }, scene.database, getBinaryData);
  9020. }
  9021. };
  9022. Mesh.prototype.isInFrustum = function (frustumPlanes) {
  9023. if (this.delayLoadState === BABYLON.Engine.DELAYLOADSTATE_LOADING) {
  9024. return false;
  9025. }
  9026. if (!_super.prototype.isInFrustum.call(this, frustumPlanes)) {
  9027. return false;
  9028. }
  9029. this._checkDelayState();
  9030. return true;
  9031. };
  9032. Mesh.prototype.setMaterialByID = function (id) {
  9033. var materials = this.getScene().materials;
  9034. for (var index = 0; index < materials.length; index++) {
  9035. if (materials[index].id == id) {
  9036. this.material = materials[index];
  9037. return;
  9038. }
  9039. }
  9040. var multiMaterials = this.getScene().multiMaterials;
  9041. for (index = 0; index < multiMaterials.length; index++) {
  9042. if (multiMaterials[index].id == id) {
  9043. this.material = multiMaterials[index];
  9044. return;
  9045. }
  9046. }
  9047. };
  9048. Mesh.prototype.getAnimatables = function () {
  9049. var results = [];
  9050. if (this.material) {
  9051. results.push(this.material);
  9052. }
  9053. if (this.skeleton) {
  9054. results.push(this.skeleton);
  9055. }
  9056. return results;
  9057. };
  9058. Mesh.prototype.bakeTransformIntoVertices = function (transform) {
  9059. if (!this.isVerticesDataPresent(BABYLON.VertexBuffer.PositionKind)) {
  9060. return;
  9061. }
  9062. this._resetPointsArrayCache();
  9063. var data = this.getVerticesData(BABYLON.VertexBuffer.PositionKind);
  9064. var temp = [];
  9065. for (var index = 0; index < data.length; index += 3) {
  9066. BABYLON.Vector3.TransformCoordinates(BABYLON.Vector3.FromArray(data, index), transform).toArray(temp, index);
  9067. }
  9068. this.setVerticesData(BABYLON.VertexBuffer.PositionKind, temp, this.getVertexBuffer(BABYLON.VertexBuffer.PositionKind).isUpdatable());
  9069. if (!this.isVerticesDataPresent(BABYLON.VertexBuffer.NormalKind)) {
  9070. return;
  9071. }
  9072. data = this.getVerticesData(BABYLON.VertexBuffer.NormalKind);
  9073. for (index = 0; index < data.length; index += 3) {
  9074. BABYLON.Vector3.TransformNormal(BABYLON.Vector3.FromArray(data, index), transform).toArray(temp, index);
  9075. }
  9076. this.setVerticesData(BABYLON.VertexBuffer.NormalKind, temp, this.getVertexBuffer(BABYLON.VertexBuffer.NormalKind).isUpdatable());
  9077. };
  9078. Mesh.prototype._resetPointsArrayCache = function () {
  9079. this._positions = null;
  9080. };
  9081. Mesh.prototype._generatePointsArray = function () {
  9082. if (this._positions)
  9083. return true;
  9084. this._positions = [];
  9085. var data = this.getVerticesData(BABYLON.VertexBuffer.PositionKind);
  9086. if (!data) {
  9087. return false;
  9088. }
  9089. for (var index = 0; index < data.length; index += 3) {
  9090. this._positions.push(BABYLON.Vector3.FromArray(data, index));
  9091. }
  9092. return true;
  9093. };
  9094. Mesh.prototype.clone = function (name, newParent, doNotCloneChildren) {
  9095. var result = new BABYLON.Mesh(name, this.getScene());
  9096. this._geometry.applyToMesh(result);
  9097. BABYLON.Tools.DeepCopy(this, result, ["name", "material", "skeleton"], []);
  9098. result.material = this.material;
  9099. if (newParent) {
  9100. result.parent = newParent;
  9101. }
  9102. if (!doNotCloneChildren) {
  9103. for (var index = 0; index < this.getScene().meshes.length; index++) {
  9104. var mesh = this.getScene().meshes[index];
  9105. if (mesh.parent == this) {
  9106. mesh.clone(mesh.name, result);
  9107. }
  9108. }
  9109. }
  9110. for (index = 0; index < this.getScene().particleSystems.length; index++) {
  9111. var system = this.getScene().particleSystems[index];
  9112. if (system.emitter == this) {
  9113. system.clone(system.name, result);
  9114. }
  9115. }
  9116. result.computeWorldMatrix(true);
  9117. return result;
  9118. };
  9119. Mesh.prototype.dispose = function (doNotRecurse) {
  9120. if (this._geometry) {
  9121. this._geometry.releaseForMesh(this, true);
  9122. }
  9123. if (this._worldMatricesInstancesBuffer) {
  9124. this.getEngine().deleteInstancesBuffer(this._worldMatricesInstancesBuffer);
  9125. this._worldMatricesInstancesBuffer = null;
  9126. }
  9127. while (this.instances.length) {
  9128. this.instances[0].dispose();
  9129. }
  9130. _super.prototype.dispose.call(this, doNotRecurse);
  9131. };
  9132. Mesh.prototype.applyDisplacementMap = function (url, minHeight, maxHeight) {
  9133. var _this = this;
  9134. var scene = this.getScene();
  9135. var onload = function (img) {
  9136. var canvas = document.createElement("canvas");
  9137. var context = canvas.getContext("2d");
  9138. var heightMapWidth = img.width;
  9139. var heightMapHeight = img.height;
  9140. canvas.width = heightMapWidth;
  9141. canvas.height = heightMapHeight;
  9142. context.drawImage(img, 0, 0);
  9143. var buffer = context.getImageData(0, 0, heightMapWidth, heightMapHeight).data;
  9144. _this.applyDisplacementMapFromBuffer(buffer, heightMapWidth, heightMapHeight, minHeight, maxHeight);
  9145. };
  9146. BABYLON.Tools.LoadImage(url, onload, function () {
  9147. }, scene.database);
  9148. };
  9149. Mesh.prototype.applyDisplacementMapFromBuffer = function (buffer, heightMapWidth, heightMapHeight, minHeight, maxHeight) {
  9150. if (!this.isVerticesDataPresent(BABYLON.VertexBuffer.PositionKind) || !this.isVerticesDataPresent(BABYLON.VertexBuffer.NormalKind) || !this.isVerticesDataPresent(BABYLON.VertexBuffer.UVKind)) {
  9151. BABYLON.Tools.Warn("Cannot call applyDisplacementMap: Given mesh is not complete. Position, Normal or UV are missing");
  9152. return;
  9153. }
  9154. var positions = this.getVerticesData(BABYLON.VertexBuffer.PositionKind);
  9155. var normals = this.getVerticesData(BABYLON.VertexBuffer.NormalKind);
  9156. var uvs = this.getVerticesData(BABYLON.VertexBuffer.UVKind);
  9157. var position = BABYLON.Vector3.Zero();
  9158. var normal = BABYLON.Vector3.Zero();
  9159. var uv = BABYLON.Vector2.Zero();
  9160. for (var index = 0; index < positions.length; index += 3) {
  9161. BABYLON.Vector3.FromArrayToRef(positions, index, position);
  9162. BABYLON.Vector3.FromArrayToRef(normals, index, normal);
  9163. BABYLON.Vector2.FromArrayToRef(uvs, (index / 3) * 2, uv);
  9164. var u = ((Math.abs(uv.x) * heightMapWidth) % heightMapWidth) | 0;
  9165. var v = ((Math.abs(uv.y) * heightMapHeight) % heightMapHeight) | 0;
  9166. var pos = (u + v * heightMapWidth) * 4;
  9167. var r = buffer[pos] / 255.0;
  9168. var g = buffer[pos + 1] / 255.0;
  9169. var b = buffer[pos + 2] / 255.0;
  9170. var gradient = r * 0.3 + g * 0.59 + b * 0.11;
  9171. normal.normalize();
  9172. normal.scaleInPlace(minHeight + (maxHeight - minHeight) * gradient);
  9173. position = position.add(normal);
  9174. position.toArray(positions, index);
  9175. }
  9176. BABYLON.VertexData.ComputeNormals(positions, this.getIndices(), normals);
  9177. this.updateVerticesData(BABYLON.VertexBuffer.PositionKind, positions);
  9178. this.updateVerticesData(BABYLON.VertexBuffer.NormalKind, normals);
  9179. };
  9180. Mesh.prototype.convertToFlatShadedMesh = function () {
  9181. var kinds = this.getVerticesDataKinds();
  9182. var vbs = [];
  9183. var data = [];
  9184. var newdata = [];
  9185. var updatableNormals = false;
  9186. for (var kindIndex = 0; kindIndex < kinds.length; kindIndex++) {
  9187. var kind = kinds[kindIndex];
  9188. var vertexBuffer = this.getVertexBuffer(kind);
  9189. if (kind === BABYLON.VertexBuffer.NormalKind) {
  9190. updatableNormals = vertexBuffer.isUpdatable();
  9191. kinds.splice(kindIndex, 1);
  9192. kindIndex--;
  9193. continue;
  9194. }
  9195. vbs[kind] = vertexBuffer;
  9196. data[kind] = vbs[kind].getData();
  9197. newdata[kind] = [];
  9198. }
  9199. var previousSubmeshes = this.subMeshes.slice(0);
  9200. var indices = this.getIndices();
  9201. var totalIndices = this.getTotalIndices();
  9202. for (index = 0; index < totalIndices; index++) {
  9203. var vertexIndex = indices[index];
  9204. for (kindIndex = 0; kindIndex < kinds.length; kindIndex++) {
  9205. kind = kinds[kindIndex];
  9206. var stride = vbs[kind].getStrideSize();
  9207. for (var offset = 0; offset < stride; offset++) {
  9208. newdata[kind].push(data[kind][vertexIndex * stride + offset]);
  9209. }
  9210. }
  9211. }
  9212. var normals = [];
  9213. var positions = newdata[BABYLON.VertexBuffer.PositionKind];
  9214. for (var index = 0; index < totalIndices; index += 3) {
  9215. indices[index] = index;
  9216. indices[index + 1] = index + 1;
  9217. indices[index + 2] = index + 2;
  9218. var p1 = BABYLON.Vector3.FromArray(positions, index * 3);
  9219. var p2 = BABYLON.Vector3.FromArray(positions, (index + 1) * 3);
  9220. var p3 = BABYLON.Vector3.FromArray(positions, (index + 2) * 3);
  9221. var p1p2 = p1.subtract(p2);
  9222. var p3p2 = p3.subtract(p2);
  9223. var normal = BABYLON.Vector3.Normalize(BABYLON.Vector3.Cross(p1p2, p3p2));
  9224. for (var localIndex = 0; localIndex < 3; localIndex++) {
  9225. normals.push(normal.x);
  9226. normals.push(normal.y);
  9227. normals.push(normal.z);
  9228. }
  9229. }
  9230. this.setIndices(indices);
  9231. this.setVerticesData(BABYLON.VertexBuffer.NormalKind, normals, updatableNormals);
  9232. for (kindIndex = 0; kindIndex < kinds.length; kindIndex++) {
  9233. kind = kinds[kindIndex];
  9234. this.setVerticesData(kind, newdata[kind], vbs[kind].isUpdatable());
  9235. }
  9236. this.releaseSubMeshes();
  9237. for (var submeshIndex = 0; submeshIndex < previousSubmeshes.length; submeshIndex++) {
  9238. var previousOne = previousSubmeshes[submeshIndex];
  9239. var subMesh = new BABYLON.SubMesh(previousOne.materialIndex, previousOne.indexStart, previousOne.indexCount, previousOne.indexStart, previousOne.indexCount, this);
  9240. }
  9241. this.synchronizeInstances();
  9242. };
  9243. Mesh.prototype.createInstance = function (name) {
  9244. return new BABYLON.InstancedMesh(name, this);
  9245. };
  9246. Mesh.prototype.synchronizeInstances = function () {
  9247. for (var instanceIndex = 0; instanceIndex < this.instances.length; instanceIndex++) {
  9248. var instance = this.instances[instanceIndex];
  9249. instance._syncSubMeshes();
  9250. }
  9251. };
  9252. Mesh.CreateBox = function (name, size, scene, updatable) {
  9253. var box = new BABYLON.Mesh(name, scene);
  9254. var vertexData = BABYLON.VertexData.CreateBox(size);
  9255. vertexData.applyToMesh(box, updatable);
  9256. return box;
  9257. };
  9258. Mesh.CreateSphere = function (name, segments, diameter, scene, updatable) {
  9259. var sphere = new BABYLON.Mesh(name, scene);
  9260. var vertexData = BABYLON.VertexData.CreateSphere(segments, diameter);
  9261. vertexData.applyToMesh(sphere, updatable);
  9262. return sphere;
  9263. };
  9264. Mesh.CreateCylinder = function (name, height, diameterTop, diameterBottom, tessellation, subdivisions, scene, updatable) {
  9265. if (scene === undefined || !(scene instanceof BABYLON.Scene)) {
  9266. if (scene !== undefined) {
  9267. updatable = scene;
  9268. }
  9269. scene = subdivisions;
  9270. subdivisions = 1;
  9271. }
  9272. var cylinder = new BABYLON.Mesh(name, scene);
  9273. var vertexData = BABYLON.VertexData.CreateCylinder(height, diameterTop, diameterBottom, tessellation, subdivisions);
  9274. vertexData.applyToMesh(cylinder, updatable);
  9275. return cylinder;
  9276. };
  9277. Mesh.CreateTorus = function (name, diameter, thickness, tessellation, scene, updatable) {
  9278. var torus = new BABYLON.Mesh(name, scene);
  9279. var vertexData = BABYLON.VertexData.CreateTorus(diameter, thickness, tessellation);
  9280. vertexData.applyToMesh(torus, updatable);
  9281. return torus;
  9282. };
  9283. Mesh.CreateTorusKnot = function (name, radius, tube, radialSegments, tubularSegments, p, q, scene, updatable) {
  9284. var torusKnot = new BABYLON.Mesh(name, scene);
  9285. var vertexData = BABYLON.VertexData.CreateTorusKnot(radius, tube, radialSegments, tubularSegments, p, q);
  9286. vertexData.applyToMesh(torusKnot, updatable);
  9287. return torusKnot;
  9288. };
  9289. Mesh.CreateLines = function (name, points, scene, updatable) {
  9290. var lines = new BABYLON.LinesMesh(name, scene, updatable);
  9291. var vertexData = BABYLON.VertexData.CreateLines(points);
  9292. vertexData.applyToMesh(lines, updatable);
  9293. return lines;
  9294. };
  9295. Mesh.CreatePlane = function (name, size, scene, updatable) {
  9296. var plane = new BABYLON.Mesh(name, scene);
  9297. var vertexData = BABYLON.VertexData.CreatePlane(size);
  9298. vertexData.applyToMesh(plane, updatable);
  9299. return plane;
  9300. };
  9301. Mesh.CreateGround = function (name, width, height, subdivisions, scene, updatable) {
  9302. var ground = new BABYLON.GroundMesh(name, scene);
  9303. ground._setReady(false);
  9304. ground._subdivisions = subdivisions;
  9305. var vertexData = BABYLON.VertexData.CreateGround(width, height, subdivisions);
  9306. vertexData.applyToMesh(ground, updatable);
  9307. ground._setReady(true);
  9308. return ground;
  9309. };
  9310. Mesh.CreateTiledGround = function (name, xmin, zmin, xmax, zmax, subdivisions, precision, scene, updatable) {
  9311. var tiledGround = new BABYLON.Mesh(name, scene);
  9312. var vertexData = BABYLON.VertexData.CreateTiledGround(xmin, zmin, xmax, zmax, subdivisions, precision);
  9313. vertexData.applyToMesh(tiledGround, updatable);
  9314. return tiledGround;
  9315. };
  9316. Mesh.CreateGroundFromHeightMap = function (name, url, width, height, subdivisions, minHeight, maxHeight, scene, updatable) {
  9317. var ground = new BABYLON.GroundMesh(name, scene);
  9318. ground._subdivisions = subdivisions;
  9319. ground._setReady(false);
  9320. var onload = function (img) {
  9321. var canvas = document.createElement("canvas");
  9322. var context = canvas.getContext("2d");
  9323. var heightMapWidth = img.width;
  9324. var heightMapHeight = img.height;
  9325. canvas.width = heightMapWidth;
  9326. canvas.height = heightMapHeight;
  9327. context.drawImage(img, 0, 0);
  9328. var buffer = context.getImageData(0, 0, heightMapWidth, heightMapHeight).data;
  9329. var vertexData = BABYLON.VertexData.CreateGroundFromHeightMap(width, height, subdivisions, minHeight, maxHeight, buffer, heightMapWidth, heightMapHeight);
  9330. vertexData.applyToMesh(ground, updatable);
  9331. ground._setReady(true);
  9332. };
  9333. BABYLON.Tools.LoadImage(url, onload, function () {
  9334. }, scene.database);
  9335. return ground;
  9336. };
  9337. Mesh.MinMax = function (meshes) {
  9338. var minVector = null;
  9339. var maxVector = null;
  9340. for (var i in meshes) {
  9341. var mesh = meshes[i];
  9342. var boundingBox = mesh.getBoundingInfo().boundingBox;
  9343. if (!minVector) {
  9344. minVector = boundingBox.minimumWorld;
  9345. maxVector = boundingBox.maximumWorld;
  9346. continue;
  9347. }
  9348. minVector.MinimizeInPlace(boundingBox.minimumWorld);
  9349. maxVector.MaximizeInPlace(boundingBox.maximumWorld);
  9350. }
  9351. return {
  9352. min: minVector,
  9353. max: maxVector
  9354. };
  9355. };
  9356. Mesh.Center = function (meshesOrMinMaxVector) {
  9357. var minMaxVector = meshesOrMinMaxVector.min !== undefined ? meshesOrMinMaxVector : BABYLON.Mesh.MinMax(meshesOrMinMaxVector);
  9358. return BABYLON.Vector3.Center(minMaxVector.min, minMaxVector.max);
  9359. };
  9360. return Mesh;
  9361. })(BABYLON.AbstractMesh);
  9362. BABYLON.Mesh = Mesh;
  9363. })(BABYLON || (BABYLON = {}));
  9364. var __extends = this.__extends || function (d, b) {
  9365. for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p];
  9366. function __() { this.constructor = d; }
  9367. __.prototype = b.prototype;
  9368. d.prototype = new __();
  9369. };
  9370. var BABYLON;
  9371. (function (BABYLON) {
  9372. var GroundMesh = (function (_super) {
  9373. __extends(GroundMesh, _super);
  9374. function GroundMesh(name, scene) {
  9375. _super.call(this, name, scene);
  9376. this.generateOctree = false;
  9377. this._worldInverse = new BABYLON.Matrix();
  9378. }
  9379. Object.defineProperty(GroundMesh.prototype, "subdivisions", {
  9380. get: function () {
  9381. return this._subdivisions;
  9382. },
  9383. enumerable: true,
  9384. configurable: true
  9385. });
  9386. GroundMesh.prototype.optimize = function (chunksCount) {
  9387. this.subdivide(this._subdivisions);
  9388. this.createOrUpdateSubmeshesOctree(32);
  9389. };
  9390. GroundMesh.prototype.getHeightAtCoordinates = function (x, z) {
  9391. var ray = new BABYLON.Ray(new BABYLON.Vector3(x, this.getBoundingInfo().boundingBox.maximumWorld.y + 1, z), new BABYLON.Vector3(0, -1, 0));
  9392. this.getWorldMatrix().invertToRef(this._worldInverse);
  9393. ray = BABYLON.Ray.Transform(ray, this._worldInverse);
  9394. var pickInfo = this.intersects(ray);
  9395. if (pickInfo.hit) {
  9396. return pickInfo.pickedPoint.y;
  9397. }
  9398. return 0;
  9399. };
  9400. return GroundMesh;
  9401. })(BABYLON.Mesh);
  9402. BABYLON.GroundMesh = GroundMesh;
  9403. })(BABYLON || (BABYLON = {}));
  9404. var __extends = this.__extends || function (d, b) {
  9405. for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p];
  9406. function __() { this.constructor = d; }
  9407. __.prototype = b.prototype;
  9408. d.prototype = new __();
  9409. };
  9410. var BABYLON;
  9411. (function (BABYLON) {
  9412. var InstancedMesh = (function (_super) {
  9413. __extends(InstancedMesh, _super);
  9414. function InstancedMesh(name, source) {
  9415. _super.call(this, name, source.getScene());
  9416. source.instances.push(this);
  9417. this._sourceMesh = source;
  9418. this.position.copyFrom(source.position);
  9419. this.rotation.copyFrom(source.rotation);
  9420. this.scaling.copyFrom(source.scaling);
  9421. if (source.rotationQuaternion) {
  9422. this.rotationQuaternion = source.rotationQuaternion.clone();
  9423. }
  9424. this.infiniteDistance = source.infiniteDistance;
  9425. this.setPivotMatrix(source.getPivotMatrix());
  9426. this.refreshBoundingInfo();
  9427. this._syncSubMeshes();
  9428. }
  9429. Object.defineProperty(InstancedMesh.prototype, "receiveShadows", {
  9430. get: function () {
  9431. return this._sourceMesh.receiveShadows;
  9432. },
  9433. enumerable: true,
  9434. configurable: true
  9435. });
  9436. Object.defineProperty(InstancedMesh.prototype, "material", {
  9437. get: function () {
  9438. return this._sourceMesh.material;
  9439. },
  9440. enumerable: true,
  9441. configurable: true
  9442. });
  9443. Object.defineProperty(InstancedMesh.prototype, "visibility", {
  9444. get: function () {
  9445. return this._sourceMesh.visibility;
  9446. },
  9447. enumerable: true,
  9448. configurable: true
  9449. });
  9450. Object.defineProperty(InstancedMesh.prototype, "skeleton", {
  9451. get: function () {
  9452. return this._sourceMesh.skeleton;
  9453. },
  9454. enumerable: true,
  9455. configurable: true
  9456. });
  9457. InstancedMesh.prototype.getTotalVertices = function () {
  9458. return this._sourceMesh.getTotalVertices();
  9459. };
  9460. Object.defineProperty(InstancedMesh.prototype, "sourceMesh", {
  9461. get: function () {
  9462. return this._sourceMesh;
  9463. },
  9464. enumerable: true,
  9465. configurable: true
  9466. });
  9467. InstancedMesh.prototype.getVerticesData = function (kind) {
  9468. return this._sourceMesh.getVerticesData(kind);
  9469. };
  9470. InstancedMesh.prototype.isVerticesDataPresent = function (kind) {
  9471. return this._sourceMesh.isVerticesDataPresent(kind);
  9472. };
  9473. InstancedMesh.prototype.getIndices = function () {
  9474. return this._sourceMesh.getIndices();
  9475. };
  9476. Object.defineProperty(InstancedMesh.prototype, "_positions", {
  9477. get: function () {
  9478. return this._sourceMesh._positions;
  9479. },
  9480. enumerable: true,
  9481. configurable: true
  9482. });
  9483. InstancedMesh.prototype.refreshBoundingInfo = function () {
  9484. var data = this._sourceMesh.getVerticesData(BABYLON.VertexBuffer.PositionKind);
  9485. if (data) {
  9486. var extend = BABYLON.Tools.ExtractMinAndMax(data, 0, this._sourceMesh.getTotalVertices());
  9487. this._boundingInfo = new BABYLON.BoundingInfo(extend.minimum, extend.maximum);
  9488. }
  9489. this._updateBoundingInfo();
  9490. };
  9491. InstancedMesh.prototype._preActivate = function () {
  9492. if (this._currentLOD) {
  9493. this._currentLOD._preActivate();
  9494. }
  9495. };
  9496. InstancedMesh.prototype._activate = function (renderId) {
  9497. if (this._currentLOD) {
  9498. this._currentLOD._registerInstanceForRenderId(this, renderId);
  9499. }
  9500. };
  9501. InstancedMesh.prototype.getLOD = function (camera) {
  9502. this._currentLOD = this.sourceMesh.getLOD(this.getScene().activeCamera, this.getBoundingInfo().boundingSphere);
  9503. return this._currentLOD;
  9504. };
  9505. InstancedMesh.prototype._syncSubMeshes = function () {
  9506. this.releaseSubMeshes();
  9507. for (var index = 0; index < this._sourceMesh.subMeshes.length; index++) {
  9508. this._sourceMesh.subMeshes[index].clone(this, this._sourceMesh);
  9509. }
  9510. };
  9511. InstancedMesh.prototype._generatePointsArray = function () {
  9512. return this._sourceMesh._generatePointsArray();
  9513. };
  9514. InstancedMesh.prototype.clone = function (name, newParent, doNotCloneChildren) {
  9515. var result = this._sourceMesh.createInstance(name);
  9516. BABYLON.Tools.DeepCopy(this, result, ["name"], []);
  9517. this.refreshBoundingInfo();
  9518. if (newParent) {
  9519. result.parent = newParent;
  9520. }
  9521. if (!doNotCloneChildren) {
  9522. for (var index = 0; index < this.getScene().meshes.length; index++) {
  9523. var mesh = this.getScene().meshes[index];
  9524. if (mesh.parent == this) {
  9525. mesh.clone(mesh.name, result);
  9526. }
  9527. }
  9528. }
  9529. result.computeWorldMatrix(true);
  9530. return result;
  9531. };
  9532. InstancedMesh.prototype.dispose = function (doNotRecurse) {
  9533. var index = this._sourceMesh.instances.indexOf(this);
  9534. this._sourceMesh.instances.splice(index, 1);
  9535. _super.prototype.dispose.call(this, doNotRecurse);
  9536. };
  9537. return InstancedMesh;
  9538. })(BABYLON.AbstractMesh);
  9539. BABYLON.InstancedMesh = InstancedMesh;
  9540. })(BABYLON || (BABYLON = {}));
  9541. var BABYLON;
  9542. (function (BABYLON) {
  9543. var SubMesh = (function () {
  9544. function SubMesh(materialIndex, verticesStart, verticesCount, indexStart, indexCount, mesh, renderingMesh, createBoundingBox) {
  9545. if (typeof createBoundingBox === "undefined") { createBoundingBox = true; }
  9546. this.materialIndex = materialIndex;
  9547. this.verticesStart = verticesStart;
  9548. this.verticesCount = verticesCount;
  9549. this.indexStart = indexStart;
  9550. this.indexCount = indexCount;
  9551. this._renderId = 0;
  9552. this._mesh = mesh;
  9553. this._renderingMesh = renderingMesh || mesh;
  9554. mesh.subMeshes.push(this);
  9555. this._id = mesh.subMeshes.length - 1;
  9556. if (createBoundingBox) {
  9557. this.refreshBoundingInfo();
  9558. }
  9559. }
  9560. SubMesh.prototype.getBoundingInfo = function () {
  9561. return this._boundingInfo;
  9562. };
  9563. SubMesh.prototype.getMesh = function () {
  9564. return this._mesh;
  9565. };
  9566. SubMesh.prototype.getRenderingMesh = function () {
  9567. return this._renderingMesh;
  9568. };
  9569. SubMesh.prototype.getMaterial = function () {
  9570. var rootMaterial = this._renderingMesh.material;
  9571. if (rootMaterial && rootMaterial instanceof BABYLON.MultiMaterial) {
  9572. var multiMaterial = rootMaterial;
  9573. return multiMaterial.getSubMaterial(this.materialIndex);
  9574. }
  9575. if (!rootMaterial) {
  9576. return this._mesh.getScene().defaultMaterial;
  9577. }
  9578. return rootMaterial;
  9579. };
  9580. SubMesh.prototype.refreshBoundingInfo = function () {
  9581. var data = this._renderingMesh.getVerticesData(BABYLON.VertexBuffer.PositionKind);
  9582. if (!data) {
  9583. this._boundingInfo = this._mesh._boundingInfo;
  9584. return;
  9585. }
  9586. var indices = this._renderingMesh.getIndices();
  9587. var extend;
  9588. if (this.indexStart === 0 && this.indexCount === indices.length) {
  9589. extend = BABYLON.Tools.ExtractMinAndMax(data, this.verticesStart, this.verticesCount);
  9590. } else {
  9591. extend = BABYLON.Tools.ExtractMinAndMaxIndexed(data, indices, this.indexStart, this.indexCount);
  9592. }
  9593. this._boundingInfo = new BABYLON.BoundingInfo(extend.minimum, extend.maximum);
  9594. };
  9595. SubMesh.prototype._checkCollision = function (collider) {
  9596. return this._boundingInfo._checkCollision(collider);
  9597. };
  9598. SubMesh.prototype.updateBoundingInfo = function (world) {
  9599. if (!this._boundingInfo) {
  9600. this.refreshBoundingInfo();
  9601. }
  9602. this._boundingInfo._update(world);
  9603. };
  9604. SubMesh.prototype.isInFrustum = function (frustumPlanes) {
  9605. return this._boundingInfo.isInFrustum(frustumPlanes);
  9606. };
  9607. SubMesh.prototype.render = function () {
  9608. this._renderingMesh.render(this);
  9609. };
  9610. SubMesh.prototype.getLinesIndexBuffer = function (indices, engine) {
  9611. if (!this._linesIndexBuffer) {
  9612. var linesIndices = [];
  9613. for (var index = this.indexStart; index < this.indexStart + this.indexCount; index += 3) {
  9614. linesIndices.push(indices[index], indices[index + 1], indices[index + 1], indices[index + 2], indices[index + 2], indices[index]);
  9615. }
  9616. this._linesIndexBuffer = engine.createIndexBuffer(linesIndices);
  9617. this.linesIndexCount = linesIndices.length;
  9618. }
  9619. return this._linesIndexBuffer;
  9620. };
  9621. SubMesh.prototype.canIntersects = function (ray) {
  9622. return ray.intersectsBox(this._boundingInfo.boundingBox);
  9623. };
  9624. SubMesh.prototype.intersects = function (ray, positions, indices, fastCheck) {
  9625. var intersectInfo = null;
  9626. for (var index = this.indexStart; index < this.indexStart + this.indexCount; index += 3) {
  9627. var p0 = positions[indices[index]];
  9628. var p1 = positions[indices[index + 1]];
  9629. var p2 = positions[indices[index + 2]];
  9630. var currentIntersectInfo = ray.intersectsTriangle(p0, p1, p2);
  9631. if (currentIntersectInfo) {
  9632. if (fastCheck || !intersectInfo || currentIntersectInfo.distance < intersectInfo.distance) {
  9633. intersectInfo = currentIntersectInfo;
  9634. intersectInfo.faceId = index / 3;
  9635. if (fastCheck) {
  9636. break;
  9637. }
  9638. }
  9639. }
  9640. }
  9641. return intersectInfo;
  9642. };
  9643. SubMesh.prototype.clone = function (newMesh, newRenderingMesh) {
  9644. var result = new SubMesh(this.materialIndex, this.verticesStart, this.verticesCount, this.indexStart, this.indexCount, newMesh, newRenderingMesh, false);
  9645. result._boundingInfo = new BABYLON.BoundingInfo(this._boundingInfo.minimum, this._boundingInfo.maximum);
  9646. return result;
  9647. };
  9648. SubMesh.prototype.dispose = function () {
  9649. if (this._linesIndexBuffer) {
  9650. this._mesh.getScene().getEngine()._releaseBuffer(this._linesIndexBuffer);
  9651. this._linesIndexBuffer = null;
  9652. }
  9653. var index = this._mesh.subMeshes.indexOf(this);
  9654. this._mesh.subMeshes.splice(index, 1);
  9655. };
  9656. SubMesh.CreateFromIndices = function (materialIndex, startIndex, indexCount, mesh, renderingMesh) {
  9657. var minVertexIndex = Number.MAX_VALUE;
  9658. var maxVertexIndex = -Number.MAX_VALUE;
  9659. renderingMesh = renderingMesh || mesh;
  9660. var indices = renderingMesh.getIndices();
  9661. for (var index = startIndex; index < startIndex + indexCount; index++) {
  9662. var vertexIndex = indices[index];
  9663. if (vertexIndex < minVertexIndex)
  9664. minVertexIndex = vertexIndex;
  9665. if (vertexIndex > maxVertexIndex)
  9666. maxVertexIndex = vertexIndex;
  9667. }
  9668. return new BABYLON.SubMesh(materialIndex, minVertexIndex, maxVertexIndex - minVertexIndex + 1, startIndex, indexCount, mesh, renderingMesh);
  9669. };
  9670. return SubMesh;
  9671. })();
  9672. BABYLON.SubMesh = SubMesh;
  9673. })(BABYLON || (BABYLON = {}));
  9674. var BABYLON;
  9675. (function (BABYLON) {
  9676. var BaseTexture = (function () {
  9677. function BaseTexture(scene) {
  9678. this.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_NONE;
  9679. this.hasAlpha = false;
  9680. this.getAlphaFromRGB = false;
  9681. this.level = 1;
  9682. this.isCube = false;
  9683. this.isRenderTarget = false;
  9684. this.animations = new Array();
  9685. this.coordinatesIndex = 0;
  9686. this.coordinatesMode = BABYLON.Texture.EXPLICIT_MODE;
  9687. this.wrapU = BABYLON.Texture.WRAP_ADDRESSMODE;
  9688. this.wrapV = BABYLON.Texture.WRAP_ADDRESSMODE;
  9689. this.anisotropicFilteringLevel = 4;
  9690. this._scene = scene;
  9691. this._scene.textures.push(this);
  9692. }
  9693. BaseTexture.prototype.getScene = function () {
  9694. return this._scene;
  9695. };
  9696. BaseTexture.prototype.getTextureMatrix = function () {
  9697. return null;
  9698. };
  9699. BaseTexture.prototype.getReflectionTextureMatrix = function () {
  9700. return null;
  9701. };
  9702. BaseTexture.prototype.getInternalTexture = function () {
  9703. return this._texture;
  9704. };
  9705. BaseTexture.prototype.isReady = function () {
  9706. if (this.delayLoadState === BABYLON.Engine.DELAYLOADSTATE_NOTLOADED) {
  9707. return true;
  9708. }
  9709. if (this._texture) {
  9710. return this._texture.isReady;
  9711. }
  9712. return false;
  9713. };
  9714. BaseTexture.prototype.getSize = function () {
  9715. if (this._texture._width) {
  9716. return { width: this._texture._width, height: this._texture._height };
  9717. }
  9718. if (this._texture._size) {
  9719. return { width: this._texture._size, height: this._texture._size };
  9720. }
  9721. return { width: 0, height: 0 };
  9722. };
  9723. BaseTexture.prototype.getBaseSize = function () {
  9724. if (!this.isReady())
  9725. return { width: 0, height: 0 };
  9726. if (this._texture._size) {
  9727. return { width: this._texture._size, height: this._texture._size };
  9728. }
  9729. return { width: this._texture._baseWidth, height: this._texture._baseHeight };
  9730. };
  9731. BaseTexture.prototype.scale = function (ratio) {
  9732. };
  9733. Object.defineProperty(BaseTexture.prototype, "canRescale", {
  9734. get: function () {
  9735. return false;
  9736. },
  9737. enumerable: true,
  9738. configurable: true
  9739. });
  9740. BaseTexture.prototype._removeFromCache = function (url, noMipmap) {
  9741. var texturesCache = this._scene.getEngine().getLoadedTexturesCache();
  9742. for (var index = 0; index < texturesCache.length; index++) {
  9743. var texturesCacheEntry = texturesCache[index];
  9744. if (texturesCacheEntry.url === url && texturesCacheEntry.noMipmap === noMipmap) {
  9745. texturesCache.splice(index, 1);
  9746. return;
  9747. }
  9748. }
  9749. };
  9750. BaseTexture.prototype._getFromCache = function (url, noMipmap) {
  9751. var texturesCache = this._scene.getEngine().getLoadedTexturesCache();
  9752. for (var index = 0; index < texturesCache.length; index++) {
  9753. var texturesCacheEntry = texturesCache[index];
  9754. if (texturesCacheEntry.url === url && texturesCacheEntry.noMipmap === noMipmap) {
  9755. texturesCacheEntry.references++;
  9756. return texturesCacheEntry;
  9757. }
  9758. }
  9759. return null;
  9760. };
  9761. BaseTexture.prototype.delayLoad = function () {
  9762. };
  9763. BaseTexture.prototype.releaseInternalTexture = function () {
  9764. if (!this._texture) {
  9765. return;
  9766. }
  9767. var texturesCache = this._scene.getEngine().getLoadedTexturesCache();
  9768. this._texture.references--;
  9769. if (this._texture.references == 0) {
  9770. var index = texturesCache.indexOf(this._texture);
  9771. texturesCache.splice(index, 1);
  9772. this._scene.getEngine()._releaseTexture(this._texture);
  9773. delete this._texture;
  9774. }
  9775. };
  9776. BaseTexture.prototype.clone = function () {
  9777. return null;
  9778. };
  9779. BaseTexture.prototype.dispose = function () {
  9780. var index = this._scene.textures.indexOf(this);
  9781. if (index >= 0) {
  9782. this._scene.textures.splice(index, 1);
  9783. }
  9784. if (this._texture === undefined) {
  9785. return;
  9786. }
  9787. this.releaseInternalTexture();
  9788. if (this.onDispose) {
  9789. this.onDispose();
  9790. }
  9791. };
  9792. return BaseTexture;
  9793. })();
  9794. BABYLON.BaseTexture = BaseTexture;
  9795. })(BABYLON || (BABYLON = {}));
  9796. var BABYLON;
  9797. (function (BABYLON) {
  9798. var RenderingGroup = (function () {
  9799. function RenderingGroup(index, scene) {
  9800. this.index = index;
  9801. this._opaqueSubMeshes = new BABYLON.SmartArray(256);
  9802. this._transparentSubMeshes = new BABYLON.SmartArray(256);
  9803. this._alphaTestSubMeshes = new BABYLON.SmartArray(256);
  9804. this._scene = scene;
  9805. }
  9806. RenderingGroup.prototype.render = function (customRenderFunction, beforeTransparents) {
  9807. if (customRenderFunction) {
  9808. customRenderFunction(this._opaqueSubMeshes, this._alphaTestSubMeshes, this._transparentSubMeshes, beforeTransparents);
  9809. return true;
  9810. }
  9811. if (this._opaqueSubMeshes.length === 0 && this._alphaTestSubMeshes.length === 0 && this._transparentSubMeshes.length === 0) {
  9812. return false;
  9813. }
  9814. var engine = this._scene.getEngine();
  9815. var subIndex;
  9816. var submesh;
  9817. for (subIndex = 0; subIndex < this._opaqueSubMeshes.length; subIndex++) {
  9818. submesh = this._opaqueSubMeshes.data[subIndex];
  9819. this._activeVertices += submesh.verticesCount;
  9820. submesh.render();
  9821. }
  9822. engine.setAlphaTesting(true);
  9823. for (subIndex = 0; subIndex < this._alphaTestSubMeshes.length; subIndex++) {
  9824. submesh = this._alphaTestSubMeshes.data[subIndex];
  9825. this._activeVertices += submesh.verticesCount;
  9826. submesh.render();
  9827. }
  9828. engine.setAlphaTesting(false);
  9829. if (beforeTransparents) {
  9830. beforeTransparents();
  9831. }
  9832. if (this._transparentSubMeshes.length) {
  9833. for (subIndex = 0; subIndex < this._transparentSubMeshes.length; subIndex++) {
  9834. submesh = this._transparentSubMeshes.data[subIndex];
  9835. submesh._alphaLayer = submesh.getMesh().alphaLayer;
  9836. submesh._distanceToCamera = submesh.getBoundingInfo().boundingSphere.centerWorld.subtract(this._scene.activeCamera.position).length();
  9837. }
  9838. var sortedArray = this._transparentSubMeshes.data.slice(0, this._transparentSubMeshes.length);
  9839. sortedArray.sort(function (a, b) {
  9840. if (a._alphaLayer > b._alphaLayer) {
  9841. return 1;
  9842. }
  9843. if (a._alphaLayer < b._alphaLayer) {
  9844. return -1;
  9845. }
  9846. if (a._distanceToCamera < b._distanceToCamera) {
  9847. return 1;
  9848. }
  9849. if (a._distanceToCamera > b._distanceToCamera) {
  9850. return -1;
  9851. }
  9852. return 0;
  9853. });
  9854. engine.setAlphaMode(BABYLON.Engine.ALPHA_COMBINE);
  9855. for (subIndex = 0; subIndex < sortedArray.length; subIndex++) {
  9856. submesh = sortedArray[subIndex];
  9857. this._activeVertices += submesh.verticesCount;
  9858. submesh.render();
  9859. }
  9860. engine.setAlphaMode(BABYLON.Engine.ALPHA_DISABLE);
  9861. }
  9862. return true;
  9863. };
  9864. RenderingGroup.prototype.prepare = function () {
  9865. this._opaqueSubMeshes.reset();
  9866. this._transparentSubMeshes.reset();
  9867. this._alphaTestSubMeshes.reset();
  9868. };
  9869. RenderingGroup.prototype.dispatch = function (subMesh) {
  9870. var material = subMesh.getMaterial();
  9871. var mesh = subMesh.getMesh();
  9872. if (material.needAlphaBlending() || mesh.visibility < 1.0 || mesh.hasVertexAlpha) {
  9873. if (material.alpha > 0 || mesh.visibility < 1.0) {
  9874. this._transparentSubMeshes.push(subMesh);
  9875. }
  9876. } else if (material.needAlphaTesting()) {
  9877. this._alphaTestSubMeshes.push(subMesh);
  9878. } else {
  9879. this._opaqueSubMeshes.push(subMesh);
  9880. }
  9881. };
  9882. return RenderingGroup;
  9883. })();
  9884. BABYLON.RenderingGroup = RenderingGroup;
  9885. })(BABYLON || (BABYLON = {}));
  9886. var BABYLON;
  9887. (function (BABYLON) {
  9888. var RenderingManager = (function () {
  9889. function RenderingManager(scene) {
  9890. this._renderingGroups = new Array();
  9891. this._scene = scene;
  9892. }
  9893. RenderingManager.prototype._renderParticles = function (index, activeMeshes) {
  9894. if (this._scene._activeParticleSystems.length === 0) {
  9895. return;
  9896. }
  9897. var beforeParticlesDate = BABYLON.Tools.Now;
  9898. for (var particleIndex = 0; particleIndex < this._scene._activeParticleSystems.length; particleIndex++) {
  9899. var particleSystem = this._scene._activeParticleSystems.data[particleIndex];
  9900. if (particleSystem.renderingGroupId !== index) {
  9901. continue;
  9902. }
  9903. this._clearDepthBuffer();
  9904. if (!particleSystem.emitter.position || !activeMeshes || activeMeshes.indexOf(particleSystem.emitter) !== -1) {
  9905. this._scene._activeParticles += particleSystem.render();
  9906. }
  9907. }
  9908. this._scene._particlesDuration += BABYLON.Tools.Now - beforeParticlesDate;
  9909. };
  9910. RenderingManager.prototype._renderSprites = function (index) {
  9911. if (this._scene.spriteManagers.length === 0) {
  9912. return;
  9913. }
  9914. var beforeSpritessDate = BABYLON.Tools.Now;
  9915. for (var id = 0; id < this._scene.spriteManagers.length; id++) {
  9916. var spriteManager = this._scene.spriteManagers[id];
  9917. if (spriteManager.renderingGroupId === index) {
  9918. this._clearDepthBuffer();
  9919. spriteManager.render();
  9920. }
  9921. }
  9922. this._scene._spritesDuration += BABYLON.Tools.Now - beforeSpritessDate;
  9923. };
  9924. RenderingManager.prototype._clearDepthBuffer = function () {
  9925. if (this._depthBufferAlreadyCleaned) {
  9926. return;
  9927. }
  9928. this._scene.getEngine().clear(0, false, true);
  9929. this._depthBufferAlreadyCleaned = true;
  9930. };
  9931. RenderingManager.prototype.render = function (customRenderFunction, activeMeshes, renderParticles, renderSprites) {
  9932. var _this = this;
  9933. for (var index = 0; index < BABYLON.RenderingManager.MAX_RENDERINGGROUPS; index++) {
  9934. this._depthBufferAlreadyCleaned = false;
  9935. var renderingGroup = this._renderingGroups[index];
  9936. if (renderingGroup) {
  9937. this._clearDepthBuffer();
  9938. if (!renderingGroup.render(customRenderFunction, function () {
  9939. if (renderSprites) {
  9940. _this._renderSprites(index);
  9941. }
  9942. })) {
  9943. this._renderingGroups.splice(index, 1);
  9944. } else if (renderSprites) {
  9945. this._renderSprites(index);
  9946. }
  9947. }
  9948. if (renderParticles) {
  9949. this._renderParticles(index, activeMeshes);
  9950. }
  9951. }
  9952. };
  9953. RenderingManager.prototype.reset = function () {
  9954. for (var index in this._renderingGroups) {
  9955. var renderingGroup = this._renderingGroups[index];
  9956. renderingGroup.prepare();
  9957. }
  9958. };
  9959. RenderingManager.prototype.dispatch = function (subMesh) {
  9960. var mesh = subMesh.getMesh();
  9961. var renderingGroupId = mesh.renderingGroupId || 0;
  9962. if (!this._renderingGroups[renderingGroupId]) {
  9963. this._renderingGroups[renderingGroupId] = new BABYLON.RenderingGroup(renderingGroupId, this._scene);
  9964. }
  9965. this._renderingGroups[renderingGroupId].dispatch(subMesh);
  9966. };
  9967. RenderingManager.MAX_RENDERINGGROUPS = 4;
  9968. return RenderingManager;
  9969. })();
  9970. BABYLON.RenderingManager = RenderingManager;
  9971. })(BABYLON || (BABYLON = {}));
  9972. var __extends = this.__extends || function (d, b) {
  9973. for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p];
  9974. function __() { this.constructor = d; }
  9975. __.prototype = b.prototype;
  9976. d.prototype = new __();
  9977. };
  9978. var BABYLON;
  9979. (function (BABYLON) {
  9980. var Texture = (function (_super) {
  9981. __extends(Texture, _super);
  9982. function Texture(url, scene, noMipmap, invertY, samplingMode, onLoad, onError, buffer, deleteBuffer) {
  9983. if (typeof samplingMode === "undefined") { samplingMode = Texture.TRILINEAR_SAMPLINGMODE; }
  9984. if (typeof onLoad === "undefined") { onLoad = null; }
  9985. if (typeof onError === "undefined") { onError = null; }
  9986. if (typeof buffer === "undefined") { buffer = null; }
  9987. if (typeof deleteBuffer === "undefined") { deleteBuffer = false; }
  9988. _super.call(this, scene);
  9989. this.uOffset = 0;
  9990. this.vOffset = 0;
  9991. this.uScale = 1.0;
  9992. this.vScale = 1.0;
  9993. this.uAng = 0;
  9994. this.vAng = 0;
  9995. this.wAng = 0;
  9996. this.name = url;
  9997. this.url = url;
  9998. this._noMipmap = noMipmap;
  9999. this._invertY = invertY;
  10000. this._samplingMode = samplingMode;
  10001. this._buffer = buffer;
  10002. this._deleteBuffer = deleteBuffer;
  10003. if (!url) {
  10004. return;
  10005. }
  10006. this._texture = this._getFromCache(url, noMipmap);
  10007. if (!this._texture) {
  10008. if (!scene.useDelayedTextureLoading) {
  10009. this._texture = scene.getEngine().createTexture(url, noMipmap, invertY, scene, this._samplingMode, onLoad, onError, this._buffer);
  10010. if (deleteBuffer) {
  10011. delete this._buffer;
  10012. }
  10013. } else {
  10014. this.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_NOTLOADED;
  10015. }
  10016. }
  10017. }
  10018. Texture.prototype.delayLoad = function () {
  10019. if (this.delayLoadState != BABYLON.Engine.DELAYLOADSTATE_NOTLOADED) {
  10020. return;
  10021. }
  10022. this.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_LOADED;
  10023. this._texture = this._getFromCache(this.url, this._noMipmap);
  10024. if (!this._texture) {
  10025. this._texture = this.getScene().getEngine().createTexture(this.url, this._noMipmap, this._invertY, this.getScene(), this._samplingMode, null, null, this._buffer);
  10026. if (this._deleteBuffer) {
  10027. delete this._buffer;
  10028. }
  10029. }
  10030. };
  10031. Texture.prototype._prepareRowForTextureGeneration = function (x, y, z, t) {
  10032. x -= this.uOffset + 0.5;
  10033. y -= this.vOffset + 0.5;
  10034. z -= 0.5;
  10035. BABYLON.Vector3.TransformCoordinatesFromFloatsToRef(x, y, z, this._rowGenerationMatrix, t);
  10036. t.x *= this.uScale;
  10037. t.y *= this.vScale;
  10038. t.x += 0.5;
  10039. t.y += 0.5;
  10040. t.z += 0.5;
  10041. };
  10042. Texture.prototype.getTextureMatrix = function () {
  10043. if (this.uOffset === this._cachedUOffset && this.vOffset === this._cachedVOffset && this.uScale === this._cachedUScale && this.vScale === this._cachedVScale && this.uAng === this._cachedUAng && this.vAng === this._cachedVAng && this.wAng === this._cachedWAng) {
  10044. return this._cachedTextureMatrix;
  10045. }
  10046. this._cachedUOffset = this.uOffset;
  10047. this._cachedVOffset = this.vOffset;
  10048. this._cachedUScale = this.uScale;
  10049. this._cachedVScale = this.vScale;
  10050. this._cachedUAng = this.uAng;
  10051. this._cachedVAng = this.vAng;
  10052. this._cachedWAng = this.wAng;
  10053. if (!this._cachedTextureMatrix) {
  10054. this._cachedTextureMatrix = BABYLON.Matrix.Zero();
  10055. this._rowGenerationMatrix = new BABYLON.Matrix();
  10056. this._t0 = BABYLON.Vector3.Zero();
  10057. this._t1 = BABYLON.Vector3.Zero();
  10058. this._t2 = BABYLON.Vector3.Zero();
  10059. }
  10060. BABYLON.Matrix.RotationYawPitchRollToRef(this.vAng, this.uAng, this.wAng, this._rowGenerationMatrix);
  10061. this._prepareRowForTextureGeneration(0, 0, 0, this._t0);
  10062. this._prepareRowForTextureGeneration(1.0, 0, 0, this._t1);
  10063. this._prepareRowForTextureGeneration(0, 1.0, 0, this._t2);
  10064. this._t1.subtractInPlace(this._t0);
  10065. this._t2.subtractInPlace(this._t0);
  10066. BABYLON.Matrix.IdentityToRef(this._cachedTextureMatrix);
  10067. this._cachedTextureMatrix.m[0] = this._t1.x;
  10068. this._cachedTextureMatrix.m[1] = this._t1.y;
  10069. this._cachedTextureMatrix.m[2] = this._t1.z;
  10070. this._cachedTextureMatrix.m[4] = this._t2.x;
  10071. this._cachedTextureMatrix.m[5] = this._t2.y;
  10072. this._cachedTextureMatrix.m[6] = this._t2.z;
  10073. this._cachedTextureMatrix.m[8] = this._t0.x;
  10074. this._cachedTextureMatrix.m[9] = this._t0.y;
  10075. this._cachedTextureMatrix.m[10] = this._t0.z;
  10076. return this._cachedTextureMatrix;
  10077. };
  10078. Texture.prototype.getReflectionTextureMatrix = function () {
  10079. if (this.uOffset === this._cachedUOffset && this.vOffset === this._cachedVOffset && this.uScale === this._cachedUScale && this.vScale === this._cachedVScale && this.coordinatesMode === this._cachedCoordinatesMode) {
  10080. return this._cachedTextureMatrix;
  10081. }
  10082. if (!this._cachedTextureMatrix) {
  10083. this._cachedTextureMatrix = BABYLON.Matrix.Zero();
  10084. this._projectionModeMatrix = BABYLON.Matrix.Zero();
  10085. }
  10086. switch (this.coordinatesMode) {
  10087. case BABYLON.Texture.SPHERICAL_MODE:
  10088. BABYLON.Matrix.IdentityToRef(this._cachedTextureMatrix);
  10089. this._cachedTextureMatrix[0] = -0.5 * this.uScale;
  10090. this._cachedTextureMatrix[5] = -0.5 * this.vScale;
  10091. this._cachedTextureMatrix[12] = 0.5 + this.uOffset;
  10092. this._cachedTextureMatrix[13] = 0.5 + this.vOffset;
  10093. break;
  10094. case BABYLON.Texture.PLANAR_MODE:
  10095. BABYLON.Matrix.IdentityToRef(this._cachedTextureMatrix);
  10096. this._cachedTextureMatrix[0] = this.uScale;
  10097. this._cachedTextureMatrix[5] = this.vScale;
  10098. this._cachedTextureMatrix[12] = this.uOffset;
  10099. this._cachedTextureMatrix[13] = this.vOffset;
  10100. break;
  10101. case BABYLON.Texture.PROJECTION_MODE:
  10102. BABYLON.Matrix.IdentityToRef(this._projectionModeMatrix);
  10103. this._projectionModeMatrix.m[0] = 0.5;
  10104. this._projectionModeMatrix.m[5] = -0.5;
  10105. this._projectionModeMatrix.m[10] = 0.0;
  10106. this._projectionModeMatrix.m[12] = 0.5;
  10107. this._projectionModeMatrix.m[13] = 0.5;
  10108. this._projectionModeMatrix.m[14] = 1.0;
  10109. this._projectionModeMatrix.m[15] = 1.0;
  10110. this.getScene().getProjectionMatrix().multiplyToRef(this._projectionModeMatrix, this._cachedTextureMatrix);
  10111. break;
  10112. default:
  10113. BABYLON.Matrix.IdentityToRef(this._cachedTextureMatrix);
  10114. break;
  10115. }
  10116. return this._cachedTextureMatrix;
  10117. };
  10118. Texture.prototype.clone = function () {
  10119. var newTexture = new BABYLON.Texture(this._texture.url, this.getScene(), this._noMipmap, this._invertY);
  10120. newTexture.hasAlpha = this.hasAlpha;
  10121. newTexture.level = this.level;
  10122. newTexture.wrapU = this.wrapU;
  10123. newTexture.wrapV = this.wrapV;
  10124. newTexture.coordinatesIndex = this.coordinatesIndex;
  10125. newTexture.coordinatesMode = this.coordinatesMode;
  10126. newTexture.uOffset = this.uOffset;
  10127. newTexture.vOffset = this.vOffset;
  10128. newTexture.uScale = this.uScale;
  10129. newTexture.vScale = this.vScale;
  10130. newTexture.uAng = this.uAng;
  10131. newTexture.vAng = this.vAng;
  10132. newTexture.wAng = this.wAng;
  10133. return newTexture;
  10134. };
  10135. Texture.CreateFromBase64String = function (data, name, scene, noMipmap, invertY, samplingMode, onLoad, onError) {
  10136. if (typeof samplingMode === "undefined") { samplingMode = Texture.TRILINEAR_SAMPLINGMODE; }
  10137. if (typeof onLoad === "undefined") { onLoad = null; }
  10138. if (typeof onError === "undefined") { onError = null; }
  10139. return new Texture("data:" + name, scene, noMipmap, invertY, samplingMode, onLoad, onError, data);
  10140. };
  10141. Texture.NEAREST_SAMPLINGMODE = 1;
  10142. Texture.BILINEAR_SAMPLINGMODE = 2;
  10143. Texture.TRILINEAR_SAMPLINGMODE = 3;
  10144. Texture.EXPLICIT_MODE = 0;
  10145. Texture.SPHERICAL_MODE = 1;
  10146. Texture.PLANAR_MODE = 2;
  10147. Texture.CUBIC_MODE = 3;
  10148. Texture.PROJECTION_MODE = 4;
  10149. Texture.SKYBOX_MODE = 5;
  10150. Texture.CLAMP_ADDRESSMODE = 0;
  10151. Texture.WRAP_ADDRESSMODE = 1;
  10152. Texture.MIRROR_ADDRESSMODE = 2;
  10153. return Texture;
  10154. })(BABYLON.BaseTexture);
  10155. BABYLON.Texture = Texture;
  10156. })(BABYLON || (BABYLON = {}));
  10157. var __extends = this.__extends || function (d, b) {
  10158. for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p];
  10159. function __() { this.constructor = d; }
  10160. __.prototype = b.prototype;
  10161. d.prototype = new __();
  10162. };
  10163. var BABYLON;
  10164. (function (BABYLON) {
  10165. var CubeTexture = (function (_super) {
  10166. __extends(CubeTexture, _super);
  10167. function CubeTexture(rootUrl, scene, extensions, noMipmap) {
  10168. _super.call(this, scene);
  10169. this.coordinatesMode = BABYLON.Texture.CUBIC_MODE;
  10170. this.name = rootUrl;
  10171. this.url = rootUrl;
  10172. this._noMipmap = noMipmap;
  10173. this.hasAlpha = false;
  10174. this._texture = this._getFromCache(rootUrl, noMipmap);
  10175. if (!extensions) {
  10176. extensions = ["_px.jpg", "_py.jpg", "_pz.jpg", "_nx.jpg", "_ny.jpg", "_nz.jpg"];
  10177. }
  10178. this._extensions = extensions;
  10179. if (!this._texture) {
  10180. if (!scene.useDelayedTextureLoading) {
  10181. this._texture = scene.getEngine().createCubeTexture(rootUrl, scene, extensions, noMipmap);
  10182. } else {
  10183. this.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_NOTLOADED;
  10184. }
  10185. }
  10186. this.isCube = true;
  10187. this._textureMatrix = BABYLON.Matrix.Identity();
  10188. }
  10189. CubeTexture.prototype.clone = function () {
  10190. var newTexture = new BABYLON.CubeTexture(this.url, this.getScene(), this._extensions, this._noMipmap);
  10191. newTexture.level = this.level;
  10192. newTexture.wrapU = this.wrapU;
  10193. newTexture.wrapV = this.wrapV;
  10194. newTexture.coordinatesIndex = this.coordinatesIndex;
  10195. newTexture.coordinatesMode = this.coordinatesMode;
  10196. return newTexture;
  10197. };
  10198. CubeTexture.prototype.delayLoad = function () {
  10199. if (this.delayLoadState != BABYLON.Engine.DELAYLOADSTATE_NOTLOADED) {
  10200. return;
  10201. }
  10202. this.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_LOADED;
  10203. this._texture = this._getFromCache(this.url, this._noMipmap);
  10204. if (!this._texture) {
  10205. this._texture = this.getScene().getEngine().createCubeTexture(this.url, this.getScene(), this._extensions);
  10206. }
  10207. };
  10208. CubeTexture.prototype.getReflectionTextureMatrix = function () {
  10209. return this._textureMatrix;
  10210. };
  10211. return CubeTexture;
  10212. })(BABYLON.BaseTexture);
  10213. BABYLON.CubeTexture = CubeTexture;
  10214. })(BABYLON || (BABYLON = {}));
  10215. var __extends = this.__extends || function (d, b) {
  10216. for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p];
  10217. function __() { this.constructor = d; }
  10218. __.prototype = b.prototype;
  10219. d.prototype = new __();
  10220. };
  10221. var BABYLON;
  10222. (function (BABYLON) {
  10223. var RenderTargetTexture = (function (_super) {
  10224. __extends(RenderTargetTexture, _super);
  10225. function RenderTargetTexture(name, size, scene, generateMipMaps, doNotChangeAspectRatio) {
  10226. if (typeof doNotChangeAspectRatio === "undefined") { doNotChangeAspectRatio = true; }
  10227. _super.call(this, null, scene, !generateMipMaps);
  10228. this.renderList = new Array();
  10229. this.renderParticles = true;
  10230. this.renderSprites = false;
  10231. this.coordinatesMode = BABYLON.Texture.PROJECTION_MODE;
  10232. this._currentRefreshId = -1;
  10233. this._refreshRate = 1;
  10234. this.name = name;
  10235. this.isRenderTarget = true;
  10236. this._size = size;
  10237. this._generateMipMaps = generateMipMaps;
  10238. this._doNotChangeAspectRatio = doNotChangeAspectRatio;
  10239. this._texture = scene.getEngine().createRenderTargetTexture(size, generateMipMaps);
  10240. this._renderingManager = new BABYLON.RenderingManager(scene);
  10241. }
  10242. RenderTargetTexture.prototype.resetRefreshCounter = function () {
  10243. this._currentRefreshId = -1;
  10244. };
  10245. Object.defineProperty(RenderTargetTexture.prototype, "refreshRate", {
  10246. get: function () {
  10247. return this._refreshRate;
  10248. },
  10249. set: function (value) {
  10250. this._refreshRate = value;
  10251. this.resetRefreshCounter();
  10252. },
  10253. enumerable: true,
  10254. configurable: true
  10255. });
  10256. RenderTargetTexture.prototype._shouldRender = function () {
  10257. if (this._currentRefreshId === -1) {
  10258. this._currentRefreshId = 1;
  10259. return true;
  10260. }
  10261. if (this.refreshRate == this._currentRefreshId) {
  10262. this._currentRefreshId = 1;
  10263. return true;
  10264. }
  10265. this._currentRefreshId++;
  10266. return false;
  10267. };
  10268. RenderTargetTexture.prototype.isReady = function () {
  10269. if (!this.getScene().renderTargetsEnabled) {
  10270. return false;
  10271. }
  10272. return _super.prototype.isReady.call(this);
  10273. };
  10274. RenderTargetTexture.prototype.getRenderSize = function () {
  10275. return this._size;
  10276. };
  10277. Object.defineProperty(RenderTargetTexture.prototype, "canRescale", {
  10278. get: function () {
  10279. return true;
  10280. },
  10281. enumerable: true,
  10282. configurable: true
  10283. });
  10284. RenderTargetTexture.prototype.scale = function (ratio) {
  10285. var newSize = this._size * ratio;
  10286. this.resize(newSize, this._generateMipMaps);
  10287. };
  10288. RenderTargetTexture.prototype.resize = function (size, generateMipMaps) {
  10289. this.releaseInternalTexture();
  10290. this._texture = this.getScene().getEngine().createRenderTargetTexture(size, generateMipMaps);
  10291. };
  10292. RenderTargetTexture.prototype.render = function (useCameraPostProcess) {
  10293. var scene = this.getScene();
  10294. var engine = scene.getEngine();
  10295. if (this._waitingRenderList) {
  10296. this.renderList = [];
  10297. for (var index = 0; index < this._waitingRenderList.length; index++) {
  10298. var id = this._waitingRenderList[index];
  10299. this.renderList.push(scene.getMeshByID(id));
  10300. }
  10301. delete this._waitingRenderList;
  10302. }
  10303. if (!this.renderList) {
  10304. return;
  10305. }
  10306. if (!useCameraPostProcess || !scene.postProcessManager._prepareFrame(this._texture)) {
  10307. engine.bindFramebuffer(this._texture);
  10308. }
  10309. engine.clear(scene.clearColor, true, true);
  10310. this._renderingManager.reset();
  10311. for (var meshIndex = 0; meshIndex < this.renderList.length; meshIndex++) {
  10312. var mesh = this.renderList[meshIndex];
  10313. if (mesh) {
  10314. if (!mesh.isReady() || (mesh.material && !mesh.material.isReady())) {
  10315. this.resetRefreshCounter();
  10316. continue;
  10317. }
  10318. if (mesh.isEnabled() && mesh.isVisible && mesh.subMeshes && ((mesh.layerMask & scene.activeCamera.layerMask) != 0)) {
  10319. mesh._activate(scene.getRenderId());
  10320. for (var subIndex = 0; subIndex < mesh.subMeshes.length; subIndex++) {
  10321. var subMesh = mesh.subMeshes[subIndex];
  10322. scene._activeVertices += subMesh.verticesCount;
  10323. this._renderingManager.dispatch(subMesh);
  10324. }
  10325. }
  10326. }
  10327. }
  10328. if (!this._doNotChangeAspectRatio) {
  10329. scene.updateTransformMatrix(true);
  10330. }
  10331. if (this.onBeforeRender) {
  10332. this.onBeforeRender();
  10333. }
  10334. this._renderingManager.render(this.customRenderFunction, this.renderList, this.renderParticles, this.renderSprites);
  10335. if (useCameraPostProcess) {
  10336. scene.postProcessManager._finalizeFrame(false, this._texture);
  10337. }
  10338. if (this.onAfterRender) {
  10339. this.onAfterRender();
  10340. }
  10341. engine.unBindFramebuffer(this._texture);
  10342. if (!this._doNotChangeAspectRatio) {
  10343. scene.updateTransformMatrix(true);
  10344. }
  10345. };
  10346. RenderTargetTexture.prototype.clone = function () {
  10347. var textureSize = this.getSize();
  10348. var newTexture = new BABYLON.RenderTargetTexture(this.name, textureSize.width, this.getScene(), this._generateMipMaps);
  10349. newTexture.hasAlpha = this.hasAlpha;
  10350. newTexture.level = this.level;
  10351. newTexture.coordinatesMode = this.coordinatesMode;
  10352. newTexture.renderList = this.renderList.slice(0);
  10353. return newTexture;
  10354. };
  10355. return RenderTargetTexture;
  10356. })(BABYLON.Texture);
  10357. BABYLON.RenderTargetTexture = RenderTargetTexture;
  10358. })(BABYLON || (BABYLON = {}));
  10359. var __extends = this.__extends || function (d, b) {
  10360. for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p];
  10361. function __() { this.constructor = d; }
  10362. __.prototype = b.prototype;
  10363. d.prototype = new __();
  10364. };
  10365. var BABYLON;
  10366. (function (BABYLON) {
  10367. var ProceduralTexture = (function (_super) {
  10368. __extends(ProceduralTexture, _super);
  10369. function ProceduralTexture(name, size, fragment, scene, fallbackTexture, generateMipMaps) {
  10370. _super.call(this, null, scene, !generateMipMaps);
  10371. this._currentRefreshId = -1;
  10372. this._refreshRate = 1;
  10373. this._vertexDeclaration = [2];
  10374. this._vertexStrideSize = 2 * 4;
  10375. this._uniforms = new Array();
  10376. this._samplers = new Array();
  10377. this._textures = new Array();
  10378. this._floats = new Array();
  10379. this._floatsArrays = {};
  10380. this._colors3 = new Array();
  10381. this._colors4 = new Array();
  10382. this._vectors2 = new Array();
  10383. this._vectors3 = new Array();
  10384. this._matrices = new Array();
  10385. scene._proceduralTextures.push(this);
  10386. this.name = name;
  10387. this.isRenderTarget = true;
  10388. this._size = size;
  10389. this._generateMipMaps = generateMipMaps;
  10390. this._fragment = fragment;
  10391. this._fallbackTexture = fallbackTexture;
  10392. this._texture = scene.getEngine().createRenderTargetTexture(size, generateMipMaps);
  10393. var vertices = [];
  10394. vertices.push(1, 1);
  10395. vertices.push(-1, 1);
  10396. vertices.push(-1, -1);
  10397. vertices.push(1, -1);
  10398. this._vertexBuffer = scene.getEngine().createVertexBuffer(vertices);
  10399. var indices = [];
  10400. indices.push(0);
  10401. indices.push(1);
  10402. indices.push(2);
  10403. indices.push(0);
  10404. indices.push(2);
  10405. indices.push(3);
  10406. this._indexBuffer = scene.getEngine().createIndexBuffer(indices);
  10407. }
  10408. ProceduralTexture.prototype.reset = function () {
  10409. var engine = this.getScene().getEngine();
  10410. engine._releaseEffect(this._effect);
  10411. };
  10412. ProceduralTexture.prototype.isReady = function () {
  10413. var _this = this;
  10414. var engine = this.getScene().getEngine();
  10415. var shaders;
  10416. if (this._fragment.fragmentElement == undefined) {
  10417. shaders = { vertex: "procedural", fragment: this._fragment };
  10418. } else {
  10419. shaders = { vertex: "procedural", fragmentElement: this._fragment.fragmentElement };
  10420. }
  10421. this._effect = engine.createEffect(shaders, ["position"], this._uniforms, this._samplers, "", null, null, function () {
  10422. _this.releaseInternalTexture();
  10423. _this._texture = _this._fallbackTexture._texture;
  10424. _this._texture.references++;
  10425. });
  10426. return this._effect.isReady();
  10427. };
  10428. ProceduralTexture.prototype.resetRefreshCounter = function () {
  10429. this._currentRefreshId = -1;
  10430. };
  10431. ProceduralTexture.prototype.setFragment = function (fragment) {
  10432. this._fragment = fragment;
  10433. };
  10434. Object.defineProperty(ProceduralTexture.prototype, "refreshRate", {
  10435. get: function () {
  10436. return this._refreshRate;
  10437. },
  10438. set: function (value) {
  10439. this._refreshRate = value;
  10440. this.resetRefreshCounter();
  10441. },
  10442. enumerable: true,
  10443. configurable: true
  10444. });
  10445. ProceduralTexture.prototype._shouldRender = function () {
  10446. if (!this.isReady() || !this._texture) {
  10447. return false;
  10448. }
  10449. if (this._currentRefreshId === -1) {
  10450. this._currentRefreshId = 1;
  10451. return true;
  10452. }
  10453. if (this.refreshRate == this._currentRefreshId) {
  10454. this._currentRefreshId = 1;
  10455. return true;
  10456. }
  10457. this._currentRefreshId++;
  10458. return false;
  10459. };
  10460. ProceduralTexture.prototype.getRenderSize = function () {
  10461. return this._size;
  10462. };
  10463. ProceduralTexture.prototype.resize = function (size, generateMipMaps) {
  10464. this.releaseInternalTexture();
  10465. this._texture = this.getScene().getEngine().createRenderTargetTexture(size, generateMipMaps);
  10466. };
  10467. ProceduralTexture.prototype._checkUniform = function (uniformName) {
  10468. if (this._uniforms.indexOf(uniformName) === -1) {
  10469. this._uniforms.push(uniformName);
  10470. }
  10471. };
  10472. ProceduralTexture.prototype.setTexture = function (name, texture) {
  10473. if (this._samplers.indexOf(name) === -1) {
  10474. this._samplers.push(name);
  10475. }
  10476. this._textures[name] = texture;
  10477. return this;
  10478. };
  10479. ProceduralTexture.prototype.setFloat = function (name, value) {
  10480. this._checkUniform(name);
  10481. this._floats[name] = value;
  10482. return this;
  10483. };
  10484. ProceduralTexture.prototype.setFloats = function (name, value) {
  10485. this._checkUniform(name);
  10486. this._floatsArrays[name] = value;
  10487. return this;
  10488. };
  10489. ProceduralTexture.prototype.setColor3 = function (name, value) {
  10490. this._checkUniform(name);
  10491. this._colors3[name] = value;
  10492. return this;
  10493. };
  10494. ProceduralTexture.prototype.setColor4 = function (name, value) {
  10495. this._checkUniform(name);
  10496. this._colors4[name] = value;
  10497. return this;
  10498. };
  10499. ProceduralTexture.prototype.setVector2 = function (name, value) {
  10500. this._checkUniform(name);
  10501. this._vectors2[name] = value;
  10502. return this;
  10503. };
  10504. ProceduralTexture.prototype.setVector3 = function (name, value) {
  10505. this._checkUniform(name);
  10506. this._vectors3[name] = value;
  10507. return this;
  10508. };
  10509. ProceduralTexture.prototype.setMatrix = function (name, value) {
  10510. this._checkUniform(name);
  10511. this._matrices[name] = value;
  10512. return this;
  10513. };
  10514. ProceduralTexture.prototype.render = function (useCameraPostProcess) {
  10515. var scene = this.getScene();
  10516. var engine = scene.getEngine();
  10517. engine.bindFramebuffer(this._texture);
  10518. engine.clear(scene.clearColor, true, true);
  10519. engine.enableEffect(this._effect);
  10520. engine.setState(false);
  10521. for (var name in this._textures) {
  10522. this._effect.setTexture(name, this._textures[name]);
  10523. }
  10524. for (name in this._floats) {
  10525. this._effect.setFloat(name, this._floats[name]);
  10526. }
  10527. for (name in this._floatsArrays) {
  10528. this._effect.setArray(name, this._floatsArrays[name]);
  10529. }
  10530. for (name in this._colors3) {
  10531. this._effect.setColor3(name, this._colors3[name]);
  10532. }
  10533. for (name in this._colors4) {
  10534. var color = this._colors4[name];
  10535. this._effect.setFloat4(name, color.r, color.g, color.b, color.a);
  10536. }
  10537. for (name in this._vectors2) {
  10538. this._effect.setVector2(name, this._vectors2[name]);
  10539. }
  10540. for (name in this._vectors3) {
  10541. this._effect.setVector3(name, this._vectors3[name]);
  10542. }
  10543. for (name in this._matrices) {
  10544. this._effect.setMatrix(name, this._matrices[name]);
  10545. }
  10546. engine.bindBuffers(this._vertexBuffer, this._indexBuffer, this._vertexDeclaration, this._vertexStrideSize, this._effect);
  10547. engine.draw(true, 0, 6);
  10548. engine.unBindFramebuffer(this._texture);
  10549. };
  10550. ProceduralTexture.prototype.clone = function () {
  10551. var textureSize = this.getSize();
  10552. var newTexture = new BABYLON.ProceduralTexture(this.name, textureSize.width, this._fragment, this.getScene(), this._fallbackTexture, this._generateMipMaps);
  10553. newTexture.hasAlpha = this.hasAlpha;
  10554. newTexture.level = this.level;
  10555. newTexture.coordinatesMode = this.coordinatesMode;
  10556. return newTexture;
  10557. };
  10558. ProceduralTexture.prototype.dispose = function () {
  10559. var index = this.getScene()._proceduralTextures.indexOf(this);
  10560. if (index >= 0) {
  10561. this.getScene()._proceduralTextures.splice(index, 1);
  10562. }
  10563. _super.prototype.dispose.call(this);
  10564. };
  10565. return ProceduralTexture;
  10566. })(BABYLON.Texture);
  10567. BABYLON.ProceduralTexture = ProceduralTexture;
  10568. })(BABYLON || (BABYLON = {}));
  10569. var __extends = this.__extends || function (d, b) {
  10570. for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p];
  10571. function __() { this.constructor = d; }
  10572. __.prototype = b.prototype;
  10573. d.prototype = new __();
  10574. };
  10575. var BABYLON;
  10576. (function (BABYLON) {
  10577. var WoodProceduralTexture = (function (_super) {
  10578. __extends(WoodProceduralTexture, _super);
  10579. function WoodProceduralTexture(name, size, scene, fallbackTexture, generateMipMaps) {
  10580. _super.call(this, name, size, "wood", scene, fallbackTexture, generateMipMaps);
  10581. this._ampScale = 100.0;
  10582. this._woodColor = new BABYLON.Color3(0.32, 0.17, 0.09);
  10583. this.updateShaderUniforms();
  10584. this.refreshRate = 0;
  10585. }
  10586. WoodProceduralTexture.prototype.updateShaderUniforms = function () {
  10587. this.setFloat("ampScale", this._ampScale);
  10588. this.setColor3("woodColor", this._woodColor);
  10589. };
  10590. Object.defineProperty(WoodProceduralTexture.prototype, "ampScale", {
  10591. get: function () {
  10592. return this._ampScale;
  10593. },
  10594. set: function (value) {
  10595. this._ampScale = value;
  10596. this.updateShaderUniforms();
  10597. },
  10598. enumerable: true,
  10599. configurable: true
  10600. });
  10601. Object.defineProperty(WoodProceduralTexture.prototype, "woodColor", {
  10602. get: function () {
  10603. return this._woodColor;
  10604. },
  10605. set: function (value) {
  10606. this._woodColor = value;
  10607. this.updateShaderUniforms();
  10608. },
  10609. enumerable: true,
  10610. configurable: true
  10611. });
  10612. return WoodProceduralTexture;
  10613. })(BABYLON.ProceduralTexture);
  10614. BABYLON.WoodProceduralTexture = WoodProceduralTexture;
  10615. var FireProceduralTexture = (function (_super) {
  10616. __extends(FireProceduralTexture, _super);
  10617. function FireProceduralTexture(name, size, scene, fallbackTexture, generateMipMaps) {
  10618. _super.call(this, name, size, "fire", scene, fallbackTexture, generateMipMaps);
  10619. this._time = 0.0;
  10620. this._speed = new BABYLON.Vector2(0.5, 0.3);
  10621. this._shift = 1.6;
  10622. this._alpha = 0.0;
  10623. this._autoGenerateTime = true;
  10624. this._alphaThreshold = 0.5;
  10625. this._fireColors = FireProceduralTexture.RedFireColors;
  10626. this.updateShaderUniforms();
  10627. this.refreshRate = 1;
  10628. }
  10629. FireProceduralTexture.prototype.updateShaderUniforms = function () {
  10630. this.setFloat("iGlobalTime", this._time);
  10631. this.setVector2("speed", this._speed);
  10632. this.setFloat("shift", this._shift);
  10633. this.setFloat("alpha", this._alpha);
  10634. this.setColor3("c1", this._fireColors[0]);
  10635. this.setColor3("c2", this._fireColors[1]);
  10636. this.setColor3("c3", this._fireColors[2]);
  10637. this.setColor3("c4", this._fireColors[3]);
  10638. this.setColor3("c5", this._fireColors[4]);
  10639. this.setColor3("c6", this._fireColors[5]);
  10640. this.setFloat("alphaThreshold", this._alphaThreshold);
  10641. };
  10642. FireProceduralTexture.prototype.render = function (useCameraPostProcess) {
  10643. if (this._autoGenerateTime) {
  10644. this._time += this.getScene().getAnimationRatio() * 0.03;
  10645. this.updateShaderUniforms();
  10646. }
  10647. _super.prototype.render.call(this, useCameraPostProcess);
  10648. };
  10649. Object.defineProperty(FireProceduralTexture, "PurpleFireColors", {
  10650. get: function () {
  10651. return [
  10652. new BABYLON.Color3(0.5, 0.0, 1.0),
  10653. new BABYLON.Color3(0.9, 0.0, 1.0),
  10654. new BABYLON.Color3(0.2, 0.0, 1.0),
  10655. new BABYLON.Color3(1.0, 0.9, 1.0),
  10656. new BABYLON.Color3(0.1, 0.1, 1.0),
  10657. new BABYLON.Color3(0.9, 0.9, 1.0)
  10658. ];
  10659. },
  10660. enumerable: true,
  10661. configurable: true
  10662. });
  10663. Object.defineProperty(FireProceduralTexture, "GreenFireColors", {
  10664. get: function () {
  10665. return [
  10666. new BABYLON.Color3(0.5, 1.0, 0.0),
  10667. new BABYLON.Color3(0.5, 1.0, 0.0),
  10668. new BABYLON.Color3(0.3, 0.4, 0.0),
  10669. new BABYLON.Color3(0.5, 1.0, 0.0),
  10670. new BABYLON.Color3(0.2, 0.0, 0.0),
  10671. new BABYLON.Color3(0.5, 1.0, 0.0)
  10672. ];
  10673. },
  10674. enumerable: true,
  10675. configurable: true
  10676. });
  10677. Object.defineProperty(FireProceduralTexture, "RedFireColors", {
  10678. get: function () {
  10679. return [
  10680. new BABYLON.Color3(0.5, 0.0, 0.1),
  10681. new BABYLON.Color3(0.9, 0.0, 0.0),
  10682. new BABYLON.Color3(0.2, 0.0, 0.0),
  10683. new BABYLON.Color3(1.0, 0.9, 0.0),
  10684. new BABYLON.Color3(0.1, 0.1, 0.1),
  10685. new BABYLON.Color3(0.9, 0.9, 0.9)
  10686. ];
  10687. },
  10688. enumerable: true,
  10689. configurable: true
  10690. });
  10691. Object.defineProperty(FireProceduralTexture, "BlueFireColors", {
  10692. get: function () {
  10693. return [
  10694. new BABYLON.Color3(0.1, 0.0, 0.5),
  10695. new BABYLON.Color3(0.0, 0.0, 0.5),
  10696. new BABYLON.Color3(0.1, 0.0, 0.2),
  10697. new BABYLON.Color3(0.0, 0.0, 1.0),
  10698. new BABYLON.Color3(0.1, 0.2, 0.3),
  10699. new BABYLON.Color3(0.0, 0.2, 0.9)
  10700. ];
  10701. },
  10702. enumerable: true,
  10703. configurable: true
  10704. });
  10705. Object.defineProperty(FireProceduralTexture.prototype, "fireColors", {
  10706. get: function () {
  10707. return this._fireColors;
  10708. },
  10709. set: function (value) {
  10710. this._fireColors = value;
  10711. this.updateShaderUniforms();
  10712. },
  10713. enumerable: true,
  10714. configurable: true
  10715. });
  10716. Object.defineProperty(FireProceduralTexture.prototype, "time", {
  10717. get: function () {
  10718. return this._time;
  10719. },
  10720. set: function (value) {
  10721. this._time = value;
  10722. this.updateShaderUniforms();
  10723. },
  10724. enumerable: true,
  10725. configurable: true
  10726. });
  10727. Object.defineProperty(FireProceduralTexture.prototype, "speed", {
  10728. get: function () {
  10729. return this._speed;
  10730. },
  10731. set: function (value) {
  10732. this._speed = value;
  10733. this.updateShaderUniforms();
  10734. },
  10735. enumerable: true,
  10736. configurable: true
  10737. });
  10738. Object.defineProperty(FireProceduralTexture.prototype, "shift", {
  10739. get: function () {
  10740. return this._shift;
  10741. },
  10742. set: function (value) {
  10743. this._shift = value;
  10744. this.updateShaderUniforms();
  10745. },
  10746. enumerable: true,
  10747. configurable: true
  10748. });
  10749. Object.defineProperty(FireProceduralTexture.prototype, "alpha", {
  10750. get: function () {
  10751. return this._alpha;
  10752. },
  10753. set: function (value) {
  10754. this._alpha = value;
  10755. this.updateShaderUniforms();
  10756. },
  10757. enumerable: true,
  10758. configurable: true
  10759. });
  10760. return FireProceduralTexture;
  10761. })(BABYLON.ProceduralTexture);
  10762. BABYLON.FireProceduralTexture = FireProceduralTexture;
  10763. var CloudProceduralTexture = (function (_super) {
  10764. __extends(CloudProceduralTexture, _super);
  10765. function CloudProceduralTexture(name, size, scene, fallbackTexture, generateMipMaps) {
  10766. _super.call(this, name, size, "cloud", scene, fallbackTexture, generateMipMaps);
  10767. this._skyColor = new BABYLON.Color3(0.15, 0.68, 1.0);
  10768. this._cloudColor = new BABYLON.Color3(1, 1, 1);
  10769. this.updateShaderUniforms();
  10770. this.refreshRate = 0;
  10771. }
  10772. CloudProceduralTexture.prototype.updateShaderUniforms = function () {
  10773. this.setColor3("skyColor", this._skyColor);
  10774. this.setColor3("cloudColor", this._cloudColor);
  10775. };
  10776. Object.defineProperty(CloudProceduralTexture.prototype, "skyColor", {
  10777. get: function () {
  10778. return this._skyColor;
  10779. },
  10780. set: function (value) {
  10781. this._skyColor = value;
  10782. this.updateShaderUniforms();
  10783. },
  10784. enumerable: true,
  10785. configurable: true
  10786. });
  10787. Object.defineProperty(CloudProceduralTexture.prototype, "cloudColor", {
  10788. get: function () {
  10789. return this._cloudColor;
  10790. },
  10791. set: function (value) {
  10792. this._cloudColor = value;
  10793. this.updateShaderUniforms();
  10794. },
  10795. enumerable: true,
  10796. configurable: true
  10797. });
  10798. return CloudProceduralTexture;
  10799. })(BABYLON.ProceduralTexture);
  10800. BABYLON.CloudProceduralTexture = CloudProceduralTexture;
  10801. var GrassProceduralTexture = (function (_super) {
  10802. __extends(GrassProceduralTexture, _super);
  10803. function GrassProceduralTexture(name, size, scene, fallbackTexture, generateMipMaps) {
  10804. _super.call(this, name, size, "grass", scene, fallbackTexture, generateMipMaps);
  10805. this._herb1 = new BABYLON.Color3(0.29, 0.38, 0.02);
  10806. this._herb2 = new BABYLON.Color3(0.36, 0.49, 0.09);
  10807. this._herb3 = new BABYLON.Color3(0.51, 0.6, 0.28);
  10808. this._dirtColor = new BABYLON.Color3(0.6, 0.46, 0.13);
  10809. this._groundColor = new BABYLON.Color3(1, 1, 1);
  10810. this._grassColors = [
  10811. new BABYLON.Color3(0.29, 0.38, 0.02),
  10812. new BABYLON.Color3(0.36, 0.49, 0.09),
  10813. new BABYLON.Color3(0.51, 0.6, 0.28)
  10814. ];
  10815. this.updateShaderUniforms();
  10816. this.refreshRate = 0;
  10817. }
  10818. GrassProceduralTexture.prototype.updateShaderUniforms = function () {
  10819. this.setColor3("herb1", this._grassColors[0]);
  10820. this.setColor3("herb2", this._grassColors[1]);
  10821. this.setColor3("herb3", this._grassColors[2]);
  10822. this.setColor3("dirt", this._dirtColor);
  10823. this.setColor3("ground", this._groundColor);
  10824. };
  10825. Object.defineProperty(GrassProceduralTexture.prototype, "grassColors", {
  10826. get: function () {
  10827. return this._grassColors;
  10828. },
  10829. set: function (value) {
  10830. this._grassColors = value;
  10831. this.updateShaderUniforms();
  10832. },
  10833. enumerable: true,
  10834. configurable: true
  10835. });
  10836. Object.defineProperty(GrassProceduralTexture.prototype, "dirtColor", {
  10837. get: function () {
  10838. return this._dirtColor;
  10839. },
  10840. set: function (value) {
  10841. this._dirtColor = value;
  10842. this.updateShaderUniforms();
  10843. },
  10844. enumerable: true,
  10845. configurable: true
  10846. });
  10847. Object.defineProperty(GrassProceduralTexture.prototype, "groundColor", {
  10848. get: function () {
  10849. return this._groundColor;
  10850. },
  10851. enumerable: true,
  10852. configurable: true
  10853. });
  10854. Object.defineProperty(GrassProceduralTexture.prototype, "ground", {
  10855. set: function (value) {
  10856. this.groundColor = value;
  10857. this.updateShaderUniforms();
  10858. },
  10859. enumerable: true,
  10860. configurable: true
  10861. });
  10862. return GrassProceduralTexture;
  10863. })(BABYLON.ProceduralTexture);
  10864. BABYLON.GrassProceduralTexture = GrassProceduralTexture;
  10865. var RoadProceduralTexture = (function (_super) {
  10866. __extends(RoadProceduralTexture, _super);
  10867. function RoadProceduralTexture(name, size, scene, fallbackTexture, generateMipMaps) {
  10868. _super.call(this, name, size, "road", scene, fallbackTexture, generateMipMaps);
  10869. this._roadColor = new BABYLON.Color3(0.53, 0.53, 0.53);
  10870. this.updateShaderUniforms();
  10871. this.refreshRate = 0;
  10872. }
  10873. RoadProceduralTexture.prototype.updateShaderUniforms = function () {
  10874. this.setColor3("roadColor", this._roadColor);
  10875. };
  10876. Object.defineProperty(RoadProceduralTexture.prototype, "roadColor", {
  10877. get: function () {
  10878. return this._roadColor;
  10879. },
  10880. set: function (value) {
  10881. this._roadColor = value;
  10882. this.updateShaderUniforms();
  10883. },
  10884. enumerable: true,
  10885. configurable: true
  10886. });
  10887. return RoadProceduralTexture;
  10888. })(BABYLON.ProceduralTexture);
  10889. BABYLON.RoadProceduralTexture = RoadProceduralTexture;
  10890. var BrickProceduralTexture = (function (_super) {
  10891. __extends(BrickProceduralTexture, _super);
  10892. function BrickProceduralTexture(name, size, scene, fallbackTexture, generateMipMaps) {
  10893. _super.call(this, name, size, "brick", scene, fallbackTexture, generateMipMaps);
  10894. this._numberOfBricksHeight = 15;
  10895. this._numberOfBricksWidth = 5;
  10896. this._jointColor = new BABYLON.Color3(0.72, 0.72, 0.72);
  10897. this._brickColor = new BABYLON.Color3(0.77, 0.47, 0.40);
  10898. this.updateShaderUniforms();
  10899. this.refreshRate = 0;
  10900. }
  10901. BrickProceduralTexture.prototype.updateShaderUniforms = function () {
  10902. this.setFloat("numberOfBricksHeight", this._numberOfBricksHeight);
  10903. this.setFloat("numberOfBricksWidth", this._numberOfBricksWidth);
  10904. this.setColor3("brick", this._brickColor);
  10905. this.setColor3("joint", this._jointColor);
  10906. };
  10907. Object.defineProperty(BrickProceduralTexture.prototype, "numberOfBricksHeight", {
  10908. get: function () {
  10909. return this._numberOfBricksHeight;
  10910. },
  10911. enumerable: true,
  10912. configurable: true
  10913. });
  10914. Object.defineProperty(BrickProceduralTexture.prototype, "cloudColor", {
  10915. set: function (value) {
  10916. this._numberOfBricksHeight = value;
  10917. this.updateShaderUniforms();
  10918. },
  10919. enumerable: true,
  10920. configurable: true
  10921. });
  10922. Object.defineProperty(BrickProceduralTexture.prototype, "numberOfBricksWidth", {
  10923. get: function () {
  10924. return this._numberOfBricksWidth;
  10925. },
  10926. set: function (value) {
  10927. this._numberOfBricksHeight = value;
  10928. this.updateShaderUniforms();
  10929. },
  10930. enumerable: true,
  10931. configurable: true
  10932. });
  10933. Object.defineProperty(BrickProceduralTexture.prototype, "jointColor", {
  10934. get: function () {
  10935. return this._jointColor;
  10936. },
  10937. set: function (value) {
  10938. this._jointColor = value;
  10939. this.updateShaderUniforms();
  10940. },
  10941. enumerable: true,
  10942. configurable: true
  10943. });
  10944. Object.defineProperty(BrickProceduralTexture.prototype, "brickColor", {
  10945. get: function () {
  10946. return this._brickColor;
  10947. },
  10948. set: function (value) {
  10949. this._brickColor = value;
  10950. this.updateShaderUniforms();
  10951. },
  10952. enumerable: true,
  10953. configurable: true
  10954. });
  10955. return BrickProceduralTexture;
  10956. })(BABYLON.ProceduralTexture);
  10957. BABYLON.BrickProceduralTexture = BrickProceduralTexture;
  10958. var MarbleProceduralTexture = (function (_super) {
  10959. __extends(MarbleProceduralTexture, _super);
  10960. function MarbleProceduralTexture(name, size, scene, fallbackTexture, generateMipMaps) {
  10961. _super.call(this, name, size, "marble", scene, fallbackTexture, generateMipMaps);
  10962. this._numberOfTilesHeight = 3;
  10963. this._numberOfTilesWidth = 3;
  10964. this._amplitude = 9.0;
  10965. this._marbleColor = new BABYLON.Color3(0.77, 0.47, 0.40);
  10966. this._jointColor = new BABYLON.Color3(0.72, 0.72, 0.72);
  10967. this.updateShaderUniforms();
  10968. this.refreshRate = 0;
  10969. }
  10970. MarbleProceduralTexture.prototype.updateShaderUniforms = function () {
  10971. this.setFloat("numberOfBricksHeight", this._numberOfTilesHeight);
  10972. this.setFloat("numberOfBricksWidth", this._numberOfTilesWidth);
  10973. this.setFloat("amplitude", this._amplitude);
  10974. this.setColor3("brick", this._marbleColor);
  10975. this.setColor3("joint", this._jointColor);
  10976. };
  10977. Object.defineProperty(MarbleProceduralTexture.prototype, "numberOfTilesHeight", {
  10978. get: function () {
  10979. return this._numberOfTilesHeight;
  10980. },
  10981. set: function (value) {
  10982. this._numberOfTilesHeight = value;
  10983. this.updateShaderUniforms();
  10984. },
  10985. enumerable: true,
  10986. configurable: true
  10987. });
  10988. Object.defineProperty(MarbleProceduralTexture.prototype, "numberOfTilesWidth", {
  10989. get: function () {
  10990. return this._numberOfTilesWidth;
  10991. },
  10992. set: function (value) {
  10993. this._numberOfTilesWidth = value;
  10994. this.updateShaderUniforms();
  10995. },
  10996. enumerable: true,
  10997. configurable: true
  10998. });
  10999. Object.defineProperty(MarbleProceduralTexture.prototype, "jointColor", {
  11000. get: function () {
  11001. return this._jointColor;
  11002. },
  11003. set: function (value) {
  11004. this._jointColor = value;
  11005. this.updateShaderUniforms();
  11006. },
  11007. enumerable: true,
  11008. configurable: true
  11009. });
  11010. Object.defineProperty(MarbleProceduralTexture.prototype, "marbleColor", {
  11011. get: function () {
  11012. return this._marbleColor;
  11013. },
  11014. set: function (value) {
  11015. this._marbleColor = value;
  11016. this.updateShaderUniforms();
  11017. },
  11018. enumerable: true,
  11019. configurable: true
  11020. });
  11021. return MarbleProceduralTexture;
  11022. })(BABYLON.ProceduralTexture);
  11023. BABYLON.MarbleProceduralTexture = MarbleProceduralTexture;
  11024. })(BABYLON || (BABYLON = {}));
  11025. var __extends = this.__extends || function (d, b) {
  11026. for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p];
  11027. function __() { this.constructor = d; }
  11028. __.prototype = b.prototype;
  11029. d.prototype = new __();
  11030. };
  11031. var BABYLON;
  11032. (function (BABYLON) {
  11033. var CustomProceduralTexture = (function (_super) {
  11034. __extends(CustomProceduralTexture, _super);
  11035. function CustomProceduralTexture(name, texturePath, size, scene, fallbackTexture, generateMipMaps) {
  11036. _super.call(this, name, size, "empty", scene, fallbackTexture, generateMipMaps);
  11037. this._animate = true;
  11038. this._time = 0;
  11039. this._shaderLoaded = false;
  11040. this._updateTexture = false;
  11041. this._texturePath = texturePath;
  11042. this.loadJson(texturePath);
  11043. this.refreshRate = 1;
  11044. }
  11045. CustomProceduralTexture.prototype.loadJson = function (jsonUrl) {
  11046. var that = this;
  11047. function noConfigFile() {
  11048. BABYLON.Tools.Log("No config file found in " + jsonUrl + " trying as a shaderstore or dom");
  11049. try {
  11050. that._customFragment = that._texturePath;
  11051. that._updateTexture = true;
  11052. that._shaderLoaded = true;
  11053. } catch (ex) {
  11054. BABYLON.Tools.Error("No json or shaderStore or Dom element found for the Custom Procedural Texture");
  11055. }
  11056. }
  11057. var configFileUrl = jsonUrl + "/config.json";
  11058. var xhr = new XMLHttpRequest();
  11059. xhr.open("GET", configFileUrl, true);
  11060. xhr.addEventListener("load", function () {
  11061. if (xhr.status === 200 || BABYLON.Tools.ValidateXHRData(xhr, 1)) {
  11062. try {
  11063. that._config = JSON.parse(xhr.response);
  11064. that._customFragment = this._texturePath + "/custom";
  11065. that._updateTexture = true;
  11066. that._shaderLoaded = true;
  11067. } catch (ex) {
  11068. noConfigFile();
  11069. }
  11070. } else {
  11071. noConfigFile();
  11072. }
  11073. }, false);
  11074. xhr.addEventListener("error", function (event) {
  11075. noConfigFile();
  11076. }, false);
  11077. try {
  11078. xhr.send();
  11079. } catch (ex) {
  11080. BABYLON.Tools.Error("Error on XHR send request.");
  11081. }
  11082. };
  11083. CustomProceduralTexture.prototype.render = function (useCameraPostProcess) {
  11084. if (!this._shaderLoaded)
  11085. return;
  11086. if (this._updateTexture) {
  11087. this.reset();
  11088. this.setFragment(this._customFragment);
  11089. this.updateTextures();
  11090. this.updateShaderUniforms();
  11091. this._shaderLoaded = true;
  11092. if (this._config) {
  11093. this._animate = this._config.animate;
  11094. this.refreshRate = this._config.refreshrate;
  11095. }
  11096. this.isReady();
  11097. this._updateTexture = false;
  11098. return;
  11099. }
  11100. if (this._animate) {
  11101. this._time += this.getScene().getAnimationRatio() * 0.03;
  11102. this.updateShaderUniforms();
  11103. }
  11104. _super.prototype.render.call(this, useCameraPostProcess);
  11105. };
  11106. CustomProceduralTexture.prototype.updateTextures = function () {
  11107. if (this._config) {
  11108. for (var i = 0; i < this._config.texture2Ds.length; i++) {
  11109. this.setTexture(this._config.texture2Ds[i].textureName, new BABYLON.Texture(this._texturePath + "/" + this._config.texture2Ds[i].textureRelativeUrl, this.getScene(), false, false, BABYLON.Texture.TRILINEAR_SAMPLINGMODE, null, null, null, true));
  11110. }
  11111. }
  11112. };
  11113. CustomProceduralTexture.prototype.updateShaderUniforms = function () {
  11114. if (this._config) {
  11115. for (var j = 0; j < this._config.uniforms.length; j++) {
  11116. var uniform = this._config.uniforms[j];
  11117. switch (uniform.type) {
  11118. case "float":
  11119. this.setFloat(uniform.name, uniform.value);
  11120. break;
  11121. case "color3":
  11122. this.setColor3(uniform.name, new BABYLON.Color3(uniform.r, uniform.g, uniform.b));
  11123. break;
  11124. case "color4":
  11125. this.setColor4(uniform.name, new BABYLON.Color4(uniform.r, uniform.g, uniform.b, uniform.a));
  11126. break;
  11127. case "vector2":
  11128. this.setVector2(uniform.name, new BABYLON.Vector2(uniform.x, uniform.y));
  11129. break;
  11130. case "vector3":
  11131. this.setVector3(uniform.name, new BABYLON.Vector3(uniform.x, uniform.y, uniform.z));
  11132. break;
  11133. }
  11134. }
  11135. }
  11136. this.setFloat("time", this._time);
  11137. };
  11138. Object.defineProperty(CustomProceduralTexture.prototype, "animate", {
  11139. get: function () {
  11140. return this._animate;
  11141. },
  11142. set: function (value) {
  11143. this._animate = value;
  11144. this.updateShaderUniforms();
  11145. },
  11146. enumerable: true,
  11147. configurable: true
  11148. });
  11149. return CustomProceduralTexture;
  11150. })(BABYLON.ProceduralTexture);
  11151. BABYLON.CustomProceduralTexture = CustomProceduralTexture;
  11152. })(BABYLON || (BABYLON = {}));
  11153. var __extends = this.__extends || function (d, b) {
