babylon.2.0-alpha.debug.js 1.2 MB

12345678910111213141516171819202122232425262728293031323334353637383940414243444546474849505152535455565758596061626364656667686970717273747576777879808182838485868788899091929394959697989910010110210310410510610710810911011111211311411511611711811912012112212312412512612712812913013113213313413513613713813914014114214314414514614714814915015115215315415515615715815916016116216316416516616716816917017117217317417517617717817918018118218318418518618718818919019119219319419519619719819920020120220320420520620720820921021121221321421521621721821922022122222322422522622722822923023123223323423523623723823924024124224324424524624724824925025125225325425525625725825926026126226326426526626726826927027127227327427527627727827928028128228328428528628728828929029129229329429529629729829930030130230330430530630730830931031131231331431531631731831932032132232332432532632732832933033133233333433533633733833934034134234334434534634734834935035135235335435535635735835936036136236336436536636736836937037137237337437537637737837938038138238338438538638738838939039139239339439539639739839940040140240340440540640740840941041141241341441541641741841942042142242342442542642742842943043143243343443543643743843944044144244344444544644744844945045145245345445545645745845946046146246346446546646746846947047147247347447547647747847948048148248348448548648748848949049149249349449549649749849950050150250350450550650750850951051151251351451551651751851952052152252352452552652752852953053153253353453553653753853954054154254354454554654754854955055155255355455555655755855956056156256356456556656756856957057157257357457557657757857958058158258358458558658758858959059159259359459559659759859960060160260360460560660760860961061161261361461561661761861962062162262362462562662762862963063163263363463563663763863964064164264364464564664764864965065165265365465565665765865966066166266366466566666766866967067167267367467567667767867968068168268368468568668768868969069169269369469569669769869970070170270370470570670770870971071171271371471571671771871972072172272372472572672772872973073173273373473573673773873974074174274374474574674774874975075175275375475575675775875976076176276376476576676776876977077177277377477577677777877978078178278378478578678778878979079179279379479579679779879980080180280380480580680780880981081181281381481581681781881982082182282382482582682782882983083183283383483583683783883984084184284384484584684784884985085185285385485585685785885986086186286386486586686786886987087187287387487587687787887988088188288388488588688788888989089189289389489589689789889990090190290390490590690790890991091191291391491591691791891992092192292392492592692792892993093193293393493593693793893994094194294394494594694794894995095195295395495595695795895996096196296396496596696796896997097197297397497597697797897998098198298398498598698798898999099199299399499599699799899910001001100210031004100510061007100810091010101110121013101410151016101710181019102010211022102310241025102610271028102910301031103210331034103510361037103810391040104110421043104410451046104710481049105010511052105310541055105610571058105910601061106210631064106510661067106810691070107110721073107410751076107710781079108010811082108310841085108610871088108910901091109210931094109510961097109810991100110111021103110411051106110711081109111011111112111311141115111611171118111911201121112211231124112511261127112811291130113111321133113411351136113711381139114011411142114311441145114611471148114911501151115211531154115511561157115811591160116111621163116411651166116711681169117011711172117311741175117611771178117911801181118211831184118511861187118811891190119111921193119411951196119711981199120012011202120312041205120612071208120912101211121212131214121512161217121812191220122112221223122412251226122712281229123012311232123312341235123612371238123912401241124212431244124512461247124812491250125112521253125412551256125712581259126012611262126312641265126612671268126912701271127212731274127512761277127812791280128112821283128412851286128712881289129012911292129312941295129612971298129913001301130213031304130513061307130813091310131113121313131413151316131713181319132013211322132313241325132613271328132913301331133213331334133513361337133813391340134113421343134413451346134713481349135013511352135313541355135613571358135913601361136213631364136513661367136813691370137113721373137413751376137713781379138013811382138313841385138613871388138913901391139213931394139513961397139813991400140114021403140414051406140714081409141014111412141314141415141614171418141914201421142214231424142514261427142814291430143114321433143414351436143714381439144014411442144314441445144614471448144914501451145214531454145514561457145814591460146114621463146414651466146714681469147014711472147314741475147614771478147914801481148214831484148514861487148814891490149114921493149414951496149714981499150015011502150315041505150615071508150915101511151215131514151515161517151815191520152115221523152415251526152715281529153015311532153315341535153615371538153915401541154215431544154515461547154815491550155115521553155415551556155715581559156015611562156315641565156615671568156915701571157215731574157515761577157815791580158115821583158415851586158715881589159015911592159315941595159615971598159916001601160216031604160516061607160816091610161116121613161416151616161716181619162016211622162316241625162616271628162916301631163216331634163516361637163816391640164116421643164416451646164716481649165016511652165316541655165616571658165916601661166216631664166516661667166816691670167116721673167416751676167716781679168016811682168316841685168616871688168916901691169216931694169516961697169816991700170117021703170417051706170717081709171017111712171317141715171617171718171917201721172217231724172517261727172817291730173117321733173417351736173717381739174017411742174317441745174617471748174917501751175217531754175517561757175817591760176117621763176417651766176717681769177017711772177317741775177617771778177917801781178217831784178517861787178817891790179117921793179417951796179717981799180018011802180318041805180618071808180918101811181218131814181518161817181818191820182118221823182418251826182718281829183018311832183318341835183618371838183918401841184218431844184518461847184818491850185118521853185418551856185718581859186018611862186318641865186618671868186918701871187218731874187518761877187818791880188118821883188418851886188718881889189018911892189318941895189618971898189919001901190219031904190519061907190819091910191119121913191419151916191719181919192019211922192319241925192619271928192919301931193219331934193519361937193819391940194119421943194419451946194719481949195019511952195319541955195619571958195919601961196219631964196519661967196819691970197119721973197419751976197719781979198019811982198319841985198619871988198919901991199219931994199519961997199819992000200120022003200420052006200720082009201020112012201320142015201620172018201920202021202220232024202520262027202820292030203120322033203420352036203720382039204020412042204320442045204620472048204920502051205220532054205520562057205820592060206120622063206420652066206720682069207020712072207320742075207620772078207920802081208220832084208520862087208820892090209120922093209420952096209720982099210021012102210321042105210621072108210921102111211221132114211521162117211821192120212121222123212421252126212721282129213021312132213321342135213621372138213921402141214221432144214521462147214821492150215121522153215421552156215721582159216021612162216321642165216621672168216921702171217221732174217521762177217821792180218121822183218421852186218721882189219021912192219321942195219621972198219922002201220222032204220522062207220822092210221122122213221422152216221722182219222022212222222322242225222622272228222922302231223222332234223522362237223822392240224122422243224422452246224722482249225022512252225322542255225622572258225922602261226222632264226522662267226822692270227122722273227422752276227722782279228022812282228322842285228622872288228922902291229222932294229522962297229822992300230123022303230423052306230723082309231023112312231323142315231623172318231923202321232223232324232523262327232823292330233123322333233423352336233723382339234023412342234323442345234623472348234923502351235223532354235523562357235823592360236123622363236423652366236723682369237023712372237323742375237623772378237923802381238223832384238523862387238823892390239123922393239423952396239723982399240024012402240324042405240624072408240924102411241224132414241524162417241824192420242124222423242424252426242724282429243024312432243324342435243624372438243924402441244224432444244524462447244824492450245124522453245424552456245724582459246024612462246324642465246624672468246924702471247224732474247524762477247824792480248124822483248424852486248724882489249024912492249324942495249624972498249925002501250225032504250525062507250825092510251125122513251425152516251725182519252025212522252325242525252625272528252925302531253225332534253525362537253825392540254125422543254425452546254725482549255025512552255325542555255625572558255925602561256225632564256525662567256825692570257125722573257425752576257725782579258025812582258325842585258625872588258925902591259225932594259525962597259825992600260126022603260426052606260726082609261026112612261326142615261626172618261926202621262226232624262526262627262826292630263126322633263426352636263726382639264026412642264326442645264626472648264926502651265226532654265526562657265826592660266126622663266426652666266726682669267026712672267326742675267626772678267926802681268226832684268526862687268826892690269126922693269426952696269726982699270027012702270327042705270627072708270927102711271227132714271527162717271827192720272127222723272427252726272727282729273027312732273327342735273627372738273927402741274227432744274527462747274827492750275127522753275427552756275727582759276027612762276327642765276627672768276927702771277227732774277527762777277827792780278127822783278427852786278727882789279027912792279327942795279627972798279928002801280228032804280528062807280828092810281128122813281428152816281728182819282028212822282328242825282628272828282928302831283228332834283528362837283828392840284128422843284428452846284728482849285028512852285328542855285628572858285928602861286228632864286528662867286828692870287128722873287428752876287728782879288028812882288328842885288628872888288928902891289228932894289528962897289828992900290129022903290429052906290729082909291029112912291329142915291629172918291929202921292229232924292529262927292829292930293129322933293429352936293729382939294029412942294329442945294629472948294929502951295229532954295529562957295829592960296129622963296429652966296729682969297029712972297329742975297629772978297929802981298229832984298529862987298829892990299129922993299429952996299729982999300030013002300330043005300630073008300930103011301230133014301530163017301830193020302130223023302430253026302730283029303030313032303330343035303630373038303930403041304230433044304530463047304830493050305130523053305430553056305730583059306030613062306330643065306630673068306930703071307230733074307530763077307830793080308130823083308430853086308730883089309030913092309330943095309630973098309931003101310231033104310531063107310831093110311131123113311431153116311731183119312031213122312331243125312631273128312931303131313231333134313531363137313831393140314131423143314431453146314731483149315031513152315331543155315631573158315931603161316231633164316531663167316831693170317131723173317431753176317731783179318031813182318331843185318631873188318931903191319231933194319531963197319831993200320132023203320432053206320732083209321032113212321332143215321632173218321932203221322232233224322532263227322832293230323132323233323432353236323732383239324032413242324332443245324632473248324932503251325232533254325532563257325832593260326132623263326432653266326732683269327032713272327332743275327632773278327932803281328232833284328532863287328832893290329132923293329432953296329732983299330033013302330333043305330633073308330933103311331233133314331533163317331833193320332133223323332433253326332733283329333033313332333333343335333633373338333933403341334233433344334533463347334833493350335133523353335433553356335733583359336033613362336333643365336633673368336933703371337233733374337533763377337833793380338133823383338433853386338733883389339033913392339333943395339633973398339934003401340234033404340534063407340834093410341134123413341434153416341734183419342034213422342334243425342634273428342934303431343234333434343534363437343834393440344134423443344434453446344734483449345034513452345334543455345634573458345934603461346234633464346534663467346834693470347134723473347434753476347734783479348034813482348334843485348634873488348934903491349234933494349534963497349834993500350135023503350435053506350735083509351035113512351335143515351635173518351935203521352235233524352535263527352835293530353135323533353435353536353735383539354035413542354335443545354635473548354935503551355235533554355535563557355835593560356135623563356435653566356735683569357035713572357335743575357635773578357935803581358235833584358535863587358835893590359135923593359435953596359735983599360036013602360336043605360636073608360936103611361236133614361536163617361836193620362136223623362436253626362736283629363036313632363336343635363636373638363936403641364236433644364536463647364836493650365136523653365436553656365736583659366036613662366336643665366636673668366936703671367236733674367536763677367836793680368136823683368436853686368736883689369036913692369336943695369636973698369937003701370237033704370537063707370837093710371137123713371437153716371737183719372037213722372337243725372637273728372937303731373237333734373537363737373837393740374137423743374437453746374737483749375037513752375337543755375637573758375937603761376237633764376537663767376837693770377137723773377437753776377737783779378037813782378337843785378637873788378937903791379237933794379537963797379837993800380138023803380438053806380738083809381038113812381338143815381638173818381938203821382238233824382538263827382838293830383138323833383438353836383738383839384038413842384338443845384638473848384938503851385238533854385538563857385838593860386138623863386438653866386738683869387038713872387338743875387638773878387938803881388238833884388538863887388838893890389138923893389438953896389738983899390039013902390339043905390639073908390939103911391239133914391539163917391839193920392139223923392439253926392739283929393039313932393339343935393639373938393939403941394239433944394539463947394839493950395139523953395439553956395739583959396039613962396339643965396639673968396939703971397239733974397539763977397839793980398139823983398439853986398739883989399039913992399339943995399639973998399940004001400240034004400540064007400840094010401140124013401440154016401740184019402040214022402340244025402640274028402940304031403240334034403540364037403840394040404140424043404440454046404740484049405040514052405340544055405640574058405940604061406240634064406540664067406840694070407140724073407440754076407740784079408040814082408340844085408640874088408940904091409240934