  11154. for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p];
  11155. function __() { this.constructor = d; }
  11156. __.prototype = b.prototype;
  11157. d.prototype = new __();
  11158. };
  11159. var BABYLON;
  11160. (function (BABYLON) {
  11161. var MirrorTexture = (function (_super) {
  11162. __extends(MirrorTexture, _super);
  11163. function MirrorTexture(name, size, scene, generateMipMaps) {
  11164. var _this = this;
  11165. _super.call(this, name, size, scene, generateMipMaps, true);
  11166. this.mirrorPlane = new BABYLON.Plane(0, 1, 0, 1);
  11167. this._transformMatrix = BABYLON.Matrix.Zero();
  11168. this._mirrorMatrix = BABYLON.Matrix.Zero();
  11169. this.onBeforeRender = function () {
  11170. BABYLON.Matrix.ReflectionToRef(_this.mirrorPlane, _this._mirrorMatrix);
  11171. _this._savedViewMatrix = scene.getViewMatrix();
  11172. _this._mirrorMatrix.multiplyToRef(_this._savedViewMatrix, _this._transformMatrix);
  11173. scene.setTransformMatrix(_this._transformMatrix, scene.getProjectionMatrix());
  11174. scene.clipPlane = _this.mirrorPlane;
  11175. scene.getEngine().cullBackFaces = false;
  11176. };
  11177. this.onAfterRender = function () {
  11178. scene.setTransformMatrix(_this._savedViewMatrix, scene.getProjectionMatrix());
  11179. scene.getEngine().cullBackFaces = true;
  11180. delete scene.clipPlane;
  11181. };
  11182. }
  11183. MirrorTexture.prototype.clone = function () {
  11184. var textureSize = this.getSize();
  11185. var newTexture = new BABYLON.MirrorTexture(this.name, textureSize.width, this.getScene(), this._generateMipMaps);
  11186. newTexture.hasAlpha = this.hasAlpha;
  11187. newTexture.level = this.level;
  11188. newTexture.mirrorPlane = this.mirrorPlane.clone();
  11189. newTexture.renderList = this.renderList.slice(0);
  11190. return newTexture;
  11191. };
  11192. return MirrorTexture;
  11193. })(BABYLON.RenderTargetTexture);
  11194. BABYLON.MirrorTexture = MirrorTexture;
  11195. })(BABYLON || (BABYLON = {}));
  11196. var __extends = this.__extends || function (d, b) {
  11197. for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p];
  11198. function __() { this.constructor = d; }
  11199. __.prototype = b.prototype;
  11200. d.prototype = new __();
  11201. };
  11202. var BABYLON;
  11203. (function (BABYLON) {
  11204. var DynamicTexture = (function (_super) {
  11205. __extends(DynamicTexture, _super);
  11206. function DynamicTexture(name, options, scene, generateMipMaps, samplingMode) {
  11207. if (typeof samplingMode === "undefined") { samplingMode = BABYLON.Texture.TRILINEAR_SAMPLINGMODE; }
  11208. _super.call(this, null, scene, !generateMipMaps);
  11209. this.name = name;
  11210. this.wrapU = BABYLON.Texture.CLAMP_ADDRESSMODE;
  11211. this.wrapV = BABYLON.Texture.CLAMP_ADDRESSMODE;
  11212. this._generateMipMaps = generateMipMaps;
  11213. if (options.getContext) {
  11214. this._canvas = options;
  11215. this._texture = scene.getEngine().createDynamicTexture(options.width, options.height, generateMipMaps, samplingMode);
  11216. } else {
  11217. this._canvas = document.createElement("canvas");
  11218. if (options.width) {
  11219. this._texture = scene.getEngine().createDynamicTexture(options.width, options.height, generateMipMaps, samplingMode);
  11220. } else {
  11221. this._texture = scene.getEngine().createDynamicTexture(options, options, generateMipMaps, samplingMode);
  11222. }
  11223. }
  11224. var textureSize = this.getSize();
  11225. this._canvas.width = textureSize.width;
  11226. this._canvas.height = textureSize.height;
  11227. this._context = this._canvas.getContext("2d");
  11228. }
  11229. Object.defineProperty(DynamicTexture.prototype, "canRescale", {
  11230. get: function () {
  11231. return true;
  11232. },
  11233. enumerable: true,
  11234. configurable: true
  11235. });
  11236. DynamicTexture.prototype.scale = function (ratio) {
  11237. var textureSize = this.getSize();
  11238. textureSize.width *= ratio;
  11239. textureSize.height *= ratio;
  11240. this._canvas.width = textureSize.width;
  11241. this._canvas.height = textureSize.height;
  11242. this.releaseInternalTexture();
  11243. this._texture = this.getScene().getEngine().createDynamicTexture(textureSize.width, textureSize.height, this._generateMipMaps, this._samplingMode);
  11244. };
  11245. DynamicTexture.prototype.getContext = function () {
  11246. return this._context;
  11247. };
  11248. DynamicTexture.prototype.update = function (invertY) {
  11249. this.getScene().getEngine().updateDynamicTexture(this._texture, this._canvas, invertY === undefined ? true : invertY);
  11250. };
  11251. DynamicTexture.prototype.drawText = function (text, x, y, font, color, clearColor, invertY) {
  11252. var size = this.getSize();
  11253. if (clearColor) {
  11254. this._context.fillStyle = clearColor;
  11255. this._context.fillRect(0, 0, size.width, size.height);
  11256. }
  11257. this._context.font = font;
  11258. if (x === null) {
  11259. var textSize = this._context.measureText(text);
  11260. x = (size.width - textSize.width) / 2;
  11261. }
  11262. this._context.fillStyle = color;
  11263. this._context.fillText(text, x, y);
  11264. this.update(invertY);
  11265. };
  11266. DynamicTexture.prototype.clone = function () {
  11267. var textureSize = this.getSize();
  11268. var newTexture = new BABYLON.DynamicTexture(this.name, textureSize.width, this.getScene(), this._generateMipMaps);
  11269. newTexture.hasAlpha = this.hasAlpha;
  11270. newTexture.level = this.level;
  11271. newTexture.wrapU = this.wrapU;
  11272. newTexture.wrapV = this.wrapV;
  11273. return newTexture;
  11274. };
  11275. return DynamicTexture;
  11276. })(BABYLON.Texture);
  11277. BABYLON.DynamicTexture = DynamicTexture;
  11278. })(BABYLON || (BABYLON = {}));
  11279. var __extends = this.__extends || function (d, b) {
  11280. for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p];
  11281. function __() { this.constructor = d; }
  11282. __.prototype = b.prototype;
  11283. d.prototype = new __();
  11284. };
  11285. var BABYLON;
  11286. (function (BABYLON) {
  11287. var VideoTexture = (function (_super) {
  11288. __extends(VideoTexture, _super);
  11289. function VideoTexture(name, urls, size, scene, generateMipMaps, invertY, samplingMode) {
  11290. if (typeof samplingMode === "undefined") { samplingMode = BABYLON.Texture.TRILINEAR_SAMPLINGMODE; }
  11291. var _this = this;
  11292. _super.call(this, null, scene, !generateMipMaps, invertY);
  11293. this._autoLaunch = true;
  11294. this.name = name;
  11295. this.wrapU = BABYLON.Texture.WRAP_ADDRESSMODE;
  11296. this.wrapV = BABYLON.Texture.WRAP_ADDRESSMODE;
  11297. var requiredWidth = size.width || size;
  11298. var requiredHeight = size.height || size;
  11299. this._texture = scene.getEngine().createDynamicTexture(requiredWidth, requiredHeight, generateMipMaps, samplingMode);
  11300. var textureSize = this.getSize();
  11301. this.video = document.createElement("video");
  11302. this.video.width = textureSize.width;
  11303. this.video.height = textureSize.height;
  11304. this.video.autoplay = false;
  11305. this.video.loop = true;
  11306. this.video.addEventListener("canplaythrough", function () {
  11307. if (_this._texture) {
  11308. _this._texture.isReady = true;
  11309. }
  11310. });
  11311. urls.forEach(function (url) {
  11312. var source = document.createElement("source");
  11313. source.src = url;
  11314. _this.video.appendChild(source);
  11315. });
  11316. this._lastUpdate = BABYLON.Tools.Now;
  11317. }
  11318. VideoTexture.prototype.update = function () {
  11319. if (this._autoLaunch) {
  11320. this._autoLaunch = false;
  11321. this.video.play();
  11322. }
  11323. var now = BABYLON.Tools.Now;
  11324. if (now - this._lastUpdate < 15) {
  11325. return false;
  11326. }
  11327. this._lastUpdate = now;
  11328. this.getScene().getEngine().updateVideoTexture(this._texture, this.video, this._invertY);
  11329. return true;
  11330. };
  11331. return VideoTexture;
  11332. })(BABYLON.Texture);
  11333. BABYLON.VideoTexture = VideoTexture;
  11334. })(BABYLON || (BABYLON = {}));
  11335. var BABYLON;
  11336. (function (BABYLON) {
  11337. var EffectFallbacks = (function () {
  11338. function EffectFallbacks() {
  11339. this._defines = {};
  11340. this._currentRank = 32;
  11341. this._maxRank = -1;
  11342. }
  11343. EffectFallbacks.prototype.addFallback = function (rank, define) {
  11344. if (!this._defines[rank]) {
  11345. if (rank < this._currentRank) {
  11346. this._currentRank = rank;
  11347. }
  11348. if (rank > this._maxRank) {
  11349. this._maxRank = rank;
  11350. }
  11351. this._defines[rank] = new Array();
  11352. }
  11353. this._defines[rank].push(define);
  11354. };
  11355. Object.defineProperty(EffectFallbacks.prototype, "isMoreFallbacks", {
  11356. get: function () {
  11357. return this._currentRank <= this._maxRank;
  11358. },
  11359. enumerable: true,
  11360. configurable: true
  11361. });
  11362. EffectFallbacks.prototype.reduce = function (currentDefines) {
  11363. var currentFallbacks = this._defines[this._currentRank];
  11364. for (var index = 0; index < currentFallbacks.length; index++) {
  11365. currentDefines = currentDefines.replace("#define " + currentFallbacks[index], "");
  11366. }
  11367. this._currentRank++;
  11368. return currentDefines;
  11369. };
  11370. return EffectFallbacks;
  11371. })();
  11372. BABYLON.EffectFallbacks = EffectFallbacks;
  11373. var Effect = (function () {
  11374. function Effect(baseName, attributesNames, uniformsNames, samplers, engine, defines, fallbacks, onCompiled, onError) {
  11375. var _this = this;
  11376. this._isReady = false;
  11377. this._compilationError = "";
  11378. this._valueCache = [];
  11379. this._engine = engine;
  11380. this.name = baseName;
  11381. this.defines = defines;
  11382. this._uniformsNames = uniformsNames.concat(samplers);
  11383. this._samplers = samplers;
  11384. this._attributesNames = attributesNames;
  11385. this.onError = onError;
  11386. this.onCompiled = onCompiled;
  11387. var vertexSource;
  11388. var fragmentSource;
  11389. if (baseName.vertexElement) {
  11390. vertexSource = document.getElementById(baseName.vertexElement);
  11391. if (!vertexSource) {
  11392. vertexSource = baseName.vertexElement;
  11393. }
  11394. } else {
  11395. vertexSource = baseName.vertex || baseName;
  11396. }
  11397. if (baseName.fragmentElement) {
  11398. fragmentSource = document.getElementById(baseName.fragmentElement);
  11399. if (!fragmentSource) {
  11400. fragmentSource = baseName.fragmentElement;
  11401. }
  11402. } else {
  11403. fragmentSource = baseName.fragment || baseName;
  11404. }
  11405. this._loadVertexShader(vertexSource, function (vertexCode) {
  11406. _this._loadFragmentShader(fragmentSource, function (fragmentCode) {
  11407. _this._prepareEffect(vertexCode, fragmentCode, attributesNames, defines, fallbacks);
  11408. });
  11409. });
  11410. }
  11411. Effect.prototype.isReady = function () {
  11412. return this._isReady;
  11413. };
  11414. Effect.prototype.getProgram = function () {
  11415. return this._program;
  11416. };
  11417. Effect.prototype.getAttributesNames = function () {
  11418. return this._attributesNames;
  11419. };
  11420. Effect.prototype.getAttributeLocation = function (index) {
  11421. return this._attributes[index];
  11422. };
  11423. Effect.prototype.getAttributeLocationByName = function (name) {
  11424. var index = this._attributesNames.indexOf(name);
  11425. return this._attributes[index];
  11426. };
  11427. Effect.prototype.getAttributesCount = function () {
  11428. return this._attributes.length;
  11429. };
  11430. Effect.prototype.getUniformIndex = function (uniformName) {
  11431. return this._uniformsNames.indexOf(uniformName);
  11432. };
  11433. Effect.prototype.getUniform = function (uniformName) {
  11434. return this._uniforms[this._uniformsNames.indexOf(uniformName)];
  11435. };
  11436. Effect.prototype.getSamplers = function () {
  11437. return this._samplers;
  11438. };
  11439. Effect.prototype.getCompilationError = function () {
  11440. return this._compilationError;
  11441. };
  11442. Effect.prototype._loadVertexShader = function (vertex, callback) {
  11443. if (vertex instanceof HTMLElement) {
  11444. var vertexCode = BABYLON.Tools.GetDOMTextContent(vertex);
  11445. callback(vertexCode);
  11446. return;
  11447. }
  11448. if (BABYLON.Effect.ShadersStore[vertex + "VertexShader"]) {
  11449. callback(BABYLON.Effect.ShadersStore[vertex + "VertexShader"]);
  11450. return;
  11451. }
  11452. var vertexShaderUrl;
  11453. if (vertex[0] === ".") {
  11454. vertexShaderUrl = vertex;
  11455. } else {
  11456. vertexShaderUrl = BABYLON.Engine.ShadersRepository + vertex;
  11457. }
  11458. BABYLON.Tools.LoadFile(vertexShaderUrl + ".vertex.fx", callback);
  11459. };
  11460. Effect.prototype._loadFragmentShader = function (fragment, callback) {
  11461. if (fragment instanceof HTMLElement) {
  11462. var fragmentCode = BABYLON.Tools.GetDOMTextContent(fragment);
  11463. callback(fragmentCode);
  11464. return;
  11465. }
  11466. if (BABYLON.Effect.ShadersStore[fragment + "PixelShader"]) {
  11467. callback(BABYLON.Effect.ShadersStore[fragment + "PixelShader"]);
  11468. return;
  11469. }
  11470. if (BABYLON.Effect.ShadersStore[fragment + "FragmentShader"]) {
  11471. callback(BABYLON.Effect.ShadersStore[fragment + "FragmentShader"]);
  11472. return;
  11473. }
  11474. var fragmentShaderUrl;
  11475. if (fragment[0] === ".") {
  11476. fragmentShaderUrl = fragment;
  11477. } else {
  11478. fragmentShaderUrl = BABYLON.Engine.ShadersRepository + fragment;
  11479. }
  11480. BABYLON.Tools.LoadFile(fragmentShaderUrl + ".fragment.fx", callback);
  11481. };
  11482. Effect.prototype._prepareEffect = function (vertexSourceCode, fragmentSourceCode, attributesNames, defines, fallbacks) {
  11483. try {
  11484. var engine = this._engine;
  11485. this._program = engine.createShaderProgram(vertexSourceCode, fragmentSourceCode, defines);
  11486. this._uniforms = engine.getUniforms(this._program, this._uniformsNames);
  11487. this._attributes = engine.getAttributes(this._program, attributesNames);
  11488. for (var index = 0; index < this._samplers.length; index++) {
  11489. var sampler = this.getUniform(this._samplers[index]);
  11490. if (sampler == null) {
  11491. this._samplers.splice(index, 1);
  11492. index--;
  11493. }
  11494. }
  11495. engine.bindSamplers(this);
  11496. this._isReady = true;
  11497. if (this.onCompiled) {
  11498. this.onCompiled(this);
  11499. }
  11500. } catch (e) {
  11501. if (e.message.indexOf("highp") !== -1) {
  11502. vertexSourceCode = vertexSourceCode.replace("precision highp float", "precision mediump float");
  11503. fragmentSourceCode = fragmentSourceCode.replace("precision highp float", "precision mediump float");
  11504. this._prepareEffect(vertexSourceCode, fragmentSourceCode, attributesNames, defines, fallbacks);
  11505. return;
  11506. }
  11507. if (fallbacks && fallbacks.isMoreFallbacks) {
  11508. defines = fallbacks.reduce(defines);
  11509. this._prepareEffect(vertexSourceCode, fragmentSourceCode, attributesNames, defines, fallbacks);
  11510. } else {
  11511. BABYLON.Tools.Error("Unable to compile effect: " + this.name);
  11512. BABYLON.Tools.Error("Defines: " + defines);
  11513. BABYLON.Tools.Error("Error: " + e.message);
  11514. this._compilationError = e.message;
  11515. if (this.onError) {
  11516. this.onError(this, this._compilationError);
  11517. }
  11518. }
  11519. }
  11520. };
  11521. Effect.prototype._bindTexture = function (channel, texture) {
  11522. this._engine._bindTexture(this._samplers.indexOf(channel), texture);
  11523. };
  11524. Effect.prototype.setTexture = function (channel, texture) {
  11525. this._engine.setTexture(this._samplers.indexOf(channel), texture);
  11526. };
  11527. Effect.prototype.setTextureFromPostProcess = function (channel, postProcess) {
  11528. this._engine.setTextureFromPostProcess(this._samplers.indexOf(channel), postProcess);
  11529. };
  11530. Effect.prototype._cacheFloat2 = function (uniformName, x, y) {
  11531. if (!this._valueCache[uniformName]) {
  11532. this._valueCache[uniformName] = [x, y];
  11533. return;
  11534. }
  11535. this._valueCache[uniformName][0] = x;
  11536. this._valueCache[uniformName][1] = y;
  11537. };
  11538. Effect.prototype._cacheFloat3 = function (uniformName, x, y, z) {
  11539. if (!this._valueCache[uniformName]) {
  11540. this._valueCache[uniformName] = [x, y, z];
  11541. return;
  11542. }
  11543. this._valueCache[uniformName][0] = x;
  11544. this._valueCache[uniformName][1] = y;
  11545. this._valueCache[uniformName][2] = z;
  11546. };
  11547. Effect.prototype._cacheFloat4 = function (uniformName, x, y, z, w) {
  11548. if (!this._valueCache[uniformName]) {
  11549. this._valueCache[uniformName] = [x, y, z, w];
  11550. return;
  11551. }
  11552. this._valueCache[uniformName][0] = x;
  11553. this._valueCache[uniformName][1] = y;
  11554. this._valueCache[uniformName][2] = z;
  11555. this._valueCache[uniformName][3] = w;
  11556. };
  11557. Effect.prototype.setArray = function (uniformName, array) {
  11558. this._engine.setArray(this.getUniform(uniformName), array);
  11559. return this;
  11560. };
  11561. Effect.prototype.setMatrices = function (uniformName, matrices) {
  11562. this._engine.setMatrices(this.getUniform(uniformName), matrices);
  11563. return this;
  11564. };
  11565. Effect.prototype.setMatrix = function (uniformName, matrix) {
  11566. this._engine.setMatrix(this.getUniform(uniformName), matrix);
  11567. return this;
  11568. };
  11569. Effect.prototype.setFloat = function (uniformName, value) {
  11570. if (this._valueCache[uniformName] && this._valueCache[uniformName] === value)
  11571. return this;
  11572. this._valueCache[uniformName] = value;
  11573. this._engine.setFloat(this.getUniform(uniformName), value);
  11574. return this;
  11575. };
  11576. Effect.prototype.setBool = function (uniformName, bool) {
  11577. if (this._valueCache[uniformName] && this._valueCache[uniformName] === bool)
  11578. return this;
  11579. this._valueCache[uniformName] = bool;
  11580. this._engine.setBool(this.getUniform(uniformName), bool ? 1 : 0);
  11581. return this;
  11582. };
  11583. Effect.prototype.setVector2 = function (uniformName, vector2) {
  11584. if (this._valueCache[uniformName] && this._valueCache[uniformName][0] == vector2.x && this._valueCache[uniformName][1] == vector2.y)
  11585. return this;
  11586. this._cacheFloat2(uniformName, vector2.x, vector2.y);
  11587. this._engine.setFloat2(this.getUniform(uniformName), vector2.x, vector2.y);
  11588. return this;
  11589. };
  11590. Effect.prototype.setFloat2 = function (uniformName, x, y) {
  11591. if (this._valueCache[uniformName] && this._valueCache[uniformName][0] == x && this._valueCache[uniformName][1] == y)
  11592. return this;
  11593. this._cacheFloat2(uniformName, x, y);
  11594. this._engine.setFloat2(this.getUniform(uniformName), x, y);
  11595. return this;
  11596. };
  11597. Effect.prototype.setVector3 = function (uniformName, vector3) {
  11598. if (this._valueCache[uniformName] && this._valueCache[uniformName][0] == vector3.x && this._valueCache[uniformName][1] == vector3.y && this._valueCache[uniformName][2] == vector3.z)
  11599. return this;
  11600. this._cacheFloat3(uniformName, vector3.x, vector3.y, vector3.z);
  11601. this._engine.setFloat3(this.getUniform(uniformName), vector3.x, vector3.y, vector3.z);
  11602. return this;
  11603. };
  11604. Effect.prototype.setFloat3 = function (uniformName, x, y, z) {
  11605. if (this._valueCache[uniformName] && this._valueCache[uniformName][0] == x && this._valueCache[uniformName][1] == y && this._valueCache[uniformName][2] == z)
  11606. return this;
  11607. this._cacheFloat3(uniformName, x, y, z);
  11608. this._engine.setFloat3(this.getUniform(uniformName), x, y, z);
  11609. return this;
  11610. };
  11611. Effect.prototype.setFloat4 = function (uniformName, x, y, z, w) {
  11612. if (this._valueCache[uniformName] && this._valueCache[uniformName][0] == x && this._valueCache[uniformName][1] == y && this._valueCache[uniformName][2] == z && this._valueCache[uniformName][3] == w)
  11613. return this;
  11614. this._cacheFloat4(uniformName, x, y, z, w);
  11615. this._engine.setFloat4(this.getUniform(uniformName), x, y, z, w);
  11616. return this;
  11617. };
  11618. Effect.prototype.setColor3 = function (uniformName, color3) {
  11619. if (this._valueCache[uniformName] && this._valueCache[uniformName][0] == color3.r && this._valueCache[uniformName][1] == color3.g && this._valueCache[uniformName][2] == color3.b)
  11620. return this;
  11621. this._cacheFloat3(uniformName, color3.r, color3.g, color3.b);
  11622. this._engine.setColor3(this.getUniform(uniformName), color3);
  11623. return this;
  11624. };
  11625. Effect.prototype.setColor4 = function (uniformName, color3, alpha) {
  11626. if (this._valueCache[uniformName] && this._valueCache[uniformName][0] == color3.r && this._valueCache[uniformName][1] == color3.g && this._valueCache[uniformName][2] == color3.b && this._valueCache[uniformName][3] == alpha)
  11627. return this;
  11628. this._cacheFloat4(uniformName, color3.r, color3.g, color3.b, alpha);
  11629. this._engine.setColor4(this.getUniform(uniformName), color3, alpha);
  11630. return this;
  11631. };
  11632. Effect.ShadersStore={anaglyphPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Samplers\nvarying vec2 vUV;\nuniform sampler2D textureSampler;\nuniform sampler2D leftSampler;\n\nvoid main(void)\n{\n vec4 leftFrag = texture2D(leftSampler, vUV);\n leftFrag = vec4(1.0, leftFrag.g, leftFrag.b, 1.0);\n\n vec4 rightFrag = texture2D(textureSampler, vUV);\n rightFrag = vec4(rightFrag.r, 1.0, 1.0, 1.0);\n\n gl_FragColor = vec4(rightFrag.rgb * leftFrag.rgb, 1.0);\n}",
  11633. blackAndWhitePixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Samplers\nvarying vec2 vUV;\nuniform sampler2D textureSampler;\n\nvoid main(void) \n{\n float luminance = dot(texture2D(textureSampler, vUV).rgb, vec3(0.3, 0.59, 0.11));\n gl_FragColor = vec4(luminance, luminance, luminance, 1.0);\n}",
  11634. blurPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Samplers\nvarying vec2 vUV;\nuniform sampler2D textureSampler;\n\n// Parameters\nuniform vec2 screenSize;\nuniform vec2 direction;\nuniform float blurWidth;\n\nvoid main(void)\n{\n float weights[7];\n weights[0] = 0.05;\n weights[1] = 0.1;\n weights[2] = 0.2;\n weights[3] = 0.3;\n weights[4] = 0.2;\n weights[5] = 0.1;\n weights[6] = 0.05;\n\n vec2 texelSize = vec2(1.0 / screenSize.x, 1.0 / screenSize.y);\n vec2 texelStep = texelSize * direction * blurWidth;\n vec2 start = vUV - 3.0 * texelStep;\n\n vec4 baseColor = vec4(0., 0., 0., 0.);\n vec2 texelOffset = vec2(0., 0.);\n\n for (int i = 0; i < 7; i++)\n {\n baseColor += texture2D(textureSampler, start + texelOffset) * weights[i];\n texelOffset += texelStep;\n }\n\n gl_FragColor = baseColor;\n}",
  11635. brickPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\nvarying vec2 vPosition;\nvarying vec2 vUV;\n\nuniform float numberOfBricksHeight;\nuniform float numberOfBricksWidth;\nuniform vec3 brick;\nuniform vec3 joint;\n\nfloat rand(vec2 n) {\n return fract(cos(dot(n, vec2(12.9898, 4.1414))) * 43758.5453);\n}\n\nfloat noise(vec2 n) {\n const vec2 d = vec2(0.0, 1.0);\n vec2 b = floor(n), f = smoothstep(vec2(0.0), vec2(1.0), fract(n));\n return mix(mix(rand(b), rand(b + d.yx), f.x), mix(rand(b + d.xy), rand(b + d.yy), f.x), f.y);\n}\n\nfloat fbm(vec2 n) {\n float total = 0.0, amplitude = 1.0;\n for (int i = 0; i < 4; i++) {\n total += noise(n) * amplitude;\n n += n;\n amplitude *= 0.5;\n }\n return total;\n}\n\nfloat round(float number){\n return sign(number)*floor(abs(number) + 0.5);\n}\n\nvoid main(void)\n{\n float brickW = 1.0 / numberOfBricksWidth;\n float brickH = 1.0 / numberOfBricksHeight;\n float jointWPercentage = 0.01;\n float jointHPercentage = 0.05;\n vec3 color = brick;\n float yi = vUV.y / brickH;\n float nyi = round(yi);\n float xi = vUV.x / brickW;\n\n if (mod(floor(yi), 2.0) == 0.0){\n xi = xi - 0.5;\n }\n\n float nxi = round(xi);\n vec2 brickvUV = vec2((xi - floor(xi)) / brickH, (yi - floor(yi)) / brickW);\n\n if (yi < nyi + jointHPercentage && yi > nyi - jointHPercentage){\n color = mix(joint, vec3(0.37, 0.25, 0.25), (yi - nyi) / jointHPercentage + 0.2);\n }\n else if (xi < nxi + jointWPercentage && xi > nxi - jointWPercentage){\n color = mix(joint, vec3(0.44, 0.44, 0.44), (xi - nxi) / jointWPercentage + 0.2);\n }\n else {\n float brickColorSwitch = mod(floor(yi) + floor(xi), 3.0);\n\n if (brickColorSwitch == 0.0)\n color = mix(color, vec3(0.33, 0.33, 0.33), 0.3);\n else if (brickColorSwitch == 2.0)\n color = mix(color, vec3(0.11, 0.11, 0.11), 0.3);\n }\n\n gl_FragColor = vec4(color, 1.0);\n}",
  11636. cloudPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\nvarying vec2 vUV;\n\nuniform vec3 skyColor;\nuniform vec3 cloudColor;\n\nfloat rand(vec2 n) {\n return fract(cos(dot(n, vec2(12.9898, 4.1414))) * 43758.5453);\n}\n\nfloat noise(vec2 n) {\n const vec2 d = vec2(0.0, 1.0);\n vec2 b = floor(n), f = smoothstep(vec2(0.0), vec2(1.0), fract(n));\n return mix(mix(rand(b), rand(b + d.yx), f.x), mix(rand(b + d.xy), rand(b + d.yy), f.x), f.y);\n}\n\nfloat fbm(vec2 n) {\n float total = 0.0, amplitude = 1.0;\n for (int i = 0; i < 4; i++) {\n total += noise(n) * amplitude;\n n += n;\n amplitude *= 0.5;\n }\n return total;\n}\n\nvoid main() {\n\n vec2 p = vUV * 12.0;\n vec3 c = mix(skyColor, cloudColor, fbm(p));\n gl_FragColor = vec4(c, 1);\n\n}",
  11637. colorPixelShader:"precision highp float;\n\nuniform vec4 color;\n\nvoid main(void) {\n gl_FragColor = color;\n}",
  11638. colorVertexShader:"precision highp float;\n\n// Attributes\nattribute vec3 position;\n\n// Uniforms\nuniform mat4 worldViewProjection;\n\nvoid main(void) {\n gl_Position = worldViewProjection * vec4(position, 1.0);\n}",
  11639. convolutionPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Samplers\nvarying vec2 vUV;\nuniform sampler2D textureSampler;\n\nuniform vec2 screenSize;\nuniform float kernel[9];\n\nvoid main(void)\n{\n vec2 onePixel = vec2(1.0, 1.0) / screenSize;\n vec4 colorSum =\n texture2D(textureSampler, vUV + onePixel * vec2(-1, -1)) * kernel[0] +\n texture2D(textureSampler, vUV + onePixel * vec2(0, -1)) * kernel[1] +\n texture2D(textureSampler, vUV + onePixel * vec2(1, -1)) * kernel[2] +\n texture2D(textureSampler, vUV + onePixel * vec2(-1, 0)) * kernel[3] +\n texture2D(textureSampler, vUV + onePixel * vec2(0, 0)) * kernel[4] +\n texture2D(textureSampler, vUV + onePixel * vec2(1, 0)) * kernel[5] +\n texture2D(textureSampler, vUV + onePixel * vec2(-1, 1)) * kernel[6] +\n texture2D(textureSampler, vUV + onePixel * vec2(0, 1)) * kernel[7] +\n texture2D(textureSampler, vUV + onePixel * vec2(1, 1)) * kernel[8];\n\n float kernelWeight =\n kernel[0] +\n kernel[1] +\n kernel[2] +\n kernel[3] +\n kernel[4] +\n kernel[5] +\n kernel[6] +\n kernel[7] +\n kernel[8];\n\n if (kernelWeight <= 0.0) {\n kernelWeight = 1.0;\n }\n\n gl_FragColor = vec4((colorSum / kernelWeight).rgb, 1);\n}",
  11640. defaultPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n#define MAP_EXPLICIT 0.\n#define MAP_SPHERICAL 1.\n#define MAP_PLANAR 2.\n#define MAP_CUBIC 3.\n#define MAP_PROJECTION 4.\n#define MAP_SKYBOX 5.\n\n// Constants\nuniform vec3 vEyePosition;\nuniform vec3 vAmbientColor;\nuniform vec4 vDiffuseColor;\nuniform vec4 vSpecularColor;\nuniform vec3 vEmissiveColor;\n\n// Input\nvarying vec3 vPositionW;\nvarying vec3 vNormalW;\n\n#ifdef VERTEXCOLOR\nvarying vec4 vColor;\n#endif\n\n// Lights\n#ifdef LIGHT0\nuniform vec4 vLightData0;\nuniform vec4 vLightDiffuse0;\nuniform vec3 vLightSpecular0;\n#ifdef SHADOW0\nvarying vec4 vPositionFromLight0;\nuniform sampler2D shadowSampler0;\nuniform float darkness0;\n#endif\n#ifdef SPOTLIGHT0\nuniform vec4 vLightDirection0;\n#endif\n#ifdef HEMILIGHT0\nuniform vec3 vLightGround0;\n#endif\n#endif\n\n#ifdef LIGHT1\nuniform vec4 vLightData1;\nuniform vec4 vLightDiffuse1;\nuniform vec3 vLightSpecular1;\n#ifdef SHADOW1\nvarying vec4 vPositionFromLight1;\nuniform sampler2D shadowSampler1;\nuniform float darkness1;\n#endif\n#ifdef SPOTLIGHT1\nuniform vec4 vLightDirection1;\n#endif\n#ifdef HEMILIGHT1\nuniform vec3 vLightGround1;\n#endif\n#endif\n\n#ifdef LIGHT2\nuniform vec4 vLightData2;\nuniform vec4 vLightDiffuse2;\nuniform vec3 vLightSpecular2;\n#ifdef SHADOW2\nvarying vec4 vPositionFromLight2;\nuniform sampler2D shadowSampler2;\nuniform float darkness2;\n#endif\n#ifdef SPOTLIGHT2\nuniform vec4 vLightDirection2;\n#endif\n#ifdef HEMILIGHT2\nuniform vec3 vLightGround2;\n#endif\n#endif\n\n#ifdef LIGHT3\nuniform vec4 vLightData3;\nuniform vec4 vLightDiffuse3;\nuniform vec3 vLightSpecular3;\n#ifdef SHADOW3\nvarying vec4 vPositionFromLight3;\nuniform sampler2D shadowSampler3;\nuniform float darkness3;\n#endif\n#ifdef SPOTLIGHT3\nuniform vec4 vLightDirection3;\n#endif\n#ifdef HEMILIGHT3\nuniform vec3 vLightGround3;\n#endif\n#endif\n\n// Samplers\n#ifdef DIFFUSE\nvarying vec2 vDiffuseUV;\nuniform sampler2D diffuseSampler;\nuniform vec2 vDiffuseInfos;\n#endif\n\n#ifdef AMBIENT\nvarying vec2 vAmbientUV;\nuniform sampler2D ambientSampler;\nuniform vec2 vAmbientInfos;\n#endif\n\n#ifdef OPACITY \nvarying vec2 vOpacityUV;\nuniform sampler2D opacitySampler;\nuniform vec2 vOpacityInfos;\n#endif\n\n#ifdef EMISSIVE\nvarying vec2 vEmissiveUV;\nuniform vec2 vEmissiveInfos;\nuniform sampler2D emissiveSampler;\n#endif\n\n#ifdef SPECULAR\nvarying vec2 vSpecularUV;\nuniform vec2 vSpecularInfos;\nuniform sampler2D specularSampler;\n#endif\n\n// Fresnel\n#ifdef FRESNEL\nfloat computeFresnelTerm(vec3 viewDirection, vec3 worldNormal, float bias, float power)\n{\n float fresnelTerm = pow(bias + abs(dot(viewDirection, worldNormal)), power);\n return clamp(fresnelTerm, 0., 1.);\n}\n#endif\n\n#ifdef DIFFUSEFRESNEL\nuniform vec4 diffuseLeftColor;\nuniform vec4 diffuseRightColor;\n#endif\n\n#ifdef OPACITYFRESNEL\nuniform vec4 opacityParts;\n#endif\n\n#ifdef REFLECTIONFRESNEL\nuniform vec4 reflectionLeftColor;\nuniform vec4 reflectionRightColor;\n#endif\n\n#ifdef EMISSIVEFRESNEL\nuniform vec4 emissiveLeftColor;\nuniform vec4 emissiveRightColor;\n#endif\n\n// Reflection\n#ifdef REFLECTION\nvarying vec3 vPositionUVW;\nuniform samplerCube reflectionCubeSampler;\nuniform sampler2D reflection2DSampler;\nuniform vec3 vReflectionInfos;\nuniform mat4 reflectionMatrix;\nuniform mat4 view;\n\nvec3 computeReflectionCoords(float mode, vec4 worldPos, vec3 worldNormal)\n{\n if (mode == MAP_SPHERICAL)\n {\n vec3 coords = vec3(view * vec4(worldNormal, 0.0));\n\n return vec3(reflectionMatrix * vec4(coords, 1.0));\n }\n else if (mode == MAP_PLANAR)\n {\n vec3 viewDir = worldPos.xyz - vEyePosition;\n vec3 coords = normalize(reflect(viewDir, worldNormal));\n\n return vec3(reflectionMatrix * vec4(coords, 1));\n }\n else if (mode == MAP_CUBIC)\n {\n vec3 viewDir = worldPos.xyz - vEyePosition;\n vec3 coords = reflect(viewDir, worldNormal);\n\n return vec3(reflectionMatrix * vec4(coords, 0));\n }\n else if (mode == MAP_PROJECTION)\n {\n return vec3(reflectionMatrix * (view * worldPos));\n }\n else if (mode == MAP_SKYBOX)\n {\n return vPositionUVW;\n }\n\n return vec3(0, 0, 0);\n}\n#endif\n\n// Shadows\n#ifdef SHADOWS\n\nfloat unpack(vec4 color)\n{\n const vec4 bitShift = vec4(1. / (255. * 255. * 255.), 1. / (255. * 255.), 1. / 255., 1.);\n return dot(color, bitShift);\n}\n\nfloat unpackHalf(vec2 color)\n{\n return color.x + (color.y / 255.0);\n}\n\nfloat computeShadow(vec4 vPositionFromLight, sampler2D shadowSampler, float darkness)\n{\n vec3 depth = vPositionFromLight.xyz / vPositionFromLight.w;\n vec2 uv = 0.5 * depth.xy + vec2(0.5, 0.5);\n\n if (uv.x < 0. || uv.x > 1.0 || uv.y < 0. || uv.y > 1.0)\n {\n return 1.0;\n }\n\n float shadow = unpack(texture2D(shadowSampler, uv));\n\n if (depth.z > shadow)\n {\n return darkness;\n }\n return 1.;\n}\n\nfloat computeShadowWithPCF(vec4 vPositionFromLight, sampler2D shadowSampler)\n{\n vec3 depth = vPositionFromLight.xyz / vPositionFromLight.w;\n vec2 uv = 0.5 * depth.xy + vec2(0.5, 0.5);\n\n if (uv.x < 0. || uv.x > 1.0 || uv.y < 0. || uv.y > 1.0)\n {\n return 1.0;\n }\n\n float visibility = 1.;\n\n vec2 poissonDisk[4];\n poissonDisk[0] = vec2(-0.94201624, -0.39906216);\n poissonDisk[1] = vec2(0.94558609, -0.76890725);\n poissonDisk[2] = vec2(-0.094184101, -0.92938870);\n poissonDisk[3] = vec2(0.34495938, 0.29387760);\n\n // Poisson Sampling\n if (unpack(texture2D(shadowSampler, uv + poissonDisk[0] / 1500.0)) < depth.z) visibility -= 0.2;\n if (unpack(texture2D(shadowSampler, uv + poissonDisk[1] / 1500.0)) < depth.z) visibility -= 0.2;\n if (unpack(texture2D(shadowSampler, uv + poissonDisk[2] / 1500.0)) < depth.z) visibility -= 0.2;\n if (unpack(texture2D(shadowSampler, uv + poissonDisk[3] / 1500.0)) < depth.z) visibility -= 0.2;\n\n return visibility;\n}\n\n// Thanks to http://devmaster.net/\nfloat ChebychevInequality(vec2 moments, float t)\n{\n if (t <= moments.x)\n {\n return 1.0;\n }\n\n float variance = moments.y - (moments.x * moments.x);\n variance = max(variance, 0.);\n\n float d = t - moments.x;\n return variance / (variance + d * d);\n}\n\nfloat computeShadowWithVSM(vec4 vPositionFromLight, sampler2D shadowSampler)\n{\n vec3 depth = vPositionFromLight.xyz / vPositionFromLight.w;\n vec2 uv = 0.5 * depth.xy + vec2(0.5, 0.5);\n\n if (uv.x < 0. || uv.x > 1.0 || uv.y < 0. || uv.y > 1.0)\n {\n return 1.0;\n }\n\n vec4 texel = texture2D(shadowSampler, uv);\n\n vec2 moments = vec2(unpackHalf(texel.xy), unpackHalf(texel.zw));\n return clamp(1.3 - ChebychevInequality(moments, depth.z), 0., 1.0);\n}\n#endif\n\n// Bump\n#ifdef BUMP\n#extension GL_OES_standard_derivatives : enable\nvarying vec2 vBumpUV;\nuniform vec2 vBumpInfos;\nuniform sampler2D bumpSampler;\n\n// Thanks to http://www.thetenthplanet.de/archives/1180\nmat3 cotangent_frame(vec3 normal, vec3 p, vec2 uv)\n{\n // get edge vectors of the pixel triangle\n vec3 dp1 = dFdx(p);\n vec3 dp2 = dFdy(p);\n vec2 duv1 = dFdx(uv);\n vec2 duv2 = dFdy(uv);\n\n // solve the linear system\n vec3 dp2perp = cross(dp2, normal);\n vec3 dp1perp = cross(normal, dp1);\n vec3 tangent = dp2perp * duv1.x + dp1perp * duv2.x;\n vec3 binormal = dp2perp * duv1.y + dp1perp * duv2.y;\n\n // construct a scale-invariant frame \n float invmax = inversesqrt(max(dot(tangent, tangent), dot(binormal, binormal)));\n return mat3(tangent * invmax, binormal * invmax, normal);\n}\n\nvec3 perturbNormal(vec3 viewDir)\n{\n vec3 map = texture2D(bumpSampler, vBumpUV).xyz;\n map = map * 255. / 127. - 128. / 127.;\n mat3 TBN = cotangent_frame(vNormalW * vBumpInfos.y, -viewDir, vBumpUV);\n return normalize(TBN * map);\n}\n#endif\n\n#ifdef CLIPPLANE\nvarying float fClipDistance;\n#endif\n\n// Fog\n#ifdef FOG\n\n#define FOGMODE_NONE 0.\n#define FOGMODE_EXP 1.\n#define FOGMODE_EXP2 2.\n#define FOGMODE_LINEAR 3.\n#define E 2.71828\n\nuniform vec4 vFogInfos;\nuniform vec3 vFogColor;\nvarying float fFogDistance;\n\nfloat CalcFogFactor()\n{\n float fogCoeff = 1.0;\n float fogStart = vFogInfos.y;\n float fogEnd = vFogInfos.z;\n float fogDensity = vFogInfos.w;\n\n if (FOGMODE_LINEAR == vFogInfos.x)\n {\n fogCoeff = (fogEnd - fFogDistance) / (fogEnd - fogStart);\n }\n else if (FOGMODE_EXP == vFogInfos.x)\n {\n fogCoeff = 1.0 / pow(E, fFogDistance * fogDensity);\n }\n else if (FOGMODE_EXP2 == vFogInfos.x)\n {\n fogCoeff = 1.0 / pow(E, fFogDistance * fFogDistance * fogDensity * fogDensity);\n }\n\n return clamp(fogCoeff, 0.0, 1.0);\n}\n#endif\n\n// Light Computing\nstruct lightingInfo\n{\n vec3 diffuse;\n vec3 specular;\n};\n\nlightingInfo computeLighting(vec3 viewDirectionW, vec3 vNormal, vec4 lightData, vec3 diffuseColor, vec3 specularColor, float range) {\n lightingInfo result;\n\n vec3 lightVectorW;\n float attenuation = 1.0;\n if (lightData.w == 0.)\n {\n vec3 direction = lightData.xyz - vPositionW;\n\n attenuation = max(0., 1.0 - length(direction) / range);\n lightVectorW = normalize(direction);\n }\n else\n {\n lightVectorW = normalize(-lightData.xyz);\n }\n\n // diffuse\n float ndl = max(0., dot(vNormal, lightVectorW));\n\n // Specular\n vec3 angleW = normalize(viewDirectionW + lightVectorW);\n float specComp = max(0., dot(vNormal, angleW));\n specComp = pow(specComp, max(1., vSpecularColor.a));\n\n result.diffuse = ndl * diffuseColor * attenuation;\n result.specular = specComp * specularColor * attenuation;\n\n return result;\n}\n\nlightingInfo computeSpotLighting(vec3 viewDirectionW, vec3 vNormal, vec4 lightData, vec4 lightDirection, vec3 diffuseColor, vec3 specularColor, float range) {\n lightingInfo result;\n\n vec3 direction = lightData.xyz - vPositionW;\n vec3 lightVectorW = normalize(direction);\n float attenuation = max(0., 1.0 - length(direction) / range);\n\n // diffuse\n float cosAngle = max(0., dot(-lightDirection.xyz, lightVectorW));\n float spotAtten = 0.0;\n\n if (cosAngle >= lightDirection.w)\n {\n cosAngle = max(0., pow(cosAngle, lightData.w));\n spotAtten = max(0., (cosAngle - lightDirection.w) / (1. - cosAngle));\n\n // Diffuse\n float ndl = max(0., dot(vNormal, -lightDirection.xyz));\n\n // Specular\n vec3 angleW = normalize(viewDirectionW - lightDirection.xyz);\n float specComp = max(0., dot(vNormal, angleW));\n specComp = pow(specComp, vSpecularColor.a);\n\n result.diffuse = ndl * spotAtten * diffuseColor * attenuation;\n result.specular = specComp * specularColor * spotAtten * attenuation;\n\n return result;\n }\n\n result.diffuse = vec3(0.);\n result.specular = vec3(0.);\n\n return result;\n}\n\nlightingInfo computeHemisphericLighting(vec3 viewDirectionW, vec3 vNormal, vec4 lightData, vec3 diffuseColor, vec3 specularColor, vec3 groundColor) {\n lightingInfo result;\n\n // Diffuse\n float ndl = dot(vNormal, lightData.xyz) * 0.5 + 0.5;\n\n // Specular\n vec3 angleW = normalize(viewDirectionW + lightData.xyz);\n float specComp = max(0., dot(vNormal, angleW));\n specComp = pow(specComp, vSpecularColor.a);\n\n result.diffuse = mix(groundColor, diffuseColor, ndl);\n result.specular = specComp * specularColor;\n\n return result;\n}\n\nvoid main(void) {\n // Clip plane\n#ifdef CLIPPLANE\n if (fClipDistance > 0.0)\n discard;\n#endif\n\n vec3 viewDirectionW = normalize(vEyePosition - vPositionW);\n\n // Base color\n vec4 baseColor = vec4(1., 1., 1., 1.);\n vec3 diffuseColor = vDiffuseColor.rgb;\n\n // Alpha\n float alpha = vDiffuseColor.a;\n\n#ifdef VERTEXCOLOR\n baseColor.rgb *= vColor.rgb;\n#endif\n\n#ifdef DIFFUSE\n baseColor = texture2D(diffuseSampler, vDiffuseUV);\n\n#ifdef ALPHATEST\n if (baseColor.a < 0.4)\n discard;\n#endif\n\n#ifdef ALPHAFROMDIFFUSE\n alpha *= baseColor.a;\n#endif\n\n baseColor.rgb *= vDiffuseInfos.y;\n#endif\n\n // Bump\n vec3 normalW = normalize(vNormalW);\n\n#ifdef BUMP\n normalW = perturbNormal(viewDirectionW);\n#endif\n\n // Ambient color\n vec3 baseAmbientColor = vec3(1., 1., 1.);\n\n#ifdef AMBIENT\n baseAmbientColor = texture2D(ambientSampler, vAmbientUV).rgb * vAmbientInfos.y;\n#endif\n\n // Lighting\n vec3 diffuseBase = vec3(0., 0., 0.);\n vec3 specularBase = vec3(0., 0., 0.);\n float shadow = 1.;\n\n#ifdef LIGHT0\n#ifdef SPOTLIGHT0\n lightingInfo info = computeSpotLighting(viewDirectionW, normalW, vLightData0, vLightDirection0, vLightDiffuse0.rgb, vLightSpecular0, vLightDiffuse0.a);\n#endif\n#ifdef HEMILIGHT0\n lightingInfo info = computeHemisphericLighting(viewDirectionW, normalW, vLightData0, vLightDiffuse0.rgb, vLightSpecular0, vLightGround0);\n#endif\n#ifdef POINTDIRLIGHT0\n lightingInfo info = computeLighting(viewDirectionW, normalW, vLightData0, vLightDiffuse0.rgb, vLightSpecular0, vLightDiffuse0.a);\n#endif\n#ifdef SHADOW0\n#ifdef SHADOWVSM0\n shadow = computeShadowWithVSM(vPositionFromLight0, shadowSampler0);\n#else\n #ifdef SHADOWPCF0\n shadow = computeShadowWithPCF(vPositionFromLight0, shadowSampler0);\n #else\n shadow = computeShadow(vPositionFromLight0, shadowSampler0, darkness0);\n #endif\n#endif\n#else\n shadow = 1.;\n#endif\n diffuseBase += info.diffuse * shadow;\n specularBase += info.specular * shadow;\n#endif\n\n#ifdef LIGHT1\n#ifdef SPOTLIGHT1\n info = computeSpotLighting(viewDirectionW, normalW, vLightData1, vLightDirection1, vLightDiffuse1.rgb, vLightSpecular1, vLightDiffuse1.a);\n#endif\n#ifdef HEMILIGHT1\n info = computeHemisphericLighting(viewDirectionW, normalW, vLightData1, vLightDiffuse1.rgb, vLightSpecular1, vLightGround1);\n#endif\n#ifdef POINTDIRLIGHT1\n info = computeLighting(viewDirectionW, normalW, vLightData1, vLightDiffuse1.rgb, vLightSpecular1, vLightDiffuse1.a);\n#endif\n#ifdef SHADOW1\n#ifdef SHADOWVSM1\n shadow = computeShadowWithVSM(vPositionFromLight1, shadowSampler1);\n#else\n #ifdef SHADOWPCF1\n shadow = computeShadowWithPCF(vPositionFromLight1, shadowSampler1);\n #else\n shadow = computeShadow(vPositionFromLight1, shadowSampler1, darkness1);\n #endif\n#endif\n#else\n shadow = 1.;\n#endif\n diffuseBase += info.diffuse * shadow;\n specularBase += info.specular * shadow;\n#endif\n\n#ifdef LIGHT2\n#ifdef SPOTLIGHT2\n info = computeSpotLighting(viewDirectionW, normalW, vLightData2, vLightDirection2, vLightDiffuse2.rgb, vLightSpecular2, vLightDiffuse2.a);\n#endif\n#ifdef HEMILIGHT2\n info = computeHemisphericLighting(viewDirectionW, normalW, vLightData2, vLightDiffuse2.rgb, vLightSpecular2, vLightGround2);\n#endif\n#ifdef POINTDIRLIGHT2\n info = computeLighting(viewDirectionW, normalW, vLightData2, vLightDiffuse2.rgb, vLightSpecular2, vLightDiffuse2.a);\n#endif\n#ifdef SHADOW2\n#ifdef SHADOWVSM2\n shadow = computeShadowWithVSM(vPositionFromLight2, shadowSampler2);\n#else\n #ifdef SHADOWPCF2\n shadow = computeShadowWithPCF(vPositionFromLight2, shadowSampler2);\n #else\n shadow = computeShadow(vPositionFromLight2, shadowSampler2, darkness2);\n #endif \n#endif \n#else\n shadow = 1.;\n#endif\n diffuseBase += info.diffuse * shadow;\n specularBase += info.specular * shadow;\n#endif\n\n#ifdef LIGHT3\n#ifdef SPOTLIGHT3\n info = computeSpotLighting(viewDirectionW, normalW, vLightData3, vLightDirection3, vLightDiffuse3.rgb, vLightSpecular3, vLightDiffuse3.a);\n#endif\n#ifdef HEMILIGHT3\n info = computeHemisphericLighting(viewDirectionW, normalW, vLightData3, vLightDiffuse3.rgb, vLightSpecular3, vLightGround3);\n#endif\n#ifdef POINTDIRLIGHT3\n info = computeLighting(viewDirectionW, normalW, vLightData3, vLightDiffuse3.rgb, vLightSpecular3, vLightDiffuse3.a);\n#endif\n#ifdef SHADOW3\n#ifdef SHADOWVSM3\n shadow = computeShadowWithVSM(vPositionFromLight3, shadowSampler3);\n#else\n #ifdef SHADOWPCF3\n shadow = computeShadowWithPCF(vPositionFromLight3, shadowSampler3);\n #else\n shadow = computeShadow(vPositionFromLight3, shadowSampler3, darkness3);\n #endif \n#endif \n#else\n shadow = 1.;\n#endif\n diffuseBase += info.diffuse * shadow;\n specularBase += info.specular * shadow;\n#endif\n\n // Reflection\n vec3 reflectionColor = vec3(0., 0., 0.);\n\n#ifdef REFLECTION\n vec3 vReflectionUVW = computeReflectionCoords(vReflectionInfos.x, vec4(vPositionW, 1.0), normalW);\n\n if (vReflectionInfos.z != 0.0)\n {\n reflectionColor = textureCube(reflectionCubeSampler, vReflectionUVW).rgb * vReflectionInfos.y * shadow;\n }\n else\n {\n vec2 coords = vReflectionUVW.xy;\n\n if (vReflectionInfos.x == MAP_PROJECTION)\n {\n coords /= vReflectionUVW.z;\n }\n\n coords.y = 1.0 - coords.y;\n\n reflectionColor = texture2D(reflection2DSampler, coords).rgb * vReflectionInfos.y * shadow;\n }\n\n#ifdef REFLECTIONFRESNEL\n float reflectionFresnelTerm = computeFresnelTerm(viewDirectionW, normalW, reflectionRightColor.a, reflectionLeftColor.a);\n\n reflectionColor *= reflectionLeftColor.rgb * (1.0 - reflectionFresnelTerm) + reflectionFresnelTerm * reflectionRightColor.rgb;\n#endif\n#endif\n\n#ifdef OPACITY\n vec4 opacityMap = texture2D(opacitySampler, vOpacityUV);\n\n#ifdef OPACITYRGB\n opacityMap.rgb = opacityMap.rgb * vec3(0.3, 0.59, 0.11);\n alpha *= (opacityMap.x + opacityMap.y + opacityMap.z)* vOpacityInfos.y;\n#else\n alpha *= opacityMap.a * vOpacityInfos.y;\n#endif\n\n#endif\n\n#ifdef VERTEXALPHA\n alpha *= vColor.a;\n#endif\n\n#ifdef OPACITYFRESNEL\n float opacityFresnelTerm = computeFresnelTerm(viewDirectionW, normalW, opacityParts.z, opacityParts.w);\n\n alpha += opacityParts.x * (1.0 - opacityFresnelTerm) + opacityFresnelTerm * opacityParts.y;\n#endif\n\n // Emissive\n vec3 emissiveColor = vEmissiveColor;\n#ifdef EMISSIVE\n emissiveColor += texture2D(emissiveSampler, vEmissiveUV).rgb * vEmissiveInfos.y;\n#endif\n\n#ifdef EMISSIVEFRESNEL\n float emissiveFresnelTerm = computeFresnelTerm(viewDirectionW, normalW, emissiveRightColor.a, emissiveLeftColor.a);\n\n emissiveColor *= emissiveLeftColor.rgb * (1.0 - emissiveFresnelTerm) + emissiveFresnelTerm * emissiveRightColor.rgb;\n#endif\n\n // Specular map\n vec3 specularColor = vSpecularColor.rgb;\n#ifdef SPECULAR\n specularColor = texture2D(specularSampler, vSpecularUV).rgb * vSpecularInfos.y;\n#endif\n\n // Fresnel\n#ifdef DIFFUSEFRESNEL\n float diffuseFresnelTerm = computeFresnelTerm(viewDirectionW, normalW, diffuseRightColor.a, diffuseLeftColor.a);\n\n diffuseBase *= diffuseLeftColor.rgb * (1.0 - diffuseFresnelTerm) + diffuseFresnelTerm * diffuseRightColor.rgb;\n#endif\n\n // Composition\n vec3 finalDiffuse = clamp(diffuseBase * diffuseColor + emissiveColor + vAmbientColor, 0.0, 1.0) * baseColor.rgb;\n vec3 finalSpecular = specularBase * specularColor;\n\n#ifdef SPECULAROVERALPHA\n alpha = clamp(alpha + dot(finalSpecular, vec3(0.3, 0.59, 0.11)), 0., 1.);\n#endif\n\n vec4 color = vec4(finalDiffuse * baseAmbientColor + finalSpecular + reflectionColor, alpha);\n\n#ifdef FOG\n float fog = CalcFogFactor();\n color.rgb = fog * color.rgb + (1.0 - fog) * vFogColor;\n#endif\n\n gl_FragColor = color;\n}",
  11641. defaultVertexShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Attributes\nattribute vec3 position;\nattribute vec3 normal;\n#ifdef UV1\nattribute vec2 uv;\n#endif\n#ifdef UV2\nattribute vec2 uv2;\n#endif\n#ifdef VERTEXCOLOR\nattribute vec4 color;\n#endif\n#ifdef BONES\nattribute vec4 matricesIndices;\nattribute vec4 matricesWeights;\n#endif\n\n// Uniforms\n\n#ifdef INSTANCES\nattribute vec4 world0;\nattribute vec4 world1;\nattribute vec4 world2;\nattribute vec4 world3;\n#else\nuniform mat4 world;\n#endif\n\nuniform mat4 view;\nuniform mat4 viewProjection;\n\n#ifdef DIFFUSE\nvarying vec2 vDiffuseUV;\nuniform mat4 diffuseMatrix;\nuniform vec2 vDiffuseInfos;\n#endif\n\n#ifdef AMBIENT\nvarying vec2 vAmbientUV;\nuniform mat4 ambientMatrix;\nuniform vec2 vAmbientInfos;\n#endif\n\n#ifdef OPACITY\nvarying vec2 vOpacityUV;\nuniform mat4 opacityMatrix;\nuniform vec2 vOpacityInfos;\n#endif\n\n#ifdef EMISSIVE\nvarying vec2 vEmissiveUV;\nuniform vec2 vEmissiveInfos;\nuniform mat4 emissiveMatrix;\n#endif\n\n#ifdef SPECULAR\nvarying vec2 vSpecularUV;\nuniform vec2 vSpecularInfos;\nuniform mat4 specularMatrix;\n#endif\n\n#ifdef BUMP\nvarying vec2 vBumpUV;\nuniform vec2 vBumpInfos;\nuniform mat4 bumpMatrix;\n#endif\n\n#ifdef BONES\nuniform mat4 mBones[BonesPerMesh];\n#endif\n\n#ifdef POINTSIZE\nuniform float pointSize;\n#endif\n\n// Output\nvarying vec3 vPositionW;\nvarying vec3 vNormalW;\n\n#ifdef VERTEXCOLOR\nvarying vec4 vColor;\n#endif\n\n#ifdef CLIPPLANE\nuniform vec4 vClipPlane;\nvarying float fClipDistance;\n#endif\n\n#ifdef FOG\nvarying float fFogDistance;\n#endif\n\n#ifdef SHADOWS\n#ifdef LIGHT0\nuniform mat4 lightMatrix0;\nvarying vec4 vPositionFromLight0;\n#endif\n#ifdef LIGHT1\nuniform mat4 lightMatrix1;\nvarying vec4 vPositionFromLight1;\n#endif\n#ifdef LIGHT2\nuniform mat4 lightMatrix2;\nvarying vec4 vPositionFromLight2;\n#endif\n#ifdef LIGHT3\nuniform mat4 lightMatrix3;\nvarying vec4 vPositionFromLight3;\n#endif\n#endif\n\n#ifdef REFLECTION\nvarying vec3 vPositionUVW;\n#endif\n\nvoid main(void) {\n mat4 finalWorld;\n\n#ifdef REFLECTION\n vPositionUVW = position;\n#endif \n\n#ifdef BONES\n mat4 m0 = mBones[int(matricesIndices.x)] * matricesWeights.x;\n mat4 m1 = mBones[int(matricesIndices.y)] * matricesWeights.y;\n mat4 m2 = mBones[int(matricesIndices.z)] * matricesWeights.z;\n\n#ifdef BONES4\n mat4 m3 = mBones[int(matricesIndices.w)] * matricesWeights.w;\n finalWorld = world * (m0 + m1 + m2 + m3);\n#else\n finalWorld = world * (m0 + m1 + m2);\n#endif \n\n#else\n#ifdef INSTANCES\n finalWorld = mat4(world0, world1, world2, world3);\n#else\n finalWorld = world;\n#endif\n#endif\n gl_Position = viewProjection * finalWorld * vec4(position, 1.0);\n\n vec4 worldPos = finalWorld * vec4(position, 1.0);\n vPositionW = vec3(worldPos);\n vNormalW = normalize(vec3(finalWorld * vec4(normal, 0.0)));\n\n // Texture coordinates\n#ifndef UV1\n vec2 uv = vec2(0., 0.);\n#endif\n#ifndef UV2\n vec2 uv2 = vec2(0., 0.);\n#endif\n\n#ifdef DIFFUSE\n if (vDiffuseInfos.x == 0.)\n {\n vDiffuseUV = vec2(diffuseMatrix * vec4(uv, 1.0, 0.0));\n }\n else\n {\n vDiffuseUV = vec2(diffuseMatrix * vec4(uv2, 1.0, 0.0));\n }\n#endif\n\n#ifdef AMBIENT\n if (vAmbientInfos.x == 0.)\n {\n vAmbientUV = vec2(ambientMatrix * vec4(uv, 1.0, 0.0));\n }\n else\n {\n vAmbientUV = vec2(ambientMatrix * vec4(uv2, 1.0, 0.0));\n }\n#endif\n\n#ifdef OPACITY\n if (vOpacityInfos.x == 0.)\n {\n vOpacityUV = vec2(opacityMatrix * vec4(uv, 1.0, 0.0));\n }\n else\n {\n vOpacityUV = vec2(opacityMatrix * vec4(uv2, 1.0, 0.0));\n }\n#endif\n\n#ifdef EMISSIVE\n if (vEmissiveInfos.x == 0.)\n {\n vEmissiveUV = vec2(emissiveMatrix * vec4(uv, 1.0, 0.0));\n }\n else\n {\n vEmissiveUV = vec2(emissiveMatrix * vec4(uv2, 1.0, 0.0));\n }\n#endif\n\n#ifdef SPECULAR\n if (vSpecularInfos.x == 0.)\n {\n vSpecularUV = vec2(specularMatrix * vec4(uv, 1.0, 0.0));\n }\n else\n {\n vSpecularUV = vec2(specularMatrix * vec4(uv2, 1.0, 0.0));\n }\n#endif\n\n#ifdef BUMP\n if (vBumpInfos.x == 0.)\n {\n vBumpUV = vec2(bumpMatrix * vec4(uv, 1.0, 0.0));\n }\n else\n {\n vBumpUV = vec2(bumpMatrix * vec4(uv2, 1.0, 0.0));\n }\n#endif\n\n // Clip plane\n#ifdef CLIPPLANE\n fClipDistance = dot(worldPos, vClipPlane);\n#endif\n\n // Fog\n#ifdef FOG\n fFogDistance = (view * worldPos).z;\n#endif\n\n // Shadows\n#ifdef SHADOWS\n#ifdef LIGHT0\n vPositionFromLight0 = lightMatrix0 * worldPos;\n#endif\n#ifdef LIGHT1\n vPositionFromLight1 = lightMatrix1 * worldPos;\n#endif\n#ifdef LIGHT2\n vPositionFromLight2 = lightMatrix2 * worldPos;\n#endif\n#ifdef LIGHT3\n vPositionFromLight3 = lightMatrix3 * worldPos;\n#endif\n#endif\n\n // Vertex color\n#ifdef VERTEXCOLOR\n vColor = color;\n#endif\n\n // Point size\n#ifdef POINTSIZE\n gl_PointSize = pointSize;\n#endif\n}",
  11642. displayPassPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Samplers\nvarying vec2 vUV;\nuniform sampler2D textureSampler;\nuniform sampler2D passSampler;\n\nvoid main(void)\n{\n gl_FragColor = texture2D(passSampler, vUV);\n}",
  11643. emptyPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\nvoid main(void)\n{\n \n}",
  11644. filterPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Samplers\nvarying vec2 vUV;\nuniform sampler2D textureSampler;\n\nuniform mat4 kernelMatrix;\n\nvoid main(void)\n{\n vec3 baseColor = texture2D(textureSampler, vUV).rgb;\n vec3 updatedColor = (kernelMatrix * vec4(baseColor, 1.0)).rgb;\n\n gl_FragColor = vec4(updatedColor, 1.0);\n}",
  11645. firePixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\nuniform float iGlobalTime;\nuniform vec3 c1;\nuniform vec3 c2;\nuniform vec3 c3;\nuniform vec3 c4;\nuniform vec3 c5;\nuniform vec3 c6;\nuniform vec2 speed;\nuniform float shift;\nuniform float alphaThreshold;\n\nvarying vec2 vUV;\n\nfloat rand(vec2 n) {\n return fract(cos(dot(n, vec2(12.9898, 4.1414))) * 43758.5453);\n}\n\nfloat noise(vec2 n) {\n const vec2 d = vec2(0.0, 1.0);\n vec2 b = floor(n), f = smoothstep(vec2(0.0), vec2(1.0), fract(n));\n return mix(mix(rand(b), rand(b + d.yx), f.x), mix(rand(b + d.xy), rand(b + d.yy), f.x), f.y);\n}\n\nfloat fbm(vec2 n) {\n float total = 0.0, amplitude = 1.0;\n for (int i = 0; i < 4; i++) {\n total += noise(n) * amplitude;\n n += n;\n amplitude *= 0.5;\n }\n return total;\n}\n\nvoid main() {\n vec2 p = vUV * 8.0;\n float q = fbm(p - iGlobalTime * 0.1);\n vec2 r = vec2(fbm(p + q + iGlobalTime * speed.x - p.x - p.y), fbm(p + q - iGlobalTime * speed.y));\n vec3 c = mix(c1, c2, fbm(p + r)) + mix(c3, c4, r.x) - mix(c5, c6, r.y);\n vec3 color = c * cos(shift * vUV.y);\n float luminance = dot(color.rgb, vec3(0.3, 0.59, 0.11));\n\n gl_FragColor = vec4(color, luminance * alphaThreshold + (1.0 - alphaThreshold));\n}",
  11646. fxaaPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n#define FXAA_REDUCE_MIN (1.0/128.0)\n#define FXAA_REDUCE_MUL (1.0/8.0)\n#define FXAA_SPAN_MAX 8.0\n\nvarying vec2 vUV;\nuniform sampler2D textureSampler;\nuniform vec2 texelSize;\n\nvoid main(){\n vec2 localTexelSize = texelSize;\n vec4 rgbNW = texture2D(textureSampler, (vUV + vec2(-1.0, -1.0) * localTexelSize));\n vec4 rgbNE = texture2D(textureSampler, (vUV + vec2(1.0, -1.0) * localTexelSize));\n vec4 rgbSW = texture2D(textureSampler, (vUV + vec2(-1.0, 1.0) * localTexelSize));\n vec4 rgbSE = texture2D(textureSampler, (vUV + vec2(1.0, 1.0) * localTexelSize));\n vec4 rgbM = texture2D(textureSampler, vUV);\n vec4 luma = vec4(0.299, 0.587, 0.114, 1.0);\n float lumaNW = dot(rgbNW, luma);\n float lumaNE = dot(rgbNE, luma);\n float lumaSW = dot(rgbSW, luma);\n float lumaSE = dot(rgbSE, luma);\n float lumaM = dot(rgbM, luma);\n float lumaMin = min(lumaM, min(min(lumaNW, lumaNE), min(lumaSW, lumaSE)));\n float lumaMax = max(lumaM, max(max(lumaNW, lumaNE), max(lumaSW, lumaSE)));\n\n vec2 dir = vec2(-((lumaNW + lumaNE) - (lumaSW + lumaSE)), ((lumaNW + lumaSW) - (lumaNE + lumaSE)));\n\n float dirReduce = max(\n (lumaNW + lumaNE + lumaSW + lumaSE) * (0.25 * FXAA_REDUCE_MUL),\n FXAA_REDUCE_MIN);\n\n float rcpDirMin = 1.0 / (min(abs(dir.x), abs(dir.y)) + dirReduce);\n dir = min(vec2(FXAA_SPAN_MAX, FXAA_SPAN_MAX),\n max(vec2(-FXAA_SPAN_MAX, -FXAA_SPAN_MAX),\n dir * rcpDirMin)) * localTexelSize;\n\n vec4 rgbA = 0.5 * (\n texture2D(textureSampler, vUV + dir * (1.0 / 3.0 - 0.5)) +\n texture2D(textureSampler, vUV + dir * (2.0 / 3.0 - 0.5)));\n\n vec4 rgbB = rgbA * 0.5 + 0.25 * (\n texture2D(textureSampler, vUV + dir * -0.5) +\n texture2D(textureSampler, vUV + dir * 0.5));\n float lumaB = dot(rgbB, luma);\n if ((lumaB < lumaMin) || (lumaB > lumaMax)) {\n gl_FragColor = rgbA;\n }\n else {\n gl_FragColor = rgbB;\n }\n}",
  11647. grassPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\nvarying vec2 vPosition;\nvarying vec2 vUV;\n\nuniform vec3 herb1;\nuniform vec3 herb2;\nuniform vec3 herb3;\nuniform vec3 dirt;\nuniform vec3 ground;\n\nfloat rand(vec2 n) {\n return fract(cos(dot(n, vec2(12.9898, 4.1414))) * 43758.5453);\n}\n\nfloat noise(vec2 n) {\n const vec2 d = vec2(0.0, 1.0);\n vec2 b = floor(n), f = smoothstep(vec2(0.0), vec2(1.0), fract(n));\n return mix(mix(rand(b), rand(b + d.yx), f.x), mix(rand(b + d.xy), rand(b + d.yy), f.x), f.y);\n}\n\nfloat fbm(vec2 n) {\n float total = 0.0, amplitude = 1.0;\n for (int i = 0; i < 4; i++) {\n total += noise(n) * amplitude;\n n += n;\n amplitude *= 0.5;\n }\n return total;\n}\n\nvoid main(void) {\n vec3 color = mix(ground, herb1, rand(gl_FragCoord.xy * 4.0));\n color = mix(color, herb2, rand(gl_FragCoord.xy * 8.0));\n color = mix(color, herb3, rand(gl_FragCoord.xy));\n color = mix(color, herb1, fbm(gl_FragCoord.xy * 16.0));\n gl_FragColor = vec4(color, 1.0);\n}",
  11648. layerPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Samplers\nvarying vec2 vUV;\nuniform sampler2D textureSampler;\n\n// Color\nuniform vec4 color;\n\nvoid main(void) {\n vec4 baseColor = texture2D(textureSampler, vUV);\n\n gl_FragColor = baseColor * color;\n}",
  11649. layerVertexShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Attributes\nattribute vec2 position;\n\n// Uniforms\nuniform mat4 textureMatrix;\n\n// Output\nvarying vec2 vUV;\n\nconst vec2 madd = vec2(0.5, 0.5);\n\nvoid main(void) { \n\n vUV = vec2(textureMatrix * vec4(position * madd + madd, 1.0, 0.0));\n gl_Position = vec4(position, 0.0, 1.0);\n}",
  11650. legacydefaultPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n#define MAP_PROJECTION 4.\n\n// Constants\nuniform vec3 vEyePosition;\nuniform vec3 vAmbientColor;\nuniform vec4 vDiffuseColor;\nuniform vec4 vSpecularColor;\nuniform vec3 vEmissiveColor;\n\n// Input\nvarying vec3 vPositionW;\nvarying vec3 vNormalW;\n\n#ifdef VERTEXCOLOR\nvarying vec4 vColor;\n#endif\n\n// Lights\n#ifdef LIGHT0\nuniform vec4 vLightData0;\nuniform vec4 vLightDiffuse0;\nuniform vec3 vLightSpecular0;\n#ifdef SHADOW0\nvarying vec4 vPositionFromLight0;\nuniform sampler2D shadowSampler0;\n#endif\n#ifdef SPOTLIGHT0\nuniform vec4 vLightDirection0;\n#endif\n#ifdef HEMILIGHT0\nuniform vec3 vLightGround0;\n#endif\n#endif\n\n#ifdef LIGHT1\nuniform vec4 vLightData1;\nuniform vec4 vLightDiffuse1;\nuniform vec3 vLightSpecular1;\n#ifdef SHADOW1\nvarying vec4 vPositionFromLight1;\nuniform sampler2D shadowSampler1;\n#endif\n#ifdef SPOTLIGHT1\nuniform vec4 vLightDirection1;\n#endif\n#ifdef HEMILIGHT1\nuniform vec3 vLightGround1;\n#endif\n#endif\n\n#ifdef LIGHT2\nuniform vec4 vLightData2;\nuniform vec4 vLightDiffuse2;\nuniform vec3 vLightSpecular2;\n#ifdef SHADOW2\nvarying vec4 vPositionFromLight2;\nuniform sampler2D shadowSampler2;\n#endif\n#ifdef SPOTLIGHT2\nuniform vec4 vLightDirection2;\n#endif\n#ifdef HEMILIGHT2\nuniform vec3 vLightGround2;\n#endif\n#endif\n\n#ifdef LIGHT3\nuniform vec4 vLightData3;\nuniform vec4 vLightDiffuse3;\nuniform vec3 vLightSpecular3;\n#ifdef SHADOW3\nvarying vec4 vPositionFromLight3;\nuniform sampler2D shadowSampler3;\n#endif\n#ifdef SPOTLIGHT3\nuniform vec4 vLightDirection3;\n#endif\n#ifdef HEMILIGHT3\nuniform vec3 vLightGround3;\n#endif\n#endif\n\n// Samplers\n#ifdef DIFFUSE\nvarying vec2 vDiffuseUV;\nuniform sampler2D diffuseSampler;\nuniform vec2 vDiffuseInfos;\n#endif\n\n#ifdef AMBIENT\nvarying vec2 vAmbientUV;\nuniform sampler2D ambientSampler;\nuniform vec2 vAmbientInfos;\n#endif\n\n#ifdef OPACITY \nvarying vec2 vOpacityUV;\nuniform sampler2D opacitySampler;\nuniform vec2 vOpacityInfos;\n#endif\n\n#ifdef REFLECTION\nvarying vec3 vReflectionUVW;\nuniform samplerCube reflectionCubeSampler;\nuniform sampler2D reflection2DSampler;\nuniform vec3 vReflectionInfos;\n#endif\n\n#ifdef EMISSIVE\nvarying vec2 vEmissiveUV;\nuniform vec2 vEmissiveInfos;\nuniform sampler2D emissiveSampler;\n#endif\n\n#ifdef SPECULAR\nvarying vec2 vSpecularUV;\nuniform vec2 vSpecularInfos;\nuniform sampler2D specularSampler;\n#endif\n\n// Fresnel\n#ifdef FRESNEL\nfloat computeFresnelTerm(vec3 viewDirection, vec3 worldNormal, float bias, float power)\n{\n float fresnelTerm = pow(bias + abs(dot(viewDirection, worldNormal)), power);\n return clamp(fresnelTerm, 0., 1.);\n}\n#endif\n\n#ifdef DIFFUSEFRESNEL\nuniform vec4 diffuseLeftColor;\nuniform vec4 diffuseRightColor;\n#endif\n\n#ifdef OPACITYFRESNEL\nuniform vec4 opacityParts;\n#endif\n\n#ifdef REFLECTIONFRESNEL\nuniform vec4 reflectionLeftColor;\nuniform vec4 reflectionRightColor;\n#endif\n\n#ifdef EMISSIVEFRESNEL\nuniform vec4 emissiveLeftColor;\nuniform vec4 emissiveRightColor;\n#endif\n\n// Shadows\n#ifdef SHADOWS\n\nfloat unpack(vec4 color)\n{\n const vec4 bitShift = vec4(1. / (255. * 255. * 255.), 1. / (255. * 255.), 1. / 255., 1.);\n return dot(color, bitShift);\n}\n\nfloat unpackHalf(vec2 color)\n{\n return color.x + (color.y / 255.0);\n}\n\nfloat computeShadow(vec4 vPositionFromLight, sampler2D shadowSampler)\n{\n vec3 depth = vPositionFromLight.xyz / vPositionFromLight.w;\n vec2 uv = 0.5 * depth.xy + vec2(0.5, 0.5);\n\n if (uv.x < 0. || uv.x > 1.0 || uv.y < 0. || uv.y > 1.0)\n {\n return 1.0;\n }\n\n float shadow = unpack(texture2D(shadowSampler, uv));\n\n if (depth.z > shadow)\n {\n return 0.;\n }\n return 1.;\n}\n\n// Thanks to http://devmaster.net/\nfloat ChebychevInequality(vec2 moments, float t)\n{\n if (t <= moments.x)\n {\n return 1.0;\n }\n\n float variance = moments.y - (moments.x * moments.x);\n variance = max(variance, 0.);\n\n float d = t - moments.x;\n return variance / (variance + d * d);\n}\n\nfloat computeShadowWithVSM(vec4 vPositionFromLight, sampler2D shadowSampler)\n{\n vec3 depth = vPositionFromLight.xyz / vPositionFromLight.w;\n vec2 uv = 0.5 * depth.xy + vec2(0.5, 0.5);\n\n if (uv.x < 0. || uv.x > 1.0 || uv.y < 0. || uv.y > 1.0)\n {\n return 1.0;\n }\n\n vec4 texel = texture2D(shadowSampler, uv);\n\n vec2 moments = vec2(unpackHalf(texel.xy), unpackHalf(texel.zw));\n return clamp(1.3 - ChebychevInequality(moments, depth.z), 0., 1.0);\n}\n#endif\n\n#ifdef CLIPPLANE\nvarying float fClipDistance;\n#endif\n\n// Fog\n#ifdef FOG\n\n#define FOGMODE_NONE 0.\n#define FOGMODE_EXP 1.\n#define FOGMODE_EXP2 2.\n#define FOGMODE_LINEAR 3.\n#define E 2.71828\n\nuniform vec4 vFogInfos;\nuniform vec3 vFogColor;\nvarying float fFogDistance;\n\nfloat CalcFogFactor()\n{\n float fogCoeff = 1.0;\n float fogStart = vFogInfos.y;\n float fogEnd = vFogInfos.z;\n float fogDensity = vFogInfos.w;\n\n if (FOGMODE_LINEAR == vFogInfos.x)\n {\n fogCoeff = (fogEnd - fFogDistance) / (fogEnd - fogStart);\n }\n else if (FOGMODE_EXP == vFogInfos.x)\n {\n fogCoeff = 1.0 / pow(E, fFogDistance * fogDensity);\n }\n else if (FOGMODE_EXP2 == vFogInfos.x)\n {\n fogCoeff = 1.0 / pow(E, fFogDistance * fFogDistance * fogDensity * fogDensity);\n }\n\n return clamp(fogCoeff, 0.0, 1.0);\n}\n#endif\n\n// Light Computing\nmat3 computeLighting(vec3 viewDirectionW, vec3 vNormal, vec4 lightData, vec4 diffuseColor, vec3 specularColor) {\n mat3 result;\n\n vec3 lightVectorW;\n if (lightData.w == 0.)\n {\n lightVectorW = normalize(lightData.xyz - vPositionW);\n }\n else\n {\n lightVectorW = normalize(-lightData.xyz);\n }\n\n // diffuse\n float ndl = max(0., dot(vNormal, lightVectorW));\n\n // Specular\n vec3 angleW = normalize(viewDirectionW + lightVectorW);\n float specComp = max(0., dot(vNormal, angleW));\n specComp = max(0., pow(specComp, max(1.0, vSpecularColor.a)));\n\n result[0] = ndl * diffuseColor.rgb;\n result[1] = specComp * specularColor;\n result[2] = vec3(0.);\n\n return result;\n}\n\nmat3 computeSpotLighting(vec3 viewDirectionW, vec3 vNormal, vec4 lightData, vec4 lightDirection, vec4 diffuseColor, vec3 specularColor) {\n mat3 result;\n\n vec3 lightVectorW = normalize(lightData.xyz - vPositionW);\n\n // diffuse\n float cosAngle = max(0., dot(-lightDirection.xyz, lightVectorW));\n float spotAtten = 0.0;\n\n if (cosAngle >= lightDirection.w)\n {\n cosAngle = max(0., pow(cosAngle, lightData.w));\n spotAtten = max(0., (cosAngle - lightDirection.w) / (1. - cosAngle));\n\n // Diffuse\n float ndl = max(0., dot(vNormal, -lightDirection.xyz));\n\n // Specular\n vec3 angleW = normalize(viewDirectionW - lightDirection.xyz);\n float specComp = max(0., dot(vNormal, angleW));\n specComp = pow(specComp, vSpecularColor.a);\n\n result[0] = ndl * spotAtten * diffuseColor.rgb;\n result[1] = specComp * specularColor * spotAtten;\n result[2] = vec3(0.);\n\n return result;\n }\n\n result[0] = vec3(0.);\n result[1] = vec3(0.);\n result[2] = vec3(0.);\n\n return result;\n}\n\nmat3 computeHemisphericLighting(vec3 viewDirectionW, vec3 vNormal, vec4 lightData, vec4 diffuseColor, vec3 specularColor, vec3 groundColor) {\n mat3 result;\n\n // Diffuse\n float ndl = dot(vNormal, lightData.xyz) * 0.5 + 0.5;\n\n // Specular\n vec3 angleW = normalize(viewDirectionW + lightData.xyz);\n float specComp = max(0., dot(vNormal, angleW));\n specComp = pow(specComp, vSpecularColor.a);\n\n result[0] = mix(groundColor, diffuseColor.rgb, ndl);\n result[1] = specComp * specularColor;\n result[2] = vec3(0.);\n\n return result;\n}\n\nvoid main(void) {\n // Clip plane\n#ifdef CLIPPLANE\n if (fClipDistance > 0.0)\n discard;\n#endif\n\n vec3 viewDirectionW = normalize(vEyePosition - vPositionW);\n\n // Base color\n vec4 baseColor = vec4(1., 1., 1., 1.);\n vec3 diffuseColor = vDiffuseColor.rgb;\n\n#ifdef VERTEXCOLOR\n baseColor.rgb *= vColor.rgb;\n#endif\n\n#ifdef DIFFUSE\n baseColor = texture2D(diffuseSampler, vDiffuseUV);\n\n#ifdef ALPHATEST\n if (baseColor.a < 0.4)\n discard;\n#endif\n\n baseColor.rgb *= vDiffuseInfos.y;\n#endif\n\n // Bump\n vec3 normalW = normalize(vNormalW);\n\n // Ambient color\n vec3 baseAmbientColor = vec3(1., 1., 1.);\n\n#ifdef AMBIENT\n baseAmbientColor = texture2D(ambientSampler, vAmbientUV).rgb * vAmbientInfos.y;\n#endif\n\n // Lighting\n vec3 diffuseBase = vec3(0., 0., 0.);\n vec3 specularBase = vec3(0., 0., 0.);\n float shadow = 1.;\n\n#ifdef LIGHT0\n#ifdef SPOTLIGHT0\n mat3 info = computeSpotLighting(viewDirectionW, normalW, vLightData0, vLightDirection0, vLightDiffuse0, vLightSpecular0);\n#endif\n#ifdef HEMILIGHT0\n mat3 info = computeHemisphericLighting(viewDirectionW, normalW, vLightData0, vLightDiffuse0, vLightSpecular0, vLightGround0);\n#endif\n#ifdef POINTDIRLIGHT0\n mat3 info = computeLighting(viewDirectionW, normalW, vLightData0, vLightDiffuse0, vLightSpecular0);\n#endif\n#ifdef SHADOW0\n#ifdef SHADOWVSM0\n shadow = computeShadowWithVSM(vPositionFromLight0, shadowSampler0);\n#else\n shadow = computeShadow(vPositionFromLight0, shadowSampler0);\n#endif\n#else\n shadow = 1.;\n#endif\n diffuseBase += info[0] * shadow;\n specularBase += info[1] * shadow;\n#endif\n\n#ifdef LIGHT1\n#ifdef SPOTLIGHT1\n info = computeSpotLighting(viewDirectionW, normalW, vLightData1, vLightDirection1, vLightDiffuse1, vLightSpecular1);\n#endif\n#ifdef HEMILIGHT1\n info = computeHemisphericLighting(viewDirectionW, normalW, vLightData1, vLightDiffuse1, vLightSpecular1, vLightGround1);\n#endif\n#ifdef POINTDIRLIGHT1\n info = computeLighting(viewDirectionW, normalW, vLightData1, vLightDiffuse1, vLightSpecular1);\n#endif\n#ifdef SHADOW1\n#ifdef SHADOWVSM1\n shadow = computeShadowWithVSM(vPositionFromLight1, shadowSampler1);\n#else\n shadow = computeShadow(vPositionFromLight1, shadowSampler1);\n#endif\n#else\n shadow = 1.;\n#endif\n diffuseBase += info[0] * shadow;\n specularBase += info[1] * shadow;\n#endif\n\n#ifdef LIGHT2\n#ifdef SPOTLIGHT2\n info = computeSpotLighting(viewDirectionW, normalW, vLightData2, vLightDirection2, vLightDiffuse2, vLightSpecular2);\n#endif\n#ifdef HEMILIGHT2\n info = computeHemisphericLighting(viewDirectionW, normalW, vLightData2, vLightDiffuse2, vLightSpecular2, vLightGround2);\n#endif\n#ifdef POINTDIRLIGHT2\n info = computeLighting(viewDirectionW, normalW, vLightData2, vLightDiffuse2, vLightSpecular2);\n#endif\n#ifdef SHADOW2\n#ifdef SHADOWVSM2\n shadow = computeShadowWithVSM(vPositionFromLight2, shadowSampler2);\n#else\n shadow = computeShadow(vPositionFromLight2, shadowSampler2);\n#endif \n#else\n shadow = 1.;\n#endif\n diffuseBase += info[0] * shadow;\n specularBase += info[1] * shadow;\n#endif\n\n#ifdef LIGHT3\n#ifdef SPOTLIGHT3\n info = computeSpotLighting(viewDirectionW, normalW, vLightData3, vLightDirection3, vLightDiffuse3, vLightSpecular3);\n#endif\n#ifdef HEMILIGHT3\n info = computeHemisphericLighting(viewDirectionW, normalW, vLightData3, vLightDiffuse3, vLightSpecular3, vLightGround3);\n#endif\n#ifdef POINTDIRLIGHT3\n info = computeLighting(viewDirectionW, normalW, vLightData3, vLightDiffuse3, vLightSpecular3);\n#endif\n#ifdef SHADOW3\n#ifdef SHADOWVSM3\n shadow = computeShadowWithVSM(vPositionFromLight3, shadowSampler3);\n#else\n shadow = computeShadow(vPositionFromLight3, shadowSampler3);\n#endif \n#else\n shadow = 1.;\n#endif\n diffuseBase += info[0] * shadow;\n specularBase += info[1] * shadow;\n#endif\n\n // Reflection\n vec3 reflectionColor = vec3(0., 0., 0.);\n\n#ifdef REFLECTION\n if (vReflectionInfos.z != 0.0)\n {\n reflectionColor = textureCube(reflectionCubeSampler, vReflectionUVW).rgb * vReflectionInfos.y;\n }\n else\n {\n vec2 coords = vReflectionUVW.xy;\n\n if (vReflectionInfos.x == MAP_PROJECTION)\n {\n coords /= vReflectionUVW.z;\n }\n\n coords.y = 1.0 - coords.y;\n\n reflectionColor = texture2D(reflection2DSampler, coords).rgb * vReflectionInfos.y;\n }\n\n#ifdef REFLECTIONFRESNEL\n float reflectionFresnelTerm = computeFresnelTerm(viewDirectionW, normalW, reflectionRightColor.a, reflectionLeftColor.a);\n\n reflectionColor *= reflectionLeftColor.rgb * (1.0 - reflectionFresnelTerm) + reflectionFresnelTerm * reflectionRightColor.rgb;\n#endif\n#endif\n\n // Alpha\n float alpha = vDiffuseColor.a;\n\n#ifdef OPACITY\n vec4 opacityMap = texture2D(opacitySampler, vOpacityUV);\n#ifdef OPACITYRGB\n opacityMap.rgb = opacityMap.rgb * vec3(0.3, 0.59, 0.11);\n alpha *= (opacityMap.x + opacityMap.y + opacityMap.z)* vOpacityInfos.y;\n#else\n alpha *= opacityMap.a * vOpacityInfos.y;\n#endif\n#endif\n\n#ifdef VERTEXALPHA\n alpha *= vColor.a;\n#endif\n\n#ifdef OPACITYFRESNEL\n float opacityFresnelTerm = computeFresnelTerm(viewDirectionW, normalW, opacityParts.z, opacityParts.w);\n\n alpha += opacityParts.x * (1.0 - opacityFresnelTerm) + opacityFresnelTerm * opacityParts.y;\n#endif\n\n // Emissive\n vec3 emissiveColor = vEmissiveColor;\n#ifdef EMISSIVE\n emissiveColor += texture2D(emissiveSampler, vEmissiveUV).rgb * vEmissiveInfos.y;\n#endif\n\n#ifdef EMISSIVEFRESNEL\n float emissiveFresnelTerm = computeFresnelTerm(viewDirectionW, normalW, emissiveRightColor.a, emissiveLeftColor.a);\n\n emissiveColor *= emissiveLeftColor.rgb * (1.0 - emissiveFresnelTerm) + emissiveFresnelTerm * emissiveRightColor.rgb;\n#endif\n\n // Specular map\n vec3 specularColor = vSpecularColor.rgb;\n#ifdef SPECULAR\n specularColor = texture2D(specularSampler, vSpecularUV).rgb * vSpecularInfos.y;\n#endif\n\n // Fresnel\n#ifdef DIFFUSEFRESNEL\n float diffuseFresnelTerm = computeFresnelTerm(viewDirectionW, normalW, diffuseRightColor.a, diffuseLeftColor.a);\n\n diffuseBase *= diffuseLeftColor.rgb * (1.0 - diffuseFresnelTerm) + diffuseFresnelTerm * diffuseRightColor.rgb;\n#endif\n\n // Composition\n vec3 finalDiffuse = clamp(diffuseBase * diffuseColor + emissiveColor + vAmbientColor, 0.0, 1.0) * baseColor.rgb;\n vec3 finalSpecular = specularBase * specularColor;\n\n vec4 color = vec4(finalDiffuse * baseAmbientColor + finalSpecular + reflectionColor, alpha);\n\n#ifdef FOG\n float fog = CalcFogFactor();\n color.rgb = fog * color.rgb + (1.0 - fog) * vFogColor;\n#endif\n\n gl_FragColor = color;\n}",
  11651. legacydefaultVertexShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n#define MAP_EXPLICIT 0.\n#define MAP_SPHERICAL 1.\n#define MAP_PLANAR 2.\n#define MAP_CUBIC 3.\n#define MAP_PROJECTION 4.\n#define MAP_SKYBOX 5.\n\n// Attributes\nattribute vec3 position;\nattribute vec3 normal;\n#ifdef UV1\nattribute vec2 uv;\n#endif\n#ifdef UV2\nattribute vec2 uv2;\n#endif\n#ifdef VERTEXCOLOR\nattribute vec4 color;\n#endif\n#ifdef BONES\nattribute vec4 matricesIndices;\nattribute vec4 matricesWeights;\n#endif\n\n// Uniforms\nuniform mat4 world;\nuniform mat4 view;\nuniform mat4 viewProjection;\n\n#ifdef DIFFUSE\nvarying vec2 vDiffuseUV;\nuniform mat4 diffuseMatrix;\nuniform vec2 vDiffuseInfos;\n#endif\n\n#ifdef AMBIENT\nvarying vec2 vAmbientUV;\nuniform mat4 ambientMatrix;\nuniform vec2 vAmbientInfos;\n#endif\n\n#ifdef OPACITY\nvarying vec2 vOpacityUV;\nuniform mat4 opacityMatrix;\nuniform vec2 vOpacityInfos;\n#endif\n\n#ifdef REFLECTION\nuniform vec3 vEyePosition;\nvarying vec3 vReflectionUVW;\nuniform vec3 vReflectionInfos;\nuniform mat4 reflectionMatrix;\n#endif\n\n#ifdef EMISSIVE\nvarying vec2 vEmissiveUV;\nuniform vec2 vEmissiveInfos;\nuniform mat4 emissiveMatrix;\n#endif\n\n#ifdef SPECULAR\nvarying vec2 vSpecularUV;\nuniform vec2 vSpecularInfos;\nuniform mat4 specularMatrix;\n#endif\n\n#ifdef BUMP\nvarying vec2 vBumpUV;\nuniform vec2 vBumpInfos;\nuniform mat4 bumpMatrix;\n#endif\n\n#ifdef BONES\nuniform mat4 mBones[BonesPerMesh];\n#endif\n\n// Output\nvarying vec3 vPositionW;\nvarying vec3 vNormalW;\n\n#ifdef VERTEXCOLOR\nvarying vec4 vColor;\n#endif\n\n#ifdef CLIPPLANE\nuniform vec4 vClipPlane;\nvarying float fClipDistance;\n#endif\n\n#ifdef FOG\nvarying float fFogDistance;\n#endif\n\n#ifdef SHADOWS\n#ifdef LIGHT0\nuniform mat4 lightMatrix0;\nvarying vec4 vPositionFromLight0;\n#endif\n#ifdef LIGHT1\nuniform mat4 lightMatrix1;\nvarying vec4 vPositionFromLight1;\n#endif\n#ifdef LIGHT2\nuniform mat4 lightMatrix2;\nvarying vec4 vPositionFromLight2;\n#endif\n#ifdef LIGHT3\nuniform mat4 lightMatrix3;\nvarying vec4 vPositionFromLight3;\n#endif\n#endif\n\n#ifdef REFLECTION\nvec3 computeReflectionCoords(float mode, vec4 worldPos, vec3 worldNormal)\n{\n if (mode == MAP_SPHERICAL)\n {\n vec3 coords = vec3(view * vec4(worldNormal, 0.0));\n\n return vec3(reflectionMatrix * vec4(coords, 1.0));\n }\n else if (mode == MAP_PLANAR)\n {\n vec3 viewDir = worldPos.xyz - vEyePosition;\n vec3 coords = normalize(reflect(viewDir, worldNormal));\n\n return vec3(reflectionMatrix * vec4(coords, 1));\n }\n else if (mode == MAP_CUBIC)\n {\n vec3 viewDir = worldPos.xyz - vEyePosition;\n vec3 coords = reflect(viewDir, worldNormal);\n\n return vec3(reflectionMatrix * vec4(coords, 0));\n }\n else if (mode == MAP_PROJECTION)\n {\n return vec3(reflectionMatrix * (view * worldPos));\n }\n else if (mode == MAP_SKYBOX)\n {\n return position;\n }\n\n return vec3(0, 0, 0);\n}\n#endif\n\nvoid main(void) {\n mat4 finalWorld;\n\n#ifdef BONES\n mat4 m0 = mBones[int(matricesIndices.x)] * matricesWeights.x;\n mat4 m1 = mBones[int(matricesIndices.y)] * matricesWeights.y;\n mat4 m2 = mBones[int(matricesIndices.z)] * matricesWeights.z;\n\n#ifdef BONES4\n mat4 m3 = mBones[int(matricesIndices.w)] * matricesWeights.w;\n finalWorld = world * (m0 + m1 + m2 + m3);\n#else\n finalWorld = world * (m0 + m1 + m2);\n#endif \n\n#else\n finalWorld = world;\n#endif\n\n gl_Position = viewProjection * finalWorld * vec4(position, 1.0);\n\n vec4 worldPos = finalWorld * vec4(position, 1.0);\n vPositionW = vec3(worldPos);\n vNormalW = normalize(vec3(finalWorld * vec4(normal, 0.0)));\n\n // Texture coordinates\n#ifndef UV1\n vec2 uv = vec2(0., 0.);\n#endif\n#ifndef UV2\n vec2 uv2 = vec2(0., 0.);\n#endif\n\n#ifdef DIFFUSE\n if (vDiffuseInfos.x == 0.)\n {\n vDiffuseUV = vec2(diffuseMatrix * vec4(uv, 1.0, 0.0));\n }\n else\n {\n vDiffuseUV = vec2(diffuseMatrix * vec4(uv2, 1.0, 0.0));\n }\n#endif\n\n#ifdef AMBIENT\n if (vAmbientInfos.x == 0.)\n {\n vAmbientUV = vec2(ambientMatrix * vec4(uv, 1.0, 0.0));\n }\n else\n {\n vAmbientUV = vec2(ambientMatrix * vec4(uv2, 1.0, 0.0));\n }\n#endif\n\n#ifdef OPACITY\n if (vOpacityInfos.x == 0.)\n {\n vOpacityUV = vec2(opacityMatrix * vec4(uv, 1.0, 0.0));\n }\n else\n {\n vOpacityUV = vec2(opacityMatrix * vec4(uv2, 1.0, 0.0));\n }\n#endif\n\n#ifdef REFLECTION\n vReflectionUVW = computeReflectionCoords(vReflectionInfos.x, vec4(vPositionW, 1.0), vNormalW);\n#endif\n\n#ifdef EMISSIVE\n if (vEmissiveInfos.x == 0.)\n {\n vEmissiveUV = vec2(emissiveMatrix * vec4(uv, 1.0, 0.0));\n }\n else\n {\n vEmissiveUV = vec2(emissiveMatrix * vec4(uv2, 1.0, 0.0));\n }\n#endif\n\n#ifdef SPECULAR\n if (vSpecularInfos.x == 0.)\n {\n vSpecularUV = vec2(specularMatrix * vec4(uv, 1.0, 0.0));\n }\n else\n {\n vSpecularUV = vec2(specularMatrix * vec4(uv2, 1.0, 0.0));\n }\n#endif\n\n#ifdef BUMP\n if (vBumpInfos.x == 0.)\n {\n vBumpUV = vec2(bumpMatrix * vec4(uv, 1.0, 0.0));\n }\n else\n {\n vBumpUV = vec2(bumpMatrix * vec4(uv2, 1.0, 0.0));\n }\n#endif\n\n // Clip plane\n#ifdef CLIPPLANE\n fClipDistance = dot(worldPos, vClipPlane);\n#endif\n\n // Fog\n#ifdef FOG\n fFogDistance = (view * worldPos).z;\n#endif\n\n // Shadows\n#ifdef SHADOWS\n#ifdef LIGHT0\n vPositionFromLight0 = lightMatrix0 * worldPos;\n#endif\n#ifdef LIGHT1\n vPositionFromLight1 = lightMatrix1 * worldPos;\n#endif\n#ifdef LIGHT2\n vPositionFromLight2 = lightMatrix2 * worldPos;\n#endif\n#ifdef LIGHT3\n vPositionFromLight3 = lightMatrix3 * worldPos;\n#endif\n#endif\n\n // Vertex color\n#ifdef VERTEXCOLOR\n vColor = color;\n#endif\n}",
  11652. lensFlarePixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Samplers\nvarying vec2 vUV;\nuniform sampler2D textureSampler;\n\n// Color\nuniform vec4 color;\n\nvoid main(void) {\n vec4 baseColor = texture2D(textureSampler, vUV);\n\n gl_FragColor = baseColor * color;\n}",
  11653. lensFlareVertexShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Attributes\nattribute vec2 position;\n\n// Uniforms\nuniform mat4 viewportMatrix;\n\n// Output\nvarying vec2 vUV;\n\nconst vec2 madd = vec2(0.5, 0.5);\n\nvoid main(void) { \n\n vUV = position * madd + madd;\n gl_Position = viewportMatrix * vec4(position, 0.0, 1.0);\n}",
  11654. marblePixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\nvarying vec2 vPosition;\nvarying vec2 vUV;\n\nuniform float numberOfBricksHeight;\nuniform float numberOfBricksWidth ;\nuniform float amplitude;\nuniform vec3 brick;\nuniform vec3 joint;\n\nconst vec3 tileSize = vec3(1.1, 1.0, 1.1);\nconst vec3 tilePct = vec3(0.98, 1.0, 0.98);\n\nfloat rand(vec2 n) {\n return fract(cos(dot(n, vec2(12.9898, 4.1414))) * 43758.5453);\n}\n\nfloat noise(vec2 n) {\n const vec2 d = vec2(0.0, 1.0);\n vec2 b = floor(n), f = smoothstep(vec2(0.0), vec2(1.0), fract(n));\n return mix(mix(rand(b), rand(b + d.yx), f.x), mix(rand(b + d.xy), rand(b + d.yy), f.x), f.y);\n}\n\nfloat turbulence(vec2 P)\n{\n float val = 0.0;\n float freq = 1.0;\n for (int i = 0; i < 4; i++)\n {\n val += abs(noise(P*freq) / freq);\n freq *= 2.07;\n }\n return val;\n}\n\nfloat round(float number){\n return sign(number)*floor(abs(number) + 0.5);\n}\n\nvec3 marble_color(float x)\n{\n vec3 col;\n x = 0.5*(x + 1.);\n x = sqrt(x); \n x = sqrt(x);\n x = sqrt(x);\n col = vec3(.2 + .75*x); \n col.b *= 0.95; \n return col;\n}\n\nvoid main()\n{\n float brickW = 1.0 / numberOfBricksWidth;\n float brickH = 1.0 / numberOfBricksHeight;\n float jointWPercentage = 0.01;\n float jointHPercentage = 0.01;\n vec3 color = brick;\n float yi = vUV.y / brickH;\n float nyi = round(yi);\n float xi = vUV.x / brickW;\n\n if (mod(floor(yi), 2.0) == 0.0){\n xi = xi - 0.5;\n }\n\n float nxi = round(xi);\n vec2 brickvUV = vec2((xi - floor(xi)) / brickH, (yi - floor(yi)) / brickW);\n\n if (yi < nyi + jointHPercentage && yi > nyi - jointHPercentage){\n color = mix(joint, vec3(0.37, 0.25, 0.25), (yi - nyi) / jointHPercentage + 0.2);\n }\n else if (xi < nxi + jointWPercentage && xi > nxi - jointWPercentage){\n color = mix(joint, vec3(0.44, 0.44, 0.44), (xi - nxi) / jointWPercentage + 0.2);\n }\n else {\n float t = 6.28 * brickvUV.x / (tileSize.x + noise(vec2(vUV)*6.0));\n t += amplitude * turbulence(brickvUV.xy);\n t = sin(t);\n color = marble_color(t);\n }\n\n gl_FragColor = vec4(color, 0.0);\n}",
  11655. oculusDistortionCorrectionPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Samplers\nvarying vec2 vUV;\nuniform sampler2D textureSampler;\nuniform vec2 LensCenter;\nuniform vec2 Scale;\nuniform vec2 ScaleIn;\nuniform vec4 HmdWarpParam;\n\nvec2 HmdWarp(vec2 in01) {\n\n vec2 theta = (in01 - LensCenter) * ScaleIn; // Scales to [-1, 1]\n float rSq = theta.x * theta.x + theta.y * theta.y;\n vec2 rvector = theta * (HmdWarpParam.x + HmdWarpParam.y * rSq + HmdWarpParam.z * rSq * rSq + HmdWarpParam.w * rSq * rSq * rSq);\n return LensCenter + Scale * rvector;\n}\n\nvoid main(void)\n{\n vec2 tc = HmdWarp(vUV);\n if (tc.x <0.0 || tc.x>1.0 || tc.y<0.0 || tc.y>1.0)\n gl_FragColor = vec4(0.0, 0.0, 0.0, 1.0);\n else{\n gl_FragColor = vec4(texture2D(textureSampler, tc).rgb, 1.0);\n }\n}",
  11656. outlinePixelShader:"precision highp float;\n\nuniform vec4 color;\n\n#ifdef ALPHATEST\nvarying vec2 vUV;\nuniform sampler2D diffuseSampler;\n#endif\n\nvoid main(void) {\n#ifdef ALPHATEST\n if (texture2D(diffuseSampler, vUV).a < 0.4)\n discard;\n#endif\n\n gl_FragColor = color;\n}",
  11657. outlineVertexShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Attribute\nattribute vec3 position;\nattribute vec3 normal;\n\n#ifdef BONES\nattribute vec4 matricesIndices;\nattribute vec4 matricesWeights;\n#endif\n\n// Uniform\nuniform float offset;\n\n#ifdef INSTANCES\nattribute vec4 world0;\nattribute vec4 world1;\nattribute vec4 world2;\nattribute vec4 world3;\n#else\nuniform mat4 world;\n#endif\n\nuniform mat4 viewProjection;\n#ifdef BONES\nuniform mat4 mBones[BonesPerMesh];\n#endif\n\n#ifdef ALPHATEST\nvarying vec2 vUV;\nuniform mat4 diffuseMatrix;\n#ifdef UV1\nattribute vec2 uv;\n#endif\n#ifdef UV2\nattribute vec2 uv2;\n#endif\n#endif\n\nvoid main(void)\n{\n#ifdef INSTANCES\n mat4 finalWorld = mat4(world0, world1, world2, world3);\n#else\n mat4 finalWorld = world;\n#endif\n\n vec3 offsetPosition = position + normal * offset;\n\n#ifdef BONES\n mat4 m0 = mBones[int(matricesIndices.x)] * matricesWeights.x;\n mat4 m1 = mBones[int(matricesIndices.y)] * matricesWeights.y;\n mat4 m2 = mBones[int(matricesIndices.z)] * matricesWeights.z;\n mat4 m3 = mBones[int(matricesIndices.w)] * matricesWeights.w;\n finalWorld = finalWorld * (m0 + m1 + m2 + m3);\n gl_Position = viewProjection * finalWorld * vec4(offsetPosition, 1.0);\n#else\n gl_Position = viewProjection * finalWorld * vec4(offsetPosition, 1.0);\n#endif\n\n#ifdef ALPHATEST\n#ifdef UV1\n vUV = vec2(diffuseMatrix * vec4(uv, 1.0, 0.0));\n#endif\n#ifdef UV2\n vUV = vec2(diffuseMatrix * vec4(uv2, 1.0, 0.0));\n#endif\n#endif\n}",
  11658. particlesPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Samplers\nvarying vec2 vUV;\nvarying vec4 vColor;\nuniform vec4 textureMask;\nuniform sampler2D diffuseSampler;\n\n#ifdef CLIPPLANE\nvarying float fClipDistance;\n#endif\n\nvoid main(void) {\n#ifdef CLIPPLANE\n if (fClipDistance > 0.0)\n discard;\n#endif\n vec4 baseColor = texture2D(diffuseSampler, vUV);\n\n gl_FragColor = (baseColor * textureMask + (vec4(1., 1., 1., 1.) - textureMask)) * vColor;\n}",
  11659. particlesVertexShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Attributes\nattribute vec3 position;\nattribute vec4 color;\nattribute vec4 options;\n\n// Uniforms\nuniform mat4 view;\nuniform mat4 projection;\n\n// Output\nvarying vec2 vUV;\nvarying vec4 vColor;\n\n#ifdef CLIPPLANE\nuniform vec4 vClipPlane;\nuniform mat4 invView;\nvarying float fClipDistance;\n#endif\n\nvoid main(void) { \n vec3 viewPos = (view * vec4(position, 1.0)).xyz; \n vec3 cornerPos;\n float size = options.y;\n float angle = options.x;\n vec2 offset = options.zw;\n\n cornerPos = vec3(offset.x - 0.5, offset.y - 0.5, 0.) * size;\n\n // Rotate\n vec3 rotatedCorner;\n rotatedCorner.x = cornerPos.x * cos(angle) - cornerPos.y * sin(angle);\n rotatedCorner.y = cornerPos.x * sin(angle) + cornerPos.y * cos(angle);\n rotatedCorner.z = 0.;\n\n // Position\n viewPos += rotatedCorner;\n gl_Position = projection * vec4(viewPos, 1.0); \n \n vColor = color;\n vUV = offset;\n\n // Clip plane\n#ifdef CLIPPLANE\n vec4 worldPos = invView * vec4(viewPos, 1.0);\n fClipDistance = dot(worldPos, vClipPlane);\n#endif\n}",
  11660. passPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Samplers\nvarying vec2 vUV;\nuniform sampler2D textureSampler;\n\nvoid main(void) \n{\n gl_FragColor = texture2D(textureSampler, vUV);\n}",
  11661. postprocessVertexShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Attributes\nattribute vec2 position;\n\n// Output\nvarying vec2 vUV;\n\nconst vec2 madd = vec2(0.5, 0.5);\n\nvoid main(void) { \n\n vUV = position * madd + madd;\n gl_Position = vec4(position, 0.0, 1.0);\n}",
  11662. proceduralVertexShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Attributes\nattribute vec2 position;\n\n// Output\nvarying vec2 vPosition;\nvarying vec2 vUV;\n\nconst vec2 madd = vec2(0.5, 0.5);\n\nvoid main(void) { \n vPosition = position;\n vUV = position * madd + madd;\n gl_Position = vec4(position, 0.0, 1.0);\n}",
  11663. refractionPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Samplers\nvarying vec2 vUV;\nuniform sampler2D textureSampler;\nuniform sampler2D refractionSampler;\n\n// Parameters\nuniform vec3 baseColor;\nuniform float depth;\nuniform float colorLevel;\n\nvoid main() {\n float ref = 1.0 - texture2D(refractionSampler, vUV).r;\n\n vec2 uv = vUV - vec2(0.5);\n vec2 offset = uv * depth * ref;\n vec3 sourceColor = texture2D(textureSampler, vUV - offset).rgb;\n\n gl_FragColor = vec4(sourceColor + sourceColor * ref * colorLevel, 1.0);\n}",
  11664. roadPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\nvarying vec2 vUV; \nuniform vec3 roadColor;\n\nfloat rand(vec2 n) {\n return fract(cos(dot(n, vec2(12.9898, 4.1414))) * 43758.5453);\n}\n\nfloat noise(vec2 n) {\n const vec2 d = vec2(0.0, 1.0);\n vec2 b = floor(n), f = smoothstep(vec2(0.0), vec2(1.0), fract(n));\n return mix(mix(rand(b), rand(b + d.yx), f.x), mix(rand(b + d.xy), rand(b + d.yy), f.x), f.y);\n}\n\nfloat fbm(vec2 n) {\n float total = 0.0, amplitude = 1.0;\n for (int i = 0; i < 4; i++) {\n total += noise(n) * amplitude;\n n += n;\n amplitude *= 0.5;\n }\n return total;\n}\n\nvoid main(void) {\n float ratioy = mod(gl_FragCoord.y * 100.0 , fbm(vUV * 2.0));\n vec3 color = roadColor * ratioy;\n gl_FragColor = vec4(color, 1.0);\n}",
  11665. shadowMapPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\nvec4 pack(float depth)\n{\n const vec4 bitOffset = vec4(255. * 255. * 255., 255. * 255., 255., 1.);\n const vec4 bitMask = vec4(0., 1. / 255., 1. / 255., 1. / 255.);\n \n vec4 comp = mod(depth * bitOffset * vec4(254.), vec4(255.)) / vec4(254.);\n comp -= comp.xxyz * bitMask;\n \n return comp;\n}\n\n// Thanks to http://devmaster.net/\nvec2 packHalf(float depth) \n{ \n const vec2 bitOffset = vec2(1.0 / 255., 0.);\n vec2 color = vec2(depth, fract(depth * 255.));\n\n return color - (color.yy * bitOffset);\n}\n\n#ifndef VSM\nvarying vec4 vPosition;\n#endif\n\n#ifdef ALPHATEST\nvarying vec2 vUV;\nuniform sampler2D diffuseSampler;\n#endif\n\nvoid main(void)\n{\n#ifdef ALPHATEST\n if (texture2D(diffuseSampler, vUV).a < 0.4)\n discard;\n#endif\n\n#ifdef VSM\n float moment1 = gl_FragCoord.z / gl_FragCoord.w;\n float moment2 = moment1 * moment1;\n gl_FragColor = vec4(packHalf(moment1), packHalf(moment2));\n#else\n gl_FragColor = pack(vPosition.z / vPosition.w);\n#endif\n}",
  11666. shadowMapVertexShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Attribute\nattribute vec3 position;\n#ifdef BONES\nattribute vec4 matricesIndices;\nattribute vec4 matricesWeights;\n#endif\n\n// Uniform\n#ifdef INSTANCES\nattribute vec4 world0;\nattribute vec4 world1;\nattribute vec4 world2;\nattribute vec4 world3;\n#else\nuniform mat4 world;\n#endif\n\nuniform mat4 viewProjection;\n#ifdef BONES\nuniform mat4 mBones[BonesPerMesh];\n#endif\n\n#ifndef VSM\nvarying vec4 vPosition;\n#endif\n\n#ifdef ALPHATEST\nvarying vec2 vUV;\nuniform mat4 diffuseMatrix;\n#ifdef UV1\nattribute vec2 uv;\n#endif\n#ifdef UV2\nattribute vec2 uv2;\n#endif\n#endif\n\nvoid main(void)\n{\n#ifdef INSTANCES\n mat4 finalWorld = mat4(world0, world1, world2, world3);\n#else\n mat4 finalWorld = world;\n#endif\n\n#ifdef BONES\n mat4 m0 = mBones[int(matricesIndices.x)] * matricesWeights.x;\n mat4 m1 = mBones[int(matricesIndices.y)] * matricesWeights.y;\n mat4 m2 = mBones[int(matricesIndices.z)] * matricesWeights.z;\n mat4 m3 = mBones[int(matricesIndices.w)] * matricesWeights.w;\n finalWorld = finalWorld * (m0 + m1 + m2 + m3);\n gl_Position = viewProjection * finalWorld * vec4(position, 1.0);\n#else\n#ifndef VSM\n vPosition = viewProjection * finalWorld * vec4(position, 1.0);\n#endif\n gl_Position = viewProjection * finalWorld * vec4(position, 1.0);\n#endif\n\n#ifdef ALPHATEST\n#ifdef UV1\n vUV = vec2(diffuseMatrix * vec4(uv, 1.0, 0.0));\n#endif\n#ifdef UV2\n vUV = vec2(diffuseMatrix * vec4(uv2, 1.0, 0.0));\n#endif\n#endif\n}",
  11667. spritesPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\nuniform bool alphaTest;\n\nvarying vec4 vColor;\n\n// Samplers\nvarying vec2 vUV;\nuniform sampler2D diffuseSampler;\n\n// Fog\n#ifdef FOG\n\n#define FOGMODE_NONE 0.\n#define FOGMODE_EXP 1.\n#define FOGMODE_EXP2 2.\n#define FOGMODE_LINEAR 3.\n#define E 2.71828\n\nuniform vec4 vFogInfos;\nuniform vec3 vFogColor;\nvarying float fFogDistance;\n\nfloat CalcFogFactor()\n{\n float fogCoeff = 1.0;\n float fogStart = vFogInfos.y;\n float fogEnd = vFogInfos.z;\n float fogDensity = vFogInfos.w;\n\n if (FOGMODE_LINEAR == vFogInfos.x)\n {\n fogCoeff = (fogEnd - fFogDistance) / (fogEnd - fogStart);\n }\n else if (FOGMODE_EXP == vFogInfos.x)\n {\n fogCoeff = 1.0 / pow(E, fFogDistance * fogDensity);\n }\n else if (FOGMODE_EXP2 == vFogInfos.x)\n {\n fogCoeff = 1.0 / pow(E, fFogDistance * fFogDistance * fogDensity * fogDensity);\n }\n\n return min(1., max(0., fogCoeff));\n}\n#endif\n\n\nvoid main(void) {\n vec4 baseColor = texture2D(diffuseSampler, vUV);\n\n if (alphaTest) \n {\n if (baseColor.a < 0.95)\n discard;\n }\n\n baseColor *= vColor;\n\n#ifdef FOG\n float fog = CalcFogFactor();\n baseColor.rgb = fog * baseColor.rgb + (1.0 - fog) * vFogColor;\n#endif\n\n gl_FragColor = baseColor;\n}",