094409540964097409840994100410141024103410441054106410741084109411041114112411341144115411641174118411941204121412241234124412541264127412841294130413141324133413441354136413741384139414041414142414341444145414641474148414941504151415241534154415541564157415841594160416141624163416441654166416741684169417041714172417341744175417641774178417941804181418241834184418541864187418841894190419141924193419441954196419741984199420042014202420342044205420642074208420942104211421242134214421542164217421842194220422142224223422442254226422742284229423042314232423342344235423642374238423942404241424242434244424542464247424842494250425142524253425442554256425742584259426042614262426342644265426642674268426942704271427242734274427542764277427842794280428142824283428442854286428742884289429042914292429342944295429642974298429943004301430243034304430543064307430843094310431143124313431443154316431743184319432043214322432343244325432643274328432943304331433243334334433543364337433843394340434143424343434443454346434743484349435043514352435343544355435643574358435943604361436243634364436543664367436843694370437143724373437443754376437743784379438043814382438343844385438643874388438943904391439243934394439543964397439843994400440144024403440444054406440744084409441044114412441344144415441644174418441944204421442244234424442544264427442844294430443144324433443444354436443744384439444044414442444344444445444644474448444944504451445244534454445544564457445844594460446144624463446444654466446744684469447044714472447344744475447644774478447944804481448244834484448544864487448844894490449144924493449444954496449744984499450045014502450345044505450645074508450945104511451245134514451545164517451845194520452145224523452445254526452745284529453045314532453345344535453645374538453945404541454245434544454545464547454845494550455145524553455445554556455745584559456045614562456345644565456645674568456945704571457245734574457545764577457845794580458145824583458445854586458745884589459045914592459345944595459645974598459946004601460246034604460546064607460846094610461146124613461446154616461746184619462046214622462346244625462646274628462946304631463246334634463546364637463846394640464146424643464446454646464746484649465046514652465346544655465646574658465946604661466246634664466546664667466846694670467146724673467446754676467746784679468046814682468346844685468646874688468946904691469246934694469546964697469846994700470147024703470447054706470747084709471047114712471347144715471647174718471947204721472247234724472547264727472847294730473147324733473447354736473747384739474047414742474347444745474647474748474947504751475247534754475547564757475847594760476147624763476447654766476747684769477047714772477347744775477647774778477947804781478247834784478547864787478847894790479147924793479447954796479747984799480048014802480348044805480648074808480948104811481248134814481548164817481848194820482148224823482448254826482748284829483048314832483348344835483648374838483948404841484248434844484548464847484848494850485148524853485448554856485748584859486048614862486348644865486648674868486948704871487248734874487548764877487848794880488148824883488448854886488748884889489048914892489348944895489648974898489949004901490249034904490549064907490849094910491149124913491449154916491749184919492049214922492349244925492649274928492949304931493249334934493549364937493849394940494149424943494449454946494749484949495049514952495349544955495649574958495949604961496249634964496549664967496849694970497149724973497449754976497749784979498049814982498349844985498649874988498949904991499249934994499549964997499849995000500150025003500450055006500750085009501050115012501350145015501650175018501950205021502250235024502550265027502850295030503150325033503450355036503750385039504050415042504350445045504650475048504950505051505250535054505550565057505850595060506150625063506450655066506750685069507050715072507350745075507650775078507950805081508250835084508550865087508850895090509150925093509450955096509750985099510051015102510351045105510651075108510951105111511251135114511551165117511851195120512151225123512451255126512751285129513051315132513351345135513651375138513951405141514251435144514551465147514851495150515151525153515451555156515751585159516051615162516351645165516651675168516951705171517251735174517551765177517851795180518151825183518451855186518751885189519051915192519351945195519651975198519952005201520252035204520552065207520852095210521152125213521452155216521752185219522052215222522352245225522652275228522952305231523252335234523552365237523852395240524152425243524452455246524752485249525052515252525352545255525652575258525952605261526252635264526552665267526852695270527152725273527452755276527752785279528052815282528352845285528652875288528952905291529252935294529552965297529852995300530153025303530453055306530753085309531053115312531353145315531653175318531953205321532253235324532553265327532853295330533153325333533453355336533753385339534053415342534353445345534653475348534953505351535253535354535553565357535853595360536153625363536453655366536753685369537053715372537353745375537653775378537953805381538253835384538553865387538853895390539153925393539453955396539753985399540054015402540354045405540654075408540954105411541254135414541554165417541854195420542154225423542454255426542754285429543054315432543354345435543654375438543954405441544254435444544554465447544854495450545154525453545454555456545754585459546054615462546354645465546654675468546954705471547254735474547554765477547854795480548154825483548454855486548754885489549054915492549354945495549654975498549955005501550255035504550555065507550855095510551155125513551455155516551755185519552055215522552355245525552655275528552955305531553255335534553555365537553855395540554155425543554455455546554755485549555055515552555355545555555655575558555955605561556255635564556555665567556855695570557155725573557455755576557755785579558055815582558355845585558655875588558955905591559255935594559555965597559855995600560156025603560456055606560756085609561056115612561356145615561656175618561956205621562256235624562556265627562856295630563156325633563456355636563756385639564056415642564356445645564656475648564956505651565256535654565556565657565856595660566156625663566456655666566756685669567056715672567356745675567656775678567956805681568256835684568556865687568856895690569156925693569456955696569756985699570057015702570357045705570657075708570957105711571257135714571557165717571857195720572157225723572457255726572757285729573057315732573357345735573657375738573957405741574257435744574557465747574857495750575157525753575457555756575757585759576057615762576357645765576657675768576957705771577257735774577557765777577857795780578157825783578457855786578757885789579057915792579357945795579657975798579958005801580258035804580558065807580858095810581158125813581458155816581758185819582058215822582358245825582658275828582958305831583258335834583558365837583858395840584158425843584458455846584758485849585058515852585358545855585658575858585958605861586258635864586558665867586858695870587158725873587458755876587758785879588058815882588358845885588658875888588958905891589258935894589558965897589858995900590159025903590459055906590759085909591059115912591359145915591659175918591959205921592259235924592559265927592859295930593159325933593459355936593759385939594059415942594359445945594659475948594959505951595259535954595559565957595859595960596159625963596459655966596759685969597059715972597359745975597659775978597959805981598259835984598559865987598859895990599159925993599459955996599759985999600060016002600360046005600660076008600960106011601260136014601560166017601860196020602160226023602460256026602760286029603060316032603360346035603660376038603960406041604260436044604560466047604860496050605160526053605460556056605760586059606060616062606360646065606660676068606960706071607260736074607560766077607860796080608160826083608460856086608760886089609060916092609360946095609660976098609961006101610261036104610561066107610861096110611161126113611461156116611761186119612061216122612361246125612661276128612961306131613261336134613561366137613861396140614161426143614461456146614761486149615061516152615361546155615661576158615961606161616261636164616561666167616861696170617161726173617461756176617761786179618061816182618361846185618661876188618961906191619261936194619561966197619861996200620162026203620462056206620762086209621062116212621362146215621662176218621962206221622262236224622562266227622862296230623162326233623462356236623762386239624062416242624362446245624662476248624962506251625262536254625562566257625862596260626162626263626462656266626762686269627062716272627362746275627662776278627962806281628262836284628562866287628862896290629162926293629462956296629762986299630063016302630363046305630663076308630963106311631263136314631563166317631863196320632163226323632463256326632763286329633063316332633363346335633663376338633963406341634263436344634563466347634863496350635163526353635463556356635763586359636063616362636363646365636663676368636963706371637263736374637563766377637863796380638163826383638463856386638763886389639063916392639363946395639663976398639964006401640264036404640564066407640864096410641164126413641464156416641764186419642064216422642364246425642664276428642964306431643264336434643564366437643864396440644164426443644464456446644764486449645064516452645364546455645664576458645964606461646264636464646564666467646864696470647164726473647464756476647764786479648064816482648364846485648664876488648964906491649264936494649564966497649864996500650165026503650465056506650765086509651065116512651365146515651665176518651965206521652265236524652565266527652865296530653165326533653465356536653765386539654065416542654365446545654665476548654965506551655265536554655565566557655865596560656165626563656465656566656765686569657065716572657365746575657665776578657965806581658265836584658565866587658865896590659165926593659465956596659765986599660066016602660366046605660666076608660966106611661266136614661566166617661866196620662166226623662466256626662766286629663066316632663366346635663666376638663966406641664266436644664566466647664866496650665166526653665466556656665766586659666066616662666366646665666666676668666966706671667266736674667566766677667866796680668166826683668466856686668766886689669066916692669366946695669666976698669967006701670267036704670567066707670867096710671167126713671467156716671767186719672067216722672367246725672667276728672967306731673267336734673567366737673867396740674167426743674467456746674767486749675067516752675367546755675667576758675967606761676267636764676567666767676867696770677167726773677467756776677767786779678067816782678367846785678667876788678967906791679267936794679567966797679867996800680168026803680468056806680768086809681068116812681368146815681668176818681968206821682268236824682568266827682868296830683168326833683468356836683768386839684068416842684368446845684668476848684968506851685268536854685568566857685868596860686168626863686468656866686768686869687068716872687368746875687668776878687968806881688268836884688568866887688868896890689168926893689468956896689768986899690069016902690369046905690669076908690969106911691269136914691569166917691869196920692169226923692469256926692769286929693069316932693369346935693669376938693969406941694269436944694569466947694869496950695169526953695469556956695769586959696069616962696369646965696669676968696969706971697269736974697569766977697869796980698169826983698469856986698769886989699069916992699369946995699669976998699970007001700270037004700570067007700870097010701170127013701470157016701770187019702070217022702370247025702670277028702970307031703270337034703570367037703870397040704170427043704470457046704770487049705070517052705370547055705670577058705970607061706270637064706570667067706870697070707170727073707470757076707770787079708070817082708370847085708670877088708970907091709270937094709570967097709870997100710171027103710471057106710771087109711071117112711371147115711671177118711971207121712271237124712571267127712871297130713171327133713471357136713771387139714071417142714371447145714671477148714971507151715271537154715571567157715871597160716171627163716471657166716771687169717071717172717371747175717671777178717971807181718271837184718571867187718871897190719171927193719471957196719771987199720072017202720372047205720672077208720972107211721272137214721572167217721872197220722172227223722472257226722772287229723072317232723372347235723672377238723972407241724272437244724572467247724872497250725172527253725472557256725772587259726072617262726372647265726672677268726972707271727272737274727572767277727872797280728172827283728472857286728772887289729072917292729372947295729672977298729973007301730273037304730573067307730873097310731173127313731473157316731773187319732073217322732373247325732673277328732973307331733273337334733573367337733873397340734173427343734473457346734773487349735073517352735373547355735673577358735973607361736273637364736573667367736873697370737173727373737473757376737773787379738073817382738373847385738673877388738973907391739273937394739573967397739873997400740174027403740474057406740774087409741074117412741374147415741674177418741974207421742274237424742574267427742874297430743174327433743474357436743774387439744074417442744374447445744674477448744974507451745274537454745574567457745874597460746174627463746474657466746774687469747074717472747374747475747674777478747974807481748274837484748574867487748874897490749174927493749474957496749774987499750075017502750375047505750675077508750975107511751275137514751575167517751875197520752175227523752475257526752775287529753075317532753375347535753675377538753975407541754275437544754575467547754875497550755175527553755475557556755775587559756075617562756375647565756675677568756975707571757275737574757575767577757875797580758175827583758475857586758775887589759075917592759375947595759675977598759976007601760276037604760576067607760876097610761176127613761476157616761776187619762076217622762376247625762676277628762976307631763276337634763576367637763876397640764176427643764476457646764776487649765076517652765376547655765676577658765976607661766276637664766576667667766876697670767176727673767476757676767776787679768076817682768376847685768676877688768976907691769276937694769576967697769876997700770177027703770477057706770777087709771077117712771377147715771677177718771977207721772277237724772577267727772877297730773177327733773477357736773777387739774077417742774377447745774677477748774977507751775277537754775577567757775877597760776177627763776477657766776777687769777077717772777377747775777677777778777977807781778277837784778577867787778877897790779177927793779477957796779777987799780078017802780378047805780678077808780978107811781278137814781578167817781878197820782178227823782478257826782778287829783078317832783378347835783678377838783978407841784278437844784578467847784878497850785178527853785478557856785778587859786078617862786378647865786678677868786978707871787278737874787578767877787878797880788178827883788478857886788778887889789078917892789378947895789678977898789979007901790279037904790579067907790879097910791179127913791479157916791779187919