  11668. spritesVertexShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Attributes\nattribute vec3 position;\nattribute vec4 options;\nattribute vec4 cellInfo;\nattribute vec4 color;\n\n// Uniforms\nuniform vec2 textureInfos;\nuniform mat4 view;\nuniform mat4 projection;\n\n// Output\nvarying vec2 vUV;\nvarying vec4 vColor;\n\n#ifdef FOG\nvarying float fFogDistance;\n#endif\n\nvoid main(void) { \n vec3 viewPos = (view * vec4(position, 1.0)).xyz; \n vec3 cornerPos;\n \n float angle = options.x;\n float size = options.y;\n vec2 offset = options.zw;\n vec2 uvScale = textureInfos.xy;\n\n cornerPos = vec3(offset.x - 0.5, offset.y - 0.5, 0.) * size;\n\n // Rotate\n vec3 rotatedCorner;\n rotatedCorner.x = cornerPos.x * cos(angle) - cornerPos.y * sin(angle);\n rotatedCorner.y = cornerPos.x * sin(angle) + cornerPos.y * cos(angle);\n rotatedCorner.z = 0.;\n\n // Position\n viewPos += rotatedCorner;\n gl_Position = projection * vec4(viewPos, 1.0); \n\n // Color\n vColor = color;\n \n // Texture\n vec2 uvOffset = vec2(abs(offset.x - cellInfo.x), 1.0 - abs(offset.y - cellInfo.y));\n\n vUV = (uvOffset + cellInfo.zw) * uvScale;\n\n // Fog\n#ifdef FOG\n fFogDistance = viewPos.z;\n#endif\n}",
  11669. woodPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\nvarying vec2 vPosition;\nvarying vec2 vUV;\n\nuniform float ampScale;\nuniform vec3 woodColor;\n\nfloat rand(vec2 n) {\n return fract(cos(dot(n, vec2(12.9898, 4.1414))) * 43758.5453);\n}\n\nfloat noise(vec2 n) {\n const vec2 d = vec2(0.0, 1.0);\n vec2 b = floor(n), f = smoothstep(vec2(0.0), vec2(1.0), fract(n));\n return mix(mix(rand(b), rand(b + d.yx), f.x), mix(rand(b + d.xy), rand(b + d.yy), f.x), f.y);\n}\n\nfloat fbm(vec2 n) {\n float total = 0.0, amplitude = 1.0;\n for (int i = 0; i < 4; i++) {\n total += noise(n) * amplitude;\n n += n;\n amplitude *= 0.5;\n }\n return total;\n}\n\nvoid main(void) {\n float ratioy = mod(vUV.x * ampScale, 2.0 + fbm(vUV * 0.8));\n vec3 wood = woodColor * ratioy;\n gl_FragColor = vec4(wood, 1.0);\n}",
  11670. };
  11671. return Effect;
  11672. })();
  11673. BABYLON.Effect = Effect;
  11674. })(BABYLON || (BABYLON = {}));
  11675. var BABYLON;
  11676. (function (BABYLON) {
  11677. var Material = (function () {
  11678. function Material(name, scene, doNotAdd) {
  11679. this.name = name;
  11680. this.checkReadyOnEveryCall = true;
  11681. this.checkReadyOnlyOnce = false;
  11682. this.state = "";
  11683. this.alpha = 1.0;
  11684. this.backFaceCulling = true;
  11685. this._wasPreviouslyReady = false;
  11686. this._fillMode = Material.TriangleFillMode;
  11687. this.pointSize = 1.0;
  11688. this.id = name;
  11689. this._scene = scene;
  11690. if (!doNotAdd) {
  11691. scene.materials.push(this);
  11692. }
  11693. }
  11694. Object.defineProperty(Material, "TriangleFillMode", {
  11695. get: function () {
  11696. return Material._TriangleFillMode;
  11697. },
  11698. enumerable: true,
  11699. configurable: true
  11700. });
  11701. Object.defineProperty(Material, "WireFrameFillMode", {
  11702. get: function () {
  11703. return Material._WireFrameFillMode;
  11704. },
  11705. enumerable: true,
  11706. configurable: true
  11707. });
  11708. Object.defineProperty(Material, "PointFillMode", {
  11709. get: function () {
  11710. return Material._PointFillMode;
  11711. },
  11712. enumerable: true,
  11713. configurable: true
  11714. });
  11715. Object.defineProperty(Material.prototype, "wireframe", {
  11716. get: function () {
  11717. return this._fillMode === Material.WireFrameFillMode;
  11718. },
  11719. set: function (value) {
  11720. this._fillMode = (value ? Material.WireFrameFillMode : Material.TriangleFillMode);
  11721. },
  11722. enumerable: true,
  11723. configurable: true
  11724. });
  11725. Object.defineProperty(Material.prototype, "pointsCloud", {
  11726. get: function () {
  11727. return this._fillMode === Material.PointFillMode;
  11728. },
  11729. set: function (value) {
  11730. this._fillMode = (value ? Material.PointFillMode : Material.TriangleFillMode);
  11731. },
  11732. enumerable: true,
  11733. configurable: true
  11734. });
  11735. Object.defineProperty(Material.prototype, "fillMode", {
  11736. get: function () {
  11737. return this._fillMode;
  11738. },
  11739. set: function (value) {
  11740. this._fillMode = value;
  11741. },
  11742. enumerable: true,
  11743. configurable: true
  11744. });
  11745. Material.prototype.isReady = function (mesh, useInstances) {
  11746. return true;
  11747. };
  11748. Material.prototype.getEffect = function () {
  11749. return this._effect;
  11750. };
  11751. Material.prototype.getScene = function () {
  11752. return this._scene;
  11753. };
  11754. Material.prototype.needAlphaBlending = function () {
  11755. return (this.alpha < 1.0);
  11756. };
  11757. Material.prototype.needAlphaTesting = function () {
  11758. return false;
  11759. };
  11760. Material.prototype.getAlphaTestTexture = function () {
  11761. return null;
  11762. };
  11763. Material.prototype.trackCreation = function (onCompiled, onError) {
  11764. };
  11765. Material.prototype._preBind = function () {
  11766. var engine = this._scene.getEngine();
  11767. engine.enableEffect(this._effect);
  11768. engine.setState(this.backFaceCulling);
  11769. };
  11770. Material.prototype.bind = function (world, mesh) {
  11771. };
  11772. Material.prototype.bindOnlyWorldMatrix = function (world) {
  11773. };
  11774. Material.prototype.unbind = function () {
  11775. };
  11776. Material.prototype.dispose = function (forceDisposeEffect) {
  11777. var index = this._scene.materials.indexOf(this);
  11778. this._scene.materials.splice(index, 1);
  11779. if (forceDisposeEffect && this._effect) {
  11780. this._scene.getEngine()._releaseEffect(this._effect);
  11781. this._effect = null;
  11782. }
  11783. if (this.onDispose) {
  11784. this.onDispose();
  11785. }
  11786. };
  11787. Material._TriangleFillMode = 0;
  11788. Material._WireFrameFillMode = 1;
  11789. Material._PointFillMode = 2;
  11790. return Material;
  11791. })();
  11792. BABYLON.Material = Material;
  11793. })(BABYLON || (BABYLON = {}));
  11794. var __extends = this.__extends || function (d, b) {
  11795. for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p];
  11796. function __() { this.constructor = d; }
  11797. __.prototype = b.prototype;
  11798. d.prototype = new __();
  11799. };
  11800. var BABYLON;
  11801. (function (BABYLON) {
  11802. var maxSimultaneousLights = 4;
  11803. var FresnelParameters = (function () {
  11804. function FresnelParameters() {
  11805. this.isEnabled = true;
  11806. this.leftColor = BABYLON.Color3.White();
  11807. this.rightColor = BABYLON.Color3.Black();
  11808. this.bias = 0;
  11809. this.power = 1;
  11810. }
  11811. return FresnelParameters;
  11812. })();
  11813. BABYLON.FresnelParameters = FresnelParameters;
  11814. var StandardMaterial = (function (_super) {
  11815. __extends(StandardMaterial, _super);
  11816. function StandardMaterial(name, scene) {
  11817. var _this = this;
  11818. _super.call(this, name, scene);
  11819. this.ambientColor = new BABYLON.Color3(0, 0, 0);
  11820. this.diffuseColor = new BABYLON.Color3(1, 1, 1);
  11821. this.specularColor = new BABYLON.Color3(1, 1, 1);
  11822. this.specularPower = 64;
  11823. this.emissiveColor = new BABYLON.Color3(0, 0, 0);
  11824. this.useAlphaFromDiffuseTexture = false;
  11825. this.useSpecularOverAlpha = true;
  11826. this.fogEnabled = true;
  11827. this._cachedDefines = null;
  11828. this._renderTargets = new BABYLON.SmartArray(16);
  11829. this._worldViewProjectionMatrix = BABYLON.Matrix.Zero();
  11830. this._globalAmbientColor = new BABYLON.Color3(0, 0, 0);
  11831. this._scaledDiffuse = new BABYLON.Color3();
  11832. this._scaledSpecular = new BABYLON.Color3();
  11833. this.getRenderTargetTextures = function () {
  11834. _this._renderTargets.reset();
  11835. if (_this.reflectionTexture && _this.reflectionTexture.isRenderTarget) {
  11836. _this._renderTargets.push(_this.reflectionTexture);
  11837. }
  11838. return _this._renderTargets;
  11839. };
  11840. }
  11841. StandardMaterial.prototype.needAlphaBlending = function () {
  11842. return (this.alpha < 1.0) || (this.opacityTexture != null) || this._shouldUseAlphaFromDiffuseTexture() || this.opacityFresnelParameters && this.opacityFresnelParameters.isEnabled;
  11843. };
  11844. StandardMaterial.prototype.needAlphaTesting = function () {
  11845. return this.diffuseTexture != null && this.diffuseTexture.hasAlpha && !this.diffuseTexture.getAlphaFromRGB;
  11846. };
  11847. StandardMaterial.prototype._shouldUseAlphaFromDiffuseTexture = function () {
  11848. return this.diffuseTexture != null && this.diffuseTexture.hasAlpha && this.useAlphaFromDiffuseTexture;
  11849. };
  11850. StandardMaterial.prototype.getAlphaTestTexture = function () {
  11851. return this.diffuseTexture;
  11852. };
  11853. StandardMaterial.prototype.isReady = function (mesh, useInstances) {
  11854. if (this.checkReadyOnlyOnce) {
  11855. if (this._wasPreviouslyReady) {
  11856. return true;
  11857. }
  11858. }
  11859. var scene = this.getScene();
  11860. if (!this.checkReadyOnEveryCall) {
  11861. if (this._renderId === scene.getRenderId()) {
  11862. return true;
  11863. }
  11864. }
  11865. var engine = scene.getEngine();
  11866. var defines = [];
  11867. var fallbacks = new BABYLON.EffectFallbacks();
  11868. if (scene.texturesEnabled) {
  11869. if (this.diffuseTexture && BABYLON.StandardMaterial.DiffuseTextureEnabled) {
  11870. if (!this.diffuseTexture.isReady()) {
  11871. return false;
  11872. } else {
  11873. defines.push("#define DIFFUSE");
  11874. }
  11875. }
  11876. if (this.ambientTexture && BABYLON.StandardMaterial.AmbientTextureEnabled) {
  11877. if (!this.ambientTexture.isReady()) {
  11878. return false;
  11879. } else {
  11880. defines.push("#define AMBIENT");
  11881. }
  11882. }
  11883. if (this.opacityTexture && BABYLON.StandardMaterial.OpacityTextureEnabled) {
  11884. if (!this.opacityTexture.isReady()) {
  11885. return false;
  11886. } else {
  11887. defines.push("#define OPACITY");
  11888. if (this.opacityTexture.getAlphaFromRGB) {
  11889. defines.push("#define OPACITYRGB");
  11890. }
  11891. }
  11892. }
  11893. if (this.reflectionTexture && BABYLON.StandardMaterial.ReflectionTextureEnabled) {
  11894. if (!this.reflectionTexture.isReady()) {
  11895. return false;
  11896. } else {
  11897. defines.push("#define REFLECTION");
  11898. fallbacks.addFallback(0, "REFLECTION");
  11899. }
  11900. }
  11901. if (this.emissiveTexture && BABYLON.StandardMaterial.EmissiveTextureEnabled) {
  11902. if (!this.emissiveTexture.isReady()) {
  11903. return false;
  11904. } else {
  11905. defines.push("#define EMISSIVE");
  11906. }
  11907. }
  11908. if (this.specularTexture && BABYLON.StandardMaterial.SpecularTextureEnabled) {
  11909. if (!this.specularTexture.isReady()) {
  11910. return false;
  11911. } else {
  11912. defines.push("#define SPECULAR");
  11913. fallbacks.addFallback(0, "SPECULAR");
  11914. }
  11915. }
  11916. }
  11917. if (scene.getEngine().getCaps().standardDerivatives && this.bumpTexture && BABYLON.StandardMaterial.BumpTextureEnabled) {
  11918. if (!this.bumpTexture.isReady()) {
  11919. return false;
  11920. } else {
  11921. defines.push("#define BUMP");
  11922. fallbacks.addFallback(0, "BUMP");
  11923. }
  11924. }
  11925. if (this.useSpecularOverAlpha) {
  11926. defines.push("#define SPECULAROVERALPHA");
  11927. fallbacks.addFallback(0, "SPECULAROVERALPHA");
  11928. }
  11929. if (scene.clipPlane) {
  11930. defines.push("#define CLIPPLANE");
  11931. }
  11932. if (engine.getAlphaTesting()) {
  11933. defines.push("#define ALPHATEST");
  11934. }
  11935. if (this._shouldUseAlphaFromDiffuseTexture()) {
  11936. defines.push("#define ALPHAFROMDIFFUSE");
  11937. }
  11938. if (this.pointsCloud) {
  11939. defines.push("#define POINTSIZE");
  11940. }
  11941. if (mesh && mesh.applyFog && scene.fogMode !== BABYLON.Scene.FOGMODE_NONE && this.fogEnabled) {
  11942. defines.push("#define FOG");
  11943. fallbacks.addFallback(1, "FOG");
  11944. }
  11945. var shadowsActivated = false;
  11946. var lightIndex = 0;
  11947. if (scene.lightsEnabled) {
  11948. for (var index = 0; index < scene.lights.length; index++) {
  11949. var light = scene.lights[index];
  11950. if (!light.isEnabled()) {
  11951. continue;
  11952. }
  11953. if (light._excludedMeshesIds.length > 0) {
  11954. for (var excludedIndex = 0; excludedIndex < light._excludedMeshesIds.length; excludedIndex++) {
  11955. var excludedMesh = scene.getMeshByID(light._excludedMeshesIds[excludedIndex]);
  11956. if (excludedMesh) {
  11957. light.excludedMeshes.push(excludedMesh);
  11958. }
  11959. }
  11960. light._excludedMeshesIds = [];
  11961. }
  11962. if (light._includedOnlyMeshesIds.length > 0) {
  11963. for (var includedOnlyIndex = 0; includedOnlyIndex < light._includedOnlyMeshesIds.length; includedOnlyIndex++) {
  11964. var includedOnlyMesh = scene.getMeshByID(light._includedOnlyMeshesIds[includedOnlyIndex]);
  11965. if (includedOnlyMesh) {
  11966. light.includedOnlyMeshes.push(includedOnlyMesh);
  11967. }
  11968. }
  11969. light._includedOnlyMeshesIds = [];
  11970. }
  11971. if (!light.canAffectMesh(mesh)) {
  11972. continue;
  11973. }
  11974. defines.push("#define LIGHT" + lightIndex);
  11975. if (lightIndex > 0) {
  11976. fallbacks.addFallback(lightIndex, "LIGHT" + lightIndex);
  11977. }
  11978. var type;
  11979. if (light instanceof BABYLON.SpotLight) {
  11980. type = "#define SPOTLIGHT" + lightIndex;
  11981. } else if (light instanceof BABYLON.HemisphericLight) {
  11982. type = "#define HEMILIGHT" + lightIndex;
  11983. } else {
  11984. type = "#define POINTDIRLIGHT" + lightIndex;
  11985. }
  11986. defines.push(type);
  11987. if (lightIndex > 0) {
  11988. fallbacks.addFallback(lightIndex, type.replace("#define ", ""));
  11989. }
  11990. if (scene.shadowsEnabled) {
  11991. var shadowGenerator = light.getShadowGenerator();
  11992. if (mesh && mesh.receiveShadows && shadowGenerator) {
  11993. defines.push("#define SHADOW" + lightIndex);
  11994. fallbacks.addFallback(0, "SHADOW" + lightIndex);
  11995. if (!shadowsActivated) {
  11996. defines.push("#define SHADOWS");
  11997. shadowsActivated = true;
  11998. }
  11999. if (shadowGenerator.useVarianceShadowMap) {
  12000. defines.push("#define SHADOWVSM" + lightIndex);
  12001. if (lightIndex > 0) {
  12002. fallbacks.addFallback(0, "SHADOWVSM" + lightIndex);
  12003. }
  12004. }
  12005. if (shadowGenerator.usePoissonSampling) {
  12006. defines.push("#define SHADOWPCF" + lightIndex);
  12007. if (lightIndex > 0) {
  12008. fallbacks.addFallback(0, "SHADOWPCF" + lightIndex);
  12009. }
  12010. }
  12011. }
  12012. }
  12013. lightIndex++;
  12014. if (lightIndex == maxSimultaneousLights)
  12015. break;
  12016. }
  12017. }
  12018. if (this.diffuseFresnelParameters && this.diffuseFresnelParameters.isEnabled || this.opacityFresnelParameters && this.opacityFresnelParameters.isEnabled || this.emissiveFresnelParameters && this.emissiveFresnelParameters.isEnabled || this.reflectionFresnelParameters && this.reflectionFresnelParameters.isEnabled) {
  12019. var fresnelRank = 1;
  12020. if (this.diffuseFresnelParameters && this.diffuseFresnelParameters.isEnabled) {
  12021. defines.push("#define DIFFUSEFRESNEL");
  12022. fallbacks.addFallback(fresnelRank, "DIFFUSEFRESNEL");
  12023. fresnelRank++;
  12024. }
  12025. if (this.opacityFresnelParameters && this.opacityFresnelParameters.isEnabled) {
  12026. defines.push("#define OPACITYFRESNEL");
  12027. fallbacks.addFallback(fresnelRank, "OPACITYFRESNEL");
  12028. fresnelRank++;
  12029. }
  12030. if (this.reflectionFresnelParameters && this.reflectionFresnelParameters.isEnabled) {
  12031. defines.push("#define REFLECTIONFRESNEL");
  12032. fallbacks.addFallback(fresnelRank, "REFLECTIONFRESNEL");
  12033. fresnelRank++;
  12034. }
  12035. if (this.emissiveFresnelParameters && this.emissiveFresnelParameters.isEnabled) {
  12036. defines.push("#define EMISSIVEFRESNEL");
  12037. fallbacks.addFallback(fresnelRank, "EMISSIVEFRESNEL");
  12038. fresnelRank++;
  12039. }
  12040. defines.push("#define FRESNEL");
  12041. fallbacks.addFallback(fresnelRank - 1, "FRESNEL");
  12042. }
  12043. var attribs = [BABYLON.VertexBuffer.PositionKind, BABYLON.VertexBuffer.NormalKind];
  12044. if (mesh) {
  12045. if (mesh.isVerticesDataPresent(BABYLON.VertexBuffer.UVKind)) {
  12046. attribs.push(BABYLON.VertexBuffer.UVKind);
  12047. defines.push("#define UV1");
  12048. }
  12049. if (mesh.isVerticesDataPresent(BABYLON.VertexBuffer.UV2Kind)) {
  12050. attribs.push(BABYLON.VertexBuffer.UV2Kind);
  12051. defines.push("#define UV2");
  12052. }
  12053. if (mesh.useVertexColors && mesh.isVerticesDataPresent(BABYLON.VertexBuffer.ColorKind)) {
  12054. attribs.push(BABYLON.VertexBuffer.ColorKind);
  12055. defines.push("#define VERTEXCOLOR");
  12056. if (mesh.hasVertexAlpha) {
  12057. defines.push("#define VERTEXALPHA");
  12058. }
  12059. }
  12060. if (mesh.skeleton && mesh.isVerticesDataPresent(BABYLON.VertexBuffer.MatricesIndicesKind) && mesh.isVerticesDataPresent(BABYLON.VertexBuffer.MatricesWeightsKind)) {
  12061. attribs.push(BABYLON.VertexBuffer.MatricesIndicesKind);
  12062. attribs.push(BABYLON.VertexBuffer.MatricesWeightsKind);
  12063. defines.push("#define BONES");
  12064. defines.push("#define BonesPerMesh " + (mesh.skeleton.bones.length + 1));
  12065. defines.push("#define BONES4");
  12066. fallbacks.addFallback(0, "BONES4");
  12067. }
  12068. if (useInstances) {
  12069. defines.push("#define INSTANCES");
  12070. attribs.push("world0");
  12071. attribs.push("world1");
  12072. attribs.push("world2");
  12073. attribs.push("world3");
  12074. }
  12075. }
  12076. var join = defines.join("\n");
  12077. if (this._cachedDefines != join) {
  12078. this._cachedDefines = join;
  12079. var shaderName = "default";
  12080. if (!scene.getEngine().getCaps().standardDerivatives) {
  12081. shaderName = "legacydefault";
  12082. }
  12083. this._effect = scene.getEngine().createEffect(shaderName, attribs, [
  12084. "world", "view", "viewProjection", "vEyePosition", "vLightsType", "vAmbientColor", "vDiffuseColor", "vSpecularColor", "vEmissiveColor",
  12085. "vLightData0", "vLightDiffuse0", "vLightSpecular0", "vLightDirection0", "vLightGround0", "lightMatrix0",
  12086. "vLightData1", "vLightDiffuse1", "vLightSpecular1", "vLightDirection1", "vLightGround1", "lightMatrix1",
  12087. "vLightData2", "vLightDiffuse2", "vLightSpecular2", "vLightDirection2", "vLightGround2", "lightMatrix2",
  12088. "vLightData3", "vLightDiffuse3", "vLightSpecular3", "vLightDirection3", "vLightGround3", "lightMatrix3",
  12089. "vFogInfos", "vFogColor", "pointSize",
  12090. "vDiffuseInfos", "vAmbientInfos", "vOpacityInfos", "vReflectionInfos", "vEmissiveInfos", "vSpecularInfos", "vBumpInfos",
  12091. "mBones",
  12092. "vClipPlane", "diffuseMatrix", "ambientMatrix", "opacityMatrix", "reflectionMatrix", "emissiveMatrix", "specularMatrix", "bumpMatrix",
  12093. "darkness0", "darkness1", "darkness2", "darkness3",
  12094. "diffuseLeftColor", "diffuseRightColor", "opacityParts", "reflectionLeftColor", "reflectionRightColor", "emissiveLeftColor", "emissiveRightColor"
  12095. ], [
  12096. "diffuseSampler", "ambientSampler", "opacitySampler", "reflectionCubeSampler", "reflection2DSampler", "emissiveSampler", "specularSampler", "bumpSampler",
  12097. "shadowSampler0", "shadowSampler1", "shadowSampler2", "shadowSampler3"
  12098. ], join, fallbacks, this.onCompiled, this.onError);
  12099. }
  12100. if (!this._effect.isReady()) {
  12101. return false;
  12102. }
  12103. this._renderId = scene.getRenderId();
  12104. this._wasPreviouslyReady = true;
  12105. return true;
  12106. };
  12107. StandardMaterial.prototype.unbind = function () {
  12108. if (this.reflectionTexture && this.reflectionTexture.isRenderTarget) {
  12109. this._effect.setTexture("reflection2DSampler", null);
  12110. }
  12111. };
  12112. StandardMaterial.prototype.bindOnlyWorldMatrix = function (world) {
  12113. this._effect.setMatrix("world", world);
  12114. };
  12115. StandardMaterial.prototype.bind = function (world, mesh) {
  12116. var scene = this.getScene();
  12117. this.bindOnlyWorldMatrix(world);
  12118. this._effect.setMatrix("viewProjection", scene.getTransformMatrix());
  12119. if (mesh.skeleton && mesh.isVerticesDataPresent(BABYLON.VertexBuffer.MatricesIndicesKind) && mesh.isVerticesDataPresent(BABYLON.VertexBuffer.MatricesWeightsKind)) {
  12120. this._effect.setMatrices("mBones", mesh.skeleton.getTransformMatrices());
  12121. }
  12122. if (this.diffuseFresnelParameters && this.diffuseFresnelParameters.isEnabled) {
  12123. this._effect.setColor4("diffuseLeftColor", this.diffuseFresnelParameters.leftColor, this.diffuseFresnelParameters.power);
  12124. this._effect.setColor4("diffuseRightColor", this.diffuseFresnelParameters.rightColor, this.diffuseFresnelParameters.bias);
  12125. }
  12126. if (this.opacityFresnelParameters && this.opacityFresnelParameters.isEnabled) {
  12127. this._effect.setColor4("opacityParts", new BABYLON.Color3(this.opacityFresnelParameters.leftColor.toLuminance(), this.opacityFresnelParameters.rightColor.toLuminance(), this.opacityFresnelParameters.bias), this.opacityFresnelParameters.power);
  12128. }
  12129. if (this.reflectionFresnelParameters && this.reflectionFresnelParameters.isEnabled) {
  12130. this._effect.setColor4("reflectionLeftColor", this.reflectionFresnelParameters.leftColor, this.reflectionFresnelParameters.power);
  12131. this._effect.setColor4("reflectionRightColor", this.reflectionFresnelParameters.rightColor, this.reflectionFresnelParameters.bias);
  12132. }
  12133. if (this.emissiveFresnelParameters && this.emissiveFresnelParameters.isEnabled) {
  12134. this._effect.setColor4("emissiveLeftColor", this.emissiveFresnelParameters.leftColor, this.emissiveFresnelParameters.power);
  12135. this._effect.setColor4("emissiveRightColor", this.emissiveFresnelParameters.rightColor, this.emissiveFresnelParameters.bias);
  12136. }
  12137. if (this.diffuseTexture && BABYLON.StandardMaterial.DiffuseTextureEnabled) {
  12138. this._effect.setTexture("diffuseSampler", this.diffuseTexture);
  12139. this._effect.setFloat2("vDiffuseInfos", this.diffuseTexture.coordinatesIndex, this.diffuseTexture.level);
  12140. this._effect.setMatrix("diffuseMatrix", this.diffuseTexture.getTextureMatrix());
  12141. }
  12142. if (this.ambientTexture && BABYLON.StandardMaterial.AmbientTextureEnabled) {
  12143. this._effect.setTexture("ambientSampler", this.ambientTexture);
  12144. this._effect.setFloat2("vAmbientInfos", this.ambientTexture.coordinatesIndex, this.ambientTexture.level);
  12145. this._effect.setMatrix("ambientMatrix", this.ambientTexture.getTextureMatrix());
  12146. }
  12147. if (this.opacityTexture && BABYLON.StandardMaterial.OpacityTextureEnabled) {
  12148. this._effect.setTexture("opacitySampler", this.opacityTexture);
  12149. this._effect.setFloat2("vOpacityInfos", this.opacityTexture.coordinatesIndex, this.opacityTexture.level);
  12150. this._effect.setMatrix("opacityMatrix", this.opacityTexture.getTextureMatrix());
  12151. }
  12152. if (this.reflectionTexture && BABYLON.StandardMaterial.ReflectionTextureEnabled) {
  12153. if (this.reflectionTexture.isCube) {
  12154. this._effect.setTexture("reflectionCubeSampler", this.reflectionTexture);
  12155. } else {
  12156. this._effect.setTexture("reflection2DSampler", this.reflectionTexture);
  12157. }
  12158. this._effect.setMatrix("reflectionMatrix", this.reflectionTexture.getReflectionTextureMatrix());
  12159. this._effect.setFloat3("vReflectionInfos", this.reflectionTexture.coordinatesMode, this.reflectionTexture.level, this.reflectionTexture.isCube ? 1 : 0);
  12160. }
  12161. if (this.emissiveTexture && BABYLON.StandardMaterial.EmissiveTextureEnabled) {
  12162. this._effect.setTexture("emissiveSampler", this.emissiveTexture);
  12163. this._effect.setFloat2("vEmissiveInfos", this.emissiveTexture.coordinatesIndex, this.emissiveTexture.level);
  12164. this._effect.setMatrix("emissiveMatrix", this.emissiveTexture.getTextureMatrix());
  12165. }
  12166. if (this.specularTexture && BABYLON.StandardMaterial.SpecularTextureEnabled) {
  12167. this._effect.setTexture("specularSampler", this.specularTexture);
  12168. this._effect.setFloat2("vSpecularInfos", this.specularTexture.coordinatesIndex, this.specularTexture.level);
  12169. this._effect.setMatrix("specularMatrix", this.specularTexture.getTextureMatrix());
  12170. }
  12171. if (this.bumpTexture && scene.getEngine().getCaps().standardDerivatives && BABYLON.StandardMaterial.BumpTextureEnabled) {
  12172. this._effect.setTexture("bumpSampler", this.bumpTexture);
  12173. this._effect.setFloat2("vBumpInfos", this.bumpTexture.coordinatesIndex, 1.0 / this.bumpTexture.level);
  12174. this._effect.setMatrix("bumpMatrix", this.bumpTexture.getTextureMatrix());
  12175. }
  12176. scene.ambientColor.multiplyToRef(this.ambientColor, this._globalAmbientColor);
  12177. this._scaledDiffuse.r = this.diffuseColor.r * BABYLON.Tools.Clamp(1.0 - this.emissiveColor.r);
  12178. this._scaledDiffuse.g = this.diffuseColor.g * BABYLON.Tools.Clamp(1.0 - this.emissiveColor.g);
  12179. this._scaledDiffuse.b = this.diffuseColor.b * BABYLON.Tools.Clamp(1.0 - this.emissiveColor.b);
  12180. this._scaledSpecular.r = this.specularColor.r * BABYLON.Tools.Clamp(1.0 - this.emissiveColor.r);
  12181. this._scaledSpecular.g = this.specularColor.g * BABYLON.Tools.Clamp(1.0 - this.emissiveColor.g);
  12182. this._scaledSpecular.b = this.specularColor.b * BABYLON.Tools.Clamp(1.0 - this.emissiveColor.b);
  12183. this._effect.setVector3("vEyePosition", scene.activeCamera.position);
  12184. this._effect.setColor3("vAmbientColor", this._globalAmbientColor);
  12185. this._effect.setColor4("vDiffuseColor", this._scaledDiffuse, this.alpha * mesh.visibility);
  12186. this._effect.setColor4("vSpecularColor", this._scaledSpecular, this.specularPower);
  12187. this._effect.setColor3("vEmissiveColor", this.emissiveColor);
  12188. if (scene.lightsEnabled) {
  12189. var lightIndex = 0;
  12190. for (var index = 0; index < scene.lights.length; index++) {
  12191. var light = scene.lights[index];
  12192. if (!light.isEnabled()) {
  12193. continue;
  12194. }
  12195. if (!light.canAffectMesh(mesh)) {
  12196. continue;
  12197. }
  12198. if (light instanceof BABYLON.PointLight) {
  12199. light.transferToEffect(this._effect, "vLightData" + lightIndex);
  12200. } else if (light instanceof BABYLON.DirectionalLight) {
  12201. light.transferToEffect(this._effect, "vLightData" + lightIndex);
  12202. } else if (light instanceof BABYLON.SpotLight) {
  12203. light.transferToEffect(this._effect, "vLightData" + lightIndex, "vLightDirection" + lightIndex);
  12204. } else if (light instanceof BABYLON.HemisphericLight) {
  12205. light.transferToEffect(this._effect, "vLightData" + lightIndex, "vLightGround" + lightIndex);
  12206. }
  12207. light.diffuse.scaleToRef(light.intensity, this._scaledDiffuse);
  12208. light.specular.scaleToRef(light.intensity, this._scaledSpecular);
  12209. this._effect.setColor4("vLightDiffuse" + lightIndex, this._scaledDiffuse, light.range);
  12210. this._effect.setColor3("vLightSpecular" + lightIndex, this._scaledSpecular);
  12211. if (scene.shadowsEnabled) {
  12212. var shadowGenerator = light.getShadowGenerator();
  12213. if (mesh.receiveShadows && shadowGenerator) {
  12214. this._effect.setMatrix("lightMatrix" + lightIndex, shadowGenerator.getTransformMatrix());
  12215. this._effect.setTexture("shadowSampler" + lightIndex, shadowGenerator.getShadowMap());
  12216. this._effect.setFloat("darkness" + lightIndex, shadowGenerator.getDarkness());
  12217. }
  12218. }
  12219. lightIndex++;
  12220. if (lightIndex == maxSimultaneousLights)
  12221. break;
  12222. }
  12223. }
  12224. if (scene.clipPlane) {
  12225. var clipPlane = scene.clipPlane;
  12226. this._effect.setFloat4("vClipPlane", clipPlane.normal.x, clipPlane.normal.y, clipPlane.normal.z, clipPlane.d);
  12227. }
  12228. if (mesh.applyFog && scene.fogMode !== BABYLON.Scene.FOGMODE_NONE || this.reflectionTexture) {
  12229. this._effect.setMatrix("view", scene.getViewMatrix());
  12230. }
  12231. if (mesh.applyFog && scene.fogMode !== BABYLON.Scene.FOGMODE_NONE) {
  12232. this._effect.setFloat4("vFogInfos", scene.fogMode, scene.fogStart, scene.fogEnd, scene.fogDensity);
  12233. this._effect.setColor3("vFogColor", scene.fogColor);
  12234. }
  12235. if (this.pointsCloud) {
  12236. this._effect.setFloat("pointSize", this.pointSize);
  12237. }
  12238. };
  12239. StandardMaterial.prototype.getAnimatables = function () {
  12240. var results = [];
  12241. if (this.diffuseTexture && this.diffuseTexture.animations && this.diffuseTexture.animations.length > 0) {
  12242. results.push(this.diffuseTexture);
  12243. }
  12244. if (this.ambientTexture && this.ambientTexture.animations && this.ambientTexture.animations.length > 0) {
  12245. results.push(this.ambientTexture);
  12246. }
  12247. if (this.opacityTexture && this.opacityTexture.animations && this.opacityTexture.animations.length > 0) {
  12248. results.push(this.opacityTexture);
  12249. }
  12250. if (this.reflectionTexture && this.reflectionTexture.animations && this.reflectionTexture.animations.length > 0) {
  12251. results.push(this.reflectionTexture);
  12252. }
  12253. if (this.emissiveTexture && this.emissiveTexture.animations && this.emissiveTexture.animations.length > 0) {
  12254. results.push(this.emissiveTexture);
  12255. }
  12256. if (this.specularTexture && this.specularTexture.animations && this.specularTexture.animations.length > 0) {
  12257. results.push(this.specularTexture);
  12258. }
  12259. if (this.bumpTexture && this.bumpTexture.animations && this.bumpTexture.animations.length > 0) {
  12260. results.push(this.bumpTexture);
  12261. }
  12262. return results;
  12263. };
  12264. StandardMaterial.prototype.dispose = function (forceDisposeEffect) {
  12265. if (this.diffuseTexture) {
  12266. this.diffuseTexture.dispose();
  12267. }
  12268. if (this.ambientTexture) {
  12269. this.ambientTexture.dispose();
  12270. }
  12271. if (this.opacityTexture) {
  12272. this.opacityTexture.dispose();
  12273. }
  12274. if (this.reflectionTexture) {
  12275. this.reflectionTexture.dispose();
  12276. }
  12277. if (this.emissiveTexture) {
  12278. this.emissiveTexture.dispose();
  12279. }
  12280. if (this.specularTexture) {
  12281. this.specularTexture.dispose();
  12282. }
  12283. if (this.bumpTexture) {
  12284. this.bumpTexture.dispose();
  12285. }
  12286. _super.prototype.dispose.call(this, forceDisposeEffect);
  12287. };
  12288. StandardMaterial.prototype.clone = function (name) {
  12289. var newStandardMaterial = new BABYLON.StandardMaterial(name, this.getScene());
  12290. newStandardMaterial.checkReadyOnEveryCall = this.checkReadyOnEveryCall;
  12291. newStandardMaterial.alpha = this.alpha;
  12292. newStandardMaterial.fillMode = this.fillMode;
  12293. newStandardMaterial.backFaceCulling = this.backFaceCulling;
  12294. if (this.diffuseTexture && this.diffuseTexture.clone) {
  12295. newStandardMaterial.diffuseTexture = this.diffuseTexture.clone();
  12296. }
  12297. if (this.ambientTexture && this.ambientTexture.clone) {
  12298. newStandardMaterial.ambientTexture = this.ambientTexture.clone();
  12299. }
  12300. if (this.opacityTexture && this.opacityTexture.clone) {
  12301. newStandardMaterial.opacityTexture = this.opacityTexture.clone();
  12302. }
  12303. if (this.reflectionTexture && this.reflectionTexture.clone) {
  12304. newStandardMaterial.reflectionTexture = this.reflectionTexture.clone();
  12305. }
  12306. if (this.emissiveTexture && this.emissiveTexture.clone) {
  12307. newStandardMaterial.emissiveTexture = this.emissiveTexture.clone();
  12308. }
  12309. if (this.specularTexture && this.specularTexture.clone) {
  12310. newStandardMaterial.specularTexture = this.specularTexture.clone();
  12311. }
  12312. if (this.bumpTexture && this.bumpTexture.clone) {
  12313. newStandardMaterial.bumpTexture = this.bumpTexture.clone();
  12314. }
  12315. newStandardMaterial.ambientColor = this.ambientColor.clone();
  12316. newStandardMaterial.diffuseColor = this.diffuseColor.clone();
  12317. newStandardMaterial.specularColor = this.specularColor.clone();
  12318. newStandardMaterial.specularPower = this.specularPower;
  12319. newStandardMaterial.emissiveColor = this.emissiveColor.clone();
  12320. return newStandardMaterial;
  12321. };
  12322. StandardMaterial.DiffuseTextureEnabled = true;
  12323. StandardMaterial.AmbientTextureEnabled = true;
  12324. StandardMaterial.OpacityTextureEnabled = true;
  12325. StandardMaterial.ReflectionTextureEnabled = true;
  12326. StandardMaterial.EmissiveTextureEnabled = true;
  12327. StandardMaterial.SpecularTextureEnabled = true;
  12328. StandardMaterial.BumpTextureEnabled = true;
  12329. return StandardMaterial;
  12330. })(BABYLON.Material);
  12331. BABYLON.StandardMaterial = StandardMaterial;
  12332. })(BABYLON || (BABYLON = {}));
  12333. var __extends = this.__extends || function (d, b) {
  12334. for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p];
  12335. function __() { this.constructor = d; }
  12336. __.prototype = b.prototype;
  12337. d.prototype = new __();
  12338. };
  12339. var BABYLON;
  12340. (function (BABYLON) {
  12341. var MultiMaterial = (function (_super) {
  12342. __extends(MultiMaterial, _super);
  12343. function MultiMaterial(name, scene) {
  12344. _super.call(this, name, scene, true);
  12345. this.subMaterials = new Array();
  12346. scene.multiMaterials.push(this);
  12347. }
  12348. MultiMaterial.prototype.getSubMaterial = function (index) {
  12349. if (index < 0 || index >= this.subMaterials.length) {
  12350. return this.getScene().defaultMaterial;
  12351. }
  12352. return this.subMaterials[index];
  12353. };
  12354. MultiMaterial.prototype.isReady = function (mesh) {
  12355. for (var index = 0; index < this.subMaterials.length; index++) {
  12356. var subMaterial = this.subMaterials[index];
  12357. if (subMaterial) {
  12358. if (!this.subMaterials[index].isReady(mesh)) {
  12359. return false;
  12360. }
  12361. }
  12362. }
  12363. return true;
  12364. };
  12365. return MultiMaterial;
  12366. })(BABYLON.Material);
  12367. BABYLON.MultiMaterial = MultiMaterial;
  12368. })(BABYLON || (BABYLON = {}));
  12369. var BABYLON;
  12370. (function (BABYLON) {
  12371. var Database = (function () {
  12372. function Database(urlToScene, callbackManifestChecked) {
  12373. this.idbFactory = (window.indexedDB || window.mozIndexedDB || window.webkitIndexedDB || window.msIndexedDB);
  12374. this.callbackManifestChecked = callbackManifestChecked;
  12375. this.currentSceneUrl = BABYLON.Database.ReturnFullUrlLocation(urlToScene);
  12376. this.db = null;
  12377. this.enableSceneOffline = false;
  12378. this.enableTexturesOffline = false;
  12379. this.manifestVersionFound = 0;
  12380. this.mustUpdateRessources = false;
  12381. this.hasReachedQuota = false;
  12382. this.checkManifestFile();
  12383. }
  12384. Database.prototype.checkManifestFile = function () {
  12385. var _this = this;
  12386. function noManifestFile() {
  12387. BABYLON.Tools.Log("Valid manifest file not found. Scene & textures will be loaded directly from the web server.");
  12388. that.enableSceneOffline = false;
  12389. that.enableTexturesOffline = false;
  12390. that.callbackManifestChecked(false);
  12391. }
  12392. var that = this;
  12393. var manifestURL = this.currentSceneUrl + ".manifest";
  12394. var xhr = new XMLHttpRequest();
  12395. var manifestURLTimeStamped = manifestURL + (manifestURL.match(/\?/) == null ? "?" : "&") + (new Date()).getTime();
  12396. xhr.open("GET", manifestURLTimeStamped, true);
  12397. xhr.addEventListener("load", function () {
  12398. if (xhr.status === 200 || BABYLON.Tools.ValidateXHRData(xhr, 1)) {
  12399. try {
  12400. var manifestFile = JSON.parse(xhr.response);
  12401. _this.enableSceneOffline = manifestFile.enableSceneOffline;
  12402. _this.enableTexturesOffline = manifestFile.enableTexturesOffline;
  12403. if (manifestFile.version && !isNaN(parseInt(manifestFile.version))) {
  12404. _this.manifestVersionFound = manifestFile.version;
  12405. }
  12406. if (_this.callbackManifestChecked) {
  12407. _this.callbackManifestChecked(true);
  12408. }
  12409. } catch (ex) {
  12410. noManifestFile();
  12411. }
  12412. } else {
  12413. noManifestFile();
  12414. }
  12415. }, false);
  12416. xhr.addEventListener("error", function (event) {
  12417. noManifestFile();
  12418. }, false);
  12419. try {
  12420. xhr.send();
  12421. } catch (ex) {
  12422. BABYLON.Tools.Error("Error on XHR send request.");
  12423. that.callbackManifestChecked(false);
  12424. }
  12425. };
  12426. Database.prototype.openAsync = function (successCallback, errorCallback) {
  12427. var _this = this;
  12428. function handleError() {
  12429. that.isSupported = false;
  12430. if (errorCallback)
  12431. errorCallback();
  12432. }
  12433. var that = this;
  12434. if (!this.idbFactory || !(this.enableSceneOffline || this.enableTexturesOffline)) {
  12435. this.isSupported = false;
  12436. if (errorCallback)
  12437. errorCallback();
  12438. } else {
  12439. if (!this.db) {
  12440. this.hasReachedQuota = false;
  12441. this.isSupported = true;
  12442. var request = this.idbFactory.open("babylonjs", 1);
  12443. request.onerror = function (event) {
  12444. handleError();
  12445. };
  12446. request.onblocked = function (event) {
  12447. BABYLON.Tools.Error("IDB request blocked. Please reload the page.");
  12448. handleError();
  12449. };
  12450. request.onsuccess = function (event) {
  12451. _this.db = request.result;
  12452. successCallback();
  12453. };
  12454. request.onupgradeneeded = function (event) {
  12455. _this.db = (event.target).result;
  12456. try {
  12457. var scenesStore = _this.db.createObjectStore("scenes", { keyPath: "sceneUrl" });
  12458. var versionsStore = _this.db.createObjectStore("versions", { keyPath: "sceneUrl" });
  12459. var texturesStore = _this.db.createObjectStore("textures", { keyPath: "textureUrl" });
  12460. } catch (ex) {
  12461. BABYLON.Tools.Error("Error while creating object stores. Exception: " + ex.message);
  12462. handleError();
  12463. }
  12464. };
  12465. } else {
  12466. if (successCallback)
  12467. successCallback();
  12468. }
  12469. }
  12470. };
  12471. Database.prototype.loadImageFromDB = function (url, image) {
  12472. var _this = this;
  12473. var completeURL = BABYLON.Database.ReturnFullUrlLocation(url);
  12474. var saveAndLoadImage = function () {
  12475. if (!_this.hasReachedQuota && _this.db !== null) {
  12476. _this._saveImageIntoDBAsync(completeURL, image);
  12477. } else {
  12478. image.src = url;
  12479. }
  12480. };
  12481. if (!this.mustUpdateRessources) {
  12482. this._loadImageFromDBAsync(completeURL, image, saveAndLoadImage);
  12483. } else {
  12484. saveAndLoadImage();
  12485. }
  12486. };
  12487. Database.prototype._loadImageFromDBAsync = function (url, image, notInDBCallback) {
  12488. if (this.isSupported && this.db !== null) {
  12489. var texture;
  12490. var transaction = this.db.transaction(["textures"]);
  12491. transaction.onabort = function (event) {
  12492. image.src = url;
  12493. };
  12494. transaction.oncomplete = function (event) {
  12495. var blobTextureURL;
  12496. if (texture) {
  12497. var URL = window.URL || window.webkitURL;
  12498. blobTextureURL = URL.createObjectURL(texture.data, { oneTimeOnly: true });
  12499. image.onerror = function () {
  12500. BABYLON.Tools.Error("Error loading image from blob URL: " + blobTextureURL + " switching back to web url: " + url);
  12501. image.src = url;
  12502. };
  12503. image.src = blobTextureURL;
  12504. } else {
  12505. notInDBCallback();
  12506. }
  12507. };
  12508. var getRequest = transaction.objectStore("textures").get(url);
  12509. getRequest.onsuccess = function (event) {
  12510. texture = (event.target).result;
  12511. };
  12512. getRequest.onerror = function (event) {
  12513. BABYLON.Tools.Error("Error loading texture " + url + " from DB.");
  12514. image.src = url;
  12515. };
  12516. } else {
  12517. BABYLON.Tools.Error("Error: IndexedDB not supported by your browser or BabylonJS Database is not open.");
  12518. image.src = url;
  12519. }
  12520. };
  12521. Database.prototype._saveImageIntoDBAsync = function (url, image) {
  12522. var _this = this;
  12523. if (this.isSupported) {
  12524. var generateBlobUrl = function () {
  12525. var blobTextureURL;
  12526. if (blob) {
  12527. var URL = window.URL || window.webkitURL;
  12528. try {
  12529. blobTextureURL = URL.createObjectURL(blob, { oneTimeOnly: true });
  12530. } catch (ex) {
  12531. blobTextureURL = URL.createObjectURL(blob);
  12532. }
  12533. }
  12534. image.src = blobTextureURL;
  12535. };
  12536. if (BABYLON.Database.isUASupportingBlobStorage) {
  12537. var xhr = new XMLHttpRequest(), blob;
  12538. xhr.open("GET", url, true);
  12539. xhr.responseType = "blob";
  12540. xhr.addEventListener("load", function () {
  12541. if (xhr.status === 200) {
  12542. blob = xhr.response;
  12543. var transaction = _this.db.transaction(["textures"], "readwrite");
  12544. transaction.onabort = function (event) {
  12545. try {
  12546. if (event.srcElement.error.name === "QuotaExceededError") {
  12547. this.hasReachedQuota = true;
  12548. }
  12549. } catch (ex) {
  12550. }
  12551. generateBlobUrl();
  12552. };
  12553. transaction.oncomplete = function (event) {
  12554. generateBlobUrl();
  12555. };
  12556. var newTexture = { textureUrl: url, data: blob };
  12557. try {
  12558. var addRequest = transaction.objectStore("textures").put(newTexture);
  12559. addRequest.onsuccess = function (event) {
  12560. };
  12561. addRequest.onerror = function (event) {
  12562. generateBlobUrl();
  12563. };
  12564. } catch (ex) {
  12565. if (ex.code === 25) {
  12566. BABYLON.Database.isUASupportingBlobStorage = false;
  12567. }
  12568. image.src = url;
  12569. }
  12570. } else {
  12571. image.src = url;
  12572. }
  12573. }, false);
  12574. xhr.addEventListener("error", function (event) {
  12575. BABYLON.Tools.Error("Error in XHR request in BABYLON.Database.");
  12576. image.src = url;
  12577. }, false);
  12578. xhr.send();
  12579. } else {
  12580. image.src = url;
  12581. }
  12582. } else {
  12583. BABYLON.Tools.Error("Error: IndexedDB not supported by your browser or BabylonJS Database is not open.");
  12584. image.src = url;
  12585. }
  12586. };
  12587. Database.prototype._checkVersionFromDB = function (url, versionLoaded) {
  12588. var _this = this;
  12589. var updateVersion = function (event) {
  12590. _this._saveVersionIntoDBAsync(url, versionLoaded);
  12591. };
  12592. this._loadVersionFromDBAsync(url, versionLoaded, updateVersion);
  12593. };
  12594. Database.prototype._loadVersionFromDBAsync = function (url, callback, updateInDBCallback) {
  12595. var _this = this;
  12596. if (this.isSupported) {
  12597. var version;
  12598. try {
  12599. var transaction = this.db.transaction(["versions"]);
  12600. transaction.oncomplete = function (event) {
  12601. if (version) {
  12602. if (_this.manifestVersionFound > version.data) {
  12603. _this.mustUpdateRessources = true;
  12604. updateInDBCallback();
  12605. } else {
  12606. callback(version.data);
  12607. }
  12608. } else {
  12609. _this.mustUpdateRessources = true;
  12610. updateInDBCallback();
  12611. }
  12612. };
  12613. transaction.onabort = function (event) {
  12614. callback(-1);
  12615. };
  12616. var getRequest = transaction.objectStore("versions").get(url);
  12617. getRequest.onsuccess = function (event) {
  12618. version = (event.target).result;
  12619. };
  12620. getRequest.onerror = function (event) {
  12621. BABYLON.Tools.Error("Error loading version for scene " + url + " from DB.");
  12622. callback(-1);
  12623. };
  12624. } catch (ex) {
  12625. BABYLON.Tools.Error("Error while accessing 'versions' object store (READ OP). Exception: " + ex.message);
  12626. callback(-1);
  12627. }
  12628. } else {
  12629. BABYLON.Tools.Error("Error: IndexedDB not supported by your browser or BabylonJS Database is not open.");
  12630. callback(-1);
  12631. }
  12632. };
  12633. Database.prototype._saveVersionIntoDBAsync = function (url, callback) {
  12634. var _this = this;
  12635. if (this.isSupported && !this.hasReachedQuota) {
  12636. try {
  12637. var transaction = this.db.transaction(["versions"], "readwrite");
  12638. transaction.onabort = function (event) {
  12639. try {
  12640. if (event.srcElement.error.name === "QuotaExceededError") {
  12641. _this.hasReachedQuota = true;
  12642. }
  12643. } catch (ex) {
  12644. }
  12645. callback(-1);
  12646. };
  12647. transaction.oncomplete = function (event) {
  12648. callback(_this.manifestVersionFound);
  12649. };
  12650. var newVersion = { sceneUrl: url, data: this.manifestVersionFound };
  12651. var addRequest = transaction.objectStore("versions").put(newVersion);
  12652. addRequest.onsuccess = function (event) {
  12653. };
  12654. addRequest.onerror = function (event) {
  12655. BABYLON.Tools.Error("Error in DB add version request in BABYLON.Database.");
  12656. };
  12657. } catch (ex) {
  12658. BABYLON.Tools.Error("Error while accessing 'versions' object store (WRITE OP). Exception: " + ex.message);
  12659. callback(-1);
  12660. }
  12661. } else {
  12662. callback(-1);
  12663. }
  12664. };
  12665. Database.prototype.loadFileFromDB = function (url, sceneLoaded, progressCallBack, errorCallback, useArrayBuffer) {
  12666. var _this = this;
  12667. var completeUrl = BABYLON.Database.ReturnFullUrlLocation(url);
  12668. var saveAndLoadFile = function (event) {
  12669. _this._saveFileIntoDBAsync(completeUrl, sceneLoaded, progressCallBack);
  12670. };
  12671. this._checkVersionFromDB(completeUrl, function (version) {
  12672. if (version !== -1) {
  12673. if (!_this.mustUpdateRessources) {
  12674. _this._loadFileFromDBAsync(completeUrl, sceneLoaded, saveAndLoadFile, useArrayBuffer);
  12675. } else {
  12676. _this._saveFileIntoDBAsync(completeUrl, sceneLoaded, progressCallBack, useArrayBuffer);
  12677. }
  12678. } else {
  12679. errorCallback();
  12680. }
  12681. });
  12682. };
  12683. Database.prototype._loadFileFromDBAsync = function (url, callback, notInDBCallback, useArrayBuffer) {
  12684. if (this.isSupported) {
  12685. var targetStore;
  12686. if (url.indexOf(".babylon") !== -1) {
  12687. targetStore = "scenes";
  12688. } else {
  12689. targetStore = "textures";
  12690. }
  12691. var file;
  12692. var transaction = this.db.transaction([targetStore]);
  12693. transaction.oncomplete = function (event) {
  12694. if (file) {
  12695. callback(file.data);
  12696. } else {
  12697. notInDBCallback();
  12698. }
  12699. };
  12700. transaction.onabort = function (event) {
  12701. notInDBCallback();
  12702. };
  12703. var getRequest = transaction.objectStore(targetStore).get(url);
  12704. getRequest.onsuccess = function (event) {
  12705. file = (event.target).result;
  12706. };
  12707. getRequest.onerror = function (event) {
  12708. BABYLON.Tools.Error("Error loading file " + url + " from DB.");
  12709. notInDBCallback();
  12710. };
  12711. } else {
  12712. BABYLON.Tools.Error("Error: IndexedDB not supported by your browser or BabylonJS Database is not open.");
  12713. callback();
  12714. }
  12715. };
  12716. Database.prototype._saveFileIntoDBAsync = function (url, callback, progressCallback, useArrayBuffer) {
  12717. var _this = this;
  12718. if (this.isSupported) {
  12719. var targetStore;
  12720. if (url.indexOf(".babylon") !== -1) {
  12721. targetStore = "scenes";
  12722. } else {
  12723. targetStore = "textures";
  12724. }
  12725. var xhr = new XMLHttpRequest(), fileData;
  12726. xhr.open("GET", url, true);
  12727. if (useArrayBuffer) {
  12728. xhr.responseType = "arraybuffer";
  12729. }
  12730. xhr.onprogress = progressCallback;
  12731. xhr.addEventListener("load", function () {
  12732. if (xhr.status === 200 || BABYLON.Tools.ValidateXHRData(xhr, !useArrayBuffer ? 1 : 6)) {
  12733. fileData = !useArrayBuffer ? xhr.responseText : xhr.response;
  12734. if (!_this.hasReachedQuota) {
  12735. var transaction = _this.db.transaction([targetStore], "readwrite");
  12736. transaction.onabort = function (event) {
  12737. try {
  12738. if (event.srcElement.error.name === "QuotaExceededError") {
  12739. this.hasReachedQuota = true;
  12740. }
  12741. } catch (ex) {
  12742. }
  12743. callback(fileData);
  12744. };
  12745. transaction.oncomplete = function (event) {
  12746. callback(fileData);
  12747. };
  12748. var newFile;
  12749. if (targetStore === "scenes") {
  12750. newFile = { sceneUrl: url, data: fileData, version: _this.manifestVersionFound };
  12751. } else {
  12752. newFile = { textureUrl: url, data: fileData };
  12753. }
  12754. try {
  12755. var addRequest = transaction.objectStore(targetStore).put(newFile);
  12756. addRequest.onsuccess = function (event) {
  12757. };
  12758. addRequest.onerror = function (event) {
  12759. BABYLON.Tools.Error("Error in DB add file request in BABYLON.Database.");
  12760. };
  12761. } catch (ex) {
  12762. callback(fileData);
  12763. }
  12764. } else {
  12765. callback(fileData);
  12766. }
  12767. } else {
  12768. callback();
  12769. }
  12770. }, false);
  12771. xhr.addEventListener("error", function (event) {
  12772. BABYLON.Tools.Error("error on XHR request.");
  12773. callback();
  12774. }, false);
  12775. xhr.send();
  12776. } else {
  12777. BABYLON.Tools.Error("Error: IndexedDB not supported by your browser or BabylonJS Database is not open.");
  12778. callback();
  12779. }
  12780. };
  12781. Database.isUASupportingBlobStorage = true;
  12782. Database.parseURL = function (url) {
  12783. var a = document.createElement('a');
  12784. a.href = url;
  12785. var urlWithoutHash = url.substring(0, url.lastIndexOf("#"));
  12786. var fileName = url.substring(urlWithoutHash.lastIndexOf("/") + 1, url.length);
  12787. var absLocation = url.substring(0, url.indexOf(fileName, 0));
  12788. return absLocation;
  12789. };
  12790. Database.ReturnFullUrlLocation = function (url) {
  12791. if (url.indexOf("http:/") === -1) {
  12792. return (BABYLON.Database.parseURL(window.location.href) + url);
  12793. } else {
  12794. return url;
  12795. }
  12796. };
  12797. return Database;
  12798. })();
  12799. BABYLON.Database = Database;
  12800. })(BABYLON || (BABYLON = {}));
  12801. var BABYLON;
  12802. (function (BABYLON) {
  12803. var SpriteManager = (function () {
  12804. function SpriteManager(name, imgUrl, capacity, cellSize, scene, epsilon) {
  12805. this.name = name;
  12806. this.cellSize = cellSize;
  12807. this.sprites = new Array();
  12808. this.renderingGroupId = 0;
  12809. this.fogEnabled = true;
  12810. this._vertexDeclaration = [3, 4, 4, 4];
  12811. this._vertexStrideSize = 15 * 4;
  12812. this._capacity = capacity;
  12813. this._spriteTexture = new BABYLON.Texture(imgUrl, scene, true, false);
  12814. this._spriteTexture.wrapU = BABYLON.Texture.CLAMP_ADDRESSMODE;
  12815. this._spriteTexture.wrapV = BABYLON.Texture.CLAMP_ADDRESSMODE;
  12816. this._epsilon = epsilon === undefined ? 0.01 : epsilon;
  12817. this._scene = scene;
  12818. this._scene.spriteManagers.push(this);
  12819. this._vertexDeclaration = [3, 4, 4, 4];
  12820. this._vertexStrideSize = 15 * 4;
  12821. this._vertexBuffer = scene.getEngine().createDynamicVertexBuffer(capacity * this._vertexStrideSize * 4);
  12822. var indices = [];
  12823. var index = 0;
  12824. for (var count = 0; count < capacity; count++) {
  12825. indices.push(index);
  12826. indices.push(index + 1);
  12827. indices.push(index + 2);
  12828. indices.push(index);
  12829. indices.push(index + 2);
  12830. indices.push(index + 3);
  12831. index += 4;
  12832. }
  12833. this._indexBuffer = scene.getEngine().createIndexBuffer(indices);
  12834. this._vertices = new Float32Array(capacity * this._vertexStrideSize);
  12835. this._effectBase = this._scene.getEngine().createEffect("sprites", ["position", "options", "cellInfo", "color"], ["view", "projection", "textureInfos", "alphaTest"], ["diffuseSampler"], "");
  12836. this._effectFog = this._scene.getEngine().createEffect("sprites", ["position", "options", "cellInfo", "color"], ["view", "projection", "textureInfos", "alphaTest", "vFogInfos", "vFogColor"], ["diffuseSampler"], "#define FOG");
  12837. }
  12838. SpriteManager.prototype._appendSpriteVertex = function (index, sprite, offsetX, offsetY, rowSize) {
  12839. var arrayOffset = index * 15;
  12840. if (offsetX == 0)
  12841. offsetX = this._epsilon;
  12842. else if (offsetX == 1)
  12843. offsetX = 1 - this._epsilon;
  12844. if (offsetY == 0)
  12845. offsetY = this._epsilon;
  12846. else if (offsetY == 1)
  12847. offsetY = 1 - this._epsilon;
  12848. this._vertices[arrayOffset] = sprite.position.x;
  12849. this._vertices[arrayOffset + 1] = sprite.position.y;
  12850. this._vertices[arrayOffset + 2] = sprite.position.z;
  12851. this._vertices[arrayOffset + 3] = sprite.angle;
  12852. this._vertices[arrayOffset + 4] = sprite.size;
  12853. this._vertices[arrayOffset + 5] = offsetX;
  12854. this._vertices[arrayOffset + 6] = offsetY;
  12855. this._vertices[arrayOffset + 7] = sprite.invertU ? 1 : 0;
  12856. this._vertices[arrayOffset + 8] = sprite.invertV ? 1 : 0;
  12857. var offset = (sprite.cellIndex / rowSize) >> 0;
  12858. this._vertices[arrayOffset + 9] = sprite.cellIndex - offset * rowSize;
  12859. this._vertices[arrayOffset + 10] = offset;
  12860. this._vertices[arrayOffset + 11] = sprite.color.r;
  12861. this._vertices[arrayOffset + 12] = sprite.color.g;
  12862. this._vertices[arrayOffset + 13] = sprite.color.b;
  12863. this._vertices[arrayOffset + 14] = sprite.color.a;
  12864. };
  12865. SpriteManager.prototype.render = function () {
  12866. if (!this._effectBase.isReady() || !this._effectFog.isReady() || !this._spriteTexture || !this._spriteTexture.isReady())
  12867. return;
  12868. var engine = this._scene.getEngine();
  12869. var baseSize = this._spriteTexture.getBaseSize();
  12870. var deltaTime = BABYLON.Tools.GetDeltaTime();
  12871. var max = Math.min(this._capacity, this.sprites.length);
  12872. var rowSize = baseSize.width / this.cellSize;
  12873. var offset = 0;
  12874. for (var index = 0; index < max; index++) {
  12875. var sprite = this.sprites[index];
  12876. if (!sprite) {
  12877. continue;
  12878. }
  12879. sprite._animate(deltaTime);
  12880. this._appendSpriteVertex(offset++, sprite, 0, 0, rowSize);
  12881. this._appendSpriteVertex(offset++, sprite, 1, 0, rowSize);
  12882. this._appendSpriteVertex(offset++, sprite, 1, 1, rowSize);
  12883. this._appendSpriteVertex(offset++, sprite, 0, 1, rowSize);
  12884. }
  12885. engine.updateDynamicVertexBuffer(this._vertexBuffer, this._vertices, max * this._vertexStrideSize);
  12886. var effect = this._effectBase;
  12887. if (this._scene.fogMode !== BABYLON.Scene.FOGMODE_NONE && this.fogEnabled) {
  12888. effect = this._effectFog;
  12889. }
  12890. engine.enableEffect(effect);
  12891. var viewMatrix = this._scene.getViewMatrix();
  12892. effect.setTexture("diffuseSampler", this._spriteTexture);
  12893. effect.setMatrix("view", viewMatrix);
  12894. effect.setMatrix("projection", this._scene.getProjectionMatrix());
  12895. effect.setFloat2("textureInfos", this.cellSize / baseSize.width, this.cellSize / baseSize.height);
  12896. if (this._scene.fogMode !== BABYLON.Scene.FOGMODE_NONE && this.fogEnabled) {
  12897. effect.setFloat4("vFogInfos", this._scene.fogMode, this._scene.fogStart, this._scene.fogEnd, this._scene.fogDensity);
  12898. effect.setColor3("vFogColor", this._scene.fogColor);
  12899. }
  12900. engine.bindBuffers(this._vertexBuffer, this._indexBuffer, this._vertexDeclaration, this._vertexStrideSize, effect);
  12901. effect.setBool("alphaTest", true);
  12902. engine.setColorWrite(false);
  12903. engine.draw(true, 0, max * 6);
  12904. engine.setColorWrite(true);
  12905. effect.setBool("alphaTest", false);
  12906. engine.setAlphaMode(BABYLON.Engine.ALPHA_COMBINE);
  12907. engine.draw(true, 0, max * 6);
  12908. engine.setAlphaMode(BABYLON.Engine.ALPHA_DISABLE);
  12909. };
  12910. SpriteManager.prototype.dispose = function () {
  12911. if (this._vertexBuffer) {
  12912. this._scene.getEngine()._releaseBuffer(this._vertexBuffer);
  12913. this._vertexBuffer = null;
  12914. }
  12915. if (this._indexBuffer) {
  12916. this._scene.getEngine()._releaseBuffer(this._indexBuffer);
  12917. this._indexBuffer = null;
  12918. }
  12919. if (this._spriteTexture) {
  12920. this._spriteTexture.dispose();
  12921. this._spriteTexture = null;
  12922. }
  12923. var index = this._scene.spriteManagers.indexOf(this);
  12924. this._scene.spriteManagers.splice(index, 1);
  12925. if (this.onDispose) {
  12926. this.onDispose();
  12927. }
  12928. };
  12929. return SpriteManager;
  12930. })();
  12931. BABYLON.SpriteManager = SpriteManager;
  12932. })(BABYLON || (BABYLON = {}));
  12933. var BABYLON;
  12934. (function (BABYLON) {
  12935. var Sprite = (function () {
  12936. function Sprite(name, manager) {
  12937. this.name = name;
  12938. this.color = new BABYLON.Color4(1.0, 1.0, 1.0, 1.0);
  12939. this.size = 1.0;
  12940. this.angle = 0;
  12941. this.cellIndex = 0;
  12942. this.invertU = 0;
  12943. this.invertV = 0;
  12944. this.animations = new Array();
  12945. this._animationStarted = false;
  12946. this._loopAnimation = false;
  12947. this._fromIndex = 0;
  12948. this._toIndex = 0;
  12949. this._delay = 0;
  12950. this._direction = 1;
  12951. this._frameCount = 0;
  12952. this._time = 0;
  12953. this._manager = manager;
  12954. this._manager.sprites.push(this);
  12955. this.position = BABYLON.Vector3.Zero();
  12956. }
  12957. Sprite.prototype.playAnimation = function (from, to, loop, delay) {
  12958. this._fromIndex = from;
  12959. this._toIndex = to;
  12960. this._loopAnimation = loop;
  12961. this._delay = delay;
  12962. this._animationStarted = true;
  12963. this._direction = from < to ? 1 : -1;
  12964. this.cellIndex = from;
  12965. this._time = 0;
  12966. };
  12967. Sprite.prototype.stopAnimation = function () {
  12968. this._animationStarted = false;
  12969. };
  12970. Sprite.prototype._animate = function (deltaTime) {
  12971. if (!this._animationStarted)
  12972. return;
  12973. this._time += deltaTime;
  12974. if (this._time > this._delay) {
  12975. this._time = this._time % this._delay;
  12976. this.cellIndex += this._direction;
  12977. if (this.cellIndex == this._toIndex) {
  12978. if (this._loopAnimation) {
  12979. this.cellIndex = this._fromIndex;
  12980. } else {
  12981. this._animationStarted = false;
  12982. if (this.disposeWhenFinishedAnimating) {
  12983. this.dispose();
  12984. }
  12985. }
  12986. }
  12987. }
  12988. };
  12989. Sprite.prototype.dispose = function () {
  12990. for (var i = 0; i < this._manager.sprites.length; i++) {
  12991. if (this._manager.sprites[i] == this) {
  12992. this._manager.sprites.splice(i, 1);
  12993. }
  12994. }
  12995. };
  12996. return Sprite;
  12997. })();
  12998. BABYLON.Sprite = Sprite;
  12999. })(BABYLON || (BABYLON = {}));
  13000. var BABYLON;
  13001. (function (BABYLON) {
  13002. var Layer = (function () {
  13003. function Layer(name, imgUrl, scene, isBackground, color) {
  13004. this.name = name;
  13005. this._vertexDeclaration = [2];
  13006. this._vertexStrideSize = 2 * 4;
  13007. this.texture = imgUrl ? new BABYLON.Texture(imgUrl, scene, true) : null;
  13008. this.isBackground = isBackground === undefined ? true : isBackground;
  13009. this.color = color === undefined ? new BABYLON.Color4(1, 1, 1, 1) : color;
  13010. this._scene = scene;
  13011. this._scene.layers.push(this);
  13012. var vertices = [];
  13013. vertices.push(1, 1);
  13014. vertices.push(-1, 1);
  13015. vertices.push(-1, -1);
  13016. vertices.push(1, -1);
  13017. this._vertexBuffer = scene.getEngine().createVertexBuffer(vertices);
  13018. var indices = [];
  13019. indices.push(0);
  13020. indices.push(1);
  13021. indices.push(2);
  13022. indices.push(0);
  13023. indices.push(2);
  13024. indices.push(3);
  13025. this._indexBuffer = scene.getEngine().createIndexBuffer(indices);
  13026. this._effect = this._scene.getEngine().createEffect("layer", ["position"], ["textureMatrix", "color"], ["textureSampler"], "");
  13027. }
  13028. Layer.prototype.render = function () {
  13029. if (!this._effect.isReady() || !this.texture || !this.texture.isReady())
  13030. return;
  13031. var engine = this._scene.getEngine();
  13032. engine.enableEffect(this._effect);
  13033. engine.setState(false);
  13034. this._effect.setTexture("textureSampler", this.texture);
  13035. this._effect.setMatrix("textureMatrix", this.texture.getTextureMatrix());
  13036. this._effect.setFloat4("color", this.color.r, this.color.g, this.color.b, this.color.a);
  13037. engine.bindBuffers(this._vertexBuffer, this._indexBuffer, this._vertexDeclaration, this._vertexStrideSize, this._effect);
  13038. engine.setAlphaMode(BABYLON.Engine.ALPHA_COMBINE);
  13039. engine.draw(true, 0, 6);
  13040. engine.setAlphaMode(BABYLON.Engine.ALPHA_DISABLE);
  13041. };
  13042. Layer.prototype.dispose = function () {
  13043. if (this._vertexBuffer) {
  13044. this._scene.getEngine()._releaseBuffer(this._vertexBuffer);
  13045. this._vertexBuffer = null;
  13046. }
  13047. if (this._indexBuffer) {
  13048. this._scene.getEngine()._releaseBuffer(this._indexBuffer);
  13049. this._indexBuffer = null;
  13050. }
  13051. if (this.texture) {
  13052. this.texture.dispose();
  13053. this.texture = null;
  13054. }
  13055. var index = this._scene.layers.indexOf(this);
  13056. this._scene.layers.splice(index, 1);
  13057. if (this.onDispose) {
  13058. this.onDispose();
  13059. }
  13060. };
  13061. return Layer;
  13062. })();
  13063. BABYLON.Layer = Layer;
  13064. })(BABYLON || (BABYLON = {}));
  13065. var BABYLON;
  13066. (function (BABYLON) {
  13067. var Particle = (function () {
  13068. function Particle() {
  13069. this.position = BABYLON.Vector3.Zero();
  13070. this.direction = BABYLON.Vector3.Zero();
  13071. this.color = new BABYLON.Color4(0, 0, 0, 0);
  13072. this.colorStep = new BABYLON.Color4(0, 0, 0, 0);
  13073. this.lifeTime = 1.0;
  13074. this.age = 0;
  13075. this.size = 0;
  13076. this.angle = 0;
  13077. this.angularSpeed = 0;
  13078. }
  13079. return Particle;
  13080. })();
  13081. BABYLON.Particle = Particle;
  13082. })(BABYLON || (BABYLON = {}));
  13083. var BABYLON;
  13084. (function (BABYLON) {
  13085. var randomNumber = function (min, max) {
  13086. if (min == max) {
  13087. return (min);
  13088. }
  13089. var random = Math.random();
  13090. return ((random * (max - min)) + min);
  13091. };
  13092. var ParticleSystem = (function () {
  13093. function ParticleSystem(name, capacity, scene, customEffect) {
  13094. var _this = this;
  13095. this.name = name;
  13096. this.renderingGroupId = 0;
  13097. this.emitter = null;
  13098. this.emitRate = 10;
  13099. this.manualEmitCount = -1;
  13100. this.updateSpeed = 0.01;
  13101. this.targetStopDuration = 0;
  13102. this.disposeOnStop = false;
  13103. this.minEmitPower = 1;
  13104. this.maxEmitPower = 1;
  13105. this.minLifeTime = 1;
  13106. this.maxLifeTime = 1;
  13107. this.minSize = 1;
  13108. this.maxSize = 1;
  13109. this.minAngularSpeed = 0;
  13110. this.maxAngularSpeed = 0;
  13111. this.blendMode = BABYLON.ParticleSystem.BLENDMODE_ONEONE;
  13112. this.forceDepthWrite = false;
  13113. this.gravity = BABYLON.Vector3.Zero();
  13114. this.direction1 = new BABYLON.Vector3(0, 1.0, 0);
  13115. this.direction2 = new BABYLON.Vector3(0, 1.0, 0);
  13116. this.minEmitBox = new BABYLON.Vector3(-0.5, -0.5, -0.5);
  13117. this.maxEmitBox = new BABYLON.Vector3(0.5, 0.5, 0.5);
  13118. this.color1 = new BABYLON.Color4(1.0, 1.0, 1.0, 1.0);
  13119. this.color2 = new BABYLON.Color4(1.0, 1.0, 1.0, 1.0);
  13120. this.colorDead = new BABYLON.Color4(0, 0, 0, 1.0);
  13121. this.textureMask = new BABYLON.Color4(1.0, 1.0, 1.0, 1.0);
  13122. this.particles = new Array();
  13123. this._vertexDeclaration = [3, 4, 4];
  13124. this._vertexStrideSize = 11 * 4;
  13125. this._stockParticles = new Array();
  13126. this._newPartsExcess = 0;
  13127. this._scaledColorStep = new BABYLON.Color4(0, 0, 0, 0);
  13128. this._colorDiff = new BABYLON.Color4(0, 0, 0, 0);
  13129. this._scaledDirection = BABYLON.Vector3.Zero();
  13130. this._scaledGravity = BABYLON.Vector3.Zero();
  13131. this._currentRenderId = -1;
  13132. this._started = false;
  13133. this._stopped = false;
  13134. this._actualFrame = 0;
  13135. this.id = name;
  13136. this._capacity = capacity;
  13137. this._scene = scene;
  13138. this._customEffect = customEffect;
  13139. scene.particleSystems.push(this);
  13140. this._vertexBuffer = scene.getEngine().createDynamicVertexBuffer(capacity * this._vertexStrideSize * 4);
  13141. var indices = [];
  13142. var index = 0;
  13143. for (var count = 0; count < capacity; count++) {
  13144. indices.push(index);
  13145. indices.push(index + 1);
  13146. indices.push(index + 2);
  13147. indices.push(index);
  13148. indices.push(index + 2);
  13149. indices.push(index + 3);
  13150. index += 4;
  13151. }
  13152. this._indexBuffer = scene.getEngine().createIndexBuffer(indices);
  13153. this._vertices = new Float32Array(capacity * this._vertexStrideSize);
  13154. this.startDirectionFunction = function (emitPower, worldMatrix, directionToUpdate) {
  13155. var randX = randomNumber(_this.direction1.x, _this.direction2.x);
  13156. var randY = randomNumber(_this.direction1.y, _this.direction2.y);
  13157. var randZ = randomNumber(_this.direction1.z, _this.direction2.z);
  13158. BABYLON.Vector3.TransformNormalFromFloatsToRef(randX * emitPower, randY * emitPower, randZ * emitPower, worldMatrix, directionToUpdate);
  13159. };
  13160. this.startPositionFunction = function (worldMatrix, positionToUpdate) {
  13161. var randX = randomNumber(_this.minEmitBox.x, _this.maxEmitBox.x);
  13162. var randY = randomNumber(_this.minEmitBox.y, _this.maxEmitBox.y);
  13163. var randZ = randomNumber(_this.minEmitBox.z, _this.maxEmitBox.z);
  13164. BABYLON.Vector3.TransformCoordinatesFromFloatsToRef(randX, randY, randZ, worldMatrix, positionToUpdate);
  13165. };
  13166. }
  13167. ParticleSystem.prototype.getCapacity = function () {
  13168. return this._capacity;
  13169. };
  13170. ParticleSystem.prototype.isAlive = function () {
  13171. return this._alive;
  13172. };
  13173. ParticleSystem.prototype.isStarted = function () {
  13174. return this._started;
  13175. };
  13176. ParticleSystem.prototype.start = function () {
  13177. this._started = true;
  13178. this._stopped = false;
  13179. this._actualFrame = 0;
  13180. };
  13181. ParticleSystem.prototype.stop = function () {
  13182. this._stopped = true;
  13183. };
  13184. ParticleSystem.prototype._appendParticleVertex = function (index, particle, offsetX, offsetY) {
  13185. var offset = index * 11;
  13186. this._vertices[offset] = particle.position.x;
  13187. this._vertices[offset + 1] = particle.position.y;
  13188. this._vertices[offset + 2] = particle.position.z;
  13189. this._vertices[offset + 3] = particle.color.r;
  13190. this._vertices[offset + 4] = particle.color.g;
  13191. this._vertices[offset + 5] = particle.color.b;
  13192. this._vertices[offset + 6] = particle.color.a;
  13193. this._vertices[offset + 7] = particle.angle;
  13194. this._vertices[offset + 8] = particle.size;
  13195. this._vertices[offset + 9] = offsetX;
  13196. this._vertices[offset + 10] = offsetY;
  13197. };
  13198. ParticleSystem.prototype._update = function (newParticles) {
  13199. this._alive = this.particles.length > 0;
  13200. for (var index = 0; index < this.particles.length; index++) {
  13201. var particle = this.particles[index];
  13202. particle.age += this._scaledUpdateSpeed;
  13203. if (particle.age >= particle.lifeTime) {
  13204. this._stockParticles.push(this.particles.splice(index, 1)[0]);
  13205. index--;
  13206. continue;
  13207. } else {
  13208. particle.colorStep.scaleToRef(this._scaledUpdateSpeed, this._scaledColorStep);
  13209. particle.color.addInPlace(this._scaledColorStep);
  13210. if (particle.color.a < 0)
  13211. particle.color.a = 0;
  13212. particle.angle += particle.angularSpeed * this._scaledUpdateSpeed;
  13213. particle.direction.scaleToRef(this._scaledUpdateSpeed, this._scaledDirection);
  13214. particle.position.addInPlace(this._scaledDirection);
  13215. this.gravity.scaleToRef(this._scaledUpdateSpeed, this._scaledGravity);
  13216. particle.direction.addInPlace(this._scaledGravity);
  13217. }
  13218. }
  13219. var worldMatrix;
  13220. if (this.emitter.position) {
  13221. worldMatrix = this.emitter.getWorldMatrix();
  13222. } else {
  13223. worldMatrix = BABYLON.Matrix.Translation(this.emitter.x, this.emitter.y, this.emitter.z);
  13224. }
  13225. for (index = 0; index < newParticles; index++) {
  13226. if (this.particles.length == this._capacity) {
  13227. break;
  13228. }
  13229. if (this._stockParticles.length !== 0) {
  13230. particle = this._stockParticles.pop();
  13231. particle.age = 0;
  13232. } else {
  13233. particle = new BABYLON.Particle();
  13234. }
  13235. this.particles.push(particle);
  13236. var emitPower = randomNumber(this.minEmitPower, this.maxEmitPower);
  13237. this.startDirectionFunction(emitPower, worldMatrix, particle.direction);
  13238. particle.lifeTime = randomNumber(this.minLifeTime, this.maxLifeTime);
  13239. particle.size = randomNumber(this.minSize, this.maxSize);
  13240. particle.angularSpeed = randomNumber(this.minAngularSpeed, this.maxAngularSpeed);
  13241. this.startPositionFunction(worldMatrix, particle.position);
  13242. var step = randomNumber(0, 1.0);
  13243. BABYLON.Color4.LerpToRef(this.color1, this.color2, step, particle.color);
  13244. this.colorDead.subtractToRef(particle.color, this._colorDiff);
  13245. this._colorDiff.scaleToRef(1.0 / particle.lifeTime, particle.colorStep);
  13246. }
  13247. };
  13248. ParticleSystem.prototype._getEffect = function () {
  13249. if (this._customEffect) {
  13250. return this._customEffect;
  13251. }
  13252. ;
  13253. var defines = [];
  13254. if (this._scene.clipPlane) {
  13255. defines.push("#define CLIPPLANE");
  13256. }
  13257. var join = defines.join("\n");
  13258. if (this._cachedDefines != join) {
  13259. this._cachedDefines = join;
  13260. this._effect = this._scene.getEngine().createEffect("particles", ["position", "color", "options"], ["invView", "view", "projection", "vClipPlane", "textureMask"], ["diffuseSampler"], join);
  13261. }
  13262. return this._effect;
  13263. };
  13264. ParticleSystem.prototype.animate = function () {
  13265. if (!this._started)
  13266. return;
  13267. var effect = this._getEffect();
  13268. if (!this.emitter || !effect.isReady() || !this.particleTexture || !this.particleTexture.isReady())
  13269. return;
  13270. if (this._currentRenderId === this._scene.getRenderId()) {
  13271. return;
  13272. }
  13273. this._currentRenderId = this._scene.getRenderId();
  13274. this._scaledUpdateSpeed = this.updateSpeed * this._scene.getAnimationRatio();
  13275. var emitCout;
  13276. if (this.manualEmitCount > -1) {
  13277. emitCout = this.manualEmitCount;
  13278. this.manualEmitCount = 0;
  13279. } else {
  13280. emitCout = this.emitRate;
  13281. }
  13282. var newParticles = ((emitCout * this._scaledUpdateSpeed) >> 0);
  13283. this._newPartsExcess += emitCout * this._scaledUpdateSpeed - newParticles;
  13284. if (this._newPartsExcess > 1.0) {
  13285. newParticles += this._newPartsExcess >> 0;
  13286. this._newPartsExcess -= this._newPartsExcess >> 0;
  13287. }
  13288. this._alive = false;
  13289. if (!this._stopped) {
  13290. this._actualFrame += this._scaledUpdateSpeed;
  13291. if (this.targetStopDuration && this._actualFrame >= this.targetStopDuration)
  13292. this.stop();
  13293. } else {
  13294. newParticles = 0;
  13295. }
  13296. this._update(newParticles);
  13297. if (this._stopped) {
  13298. if (!this._alive) {
  13299. this._started = false;
  13300. if (this.disposeOnStop) {
  13301. this._scene._toBeDisposed.push(this);
  13302. }
  13303. }
  13304. }
  13305. var offset = 0;
  13306. for (var index = 0; index < this.particles.length; index++) {
  13307. var particle = this.particles[index];
  13308. this._appendParticleVertex(offset++, particle, 0, 0);
  13309. this._appendParticleVertex(offset++, particle, 1, 0);
  13310. this._appendParticleVertex(offset++, particle, 1, 1);
  13311. this._appendParticleVertex(offset++, particle, 0, 1);
  13312. }
  13313. var engine = this._scene.getEngine();
  13314. engine.updateDynamicVertexBuffer(this._vertexBuffer, this._vertices, this.particles.length * this._vertexStrideSize);
  13315. };
  13316. ParticleSystem.prototype.render = function () {
  13317. var effect = this._getEffect();
  13318. if (!this.emitter || !effect.isReady() || !this.particleTexture || !this.particleTexture.isReady() || !this.particles.length)
  13319. return 0;
  13320. var engine = this._scene.getEngine();
  13321. engine.enableEffect(effect);
  13322. engine.setState(false);
  13323. var viewMatrix = this._scene.getViewMatrix();
  13324. effect.setTexture("diffuseSampler", this.particleTexture);
  13325. effect.setMatrix("view", viewMatrix);
  13326. effect.setMatrix("projection", this._scene.getProjectionMatrix());
  13327. effect.setFloat4("textureMask", this.textureMask.r, this.textureMask.g, this.textureMask.b, this.textureMask.a);
  13328. if (this._scene.clipPlane) {
  13329. var clipPlane = this._scene.clipPlane;
  13330. var invView = viewMatrix.clone();
  13331. invView.invert();
  13332. effect.setMatrix("invView", invView);
  13333. effect.setFloat4("vClipPlane", clipPlane.normal.x, clipPlane.normal.y, clipPlane.normal.z, clipPlane.d);
  13334. }
  13335. engine.bindBuffers(this._vertexBuffer, this._indexBuffer, this._vertexDeclaration, this._vertexStrideSize, effect);
  13336. if (this.blendMode === BABYLON.ParticleSystem.BLENDMODE_ONEONE) {
  13337. engine.setAlphaMode(BABYLON.Engine.ALPHA_ADD);
  13338. } else {
  13339. engine.setAlphaMode(BABYLON.Engine.ALPHA_COMBINE);
  13340. }
  13341. if (this.forceDepthWrite) {
  13342. engine.setDepthWrite(true);
  13343. }
  13344. engine.draw(true, 0, this.particles.length * 6);
  13345. engine.setAlphaMode(BABYLON.Engine.ALPHA_DISABLE);
  13346. return this.particles.length;
  13347. };
  13348. ParticleSystem.prototype.dispose = function () {
  13349. if (this._vertexBuffer) {
  13350. this._scene.getEngine()._releaseBuffer(this._vertexBuffer);
  13351. this._vertexBuffer = null;
  13352. }
  13353. if (this._indexBuffer) {
  13354. this._scene.getEngine()._releaseBuffer(this._indexBuffer);
  13355. this._indexBuffer = null;
  13356. }
  13357. if (this.particleTexture) {
  13358. this.particleTexture.dispose();
  13359. this.particleTexture = null;
  13360. }
  13361. var index = this._scene.particleSystems.indexOf(this);
  13362. this._scene.particleSystems.splice(index, 1);
  13363. if (this.onDispose) {
  13364. this.onDispose();
  13365. }
  13366. };
  13367. ParticleSystem.prototype.clone = function (name, newEmitter) {
  13368. var result = new BABYLON.ParticleSystem(name, this._capacity, this._scene);
  13369. BABYLON.Tools.DeepCopy(this, result, ["particles"], ["_vertexDeclaration", "_vertexStrideSize"]);
  13370. if (newEmitter === undefined) {
  13371. newEmitter = this.emitter;
  13372. }
  13373. result.emitter = newEmitter;
  13374. if (this.particleTexture) {
  13375. result.particleTexture = new BABYLON.Texture(this.particleTexture.url, this._scene);
  13376. }
  13377. result.start();
  13378. return result;
  13379. };
  13380. ParticleSystem.BLENDMODE_ONEONE = 0;
  13381. ParticleSystem.BLENDMODE_STANDARD = 1;
  13382. return ParticleSystem;
  13383. })();
  13384. BABYLON.ParticleSystem = ParticleSystem;
  13385. })(BABYLON || (BABYLON = {}));
  13386. var BABYLON;
  13387. (function (BABYLON) {
  13388. var Animation = (function () {
  13389. function Animation(name, targetProperty, framePerSecond, dataType, loopMode) {
  13390. this.name = name;
  13391. this.targetProperty = targetProperty;
  13392. this.framePerSecond = framePerSecond;
  13393. this.dataType = dataType;
  13394. this.loopMode = loopMode;
  13395. this._offsetsCache = {};
  13396. this._highLimitsCache = {};
  13397. this._stopped = false;
  13398. this.targetPropertyPath = targetProperty.split(".");
  13399. this.dataType = dataType;
  13400. this.loopMode = loopMode === undefined ? Animation.ANIMATIONLOOPMODE_CYCLE : loopMode;
  13401. }
  13402. Animation.CreateAndStartAnimation = function (name, mesh, tartgetProperty, framePerSecond, totalFrame, from, to, loopMode) {
  13403. var dataType = undefined;
  13404. if (!isNaN(parseFloat(from)) && isFinite(from)) {
  13405. dataType = Animation.ANIMATIONTYPE_FLOAT;
  13406. } else if (from instanceof BABYLON.Quaternion) {
  13407. dataType = Animation.ANIMATIONTYPE_QUATERNION;
  13408. } else if (from instanceof BABYLON.Vector3) {
  13409. dataType = Animation.ANIMATIONTYPE_VECTOR3;
  13410. } else if (from instanceof BABYLON.Vector2) {
  13411. dataType = Animation.ANIMATIONTYPE_VECTOR2;
  13412. } else if (from instanceof BABYLON.Color3) {
  13413. dataType = Animation.ANIMATIONTYPE_COLOR3;
  13414. }
  13415. if (dataType == undefined) {
  13416. return;
  13417. }
  13418. var animation = new Animation(name, tartgetProperty, framePerSecond, dataType, loopMode);
  13419. var keys = [];
  13420. keys.push({ frame: 0, value: from });
  13421. keys.push({ frame: totalFrame, value: to });
  13422. animation.setKeys(keys);
  13423. mesh.animations.push(animation);
  13424. mesh.getScene().beginAnimation(mesh, 0, totalFrame, (animation.loopMode == 1));
  13425. };
  13426. Animation.prototype.isStopped = function () {
  13427. return this._stopped;
  13428. };
  13429. Animation.prototype.getKeys = function () {
  13430. return this._keys;
  13431. };
  13432. Animation.prototype.getEasingFunction = function () {
  13433. return this._easingFunction;
  13434. };
  13435. Animation.prototype.setEasingFunction = function (easingFunction) {
  13436. this._easingFunction = easingFunction;
  13437. };
  13438. Animation.prototype.floatInterpolateFunction = function (startValue, endValue, gradient) {
  13439. return startValue + (endValue - startValue) * gradient;
  13440. };
  13441. Animation.prototype.quaternionInterpolateFunction = function (startValue, endValue, gradient) {
  13442. return BABYLON.Quaternion.Slerp(startValue, endValue, gradient);
  13443. };
  13444. Animation.prototype.vector3InterpolateFunction = function (startValue, endValue, gradient) {
  13445. return BABYLON.Vector3.Lerp(startValue, endValue, gradient);
  13446. };
  13447. Animation.prototype.vector2InterpolateFunction = function (startValue, endValue, gradient) {
  13448. return BABYLON.Vector2.Lerp(startValue, endValue, gradient);
  13449. };
  13450. Animation.prototype.color3InterpolateFunction = function (startValue, endValue, gradient) {
  13451. return BABYLON.Color3.Lerp(startValue, endValue, gradient);
  13452. };
  13453. Animation.prototype.clone = function () {
  13454. var clone = new Animation(this.name, this.targetPropertyPath.join("."), this.framePerSecond, this.dataType, this.loopMode);
  13455. clone.setKeys(this._keys);
  13456. return clone;
  13457. };
  13458. Animation.prototype.setKeys = function (values) {
  13459. this._keys = values.slice(0);
  13460. this._offsetsCache = {};
  13461. this._highLimitsCache = {};
  13462. };
  13463. Animation.prototype._interpolate = function (currentFrame, repeatCount, loopMode, offsetValue, highLimitValue) {
  13464. if (loopMode === Animation.ANIMATIONLOOPMODE_CONSTANT && repeatCount > 0) {
  13465. return highLimitValue.clone ? highLimitValue.clone() : highLimitValue;
  13466. }
  13467. this.currentFrame = currentFrame;
  13468. for (var key = 0; key < this._keys.length; key++) {
  13469. if (this._keys[key + 1].frame >= currentFrame) {
  13470. var startValue = this._keys[key].value;
  13471. var endValue = this._keys[key + 1].value;
  13472. var gradient = (currentFrame - this._keys[key].frame) / (this._keys[key + 1].frame - this._keys[key].frame);
  13473. if (this._easingFunction != null) {
  13474. gradient = this._easingFunction.ease(gradient);
  13475. }
  13476. switch (this.dataType) {
  13477. case Animation.ANIMATIONTYPE_FLOAT:
  13478. switch (loopMode) {
  13479. case Animation.ANIMATIONLOOPMODE_CYCLE:
  13480. case Animation.ANIMATIONLOOPMODE_CONSTANT:
  13481. return this.floatInterpolateFunction(startValue, endValue, gradient);
  13482. case Animation.ANIMATIONLOOPMODE_RELATIVE:
  13483. return offsetValue * repeatCount + this.floatInterpolateFunction(startValue, endValue, gradient);
  13484. }
  13485. break;
  13486. case Animation.ANIMATIONTYPE_QUATERNION:
  13487. var quaternion = null;
  13488. switch (loopMode) {
  13489. case Animation.ANIMATIONLOOPMODE_CYCLE:
  13490. case Animation.ANIMATIONLOOPMODE_CONSTANT:
  13491. quaternion = this.quaternionInterpolateFunction(startValue, endValue, gradient);
  13492. break;
  13493. case Animation.ANIMATIONLOOPMODE_RELATIVE:
  13494. quaternion = this.quaternionInterpolateFunction(startValue, endValue, gradient).add(offsetValue.scale(repeatCount));
  13495. break;
  13496. }
  13497. return quaternion;
  13498. case Animation.ANIMATIONTYPE_VECTOR3:
  13499. switch (loopMode) {
  13500. case Animation.ANIMATIONLOOPMODE_CYCLE:
  13501. case Animation.ANIMATIONLOOPMODE_CONSTANT:
  13502. return this.vector3InterpolateFunction(startValue, endValue, gradient);
  13503. case Animation.ANIMATIONLOOPMODE_RELATIVE:
  13504. return this.vector3InterpolateFunction(startValue, endValue, gradient).add(offsetValue.scale(repeatCount));
  13505. }
  13506. case Animation.ANIMATIONTYPE_VECTOR2:
  13507. switch (loopMode) {
  13508. case Animation.ANIMATIONLOOPMODE_CYCLE:
  13509. case Animation.ANIMATIONLOOPMODE_CONSTANT:
  13510. return this.vector2InterpolateFunction(startValue, endValue, gradient);
  13511. case Animation.ANIMATIONLOOPMODE_RELATIVE:
  13512. return this.vector2InterpolateFunction(startValue, endValue, gradient).add(offsetValue.scale(repeatCount));
  13513. }
  13514. case Animation.ANIMATIONTYPE_COLOR3:
  13515. switch (loopMode) {
  13516. case Animation.ANIMATIONLOOPMODE_CYCLE:
  13517. case Animation.ANIMATIONLOOPMODE_CONSTANT:
  13518. return this.color3InterpolateFunction(startValue, endValue, gradient);
  13519. case Animation.ANIMATIONLOOPMODE_RELATIVE:
  13520. return this.color3InterpolateFunction(startValue, endValue, gradient).add(offsetValue.scale(repeatCount));
  13521. }
  13522. case Animation.ANIMATIONTYPE_MATRIX:
  13523. switch (loopMode) {
  13524. case Animation.ANIMATIONLOOPMODE_CYCLE:
  13525. case Animation.ANIMATIONLOOPMODE_CONSTANT:
  13526. case Animation.ANIMATIONLOOPMODE_RELATIVE:
  13527. return startValue;
  13528. }
  13529. default:
  13530. break;
  13531. }
  13532. break;
  13533. }
  13534. }
  13535. return this._keys[this._keys.length - 1].value;
  13536. };
  13537. Animation.prototype.animate = function (delay, from, to, loop, speedRatio) {
  13538. if (!this.targetPropertyPath || this.targetPropertyPath.length < 1) {
  13539. this._stopped = true;
  13540. return false;
  13541. }
  13542. var returnValue = true;
  13543. if (this._keys[0].frame != 0) {
  13544. var newKey = { frame: 0, value: this._keys[0].value };
  13545. this._keys.splice(0, 0, newKey);
  13546. }
  13547. if (from < this._keys[0].frame || from > this._keys[this._keys.length - 1].frame) {
  13548. from = this._keys[0].frame;
  13549. }
  13550. if (to < this._keys[0].frame || to > this._keys[this._keys.length - 1].frame) {
  13551. to = this._keys[this._keys.length - 1].frame;
  13552. }
  13553. var range = to - from;
  13554. var offsetValue;
  13555. var ratio = delay * (this.framePerSecond * speedRatio) / 1000.0;
  13556. if (ratio > range && !loop) {
  13557. returnValue = false;
  13558. highLimitValue = this._keys[this._keys.length - 1].value;
  13559. } else {
  13560. var highLimitValue = 0;
  13561. if (this.loopMode != Animation.ANIMATIONLOOPMODE_CYCLE) {
  13562. var keyOffset = to.toString() + from.toString();
  13563. if (!this._offsetsCache[keyOffset]) {
  13564. var fromValue = this._interpolate(from, 0, Animation.ANIMATIONLOOPMODE_CYCLE);
  13565. var toValue = this._interpolate(to, 0, Animation.ANIMATIONLOOPMODE_CYCLE);
  13566. switch (this.dataType) {
  13567. case Animation.ANIMATIONTYPE_FLOAT:
  13568. this._offsetsCache[keyOffset] = toValue - fromValue;
  13569. break;
  13570. case Animation.ANIMATIONTYPE_QUATERNION:
  13571. this._offsetsCache[keyOffset] = toValue.subtract(fromValue);
  13572. break;
  13573. case Animation.ANIMATIONTYPE_VECTOR3:
  13574. this._offsetsCache[keyOffset] = toValue.subtract(fromValue);
  13575. case Animation.ANIMATIONTYPE_VECTOR2:
  13576. this._offsetsCache[keyOffset] = toValue.subtract(fromValue);
  13577. case Animation.ANIMATIONTYPE_COLOR3:
  13578. this._offsetsCache[keyOffset] = toValue.subtract(fromValue);
  13579. default:
  13580. break;
  13581. }
  13582. this._highLimitsCache[keyOffset] = toValue;
  13583. }
  13584. highLimitValue = this._highLimitsCache[keyOffset];
  13585. offsetValue = this._offsetsCache[keyOffset];
  13586. }
  13587. }
  13588. if (offsetValue === undefined) {
  13589. switch (this.dataType) {
  13590. case Animation.ANIMATIONTYPE_FLOAT:
  13591. offsetValue = 0;
  13592. break;
  13593. case Animation.ANIMATIONTYPE_QUATERNION:
  13594. offsetValue = new BABYLON.Quaternion(0, 0, 0, 0);
  13595. break;
  13596. case Animation.ANIMATIONTYPE_VECTOR3:
  13597. offsetValue = BABYLON.Vector3.Zero();
  13598. break;
  13599. case Animation.ANIMATIONTYPE_VECTOR2:
  13600. offsetValue = BABYLON.Vector2.Zero();
  13601. break;
  13602. case Animation.ANIMATIONTYPE_COLOR3:
  13603. offsetValue = BABYLON.Color3.Black();
  13604. }
  13605. }
  13606. var repeatCount = (ratio / range) >> 0;
  13607. var currentFrame = returnValue ? from + ratio % range : to;
  13608. var currentValue = this._interpolate(currentFrame, repeatCount, this.loopMode, offsetValue, highLimitValue);
  13609. if (this.targetPropertyPath.length > 1) {
  13610. var property = this._target[this.targetPropertyPath[0]];
  13611. for (var index = 1; index < this.targetPropertyPath.length - 1; index++) {
  13612. property = property[this.targetPropertyPath[index]];
  13613. }
  13614. property[this.targetPropertyPath[this.targetPropertyPath.length - 1]] = currentValue;
  13615. } else {
  13616. this._target[this.targetPropertyPath[0]] = currentValue;
  13617. }
  13618. if (this._target.markAsDirty) {
  13619. this._target.markAsDirty(this.targetProperty);
  13620. }
  13621. if (!returnValue) {
  13622. this._stopped = true;
  13623. }