792079217922792379247925792679277928792979307931793279337934793579367937793879397940794179427943794479457946794779487949795079517952795379547955795679577958795979607961796279637964796579667967796879697970797179727973797479757976797779787979798079817982798379847985798679877988798979907991799279937994799579967997799879998000800180028003800480058006800780088009801080118012801380148015801680178018801980208021802280238024802580268027802880298030803180328033803480358036803780388039804080418042804380448045804680478048804980508051805280538054805580568057805880598060806180628063806480658066806780688069807080718072807380748075807680778078807980808081808280838084808580868087808880898090809180928093809480958096809780988099810081018102810381048105810681078108810981108111811281138114811581168117811881198120812181228123812481258126812781288129813081318132813381348135813681378138813981408141814281438144814581468147814881498150815181528153815481558156815781588159816081618162816381648165816681678168816981708171817281738174817581768177817881798180818181828183818481858186818781888189819081918192819381948195819681978198819982008201820282038204820582068207820882098210821182128213821482158216821782188219822082218222822382248225822682278228822982308231823282338234823582368237823882398240824182428243824482458246824782488249825082518252825382548255825682578258825982608261826282638264826582668267826882698270827182728273827482758276827782788279828082818282828382848285828682878288828982908291829282938294829582968297829882998300830183028303830483058306830783088309831083118312831383148315831683178318831983208321832283238324832583268327832883298330833183328333833483358336833783388339834083418342834383448345834683478348834983508351835283538354835583568357835883598360836183628363836483658366836783688369837083718372837383748375837683778378837983808381838283838384838583868387838883898390839183928393839483958396839783988399840084018402840384048405840684078408840984108411841284138414841584168417841884198420842184228423842484258426842784288429843084318432843384348435843684378438843984408441844284438444844584468447844884498450845184528453845484558456845784588459846084618462846384648465846684678468846984708471847284738474847584768477847884798480848184828483848484858486848784888489849084918492849384948495849684978498849985008501850285038504850585068507850885098510851185128513851485158516851785188519852085218522852385248525852685278528852985308531853285338534853585368537853885398540854185428543854485458546854785488549855085518552855385548555855685578558855985608561856285638564856585668567856885698570857185728573857485758576857785788579858085818582858385848585858685878588858985908591859285938594859585968597859885998600860186028603860486058606860786088609861086118612861386148615861686178618861986208621862286238624862586268627862886298630863186328633863486358636863786388639864086418642864386448645864686478648864986508651865286538654865586568657865886598660866186628663866486658666866786688669867086718672867386748675867686778678867986808681868286838684868586868687868886898690869186928693869486958696869786988699870087018702870387048705870687078708870987108711871287138714871587168717871887198720872187228723872487258726872787288729873087318732873387348735873687378738873987408741874287438744874587468747874887498750875187528753875487558756875787588759876087618762876387648765876687678768876987708771877287738774877587768777877887798780878187828783878487858786878787888789879087918792879387948795879687978798879988008801880288038804880588068807880888098810881188128813881488158816881788188819882088218822882388248825882688278828882988308831883288338834883588368837883888398840884188428843884488458846884788488849885088518852885388548855885688578858885988608861886288638864886588668867886888698870887188728873887488758876887788788879888088818882888388848885888688878888888988908891889288938894889588968897889888998900890189028903890489058906890789088909891089118912891389148915891689178918891989208921892289238924892589268927892889298930893189328933893489358936893789388939894089418942894389448945894689478948894989508951895289538954895589568957895889598960896189628963896489658966896789688969897089718972897389748975897689778978897989808981898289838984898589868987898889898990899189928993899489958996899789988999900090019002900390049005900690079008900990109011901290139014901590169017901890199020902190229023902490259026902790289029903090319032903390349035903690379038903990409041904290439044904590469047904890499050905190529053905490559056905790589059906090619062906390649065906690679068906990709071907290739074907590769077907890799080908190829083908490859086908790889089909090919092909390949095909690979098909991009101910291039104910591069107910891099110911191129113911491159116911791189119912091219122912391249125912691279128912991309131913291339134913591369137913891399140914191429143914491459146914791489149915091519152915391549155915691579158915991609161916291639164916591669167916891699170917191729173917491759176917791789179918091819182918391849185918691879188918991909191919291939194919591969197919891999200920192029203920492059206920792089209921092119212921392149215921692179218921992209221922292239224922592269227922892299230923192329233923492359236923792389239924092419242924392449245924692479248924992509251925292539254925592569257925892599260926192629263926492659266926792689269927092719272927392749275927692779278927992809281928292839284928592869287928892899290929192929293929492959296929792989299930093019302930393049305930693079308930993109311931293139314931593169317931893199320932193229323932493259326932793289329933093319332933393349335933693379338933993409341934293439344934593469347934893499350935193529353935493559356935793589359936093619362936393649365936693679368936993709371937293739374937593769377937893799380938193829383938493859386938793889389939093919392939393949395939693979398939994009401940294039404940594069407940894099410941194129413941494159416941794189419942094219422942394249425942694279428942994309431943294339434943594369437943894399440944194429443944494459446944794489449945094519452945394549455945694579458945994609461946294639464946594669467946894699470947194729473947494759476947794789479948094819482948394849485948694879488948994909491949294939494949594969497949894999500950195029503950495059506950795089509951095119512951395149515951695179518951995209521952295239524952595269527952895299530953195329533953495359536953795389539954095419542954395449545954695479548954995509551955295539554955595569557955895599560956195629563956495659566956795689569957095719572957395749575957695779578957995809581958295839584958595869587958895899590959195929593959495959596959795989599960096019602960396049605960696079608960996109611961296139614961596169617961896199620962196229623962496259626962796289629963096319632963396349635963696379638963996409641964296439644964596469647964896499650965196529653965496559656965796589659966096619662966396649665966696679668966996709671967296739674967596769677967896799680968196829683968496859686968796889689969096919692969396949695969696979698969997009701970297039704970597069707970897099710971197129713971497159716971797189719972097219722972397249725972697279728972997309731973297339734973597369737973897399740974197429743974497459746974797489749975097519752975397549755975697579758975997609761976297639764976597669767976897699770977197729773977497759776977797789779978097819782978397849785978697879788978997909791979297939794979597969797979897999800980198029803980498059806980798089809981098119812981398149815981698179818981998209821982298239824982598269827982898299830983198329833983498359836983798389839984098419842984398449845984698479848984998509851985298539854985598569857985898599860986198629863986498659866986798689869987098719872987398749875987698779878987998809881988298839884988598869887988898899890989198929893989498959896989798989899990099019902990399049905990699079908990999109911991299139914991599169917991899199920992199229923992499259926992799289929993099319932993399349935993699379938993999409941994299439944994599469947994899499950995199529953995499559956995799589959996099619962996399649965996699679968996999709971997299739974997599769977997899799980998199829983998499859986998799889989999099919992999399949995999699979998999910000100011000210003100041000510006100071000810009100101001110012100131001410015100161001710018100191002010021100221002310024100251002610027100281002910030100311003210033100341003510036100371003810039100401004110042100431004410045100461004710048100491005010051100521005310054100551005610057100581005910060100611006210063100641006510066100671006810069100701007110072100731007410075100761007710078100791008010081100821008310084100851008610087100881008910090100911009210093100941009510096100971009810099101001010110102101031010410105101061010710108101091011010111101121011310114101151011610117101181011910120101211012210123101241012510126101271012810129101301013110132101331013410135101361013710138101391014010141101421014310144101451014610147101481014910150101511015210153101541015510156101571015810159101601016110162101631016410165101661016710168101691017010171101721017310174101751017610177101781017910180101811018210183101841018510186101871018810189101901019110192101931019410195101961019710198101991020010201102021020310204102051020610207102081020910210102111021210213102141021510216102171021810219102201022110222102231022410225102261022710228102291023010231102321023310234102351023610237102381023910240102411024210243102441024510246102471024810249102501025110252102531025410255102561025710258102591026010261102621026310264102651026610267102681026910270102711027210273102741027510276102771027810279102801028110282102831028410285102861028710288102891029010291102921029310294102951029610297102981029910300103011030210303103041030510306103071030810309103101031110312103131031410315103161031710318103191032010321103221032310324103251032610327103281032910330103311033210333103341033510336103371033810339103401034110342103431034410345103461034710348103491035010351103521035310354103551035610357103581035910360103611036210363103641036510366103671036810369103701037110372103731037410375103761037710378103791038010381103821038310384103851038610387103881038910390103911039210393103941039510396103971039810399104001040110402104031040410405104061040710408104091041010411104121041310414104151041610417104181041910420104211042210423104241042510426104271042810429104301043110432104331043410435104361043710438104391044010441104421044310444104451044610447104481044910450104511045210453104541045510456104571045810459104601046110462104631046410465104661046710468104691047010471104721047310474104751047610477104781047910480104811048210483104841048510486104871048810489104901049110492104931049410495104961049710498104991050010501105021050310504105051050610507105081050910510105111051210513105141051510516105171051810519105201052110522105231052410525105261052710528105291053010531105321053310534105351053610537105381053910540105411054210543105441054510546105471054810549105501055110552105531055410555105561055710558105591056010561105621056310564105651056610567105681056910570105711057210573105741057510576105771057810579105801058110582105831058410585105861058710588105891059010591105921059310594105951059610597105981059910600106011060210603106041060510606106071060810609106101061110612106131061410615106161061710618106191062010621106221062310624106251062610627106281062910630106311063210633106341063510636106371063810639106401064110642106431064410645106461064710648106491065010651106521065310654106551065610657106581065910660106611066210663106641066510666106671066810669106701067110672106731067410675106761067710678106791068010681106821068310684106851068610687106881068910690106911069210693106941069510696106971069810699107001070110702107031070410705107061070710708107091071010711107121071310714107151071610717107181071910720107211072210723107241072510726107271072810729107301073110732107331073410735107361073710738107391074010741107421074310744107451074610747107481074910750107511075210753107541075510756107571075810759107601076110762107631076410765107661076710768107691077010771107721077310774107751077610777107781077910780107811078210783107841078510786107871078810789107901079110792107931079410795107961079710798107991080010801108021080310804108051080610807108081080910810108111081210813108141081510816108171081810819108201082110822108231082410825108261082710828108291083010831108321083310834108351083610837108381083910840108411084210843108441084510846108471084810849108501085110852108531085410855108561085710858108591086010861108621086310864108651086610867108681086910870108711087210873108741087510876108771087810879108801088110882108831088410885108861088710888108891089010891108921089310894108951089610897108981089910900109011090210903109041090510906109071090810909109101091110912109131091410915109161091710918109191092010921109221092310924109251092610927109281092910930109311093210933109341093510936109371093810939109401094110942109431094410945109461094710948109491095010951109521095310954109551095610957109581095910960109611096210963109641096510966109671096810969109701097110972109731097410975109761097710978109791098010981109821098310984109851098610987109881098910990109911099210993109941099510996109971099810999110001100111002110031100411005110061100711008110091101011011110121101311014110151101611017110181101911020110211102211023110241102511026110271102811029110301103111032110331103411035110361103711038110391104011041110421104311044110451104611047110481104911050110511105211053110541105511056110571105811059110601106111062110631106411065110661106711068110691107011071110721107311074110751107611077110781107911080110811108211083110841108511086110871108811089110901109111092110931109411095110961109711098110991110011101111021110311104111051110611107111081110911110111111111211113111141111511116111171111811119111201112111122111231112411125111261112711128111291113011131111321113311134111351113611137111381113911140111411114211143111441114511146111471114811149111501115111152111531115411155111561115711158111591116011161111621116311164111651116611167111681116911170111711117211173111741117511176111771117811179111801118111182111831118411185111861118711188111891119011191111921119311194111951119611197111981119911200112011120211203112041120511206112071120811209112101121111212112131121411215112161121711218112191122011221112221122311224112251122611227112281122911230112311123211233112341123511236112371123811239112401124111242112431124411245112461124711248112491125011251112521125311254112551125611257112581125911260112611126211263112641126511266112671126811269112701127111272112731127411275112761127711278112791128011281112821128311284112851128611287112881128911290112911129211293112941129511296112971129811299113001130111302113031130411305113061130711308113091131011311113121131311314113151131611317113181131911320113211132211323113241132511326113271132811329113301133111332113331133411335113361133711338113391134011341113421134311344113451134611347113481134911350113511135211353113541135511356113571135811359113601136111362113631136411365113661136711368113691137011371113721137311374113751137611377113781137911380113811138211383113841138511386113871138811389113901139111392113931139411395113961139711398113991140011401114021140311404114051140611407114081140911410114111141211413114141141511416114171141811419114201142111422114231142411425114261142711428114291143011431114321143311434114351143611437114381143911440114411144211443114441144511446114471144811449114501145111452114531145411455114561145711458114591146011461114621146311464114651146611467114681146911470114711147211473114741147511476114771147811479114801148111482114831148411485114861148711488114891149011491114921149311494114951149611497114981149911500115011150211503115041150511506115071150811509115101151111512115131151411515115161151711518115191152011521115221152311524115251152611527115281152911530115311153211533115341153511536115371153811539115401154111542115431154411545115461154711548115491155011551115521155311554115551155611557115581155911560115611156211563115641156511566115671156811569115701157111572115731157411575115761157711578115791158011581115821158311584115851158611587115881158911590115911159211593115941159511596115971159811599116001160111602116031160411605116061160711608116091161011611116121161311614116151161611617116181161911620116211162211623116241162511626116271162811629116301163111632116331163411635116361163711638116391164011641116421164311644116451164611647116481164911650116511165211653116541165511656116571165811659116601166111662116631166411665116661166711668116691167011671116721167311674116751167611677116781167911680116811168211683116841168511686116871168811689116901169111692116931169411695116961169711698116991170011701117021170311704117051170611707117081170911710117111171211713117141171511716117171171811719117201172111722117231172411725117261172711728117291173011731117321173311734117351173611737117381173911740117411174211743117441174511746117471174811749117501175111752117531175411755117561175711758117591176011761117621176311764117651176611767117681176911770117711177211773117741177511776117771177811779117801178111782117831178411785117861178711788117891179011791117921179311794117951179611797117981179911800118011180211803118041180511806118071180811809118101181111812118131181411815118161181711818118191182011821118221182311824118251182611827118281182911830118311183211833118341183511836118371183811839118401184111842118431184411845118461184711848118491185011851118521185311854118551185611857118581185911860118611186211863118641186511866118671186811869118701187111872118731187411875118761187711878118791188011881118821188311884118851188611887118881188911890118911189211893118941189511896118971189811899119001190111902119031190411905119061190711908119091191011911119121191311914119151191611917119181191911920119211192211923119241192511926119271192811929119301193111932119331193411935119361193711938119391194011941119421194311944119451194611947119481194911950119511195211953119541195511956119571195811959119601196111962119631196411965119661196711968119691197011971119721197311974119751197611977119781197911980119811198211983119841198511986119871198811989119901199111992119931199411995119961199711998119991200012001120021200312004120051200612007120081200912010120111201212013120141201512016120171201812019120201202112022120231202412025120261202712028120291203012031120321203312034120351203612037120381203912040120411204212043120441204512046120471204812049120501205112052120531205412055120561205712058120591206012061120621206312064120651206612067120681206912070120711207212073120741207512076120771207812079120801208112082120831208412085120861208712088120891209012091120921209312094120951209612097120981209912100121011210212103121041210512106121071210812109121101211112112121131211412115121161211712118121191212012121121221212312124121251212612127121281212912130121311213212133121341213512136121371213812139121401214112142121431214412145121461214712148121491215012151121521215312154121551215612157121581215912160121611216212163121641216512166121671216812169121701217112172121731217412175121761217712178121791218012181121821218312184121851218612187121881218912190121911219212193121941219512196121971219812199122001220112202122031220412205122061220712208122091221012211122121221312214122151221612217122181221912220122211222212223122241222512226122271222812229122301223112232122331223412235122361223712238122391224012241122421224312244122451224612247122481224912250122511225212253122541225512256122571225812259122601226112262122631226412265122661226712268122691227012271122721227312274122751227612277122781227912280122811228212283122841228512286122871228812289122901229112292122931229412295122961229712298122991230012301123021230312304123051230612307123081230912310123111231212313123141231512316123171231812319123201232112322123231232412325123261232712328123291233012331123321233312334123351233612337123381233912340123411234212343123441234512346123471234812349123501235112352123531235412355123561235712358123591236012361123621236312364123651236612367123681236912370123711237212373123741237512376123771237812379123801238112382123831238412385123861238712388123891239012391123921239312394123951239612397123981239912400124011240212403124041240512406124071240812409124101241112412124131241412415124161241712418124191242012421124221242312424124251242612427124281242912430124311243212433124341243512436124371243812439124401244112442124431244412445124461244712448124491245012451124521245312454124551245612457124581245912460124611246212463124641246512466124671246812469124701247112472124731247412475124761247712478124791248012481124821248312484124851248612487124881248912490124911249212493124941249512496124971249812499125001250112502125031250412505125061250712508125091251012511125121251312514125151251612517125181251912520125211252212523125241252512526125271252812529125301253112532125331253412535125361253712538125391254012541125421254312544125451254612547125481254912550125511255212553125541255512556125571255812559125601256112562125631256412565125661256712568125691257012571125721257312574125751257612577125781257912580125811258212583125841258512586125871258812589125901259112592125931259412595125961259712598125991260012601126021260312604126051260612607126081260912610126111261212613126141261512616126171261812619126201262112622126231262412625126261262712628126291263012631126321263312634126351263612637126381263912640126411264212643126441264512646126471264812649126501265112652126531265412655126561265712658126591266012661126621266312664126651266612667126681266912670126711267212673126741267512676126771267812679126801268112682126831268412685126861268712688126891269012691126921269312694126951269612697126981269912700127011270212703127041270512706127071270812709127101271112712127131271412715127161271712718127191272012721127221272312724127251272612727127281272912730127311273212733127341273512736127371273812739127401274112742127431274412745127461274712748127491275012751127521275312754127551275612757127581275912760127611276212763127641276512766127671276812769127701277112772127731277412775127761277712778127791278012781127821278312784127851278612787127881278912790127911279212793127941279512796127971279812799128001280112802128031280412805128061280712808128091281012811128121281312814128151281612817128181281912820128211282212823128241282512826128271282812829128301283112832128331283412835128361283712838128391284012841128421284312844128451284612847128481284912850128511285212853128541285512856128571285812859128601286112862128631286412865128661286712868128691287012871128721287312874128751287612877128781287912880128811288212883128841288512886128871288812889128901289112892128931289412895128961289712898128991290012901129021290312904129051290612907129081290912910129111291212913129141291512916129171291812919129201292112922129231292412925129261292712928129291293012931129321293312934129351293612937129381293912940129411294212943129441294512946129471294812949129501295112952129531295412955129561295712958129591296012961129621296312964129651296612967129681296912970129711297212973129741297512976129771297812979129801298112982129831298412985129861298712988129891299012991129921299312994129951299612997129981299913000130011300213003130041300513006130071300813009130101301113012130131301413015130161301713018130191302013021130221302313024130251302613027130281302913030130311303213033130341303513036130371303813039130401304113042130431304413045130461304713048130491305013051130521305313054130551305613057130581305913060130611306213063130641306513066130671306813069130701307113072130731307413075130761307713078130791308013081130821308313084130851308613087130881308913090130911309213093130941309513096130971309813099131001310113102131031310413105131061310713108131091311013111131121311313114131151311613117131181311913120131211312213123131241312513126131271312813129131301313113132131331313413135131361313713138131391314013141131421314313144131451314613147131481314913150131511315213153131541315513156131571315813159131601316113162131631316413165131661316713168131691317013171131721317313174131751317613177131781317913180131811318213183131841318513186131871318813189131901319113192131931319413195131961319713198131991320013201132021320313204132051320613207132081320913210132111321213213132141321513216132171321813219132201322113222132231322413225132261322713228132291323013231132321323313234132351323613237132381323913240132411324213243132441324513246132471324813249132501325113252132531325413255132561325713258132591326013261132621326313264132651326613267132681326913270132711327213273132741327513276132771327813279132801328113282132831328413285132861328713288132891329013291132921329313294132951329613297132981329913300133011330213303133041330513306133071330813309133101331113312133131331413315133161331713318133191332013321133221332313324133251332613327133281332913330133311333213333133341333513336133371333813339133401334113342133431334413345133461334713348133491335013351133521335313354133551335613357133581335913360133611336213363133641336513366133671336813369133701337113372133731337413375133761337713378133791338013381133821338313384133851338613387133881338913390133911339213393133941339513396133971339813399134001340113402134031340413405134061340713408134091341013411134121341313414134151341613417134181341913420134211342213423134241342513426134271342813429134301343113432134331343413435134361343713438134391344013441134421344313444134451344613447134481344913450134511345213453134541345513456134571345813459134601346113462134631346413465134661346713468134691347013471134721347313474134751347613477134781347913480134811348213483134841348513486134871348813489134901349113492134931349413495134961349713498134991350013501135021350313504135051350613507135081350913510135111351213513135141351513516135171351813519135201352113522135231352413525135261352713528135291353013531135321353313534135351353613537135381353913540135411354213543135441354513546135471354813549135501355113552135531355413555135561355713558135591356013561135621356313564135651356613567135681356913570135711357213573135741357513576135771357813579135801358113582135831358413585135861358713588135891359013591135921359313594135951359613597135981359913600136011360213603136041360513606136071360813609136101361113612136131361413615136161361713618136191362013621136221362313624136251362613627136281362913630136311363213633136341363513636136371363813639136401364113642136431364413645136461364713648136491365013651136521365313654136551365613657136581365913660136611366213663136641366513666136671366813669136701367113672136731367413675136761367713678136791368013681136821368313684136851368613687136881368913690136911369213693136941369513696136971369813699137001370113702137031370413705137061370713708137091371013711137121371313714137151371613717137181371913720137211372213723137241372513726137271372813729137301373113732137331373413735137361373713738137391374013741137421374313744137451374613747137481374913750137511375213753137541375513756137571375813759137601376113762137631376413765137661376713768137691377013771137721377313774137751377613777137781377913780137811378213783137841378513786137871378813789137901379113792137931379413795137961379713798137991380013801138021380313804138051380613807138081380913810138111381213813138141381513816138171381813819138201382113822138231382413825138261382713828138291383013831138321383313834138351383613837138381383913840138411384213843138441384513846138471384813849138501385113852138531385413855138561385713858138591386013861138621386313864138651386613867138681386913870138711387213873138741387513876138771387813879138801388113882138831388413885138861388713888138891389013891138921389313894138951389613897138981389913900139011390213903139041390513906139071390813909139101391113912139131391413915139161391713918139191392013921139221392313924139251392613927139281392913930139311393213933139341393513936139371393813939139401394113942139431394413945139461394713948139491395013951139521395313954139551395613957139581395913960139611396213963139641396513966139671396813969139701397113972139731397413975139761397713978139791398013981139821398313984139851398613987139881398913990139911399213993139941399513996139971399813999140001400114002140031400414005140061400714008140091401014011140121401314014140151401614017140181401914020140211402214023140241402514026140271402814029140301403114032140331403414035140361403714038140391404014041140421404314044140451404614047140481404914050140511405214053140541405514056140571405814059140601406114062140631406414065140661406714068140691407014071140721407314074140751407614077140781407914080140811408214083140841408514086140871408814089140901409114092140931409414095140961409714098140991410014101141021410314104141051410614107141081410914110141111411214113141141411514116141171411814119141201412114122141231412414125141261412714128141291413014131141321413314134141351413614137141381413914140141411414214143141441414514146141471414814149141501415114152141531415414155141561415714158141591416014161141621416314164141651416614167141681416914170141711417214173141741417514176141771417814179141801418114182141831418414185141861418714188141891419014191141921419314194141951419614197141981419914200142011420214203142041420514206142071420814209142101421114212142131421414215142161421714218142191422014221142221422314224142251422614227142281422914230142311423214233142341423514236142371423814239142401424114242142431424414245142461424714248142491425014251142521425314254142551425614257142581425914260142611426214263142641426514266142671426814269142701427114272142731427414275142761427714278142791428014281142821428314284142851428614287142881428914290142911429214293142941429514296142971429814299143001430114302143031430414305143061430714308143091431014311143121431314314143151431614317143181431914320143211432214323143241432514326143271432814329143301433114332143331433414335143361433714338143391434014341143421434314344143451434614347143481434914350143511435214353143541435514356143571435814359143601436114362143631436414365143661436714368143691437014371143721437314374143751437614377143781437914380143811438214383143841438514386143871438814389143901439114392143931439414395143961439714398143991440014401144021440314404144051440614407144081440914410144111441214413144141441514416144171441814419144201442114422144231442414425144261442714428144291443014431144321443314434144351443614437144381443914440144411444214443144441444514446144471444814449144501445114452144531445414455