  13624. return returnValue;
  13625. };
  13626. Object.defineProperty(Animation, "ANIMATIONTYPE_FLOAT", {
  13627. get: function () {
  13628. return Animation._ANIMATIONTYPE_FLOAT;
  13629. },
  13630. enumerable: true,
  13631. configurable: true
  13632. });
  13633. Object.defineProperty(Animation, "ANIMATIONTYPE_VECTOR3", {
  13634. get: function () {
  13635. return Animation._ANIMATIONTYPE_VECTOR3;
  13636. },
  13637. enumerable: true,
  13638. configurable: true
  13639. });
  13640. Object.defineProperty(Animation, "ANIMATIONTYPE_VECTOR2", {
  13641. get: function () {
  13642. return Animation._ANIMATIONTYPE_VECTOR2;
  13643. },
  13644. enumerable: true,
  13645. configurable: true
  13646. });
  13647. Object.defineProperty(Animation, "ANIMATIONTYPE_QUATERNION", {
  13648. get: function () {
  13649. return Animation._ANIMATIONTYPE_QUATERNION;
  13650. },
  13651. enumerable: true,
  13652. configurable: true
  13653. });
  13654. Object.defineProperty(Animation, "ANIMATIONTYPE_MATRIX", {
  13655. get: function () {
  13656. return Animation._ANIMATIONTYPE_MATRIX;
  13657. },
  13658. enumerable: true,
  13659. configurable: true
  13660. });
  13661. Object.defineProperty(Animation, "ANIMATIONTYPE_COLOR3", {
  13662. get: function () {
  13663. return Animation._ANIMATIONTYPE_COLOR3;
  13664. },
  13665. enumerable: true,
  13666. configurable: true
  13667. });
  13668. Object.defineProperty(Animation, "ANIMATIONLOOPMODE_RELATIVE", {
  13669. get: function () {
  13670. return Animation._ANIMATIONLOOPMODE_RELATIVE;
  13671. },
  13672. enumerable: true,
  13673. configurable: true
  13674. });
  13675. Object.defineProperty(Animation, "ANIMATIONLOOPMODE_CYCLE", {
  13676. get: function () {
  13677. return Animation._ANIMATIONLOOPMODE_CYCLE;
  13678. },
  13679. enumerable: true,
  13680. configurable: true
  13681. });
  13682. Object.defineProperty(Animation, "ANIMATIONLOOPMODE_CONSTANT", {
  13683. get: function () {
  13684. return Animation._ANIMATIONLOOPMODE_CONSTANT;
  13685. },
  13686. enumerable: true,
  13687. configurable: true
  13688. });
  13689. Animation._ANIMATIONTYPE_FLOAT = 0;
  13690. Animation._ANIMATIONTYPE_VECTOR3 = 1;
  13691. Animation._ANIMATIONTYPE_QUATERNION = 2;
  13692. Animation._ANIMATIONTYPE_MATRIX = 3;
  13693. Animation._ANIMATIONTYPE_COLOR3 = 4;
  13694. Animation._ANIMATIONTYPE_VECTOR2 = 5;
  13695. Animation._ANIMATIONLOOPMODE_RELATIVE = 0;
  13696. Animation._ANIMATIONLOOPMODE_CYCLE = 1;
  13697. Animation._ANIMATIONLOOPMODE_CONSTANT = 2;
  13698. return Animation;
  13699. })();
  13700. BABYLON.Animation = Animation;
  13701. })(BABYLON || (BABYLON = {}));
  13702. var BABYLON;
  13703. (function (BABYLON) {
  13704. var Animatable = (function () {
  13705. function Animatable(scene, target, fromFrame, toFrame, loopAnimation, speedRatio, onAnimationEnd, animations) {
  13706. if (typeof fromFrame === "undefined") { fromFrame = 0; }
  13707. if (typeof toFrame === "undefined") { toFrame = 100; }
  13708. if (typeof loopAnimation === "undefined") { loopAnimation = false; }
  13709. if (typeof speedRatio === "undefined") { speedRatio = 1.0; }
  13710. this.target = target;
  13711. this.fromFrame = fromFrame;
  13712. this.toFrame = toFrame;
  13713. this.loopAnimation = loopAnimation;
  13714. this.speedRatio = speedRatio;
  13715. this.onAnimationEnd = onAnimationEnd;
  13716. this._animations = new Array();
  13717. this._paused = false;
  13718. this.animationStarted = false;
  13719. if (animations) {
  13720. this.appendAnimations(target, animations);
  13721. }
  13722. this._scene = scene;
  13723. scene._activeAnimatables.push(this);
  13724. }
  13725. Animatable.prototype.appendAnimations = function (target, animations) {
  13726. for (var index = 0; index < animations.length; index++) {
  13727. var animation = animations[index];
  13728. animation._target = target;
  13729. this._animations.push(animation);
  13730. }
  13731. };
  13732. Animatable.prototype.getAnimationByTargetProperty = function (property) {
  13733. var animations = this._animations;
  13734. for (var index = 0; index < animations.length; index++) {
  13735. if (animations[index].targetProperty === property) {
  13736. return animations[index];
  13737. }
  13738. }
  13739. return null;
  13740. };
  13741. Animatable.prototype.pause = function () {
  13742. if (this._paused) {
  13743. return;
  13744. }
  13745. this._paused = true;
  13746. };
  13747. Animatable.prototype.restart = function () {
  13748. this._paused = false;
  13749. };
  13750. Animatable.prototype.stop = function () {
  13751. var index = this._scene._activeAnimatables.indexOf(this);
  13752. if (index > -1) {
  13753. this._scene._activeAnimatables.splice(index, 1);
  13754. }
  13755. if (this.onAnimationEnd) {
  13756. this.onAnimationEnd();
  13757. }
  13758. };
  13759. Animatable.prototype._animate = function (delay) {
  13760. if (this._paused) {
  13761. if (!this._pausedDelay) {
  13762. this._pausedDelay = delay;
  13763. }
  13764. return true;
  13765. }
  13766. if (!this._localDelayOffset) {
  13767. this._localDelayOffset = delay;
  13768. } else if (this._pausedDelay) {
  13769. this._localDelayOffset += delay - this._pausedDelay;
  13770. this._pausedDelay = null;
  13771. }
  13772. var running = false;
  13773. var animations = this._animations;
  13774. for (var index = 0; index < animations.length; index++) {
  13775. var animation = animations[index];
  13776. var isRunning = animation.animate(delay - this._localDelayOffset, this.fromFrame, this.toFrame, this.loopAnimation, this.speedRatio);
  13777. running = running || isRunning;
  13778. }
  13779. if (!running && this.onAnimationEnd) {
  13780. this.onAnimationEnd();
  13781. }
  13782. return running;
  13783. };
  13784. return Animatable;
  13785. })();
  13786. BABYLON.Animatable = Animatable;
  13787. })(BABYLON || (BABYLON = {}));
  13788. var __extends = this.__extends || function (d, b) {
  13789. for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p];
  13790. function __() { this.constructor = d; }
  13791. __.prototype = b.prototype;
  13792. d.prototype = new __();
  13793. };
  13794. var BABYLON;
  13795. (function (BABYLON) {
  13796. var EasingFunction = (function () {
  13797. function EasingFunction() {
  13798. this._easingMode = EasingFunction.EASINGMODE_EASEIN;
  13799. }
  13800. Object.defineProperty(EasingFunction, "EASINGMODE_EASEIN", {
  13801. get: function () {
  13802. return EasingFunction._EASINGMODE_EASEIN;
  13803. },
  13804. enumerable: true,
  13805. configurable: true
  13806. });
  13807. Object.defineProperty(EasingFunction, "EASINGMODE_EASEOUT", {
  13808. get: function () {
  13809. return EasingFunction._EASINGMODE_EASEOUT;
  13810. },
  13811. enumerable: true,
  13812. configurable: true
  13813. });
  13814. Object.defineProperty(EasingFunction, "EASINGMODE_EASEINOUT", {
  13815. get: function () {
  13816. return EasingFunction._EASINGMODE_EASEINOUT;
  13817. },
  13818. enumerable: true,
  13819. configurable: true
  13820. });
  13821. EasingFunction.prototype.setEasingMode = function (easingMode) {
  13822. var n = Math.min(Math.max(easingMode, 0), 2);
  13823. this._easingMode = n;
  13824. };
  13825. EasingFunction.prototype.getEasingMode = function () {
  13826. return this._easingMode;
  13827. };
  13828. EasingFunction.prototype.easeInCore = function (gradient) {
  13829. throw new Error('You must implement this method');
  13830. };
  13831. EasingFunction.prototype.ease = function (gradient) {
  13832. switch (this._easingMode) {
  13833. case EasingFunction.EASINGMODE_EASEIN:
  13834. return this.easeInCore(gradient);
  13835. case EasingFunction.EASINGMODE_EASEOUT:
  13836. return (1 - this.easeInCore(1 - gradient));
  13837. }
  13838. if (gradient >= 0.5) {
  13839. return (((1 - this.easeInCore((1 - gradient) * 2)) * 0.5) + 0.5);
  13840. }
  13841. return (this.easeInCore(gradient * 2) * 0.5);
  13842. };
  13843. EasingFunction._EASINGMODE_EASEIN = 0;
  13844. EasingFunction._EASINGMODE_EASEOUT = 1;
  13845. EasingFunction._EASINGMODE_EASEINOUT = 2;
  13846. return EasingFunction;
  13847. })();
  13848. BABYLON.EasingFunction = EasingFunction;
  13849. var CircleEase = (function (_super) {
  13850. __extends(CircleEase, _super);
  13851. function CircleEase() {
  13852. _super.apply(this, arguments);
  13853. }
  13854. CircleEase.prototype.easeInCore = function (gradient) {
  13855. gradient = Math.max(0, Math.min(1, gradient));
  13856. return (1.0 - Math.sqrt(1.0 - (gradient * gradient)));
  13857. };
  13858. return CircleEase;
  13859. })(EasingFunction);
  13860. BABYLON.CircleEase = CircleEase;
  13861. var BackEase = (function (_super) {
  13862. __extends(BackEase, _super);
  13863. function BackEase(amplitude) {
  13864. if (typeof amplitude === "undefined") { amplitude = 1; }
  13865. _super.call(this);
  13866. this.amplitude = amplitude;
  13867. }
  13868. BackEase.prototype.easeInCore = function (gradient) {
  13869. var num = Math.max(0, this.amplitude);
  13870. return (Math.pow(gradient, 3.0) - ((gradient * num) * Math.sin(3.1415926535897931 * gradient)));
  13871. };
  13872. return BackEase;
  13873. })(EasingFunction);
  13874. BABYLON.BackEase = BackEase;
  13875. var BounceEase = (function (_super) {
  13876. __extends(BounceEase, _super);
  13877. function BounceEase(bounces, bounciness) {
  13878. if (typeof bounces === "undefined") { bounces = 3; }
  13879. if (typeof bounciness === "undefined") { bounciness = 2; }
  13880. _super.call(this);
  13881. this.bounces = bounces;
  13882. this.bounciness = bounciness;
  13883. }
  13884. BounceEase.prototype.easeInCore = function (gradient) {
  13885. var y = Math.max(0.0, this.bounces);
  13886. var bounciness = this.bounciness;
  13887. if (bounciness <= 1.0) {
  13888. bounciness = 1.001;
  13889. }
  13890. var num9 = Math.pow(bounciness, y);
  13891. var num5 = 1.0 - bounciness;
  13892. var num4 = ((1.0 - num9) / num5) + (num9 * 0.5);
  13893. var num15 = gradient * num4;
  13894. var num65 = Math.log((-num15 * (1.0 - bounciness)) + 1.0) / Math.log(bounciness);
  13895. var num3 = Math.floor(num65);
  13896. var num13 = num3 + 1.0;
  13897. var num8 = (1.0 - Math.pow(bounciness, num3)) / (num5 * num4);
  13898. var num12 = (1.0 - Math.pow(bounciness, num13)) / (num5 * num4);
  13899. var num7 = (num8 + num12) * 0.5;
  13900. var num6 = gradient - num7;
  13901. var num2 = num7 - num8;
  13902. return (((-Math.pow(1.0 / bounciness, y - num3) / (num2 * num2)) * (num6 - num2)) * (num6 + num2));
  13903. };
  13904. return BounceEase;
  13905. })(EasingFunction);
  13906. BABYLON.BounceEase = BounceEase;
  13907. var CubicEase = (function (_super) {
  13908. __extends(CubicEase, _super);
  13909. function CubicEase() {
  13910. _super.apply(this, arguments);
  13911. }
  13912. CubicEase.prototype.easeInCore = function (gradient) {
  13913. return (gradient * gradient * gradient);
  13914. };
  13915. return CubicEase;
  13916. })(EasingFunction);
  13917. BABYLON.CubicEase = CubicEase;
  13918. var ElasticEase = (function (_super) {
  13919. __extends(ElasticEase, _super);
  13920. function ElasticEase(oscillations, springiness) {
  13921. if (typeof oscillations === "undefined") { oscillations = 3; }
  13922. if (typeof springiness === "undefined") { springiness = 3; }
  13923. _super.call(this);
  13924. this.oscillations = oscillations;
  13925. this.springiness = springiness;
  13926. }
  13927. ElasticEase.prototype.easeInCore = function (gradient) {
  13928. var num2;
  13929. var num3 = Math.max(0.0, this.oscillations);
  13930. var num = Math.max(0.0, this.springiness);
  13931. if (num == 0) {
  13932. num2 = gradient;
  13933. } else {
  13934. num2 = (Math.exp(num * gradient) - 1.0) / (Math.exp(num) - 1.0);
  13935. }
  13936. return (num2 * Math.sin(((6.2831853071795862 * num3) + 1.5707963267948966) * gradient));
  13937. };
  13938. return ElasticEase;
  13939. })(EasingFunction);
  13940. BABYLON.ElasticEase = ElasticEase;
  13941. var ExponentialEase = (function (_super) {
  13942. __extends(ExponentialEase, _super);
  13943. function ExponentialEase(exponent) {
  13944. if (typeof exponent === "undefined") { exponent = 2; }
  13945. _super.call(this);
  13946. this.exponent = exponent;
  13947. }
  13948. ExponentialEase.prototype.easeInCore = function (gradient) {
  13949. if (this.exponent <= 0) {
  13950. return gradient;
  13951. }
  13952. return ((Math.exp(this.exponent * gradient) - 1.0) / (Math.exp(this.exponent) - 1.0));
  13953. };
  13954. return ExponentialEase;
  13955. })(EasingFunction);
  13956. BABYLON.ExponentialEase = ExponentialEase;
  13957. var PowerEase = (function (_super) {
  13958. __extends(PowerEase, _super);
  13959. function PowerEase(power) {
  13960. if (typeof power === "undefined") { power = 2; }
  13961. _super.call(this);
  13962. this.power = power;
  13963. }
  13964. PowerEase.prototype.easeInCore = function (gradient) {
  13965. var y = Math.max(0.0, this.power);
  13966. return Math.pow(gradient, y);
  13967. };
  13968. return PowerEase;
  13969. })(EasingFunction);
  13970. BABYLON.PowerEase = PowerEase;
  13971. var QuadraticEase = (function (_super) {
  13972. __extends(QuadraticEase, _super);
  13973. function QuadraticEase() {
  13974. _super.apply(this, arguments);
  13975. }
  13976. QuadraticEase.prototype.easeInCore = function (gradient) {
  13977. return (gradient * gradient);
  13978. };
  13979. return QuadraticEase;
  13980. })(EasingFunction);
  13981. BABYLON.QuadraticEase = QuadraticEase;
  13982. var QuarticEase = (function (_super) {
  13983. __extends(QuarticEase, _super);
  13984. function QuarticEase() {
  13985. _super.apply(this, arguments);
  13986. }
  13987. QuarticEase.prototype.easeInCore = function (gradient) {
  13988. return (gradient * gradient * gradient * gradient);
  13989. };
  13990. return QuarticEase;
  13991. })(EasingFunction);
  13992. BABYLON.QuarticEase = QuarticEase;
  13993. var QuinticEase = (function (_super) {
  13994. __extends(QuinticEase, _super);
  13995. function QuinticEase() {
  13996. _super.apply(this, arguments);
  13997. }
  13998. QuinticEase.prototype.easeInCore = function (gradient) {
  13999. return (gradient * gradient * gradient * gradient * gradient);
  14000. };
  14001. return QuinticEase;
  14002. })(EasingFunction);
  14003. BABYLON.QuinticEase = QuinticEase;
  14004. var SineEase = (function (_super) {
  14005. __extends(SineEase, _super);
  14006. function SineEase() {
  14007. _super.apply(this, arguments);
  14008. }
  14009. SineEase.prototype.easeInCore = function (gradient) {
  14010. return (1.0 - Math.sin(1.5707963267948966 * (1.0 - gradient)));
  14011. };
  14012. return SineEase;
  14013. })(EasingFunction);
  14014. BABYLON.SineEase = SineEase;
  14015. var BezierCurveEase = (function (_super) {
  14016. __extends(BezierCurveEase, _super);
  14017. function BezierCurveEase(x1, y1, x2, y2) {
  14018. if (typeof x1 === "undefined") { x1 = 0; }
  14019. if (typeof y1 === "undefined") { y1 = 0; }
  14020. if (typeof x2 === "undefined") { x2 = 1; }
  14021. if (typeof y2 === "undefined") { y2 = 1; }
  14022. _super.call(this);
  14023. this.x1 = x1;
  14024. this.y1 = y1;
  14025. this.x2 = x2;
  14026. this.y2 = y2;
  14027. }
  14028. BezierCurveEase.prototype.easeInCore = function (gradient) {
  14029. return BABYLON.BezierCurve.interpolate(gradient, this.x1, this.y1, this.x2, this.y2);
  14030. };
  14031. return BezierCurveEase;
  14032. })(EasingFunction);
  14033. BABYLON.BezierCurveEase = BezierCurveEase;
  14034. })(BABYLON || (BABYLON = {}));
  14035. var BABYLON;
  14036. (function (BABYLON) {
  14037. var Octree = (function () {
  14038. function Octree(creationFunc, maxBlockCapacity, maxDepth) {
  14039. if (typeof maxDepth === "undefined") { maxDepth = 2; }
  14040. this.maxDepth = maxDepth;
  14041. this.dynamicContent = new Array();
  14042. this._maxBlockCapacity = maxBlockCapacity || 64;
  14043. this._selectionContent = new BABYLON.SmartArray(1024);
  14044. this._creationFunc = creationFunc;
  14045. }
  14046. Octree.prototype.update = function (worldMin, worldMax, entries) {
  14047. Octree._CreateBlocks(worldMin, worldMax, entries, this._maxBlockCapacity, 0, this.maxDepth, this, this._creationFunc);
  14048. };
  14049. Octree.prototype.addMesh = function (entry) {
  14050. for (var index = 0; index < this.blocks.length; index++) {
  14051. var block = this.blocks[index];
  14052. block.addEntry(entry);
  14053. }
  14054. };
  14055. Octree.prototype.select = function (frustumPlanes, allowDuplicate) {
  14056. this._selectionContent.reset();
  14057. for (var index = 0; index < this.blocks.length; index++) {
  14058. var block = this.blocks[index];
  14059. block.select(frustumPlanes, this._selectionContent, allowDuplicate);
  14060. }
  14061. if (allowDuplicate) {
  14062. this._selectionContent.concat(this.dynamicContent);
  14063. } else {
  14064. this._selectionContent.concatWithNoDuplicate(this.dynamicContent);
  14065. }
  14066. return this._selectionContent;
  14067. };
  14068. Octree.prototype.intersects = function (sphereCenter, sphereRadius, allowDuplicate) {
  14069. this._selectionContent.reset();
  14070. for (var index = 0; index < this.blocks.length; index++) {
  14071. var block = this.blocks[index];
  14072. block.intersects(sphereCenter, sphereRadius, this._selectionContent, allowDuplicate);
  14073. }
  14074. if (allowDuplicate) {
  14075. this._selectionContent.concat(this.dynamicContent);
  14076. } else {
  14077. this._selectionContent.concatWithNoDuplicate(this.dynamicContent);
  14078. }
  14079. return this._selectionContent;
  14080. };
  14081. Octree.prototype.intersectsRay = function (ray) {
  14082. this._selectionContent.reset();
  14083. for (var index = 0; index < this.blocks.length; index++) {
  14084. var block = this.blocks[index];
  14085. block.intersectsRay(ray, this._selectionContent);
  14086. }
  14087. this._selectionContent.concatWithNoDuplicate(this.dynamicContent);
  14088. return this._selectionContent;
  14089. };
  14090. Octree._CreateBlocks = function (worldMin, worldMax, entries, maxBlockCapacity, currentDepth, maxDepth, target, creationFunc) {
  14091. target.blocks = new Array();
  14092. var blockSize = new BABYLON.Vector3((worldMax.x - worldMin.x) / 2, (worldMax.y - worldMin.y) / 2, (worldMax.z - worldMin.z) / 2);
  14093. for (var x = 0; x < 2; x++) {
  14094. for (var y = 0; y < 2; y++) {
  14095. for (var z = 0; z < 2; z++) {
  14096. var localMin = worldMin.add(blockSize.multiplyByFloats(x, y, z));
  14097. var localMax = worldMin.add(blockSize.multiplyByFloats(x + 1, y + 1, z + 1));
  14098. var block = new BABYLON.OctreeBlock(localMin, localMax, maxBlockCapacity, currentDepth + 1, maxDepth, creationFunc);
  14099. block.addEntries(entries);
  14100. target.blocks.push(block);
  14101. }
  14102. }
  14103. }
  14104. };
  14105. Octree.CreationFuncForMeshes = function (entry, block) {
  14106. if (!entry.isBlocked && entry.getBoundingInfo().boundingBox.intersectsMinMax(block.minPoint, block.maxPoint)) {
  14107. block.entries.push(entry);
  14108. }
  14109. };
  14110. Octree.CreationFuncForSubMeshes = function (entry, block) {
  14111. if (entry.getBoundingInfo().boundingBox.intersectsMinMax(block.minPoint, block.maxPoint)) {
  14112. block.entries.push(entry);
  14113. }
  14114. };
  14115. return Octree;
  14116. })();
  14117. BABYLON.Octree = Octree;
  14118. })(BABYLON || (BABYLON = {}));
  14119. var BABYLON;
  14120. (function (BABYLON) {
  14121. var OctreeBlock = (function () {
  14122. function OctreeBlock(minPoint, maxPoint, capacity, depth, maxDepth, creationFunc) {
  14123. this.entries = new Array();
  14124. this._boundingVectors = new Array();
  14125. this._capacity = capacity;
  14126. this._depth = depth;
  14127. this._maxDepth = maxDepth;
  14128. this._creationFunc = creationFunc;
  14129. this._minPoint = minPoint;
  14130. this._maxPoint = maxPoint;
  14131. this._boundingVectors.push(minPoint.clone());
  14132. this._boundingVectors.push(maxPoint.clone());
  14133. this._boundingVectors.push(minPoint.clone());
  14134. this._boundingVectors[2].x = maxPoint.x;
  14135. this._boundingVectors.push(minPoint.clone());
  14136. this._boundingVectors[3].y = maxPoint.y;
  14137. this._boundingVectors.push(minPoint.clone());
  14138. this._boundingVectors[4].z = maxPoint.z;
  14139. this._boundingVectors.push(maxPoint.clone());
  14140. this._boundingVectors[5].z = minPoint.z;
  14141. this._boundingVectors.push(maxPoint.clone());
  14142. this._boundingVectors[6].x = minPoint.x;
  14143. this._boundingVectors.push(maxPoint.clone());
  14144. this._boundingVectors[7].y = minPoint.y;
  14145. }
  14146. Object.defineProperty(OctreeBlock.prototype, "capacity", {
  14147. get: function () {
  14148. return this._capacity;
  14149. },
  14150. enumerable: true,
  14151. configurable: true
  14152. });
  14153. Object.defineProperty(OctreeBlock.prototype, "minPoint", {
  14154. get: function () {
  14155. return this._minPoint;
  14156. },
  14157. enumerable: true,
  14158. configurable: true
  14159. });
  14160. Object.defineProperty(OctreeBlock.prototype, "maxPoint", {
  14161. get: function () {
  14162. return this._maxPoint;
  14163. },
  14164. enumerable: true,
  14165. configurable: true
  14166. });
  14167. OctreeBlock.prototype.addEntry = function (entry) {
  14168. if (this.blocks) {
  14169. for (var index = 0; index < this.blocks.length; index++) {
  14170. var block = this.blocks[index];
  14171. block.addEntry(entry);
  14172. }
  14173. return;
  14174. }
  14175. this._creationFunc(entry, this);
  14176. if (this.entries.length > this.capacity && this._depth < this._maxDepth) {
  14177. this.createInnerBlocks();
  14178. }
  14179. };
  14180. OctreeBlock.prototype.addEntries = function (entries) {
  14181. for (var index = 0; index < entries.length; index++) {
  14182. var mesh = entries[index];
  14183. this.addEntry(mesh);
  14184. }
  14185. };
  14186. OctreeBlock.prototype.select = function (frustumPlanes, selection, allowDuplicate) {
  14187. if (BABYLON.BoundingBox.IsInFrustum(this._boundingVectors, frustumPlanes)) {
  14188. if (this.blocks) {
  14189. for (var index = 0; index < this.blocks.length; index++) {
  14190. var block = this.blocks[index];
  14191. block.select(frustumPlanes, selection, allowDuplicate);
  14192. }
  14193. return;
  14194. }
  14195. if (allowDuplicate) {
  14196. selection.concat(this.entries);
  14197. } else {
  14198. selection.concatWithNoDuplicate(this.entries);
  14199. }
  14200. }
  14201. };
  14202. OctreeBlock.prototype.intersects = function (sphereCenter, sphereRadius, selection, allowDuplicate) {
  14203. if (BABYLON.BoundingBox.IntersectsSphere(this._minPoint, this._maxPoint, sphereCenter, sphereRadius)) {
  14204. if (this.blocks) {
  14205. for (var index = 0; index < this.blocks.length; index++) {
  14206. var block = this.blocks[index];
  14207. block.intersects(sphereCenter, sphereRadius, selection, allowDuplicate);
  14208. }
  14209. return;
  14210. }
  14211. if (allowDuplicate) {
  14212. selection.concat(this.entries);
  14213. } else {
  14214. selection.concatWithNoDuplicate(this.entries);
  14215. }
  14216. }
  14217. };
  14218. OctreeBlock.prototype.intersectsRay = function (ray, selection) {
  14219. if (ray.intersectsBoxMinMax(this._minPoint, this._maxPoint)) {
  14220. if (this.blocks) {
  14221. for (var index = 0; index < this.blocks.length; index++) {
  14222. var block = this.blocks[index];
  14223. block.intersectsRay(ray, selection);
  14224. }
  14225. return;
  14226. }
  14227. selection.concatWithNoDuplicate(this.entries);
  14228. }
  14229. };
  14230. OctreeBlock.prototype.createInnerBlocks = function () {
  14231. BABYLON.Octree._CreateBlocks(this._minPoint, this._maxPoint, this.entries, this._capacity, this._depth, this._maxDepth, this, this._creationFunc);
  14232. };
  14233. return OctreeBlock;
  14234. })();
  14235. BABYLON.OctreeBlock = OctreeBlock;
  14236. })(BABYLON || (BABYLON = {}));
  14237. var BABYLON;
  14238. (function (BABYLON) {
  14239. var Bone = (function () {
  14240. function Bone(name, skeleton, parentBone, matrix) {
  14241. this.name = name;
  14242. this.children = new Array();
  14243. this.animations = new Array();
  14244. this._worldTransform = new BABYLON.Matrix();
  14245. this._absoluteTransform = new BABYLON.Matrix();
  14246. this._invertedAbsoluteTransform = new BABYLON.Matrix();
  14247. this._skeleton = skeleton;
  14248. this._matrix = matrix;
  14249. this._baseMatrix = matrix;
  14250. skeleton.bones.push(this);
  14251. if (parentBone) {
  14252. this._parent = parentBone;
  14253. parentBone.children.push(this);
  14254. } else {
  14255. this._parent = null;
  14256. }
  14257. this._updateDifferenceMatrix();
  14258. }
  14259. Bone.prototype.getParent = function () {
  14260. return this._parent;
  14261. };
  14262. Bone.prototype.getLocalMatrix = function () {
  14263. return this._matrix;
  14264. };
  14265. Bone.prototype.getBaseMatrix = function () {
  14266. return this._baseMatrix;
  14267. };
  14268. Bone.prototype.getWorldMatrix = function () {
  14269. return this._worldTransform;
  14270. };
  14271. Bone.prototype.getInvertedAbsoluteTransform = function () {
  14272. return this._invertedAbsoluteTransform;
  14273. };
  14274. Bone.prototype.getAbsoluteMatrix = function () {
  14275. var matrix = this._matrix.clone();
  14276. var parent = this._parent;
  14277. while (parent) {
  14278. matrix = matrix.multiply(parent.getLocalMatrix());
  14279. parent = parent.getParent();
  14280. }
  14281. return matrix;
  14282. };
  14283. Bone.prototype.updateMatrix = function (matrix) {
  14284. this._matrix = matrix;
  14285. this._skeleton._markAsDirty();
  14286. this._updateDifferenceMatrix();
  14287. };
  14288. Bone.prototype._updateDifferenceMatrix = function () {
  14289. if (this._parent) {
  14290. this._matrix.multiplyToRef(this._parent._absoluteTransform, this._absoluteTransform);
  14291. } else {
  14292. this._absoluteTransform.copyFrom(this._matrix);
  14293. }
  14294. this._absoluteTransform.invertToRef(this._invertedAbsoluteTransform);
  14295. for (var index = 0; index < this.children.length; index++) {
  14296. this.children[index]._updateDifferenceMatrix();
  14297. }
  14298. };
  14299. Bone.prototype.markAsDirty = function () {
  14300. this._skeleton._markAsDirty();
  14301. };
  14302. return Bone;
  14303. })();
  14304. BABYLON.Bone = Bone;
  14305. })(BABYLON || (BABYLON = {}));
  14306. var BABYLON;
  14307. (function (BABYLON) {
  14308. var Skeleton = (function () {
  14309. function Skeleton(name, id, scene) {
  14310. this.name = name;
  14311. this.id = id;
  14312. this.bones = new Array();
  14313. this._isDirty = true;
  14314. this._identity = BABYLON.Matrix.Identity();
  14315. this.bones = [];
  14316. this._scene = scene;
  14317. scene.skeletons.push(this);
  14318. }
  14319. Skeleton.prototype.getTransformMatrices = function () {
  14320. return this._transformMatrices;
  14321. };
  14322. Skeleton.prototype._markAsDirty = function () {
  14323. this._isDirty = true;
  14324. };
  14325. Skeleton.prototype.prepare = function () {
  14326. if (!this._isDirty) {
  14327. return;
  14328. }
  14329. if (!this._transformMatrices || this._transformMatrices.length !== 16 * (this.bones.length + 1)) {
  14330. this._transformMatrices = new Float32Array(16 * (this.bones.length + 1));
  14331. }
  14332. for (var index = 0; index < this.bones.length; index++) {
  14333. var bone = this.bones[index];
  14334. var parentBone = bone.getParent();
  14335. if (parentBone) {
  14336. bone.getLocalMatrix().multiplyToRef(parentBone.getWorldMatrix(), bone.getWorldMatrix());
  14337. } else {
  14338. bone.getWorldMatrix().copyFrom(bone.getLocalMatrix());
  14339. }
  14340. bone.getInvertedAbsoluteTransform().multiplyToArray(bone.getWorldMatrix(), this._transformMatrices, index * 16);
  14341. }
  14342. this._identity.copyToArray(this._transformMatrices, this.bones.length * 16);
  14343. this._isDirty = false;
  14344. };
  14345. Skeleton.prototype.getAnimatables = function () {
  14346. if (!this._animatables || this._animatables.length != this.bones.length) {
  14347. this._animatables = [];
  14348. for (var index = 0; index < this.bones.length; index++) {
  14349. this._animatables.push(this.bones[index]);
  14350. }
  14351. }
  14352. return this._animatables;
  14353. };
  14354. Skeleton.prototype.clone = function (name, id) {
  14355. var result = new BABYLON.Skeleton(name, id || name, this._scene);
  14356. for (var index = 0; index < this.bones.length; index++) {
  14357. var source = this.bones[index];
  14358. var parentBone = null;
  14359. if (source.getParent()) {
  14360. var parentIndex = this.bones.indexOf(source.getParent());
  14361. parentBone = result.bones[parentIndex];
  14362. }
  14363. var bone = new BABYLON.Bone(source.name, result, parentBone, source.getBaseMatrix());
  14364. BABYLON.Tools.DeepCopy(source.animations, bone.animations);
  14365. }
  14366. return result;
  14367. };
  14368. return Skeleton;
  14369. })();
  14370. BABYLON.Skeleton = Skeleton;
  14371. })(BABYLON || (BABYLON = {}));
  14372. var BABYLON;
  14373. (function (BABYLON) {
  14374. var PostProcess = (function () {
  14375. function PostProcess(name, fragmentUrl, parameters, samplers, ratio, camera, samplingMode, engine, reusable) {
  14376. this.name = name;
  14377. this.width = -1;
  14378. this.height = -1;
  14379. this._reusable = false;
  14380. this._textures = new BABYLON.SmartArray(2);
  14381. this._currentRenderTextureInd = 0;
  14382. if (camera != null) {
  14383. this._camera = camera;
  14384. this._scene = camera.getScene();
  14385. camera.attachPostProcess(this);
  14386. this._engine = this._scene.getEngine();
  14387. } else {
  14388. this._engine = engine;
  14389. }
  14390. this._renderRatio = ratio;
  14391. this.renderTargetSamplingMode = samplingMode ? samplingMode : BABYLON.Texture.NEAREST_SAMPLINGMODE;
  14392. this._reusable = reusable || false;
  14393. samplers = samplers || [];
  14394. samplers.push("textureSampler");
  14395. this._effect = this._engine.createEffect({ vertex: "postprocess", fragment: fragmentUrl }, ["position"], parameters || [], samplers, "");
  14396. }
  14397. PostProcess.prototype.isReusable = function () {
  14398. return this._reusable;
  14399. };
  14400. PostProcess.prototype.activate = function (camera, sourceTexture) {
  14401. camera = camera || this._camera;
  14402. var scene = camera.getScene();
  14403. var maxSize = camera.getEngine().getCaps().maxTextureSize;
  14404. var desiredWidth = ((sourceTexture ? sourceTexture._width : this._engine.getRenderingCanvas().width) * this._renderRatio) | 0;
  14405. var desiredHeight = ((sourceTexture ? sourceTexture._height : this._engine.getRenderingCanvas().height) * this._renderRatio) | 0;
  14406. desiredWidth = BABYLON.Tools.GetExponantOfTwo(desiredWidth, maxSize);
  14407. desiredHeight = BABYLON.Tools.GetExponantOfTwo(desiredHeight, maxSize);
  14408. if (this.width !== desiredWidth || this.height !== desiredHeight) {
  14409. if (this._textures.length > 0) {
  14410. for (var i = 0; i < this._textures.length; i++) {
  14411. this._engine._releaseTexture(this._textures.data[i]);
  14412. }
  14413. this._textures.reset();
  14414. }
  14415. this.width = desiredWidth;
  14416. this.height = desiredHeight;
  14417. this._textures.push(this._engine.createRenderTargetTexture({ width: this.width, height: this.height }, { generateMipMaps: false, generateDepthBuffer: camera._postProcesses.indexOf(this) === camera._postProcessesTakenIndices[0], samplingMode: this.renderTargetSamplingMode }));
  14418. if (this._reusable) {
  14419. this._textures.push(this._engine.createRenderTargetTexture({ width: this.width, height: this.height }, { generateMipMaps: false, generateDepthBuffer: camera._postProcesses.indexOf(this) === camera._postProcessesTakenIndices[0], samplingMode: this.renderTargetSamplingMode }));
  14420. }
  14421. if (this.onSizeChanged) {
  14422. this.onSizeChanged();
  14423. }
  14424. }
  14425. this._engine.bindFramebuffer(this._textures.data[this._currentRenderTextureInd]);
  14426. if (this.onActivate) {
  14427. this.onActivate(camera);
  14428. }
  14429. this._engine.clear(scene.clearColor, scene.autoClear || scene.forceWireframe, true);
  14430. if (this._reusable) {
  14431. this._currentRenderTextureInd = (this._currentRenderTextureInd + 1) % 2;
  14432. }
  14433. };
  14434. PostProcess.prototype.apply = function () {
  14435. if (!this._effect.isReady())
  14436. return null;
  14437. this._engine.enableEffect(this._effect);
  14438. this._engine.setState(false);
  14439. this._engine.setAlphaMode(BABYLON.Engine.ALPHA_DISABLE);
  14440. this._engine.setDepthBuffer(false);
  14441. this._engine.setDepthWrite(false);
  14442. this._effect._bindTexture("textureSampler", this._textures.data[this._currentRenderTextureInd]);
  14443. if (this.onApply) {
  14444. this.onApply(this._effect);
  14445. }
  14446. return this._effect;
  14447. };
  14448. PostProcess.prototype.dispose = function (camera) {
  14449. camera = camera || this._camera;
  14450. if (this._textures.length > 0) {
  14451. for (var i = 0; i < this._textures.length; i++) {
  14452. this._engine._releaseTexture(this._textures.data[i]);
  14453. }
  14454. this._textures.reset();
  14455. }
  14456. camera.detachPostProcess(this);
  14457. var index = camera._postProcesses.indexOf(this);
  14458. if (index === camera._postProcessesTakenIndices[0] && camera._postProcessesTakenIndices.length > 0) {
  14459. this._camera._postProcesses[camera._postProcessesTakenIndices[0]].width = -1;
  14460. }
  14461. };
  14462. return PostProcess;
  14463. })();
  14464. BABYLON.PostProcess = PostProcess;
  14465. })(BABYLON || (BABYLON = {}));
  14466. var BABYLON;
  14467. (function (BABYLON) {
  14468. var PostProcessManager = (function () {
  14469. function PostProcessManager(scene) {
  14470. this._vertexDeclaration = [2];
  14471. this._vertexStrideSize = 2 * 4;
  14472. this._scene = scene;
  14473. var vertices = [];
  14474. vertices.push(1, 1);
  14475. vertices.push(-1, 1);
  14476. vertices.push(-1, -1);
  14477. vertices.push(1, -1);
  14478. this._vertexBuffer = scene.getEngine().createVertexBuffer(vertices);
  14479. var indices = [];
  14480. indices.push(0);
  14481. indices.push(1);
  14482. indices.push(2);
  14483. indices.push(0);
  14484. indices.push(2);
  14485. indices.push(3);
  14486. this._indexBuffer = scene.getEngine().createIndexBuffer(indices);
  14487. }
  14488. PostProcessManager.prototype._prepareFrame = function (sourceTexture) {
  14489. var postProcesses = this._scene.activeCamera._postProcesses;
  14490. var postProcessesTakenIndices = this._scene.activeCamera._postProcessesTakenIndices;
  14491. if (postProcessesTakenIndices.length === 0 || !this._scene.postProcessesEnabled) {
  14492. return false;
  14493. }
  14494. postProcesses[this._scene.activeCamera._postProcessesTakenIndices[0]].activate(this._scene.activeCamera, sourceTexture);
  14495. return true;
  14496. };
  14497. PostProcessManager.prototype._finalizeFrame = function (doNotPresent, targetTexture) {
  14498. var postProcesses = this._scene.activeCamera._postProcesses;
  14499. var postProcessesTakenIndices = this._scene.activeCamera._postProcessesTakenIndices;
  14500. if (postProcessesTakenIndices.length === 0 || !this._scene.postProcessesEnabled) {
  14501. return;
  14502. }
  14503. var engine = this._scene.getEngine();
  14504. for (var index = 0; index < postProcessesTakenIndices.length; index++) {
  14505. if (index < postProcessesTakenIndices.length - 1) {
  14506. postProcesses[postProcessesTakenIndices[index + 1]].activate(this._scene.activeCamera);
  14507. } else {
  14508. if (targetTexture) {
  14509. engine.bindFramebuffer(targetTexture);
  14510. } else {
  14511. engine.restoreDefaultFramebuffer();
  14512. }
  14513. }
  14514. if (doNotPresent) {
  14515. break;
  14516. }
  14517. var pp = postProcesses[postProcessesTakenIndices[index]];
  14518. var effect = pp.apply();
  14519. if (effect) {
  14520. if (pp.onBeforeRender) {
  14521. pp.onBeforeRender(effect);
  14522. }
  14523. engine.bindBuffers(this._vertexBuffer, this._indexBuffer, this._vertexDeclaration, this._vertexStrideSize, effect);
  14524. engine.draw(true, 0, 6);
  14525. }
  14526. }
  14527. engine.setDepthBuffer(true);
  14528. engine.setDepthWrite(true);
  14529. };
  14530. PostProcessManager.prototype.dispose = function () {
  14531. if (this._vertexBuffer) {
  14532. this._scene.getEngine()._releaseBuffer(this._vertexBuffer);
  14533. this._vertexBuffer = null;
  14534. }
  14535. if (this._indexBuffer) {
  14536. this._scene.getEngine()._releaseBuffer(this._indexBuffer);
  14537. this._indexBuffer = null;
  14538. }
  14539. };
  14540. return PostProcessManager;
  14541. })();
  14542. BABYLON.PostProcessManager = PostProcessManager;
  14543. })(BABYLON || (BABYLON = {}));
  14544. var __extends = this.__extends || function (d, b) {
  14545. for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p];
  14546. function __() { this.constructor = d; }
  14547. __.prototype = b.prototype;
  14548. d.prototype = new __();
  14549. };
  14550. var BABYLON;
  14551. (function (BABYLON) {
  14552. var PassPostProcess = (function (_super) {
  14553. __extends(PassPostProcess, _super);
  14554. function PassPostProcess(name, ratio, camera, samplingMode, engine, reusable) {
  14555. _super.call(this, name, "pass", null, null, ratio, camera, samplingMode, engine, reusable);
  14556. }
  14557. return PassPostProcess;
  14558. })(BABYLON.PostProcess);
  14559. BABYLON.PassPostProcess = PassPostProcess;
  14560. })(BABYLON || (BABYLON = {}));
  14561. var __extends = this.__extends || function (d, b) {
  14562. for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p];
  14563. function __() { this.constructor = d; }
  14564. __.prototype = b.prototype;
  14565. d.prototype = new __();
  14566. };
  14567. var BABYLON;
  14568. (function (BABYLON) {
  14569. var BlurPostProcess = (function (_super) {
  14570. __extends(BlurPostProcess, _super);
  14571. function BlurPostProcess(name, direction, blurWidth, ratio, camera, samplingMode, engine, reusable) {
  14572. if (typeof samplingMode === "undefined") { samplingMode = BABYLON.Texture.BILINEAR_SAMPLINGMODE; }
  14573. var _this = this;
  14574. _super.call(this, name, "blur", ["screenSize", "direction", "blurWidth"], null, ratio, camera, samplingMode, engine, reusable);
  14575. this.direction = direction;
  14576. this.blurWidth = blurWidth;
  14577. this.onApply = function (effect) {
  14578. effect.setFloat2("screenSize", _this.width, _this.height);
  14579. effect.setVector2("direction", _this.direction);
  14580. effect.setFloat("blurWidth", _this.blurWidth);
  14581. };
  14582. }
  14583. return BlurPostProcess;
  14584. })(BABYLON.PostProcess);
  14585. BABYLON.BlurPostProcess = BlurPostProcess;
  14586. })(BABYLON || (BABYLON = {}));
  14587. var __extends = this.__extends || function (d, b) {
  14588. for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p];
  14589. function __() { this.constructor = d; }
  14590. __.prototype = b.prototype;
  14591. d.prototype = new __();
  14592. };
  14593. var BABYLON;
  14594. (function (BABYLON) {
  14595. var FilterPostProcess = (function (_super) {
  14596. __extends(FilterPostProcess, _super);
  14597. function FilterPostProcess(name, kernelMatrix, ratio, camera, samplingMode, engine, reusable) {
  14598. var _this = this;
  14599. _super.call(this, name, "filter", ["kernelMatrix"], null, ratio, camera, samplingMode, engine, reusable);
  14600. this.kernelMatrix = kernelMatrix;
  14601. this.onApply = function (effect) {
  14602. effect.setMatrix("kernelMatrix", _this.kernelMatrix);
  14603. };
  14604. }
  14605. return FilterPostProcess;
  14606. })(BABYLON.PostProcess);
  14607. BABYLON.FilterPostProcess = FilterPostProcess;
  14608. })(BABYLON || (BABYLON = {}));
  14609. var __extends = this.__extends || function (d, b) {
  14610. for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p];
  14611. function __() { this.constructor = d; }
  14612. __.prototype = b.prototype;
  14613. d.prototype = new __();
  14614. };
  14615. var BABYLON;
  14616. (function (BABYLON) {
  14617. var RefractionPostProcess = (function (_super) {
  14618. __extends(RefractionPostProcess, _super);
  14619. function RefractionPostProcess(name, refractionTextureUrl, color, depth, colorLevel, ratio, camera, samplingMode, engine, reusable) {
  14620. var _this = this;
  14621. _super.call(this, name, "refraction", ["baseColor", "depth", "colorLevel"], ["refractionSampler"], ratio, camera, samplingMode, engine, reusable);
  14622. this.color = color;
  14623. this.depth = depth;
  14624. this.colorLevel = colorLevel;
  14625. this.onActivate = function (cam) {
  14626. _this._refRexture = _this._refRexture || new BABYLON.Texture(refractionTextureUrl, cam.getScene());
  14627. };
  14628. this.onApply = function (effect) {
  14629. effect.setColor3("baseColor", _this.color);
  14630. effect.setFloat("depth", _this.depth);
  14631. effect.setFloat("colorLevel", _this.colorLevel);
  14632. effect.setTexture("refractionSampler", _this._refRexture);
  14633. };
  14634. }
  14635. RefractionPostProcess.prototype.dispose = function (camera) {
  14636. if (this._refRexture) {
  14637. this._refRexture.dispose();
  14638. }
  14639. _super.prototype.dispose.call(this, camera);
  14640. };
  14641. return RefractionPostProcess;
  14642. })(BABYLON.PostProcess);
  14643. BABYLON.RefractionPostProcess = RefractionPostProcess;
  14644. })(BABYLON || (BABYLON = {}));
  14645. var __extends = this.__extends || function (d, b) {
  14646. for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p];
  14647. function __() { this.constructor = d; }
  14648. __.prototype = b.prototype;
  14649. d.prototype = new __();
  14650. };
  14651. var BABYLON;
  14652. (function (BABYLON) {
  14653. var BlackAndWhitePostProcess = (function (_super) {
  14654. __extends(BlackAndWhitePostProcess, _super);
  14655. function BlackAndWhitePostProcess(name, ratio, camera, samplingMode, engine, reusable) {
  14656. _super.call(this, name, "blackAndWhite", null, null, ratio, camera, samplingMode, engine, reusable);
  14657. }
  14658. return BlackAndWhitePostProcess;
  14659. })(BABYLON.PostProcess);
  14660. BABYLON.BlackAndWhitePostProcess = BlackAndWhitePostProcess;
  14661. })(BABYLON || (BABYLON = {}));
  14662. var __extends = this.__extends || function (d, b) {
  14663. for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p];
  14664. function __() { this.constructor = d; }
  14665. __.prototype = b.prototype;
  14666. d.prototype = new __();
  14667. };
  14668. var BABYLON;
  14669. (function (BABYLON) {
  14670. var ConvolutionPostProcess = (function (_super) {
  14671. __extends(ConvolutionPostProcess, _super);
  14672. function ConvolutionPostProcess(name, kernel, ratio, camera, samplingMode, engine, reusable) {
  14673. var _this = this;
  14674. _super.call(this, name, "convolution", ["kernel", "screenSize"], null, ratio, camera, samplingMode, engine, reusable);
  14675. this.kernel = kernel;
  14676. this.onApply = function (effect) {
  14677. effect.setFloat2("screenSize", _this.width, _this.height);
  14678. effect.setArray("kernel", _this.kernel);
  14679. };
  14680. }
  14681. ConvolutionPostProcess.EdgeDetect0Kernel = [1, 0, -1, 0, 0, 0, -1, 0, 1];
  14682. ConvolutionPostProcess.EdgeDetect1Kernel = [0, 1, 0, 1, -4, 1, 0, 1, 0];
  14683. ConvolutionPostProcess.EdgeDetect2Kernel = [-1, -1, -1, -1, 8, -1, -1, -1, -1];
  14684. ConvolutionPostProcess.SharpenKernel = [0, -1, 0, -1, 5, -1, 0, -1, 0];
  14685. ConvolutionPostProcess.EmbossKernel = [-2, -1, 0, -1, 1, 1, 0, 1, 2];
  14686. ConvolutionPostProcess.GaussianKernel = [0, 1, 0, 1, 1, 1, 0, 1, 0];
  14687. return ConvolutionPostProcess;
  14688. })(BABYLON.PostProcess);
  14689. BABYLON.ConvolutionPostProcess = ConvolutionPostProcess;
  14690. })(BABYLON || (BABYLON = {}));
  14691. var __extends = this.__extends || function (d, b) {
  14692. for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p];
  14693. function __() { this.constructor = d; }
  14694. __.prototype = b.prototype;
  14695. d.prototype = new __();
  14696. };
  14697. var BABYLON;
  14698. (function (BABYLON) {
  14699. var FxaaPostProcess = (function (_super) {
  14700. __extends(FxaaPostProcess, _super);
  14701. function FxaaPostProcess(name, ratio, camera, samplingMode, engine, reusable) {
  14702. var _this = this;
  14703. _super.call(this, name, "fxaa", ["texelSize"], null, ratio, camera, samplingMode, engine, reusable);
  14704. this.onSizeChanged = function () {
  14705. _this.texelWidth = 1.0 / _this.width;
  14706. _this.texelHeight = 1.0 / _this.height;
  14707. };
  14708. this.onApply = function (effect) {
  14709. effect.setFloat2("texelSize", _this.texelWidth, _this.texelHeight);
  14710. };
  14711. }
  14712. return FxaaPostProcess;
  14713. })(BABYLON.PostProcess);
  14714. BABYLON.FxaaPostProcess = FxaaPostProcess;
  14715. })(BABYLON || (BABYLON = {}));
  14716. var BABYLON;
  14717. (function (BABYLON) {
  14718. var LensFlare = (function () {
  14719. function LensFlare(size, position, color, imgUrl, system) {
  14720. this.size = size;
  14721. this.position = position;
  14722. this.dispose = function () {
  14723. if (this.texture) {
  14724. this.texture.dispose();
  14725. }
  14726. var index = this._system.lensFlares.indexOf(this);
  14727. this._system.lensFlares.splice(index, 1);
  14728. };
  14729. this.color = color || new BABYLON.Color3(1, 1, 1);
  14730. this.texture = imgUrl ? new BABYLON.Texture(imgUrl, system.getScene(), true) : null;
  14731. this._system = system;
  14732. system.lensFlares.push(this);
  14733. }
  14734. return LensFlare;
  14735. })();
  14736. BABYLON.LensFlare = LensFlare;
  14737. })(BABYLON || (BABYLON = {}));
  14738. var BABYLON;
  14739. (function (BABYLON) {
  14740. var LensFlareSystem = (function () {
  14741. function LensFlareSystem(name, emitter, scene) {
  14742. this.name = name;
  14743. this.lensFlares = new Array();
  14744. this.borderLimit = 300;
  14745. this._vertexDeclaration = [2];
  14746. this._vertexStrideSize = 2 * 4;
  14747. this._isEnabled = true;
  14748. this._scene = scene;
  14749. this._emitter = emitter;
  14750. scene.lensFlareSystems.push(this);
  14751. this.meshesSelectionPredicate = function (m) {
  14752. return m.material && m.isVisible && m.isEnabled() && m.isBlocker && ((m.layerMask & scene.activeCamera.layerMask) != 0);
  14753. };
  14754. var vertices = [];
  14755. vertices.push(1, 1);
  14756. vertices.push(-1, 1);
  14757. vertices.push(-1, -1);
  14758. vertices.push(1, -1);
  14759. this._vertexBuffer = scene.getEngine().createVertexBuffer(vertices);
  14760. var indices = [];
  14761. indices.push(0);
  14762. indices.push(1);
  14763. indices.push(2);
  14764. indices.push(0);
  14765. indices.push(2);
  14766. indices.push(3);
  14767. this._indexBuffer = scene.getEngine().createIndexBuffer(indices);
  14768. this._effect = this._scene.getEngine().createEffect("lensFlare", ["position"], ["color", "viewportMatrix"], ["textureSampler"], "");
  14769. }
  14770. Object.defineProperty(LensFlareSystem.prototype, "isEnabled", {
  14771. get: function () {
  14772. return this._isEnabled;
  14773. },
  14774. set: function (value) {
  14775. this._isEnabled = value;
  14776. },
  14777. enumerable: true,
  14778. configurable: true
  14779. });
  14780. LensFlareSystem.prototype.getScene = function () {
  14781. return this._scene;
  14782. };
  14783. LensFlareSystem.prototype.getEmitter = function () {
  14784. return this._emitter;
  14785. };
  14786. LensFlareSystem.prototype.getEmitterPosition = function () {
  14787. return this._emitter.getAbsolutePosition ? this._emitter.getAbsolutePosition() : this._emitter.position;
  14788. };
  14789. LensFlareSystem.prototype.computeEffectivePosition = function (globalViewport) {
  14790. var position = this.getEmitterPosition();
  14791. position = BABYLON.Vector3.Project(position, BABYLON.Matrix.Identity(), this._scene.getTransformMatrix(), globalViewport);
  14792. this._positionX = position.x;
  14793. this._positionY = position.y;
  14794. position = BABYLON.Vector3.TransformCoordinates(this.getEmitterPosition(), this._scene.getViewMatrix());
  14795. if (position.z > 0) {
  14796. if ((this._positionX > globalViewport.x) && (this._positionX < globalViewport.x + globalViewport.width)) {
  14797. if ((this._positionY > globalViewport.y) && (this._positionY < globalViewport.y + globalViewport.height))
  14798. return true;
  14799. }
  14800. }
  14801. return false;
  14802. };
  14803. LensFlareSystem.prototype._isVisible = function () {
  14804. if (!this._isEnabled) {
  14805. return false;
  14806. }
  14807. var emitterPosition = this.getEmitterPosition();
  14808. var direction = emitterPosition.subtract(this._scene.activeCamera.position);
  14809. var distance = direction.length();
  14810. direction.normalize();
  14811. var ray = new BABYLON.Ray(this._scene.activeCamera.position, direction);
  14812. var pickInfo = this._scene.pickWithRay(ray, this.meshesSelectionPredicate, true);
  14813. return !pickInfo.hit || pickInfo.distance > distance;
  14814. };
  14815. LensFlareSystem.prototype.render = function () {
  14816. if (!this._effect.isReady())
  14817. return false;
  14818. var engine = this._scene.getEngine();
  14819. var viewport = this._scene.activeCamera.viewport;
  14820. var globalViewport = viewport.toGlobal(engine);
  14821. if (!this.computeEffectivePosition(globalViewport)) {
  14822. return false;
  14823. }
  14824. if (!this._isVisible()) {
  14825. return false;
  14826. }
  14827. var awayX;
  14828. var awayY;
  14829. if (this._positionX < this.borderLimit + globalViewport.x) {
  14830. awayX = this.borderLimit + globalViewport.x - this._positionX;
  14831. } else if (this._positionX > globalViewport.x + globalViewport.width - this.borderLimit) {
  14832. awayX = this._positionX - globalViewport.x - globalViewport.width + this.borderLimit;
  14833. } else {
  14834. awayX = 0;
  14835. }
  14836. if (this._positionY < this.borderLimit + globalViewport.y) {
  14837. awayY = this.borderLimit + globalViewport.y - this._positionY;
  14838. } else if (this._positionY > globalViewport.y + globalViewport.height - this.borderLimit) {
  14839. awayY = this._positionY - globalViewport.y - globalViewport.height + this.borderLimit;
  14840. } else {
  14841. awayY = 0;
  14842. }
  14843. var away = (awayX > awayY) ? awayX : awayY;
  14844. if (away > this.borderLimit) {
  14845. away = this.borderLimit;
  14846. }
  14847. var intensity = 1.0 - (away / this.borderLimit);
  14848. if (intensity < 0) {
  14849. return false;
  14850. }
  14851. if (intensity > 1.0) {
  14852. intensity = 1.0;
  14853. }
  14854. var centerX = globalViewport.x + globalViewport.width / 2;
  14855. var centerY = globalViewport.y + globalViewport.height / 2;
  14856. var distX = centerX - this._positionX;
  14857. var distY = centerY - this._positionY;
  14858. engine.enableEffect(this._effect);
  14859. engine.setState(false);
  14860. engine.setDepthBuffer(false);
  14861. engine.setAlphaMode(BABYLON.Engine.ALPHA_ADD);
  14862. engine.bindBuffers(this._vertexBuffer, this._indexBuffer, this._vertexDeclaration, this._vertexStrideSize, this._effect);
  14863. for (var index = 0; index < this.lensFlares.length; index++) {
  14864. var flare = this.lensFlares[index];
  14865. var x = centerX - (distX * flare.position);
  14866. var y = centerY - (distY * flare.position);
  14867. var cw = flare.size;
  14868. var ch = flare.size * engine.getAspectRatio(this._scene.activeCamera);
  14869. var cx = 2 * (x / globalViewport.width) - 1.0;
  14870. var cy = 1.0 - 2 * (y / globalViewport.height);
  14871. var viewportMatrix = BABYLON.Matrix.FromValues(cw / 2, 0, 0, 0, 0, ch / 2, 0, 0, 0, 0, 1, 0, cx, cy, 0, 1);
  14872. this._effect.setMatrix("viewportMatrix", viewportMatrix);
  14873. this._effect.setTexture("textureSampler", flare.texture);
  14874. this._effect.setFloat4("color", flare.color.r * intensity, flare.color.g * intensity, flare.color.b * intensity, 1.0);
  14875. engine.draw(true, 0, 6);
  14876. }
  14877. engine.setDepthBuffer(true);
  14878. engine.setAlphaMode(BABYLON.Engine.ALPHA_DISABLE);
  14879. return true;
  14880. };
  14881. LensFlareSystem.prototype.dispose = function () {
  14882. if (this._vertexBuffer) {
  14883. this._scene.getEngine()._releaseBuffer(this._vertexBuffer);
  14884. this._vertexBuffer = null;
  14885. }
  14886. if (this._indexBuffer) {
  14887. this._scene.getEngine()._releaseBuffer(this._indexBuffer);
  14888. this._indexBuffer = null;
  14889. }
  14890. while (this.lensFlares.length) {
  14891. this.lensFlares[0].dispose();
  14892. }
  14893. var index = this._scene.lensFlareSystems.indexOf(this);
  14894. this._scene.lensFlareSystems.splice(index, 1);
  14895. };
  14896. return LensFlareSystem;
  14897. })();
  14898. BABYLON.LensFlareSystem = LensFlareSystem;
  14899. })(BABYLON || (BABYLON = {}));
  14900. var BABYLON;
  14901. (function (BABYLON) {
  14902. var IntersectionInfo = (function () {
  14903. function IntersectionInfo(bu, bv, distance) {
  14904. this.bu = bu;
  14905. this.bv = bv;
  14906. this.distance = distance;
  14907. this.faceId = 0;
  14908. }
  14909. return IntersectionInfo;
  14910. })();
  14911. BABYLON.IntersectionInfo = IntersectionInfo;
  14912. var PickingInfo = (function () {
  14913. function PickingInfo() {
  14914. this.hit = false;
  14915. this.distance = 0;
  14916. this.pickedPoint = null;
  14917. this.pickedMesh = null;
  14918. this.bu = 0;
  14919. this.bv = 0;
  14920. this.faceId = -1;
  14921. }
  14922. PickingInfo.prototype.getNormal = function () {
  14923. if (!this.pickedMesh || !this.pickedMesh.isVerticesDataPresent(BABYLON.VertexBuffer.NormalKind)) {
  14924. return null;
  14925. }
  14926. var indices = this.pickedMesh.getIndices();
  14927. var normals = this.pickedMesh.getVerticesData(BABYLON.VertexBuffer.NormalKind);
  14928. var normal0 = BABYLON.Vector3.FromArray(normals, indices[this.faceId * 3] * 3);
  14929. var normal1 = BABYLON.Vector3.FromArray(normals, indices[this.faceId * 3 + 1] * 3);
  14930. var normal2 = BABYLON.Vector3.FromArray(normals, indices[this.faceId * 3 + 2] * 3);
  14931. normal0 = normal0.scale(this.bu);
  14932. normal1 = normal1.scale(this.bv);
  14933. normal2 = normal2.scale(1.0 - this.bu - this.bv);
  14934. return new BABYLON.Vector3(normal0.x + normal1.x + normal2.x, normal0.y + normal1.y + normal2.y, normal0.z + normal1.z + normal2.z);
  14935. };
  14936. PickingInfo.prototype.getTextureCoordinates = function () {
  14937. if (!this.pickedMesh || !this.pickedMesh.isVerticesDataPresent(BABYLON.VertexBuffer.UVKind)) {
  14938. return null;
  14939. }
  14940. var indices = this.pickedMesh.getIndices();
  14941. var uvs = this.pickedMesh.getVerticesData(BABYLON.VertexBuffer.UVKind);
  14942. var uv0 = BABYLON.Vector2.FromArray(uvs, indices[this.faceId * 3] * 2);
  14943. var uv1 = BABYLON.Vector2.FromArray(uvs, indices[this.faceId * 3 + 1] * 2);
  14944. var uv2 = BABYLON.Vector2.FromArray(uvs, indices[this.faceId * 3 + 2] * 2);
  14945. uv0 = uv0.scale(this.bu);
  14946. uv1 = uv1.scale(this.bv);
  14947. uv2 = uv2.scale(1.0 - this.bu - this.bv);
  14948. return new BABYLON.Vector2(uv0.x + uv1.x + uv2.x, uv0.y + uv1.y + uv2.y);
  14949. };
  14950. return PickingInfo;
  14951. })();
  14952. BABYLON.PickingInfo = PickingInfo;
  14953. })(BABYLON || (BABYLON = {}));
  14954. var BABYLON;
  14955. (function (BABYLON) {
  14956. var FilesInput = (function () {
  14957. function FilesInput(p_engine, p_scene, p_canvas, p_sceneLoadedCallback, p_progressCallback, p_additionnalRenderLoopLogicCallback, p_textureLoadingCallback, p_startingProcessingFilesCallback) {
  14958. this.engine = p_engine;
  14959. this.canvas = p_canvas;
  14960. this.currentScene = p_scene;
  14961. this.sceneLoadedCallback = p_sceneLoadedCallback;
  14962. this.progressCallback = p_progressCallback;
  14963. this.additionnalRenderLoopLogicCallback = p_additionnalRenderLoopLogicCallback;
  14964. this.textureLoadingCallback = p_textureLoadingCallback;
  14965. this.startingProcessingFilesCallback = p_startingProcessingFilesCallback;
  14966. }
  14967. FilesInput.prototype.monitorElementForDragNDrop = function (p_elementToMonitor) {
  14968. var _this = this;
  14969. if (p_elementToMonitor) {
  14970. this.elementToMonitor = p_elementToMonitor;
  14971. this.elementToMonitor.addEventListener("dragenter", function (e) {
  14972. _this.drag(e);
  14973. }, false);
  14974. this.elementToMonitor.addEventListener("dragover", function (e) {
  14975. _this.drag(e);
  14976. }, false);
  14977. this.elementToMonitor.addEventListener("drop", function (e) {
  14978. _this.drop(e);
  14979. }, false);
  14980. }
  14981. };
  14982. FilesInput.prototype.renderFunction = function () {
  14983. if (this.additionnalRenderLoopLogicCallback) {
  14984. this.additionnalRenderLoopLogicCallback();
  14985. }
  14986. if (this.currentScene) {
  14987. if (this.textureLoadingCallback) {
  14988. var remaining = this.currentScene.getWaitingItemsCount();
  14989. if (remaining > 0) {
  14990. this.textureLoadingCallback(remaining);
  14991. }
  14992. }
  14993. this.currentScene.render();
  14994. }
  14995. };
  14996. FilesInput.prototype.drag = function (e) {
  14997. e.stopPropagation();
  14998. e.preventDefault();
  14999. };
  15000. FilesInput.prototype.drop = function (eventDrop) {
  15001. eventDrop.stopPropagation();
  15002. eventDrop.preventDefault();
  15003. this.loadFiles(eventDrop);
  15004. };
  15005. FilesInput.prototype.loadFiles = function (event) {
  15006. var _this = this;
  15007. var that = this;
  15008. if (this.startingProcessingFilesCallback)
  15009. this.startingProcessingFilesCallback();
  15010. var sceneFileToLoad;
  15011. var filesToLoad;
  15012. if (event && event.dataTransfer && event.dataTransfer.files) {
  15013. filesToLoad = event.dataTransfer.files;
  15014. }
  15015. if (event && event.target && event.target.files) {
  15016. filesToLoad = event.target.files;
  15017. }
  15018. if (filesToLoad && filesToLoad.length > 0) {
  15019. for (var i = 0; i < filesToLoad.length; i++) {
  15020. switch (filesToLoad[i].type) {
  15021. case "image/jpeg":
  15022. case "image/png":
  15023. BABYLON.FilesInput.FilesTextures[filesToLoad[i].name] = filesToLoad[i];
  15024. break;
  15025. case "image/targa":
  15026. case "image/vnd.ms-dds":
  15027. BABYLON.FilesInput.FilesToLoad[filesToLoad[i].name] = filesToLoad[i];
  15028. break;
  15029. default:
  15030. if (filesToLoad[i].name.indexOf(".babylon") !== -1 && filesToLoad[i].name.indexOf(".manifest") === -1 && filesToLoad[i].name.indexOf(".incremental") === -1 && filesToLoad[i].name.indexOf(".babylonmeshdata") === -1 && filesToLoad[i].name.indexOf(".babylongeometrydata") === -1) {
  15031. sceneFileToLoad = filesToLoad[i];
  15032. }
  15033. break;
  15034. }
  15035. }
  15036. if (sceneFileToLoad) {
  15037. if (this.currentScene) {
  15038. this.engine.stopRenderLoop();
  15039. this.currentScene.dispose();
  15040. }
  15041. BABYLON.SceneLoader.Load("file:", sceneFileToLoad, this.engine, function (newScene) {
  15042. that.currentScene = newScene;
  15043. that.currentScene.executeWhenReady(function () {
  15044. if (that.currentScene.activeCamera) {
  15045. that.currentScene.activeCamera.attachControl(that.canvas);
  15046. }
  15047. if (that.sceneLoadedCallback) {
  15048. that.sceneLoadedCallback(sceneFileToLoad, that.currentScene);
  15049. }
  15050. that.engine.runRenderLoop(function () {
  15051. that.renderFunction();
  15052. });
  15053. });
  15054. }, function (progress) {
  15055. if (_this.progressCallback) {
  15056. _this.progressCallback(progress);
  15057. }
  15058. });
  15059. } else {
  15060. BABYLON.Tools.Error("Please provide a valid .babylon file.");
  15061. }
  15062. }
  15063. };
  15064. FilesInput.FilesTextures = new Array();
  15065. FilesInput.FilesToLoad = new Array();
  15066. return FilesInput;
  15067. })();
  15068. BABYLON.FilesInput = FilesInput;
  15069. })(BABYLON || (BABYLON = {}));
  15070. var BABYLON;
  15071. (function (BABYLON) {
  15072. var OimoJSPlugin = (function () {
  15073. function OimoJSPlugin() {
  15074. this._registeredMeshes = [];
  15075. /**
  15076. * Update the body position according to the mesh position
  15077. * @param mesh
  15078. */
  15079. this.updateBodyPosition = function (mesh) {
  15080. for (var index = 0; index < this._registeredMeshes.length; index++) {
  15081. var registeredMesh = this._registeredMeshes[index];
  15082. if (registeredMesh.mesh === mesh || registeredMesh.mesh === mesh.parent) {
  15083. var body = registeredMesh.body.body;
  15084. mesh.computeWorldMatrix(true);
  15085. var center = mesh.getBoundingInfo().boundingBox.center;
  15086. body.setPosition(center.x, center.y, center.z);
  15087. body.setOrientation(mesh.rotation.x, mesh.rotation.y, mesh.rotation.z);
  15088. return;
  15089. }
  15090. if (registeredMesh.mesh.parent === mesh) {
  15091. mesh.computeWorldMatrix(true);
  15092. registeredMesh.mesh.computeWorldMatrix(true);
  15093. var absolutePosition = registeredMesh.mesh.getAbsolutePosition();
  15094. var absoluteRotation = mesh.rotation;
  15095. body = registeredMesh.body.body;
  15096. body.setPosition(absolutePosition.x, absolutePosition.y, absolutePosition.z);
  15097. body.setOrientation(absoluteRotation.x, absoluteRotation.y, absoluteRotation.z);
  15098. return;
  15099. }
  15100. }
  15101. };
  15102. }
  15103. OimoJSPlugin.prototype._checkWithEpsilon = function (value) {
  15104. return value < BABYLON.PhysicsEngine.Epsilon ? BABYLON.PhysicsEngine.Epsilon : value;
  15105. };
  15106. OimoJSPlugin.prototype.initialize = function (iterations) {
  15107. this._world = new OIMO.World();
  15108. this._world.clear();
  15109. };
  15110. OimoJSPlugin.prototype.setGravity = function (gravity) {
  15111. this._world.gravity = gravity;
  15112. };
  15113. OimoJSPlugin.prototype.registerMesh = function (mesh, impostor, options) {
  15114. var body = null;
  15115. this.unregisterMesh(mesh);
  15116. mesh.computeWorldMatrix(true);
  15117. switch (impostor) {
  15118. case BABYLON.PhysicsEngine.SphereImpostor:
  15119. var bbox = mesh.getBoundingInfo().boundingBox;
  15120. var radiusX = bbox.maximumWorld.x - bbox.minimumWorld.x;
  15121. var radiusY = bbox.maximumWorld.y - bbox.minimumWorld.y;
  15122. var radiusZ = bbox.maximumWorld.z - bbox.minimumWorld.z;
  15123. var size = Math.max(this._checkWithEpsilon(radiusX), this._checkWithEpsilon(radiusY), this._checkWithEpsilon(radiusZ)) / 2;
  15124. var deltaPosition = mesh.position.subtract(bbox.center);
  15125. body = new OIMO.Body({
  15126. type: 'sphere',
  15127. size: [size],
  15128. pos: [bbox.center.x, bbox.center.y, bbox.center.z],
  15129. rot: [mesh.rotation.x / OIMO.TO_RAD, mesh.rotation.y / OIMO.TO_RAD, mesh.rotation.z / OIMO.TO_RAD],
  15130. move: options.mass != 0,
  15131. config: [options.mass, options.friction, options.restitution],
  15132. world: this._world
  15133. });
  15134. this._registeredMeshes.push({
  15135. mesh: mesh,
  15136. body: body,
  15137. delta: deltaPosition
  15138. });
  15139. break;
  15140. case BABYLON.PhysicsEngine.PlaneImpostor:
  15141. case BABYLON.PhysicsEngine.BoxImpostor:
  15142. bbox = mesh.getBoundingInfo().boundingBox;
  15143. var min = bbox.minimumWorld;
  15144. var max = bbox.maximumWorld;
  15145. var box = max.subtract(min);
  15146. var sizeX = this._checkWithEpsilon(box.x);
  15147. var sizeY = this._checkWithEpsilon(box.y);
  15148. var sizeZ = this._checkWithEpsilon(box.z);
  15149. var deltaPosition = mesh.position.subtract(bbox.center);
  15150. body = new OIMO.Body({
  15151. type: 'box',
  15152. size: [sizeX, sizeY, sizeZ],
  15153. pos: [bbox.center.x, bbox.center.y, bbox.center.z],
  15154. rot: [mesh.rotation.x / OIMO.TO_RAD, mesh.rotation.y / OIMO.TO_RAD, mesh.rotation.z / OIMO.TO_RAD],
  15155. move: options.mass != 0,
  15156. config: [options.mass, options.friction, options.restitution],
  15157. world: this._world
  15158. });
  15159. this._registeredMeshes.push({
  15160. mesh: mesh,
  15161. body: body,
  15162. delta: deltaPosition
  15163. });
  15164. break;
  15165. }
  15166. return body;
  15167. };
  15168. OimoJSPlugin.prototype.registerMeshesAsCompound = function (parts, options) {
  15169. var types = [], sizes = [], positions = [], rotations = [];
  15170. var initialMesh = parts[0].mesh;
  15171. for (var index = 0; index < parts.length; index++) {
  15172. var part = parts[index];
  15173. var bodyParameters = this._createBodyAsCompound(part, options, initialMesh);
  15174. types.push(bodyParameters.type);
  15175. sizes.push.apply(sizes, bodyParameters.size);
  15176. positions.push.apply(positions, bodyParameters.pos);
  15177. rotations.push.apply(rotations, bodyParameters.rot);
  15178. }
  15179. var body = new OIMO.Body({
  15180. type: types,
  15181. size: sizes,
  15182. pos: positions,
  15183. rot: rotations,
  15184. move: options.mass != 0,
  15185. config: [options.mass, options.friction, options.restitution],
  15186. world: this._world
  15187. });
  15188. this._registeredMeshes.push({
  15189. mesh: initialMesh,
  15190. body: body
  15191. });
  15192. return body;
  15193. };
  15194. OimoJSPlugin.prototype._createBodyAsCompound = function (part, options, initialMesh) {
  15195. var bodyParameters = null;
  15196. var mesh = part.mesh;
  15197. switch (part.impostor) {
  15198. case BABYLON.PhysicsEngine.SphereImpostor:
  15199. var bbox = mesh.getBoundingInfo().boundingBox;
  15200. var radiusX = bbox.maximumWorld.x - bbox.minimumWorld.x;
  15201. var radiusY = bbox.maximumWorld.y - bbox.minimumWorld.y;
  15202. var radiusZ = bbox.maximumWorld.z - bbox.minimumWorld.z;
  15203. var size = Math.max(this._checkWithEpsilon(radiusX), this._checkWithEpsilon(radiusY), this._checkWithEpsilon(radiusZ)) / 2;
  15204. bodyParameters = {
  15205. type: 'sphere',
  15206. /* bug with oimo : sphere needs 3 sizes in this case */
  15207. size: [size, -1, -1],
  15208. pos: [mesh.position.x, mesh.position.y, mesh.position.z],
  15209. rot: [mesh.rotation.x / OIMO.TO_RAD, mesh.rotation.y / OIMO.TO_RAD, mesh.rotation.z / OIMO.TO_RAD]
  15210. };
  15211. break;
  15212. case BABYLON.PhysicsEngine.PlaneImpostor:
  15213. case BABYLON.PhysicsEngine.BoxImpostor:
  15214. bbox = mesh.getBoundingInfo().boundingBox;
  15215. var min = bbox.minimumWorld;
  15216. var max = bbox.maximumWorld;
  15217. var box = max.subtract(min);
  15218. var sizeX = this._checkWithEpsilon(box.x);
  15219. var sizeY = this._checkWithEpsilon(box.y);
  15220. var sizeZ = this._checkWithEpsilon(box.z);
  15221. var relativePosition = mesh.position;
  15222. bodyParameters = {
  15223. type: 'box',
  15224. size: [sizeX, sizeY, sizeZ],
  15225. pos: [relativePosition.x, relativePosition.y, relativePosition.z],
  15226. rot: [mesh.rotation.x / OIMO.TO_RAD, mesh.rotation.y / OIMO.TO_RAD, mesh.rotation.z / OIMO.TO_RAD]
  15227. };
  15228. break;
  15229. }
  15230. return bodyParameters;
  15231. };
  15232. OimoJSPlugin.prototype.unregisterMesh = function (mesh) {
  15233. for (var index = 0; index < this._registeredMeshes.length; index++) {
  15234. var registeredMesh = this._registeredMeshes[index];
  15235. if (registeredMesh.mesh === mesh || registeredMesh.mesh === mesh.parent) {
  15236. if (registeredMesh.body) {
  15237. this._world.removeRigidBody(registeredMesh.body.body);
  15238. this._unbindBody(registeredMesh.body);
  15239. }
  15240. this._registeredMeshes.splice(index, 1);
  15241. return;
  15242. }
  15243. }
  15244. };
  15245. OimoJSPlugin.prototype._unbindBody = function (body) {
  15246. for (var index = 0; index < this._registeredMeshes.length; index++) {
  15247. var registeredMesh = this._registeredMeshes[index];
  15248. if (registeredMesh.body === body) {
  15249. registeredMesh.body = null;
  15250. }
  15251. }
  15252. };
  15253. OimoJSPlugin.prototype.applyImpulse = function (mesh, force, contactPoint) {
  15254. for (var index = 0; index < this._registeredMeshes.length; index++) {
  15255. var registeredMesh = this._registeredMeshes[index];
  15256. if (registeredMesh.mesh === mesh || registeredMesh.mesh === mesh.parent) {
  15257. var mass = registeredMesh.body.body.massInfo.mass;
  15258. registeredMesh.body.body.applyImpulse(contactPoint.scale(OIMO.INV_SCALE), force.scale(OIMO.INV_SCALE * mass));
  15259. return;
  15260. }
  15261. }
  15262. };
  15263. OimoJSPlugin.prototype.createLink = function (mesh1, mesh2, pivot1, pivot2, options) {
  15264. var body1 = null, body2 = null;
  15265. for (var index = 0; index < this._registeredMeshes.length; index++) {
  15266. var registeredMesh = this._registeredMeshes[index];
  15267. if (registeredMesh.mesh === mesh1) {
  15268. body1 = registeredMesh.body.body;
  15269. } else if (registeredMesh.mesh === mesh2) {
  15270. body2 = registeredMesh.body.body;
  15271. }
  15272. }
  15273. if (!body1 || !body2) {
  15274. return false;
  15275. }
  15276. if (!options) {
  15277. options = {};
  15278. }
  15279. new OIMO.Link({
  15280. type: options.type,
  15281. body1: body1,
  15282. body2: body2,
  15283. min: options.min,
  15284. max: options.max,
  15285. axe1: options.axe1,
  15286. axe2: options.axe2,
  15287. pos1: [pivot1.x, pivot1.y, pivot1.z],
  15288. pos2: [pivot2.x, pivot2.y, pivot2.z],
  15289. collision: options.collision,
  15290. spring: options.spring,
  15291. world: this._world
  15292. });
  15293. return true;
  15294. };
  15295. OimoJSPlugin.prototype.dispose = function () {
  15296. this._world.clear();
  15297. while (this._registeredMeshes.length) {
  15298. this.unregisterMesh(this._registeredMeshes[0].mesh);
  15299. }
  15300. };
  15301. OimoJSPlugin.prototype.isSupported = function () {
  15302. return OIMO !== undefined;
  15303. };
  15304. OimoJSPlugin.prototype._getLastShape = function (body) {
  15305. var lastShape = body.shapes;
  15306. while (lastShape.next) {
  15307. lastShape = lastShape.next;
  15308. }
  15309. return lastShape;
  15310. };
  15311. OimoJSPlugin.prototype.runOneStep = function (time) {
  15312. this._world.step();
  15313. var i = this._registeredMeshes.length;
  15314. var m;
  15315. while (i--) {
  15316. var body = this._registeredMeshes[i].body.body;
  15317. var mesh = this._registeredMeshes[i].mesh;
  15318. var delta = this._registeredMeshes[i].delta;
  15319. if (!body.sleeping) {
  15320. if (body.shapes.next) {
  15321. var parentShape = this._getLastShape(body);
  15322. mesh.position.x = parentShape.position.x * OIMO.WORLD_SCALE;
  15323. mesh.position.y = parentShape.position.y * OIMO.WORLD_SCALE;
  15324. mesh.position.z = parentShape.position.z * OIMO.WORLD_SCALE;
  15325. var mtx = BABYLON.Matrix.FromArray(body.getMatrix());
  15326. if (!mesh.rotationQuaternion) {
  15327. mesh.rotationQuaternion = new BABYLON.Quaternion(0, 0, 0, 1);
  15328. }
  15329. mesh.rotationQuaternion.fromRotationMatrix(mtx);
  15330. mesh.computeWorldMatrix();
  15331. } else {
  15332. m = body.getMatrix();
  15333. mtx = BABYLON.Matrix.FromArray(m);
  15334. var bodyX = mtx.m[12], bodyY = mtx.m[13], bodyZ = mtx.m[14];
  15335. if (!delta) {
  15336. mesh.position.x = bodyX;
  15337. mesh.position.y = bodyY;
  15338. mesh.position.z = bodyZ;
  15339. } else {
  15340. mesh.position.x = bodyX + delta.x;
  15341. mesh.position.y = bodyY + delta.y;
  15342. mesh.position.z = bodyZ + delta.z;
  15343. }
  15344. if (!mesh.rotationQuaternion) {
  15345. mesh.rotationQuaternion = new BABYLON.Quaternion(0, 0, 0, 1);
  15346. }
  15347. mesh.rotationQuaternion.fromRotationMatrix(mtx);
  15348. mesh.computeWorldMatrix();
  15349. }
  15350. }
  15351. }
  15352. };
  15353. return OimoJSPlugin;
  15354. })();
  15355. BABYLON.OimoJSPlugin = OimoJSPlugin;
  15356. })(BABYLON || (BABYLON = {}));
  15357. var BABYLON;
  15358. (function (BABYLON) {
  15359. var PhysicsEngine = (function () {
  15360. function PhysicsEngine(plugin) {
  15361. this._currentPlugin = plugin || new BABYLON.OimoJSPlugin();
  15362. }
  15363. PhysicsEngine.prototype._initialize = function (gravity) {
  15364. this._currentPlugin.initialize();
  15365. this._setGravity(gravity);
  15366. };
  15367. PhysicsEngine.prototype._runOneStep = function (delta) {
  15368. if (delta > 0.1) {
  15369. delta = 0.1;
  15370. } else if (delta <= 0) {
  15371. delta = 1.0 / 60.0;
  15372. }
  15373. this._currentPlugin.runOneStep(delta);
  15374. };
  15375. PhysicsEngine.prototype._setGravity = function (gravity) {
  15376. this.gravity = gravity || new BABYLON.Vector3(0, -9.82, 0);
  15377. this._currentPlugin.setGravity(this.gravity);
  15378. };
  15379. PhysicsEngine.prototype._registerMesh = function (mesh, impostor, options) {
  15380. return this._currentPlugin.registerMesh(mesh, impostor, options);
  15381. };
  15382. PhysicsEngine.prototype._registerMeshesAsCompound = function (parts, options) {
  15383. return this._currentPlugin.registerMeshesAsCompound(parts, options);
  15384. };
  15385. PhysicsEngine.prototype._unregisterMesh = function (mesh) {
  15386. this._currentPlugin.unregisterMesh(mesh);
  15387. };
  15388. PhysicsEngine.prototype._applyImpulse = function (mesh, force, contactPoint) {
  15389. this._currentPlugin.applyImpulse(mesh, force, contactPoint);
  15390. };
  15391. PhysicsEngine.prototype._createLink = function (mesh1, mesh2, pivot1, pivot2, options) {
  15392. return this._currentPlugin.createLink(mesh1, mesh2, pivot1, pivot2, options);
  15393. };
  15394. PhysicsEngine.prototype._updateBodyPosition = function (mesh) {
  15395. this._currentPlugin.updateBodyPosition(mesh);
  15396. };
  15397. PhysicsEngine.prototype.dispose = function () {
  15398. this._currentPlugin.dispose();
  15399. };
  15400. PhysicsEngine.prototype.isSupported = function () {
  15401. return this._currentPlugin.isSupported();
  15402. };
  15403. PhysicsEngine.NoImpostor = 0;
  15404. PhysicsEngine.SphereImpostor = 1;
  15405. PhysicsEngine.BoxImpostor = 2;
  15406. PhysicsEngine.PlaneImpostor = 3;
  15407. PhysicsEngine.MeshImpostor = 4;
  15408. PhysicsEngine.CapsuleImpostor = 5;
  15409. PhysicsEngine.ConeImpostor = 6;
  15410. PhysicsEngine.CylinderImpostor = 7;
  15411. PhysicsEngine.ConvexHullImpostor = 8;
  15412. PhysicsEngine.Epsilon = 0.001;
  15413. return PhysicsEngine;
  15414. })();
  15415. BABYLON.PhysicsEngine = PhysicsEngine;
  15416. })(BABYLON || (BABYLON = {}));
  15417. var BABYLON;
  15418. (function (BABYLON) {
  15419. var serializeLight = function (light) {
  15420. var serializationObject = {};
  15421. serializationObject.name = light.name;
  15422. serializationObject.id = light.id;
  15423. serializationObject.tags = BABYLON.Tags.GetTags(light);
  15424. if (light instanceof BABYLON.PointLight) {
  15425. serializationObject.type = 0;
  15426. serializationObject.position = light.position.asArray();
  15427. } else if (light instanceof BABYLON.DirectionalLight) {
  15428. serializationObject.type = 1;
  15429. var directionalLight = light;
  15430. serializationObject.position = directionalLight.position.asArray();
  15431. serializationObject.direction = directionalLight.direction.asArray();
  15432. } else if (light instanceof BABYLON.SpotLight) {
  15433. serializationObject.type = 2;
  15434. var spotLight = light;
  15435. serializationObject.position = spotLight.position.asArray();
  15436. serializationObject.direction = spotLight.position.asArray();
  15437. serializationObject.angle = spotLight.angle;
  15438. serializationObject.exponent = spotLight.exponent;
  15439. } else if (light instanceof BABYLON.HemisphericLight) {
  15440. serializationObject.type = 3;
  15441. var hemisphericLight = light;
  15442. serializationObject.direction = hemisphericLight.direction.asArray();
  15443. serializationObject.groundColor = hemisphericLight.groundColor.asArray();
  15444. }
  15445. if (light.intensity) {
  15446. serializationObject.intensity = light.intensity;
  15447. }
  15448. serializationObject.range = light.range;
  15449. serializationObject.diffuse = light.diffuse.asArray();
  15450. serializationObject.specular = light.specular.asArray();
  15451. return serializationObject;
  15452. };
  15453. var serializeFresnelParameter = function (fresnelParameter) {
  15454. var serializationObject = {};
  15455. serializationObject.isEnabled = fresnelParameter.isEnabled;
  15456. serializationObject.leftColor = fresnelParameter.leftColor;
  15457. serializationObject.rightColor = fresnelParameter.rightColor;
  15458. serializationObject.bias = fresnelParameter.bias;
  15459. serializationObject.power = fresnelParameter.power;
  15460. return serializationObject;
  15461. };
  15462. var serializeCamera = function (camera) {
  15463. var serializationObject = {};
  15464. serializationObject.name = camera.name;
  15465. serializationObject.tags = BABYLON.Tags.GetTags(camera);
  15466. serializationObject.id = camera.id;
  15467. serializationObject.position = camera.position.asArray();
  15468. if (camera.parent) {
  15469. serializationObject.parentId = camera.parent.id;
  15470. }
  15471. serializationObject.rotation = camera.rotation.asArray();
  15472. if (camera.lockedTarget && camera.lockedTarget.id) {
  15473. serializationObject.lockedTargetId = camera.lockedTarget.id;
  15474. }
  15475. serializationObject.fov = camera.fov;
  15476. serializationObject.minZ = camera.minZ;
  15477. serializationObject.maxZ = camera.maxZ;
  15478. serializationObject.speed = camera.speed;
  15479. serializationObject.inertia = camera.inertia;
  15480. serializationObject.checkCollisions = camera.checkCollisions;
  15481. serializationObject.applyGravity = camera.applyGravity;
  15482. if (camera.ellipsoid) {
  15483. serializationObject.ellipsoid = camera.ellipsoid.asArray();
  15484. }
  15485. appendAnimations(camera, serializationObject);
  15486. serializationObject.layerMask = camera.layerMask;
  15487. return serializationObject;
  15488. };
  15489. var appendAnimations = function (source, destination) {
  15490. if (source.animations) {
  15491. destination.animations = [];
  15492. for (var animationIndex = 0; animationIndex < source.animations.length; animationIndex++) {
  15493. var animation = source.animations[animationIndex];
  15494. destination.animations.push(serializeAnimation(animation));
  15495. }
  15496. }
  15497. };
  15498. var serializeAnimation = function (animation) {
  15499. var serializationObject = {};
  15500. serializationObject.name = animation.name;
  15501. serializationObject.property = animation.targetProperty;
  15502. serializationObject.framePerSecond = animation.framePerSecond;
  15503. serializationObject.dataType = animation.dataType;
  15504. serializationObject.loopBehavior = animation.loopMode;
  15505. var dataType = animation.dataType;
  15506. serializationObject.keys = [];
  15507. var keys = animation.getKeys();
  15508. for (var index = 0; index < keys.length; index++) {
  15509. var animationKey = keys[index];
  15510. var key = {};
  15511. key.frame = animationKey.frame;
  15512. switch (dataType) {
  15513. case BABYLON.Animation.ANIMATIONTYPE_FLOAT:
  15514. key.values = [animationKey.value];
  15515. break;
  15516. case BABYLON.Animation.ANIMATIONTYPE_QUATERNION:
  15517. case BABYLON.Animation.ANIMATIONTYPE_MATRIX:
  15518. case BABYLON.Animation.ANIMATIONTYPE_VECTOR3:
  15519. key.values = animationKey.value.asArray();
  15520. break;
  15521. }
  15522. serializationObject.keys.push(key);
  15523. }
  15524. return serializationObject;
  15525. };
  15526. var serializeMultiMaterial = function (material) {
  15527. var serializationObject = {};
  15528. serializationObject.name = material.name;
  15529. serializationObject.id = material.id;
  15530. serializationObject.tags = BABYLON.Tags.GetTags(material);
  15531. serializationObject.materials = [];
  15532. for (var matIndex = 0; matIndex < material.subMaterials.length; matIndex++) {
  15533. var subMat = material.subMaterials[matIndex];
  15534. if (subMat) {
  15535. serializationObject.materials.push(subMat.id);
  15536. } else {
  15537. serializationObject.materials.push(null);
  15538. }
  15539. }
  15540. return serializationObject;
  15541. };
  15542. var serializeMaterial = function (material) {
  15543. var serializationObject = {};
  15544. serializationObject.name = material.name;
  15545. serializationObject.ambient = material.ambientColor.asArray();
  15546. serializationObject.diffuse = material.diffuseColor.asArray();
  15547. serializationObject.specular = material.specularColor.asArray();
  15548. serializationObject.specularPower = material.specularPower;
  15549. serializationObject.emissive = material.emissiveColor.asArray();
  15550. serializationObject.alpha = material.alpha;
  15551. serializationObject.id = material.id;
  15552. serializationObject.tags = BABYLON.Tags.GetTags(material);
  15553. serializationObject.backFaceCulling = material.backFaceCulling;
  15554. if (material.diffuseTexture) {
  15555. serializationObject.diffuseTexture = serializeTexture(material.diffuseTexture);
  15556. }
  15557. if (material.diffuseFresnelParameters) {
  15558. serializationObject.diffuseFresnelParameters = serializeFresnelParameter(material.diffuseFresnelParameters);
  15559. }
  15560. if (material.ambientTexture) {
  15561. serializationObject.ambientTexture = serializeTexture(material.ambientTexture);
  15562. }
  15563. if (material.opacityTexture) {
  15564. serializationObject.opacityTexture = serializeTexture(material.opacityTexture);
  15565. }
  15566. if (material.opacityFresnelParameters) {
  15567. serializationObject.opacityFresnelParameters = serializeFresnelParameter(material.opacityFresnelParameters);
  15568. }
  15569. if (material.reflectionTexture) {
  15570. serializationObject.reflectionTexture = serializeTexture(material.reflectionTexture);
  15571. }
  15572. if (material.reflectionFresnelParameters) {
  15573. serializationObject.reflectionFresnelParameters = serializeFresnelParameter(material.reflectionFresnelParameters);
  15574. }
  15575. if (material.emissiveTexture) {
  15576. serializationObject.emissiveTexture = serializeTexture(material.emissiveTexture);
  15577. }
  15578. if (material.emissiveFresnelParameters) {
  15579. serializationObject.emissiveFresnelParameters = serializeFresnelParameter(material.emissiveFresnelParameters);
  15580. }
  15581. if (material.specularTexture) {
  15582. serializationObject.specularTexture = serializeTexture(material.specularTexture);
  15583. }
  15584. if (material.bumpTexture) {
  15585. serializationObject.bumpTexture = serializeTexture(material.bumpTexture);
  15586. }
  15587. return serializationObject;
  15588. };
  15589. var serializeTexture = function (texture) {
  15590. var serializationObject = {};
  15591. if (!texture.name) {
  15592. return null;
  15593. }
  15594. if (texture instanceof BABYLON.CubeTexture) {
  15595. serializationObject.name = texture.name;
  15596. serializationObject.hasAlpha = texture.hasAlpha;
  15597. serializationObject.level = texture.level;
  15598. serializationObject.coordinatesMode = texture.coordinatesMode;
  15599. return serializationObject;
  15600. }
  15601. if (texture instanceof BABYLON.MirrorTexture) {
  15602. var mirrorTexture = texture;
  15603. serializationObject.renderTargetSize = mirrorTexture.getRenderSize();
  15604. serializationObject.renderList = [];
  15605. for (var index = 0; index < mirrorTexture.renderList.length; index++) {
  15606. serializationObject.renderList.push(mirrorTexture.renderList[index].id);
  15607. }
  15608. serializationObject.mirrorPlane = mirrorTexture.mirrorPlane.asArray();
  15609. } else if (texture instanceof BABYLON.RenderTargetTexture) {
  15610. var renderTargetTexture = texture;
  15611. serializationObject.renderTargetSize = renderTargetTexture.getRenderSize();
  15612. serializationObject.renderList = [];
  15613. for (index = 0; index < renderTargetTexture.renderList.length; index++) {
  15614. serializationObject.renderList.push(renderTargetTexture.renderList[index].id);
  15615. }
  15616. }
  15617. var regularTexture = texture;
  15618. serializationObject.name = texture.name;
  15619. serializationObject.hasAlpha = texture.hasAlpha;
  15620. serializationObject.level = texture.level;
  15621. serializationObject.coordinatesIndex = texture.coordinatesIndex;
  15622. serializationObject.coordinatesMode = texture.coordinatesMode;
  15623. serializationObject.uOffset = regularTexture.uOffset;
  15624. serializationObject.vOffset = regularTexture.vOffset;
  15625. serializationObject.uScale = regularTexture.uScale;
  15626. serializationObject.vScale = regularTexture.vScale;
  15627. serializationObject.uAng = regularTexture.uAng;
  15628. serializationObject.vAng = regularTexture.vAng;
  15629. serializationObject.wAng = regularTexture.wAng;
  15630. serializationObject.wrapU = texture.wrapU;
  15631. serializationObject.wrapV = texture.wrapV;
  15632. appendAnimations(texture, serializationObject);
  15633. return serializationObject;
  15634. };
  15635. var serializeSkeleton = function (skeleton) {
  15636. var serializationObject = {};
  15637. serializationObject.name = skeleton.name;
  15638. serializationObject.id = skeleton.id;
  15639. serializationObject.bones = [];
  15640. for (var index = 0; index < skeleton.bones.length; index++) {
  15641. var bone = skeleton.bones[index];
  15642. var serializedBone = {
  15643. parentBoneIndex: bone.getParent() ? skeleton.bones.indexOf(bone.getParent()) : -1,
  15644. name: bone.name,
  15645. matrix: bone.getLocalMatrix().toArray()
  15646. };
  15647. serializationObject.bones.push(serializedBone);
  15648. if (bone.animations && bone.animations.length > 0) {
  15649. serializedBone.animation = serializeAnimation(bone.animations[0]);
  15650. }
  15651. }
  15652. return serializationObject;
  15653. };
  15654. var serializeParticleSystem = function (particleSystem) {
  15655. var serializationObject = {};
  15656. serializationObject.emitterId = particleSystem.emitter.id;
  15657. serializationObject.capacity = particleSystem.getCapacity();
  15658. if (particleSystem.particleTexture) {
  15659. serializationObject.textureName = particleSystem.particleTexture.name;
  15660. }
  15661. serializationObject.minAngularSpeed = particleSystem.minAngularSpeed;
  15662. serializationObject.maxAngularSpeed = particleSystem.maxAngularSpeed;
  15663. serializationObject.minSize = particleSystem.minSize;
  15664. serializationObject.maxSize = particleSystem.maxSize;
  15665. serializationObject.minLifeTime = particleSystem.minLifeTime;
  15666. serializationObject.maxLifeTime = particleSystem.maxLifeTime;
  15667. serializationObject.emitRate = particleSystem.emitRate;
  15668. serializationObject.minEmitBox = particleSystem.minEmitBox.asArray();
  15669. serializationObject.maxEmitBox = particleSystem.maxEmitBox.asArray();
  15670. serializationObject.gravity = particleSystem.gravity.asArray();
  15671. serializationObject.direction1 = particleSystem.direction1.asArray();
  15672. serializationObject.direction2 = particleSystem.direction2.asArray();
  15673. serializationObject.color1 = particleSystem.color1.asArray();
  15674. serializationObject.color2 = particleSystem.color2.asArray();
  15675. serializationObject.colorDead = particleSystem.colorDead.asArray();