144561445714458144591446014461144621446314464144651446614467144681446914470144711447214473144741447514476144771447814479144801448114482144831448414485144861448714488144891449014491144921449314494144951449614497144981449914500145011450214503145041450514506145071450814509145101451114512145131451414515145161451714518145191452014521145221452314524145251452614527145281452914530145311453214533145341453514536145371453814539145401454114542145431454414545145461454714548145491455014551145521455314554145551455614557145581455914560145611456214563145641456514566145671456814569145701457114572145731457414575145761457714578145791458014581145821458314584145851458614587145881458914590145911459214593145941459514596145971459814599146001460114602146031460414605146061460714608146091461014611146121461314614146151461614617146181461914620146211462214623146241462514626146271462814629146301463114632146331463414635146361463714638146391464014641146421464314644146451464614647146481464914650146511465214653146541465514656146571465814659146601466114662146631466414665146661466714668146691467014671146721467314674146751467614677146781467914680146811468214683146841468514686146871468814689146901469114692146931469414695146961469714698146991470014701147021470314704147051470614707147081470914710147111471214713147141471514716147171471814719147201472114722147231472414725147261472714728147291473014731147321473314734147351473614737147381473914740147411474214743147441474514746147471474814749147501475114752147531475414755147561475714758147591476014761147621476314764147651476614767147681476914770147711477214773147741477514776147771477814779147801478114782147831478414785147861478714788147891479014791147921479314794147951479614797147981479914800148011480214803148041480514806148071480814809148101481114812148131481414815148161481714818148191482014821148221482314824148251482614827148281482914830148311483214833148341483514836148371483814839148401484114842148431484414845148461484714848148491485014851148521485314854148551485614857148581485914860148611486214863148641486514866148671486814869148701487114872148731487414875148761487714878148791488014881148821488314884148851488614887148881488914890148911489214893148941489514896148971489814899149001490114902149031490414905149061490714908149091491014911149121491314914149151491614917149181491914920149211492214923149241492514926149271492814929149301493114932149331493414935149361493714938149391494014941149421494314944149451494614947149481494914950149511495214953149541495514956149571495814959149601496114962149631496414965149661496714968149691497014971149721497314974149751497614977149781497914980149811498214983149841498514986149871498814989149901499114992149931499414995149961499714998149991500015001150021500315004150051500615007150081500915010150111501215013150141501515016150171501815019150201502115022150231502415025150261502715028150291503015031150321503315034150351503615037150381503915040150411504215043150441504515046150471504815049150501505115052150531505415055150561505715058150591506015061150621506315064150651506615067150681506915070150711507215073150741507515076150771507815079150801508115082150831508415085150861508715088150891509015091150921509315094150951509615097150981509915100151011510215103151041510515106151071510815109151101511115112151131511415115151161511715118151191512015121151221512315124151251512615127151281512915130151311513215133151341513515136151371513815139151401514115142151431514415145151461514715148151491515015151151521515315154151551515615157151581515915160151611516215163151641516515166151671516815169151701517115172151731517415175151761517715178151791518015181151821518315184151851518615187151881518915190151911519215193151941519515196151971519815199152001520115202152031520415205152061520715208152091521015211152121521315214152151521615217152181521915220152211522215223152241522515226152271522815229152301523115232152331523415235152361523715238152391524015241152421524315244152451524615247152481524915250152511525215253152541525515256152571525815259152601526115262152631526415265152661526715268152691527015271152721527315274152751527615277152781527915280152811528215283152841528515286152871528815289152901529115292152931529415295152961529715298152991530015301153021530315304153051530615307153081530915310153111531215313153141531515316153171531815319153201532115322153231532415325153261532715328153291533015331153321533315334153351533615337153381533915340153411534215343153441534515346153471534815349153501535115352153531535415355153561535715358153591536015361153621536315364153651536615367153681536915370153711537215373153741537515376153771537815379153801538115382153831538415385153861538715388153891539015391153921539315394153951539615397153981539915400154011540215403154041540515406154071540815409154101541115412154131541415415154161541715418154191542015421154221542315424154251542615427154281542915430154311543215433154341543515436154371543815439154401544115442154431544415445154461544715448154491545015451154521545315454154551545615457154581545915460154611546215463154641546515466154671546815469154701547115472154731547415475154761547715478154791548015481154821548315484154851548615487154881548915490154911549215493154941549515496154971549815499155001550115502155031550415505155061550715508155091551015511155121551315514155151551615517155181551915520155211552215523155241552515526155271552815529155301553115532155331553415535155361553715538155391554015541155421554315544155451554615547155481554915550155511555215553155541555515556155571555815559155601556115562155631556415565155661556715568155691557015571155721557315574155751557615577155781557915580155811558215583155841558515586155871558815589155901559115592155931559415595155961559715598155991560015601156021560315604156051560615607156081560915610156111561215613156141561515616156171561815619156201562115622156231562415625156261562715628156291563015631156321563315634156351563615637156381563915640156411564215643156441564515646156471564815649156501565115652156531565415655156561565715658156591566015661156621566315664156651566615667156681566915670156711567215673156741567515676156771567815679156801568115682156831568415685156861568715688156891569015691156921569315694156951569615697156981569915700157011570215703157041570515706157071570815709157101571115712157131571415715157161571715718157191572015721157221572315724157251572615727157281572915730157311573215733157341573515736157371573815739157401574115742157431574415745157461574715748157491575015751157521575315754157551575615757157581575915760157611576215763157641576515766157671576815769157701577115772157731577415775157761577715778157791578015781157821578315784157851578615787157881578915790157911579215793157941579515796157971579815799158001580115802158031580415805158061580715808158091581015811158121581315814158151581615817158181581915820158211582215823158241582515826158271582815829158301583115832158331583415835158361583715838158391584015841158421584315844158451584615847158481584915850158511585215853158541585515856158571585815859158601586115862158631586415865158661586715868158691587015871158721587315874158751587615877158781587915880158811588215883158841588515886158871588815889158901589115892158931589415895158961589715898158991590015901159021590315904159051590615907159081590915910159111591215913159141591515916159171591815919159201592115922159231592415925159261592715928159291593015931159321593315934159351593615937159381593915940159411594215943159441594515946159471594815949159501595115952159531595415955159561595715958159591596015961159621596315964159651596615967159681596915970159711597215973159741597515976159771597815979159801598115982159831598415985159861598715988159891599015991159921599315994159951599615997159981599916000160011600216003160041600516006160071600816009160101601116012160131601416015160161601716018160191602016021160221602316024160251602616027160281602916030160311603216033160341603516036160371603816039160401604116042160431604416045160461604716048160491605016051160521605316054160551605616057160581605916060160611606216063160641606516066160671606816069160701607116072160731607416075160761607716078160791608016081160821608316084160851608616087160881608916090160911609216093160941609516096160971609816099161001610116102161031610416105161061610716108161091611016111161121611316114161151611616117161181611916120161211612216123161241612516126161271612816129161301613116132161331613416135161361613716138161391614016141161421614316144161451614616147161481614916150161511615216153161541615516156161571615816159161601616116162161631616416165161661616716168161691617016171161721617316174161751617616177161781617916180161811618216183161841618516186161871618816189161901619116192161931619416195161961619716198161991620016201162021620316204162051620616207162081620916210162111621216213162141621516216162171621816219162201622116222162231622416225162261622716228162291623016231162321623316234162351623616237162381623916240162411624216243162441624516246162471624816249162501625116252162531625416255162561625716258162591626016261162621626316264162651626616267162681626916270162711627216273162741627516276162771627816279162801628116282162831628416285162861628716288162891629016291162921629316294162951629616297162981629916300163011630216303163041630516306163071630816309163101631116312163131631416315163161631716318163191632016321163221632316324163251632616327163281632916330163311633216333163341633516336163371633816339163401634116342163431634416345163461634716348163491635016351163521635316354163551635616357163581635916360163611636216363163641636516366163671636816369163701637116372163731637416375163761637716378163791638016381163821638316384163851638616387163881638916390163911639216393163941639516396163971639816399164001640116402164031640416405164061640716408164091641016411164121641316414164151641616417164181641916420164211642216423164241642516426164271642816429164301643116432164331643416435164361643716438164391644016441164421644316444164451644616447164481644916450164511645216453164541645516456164571645816459164601646116462164631646416465164661646716468164691647016471164721647316474164751647616477164781647916480164811648216483164841648516486164871648816489164901649116492164931649416495164961649716498164991650016501165021650316504165051650616507165081650916510165111651216513165141651516516165171651816519165201652116522165231652416525165261652716528165291653016531165321653316534165351653616537165381653916540165411654216543165441654516546165471654816549165501655116552165531655416555165561655716558165591656016561165621656316564165651656616567165681656916570165711657216573165741657516576165771657816579165801658116582165831658416585165861658716588165891659016591165921659316594165951659616597165981659916600166011660216603166041660516606166071660816609166101661116612166131661416615166161661716618166191662016621166221662316624166251662616627166281662916630166311663216633166341663516636166371663816639166401664116642166431664416645166461664716648166491665016651166521665316654166551665616657166581665916660166611666216663166641666516666166671666816669166701667116672166731667416675166761667716678166791668016681166821668316684166851668616687166881668916690166911669216693166941669516696166971669816699167001670116702167031670416705167061670716708167091671016711167121671316714167151671616717167181671916720167211672216723167241672516726167271672816729167301673116732167331673416735167361673716738167391674016741167421674316744167451674616747167481674916750167511675216753167541675516756167571675816759167601676116762167631676416765167661676716768167691677016771167721677316774167751677616777167781677916780167811678216783167841678516786167871678816789167901679116792167931679416795167961679716798167991680016801168021680316804168051680616807168081680916810168111681216813168141681516816168171681816819168201682116822168231682416825168261682716828168291683016831168321683316834168351683616837168381683916840168411684216843168441684516846168471684816849168501685116852168531685416855168561685716858168591686016861168621686316864168651686616867168681686916870168711687216873168741687516876168771687816879168801688116882168831688416885168861688716888168891689016891168921689316894168951689616897168981689916900169011690216903169041690516906169071690816909169101691116912169131691416915169161691716918169191692016921169221692316924169251692616927169281692916930169311693216933169341693516936169371693816939169401694116942169431694416945169461694716948169491695016951169521695316954169551695616957169581695916960169611696216963169641696516966169671696816969169701697116972169731697416975169761697716978169791698016981169821698316984169851698616987169881698916990169911699216993169941699516996169971699816999170001700117002170031700417005170061700717008170091701017011170121701317014170151701617017170181701917020170211702217023170241702517026170271702817029170301703117032170331703417035170361703717038170391704017041170421704317044170451704617047170481704917050170511705217053170541705517056170571705817059170601706117062170631706417065170661706717068170691707017071170721707317074170751707617077170781707917080170811708217083170841708517086170871708817089170901709117092170931709417095170961709717098170991710017101171021710317104171051710617107171081710917110171111711217113171141711517116171171711817119171201712117122171231712417125171261712717128171291713017131171321713317134171351713617137171381713917140171411714217143171441714517146171471714817149171501715117152171531715417155171561715717158171591716017161171621716317164171651716617167171681716917170171711717217173171741717517176171771717817179171801718117182171831718417185171861718717188171891719017191171921719317194171951719617197171981719917200172011720217203172041720517206172071720817209172101721117212172131721417215172161721717218172191722017221172221722317224172251722617227172281722917230172311723217233172341723517236172371723817239172401724117242172431724417245172461724717248172491725017251172521725317254172551725617257172581725917260172611726217263172641726517266172671726817269172701727117272172731727417275172761727717278172791728017281172821728317284172851728617287172881728917290172911729217293172941729517296172971729817299173001730117302173031730417305173061730717308173091731017311173121731317314173151731617317173181731917320173211732217323173241732517326173271732817329173301733117332173331733417335173361733717338173391734017341173421734317344173451734617347173481734917350173511735217353173541735517356173571735817359173601736117362173631736417365173661736717368173691737017371173721737317374173751737617377173781737917380173811738217383173841738517386173871738817389173901739117392173931739417395173961739717398173991740017401174021740317404174051740617407174081740917410174111741217413174141741517416174171741817419174201742117422174231742417425174261742717428174291743017431174321743317434174351743617437174381743917440174411744217443174441744517446174471744817449174501745117452174531745417455174561745717458174591746017461174621746317464174651746617467174681746917470174711747217473174741747517476174771747817479174801748117482174831748417485174861748717488174891749017491174921749317494174951749617497174981749917500175011750217503175041750517506175071750817509175101751117512175131751417515175161751717518175191752017521175221752317524175251752617527175281752917530175311753217533175341753517536175371753817539175401754117542175431754417545175461754717548175491755017551175521755317554175551755617557175581755917560175611756217563175641756517566175671756817569175701757117572175731757417575175761757717578175791758017581175821758317584175851758617587175881758917590175911759217593175941759517596175971759817599176001760117602176031760417605176061760717608176091761017611176121761317614176151761617617176181761917620176211762217623176241762517626176271762817629176301763117632176331763417635176361763717638176391764017641176421764317644176451764617647176481764917650176511765217653176541765517656176571765817659176601766117662176631766417665176661766717668176691767017671176721767317674176751767617677176781767917680176811768217683176841768517686176871768817689176901769117692176931769417695176961769717698176991770017701177021770317704177051770617707177081770917710177111771217713177141771517716177171771817719177201772117722177231772417725177261772717728177291773017731177321773317734177351773617737177381773917740177411774217743177441774517746177471774817749177501775117752177531775417755177561775717758177591776017761177621776317764177651776617767177681776917770177711777217773177741777517776177771777817779177801778117782177831778417785177861778717788177891779017791177921779317794177951779617797177981779917800178011780217803178041780517806178071780817809178101781117812178131781417815178161781717818178191782017821178221782317824178251782617827178281782917830178311783217833178341783517836178371783817839178401784117842178431784417845178461784717848178491785017851178521785317854178551785617857178581785917860178611786217863178641786517866178671786817869178701787117872178731787417875178761787717878178791788017881178821788317884178851788617887178881788917890178911789217893178941789517896178971789817899179001790117902179031790417905179061790717908179091791017911179121791317914179151791617917179181791917920179211792217923179241792517926179271792817929179301793117932179331793417935179361793717938179391794017941179421794317944179451794617947179481794917950179511795217953179541795517956179571795817959179601796117962179631796417965179661796717968179691797017971179721797317974179751797617977179781797917980179811798217983179841798517986179871798817989179901799117992179931799417995179961799717998179991800018001180021800318004180051800618007180081800918010180111801218013180141801518016180171801818019180201802118022180231802418025180261802718028180291803018031180321803318034180351803618037180381803918040180411804218043180441804518046180471804818049180501805118052180531805418055180561805718058180591806018061180621806318064180651806618067180681806918070180711807218073180741807518076180771807818079180801808118082180831808418085180861808718088180891809018091180921809318094180951809618097180981809918100181011810218103181041810518106181071810818109181101811118112181131811418115181161811718118181191812018121181221812318124181251812618127181281812918130181311813218133181341813518136181371813818139181401814118142181431814418145181461814718148181491815018151181521815318154181551815618157181581815918160181611816218163181641816518166181671816818169181701817118172181731817418175181761817718178181791818018181181821818318184181851818618187181881818918190181911819218193181941819518196181971819818199182001820118202182031820418205182061820718208182091821018211182121821318214182151821618217182181821918220182211822218223182241822518226182271822818229182301823118232182331823418235182361823718238182391824018241182421824318244182451824618247182481824918250182511825218253182541825518256182571825818259182601826118262182631826418265182661826718268182691827018271182721827318274182751827618277182781827918280182811828218283182841828518286182871828818289182901829118292182931829418295182961829718298182991830018301183021830318304183051830618307183081830918310183111831218313183141831518316183171831818319183201832118322183231832418325183261832718328183291833018331183321833318334183351833618337183381833918340183411834218343183441834518346183471834818349183501835118352183531835418355183561835718358183591836018361183621836318364183651836618367183681836918370183711837218373183741837518376183771837818379183801838118382183831838418385183861838718388183891839018391183921839318394183951839618397183981839918400184011840218403184041840518406184071840818409184101841118412184131841418415184161841718418184191842018421184221842318424184251842618427184281842918430184311843218433184341843518436184371843818439184401844118442184431844418445184461844718448184491845018451184521845318454184551845618457184581845918460184611846218463184641846518466184671846818469184701847118472184731847418475184761847718478184791848018481184821848318484184851848618487184881848918490184911849218493184941849518496184971849818499185001850118502185031850418505185061850718508185091851018511185121851318514185151851618517185181851918520185211852218523185241852518526185271852818529185301853118532185331853418535185361853718538185391854018541185421854318544185451854618547185481854918550185511855218553185541855518556185571855818559185601856118562185631856418565185661856718568185691857018571185721857318574185751857618577185781857918580185811858218583185841858518586185871858818589185901859118592185931859418595185961859718598185991860018601186021860318604186051860618607186081860918610186111861218613186141861518616186171861818619186201862118622186231862418625186261862718628186291863018631186321863318634186351863618637186381863918640186411864218643186441864518646186471864818649186501865118652186531865418655186561865718658186591866018661186621866318664186651866618667186681866918670186711867218673186741867518676186771867818679186801868118682186831868418685186861868718688186891869018691186921869318694186951869618697186981869918700187011870218703187041870518706187071870818709187101871118712187131871418715187161871718718187191872018721187221872318724187251872618727187281872918730187311873218733187341873518736187371873818739187401874118742187431874418745187461874718748187491875018751187521875318754187551875618757187581875918760187611876218763187641876518766187671876818769187701877118772187731877418775187761877718778187791878018781187821878318784187851878618787187881878918790187911879218793187941879518796187971879818799188001880118802188031880418805188061880718808188091881018811188121881318814188151881618817188181881918820188211882218823188241882518826188271882818829188301883118832188331883418835188361883718838188391884018841188421884318844188451884618847188481884918850188511885218853188541885518856188571885818859188601886118862188631886418865188661886718868188691887018871188721887318874188751887618877188781887918880188811888218883188841888518886188871888818889188901889118892188931889418895188961889718898188991890018901189021890318904189051890618907189081890918910189111891218913189141891518916189171891818919189201892118922189231892418925189261892718928189291893018931189321893318934189351893618937189381893918940189411894218943189441894518946189471894818949189501895118952189531895418955189561895718958189591896018961189621896318964189651896618967189681896918970189711897218973189741897518976189771897818979189801898118982189831898418985189861898718988189891899018991189921899318994189951899618997189981899919000190011900219003190041900519006190071900819009190101901119012190131901419015190161901719018190191902019021190221902319024190251902619027190281902919030190311903219033190341903519036190371903819039190401904119042190431904419045190461904719048190491905019051190521905319054190551905619057190581905919060190611906219063190641906519066190671906819069190701907119072190731907419075190761907719078190791908019081190821908319084190851908619087190881908919090190911909219093190941909519096190971909819099191001910119102191031910419105191061910719108191091911019111191121911319114191151911619117191181911919120191211912219123191241912519126191271912819129191301913119132191331913419135191361913719138191391914019141191421914319144191451914619147191481914919150191511915219153191541915519156191571915819159191601916119162191631916419165191661916719168191691917019171191721917319174191751917619177191781917919180191811918219183191841918519186191871918819189191901919119192191931919419195191961919719198191991920019201192021920319204192051920619207192081920919210192111921219213192141921519216192171921819219192201922119222192231922419225192261922719228192291923019231192321923319234192351923619237192381923919240192411924219243192441924519246192471924819249192501925119252192531925419255192561925719258192591926019261192621926319264192651926619267192681926919270192711927219273192741927519276192771927819279192801928119282192831928419285192861928719288192891929019291192921929319294192951929619297192981929919300193011930219303193041930519306193071930819309193101931119312193131931419315193161931719318193191932019321193221932319324193251932619327193281932919330193311933219333193341933519336193371933819339193401934119342193431934419345193461934719348193491935019351193521935319354193551935619357193581935919360193611936219363193641936519366193671936819369193701937119372193731937419375193761937719378193791938019381193821938319384193851938619387193881938919390193911939219393193941939519396193971939819399194001940119402194031940419405194061940719408194091941019411194121941319414194151941619417194181941919420194211942219423194241942519426194271942819429194301943119432194331943419435194361943719438194391944019441194421944319444194451944619447194481944919450194511945219453194541945519456194571945819459194601946119462194631946419465194661946719468194691947019471194721947319474194751947619477194781947919480194811948219483194841948519486194871948819489194901949119492194931949419495194961949719498194991950019501195021950319504195051950619507195081950919510195111951219513195141951519516195171951819519195201952119522195231952419525195261952719528195291953019531195321953319534195351953619537195381953919540195411954219543195441954519546195471954819549195501955119552195531955419555195561955719558195591956019561195621956319564195651956619567195681956919570195711957219573195741957519576195771957819579195801958119582195831958419585195861958719588195891959019591195921959319594195951959619597195981959919600196011960219603196041960519606196071960819609196101961119612196131961419615196161961719618196191962019621196221962319624196251962619627196281962919630196311963219633196341963519636196371963819639196401964119642196431964419645196461964719648196491965019651196521965319654196551965619657196581965919660196611966219663196641966519666196671966819669196701967119672196731967419675196761967719678196791968019681196821968319684196851968619687196881968919690196911969219693196941969519696196971969819699197001970119702197031970419705197061970719708197091971019711197121971319714197151971619717197181971919720197211972219723197241972519726197271972819729197301973119732197331973419735197361973719738197391974019741197421974319744197451974619747197481974919750197511975219753197541975519756197571975819759197601976119762197631976419765197661976719768197691977019771197721977319774197751977619777197781977919780197811978219783197841978519786197871978819789197901979119792197931979419795197961979719798197991980019801198021980319804198051980619807198081980919810198111981219813198141981519816198171981819819198201982119822198231982419825198261982719828198291983019831198321983319834198351983619837198381983919840198411984219843198441984519846198471984819849198501985119852198531985419855198561985719858198591986019861198621986319864198651986619867198681986919870198711987219873198741987519876198771987819879198801988119882198831988419885198861988719888198891989019891198921989319894198951989619897198981989919900199011990219903199041990519906199071990819909199101991119912199131991419915199161991719918199191992019921199221992319924199251992619927199281992919930199311993219933199341993519936199371993819939199401994119942199431994419945199461994719948199491995019951199521995319954199551995619957199581995919960199611996219963199641996519966199671996819969199701997119972199731997419975199761997719978199791998019981199821998319984199851998619987199881998919990199911999219993199941999519996199971999819999200002000120002200032000420005200062000720008200092001020011200122001320014200152001620017200182001920020200212002220023200242002520026200272002820029200302003120032200332003420035200362003720038200392004020041200422004320044200452004620047200482004920050200512005220053200542005520056200572005820059200602006120062200632006420065200662006720068200692007020071200722007320074200752007620077200782007920080200812008220083200842008520086200872008820089200902009120092200932009420095200962009720098200992010020101201022010320104201052010620107201082010920110201112011220113201142011520116201172011820119201202012120122201232012420125201262012720128201292013020131201322013320134201352013620137201382013920140201412014220143201442014520146201472014820149201502015120152201532015420155201562015720158201592016020161201622016320164201652016620167201682016920170201712017220173201742017520176201772017820179201802018120182201832018420185201862018720188201892019020191201922019320194201952019620197201982019920200202012020220203202042020520206202072020820209202102021120212202132021420215202162021720218202192022020221202222022320224202252022620227202282022920230202312023220233202342023520236202372023820239202402024120242202432024420245202462024720248202492025020251202522025320254202552025620257202582025920260202612026220263202642026520266202672026820269202702027120272202732027420275202762027720278202792028020281202822028320284202852028620287202882028920290202912029220293202942029520296202972029820299203002030120302203032030420305203062030720308203092031020311203122031320314203152031620317203182031920320203212032220323203242032520326203272032820329203302033120332203332033420335203362033720338203392034020341203422034320344203452034620347203482034920350203512035220353203542035520356203572035820359203602036120362203632036420365203662036720368203692037020371203722037320374203752037620377203782037920380203812038220383203842038520386203872038820389203902039120392203932039420395203962039720398203992040020401204022040320404204052040620407204082040920410204112041220413204142041520416204172041820419204202042120422204232042420425204262042720428204292043020431204322043320434204352043620437204382043920440204412044220443204442044520446204472044820449204502045120452204532045420455204562045720458204592046020461204622046320464204652046620467204682046920470204712047220473204742047520476204772047820479204802048120482204832048420485204862048720488204892049020491204922049320494204952049620497204982049920500205012050220503205042050520506205072050820509205102051120512205132051420515205162051720518205192052020521205222052320524205252052620527205282052920530205312053220533205342053520536205372053820539205402054120542205432054420545205462054720548205492055020551205522055320554205552055620557205582055920560205612056220563205642056520566205672056820569205702057120572205732057420575205