  15676. serializationObject.updateSpeed = particleSystem.updateSpeed;
  15677. serializationObject.targetStopDuration = particleSystem.targetStopDuration;
  15678. serializationObject.textureMask = particleSystem.textureMask.asArray();
  15679. serializationObject.blendMode = particleSystem.blendMode;
  15680. return serializationObject;
  15681. };
  15682. var serializeLensFlareSystem = function (lensFlareSystem) {
  15683. var serializationObject = {};
  15684. serializationObject.emitterId = lensFlareSystem.getEmitter().id;
  15685. serializationObject.borderLimit = lensFlareSystem.borderLimit;
  15686. serializationObject.flares = [];
  15687. for (var index = 0; index < lensFlareSystem.lensFlares.length; index++) {
  15688. var flare = lensFlareSystem.lensFlares[index];
  15689. serializationObject.flares.push({
  15690. size: flare.size,
  15691. position: flare.position,
  15692. color: flare.color.asArray(),
  15693. textureName: BABYLON.Tools.GetFilename(flare.texture.name)
  15694. });
  15695. }
  15696. return serializationObject;
  15697. };
  15698. var serializeShadowGenerator = function (light) {
  15699. var serializationObject = {};
  15700. var shadowGenerator = light.getShadowGenerator();
  15701. serializationObject.lightId = light.id;
  15702. serializationObject.mapSize = shadowGenerator.getShadowMap().getRenderSize();
  15703. serializationObject.useVarianceShadowMap = shadowGenerator.useVarianceShadowMap;
  15704. serializationObject.usePoissonSampling = shadowGenerator.usePoissonSampling;
  15705. serializationObject.renderList = [];
  15706. for (var meshIndex = 0; meshIndex < shadowGenerator.getShadowMap().renderList.length; meshIndex++) {
  15707. var mesh = shadowGenerator.getShadowMap().renderList[meshIndex];
  15708. serializationObject.renderList.push(mesh.id);
  15709. }
  15710. return serializationObject;
  15711. };
  15712. var serializedGeometries = [];
  15713. var serializeGeometry = function (geometry, serializationGeometries) {
  15714. if (serializedGeometries[geometry.id]) {
  15715. return;
  15716. }
  15717. if (geometry instanceof BABYLON.Geometry.Primitives.Box) {
  15718. serializationGeometries.boxes.push(serializeBox(geometry));
  15719. } else if (geometry instanceof BABYLON.Geometry.Primitives.Sphere) {
  15720. serializationGeometries.spheres.push(serializeSphere(geometry));
  15721. } else if (geometry instanceof BABYLON.Geometry.Primitives.Cylinder) {
  15722. serializationGeometries.cylinders.push(serializeCylinder(geometry));
  15723. } else if (geometry instanceof BABYLON.Geometry.Primitives.Torus) {
  15724. serializationGeometries.toruses.push(serializeTorus(geometry));
  15725. } else if (geometry instanceof BABYLON.Geometry.Primitives.Ground) {
  15726. serializationGeometries.grounds.push(serializeGround(geometry));
  15727. } else if (geometry instanceof BABYLON.Geometry.Primitives.Plane) {
  15728. serializationGeometries.planes.push(serializePlane(geometry));
  15729. } else if (geometry instanceof BABYLON.Geometry.Primitives.TorusKnot) {
  15730. serializationGeometries.torusKnots.push(serializeTorusKnot(geometry));
  15731. } else if (geometry instanceof BABYLON.Geometry.Primitives._Primitive) {
  15732. throw new Error("Unknow primitive type");
  15733. } else {
  15734. serializationGeometries.vertexData.push(serializeVertexData(geometry));
  15735. }
  15736. serializedGeometries[geometry.id] = true;
  15737. };
  15738. var serializeGeometryBase = function (geometry) {
  15739. var serializationObject = {};
  15740. serializationObject.id = geometry.id;
  15741. if (BABYLON.Tags.HasTags(geometry)) {
  15742. serializationObject.tags = BABYLON.Tags.GetTags(geometry);
  15743. }
  15744. return serializationObject;
  15745. };
  15746. var serializeVertexData = function (vertexData) {
  15747. var serializationObject = serializeGeometryBase(vertexData);
  15748. if (vertexData.isVerticesDataPresent(BABYLON.VertexBuffer.PositionKind)) {
  15749. serializationObject.positions = vertexData.getVerticesData(BABYLON.VertexBuffer.PositionKind);
  15750. }
  15751. if (vertexData.isVerticesDataPresent(BABYLON.VertexBuffer.NormalKind)) {
  15752. serializationObject.normals = vertexData.getVerticesData(BABYLON.VertexBuffer.NormalKind);
  15753. }
  15754. if (vertexData.isVerticesDataPresent(BABYLON.VertexBuffer.UVKind)) {
  15755. serializationObject.uvs = vertexData.getVerticesData(BABYLON.VertexBuffer.UVKind);
  15756. }
  15757. if (vertexData.isVerticesDataPresent(BABYLON.VertexBuffer.UV2Kind)) {
  15758. serializationObject.uvs2 = vertexData.getVerticesData(BABYLON.VertexBuffer.UV2Kind);
  15759. }
  15760. if (vertexData.isVerticesDataPresent(BABYLON.VertexBuffer.ColorKind)) {
  15761. serializationObject.colors = vertexData.getVerticesData(BABYLON.VertexBuffer.ColorKind);
  15762. }
  15763. if (vertexData.isVerticesDataPresent(BABYLON.VertexBuffer.MatricesIndicesKind)) {
  15764. serializationObject.matricesIndices = vertexData.getVerticesData(BABYLON.VertexBuffer.MatricesIndicesKind);
  15765. serializationObject.matricesIndices._isExpanded = true;
  15766. }
  15767. if (vertexData.isVerticesDataPresent(BABYLON.VertexBuffer.MatricesWeightsKind)) {
  15768. serializationObject.matricesWeights = vertexData.getVerticesData(BABYLON.VertexBuffer.MatricesWeightsKind);
  15769. }
  15770. serializationObject.indices = vertexData.getIndices();
  15771. return serializationObject;
  15772. };
  15773. var serializePrimitive = function (primitive) {
  15774. var serializationObject = serializeGeometryBase(primitive);
  15775. serializationObject.canBeRegenerated = primitive.canBeRegenerated();
  15776. return serializationObject;
  15777. };
  15778. var serializeBox = function (box) {
  15779. var serializationObject = serializePrimitive(box);
  15780. serializationObject.size = box.size;
  15781. return serializationObject;
  15782. };
  15783. var serializeSphere = function (sphere) {
  15784. var serializationObject = serializePrimitive(sphere);
  15785. serializationObject.segments = sphere.segments;
  15786. serializationObject.diameter = sphere.diameter;
  15787. return serializationObject;
  15788. };
  15789. var serializeCylinder = function (cylinder) {
  15790. var serializationObject = serializePrimitive(cylinder);
  15791. serializationObject.height = cylinder.height;
  15792. serializationObject.diameterTop = cylinder.diameterTop;
  15793. serializationObject.diameterBottom = cylinder.diameterBottom;
  15794. serializationObject.tessellation = cylinder.tessellation;
  15795. return serializationObject;
  15796. };
  15797. var serializeTorus = function (torus) {
  15798. var serializationObject = serializePrimitive(torus);
  15799. serializationObject.diameter = torus.diameter;
  15800. serializationObject.thickness = torus.thickness;
  15801. serializationObject.tessellation = torus.tessellation;
  15802. return serializationObject;
  15803. };
  15804. var serializeGround = function (ground) {
  15805. var serializationObject = serializePrimitive(ground);
  15806. serializationObject.width = ground.width;
  15807. serializationObject.height = ground.height;
  15808. serializationObject.subdivisions = ground.subdivisions;
  15809. return serializationObject;
  15810. };
  15811. var serializePlane = function (plane) {
  15812. var serializationObject = serializePrimitive(plane);
  15813. serializationObject.size = plane.size;
  15814. return serializationObject;
  15815. };
  15816. var serializeTorusKnot = function (torusKnot) {
  15817. var serializationObject = serializePrimitive(torusKnot);
  15818. serializationObject.radius = torusKnot.radius;
  15819. serializationObject.tube = torusKnot.tube;
  15820. serializationObject.radialSegments = torusKnot.radialSegments;
  15821. serializationObject.tubularSegments = torusKnot.tubularSegments;
  15822. serializationObject.p = torusKnot.p;
  15823. serializationObject.q = torusKnot.q;
  15824. return serializationObject;
  15825. };
  15826. var serializeMesh = function (mesh, serializationScene) {
  15827. var serializationObject = {};
  15828. serializationObject.name = mesh.name;
  15829. serializationObject.id = mesh.id;
  15830. if (BABYLON.Tags.HasTags(mesh)) {
  15831. serializationObject.tags = BABYLON.Tags.GetTags(mesh);
  15832. }
  15833. serializationObject.position = mesh.position.asArray();
  15834. if (mesh.rotationQuaternion) {
  15835. serializationObject.rotationQuaternion = mesh.rotationQuaternion.asArray();
  15836. } else if (mesh.rotation) {
  15837. serializationObject.rotation = mesh.rotation.asArray();
  15838. }
  15839. serializationObject.scaling = mesh.scaling.asArray();
  15840. serializationObject.localMatrix = mesh.getPivotMatrix().asArray();
  15841. serializationObject.isEnabled = mesh.isEnabled();
  15842. serializationObject.isVisible = mesh.isVisible;
  15843. serializationObject.infiniteDistance = mesh.infiniteDistance;
  15844. serializationObject.pickable = mesh.isPickable;
  15845. serializationObject.receiveShadows = mesh.receiveShadows;
  15846. serializationObject.billboardMode = mesh.billboardMode;
  15847. serializationObject.visibility = mesh.visibility;
  15848. serializationObject.checkCollisions = mesh.checkCollisions;
  15849. if (mesh.parent) {
  15850. serializationObject.parentId = mesh.parent.id;
  15851. }
  15852. var geometry = mesh._geometry;
  15853. if (geometry) {
  15854. var geometryId = geometry.id;
  15855. serializationObject.geometryId = geometryId;
  15856. if (!mesh.getScene().getGeometryByID(geometryId)) {
  15857. serializeGeometry(geometry, serializationScene.geometries);
  15858. }
  15859. serializationObject.subMeshes = [];
  15860. for (var subIndex = 0; subIndex < mesh.subMeshes.length; subIndex++) {
  15861. var subMesh = mesh.subMeshes[subIndex];
  15862. serializationObject.subMeshes.push({
  15863. materialIndex: subMesh.materialIndex,
  15864. verticesStart: subMesh.verticesStart,
  15865. verticesCount: subMesh.verticesCount,
  15866. indexStart: subMesh.indexStart,
  15867. indexCount: subMesh.indexCount
  15868. });
  15869. }
  15870. }
  15871. if (mesh.material) {
  15872. serializationObject.materialId = mesh.material.id;
  15873. } else {
  15874. mesh.material = null;
  15875. }
  15876. if (mesh.skeleton) {
  15877. serializationObject.skeletonId = mesh.skeleton.id;
  15878. }
  15879. if (mesh.getPhysicsImpostor() !== BABYLON.PhysicsEngine.NoImpostor) {
  15880. serializationObject.physicsMass = mesh.getPhysicsMass();
  15881. serializationObject.physicsFriction = mesh.getPhysicsFriction();
  15882. serializationObject.physicsRestitution = mesh.getPhysicsRestitution();
  15883. switch (mesh.getPhysicsImpostor()) {
  15884. case BABYLON.PhysicsEngine.BoxImpostor:
  15885. serializationObject.physicsImpostor = 1;
  15886. break;
  15887. case BABYLON.PhysicsEngine.SphereImpostor:
  15888. serializationObject.physicsImpostor = 2;
  15889. break;
  15890. }
  15891. }
  15892. serializationObject.instances = [];
  15893. for (var index = 0; index < mesh.instances.length; index++) {
  15894. var instance = mesh.instances[index];
  15895. var serializationInstance = {
  15896. name: instance.name,
  15897. position: instance.position,
  15898. rotation: instance.rotation,
  15899. rotationQuaternion: instance.rotationQuaternion,
  15900. scaling: instance.scaling
  15901. };
  15902. serializationObject.instances.push(serializationInstance);
  15903. appendAnimations(instance, serializationInstance);
  15904. }
  15905. appendAnimations(mesh, serializationObject);
  15906. serializationObject.layerMask = mesh.layerMask;
  15907. return serializationObject;
  15908. };
  15909. var SceneSerializer = (function () {
  15910. function SceneSerializer() {
  15911. }
  15912. SceneSerializer.Serialize = function (scene) {
  15913. var serializationObject = {};
  15914. serializationObject.useDelayedTextureLoading = scene.useDelayedTextureLoading;
  15915. serializationObject.autoClear = scene.autoClear;
  15916. serializationObject.clearColor = scene.clearColor.asArray();
  15917. serializationObject.ambientColor = scene.ambientColor.asArray();
  15918. serializationObject.gravity = scene.gravity.asArray();
  15919. if (scene.fogMode && scene.fogMode !== 0) {
  15920. serializationObject.fogMode = scene.fogMode;
  15921. serializationObject.fogColor = scene.fogColor.asArray();
  15922. serializationObject.fogStart = scene.fogStart;
  15923. serializationObject.fogEnd = scene.fogEnd;
  15924. serializationObject.fogDensity = scene.fogDensity;
  15925. }
  15926. serializationObject.lights = [];
  15927. for (var index = 0; index < scene.lights.length; index++) {
  15928. var light = scene.lights[index];
  15929. serializationObject.lights.push(serializeLight(light));
  15930. }
  15931. serializationObject.cameras = [];
  15932. for (index = 0; index < scene.cameras.length; index++) {
  15933. var camera = scene.cameras[index];
  15934. if (camera instanceof BABYLON.FreeCamera) {
  15935. serializationObject.cameras.push(serializeCamera(camera));
  15936. }
  15937. }
  15938. if (scene.activeCamera) {
  15939. serializationObject.activeCameraID = scene.activeCamera.id;
  15940. }
  15941. serializationObject.materials = [];
  15942. serializationObject.multiMaterials = [];
  15943. for (index = 0; index < scene.materials.length; index++) {
  15944. var material = scene.materials[index];
  15945. if (material instanceof BABYLON.StandardMaterial) {
  15946. serializationObject.materials.push(serializeMaterial(material));
  15947. } else if (material instanceof BABYLON.MultiMaterial) {
  15948. serializationObject.multiMaterials.push(serializeMultiMaterial(material));
  15949. }
  15950. }
  15951. serializationObject.skeletons = [];
  15952. for (index = 0; index < scene.skeletons.length; index++) {
  15953. serializationObject.skeletons.push(serializeSkeleton(scene.skeletons[index]));
  15954. }
  15955. serializationObject.geometries = {};
  15956. serializationObject.geometries.boxes = [];
  15957. serializationObject.geometries.spheres = [];
  15958. serializationObject.geometries.cylinders = [];
  15959. serializationObject.geometries.toruses = [];
  15960. serializationObject.geometries.grounds = [];
  15961. serializationObject.geometries.planes = [];
  15962. serializationObject.geometries.torusKnots = [];
  15963. serializationObject.geometries.vertexData = [];
  15964. serializedGeometries = [];
  15965. var geometries = scene.getGeometries();
  15966. for (var index = 0; index < geometries.length; index++) {
  15967. var geometry = geometries[index];
  15968. if (geometry.isReady()) {
  15969. serializeGeometry(geometry, serializationObject.geometries);
  15970. }
  15971. }
  15972. serializationObject.meshes = [];
  15973. for (index = 0; index < scene.meshes.length; index++) {
  15974. var abstractMesh = scene.meshes[index];
  15975. if (abstractMesh instanceof BABYLON.Mesh) {
  15976. var mesh = abstractMesh;
  15977. if (mesh.delayLoadState === BABYLON.Engine.DELAYLOADSTATE_LOADED || mesh.delayLoadState === BABYLON.Engine.DELAYLOADSTATE_NONE) {
  15978. serializationObject.meshes.push(serializeMesh(mesh, serializationObject));
  15979. }
  15980. }
  15981. }
  15982. serializationObject.particleSystems = [];
  15983. for (index = 0; index < scene.particleSystems.length; index++) {
  15984. serializationObject.particleSystems.push(serializeParticleSystem(scene.particleSystems[index]));
  15985. }
  15986. serializationObject.lensFlareSystems = [];
  15987. for (index = 0; index < scene.lensFlareSystems.length; index++) {
  15988. serializationObject.lensFlareSystems.push(serializeLensFlareSystem(scene.lensFlareSystems[index]));
  15989. }
  15990. serializationObject.shadowGenerators = [];
  15991. for (index = 0; index < scene.lights.length; index++) {
  15992. light = scene.lights[index];
  15993. if (light.getShadowGenerator()) {
  15994. serializationObject.shadowGenerators.push(serializeShadowGenerator(light));
  15995. }
  15996. }
  15997. return serializationObject;
  15998. };
  15999. return SceneSerializer;
  16000. })();
  16001. BABYLON.SceneSerializer = SceneSerializer;
  16002. })(BABYLON || (BABYLON = {}));
  16003. var BABYLON;
  16004. (function (BABYLON) {
  16005. var SceneLoader = (function () {
  16006. function SceneLoader() {
  16007. }
  16008. Object.defineProperty(SceneLoader, "ForceFullSceneLoadingForIncremental", {
  16009. get: function () {
  16010. return SceneLoader._ForceFullSceneLoadingForIncremental;
  16011. },
  16012. set: function (value) {
  16013. SceneLoader._ForceFullSceneLoadingForIncremental = value;
  16014. },
  16015. enumerable: true,
  16016. configurable: true
  16017. });
  16018. Object.defineProperty(SceneLoader, "ShowLoadingScreen", {
  16019. get: function () {
  16020. return SceneLoader._ShowLoadingScreen;
  16021. },
  16022. set: function (value) {
  16023. SceneLoader._ShowLoadingScreen = value;
  16024. },
  16025. enumerable: true,
  16026. configurable: true
  16027. });
  16028. SceneLoader._getPluginForFilename = function (sceneFilename) {
  16029. var dotPosition = sceneFilename.lastIndexOf(".");
  16030. var queryStringPosition = sceneFilename.indexOf("?");
  16031. var extension = sceneFilename.substring(dotPosition, queryStringPosition).toLowerCase();
  16032. for (var index = 0; index < this._registeredPlugins.length; index++) {
  16033. var plugin = this._registeredPlugins[index];
  16034. if (plugin.extensions.indexOf(extension) !== -1) {
  16035. return plugin;
  16036. }
  16037. }
  16038. return this._registeredPlugins[this._registeredPlugins.length - 1];
  16039. };
  16040. SceneLoader.RegisterPlugin = function (plugin) {
  16041. plugin.extensions = plugin.extensions.toLowerCase();
  16042. SceneLoader._registeredPlugins.push(plugin);
  16043. };
  16044. SceneLoader.ImportMesh = function (meshesNames, rootUrl, sceneFilename, scene, onsuccess, progressCallBack, onerror) {
  16045. var manifestChecked = function (success) {
  16046. scene.database = database;
  16047. var plugin = SceneLoader._getPluginForFilename(sceneFilename);
  16048. var importMeshFromData = function (data) {
  16049. var meshes = [];
  16050. var particleSystems = [];
  16051. var skeletons = [];
  16052. try {
  16053. if (!plugin.importMesh(meshesNames, scene, data, rootUrl, meshes, particleSystems, skeletons)) {
  16054. if (onerror) {
  16055. onerror(scene, 'unable to load the scene');
  16056. }
  16057. return;
  16058. }
  16059. } catch (e) {
  16060. if (onerror) {
  16061. onerror(scene, e);
  16062. }
  16063. return;
  16064. }
  16065. if (onsuccess) {
  16066. scene.importedMeshesFiles.push(rootUrl + sceneFilename);
  16067. onsuccess(meshes, particleSystems, skeletons);
  16068. }
  16069. };
  16070. if (sceneFilename.substr && sceneFilename.substr(0, 5) === "data:") {
  16071. importMeshFromData(sceneFilename.substr(5));
  16072. return;
  16073. }
  16074. BABYLON.Tools.LoadFile(rootUrl + sceneFilename, function (data) {
  16075. importMeshFromData(data);
  16076. }, progressCallBack, database);
  16077. };
  16078. var database = new BABYLON.Database(rootUrl + sceneFilename, manifestChecked);
  16079. };
  16080. /**
  16081. * Load a scene
  16082. * @param rootUrl a string that defines the root url for scene and resources
  16083. * @param sceneFilename a string that defines the name of the scene file. can start with "data:" following by the stringified version of the scene
  16084. * @param engine is the instance of BABYLON.Engine to use to create the scene
  16085. */
  16086. SceneLoader.Load = function (rootUrl, sceneFilename, engine, onsuccess, progressCallBack, onerror) {
  16087. SceneLoader.Append(rootUrl, sceneFilename, new BABYLON.Scene(engine), onsuccess, progressCallBack, onerror);
  16088. };
  16089. /**
  16090. * Append a scene
  16091. * @param rootUrl a string that defines the root url for scene and resources
  16092. * @param sceneFilename a string that defines the name of the scene file. can start with "data:" following by the stringified version of the scene
  16093. * @param scene is the instance of BABYLON.Scene to append to
  16094. */
  16095. SceneLoader.Append = function (rootUrl, sceneFilename, scene, onsuccess, progressCallBack, onerror) {
  16096. var plugin = this._getPluginForFilename(sceneFilename.name || sceneFilename);
  16097. var database;
  16098. if (SceneLoader.ShowLoadingScreen) {
  16099. scene.getEngine().displayLoadingUI();
  16100. }
  16101. var loadSceneFromData = function (data) {
  16102. scene.database = database;
  16103. if (!plugin.load(scene, data, rootUrl)) {
  16104. if (onerror) {
  16105. onerror(scene);
  16106. }
  16107. scene.getEngine().hideLoadingUI();
  16108. return;
  16109. }
  16110. if (onsuccess) {
  16111. onsuccess(scene);
  16112. }
  16113. if (SceneLoader.ShowLoadingScreen) {
  16114. scene.executeWhenReady(function () {
  16115. scene.getEngine().hideLoadingUI();
  16116. });
  16117. }
  16118. };
  16119. var manifestChecked = function (success) {
  16120. BABYLON.Tools.LoadFile(rootUrl + sceneFilename, loadSceneFromData, progressCallBack, database);
  16121. };
  16122. if (sceneFilename.substr && sceneFilename.substr(0, 5) === "data:") {
  16123. loadSceneFromData(sceneFilename.substr(5));
  16124. return;
  16125. }
  16126. if (rootUrl.indexOf("file:") === -1) {
  16127. database = new BABYLON.Database(rootUrl + sceneFilename, manifestChecked);
  16128. } else {
  16129. BABYLON.Tools.ReadFile(sceneFilename, loadSceneFromData, progressCallBack);
  16130. }
  16131. };
  16132. SceneLoader._ForceFullSceneLoadingForIncremental = false;
  16133. SceneLoader._ShowLoadingScreen = true;
  16134. SceneLoader._registeredPlugins = new Array();
  16135. return SceneLoader;
  16136. })();
  16137. BABYLON.SceneLoader = SceneLoader;
  16138. ;
  16139. })(BABYLON || (BABYLON = {}));
  16140. var BABYLON;
  16141. (function (BABYLON) {
  16142. (function (Internals) {
  16143. var checkColors4 = function (colors, count) {
  16144. if (colors.length === count * 3) {
  16145. var colors4 = [];
  16146. for (var index = 0; index < colors.length; index += 3) {
  16147. var newIndex = (index / 3) * 4;
  16148. colors4[newIndex] = colors[index];
  16149. colors4[newIndex + 1] = colors[index + 1];
  16150. colors4[newIndex + 2] = colors[index + 2];
  16151. colors4[newIndex + 3] = 1.0;
  16152. }
  16153. return colors4;
  16154. }
  16155. return colors;
  16156. };
  16157. var loadCubeTexture = function (rootUrl, parsedTexture, scene) {
  16158. var texture = new BABYLON.CubeTexture(rootUrl + parsedTexture.name, scene);
  16159. texture.name = parsedTexture.name;
  16160. texture.hasAlpha = parsedTexture.hasAlpha;
  16161. texture.level = parsedTexture.level;
  16162. texture.coordinatesMode = parsedTexture.coordinatesMode;
  16163. return texture;
  16164. };
  16165. var loadTexture = function (rootUrl, parsedTexture, scene) {
  16166. if (!parsedTexture.name && !parsedTexture.isRenderTarget) {
  16167. return null;
  16168. }
  16169. if (parsedTexture.isCube) {
  16170. return loadCubeTexture(rootUrl, parsedTexture, scene);
  16171. }
  16172. var texture;
  16173. if (parsedTexture.mirrorPlane) {
  16174. texture = new BABYLON.MirrorTexture(parsedTexture.name, parsedTexture.renderTargetSize, scene);
  16175. texture._waitingRenderList = parsedTexture.renderList;
  16176. texture.mirrorPlane = BABYLON.Plane.FromArray(parsedTexture.mirrorPlane);
  16177. } else if (parsedTexture.isRenderTarget) {
  16178. texture = new BABYLON.RenderTargetTexture(parsedTexture.name, parsedTexture.renderTargetSize, scene);
  16179. texture._waitingRenderList = parsedTexture.renderList;
  16180. } else {
  16181. texture = new BABYLON.Texture(rootUrl + parsedTexture.name, scene);
  16182. }
  16183. texture.name = parsedTexture.name;
  16184. texture.hasAlpha = parsedTexture.hasAlpha;
  16185. texture.getAlphaFromRGB = parsedTexture.getAlphaFromRGB;
  16186. texture.level = parsedTexture.level;
  16187. texture.coordinatesIndex = parsedTexture.coordinatesIndex;
  16188. texture.coordinatesMode = parsedTexture.coordinatesMode;
  16189. texture.uOffset = parsedTexture.uOffset;
  16190. texture.vOffset = parsedTexture.vOffset;
  16191. texture.uScale = parsedTexture.uScale;
  16192. texture.vScale = parsedTexture.vScale;
  16193. texture.uAng = parsedTexture.uAng;
  16194. texture.vAng = parsedTexture.vAng;
  16195. texture.wAng = parsedTexture.wAng;
  16196. texture.wrapU = parsedTexture.wrapU;
  16197. texture.wrapV = parsedTexture.wrapV;
  16198. if (parsedTexture.animations) {
  16199. for (var animationIndex = 0; animationIndex < parsedTexture.animations.length; animationIndex++) {
  16200. var parsedAnimation = parsedTexture.animations[animationIndex];
  16201. texture.animations.push(parseAnimation(parsedAnimation));
  16202. }
  16203. }
  16204. return texture;
  16205. };
  16206. var parseSkeleton = function (parsedSkeleton, scene) {
  16207. var skeleton = new BABYLON.Skeleton(parsedSkeleton.name, parsedSkeleton.id, scene);
  16208. for (var index = 0; index < parsedSkeleton.bones.length; index++) {
  16209. var parsedBone = parsedSkeleton.bones[index];
  16210. var parentBone = null;
  16211. if (parsedBone.parentBoneIndex > -1) {
  16212. parentBone = skeleton.bones[parsedBone.parentBoneIndex];
  16213. }
  16214. var bone = new BABYLON.Bone(parsedBone.name, skeleton, parentBone, BABYLON.Matrix.FromArray(parsedBone.matrix));
  16215. if (parsedBone.animation) {
  16216. bone.animations.push(parseAnimation(parsedBone.animation));
  16217. }
  16218. }
  16219. return skeleton;
  16220. };
  16221. var parseFresnelParameters = function (parsedFresnelParameters) {
  16222. var fresnelParameters = new BABYLON.FresnelParameters();
  16223. fresnelParameters.isEnabled = parsedFresnelParameters.isEnabled;
  16224. fresnelParameters.leftColor = BABYLON.Color3.FromArray(parsedFresnelParameters.leftColor);
  16225. fresnelParameters.rightColor = BABYLON.Color3.FromArray(parsedFresnelParameters.rightColor);
  16226. fresnelParameters.bias = parsedFresnelParameters.bias;
  16227. fresnelParameters.power = parsedFresnelParameters.power || 1.0;
  16228. return fresnelParameters;
  16229. };
  16230. var parseMaterial = function (parsedMaterial, scene, rootUrl) {
  16231. var material;
  16232. material = new BABYLON.StandardMaterial(parsedMaterial.name, scene);
  16233. material.ambientColor = BABYLON.Color3.FromArray(parsedMaterial.ambient);
  16234. material.diffuseColor = BABYLON.Color3.FromArray(parsedMaterial.diffuse);
  16235. material.specularColor = BABYLON.Color3.FromArray(parsedMaterial.specular);
  16236. material.specularPower = parsedMaterial.specularPower;
  16237. material.emissiveColor = BABYLON.Color3.FromArray(parsedMaterial.emissive);
  16238. material.alpha = parsedMaterial.alpha;
  16239. material.id = parsedMaterial.id;
  16240. BABYLON.Tags.AddTagsTo(material, parsedMaterial.tags);
  16241. material.backFaceCulling = parsedMaterial.backFaceCulling;
  16242. material.wireframe = parsedMaterial.wireframe;
  16243. if (parsedMaterial.diffuseTexture) {
  16244. material.diffuseTexture = loadTexture(rootUrl, parsedMaterial.diffuseTexture, scene);
  16245. }
  16246. if (parsedMaterial.diffuseFresnelParameters) {
  16247. material.diffuseFresnelParameters = parseFresnelParameters(parsedMaterial.diffuseFresnelParameters);
  16248. }
  16249. if (parsedMaterial.ambientTexture) {
  16250. material.ambientTexture = loadTexture(rootUrl, parsedMaterial.ambientTexture, scene);
  16251. }
  16252. if (parsedMaterial.opacityTexture) {
  16253. material.opacityTexture = loadTexture(rootUrl, parsedMaterial.opacityTexture, scene);
  16254. }
  16255. if (parsedMaterial.opacityFresnelParameters) {
  16256. material.opacityFresnelParameters = parseFresnelParameters(parsedMaterial.opacityFresnelParameters);
  16257. }
  16258. if (parsedMaterial.reflectionTexture) {
  16259. material.reflectionTexture = loadTexture(rootUrl, parsedMaterial.reflectionTexture, scene);
  16260. }
  16261. if (parsedMaterial.reflectionFresnelParameters) {
  16262. material.reflectionFresnelParameters = parseFresnelParameters(parsedMaterial.reflectionFresnelParameters);
  16263. }
  16264. if (parsedMaterial.emissiveTexture) {
  16265. material.emissiveTexture = loadTexture(rootUrl, parsedMaterial.emissiveTexture, scene);
  16266. }
  16267. if (parsedMaterial.emissiveFresnelParameters) {
  16268. material.emissiveFresnelParameters = parseFresnelParameters(parsedMaterial.emissiveFresnelParameters);
  16269. }
  16270. if (parsedMaterial.specularTexture) {
  16271. material.specularTexture = loadTexture(rootUrl, parsedMaterial.specularTexture, scene);
  16272. }
  16273. if (parsedMaterial.bumpTexture) {
  16274. material.bumpTexture = loadTexture(rootUrl, parsedMaterial.bumpTexture, scene);
  16275. }
  16276. return material;
  16277. };
  16278. var parseMaterialById = function (id, parsedData, scene, rootUrl) {
  16279. for (var index = 0; index < parsedData.materials.length; index++) {
  16280. var parsedMaterial = parsedData.materials[index];
  16281. if (parsedMaterial.id === id) {
  16282. return parseMaterial(parsedMaterial, scene, rootUrl);
  16283. }
  16284. }
  16285. return null;
  16286. };
  16287. var parseMultiMaterial = function (parsedMultiMaterial, scene) {
  16288. var multiMaterial = new BABYLON.MultiMaterial(parsedMultiMaterial.name, scene);
  16289. multiMaterial.id = parsedMultiMaterial.id;
  16290. BABYLON.Tags.AddTagsTo(multiMaterial, parsedMultiMaterial.tags);
  16291. for (var matIndex = 0; matIndex < parsedMultiMaterial.materials.length; matIndex++) {
  16292. var subMatId = parsedMultiMaterial.materials[matIndex];
  16293. if (subMatId) {
  16294. multiMaterial.subMaterials.push(scene.getMaterialByID(subMatId));
  16295. } else {
  16296. multiMaterial.subMaterials.push(null);
  16297. }
  16298. }
  16299. return multiMaterial;
  16300. };
  16301. var parseLensFlareSystem = function (parsedLensFlareSystem, scene, rootUrl) {
  16302. var emitter = scene.getLastEntryByID(parsedLensFlareSystem.emitterId);
  16303. var lensFlareSystem = new BABYLON.LensFlareSystem("lensFlareSystem#" + parsedLensFlareSystem.emitterId, emitter, scene);
  16304. lensFlareSystem.borderLimit = parsedLensFlareSystem.borderLimit;
  16305. for (var index = 0; index < parsedLensFlareSystem.flares.length; index++) {
  16306. var parsedFlare = parsedLensFlareSystem.flares[index];
  16307. var flare = new BABYLON.LensFlare(parsedFlare.size, parsedFlare.position, BABYLON.Color3.FromArray(parsedFlare.color), rootUrl + parsedFlare.textureName, lensFlareSystem);
  16308. }
  16309. return lensFlareSystem;
  16310. };
  16311. var parseParticleSystem = function (parsedParticleSystem, scene, rootUrl) {
  16312. var emitter = scene.getLastMeshByID(parsedParticleSystem.emitterId);
  16313. var particleSystem = new BABYLON.ParticleSystem("particles#" + emitter.name, parsedParticleSystem.capacity, scene);
  16314. if (parsedParticleSystem.textureName) {
  16315. particleSystem.particleTexture = new BABYLON.Texture(rootUrl + parsedParticleSystem.textureName, scene);
  16316. particleSystem.particleTexture.name = parsedParticleSystem.textureName;
  16317. }
  16318. particleSystem.minAngularSpeed = parsedParticleSystem.minAngularSpeed;
  16319. particleSystem.maxAngularSpeed = parsedParticleSystem.maxAngularSpeed;
  16320. particleSystem.minSize = parsedParticleSystem.minSize;
  16321. particleSystem.maxSize = parsedParticleSystem.maxSize;
  16322. particleSystem.minLifeTime = parsedParticleSystem.minLifeTime;
  16323. particleSystem.maxLifeTime = parsedParticleSystem.maxLifeTime;
  16324. particleSystem.emitter = emitter;
  16325. particleSystem.emitRate = parsedParticleSystem.emitRate;
  16326. particleSystem.minEmitBox = BABYLON.Vector3.FromArray(parsedParticleSystem.minEmitBox);
  16327. particleSystem.maxEmitBox = BABYLON.Vector3.FromArray(parsedParticleSystem.maxEmitBox);
  16328. particleSystem.gravity = BABYLON.Vector3.FromArray(parsedParticleSystem.gravity);
  16329. particleSystem.direction1 = BABYLON.Vector3.FromArray(parsedParticleSystem.direction1);
  16330. particleSystem.direction2 = BABYLON.Vector3.FromArray(parsedParticleSystem.direction2);
  16331. particleSystem.color1 = BABYLON.Color4.FromArray(parsedParticleSystem.color1);
  16332. particleSystem.color2 = BABYLON.Color4.FromArray(parsedParticleSystem.color2);
  16333. particleSystem.colorDead = BABYLON.Color4.FromArray(parsedParticleSystem.colorDead);
  16334. particleSystem.updateSpeed = parsedParticleSystem.updateSpeed;
  16335. particleSystem.targetStopDuration = parsedParticleSystem.targetStopFrame;
  16336. particleSystem.textureMask = BABYLON.Color4.FromArray(parsedParticleSystem.textureMask);
  16337. particleSystem.blendMode = parsedParticleSystem.blendMode;
  16338. particleSystem.start();
  16339. return particleSystem;
  16340. };
  16341. var parseShadowGenerator = function (parsedShadowGenerator, scene) {
  16342. var light = scene.getLightByID(parsedShadowGenerator.lightId);
  16343. var shadowGenerator = new BABYLON.ShadowGenerator(parsedShadowGenerator.mapSize, light);
  16344. for (var meshIndex = 0; meshIndex < parsedShadowGenerator.renderList.length; meshIndex++) {
  16345. var mesh = scene.getMeshByID(parsedShadowGenerator.renderList[meshIndex]);
  16346. shadowGenerator.getShadowMap().renderList.push(mesh);
  16347. }
  16348. if (parsedShadowGenerator.usePoissonSampling) {
  16349. shadowGenerator.usePoissonSampling = true;
  16350. } else {
  16351. shadowGenerator.useVarianceShadowMap = parsedShadowGenerator.useVarianceShadowMap;
  16352. }
  16353. return shadowGenerator;
  16354. };
  16355. var parseAnimation = function (parsedAnimation) {
  16356. var animation = new BABYLON.Animation(parsedAnimation.name, parsedAnimation.property, parsedAnimation.framePerSecond, parsedAnimation.dataType, parsedAnimation.loopBehavior);
  16357. var dataType = parsedAnimation.dataType;
  16358. var keys = [];
  16359. for (var index = 0; index < parsedAnimation.keys.length; index++) {
  16360. var key = parsedAnimation.keys[index];
  16361. var data;
  16362. switch (dataType) {
  16363. case BABYLON.Animation.ANIMATIONTYPE_FLOAT:
  16364. data = key.values[0];
  16365. break;
  16366. case BABYLON.Animation.ANIMATIONTYPE_QUATERNION:
  16367. data = BABYLON.Quaternion.FromArray(key.values);
  16368. break;
  16369. case BABYLON.Animation.ANIMATIONTYPE_MATRIX:
  16370. data = BABYLON.Matrix.FromArray(key.values);
  16371. break;
  16372. case BABYLON.Animation.ANIMATIONTYPE_VECTOR3:
  16373. default:
  16374. data = BABYLON.Vector3.FromArray(key.values);
  16375. break;
  16376. }
  16377. keys.push({
  16378. frame: key.frame,
  16379. value: data
  16380. });
  16381. }
  16382. animation.setKeys(keys);
  16383. return animation;
  16384. };
  16385. var parseLight = function (parsedLight, scene) {
  16386. var light;
  16387. switch (parsedLight.type) {
  16388. case 0:
  16389. light = new BABYLON.PointLight(parsedLight.name, BABYLON.Vector3.FromArray(parsedLight.position), scene);
  16390. break;
  16391. case 1:
  16392. light = new BABYLON.DirectionalLight(parsedLight.name, BABYLON.Vector3.FromArray(parsedLight.direction), scene);
  16393. light.position = BABYLON.Vector3.FromArray(parsedLight.position);
  16394. break;
  16395. case 2:
  16396. light = new BABYLON.SpotLight(parsedLight.name, BABYLON.Vector3.FromArray(parsedLight.position), BABYLON.Vector3.FromArray(parsedLight.direction), parsedLight.angle, parsedLight.exponent, scene);
  16397. break;
  16398. case 3:
  16399. light = new BABYLON.HemisphericLight(parsedLight.name, BABYLON.Vector3.FromArray(parsedLight.direction), scene);
  16400. light.groundColor = BABYLON.Color3.FromArray(parsedLight.groundColor);
  16401. break;
  16402. }
  16403. light.id = parsedLight.id;
  16404. BABYLON.Tags.AddTagsTo(light, parsedLight.tags);
  16405. if (parsedLight.intensity !== undefined) {
  16406. light.intensity = parsedLight.intensity;
  16407. }
  16408. if (parsedLight.range) {
  16409. light.range = parsedLight.range;
  16410. }
  16411. light.diffuse = BABYLON.Color3.FromArray(parsedLight.diffuse);
  16412. light.specular = BABYLON.Color3.FromArray(parsedLight.specular);
  16413. if (parsedLight.excludedMeshesIds) {
  16414. light._excludedMeshesIds = parsedLight.excludedMeshesIds;
  16415. }
  16416. if (parsedLight.parentId) {
  16417. light._waitingParentId = parsedLight.parentId;
  16418. }
  16419. if (parsedLight.includedOnlyMeshesIds) {
  16420. light._includedOnlyMeshesIds = parsedLight.includedOnlyMeshesIds;
  16421. }
  16422. if (parsedLight.animations) {
  16423. for (var animationIndex = 0; animationIndex < parsedLight.animations.length; animationIndex++) {
  16424. var parsedAnimation = parsedLight.animations[animationIndex];
  16425. light.animations.push(parseAnimation(parsedAnimation));
  16426. }
  16427. }
  16428. if (parsedLight.autoAnimate) {
  16429. scene.beginAnimation(light, parsedLight.autoAnimateFrom, parsedLight.autoAnimateTo, parsedLight.autoAnimateLoop, 1.0);
  16430. }
  16431. };
  16432. var parseCamera = function (parsedCamera, scene) {
  16433. var camera;
  16434. var position = BABYLON.Vector3.FromArray(parsedCamera.position);
  16435. var lockedTargetMesh = (parsedCamera.lockedTargetId) ? scene.getLastMeshByID(parsedCamera.lockedTargetId) : null;
  16436. if (parsedCamera.type === "AnaglyphArcRotateCamera" || parsedCamera.type === "ArcRotateCamera") {
  16437. var alpha = parsedCamera.alpha;
  16438. var beta = parsedCamera.beta;
  16439. var radius = parsedCamera.radius;
  16440. if (parsedCamera.type === "AnaglyphArcRotateCamera") {
  16441. var eye_space = parsedCamera.eye_space;
  16442. camera = new BABYLON.AnaglyphArcRotateCamera(parsedCamera.name, alpha, beta, radius, lockedTargetMesh, eye_space, scene);
  16443. } else {
  16444. camera = new BABYLON.ArcRotateCamera(parsedCamera.name, alpha, beta, radius, lockedTargetMesh, scene);
  16445. }
  16446. } else if (parsedCamera.type === "AnaglyphFreeCamera") {
  16447. var eye_space = parsedCamera.eye_space;
  16448. camera = new BABYLON.AnaglyphFreeCamera(parsedCamera.name, position, eye_space, scene);
  16449. } else if (parsedCamera.type === "DeviceOrientationCamera") {
  16450. camera = new BABYLON.DeviceOrientationCamera(parsedCamera.name, position, scene);
  16451. } else if (parsedCamera.type === "FollowCamera") {
  16452. camera = new BABYLON.FollowCamera(parsedCamera.name, position, scene);
  16453. camera.heightOffset = parsedCamera.heightOffset;
  16454. camera.radius = parsedCamera.radius;
  16455. camera.rotationOffset = parsedCamera.rotationOffset;
  16456. if (lockedTargetMesh)
  16457. camera.target = lockedTargetMesh;
  16458. } else if (parsedCamera.type === "GamepadCamera") {
  16459. camera = new BABYLON.GamepadCamera(parsedCamera.name, position, scene);
  16460. } else if (parsedCamera.type === "OculusCamera") {
  16461. camera = new BABYLON.OculusCamera(parsedCamera.name, position, scene);
  16462. } else if (parsedCamera.type === "TouchCamera") {
  16463. camera = new BABYLON.TouchCamera(parsedCamera.name, position, scene);
  16464. } else if (parsedCamera.type === "VirtualJoysticksCamera") {
  16465. camera = new BABYLON.VirtualJoysticksCamera(parsedCamera.name, position, scene);
  16466. } else if (parsedCamera.type === "WebVRCamera") {
  16467. camera = new BABYLON.WebVRCamera(parsedCamera.name, position, scene);
  16468. } else if (parsedCamera.type === "VRDeviceOrientationCamera") {
  16469. camera = new BABYLON.VRDeviceOrientationCamera(parsedCamera.name, position, scene);
  16470. } else {
  16471. camera = new BABYLON.FreeCamera(parsedCamera.name, position, scene);
  16472. }
  16473. if (lockedTargetMesh && camera instanceof BABYLON.FreeCamera) {
  16474. camera.lockedTarget = lockedTargetMesh;
  16475. }
  16476. camera.id = parsedCamera.id;
  16477. BABYLON.Tags.AddTagsTo(camera, parsedCamera.tags);
  16478. if (parsedCamera.parentId) {
  16479. camera._waitingParentId = parsedCamera.parentId;
  16480. }
  16481. if (parsedCamera.target) {
  16482. camera.setTarget(BABYLON.Vector3.FromArray(parsedCamera.target));
  16483. } else {
  16484. camera.rotation = BABYLON.Vector3.FromArray(parsedCamera.rotation);
  16485. }
  16486. camera.fov = parsedCamera.fov;
  16487. camera.minZ = parsedCamera.minZ;
  16488. camera.maxZ = parsedCamera.maxZ;
  16489. camera.speed = parsedCamera.speed;
  16490. camera.inertia = parsedCamera.inertia;
  16491. camera.checkCollisions = parsedCamera.checkCollisions;
  16492. camera.applyGravity = parsedCamera.applyGravity;
  16493. if (parsedCamera.ellipsoid) {
  16494. camera.ellipsoid = BABYLON.Vector3.FromArray(parsedCamera.ellipsoid);
  16495. }
  16496. if (parsedCamera.animations) {
  16497. for (var animationIndex = 0; animationIndex < parsedCamera.animations.length; animationIndex++) {
  16498. var parsedAnimation = parsedCamera.animations[animationIndex];
  16499. camera.animations.push(parseAnimation(parsedAnimation));
  16500. }
  16501. }
  16502. if (parsedCamera.autoAnimate) {
  16503. scene.beginAnimation(camera, parsedCamera.autoAnimateFrom, parsedCamera.autoAnimateTo, parsedCamera.autoAnimateLoop, 1.0);
  16504. }
  16505. if (parsedCamera.layerMask && (!isNaN(parsedCamera.layerMask))) {
  16506. camera.layerMask = Math.abs(parseInt(parsedCamera.layerMask));
  16507. } else {
  16508. camera.layerMask = 0xFFFFFFFF;
  16509. }
  16510. return camera;
  16511. };
  16512. var parseGeometry = function (parsedGeometry, scene) {
  16513. var id = parsedGeometry.id;
  16514. return scene.getGeometryByID(id);
  16515. };
  16516. var parseBox = function (parsedBox, scene) {
  16517. if (parseGeometry(parsedBox, scene)) {
  16518. return null;
  16519. }
  16520. var box = new BABYLON.Geometry.Primitives.Box(parsedBox.id, scene, parsedBox.size, parsedBox.canBeRegenerated, null);
  16521. BABYLON.Tags.AddTagsTo(box, parsedBox.tags);
  16522. scene.pushGeometry(box, true);
  16523. return box;
  16524. };
  16525. var parseSphere = function (parsedSphere, scene) {
  16526. if (parseGeometry(parsedSphere, scene)) {
  16527. return null;
  16528. }
  16529. var sphere = new BABYLON.Geometry.Primitives.Sphere(parsedSphere.id, scene, parsedSphere.segments, parsedSphere.diameter, parsedSphere.canBeRegenerated, null);
  16530. BABYLON.Tags.AddTagsTo(sphere, parsedSphere.tags);
  16531. scene.pushGeometry(sphere, true);
  16532. return sphere;
  16533. };
  16534. var parseCylinder = function (parsedCylinder, scene) {
  16535. if (parseGeometry(parsedCylinder, scene)) {
  16536. return null;
  16537. }
  16538. var cylinder = new BABYLON.Geometry.Primitives.Cylinder(parsedCylinder.id, scene, parsedCylinder.height, parsedCylinder.diameterTop, parsedCylinder.diameterBottom, parsedCylinder.tessellation, parsedCylinder.subdivisions, parsedCylinder.canBeRegenerated, null);
  16539. BABYLON.Tags.AddTagsTo(cylinder, parsedCylinder.tags);
  16540. scene.pushGeometry(cylinder, true);
  16541. return cylinder;
  16542. };
  16543. var parseTorus = function (parsedTorus, scene) {
  16544. if (parseGeometry(parsedTorus, scene)) {
  16545. return null;
  16546. }
  16547. var torus = new BABYLON.Geometry.Primitives.Torus(parsedTorus.id, scene, parsedTorus.diameter, parsedTorus.thickness, parsedTorus.tessellation, parsedTorus.canBeRegenerated, null);
  16548. BABYLON.Tags.AddTagsTo(torus, parsedTorus.tags);
  16549. scene.pushGeometry(torus, true);
  16550. return torus;
  16551. };
  16552. var parseGround = function (parsedGround, scene) {
  16553. if (parseGeometry(parsedGround, scene)) {
  16554. return null;
  16555. }
  16556. var ground = new BABYLON.Geometry.Primitives.Ground(parsedGround.id, scene, parsedGround.width, parsedGround.height, parsedGround.subdivisions, parsedGround.canBeRegenerated, null);
  16557. BABYLON.Tags.AddTagsTo(ground, parsedGround.tags);
  16558. scene.pushGeometry(ground, true);
  16559. return ground;
  16560. };
  16561. var parsePlane = function (parsedPlane, scene) {
  16562. if (parseGeometry(parsedPlane, scene)) {
  16563. return null;
  16564. }
  16565. var plane = new BABYLON.Geometry.Primitives.Plane(parsedPlane.id, scene, parsedPlane.size, parsedPlane.canBeRegenerated, null);
  16566. BABYLON.Tags.AddTagsTo(plane, parsedPlane.tags);
  16567. scene.pushGeometry(plane, true);
  16568. return plane;
  16569. };
  16570. var parseTorusKnot = function (parsedTorusKnot, scene) {
  16571. if (parseGeometry(parsedTorusKnot, scene)) {
  16572. return null;
  16573. }
  16574. var torusKnot = new BABYLON.Geometry.Primitives.TorusKnot(parsedTorusKnot.id, scene, parsedTorusKnot.radius, parsedTorusKnot.tube, parsedTorusKnot.radialSegments, parsedTorusKnot.tubularSegments, parsedTorusKnot.p, parsedTorusKnot.q, parsedTorusKnot.canBeRegenerated, null);
  16575. BABYLON.Tags.AddTagsTo(torusKnot, parsedTorusKnot.tags);
  16576. scene.pushGeometry(torusKnot, true);
  16577. return torusKnot;
  16578. };
  16579. var parseVertexData = function (parsedVertexData, scene, rootUrl) {
  16580. if (parseGeometry(parsedVertexData, scene)) {
  16581. return null;
  16582. }
  16583. var geometry = new BABYLON.Geometry(parsedVertexData.id, scene);
  16584. BABYLON.Tags.AddTagsTo(geometry, parsedVertexData.tags);
  16585. if (parsedVertexData.delayLoadingFile) {
  16586. geometry.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_NOTLOADED;
  16587. geometry.delayLoadingFile = rootUrl + parsedVertexData.delayLoadingFile;
  16588. geometry._boundingInfo = new BABYLON.BoundingInfo(BABYLON.Vector3.FromArray(parsedVertexData.boundingBoxMinimum), BABYLON.Vector3.FromArray(parsedVertexData.boundingBoxMaximum));
  16589. geometry._delayInfo = [];
  16590. if (parsedVertexData.hasUVs) {
  16591. geometry._delayInfo.push(BABYLON.VertexBuffer.UVKind);
  16592. }
  16593. if (parsedVertexData.hasUVs2) {
  16594. geometry._delayInfo.push(BABYLON.VertexBuffer.UV2Kind);
  16595. }
  16596. if (parsedVertexData.hasColors) {
  16597. geometry._delayInfo.push(BABYLON.VertexBuffer.ColorKind);
  16598. }
  16599. if (parsedVertexData.hasMatricesIndices) {
  16600. geometry._delayInfo.push(BABYLON.VertexBuffer.MatricesIndicesKind);
  16601. }
  16602. if (parsedVertexData.hasMatricesWeights) {
  16603. geometry._delayInfo.push(BABYLON.VertexBuffer.MatricesWeightsKind);
  16604. }
  16605. geometry._delayLoadingFunction = importVertexData;
  16606. } else {
  16607. importVertexData(parsedVertexData, geometry);
  16608. }
  16609. scene.pushGeometry(geometry, true);
  16610. return geometry;
  16611. };
  16612. var parseMesh = function (parsedMesh, scene, rootUrl) {
  16613. var mesh = new BABYLON.Mesh(parsedMesh.name, scene);
  16614. mesh.id = parsedMesh.id;
  16615. BABYLON.Tags.AddTagsTo(mesh, parsedMesh.tags);
  16616. mesh.position = BABYLON.Vector3.FromArray(parsedMesh.position);
  16617. if (parsedMesh.rotationQuaternion) {
  16618. mesh.rotationQuaternion = BABYLON.Quaternion.FromArray(parsedMesh.rotationQuaternion);
  16619. } else if (parsedMesh.rotation) {
  16620. mesh.rotation = BABYLON.Vector3.FromArray(parsedMesh.rotation);
  16621. }
  16622. mesh.scaling = BABYLON.Vector3.FromArray(parsedMesh.scaling);
  16623. if (parsedMesh.localMatrix) {
  16624. mesh.setPivotMatrix(BABYLON.Matrix.FromArray(parsedMesh.localMatrix));
  16625. } else if (parsedMesh.pivotMatrix) {
  16626. mesh.setPivotMatrix(BABYLON.Matrix.FromArray(parsedMesh.pivotMatrix));
  16627. }
  16628. mesh.setEnabled(parsedMesh.isEnabled);
  16629. mesh.isVisible = parsedMesh.isVisible;
  16630. mesh.infiniteDistance = parsedMesh.infiniteDistance;
  16631. mesh.showBoundingBox = parsedMesh.showBoundingBox;
  16632. mesh.showSubMeshesBoundingBox = parsedMesh.showSubMeshesBoundingBox;
  16633. if (parseMesh.applyFog !== undefined) {
  16634. mesh.applyFog = parseMesh.applyFog;
  16635. }
  16636. if (parsedMesh.pickable !== undefined) {
  16637. mesh.isPickable = parsedMesh.pickable;
  16638. }
  16639. mesh.receiveShadows = parsedMesh.receiveShadows;
  16640. mesh.billboardMode = parsedMesh.billboardMode;
  16641. if (parsedMesh.visibility !== undefined) {
  16642. mesh.visibility = parsedMesh.visibility;
  16643. }
  16644. mesh.checkCollisions = parsedMesh.checkCollisions;
  16645. mesh._shouldGenerateFlatShading = parsedMesh.useFlatShading;
  16646. if (parsedMesh.parentId) {
  16647. mesh._waitingParentId = parsedMesh.parentId;
  16648. }
  16649. mesh.hasVertexAlpha = parsedMesh.hasVertexAlpha;
  16650. if (parsedMesh.delayLoadingFile) {
  16651. mesh.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_NOTLOADED;
  16652. mesh.delayLoadingFile = rootUrl + parsedMesh.delayLoadingFile;
  16653. mesh._boundingInfo = new BABYLON.BoundingInfo(BABYLON.Vector3.FromArray(parsedMesh.boundingBoxMinimum), BABYLON.Vector3.FromArray(parsedMesh.boundingBoxMaximum));
  16654. if (parsedMesh._binaryInfo) {
  16655. mesh._binaryInfo = parsedMesh._binaryInfo;
  16656. }
  16657. mesh._delayInfo = [];
  16658. if (parsedMesh.hasUVs) {
  16659. mesh._delayInfo.push(BABYLON.VertexBuffer.UVKind);
  16660. }
  16661. if (parsedMesh.hasUVs2) {
  16662. mesh._delayInfo.push(BABYLON.VertexBuffer.UV2Kind);
  16663. }
  16664. if (parsedMesh.hasColors) {
  16665. mesh._delayInfo.push(BABYLON.VertexBuffer.ColorKind);
  16666. }
  16667. if (parsedMesh.hasMatricesIndices) {
  16668. mesh._delayInfo.push(BABYLON.VertexBuffer.MatricesIndicesKind);
  16669. }
  16670. if (parsedMesh.hasMatricesWeights) {
  16671. mesh._delayInfo.push(BABYLON.VertexBuffer.MatricesWeightsKind);
  16672. }
  16673. mesh._delayLoadingFunction = importGeometry;
  16674. if (BABYLON.SceneLoader.ForceFullSceneLoadingForIncremental) {
  16675. mesh._checkDelayState();
  16676. }
  16677. } else {
  16678. importGeometry(parsedMesh, mesh);
  16679. }
  16680. if (parsedMesh.materialId) {
  16681. mesh.setMaterialByID(parsedMesh.materialId);
  16682. } else {
  16683. mesh.material = null;
  16684. }
  16685. if (parsedMesh.skeletonId > -1) {
  16686. mesh.skeleton = scene.getLastSkeletonByID(parsedMesh.skeletonId);
  16687. }
  16688. if (parsedMesh.physicsImpostor) {
  16689. if (!scene.isPhysicsEnabled()) {
  16690. scene.enablePhysics();
  16691. }
  16692. mesh.setPhysicsState({ impostor: parsedMesh.physicsImpostor, mass: parsedMesh.physicsMass, friction: parsedMesh.physicsFriction, restitution: parsedMesh.physicsRestitution });
  16693. }
  16694. if (parsedMesh.animations) {
  16695. for (var animationIndex = 0; animationIndex < parsedMesh.animations.length; animationIndex++) {
  16696. var parsedAnimation = parsedMesh.animations[animationIndex];
  16697. mesh.animations.push(parseAnimation(parsedAnimation));
  16698. }
  16699. }
  16700. if (parsedMesh.autoAnimate) {
  16701. scene.beginAnimation(mesh, parsedMesh.autoAnimateFrom, parsedMesh.autoAnimateTo, parsedMesh.autoAnimateLoop, 1.0);
  16702. }
  16703. if (parsedMesh.layerMask && (!isNaN(parsedMesh.layerMask))) {
  16704. mesh.layerMask = Math.abs(parseInt(parsedMesh.layerMask));
  16705. } else {
  16706. mesh.layerMask = 0xFFFFFFFF;
  16707. }
  16708. if (parsedMesh.instances) {
  16709. for (var index = 0; index < parsedMesh.instances.length; index++) {
  16710. var parsedInstance = parsedMesh.instances[index];
  16711. var instance = mesh.createInstance(parsedInstance.name);
  16712. BABYLON.Tags.AddTagsTo(instance, parsedInstance.tags);
  16713. instance.position = BABYLON.Vector3.FromArray(parsedInstance.position);
  16714. if (parsedInstance.rotationQuaternion) {
  16715. instance.rotationQuaternion = BABYLON.Quaternion.FromArray(parsedInstance.rotationQuaternion);
  16716. } else if (parsedInstance.rotation) {
  16717. instance.rotation = BABYLON.Vector3.FromArray(parsedInstance.rotation);
  16718. }
  16719. instance.scaling = BABYLON.Vector3.FromArray(parsedInstance.scaling);
  16720. instance.checkCollisions = mesh.checkCollisions;
  16721. if (parsedMesh.animations) {
  16722. for (animationIndex = 0; animationIndex < parsedMesh.animations.length; animationIndex++) {
  16723. parsedAnimation = parsedMesh.animations[animationIndex];
  16724. instance.animations.push(parseAnimation(parsedAnimation));
  16725. }
  16726. }
  16727. }
  16728. }
  16729. return mesh;
  16730. };
  16731. var isDescendantOf = function (mesh, names, hierarchyIds) {
  16732. names = (names instanceof Array) ? names : [names];
  16733. for (var i in names) {
  16734. if (mesh.name === names[i]) {
  16735. hierarchyIds.push(mesh.id);
  16736. return true;
  16737. }
  16738. }
  16739. if (mesh.parentId && hierarchyIds.indexOf(mesh.parentId) !== -1) {
  16740. hierarchyIds.push(mesh.id);
  16741. return true;
  16742. }
  16743. return false;
  16744. };
  16745. var importVertexData = function (parsedVertexData, geometry) {
  16746. var vertexData = new BABYLON.VertexData();
  16747. var positions = parsedVertexData.positions;
  16748. if (positions) {
  16749. vertexData.set(positions, BABYLON.VertexBuffer.PositionKind);
  16750. }
  16751. var normals = parsedVertexData.normals;
  16752. if (normals) {
  16753. vertexData.set(normals, BABYLON.VertexBuffer.NormalKind);
  16754. }
  16755. var uvs = parsedVertexData.uvs;
  16756. if (uvs) {
  16757. vertexData.set(uvs, BABYLON.VertexBuffer.UVKind);
  16758. }
  16759. var uv2s = parsedVertexData.uv2s;
  16760. if (uv2s) {
  16761. vertexData.set(uv2s, BABYLON.VertexBuffer.UV2Kind);
  16762. }
  16763. var colors = parsedVertexData.colors;
  16764. if (colors) {
  16765. vertexData.set(checkColors4(colors, positions.length / 3), BABYLON.VertexBuffer.ColorKind);
  16766. }
  16767. var matricesIndices = parsedVertexData.matricesIndices;
  16768. if (matricesIndices) {
  16769. vertexData.set(matricesIndices, BABYLON.VertexBuffer.MatricesIndicesKind);
  16770. }
  16771. var matricesWeights = parsedVertexData.matricesWeights;
  16772. if (matricesWeights) {
  16773. vertexData.set(matricesWeights, BABYLON.VertexBuffer.MatricesWeightsKind);
  16774. }
  16775. var indices = parsedVertexData.indices;
  16776. if (indices) {
  16777. vertexData.indices = indices;
  16778. }
  16779. geometry.setAllVerticesData(vertexData, parsedVertexData.updatable);
  16780. };
  16781. var importGeometry = function (parsedGeometry, mesh) {
  16782. var scene = mesh.getScene();
  16783. var geometryId = parsedGeometry.geometryId;
  16784. if (geometryId) {
  16785. var geometry = scene.getGeometryByID(geometryId);
  16786. if (geometry) {
  16787. geometry.applyToMesh(mesh);
  16788. }
  16789. } else if (parsedGeometry instanceof ArrayBuffer) {
  16790. var binaryInfo = mesh._binaryInfo;
  16791. if (binaryInfo.positionsAttrDesc && binaryInfo.positionsAttrDesc.count > 0) {
  16792. var positionsData = new Float32Array(parsedGeometry, binaryInfo.positionsAttrDesc.offset, binaryInfo.positionsAttrDesc.count);
  16793. mesh.setVerticesData(BABYLON.VertexBuffer.PositionKind, positionsData, false);
  16794. }
  16795. if (binaryInfo.normalsAttrDesc && binaryInfo.normalsAttrDesc.count > 0) {
  16796. var normalsData = new Float32Array(parsedGeometry, binaryInfo.normalsAttrDesc.offset, binaryInfo.normalsAttrDesc.count);
  16797. mesh.setVerticesData(BABYLON.VertexBuffer.NormalKind, normalsData, false);
  16798. }
  16799. if (binaryInfo.uvsAttrDesc && binaryInfo.uvsAttrDesc.count > 0) {
  16800. var uvsData = new Float32Array(parsedGeometry, binaryInfo.uvsAttrDesc.offset, binaryInfo.uvsAttrDesc.count);
  16801. mesh.setVerticesData(BABYLON.VertexBuffer.UVKind, uvsData, false);
  16802. }
  16803. if (binaryInfo.uvs2AttrDesc && binaryInfo.uvs2AttrDesc.count > 0) {
  16804. var uvs2Data = new Float32Array(parsedGeometry, binaryInfo.uvs2AttrDesc.offset, binaryInfo.uvs2AttrDesc.count);
  16805. mesh.setVerticesData(BABYLON.VertexBuffer.UV2Kind, uvs2Data, false);
  16806. }
  16807. if (binaryInfo.colorsAttrDesc && binaryInfo.colorsAttrDesc.count > 0) {
  16808. var colorsData = new Float32Array(parsedGeometry, binaryInfo.colorsAttrDesc.offset, binaryInfo.colorsAttrDesc.count);
  16809. mesh.setVerticesData(BABYLON.VertexBuffer.ColorKind, colorsData, false);
  16810. }
  16811. if (binaryInfo.matricesIndicesAttrDesc && binaryInfo.matricesIndicesAttrDesc.count > 0) {
  16812. var matricesIndicesData = new Int32Array(parsedGeometry, binaryInfo.matricesIndicesAttrDesc.offset, binaryInfo.matricesIndicesAttrDesc.count);
  16813. mesh.setVerticesData(BABYLON.VertexBuffer.MatricesIndicesKind, matricesIndicesData, false);
  16814. }
  16815. if (binaryInfo.matricesWeightsAttrDesc && binaryInfo.matricesWeightsAttrDesc.count > 0) {
  16816. var matricesWeightsData = new Float32Array(parsedGeometry, binaryInfo.matricesWeightsAttrDesc.offset, binaryInfo.matricesWeightsAttrDesc.count);
  16817. mesh.setVerticesData(BABYLON.VertexBuffer.MatricesWeightsKind, matricesWeightsData, false);
  16818. }
  16819. if (binaryInfo.indicesAttrDesc && binaryInfo.indicesAttrDesc.count > 0) {
  16820. var indicesData = new Int32Array(parsedGeometry, binaryInfo.indicesAttrDesc.offset, binaryInfo.indicesAttrDesc.count);
  16821. mesh.setIndices(indicesData);
  16822. }
  16823. if (binaryInfo.subMeshesAttrDesc && binaryInfo.subMeshesAttrDesc.count > 0) {
  16824. var subMeshesData = new Int32Array(parsedGeometry, binaryInfo.subMeshesAttrDesc.offset, binaryInfo.subMeshesAttrDesc.count * 5);
  16825. mesh.subMeshes = [];
  16826. for (var i = 0; i < binaryInfo.subMeshesAttrDesc.count; i++) {
  16827. var materialIndex = subMeshesData[(i * 5) + 0];
  16828. var verticesStart = subMeshesData[(i * 5) + 1];
  16829. var verticesCount = subMeshesData[(i * 5) + 2];
  16830. var indexStart = subMeshesData[(i * 5) + 3];
  16831. var indexCount = subMeshesData[(i * 5) + 4];
  16832. var subMesh = new BABYLON.SubMesh(materialIndex, verticesStart, verticesCount, indexStart, indexCount, mesh);
  16833. }
  16834. }
  16835. } else if (parsedGeometry.positions && parsedGeometry.normals && parsedGeometry.indices) {
  16836. mesh.setVerticesData(BABYLON.VertexBuffer.PositionKind, parsedGeometry.positions, false);
  16837. mesh.setVerticesData(BABYLON.VertexBuffer.NormalKind, parsedGeometry.normals, false);
  16838. if (parsedGeometry.uvs) {
  16839. mesh.setVerticesData(BABYLON.VertexBuffer.UVKind, parsedGeometry.uvs, false);
  16840. }
  16841. if (parsedGeometry.uvs2) {
  16842. mesh.setVerticesData(BABYLON.VertexBuffer.UV2Kind, parsedGeometry.uvs2, false);
  16843. }
  16844. if (parsedGeometry.colors) {
  16845. mesh.setVerticesData(BABYLON.VertexBuffer.ColorKind, checkColors4(parsedGeometry.colors, parsedGeometry.positions.length / 3), false);
  16846. }
  16847. if (parsedGeometry.matricesIndices) {
  16848. if (!parsedGeometry.matricesIndices._isExpanded) {
  16849. var floatIndices = [];
  16850. for (var i = 0; i < parsedGeometry.matricesIndices.length; i++) {
  16851. var matricesIndex = parsedGeometry.matricesIndices[i];
  16852. floatIndices.push(matricesIndex & 0x000000FF);
  16853. floatIndices.push((matricesIndex & 0x0000FF00) >> 8);
  16854. floatIndices.push((matricesIndex & 0x00FF0000) >> 16);
  16855. floatIndices.push(matricesIndex >> 24);
  16856. }
  16857. mesh.setVerticesData(BABYLON.VertexBuffer.MatricesIndicesKind, floatIndices, false);
  16858. } else {
  16859. delete parsedGeometry.matricesIndices._isExpanded;
  16860. mesh.setVerticesData(BABYLON.VertexBuffer.MatricesIndicesKind, parsedGeometry.matricesIndices, false);
  16861. }
  16862. }
  16863. if (parsedGeometry.matricesWeights) {
  16864. mesh.setVerticesData(BABYLON.VertexBuffer.MatricesWeightsKind, parsedGeometry.matricesWeights, false);
  16865. }
  16866. mesh.setIndices(parsedGeometry.indices);
  16867. if (parsedGeometry.subMeshes) {
  16868. mesh.subMeshes = [];
  16869. for (var subIndex = 0; subIndex < parsedGeometry.subMeshes.length; subIndex++) {
  16870. var parsedSubMesh = parsedGeometry.subMeshes[subIndex];
  16871. var subMesh = new BABYLON.SubMesh(parsedSubMesh.materialIndex, parsedSubMesh.verticesStart, parsedSubMesh.verticesCount, parsedSubMesh.indexStart, parsedSubMesh.indexCount, mesh);
  16872. }
  16873. }
  16874. }
  16875. if (mesh._shouldGenerateFlatShading) {
  16876. mesh.convertToFlatShadedMesh();
  16877. delete mesh._shouldGenerateFlatShading;
  16878. }
  16879. mesh.computeWorldMatrix(true);
  16880. if (scene._selectionOctree) {
  16881. scene._selectionOctree.addMesh(mesh);
  16882. }
  16883. };
  16884. BABYLON.SceneLoader.RegisterPlugin({
  16885. extensions: ".babylon",
  16886. importMesh: function (meshesNames, scene, data, rootUrl, meshes, particleSystems, skeletons) {
  16887. var parsedData = JSON.parse(data);
  16888. var loadedSkeletonsIds = [];
  16889. var loadedMaterialsIds = [];
  16890. var hierarchyIds = [];
  16891. for (var index = 0; index < parsedData.meshes.length; index++) {
  16892. var parsedMesh = parsedData.meshes[index];
  16893. if (!meshesNames || isDescendantOf(parsedMesh, meshesNames, hierarchyIds)) {
  16894. if (meshesNames instanceof Array) {
  16895. delete meshesNames[meshesNames.indexOf(parsedMesh.name)];
  16896. }
  16897. if (parsedMesh.materialId) {
  16898. var materialFound = (loadedMaterialsIds.indexOf(parsedMesh.materialId) !== -1);
  16899. if (!materialFound) {
  16900. for (var multimatIndex = 0; multimatIndex < parsedData.multiMaterials.length; multimatIndex++) {
  16901. var parsedMultiMaterial = parsedData.multiMaterials[multimatIndex];
  16902. if (parsedMultiMaterial.id == parsedMesh.materialId) {
  16903. for (var matIndex = 0; matIndex < parsedMultiMaterial.materials.length; matIndex++) {
  16904. var subMatId = parsedMultiMaterial.materials[matIndex];
  16905. loadedMaterialsIds.push(subMatId);
  16906. parseMaterialById(subMatId, parsedData, scene, rootUrl);
  16907. }
  16908. loadedMaterialsIds.push(parsedMultiMaterial.id);
  16909. parseMultiMaterial(parsedMultiMaterial, scene);
  16910. materialFound = true;
  16911. break;
  16912. }
  16913. }
  16914. }
  16915. if (!materialFound) {
  16916. loadedMaterialsIds.push(parsedMesh.materialId);
  16917. parseMaterialById(parsedMesh.materialId, parsedData, scene, rootUrl);
  16918. }
  16919. }
  16920. if (parsedMesh.skeletonId > -1 && scene.skeletons) {
  16921. var skeletonAlreadyLoaded = (loadedSkeletonsIds.indexOf(parsedMesh.skeletonId) > -1);
  16922. if (!skeletonAlreadyLoaded) {
  16923. for (var skeletonIndex = 0; skeletonIndex < parsedData.skeletons.length; skeletonIndex++) {
  16924. var parsedSkeleton = parsedData.skeletons[skeletonIndex];
  16925. if (parsedSkeleton.id === parsedMesh.skeletonId) {
  16926. skeletons.push(parseSkeleton(parsedSkeleton, scene));
  16927. loadedSkeletonsIds.push(parsedSkeleton.id);
  16928. }
  16929. }
  16930. }
  16931. }
  16932. var mesh = parseMesh(parsedMesh, scene, rootUrl);
  16933. meshes.push(mesh);
  16934. }
  16935. }
  16936. for (index = 0; index < scene.meshes.length; index++) {
  16937. var currentMesh = scene.meshes[index];
  16938. if (currentMesh._waitingParentId) {
  16939. currentMesh.parent = scene.getLastEntryByID(currentMesh._waitingParentId);
  16940. currentMesh._waitingParentId = undefined;
  16941. }
  16942. }
  16943. if (parsedData.particleSystems) {
  16944. for (index = 0; index < parsedData.particleSystems.length; index++) {
  16945. var parsedParticleSystem = parsedData.particleSystems[index];
  16946. if (hierarchyIds.indexOf(parsedParticleSystem.emitterId) !== -1) {
  16947. particleSystems.push(parseParticleSystem(parsedParticleSystem, scene, rootUrl));
  16948. }
  16949. }
  16950. }
  16951. return true;
  16952. },
  16953. load: function (scene, data, rootUrl) {
  16954. var parsedData = JSON.parse(data);
  16955. scene.useDelayedTextureLoading = parsedData.useDelayedTextureLoading && !BABYLON.SceneLoader.ForceFullSceneLoadingForIncremental;
  16956. scene.autoClear = parsedData.autoClear;
  16957. scene.clearColor = BABYLON.Color3.FromArray(parsedData.clearColor);
  16958. scene.ambientColor = BABYLON.Color3.FromArray(parsedData.ambientColor);
  16959. scene.gravity = BABYLON.Vector3.FromArray(parsedData.gravity);
  16960. if (parsedData.fogMode && parsedData.fogMode !== 0) {
  16961. scene.fogMode = parsedData.fogMode;
  16962. scene.fogColor = BABYLON.Color3.FromArray(parsedData.fogColor);
  16963. scene.fogStart = parsedData.fogStart;
  16964. scene.fogEnd = parsedData.fogEnd;
  16965. scene.fogDensity = parsedData.fogDensity;
  16966. }
  16967. for (var index = 0; index < parsedData.lights.length; index++) {
  16968. var parsedLight = parsedData.lights[index];
  16969. parseLight(parsedLight, scene);
  16970. }
  16971. if (parsedData.materials) {
  16972. for (index = 0; index < parsedData.materials.length; index++) {
  16973. var parsedMaterial = parsedData.materials[index];
  16974. parseMaterial(parsedMaterial, scene, rootUrl);
  16975. }
  16976. }
  16977. if (parsedData.multiMaterials) {
  16978. for (index = 0; index < parsedData.multiMaterials.length; index++) {
  16979. var parsedMultiMaterial = parsedData.multiMaterials[index];
  16980. parseMultiMaterial(parsedMultiMaterial, scene);
  16981. }
  16982. }
  16983. if (parsedData.skeletons) {
  16984. for (index = 0; index < parsedData.skeletons.length; index++) {
  16985. var parsedSkeleton = parsedData.skeletons[index];
  16986. parseSkeleton(parsedSkeleton, scene);
  16987. }
  16988. }
  16989. var geometries = parsedData.geometries;
  16990. if (geometries) {
  16991. var boxes = geometries.boxes;
  16992. if (boxes) {
  16993. for (index = 0; index < boxes.length; index++) {
  16994. var parsedBox = boxes[index];
  16995. parseBox(parsedBox, scene);
  16996. }
  16997. }
  16998. var spheres = geometries.spheres;
  16999. if (spheres) {
  17000. for (index = 0; index < spheres.length; index++) {
  17001. var parsedSphere = spheres[index];
  17002. parseSphere(parsedSphere, scene);
  17003. }
  17004. }
  17005. var cylinders = geometries.cylinders;
  17006. if (cylinders) {
  17007. for (index = 0; index < cylinders.length; index++) {
  17008. var parsedCylinder = cylinders[index];
  17009. parseCylinder(parsedCylinder, scene);
  17010. }
  17011. }
  17012. var toruses = geometries.toruses;
  17013. if (toruses) {
  17014. for (index = 0; index < toruses.length; index++) {
  17015. var parsedTorus = toruses[index];
  17016. parseTorus(parsedTorus, scene);
  17017. }
  17018. }
  17019. var grounds = geometries.grounds;
  17020. if (grounds) {
  17021. for (index = 0; index < grounds.length; index++) {
  17022. var parsedGround = grounds[index];
  17023. parseGround(parsedGround, scene);
  17024. }
  17025. }
  17026. var planes = geometries.planes;
  17027. if (planes) {
  17028. for (index = 0; index < planes.length; index++) {
  17029. var parsedPlane = planes[index];
  17030. parsePlane(parsedPlane, scene);
  17031. }
  17032. }
  17033. var torusKnots = geometries.torusKnots;
  17034. if (torusKnots) {
  17035. for (index = 0; index < torusKnots.length; index++) {
  17036. var parsedTorusKnot = torusKnots[index];
  17037. parseTorusKnot(parsedTorusKnot, scene);
  17038. }
  17039. }
  17040. var vertexData = geometries.vertexData;
  17041. if (vertexData) {
  17042. for (index = 0; index < vertexData.length; index++) {
  17043. var parsedVertexData = vertexData[index];
  17044. parseVertexData(parsedVertexData, scene, rootUrl);
  17045. }
  17046. }
  17047. }
  17048. for (index = 0; index < parsedData.meshes.length; index++) {
  17049. var parsedMesh = parsedData.meshes[index];
  17050. parseMesh(parsedMesh, scene, rootUrl);
  17051. }
  17052. for (index = 0; index < parsedData.cameras.length; index++) {
  17053. var parsedCamera = parsedData.cameras[index];
  17054. parseCamera(parsedCamera, scene);
  17055. }
  17056. if (parsedData.activeCameraID) {
  17057. scene.setActiveCameraByID(parsedData.activeCameraID);
  17058. }
  17059. for (index = 0; index < scene.cameras.length; index++) {
  17060. var camera = scene.cameras[index];
  17061. if (camera._waitingParentId) {
  17062. camera.parent = scene.getLastEntryByID(camera._waitingParentId);
  17063. camera._waitingParentId = undefined;
  17064. }
  17065. }
  17066. for (index = 0; index < scene.lights.length; index++) {
  17067. var light = scene.lights[index];
  17068. if (light._waitingParentId) {
  17069. light.parent = scene.getLastEntryByID(light._waitingParentId);
  17070. light._waitingParentId = undefined;
  17071. }
  17072. }
  17073. for (index = 0; index < scene.meshes.length; index++) {
  17074. var mesh = scene.meshes[index];
  17075. if (mesh._waitingParentId) {
  17076. mesh.parent = scene.getLastEntryByID(mesh._waitingParentId);
  17077. mesh._waitingParentId = undefined;
  17078. }
  17079. }
  17080. if (parsedData.particleSystems) {
  17081. for (index = 0; index < parsedData.particleSystems.length; index++) {
  17082. var parsedParticleSystem = parsedData.particleSystems[index];
  17083. parseParticleSystem(parsedParticleSystem, scene, rootUrl);
  17084. }
  17085. }
  17086. if (parsedData.lensFlareSystems) {
  17087. for (index = 0; index < parsedData.lensFlareSystems.length; index++) {
  17088. var parsedLensFlareSystem = parsedData.lensFlareSystems[index];
  17089. parseLensFlareSystem(parsedLensFlareSystem, scene, rootUrl);
  17090. }
  17091. }
  17092. if (parsedData.shadowGenerators) {
  17093. for (index = 0; index < parsedData.shadowGenerators.length; index++) {
  17094. var parsedShadowGenerator = parsedData.shadowGenerators[index];
  17095. parseShadowGenerator(parsedShadowGenerator, scene);
  17096. }
  17097. }
  17098. return true;
  17099. }
  17100. });
  17101. })(BABYLON.Internals || (BABYLON.Internals = {}));
  17102. var Internals = BABYLON.Internals;
  17103. })(BABYLON || (BABYLON = {}));
  17104. var BABYLON;
  17105. (function (BABYLON) {
  17106. var currentCSGMeshId = 0;
  17107. var Vertex = (function () {
  17108. function Vertex(pos, normal, uv) {
  17109. this.pos = pos;
  17110. this.normal = normal;
  17111. this.uv = uv;
  17112. }
  17113. Vertex.prototype.clone = function () {
  17114. return new Vertex(this.pos.clone(), this.normal.clone(), this.uv.clone());
  17115. };
  17116. Vertex.prototype.flip = function () {
  17117. this.normal = this.normal.scale(-1);
  17118. };
  17119. Vertex.prototype.interpolate = function (other, t) {
  17120. return new Vertex(BABYLON.Vector3.Lerp(this.pos, other.pos, t), BABYLON.Vector3.Lerp(this.normal, other.normal, t), BABYLON.Vector2.Lerp(this.uv, other.uv, t));
  17121. };
  17122. return Vertex;
  17123. })();
  17124. var Plane = (function () {
  17125. function Plane(normal, w) {
  17126. this.normal = normal;
  17127. this.w = w;
  17128. }
  17129. Plane.FromPoints = function (a, b, c) {
  17130. var v0 = c.subtract(a);
  17131. var v1 = b.subtract(a);
  17132. if (v0.lengthSquared() === 0 || v1.lengthSquared() === 0) {
  17133. return null;
  17134. }
  17135. var n = BABYLON.Vector3.Normalize(BABYLON.Vector3.Cross(v0, v1));
  17136. return new Plane(n, BABYLON.Vector3.Dot(n, a));
  17137. };
  17138. Plane.prototype.clone = function () {
  17139. return new Plane(this.normal.clone(), this.w);
  17140. };
  17141. Plane.prototype.flip = function () {
  17142. this.normal.scaleInPlace(-1);
  17143. this.w = -this.w;
  17144. };
  17145. Plane.prototype.splitPolygon = function (polygon, coplanarFront, coplanarBack, front, back) {
  17146. var COPLANAR = 0;
  17147. var FRONT = 1;
  17148. var BACK = 2;
  17149. var SPANNING = 3;
  17150. var polygonType = 0;
  17151. var types = [];
  17152. for (var i = 0; i < polygon.vertices.length; i++) {
  17153. var t = BABYLON.Vector3.Dot(this.normal, polygon.vertices[i].pos) - this.w;
  17154. var type = (t < -Plane.EPSILON) ? BACK : (t > Plane.EPSILON) ? FRONT : COPLANAR;
  17155. polygonType |= type;
  17156. types.push(type);
  17157. }
  17158. switch (polygonType) {
  17159. case COPLANAR:
  17160. (BABYLON.Vector3.Dot(this.normal, polygon.plane.normal) > 0 ? coplanarFront : coplanarBack).push(polygon);
  17161. break;
  17162. case FRONT:
  17163. front.push(polygon);
  17164. break;
  17165. case BACK:
  17166. back.push(polygon);
  17167. break;
  17168. case SPANNING:
  17169. var f = [], b = [];
  17170. for (i = 0; i < polygon.vertices.length; i++) {
  17171. var j = (i + 1) % polygon.vertices.length;
  17172. var ti = types[i], tj = types[j];
  17173. var vi = polygon.vertices[i], vj = polygon.vertices[j];
  17174. if (ti != BACK)
  17175. f.push(vi);
  17176. if (ti != FRONT)
  17177. b.push(ti != BACK ? vi.clone() : vi);
  17178. if ((ti | tj) == SPANNING) {
  17179. t = (this.w - BABYLON.Vector3.Dot(this.normal, vi.pos)) / BABYLON.Vector3.Dot(this.normal, vj.pos.subtract(vi.pos));
  17180. var v = vi.interpolate(vj, t);
  17181. f.push(v);
  17182. b.push(v.clone());
  17183. }
  17184. }
  17185. if (f.length >= 3) {
  17186. var poly = new Polygon(f, polygon.shared);
  17187. if (poly.plane)
  17188. front.push(poly);
  17189. }
  17190. if (b.length >= 3) {
  17191. poly = new Polygon(b, polygon.shared);
  17192. if (poly.plane)
  17193. back.push(poly);
  17194. }
  17195. break;
  17196. }
  17197. };
  17198. Plane.EPSILON = 1e-5;
  17199. return Plane;
  17200. })();
  17201. var Polygon = (function () {
  17202. function Polygon(vertices, shared) {
  17203. this.vertices = vertices;
  17204. this.shared = shared;
  17205. this.plane = Plane.FromPoints(vertices[0].pos, vertices[1].pos, vertices[2].pos);
  17206. }
  17207. Polygon.prototype.clone = function () {
  17208. var vertices = this.vertices.map(function (v) {
  17209. return v.clone();
  17210. });
  17211. return new Polygon(vertices, this.shared);
  17212. };
  17213. Polygon.prototype.flip = function () {
  17214. this.vertices.reverse().map(function (v) {
  17215. v.flip();
  17216. });
  17217. this.plane.flip();
  17218. };
  17219. return Polygon;
  17220. })();
  17221. var Node = (function () {
  17222. function Node(polygons) {
  17223. this.plane = null;
  17224. this.front = null;
  17225. this.back = null;
  17226. this.polygons = [];
  17227. if (polygons) {
  17228. this.build(polygons);
  17229. }
  17230. }
  17231. Node.prototype.clone = function () {
  17232. var node = new Node();
  17233. node.plane = this.plane && this.plane.clone();
  17234. node.front = this.front && this.front.clone();
  17235. node.back = this.back && this.back.clone();
  17236. node.polygons = this.polygons.map(function (p) {
  17237. return p.clone();
  17238. });
  17239. return node;
  17240. };
  17241. Node.prototype.invert = function () {
  17242. for (var i = 0; i < this.polygons.length; i++) {
  17243. this.polygons[i].flip();
  17244. }
  17245. if (this.plane) {
  17246. this.plane.flip();
  17247. }
  17248. if (this.front) {
  17249. this.front.invert();
  17250. }
  17251. if (this.back) {
  17252. this.back.invert();
  17253. }
  17254. var temp = this.front;
  17255. this.front = this.back;
  17256. this.back = temp;
  17257. };
  17258. Node.prototype.clipPolygons = function (polygons) {
  17259. if (!this.plane)
  17260. return polygons.slice();
  17261. var front = [], back = [];
  17262. for (var i = 0; i < polygons.length; i++) {
  17263. this.plane.splitPolygon(polygons[i], front, back, front, back);
  17264. }
  17265. if (this.front) {
  17266. front = this.front.clipPolygons(front);
  17267. }
  17268. if (this.back) {
  17269. back = this.back.clipPolygons(back);
  17270. } else {
  17271. back = [];
  17272. }
  17273. return front.concat(back);
  17274. };
  17275. Node.prototype.clipTo = function (bsp) {
  17276. this.polygons = bsp.clipPolygons(this.polygons);
  17277. if (this.front)
  17278. this.front.clipTo(bsp);
  17279. if (this.back)
  17280. this.back.clipTo(bsp);
  17281. };
  17282. Node.prototype.allPolygons = function () {
  17283. var polygons = this.polygons.slice();
  17284. if (this.front)
  17285. polygons = polygons.concat(this.front.allPolygons());
  17286. if (this.back)
  17287. polygons = polygons.concat(this.back.allPolygons());
  17288. return polygons;
  17289. };
  17290. Node.prototype.build = function (polygons) {
  17291. if (!polygons.length)
  17292. return;
  17293. if (!this.plane)
  17294. this.plane = polygons[0].plane.clone();
  17295. var front = [], back = [];
  17296. for (var i = 0; i < polygons.length; i++) {
  17297. this.plane.splitPolygon(polygons[i], this.polygons, this.polygons, front, back);
  17298. }
  17299. if (front.length) {
  17300. if (!this.front)
  17301. this.front = new Node();
  17302. this.front.build(front);
  17303. }
  17304. if (back.length) {
  17305. if (!this.back)
  17306. this.back = new Node();
  17307. this.back.build(back);
  17308. }
  17309. };
  17310. return Node;
  17311. })();
  17312. var CSG = (function () {
  17313. function CSG() {
  17314. this.polygons = new Array();
  17315. }
  17316. CSG.FromMesh = function (mesh) {
  17317. var vertex, normal, uv, position, polygon, polygons = [], vertices;
  17318. if (mesh instanceof BABYLON.Mesh) {
  17319. mesh.computeWorldMatrix(true);
  17320. var matrix = mesh.getWorldMatrix();
  17321. var meshPosition = mesh.position.clone();
  17322. var meshRotation = mesh.rotation.clone();
  17323. var meshScaling = mesh.scaling.clone();
  17324. } else {
  17325. throw 'BABYLON.CSG: Wrong Mesh type, must be BABYLON.Mesh';
  17326. }
  17327. var indices = mesh.getIndices(), positions = mesh.getVerticesData(BABYLON.VertexBuffer.PositionKind), normals = mesh.getVerticesData(BABYLON.VertexBuffer.NormalKind), uvs = mesh.getVerticesData(BABYLON.VertexBuffer.UVKind);
  17328. var subMeshes = mesh.subMeshes;
  17329. for (var sm = 0, sml = subMeshes.length; sm < sml; sm++) {
  17330. for (var i = subMeshes[sm].indexStart, il = subMeshes[sm].indexCount + subMeshes[sm].indexStart; i < il; i += 3) {
  17331. vertices = [];
  17332. for (var j = 0; j < 3; j++) {
  17333. var sourceNormal = new BABYLON.Vector3(normals[indices[i + j] * 3], normals[indices[i + j] * 3 + 1], normals[indices[i + j] * 3 + 2]);
  17334. uv = new BABYLON.Vector2(uvs[indices[i + j] * 2], uvs[indices[i + j] * 2 + 1]);
  17335. var sourcePosition = new BABYLON.Vector3(positions[indices[i + j] * 3], positions[indices[i + j] * 3 + 1], positions[indices[i + j] * 3 + 2]);
  17336. position = BABYLON.Vector3.TransformCoordinates(sourcePosition, matrix);
  17337. normal = BABYLON.Vector3.TransformNormal(sourceNormal, matrix);
  17338. vertex = new Vertex(position, normal, uv);
  17339. vertices.push(vertex);
  17340. }
  17341. polygon = new Polygon(vertices, { subMeshId: sm, meshId: currentCSGMeshId, materialIndex: subMeshes[sm].materialIndex });
  17342. if (polygon.plane)
  17343. polygons.push(polygon);
  17344. }
  17345. }
  17346. var csg = CSG.FromPolygons(polygons);
  17347. csg.matrix = matrix;
  17348. csg.position = meshPosition;
  17349. csg.rotation = meshRotation;
  17350. csg.scaling = meshScaling;
  17351. currentCSGMeshId++;
  17352. return csg;
  17353. };
  17354. CSG.FromPolygons = function (polygons) {
  17355. var csg = new BABYLON.CSG();
  17356. csg.polygons = polygons;
  17357. return csg;
  17358. };
  17359. CSG.prototype.clone = function () {
  17360. var csg = new BABYLON.CSG();
  17361. csg.polygons = this.polygons.map(function (p) {
  17362. return p.clone();
  17363. });
  17364. csg.copyTransformAttributes(this);
  17365. return csg;
  17366. };
  17367. CSG.prototype.toPolygons = function () {
  17368. return this.polygons;
  17369. };
  17370. CSG.prototype.union = function (csg) {
  17371. var a = new Node(this.clone().polygons);
  17372. var b = new Node(csg.clone().polygons);
  17373. a.clipTo(b);
  17374. b.clipTo(a);
  17375. b.invert();
  17376. b.clipTo(a);
  17377. b.invert();
  17378. a.build(b.allPolygons());
  17379. return CSG.FromPolygons(a.allPolygons()).copyTransformAttributes(this);
  17380. };
  17381. CSG.prototype.unionInPlace = function (csg) {
  17382. var a = new Node(this.polygons);
  17383. var b = new Node(csg.polygons);
  17384. a.clipTo(b);
  17385. b.clipTo(a);
  17386. b.invert();
  17387. b.clipTo(a);
  17388. b.invert();
  17389. a.build(b.allPolygons());
  17390. this.polygons = a.allPolygons();
  17391. };
  17392. CSG.prototype.subtract = function (csg) {
  17393. var a = new Node(this.clone().polygons);
  17394. var b = new Node(csg.clone().polygons);
  17395. a.invert();
  17396. a.clipTo(b);
  17397. b.clipTo(a);
  17398. b.invert();
  17399. b.clipTo(a);
  17400. b.invert();
  17401. a.build(b.allPolygons());
  17402. a.invert();
  17403. return CSG.FromPolygons(a.allPolygons()).copyTransformAttributes(this);
  17404. };
  17405. CSG.prototype.subtractInPlace = function (csg) {
  17406. var a = new Node(this.polygons);
  17407. var b = new Node(csg.polygons);
  17408. a.invert();
  17409. a.clipTo(b);
  17410. b.clipTo(a);
  17411. b.invert();
  17412. b.clipTo(a);
  17413. b.invert();
  17414. a.build(b.allPolygons());
  17415. a.invert();
  17416. this.polygons = a.allPolygons();
  17417. };
  17418. CSG.prototype.intersect = function (csg) {
  17419. var a = new Node(this.clone().polygons);
  17420. var b = new Node(csg.clone().polygons);
  17421. a.invert();
  17422. b.clipTo(a);
  17423. b.invert();
  17424. a.clipTo(b);
  17425. b.clipTo(a);
  17426. a.build(b.allPolygons());
  17427. a.invert();
  17428. return CSG.FromPolygons(a.allPolygons()).copyTransformAttributes(this);
  17429. };
  17430. CSG.prototype.intersectInPlace = function (csg) {
  17431. var a = new Node(this.polygons);
  17432. var b = new Node(csg.polygons);
  17433. a.invert();
  17434. b.clipTo(a);
  17435. b.invert();
  17436. a.clipTo(b);
  17437. b.clipTo(a);
  17438. a.build(b.allPolygons());
  17439. a.invert();
  17440. this.polygons = a.allPolygons();
  17441. };
  17442. CSG.prototype.inverse = function () {
  17443. var csg = this.clone();
  17444. csg.inverseInPlace();
  17445. return csg;
  17446. };
  17447. CSG.prototype.inverseInPlace = function () {
  17448. this.polygons.map(function (p) {
  17449. p.flip();
  17450. });
  17451. };
  17452. CSG.prototype.copyTransformAttributes = function (csg) {
  17453. this.matrix = csg.matrix;
  17454. this.position = csg.position;
  17455. this.rotation = csg.rotation;
  17456. this.scaling = csg.scaling;
  17457. return this;
  17458. };
  17459. CSG.prototype.buildMeshGeometry = function (name, scene, keepSubMeshes) {
  17460. var matrix = this.matrix.clone();
  17461. matrix.invert();
  17462. var mesh = new BABYLON.Mesh(name, scene), vertices = [], indices = [], normals = [], uvs = [], vertex = BABYLON.Vector3.Zero(), normal = BABYLON.Vector3.Zero(), uv = BABYLON.Vector2.Zero(), polygons = this.polygons, polygonIndices = [0, 0, 0], polygon, vertice_dict = {}, vertex_idx, currentIndex = 0, subMesh_dict = {}, subMesh_obj;
  17463. if (keepSubMeshes) {
  17464. polygons.sort(function (a, b) {
  17465. if (a.shared.meshId === b.shared.meshId) {
  17466. return a.shared.subMeshId - b.shared.subMeshId;
  17467. } else {
  17468. return a.shared.meshId - b.shared.meshId;
  17469. }
  17470. });
  17471. }
  17472. for (var i = 0, il = polygons.length; i < il; i++) {
  17473. polygon = polygons[i];
  17474. if (!subMesh_dict[polygon.shared.meshId]) {
  17475. subMesh_dict[polygon.shared.meshId] = {};
  17476. }
  17477. if (!subMesh_dict[polygon.shared.meshId][polygon.shared.subMeshId]) {
  17478. subMesh_dict[polygon.shared.meshId][polygon.shared.subMeshId] = {
  17479. indexStart: +Infinity,
  17480. indexEnd: -Infinity,
  17481. materialIndex: polygon.shared.materialIndex
  17482. };
  17483. }
  17484. subMesh_obj = subMesh_dict[polygon.shared.meshId][polygon.shared.subMeshId];
  17485. for (var j = 2, jl = polygon.vertices.length; j < jl; j++) {
  17486. polygonIndices[0] = 0;
  17487. polygonIndices[1] = j - 1;
  17488. polygonIndices[2] = j;
  17489. for (var k = 0; k < 3; k++) {
  17490. vertex.copyFrom(polygon.vertices[polygonIndices[k]].pos);
  17491. normal.copyFrom(polygon.vertices[polygonIndices[k]].normal);
  17492. uv.copyFrom(polygon.vertices[polygonIndices[k]].uv);
  17493. var localVertex = BABYLON.Vector3.TransformCoordinates(vertex, matrix);
  17494. var localNormal = BABYLON.Vector3.TransformNormal(normal, matrix);
  17495. vertex_idx = vertice_dict[localVertex.x + ',' + localVertex.y + ',' + localVertex.z];
  17496. if (!(typeof vertex_idx !== 'undefined' && normals[vertex_idx * 3] === localNormal.x && normals[vertex_idx * 3 + 1] === localNormal.y && normals[vertex_idx * 3 + 2] === localNormal.z && uvs[vertex_idx * 2] === uv.x && uvs[vertex_idx * 2 + 1] === uv.y)) {
  17497. vertices.push(localVertex.x, localVertex.y, localVertex.z);
  17498. uvs.push(uv.x, uv.y);
  17499. normals.push(normal.x, normal.y, normal.z);
  17500. vertex_idx = vertice_dict[localVertex.x + ',' + localVertex.y + ',' + localVertex.z] = (vertices.length / 3) - 1;
  17501. }
  17502. indices.push(vertex_idx);
  17503. subMesh_obj.indexStart = Math.min(currentIndex, subMesh_obj.indexStart);
  17504. subMesh_obj.indexEnd = Math.max(currentIndex, subMesh_obj.indexEnd);
  17505. currentIndex++;
  17506. }
  17507. }
  17508. }
  17509. mesh.setVerticesData(BABYLON.VertexBuffer.PositionKind, vertices);
  17510. mesh.setVerticesData(BABYLON.VertexBuffer.NormalKind, normals);
  17511. mesh.setVerticesData(BABYLON.VertexBuffer.UVKind, uvs);
  17512. mesh.setIndices(indices);
  17513. if (keepSubMeshes) {
  17514. var materialIndexOffset = 0, materialMaxIndex;
  17515. mesh.subMeshes.length = 0;
  17516. for (var m in subMesh_dict) {
  17517. materialMaxIndex = -1;
  17518. for (var sm in subMesh_dict[m]) {
  17519. subMesh_obj = subMesh_dict[m][sm];
  17520. BABYLON.SubMesh.CreateFromIndices(subMesh_obj.materialIndex + materialIndexOffset, subMesh_obj.indexStart, subMesh_obj.indexEnd - subMesh_obj.indexStart + 1, mesh);
  17521. materialMaxIndex = Math.max(subMesh_obj.materialIndex, materialMaxIndex);
  17522. }
  17523. materialIndexOffset += ++materialMaxIndex;
  17524. }
  17525. }
  17526. return mesh;
  17527. };
  17528. CSG.prototype.toMesh = function (name, material, scene, keepSubMeshes) {
  17529. var mesh = this.buildMeshGeometry(name, scene, keepSubMeshes);
  17530. mesh.material = material;
  17531. mesh.position.copyFrom(this.position);
  17532. mesh.rotation.copyFrom(this.rotation);
  17533. mesh.scaling.copyFrom(this.scaling);
  17534. mesh.computeWorldMatrix(true);
  17535. return mesh;
  17536. };
  17537. return CSG;
  17538. })();
  17539. BABYLON.CSG = CSG;
  17540. })(BABYLON || (BABYLON = {}));
  17541. var __extends = this.__extends || function (d, b) {
  17542. for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p];
  17543. function __() { this.constructor = d; }
  17544. __.prototype = b.prototype;
  17545. d.prototype = new __();
  17546. };
  17547. var BABYLON;
  17548. (function (BABYLON) {
  17549. var OculusDistortionCorrectionPostProcess = (function (_super) {
  17550. __extends(OculusDistortionCorrectionPostProcess, _super);
  17551. function OculusDistortionCorrectionPostProcess(name, camera, isRightEye, cameraSettings) {
  17552. var _this = this;
  17553. _super.call(this, name, "oculusDistortionCorrection", [
  17554. 'LensCenter',
  17555. 'Scale',
  17556. 'ScaleIn',
  17557. 'HmdWarpParam'
  17558. ], null, cameraSettings.PostProcessScaleFactor, camera, BABYLON.Texture.BILINEAR_SAMPLINGMODE, null, null);
  17559. this._isRightEye = isRightEye;
  17560. this._distortionFactors = cameraSettings.DistortionK;
  17561. this._postProcessScaleFactor = cameraSettings.PostProcessScaleFactor;
  17562. this._lensCenterOffset = cameraSettings.LensCenterOffset;
  17563. this.onSizeChanged = function () {
  17564. _this.aspectRatio = _this.width * .5 / _this.height;
  17565. _this._scaleIn = new BABYLON.Vector2(2, 2 / _this.aspectRatio);
  17566. _this._scaleFactor = new BABYLON.Vector2(.5 * (1 / _this._postProcessScaleFactor), .5 * (1 / _this._postProcessScaleFactor) * _this.aspectRatio);
  17567. _this._lensCenter = new BABYLON.Vector2(_this._isRightEye ? 0.5 - _this._lensCenterOffset * 0.5 : 0.5 + _this._lensCenterOffset * 0.5, 0.5);
  17568. };
  17569. this.onApply = function (effect) {
  17570. effect.setFloat2("LensCenter", _this._lensCenter.x, _this._lensCenter.y);
  17571. effect.setFloat2("Scale", _this._scaleFactor.x, _this._scaleFactor.y);
  17572. effect.setFloat2("ScaleIn", _this._scaleIn.x, _this._scaleIn.y);
  17573. effect.setFloat4("HmdWarpParam", _this._distortionFactors[0], _this._distortionFactors[1], _this._distortionFactors[2], _this._distortionFactors[3]);
  17574. };
  17575. }
  17576. return OculusDistortionCorrectionPostProcess;
  17577. })(BABYLON.PostProcess);
  17578. BABYLON.OculusDistortionCorrectionPostProcess = OculusDistortionCorrectionPostProcess;
  17579. })(BABYLON || (BABYLON = {}));
  17580. var BABYLON;
  17581. (function (BABYLON) {
  17582. (function (JoystickAxis) {
  17583. JoystickAxis[JoystickAxis["X"] = 0] = "X";
  17584. JoystickAxis[JoystickAxis["Y"] = 1] = "Y";
  17585. JoystickAxis[JoystickAxis["Z"] = 2] = "Z";
  17586. })(BABYLON.JoystickAxis || (BABYLON.JoystickAxis = {}));
  17587. var JoystickAxis = BABYLON.JoystickAxis;
  17588. var VirtualJoystick = (function () {
  17589. function VirtualJoystick(leftJoystick) {
  17590. var _this = this;
  17591. if (leftJoystick) {
  17592. this._leftJoystick = true;
  17593. } else {
  17594. this._leftJoystick = false;
  17595. }
  17596. this._joystickIndex = VirtualJoystick._globalJoystickIndex;
  17597. VirtualJoystick._globalJoystickIndex++;
  17598. this._axisTargetedByLeftAndRight = 0 /* X */;
  17599. this._axisTargetedByUpAndDown = 1 /* Y */;
  17600. this.reverseLeftRight = false;
  17601. this.reverseUpDown = false;
  17602. this._touches = new BABYLON.VirtualJoystick.Collection();
  17603. this.deltaPosition = BABYLON.Vector3.Zero();
  17604. this._joystickSensibility = 25;
  17605. this._inversedSensibility = 1 / (this._joystickSensibility / 1000);
  17606. this._rotationSpeed = 25;
  17607. this._inverseRotationSpeed = 1 / (this._rotationSpeed / 1000);
  17608. this._rotateOnAxisRelativeToMesh = false;
  17609. if (!VirtualJoystick.vjCanvas) {
  17610. window.addEventListener("resize", function () {
  17611. VirtualJoystick.vjCanvasWidth = window.innerWidth;
  17612. VirtualJoystick.vjCanvasHeight = window.innerHeight;
  17613. VirtualJoystick.vjCanvas.width = VirtualJoystick.vjCanvasWidth;
  17614. VirtualJoystick.vjCanvas.height = VirtualJoystick.vjCanvasHeight;
  17615. VirtualJoystick.halfWidth = VirtualJoystick.vjCanvasWidth / 2;
  17616. VirtualJoystick.halfHeight = VirtualJoystick.vjCanvasHeight / 2;
  17617. }, false);
  17618. VirtualJoystick.vjCanvas = document.createElement("canvas");
  17619. VirtualJoystick.vjCanvasWidth = window.innerWidth;
  17620. VirtualJoystick.vjCanvasHeight = window.innerHeight;
  17621. VirtualJoystick.vjCanvas.width = window.innerWidth;
  17622. VirtualJoystick.vjCanvas.height = window.innerHeight;
  17623. VirtualJoystick.vjCanvas.style.width = "100%";
  17624. VirtualJoystick.vjCanvas.style.height = "100%";
  17625. VirtualJoystick.vjCanvas.style.position = "absolute";
  17626. VirtualJoystick.vjCanvas.style.backgroundColor = "transparent";
  17627. VirtualJoystick.vjCanvas.style.top = "0px";
  17628. VirtualJoystick.vjCanvas.style.left = "0px";
  17629. VirtualJoystick.vjCanvas.style.zIndex = "5";
  17630. VirtualJoystick.vjCanvas.style.msTouchAction = "none";
  17631. VirtualJoystick.vjCanvasContext = VirtualJoystick.vjCanvas.getContext('2d');
  17632. VirtualJoystick.vjCanvasContext.strokeStyle = "#ffffff";
  17633. VirtualJoystick.vjCanvasContext.lineWidth = 2;
  17634. document.body.appendChild(VirtualJoystick.vjCanvas);
  17635. }
  17636. VirtualJoystick.halfWidth = VirtualJoystick.vjCanvas.width / 2;
  17637. VirtualJoystick.halfHeight = VirtualJoystick.vjCanvas.height / 2;
  17638. this.pressed = false;
  17639. this._joystickColor = "cyan";
  17640. this._joystickPointerID = -1;
  17641. this._joystickPointerPos = new BABYLON.Vector2(0, 0);
  17642. this._joystickPointerStartPos = new BABYLON.Vector2(0, 0);
  17643. this._deltaJoystickVector = new BABYLON.Vector2(0, 0);
  17644. VirtualJoystick.vjCanvas.addEventListener('pointerdown', function (evt) {
  17645. _this._onPointerDown(evt);
  17646. }, false);
  17647. VirtualJoystick.vjCanvas.addEventListener('pointermove', function (evt) {
  17648. _this._onPointerMove(evt);
  17649. }, false);
  17650. VirtualJoystick.vjCanvas.addEventListener('pointerup', function (evt) {
  17651. _this._onPointerUp(evt);
  17652. }, false);
  17653. VirtualJoystick.vjCanvas.addEventListener('pointerout', function (evt) {
  17654. _this._onPointerUp(evt);
  17655. }, false);
  17656. VirtualJoystick.vjCanvas.addEventListener("contextmenu", function (evt) {
  17657. evt.preventDefault();
  17658. }, false);
  17659. requestAnimationFrame(function () {
  17660. _this._drawVirtualJoystick();
  17661. });
  17662. }
  17663. VirtualJoystick.prototype.setJoystickSensibility = function (newJoystickSensibility) {
  17664. this._joystickSensibility = newJoystickSensibility;
  17665. this._inversedSensibility = 1 / (this._joystickSensibility / 1000);
  17666. };
  17667. VirtualJoystick.prototype._onPointerDown = function (e) {
  17668. var positionOnScreenCondition;
  17669. e.preventDefault();
  17670. if (this._leftJoystick === true) {
  17671. positionOnScreenCondition = (e.clientX < VirtualJoystick.halfWidth);
  17672. } else {
  17673. positionOnScreenCondition = (e.clientX > VirtualJoystick.halfWidth);
  17674. }
  17675. if (positionOnScreenCondition && this._joystickPointerID < 0) {
  17676. this._joystickPointerID = e.pointerId;
  17677. this._joystickPointerStartPos.x = e.clientX;
  17678. this._joystickPointerStartPos.y = e.clientY;
  17679. this._joystickPointerPos = this._joystickPointerStartPos.clone();
  17680. this._deltaJoystickVector.x = 0;
  17681. this._deltaJoystickVector.y = 0;
  17682. this.pressed = true;
  17683. this._touches.add(e.pointerId.toString(), e);
  17684. } else {
  17685. if (VirtualJoystick._globalJoystickIndex < 2 && this._action) {
  17686. this._action();
  17687. this._touches.add(e.pointerId.toString(), e);
  17688. }
  17689. }
  17690. };
  17691. VirtualJoystick.prototype._onPointerMove = function (e) {
  17692. if (this._joystickPointerID == e.pointerId) {
  17693. this._joystickPointerPos.x = e.clientX;
  17694. this._joystickPointerPos.y = e.clientY;
  17695. this._deltaJoystickVector = this._joystickPointerPos.clone();
  17696. this._deltaJoystickVector = this._deltaJoystickVector.subtract(this._joystickPointerStartPos);
  17697. var directionLeftRight = this.reverseLeftRight ? -1 : 1;
  17698. var deltaJoystickX = directionLeftRight * this._deltaJoystickVector.x / this._inversedSensibility;
  17699. switch (this._axisTargetedByLeftAndRight) {
  17700. case 0 /* X */:
  17701. this.deltaPosition.x = Math.min(1, Math.max(-1, deltaJoystickX));
  17702. break;
  17703. case 1 /* Y */:
  17704. this.deltaPosition.y = Math.min(1, Math.max(-1, deltaJoystickX));
  17705. break;
  17706. case 2 /* Z */:
  17707. this.deltaPosition.z = Math.min(1, Math.max(-1, deltaJoystickX));
  17708. break;
  17709. }
  17710. var directionUpDown = this.reverseUpDown ? 1 : -1;
  17711. var deltaJoystickY = directionUpDown * this._deltaJoystickVector.y / this._inversedSensibility;
  17712. switch (this._axisTargetedByUpAndDown) {
  17713. case 0 /* X */:
  17714. this.deltaPosition.x = Math.min(1, Math.max(-1, deltaJoystickY));
  17715. break;
  17716. case 1 /* Y */:
  17717. this.deltaPosition.y = Math.min(1, Math.max(-1, deltaJoystickY));
  17718. break;
  17719. case 2 /* Z */:
  17720. this.deltaPosition.z = Math.min(1, Math.max(-1, deltaJoystickY));
  17721. break;
  17722. }
  17723. } else {
  17724. if (this._touches.item(e.pointerId.toString())) {
  17725. this._touches.item(e.pointerId.toString()).x = e.clientX;
  17726. this._touches.item(e.pointerId.toString()).y = e.clientY;
  17727. }
  17728. }
  17729. };
  17730. VirtualJoystick.prototype._onPointerUp = function (e) {
  17731. this._clearCanvas();
  17732. if (this._joystickPointerID == e.pointerId) {
  17733. this._joystickPointerID = -1;
  17734. this.pressed = false;
  17735. }
  17736. this._deltaJoystickVector.x = 0;
  17737. this._deltaJoystickVector.y = 0;
  17738. this._touches.remove(e.pointerId.toString());
  17739. };
  17740. /**
  17741. * Change the color of the virtual joystick
  17742. * @param newColor a string that must be a CSS color value (like "red") or the hexa value (like "#FF0000")
  17743. */
  17744. VirtualJoystick.prototype.setJoystickColor = function (newColor) {
  17745. this._joystickColor = newColor;
  17746. };
  17747. VirtualJoystick.prototype.setActionOnTouch = function (action) {
  17748. this._action = action;
  17749. };
  17750. VirtualJoystick.prototype.setAxisForLeftRight = function (axis) {
  17751. switch (axis) {
  17752. case 0 /* X */:
  17753. case 1 /* Y */:
  17754. case 2 /* Z */:
  17755. this._axisTargetedByLeftAndRight = axis;
  17756. break;
  17757. default:
  17758. this._axisTargetedByLeftAndRight = 0 /* X */;
  17759. break;
  17760. }
  17761. };
  17762. VirtualJoystick.prototype.setAxisForUpDown = function (axis) {
  17763. switch (axis) {
  17764. case 0 /* X */:
  17765. case 1 /* Y */:
  17766. case 2 /* Z */:
  17767. this._axisTargetedByUpAndDown = axis;
  17768. break;
  17769. default:
  17770. this._axisTargetedByUpAndDown = 1 /* Y */;
  17771. break;
  17772. }
  17773. };
  17774. VirtualJoystick.prototype._clearCanvas = function () {
  17775. if (this._leftJoystick) {
  17776. VirtualJoystick.vjCanvasContext.clearRect(0, 0, VirtualJoystick.vjCanvasWidth / 2, VirtualJoystick.vjCanvasHeight);
  17777. } else {
  17778. VirtualJoystick.vjCanvasContext.clearRect(VirtualJoystick.vjCanvasWidth / 2, 0, VirtualJoystick.vjCanvasWidth, VirtualJoystick.vjCanvasHeight);
  17779. }
  17780. };
  17781. VirtualJoystick.prototype._drawVirtualJoystick = function () {
  17782. var _this = this;
  17783. if (this.pressed) {
  17784. this._clearCanvas();
  17785. this._touches.forEach(function (touch) {
  17786. if (touch.pointerId === _this._joystickPointerID) {
  17787. VirtualJoystick.vjCanvasContext.beginPath();
  17788. VirtualJoystick.vjCanvasContext.strokeStyle = _this._joystickColor;
  17789. VirtualJoystick.vjCanvasContext.lineWidth = 6;
  17790. VirtualJoystick.vjCanvasContext.arc(_this._joystickPointerStartPos.x, _this._joystickPointerStartPos.y, 40, 0, Math.PI * 2, true);
  17791. VirtualJoystick.vjCanvasContext.stroke();
  17792. VirtualJoystick.vjCanvasContext.beginPath();
  17793. VirtualJoystick.vjCanvasContext.strokeStyle = _this._joystickColor;
  17794. VirtualJoystick.vjCanvasContext.lineWidth = 2;
  17795. VirtualJoystick.vjCanvasContext.arc(_this._joystickPointerStartPos.x, _this._joystickPointerStartPos.y, 60, 0, Math.PI * 2, true);
  17796. VirtualJoystick.vjCanvasContext.stroke();
  17797. VirtualJoystick.vjCanvasContext.beginPath();
  17798. VirtualJoystick.vjCanvasContext.strokeStyle = _this._joystickColor;
  17799. VirtualJoystick.vjCanvasContext.arc(_this._joystickPointerPos.x, _this._joystickPointerPos.y, 40, 0, Math.PI * 2, true);
  17800. VirtualJoystick.vjCanvasContext.stroke();
  17801. } else {
  17802. VirtualJoystick.vjCanvasContext.beginPath();
  17803. VirtualJoystick.vjCanvasContext.fillStyle = "white";
  17804. VirtualJoystick.vjCanvasContext.beginPath();
  17805. VirtualJoystick.vjCanvasContext.strokeStyle = "red";
  17806. VirtualJoystick.vjCanvasContext.lineWidth = 6;
  17807. VirtualJoystick.vjCanvasContext.arc(touch.x, touch.y, 40, 0, Math.PI * 2, true);
  17808. VirtualJoystick.vjCanvasContext.stroke();
  17809. }
  17810. ;
  17811. });
  17812. }
  17813. requestAnimationFrame(function () {
  17814. _this._drawVirtualJoystick();
  17815. });
  17816. };
  17817. VirtualJoystick.prototype.releaseCanvas = function () {
  17818. if (VirtualJoystick.vjCanvas) {
  17819. document.body.removeChild(VirtualJoystick.vjCanvas);
  17820. VirtualJoystick.vjCanvas = null;
  17821. }
  17822. };
  17823. VirtualJoystick._globalJoystickIndex = 0;
  17824. return VirtualJoystick;
  17825. })();
  17826. BABYLON.VirtualJoystick = VirtualJoystick;
  17827. })(BABYLON || (BABYLON = {}));
  17828. var BABYLON;
  17829. (function (BABYLON) {
  17830. (function (VirtualJoystick) {
  17831. var Collection = (function () {
  17832. function Collection() {
  17833. this._count = 0;
  17834. this._collection = new Array();
  17835. }
  17836. Collection.prototype.Count = function () {
  17837. return this._count;
  17838. };
  17839. Collection.prototype.add = function (key, item) {
  17840. if (this._collection[key] != undefined) {
  17841. return undefined;
  17842. }
  17843. this._collection[key] = item;
  17844. return ++this._count;
  17845. };
  17846. Collection.prototype.remove = function (key) {
  17847. if (this._collection[key] == undefined) {
  17848. return undefined;
  17849. }
  17850. delete this._collection[key];
  17851. return --this._count;
  17852. };
  17853. Collection.prototype.item = function (key) {
  17854. return this._collection[key];
  17855. };
  17856. Collection.prototype.forEach = function (block) {
  17857. var key;
  17858. for (key in this._collection) {
  17859. if (this._collection.hasOwnProperty(key)) {
  17860. block(this._collection[key]);
  17861. }
  17862. }
  17863. };
  17864. return Collection;
  17865. })();
  17866. VirtualJoystick.Collection = Collection;
  17867. })(BABYLON.VirtualJoystick || (BABYLON.VirtualJoystick = {}));
  17868. var VirtualJoystick = BABYLON.VirtualJoystick;
  17869. })(BABYLON || (BABYLON = {}));
  17870. var __extends = this.__extends || function (d, b) {
  17871. for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p];
  17872. function __() { this.constructor = d; }
  17873. __.prototype = b.prototype;
  17874. d.prototype = new __();
  17875. };
  17876. var BABYLON;
  17877. (function (BABYLON) {
  17878. var OculusRiftDevKit2013_Metric = {
  17879. HResolution: 1280,
  17880. VResolution: 800,
  17881. HScreenSize: 0.149759993,
  17882. VScreenSize: 0.0935999975,
  17883. VScreenCenter: 0.0467999987,
  17884. EyeToScreenDistance: 0.0410000011,
  17885. LensSeparationDistance: 0.0635000020,
  17886. InterpupillaryDistance: 0.0640000030,
  17887. DistortionK: [1.0, 0.219999999, 0.239999995, 0.0],
  17888. ChromaAbCorrection: [0.995999992, -0.00400000019, 1.01400006, 0.0],
  17889. PostProcessScaleFactor: 1.714605507808412,
  17890. LensCenterOffset: 0.151976421
  17891. };
  17892. var _OculusInnerCamera = (function (_super) {
  17893. __extends(_OculusInnerCamera, _super);
  17894. function _OculusInnerCamera(name, position, scene, isLeftEye) {
  17895. _super.call(this, name, position, scene);
  17896. this._workMatrix = new BABYLON.Matrix();
  17897. this._actualUp = new BABYLON.Vector3(0, 0, 0);
  17898. this._aspectRatioAspectRatio = OculusRiftDevKit2013_Metric.HResolution / (2 * OculusRiftDevKit2013_Metric.VResolution);
  17899. this._aspectRatioFov = (2 * Math.atan((OculusRiftDevKit2013_Metric.PostProcessScaleFactor * OculusRiftDevKit2013_Metric.VScreenSize) / (2 * OculusRiftDevKit2013_Metric.EyeToScreenDistance)));
  17900. var hMeters = (OculusRiftDevKit2013_Metric.HScreenSize / 4) - (OculusRiftDevKit2013_Metric.LensSeparationDistance / 2);
  17901. var h = (4 * hMeters) / OculusRiftDevKit2013_Metric.HScreenSize;
  17902. this._hMatrix = BABYLON.Matrix.Translation(isLeftEye ? h : -h, 0, 0);
  17903. this.viewport = new BABYLON.Viewport(isLeftEye ? 0 : 0.5, 0, 0.5, 1.0);
  17904. this._preViewMatrix = BABYLON.Matrix.Translation(isLeftEye ? .5 * OculusRiftDevKit2013_Metric.InterpupillaryDistance : -.5 * OculusRiftDevKit2013_Metric.InterpupillaryDistance, 0, 0);
  17905. var postProcess = new BABYLON.OculusDistortionCorrectionPostProcess("Oculus Distortion", this, !isLeftEye, OculusRiftDevKit2013_Metric);
  17906. }
  17907. _OculusInnerCamera.prototype.getProjectionMatrix = function () {
  17908. BABYLON.Matrix.PerspectiveFovLHToRef(this._aspectRatioFov, this._aspectRatioAspectRatio, this.minZ, this.maxZ, this._workMatrix);
  17909. this._workMatrix.multiplyToRef(this._hMatrix, this._projectionMatrix);
  17910. return this._projectionMatrix;
  17911. };
  17912. _OculusInnerCamera.prototype._getViewMatrix = function () {
  17913. BABYLON.Matrix.RotationYawPitchRollToRef(this.rotation.y, this.rotation.x, this.rotation.z, this._cameraRotationMatrix);
  17914. BABYLON.Vector3.TransformCoordinatesToRef(this._referencePoint, this._cameraRotationMatrix, this._transformedReferencePoint);
  17915. BABYLON.Vector3.TransformNormalToRef(this.upVector, this._cameraRotationMatrix, this._actualUp);
  17916. this.position.addToRef(this._transformedReferencePoint, this._currentTarget);
  17917. BABYLON.Matrix.LookAtLHToRef(this.position, this._currentTarget, this._actualUp, this._workMatrix);
  17918. this._workMatrix.multiplyToRef(this._preViewMatrix, this._viewMatrix);
  17919. return this._viewMatrix;
  17920. };
  17921. return _OculusInnerCamera;
  17922. })(BABYLON.FreeCamera);
  17923. var OculusCamera = (function (_super) {
  17924. __extends(OculusCamera, _super);
  17925. function OculusCamera(name, position, scene) {
  17926. _super.call(this, name, position, scene);
  17927. this._leftCamera = new _OculusInnerCamera(name + "_left", position.clone(), scene, true);
  17928. this._rightCamera = new _OculusInnerCamera(name + "_right", position.clone(), scene, false);
  17929. this.subCameras.push(this._leftCamera);
  17930. this.subCameras.push(this._rightCamera);
  17931. this._deviceOrientationHandler = this._onOrientationEvent.bind(this);
  17932. }
  17933. OculusCamera.prototype._update = function () {
  17934. this._leftCamera.position.copyFrom(this.position);
  17935. this._rightCamera.position.copyFrom(this.position);
  17936. this._updateCamera(this._leftCamera);
  17937. this._updateCamera(this._rightCamera);
  17938. _super.prototype._update.call(this);
  17939. };
  17940. OculusCamera.prototype._updateCamera = function (camera) {
  17941. camera.minZ = this.minZ;
  17942. camera.maxZ = this.maxZ;
  17943. camera.rotation.x = this.rotation.x;
  17944. camera.rotation.y = this.rotation.y;
  17945. camera.rotation.z = this.rotation.z;
  17946. };
  17947. OculusCamera.prototype._onOrientationEvent = function (evt) {
  17948. var yaw = evt.alpha / 180 * Math.PI;
  17949. var pitch = evt.beta / 180 * Math.PI;
  17950. var roll = evt.gamma / 180 * Math.PI;
  17951. if (!this._offsetOrientation) {
  17952. this._offsetOrientation = {
  17953. yaw: yaw,
  17954. pitch: pitch,
  17955. roll: roll
  17956. };
  17957. return;
  17958. } else {
  17959. this.rotation.y += yaw - this._offsetOrientation.yaw;
  17960. this.rotation.x += pitch - this._offsetOrientation.pitch;
  17961. this.rotation.z += this._offsetOrientation.roll - roll;
  17962. this._offsetOrientation.yaw = yaw;
  17963. this._offsetOrientation.pitch = pitch;
  17964. this._offsetOrientation.roll = roll;
  17965. }
  17966. };
  17967. OculusCamera.prototype.attachControl = function (element, noPreventDefault) {
  17968. _super.prototype.attachControl.call(this, element, noPreventDefault);
  17969. window.addEventListener("deviceorientation", this._deviceOrientationHandler);
  17970. };
  17971. OculusCamera.prototype.detachControl = function (element) {
  17972. _super.prototype.detachControl.call(this, element);
  17973. window.removeEventListener("deviceorientation", this._deviceOrientationHandler);
  17974. };
  17975. return OculusCamera;
  17976. })(BABYLON.FreeCamera);
  17977. BABYLON.OculusCamera = OculusCamera;
  17978. })(BABYLON || (BABYLON = {}));
  17979. var __extends = this.__extends || function (d, b) {
  17980. for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p];
  17981. function __() { this.constructor = d; }
  17982. __.prototype = b.prototype;
  17983. d.prototype = new __();
  17984. };
  17985. var BABYLON;
  17986. (function (BABYLON) {
  17987. var OculusRiftDevKit2013_Metric = {
  17988. HResolution: 1280,
  17989. VResolution: 800,
  17990. HScreenSize: 0.149759993,
  17991. VScreenSize: 0.0935999975,
  17992. VScreenCenter: 0.0467999987,
  17993. EyeToScreenDistance: 0.0410000011,
  17994. LensSeparationDistance: 0.0635000020,
  17995. InterpupillaryDistance: 0.0640000030,
  17996. DistortionK: [1.0, 0.219999999, 0.239999995, 0.0],
  17997. ChromaAbCorrection: [0.995999992, -0.00400000019, 1.01400006, 0.0],
  17998. PostProcessScaleFactor: 1.714605507808412,
  17999. LensCenterOffset: 0.151976421
  18000. };
  18001. var _OculusInnerGamepadCamera = (function (_super) {
  18002. __extends(_OculusInnerGamepadCamera, _super);
  18003. function _OculusInnerGamepadCamera(name, position, scene, isLeftEye) {
  18004. _super.call(this, name, position, scene);
  18005. this._workMatrix = new BABYLON.Matrix();
  18006. this._actualUp = new BABYLON.Vector3(0, 0, 0);
  18007. this._aspectRatioAspectRatio = OculusRiftDevKit2013_Metric.HResolution / (2 * OculusRiftDevKit2013_Metric.VResolution);
  18008. this._aspectRatioFov = (2 * Math.atan((OculusRiftDevKit2013_Metric.PostProcessScaleFactor * OculusRiftDevKit2013_Metric.VScreenSize) / (2 * OculusRiftDevKit2013_Metric.EyeToScreenDistance)));
  18009. var hMeters = (OculusRiftDevKit2013_Metric.HScreenSize / 4) - (OculusRiftDevKit2013_Metric.LensSeparationDistance / 2);
  18010. var h = (4 * hMeters) / OculusRiftDevKit2013_Metric.HScreenSize;
  18011. this._hMatrix = BABYLON.Matrix.Translation(isLeftEye ? h : -h, 0, 0);
  18012. this.viewport = new BABYLON.Viewport(isLeftEye ? 0 : 0.5, 0, 0.5, 1.0);
  18013. this._preViewMatrix = BABYLON.Matrix.Translation(isLeftEye ? .5 * OculusRiftDevKit2013_Metric.InterpupillaryDistance : -.5 * OculusRiftDevKit2013_Metric.InterpupillaryDistance, 0, 0);
  18014. var postProcess = new BABYLON.OculusDistortionCorrectionPostProcess("Oculus Distortion", this, !isLeftEye, OculusRiftDevKit2013_Metric);
  18015. }
  18016. _OculusInnerGamepadCamera.prototype.getProjectionMatrix = function () {
  18017. BABYLON.Matrix.PerspectiveFovLHToRef(this._aspectRatioFov, this._aspectRatioAspectRatio, this.minZ, this.maxZ, this._workMatrix);
  18018. this._workMatrix.multiplyToRef(this._hMatrix, this._projectionMatrix);
  18019. return this._projectionMatrix;
  18020. };
  18021. _OculusInnerGamepadCamera.prototype._getViewMatrix = function () {
  18022. BABYLON.Matrix.RotationYawPitchRollToRef(this.rotation.y, this.rotation.x, this.rotation.z, this._cameraRotationMatrix);
  18023. BABYLON.Vector3.TransformCoordinatesToRef(this._referencePoint, this._cameraRotationMatrix, this._transformedReferencePoint);
  18024. BABYLON.Vector3.TransformNormalToRef(this.upVector, this._cameraRotationMatrix, this._actualUp);
  18025. this.position.addToRef(this._transformedReferencePoint, this._currentTarget);
  18026. BABYLON.Matrix.LookAtLHToRef(this.position, this._currentTarget, this._actualUp, this._workMatrix);
  18027. this._workMatrix.multiplyToRef(this._preViewMatrix, this._viewMatrix);
  18028. return this._viewMatrix;
  18029. };
  18030. return _OculusInnerGamepadCamera;
  18031. })(BABYLON.FreeCamera);
  18032. var OculusGamepadCamera = (function (_super) {
  18033. __extends(OculusGamepadCamera, _super);
  18034. function OculusGamepadCamera(name, position, scene) {
  18035. var _this = this;
  18036. _super.call(this, name, position, scene);
  18037. this.angularSensibility = 200;
  18038. this.moveSensibility = 75;
  18039. this._leftCamera = new _OculusInnerGamepadCamera(name + "_left", position.clone(), scene, true);
  18040. this._rightCamera = new _OculusInnerGamepadCamera(name + "_right", position.clone(), scene, false);
  18041. this.subCameras.push(this._leftCamera);
  18042. this.subCameras.push(this._rightCamera);
  18043. this._deviceOrientationHandler = this._onOrientationEvent.bind(this);
  18044. this._gamepads = new BABYLON.Gamepads(function (gamepad) {
  18045. _this._onNewGameConnected(gamepad);
  18046. });
  18047. }
  18048. OculusGamepadCamera.prototype._onNewGameConnected = function (gamepad) {
  18049. if (gamepad.index === 0) {
  18050. this._gamepad = gamepad;
  18051. }
  18052. };
  18053. OculusGamepadCamera.prototype._update = function () {
  18054. this._leftCamera.position.copyFrom(this.position);
  18055. this._rightCamera.position.copyFrom(this.position);
  18056. this._updateCamera(this._leftCamera);
  18057. this._updateCamera(this._rightCamera);
  18058. _super.prototype._update.call(this);
  18059. };
  18060. OculusGamepadCamera.prototype._checkInputs = function () {
  18061. if (!this._gamepad) {
  18062. return;
  18063. }
  18064. var LSValues = this._gamepad.leftStick;
  18065. var normalizedLX = LSValues.x / this.moveSensibility;
  18066. var normalizedLY = LSValues.y / this.moveSensibility;
  18067. LSValues.x = Math.abs(normalizedLX) > 0.005 ? 0 + normalizedLX : 0;
  18068. LSValues.y = Math.abs(normalizedLY) > 0.005 ? 0 + normalizedLY : 0;
  18069. var cameraTransform = BABYLON.Matrix.RotationYawPitchRoll(this.rotation.y, this.rotation.x, 0);
  18070. var deltaTransform = BABYLON.Vector3.TransformCoordinates(new BABYLON.Vector3(LSValues.x, 0, -LSValues.y), cameraTransform);
  18071. this.cameraDirection = this.cameraDirection.add(deltaTransform);
  18072. };
  18073. OculusGamepadCamera.prototype._updateCamera = function (camera) {
  18074. camera.minZ = this.minZ;
  18075. camera.maxZ = this.maxZ;
  18076. camera.rotation.x = this.rotation.x;
  18077. camera.rotation.y = this.rotation.y;
  18078. camera.rotation.z = this.rotation.z;
  18079. };
  18080. OculusGamepadCamera.prototype._onOrientationEvent = function (evt) {
  18081. var yaw = evt.alpha / 180 * Math.PI;
  18082. var pitch = evt.beta / 180 * Math.PI;
  18083. var roll = evt.gamma / 180 * Math.PI;
  18084. if (!this._offsetOrientation) {
  18085. this._offsetOrientation = {
  18086. yaw: yaw,
  18087. pitch: pitch,
  18088. roll: roll
  18089. };
  18090. return;
  18091. } else {
  18092. this.rotation.y += yaw - this._offsetOrientation.yaw;
  18093. this.rotation.x += pitch - this._offsetOrientation.pitch;
  18094. this.rotation.z += this._offsetOrientation.roll - roll;
  18095. this._offsetOrientation.yaw = yaw;
  18096. this._offsetOrientation.pitch = pitch;
  18097. this._offsetOrientation.roll = roll;
  18098. }
  18099. };
  18100. OculusGamepadCamera.prototype.attachControl = function (element, noPreventDefault) {
  18101. _super.prototype.attachControl.call(this, element, noPreventDefault);
  18102. window.addEventListener("deviceorientation", this._deviceOrientationHandler);
  18103. };
  18104. OculusGamepadCamera.prototype.detachControl = function (element) {
  18105. _super.prototype.detachControl.call(this, element);
  18106. window.removeEventListener("deviceorientation", this._deviceOrientationHandler);
  18107. };
  18108. OculusGamepadCamera.prototype.dispose = function () {
  18109. this._gamepads.dispose();
  18110. _super.prototype.dispose.call(this);
  18111. };
  18112. return OculusGamepadCamera;
  18113. })(BABYLON.FreeCamera);
  18114. BABYLON.OculusGamepadCamera = OculusGamepadCamera;
  18115. })(BABYLON || (BABYLON = {}));
  18116. var __extends = this.__extends || function (d, b) {
  18117. for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p];
  18118. function __() { this.constructor = d; }
  18119. __.prototype = b.prototype;
  18120. d.prototype = new __();
  18121. };
  18122. var BABYLON;
  18123. (function (BABYLON) {
  18124. var VirtualJoysticksCamera = (function (_super) {
  18125. __extends(VirtualJoysticksCamera, _super);
  18126. function VirtualJoysticksCamera(name, position, scene) {
  18127. _super.call(this, name, position, scene);
  18128. this._leftjoystick = new BABYLON.VirtualJoystick(true);
  18129. this._leftjoystick.setAxisForUpDown(2 /* Z */);
  18130. this._leftjoystick.setAxisForLeftRight(0 /* X */);
  18131. this._leftjoystick.setJoystickSensibility(0.15);
  18132. this._rightjoystick = new BABYLON.VirtualJoystick(false);
  18133. this._rightjoystick.setAxisForUpDown(0 /* X */);
  18134. this._rightjoystick.setAxisForLeftRight(1 /* Y */);
  18135. this._rightjoystick.reverseUpDown = true;
  18136. this._rightjoystick.setJoystickSensibility(0.05);
  18137. this._rightjoystick.setJoystickColor("yellow");
  18138. }
  18139. VirtualJoysticksCamera.prototype._checkInputs = function () {
  18140. var cameraTransform = BABYLON.Matrix.RotationYawPitchRoll(this.rotation.y, this.rotation.x, 0);
  18141. var deltaTransform = BABYLON.Vector3.TransformCoordinates(this._leftjoystick.deltaPosition, cameraTransform);
  18142. this.cameraDirection = this.cameraDirection.add(deltaTransform);
  18143. this.cameraRotation = this.cameraRotation.addVector3(this._rightjoystick.deltaPosition);
  18144. if (!this._leftjoystick.pressed) {
  18145. this._leftjoystick.deltaPosition = this._leftjoystick.deltaPosition.scale(0.9);
  18146. }
  18147. if (!this._rightjoystick.pressed) {
  18148. this._rightjoystick.deltaPosition = this._rightjoystick.deltaPosition.scale(0.9);
  18149. }
  18150. };
  18151. VirtualJoysticksCamera.prototype.dispose = function () {
  18152. this._leftjoystick.releaseCanvas();
  18153. _super.prototype.dispose.call(this);
  18154. };
  18155. return VirtualJoysticksCamera;
  18156. })(BABYLON.FreeCamera);
  18157. BABYLON.VirtualJoysticksCamera = VirtualJoysticksCamera;
  18158. })(BABYLON || (BABYLON = {}));
  18159. var __extends = this.__extends || function (d, b) {
  18160. for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p];
  18161. function __() { this.constructor = d; }
  18162. __.prototype = b.prototype;
  18163. d.prototype = new __();
  18164. };
  18165. var BABYLON;
  18166. (function (BABYLON) {
  18167. var ShaderMaterial = (function (_super) {
  18168. __extends(ShaderMaterial, _super);
  18169. function ShaderMaterial(name, scene, shaderPath, options) {
  18170. _super.call(this, name, scene);
  18171. this._textures = new Array();
  18172. this._floats = new Array();
  18173. this._floatsArrays = {};
  18174. this._colors3 = new Array();
  18175. this._colors4 = new Array();
  18176. this._vectors2 = new Array();
  18177. this._vectors3 = new Array();
  18178. this._matrices = new Array();
  18179. this._cachedWorldViewMatrix = new BABYLON.Matrix();
  18180. this._shaderPath = shaderPath;
  18181. options.needAlphaBlending = options.needAlphaBlending || false;
  18182. options.needAlphaTesting = options.needAlphaTesting || false;
  18183. options.attributes = options.attributes || ["position", "normal", "uv"];
  18184. options.uniforms = options.uniforms || ["worldViewProjection"];
  18185. options.samplers = options.samplers || [];
  18186. this._options = options;
  18187. }
  18188. ShaderMaterial.prototype.needAlphaBlending = function () {
  18189. return this._options.needAlphaBlending;
  18190. };
  18191. ShaderMaterial.prototype.needAlphaTesting = function () {
  18192. return this._options.needAlphaTesting;
  18193. };
  18194. ShaderMaterial.prototype._checkUniform = function (uniformName) {
  18195. if (this._options.uniforms.indexOf(uniformName) === -1) {
  18196. this._options.uniforms.push(uniformName);
  18197. }
  18198. };
  18199. ShaderMaterial.prototype.setTexture = function (name, texture) {
  18200. if (this._options.samplers.indexOf(name) === -1) {
  18201. this._options.samplers.push(name);
  18202. }
  18203. this._textures[name] = texture;
  18204. return this;
  18205. };
  18206. ShaderMaterial.prototype.setFloat = function (name, value) {
  18207. this._checkUniform(name);
  18208. this._floats[name] = value;
  18209. return this;
  18210. };
  18211. ShaderMaterial.prototype.setFloats = function (name, value) {
  18212. this._checkUniform(name);
  18213. this._floatsArrays[name] = value;
  18214. return this;
  18215. };
  18216. ShaderMaterial.prototype.setColor3 = function (name, value) {
  18217. this._checkUniform(name);
  18218. this._colors3[name] = value;
  18219. return this;
  18220. };
  18221. ShaderMaterial.prototype.setColor4 = function (name, value) {
  18222. this._checkUniform(name);
  18223. this._colors4[name] = value;
  18224. return this;
  18225. };
  18226. ShaderMaterial.prototype.setVector2 = function (name, value) {
  18227. this._checkUniform(name);
  18228. this._vectors2[name] = value;
  18229. return this;
  18230. };
  18231. ShaderMaterial.prototype.setVector3 = function (name, value) {
  18232. this._checkUniform(name);
  18233. this._vectors3[name] = value;
  18234. return this;
  18235. };
  18236. ShaderMaterial.prototype.setMatrix = function (name, value) {
  18237. this._checkUniform(name);
  18238. this._matrices[name] = value;
  18239. return this;
  18240. };
  18241. ShaderMaterial.prototype.isReady = function () {
  18242. var engine = this.getScene().getEngine();
  18243. this._effect = engine.createEffect(this._shaderPath, this._options.attributes, this._options.uniforms, this._options.samplers, "", null, this.onCompiled, this.onError);
  18244. if (!this._effect.isReady()) {
  18245. return false;
  18246. }
  18247. return true;
  18248. };
  18249. ShaderMaterial.prototype.bind = function (world) {
  18250. if (this._options.uniforms.indexOf("world") !== -1) {
  18251. this._effect.setMatrix("world", world);
  18252. }
  18253. if (this._options.uniforms.indexOf("view") !== -1) {
  18254. this._effect.setMatrix("view", this.getScene().getViewMatrix());
  18255. }
  18256. if (this._options.uniforms.indexOf("worldView") !== -1) {
  18257. world.multiplyToRef(this.getScene().getViewMatrix(), this._cachedWorldViewMatrix);
  18258. this._effect.setMatrix("worldView", this._cachedWorldViewMatrix);
  18259. }
  18260. if (this._options.uniforms.indexOf("projection") !== -1) {
  18261. this._effect.setMatrix("projection", this.getScene().getProjectionMatrix());
  18262. }
  18263. if (this._options.uniforms.indexOf("worldViewProjection") !== -1) {
  18264. this._effect.setMatrix("worldViewProjection", world.multiply(this.getScene().getTransformMatrix()));
  18265. }
  18266. for (var name in this._textures) {
  18267. this._effect.setTexture(name, this._textures[name]);
  18268. }
  18269. for (name in this._floats) {
  18270. this._effect.setFloat(name, this._floats[name]);
  18271. }
  18272. for (name in this._floatsArrays) {
  18273. this._effect.setArray(name, this._floatsArrays[name]);
  18274. }
  18275. for (name in this._colors3) {
  18276. this._effect.setColor3(name, this._colors3[name]);
  18277. }
  18278. for (name in this._colors4) {
  18279. var color = this._colors4[name];
  18280. this._effect.setFloat4(name, color.r, color.g, color.b, color.a);
  18281. }
  18282. for (name in this._vectors2) {
  18283. this._effect.setVector2(name, this._vectors2[name]);
  18284. }
  18285. for (name in this._vectors3) {
  18286. this._effect.setVector3(name, this._vectors3[name]);
  18287. }
  18288. for (name in this._matrices) {
  18289. this._effect.setMatrix(name, this._matrices[name]);
  18290. }
  18291. };
  18292. ShaderMaterial.prototype.dispose = function (forceDisposeEffect) {
  18293. for (var name in this._textures) {
  18294. this._textures[name].dispose();
  18295. }
  18296. this._textures = [];
  18297. _super.prototype.dispose.call(this, forceDisposeEffect);
  18298. };
  18299. return ShaderMaterial;
  18300. })(BABYLON.Material);
  18301. BABYLON.ShaderMaterial = ShaderMaterial;
  18302. })(BABYLON || (BABYLON = {}));
  18303. var BABYLON;
  18304. (function (BABYLON) {
  18305. var VertexData = (function () {
  18306. function VertexData() {
  18307. }
  18308. VertexData.prototype.set = function (data, kind) {
  18309. switch (kind) {
  18310. case BABYLON.VertexBuffer.PositionKind:
  18311. this.positions = data;
  18312. break;
  18313. case BABYLON.VertexBuffer.NormalKind:
  18314. this.normals = data;
  18315. break;
  18316. case BABYLON.VertexBuffer.UVKind:
  18317. this.uvs = data;
  18318. break;
  18319. case BABYLON.VertexBuffer.UV2Kind:
  18320. this.uv2s = data;
  18321. break;
  18322. case BABYLON.VertexBuffer.ColorKind:
  18323. this.colors = data;
  18324. break;
  18325. case BABYLON.VertexBuffer.MatricesIndicesKind:
  18326. this.matricesIndices = data;
  18327. break;
  18328. case BABYLON.VertexBuffer.MatricesWeightsKind:
  18329. this.matricesWeights = data;
  18330. break;
  18331. }
  18332. };
  18333. VertexData.prototype.applyToMesh = function (mesh, updatable) {
  18334. this._applyTo(mesh, updatable);
  18335. };
  18336. VertexData.prototype.applyToGeometry = function (geometry, updatable) {
  18337. this._applyTo(geometry, updatable);
  18338. };
  18339. VertexData.prototype.updateMesh = function (mesh, updateExtends, makeItUnique) {
  18340. this._update(mesh);
  18341. };
  18342. VertexData.prototype.updateGeometry = function (geometry, updateExtends, makeItUnique) {
  18343. this._update(geometry);
  18344. };
  18345. VertexData.prototype._applyTo = function (meshOrGeometry, updatable) {
  18346. if (this.positions) {
  18347. meshOrGeometry.setVerticesData(BABYLON.VertexBuffer.PositionKind, this.positions, updatable);
  18348. }
  18349. if (this.normals) {
  18350. meshOrGeometry.setVerticesData(BABYLON.VertexBuffer.NormalKind, this.normals, updatable);
  18351. }
  18352. if (this.uvs) {
  18353. meshOrGeometry.setVerticesData(BABYLON.VertexBuffer.UVKind, this.uvs, updatable);
  18354. }
  18355. if (this.uv2s) {
  18356. meshOrGeometry.setVerticesData(BABYLON.VertexBuffer.UV2Kind, this.uv2s, updatable);
  18357. }
  18358. if (this.colors) {
  18359. meshOrGeometry.setVerticesData(BABYLON.VertexBuffer.ColorKind, this.colors, updatable);
  18360. }
  18361. if (this.matricesIndices) {
  18362. meshOrGeometry.setVerticesData(BABYLON.VertexBuffer.MatricesIndicesKind, this.matricesIndices, updatable);
  18363. }
  18364. if (this.matricesWeights) {
  18365. meshOrGeometry.setVerticesData(BABYLON.VertexBuffer.MatricesWeightsKind, this.matricesWeights, updatable);
  18366. }
  18367. if (this.indices) {
  18368. meshOrGeometry.setIndices(this.indices);
  18369. }
  18370. };
  18371. VertexData.prototype._update = function (meshOrGeometry, updateExtends, makeItUnique) {
  18372. if (this.positions) {
  18373. meshOrGeometry.updateVerticesData(BABYLON.VertexBuffer.PositionKind, this.positions, updateExtends, makeItUnique);
  18374. }
  18375. if (this.normals) {
  18376. meshOrGeometry.updateVerticesData(BABYLON.VertexBuffer.NormalKind, this.normals, updateExtends, makeItUnique);
  18377. }
  18378. if (this.uvs) {
  18379. meshOrGeometry.updateVerticesData(BABYLON.VertexBuffer.UVKind, this.uvs, updateExtends, makeItUnique);
  18380. }
  18381. if (this.uv2s) {
  18382. meshOrGeometry.updateVerticesData(BABYLON.VertexBuffer.UV2Kind, this.uv2s, updateExtends, makeItUnique);
  18383. }
  18384. if (this.colors) {
  18385. meshOrGeometry.updateVerticesData(BABYLON.VertexBuffer.ColorKind, this.colors, updateExtends, makeItUnique);
  18386. }
  18387. if (this.matricesIndices) {
  18388. meshOrGeometry.updateVerticesData(BABYLON.VertexBuffer.MatricesIndicesKind, this.matricesIndices, updateExtends, makeItUnique);
  18389. }
  18390. if (this.matricesWeights) {
  18391. meshOrGeometry.updateVerticesData(BABYLON.VertexBuffer.MatricesWeightsKind, this.matricesWeights, updateExtends, makeItUnique);
  18392. }
  18393. if (this.indices) {
  18394. meshOrGeometry.setIndices(this.indices);
  18395. }
  18396. };
  18397. VertexData.prototype.transform = function (matrix) {
  18398. var transformed = BABYLON.Vector3.Zero();
  18399. if (this.positions) {
  18400. var position = BABYLON.Vector3.Zero();
  18401. for (var index = 0; index < this.positions.length; index += 3) {
  18402. BABYLON.Vector3.FromArrayToRef(this.positions, index, position);
  18403. BABYLON.Vector3.TransformCoordinatesToRef(position, matrix, transformed);
  18404. this.positions[index] = transformed.x;
  18405. this.positions[index + 1] = transformed.y;
  18406. this.positions[index + 2] = transformed.z;
  18407. }
  18408. }
  18409. if (this.normals) {
  18410. var normal = BABYLON.Vector3.Zero();
  18411. for (index = 0; index < this.normals.length; index += 3) {
  18412. BABYLON.Vector3.FromArrayToRef(this.normals, index, normal);
  18413. BABYLON.Vector3.TransformNormalToRef(normal, matrix, transformed);
  18414. this.normals[index] = transformed.x;
  18415. this.normals[index + 1] = transformed.y;
  18416. this.normals[index + 2] = transformed.z;
  18417. }
  18418. }
  18419. };
  18420. VertexData.prototype.merge = function (other) {
  18421. if (other.indices) {
  18422. if (!this.indices) {
  18423. this.indices = [];
  18424. }
  18425. var offset = this.positions ? this.positions.length / 3 : 0;
  18426. for (var index = 0; index < other.indices.length; index++) {
  18427. this.indices.push(other.indices[index] + offset);
  18428. }
  18429. }
  18430. if (other.positions) {
  18431. if (!this.positions) {
  18432. this.positions = [];
  18433. }
  18434. for (index = 0; index < other.positions.length; index++) {
  18435. this.positions.push(other.positions[index]);
  18436. }
  18437. }
  18438. if (other.normals) {
  18439. if (!this.normals) {
  18440. this.normals = [];
  18441. }
  18442. for (index = 0; index < other.normals.length; index++) {
  18443. this.normals.push(other.normals[index]);
  18444. }
  18445. }
  18446. if (other.uvs) {
  18447. if (!this.uvs) {
  18448. this.uvs = [];
  18449. }
  18450. for (index = 0; index < other.uvs.length; index++) {
  18451. this.uvs.push(other.uvs[index]);
  18452. }
  18453. }
  18454. if (other.uv2s) {
  18455. if (!this.uv2s) {
  18456. this.uv2s = [];
  18457. }
  18458. for (index = 0; index < other.uv2s.length; index++) {
  18459. this.uv2s.push(other.uv2s[index]);
  18460. }
  18461. }
  18462. if (other.matricesIndices) {
  18463. if (!this.matricesIndices) {
  18464. this.matricesIndices = [];
  18465. }
  18466. for (index = 0; index < other.matricesIndices.length; index++) {
  18467. this.matricesIndices.push(other.matricesIndices[index]);
  18468. }
  18469. }
  18470. if (other.matricesWeights) {
  18471. if (!this.matricesWeights) {
  18472. this.matricesWeights = [];
  18473. }
  18474. for (index = 0; index < other.matricesWeights.length; index++) {
  18475. this.matricesWeights.push(other.matricesWeights[index]);
  18476. }
  18477. }
  18478. if (other.colors) {
  18479. if (!this.colors) {
  18480. this.colors = [];
  18481. }
  18482. for (index = 0; index < other.colors.length; index++) {
  18483. this.colors.push(other.colors[index]);
  18484. }
  18485. }
  18486. };
  18487. VertexData.ExtractFromMesh = function (mesh) {
  18488. return VertexData._ExtractFrom(mesh);
  18489. };
  18490. VertexData.ExtractFromGeometry = function (geometry) {
  18491. return VertexData._ExtractFrom(geometry);
  18492. };
  18493. VertexData._ExtractFrom = function (meshOrGeometry) {
  18494. var result = new BABYLON.VertexData();
  18495. if (meshOrGeometry.isVerticesDataPresent(BABYLON.VertexBuffer.PositionKind)) {
  18496. result.positions = meshOrGeometry.getVerticesData(BABYLON.VertexBuffer.PositionKind);
  18497. }
  18498. if (meshOrGeometry.isVerticesDataPresent(BABYLON.VertexBuffer.NormalKind)) {
  18499. result.normals = meshOrGeometry.getVerticesData(BABYLON.VertexBuffer.NormalKind);
  18500. }
  18501. if (meshOrGeometry.isVerticesDataPresent(BABYLON.VertexBuffer.UVKind)) {
  18502. result.uvs = meshOrGeometry.getVerticesData(BABYLON.VertexBuffer.UVKind);
  18503. }
  18504. if (meshOrGeometry.isVerticesDataPresent(BABYLON.VertexBuffer.UV2Kind)) {
  18505. result.uv2s = meshOrGeometry.getVerticesData(BABYLON.VertexBuffer.UV2Kind);
  18506. }
  18507. if (meshOrGeometry.isVerticesDataPresent(BABYLON.VertexBuffer.ColorKind)) {
  18508. result.colors = meshOrGeometry.getVerticesData(BABYLON.VertexBuffer.ColorKind);
  18509. }
  18510. if (meshOrGeometry.isVerticesDataPresent(BABYLON.VertexBuffer.MatricesIndicesKind)) {
  18511. result.matricesIndices = meshOrGeometry.getVerticesData(BABYLON.VertexBuffer.MatricesIndicesKind);
  18512. }
  18513. if (meshOrGeometry.isVerticesDataPresent(BABYLON.VertexBuffer.MatricesWeightsKind)) {
  18514. result.matricesWeights = meshOrGeometry.getVerticesData(BABYLON.VertexBuffer.MatricesWeightsKind);
  18515. }
  18516. result.indices = meshOrGeometry.getIndices();
  18517. return result;
  18518. };
  18519. VertexData.CreateBox = function (size) {
  18520. var normalsSource = [
  18521. new BABYLON.Vector3(0, 0, 1),
  18522. new BABYLON.Vector3(0, 0, -1),
  18523. new BABYLON.Vector3(1, 0, 0),
  18524. new BABYLON.Vector3(-1, 0, 0),
  18525. new BABYLON.Vector3(0, 1, 0),
  18526. new BABYLON.Vector3(0, -1, 0)
  18527. ];
  18528. var indices = [];
  18529. var positions = [];
  18530. var normals = [];
  18531. var uvs = [];
  18532. size = size || 1;
  18533. for (var index = 0; index < normalsSource.length; index++) {
  18534. var normal = normalsSource[index];
  18535. var side1 = new BABYLON.Vector3(normal.y, normal.z, normal.x);
  18536. var side2 = BABYLON.Vector3.Cross(normal, side1);
  18537. var verticesLength = positions.length / 3;
  18538. indices.push(verticesLength);
  18539. indices.push(verticesLength + 1);
  18540. indices.push(verticesLength + 2);
  18541. indices.push(verticesLength);
  18542. indices.push(verticesLength + 2);
  18543. indices.push(verticesLength + 3);
  18544. var vertex = normal.subtract(side1).subtract(side2).scale(size / 2);
  18545. positions.push(vertex.x, vertex.y, vertex.z);
  18546. normals.push(normal.x, normal.y, normal.z);
  18547. uvs.push(1.0, 1.0);
  18548. vertex = normal.subtract(side1).add(side2).scale(size / 2);
  18549. positions.push(vertex.x, vertex.y, vertex.z);
  18550. normals.push(normal.x, normal.y, normal.z);
  18551. uvs.push(0.0, 1.0);
  18552. vertex = normal.add(side1).add(side2).scale(size / 2);
  18553. positions.push(vertex.x, vertex.y, vertex.z);
  18554. normals.push(normal.x, normal.y, normal.z);
  18555. uvs.push(0.0, 0.0);
  18556. vertex = normal.add(side1).subtract(side2).scale(size / 2);
  18557. positions.push(vertex.x, vertex.y, vertex.z);
  18558. normals.push(normal.x, normal.y, normal.z);
  18559. uvs.push(1.0, 0.0);
  18560. }
  18561. var vertexData = new BABYLON.VertexData();
  18562. vertexData.indices = indices;
  18563. vertexData.positions = positions;
  18564. vertexData.normals = normals;
  18565. vertexData.uvs = uvs;
  18566. return vertexData;
  18567. };
  18568. VertexData.CreateSphere = function (segments, diameter) {
  18569. segments = segments || 32;
  18570. diameter = diameter || 1;
  18571. var radius = diameter / 2;
  18572. var totalZRotationSteps = 2 + segments;
  18573. var totalYRotationSteps = 2 * totalZRotationSteps;
  18574. var indices = [];
  18575. var positions = [];
  18576. var normals = [];
  18577. var uvs = [];
  18578. for (var zRotationStep = 0; zRotationStep <= totalZRotationSteps; zRotationStep++) {
  18579. var normalizedZ = zRotationStep / totalZRotationSteps;
  18580. var angleZ = (normalizedZ * Math.PI);
  18581. for (var yRotationStep = 0; yRotationStep <= totalYRotationSteps; yRotationStep++) {
  18582. var normalizedY = yRotationStep / totalYRotationSteps;
  18583. var angleY = normalizedY * Math.PI * 2;
  18584. var rotationZ = BABYLON.Matrix.RotationZ(-angleZ);
  18585. var rotationY = BABYLON.Matrix.RotationY(angleY);
  18586. var afterRotZ = BABYLON.Vector3.TransformCoordinates(BABYLON.Vector3.Up(), rotationZ);
  18587. var complete = BABYLON.Vector3.TransformCoordinates(afterRotZ, rotationY);
  18588. var vertex = complete.scale(radius);
  18589. var normal = BABYLON.Vector3.Normalize(vertex);
  18590. positions.push(vertex.x, vertex.y, vertex.z);
  18591. normals.push(normal.x, normal.y, normal.z);
  18592. uvs.push(normalizedZ, normalizedY);
  18593. }
  18594. if (zRotationStep > 0) {
  18595. var verticesCount = positions.length / 3;
  18596. for (var firstIndex = verticesCount - 2 * (totalYRotationSteps + 1); (firstIndex + totalYRotationSteps + 2) < verticesCount; firstIndex++) {
  18597. indices.push((firstIndex));
  18598. indices.push((firstIndex + 1));
  18599. indices.push(firstIndex + totalYRotationSteps + 1);
  18600. indices.push((firstIndex + totalYRotationSteps + 1));
  18601. indices.push((firstIndex + 1));
  18602. indices.push((firstIndex + totalYRotationSteps + 2));
  18603. }
  18604. }
  18605. }
  18606. var vertexData = new BABYLON.VertexData();
  18607. vertexData.indices = indices;
  18608. vertexData.positions = positions;
  18609. vertexData.normals = normals;
  18610. vertexData.uvs = uvs;
  18611. return vertexData;
  18612. };
  18613. VertexData.CreateCylinder = function (height, diameterTop, diameterBottom, tessellation, subdivisions) {
  18614. if (typeof subdivisions === "undefined") { subdivisions = 1; }
  18615. var radiusTop = diameterTop / 2;
  18616. var radiusBottom = diameterBottom / 2;
  18617. var indices = [];
  18618. var positions = [];
  18619. var normals = [];
  18620. var uvs = [];
  18621. height = height || 1;
  18622. diameterTop = diameterTop || 0.5;
  18623. diameterBottom = diameterBottom || 1;
  18624. tessellation = tessellation || 16;
  18625. subdivisions = subdivisions || 1;
  18626. subdivisions = (subdivisions < 1) ? 1 : subdivisions;
  18627. var getCircleVector = function (i) {
  18628. var angle = (i * 2.0 * Math.PI / tessellation);
  18629. var dx = Math.cos(angle);
  18630. var dz = Math.sin(angle);
  18631. return new BABYLON.Vector3(dx, 0, dz);
  18632. };
  18633. var createCylinderCap = function (isTop) {
  18634. var radius = isTop ? radiusTop : radiusBottom;
  18635. if (radius == 0) {
  18636. return;
  18637. }
  18638. var vbase = positions.length / 3;
  18639. var offset = new BABYLON.Vector3(0, height / 2, 0);
  18640. var textureScale = new BABYLON.Vector2(0.5, 0.5);
  18641. if (!isTop) {
  18642. offset.scaleInPlace(-1);
  18643. textureScale.x = -textureScale.x;
  18644. }
  18645. for (i = 0; i < tessellation; i++) {
  18646. var circleVector = getCircleVector(i);
  18647. var position = circleVector.scale(radius).add(offset);
  18648. var textureCoordinate = new BABYLON.Vector2(circleVector.x * textureScale.x + 0.5, circleVector.z * textureScale.y + 0.5);
  18649. positions.push(position.x, position.y, position.z);
  18650. uvs.push(textureCoordinate.x, textureCoordinate.y);
  18651. }
  18652. for (var i = 0; i < tessellation - 2; i++) {
  18653. if (!isTop) {
  18654. indices.push(vbase);
  18655. indices.push(vbase + (i + 2) % tessellation);
  18656. indices.push(vbase + (i + 1) % tessellation);
  18657. } else {
  18658. indices.push(vbase);
  18659. indices.push(vbase + (i + 1) % tessellation);
  18660. indices.push(vbase + (i + 2) % tessellation);
  18661. }
  18662. }
  18663. };
  18664. var base = new BABYLON.Vector3(0, -1, 0).scale(height / 2);
  18665. var offset = new BABYLON.Vector3(0, 1, 0).scale(height / subdivisions);
  18666. var stride = tessellation + 1;
  18667. for (var i = 0; i <= tessellation; i++) {
  18668. var circleVector = getCircleVector(i);
  18669. var textureCoordinate = new BABYLON.Vector2(i / tessellation, 0);
  18670. var position, radius = radiusBottom;
  18671. for (var s = 0; s <= subdivisions; s++) {
  18672. position = circleVector.scale(radius);
  18673. position.addInPlace(base.add(offset.scale(s)));
  18674. textureCoordinate.y += 1 / subdivisions;
  18675. radius += (radiusTop - radiusBottom) / subdivisions;
  18676. positions.push(position.x, position.y, position.z);
  18677. uvs.push(textureCoordinate.x, textureCoordinate.y);
  18678. }
  18679. }
  18680. subdivisions += 1;
  18681. for (var s = 0; s < subdivisions - 1; s++) {
  18682. for (var i = 0; i <= tessellation; i++) {
  18683. indices.push(i * subdivisions + s);
  18684. indices.push((i * subdivisions + (s + subdivisions)) % (stride * subdivisions));
  18685. indices.push(i * subdivisions + (s + 1));
  18686. indices.push(i * subdivisions + (s + 1));
  18687. indices.push((i * subdivisions + (s + subdivisions)) % (stride * subdivisions));
  18688. indices.push((i * subdivisions + (s + subdivisions + 1)) % (stride * subdivisions));
  18689. }
  18690. }
  18691. createCylinderCap(true);
  18692. createCylinderCap(false);
  18693. BABYLON.VertexData.ComputeNormals(positions, indices, normals);
  18694. var vertexData = new BABYLON.VertexData();
  18695. vertexData.indices = indices;
  18696. vertexData.positions = positions;
  18697. vertexData.normals = normals;
  18698. vertexData.uvs = uvs;
  18699. return vertexData;
  18700. };
  18701. VertexData.CreateTorus = function (diameter, thickness, tessellation) {
  18702. var indices = [];
  18703. var positions = [];
  18704. var normals = [];
  18705. var uvs = [];
  18706. diameter = diameter || 1;
  18707. thickness = thickness || 0.5;
  18708. tessellation = tessellation || 16;
  18709. var stride = tessellation + 1;
  18710. for (var i = 0; i <= tessellation; i++) {
  18711. var u = i / tessellation;
  18712. var outerAngle = i * Math.PI * 2.0 / tessellation - Math.PI / 2.0;
  18713. var transform = BABYLON.Matrix.Translation(diameter / 2.0, 0, 0).multiply(BABYLON.Matrix.RotationY(outerAngle));
  18714. for (var j = 0; j <= tessellation; j++) {
  18715. var v = 1 - j / tessellation;
  18716. var innerAngle = j * Math.PI * 2.0 / tessellation + Math.PI;
  18717. var dx = Math.cos(innerAngle);
  18718. var dy = Math.sin(innerAngle);
  18719. var normal = new BABYLON.Vector3(dx, dy, 0);
  18720. var position = normal.scale(thickness / 2);
  18721. var textureCoordinate = new BABYLON.Vector2(u, v);
  18722. position = BABYLON.Vector3.TransformCoordinates(position, transform);
  18723. normal = BABYLON.Vector3.TransformNormal(normal, transform);
  18724. positions.push(position.x, position.y, position.z);
  18725. normals.push(normal.x, normal.y, normal.z);
  18726. uvs.push(textureCoordinate.x, textureCoordinate.y);
  18727. var nextI = (i + 1) % stride;
  18728. var nextJ = (j + 1) % stride;
  18729. indices.push(i * stride + j);
  18730. indices.push(i * stride + nextJ);
  18731. indices.push(nextI * stride + j);
  18732. indices.push(i * stride + nextJ);
  18733. indices.push(nextI * stride + nextJ);
  18734. indices.push(nextI * stride + j);
  18735. }
  18736. }
  18737. var vertexData = new BABYLON.VertexData();
  18738. vertexData.indices = indices;
  18739. vertexData.positions = positions;
  18740. vertexData.normals = normals;
  18741. vertexData.uvs = uvs;
  18742. return vertexData;
  18743. };
  18744. VertexData.CreateLines = function (points) {
  18745. var indices = [];
  18746. var positions = [];
  18747. for (var index = 0; index < points.length; index++) {
  18748. positions.push(points[index].x, points[index].y, points[index].z);
  18749. if (index > 0) {
  18750. indices.push(index - 1);
  18751. indices.push(index);
  18752. }
  18753. }
  18754. var vertexData = new BABYLON.VertexData();
  18755. vertexData.indices = indices;
  18756. vertexData.positions = positions;
  18757. return vertexData;
  18758. };
  18759. VertexData.CreateGround = function (width, height, subdivisions) {
  18760. var indices = [];
  18761. var positions = [];
  18762. var normals = [];
  18763. var uvs = [];
  18764. var row, col;
  18765. width = width || 1;
  18766. height = height || 1;
  18767. subdivisions = subdivisions || 1;
  18768. for (row = 0; row <= subdivisions; row++) {
  18769. for (col = 0; col <= subdivisions; col++) {
  18770. var position = new BABYLON.Vector3((col * width) / subdivisions - (width / 2.0), 0, ((subdivisions - row) * height) / subdivisions - (height / 2.0));
  18771. var normal = new BABYLON.Vector3(0, 1.0, 0);
  18772. positions.push(position.x, position.y, position.z);
  18773. normals.push(normal.x, normal.y, normal.z);
  18774. uvs.push(col / subdivisions, 1.0 - row / subdivisions);
  18775. }
  18776. }
  18777. for (row = 0; row < subdivisions; row++) {
  18778. for (col = 0; col < subdivisions; col++) {
  18779. indices.push(col + 1 + (row + 1) * (subdivisions + 1));
  18780. indices.push(col + 1 + row * (subdivisions + 1));
  18781. indices.push(col + row * (subdivisions + 1));
  18782. indices.push(col + (row + 1) * (subdivisions + 1));
  18783. indices.push(col + 1 + (row + 1) * (subdivisions + 1));
  18784. indices.push(col + row * (subdivisions + 1));
  18785. }
  18786. }
  18787. var vertexData = new BABYLON.VertexData();
  18788. vertexData.indices = indices;
  18789. vertexData.positions = positions;
  18790. vertexData.normals = normals;
  18791. vertexData.uvs = uvs;
  18792. return vertexData;
  18793. };
  18794. VertexData.CreateTiledGround = function (xmin, zmin, xmax, zmax, subdivisions, precision) {
  18795. if (typeof subdivisions === "undefined") { subdivisions = { w: 1, h: 1 }; }
  18796. if (typeof precision === "undefined") { precision = { w: 1, h: 1 }; }
  18797. var indices = [];
  18798. var positions = [];
  18799. var normals = [];
  18800. var uvs = [];
  18801. var row, col, tileRow, tileCol;
  18802. subdivisions.h = (subdivisions.w < 1) ? 1 : subdivisions.h;
  18803. subdivisions.w = (subdivisions.w < 1) ? 1 : subdivisions.w;
  18804. precision.w = (precision.w < 1) ? 1 : precision.w;
  18805. precision.h = (precision.h < 1) ? 1 : precision.h;
  18806. var tileSize = {
  18807. 'w': (xmax - xmin) / subdivisions.w,
  18808. 'h': (zmax - zmin) / subdivisions.h
  18809. };
  18810. for (tileRow = 0; tileRow < subdivisions.h; tileRow++) {
  18811. for (tileCol = 0; tileCol < subdivisions.w; tileCol++) {
  18812. applyTile(xmin + tileCol * tileSize.w, zmin + tileRow * tileSize.h, xmin + (tileCol + 1) * tileSize.w, zmin + (tileRow + 1) * tileSize.h);
  18813. }
  18814. }
  18815. function applyTile(xTileMin, zTileMin, xTileMax, zTileMax) {
  18816. var base = positions.length / 3;
  18817. var rowLength = precision.w + 1;
  18818. for (row = 0; row < precision.h; row++) {
  18819. for (col = 0; col < precision.w; col++) {
  18820. var square = [
  18821. base + col + row * rowLength,
  18822. base + (col + 1) + row * rowLength,
  18823. base + (col + 1) + (row + 1) * rowLength,
  18824. base + col + (row + 1) * rowLength
  18825. ];
  18826. indices.push(square[1]);
  18827. indices.push(square[2]);
  18828. indices.push(square[3]);
  18829. indices.push(square[0]);
  18830. indices.push(square[1]);
  18831. indices.push(square[3]);
  18832. }
  18833. }
  18834. var position = BABYLON.Vector3.Zero();
  18835. var normal = new BABYLON.Vector3(0, 1.0, 0);
  18836. for (row = 0; row <= precision.h; row++) {
  18837. position.z = (row * (zTileMax - zTileMin)) / precision.h + zTileMin;
  18838. for (col = 0; col <= precision.w; col++) {
  18839. position.x = (col * (xTileMax - xTileMin)) / precision.w + xTileMin;
  18840. position.y = 0;
  18841. positions.push(position.x, position.y, position.z);
  18842. normals.push(normal.x, normal.y, normal.z);
  18843. uvs.push(col / precision.w, row / precision.h);
  18844. }
  18845. }
  18846. }
  18847. var vertexData = new BABYLON.VertexData();
  18848. vertexData.indices = indices;
  18849. vertexData.positions = positions;
  18850. vertexData.normals = normals;
  18851. vertexData.uvs = uvs;
  18852. return vertexData;
  18853. };
  18854. VertexData.CreateGroundFromHeightMap = function (width, height, subdivisions, minHeight, maxHeight, buffer, bufferWidth, bufferHeight) {
  18855. var indices = [];
  18856. var positions = [];
  18857. var normals = [];
  18858. var uvs = [];
  18859. var row, col;
  18860. for (row = 0; row <= subdivisions; row++) {
  18861. for (col = 0; col <= subdivisions; col++) {
  18862. var position = new BABYLON.Vector3((col * width) / subdivisions - (width / 2.0), 0, ((subdivisions - row) * height) / subdivisions - (height / 2.0));
  18863. var heightMapX = (((position.x + width / 2) / width) * (bufferWidth - 1)) | 0;
  18864. var heightMapY = ((1.0 - (position.z + height / 2) / height) * (bufferHeight - 1)) | 0;
  18865. var pos = (heightMapX + heightMapY * bufferWidth) * 4;
  18866. var r = buffer[pos] / 255.0;
  18867. var g = buffer[pos + 1] / 255.0;
  18868. var b = buffer[pos + 2] / 255.0;
  18869. var gradient = r * 0.3 + g * 0.59 + b * 0.11;
  18870. position.y = minHeight + (maxHeight - minHeight) * gradient;
  18871. positions.push(position.x, position.y, position.z);
  18872. normals.push(0, 0, 0);
  18873. uvs.push(col / subdivisions, 1.0 - row / subdivisions);
  18874. }
  18875. }
  18876. for (row = 0; row < subdivisions; row++) {
  18877. for (col = 0; col < subdivisions; col++) {
  18878. indices.push(col + 1 + (row + 1) * (subdivisions + 1));
  18879. indices.push(col + 1 + row * (subdivisions + 1));
  18880. indices.push(col + row * (subdivisions + 1));
  18881. indices.push(col + (row + 1) * (subdivisions + 1));
  18882. indices.push(col + 1 + (row + 1) * (subdivisions + 1));
  18883. indices.push(col + row * (subdivisions + 1));
  18884. }
  18885. }
  18886. BABYLON.VertexData.ComputeNormals(positions, indices, normals);
  18887. var vertexData = new BABYLON.VertexData();
  18888. vertexData.indices = indices;
  18889. vertexData.positions = positions;
  18890. vertexData.normals = normals;
  18891. vertexData.uvs = uvs;
  18892. return vertexData;
  18893. };
  18894. VertexData.CreatePlane = function (size) {
  18895. var indices = [];
  18896. var positions = [];
  18897. var normals = [];
  18898. var uvs = [];
  18899. size = size || 1;
  18900. var halfSize = size / 2.0;
  18901. positions.push(-halfSize, -halfSize, 0);
  18902. normals.push(0, 0, -1.0);
  18903. uvs.push(0.0, 0.0);
  18904. positions.push(halfSize, -halfSize, 0);
  18905. normals.push(0, 0, -1.0);
  18906. uvs.push(1.0, 0.0);
  18907. positions.push(halfSize, halfSize, 0);
  18908. normals.push(0, 0, -1.0);
  18909. uvs.push(1.0, 1.0);
  18910. positions.push(-halfSize, halfSize, 0);
  18911. normals.push(0, 0, -1.0);
  18912. uvs.push(0.0, 1.0);
  18913. indices.push(0);
  18914. indices.push(1);
  18915. indices.push(2);
  18916. indices.push(0);
  18917. indices.push(2);
  18918. indices.push(3);
  18919. var vertexData = new BABYLON.VertexData();
  18920. vertexData.indices = indices;
  18921. vertexData.positions = positions;
  18922. vertexData.normals = normals;
  18923. vertexData.uvs = uvs;
  18924. return vertexData;
  18925. };
  18926. VertexData.CreateTorusKnot = function (radius, tube, radialSegments, tubularSegments, p, q) {
  18927. var indices = [];
  18928. var positions = [];
  18929. var normals = [];
  18930. var uvs = [];
  18931. radius = radius || 2;
  18932. tube = tube || 0.5;
  18933. radialSegments = radialSegments || 32;
  18934. tubularSegments = tubularSegments || 32;
  18935. p = p || 2;
  18936. q = q || 3;
  18937. var getPos = function (angle) {
  18938. var cu = Math.cos(angle);
  18939. var su = Math.sin(angle);
  18940. var quOverP = q / p * angle;
  18941. var cs = Math.cos(quOverP);
  18942. var tx = radius * (2 + cs) * 0.5 * cu;
  18943. var ty = radius * (2 + cs) * su * 0.5;
  18944. var tz = radius * Math.sin(quOverP) * 0.5;
  18945. return new BABYLON.Vector3(tx, ty, tz);
  18946. };
  18947. for (var i = 0; i <= radialSegments; i++) {
  18948. var modI = i % radialSegments;
  18949. var u = modI / radialSegments * 2 * p * Math.PI;
  18950. var p1 = getPos(u);
  18951. var p2 = getPos(u + 0.01);
  18952. var tang = p2.subtract(p1);
  18953. var n = p2.add(p1);
  18954. var bitan = BABYLON.Vector3.Cross(tang, n);
  18955. n = BABYLON.Vector3.Cross(bitan, tang);
  18956. bitan.normalize();
  18957. n.normalize();
  18958. for (var j = 0; j < tubularSegments; j++) {
  18959. var modJ = j % tubularSegments;
  18960. var v = modJ / tubularSegments * 2 * Math.PI;
  18961. var cx = -tube * Math.cos(v);
  18962. var cy = tube * Math.sin(v);
  18963. positions.push(p1.x + cx * n.x + cy * bitan.x);
  18964. positions.push(p1.y + cx * n.y + cy * bitan.y);
  18965. positions.push(p1.z + cx * n.z + cy * bitan.z);
  18966. uvs.push(i / radialSegments);
  18967. uvs.push(j / tubularSegments);
  18968. }
  18969. }
  18970. for (i = 0; i < radialSegments; i++) {
  18971. for (j = 0; j < tubularSegments; j++) {
  18972. var jNext = (j + 1) % tubularSegments;
  18973. var a = i * tubularSegments + j;
  18974. var b = (i + 1) * tubularSegments + j;
  18975. var c = (i + 1) * tubularSegments + jNext;
  18976. var d = i * tubularSegments + jNext;
  18977. indices.push(d);
  18978. indices.push(b);
  18979. indices.push(a);
  18980. indices.push(d);
  18981. indices.push(c);
  18982. indices.push(b);
  18983. }
  18984. }
  18985. BABYLON.VertexData.ComputeNormals(positions, indices, normals);
  18986. var vertexData = new BABYLON.VertexData();
  18987. vertexData.indices = indices;
  18988. vertexData.positions = positions;
  18989. vertexData.normals = normals;
  18990. vertexData.uvs = uvs;
  18991. return vertexData;
  18992. };
  18993. VertexData.ComputeNormals = function (positions, indices, normals) {
  18994. var positionVectors = [];
  18995. var facesOfVertices = [];
  18996. var index;
  18997. for (index = 0; index < positions.length; index += 3) {
  18998. var vector3 = new BABYLON.Vector3(positions[index], positions[index + 1], positions[index + 2]);
  18999. positionVectors.push(vector3);
  19000. facesOfVertices.push([]);
  19001. }
  19002. var facesNormals = [];
  19003. for (index = 0; index < indices.length / 3; index++) {
  19004. var i1 = indices[index * 3];
  19005. var i2 = indices[index * 3 + 1];
  19006. var i3 = indices[index * 3 + 2];
  19007. var p1 = positionVectors[i1];
  19008. var p2 = positionVectors[i2];
  19009. var p3 = positionVectors[i3];
  19010. var p1p2 = p1.subtract(p2);
  19011. var p3p2 = p3.subtract(p2);
  19012. facesNormals[index] = BABYLON.Vector3.Normalize(BABYLON.Vector3.Cross(p1p2, p3p2));
  19013. facesOfVertices[i1].push(index);
  19014. facesOfVertices[i2].push(index);
  19015. facesOfVertices[i3].push(index);
  19016. }
  19017. for (index = 0; index < positionVectors.length; index++) {
  19018. var faces = facesOfVertices[index];
  19019. var normal = BABYLON.Vector3.Zero();
  19020. for (var faceIndex = 0; faceIndex < faces.length; faceIndex++) {
  19021. normal.addInPlace(facesNormals[faces[faceIndex]]);
  19022. }
  19023. normal = BABYLON.Vector3.Normalize(normal.scale(1.0 / faces.length));
  19024. normals[index * 3] = normal.x;
  19025. normals[index * 3 + 1] = normal.y;
  19026. normals[index * 3 + 2] = normal.z;
  19027. }
  19028. };
  19029. return VertexData;
  19030. })();
  19031. BABYLON.VertexData = VertexData;
  19032. })(BABYLON || (BABYLON = {}));
  19033. var __extends = this.__extends || function (d, b) {
  19034. for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p];
  19035. function __() { this.constructor = d; }
  19036. __.prototype = b.prototype;
  19037. d.prototype = new __();
  19038. };
  19039. var BABYLON;
  19040. (function (BABYLON) {
  19041. var buildCamera = function (that, name) {
  19042. that._leftCamera.isIntermediate = true;
  19043. that.subCameras.push(that._leftCamera);
  19044. that.subCameras.push(that._rightCamera);
  19045. that._leftTexture = new BABYLON.PassPostProcess(name + "_leftTexture", 1.0, that._leftCamera);
  19046. that._anaglyphPostProcess = new BABYLON.AnaglyphPostProcess(name + "_anaglyph", 1.0, that._rightCamera);
  19047. that._anaglyphPostProcess.onApply = function (effect) {
  19048. effect.setTextureFromPostProcess("leftSampler", that._leftTexture);
  19049. };
  19050. that._update();
  19051. };
  19052. var AnaglyphArcRotateCamera = (function (_super) {
  19053. __extends(AnaglyphArcRotateCamera, _super);
  19054. function AnaglyphArcRotateCamera(name, alpha, beta, radius, target, eyeSpace, scene) {
  19055. _super.call(this, name, alpha, beta, radius, target, scene);
  19056. this._eyeSpace = BABYLON.Tools.ToRadians(eyeSpace);
  19057. this._leftCamera = new BABYLON.ArcRotateCamera(name + "_left", alpha - this._eyeSpace, beta, radius, target, scene);
  19058. this._rightCamera = new BABYLON.ArcRotateCamera(name + "_right", alpha + this._eyeSpace, beta, radius, target, scene);
  19059. buildCamera(this, name);
  19060. }
  19061. AnaglyphArcRotateCamera.prototype._update = function () {
  19062. this._updateCamera(this._leftCamera);
  19063. this._updateCamera(this._rightCamera);
  19064. this._leftCamera.alpha = this.alpha - this._eyeSpace;
  19065. this._rightCamera.alpha = this.alpha + this._eyeSpace;
  19066. _super.prototype._update.call(this);
  19067. };
  19068. AnaglyphArcRotateCamera.prototype._updateCamera = function (camera) {
  19069. camera.beta = this.beta;
  19070. camera.radius = this.radius;
  19071. camera.minZ = this.minZ;
  19072. camera.maxZ = this.maxZ;
  19073. camera.fov = this.fov;
  19074. camera.target = this.target;
  19075. };
  19076. return AnaglyphArcRotateCamera;
  19077. })(BABYLON.ArcRotateCamera);
  19078. BABYLON.AnaglyphArcRotateCamera = AnaglyphArcRotateCamera;
  19079. var AnaglyphFreeCamera = (function (_super) {
  19080. __extends(AnaglyphFreeCamera, _super);
  19081. function AnaglyphFreeCamera(name, position, eyeSpace, scene) {
  19082. _super.call(this, name, position, scene);
  19083. this._eyeSpace = BABYLON.Tools.ToRadians(eyeSpace);
  19084. this._transformMatrix = new BABYLON.Matrix();
  19085. this._leftCamera = new BABYLON.FreeCamera(name + "_left", position.clone(), scene);
  19086. this._rightCamera = new BABYLON.FreeCamera(name + "_right", position.clone(), scene);
  19087. buildCamera(this, name);
  19088. }
  19089. AnaglyphFreeCamera.prototype._getSubCameraPosition = function (eyeSpace, result) {
  19090. var target = this.getTarget();
  19091. BABYLON.Matrix.Translation(-target.x, -target.y, -target.z).multiplyToRef(BABYLON.Matrix.RotationY(eyeSpace), this._transformMatrix);
  19092. this._transformMatrix = this._transformMatrix.multiply(BABYLON.Matrix.Translation(target.x, target.y, target.z));
  19093. BABYLON.Vector3.TransformCoordinatesToRef(this.position, this._transformMatrix, result);
  19094. };
  19095. AnaglyphFreeCamera.prototype._update = function () {
  19096. this._getSubCameraPosition(-this._eyeSpace, this._leftCamera.position);
  19097. this._getSubCameraPosition(this._eyeSpace, this._rightCamera.position);
  19098. this._updateCamera(this._leftCamera);
  19099. this._updateCamera(this._rightCamera);
  19100. _super.prototype._update.call(this);
  19101. };
  19102. AnaglyphFreeCamera.prototype._updateCamera = function (camera) {
  19103. camera.minZ = this.minZ;
  19104. camera.maxZ = this.maxZ;
  19105. camera.fov = this.fov;
  19106. camera.viewport = this.viewport;
  19107. camera.setTarget(this.getTarget());
  19108. };
  19109. return AnaglyphFreeCamera;
  19110. })(BABYLON.FreeCamera);
  19111. BABYLON.AnaglyphFreeCamera = AnaglyphFreeCamera;
  19112. })(BABYLON || (BABYLON = {}));
  19113. var __extends = this.__extends || function (d, b) {
  19114. for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p];
  19115. function __() { this.constructor = d; }
  19116. __.prototype = b.prototype;
  19117. d.prototype = new __();
  19118. };
  19119. var BABYLON;
  19120. (function (BABYLON) {
  19121. var AnaglyphPostProcess = (function (_super) {
  19122. __extends(AnaglyphPostProcess, _super);
  19123. function AnaglyphPostProcess(name, ratio, camera, samplingMode, engine, reusable) {
  19124. _super.call(this, name, "anaglyph", null, ["leftSampler"], ratio, camera, samplingMode, engine, reusable);
  19125. }
  19126. return AnaglyphPostProcess;
  19127. })(BABYLON.PostProcess);
  19128. BABYLON.AnaglyphPostProcess = AnaglyphPostProcess;
  19129. })(BABYLON || (BABYLON = {}));
  19130. var BABYLON;
  19131. (function (BABYLON) {
  19132. var Tags = (function () {
  19133. function Tags() {
  19134. }
  19135. Tags.EnableFor = function (obj) {
  19136. obj._tags = obj._tags || {};
  19137. obj.hasTags = function () {
  19138. return Tags.HasTags(obj);
  19139. };
  19140. obj.addTags = function (tagsString) {
  19141. return Tags.AddTagsTo(obj, tagsString);
  19142. };
  19143. obj.removeTags = function (tagsString) {
  19144. return Tags.RemoveTagsFrom(obj, tagsString);
  19145. };
  19146. obj.matchesTagsQuery = function (tagsQuery) {
  19147. return Tags.MatchesQuery(obj, tagsQuery);
  19148. };
  19149. };
  19150. Tags.DisableFor = function (obj) {
  19151. delete obj._tags;
  19152. delete obj.hasTags;
  19153. delete obj.addTags;
  19154. delete obj.removeTags;
  19155. delete obj.matchesTagsQuery;
  19156. };
  19157. Tags.HasTags = function (obj) {
  19158. if (!obj._tags) {
  19159. return false;
  19160. }
  19161. return !BABYLON.Tools.IsEmpty(obj._tags);
  19162. };
  19163. Tags.GetTags = function (obj) {
  19164. if (!obj._tags) {
  19165. return null;
  19166. }
  19167. return obj._tags;
  19168. };
  19169. Tags.AddTagsTo = function (obj, tagsString) {
  19170. if (!tagsString) {
  19171. return;
  19172. }
  19173. var tags = tagsString.split(" ");
  19174. for (var t in tags) {
  19175. Tags._AddTagTo(obj, tags[t]);
  19176. }
  19177. };
  19178. Tags._AddTagTo = function (obj, tag) {
  19179. tag = tag.trim();
  19180. if (tag === "" || tag === "true" || tag === "false") {
  19181. return;
  19182. }
  19183. if (tag.match(/[\s]/) || tag.match(/^([!]|([|]|[&]){2})/)) {
  19184. return;
  19185. }
  19186. Tags.EnableFor(obj);
  19187. obj._tags[tag] = true;
  19188. };
  19189. Tags.RemoveTagsFrom = function (obj, tagsString) {
  19190. if (!Tags.HasTags(obj)) {
  19191. return;
  19192. }
  19193. var tags = tagsString.split(" ");
  19194. for (var t in tags) {
  19195. Tags._RemoveTagFrom(obj, tags[t]);
  19196. }
  19197. };
  19198. Tags._RemoveTagFrom = function (obj, tag) {
  19199. delete obj._tags[tag];
  19200. };
  19201. Tags.MatchesQuery = function (obj, tagsQuery) {
  19202. if (tagsQuery === undefined) {
  19203. return true;
  19204. }
  19205. if (tagsQuery === "") {
  19206. return Tags.HasTags(obj);
  19207. }
  19208. return BABYLON.Internals.AndOrNotEvaluator.Eval(tagsQuery, function (r) {
  19209. return Tags.HasTags(obj) && obj._tags[r];
  19210. });
  19211. };
  19212. return Tags;
  19213. })();
  19214. BABYLON.Tags = Tags;
  19215. })(BABYLON || (BABYLON = {}));
  19216. var BABYLON;
  19217. (function (BABYLON) {
  19218. (function (Internals) {
  19219. var AndOrNotEvaluator = (function () {
  19220. function AndOrNotEvaluator() {
  19221. }
  19222. AndOrNotEvaluator.Eval = function (query, evaluateCallback) {
  19223. if (!query.match(/\([^\(\)]*\)/g)) {
  19224. query = AndOrNotEvaluator._HandleParenthesisContent(query, evaluateCallback);
  19225. } else {
  19226. query = query.replace(/\([^\(\)]*\)/g, function (r) {
  19227. r = r.slice(1, r.length - 1);
  19228. return AndOrNotEvaluator._HandleParenthesisContent(r, evaluateCallback);
  19229. });
  19230. }
  19231. if (query === "true") {
  19232. return true;
  19233. }
  19234. if (query === "false") {
  19235. return false;
  19236. }
  19237. return AndOrNotEvaluator.Eval(query, evaluateCallback);
  19238. };
  19239. AndOrNotEvaluator._HandleParenthesisContent = function (parenthesisContent, evaluateCallback) {
  19240. evaluateCallback = evaluateCallback || (function (r) {
  19241. return r === "true" ? true : false;
  19242. });
  19243. var result;
  19244. var or = parenthesisContent.split("||");
  19245. for (var i in or) {
  19246. var ori = AndOrNotEvaluator._SimplifyNegation(or[i].trim());
  19247. var and = ori.split("&&");
  19248. if (and.length > 1) {
  19249. for (var j = 0; j < and.length; ++j) {
  19250. var andj = AndOrNotEvaluator._SimplifyNegation(and[j].trim());
  19251. if (andj !== "true" && andj !== "false") {
  19252. if (andj[0] === "!") {
  19253. result = !evaluateCallback(andj.substring(1));
  19254. } else {
  19255. result = evaluateCallback(andj);
  19256. }
  19257. } else {
  19258. result = andj === "true" ? true : false;
  19259. }
  19260. if (!result) {
  19261. ori = "false";
  19262. break;
  19263. }
  19264. }
  19265. }
  19266. if (result || ori === "true") {
  19267. result = true;
  19268. break;
  19269. }
  19270. if (ori !== "true" && ori !== "false") {
  19271. if (ori[0] === "!") {
  19272. result = !evaluateCallback(ori.substring(1));
  19273. } else {
  19274. result = evaluateCallback(ori);
  19275. }
  19276. } else {
  19277. result = ori === "true" ? true : false;
  19278. }
  19279. }
  19280. return result ? "true" : "false";
  19281. };
  19282. AndOrNotEvaluator._SimplifyNegation = function (booleanString) {
  19283. booleanString = booleanString.replace(/^[\s!]+/, function (r) {
  19284. r = r.replace(/[\s]/g, function () {
  19285. return "";
  19286. });
  19287. return r.length % 2 ? "!" : "";
  19288. });
  19289. booleanString = booleanString.trim();
  19290. if (booleanString === "!true") {
  19291. booleanString = "false";
  19292. } else if (booleanString === "!false") {
  19293. booleanString = "true";
  19294. }
  19295. return booleanString;
  19296. };
  19297. return AndOrNotEvaluator;
  19298. })();
  19299. Internals.AndOrNotEvaluator = AndOrNotEvaluator;
  19300. })(BABYLON.Internals || (BABYLON.Internals = {}));
  19301. var Internals = BABYLON.Internals;
  19302. })(BABYLON || (BABYLON = {}));
  19303. var BABYLON;
  19304. (function (BABYLON) {
  19305. var PostProcessRenderPass = (function () {
  19306. function PostProcessRenderPass(scene, name, size, renderList, beforeRender, afterRender) {
  19307. this._enabled = true;
  19308. this._refCount = 0;
  19309. this._name = name;
  19310. this._renderTexture = new BABYLON.RenderTargetTexture(name, size, scene);
  19311. this.setRenderList(renderList);
  19312. this._renderTexture.onBeforeRender = beforeRender;
  19313. this._renderTexture.onAfterRender = afterRender;
  19314. this._scene = scene;
  19315. this._renderList = renderList;
  19316. }
  19317. PostProcessRenderPass.prototype._incRefCount = function () {
  19318. if (this._refCount === 0) {
  19319. this._scene.customRenderTargets.push(this._renderTexture);
  19320. }
  19321. return ++this._refCount;
  19322. };
  19323. PostProcessRenderPass.prototype._decRefCount = function () {
  19324. this._refCount--;
  19325. if (this._refCount <= 0) {
  19326. this._scene.customRenderTargets.splice(this._scene.customRenderTargets.indexOf(this._renderTexture), 1);
  19327. }
  19328. return this._refCount;
  19329. };
  19330. PostProcessRenderPass.prototype._update = function () {
  19331. this.setRenderList(this._renderList);
  19332. };
  19333. PostProcessRenderPass.prototype.setRenderList = function (renderList) {
  19334. this._renderTexture.renderList = renderList;
  19335. };
  19336. PostProcessRenderPass.prototype.getRenderTexture = function () {
  19337. return this._renderTexture;
  19338. };
  19339. return PostProcessRenderPass;
  19340. })();
  19341. BABYLON.PostProcessRenderPass = PostProcessRenderPass;
  19342. })(BABYLON || (BABYLON = {}));
  19343. var BABYLON;
  19344. (function (BABYLON) {
  19345. var PostProcessRenderEffect = (function () {
  19346. function PostProcessRenderEffect(engine, name, getPostProcess, singleInstance) {
  19347. this._engine = engine;
  19348. this._name = name;
  19349. this._singleInstance = singleInstance || true;
  19350. this._getPostProcess = getPostProcess;
  19351. this._cameras = [];
  19352. this._postProcesses = [];
  19353. this._indicesForCamera = [];
  19354. this._renderPasses = [];
  19355. this._renderEffectAsPasses = [];
  19356. }
  19357. PostProcessRenderEffect.prototype._update = function () {
  19358. for (var renderPassName in this._renderPasses) {
  19359. this._renderPasses[renderPassName]._update();
  19360. }
  19361. };
  19362. PostProcessRenderEffect.prototype.addPass = function (renderPass) {
  19363. this._renderPasses[renderPass._name] = renderPass;
  19364. this._linkParameters();
  19365. };
  19366. PostProcessRenderEffect.prototype.removePass = function (renderPass) {
  19367. delete this._renderPasses[renderPass._name];
  19368. this._linkParameters();
  19369. };
  19370. PostProcessRenderEffect.prototype.addRenderEffectAsPass = function (renderEffect) {
  19371. this._renderEffectAsPasses[renderEffect._name] = renderEffect;
  19372. this._linkParameters();
  19373. };
  19374. PostProcessRenderEffect.prototype.getPass = function (passName) {
  19375. for (var renderPassName in this._renderPasses) {
  19376. if (renderPassName === passName) {
  19377. return this._renderPasses[passName];
  19378. }
  19379. }
  19380. };
  19381. PostProcessRenderEffect.prototype.emptyPasses = function () {
  19382. this._renderPasses.length = 0;
  19383. this._linkParameters();
  19384. };
  19385. PostProcessRenderEffect.prototype._attachCameras = function (cameras) {
  19386. var cameraKey;
  19387. var _cam = BABYLON.Tools.MakeArray(cameras || this._cameras);
  19388. for (var i = 0; i < _cam.length; i++) {
  19389. var camera = _cam[i];
  19390. var cameraName = camera.name;
  19391. if (this._singleInstance) {
  19392. cameraKey = 0;
  19393. } else {
  19394. cameraKey = cameraName;
  19395. }
  19396. this._postProcesses[cameraKey] = this._postProcesses[cameraKey] || this._getPostProcess();
  19397. var index = camera.attachPostProcess(this._postProcesses[cameraKey]);
  19398. if (!this._indicesForCamera[cameraName]) {
  19399. this._indicesForCamera[cameraName] = [];
  19400. }
  19401. this._indicesForCamera[cameraName].push(index);
  19402. if (this._cameras.indexOf(camera) === -1) {
  19403. this._cameras[cameraName] = camera;
  19404. }
  19405. for (var passName in this._renderPasses) {
  19406. this._renderPasses[passName]._incRefCount();
  19407. }
  19408. }
  19409. this._linkParameters();
  19410. };
  19411. PostProcessRenderEffect.prototype._detachCameras = function (cameras) {
  19412. var _cam = BABYLON.Tools.MakeArray(cameras || this._cameras);
  19413. for (var i = 0; i < _cam.length; i++) {
  19414. var camera = _cam[i];
  19415. var cameraName = camera.name;
  19416. camera.detachPostProcess(this._postProcesses[this._singleInstance ? 0 : cameraName], this._indicesForCamera[cameraName]);
  19417. var index = this._cameras.indexOf(cameraName);
  19418. this._indicesForCamera.splice(index, 1);
  19419. this._cameras.splice(index, 1);
  19420. for (var passName in this._renderPasses) {
  19421. this._renderPasses[passName]._decRefCount();
  19422. }
  19423. }
  19424. };
  19425. PostProcessRenderEffect.prototype._enable = function (cameras) {
  19426. var _cam = BABYLON.Tools.MakeArray(cameras || this._cameras);
  19427. for (var i = 0; i < _cam.length; i++) {
  19428. var camera = _cam[i];
  19429. var cameraName = camera.name;
  19430. for (var j = 0; j < this._indicesForCamera[cameraName].length; j++) {
  19431. if (camera._postProcesses[this._indicesForCamera[cameraName][j]] === undefined) {
  19432. cameras[i].attachPostProcess(this._postProcesses[this._singleInstance ? 0 : cameraName], this._indicesForCamera[cameraName][j]);
  19433. }
  19434. }
  19435. for (var passName in this._renderPasses) {
  19436. this._renderPasses[passName]._incRefCount();
  19437. }
  19438. }
  19439. };
  19440. PostProcessRenderEffect.prototype._disable = function (cameras) {
  19441. var _cam = BABYLON.Tools.MakeArray(cameras || this._cameras);
  19442. for (var i = 0; i < _cam.length; i++) {
  19443. var camera = _cam[i];
  19444. var cameraName = camera.Name;
  19445. camera.detachPostProcess(this._postProcesses[this._singleInstance ? 0 : cameraName], this._indicesForCamera[cameraName]);
  19446. for (var passName in this._renderPasses) {
  19447. this._renderPasses[passName]._decRefCount();
  19448. }
  19449. }
  19450. };
  19451. PostProcessRenderEffect.prototype.getPostProcess = function (camera) {
  19452. if (this._singleInstance) {
  19453. return this._postProcesses[0];
  19454. } else {
  19455. return this._postProcesses[camera.name];
  19456. }
  19457. };
  19458. PostProcessRenderEffect.prototype._linkParameters = function () {
  19459. var _this = this;
  19460. for (var index in this._postProcesses) {
  19461. if (this.applyParameters) {
  19462. this.applyParameters(this._postProcesses[index]);
  19463. }
  19464. this._postProcesses[index].onBeforeRender = function (effect) {
  19465. _this._linkTextures(effect);
  19466. };
  19467. }
  19468. };
  19469. PostProcessRenderEffect.prototype._linkTextures = function (effect) {
  19470. for (var renderPassName in this._renderPasses) {
  19471. effect.setTexture(renderPassName, this._renderPasses[renderPassName].getRenderTexture());
  19472. }
  19473. for (var renderEffectName in this._renderEffectAsPasses) {
  19474. effect.setTextureFromPostProcess(renderEffectName + "Sampler", this._renderEffectAsPasses[renderEffectName].getPostProcess());
  19475. }
  19476. };
  19477. return PostProcessRenderEffect;
  19478. })();
  19479. BABYLON.PostProcessRenderEffect = PostProcessRenderEffect;
  19480. })(BABYLON || (BABYLON = {}));
  19481. var BABYLON;
  19482. (function (BABYLON) {
  19483. var PostProcessRenderPipeline = (function () {
  19484. function PostProcessRenderPipeline(engine, name) {
  19485. this._engine = engine;
  19486. this._name = name;
  19487. this._renderEffects = [];
  19488. this._renderEffectsForIsolatedPass = [];
  19489. this._cameras = [];
  19490. }
  19491. PostProcessRenderPipeline.prototype.addEffect = function (renderEffect) {
  19492. this._renderEffects[renderEffect._name] = renderEffect;
  19493. };
  19494. PostProcessRenderPipeline.prototype._enableEffect = function (renderEffectName, cameras) {
  19495. var renderEffects = this._renderEffects[renderEffectName];
  19496. if (!renderEffects) {
  19497. return;
  19498. }
  19499. renderEffects._enable(BABYLON.Tools.MakeArray(cameras || this._cameras));
  19500. };
  19501. PostProcessRenderPipeline.prototype._disableEffect = function (renderEffectName, cameras) {
  19502. var renderEffects = this._renderEffects[renderEffectName];
  19503. if (!renderEffects) {
  19504. return;
  19505. }
  19506. renderEffects._disable(BABYLON.Tools.MakeArray(cameras || this._cameras));
  19507. };
  19508. PostProcessRenderPipeline.prototype._attachCameras = function (cameras, unique) {
  19509. var _cam = BABYLON.Tools.MakeArray(cameras || this._cameras);
  19510. var indicesToDelete = [];
  19511. for (var i = 0; i < _cam.length; i++) {
  19512. var camera = _cam[i];
  19513. var cameraName = camera.name;
  19514. if (this._cameras.indexOf(camera) === -1) {
  19515. this._cameras[cameraName] = camera;
  19516. } else if (unique) {
  19517. indicesToDelete.push(i);
  19518. }
  19519. }
  19520. for (var i = 0; i < indicesToDelete.length; i++) {
  19521. cameras.splice(indicesToDelete[i], 1);
  19522. }
  19523. for (var renderEffectName in this._renderEffects) {
  19524. this._renderEffects[renderEffectName]._attachCameras(_cam);
  19525. }
  19526. };
  19527. PostProcessRenderPipeline.prototype._detachCameras = function (cameras) {
  19528. var _cam = BABYLON.Tools.MakeArray(cameras || this._cameras);
  19529. for (var renderEffectName in this._renderEffects) {
  19530. this._renderEffects[renderEffectName]._detachCameras(_cam);
  19531. }
  19532. for (var i = 0; i < _cam.length; i++) {
  19533. this._cameras.splice(this._cameras.indexOf(_cam[i]), 1);
  19534. }
  19535. };
  19536. PostProcessRenderPipeline.prototype._enableDisplayOnlyPass = function (passName, cameras) {
  19537. var _this = this;
  19538. var _cam = BABYLON.Tools.MakeArray(cameras || this._cameras);
  19539. var pass = null;
  19540. for (var renderEffectName in this._renderEffects) {
  19541. pass = this._renderEffects[renderEffectName].getPass(passName);
  19542. if (pass != null) {
  19543. break;
  19544. }
  19545. }
  19546. if (pass === null) {
  19547. return;
  19548. }
  19549. for (var renderEffectName in this._renderEffects) {
  19550. this._renderEffects[renderEffectName]._disable(_cam);
  19551. }
  19552. pass._name = PostProcessRenderPipeline.PASS_SAMPLER_NAME;
  19553. for (var i = 0; i < _cam.length; i++) {
  19554. var camera = _cam[i];