762057720578205792058020581205822058320584205852058620587205882058920590205912059220593205942059520596205972059820599206002060120602206032060420605206062060720608206092061020611206122061320614206152061620617206182061920620206212062220623206242062520626206272062820629206302063120632206332063420635206362063720638206392064020641206422064320644206452064620647206482064920650206512065220653206542065520656206572065820659206602066120662206632066420665206662066720668206692067020671206722067320674206752067620677206782067920680206812068220683206842068520686206872068820689206902069120692206932069420695206962069720698206992070020701207022070320704207052070620707207082070920710207112071220713207142071520716207172071820719207202072120722207232072420725207262072720728207292073020731207322073320734207352073620737207382073920740207412074220743207442074520746207472074820749207502075120752207532075420755207562075720758207592076020761207622076320764207652076620767207682076920770207712077220773207742077520776207772077820779207802078120782207832078420785207862078720788207892079020791207922079320794207952079620797207982079920800208012080220803208042080520806208072080820809208102081120812208132081420815208162081720818208192082020821208222082320824208252082620827208282082920830208312083220833208342083520836208372083820839208402084120842208432084420845208462084720848208492085020851208522085320854208552085620857208582085920860208612086220863208642086520866208672086820869208702087120872208732087420875208762087720878208792088020881208822088320884208852088620887208882088920890208912089220893208942089520896208972089820899209002090120902209032090420905209062090720908209092091020911209122091320914209152091620917209182091920920209212092220923209242092520926209272092820929209302093120932209332093420935209362093720938209392094020941209422094320944209452094620947209482094920950209512095220953209542095520956209572095820959209602096120962209632096420965209662096720968209692097020971209722097320974209752097620977209782097920980209812098220983209842098520986209872098820989209902099120992209932099420995209962099720998209992100021001210022100321004210052100621007210082100921010210112101221013210142101521016210172101821019210202102121022210232102421025210262102721028210292103021031210322103321034210352103621037210382103921040210412104221043210442104521046210472104821049210502105121052210532105421055210562105721058210592106021061210622106321064210652106621067210682106921070210712107221073210742107521076210772107821079210802108121082210832108421085210862108721088210892109021091210922109321094210952109621097210982109921100211012110221103211042110521106211072110821109211102111121112211132111421115211162111721118211192112021121211222112321124211252112621127211282112921130211312113221133211342113521136211372113821139211402114121142211432114421145211462114721148211492115021151211522115321154211552115621157211582115921160211612116221163211642116521166211672116821169211702117121172211732117421175211762117721178211792118021181211822118321184211852118621187211882118921190211912119221193211942119521196211972119821199212002120121202212032120421205212062120721208212092121021211212122121321214212152121621217212182121921220212212122221223212242122521226212272122821229212302123121232212332123421235212362123721238212392124021241212422124321244212452124621247212482124921250212512125221253212542125521256212572125821259212602126121262212632126421265212662126721268212692127021271212722127321274212752127621277212782127921280212812128221283212842128521286212872128821289212902129121292212932129421295212962129721298212992130021301213022130321304213052130621307213082130921310213112131221313213142131521316213172131821319213202132121322213232132421325213262132721328213292133021331213322133321334213352133621337213382133921340213412134221343213442134521346213472134821349213502135121352213532135421355213562135721358213592136021361213622136321364213652136621367213682136921370213712137221373213742137521376213772137821379213802138121382213832138421385213862138721388213892139021391213922139321394213952139621397213982139921400214012140221403214042140521406214072140821409214102141121412214132141421415214162141721418214192142021421214222142321424214252142621427214282142921430214312143221433214342143521436214372143821439214402144121442214432144421445214462144721448214492145021451214522145321454214552145621457214582145921460214612146221463214642146521466214672146821469214702147121472214732147421475214762147721478214792148021481214822148321484214852148621487214882148921490214912149221493214942149521496214972149821499215002150121502215032150421505215062150721508215092151021511215122151321514215152151621517215182151921520215212152221523215242152521526215272152821529215302153121532215332153421535215362153721538215392154021541215422154321544215452154621547215482154921550215512155221553215542155521556215572155821559215602156121562215632156421565215662156721568215692157021571215722157321574215752157621577215782157921580215812158221583215842158521586215872158821589215902159121592215932159421595215962159721598215992160021601216022160321604216052160621607216082160921610216112161221613216142161521616216172161821619216202162121622216232162421625216262162721628216292163021631216322163321634216352163621637216382163921640216412164221643216442164521646216472164821649216502165121652216532165421655216562165721658216592166021661216622166321664216652166621667216682166921670216712167221673216742167521676216772167821679216802168121682216832168421685216862168721688216892169021691216922169321694216952169621697216982169921700217012170221703217042170521706217072170821709217102171121712217132171421715217162171721718217192172021721217222172321724217252172621727217282172921730217312173221733217342173521736217372173821739217402174121742217432174421745217462174721748217492175021751217522175321754217552175621757217582175921760217612176221763217642176521766217672176821769217702177121772217732177421775217762177721778217792178021781217822178321784217852178621787217882178921790217912179221793217942179521796217972179821799218002180121802218032180421805218062180721808218092181021811218122181321814218152181621817218182181921820218212182221823218242182521826218272182821829218302183121832218332183421835218362183721838218392184021841218422184321844218452184621847218482184921850218512185221853218542185521856218572185821859218602186121862218632186421865218662186721868218692187021871218722187321874218752187621877218782187921880218812188221883218842188521886218872188821889218902189121892218932189421895218962189721898218992190021901219022190321904219052190621907219082190921910219112191221913219142191521916219172191821919219202192121922219232192421925219262192721928219292193021931219322193321934219352193621937219382193921940219412194221943219442194521946219472194821949219502195121952219532195421955219562195721958219592196021961219622196321964219652196621967219682196921970219712197221973219742197521976219772197821979219802198121982219832198421985219862198721988219892199021991219922199321994219952199621997219982199922000220012200222003220042200522006220072200822009220102201122012220132201422015220162201722018220192202022021220222202322024220252202622027220282202922030220312203222033220342203522036220372203822039220402204122042220432204422045220462204722048220492205022051220522205322054220552205622057220582205922060220612206222063220642206522066220672206822069220702207122072220732207422075220762207722078220792208022081220822208322084220852208622087220882208922090220912209222093220942209522096220972209822099221002210122102221032210422105221062210722108221092211022111221122211322114221152211622117221182211922120221212212222123221242212522126221272212822129221302213122132221332213422135221362213722138221392214022141221422214322144221452214622147221482214922150221512215222153221542215522156221572215822159221602216122162221632216422165221662216722168221692217022171221722217322174221752217622177221782217922180221812218222183221842218522186221872218822189221902219122192221932219422195221962219722198221992220022201222022220322204222052220622207222082220922210222112221222213222142221522216222172221822219222202222122222222232222422225222262222722228222292223022231222322223322234222352223622237222382223922240222412224222243222442224522246222472224822249222502225122252222532225422255222562225722258222592226022261222622226322264222652226622267222682226922270222712227222273222742227522276222772227822279222802228122282222832228422285222862228722288222892229022291222922229322294222952229622297222982229922300223012230222303223042230522306223072230822309223102231122312223132231422315223162231722318223192232022321223222232322324223252232622327223282232922330223312233222333223342233522336223372233822339223402234122342223432234422345223462234722348223492235022351223522235322354223552235622357223582235922360223612236222363223642236522366223672236822369223702237122372223732237422375223762237722378223792238022381223822238322384223852238622387223882238922390223912239222393223942239522396223972239822399224002240122402224032240422405224062240722408224092241022411224122241322414224152241622417224182241922420224212242222423224242242522426224272242822429224302243122432224332243422435224362243722438224392244022441224422244322444224452244622447224482244922450224512245222453224542245522456224572245822459224602246122462224632246422465224662246722468224692247022471224722247322474224752247622477224782247922480224812248222483224842248522486224872248822489224902249122492224932249422495224962249722498224992250022501225022250322504225052250622507225082250922510225112251222513225142251522516225172251822519225202252122522225232252422525225262252722528225292253022531225322253322534225352253622537225382253922540225412254222543225442254522546225472254822549225502255122552225532255422555225562255722558225592256022561225622256322564225652256622567225682256922570225712257222573225742257522576225772257822579225802258122582225832258422585225862258722588225892259022591225922259322594225952259622597225982259922600226012260222603226042260522606226072260822609226102261122612226132261422615226162261722618226192262022621226222262322624226252262622627226282262922630226312263222633226342263522636226372263822639226402264122642226432264422645226462264722648226492265022651226522265322654226552265622657226582265922660226612266222663226642266522666226672266822669226702267122672226732267422675226762267722678226792268022681226822268322684226852268622687226882268922690226912269222693226942269522696226972269822699227002270122702227032270422705227062270722708227092271022711227122271322714227152271622717227182271922720227212272222723227242272522726227272272822729227302273122732227332273422735227362273722738227392274022741227422274322744227452274622747227482274922750227512275222753227542275522756227572275822759227602276122762227632276422765227662276722768227692277022771227722277322774227752277622777227782277922780227812278222783227842278522786227872278822789227902279122792227932279422795227962279722798227992280022801228022280322804228052280622807228082280922810228112281222813228142281522816228172281822819228202282122822228232282422825228262282722828228292283022831228322283322834228352283622837228382283922840228412284222843228442284522846228472284822849228502285122852228532285422855228562285722858228592286022861228622286322864228652286622867228682286922870228712287222873228742287522876228772287822879228802288122882228832288422885228862288722888228892289022891228922289322894228952289622897228982289922900229012290222903229042290522906229072290822909229102291122912229132291422915229162291722918229192292022921229222292322924229252292622927229282292922930229312293222933229342293522936229372293822939229402294122942229432294422945229462294722948229492295022951229522295322954229552295622957229582295922960229612296222963229642296522966229672296822969229702297122972229732297422975229762297722978229792298022981229822298322984229852298622987229882298922990229912299222993229942299522996229972299822999230002300123002230032300423005230062300723008230092301023011230122301323014230152301623017230182301923020230212302223023230242302523026230272302823029230302303123032230332303423035230362303723038230392304023041230422304323044230452304623047230482304923050230512305223053230542305523056230572305823059230602306123062230632306423065230662306723068230692307023071230722307323074230752307623077230782307923080230812308223083230842308523086230872308823089230902309123092230932309423095230962309723098230992310023101231022310323104231052310623107231082310923110231112311223113231142311523116231172311823119231202312123122231232312423125231262312723128231292313023131231322313323134231352313623137231382313923140231412314223143231442314523146231472314823149231502315123152231532315423155231562315723158231592316023161231622316323164231652316623167231682316923170231712317223173231742317523176231772317823179231802318123182231832318423185231862318723188231892319023191231922319323194231952319623197231982319923200232012320223203232042320523206232072320823209232102321123212232132321423215232162321723218232192322023221232222322323224232252322623227232282322923230232312323223233232342323523236232372323823239232402324123242232432324423245232462324723248232492325023251232522325323254232552325623257232582325923260232612326223263232642326523266232672326823269232702327123272232732327423275232762327723278232792328023281232822328323284232852328623287232882328923290232912329223293232942329523296232972329823299233002330123302233032330423305233062330723308233092331023311233122331323314233152331623317233182331923320233212332223323233242332523326233272332823329233302333123332233332333423335233362333723338233392334023341233422334323344233452334623347233482334923350233512335223353233542335523356233572335823359233602336123362233632336423365233662336723368233692337023371233722337323374233752337623377233782337923380233812338223383233842338523386233872338823389233902339123392233932339423395233962339723398233992340023401234022340323404234052340623407234082340923410234112341223413234142341523416234172341823419234202342123422234232342423425234262342723428234292343023431234322343323434234352343623437234382343923440234412344223443234442344523446234472344823449234502345123452234532345423455234562345723458234592346023461234622346323464234652346623467234682346923470234712347223473234742347523476234772347823479234802348123482234832348423485234862348723488234892349023491234922349323494234952349623497234982349923500235012350223503235042350523506235072350823509235102351123512235132351423515235162351723518235192352023521235222352323524235252352623527235282352923530235312353223533235342353523536235372353823539235402354123542235432354423545235462354723548235492355023551235522355323554235552355623557235582355923560235612356223563235642356523566235672356823569235702357123572235732357423575235762357723578235792358023581235822358323584235852358623587235882358923590235912359223593235942359523596235972359823599236002360123602236032360423605236062360723608236092361023611236122361323614236152361623617236182361923620236212362223623236242362523626236272362823629236302363123632236332363423635236