  19555. var cameraName = camera.name;
  19556. this._renderEffectsForIsolatedPass[cameraName] = this._renderEffectsForIsolatedPass[cameraName] || new BABYLON.PostProcessRenderEffect(this._engine, PostProcessRenderPipeline.PASS_EFFECT_NAME, function () {
  19557. return new BABYLON.DisplayPassPostProcess(PostProcessRenderPipeline.PASS_EFFECT_NAME, 1.0, null, null, _this._engine, true);
  19558. });
  19559. this._renderEffectsForIsolatedPass[cameraName].emptyPasses();
  19560. this._renderEffectsForIsolatedPass[cameraName].addPass(pass);
  19561. this._renderEffectsForIsolatedPass[cameraName]._attachCameras(camera);
  19562. }
  19563. };
  19564. PostProcessRenderPipeline.prototype._disableDisplayOnlyPass = function (cameras) {
  19565. var _this = this;
  19566. var _cam = BABYLON.Tools.MakeArray(cameras || this._cameras);
  19567. for (var i = 0; i < _cam.length; i++) {
  19568. var camera = _cam[i];
  19569. var cameraName = camera.name;
  19570. this._renderEffectsForIsolatedPass[cameraName] = this._renderEffectsForIsolatedPass[cameraName] || new BABYLON.PostProcessRenderEffect(this._engine, PostProcessRenderPipeline.PASS_EFFECT_NAME, function () {
  19571. return new BABYLON.DisplayPassPostProcess(PostProcessRenderPipeline.PASS_EFFECT_NAME, 1.0, null, null, _this._engine, true);
  19572. });
  19573. this._renderEffectsForIsolatedPass[cameraName]._disable(camera);
  19574. }
  19575. for (var renderEffectName in this._renderEffects) {
  19576. this._renderEffects[renderEffectName]._enable(_cam);
  19577. }
  19578. };
  19579. PostProcessRenderPipeline.prototype._update = function () {
  19580. for (var renderEffectName in this._renderEffects) {
  19581. this._renderEffects[renderEffectName]._update();
  19582. }
  19583. for (var i = 0; i < this._cameras.length; i++) {
  19584. var cameraName = this._cameras[i].name;
  19585. if (this._renderEffectsForIsolatedPass[cameraName]) {
  19586. this._renderEffectsForIsolatedPass[cameraName]._update();
  19587. }
  19588. }
  19589. };
  19590. PostProcessRenderPipeline.PASS_EFFECT_NAME = "passEffect";
  19591. PostProcessRenderPipeline.PASS_SAMPLER_NAME = "passSampler";
  19592. return PostProcessRenderPipeline;
  19593. })();
  19594. BABYLON.PostProcessRenderPipeline = PostProcessRenderPipeline;
  19595. })(BABYLON || (BABYLON = {}));
  19596. var BABYLON;
  19597. (function (BABYLON) {
  19598. var PostProcessRenderPipelineManager = (function () {
  19599. function PostProcessRenderPipelineManager() {
  19600. this._renderPipelines = new Array();
  19601. }
  19602. PostProcessRenderPipelineManager.prototype.addPipeline = function (renderPipeline) {
  19603. this._renderPipelines[renderPipeline._name] = renderPipeline;
  19604. };
  19605. PostProcessRenderPipelineManager.prototype.attachCamerasToRenderPipeline = function (renderPipelineName, cameras, unique) {
  19606. var renderPipeline = this._renderPipelines[renderPipelineName];
  19607. if (!renderPipeline) {
  19608. return;
  19609. }
  19610. renderPipeline._attachCameras(cameras, unique);
  19611. };
  19612. PostProcessRenderPipelineManager.prototype.detachCamerasFromRenderPipeline = function (renderPipelineName, cameras) {
  19613. var renderPipeline = this._renderPipelines[renderPipelineName];
  19614. if (!renderPipeline) {
  19615. return;
  19616. }
  19617. renderPipeline._detachCameras(cameras);
  19618. };
  19619. PostProcessRenderPipelineManager.prototype.enableEffectInPipeline = function (renderPipelineName, renderEffectName, cameras) {
  19620. var renderPipeline = this._renderPipelines[renderPipelineName];
  19621. if (!renderPipeline) {
  19622. return;
  19623. }
  19624. renderPipeline._enableEffect(renderEffectName, cameras);
  19625. };
  19626. PostProcessRenderPipelineManager.prototype.disableEffectInPipeline = function (renderPipelineName, renderEffectName, cameras) {
  19627. var renderPipeline = this._renderPipelines[renderPipelineName];
  19628. if (!renderPipeline) {
  19629. return;
  19630. }
  19631. renderPipeline._disableEffect(renderEffectName, cameras);
  19632. };
  19633. PostProcessRenderPipelineManager.prototype.enableDisplayOnlyPassInPipeline = function (renderPipelineName, passName, cameras) {
  19634. var renderPipeline = this._renderPipelines[renderPipelineName];
  19635. if (!renderPipeline) {
  19636. return;
  19637. }
  19638. renderPipeline._enableDisplayOnlyPass(passName, cameras);
  19639. };
  19640. PostProcessRenderPipelineManager.prototype.disableDisplayOnlyPassInPipeline = function (renderPipelineName, cameras) {
  19641. var renderPipeline = this._renderPipelines[renderPipelineName];
  19642. if (!renderPipeline) {
  19643. return;
  19644. }
  19645. renderPipeline._disableDisplayOnlyPass(cameras);
  19646. };
  19647. PostProcessRenderPipelineManager.prototype.update = function () {
  19648. for (var renderPipelineName in this._renderPipelines) {
  19649. this._renderPipelines[renderPipelineName]._update();
  19650. }
  19651. };
  19652. return PostProcessRenderPipelineManager;
  19653. })();
  19654. BABYLON.PostProcessRenderPipelineManager = PostProcessRenderPipelineManager;
  19655. })(BABYLON || (BABYLON = {}));
  19656. var __extends = this.__extends || function (d, b) {
  19657. for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p];
  19658. function __() { this.constructor = d; }
  19659. __.prototype = b.prototype;
  19660. d.prototype = new __();
  19661. };
  19662. var BABYLON;
  19663. (function (BABYLON) {
  19664. var DisplayPassPostProcess = (function (_super) {
  19665. __extends(DisplayPassPostProcess, _super);
  19666. function DisplayPassPostProcess(name, ratio, camera, samplingMode, engine, reusable) {
  19667. _super.call(this, name, "displayPass", ["passSampler"], ["passSampler"], ratio, camera, samplingMode, engine, reusable);
  19668. }
  19669. return DisplayPassPostProcess;
  19670. })(BABYLON.PostProcess);
  19671. BABYLON.DisplayPassPostProcess = DisplayPassPostProcess;
  19672. })(BABYLON || (BABYLON = {}));
  19673. var BABYLON;
  19674. (function (BABYLON) {
  19675. var BoundingBoxRenderer = (function () {
  19676. function BoundingBoxRenderer(scene) {
  19677. this.frontColor = new BABYLON.Color3(1, 1, 1);
  19678. this.backColor = new BABYLON.Color3(0.1, 0.1, 0.1);
  19679. this.showBackLines = true;
  19680. this.renderList = new BABYLON.SmartArray(32);
  19681. this._scene = scene;
  19682. this._colorShader = new BABYLON.ShaderMaterial("colorShader", scene, "color", {
  19683. attributes: ["position"],
  19684. uniforms: ["worldViewProjection", "color"]
  19685. });
  19686. var engine = this._scene.getEngine();
  19687. var boxdata = BABYLON.VertexData.CreateBox(1.0);
  19688. this._vb = new BABYLON.VertexBuffer(engine, boxdata.positions, BABYLON.VertexBuffer.PositionKind, false);
  19689. this._ib = engine.createIndexBuffer([0, 1, 1, 2, 2, 3, 3, 0, 4, 5, 5, 6, 6, 7, 7, 4, 0, 7, 1, 6, 2, 5, 3, 4]);
  19690. }
  19691. BoundingBoxRenderer.prototype.reset = function () {
  19692. this.renderList.reset();
  19693. };
  19694. BoundingBoxRenderer.prototype.render = function () {
  19695. if (this.renderList.length == 0 || !this._colorShader.isReady()) {
  19696. return;
  19697. }
  19698. var engine = this._scene.getEngine();
  19699. engine.setDepthWrite(false);
  19700. this._colorShader._preBind();
  19701. for (var boundingBoxIndex = 0; boundingBoxIndex < this.renderList.length; boundingBoxIndex++) {
  19702. var boundingBox = this.renderList.data[boundingBoxIndex];
  19703. var min = boundingBox.minimum;
  19704. var max = boundingBox.maximum;
  19705. var diff = max.subtract(min);
  19706. var median = min.add(diff.scale(0.5));
  19707. var worldMatrix = BABYLON.Matrix.Scaling(diff.x, diff.y, diff.z).multiply(BABYLON.Matrix.Translation(median.x, median.y, median.z)).multiply(boundingBox.getWorldMatrix());
  19708. engine.bindBuffers(this._vb.getBuffer(), this._ib, [3], 3 * 4, this._colorShader.getEffect());
  19709. if (this.showBackLines) {
  19710. engine.setDepthFunctionToGreaterOrEqual();
  19711. this._colorShader.setColor4("color", this.backColor.toColor4());
  19712. this._colorShader.bind(worldMatrix);
  19713. engine.draw(false, 0, 24);
  19714. }
  19715. engine.setDepthFunctionToLess();
  19716. this._colorShader.setColor4("color", this.frontColor.toColor4());
  19717. this._colorShader.bind(worldMatrix);
  19718. engine.draw(false, 0, 24);
  19719. }
  19720. this._colorShader.unbind();
  19721. engine.setDepthFunctionToLessOrEqual();
  19722. engine.setDepthWrite(true);
  19723. };
  19724. BoundingBoxRenderer.prototype.dispose = function () {
  19725. this._colorShader.dispose();
  19726. this._vb.dispose();
  19727. this._scene.getEngine()._releaseBuffer(this._ib);
  19728. };
  19729. return BoundingBoxRenderer;
  19730. })();
  19731. BABYLON.BoundingBoxRenderer = BoundingBoxRenderer;
  19732. })(BABYLON || (BABYLON = {}));
  19733. /**
  19734. * Based on jsTGALoader - Javascript loader for TGA file
  19735. * By Vincent Thibault
  19736. * @blog http://blog.robrowser.com/javascript-tga-loader.html
  19737. */
  19738. var BABYLON;
  19739. (function (BABYLON) {
  19740. (function (Internals) {
  19741. var TGATools = (function () {
  19742. function TGATools() {
  19743. }
  19744. TGATools.GetTGAHeader = function (data) {
  19745. var offset = 0;
  19746. var header = {
  19747. id_length: data[offset++],
  19748. colormap_type: data[offset++],
  19749. image_type: data[offset++],
  19750. colormap_index: data[offset++] | data[offset++] << 8,
  19751. colormap_length: data[offset++] | data[offset++] << 8,
  19752. colormap_size: data[offset++],
  19753. origin: [
  19754. data[offset++] | data[offset++] << 8,
  19755. data[offset++] | data[offset++] << 8
  19756. ],
  19757. width: data[offset++] | data[offset++] << 8,
  19758. height: data[offset++] | data[offset++] << 8,
  19759. pixel_size: data[offset++],
  19760. flags: data[offset++]
  19761. };
  19762. return header;
  19763. };
  19764. TGATools.UploadContent = function (gl, data) {
  19765. if (data.length < 19) {
  19766. BABYLON.Tools.Error("Unable to load TGA file - Not enough data to contain header");
  19767. return;
  19768. }
  19769. var offset = 18;
  19770. var header = TGATools.GetTGAHeader(data);
  19771. if (header.id_length + offset > data.length) {
  19772. BABYLON.Tools.Error("Unable to load TGA file - Not enough data");
  19773. return;
  19774. }
  19775. offset += header.id_length;
  19776. var use_rle = false;
  19777. var use_pal = false;
  19778. var use_rgb = false;
  19779. var use_grey = false;
  19780. switch (header.image_type) {
  19781. case TGATools._TYPE_RLE_INDEXED:
  19782. use_rle = true;
  19783. case TGATools._TYPE_INDEXED:
  19784. use_pal = true;
  19785. break;
  19786. case TGATools._TYPE_RLE_RGB:
  19787. use_rle = true;
  19788. case TGATools._TYPE_RGB:
  19789. use_rgb = true;
  19790. break;
  19791. case TGATools._TYPE_RLE_GREY:
  19792. use_rle = true;
  19793. case TGATools._TYPE_GREY:
  19794. use_grey = true;
  19795. break;
  19796. }
  19797. var pixel_data;
  19798. var numAlphaBits = header.flags & 0xf;
  19799. var pixel_size = header.pixel_size >> 3;
  19800. var pixel_total = header.width * header.height * pixel_size;
  19801. var palettes;
  19802. if (use_pal) {
  19803. palettes = data.subarray(offset, offset += header.colormap_length * (header.colormap_size >> 3));
  19804. }
  19805. if (use_rle) {
  19806. pixel_data = new Uint8Array(pixel_total);
  19807. var c, count, i;
  19808. var localOffset = 0;
  19809. var pixels = new Uint8Array(pixel_size);
  19810. while (offset < pixel_total && localOffset < pixel_total) {
  19811. c = data[offset++];
  19812. count = (c & 0x7f) + 1;
  19813. if (c & 0x80) {
  19814. for (i = 0; i < pixel_size; ++i) {
  19815. pixels[i] = data[offset++];
  19816. }
  19817. for (i = 0; i < count; ++i) {
  19818. pixel_data.set(pixels, localOffset + i * pixel_size);
  19819. }
  19820. localOffset += pixel_size * count;
  19821. } else {
  19822. count *= pixel_size;
  19823. for (i = 0; i < count; ++i) {
  19824. pixel_data[localOffset + i] = data[offset++];
  19825. }
  19826. localOffset += count;
  19827. }
  19828. }
  19829. } else {
  19830. pixel_data = data.subarray(offset, offset += (use_pal ? header.width * header.height : pixel_total));
  19831. }
  19832. var x_start, y_start, x_step, y_step, y_end, x_end;
  19833. switch ((header.flags & TGATools._ORIGIN_MASK) >> TGATools._ORIGIN_SHIFT) {
  19834. default:
  19835. case TGATools._ORIGIN_UL:
  19836. x_start = 0;
  19837. x_step = 1;
  19838. x_end = header.width;
  19839. y_start = 0;
  19840. y_step = 1;
  19841. y_end = header.height;
  19842. break;
  19843. case TGATools._ORIGIN_BL:
  19844. x_start = 0;
  19845. x_step = 1;
  19846. x_end = header.width;
  19847. y_start = header.height - 1;
  19848. y_step = -1;
  19849. y_end = -1;
  19850. break;
  19851. case TGATools._ORIGIN_UR:
  19852. x_start = header.width - 1;
  19853. x_step = -1;
  19854. x_end = -1;
  19855. y_start = 0;
  19856. y_step = 1;
  19857. y_end = header.height;
  19858. break;
  19859. case TGATools._ORIGIN_BR:
  19860. x_start = header.width - 1;
  19861. x_step = -1;
  19862. x_end = -1;
  19863. y_start = header.height - 1;
  19864. y_step = -1;
  19865. y_end = -1;
  19866. break;
  19867. }
  19868. var func = '_getImageData' + (use_grey ? 'Grey' : '') + (header.pixel_size) + 'bits';
  19869. var imageData = TGATools[func](header, palettes, pixel_data, y_start, y_step, y_end, x_start, x_step, x_end);
  19870. gl.texImage2D(gl.TEXTURE_2D, 0, gl.RGBA, header.width, header.height, 0, gl.RGBA, gl.UNSIGNED_BYTE, imageData);
  19871. };
  19872. TGATools._getImageData8bits = function (header, palettes, pixel_data, y_start, y_step, y_end, x_start, x_step, x_end) {
  19873. var image = pixel_data, colormap = palettes;
  19874. var width = header.width, height = header.height;
  19875. var color, i = 0, x, y;
  19876. var imageData = new Uint8Array(width * height * 4);
  19877. for (y = y_start; y !== y_end; y += y_step) {
  19878. for (x = x_start; x !== x_end; x += x_step, i++) {
  19879. color = image[i];
  19880. imageData[(x + width * y) * 4 + 3] = 255;
  19881. imageData[(x + width * y) * 4 + 2] = colormap[(color * 3) + 0];
  19882. imageData[(x + width * y) * 4 + 1] = colormap[(color * 3) + 1];
  19883. imageData[(x + width * y) * 4 + 0] = colormap[(color * 3) + 2];
  19884. }
  19885. }
  19886. return imageData;
  19887. };
  19888. TGATools._getImageData16bits = function (header, palettes, pixel_data, y_start, y_step, y_end, x_start, x_step, x_end) {
  19889. var image = pixel_data;
  19890. var width = header.width, height = header.height;
  19891. var color, i = 0, x, y;
  19892. var imageData = new Uint8Array(width * height * 4);
  19893. for (y = y_start; y !== y_end; y += y_step) {
  19894. for (x = x_start; x !== x_end; x += x_step, i += 2) {
  19895. color = image[i + 0] + (image[i + 1] << 8);
  19896. imageData[(x + width * y) * 4 + 0] = (color & 0x7C00) >> 7;
  19897. imageData[(x + width * y) * 4 + 1] = (color & 0x03E0) >> 2;
  19898. imageData[(x + width * y) * 4 + 2] = (color & 0x001F) >> 3;
  19899. imageData[(x + width * y) * 4 + 3] = (color & 0x8000) ? 0 : 255;
  19900. }
  19901. }
  19902. return imageData;
  19903. };
  19904. TGATools._getImageData24bits = function (header, palettes, pixel_data, y_start, y_step, y_end, x_start, x_step, x_end) {
  19905. var image = pixel_data;
  19906. var width = header.width, height = header.height;
  19907. var i = 0, x, y;
  19908. var imageData = new Uint8Array(width * height * 4);
  19909. for (y = y_start; y !== y_end; y += y_step) {
  19910. for (x = x_start; x !== x_end; x += x_step, i += 3) {
  19911. imageData[(x + width * y) * 4 + 3] = 255;
  19912. imageData[(x + width * y) * 4 + 2] = image[i + 0];
  19913. imageData[(x + width * y) * 4 + 1] = image[i + 1];
  19914. imageData[(x + width * y) * 4 + 0] = image[i + 2];
  19915. }
  19916. }
  19917. return imageData;
  19918. };
  19919. TGATools._getImageData32bits = function (header, palettes, pixel_data, y_start, y_step, y_end, x_start, x_step, x_end) {
  19920. var image = pixel_data;
  19921. var width = header.width, height = header.height;
  19922. var i = 0, x, y;
  19923. var imageData = new Uint8Array(width * height * 4);
  19924. for (y = y_start; y !== y_end; y += y_step) {
  19925. for (x = x_start; x !== x_end; x += x_step, i += 4) {
  19926. imageData[(x + width * y) * 4 + 2] = image[i + 0];
  19927. imageData[(x + width * y) * 4 + 1] = image[i + 1];
  19928. imageData[(x + width * y) * 4 + 0] = image[i + 2];
  19929. imageData[(x + width * y) * 4 + 3] = image[i + 3];
  19930. }
  19931. }
  19932. return imageData;
  19933. };
  19934. TGATools._getImageDataGrey8bits = function (header, palettes, pixel_data, y_start, y_step, y_end, x_start, x_step, x_end) {
  19935. var image = pixel_data;
  19936. var width = header.width, height = header.height;
  19937. var color, i = 0, x, y;
  19938. var imageData = new Uint8Array(width * height * 4);
  19939. for (y = y_start; y !== y_end; y += y_step) {
  19940. for (x = x_start; x !== x_end; x += x_step, i++) {
  19941. color = image[i];
  19942. imageData[(x + width * y) * 4 + 0] = color;
  19943. imageData[(x + width * y) * 4 + 1] = color;
  19944. imageData[(x + width * y) * 4 + 2] = color;
  19945. imageData[(x + width * y) * 4 + 3] = 255;
  19946. }
  19947. }
  19948. return imageData;
  19949. };
  19950. TGATools._getImageDataGrey16bits = function (header, palettes, pixel_data, y_start, y_step, y_end, x_start, x_step, x_end) {
  19951. var image = pixel_data;
  19952. var width = header.width, height = header.height;
  19953. var i = 0, x, y;
  19954. var imageData = new Uint8Array(width * height * 4);
  19955. for (y = y_start; y !== y_end; y += y_step) {
  19956. for (x = x_start; x !== x_end; x += x_step, i += 2) {
  19957. imageData[(x + width * y) * 4 + 0] = image[i + 0];
  19958. imageData[(x + width * y) * 4 + 1] = image[i + 0];
  19959. imageData[(x + width * y) * 4 + 2] = image[i + 0];
  19960. imageData[(x + width * y) * 4 + 3] = image[i + 1];
  19961. }
  19962. }
  19963. return imageData;
  19964. };
  19965. TGATools._TYPE_NO_DATA = 0;
  19966. TGATools._TYPE_INDEXED = 1;
  19967. TGATools._TYPE_RGB = 2;
  19968. TGATools._TYPE_GREY = 3;
  19969. TGATools._TYPE_RLE_INDEXED = 9;
  19970. TGATools._TYPE_RLE_RGB = 10;
  19971. TGATools._TYPE_RLE_GREY = 11;
  19972. TGATools._ORIGIN_MASK = 0x30;
  19973. TGATools._ORIGIN_SHIFT = 0x04;
  19974. TGATools._ORIGIN_BL = 0x00;
  19975. TGATools._ORIGIN_BR = 0x01;
  19976. TGATools._ORIGIN_UL = 0x02;
  19977. TGATools._ORIGIN_UR = 0x03;
  19978. return TGATools;
  19979. })();
  19980. Internals.TGATools = TGATools;
  19981. })(BABYLON.Internals || (BABYLON.Internals = {}));
  19982. var Internals = BABYLON.Internals;
  19983. })(BABYLON || (BABYLON = {}));
  19984. var BABYLON;
  19985. (function (BABYLON) {
  19986. (function (Internals) {
  19987. var DDS_MAGIC = 0x20534444;
  19988. var DDSD_CAPS = 0x1, DDSD_HEIGHT = 0x2, DDSD_WIDTH = 0x4, DDSD_PITCH = 0x8, DDSD_PIXELFORMAT = 0x1000, DDSD_MIPMAPCOUNT = 0x20000, DDSD_LINEARSIZE = 0x80000, DDSD_DEPTH = 0x800000;
  19989. var DDSCAPS_COMPLEX = 0x8, DDSCAPS_MIPMAP = 0x400000, DDSCAPS_TEXTURE = 0x1000;
  19990. var DDSCAPS2_CUBEMAP = 0x200, DDSCAPS2_CUBEMAP_POSITIVEX = 0x400, DDSCAPS2_CUBEMAP_NEGATIVEX = 0x800, DDSCAPS2_CUBEMAP_POSITIVEY = 0x1000, DDSCAPS2_CUBEMAP_NEGATIVEY = 0x2000, DDSCAPS2_CUBEMAP_POSITIVEZ = 0x4000, DDSCAPS2_CUBEMAP_NEGATIVEZ = 0x8000, DDSCAPS2_VOLUME = 0x200000;
  19991. var DDPF_ALPHAPIXELS = 0x1, DDPF_ALPHA = 0x2, DDPF_FOURCC = 0x4, DDPF_RGB = 0x40, DDPF_YUV = 0x200, DDPF_LUMINANCE = 0x20000;
  19992. function FourCCToInt32(value) {
  19993. return value.charCodeAt(0) + (value.charCodeAt(1) << 8) + (value.charCodeAt(2) << 16) + (value.charCodeAt(3) << 24);
  19994. }
  19995. function Int32ToFourCC(value) {
  19996. return String.fromCharCode(value & 0xff, (value >> 8) & 0xff, (value >> 16) & 0xff, (value >> 24) & 0xff);
  19997. }
  19998. var FOURCC_DXT1 = FourCCToInt32("DXT1");
  19999. var FOURCC_DXT3 = FourCCToInt32("DXT3");
  20000. var FOURCC_DXT5 = FourCCToInt32("DXT5");
  20001. var headerLengthInt = 31;
  20002. var off_magic = 0;
  20003. var off_size = 1;
  20004. var off_flags = 2;
  20005. var off_height = 3;
  20006. var off_width = 4;
  20007. var off_mipmapCount = 7;
  20008. var off_pfFlags = 20;
  20009. var off_pfFourCC = 21;
  20010. var off_RGBbpp = 22;
  20011. var off_RMask = 23;
  20012. var off_GMask = 24;
  20013. var off_BMask = 25;
  20014. var off_AMask = 26;
  20015. var off_caps1 = 27;
  20016. var off_caps2 = 28;
  20017. ;
  20018. var DDSTools = (function () {
  20019. function DDSTools() {
  20020. }
  20021. DDSTools.GetDDSInfo = function (arrayBuffer) {
  20022. var header = new Int32Array(arrayBuffer, 0, headerLengthInt);
  20023. var mipmapCount = 1;
  20024. if (header[off_flags] & DDSD_MIPMAPCOUNT) {
  20025. mipmapCount = Math.max(1, header[off_mipmapCount]);
  20026. }
  20027. return {
  20028. width: header[off_width],
  20029. height: header[off_height],
  20030. mipmapCount: mipmapCount,
  20031. isFourCC: (header[off_pfFlags] & DDPF_FOURCC) === DDPF_FOURCC,
  20032. isRGB: (header[off_pfFlags] & DDPF_RGB) === DDPF_RGB,
  20033. isLuminance: (header[off_pfFlags] & DDPF_LUMINANCE) === DDPF_LUMINANCE,
  20034. isCube: (header[off_caps2] & DDSCAPS2_CUBEMAP) === DDSCAPS2_CUBEMAP
  20035. };
  20036. };
  20037. DDSTools.GetRGBAArrayBuffer = function (width, height, dataOffset, dataLength, arrayBuffer) {
  20038. var byteArray = new Uint8Array(dataLength);
  20039. var srcData = new Uint8Array(arrayBuffer);
  20040. var index = 0;
  20041. for (var y = height - 1; y >= 0; y--) {
  20042. for (var x = 0; x < width; x++) {
  20043. var srcPos = dataOffset + (x + y * width) * 4;
  20044. byteArray[index + 2] = srcData[srcPos];
  20045. byteArray[index + 1] = srcData[srcPos + 1];
  20046. byteArray[index] = srcData[srcPos + 2];
  20047. byteArray[index + 3] = srcData[srcPos + 3];
  20048. index += 4;
  20049. }
  20050. }
  20051. return byteArray;
  20052. };
  20053. DDSTools.GetRGBArrayBuffer = function (width, height, dataOffset, dataLength, arrayBuffer) {
  20054. var byteArray = new Uint8Array(dataLength);
  20055. var srcData = new Uint8Array(arrayBuffer);
  20056. var index = 0;
  20057. for (var y = height - 1; y >= 0; y--) {
  20058. for (var x = 0; x < width; x++) {
  20059. var srcPos = dataOffset + (x + y * width) * 3;
  20060. byteArray[index + 2] = srcData[srcPos];
  20061. byteArray[index + 1] = srcData[srcPos + 1];
  20062. byteArray[index] = srcData[srcPos + 2];
  20063. index += 3;
  20064. }
  20065. }
  20066. return byteArray;
  20067. };
  20068. DDSTools.GetLuminanceArrayBuffer = function (width, height, dataOffset, dataLength, arrayBuffer) {
  20069. var byteArray = new Uint8Array(dataLength);
  20070. var srcData = new Uint8Array(arrayBuffer);
  20071. var index = 0;
  20072. for (var y = height - 1; y >= 0; y--) {
  20073. for (var x = 0; x < width; x++) {
  20074. var srcPos = dataOffset + (x + y * width);
  20075. byteArray[index] = srcData[srcPos];
  20076. index++;
  20077. }
  20078. }
  20079. return byteArray;
  20080. };
  20081. DDSTools.UploadDDSLevels = function (gl, ext, arrayBuffer, info, loadMipmaps, faces) {
  20082. var header = new Int32Array(arrayBuffer, 0, headerLengthInt), fourCC, blockBytes, internalFormat, width, height, dataLength, dataOffset, byteArray, mipmapCount, i;
  20083. if (header[off_magic] != DDS_MAGIC) {
  20084. BABYLON.Tools.Error("Invalid magic number in DDS header");
  20085. return;
  20086. }
  20087. if (!info.isFourCC && !info.isRGB && !info.isLuminance) {
  20088. BABYLON.Tools.Error("Unsupported format, must contain a FourCC, RGB or LUMINANCE code");
  20089. return;
  20090. }
  20091. if (info.isFourCC) {
  20092. fourCC = header[off_pfFourCC];
  20093. switch (fourCC) {
  20094. case FOURCC_DXT1:
  20095. blockBytes = 8;
  20096. internalFormat = ext.COMPRESSED_RGBA_S3TC_DXT1_EXT;
  20097. break;
  20098. case FOURCC_DXT3:
  20099. blockBytes = 16;
  20100. internalFormat = ext.COMPRESSED_RGBA_S3TC_DXT3_EXT;
  20101. break;
  20102. case FOURCC_DXT5:
  20103. blockBytes = 16;
  20104. internalFormat = ext.COMPRESSED_RGBA_S3TC_DXT5_EXT;
  20105. break;
  20106. default:
  20107. console.error("Unsupported FourCC code:", Int32ToFourCC(fourCC));
  20108. return;
  20109. }
  20110. }
  20111. mipmapCount = 1;
  20112. if (header[off_flags] & DDSD_MIPMAPCOUNT && loadMipmaps !== false) {
  20113. mipmapCount = Math.max(1, header[off_mipmapCount]);
  20114. }
  20115. var bpp = header[off_RGBbpp];
  20116. for (var face = 0; face < faces; face++) {
  20117. var sampler = faces == 1 ? gl.TEXTURE_2D : (gl.TEXTURE_CUBE_MAP_POSITIVE_X + face);
  20118. width = header[off_width];
  20119. height = header[off_height];
  20120. dataOffset = header[off_size] + 4;
  20121. for (i = 0; i < mipmapCount; ++i) {
  20122. if (info.isRGB) {
  20123. if (bpp == 24) {
  20124. dataLength = width * height * 3;
  20125. byteArray = DDSTools.GetRGBArrayBuffer(width, height, dataOffset, dataLength, arrayBuffer);
  20126. gl.texImage2D(sampler, i, gl.RGB, width, height, 0, gl.RGB, gl.UNSIGNED_BYTE, byteArray);
  20127. } else {
  20128. dataLength = width * height * 4;
  20129. byteArray = DDSTools.GetRGBAArrayBuffer(width, height, dataOffset, dataLength, arrayBuffer);
  20130. gl.texImage2D(sampler, i, gl.RGBA, width, height, 0, gl.RGBA, gl.UNSIGNED_BYTE, byteArray);
  20131. }
  20132. } else if (info.isLuminance) {
  20133. var unpackAlignment = gl.getParameter(gl.UNPACK_ALIGNMENT);
  20134. var unpaddedRowSize = width;
  20135. var paddedRowSize = Math.floor((width + unpackAlignment - 1) / unpackAlignment) * unpackAlignment;
  20136. dataLength = paddedRowSize * (height - 1) + unpaddedRowSize;
  20137. byteArray = DDSTools.GetLuminanceArrayBuffer(width, height, dataOffset, dataLength, arrayBuffer);
  20138. gl.texImage2D(sampler, i, gl.LUMINANCE, width, height, 0, gl.LUMINANCE, gl.UNSIGNED_BYTE, byteArray);
  20139. } else {
  20140. dataLength = Math.max(4, width) / 4 * Math.max(4, height) / 4 * blockBytes;
  20141. byteArray = new Uint8Array(arrayBuffer, dataOffset, dataLength);
  20142. gl.compressedTexImage2D(sampler, i, internalFormat, width, height, 0, byteArray);
  20143. }
  20144. dataOffset += dataLength;
  20145. width *= 0.5;
  20146. height *= 0.5;
  20147. width = Math.max(1.0, width);
  20148. height = Math.max(1.0, height);
  20149. }
  20150. }
  20151. };
  20152. return DDSTools;
  20153. })();
  20154. Internals.DDSTools = DDSTools;
  20155. })(BABYLON.Internals || (BABYLON.Internals = {}));
  20156. var Internals = BABYLON.Internals;
  20157. })(BABYLON || (BABYLON = {}));
  20158. var BABYLON;
  20159. (function (BABYLON) {
  20160. var SmartArray = (function () {
  20161. function SmartArray(capacity) {
  20162. this.length = 0;
  20163. this._duplicateId = 0;
  20164. this.data = new Array(capacity);
  20165. this._id = SmartArray._GlobalId++;
  20166. }
  20167. SmartArray.prototype.push = function (value) {
  20168. this.data[this.length++] = value;
  20169. if (this.length > this.data.length) {
  20170. this.data.length *= 2;
  20171. }
  20172. if (!value.__smartArrayFlags) {
  20173. value.__smartArrayFlags = {};
  20174. }
  20175. value.__smartArrayFlags[this._id] = this._duplicateId;
  20176. };
  20177. SmartArray.prototype.pushNoDuplicate = function (value) {
  20178. if (value.__smartArrayFlags && value.__smartArrayFlags[this._id] === this._duplicateId) {
  20179. return;
  20180. }
  20181. this.push(value);
  20182. };
  20183. SmartArray.prototype.sort = function (compareFn) {
  20184. this.data.sort(compareFn);
  20185. };
  20186. SmartArray.prototype.reset = function () {
  20187. this.length = 0;
  20188. this._duplicateId++;
  20189. };
  20190. SmartArray.prototype.concat = function (array) {
  20191. if (array.length === 0) {
  20192. return;
  20193. }
  20194. if (this.length + array.length > this.data.length) {
  20195. this.data.length = (this.length + array.length) * 2;
  20196. }
  20197. for (var index = 0; index < array.length; index++) {
  20198. this.data[this.length++] = (array.data || array)[index];
  20199. }
  20200. };
  20201. SmartArray.prototype.concatWithNoDuplicate = function (array) {
  20202. if (array.length === 0) {
  20203. return;
  20204. }
  20205. if (this.length + array.length > this.data.length) {
  20206. this.data.length = (this.length + array.length) * 2;
  20207. }
  20208. for (var index = 0; index < array.length; index++) {
  20209. var item = (array.data || array)[index];
  20210. this.pushNoDuplicate(item);
  20211. }
  20212. };
  20213. SmartArray.prototype.indexOf = function (value) {
  20214. var position = this.data.indexOf(value);
  20215. if (position >= this.length) {
  20216. return -1;
  20217. }
  20218. return position;
  20219. };
  20220. SmartArray._GlobalId = 0;
  20221. return SmartArray;
  20222. })();
  20223. BABYLON.SmartArray = SmartArray;
  20224. })(BABYLON || (BABYLON = {}));
  20225. var BABYLON;
  20226. (function (BABYLON) {
  20227. var CannonJSPlugin = (function () {
  20228. function CannonJSPlugin() {
  20229. this._registeredMeshes = [];
  20230. this._physicsMaterials = [];
  20231. this.updateBodyPosition = function (mesh) {
  20232. for (var index = 0; index < this._registeredMeshes.length; index++) {
  20233. var registeredMesh = this._registeredMeshes[index];
  20234. if (registeredMesh.mesh === mesh || registeredMesh.mesh === mesh.parent) {
  20235. var body = registeredMesh.body;
  20236. var center = mesh.getBoundingInfo().boundingBox.center;
  20237. body.position.set(center.x, center.z, center.y);
  20238. body.quaternion.x = mesh.rotationQuaternion.x;
  20239. body.quaternion.z = mesh.rotationQuaternion.y;
  20240. body.quaternion.y = mesh.rotationQuaternion.z;
  20241. body.quaternion.w = -mesh.rotationQuaternion.w;
  20242. return;
  20243. }
  20244. }
  20245. };
  20246. }
  20247. CannonJSPlugin.prototype.initialize = function (iterations) {
  20248. if (typeof iterations === "undefined") { iterations = 10; }
  20249. this._world = new CANNON.World();
  20250. this._world.broadphase = new CANNON.NaiveBroadphase();
  20251. this._world.solver.iterations = iterations;
  20252. };
  20253. CannonJSPlugin.prototype._checkWithEpsilon = function (value) {
  20254. return value < BABYLON.PhysicsEngine.Epsilon ? BABYLON.PhysicsEngine.Epsilon : value;
  20255. };
  20256. CannonJSPlugin.prototype.runOneStep = function (delta) {
  20257. this._world.step(delta);
  20258. for (var index = 0; index < this._registeredMeshes.length; index++) {
  20259. var registeredMesh = this._registeredMeshes[index];
  20260. if (registeredMesh.isChild) {
  20261. continue;
  20262. }
  20263. var bodyX = registeredMesh.body.position.x, bodyY = registeredMesh.body.position.y, bodyZ = registeredMesh.body.position.z;
  20264. var deltaPos = registeredMesh.delta;
  20265. if (deltaPos) {
  20266. registeredMesh.mesh.position.x = bodyX + deltaPos.x;
  20267. registeredMesh.mesh.position.y = bodyZ + deltaPos.y;
  20268. registeredMesh.mesh.position.z = bodyY + deltaPos.z;
  20269. } else {
  20270. registeredMesh.mesh.position.x = bodyX;
  20271. registeredMesh.mesh.position.y = bodyZ;
  20272. registeredMesh.mesh.position.z = bodyY;
  20273. }
  20274. if (!registeredMesh.mesh.rotationQuaternion) {
  20275. registeredMesh.mesh.rotationQuaternion = new BABYLON.Quaternion(0, 0, 0, 1);
  20276. }
  20277. registeredMesh.mesh.rotationQuaternion.x = registeredMesh.body.quaternion.x;
  20278. registeredMesh.mesh.rotationQuaternion.y = registeredMesh.body.quaternion.z;
  20279. registeredMesh.mesh.rotationQuaternion.z = registeredMesh.body.quaternion.y;
  20280. registeredMesh.mesh.rotationQuaternion.w = -registeredMesh.body.quaternion.w;
  20281. }
  20282. };
  20283. CannonJSPlugin.prototype.setGravity = function (gravity) {
  20284. this._world.gravity.set(gravity.x, gravity.z, gravity.y);
  20285. };
  20286. CannonJSPlugin.prototype.registerMesh = function (mesh, impostor, options) {
  20287. this.unregisterMesh(mesh);
  20288. mesh.computeWorldMatrix(true);
  20289. switch (impostor) {
  20290. case BABYLON.PhysicsEngine.SphereImpostor:
  20291. var bbox = mesh.getBoundingInfo().boundingBox;
  20292. var radiusX = bbox.maximumWorld.x - bbox.minimumWorld.x;
  20293. var radiusY = bbox.maximumWorld.y - bbox.minimumWorld.y;
  20294. var radiusZ = bbox.maximumWorld.z - bbox.minimumWorld.z;
  20295. return this._createSphere(Math.max(this._checkWithEpsilon(radiusX), this._checkWithEpsilon(radiusY), this._checkWithEpsilon(radiusZ)) / 2, mesh, options);
  20296. case BABYLON.PhysicsEngine.BoxImpostor:
  20297. bbox = mesh.getBoundingInfo().boundingBox;
  20298. var min = bbox.minimumWorld;
  20299. var max = bbox.maximumWorld;
  20300. var box = max.subtract(min).scale(0.5);
  20301. return this._createBox(this._checkWithEpsilon(box.x), this._checkWithEpsilon(box.y), this._checkWithEpsilon(box.z), mesh, options);
  20302. case BABYLON.PhysicsEngine.PlaneImpostor:
  20303. return this._createPlane(mesh, options);
  20304. case BABYLON.PhysicsEngine.MeshImpostor:
  20305. var rawVerts = mesh.getVerticesData(BABYLON.VertexBuffer.PositionKind);
  20306. var rawFaces = mesh.getIndices();
  20307. return this._createConvexPolyhedron(rawVerts, rawFaces, mesh, options);
  20308. }
  20309. return null;
  20310. };
  20311. CannonJSPlugin.prototype._createSphere = function (radius, mesh, options) {
  20312. var shape = new CANNON.Sphere(radius);
  20313. if (!options) {
  20314. return shape;
  20315. }
  20316. return this._createRigidBodyFromShape(shape, mesh, options.mass, options.friction, options.restitution);
  20317. };
  20318. CannonJSPlugin.prototype._createBox = function (x, y, z, mesh, options) {
  20319. var shape = new CANNON.Box(new CANNON.Vec3(x, z, y));
  20320. if (!options) {
  20321. return shape;
  20322. }
  20323. return this._createRigidBodyFromShape(shape, mesh, options.mass, options.friction, options.restitution);
  20324. };
  20325. CannonJSPlugin.prototype._createPlane = function (mesh, options) {
  20326. var shape = new CANNON.Plane();
  20327. if (!options) {
  20328. return shape;
  20329. }
  20330. return this._createRigidBodyFromShape(shape, mesh, options.mass, options.friction, options.restitution);
  20331. };
  20332. CannonJSPlugin.prototype._createConvexPolyhedron = function (rawVerts, rawFaces, mesh, options) {
  20333. var verts = [], faces = [];
  20334. mesh.computeWorldMatrix(true);
  20335. for (var i = 0; i < rawVerts.length; i += 3) {
  20336. var transformed = BABYLON.Vector3.Zero();
  20337. BABYLON.Vector3.TransformNormalFromFloatsToRef(rawVerts[i], rawVerts[i + 1], rawVerts[i + 2], mesh.getWorldMatrix(), transformed);
  20338. verts.push(new CANNON.Vec3(transformed.x, transformed.z, transformed.y));
  20339. }
  20340. for (var j = 0; j < rawFaces.length; j += 3) {
  20341. faces.push([rawFaces[j], rawFaces[j + 2], rawFaces[j + 1]]);
  20342. }
  20343. var shape = new CANNON.ConvexPolyhedron(verts, faces);
  20344. if (!options) {
  20345. return shape;
  20346. }
  20347. return this._createRigidBodyFromShape(shape, mesh, options.mass, options.friction, options.restitution);
  20348. };
  20349. CannonJSPlugin.prototype._addMaterial = function (friction, restitution) {
  20350. var index;
  20351. var mat;
  20352. for (index = 0; index < this._physicsMaterials.length; index++) {
  20353. mat = this._physicsMaterials[index];
  20354. if (mat.friction === friction && mat.restitution === restitution) {
  20355. return mat;
  20356. }
  20357. }
  20358. var currentMat = new CANNON.Material();
  20359. currentMat.friction = friction;
  20360. currentMat.restitution = restitution;
  20361. this._physicsMaterials.push(currentMat);
  20362. for (index = 0; index < this._physicsMaterials.length; index++) {
  20363. mat = this._physicsMaterials[index];
  20364. var contactMaterial = new CANNON.ContactMaterial(mat, currentMat, mat.friction * currentMat.friction, mat.restitution * currentMat.restitution);
  20365. contactMaterial.contactEquationStiffness = 1e10;
  20366. contactMaterial.contactEquationRegularizationTime = 10;
  20367. this._world.addContactMaterial(contactMaterial);
  20368. }
  20369. return currentMat;
  20370. };
  20371. CannonJSPlugin.prototype._createRigidBodyFromShape = function (shape, mesh, mass, friction, restitution) {
  20372. var initialRotation = null;
  20373. if (mesh.rotationQuaternion) {
  20374. initialRotation = mesh.rotationQuaternion.clone();
  20375. mesh.rotationQuaternion = new BABYLON.Quaternion(0, 0, 0, 1);
  20376. }
  20377. var bbox = mesh.getBoundingInfo().boundingBox;
  20378. var deltaPosition = mesh.position.subtract(bbox.center);
  20379. var material = this._addMaterial(friction, restitution);
  20380. var body = new CANNON.RigidBody(mass, shape, material);
  20381. if (initialRotation) {
  20382. body.quaternion.x = initialRotation.x;
  20383. body.quaternion.z = initialRotation.y;
  20384. body.quaternion.y = initialRotation.z;
  20385. body.quaternion.w = -initialRotation.w;
  20386. }
  20387. body.position.set(bbox.center.x, bbox.center.z, bbox.center.y);
  20388. this._world.add(body);
  20389. this._registeredMeshes.push({ mesh: mesh, body: body, material: material, delta: deltaPosition });
  20390. return body;
  20391. };
  20392. CannonJSPlugin.prototype.registerMeshesAsCompound = function (parts, options) {
  20393. var compoundShape = new CANNON.Compound();
  20394. for (var index = 0; index < parts.length; index++) {
  20395. var mesh = parts[index].mesh;
  20396. var shape = this.registerMesh(mesh, parts[index].impostor);
  20397. if (index == 0) {
  20398. compoundShape.addChild(shape, new CANNON.Vec3(0, 0, 0));
  20399. } else {
  20400. compoundShape.addChild(shape, new CANNON.Vec3(mesh.position.x, mesh.position.z, mesh.position.y));
  20401. }
  20402. }
  20403. var initialMesh = parts[0].mesh;
  20404. var body = this._createRigidBodyFromShape(compoundShape, initialMesh, options.mass, options.friction, options.restitution);
  20405. body.parts = parts;
  20406. return body;
  20407. };
  20408. CannonJSPlugin.prototype._unbindBody = function (body) {
  20409. for (var index = 0; index < this._registeredMeshes.length; index++) {
  20410. var registeredMesh = this._registeredMeshes[index];
  20411. if (registeredMesh.body === body) {
  20412. registeredMesh.body = null;
  20413. registeredMesh.delta = 0;
  20414. }
  20415. }
  20416. };
  20417. CannonJSPlugin.prototype.unregisterMesh = function (mesh) {
  20418. for (var index = 0; index < this._registeredMeshes.length; index++) {
  20419. var registeredMesh = this._registeredMeshes[index];
  20420. if (registeredMesh.mesh === mesh) {
  20421. if (registeredMesh.body) {
  20422. this._world.remove(registeredMesh.body);
  20423. this._unbindBody(registeredMesh.body);
  20424. }
  20425. this._registeredMeshes.splice(index, 1);
  20426. return;
  20427. }
  20428. }
  20429. };
  20430. CannonJSPlugin.prototype.applyImpulse = function (mesh, force, contactPoint) {
  20431. var worldPoint = new CANNON.Vec3(contactPoint.x, contactPoint.z, contactPoint.y);
  20432. var impulse = new CANNON.Vec3(force.x, force.z, force.y);
  20433. for (var index = 0; index < this._registeredMeshes.length; index++) {
  20434. var registeredMesh = this._registeredMeshes[index];
  20435. if (registeredMesh.mesh === mesh) {
  20436. registeredMesh.body.applyImpulse(impulse, worldPoint);
  20437. return;
  20438. }
  20439. }
  20440. };
  20441. CannonJSPlugin.prototype.createLink = function (mesh1, mesh2, pivot1, pivot2) {
  20442. var body1 = null, body2 = null;
  20443. for (var index = 0; index < this._registeredMeshes.length; index++) {
  20444. var registeredMesh = this._registeredMeshes[index];
  20445. if (registeredMesh.mesh === mesh1) {
  20446. body1 = registeredMesh.body;
  20447. } else if (registeredMesh.mesh === mesh2) {
  20448. body2 = registeredMesh.body;
  20449. }
  20450. }
  20451. if (!body1 || !body2) {
  20452. return false;
  20453. }
  20454. var constraint = new CANNON.PointToPointConstraint(body1, new CANNON.Vec3(pivot1.x, pivot1.z, pivot1.y), body2, new CANNON.Vec3(pivot2.x, pivot2.z, pivot2.y));
  20455. this._world.addConstraint(constraint);
  20456. return true;
  20457. };
  20458. CannonJSPlugin.prototype.dispose = function () {
  20459. while (this._registeredMeshes.length) {
  20460. this.unregisterMesh(this._registeredMeshes[0].mesh);
  20461. }
  20462. };
  20463. CannonJSPlugin.prototype.isSupported = function () {
  20464. return window.CANNON !== undefined;
  20465. };
  20466. return CannonJSPlugin;
  20467. })();
  20468. BABYLON.CannonJSPlugin = CannonJSPlugin;
  20469. })(BABYLON || (BABYLON = {}));
  20470. var __extends = this.__extends || function (d, b) {
  20471. for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p];
  20472. function __() { this.constructor = d; }
  20473. __.prototype = b.prototype;
  20474. d.prototype = new __();
  20475. };
  20476. var BABYLON;
  20477. (function (BABYLON) {
  20478. var Condition = (function () {
  20479. function Condition(actionManager) {
  20480. this._actionManager = actionManager;
  20481. }
  20482. Condition.prototype.isValid = function () {
  20483. return true;
  20484. };
  20485. Condition.prototype._getProperty = function (propertyPath) {
  20486. return this._actionManager._getProperty(propertyPath);
  20487. };
  20488. Condition.prototype._getEffectiveTarget = function (target, propertyPath) {
  20489. return this._actionManager._getEffectiveTarget(target, propertyPath);
  20490. };
  20491. return Condition;
  20492. })();
  20493. BABYLON.Condition = Condition;
  20494. var ValueCondition = (function (_super) {
  20495. __extends(ValueCondition, _super);
  20496. function ValueCondition(actionManager, target, propertyPath, value, operator) {
  20497. if (typeof operator === "undefined") { operator = ValueCondition.IsEqual; }
  20498. _super.call(this, actionManager);
  20499. this.propertyPath = propertyPath;
  20500. this.value = value;
  20501. this.operator = operator;
  20502. this._target = this._getEffectiveTarget(target, this.propertyPath);
  20503. this._property = this._getProperty(this.propertyPath);
  20504. }
  20505. Object.defineProperty(ValueCondition, "IsEqual", {
  20506. get: function () {
  20507. return ValueCondition._IsEqual;
  20508. },
  20509. enumerable: true,
  20510. configurable: true
  20511. });
  20512. Object.defineProperty(ValueCondition, "IsDifferent", {
  20513. get: function () {
  20514. return ValueCondition._IsDifferent;
  20515. },
  20516. enumerable: true,
  20517. configurable: true
  20518. });
  20519. Object.defineProperty(ValueCondition, "IsGreater", {
  20520. get: function () {
  20521. return ValueCondition._IsGreater;
  20522. },
  20523. enumerable: true,
  20524. configurable: true
  20525. });
  20526. Object.defineProperty(ValueCondition, "IsLesser", {
  20527. get: function () {
  20528. return ValueCondition._IsLesser;
  20529. },
  20530. enumerable: true,
  20531. configurable: true
  20532. });
  20533. ValueCondition.prototype.isValid = function () {
  20534. switch (this.operator) {
  20535. case ValueCondition.IsGreater:
  20536. return this._target[this._property] > this.value;
  20537. case ValueCondition.IsLesser:
  20538. return this._target[this._property] < this.value;
  20539. case ValueCondition.IsEqual:
  20540. case ValueCondition.IsDifferent:
  20541. var check;
  20542. if (this.value.equals) {
  20543. check = this.value.equals(this._target[this._property]);
  20544. } else {
  20545. check = this.value === this._target[this._property];
  20546. }
  20547. return this.operator === ValueCondition.IsEqual ? check : !check;
  20548. }
  20549. return false;
  20550. };
  20551. ValueCondition._IsEqual = 0;
  20552. ValueCondition._IsDifferent = 1;
  20553. ValueCondition._IsGreater = 2;
  20554. ValueCondition._IsLesser = 3;
  20555. return ValueCondition;
  20556. })(Condition);
  20557. BABYLON.ValueCondition = ValueCondition;
  20558. var PredicateCondition = (function (_super) {
  20559. __extends(PredicateCondition, _super);
  20560. function PredicateCondition(actionManager, predicate) {
  20561. _super.call(this, actionManager);
  20562. this.predicate = predicate;
  20563. }
  20564. PredicateCondition.prototype.isValid = function () {
  20565. return this.predicate();
  20566. };
  20567. return PredicateCondition;
  20568. })(Condition);
  20569. BABYLON.PredicateCondition = PredicateCondition;
  20570. var StateCondition = (function (_super) {
  20571. __extends(StateCondition, _super);
  20572. function StateCondition(actionManager, target, value) {
  20573. _super.call(this, actionManager);
  20574. this.value = value;
  20575. this._target = target;
  20576. }
  20577. StateCondition.prototype.isValid = function () {
  20578. return this._target.state === this.value;
  20579. };
  20580. return StateCondition;
  20581. })(Condition);
  20582. BABYLON.StateCondition = StateCondition;
  20583. })(BABYLON || (BABYLON = {}));
  20584. var BABYLON;
  20585. (function (BABYLON) {
  20586. var Action = (function () {
  20587. function Action(triggerOptions, condition) {
  20588. this.triggerOptions = triggerOptions;
  20589. if (triggerOptions.parameter) {
  20590. this.trigger = triggerOptions.trigger;
  20591. this._triggerParameter = triggerOptions.parameter;
  20592. } else {
  20593. this.trigger = triggerOptions;
  20594. }
  20595. this._nextActiveAction = this;
  20596. this._condition = condition;
  20597. }
  20598. Action.prototype._prepare = function () {
  20599. };
  20600. Action.prototype.getTriggerParameter = function () {
  20601. return this._triggerParameter;
  20602. };
  20603. Action.prototype._executeCurrent = function (evt) {
  20604. if (this._condition) {
  20605. var currentRenderId = this._actionManager.getScene().getRenderId();
  20606. if (this._condition._evaluationId === currentRenderId) {
  20607. if (!this._condition._currentResult) {
  20608. return;
  20609. }
  20610. } else {
  20611. this._condition._evaluationId = currentRenderId;
  20612. if (!this._condition.isValid()) {
  20613. this._condition._currentResult = false;
  20614. return;
  20615. }
  20616. this._condition._currentResult = true;
  20617. }
  20618. }
  20619. this._nextActiveAction.execute(evt);
  20620. if (this._nextActiveAction._child) {
  20621. if (!this._nextActiveAction._child._actionManager) {
  20622. this._nextActiveAction._child._actionManager = this._actionManager;
  20623. }
  20624. this._nextActiveAction = this._nextActiveAction._child;
  20625. } else {
  20626. this._nextActiveAction = this;
  20627. }
  20628. };
  20629. Action.prototype.execute = function (evt) {
  20630. };
  20631. Action.prototype.then = function (action) {
  20632. this._child = action;
  20633. action._actionManager = this._actionManager;
  20634. action._prepare();
  20635. return action;
  20636. };
  20637. Action.prototype._getProperty = function (propertyPath) {
  20638. return this._actionManager._getProperty(propertyPath);
  20639. };
  20640. Action.prototype._getEffectiveTarget = function (target, propertyPath) {
  20641. return this._actionManager._getEffectiveTarget(target, propertyPath);
  20642. };
  20643. return Action;
  20644. })();
  20645. BABYLON.Action = Action;
  20646. })(BABYLON || (BABYLON = {}));
  20647. var BABYLON;
  20648. (function (BABYLON) {
  20649. var ActionEvent = (function () {
  20650. function ActionEvent(source, pointerX, pointerY, meshUnderPointer, sourceEvent) {
  20651. this.source = source;
  20652. this.pointerX = pointerX;
  20653. this.pointerY = pointerY;
  20654. this.meshUnderPointer = meshUnderPointer;
  20655. this.sourceEvent = sourceEvent;
  20656. }
  20657. ActionEvent.CreateNew = function (source) {
  20658. var scene = source.getScene();
  20659. return new ActionEvent(source, scene.pointerX, scene.pointerY, scene.meshUnderPointer);
  20660. };
  20661. ActionEvent.CreateNewFromScene = function (scene, evt) {
  20662. return new ActionEvent(null, scene.pointerX, scene.pointerY, scene.meshUnderPointer, evt);
  20663. };
  20664. return ActionEvent;
  20665. })();
  20666. BABYLON.ActionEvent = ActionEvent;
  20667. var ActionManager = (function () {
  20668. function ActionManager(scene) {
  20669. this.actions = new Array();
  20670. this._scene = scene;
  20671. scene._actionManagers.push(this);
  20672. }
  20673. Object.defineProperty(ActionManager, "NothingTrigger", {
  20674. get: function () {
  20675. return ActionManager._NothingTrigger;
  20676. },
  20677. enumerable: true,
  20678. configurable: true
  20679. });
  20680. Object.defineProperty(ActionManager, "OnPickTrigger", {
  20681. get: function () {
  20682. return ActionManager._OnPickTrigger;
  20683. },
  20684. enumerable: true,
  20685. configurable: true
  20686. });
  20687. Object.defineProperty(ActionManager, "OnLeftPickTrigger", {
  20688. get: function () {
  20689. return ActionManager._OnLeftPickTrigger;
  20690. },
  20691. enumerable: true,
  20692. configurable: true
  20693. });
  20694. Object.defineProperty(ActionManager, "OnRightPickTrigger", {
  20695. get: function () {
  20696. return ActionManager._OnRightPickTrigger;
  20697. },
  20698. enumerable: true,
  20699. configurable: true
  20700. });
  20701. Object.defineProperty(ActionManager, "OnCenterPickTrigger", {
  20702. get: function () {
  20703. return ActionManager._OnCenterPickTrigger;
  20704. },
  20705. enumerable: true,
  20706. configurable: true
  20707. });
  20708. Object.defineProperty(ActionManager, "OnPointerOverTrigger", {
  20709. get: function () {
  20710. return ActionManager._OnPointerOverTrigger;
  20711. },
  20712. enumerable: true,
  20713. configurable: true
  20714. });
  20715. Object.defineProperty(ActionManager, "OnPointerOutTrigger", {
  20716. get: function () {
  20717. return ActionManager._OnPointerOutTrigger;
  20718. },
  20719. enumerable: true,
  20720. configurable: true
  20721. });
  20722. Object.defineProperty(ActionManager, "OnEveryFrameTrigger", {
  20723. get: function () {
  20724. return ActionManager._OnEveryFrameTrigger;
  20725. },
  20726. enumerable: true,
  20727. configurable: true
  20728. });
  20729. Object.defineProperty(ActionManager, "OnIntersectionEnterTrigger", {
  20730. get: function () {
  20731. return ActionManager._OnIntersectionEnterTrigger;
  20732. },
  20733. enumerable: true,
  20734. configurable: true
  20735. });
  20736. Object.defineProperty(ActionManager, "OnIntersectionExitTrigger", {
  20737. get: function () {
  20738. return ActionManager._OnIntersectionExitTrigger;
  20739. },
  20740. enumerable: true,
  20741. configurable: true
  20742. });
  20743. Object.defineProperty(ActionManager, "OnKeyDownTrigger", {
  20744. get: function () {
  20745. return ActionManager._OnKeyDownTrigger;
  20746. },
  20747. enumerable: true,
  20748. configurable: true
  20749. });
  20750. Object.defineProperty(ActionManager, "OnKeyUpTrigger", {
  20751. get: function () {
  20752. return ActionManager._OnKeyUpTrigger;
  20753. },
  20754. enumerable: true,
  20755. configurable: true
  20756. });
  20757. ActionManager.prototype.dispose = function () {
  20758. var index = this._scene._actionManagers.indexOf(this);
  20759. if (index > -1) {
  20760. this._scene._actionManagers.splice(index, 1);
  20761. }
  20762. };
  20763. ActionManager.prototype.getScene = function () {
  20764. return this._scene;
  20765. };
  20766. ActionManager.prototype.hasSpecificTriggers = function (triggers) {
  20767. for (var index = 0; index < this.actions.length; index++) {
  20768. var action = this.actions[index];
  20769. if (triggers.indexOf(action.trigger) > -1) {
  20770. return true;
  20771. }
  20772. }
  20773. return false;
  20774. };
  20775. Object.defineProperty(ActionManager.prototype, "hasPointerTriggers", {
  20776. get: function () {
  20777. for (var index = 0; index < this.actions.length; index++) {
  20778. var action = this.actions[index];
  20779. if (action.trigger >= ActionManager._OnPickTrigger && action.trigger <= ActionManager._OnPointerOutTrigger) {
  20780. return true;
  20781. }
  20782. }
  20783. return false;
  20784. },
  20785. enumerable: true,
  20786. configurable: true
  20787. });
  20788. Object.defineProperty(ActionManager.prototype, "hasPickTriggers", {
  20789. get: function () {
  20790. for (var index = 0; index < this.actions.length; index++) {
  20791. var action = this.actions[index];
  20792. if (action.trigger >= ActionManager._OnPickTrigger && action.trigger <= ActionManager._OnCenterPickTrigger) {
  20793. return true;
  20794. }
  20795. }
  20796. return false;
  20797. },
  20798. enumerable: true,
  20799. configurable: true
  20800. });
  20801. ActionManager.prototype.registerAction = function (action) {
  20802. if (action.trigger === ActionManager.OnEveryFrameTrigger) {
  20803. if (this.getScene().actionManager !== this) {
  20804. BABYLON.Tools.Warn("OnEveryFrameTrigger can only be used with scene.actionManager");
  20805. return null;
  20806. }
  20807. }
  20808. this.actions.push(action);
  20809. action._actionManager = this;
  20810. action._prepare();
  20811. return action;
  20812. };
  20813. ActionManager.prototype.processTrigger = function (trigger, evt) {
  20814. for (var index = 0; index < this.actions.length; index++) {
  20815. var action = this.actions[index];
  20816. if (action.trigger === trigger) {
  20817. if (trigger == ActionManager.OnKeyUpTrigger || trigger == ActionManager.OnKeyDownTrigger) {
  20818. var parameter = action.getTriggerParameter();
  20819. if (parameter) {
  20820. if (evt.sourceEvent.key !== parameter) {
  20821. continue;
  20822. }
  20823. }
  20824. }
  20825. action._executeCurrent(evt);
  20826. }
  20827. }
  20828. };
  20829. ActionManager.prototype._getEffectiveTarget = function (target, propertyPath) {
  20830. var properties = propertyPath.split(".");
  20831. for (var index = 0; index < properties.length - 1; index++) {
  20832. target = target[properties[index]];
  20833. }
  20834. return target;
  20835. };
  20836. ActionManager.prototype._getProperty = function (propertyPath) {
  20837. var properties = propertyPath.split(".");
  20838. return properties[properties.length - 1];
  20839. };
  20840. ActionManager._NothingTrigger = 0;
  20841. ActionManager._OnPickTrigger = 1;
  20842. ActionManager._OnLeftPickTrigger = 2;
  20843. ActionManager._OnRightPickTrigger = 3;
  20844. ActionManager._OnCenterPickTrigger = 4;
  20845. ActionManager._OnPointerOverTrigger = 5;
  20846. ActionManager._OnPointerOutTrigger = 6;
  20847. ActionManager._OnEveryFrameTrigger = 7;
  20848. ActionManager._OnIntersectionEnterTrigger = 8;
  20849. ActionManager._OnIntersectionExitTrigger = 9;
  20850. ActionManager._OnKeyDownTrigger = 10;
  20851. ActionManager._OnKeyUpTrigger = 11;
  20852. return ActionManager;
  20853. })();
  20854. BABYLON.ActionManager = ActionManager;
  20855. })(BABYLON || (BABYLON = {}));
  20856. var __extends = this.__extends || function (d, b) {
  20857. for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p];
  20858. function __() { this.constructor = d; }
  20859. __.prototype = b.prototype;
  20860. d.prototype = new __();
  20861. };
  20862. var BABYLON;
  20863. (function (BABYLON) {
  20864. var InterpolateValueAction = (function (_super) {
  20865. __extends(InterpolateValueAction, _super);
  20866. function InterpolateValueAction(triggerOptions, target, propertyPath, value, duration, condition, stopOtherAnimations) {
  20867. if (typeof duration === "undefined") { duration = 1000; }
  20868. _super.call(this, triggerOptions, condition);
  20869. this.propertyPath = propertyPath;
  20870. this.value = value;
  20871. this.duration = duration;
  20872. this.stopOtherAnimations = stopOtherAnimations;
  20873. this._target = target;
  20874. }
  20875. InterpolateValueAction.prototype._prepare = function () {
  20876. this._target = this._getEffectiveTarget(this._target, this.propertyPath);
  20877. this._property = this._getProperty(this.propertyPath);
  20878. };
  20879. InterpolateValueAction.prototype.execute = function () {
  20880. var scene = this._actionManager.getScene();
  20881. var keys = [
  20882. {
  20883. frame: 0,
  20884. value: this._target[this._property]
  20885. }, {
  20886. frame: 100,
  20887. value: this.value
  20888. }
  20889. ];
  20890. var dataType;
  20891. if (typeof this.value === "number") {
  20892. dataType = BABYLON.Animation.ANIMATIONTYPE_FLOAT;
  20893. } else if (this.value instanceof BABYLON.Color3) {
  20894. dataType = BABYLON.Animation.ANIMATIONTYPE_COLOR3;
  20895. } else if (this.value instanceof BABYLON.Vector3) {
  20896. dataType = BABYLON.Animation.ANIMATIONTYPE_VECTOR3;
  20897. } else if (this.value instanceof BABYLON.Matrix) {
  20898. dataType = BABYLON.Animation.ANIMATIONTYPE_MATRIX;
  20899. } else if (this.value instanceof BABYLON.Quaternion) {
  20900. dataType = BABYLON.Animation.ANIMATIONTYPE_QUATERNION;
  20901. } else {
  20902. BABYLON.Tools.Warn("InterpolateValueAction: Unsupported type (" + typeof this.value + ")");
  20903. return;
  20904. }
  20905. var animation = new BABYLON.Animation("InterpolateValueAction", this._property, 100 * (1000.0 / this.duration), dataType, BABYLON.Animation.ANIMATIONLOOPMODE_CONSTANT);
  20906. animation.setKeys(keys);
  20907. if (this.stopOtherAnimations) {
  20908. scene.stopAnimation(this._target);
  20909. }
  20910. scene.beginDirectAnimation(this._target, [animation], 0, 100);
  20911. };
  20912. return InterpolateValueAction;
  20913. })(BABYLON.Action);
  20914. BABYLON.InterpolateValueAction = InterpolateValueAction;
  20915. })(BABYLON || (BABYLON = {}));
  20916. var __extends = this.__extends || function (d, b) {
  20917. for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p];
  20918. function __() { this.constructor = d; }
  20919. __.prototype = b.prototype;
  20920. d.prototype = new __();
  20921. };
  20922. var BABYLON;
  20923. (function (BABYLON) {
  20924. var SwitchBooleanAction = (function (_super) {
  20925. __extends(SwitchBooleanAction, _super);
  20926. function SwitchBooleanAction(triggerOptions, target, propertyPath, condition) {
  20927. _super.call(this, triggerOptions, condition);
  20928. this.propertyPath = propertyPath;
  20929. this._target = target;
  20930. }
  20931. SwitchBooleanAction.prototype._prepare = function () {
  20932. this._target = this._getEffectiveTarget(this._target, this.propertyPath);
  20933. this._property = this._getProperty(this.propertyPath);
  20934. };
  20935. SwitchBooleanAction.prototype.execute = function () {
  20936. this._target[this._property] = !this._target[this._property];
  20937. };
  20938. return SwitchBooleanAction;
  20939. })(BABYLON.Action);
  20940. BABYLON.SwitchBooleanAction = SwitchBooleanAction;
  20941. var SetStateAction = (function (_super) {
  20942. __extends(SetStateAction, _super);
  20943. function SetStateAction(triggerOptions, target, value, condition) {
  20944. _super.call(this, triggerOptions, condition);
  20945. this.value = value;
  20946. this._target = target;
  20947. }
  20948. SetStateAction.prototype.execute = function () {
  20949. this._target.state = this.value;
  20950. };
  20951. return SetStateAction;
  20952. })(BABYLON.Action);
  20953. BABYLON.SetStateAction = SetStateAction;
  20954. var SetValueAction = (function (_super) {
  20955. __extends(SetValueAction, _super);
  20956. function SetValueAction(triggerOptions, target, propertyPath, value, condition) {
  20957. _super.call(this, triggerOptions, condition);
  20958. this.propertyPath = propertyPath;
  20959. this.value = value;
  20960. this._target = target;
  20961. }
  20962. SetValueAction.prototype._prepare = function () {
  20963. this._target = this._getEffectiveTarget(this._target, this.propertyPath);
  20964. this._property = this._getProperty(this.propertyPath);
  20965. };
  20966. SetValueAction.prototype.execute = function () {
  20967. this._target[this._property] = this.value;
  20968. };
  20969. return SetValueAction;
  20970. })(BABYLON.Action);
  20971. BABYLON.SetValueAction = SetValueAction;
  20972. var IncrementValueAction = (function (_super) {
  20973. __extends(IncrementValueAction, _super);
  20974. function IncrementValueAction(triggerOptions, target, propertyPath, value, condition) {
  20975. _super.call(this, triggerOptions, condition);
  20976. this.propertyPath = propertyPath;
  20977. this.value = value;
  20978. this._target = target;
  20979. }
  20980. IncrementValueAction.prototype._prepare = function () {
  20981. this._target = this._getEffectiveTarget(this._target, this.propertyPath);
  20982. this._property = this._getProperty(this.propertyPath);
  20983. if (typeof this._target[this._property] !== "number") {
  20984. BABYLON.Tools.Warn("Warning: IncrementValueAction can only be used with number values");
  20985. }
  20986. };
  20987. IncrementValueAction.prototype.execute = function () {
  20988. this._target[this._property] += this.value;
  20989. };
  20990. return IncrementValueAction;
  20991. })(BABYLON.Action);
  20992. BABYLON.IncrementValueAction = IncrementValueAction;
  20993. var PlayAnimationAction = (function (_super) {
  20994. __extends(PlayAnimationAction, _super);
  20995. function PlayAnimationAction(triggerOptions, target, from, to, loop, condition) {
  20996. _super.call(this, triggerOptions, condition);
  20997. this.from = from;
  20998. this.to = to;
  20999. this.loop = loop;
  21000. this._target = target;
  21001. }
  21002. PlayAnimationAction.prototype._prepare = function () {
  21003. };
  21004. PlayAnimationAction.prototype.execute = function () {
  21005. var scene = this._actionManager.getScene();
  21006. scene.beginAnimation(this._target, this.from, this.to, this.loop);
  21007. };
  21008. return PlayAnimationAction;
  21009. })(BABYLON.Action);
  21010. BABYLON.PlayAnimationAction = PlayAnimationAction;
  21011. var StopAnimationAction = (function (_super) {
  21012. __extends(StopAnimationAction, _super);
  21013. function StopAnimationAction(triggerOptions, target, condition) {
  21014. _super.call(this, triggerOptions, condition);
  21015. this._target = target;
  21016. }
  21017. StopAnimationAction.prototype._prepare = function () {
  21018. };
  21019. StopAnimationAction.prototype.execute = function () {
  21020. var scene = this._actionManager.getScene();
  21021. scene.stopAnimation(this._target);
  21022. };
  21023. return StopAnimationAction;
  21024. })(BABYLON.Action);
  21025. BABYLON.StopAnimationAction = StopAnimationAction;
  21026. var DoNothingAction = (function (_super) {
  21027. __extends(DoNothingAction, _super);
  21028. function DoNothingAction(triggerOptions, condition) {
  21029. if (typeof triggerOptions === "undefined") { triggerOptions = BABYLON.ActionManager.NothingTrigger; }
  21030. _super.call(this, triggerOptions, condition);
  21031. }
  21032. DoNothingAction.prototype.execute = function () {
  21033. };
  21034. return DoNothingAction;
  21035. })(BABYLON.Action);
  21036. BABYLON.DoNothingAction = DoNothingAction;
  21037. var CombineAction = (function (_super) {
  21038. __extends(CombineAction, _super);
  21039. function CombineAction(triggerOptions, children, condition) {
  21040. _super.call(this, triggerOptions, condition);
  21041. this.children = children;
  21042. }
  21043. CombineAction.prototype._prepare = function () {
  21044. for (var index = 0; index < this.children.length; index++) {
  21045. this.children[index]._actionManager = this._actionManager;
  21046. this.children[index]._prepare();
  21047. }
  21048. };
  21049. CombineAction.prototype.execute = function (evt) {
  21050. for (var index = 0; index < this.children.length; index++) {
  21051. this.children[index].execute(evt);
  21052. }
  21053. };
  21054. return CombineAction;
  21055. })(BABYLON.Action);
  21056. BABYLON.CombineAction = CombineAction;
  21057. var ExecuteCodeAction = (function (_super) {
  21058. __extends(ExecuteCodeAction, _super);
  21059. function ExecuteCodeAction(triggerOptions, func, condition) {
  21060. _super.call(this, triggerOptions, condition);
  21061. this.func = func;
  21062. }
  21063. ExecuteCodeAction.prototype.execute = function (evt) {
  21064. this.func(evt);
  21065. };
  21066. return ExecuteCodeAction;
  21067. })(BABYLON.Action);
  21068. BABYLON.ExecuteCodeAction = ExecuteCodeAction;
  21069. var SetParentAction = (function (_super) {
  21070. __extends(SetParentAction, _super);
  21071. function SetParentAction(triggerOptions, target, parent, condition) {
  21072. _super.call(this, triggerOptions, condition);
  21073. this._target = target;
  21074. this._parent = parent;
  21075. }
  21076. SetParentAction.prototype._prepare = function () {
  21077. };
  21078. SetParentAction.prototype.execute = function () {
  21079. if (this._target.parent === this._parent) {
  21080. return;
  21081. }
  21082. var invertParentWorldMatrix = this._parent.getWorldMatrix().clone();
  21083. invertParentWorldMatrix.invert();
  21084. this._target.position = BABYLON.Vector3.TransformCoordinates(this._target.position, invertParentWorldMatrix);
  21085. this._target.parent = this._parent;
  21086. };
  21087. return SetParentAction;
  21088. })(BABYLON.Action);
  21089. BABYLON.SetParentAction = SetParentAction;
  21090. })(BABYLON || (BABYLON = {}));
  21091. var __extends = this.__extends || function (d, b) {
  21092. for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p];
  21093. function __() { this.constructor = d; }
  21094. __.prototype = b.prototype;
  21095. d.prototype = new __();
  21096. };
  21097. var BABYLON;
  21098. (function (BABYLON) {
  21099. var Geometry = (function () {
  21100. function Geometry(id, scene, vertexData, updatable, mesh) {
  21101. this.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_NONE;
  21102. this._totalVertices = 0;
  21103. this._indices = [];
  21104. this.id = id;
  21105. this._engine = scene.getEngine();
  21106. this._meshes = [];
  21107. this._scene = scene;
  21108. if (vertexData) {
  21109. this.setAllVerticesData(vertexData, updatable);
  21110. } else {
  21111. this._totalVertices = 0;
  21112. this._indices = [];
  21113. }
  21114. if (mesh) {
  21115. this.applyToMesh(mesh);
  21116. }
  21117. }
  21118. Geometry.prototype.getScene = function () {
  21119. return this._scene;
  21120. };
  21121. Geometry.prototype.getEngine = function () {
  21122. return this._engine;
  21123. };
  21124. Geometry.prototype.isReady = function () {
  21125. return this.delayLoadState === BABYLON.Engine.DELAYLOADSTATE_LOADED || this.delayLoadState === BABYLON.Engine.DELAYLOADSTATE_NONE;
  21126. };
  21127. Geometry.prototype.setAllVerticesData = function (vertexData, updatable) {
  21128. vertexData.applyToGeometry(this, updatable);
  21129. };
  21130. Geometry.prototype.setVerticesData = function (kind, data, updatable, stride) {
  21131. this._vertexBuffers = this._vertexBuffers || {};
  21132. if (this._vertexBuffers[kind]) {
  21133. this._vertexBuffers[kind].dispose();
  21134. }
  21135. this._vertexBuffers[kind] = new BABYLON.VertexBuffer(this._engine, data, kind, updatable, this._meshes.length === 0, stride);
  21136. if (kind === BABYLON.VertexBuffer.PositionKind) {
  21137. stride = this._vertexBuffers[kind].getStrideSize();
  21138. this._totalVertices = data.length / stride;
  21139. var extend = BABYLON.Tools.ExtractMinAndMax(data, 0, this._totalVertices);
  21140. var meshes = this._meshes;
  21141. var numOfMeshes = meshes.length;
  21142. for (var index = 0; index < numOfMeshes; index++) {
  21143. var mesh = meshes[index];
  21144. mesh._resetPointsArrayCache();
  21145. mesh._boundingInfo = new BABYLON.BoundingInfo(extend.minimum, extend.maximum);
  21146. mesh._createGlobalSubMesh();
  21147. mesh.computeWorldMatrix(true);
  21148. }
  21149. }
  21150. };
  21151. Geometry.prototype.updateVerticesDataDirectly = function (kind, data) {
  21152. var vertexBuffer = this.getVertexBuffer(kind);
  21153. if (!vertexBuffer) {
  21154. return;
  21155. }
  21156. vertexBuffer.updateDirectly(data);
  21157. };
  21158. Geometry.prototype.updateVerticesData = function (kind, data, updateExtends) {
  21159. var vertexBuffer = this.getVertexBuffer(kind);
  21160. if (!vertexBuffer) {
  21161. return;
  21162. }
  21163. vertexBuffer.update(data);
  21164. if (kind === BABYLON.VertexBuffer.PositionKind) {
  21165. var extend;
  21166. if (updateExtends) {
  21167. var stride = vertexBuffer.getStrideSize();
  21168. this._totalVertices = data.length / stride;
  21169. extend = BABYLON.Tools.ExtractMinAndMax(data, 0, this._totalVertices);
  21170. }
  21171. var meshes = this._meshes;
  21172. var numOfMeshes = meshes.length;
  21173. for (var index = 0; index < numOfMeshes; index++) {
  21174. var mesh = meshes[index];
  21175. mesh._resetPointsArrayCache();
  21176. if (updateExtends) {
  21177. mesh._boundingInfo = new BABYLON.BoundingInfo(extend.minimum, extend.maximum);
  21178. }
  21179. }
  21180. }
  21181. };
  21182. Geometry.prototype.getTotalVertices = function () {
  21183. if (!this.isReady()) {
  21184. return 0;
  21185. }
  21186. return this._totalVertices;
  21187. };
  21188. Geometry.prototype.getVerticesData = function (kind) {
  21189. var vertexBuffer = this.getVertexBuffer(kind);
  21190. if (!vertexBuffer) {
  21191. return null;
  21192. }
  21193. return vertexBuffer.getData();
  21194. };
  21195. Geometry.prototype.getVertexBuffer = function (kind) {
  21196. if (!this.isReady()) {
  21197. return null;
  21198. }
  21199. return this._vertexBuffers[kind];
  21200. };
  21201. Geometry.prototype.getVertexBuffers = function () {
  21202. if (!this.isReady()) {
  21203. return null;
  21204. }
  21205. return this._vertexBuffers;
  21206. };
  21207. Geometry.prototype.isVerticesDataPresent = function (kind) {
  21208. if (!this._vertexBuffers) {
  21209. if (this._delayInfo) {
  21210. return this._delayInfo.indexOf(kind) !== -1;
  21211. }
  21212. return false;
  21213. }
  21214. return this._vertexBuffers[kind] !== undefined;
  21215. };
  21216. Geometry.prototype.getVerticesDataKinds = function () {
  21217. var result = [];
  21218. if (!this._vertexBuffers && this._delayInfo) {
  21219. for (var kind in this._delayInfo) {
  21220. result.push(kind);
  21221. }
  21222. } else {
  21223. for (kind in this._vertexBuffers) {
  21224. result.push(kind);
  21225. }
  21226. }
  21227. return result;
  21228. };
  21229. Geometry.prototype.setIndices = function (indices) {
  21230. if (this._indexBuffer) {
  21231. this._engine._releaseBuffer(this._indexBuffer);
  21232. }
  21233. this._indices = indices;
  21234. if (this._meshes.length !== 0 && this._indices) {
  21235. this._indexBuffer = this._engine.createIndexBuffer(this._indices);
  21236. }
  21237. var meshes = this._meshes;
  21238. var numOfMeshes = meshes.length;
  21239. for (var index = 0; index < numOfMeshes; index++) {
  21240. meshes[index]._createGlobalSubMesh();
  21241. }
  21242. };
  21243. Geometry.prototype.getTotalIndices = function () {
  21244. if (!this.isReady()) {
  21245. return 0;
  21246. }
  21247. return this._indices.length;
  21248. };
  21249. Geometry.prototype.getIndices = function () {
  21250. if (!this.isReady()) {
  21251. return null;
  21252. }
  21253. return this._indices;
  21254. };
  21255. Geometry.prototype.getIndexBuffer = function () {
  21256. if (!this.isReady()) {
  21257. return null;
  21258. }
  21259. return this._indexBuffer;
  21260. };
  21261. Geometry.prototype.releaseForMesh = function (mesh, shouldDispose) {
  21262. var meshes = this._meshes;
  21263. var index = meshes.indexOf(mesh);
  21264. if (index === -1) {
  21265. return;
  21266. }
  21267. for (var kind in this._vertexBuffers) {
  21268. this._vertexBuffers[kind].dispose();
  21269. }
  21270. if (this._indexBuffer && this._engine._releaseBuffer(this._indexBuffer)) {
  21271. this._indexBuffer = null;
  21272. }
  21273. meshes.splice(index, 1);
  21274. mesh._geometry = null;
  21275. if (meshes.length == 0 && shouldDispose) {
  21276. this.dispose();
  21277. }
  21278. };
  21279. Geometry.prototype.applyToMesh = function (mesh) {
  21280. if (mesh._geometry === this) {
  21281. return;
  21282. }
  21283. var previousGeometry = mesh._geometry;
  21284. if (previousGeometry) {
  21285. previousGeometry.releaseForMesh(mesh);
  21286. }
  21287. var meshes = this._meshes;
  21288. mesh._geometry = this;
  21289. this._scene.pushGeometry(this);
  21290. meshes.push(mesh);
  21291. if (this.isReady()) {
  21292. this._applyToMesh(mesh);
  21293. } else {
  21294. mesh._boundingInfo = this._boundingInfo;
  21295. }
  21296. };
  21297. Geometry.prototype._applyToMesh = function (mesh) {
  21298. var numOfMeshes = this._meshes.length;
  21299. for (var kind in this._vertexBuffers) {
  21300. if (numOfMeshes === 1) {
  21301. this._vertexBuffers[kind].create();
  21302. }
  21303. this._vertexBuffers[kind]._buffer.references = numOfMeshes;
  21304. if (kind === BABYLON.VertexBuffer.PositionKind) {
  21305. mesh._resetPointsArrayCache();
  21306. var extend = BABYLON.Tools.ExtractMinAndMax(this._vertexBuffers[kind].getData(), 0, this._totalVertices);
  21307. mesh._boundingInfo = new BABYLON.BoundingInfo(extend.minimum, extend.maximum);
  21308. mesh._createGlobalSubMesh();
  21309. }
  21310. }
  21311. if (numOfMeshes === 1 && this._indices) {
  21312. this._indexBuffer = this._engine.createIndexBuffer(this._indices);
  21313. }
  21314. if (this._indexBuffer) {
  21315. this._indexBuffer.references = numOfMeshes;
  21316. }
  21317. };
  21318. Geometry.prototype.load = function (scene, onLoaded) {
  21319. var _this = this;
  21320. if (this.delayLoadState === BABYLON.Engine.DELAYLOADSTATE_LOADING) {
  21321. return;
  21322. }
  21323. if (this.isReady()) {
  21324. if (onLoaded) {
  21325. onLoaded();
  21326. }
  21327. return;
  21328. }
  21329. this.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_LOADING;
  21330. scene._addPendingData(this);
  21331. BABYLON.Tools.LoadFile(this.delayLoadingFile, function (data) {
  21332. _this._delayLoadingFunction(JSON.parse(data), _this);
  21333. _this.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_LOADED;
  21334. _this._delayInfo = [];
  21335. scene._removePendingData(_this);
  21336. var meshes = _this._meshes;
  21337. var numOfMeshes = meshes.length;
  21338. for (var index = 0; index < numOfMeshes; index++) {
  21339. _this._applyToMesh(meshes[index]);
  21340. }
  21341. if (onLoaded) {
  21342. onLoaded();
  21343. }
  21344. }, function () {
  21345. }, scene.database);
  21346. };
  21347. Geometry.prototype.dispose = function () {
  21348. var meshes = this._meshes;
  21349. var numOfMeshes = meshes.length;
  21350. for (var index = 0; index < numOfMeshes; index++) {
  21351. this.releaseForMesh(meshes[index]);
  21352. }
  21353. this._meshes = [];
  21354. for (var kind in this._vertexBuffers) {
  21355. this._vertexBuffers[kind].dispose();
  21356. }
  21357. this._vertexBuffers = [];
  21358. this._totalVertices = 0;
  21359. if (this._indexBuffer) {
  21360. this._engine._releaseBuffer(this._indexBuffer);
  21361. }
  21362. this._indexBuffer = null;
  21363. this._indices = [];
  21364. this.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_NONE;
  21365. this.delayLoadingFile = null;
  21366. this._delayLoadingFunction = null;
  21367. this._delayInfo = [];
  21368. this._boundingInfo = null;
  21369. var geometries = this._scene.getGeometries();
  21370. index = geometries.indexOf(this);
  21371. if (index > -1) {
  21372. geometries.splice(index, 1);
  21373. }
  21374. };
  21375. Geometry.prototype.copy = function (id) {
  21376. var vertexData = new BABYLON.VertexData();
  21377. vertexData.indices = [];
  21378. var indices = this.getIndices();
  21379. for (var index = 0; index < indices.length; index++) {
  21380. vertexData.indices.push(indices[index]);
  21381. }
  21382. var updatable = false;
  21383. var stopChecking = false;
  21384. for (var kind in this._vertexBuffers) {
  21385. vertexData.set(this.getVerticesData(kind), kind);
  21386. if (!stopChecking) {
  21387. updatable = this.getVertexBuffer(kind).isUpdatable();
  21388. stopChecking = !updatable;
  21389. }
  21390. }
  21391. var geometry = new BABYLON.Geometry(id, this._scene, vertexData, updatable, null);
  21392. geometry.delayLoadState = this.delayLoadState;
  21393. geometry.delayLoadingFile = this.delayLoadingFile;
  21394. geometry._delayLoadingFunction = this._delayLoadingFunction;
  21395. for (kind in this._delayInfo) {
  21396. geometry._delayInfo = geometry._delayInfo || [];
  21397. geometry._delayInfo.push(kind);
  21398. }
  21399. var extend = BABYLON.Tools.ExtractMinAndMax(this.getVerticesData(BABYLON.VertexBuffer.PositionKind), 0, this.getTotalVertices());
  21400. geometry._boundingInfo = new BABYLON.BoundingInfo(extend.minimum, extend.maximum);
  21401. return geometry;
  21402. };
  21403. Geometry.ExtractFromMesh = function (mesh, id) {
  21404. var geometry = mesh._geometry;
  21405. if (!geometry) {
  21406. return null;
  21407. }
  21408. return geometry.copy(id);
  21409. };
  21410. Geometry.RandomId = function () {
  21411. return 'xxxxxxxx-xxxx-4xxx-yxxx-xxxxxxxxxxxx'.replace(/[xy]/g, function (c) {
  21412. var r = Math.random() * 16 | 0, v = c == 'x' ? r : (r & 0x3 | 0x8);
  21413. return v.toString(16);
  21414. });
  21415. };
  21416. return Geometry;
  21417. })();
  21418. BABYLON.Geometry = Geometry;
  21419. (function (Geometry) {
  21420. (function (Primitives) {
  21421. var _Primitive = (function (_super) {
  21422. __extends(_Primitive, _super);
  21423. function _Primitive(id, scene, vertexData, canBeRegenerated, mesh) {
  21424. this._beingRegenerated = true;
  21425. this._canBeRegenerated = canBeRegenerated;
  21426. _super.call(this, id, scene, vertexData, false, mesh);
  21427. this._beingRegenerated = false;
  21428. }
  21429. _Primitive.prototype.canBeRegenerated = function () {
  21430. return this._canBeRegenerated;
  21431. };
  21432. _Primitive.prototype.regenerate = function () {
  21433. if (!this._canBeRegenerated) {
  21434. return;
  21435. }
  21436. this._beingRegenerated = true;
  21437. this.setAllVerticesData(this._regenerateVertexData(), false);
  21438. this._beingRegenerated = false;
  21439. };
  21440. _Primitive.prototype.asNewGeometry = function (id) {
  21441. return _super.prototype.copy.call(this, id);
  21442. };
  21443. _Primitive.prototype.setAllVerticesData = function (vertexData, updatable) {
  21444. if (!this._beingRegenerated) {
  21445. return;
  21446. }
  21447. _super.prototype.setAllVerticesData.call(this, vertexData, false);
  21448. };
  21449. _Primitive.prototype.setVerticesData = function (kind, data, updatable) {
  21450. if (!this._beingRegenerated) {
  21451. return;
  21452. }
  21453. _super.prototype.setVerticesData.call(this, kind, data, false);
  21454. };
  21455. _Primitive.prototype._regenerateVertexData = function () {
  21456. throw new Error("Abstract method");
  21457. };
  21458. _Primitive.prototype.copy = function (id) {
  21459. throw new Error("Must be overriden in sub-classes.");
  21460. };
  21461. return _Primitive;
  21462. })(Geometry);
  21463. Primitives._Primitive = _Primitive;
  21464. var Box = (function (_super) {
  21465. __extends(Box, _super);
  21466. function Box(id, scene, size, canBeRegenerated, mesh) {
  21467. this.size = size;
  21468. _super.call(this, id, scene, this._regenerateVertexData(), canBeRegenerated, mesh);
  21469. }
  21470. Box.prototype._regenerateVertexData = function () {
  21471. return BABYLON.VertexData.CreateBox(this.size);
  21472. };
  21473. Box.prototype.copy = function (id) {
  21474. return new Box(id, this.getScene(), this.size, this.canBeRegenerated(), null);
  21475. };
  21476. return Box;
  21477. })(_Primitive);
  21478. Primitives.Box = Box;
  21479. var Sphere = (function (_super) {
  21480. __extends(Sphere, _super);
  21481. function Sphere(id, scene, segments, diameter, canBeRegenerated, mesh) {
  21482. this.segments = segments;
  21483. this.diameter = diameter;
  21484. _super.call(this, id, scene, this._regenerateVertexData(), canBeRegenerated, mesh);
  21485. }
  21486. Sphere.prototype._regenerateVertexData = function () {
  21487. return BABYLON.VertexData.CreateSphere(this.segments, this.diameter);
  21488. };
  21489. Sphere.prototype.copy = function (id) {
  21490. return new Sphere(id, this.getScene(), this.segments, this.diameter, this.canBeRegenerated(), null);
  21491. };
  21492. return Sphere;
  21493. })(_Primitive);
  21494. Primitives.Sphere = Sphere;
  21495. var Cylinder = (function (_super) {
  21496. __extends(Cylinder, _super);
  21497. function Cylinder(id, scene, height, diameterTop, diameterBottom, tessellation, subdivisions, canBeRegenerated, mesh) {
  21498. if (typeof subdivisions === "undefined") { subdivisions = 1; }
  21499. this.height = height;
  21500. this.diameterTop = diameterTop;
  21501. this.diameterBottom = diameterBottom;
  21502. this.tessellation = tessellation;
  21503. this.subdivisions = subdivisions;
  21504. _super.call(this, id, scene, this._regenerateVertexData(), canBeRegenerated, mesh);
  21505. }
  21506. Cylinder.prototype._regenerateVertexData = function () {
  21507. return BABYLON.VertexData.CreateCylinder(this.height, this.diameterTop, this.diameterBottom, this.tessellation, this.subdivisions);
  21508. };
  21509. Cylinder.prototype.copy = function (id) {
  21510. return new Cylinder(id, this.getScene(), this.height, this.diameterTop, this.diameterBottom, this.tessellation, this.subdivisions, this.canBeRegenerated(), null);
  21511. };
  21512. return Cylinder;
  21513. })(_Primitive);
  21514. Primitives.Cylinder = Cylinder;
  21515. var Torus = (function (_super) {
  21516. __extends(Torus, _super);
  21517. function Torus(id, scene, diameter, thickness, tessellation, canBeRegenerated, mesh) {
  21518. this.diameter = diameter;
  21519. this.thickness = thickness;
  21520. this.tessellation = tessellation;
  21521. _super.call(this, id, scene, this._regenerateVertexData(), canBeRegenerated, mesh);
  21522. }
  21523. Torus.prototype._regenerateVertexData = function () {
  21524. return BABYLON.VertexData.CreateTorus(this.diameter, this.thickness, this.tessellation);
  21525. };
  21526. Torus.prototype.copy = function (id) {
  21527. return new Torus(id, this.getScene(), this.diameter, this.thickness, this.tessellation, this.canBeRegenerated(), null);
  21528. };
  21529. return Torus;
  21530. })(_Primitive);
  21531. Primitives.Torus = Torus;
  21532. var Ground = (function (_super) {
  21533. __extends(Ground, _super);
  21534. function Ground(id, scene, width, height, subdivisions, canBeRegenerated, mesh) {
  21535. this.width = width;
  21536. this.height = height;
  21537. this.subdivisions = subdivisions;
  21538. _super.call(this, id, scene, this._regenerateVertexData(), canBeRegenerated, mesh);
  21539. }
  21540. Ground.prototype._regenerateVertexData = function () {
  21541. return BABYLON.VertexData.CreateGround(this.width, this.height, this.subdivisions);
  21542. };
  21543. Ground.prototype.copy = function (id) {
  21544. return new Ground(id, this.getScene(), this.width, this.height, this.subdivisions, this.canBeRegenerated(), null);
  21545. };
  21546. return Ground;
  21547. })(_Primitive);
  21548. Primitives.Ground = Ground;
  21549. var TiledGround = (function (_super) {
  21550. __extends(TiledGround, _super);
  21551. function TiledGround(id, scene, xmin, zmin, xmax, zmax, subdivisions, precision, canBeRegenerated, mesh) {
  21552. this.xmin = xmin;
  21553. this.zmin = zmin;
  21554. this.xmax = xmax;
  21555. this.zmax = zmax;
  21556. this.subdivisions = subdivisions;
  21557. this.precision = precision;
  21558. _super.call(this, id, scene, this._regenerateVertexData(), canBeRegenerated, mesh);
  21559. }
  21560. TiledGround.prototype._regenerateVertexData = function () {
  21561. return BABYLON.VertexData.CreateTiledGround(this.xmin, this.zmin, this.xmax, this.zmax, this.subdivisions, this.precision);
  21562. };
  21563. TiledGround.prototype.copy = function (id) {
  21564. return new TiledGround(id, this.getScene(), this.xmin, this.zmin, this.xmax, this.zmax, this.subdivisions, this.precision, this.canBeRegenerated(), null);
  21565. };
  21566. return TiledGround;
  21567. })(_Primitive);
  21568. Primitives.TiledGround = TiledGround;
  21569. var Plane = (function (_super) {
  21570. __extends(Plane, _super);
  21571. function Plane(id, scene, size, canBeRegenerated, mesh) {
  21572. this.size = size;
  21573. _super.call(this, id, scene, this._regenerateVertexData(), canBeRegenerated, mesh);
  21574. }
  21575. Plane.prototype._regenerateVertexData = function () {
  21576. return BABYLON.VertexData.CreatePlane(this.size);
  21577. };
  21578. Plane.prototype.copy = function (id) {
  21579. return new Plane(id, this.getScene(), this.size, this.canBeRegenerated(), null);
  21580. };
  21581. return Plane;
  21582. })(_Primitive);
  21583. Primitives.Plane = Plane;
  21584. var TorusKnot = (function (_super) {
  21585. __extends(TorusKnot, _super);
  21586. function TorusKnot(id, scene, radius, tube, radialSegments, tubularSegments, p, q, canBeRegenerated, mesh) {
  21587. this.radius = radius;
  21588. this.tube = tube;
  21589. this.radialSegments = radialSegments;
  21590. this.tubularSegments = tubularSegments;
  21591. this.p = p;
  21592. this.q = q;
  21593. _super.call(this, id, scene, this._regenerateVertexData(), canBeRegenerated, mesh);
  21594. }
  21595. TorusKnot.prototype._regenerateVertexData = function () {
  21596. return BABYLON.VertexData.CreateTorusKnot(this.radius, this.tube, this.radialSegments, this.tubularSegments, this.p, this.q);
  21597. };
  21598. TorusKnot.prototype.copy = function (id) {
  21599. return new TorusKnot(id, this.getScene(), this.radius, this.tube, this.radialSegments, this.tubularSegments, this.p, this.q, this.canBeRegenerated(), null);
  21600. };
  21601. return TorusKnot;
  21602. })(_Primitive);
  21603. Primitives.TorusKnot = TorusKnot;
  21604. })(Geometry.Primitives || (Geometry.Primitives = {}));
  21605. var Primitives = Geometry.Primitives;
  21606. })(BABYLON.Geometry || (BABYLON.Geometry = {}));
  21607. var Geometry = BABYLON.Geometry;
  21608. })(BABYLON || (BABYLON = {}));
  21609. var __extends = this.__extends || function (d, b) {
  21610. for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p];
  21611. function __() { this.constructor = d; }
  21612. __.prototype = b.prototype;
  21613. d.prototype = new __();
  21614. };
  21615. var BABYLON;
  21616. (function (BABYLON) {
  21617. var Gamepads = (function () {
  21618. function Gamepads(ongamedpadconnected) {
  21619. var _this = this;
  21620. this.babylonGamepads = [];
  21621. this.oneGamepadConnected = false;
  21622. this.isMonitoring = false;
  21623. this.gamepadEventSupported = 'GamepadEvent' in window;
  21624. this.gamepadSupportAvailable = (navigator.getGamepads || !!navigator.webkitGetGamepads || !!navigator.msGetGamepads || !!navigator.webkitGamepads);
  21625. this.buttonADataURL = "data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAEAAAABACAYAAACqaXHeAAAABGdBTUEAAK/INwWK6QAAABl0RVh0U29mdHdhcmUAQWRvYmUgSW1hZ2VSZWFkeXHJZTwAAA9aSURBVHja7FtpbBzneX7m3otcihSpm9Z9UJalxPKhVLZlp6ktNzEaxE0CtAnQAgnSoPWPBi3syuiPwordFi5Qt2haFygCoylSV4Vby6os1I3kOLYrS65kXXQoypJJSaFEUTyXy925+rzfzC6HFFlL1kpAIe7i5czO7H7zPs97ft8MtTAMcSu/dNzirxkCZgiYIWCGgBkCZgi4hV/mDR5fSxAt+0ZiX0ucDxMSTJLK+f83BFSA6TFgK75OclshouKBFbA+xaV4k7Z+fD6sNRlmjYFXQMu4NiUVS/oHe5/ecnHo3MYxd7QthN9UcsdW6FqEPwgDOFbqpAajL2VlTrTULzj4Ow8+s4+nipSxWMoxIUkyrl/pGswFtIR7WzHgDCX77K7vfHNkbOA+AryjYZadb27OIJdzCNZBKmXw4kbk35qPsTEfJbeEkZESentHMdBfGtY142gu1bDvqV/925f4tQJlNCaj4hXX7RHXS0AFuJEAXvfHr/zmk67vPjir0V68aFEe8xtuQ6O1FHlrEXLmHBiaDUtzYBlpNYjrF+GFZfhhCcPeBQy53ehzT+H8QBe6uwfRf7l8xjKsvX/y5X98jl8fThDhJ4i46QQkrS5I6v7oX7/++77vPtLUlFnZtnIRlubvxRxnHbJmE79sxD/SqG0oZk8MFarRqufUkQAFrxcXSkfx0eB+nOggKX2jHYZhvf79r/z4L2IiipO84aYRkASfefnAX695p3P3c9mM/UufuaMVdzRvxVx7A0xaWdOMqVULJ6Z3TZv6KmHo0ztK6CkfxpHe3Th0pAuF0fLbn1u+9cmv3vW77bE3fGoSPi0BVfAvvPEHm9rPv//iooWz5m9Z/wCWZx+Go9UrN48QTD9IGMZ1cJIzTPisRQclPMrhME4W9mDfB2+i+2z/+TXz7/z2E7/85+9OIuGGE6BV3H77zm/d33nx6Ktr18zFg2t+DQude2n1tLJ8tcJ90vDhpG5Am7qTkJAQErywiLOld7G3/d9xvL0Hy1vWPbbtS3//00Q4hDeaAFXintrx1fu7+jp2r13bgofX/gaazbVkJQdLT9P6VqRFDSu2hIgXlBUBLgtCr3cce47/CMePX0Rr08qtzz7+8k8TpfKGtcKq1jPZre7oObyjdWkGd628l7AXwvMCeL7HjO6qrS8S1E5kTE9tfbiur665ccU9EB1EF9Ep0WXesEZIJb9j5/b/XUtzNrt29Rw0og2lchmBVqLo8LSAHlCixbTpddGm8Y7pjkttCCUP+JQy3FiatNuxdvUx9F4ayopO/OL9sQeEN4oA/eHn577oWPbGVes11PsrUBxjDafze1Te1VzouqnK2TgmLQljQqmrnAsT+iaPVb5b2co7EC+QhBgUeM1R1AcrsGp9Jy6+4W8U3fZ8r+e3EnOI2uaAX3l+zgNB4O9rW5/B8tY5WGo9BtOrJ4uMfUl+uj0B8HTmPXj8Pex86xVEnTDBBSE2r78fX9i09RPyZfT2A5ceIMSPwDOH8JH7Kk5+fAHtR0Zh6MZ9e7534Wc3wgO0sXLhD9OpFOa0egjGMhguD8BgTJooMfPbV1h/umz25ondcFP90IzY2iTgrfY9uH31aqSc9CeSEHkBEyITv28M8XMGc2/z0HGCpWCs8BS/9sWrDYOrJuCBZ+vu5sUfXbicia5kYGzUw4DWTwJKbApSjHuTBBjT2H68zg0MD4KlEwabZi0Y7wd85u/3O9/B6sVrPlEXeiF9nMmRxPt6Qf4y/HyIbh3HwkdF1zefGt5fUwK8wP2WAGwh02MFE/5ogYr3Qg/STL0W3d8aB1ppa+Pw0uI2Tz6/134Mg+UoIGZlZ2HMLaJYHkPICr6//RBamvPj/UA4dYKsegGrXqAXMaqNsDT6SreOY5Gu/FptCeBFN+caAphGiKFiGaOjA3AJHoGt6r7GgNbjqjo5yQkBUVHQ8PaJExjiaZ2yue12nO27gCNdHSptvf/xGdw11I2UZSmvCIJgQiJMhoEfeqpNDvUSRvUB5hMX9fUecg0aBi+Hm2uaAz633bmbm1VN8+h07LfKJdkOkQB2fL4BTlsj8No4YLG2putMSjwjp3QNvZdH8YsiExV501isFjU30lpF7D8dVfCA8sFHp7BuWYtaIwiCsCrCSDVhh9IX8k0CoHsoMQ84FrfFAE3zQAK0VaLzO9tK79XKAxSj+aYALt3XLfNipZD1v492YexrE/sP0zBgUIQIoYaflAXbz16CzyY6YKqYl8uheTarRioD7xAxCQHUpv18L1Yud+Iloujtk4zQo9WZcKURqjbHclzKvj0Gvcw8UA6oY2WqonSuGQGb5I+TJgEFEsB4daXzc0eopabcX13W0BXwgAnRZL4Q62s8ppnR/pFz/QjF+tRvxeIsY/cizGwRt83P4czACL8HdA1JUivCNGVogvdkNkgaGDNe4CvXFyJ8n+B5XGLJ1FmJXJ53AzjZKgGbatkKL5c/liNWIPO8uM/4VO2uKCQZjLmBqQAGJ4EmI8NMabDTOuyUobYXmPlCEpiqA1IkYdWSBpjpEDl6wsrF9aAjqHNOPXDyXAGprAknY5B0btOGGk/GlfE1taqofCNuuYNIJ+omOiZ1rpUHtEYWjkpWoP5EWV2sb5isA7aIQTHHxaIniNADui8PIs0Eb6SY/Z0UQc+j+mXYuoM7Vy/Age7zkBUyCZGLhRLSOYcWpfXFA1wPhqup8JNKq5UkKeoqSHxPLSoqnUQtw5ioc60IyE/VkOji8mYE2nZELNgCXLaOkGDFJBg4OzCMDEcxCfAzS1pQX5fHSNDLClLGwmwzls6vQ09hGFJYegdZ1hha2bqIBNelB5Qjog02TzpFNVEquYpMuTSYr/lcQPKPJHoRQ8W1GYO3lDgpO9pPWTEZEQGnuodg5Hyk66Lyd8fKOQQ6gqyWict7GeuWz8HQyWEFw+bB7ksF3Nk2V1nfpZTLQqSLslzXlDmHpsQ1osVoy/Solwf/GpdErpaAQUqjWxL2GWcWaSfAMIis7RBwiuCdtD1OgmNHBJCg7r4uZBnbdjaaq+3YewB+USYicY8juYPnMtloqdCjG3f39eO+3JKIAFadSiiZigBdgdcqItMxsmZbIbvUIKlzzQjoEgLGRjU2KTp8AjRCkzEnAG0mtQh8Ku0oAqok8JzP+Lw0MkB3jpKjKpapaL5WKZxafDdBqoC6O8LtyMAQhoZdzG7MwLU8FUYKPINcl+qimismRj26v2I71I3jDxfdpM41I6CTsmG4X0djKyc8RYu9t0Vl2QJbBJ5xFPiICJIg1hdhR3fs5HnWeldleZXABLA98b7Y5HtjkgwNEtbTN4iFC5oI3I1CTsAbsfVjAizJB3Qbx9HphRp6eqr3TDprSYA0FI/3ntOxbpUNM2OjpEcE6HYEWkhIKw+ICeBxi+T09F1WZU+iJq2n8fRDf4Ymu3XSrcOIgg8H9uOFn31fNUVC0oddZ7B5YxtDwlTgo66SEici2fokwCJjju0hw7J54WypQsB7tSRAza+H+nld30Y+m2b7SS+Qn9PKFl1egRciHIfWpxC8x+7tdA97+3zUcNyWX4Ci/THOoD2x/hmlQTox+3gDjWYeg/4gmF853xjBpUsjaGnJR24fu36FNzX5pmfY7EPStlSLIgb6gwk616QRYk8tS88/l/2PT/loyqbQkEmhPpNGNp1CmvtieQHvONGtL4sdy9Hjp5kkpTWmSzM7L529hErHs0cCpt2qW00BymDV3JXSU8HkAXKIjtNnedxS48m4Mr5cR9YlMrx+XTqNRmbP2ZkMOjvHKir/PNa5pouiitFjH44iZ6YwO5tFAy+eo6SdpOUJyhBQTJR+HT9HYLJaFve0PqQmTQLaVOCdmIRIWE+wrmWTzG8iAugF7qgWjSWkGbYa32EjJQTkGFv5dBZNJKCeHdb77UPXZP1rWhKLZ4Rqjv2Fz86lLMNlpusCY9BnqTNUIyTgrVhhs7rVq2KoW2TSxWlXLOCqWX4svmpzZdEjWvgQcdVWPnu+i4ClUS+HyLIFnsVf/9eBduw8eKYy2D1XMxO8Jg+IB9wl+3s/uAC3qKMpXY88m/ecnUHaSis3Na8Ab1UtaCh3j1y+sm8m9o0J+9Fv9MR4Zhw6DufTWasOebsOs+xZKHJOtvtQtertulrwV+0BtH5yWvyW7CxubsCTX9+KUQZ4ga7qmdGUFmrya8QWHwcxlReMF8Mw4QETrR8oy7tq2ivH5Tvya8n8aXZMGc4An/nRDpy52FfR8b5KCJCImt8YkYF/KDtnegfwz3sPodGajQajCTk9z/4mQ6iphMWv9AA9IeMWdyYdn+gBkVc5amwHWV6lHvVaI2YZzfinN95Ngv/htcT/p31CRNbdV8l8e++xD5HPNeHxhx5Bgf18kTN5T1kvjBfEjGjBJCai4gnjHqAnlvqS8e9NeujEjEul/NokDbai4V/2voafHD1S0evdWLeb8ojMNyly5fS//ffbcD0L33j4K4RX4rtMh/UUGLXmr6BWXN9MEFAhYfzmZ6hcXI+TpISRH8061Ui68gTWGUJP4aU9P8ZrB39S+Xkx1ummPSMkbebnJcxU1jm4D5eGhvB7j32HJcpUJHhxLIfxTZpxwGa8eKrHC51a9Tmp+N5P1RsQ01cJAwEflHw8/+pfYn/HgaQ+n7/a1vd6k+BUS2XvVD401TXhu488gQ0r71QUuLJsrWT8mSYtfkBMm0BAmFhNrgDX4oRqqeaJMw4c6TyIv/qPP0Xf8KUJ6sXuP1XluuEEyGsD5TXKgsqBNQvW4RtbnkDb4ttJQlGt/IQqLMJE7tWqOSBZCSrL6dFSqq3AnzhzDC/tewHt5w4nr3suvgN0+P8o3TeegFe3vYDHtj+xhLt/Q3kkeW5d693YuuHXsWHZPcixW4tCwo+trVU9QEs8G6HFqW5kdBiHTu3H64dfxpGuK8r665Tv7tz2D6e/tP23cT0E1OA5QR2iiIbs1i9u/9qTPPC12CtwlIofjZVvW/BZ3LVsC5bPW4u5DQuxaPay2NpRIuy61IkLA+dw8hdHceDUPpw49z9TXUysvWPXtl3bQ4yQtMJ1a18DAsbvRO/atvM5DXXPPbp9yzP8+GXBXTkngKYBdTWvE5RXdm87+HQEfLh2T57UIAdM95Js9+04LKSDbLzG31+Omxpx9xfxKR6AukkhMP0aKuUHsag5VEzE3fGSddsUVu6KFzIE+H/iJry0mX+bu8VfMwTMEDBDwAwBMwTMEHALv/5XgAEASpR5N6rB30UAAAAASUVORK5CYII=";
  21626. this._callbackGamepadConnected = ongamedpadconnected;
  21627. if (this.gamepadSupportAvailable) {
  21628. if (this.gamepadEventSupported) {
  21629. window.addEventListener('gamepadconnected', function (evt) {
  21630. _this._onGamepadConnected(evt);
  21631. }, false);
  21632. window.addEventListener('gamepaddisconnected', function (evt) {
  21633. _this._onGamepadDisconnected(evt);
  21634. }, false);
  21635. } else {
  21636. this._startMonitoringGamepads();
  21637. }
  21638. if (!this.oneGamepadConnected) {
  21639. this._insertGamepadDOMInstructions();
  21640. }
  21641. } else {
  21642. this._insertGamepadDOMNotSupported();
  21643. }
  21644. }
  21645. Gamepads.prototype._insertGamepadDOMInstructions = function () {
  21646. Gamepads.gamepadDOMInfo = document.createElement("div");
  21647. var buttonAImage = document.createElement("img");
  21648. buttonAImage.src = this.buttonADataURL;
  21649. var spanMessage = document.createElement("span");
  21650. spanMessage.innerHTML = "<strong>to activate gamepad</strong>";
  21651. Gamepads.gamepadDOMInfo.appendChild(buttonAImage);
  21652. Gamepads.gamepadDOMInfo.appendChild(spanMessage);
  21653. Gamepads.gamepadDOMInfo.style.position = "absolute";
  21654. Gamepads.gamepadDOMInfo.style.width = "100%";
  21655. Gamepads.gamepadDOMInfo.style.height = "48px";
  21656. Gamepads.gamepadDOMInfo.style.bottom = "0px";
  21657. Gamepads.gamepadDOMInfo.style.backgroundColor = "rgba(1, 1, 1, 0.15)";
  21658. Gamepads.gamepadDOMInfo.style.textAlign = "center";
  21659. Gamepads.gamepadDOMInfo.style.zIndex = "10";
  21660. buttonAImage.style.position = "relative";
  21661. buttonAImage.style.bottom = "8px";
  21662. spanMessage.style.position = "relative";
  21663. spanMessage.style.fontSize = "32px";
  21664. spanMessage.style.bottom = "32px";
  21665. spanMessage.style.color = "green";
  21666. document.body.appendChild(Gamepads.gamepadDOMInfo);
  21667. };
  21668. Gamepads.prototype._insertGamepadDOMNotSupported = function () {
  21669. Gamepads.gamepadDOMInfo = document.createElement("div");
  21670. var spanMessage = document.createElement("span");
  21671. spanMessage.innerHTML = "<strong>gamepad not supported</strong>";
  21672. Gamepads.gamepadDOMInfo.appendChild(spanMessage);
  21673. Gamepads.gamepadDOMInfo.style.position = "absolute";
  21674. Gamepads.gamepadDOMInfo.style.width = "100%";
  21675. Gamepads.gamepadDOMInfo.style.height = "40px";
  21676. Gamepads.gamepadDOMInfo.style.bottom = "0px";
  21677. Gamepads.gamepadDOMInfo.style.backgroundColor = "rgba(1, 1, 1, 0.15)";
  21678. Gamepads.gamepadDOMInfo.style.textAlign = "center";
  21679. Gamepads.gamepadDOMInfo.style.zIndex = "10";
  21680. spanMessage.style.position = "relative";
  21681. spanMessage.style.fontSize = "32px";
  21682. spanMessage.style.color = "red";
  21683. document.body.appendChild(Gamepads.gamepadDOMInfo);
  21684. };
  21685. Gamepads.prototype.dispose = function () {
  21686. document.body.removeChild(Gamepads.gamepadDOMInfo);
  21687. };
  21688. Gamepads.prototype._onGamepadConnected = function (evt) {
  21689. var newGamepad = this._addNewGamepad(evt.gamepad);
  21690. if (this._callbackGamepadConnected)
  21691. this._callbackGamepadConnected(newGamepad);
  21692. this._startMonitoringGamepads();
  21693. };
  21694. Gamepads.prototype._addNewGamepad = function (gamepad) {
  21695. if (!this.oneGamepadConnected) {
  21696. this.oneGamepadConnected = true;
  21697. if (Gamepads.gamepadDOMInfo) {
  21698. document.body.removeChild(Gamepads.gamepadDOMInfo);
  21699. Gamepads.gamepadDOMInfo = null;
  21700. }
  21701. }
  21702. var newGamepad;
  21703. if (gamepad.id.search("Xbox 360") !== -1 || gamepad.id.search("xinput") !== -1) {
  21704. newGamepad = new BABYLON.Xbox360Pad(gamepad.id, gamepad.index, gamepad);
  21705. } else {
  21706. newGamepad = new BABYLON.GenericPad(gamepad.id, gamepad.index, gamepad);
  21707. }
  21708. this.babylonGamepads.push(newGamepad);
  21709. return newGamepad;
  21710. };
  21711. Gamepads.prototype._onGamepadDisconnected = function (evt) {
  21712. for (var i in this.babylonGamepads) {
  21713. if (this.babylonGamepads[i].index == evt.gamepad.index) {
  21714. this.babylonGamepads.splice(i, 1);
  21715. break;
  21716. }
  21717. }
  21718. if (this.babylonGamepads.length == 0) {
  21719. this._stopMonitoringGamepads();
  21720. }
  21721. };
  21722. Gamepads.prototype._startMonitoringGamepads = function () {
  21723. if (!this.isMonitoring) {
  21724. this.isMonitoring = true;
  21725. this._checkGamepadsStatus();
  21726. }
  21727. };
  21728. Gamepads.prototype._stopMonitoringGamepads = function () {
  21729. this.isMonitoring = false;
  21730. };
  21731. Gamepads.prototype._checkGamepadsStatus = function () {
  21732. var _this = this;
  21733. this._updateGamepadObjects();
  21734. for (var i in this.babylonGamepads) {
  21735. this.babylonGamepads[i].update();
  21736. }
  21737. if (this.isMonitoring) {
  21738. if (window.requestAnimationFrame) {
  21739. window.requestAnimationFrame(function () {
  21740. _this._checkGamepadsStatus();
  21741. });
  21742. } else if (window.mozRequestAnimationFrame) {
  21743. window.mozRequestAnimationFrame(function () {
  21744. _this._checkGamepadsStatus();
  21745. });
  21746. } else if (window.webkitRequestAnimationFrame) {
  21747. window.webkitRequestAnimationFrame(function () {
  21748. _this._checkGamepadsStatus();
  21749. });
  21750. }
  21751. }
  21752. };
  21753. Gamepads.prototype._updateGamepadObjects = function () {
  21754. var gamepads = navigator.getGamepads ? navigator.getGamepads() : (navigator.webkitGetGamepads ? navigator.webkitGetGamepads() : []);
  21755. for (var i = 0; i < gamepads.length; i++) {
  21756. if (gamepads[i]) {
  21757. if (!(gamepads[i].index in this.babylonGamepads)) {
  21758. var newGamepad = this._addNewGamepad(gamepads[i]);
  21759. if (this._callbackGamepadConnected) {
  21760. this._callbackGamepadConnected(newGamepad);
  21761. }
  21762. } else {
  21763. this.babylonGamepads[i].browserGamepad = gamepads[i];
  21764. }
  21765. }
  21766. }
  21767. };
  21768. return Gamepads;
  21769. })();
  21770. BABYLON.Gamepads = Gamepads;
  21771. var StickValues = (function () {
  21772. function StickValues(x, y) {
  21773. this.x = x;
  21774. this.y = y;
  21775. }
  21776. return StickValues;
  21777. })();
  21778. BABYLON.StickValues = StickValues;
  21779. var Gamepad = (function () {
  21780. function Gamepad(id, index, browserGamepad) {
  21781. this.id = id;
  21782. this.index = index;
  21783. this.browserGamepad = browserGamepad;
  21784. if (this.browserGamepad.axes.length >= 2) {
  21785. this._leftStick = { x: this.browserGamepad.axes[0], y: this.browserGamepad.axes[1] };
  21786. }
  21787. if (this.browserGamepad.axes.length >= 4) {
  21788. this._rightStick = { x: this.browserGamepad.axes[2], y: this.browserGamepad.axes[3] };
  21789. }
  21790. }
  21791. Gamepad.prototype.onleftstickchanged = function (callback) {
  21792. this._onleftstickchanged = callback;
  21793. };
  21794. Gamepad.prototype.onrightstickchanged = function (callback) {
  21795. this._onrightstickchanged = callback;
  21796. };
  21797. Object.defineProperty(Gamepad.prototype, "leftStick", {
  21798. get: function () {
  21799. return this._leftStick;
  21800. },
  21801. set: function (newValues) {
  21802. if (this._onleftstickchanged && (this._leftStick.x !== newValues.x || this._leftStick.y !== newValues.y)) {
  21803. this._onleftstickchanged(newValues);
  21804. }
  21805. this._leftStick = newValues;
  21806. },
  21807. enumerable: true,
  21808. configurable: true
  21809. });
  21810. Object.defineProperty(Gamepad.prototype, "rightStick", {
  21811. get: function () {
  21812. return this._rightStick;
  21813. },
  21814. set: function (newValues) {
  21815. if (this._onrightstickchanged && (this._rightStick.x !== newValues.x || this._rightStick.y !== newValues.y)) {
  21816. this._onrightstickchanged(newValues);
  21817. }
  21818. this._rightStick = newValues;
  21819. },
  21820. enumerable: true,
  21821. configurable: true
  21822. });
  21823. Gamepad.prototype.update = function () {
  21824. if (this._leftStick) {
  21825. this.leftStick = { x: this.browserGamepad.axes[0], y: this.browserGamepad.axes[1] };
  21826. }
  21827. if (this._rightStick) {
  21828. this.rightStick = { x: this.browserGamepad.axes[2], y: this.browserGamepad.axes[3] };
  21829. }
  21830. };
  21831. return Gamepad;
  21832. })();
  21833. BABYLON.Gamepad = Gamepad;
  21834. var GenericPad = (function (_super) {
  21835. __extends(GenericPad, _super);
  21836. function GenericPad(id, index, gamepad) {
  21837. _super.call(this, id, index, gamepad);
  21838. this.id = id;
  21839. this.index = index;
  21840. this.gamepad = gamepad;
  21841. this._buttons = new Array(gamepad.buttons.length);
  21842. }
  21843. GenericPad.prototype.onbuttondown = function (callback) {
  21844. this._onbuttondown = callback;
  21845. };
  21846. GenericPad.prototype.onbuttonup = function (callback) {
  21847. this._onbuttonup = callback;
  21848. };
  21849. GenericPad.prototype._setButtonValue = function (newValue, currentValue, buttonIndex) {
  21850. if (newValue !== currentValue) {
  21851. if (this._onbuttondown && newValue === 1) {
  21852. this._onbuttondown(buttonIndex);
  21853. }
  21854. if (this._onbuttonup && newValue === 0) {
  21855. this._onbuttonup(buttonIndex);
  21856. }
  21857. }
  21858. return newValue;
  21859. };
  21860. GenericPad.prototype.update = function () {
  21861. _super.prototype.update.call(this);
  21862. for (var index = 0; index < this._buttons.length; index++) {
  21863. this._buttons[index] = this._setButtonValue(this.gamepad.buttons[index].value, this._buttons[index], index);
  21864. }
  21865. };
  21866. return GenericPad;
  21867. })(Gamepad);
  21868. BABYLON.GenericPad = GenericPad;
  21869. (function (Xbox360Button) {
  21870. Xbox360Button[Xbox360Button["A"] = 0] = "A";
  21871. Xbox360Button[Xbox360Button["B"] = 1] = "B";
  21872. Xbox360Button[Xbox360Button["X"] = 2] = "X";
  21873. Xbox360Button[Xbox360Button["Y"] = 3] = "Y";
  21874. Xbox360Button[Xbox360Button["Start"] = 4] = "Start";
  21875. Xbox360Button[Xbox360Button["Back"] = 5] = "Back";
  21876. Xbox360Button[Xbox360Button["LB"] = 6] = "LB";
  21877. Xbox360Button[Xbox360Button["RB"] = 7] = "RB";
  21878. Xbox360Button[Xbox360Button["LeftStick"] = 8] = "LeftStick";
  21879. Xbox360Button[Xbox360Button["RightStick"] = 9] = "RightStick";
  21880. })(BABYLON.Xbox360Button || (BABYLON.Xbox360Button = {}));
  21881. var Xbox360Button = BABYLON.Xbox360Button;
  21882. (function (Xbox360Dpad) {
  21883. Xbox360Dpad[Xbox360Dpad["Up"] = 0] = "Up";
  21884. Xbox360Dpad[Xbox360Dpad["Down"] = 1] = "Down";
  21885. Xbox360Dpad[Xbox360Dpad["Left"] = 2] = "Left";
  21886. Xbox360Dpad[Xbox360Dpad["Right"] = 3] = "Right";
  21887. })(BABYLON.Xbox360Dpad || (BABYLON.Xbox360Dpad = {}));
  21888. var Xbox360Dpad = BABYLON.Xbox360Dpad;
  21889. var Xbox360Pad = (function (_super) {
  21890. __extends(Xbox360Pad, _super);
  21891. function Xbox360Pad() {
  21892. _super.apply(this, arguments);
  21893. this._leftTrigger = 0;
  21894. this._rightTrigger = 0;
  21895. this._buttonA = 0;
  21896. this._buttonB = 0;
  21897. this._buttonX = 0;
  21898. this._buttonY = 0;
  21899. this._buttonBack = 0;
  21900. this._buttonStart = 0;
  21901. this._buttonLB = 0;
  21902. this._buttonRB = 0;
  21903. this._buttonLeftStick = 0;
  21904. this._buttonRightStick = 0;
  21905. this._dPadUp = 0;
  21906. this._dPadDown = 0;
  21907. this._dPadLeft = 0;
  21908. this._dPadRight = 0;
  21909. }
  21910. Xbox360Pad.prototype.onlefttriggerchanged = function (callback) {
  21911. this._onlefttriggerchanged = callback;
  21912. };
  21913. Xbox360Pad.prototype.onrighttriggerchanged = function (callback) {
  21914. this._onrighttriggerchanged = callback;
  21915. };
  21916. Object.defineProperty(Xbox360Pad.prototype, "leftTrigger", {
  21917. get: function () {
  21918. return this._leftTrigger;
  21919. },
  21920. set: function (newValue) {
  21921. if (this._onlefttriggerchanged && this._leftTrigger !== newValue) {
  21922. this._onlefttriggerchanged(newValue);
  21923. }
  21924. this._leftTrigger = newValue;
  21925. },
  21926. enumerable: true,
  21927. configurable: true
  21928. });
  21929. Object.defineProperty(Xbox360Pad.prototype, "rightTrigger", {
  21930. get: function () {
  21931. return this._rightTrigger;
  21932. },
  21933. set: function (newValue) {
  21934. if (this._onrighttriggerchanged && this._rightTrigger !== newValue) {
  21935. this._onrighttriggerchanged(newValue);
  21936. }
  21937. this._rightTrigger = newValue;
  21938. },
  21939. enumerable: true,
  21940. configurable: true
  21941. });
  21942. Xbox360Pad.prototype.onbuttondown = function (callback) {
  21943. this._onbuttondown = callback;
  21944. };
  21945. Xbox360Pad.prototype.onbuttonup = function (callback) {
  21946. this._onbuttonup = callback;
  21947. };
  21948. Xbox360Pad.prototype.ondpaddown = function (callback) {
  21949. this._ondpaddown = callback;
  21950. };
  21951. Xbox360Pad.prototype.ondpadup = function (callback) {
  21952. this._ondpadup = callback;
  21953. };
  21954. Xbox360Pad.prototype._setButtonValue = function (newValue, currentValue, buttonType) {
  21955. if (newValue !== currentValue) {
  21956. if (this._onbuttondown && newValue === 1) {
  21957. this._onbuttondown(buttonType);
  21958. }
  21959. if (this._onbuttonup && newValue === 0) {
  21960. this._onbuttonup(buttonType);
  21961. }
  21962. }
  21963. return newValue;
  21964. };
  21965. Xbox360Pad.prototype._setDPadValue = function (newValue, currentValue, buttonType) {
  21966. if (newValue !== currentValue) {
  21967. if (this._ondpaddown && newValue === 1) {
  21968. this._ondpaddown(buttonType);
  21969. }
  21970. if (this._ondpadup && newValue === 0) {
  21971. this._ondpadup(buttonType);
  21972. }
  21973. }
  21974. return newValue;
  21975. };
  21976. Object.defineProperty(Xbox360Pad.prototype, "buttonA", {
  21977. get: function () {
  21978. return this._buttonA;
  21979. },
  21980. set: function (value) {
  21981. this._buttonA = this._setButtonValue(value, this._buttonA, 0 /* A */);
  21982. },
  21983. enumerable: true,
  21984. configurable: true
  21985. });
  21986. Object.defineProperty(Xbox360Pad.prototype, "buttonB", {
  21987. get: function () {
  21988. return this._buttonB;
  21989. },
  21990. set: function (value) {
  21991. this._buttonB = this._setButtonValue(value, this._buttonB, 1 /* B */);
  21992. },
  21993. enumerable: true,
  21994. configurable: true
  21995. });
  21996. Object.defineProperty(Xbox360Pad.prototype, "buttonX", {
  21997. get: function () {
  21998. return this._buttonX;
  21999. },
  22000. set: function (value) {
  22001. this._buttonX = this._setButtonValue(value, this._buttonX, 2 /* X */);
  22002. },
  22003. enumerable: true,
  22004. configurable: true
  22005. });
  22006. Object.defineProperty(Xbox360Pad.prototype, "buttonY", {
  22007. get: function () {
  22008. return this._buttonY;
  22009. },
  22010. set: function (value) {
  22011. this._buttonY = this._setButtonValue(value, this._buttonY, 3 /* Y */);
  22012. },
  22013. enumerable: true,
  22014. configurable: true
  22015. });
  22016. Object.defineProperty(Xbox360Pad.prototype, "buttonStart", {
  22017. get: function () {
  22018. return this._buttonStart;
  22019. },
  22020. set: function (value) {
  22021. this._buttonStart = this._setButtonValue(value, this._buttonStart, 4 /* Start */);
  22022. },
  22023. enumerable: true,
  22024. configurable: true
  22025. });
  22026. Object.defineProperty(Xbox360Pad.prototype, "buttonBack", {
  22027. get: function () {
  22028. return this._buttonBack;
  22029. },
  22030. set: function (value) {
  22031. this._buttonBack = this._setButtonValue(value, this._buttonBack, 5 /* Back */);
  22032. },
  22033. enumerable: true,
  22034. configurable: true
  22035. });
  22036. Object.defineProperty(Xbox360Pad.prototype, "buttonLB", {
  22037. get: function () {
  22038. return this._buttonLB;
  22039. },
  22040. set: function (value) {
  22041. this._buttonLB = this._setButtonValue(value, this._buttonLB, 6 /* LB */);
  22042. },
  22043. enumerable: true,
  22044. configurable: true
  22045. });
  22046. Object.defineProperty(Xbox360Pad.prototype, "buttonRB", {
  22047. get: function () {
  22048. return this._buttonRB;
  22049. },
  22050. set: function (value) {
  22051. this._buttonRB = this._setButtonValue(value, this._buttonRB, 7 /* RB */);
  22052. },
  22053. enumerable: true,
  22054. configurable: true
  22055. });
  22056. Object.defineProperty(Xbox360Pad.prototype, "buttonLeftStick", {
  22057. get: function () {
  22058. return this._buttonLeftStick;
  22059. },
  22060. set: function (value) {
  22061. this._buttonLeftStick = this._setButtonValue(value, this._buttonLeftStick, 8 /* LeftStick */);
  22062. },
  22063. enumerable: true,
  22064. configurable: true
  22065. });
  22066. Object.defineProperty(Xbox360Pad.prototype, "buttonRightStick", {
  22067. get: function () {
  22068. return this._buttonRightStick;
  22069. },
  22070. set: function (value) {
  22071. this._buttonRightStick = this._setButtonValue(value, this._buttonRightStick, 9 /* RightStick */);
  22072. },
  22073. enumerable: true,
  22074. configurable: true
  22075. });
  22076. Object.defineProperty(Xbox360Pad.prototype, "dPadUp", {
  22077. get: function () {
  22078. return this._dPadUp;
  22079. },
  22080. set: function (value) {
  22081. this._dPadUp = this._setDPadValue(value, this._dPadUp, 0 /* Up */);
  22082. },
  22083. enumerable: true,
  22084. configurable: true
  22085. });
  22086. Object.defineProperty(Xbox360Pad.prototype, "dPadDown", {
  22087. get: function () {
  22088. return this._dPadDown;
  22089. },
  22090. set: function (value) {
  22091. this._dPadDown = this._setDPadValue(value, this._dPadDown, 1 /* Down */);
  22092. },
  22093. enumerable: true,
  22094. configurable: true
  22095. });
  22096. Object.defineProperty(Xbox360Pad.prototype, "dPadLeft", {
  22097. get: function () {
  22098. return this._dPadLeft;
  22099. },
  22100. set: function (value) {
  22101. this._dPadLeft = this._setDPadValue(value, this._dPadLeft, 2 /* Left */);
  22102. },
  22103. enumerable: true,
  22104. configurable: true
  22105. });
  22106. Object.defineProperty(Xbox360Pad.prototype, "dPadRight", {
  22107. get: function () {
  22108. return this._dPadRight;
  22109. },
  22110. set: function (value) {
  22111. this._dPadRight = this._setDPadValue(value, this._dPadRight, 3 /* Right */);
  22112. },
  22113. enumerable: true,
  22114. configurable: true
  22115. });
  22116. Xbox360Pad.prototype.update = function () {
  22117. _super.prototype.update.call(this);
  22118. this.buttonA = this.browserGamepad.buttons[0].value;
  22119. this.buttonB = this.browserGamepad.buttons[1].value;
  22120. this.buttonX = this.browserGamepad.buttons[2].value;
  22121. this.buttonY = this.browserGamepad.buttons[3].value;
  22122. this.buttonLB = this.browserGamepad.buttons[4].value;
  22123. this.buttonRB = this.browserGamepad.buttons[5].value;
  22124. this.leftTrigger = this.browserGamepad.buttons[6].value;
  22125. this.rightTrigger = this.browserGamepad.buttons[7].value;
  22126. this.buttonBack = this.browserGamepad.buttons[8].value;
  22127. this.buttonStart = this.browserGamepad.buttons[9].value;
  22128. this.buttonLeftStick = this.browserGamepad.buttons[10].value;
  22129. this.buttonRightStick = this.browserGamepad.buttons[11].value;
  22130. this.dPadUp = this.browserGamepad.buttons[12].value;
  22131. this.dPadDown = this.browserGamepad.buttons[13].value;
  22132. this.dPadLeft = this.browserGamepad.buttons[14].value;
  22133. this.dPadRight = this.browserGamepad.buttons[15].value;
  22134. };
  22135. return Xbox360Pad;
  22136. })(Gamepad);
  22137. BABYLON.Xbox360Pad = Xbox360Pad;
  22138. })(BABYLON || (BABYLON = {}));
  22139. var __extends = this.__extends || function (d, b) {
  22140. for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p];
  22141. function __() { this.constructor = d; }
  22142. __.prototype = b.prototype;
  22143. d.prototype = new __();
  22144. };
  22145. var BABYLON;
  22146. (function (BABYLON) {
  22147. var GamepadCamera = (function (_super) {
  22148. __extends(GamepadCamera, _super);
  22149. function GamepadCamera(name, position, scene) {
  22150. var _this = this;
  22151. _super.call(this, name, position, scene);
  22152. this.angularSensibility = 200;
  22153. this.moveSensibility = 75;
  22154. this._gamepads = new BABYLON.Gamepads(function (gamepad) {
  22155. _this._onNewGameConnected(gamepad);
  22156. });
  22157. }
  22158. GamepadCamera.prototype._onNewGameConnected = function (gamepad) {
  22159. if (gamepad.index === 0) {
  22160. this._gamepad = gamepad;
  22161. }
  22162. };
  22163. GamepadCamera.prototype._checkInputs = function () {
  22164. if (!this._gamepad) {
  22165. return;
  22166. }
  22167. var LSValues = this._gamepad.leftStick;
  22168. var normalizedLX = LSValues.x / this.moveSensibility;
  22169. var normalizedLY = LSValues.y / this.moveSensibility;
  22170. LSValues.x = Math.abs(normalizedLX) > 0.005 ? 0 + normalizedLX : 0;
  22171. LSValues.y = Math.abs(normalizedLY) > 0.005 ? 0 + normalizedLY : 0;
  22172. var RSValues = this._gamepad.rightStick;
  22173. var normalizedRX = RSValues.x / this.angularSensibility;
  22174. var normalizedRY = RSValues.y / this.angularSensibility;
  22175. RSValues.x = Math.abs(normalizedRX) > 0.001 ? 0 + normalizedRX : 0;
  22176. RSValues.y = Math.abs(normalizedRY) > 0.001 ? 0 + normalizedRY : 0;
  22177. ;
  22178. var cameraTransform = BABYLON.Matrix.RotationYawPitchRoll(this.rotation.y, this.rotation.x, 0);
  22179. var deltaTransform = BABYLON.Vector3.TransformCoordinates(new BABYLON.Vector3(LSValues.x, 0, -LSValues.y), cameraTransform);
  22180. this.cameraDirection = this.cameraDirection.add(deltaTransform);
  22181. this.cameraRotation = this.cameraRotation.add(new BABYLON.Vector2(RSValues.y, RSValues.x));
  22182. };
  22183. GamepadCamera.prototype.dispose = function () {
  22184. this._gamepads.dispose();
  22185. _super.prototype.dispose.call(this);
  22186. };
  22187. return GamepadCamera;
  22188. })(BABYLON.FreeCamera);
  22189. BABYLON.GamepadCamera = GamepadCamera;
  22190. })(BABYLON || (BABYLON = {}));
  22191. var __extends = this.__extends || function (d, b) {
  22192. for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p];
  22193. function __() { this.constructor = d; }
  22194. __.prototype = b.prototype;
  22195. d.prototype = new __();
  22196. };
  22197. var BABYLON;
  22198. (function (BABYLON) {
  22199. var LinesMesh = (function (_super) {
  22200. __extends(LinesMesh, _super);
  22201. function LinesMesh(name, scene, updatable) {
  22202. if (typeof updatable === "undefined") { updatable = false; }
  22203. _super.call(this, name, scene);
  22204. this.color = new BABYLON.Color3(1, 1, 1);
  22205. this.alpha = 1;
  22206. this._indices = new Array();
  22207. this._colorShader = new BABYLON.ShaderMaterial("colorShader", scene, "color", {
  22208. attributes: ["position"],
  22209. uniforms: ["worldViewProjection", "color"],
  22210. needAlphaBlending: true
  22211. });
  22212. }
  22213. Object.defineProperty(LinesMesh.prototype, "material", {
  22214. get: function () {
  22215. return this._colorShader;
  22216. },
  22217. enumerable: true,
  22218. configurable: true
  22219. });
  22220. Object.defineProperty(LinesMesh.prototype, "isPickable", {
  22221. get: function () {
  22222. return false;
  22223. },
  22224. enumerable: true,
  22225. configurable: true
  22226. });
  22227. Object.defineProperty(LinesMesh.prototype, "checkCollisions", {
  22228. get: function () {
  22229. return false;
  22230. },
  22231. enumerable: true,
  22232. configurable: true
  22233. });
  22234. LinesMesh.prototype._bind = function (subMesh, effect, fillMode) {
  22235. var engine = this.getScene().getEngine();
  22236. var indexToBind = this._geometry.getIndexBuffer();
  22237. engine.bindBuffers(this._geometry.getVertexBuffer(BABYLON.VertexBuffer.PositionKind).getBuffer(), indexToBind, [3], 3 * 4, this._colorShader.getEffect());
  22238. this._colorShader.setColor4("color", this.color.toColor4(this.alpha));
  22239. };
  22240. LinesMesh.prototype._draw = function (subMesh, fillMode, instancesCount) {
  22241. if (!this._geometry || !this._geometry.getVertexBuffers() || !this._geometry.getIndexBuffer()) {
  22242. return;
  22243. }
  22244. var engine = this.getScene().getEngine();
  22245. engine.draw(false, subMesh.indexStart, subMesh.indexCount);
  22246. };
  22247. LinesMesh.prototype.intersects = function (ray, fastCheck) {
  22248. return null;
  22249. };
  22250. LinesMesh.prototype.dispose = function (doNotRecurse) {
  22251. this._colorShader.dispose();
  22252. _super.prototype.dispose.call(this, doNotRecurse);
  22253. };
  22254. return LinesMesh;
  22255. })(BABYLON.Mesh);
  22256. BABYLON.LinesMesh = LinesMesh;
  22257. })(BABYLON || (BABYLON = {}));
  22258. var BABYLON;
  22259. (function (BABYLON) {
  22260. var OutlineRenderer = (function () {
  22261. function OutlineRenderer(scene) {
  22262. this._scene = scene;
  22263. }
  22264. OutlineRenderer.prototype.render = function (subMesh, batch, useOverlay) {
  22265. if (typeof useOverlay === "undefined") { useOverlay = false; }
  22266. var scene = this._scene;
  22267. var engine = this._scene.getEngine();
  22268. var hardwareInstancedRendering = (engine.getCaps().instancedArrays !== null) && (batch.visibleInstances[subMesh._id] !== null) && (batch.visibleInstances[subMesh._id] !== undefined);
  22269. if (!this.isReady(subMesh, hardwareInstancedRendering)) {
  22270. return;
  22271. }
  22272. var mesh = subMesh.getRenderingMesh();
  22273. var material = subMesh.getMaterial();
  22274. engine.enableEffect(this._effect);
  22275. this._effect.setFloat("offset", useOverlay ? 0 : mesh.outlineWidth);
  22276. this._effect.setColor4("color", useOverlay ? mesh.overlayColor : mesh.outlineColor, useOverlay ? mesh.overlayAlpha : 1.0);
  22277. this._effect.setMatrix("viewProjection", scene.getTransformMatrix());
  22278. var useBones = mesh.skeleton && mesh.isVerticesDataPresent(BABYLON.VertexBuffer.MatricesIndicesKind) && mesh.isVerticesDataPresent(BABYLON.VertexBuffer.MatricesWeightsKind);
  22279. if (useBones) {
  22280. this._effect.setMatrices("mBones", mesh.skeleton.getTransformMatrices());
  22281. }
  22282. mesh._bind(subMesh, this._effect, BABYLON.Material.TriangleFillMode);
  22283. if (material && material.needAlphaTesting()) {
  22284. var alphaTexture = material.getAlphaTestTexture();
  22285. this._effect.setTexture("diffuseSampler", alphaTexture);
  22286. this._effect.setMatrix("diffuseMatrix", alphaTexture.getTextureMatrix());
  22287. }
  22288. if (hardwareInstancedRendering) {
  22289. mesh._renderWithInstances(subMesh, BABYLON.Material.TriangleFillMode, batch, this._effect, engine);
  22290. } else {
  22291. if (batch.renderSelf[subMesh._id]) {
  22292. this._effect.setMatrix("world", mesh.getWorldMatrix());
  22293. mesh._draw(subMesh, BABYLON.Material.TriangleFillMode);
  22294. }
  22295. if (batch.visibleInstances[subMesh._id]) {
  22296. for (var instanceIndex = 0; instanceIndex < batch.visibleInstances[subMesh._id].length; instanceIndex++) {
  22297. var instance = batch.visibleInstances[subMesh._id][instanceIndex];
  22298. this._effect.setMatrix("world", instance.getWorldMatrix());
  22299. mesh._draw(subMesh, BABYLON.Material.TriangleFillMode);
  22300. }
  22301. }
  22302. }
  22303. };
  22304. OutlineRenderer.prototype.isReady = function (subMesh, useInstances) {
  22305. var defines = [];
  22306. var attribs = [BABYLON.VertexBuffer.PositionKind, BABYLON.VertexBuffer.NormalKind];
  22307. var mesh = subMesh.getMesh();
  22308. var material = subMesh.getMaterial();
  22309. if (material && material.needAlphaTesting()) {
  22310. defines.push("#define ALPHATEST");
  22311. if (mesh.isVerticesDataPresent(BABYLON.VertexBuffer.UVKind)) {
  22312. attribs.push(BABYLON.VertexBuffer.UVKind);
  22313. defines.push("#define UV1");
  22314. }
  22315. if (mesh.isVerticesDataPresent(BABYLON.VertexBuffer.UV2Kind)) {
  22316. attribs.push(BABYLON.VertexBuffer.UV2Kind);
  22317. defines.push("#define UV2");
  22318. }
  22319. }
  22320. if (mesh.skeleton && mesh.isVerticesDataPresent(BABYLON.VertexBuffer.MatricesIndicesKind) && mesh.isVerticesDataPresent(BABYLON.VertexBuffer.MatricesWeightsKind)) {
  22321. attribs.push(BABYLON.VertexBuffer.MatricesIndicesKind);
  22322. attribs.push(BABYLON.VertexBuffer.MatricesWeightsKind);
  22323. defines.push("#define BONES");
  22324. defines.push("#define BonesPerMesh " + (mesh.skeleton.bones.length + 1));
  22325. }
  22326. if (useInstances) {
  22327. defines.push("#define INSTANCES");
  22328. attribs.push("world0");
  22329. attribs.push("world1");
  22330. attribs.push("world2");
  22331. attribs.push("world3");
  22332. }
  22333. var join = defines.join("\n");
  22334. if (this._cachedDefines != join) {
  22335. this._cachedDefines = join;
  22336. this._effect = this._scene.getEngine().createEffect("outline", attribs, ["world", "mBones", "viewProjection", "diffuseMatrix", "offset", "color"], ["diffuseSampler"], join);
  22337. }
  22338. return this._effect.isReady();
  22339. };
  22340. return OutlineRenderer;
  22341. })();
  22342. BABYLON.OutlineRenderer = OutlineRenderer;
  22343. })(BABYLON || (BABYLON = {}));
  22344. var BABYLON;
  22345. (function (BABYLON) {
  22346. var MeshAssetTask = (function () {
  22347. function MeshAssetTask(name, meshesNames, rootUrl, sceneFilename) {
  22348. this.name = name;
  22349. this.meshesNames = meshesNames;
  22350. this.rootUrl = rootUrl;
  22351. this.sceneFilename = sceneFilename;
  22352. this.isCompleted = false;
  22353. }
  22354. MeshAssetTask.prototype.run = function (scene, onSuccess, onError) {
  22355. var _this = this;
  22356. BABYLON.SceneLoader.ImportMesh(this.meshesNames, this.rootUrl, this.sceneFilename, scene, function (meshes, particleSystems, skeletons) {
  22357. _this.loadedMeshes = meshes;
  22358. _this.loadedParticleSystems = particleSystems;
  22359. _this.loadedSkeletons = skeletons;
  22360. _this.isCompleted = true;
  22361. if (_this.onSuccess) {
  22362. _this.onSuccess(_this);
  22363. }
  22364. onSuccess();
  22365. }, null, function () {
  22366. if (_this.onError) {
  22367. _this.onError(_this);
  22368. }
  22369. onError();
  22370. });
  22371. };
  22372. return MeshAssetTask;
  22373. })();
  22374. BABYLON.MeshAssetTask = MeshAssetTask;
  22375. var TextFileAssetTask = (function () {
  22376. function TextFileAssetTask(name, url) {
  22377. this.name = name;
  22378. this.url = url;
  22379. this.isCompleted = false;
  22380. }
  22381. TextFileAssetTask.prototype.run = function (scene, onSuccess, onError) {
  22382. var _this = this;
  22383. BABYLON.Tools.LoadFile(this.url, function (data) {
  22384. _this.text = data;
  22385. _this.isCompleted = true;
  22386. if (_this.onSuccess) {
  22387. _this.onSuccess(_this);
  22388. }
  22389. onSuccess();
  22390. }, null, scene.database, false, function () {
  22391. if (_this.onError) {
  22392. _this.onError(_this);
  22393. }
  22394. onError();
  22395. });
  22396. };
  22397. return TextFileAssetTask;
  22398. })();
  22399. BABYLON.TextFileAssetTask = TextFileAssetTask;
  22400. var BinaryFileAssetTask = (function () {
  22401. function BinaryFileAssetTask(name, url) {
  22402. this.name = name;
  22403. this.url = url;
  22404. this.isCompleted = false;
  22405. }
  22406. BinaryFileAssetTask.prototype.run = function (scene, onSuccess, onError) {
  22407. var _this = this;
  22408. BABYLON.Tools.LoadFile(this.url, function (data) {
  22409. _this.data = data;
  22410. _this.isCompleted = true;
  22411. if (_this.onSuccess) {
  22412. _this.onSuccess(_this);
  22413. }
  22414. onSuccess();
  22415. }, null, scene.database, true, function () {
  22416. if (_this.onError) {
  22417. _this.onError(_this);
  22418. }
  22419. onError();
  22420. });
  22421. };
  22422. return BinaryFileAssetTask;
  22423. })();
  22424. BABYLON.BinaryFileAssetTask = BinaryFileAssetTask;
  22425. var ImageAssetTask = (function () {
  22426. function ImageAssetTask(name, url) {
  22427. this.name = name;
  22428. this.url = url;
  22429. this.isCompleted = false;
  22430. }
  22431. ImageAssetTask.prototype.run = function (scene, onSuccess, onError) {
  22432. var _this = this;
  22433. var img = new Image();
  22434. img.onload = function () {
  22435. _this.image = img;
  22436. _this.isCompleted = true;
  22437. if (_this.onSuccess) {
  22438. _this.onSuccess(_this);
  22439. }
  22440. onSuccess();
  22441. };
  22442. img.onerror = function () {
  22443. if (_this.onError) {
  22444. _this.onError(_this);
  22445. }
  22446. onError();
  22447. };
  22448. img.src = this.url;
  22449. };
  22450. return ImageAssetTask;
  22451. })();
  22452. BABYLON.ImageAssetTask = ImageAssetTask;
  22453. var TextureAssetTask = (function () {
  22454. function TextureAssetTask(name, url, noMipmap, invertY, samplingMode) {
  22455. if (typeof samplingMode === "undefined") { samplingMode = BABYLON.Texture.TRILINEAR_SAMPLINGMODE; }
  22456. this.name = name;
  22457. this.url = url;
  22458. this.noMipmap = noMipmap;
  22459. this.invertY = invertY;
  22460. this.samplingMode = samplingMode;
  22461. this.isCompleted = false;
  22462. }
  22463. TextureAssetTask.prototype.run = function (scene, onSuccess, onError) {
  22464. var _this = this;
  22465. var onload = function () {
  22466. _this.isCompleted = true;
  22467. if (_this.onSuccess) {
  22468. _this.onSuccess(_this);
  22469. }
  22470. onSuccess();
  22471. };
  22472. var onerror = function () {
  22473. if (_this.onError) {
  22474. _this.onError(_this);
  22475. }
  22476. onError();
  22477. };
  22478. this.texture = new BABYLON.Texture(this.url, scene, this.noMipmap, this.invertY, this.samplingMode, onload, onError);
  22479. };
  22480. return TextureAssetTask;
  22481. })();
  22482. BABYLON.TextureAssetTask = TextureAssetTask;
  22483. var AssetsManager = (function () {
  22484. function AssetsManager(scene) {
  22485. this._tasks = new Array();
  22486. this._waitingTasksCount = 0;
  22487. this.useDefaultLoadingScreen = true;
  22488. this._scene = scene;
  22489. }
  22490. AssetsManager.prototype.addMeshTask = function (taskName, meshesNames, rootUrl, sceneFilename) {
  22491. var task = new MeshAssetTask(taskName, meshesNames, rootUrl, sceneFilename);
  22492. this._tasks.push(task);
  22493. return task;
  22494. };
  22495. AssetsManager.prototype.addTextFileTask = function (taskName, url) {
  22496. var task = new TextFileAssetTask(taskName, url);
  22497. this._tasks.push(task);
  22498. return task;
  22499. };
  22500. AssetsManager.prototype.addBinaryFileTask = function (taskName, url) {
  22501. var task = new BinaryFileAssetTask(taskName, url);
  22502. this._tasks.push(task);
  22503. return task;
  22504. };
  22505. AssetsManager.prototype.addImageTask = function (taskName, url) {
  22506. var task = new ImageAssetTask(taskName, url);
  22507. this._tasks.push(task);
  22508. return task;
  22509. };
  22510. AssetsManager.prototype.addTextureTask = function (taskName, url, noMipmap, invertY, samplingMode) {
  22511. if (typeof samplingMode === "undefined") { samplingMode = BABYLON.Texture.TRILINEAR_SAMPLINGMODE; }
  22512. var task = new TextureAssetTask(taskName, url, noMipmap, invertY, samplingMode);
  22513. this._tasks.push(task);
  22514. return task;
  22515. };
  22516. AssetsManager.prototype._decreaseWaitingTasksCount = function () {
  22517. this._waitingTasksCount--;
  22518. if (this._waitingTasksCount === 0) {
  22519. if (this.onFinish) {
  22520. this.onFinish(this._tasks);
  22521. }
  22522. this._scene.getEngine().hideLoadingUI();
  22523. }
  22524. };
  22525. AssetsManager.prototype._runTask = function (task) {
  22526. var _this = this;
  22527. task.run(this._scene, function () {
  22528. if (_this.onTaskSuccess) {
  22529. _this.onTaskSuccess(task);
  22530. }
  22531. _this._decreaseWaitingTasksCount();
  22532. }, function () {
  22533. if (_this.onTaskError) {
  22534. _this.onTaskError(task);
  22535. }
  22536. _this._decreaseWaitingTasksCount();
  22537. });
  22538. };
  22539. AssetsManager.prototype.reset = function () {
  22540. this._tasks = new Array();
  22541. return this;
  22542. };
  22543. AssetsManager.prototype.load = function () {
  22544. this._waitingTasksCount = this._tasks.length;
  22545. if (this._waitingTasksCount === 0) {
  22546. if (this.onFinish) {
  22547. this.onFinish(this._tasks);
  22548. }
  22549. return this;
  22550. }
  22551. if (this.useDefaultLoadingScreen) {
  22552. this._scene.getEngine().displayLoadingUI();
  22553. }
  22554. for (var index = 0; index < this._tasks.length; index++) {
  22555. var task = this._tasks[index];
  22556. this._runTask(task);
  22557. }
  22558. return this;
  22559. };
  22560. return AssetsManager;
  22561. })();
  22562. BABYLON.AssetsManager = AssetsManager;
  22563. })(BABYLON || (BABYLON = {}));
  22564. var __extends = this.__extends || function (d, b) {
  22565. for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p];
  22566. function __() { this.constructor = d; }
  22567. __.prototype = b.prototype;
  22568. d.prototype = new __();
  22569. };
  22570. var BABYLON;
  22571. (function (BABYLON) {
  22572. var VRDeviceOrientationCamera = (function (_super) {
  22573. __extends(VRDeviceOrientationCamera, _super);
  22574. function VRDeviceOrientationCamera(name, position, scene) {
  22575. _super.call(this, name, position, scene);
  22576. this._alpha = 0;
  22577. this._beta = 0;
  22578. this._gamma = 0;
  22579. }
  22580. VRDeviceOrientationCamera.prototype._onOrientationEvent = function (evt) {
  22581. this._alpha = +evt.alpha | 0;
  22582. this._beta = +evt.beta | 0;
  22583. this._gamma = +evt.gamma | 0;
  22584. if (this._gamma < 0) {
  22585. this._gamma = 90 + this._gamma;
  22586. } else {
  22587. this._gamma = 270 - this._gamma;
  22588. }
  22589. this.rotation.x = this._gamma / 180.0 * Math.PI;
  22590. this.rotation.y = -this._alpha / 180.0 * Math.PI;
  22591. this.rotation.z = this._beta / 180.0 * Math.PI;
  22592. };
  22593. return VRDeviceOrientationCamera;
  22594. })(BABYLON.OculusCamera);
  22595. BABYLON.VRDeviceOrientationCamera = VRDeviceOrientationCamera;
  22596. })(BABYLON || (BABYLON = {}));
  22597. var __extends = this.__extends || function (d, b) {
  22598. for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p];
  22599. function __() { this.constructor = d; }
  22600. __.prototype = b.prototype;
  22601. d.prototype = new __();
  22602. };
  22603. var BABYLON;
  22604. (function (BABYLON) {
  22605. var WebVRCamera = (function (_super) {
  22606. __extends(WebVRCamera, _super);
  22607. function WebVRCamera(name, position, scene) {
  22608. _super.call(this, name, position, scene);
  22609. this._hmdDevice = null;
  22610. this._sensorDevice = null;
  22611. this._cacheState = null;
  22612. this._cacheQuaternion = new BABYLON.Quaternion();
  22613. this._cacheRotation = BABYLON.Vector3.Zero();
  22614. this._vrEnabled = false;
  22615. this._getWebVRDevices = this._getWebVRDevices.bind(this);
  22616. }
  22617. WebVRCamera.prototype._getWebVRDevices = function (devices) {
  22618. var size = devices.length;
  22619. var i = 0;
  22620. this._sensorDevice = null;
  22621. this._hmdDevice = null;
  22622. while (i < size && this._hmdDevice === null) {
  22623. if (devices[i] instanceof HMDVRDevice) {
  22624. this._hmdDevice = devices[i];
  22625. }
  22626. i++;
  22627. }
  22628. i = 0;
  22629. while (i < size && this._sensorDevice === null) {
  22630. if (devices[i] instanceof PositionSensorVRDevice && (!this._hmdDevice || devices[i].hardwareUnitId === this._hmdDevice.hardwareUnitId)) {
  22631. this._sensorDevice = devices[i];
  22632. }
  22633. i++;
  22634. }
  22635. this._vrEnabled = this._sensorDevice && this._hmdDevice ? true : false;
  22636. };
  22637. WebVRCamera.prototype._update = function () {
  22638. if (this._vrEnabled) {
  22639. this._cacheState = this._sensorDevice.getState();
  22640. this._cacheQuaternion.copyFromFloats(this._cacheState.orientation.x, this._cacheState.orientation.y, this._cacheState.orientation.z, this._cacheState.orientation.w);
  22641. this._cacheQuaternion.toEulerAnglesToRef(this._cacheRotation);
  22642. this.rotation.x = -this._cacheRotation.z;
  22643. this.rotation.y = -this._cacheRotation.y;
  22644. this.rotation.z = this._cacheRotation.x;
  22645. }
  22646. _super.prototype._update.call(this);
  22647. };
  22648. WebVRCamera.prototype.attachControl = function (element, noPreventDefault) {
  22649. _super.prototype.attachControl.call(this, element, noPreventDefault);
  22650. if (navigator.getVRDevices) {
  22651. navigator.getVRDevices().then(this._getWebVRDevices);
  22652. } else if (navigator.mozGetVRDevices) {
  22653. navigator.mozGetVRDevices(this._getWebVRDevices);
  22654. }
  22655. };
  22656. WebVRCamera.prototype.detachControl = function (element) {
  22657. _super.prototype.detachControl.call(this, element);
  22658. this._vrEnabled = false;
  22659. };
  22660. return WebVRCamera;
  22661. })(BABYLON.OculusCamera);
  22662. BABYLON.WebVRCamera = WebVRCamera;
  22663. })(BABYLON || (BABYLON = {}));
  22664. var __extends = this.__extends || function (d, b) {
  22665. for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p];
  22666. function __() { this.constructor = d; }
  22667. __.prototype = b.prototype;
  22668. d.prototype = new __();
  22669. };
  22670. var BABYLON;
  22671. (function (BABYLON) {
  22672. var SceneOptimization = (function () {
  22673. function SceneOptimization(priority) {
  22674. if (typeof priority === "undefined") { priority = 0; }
  22675. this.priority = priority;
  22676. this.apply = function (scene) {
  22677. return true;
  22678. };
  22679. }
  22680. return SceneOptimization;
  22681. })();
  22682. BABYLON.SceneOptimization = SceneOptimization;
  22683. var TextureOptimization = (function (_super) {
  22684. __extends(TextureOptimization, _super);
  22685. function TextureOptimization(priority, maximumSize) {
  22686. if (typeof priority === "undefined") { priority = 0; }
  22687. if (typeof maximumSize === "undefined") { maximumSize = 1024; }
  22688. var _this = this;
  22689. _super.call(this, priority);
  22690. this.priority = priority;
  22691. this.maximumSize = maximumSize;
  22692. this.apply = function (scene) {
  22693. var allDone = true;
  22694. for (var index = 0; index < scene.textures.length; index++) {
  22695. var texture = scene.textures[index];
  22696. if (!texture.canRescale) {
  22697. continue;
  22698. }
  22699. var currentSize = texture.getSize();
  22700. var maxDimension = Math.max(currentSize.width, currentSize.height);
  22701. if (maxDimension > _this.maximumSize) {
  22702. texture.scale(0.5);
  22703. allDone = false;
  22704. }
  22705. }
  22706. return allDone;
  22707. };
  22708. }
  22709. return TextureOptimization;
  22710. })(SceneOptimization);
  22711. BABYLON.TextureOptimization = TextureOptimization;
  22712. var HardwareScalingOptimization = (function (_super) {
  22713. __extends(HardwareScalingOptimization, _super);
  22714. function HardwareScalingOptimization(priority, maximumScale) {
  22715. if (typeof priority === "undefined") { priority = 0; }
  22716. if (typeof maximumScale === "undefined") { maximumScale = 2; }
  22717. var _this = this;
  22718. _super.call(this, priority);
  22719. this.priority = priority;
  22720. this.maximumScale = maximumScale;
  22721. this._currentScale = 1;
  22722. this.apply = function (scene) {
  22723. _this._currentScale++;
  22724. scene.getEngine().setHardwareScalingLevel(_this._currentScale);
  22725. return _this._currentScale >= _this.maximumScale;
  22726. };
  22727. }
  22728. return HardwareScalingOptimization;
  22729. })(SceneOptimization);
  22730. BABYLON.HardwareScalingOptimization = HardwareScalingOptimization;
  22731. var ShadowsOptimization = (function (_super) {
  22732. __extends(ShadowsOptimization, _super);
  22733. function ShadowsOptimization() {
  22734. _super.apply(this, arguments);
  22735. this.apply = function (scene) {
  22736. scene.shadowsEnabled = false;
  22737. return true;
  22738. };
  22739. }
  22740. return ShadowsOptimization;
  22741. })(SceneOptimization);
  22742. BABYLON.ShadowsOptimization = ShadowsOptimization;
  22743. var PostProcessesOptimization = (function (_super) {
  22744. __extends(PostProcessesOptimization, _super);
  22745. function PostProcessesOptimization() {
  22746. _super.apply(this, arguments);
  22747. this.apply = function (scene) {
  22748. scene.postProcessesEnabled = false;
  22749. return true;
  22750. };
  22751. }
  22752. return PostProcessesOptimization;
  22753. })(SceneOptimization);
  22754. BABYLON.PostProcessesOptimization = PostProcessesOptimization;
  22755. var LensFlaresOptimization = (function (_super) {
  22756. __extends(LensFlaresOptimization, _super);
  22757. function LensFlaresOptimization() {
  22758. _super.apply(this, arguments);
  22759. this.apply = function (scene) {
  22760. scene.lensFlaresEnabled = false;
  22761. return true;
  22762. };
  22763. }
  22764. return LensFlaresOptimization;
  22765. })(SceneOptimization);
  22766. BABYLON.LensFlaresOptimization = LensFlaresOptimization;
  22767. var ParticlesOptimization = (function (_super) {
  22768. __extends(ParticlesOptimization, _super);
  22769. function ParticlesOptimization() {
  22770. _super.apply(this, arguments);
  22771. this.apply = function (scene) {
  22772. scene.particlesEnabled = false;
  22773. return true;
  22774. };
  22775. }
  22776. return ParticlesOptimization;
  22777. })(SceneOptimization);
  22778. BABYLON.ParticlesOptimization = ParticlesOptimization;
  22779. var RenderTargetsOptimization = (function (_super) {
  22780. __extends(RenderTargetsOptimization, _super);
  22781. function RenderTargetsOptimization() {
  22782. _super.apply(this, arguments);
  22783. this.apply = function (scene) {
  22784. scene.renderTargetsEnabled = false;
  22785. return true;
  22786. };
  22787. }
  22788. return RenderTargetsOptimization;
  22789. })(SceneOptimization);
  22790. BABYLON.RenderTargetsOptimization = RenderTargetsOptimization;
  22791. var SceneOptimizerOptions = (function () {
  22792. function SceneOptimizerOptions(targetFrameRate, trackerDuration) {
  22793. if (typeof targetFrameRate === "undefined") { targetFrameRate = 60; }
  22794. if (typeof trackerDuration === "undefined") { trackerDuration = 2000; }
  22795. this.targetFrameRate = targetFrameRate;
  22796. this.trackerDuration = trackerDuration;
  22797. this.optimizations = new Array();
  22798. }
  22799. SceneOptimizerOptions.LowDegradationAllowed = function (targetFrameRate) {
  22800. var result = new SceneOptimizerOptions(targetFrameRate);
  22801. var priority = 0;
  22802. result.optimizations.push(new ShadowsOptimization(priority));
  22803. result.optimizations.push(new LensFlaresOptimization(priority));
  22804. priority++;
  22805. result.optimizations.push(new PostProcessesOptimization(priority));
  22806. result.optimizations.push(new ParticlesOptimization(priority));
  22807. priority++;
  22808. result.optimizations.push(new TextureOptimization(priority, 1024));
  22809. return result;
  22810. };
  22811. SceneOptimizerOptions.ModerateDegradationAllowed = function (targetFrameRate) {
  22812. var result = new SceneOptimizerOptions(targetFrameRate);
  22813. var priority = 0;
  22814. result.optimizations.push(new ShadowsOptimization(priority));
  22815. result.optimizations.push(new LensFlaresOptimization(priority));
  22816. priority++;
  22817. result.optimizations.push(new PostProcessesOptimization(priority));
  22818. result.optimizations.push(new ParticlesOptimization(priority));
  22819. priority++;
  22820. result.optimizations.push(new TextureOptimization(priority, 512));
  22821. priority++;
  22822. result.optimizations.push(new RenderTargetsOptimization(priority));
  22823. priority++;
  22824. result.optimizations.push(new HardwareScalingOptimization(priority, 2));
  22825. return result;
  22826. };
  22827. SceneOptimizerOptions.HighDegradationAllowed = function (targetFrameRate) {
  22828. var result = new SceneOptimizerOptions(targetFrameRate);
  22829. var priority = 0;
  22830. result.optimizations.push(new ShadowsOptimization(priority));
  22831. result.optimizations.push(new LensFlaresOptimization(priority));
  22832. priority++;
  22833. result.optimizations.push(new PostProcessesOptimization(priority));
  22834. result.optimizations.push(new ParticlesOptimization(priority));
  22835. priority++;
  22836. result.optimizations.push(new TextureOptimization(priority, 256));
  22837. priority++;
  22838. result.optimizations.push(new RenderTargetsOptimization(priority));
  22839. priority++;
  22840. result.optimizations.push(new HardwareScalingOptimization(priority, 4));
  22841. return result;
  22842. };
  22843. return SceneOptimizerOptions;
  22844. })();
  22845. BABYLON.SceneOptimizerOptions = SceneOptimizerOptions;
  22846. var SceneOptimizer = (function () {
  22847. function SceneOptimizer() {
  22848. }
  22849. SceneOptimizer._CheckCurrentState = function (scene, options, currentPriorityLevel, onSuccess, onFailure) {
  22850. if (BABYLON.Tools.GetFps() >= options.targetFrameRate) {
  22851. if (onSuccess) {
  22852. onSuccess();
  22853. }
  22854. return;
  22855. }
  22856. var allDone = true;
  22857. var noOptimizationApplied = true;
  22858. for (var index = 0; index < options.optimizations.length; index++) {
  22859. var optimization = options.optimizations[index];
  22860. if (optimization.priority === currentPriorityLevel) {
  22861. noOptimizationApplied = false;
  22862. allDone = allDone && optimization.apply(scene);
  22863. }
  22864. }
  22865. if (noOptimizationApplied) {
  22866. if (onFailure) {
  22867. onFailure();
  22868. }
  22869. return;
  22870. }
  22871. if (allDone) {
  22872. currentPriorityLevel++;
  22873. }
  22874. scene.executeWhenReady(function () {
  22875. setTimeout(function () {
  22876. SceneOptimizer._CheckCurrentState(scene, options, currentPriorityLevel, onSuccess, onFailure);
  22877. }, options.trackerDuration);
  22878. });
  22879. };
  22880. SceneOptimizer.OptimizeAsync = function (scene, options, onSuccess, onFailure) {
  22881. if (!options) {
  22882. options = SceneOptimizerOptions.ModerateDegradationAllowed();
  22883. }
  22884. scene.executeWhenReady(function () {
  22885. setTimeout(function () {
  22886. SceneOptimizer._CheckCurrentState(scene, options, 0, onSuccess, onFailure);
  22887. }, options.trackerDuration);
  22888. });
  22889. };
  22890. return SceneOptimizer;
  22891. })();
  22892. BABYLON.SceneOptimizer = SceneOptimizer;
  22893. })(BABYLON || (BABYLON = {}));
  22894. var BABYLON;
  22895. (function (BABYLON) {
  22896. (function (Internals) {
  22897. var MeshLODLevel = (function () {
  22898. function MeshLODLevel(distance, mesh) {
  22899. this.distance = distance;
  22900. this.mesh = mesh;
  22901. }
  22902. return MeshLODLevel;
  22903. })();
  22904. Internals.MeshLODLevel = MeshLODLevel;
  22905. })(BABYLON.Internals || (BABYLON.Internals = {}));
  22906. var Internals = BABYLON.Internals;
  22907. })(BABYLON || (BABYLON = {}));
  22908. var BABYLON;
  22909. (function (BABYLON) {
  22910. var AudioEngine = (function () {
  22911. function AudioEngine() {
  22912. this.audioContext = null;
  22913. this.canUseWebAudio = false;
  22914. try {
  22915. if (typeof AudioContext !== 'undefined') {
  22916. this.audioContext = new AudioContext();
  22917. this.canUseWebAudio = true;
  22918. } else if (typeof webkitAudioContext !== 'undefined') {
  22919. this.audioContext = new webkitAudioContext();
  22920. this.canUseWebAudio = true;
  22921. }
  22922. } catch (e) {
  22923. this.canUseWebAudio = false;
  22924. }
  22925. if (this.canUseWebAudio) {
  22926. this.masterGain = this.audioContext.createGain();
  22927. this.masterGain.gain.value = 1;
  22928. this.masterGain.connect(this.audioContext.destination);
  22929. }
  22930. }
  22931. AudioEngine.prototype.getGlobalVolume = function () {
  22932. if (this.canUseWebAudio) {
  22933. return this.masterGain.gain.value;
  22934. } else {
  22935. return -1;
  22936. }
  22937. };
  22938. AudioEngine.prototype.setGlobalVolume = function (newVolume) {
  22939. if (this.canUseWebAudio) {
  22940. this.masterGain.gain.value = newVolume;
  22941. }
  22942. };
  22943. return AudioEngine;
  22944. })();
  22945. BABYLON.AudioEngine = AudioEngine;
  22946. })(BABYLON || (BABYLON = {}));
  22947. var BABYLON;
  22948. (function (BABYLON) {
  22949. var Sound = (function () {
  22950. /**
  22951. * Create a sound and attach it to a scene
  22952. * @param name Name of your sound
  22953. * @param url Url to the sound to load async
  22954. * @param readyToPlayCallback Provide a callback function if you'd like to load your code once the sound is ready to be played
  22955. * @param options Objects to provide with the current available options: autoplay, loop, distanceMax
  22956. */
  22957. function Sound(name, url, scene, readyToPlayCallback, options) {
  22958. var _this = this;
  22959. this.maxDistance = 10;
  22960. this.autoplay = false;
  22961. this.loop = false;
  22962. this._position = BABYLON.Vector3.Zero();
  22963. this._direction = BABYLON.Vector3.Zero();
  22964. this._isLoaded = false;
  22965. this._isReadyToPlay = false;
  22966. this._isPlaying = false;
  22967. this._isDirectional = false;
  22968. this._coneInnerAngle = null;
  22969. this._coneOuterAngle = null;
  22970. this._coneOuterGain = null;
  22971. this._name = name;
  22972. this._scene = scene;
  22973. this._audioEngine = this._scene.getEngine().getAudioEngine();
  22974. this._readyToPlayCallback = readyToPlayCallback;
  22975. if (options) {
  22976. if (options.distanceMax) {
  22977. this.maxDistance = options.distanceMax;
  22978. }
  22979. if (options.autoplay) {
  22980. this.autoplay = options.autoplay;
  22981. }
  22982. if (options.loop) {
  22983. this.loop = options.loop;
  22984. }
  22985. }
  22986. if (this._audioEngine.canUseWebAudio) {
  22987. BABYLON.Tools.LoadFile(url, function (data) {
  22988. _this._soundLoaded(data);
  22989. }, null, null, true);
  22990. }
  22991. }
  22992. /**
  22993. * Transform this sound into a directional source
  22994. * @param coneInnerAngle Size of the inner cone in degree
  22995. * @param coneOuterAngle Size of the outer cone in degree
  22996. * @param coneOuterGain Volume of the sound outside the outer cone (between 0.0 and 1.0)
  22997. */
  22998. Sound.prototype.setDirectionalCone = function (coneInnerAngle, coneOuterAngle, coneOuterGain) {
  22999. if (coneOuterAngle < coneInnerAngle) {
  23000. BABYLON.Tools.Error("setDirectionalCone(): outer angle of the cone must be superior or equal to the inner angle.");
  23001. return;
  23002. }
  23003. this._coneInnerAngle = coneInnerAngle;
  23004. this._coneOuterAngle = coneOuterAngle;
  23005. this._coneOuterGain = coneOuterGain;
  23006. this._isDirectional = true;
  23007. if (this._isPlaying && this.loop) {
  23008. this.stop();
  23009. this.play();
  23010. }
  23011. };
  23012. Sound.prototype.setPosition = function (newPosition) {
  23013. this._position = newPosition;
  23014. if (this._isPlaying) {
  23015. this._soundPanner.setPosition(this._position.x, this._position.y, this._position.z);
  23016. }
  23017. };
  23018. Sound.prototype.setDirection = function (newDirection) {
  23019. this._direction = newDirection;
  23020. if (this._isPlaying) {
  23021. console.log(this._direction.x + " " + this._direction.y + " " + this._direction.z);
  23022. this._soundPanner.setOrientation(this._direction.x, this._direction.y, this._direction.z);
  23023. }
  23024. };
  23025. Sound.prototype.play = function () {
  23026. if (this._isReadyToPlay) {
  23027. try {
  23028. this._soundSource = this._audioEngine.audioContext.createBufferSource();
  23029. this._soundSource.buffer = this._audioBuffer;
  23030. this._soundPanner = this._audioEngine.audioContext.createPanner();
  23031. this._soundPanner.setPosition(this._position.x, this._position.y, this._position.z);
  23032. if (this._isDirectional) {
  23033. this._soundPanner.coneInnerAngle = this._coneInnerAngle;
  23034. this._soundPanner.coneOuterAngle = this._coneOuterAngle;
  23035. this._soundPanner.coneOuterGain = this._coneOuterGain;
  23036. this._soundPanner.setOrientation(this._direction.x, this._direction.y, this._direction.z);
  23037. }
  23038. this._soundPanner.connect(this._audioEngine.masterGain);
  23039. this._soundSource.connect(this._soundPanner);
  23040. this._soundSource.loop = this.loop;
  23041. this._soundSource.start(0);
  23042. this._isPlaying = true;
  23043. } catch (ex) {
  23044. BABYLON.Tools.Error("Error while trying to play audio: " + this._name + ", " + ex.message);
  23045. }
  23046. }
  23047. };
  23048. Sound.prototype.stop = function () {
  23049. this._soundSource.stop(0);
  23050. this._isPlaying = false;
  23051. };
  23052. Sound.prototype.pause = function () {
  23053. };
  23054. Sound.prototype.attachToMesh = function (meshToConnectTo) {
  23055. var _this = this;
  23056. meshToConnectTo.registerAfterWorldMatrixUpdate(function (connectedMesh) {
  23057. return _this._onRegisterAfterWorldMatrixUpdate(connectedMesh);
  23058. });
  23059. };
  23060. Sound.prototype._onRegisterAfterWorldMatrixUpdate = function (connectedMesh) {
  23061. this.setPosition(connectedMesh.position);
  23062. if (this._isDirectional) {
  23063. var mat = connectedMesh.getWorldMatrix();
  23064. var direction = BABYLON.Vector3.TransformNormal(new BABYLON.Vector3(0, 0, 1), mat);
  23065. direction.normalize();
  23066. this.setDirection(direction);
  23067. }
  23068. };
  23069. Sound.prototype._soundLoaded = function (audioData) {
  23070. var _this = this;
  23071. this._isLoaded = true;
  23072. this._audioEngine.audioContext.decodeAudioData(audioData, function (buffer) {
  23073. _this._audioBuffer = buffer;
  23074. _this._isReadyToPlay = true;
  23075. if (_this.autoplay) {
  23076. _this.play();
  23077. }
  23078. if (_this._readyToPlayCallback) {
  23079. _this._readyToPlayCallback();
  23080. }
  23081. }, function (error) {
  23082. BABYLON.Tools.Error("Error while decoding audio data: " + error.err);
  23083. });
  23084. };
  23085. return Sound;
  23086. })();
  23087. BABYLON.Sound = Sound;
  23088. })(BABYLON || (BABYLON = {}));
  23089. var BABYLON;
  23090. (function (BABYLON) {
  23091. var DebugLayer = (function () {
  23092. function DebugLayer(scene) {
  23093. var _this = this;
  23094. this._enabled = false;
  23095. this._labelsEnabled = false;
  23096. this._displayStatistics = true;
  23097. this._displayLogs = false;
  23098. this._identityMatrix = BABYLON.Matrix.Identity();
  23099. this._scene = scene;
  23100. this._syncPositions = function () {
  23101. var engine = _this._scene.getEngine();
  23102. var canvasRect = engine.getRenderingCanvasClientRect();
  23103. _this._statsDiv.style.right = "0";
  23104. _this._statsDiv.style.bottom = "10px";
  23105. _this._statsDiv.style.width = "300px";
  23106. _this._statsDiv.style.height = "auto";
  23107. _this._statsDiv.style.maxHeight = (canvasRect.height - 40) + "px";
  23108. _this._optionsDiv.style.left = "0px";
  23109. _this._optionsDiv.style.top = "10px";
  23110. _this._optionsDiv.style.width = "200px";
  23111. _this._optionsDiv.style.height = "auto";
  23112. _this._optionsDiv.style.maxHeight = (canvasRect.height - 40) + "px";
  23113. _this._logDiv.style.left = "0px";
  23114. _this._logDiv.style.bottom = "10px";
  23115. _this._logDiv.style.width = "600px";
  23116. _this._logDiv.style.height = "auto";
  23117. _this._drawingCanvas.style.left = "0px";
  23118. _this._drawingCanvas.style.top = "0px";
  23119. _this._drawingCanvas.style.width = engine.getRenderWidth() + "px";
  23120. _this._drawingCanvas.style.height = engine.getRenderHeight() + "px";
  23121. var devicePixelRatio = window.devicePixelRatio || 1;
  23122. var context = _this._drawingContext;
  23123. var backingStoreRatio = context.webkitBackingStorePixelRatio || context.mozBackingStorePixelRatio || context.msBackingStorePixelRatio || context.oBackingStorePixelRatio || context.backingStorePixelRatio || 1;
  23124. _this._ratio = devicePixelRatio / backingStoreRatio;
  23125. _this._drawingCanvas.width = engine.getRenderWidth() * _this._ratio;
  23126. _this._drawingCanvas.height = engine.getRenderHeight() * _this._ratio;
  23127. };
  23128. this._onCanvasClick = function (evt) {
  23129. _this._clickPosition = {
  23130. x: evt.clientX * _this._ratio,
  23131. y: evt.clientY * _this._ratio
  23132. };
  23133. };
  23134. this._syncData = function () {
  23135. if (_this._displayStatistics) {
  23136. _this._displayStats();
  23137. _this._statsDiv.style.display = "";
  23138. } else {
  23139. _this._statsDiv.style.display = "none";
  23140. }
  23141. if (_this._displayLogs) {
  23142. _this._logDiv.style.display = "";
  23143. } else {
  23144. _this._logDiv.style.display = "none";
  23145. }
  23146. if (_this._labelsEnabled) {
  23147. _this._drawingContext.clearRect(0, 0, _this._drawingCanvas.width, _this._drawingCanvas.height);
  23148. var engine = _this._scene.getEngine();
  23149. var viewport = _this._scene.activeCamera.viewport;
  23150. var globalViewport = viewport.toGlobal(engine);
  23151. var meshes = _this._scene.getActiveMeshes();
  23152. for (var index = 0; index < meshes.length; index++) {
  23153. var mesh = meshes.data[index];
  23154. var position = mesh.getBoundingInfo().boundingSphere.center;
  23155. var projectedPosition = BABYLON.Vector3.Project(position, mesh.getWorldMatrix(), _this._scene.getTransformMatrix(), globalViewport);
  23156. if (mesh.renderOverlay) {
  23157. _this._renderAxis(projectedPosition, mesh, globalViewport);
  23158. }
  23159. _this._renderLabel(mesh.name, projectedPosition, 12, function () {
  23160. mesh.renderOverlay = !mesh.renderOverlay;
  23161. }, function () {
  23162. return mesh.renderOverlay ? 'red' : 'black';
  23163. });
  23164. }
  23165. for (index = 0; index < _this._scene.cameras.length; index++) {
  23166. var camera = _this._scene.cameras[index];
  23167. if (camera === _this._scene.activeCamera) {
  23168. continue;
  23169. }
  23170. projectedPosition = BABYLON.Vector3.Project(camera.position, _this._identityMatrix, _this._scene.getTransformMatrix(), globalViewport);
  23171. _this._renderLabel(camera.name, projectedPosition, 12, function () {
  23172. _this._scene.activeCamera.detachControl(engine.getRenderingCanvas());
  23173. _this._scene.activeCamera = camera;
  23174. _this._scene.activeCamera.attachControl(engine.getRenderingCanvas());
  23175. }, function () {
  23176. return "purple";
  23177. });
  23178. }
  23179. for (index = 0; index < _this._scene.lights.length; index++) {
  23180. var light = _this._scene.lights[index];
  23181. if (light.position) {
  23182. projectedPosition = BABYLON.Vector3.Project(light.position, _this._identityMatrix, _this._scene.getTransformMatrix(), globalViewport);
  23183. _this._renderLabel(light.name, projectedPosition, -20, function () {
  23184. light.setEnabled(!light.isEnabled());
  23185. }, function () {
  23186. return light.isEnabled() ? "orange" : "gray";
  23187. });
  23188. }
  23189. }
  23190. }
  23191. _this._clickPosition = undefined;
  23192. };
  23193. }
  23194. DebugLayer.prototype._renderSingleAxis = function (zero, unit, unitText, label, color) {
  23195. this._drawingContext.beginPath();
  23196. this._drawingContext.moveTo(zero.x, zero.y);
  23197. this._drawingContext.lineTo(unit.x, unit.y);
  23198. this._drawingContext.strokeStyle = color;
  23199. this._drawingContext.lineWidth = 4;
  23200. this._drawingContext.stroke();
  23201. this._drawingContext.font = "normal 14px Segoe UI";
  23202. this._drawingContext.fillStyle = color;
  23203. this._drawingContext.fillText(label, unitText.x, unitText.y);
  23204. };
  23205. DebugLayer.prototype._renderAxis = function (projectedPosition, mesh, globalViewport) {
  23206. var position = mesh.getBoundingInfo().boundingSphere.center;
  23207. var worldMatrix = mesh.getWorldMatrix();
  23208. var unprojectedVector = BABYLON.Vector3.UnprojectFromTransform(projectedPosition.add(new BABYLON.Vector3(this._drawingCanvas.width * 0.02, 0, 0)), globalViewport.width, globalViewport.height, worldMatrix, this._scene.getTransformMatrix());
  23209. var unit = (unprojectedVector.subtract(position)).length();
  23210. var xAxis = BABYLON.Vector3.Project(position.add(new BABYLON.Vector3(unit, 0, 0)), worldMatrix, this._scene.getTransformMatrix(), globalViewport);
  23211. var xAxisText = BABYLON.Vector3.Project(position.add(new BABYLON.Vector3(unit * 1.5, 0, 0)), worldMatrix, this._scene.getTransformMatrix(), globalViewport);
  23212. this._renderSingleAxis(projectedPosition, xAxis, xAxisText, "x", "#FF0000");
  23213. var yAxis = BABYLON.Vector3.Project(position.add(new BABYLON.Vector3(0, unit, 0)), worldMatrix, this._scene.getTransformMatrix(), globalViewport);
  23214. var yAxisText = BABYLON.Vector3.Project(position.add(new BABYLON.Vector3(0, unit * 1.5, 0)), worldMatrix, this._scene.getTransformMatrix(), globalViewport);
  23215. this._renderSingleAxis(projectedPosition, yAxis, yAxisText, "y", "#00FF00");
  23216. var zAxis = BABYLON.Vector3.Project(position.add(new BABYLON.Vector3(0, 0, unit)), worldMatrix, this._scene.getTransformMatrix(), globalViewport);
  23217. var zAxisText = BABYLON.Vector3.Project(position.add(new BABYLON.Vector3(0, 0, unit * 1.5)), worldMatrix, this._scene.getTransformMatrix(), globalViewport);
  23218. this._renderSingleAxis(projectedPosition, zAxis, zAxisText, "z", "#0000FF");
  23219. };
  23220. DebugLayer.prototype._renderLabel = function (text, projectedPosition, labelOffset, onClick, getFillStyle) {
  23221. if (projectedPosition.z > 0 && projectedPosition.z < 1.0) {
  23222. this._drawingContext.font = "normal 12px Segoe UI";
  23223. var textMetrics = this._drawingContext.measureText(text);
  23224. var centerX = projectedPosition.x - textMetrics.width / 2;
  23225. var centerY = projectedPosition.y;
  23226. if (this._isClickInsideRect(centerX - 5, centerY - labelOffset - 12, textMetrics.width + 10, 17)) {
  23227. onClick();
  23228. }
  23229. this._drawingContext.beginPath();
  23230. this._drawingContext.rect(centerX - 5, centerY - labelOffset - 12, textMetrics.width + 10, 17);
  23231. this._drawingContext.fillStyle = getFillStyle();
  23232. this._drawingContext.globalAlpha = 0.5;
  23233. this._drawingContext.fill();
  23234. this._drawingContext.globalAlpha = 1.0;
  23235. this._drawingContext.strokeStyle = '#FFFFFF';
  23236. this._drawingContext.lineWidth = 1;
  23237. this._drawingContext.stroke();
  23238. this._drawingContext.fillStyle = "#FFFFFF";
  23239. this._drawingContext.fillText(text, centerX, centerY - labelOffset);
  23240. this._drawingContext.beginPath();
  23241. this._drawingContext.arc(projectedPosition.x, centerY, 5, 0, 2 * Math.PI, false);
  23242. this._drawingContext.fill();
  23243. }
  23244. };
  23245. DebugLayer.prototype._isClickInsideRect = function (x, y, width, height) {
  23246. if (!this._clickPosition) {
  23247. return false;
  23248. }
  23249. if (this._clickPosition.x < x || this._clickPosition.x > x + width) {
  23250. return false;
  23251. }
  23252. if (this._clickPosition.y < y || this._clickPosition.y > y + height) {
  23253. return false;
  23254. }
  23255. return true;
  23256. };
  23257. Object.defineProperty(DebugLayer.prototype, "enabled", {
  23258. get: function () {
  23259. return this._enabled;
  23260. },
  23261. set: function (value) {
  23262. if (this._enabled === value) {
  23263. return;
  23264. }
  23265. this._enabled = value;
  23266. var engine = this._scene.getEngine();
  23267. var parentElement = engine.getRenderingCanvas().parentElement;
  23268. if (this._enabled) {
  23269. this._scene.registerAfterRender(this._syncData);
  23270. this._globalDiv = document.createElement("div");
  23271. parentElement.appendChild(this._globalDiv);
  23272. this._generateDOMelements();
  23273. window.addEventListener("resize", this._syncPositions);
  23274. engine.getRenderingCanvas().addEventListener("click", this._onCanvasClick);
  23275. this._syncPositions();
  23276. } else {
  23277. this._scene.unregisterAfterRender(this._syncData);
  23278. parentElement.removeChild(this._globalDiv);
  23279. window.removeEventListener("resize", this._syncPositions);
  23280. this._scene.forceShowBoundingBoxes = false;
  23281. this._scene.forceWireframe = false;
  23282. BABYLON.StandardMaterial.DiffuseTextureEnabled = true;
  23283. BABYLON.StandardMaterial.AmbientTextureEnabled = true;
  23284. BABYLON.StandardMaterial.SpecularTextureEnabled = true;
  23285. BABYLON.StandardMaterial.EmissiveTextureEnabled = true;
  23286. BABYLON.StandardMaterial.BumpTextureEnabled = true;
  23287. BABYLON.StandardMaterial.OpacityTextureEnabled = true;
  23288. BABYLON.StandardMaterial.ReflectionTextureEnabled = true;
  23289. this._scene.shadowsEnabled = true;
  23290. this._scene.particlesEnabled = true;
  23291. this._scene.postProcessesEnabled = true;
  23292. this._scene.collisionsEnabled = true;
  23293. this._scene.lightsEnabled = true;
  23294. this._scene.texturesEnabled = true;
  23295. this._scene.lensFlaresEnabled = true;
  23296. this._scene.proceduralTexturesEnabled = true;
  23297. this._scene.renderTargetsEnabled = true;
  23298. engine.getRenderingCanvas().removeEventListener("click", this._onCanvasClick);
  23299. }
  23300. },
  23301. enumerable: true,
  23302. configurable: true
  23303. });
  23304. DebugLayer.prototype._clearLabels = function () {
  23305. this._drawingContext.clearRect(0, 0, this._drawingCanvas.width, this._drawingCanvas.height);
  23306. for (var index = 0; index < this._scene.meshes.length; index++) {
  23307. var mesh = this._scene.meshes[index];
  23308. mesh.renderOverlay = false;
  23309. }
  23310. };
  23311. DebugLayer.prototype._generateTexBox = function (root, title) {
  23312. var label = document.createElement("label");
  23313. label.innerHTML = title;
  23314. root.appendChild(label);
  23315. root.appendChild(document.createElement("br"));
  23316. };
  23317. DebugLayer.prototype._generateCheckBox = function (root, title, initialState, task) {
  23318. var label = document.createElement("label");
  23319. var boundingBoxesCheckbox = document.createElement("input");
  23320. boundingBoxesCheckbox.type = "checkbox";
  23321. boundingBoxesCheckbox.checked = initialState;
  23322. boundingBoxesCheckbox.addEventListener("change", function (evt) {
  23323. task(evt.target);
  23324. });
  23325. label.appendChild(boundingBoxesCheckbox);
  23326. label.appendChild(document.createTextNode(title));
  23327. root.appendChild(label);
  23328. root.appendChild(document.createElement("br"));
  23329. };
  23330. DebugLayer.prototype._generateDOMelements = function () {
  23331. var _this = this;
  23332. var background = "rgba(128, 128, 128, 0.4)";
  23333. this._statsDiv = document.createElement("div");
  23334. this._statsDiv.id = "Debug Layer - Stats";
  23335. this._statsDiv.style.position = "absolute";
  23336. this._statsDiv.style.background = background;
  23337. this._statsDiv.style.padding = "10px";
  23338. this._statsDiv.style.pointerEvents = "none";
  23339. this._statsDiv.style.overflowY = "auto";
  23340. this._logDiv = document.createElement("div");
  23341. this._logDiv.id = "Debug Layer - Logs";
  23342. this._logDiv.style.position = "absolute";
  23343. this._logDiv.style.background = background;
  23344. this._logDiv.style.padding = "10px";
  23345. this._logDiv.style.pointerEvents = "none";
  23346. this._logDiv.style.fontSize = "12px";
  23347. this._logDiv.style.fontFamily = "consolas";
  23348. this._logDiv.style.maxHeight = "300px";
  23349. this._logDiv.style.overflowY = "auto";
  23350. this._logDiv.style.display = "none";
  23351. this._logDiv.innerHTML = BABYLON.Tools.LogCache;
  23352. BABYLON.Tools.OnNewCacheEntry = function (entry) {
  23353. _this._logDiv.innerHTML = entry + _this._logDiv.innerHTML;
  23354. };
  23355. this._drawingCanvas = document.createElement("canvas");
  23356. this._drawingCanvas.id = "Debug Layer - Drawing canvas";
  23357. this._drawingCanvas.style.position = "absolute";
  23358. this._drawingCanvas.style.pointerEvents = "none";
  23359. this._drawingContext = this._drawingCanvas.getContext("2d");
  23360. this._optionsDiv = document.createElement("div");
  23361. this._optionsDiv.id = "Debug Layer - Options";
  23362. this._optionsDiv.style.position = "absolute";
  23363. this._optionsDiv.style.background = background;
  23364. this._optionsDiv.style.padding = "10px";
  23365. this._optionsDiv.style.overflowY = "auto";
  23366. this._generateTexBox(this._optionsDiv, "<b>General:</b>");
  23367. this._generateCheckBox(this._optionsDiv, "Statistics", this._displayStatistics, function (element) {
  23368. _this._displayStatistics = element.checked;
  23369. });
  23370. this._generateCheckBox(this._optionsDiv, "Logs", this._displayLogs, function (element) {
  23371. _this._displayLogs = element.checked;
  23372. });
  23373. this._generateCheckBox(this._optionsDiv, "Bounding boxes", this._scene.forceShowBoundingBoxes, function (element) {
  23374. _this._scene.forceShowBoundingBoxes = element.checked;
  23375. });
  23376. this._generateCheckBox(this._optionsDiv, "Wireframe", this._scene.forceWireframe, function (element) {
  23377. _this._scene.forceWireframe = element.checked;
  23378. });
  23379. this._generateCheckBox(this._optionsDiv, "Labels", this._labelsEnabled, function (element) {
  23380. _this._labelsEnabled = element.checked;
  23381. if (!_this._labelsEnabled) {
  23382. _this._clearLabels();
  23383. }
  23384. });
  23385. this._optionsDiv.appendChild(document.createElement("br"));
  23386. this._generateTexBox(this._optionsDiv, "<b>Texture Channels:</b>");
  23387. this._generateCheckBox(this._optionsDiv, "Diffuse", BABYLON.StandardMaterial.DiffuseTextureEnabled, function (element) {
  23388. BABYLON.StandardMaterial.DiffuseTextureEnabled = element.checked;
  23389. });
  23390. this._generateCheckBox(this._optionsDiv, "Ambient", BABYLON.StandardMaterial.AmbientTextureEnabled, function (element) {
  23391. BABYLON.StandardMaterial.AmbientTextureEnabled = element.checked;
  23392. });
  23393. this._generateCheckBox(this._optionsDiv, "Specular", BABYLON.StandardMaterial.SpecularTextureEnabled, function (element) {
  23394. BABYLON.StandardMaterial.SpecularTextureEnabled = element.checked;
  23395. });
  23396. this._generateCheckBox(this._optionsDiv, "Emissive", BABYLON.StandardMaterial.EmissiveTextureEnabled, function (element) {
  23397. BABYLON.StandardMaterial.EmissiveTextureEnabled = element.checked;
  23398. });
  23399. this._generateCheckBox(this._optionsDiv, "Bump", BABYLON.StandardMaterial.BumpTextureEnabled, function (element) {
  23400. BABYLON.StandardMaterial.BumpTextureEnabled = element.checked;
  23401. });
  23402. this._generateCheckBox(this._optionsDiv, "Opacity", BABYLON.StandardMaterial.OpacityTextureEnabled, function (element) {
  23403. BABYLON.StandardMaterial.OpacityTextureEnabled = element.checked;
  23404. });
  23405. this._generateCheckBox(this._optionsDiv, "Reflection", BABYLON.StandardMaterial.ReflectionTextureEnabled, function (element) {
  23406. BABYLON.StandardMaterial.ReflectionTextureEnabled = element.checked;
  23407. });
  23408. this._optionsDiv.appendChild(document.createElement("br"));
  23409. this._generateTexBox(this._optionsDiv, "<b>Options:</b>");
  23410. this._generateCheckBox(this._optionsDiv, "Shadows", this._scene.shadowsEnabled, function (element) {
  23411. _this._scene.shadowsEnabled = element.checked;
  23412. });
  23413. this._generateCheckBox(this._optionsDiv, "Particles", this._scene.particlesEnabled, function (element) {
  23414. _this._scene.particlesEnabled = element.checked;
  23415. });
  23416. this._generateCheckBox(this._optionsDiv, "Post-processes", this._scene.postProcessesEnabled, function (element) {
  23417. _this._scene.postProcessesEnabled = element.checked;
  23418. });
  23419. this._generateCheckBox(this._optionsDiv, "Collisions", this._scene.collisionsEnabled, function (element) {
  23420. _this._scene.collisionsEnabled = element.checked;
  23421. });
  23422. this._generateCheckBox(this._optionsDiv, "Lights", this._scene.lightsEnabled, function (element) {
  23423. _this._scene.lightsEnabled = element.checked;
  23424. });
  23425. this._generateCheckBox(this._optionsDiv, "Textures", this._scene.texturesEnabled, function (element) {
  23426. _this._scene.texturesEnabled = element.checked;
  23427. });
  23428. this._generateCheckBox(this._optionsDiv, "Lens flares", this._scene.lensFlaresEnabled, function (element) {
  23429. _this._scene.lensFlaresEnabled = element.checked;
  23430. });
  23431. this._generateCheckBox(this._optionsDiv, "Render targets", this._scene.renderTargetsEnabled, function (element) {
  23432. _this._scene.renderTargetsEnabled = element.checked;
  23433. });
  23434. this._generateCheckBox(this._optionsDiv, "Procedural textures", this._scene.proceduralTexturesEnabled, function (element) {
  23435. _this._scene.proceduralTexturesEnabled = element.checked;
  23436. });
  23437. this._globalDiv.appendChild(this._drawingCanvas);
  23438. this._globalDiv.appendChild(this._statsDiv);
  23439. this._globalDiv.appendChild(this._logDiv);
  23440. this._globalDiv.appendChild(this._optionsDiv);
  23441. this._globalDiv.id = "Debug Layer";
  23442. this._globalDiv.style.fontFamily = "Segoe UI, Arial";
  23443. this._globalDiv.style.fontSize = "14px";
  23444. this._globalDiv.style.color = "white";
  23445. };
  23446. DebugLayer.prototype._displayStats = function () {
  23447. var scene = this._scene;
  23448. var engine = scene.getEngine();
  23449. this._statsDiv.innerHTML = "Babylon.js v" + BABYLON.Engine.Version + " - <b>" + BABYLON.Tools.Format(BABYLON.Tools.GetFps(), 0) + " fps</b><br><br>" + "Total meshes: " + scene.meshes.length + "<br>" + "Total vertices: " + scene.getTotalVertices() + "<br>" + "Active meshes: " + scene.getActiveMeshes().length + "<br>" + "Active vertices: " + scene.getActiveVertices() + "<br>" + "Active particles: " + scene.getActiveParticles() + "<br><br>" + "Frame duration: " + BABYLON.Tools.Format(scene.getLastFrameDuration()) + " ms<br>" + "<b>Draw calls: " + engine.drawCalls + "</b><br><br>" + "<i>Evaluate Active Meshes duration:</i> " + BABYLON.Tools.Format(scene.getEvaluateActiveMeshesDuration()) + " ms<br>" + "<i>Render Targets duration:</i> " + BABYLON.Tools.Format(scene.getRenderTargetsDuration()) + " ms<br>" + "<i>Particles duration:</i> " + BABYLON.Tools.Format(scene.getParticlesDuration()) + " ms<br>" + "<i>Sprites duration:</i> " + BABYLON.Tools.Format(scene.getSpritesDuration()) + " ms<br>" + "<i>Render duration:</i> <b>" + BABYLON.Tools.Format(scene.getRenderDuration()) + " ms</b>";
  23450. };
  23451. return DebugLayer;
  23452. })();
  23453. BABYLON.DebugLayer = DebugLayer;
  23454. })(BABYLON || (BABYLON = {}));
  23455. var BABYLON;
  23456. (function (BABYLON) {
  23457. var Boxels = (function () {
  23458. function Boxels() {
  23459. }
  23460. Boxels.CreateBox = function (name, size, scene, updatable) {
  23461. var box = new BABYLON.Mesh(name, scene);
  23462. var vertexData = BABYLON.Boxels.CreateBoxVertexData(size);
  23463. vertexData.applyToMesh(box, updatable);
  23464. return box;
  23465. };
  23466. Boxels.CreateBoxVertexData = function (size) {
  23467. var normalsSource = [
  23468. new BABYLON.Vector3(0, 0, 1),
  23469. new BABYLON.Vector3(0, 0, -1),
  23470. new BABYLON.Vector3(1, 0, 0),
  23471. new BABYLON.Vector3(-1, 0, 0),
  23472. new BABYLON.Vector3(0, 1, 0),
  23473. new BABYLON.Vector3(0, -1, 0)
  23474. ];
  23475. var indices = [];
  23476. var positions = [];
  23477. var normals = [];
  23478. var uvs = [];
  23479. size = size || 1;
  23480. for (var index = 0; index < normalsSource.length; index++) {
  23481. var normal = normalsSource[index];
  23482. var side1 = new BABYLON.Vector3(normal.y, normal.z, normal.x);
  23483. var side2 = BABYLON.Vector3.Cross(normal, side1);
  23484. var verticesLength = positions.length / 3;
  23485. indices.push(verticesLength);
  23486. indices.push(verticesLength + 1);
  23487. indices.push(verticesLength + 2);
  23488. indices.push(verticesLength);
  23489. indices.push(verticesLength + 2);
  23490. indices.push(verticesLength + 3);
  23491. var vertex = normal.subtract(side1).subtract(side2).scale(size / 2);
  23492. positions.push(vertex.x, vertex.y, vertex.z);
  23493. normals.push(normal.x, normal.y, normal.z);
  23494. vertex = normal.subtract(side1).add(side2).scale(size / 2);
  23495. positions.push(vertex.x, vertex.y, vertex.z);
  23496. normals.push(normal.x, normal.y, normal.z);
  23497. vertex = normal.add(side1).add(side2).scale(size / 2);
  23498. positions.push(vertex.x, vertex.y, vertex.z);
  23499. normals.push(normal.x, normal.y, normal.z);
  23500. vertex = normal.add(side1).subtract(side2).scale(size / 2);
  23501. positions.push(vertex.x, vertex.y, vertex.z);
  23502. normals.push(normal.x, normal.y, normal.z);
  23503. if (normal.x == 1) {
  23504. uvs.push(1.0, 0.0);
  23505. uvs.push(1.0, 1.0);
  23506. uvs.push(0.0, 1.0);
  23507. uvs.push(0.0, 0.0);
  23508. } else if (normal.z == 1) {
  23509. uvs.push(1.0, 1.0);
  23510. uvs.push(0.0, 1.0);
  23511. uvs.push(0.0, 0.0);
  23512. uvs.push(1.0, 0.0);
  23513. } else if (normal.x == -1) {
  23514. uvs.push(1.0, 0.0);
  23515. uvs.push(1.0, 1.0);
  23516. uvs.push(0.0, 1.0);
  23517. uvs.push(0.0, 0.0);
  23518. } else if (normal.z == -1) {
  23519. uvs.push(0.0, 0.0);
  23520. uvs.push(1.0, 0.0);
  23521. uvs.push(1.0, 1.0);
  23522. uvs.push(0.0, 1.0);
  23523. } else {
  23524. uvs.push(1.0, 1.0);
  23525. uvs.push(0.0, 1.0);
  23526. uvs.push(0.0, 0.0);
  23527. uvs.push(1.0, 0.0);
  23528. }
  23529. }
  23530. var vertexData = new BABYLON.VertexData();
  23531. vertexData.indices = indices;
  23532. vertexData.positions = positions;
  23533. vertexData.normals = normals;
  23534. vertexData.uvs = uvs;
  23535. return vertexData;
  23536. };
  23537. return Boxels;
  23538. })();
  23539. BABYLON.Boxels = Boxels;
  23540. })(BABYLON || (BABYLON = {}));