362363723638236392364023641236422364323644236452364623647236482364923650236512365223653236542365523656236572365823659236602366123662236632366423665236662366723668236692367023671236722367323674236752367623677236782367923680236812368223683236842368523686236872368823689236902369123692236932369423695236962369723698236992370023701237022370323704237052370623707237082370923710237112371223713237142371523716237172371823719237202372123722237232372423725237262372723728237292373023731237322373323734237352373623737237382373923740237412374223743237442374523746237472374823749237502375123752237532375423755237562375723758237592376023761237622376323764237652376623767237682376923770237712377223773237742377523776237772377823779237802378123782237832378423785237862378723788237892379023791237922379323794237952379623797237982379923800238012380223803238042380523806238072380823809238102381123812238132381423815238162381723818238192382023821238222382323824238252382623827238282382923830238312383223833238342383523836238372383823839238402384123842238432384423845238462384723848238492385023851238522385323854238552385623857238582385923860238612386223863238642386523866238672386823869238702387123872238732387423875238762387723878238792388023881238822388323884238852388623887238882388923890238912389223893238942389523896238972389823899239002390123902239032390423905239062390723908239092391023911239122391323914239152391623917239182391923920239212392223923239242392523926239272392823929239302393123932239332393423935239362393723938239392394023941239422394323944239452394623947239482394923950239512395223953239542395523956239572395823959239602396123962239632396423965239662396723968239692397023971239722397323974239752397623977239782397923980239812398223983239842398523986239872398823989239902399123992239932399423995239962399723998239992400024001240022400324004240052400624007240082400924010240112401224013240142401524016240172401824019240202402124022240232402424025240262402724028240292403024031240322403324034240352403624037240382403924040240412404224043240442404524046240472404824049240502405124052240532405424055240562405724058240592406024061240622406324064240652406624067240682406924070240712407224073240742407524076240772407824079240802408124082240832408424085240862408724088240892409024091240922409324094240952409624097240982409924100241012410224103241042410524106241072410824109241102411124112241132411424115241162411724118241192412024121241222412324124241252412624127241282412924130241312413224133241342413524136241372413824139241402414124142241432414424145241462414724148241492415024151241522415324154241552415624157241582415924160241612416224163241642416524166241672416824169241702417124172241732417424175241762417724178241792418024181241822418324184241852418624187241882418924190241912419224193241942419524196241972419824199242002420124202242032420424205242062420724208242092421024211242122421324214242152421624217242182421924220242212422224223242242422524226242272422824229242302423124232242332423424235242362423724238242392424024241242422424324244242452424624247242482424924250242512425224253242542425524256242572425824259242602426124262242632426424265242662426724268242692427024271242722427324274242752427624277242782427924280242812428224283242842428524286242872428824289242902429124292242932429424295242962429724298242992430024301243022430324304243052430624307243082430924310243112431224313243142431524316243172431824319243202432124322243232432424325243262432724328243292433024331243322433324334243352433624337243382433924340243412434224343243442434524346243472434824349243502435124352243532435424355243562435724358243592436024361243622436324364243652436624367243682436924370243712437224373243742437524376243772437824379243802438124382243832438424385243862438724388243892439024391243922439324394243952439624397243982439924400244012440224403244042440524406244072440824409244102441124412244132441424415244162441724418244192442024421244222442324424244252442624427244282442924430244312443224433244342443524436244372443824439244402444124442244432444424445244462444724448244492445024451244522445324454244552445624457244582445924460244612446224463244642446524466244672446824469244702447124472244732447424475244762447724478244792448024481244822448324484244852448624487244882448924490244912449224493244942449524496244972449824499245002450124502245032450424505245062450724508245092451024511245122451324514245152451624517245182451924520245212452224523245242452524526245272452824529245302453124532245332453424535245362453724538245392454024541245422454324544245452454624547245482454924550245512455224553245542455524556245572455824559245602456124562245632456424565245662456724568245692457024571245722457324574245752457624577245782457924580245812458224583245842458524586245872458824589245902459124592245932459424595245962459724598245992460024601246022460324604246052460624607246082460924610246112461224613246142461524616246172461824619246202462124622246232462424625246262462724628246292463024631246322463324634246352463624637246382463924640246412464224643246442464524646246472464824649246502465124652246532465424655246562465724658246592466024661246622466324664246652466624667246682466924670246712467224673246742467524676246772467824679246802468124682246832468424685246862468724688246892469024691246922469324694246952469624697246982469924700247012470224703247042470524706247072470824709247102471124712247132471424715247162471724718247192472024721247222472324724247252472624727247282472924730247312473224733247342473524736247372473824739247402474124742247432474424745247462474724748247492475024751247522475324754247552475624757247582475924760247612476224763247642476524766247672476824769247702477124772247732477424775247762477724778247792478024781247822478324784247852478624787247882478924790247912479224793247942479524796247972479824799248002480124802248032480424805248062480724808248092481024811248122481324814248152481624817248182481924820248212482224823248242482524826248272482824829248302483124832248332483424835248362483724838248392484024841248422484324844248452484624847248482484924850248512485224853248542485524856248572485824859248602486124862248632486424865248662486724868248692487024871248722487324874248752487624877248782487924880248812488224883248842488524886248872488824889248902489124892248932489424895248962489724898248992490024901249022490324904249052490624907249082490924910249112491224913249142491524916249172491824919249202492124922249232492424925249262492724928249292493024931249322493324934249352493624937249382493924940249412494224943249442494524946249472494824949249502495124952249532495424955249562495724958249592496024961249622496324964249652496624967249682496924970249712497224973249742497524976249772497824979249802498124982249832498424985249862498724988249892499024991249922499324994249952499624997249982499925000250012500225003250042500525006250072500825009250102501125012250132501425015250162501725018250192502025021250222502325024250252502625027250282502925030250312503225033250342503525036250372503825039250402504125042250432504425045250462504725048250492505025051250522505325054250552505625057250582505925060250612506225063250642506525066250672506825069250702507125072250732507425075250762507725078250792508025081250822508325084250852508625087250882508925090250912509225093250942509525096250972509825099251002510125102251032510425105251062510725108251092511025111251122511325114251152511625117251182511925120251212512225123251242512525126251272512825129251302513125132251332513425135251362513725138251392514025141251422514325144251452514625147251482514925150251512515225153251542515525156251572515825159251602516125162251632516425165251662516725168251692517025171251722517325174251752517625177251782517925180251812518225183251842518525186251872518825189251902519125192251932519425195251962519725198251992520025201252022520325204252052520625207252082520925210252112521225213252142521525216252172521825219252202522125222252232522425225252262522725228252292523025231252322523325234252352523625237252382523925240252412524225243252442524525246252472524825249252502525125252252532525425255252562525725258252592526025261252622526325264252652526625267252682526925270252712527225273252742527525276252772527825279252802528125282252832528425285252862528725288252892529025291252922529325294252952529625297252982529925300253012530225303253042530525306253072530825309253102531125312253132531425315253162531725318253192532025321253222532325324253252532625327253282532925330253312533225333253342533525336253372533825339253402534125342253432534425345253462534725348253492535025351253522535325354253552535625357253582535925360253612536225363253642536525366253672536825369253702537125372253732537425375253762537725378253792538025381253822538325384253852538625387253882538925390253912539225393253942539525396253972539825399254002540125402254032540425405254062540725408254092541025411254122541325414254152541625417254182541925420254212542225423254242542525426254272542825429254302543125432254332543425435254362543725438254392544025441254422544325444254452544625447254482544925450254512545225453254542545525456254572545825459254602546125462254632546425465254662546725468254692547025471254722547325474254752547625477254782547925480254812548225483254842548525486254872548825489254902549125492254932549425495254962549725498254992550025501255022550325504255052550625507255082550925510255112551225513255142551525516255172551825519255202552125522255232552425525255262552725528255292553025531255322553325534255352553625537255382553925540255412554225543255442554525546255472554825549255502555125552255532555425555255562555725558255592556025561255622556325564255652556625567255682556925570255712557225573255742557525576255772557825579255802558125582255832558425585255862558725588255892559025591255922559325594255952559625597255982559925600256012560225603256042560525606256072560825609256102561125612256132561425615256162561725618256192562025621256222562325624256252562625627256282562925630256312563225633256342563525636256372563825639256402564125642256432564425645256462564725648256492565025651256522565325654256552565625657256582565925660256612566225663256642566525666256672566825669256702567125672256732567425675256762567725678256792568025681256822568325684256852568625687256882568925690256912569225693256942569525696256972569825699257002570125702257032570425705257062570725708257092571025711257122571325714257152571625717257182571925720257212572225723257242572525726257272572825729257302573125732257332573425735257362573725738257392574025741257422574325744257452574625747257482574925750257512575225753257542575525756257572575825759257602576125762257632576425765257662576725768257692577025771257722577325774257752577625777257782577925780257812578225783257842578525786257872578825789257902579125792257932579425795257962579725798257992580025801258022580325804258052580625807258082580925810258112581225813258142581525816258172581825819258202582125822258232582425825258262582725828258292583025831258322583325834258352583625837258382583925840258412584225843258442584525846258472584825849258502585125852258532585425855258562585725858258592586025861258622586325864258652586625867258682586925870258712587225873258742587525876258772587825879258802588125882258832588425885258862588725888258892589025891258922589325894258952589625897258982589925900259012590225903259042590525906259072590825909259102591125912259132591425915259162591725918259192592025921259222592325924259252592625927259282592925930259312593225933259342593525936259372593825939259402594125942259432594425945259462594725948259492595025951259522595325954259552595625957259582595925960259612596225963259642596525966259672596825969259702597125972259732597425975259762597725978259792598025981259822598325984259852598625987259882598925990259912599225993259942599525996259972599825999260002600126002260032600426005260062600726008260092601026011260122601326014260152601626017260182601926020260212602226023260242602526026260272602826029260302603126032260332603426035260362603726038260392604026041260422604326044260452604626047260482604926050260512605226053260542605526056260572605826059260602606126062260632606426065260662606726068260692607026071260722607326074260752607626077260782607926080260812608226083260842608526086260872608826089260902609126092260932609426095260962609726098260992610026101261022610326104261052610626107261082610926110261112611226113261142611526116261172611826119261202612126122261232612426125261262612726128261292613026131261322613326134261352613626137261382613926140261412614226143261442614526146261472614826149261502615126152261532615426155261562615726158261592616026161261622616326164261652616626167261682616926170261712617226173261742617526176261772617826179261802618126182261832618426185261862618726188261892619026191261922619326194261952619626197261982619926200262012620226203262042620526206262072620826209262102621126212262132621426215262162621726218262192622026221262222622326224262252622626227262282622926230262312623226233262342623526236262372623826239262402624126242262432624426245262462624726248262492625026251262522625326254262552625626257262582625926260262612626226263262642626526266262672626826269262702627126272262732627426275262762627726278262792628026281262822628326284262852628626287262882628926290262912629226293262942629526296262972629826299263002630126302263032630426305263062630726308263092631026311263122631326314263152631626317263182631926320263212632226323263242632526326263272632826329263302633126332263332633426335263362633726338263392634026341263422634326344263452634626347263482634926350263512635226353263542635526356263572635826359263602636126362263632636426365263662636726368263692637026371263722637326374263752637626377263782637926380263812638226383263842638526386263872638826389263902639126392263932639426395263962639726398263992640026401264022640326404264052640626407264082640926410264112641226413264142641526416264172641826419264202642126422264232642426425264262642726428264292643026431264322643326434264352643626437264382643926440264412644226443264442644526446264472644826449264502645126452264532645426455264562645726458264592646026461264622646326464264652646626467264682646926470264712647226473264742647526476264772647826479264802648126482264832648426485264862648726488264892649026491264922649326494264952649626497264982649926500265012650226503265042650526506265072650826509265102651126512265132651426515265162651726518265192652026521265222652326524265252652626527265282652926530265312653226533265342653526536265372653826539265402654126542265432654426545265462654726548265492655026551265522655326554265552655626557265582655926560265612656226563265642656526566265672656826569265702657126572265732657426575265762657726578265792658026581265822658326584265852658626587265882658926590265912659226593265942659526596265972659826599266002660126602266032660426605266062660726608266092661026611266122661326614266152661626617266182661926620266212662226623266242662526626266272662826629266302663126632266332663426635266362663726638266392664026641266422664326644266452664626647266482664926650266512665226653266542665526656266572665826659266602666126662266632666426665266662666726668266692667026671266722667326674266752667626677266782667926680266812668226683266842668526686266872668826689266902669126692266932669426695266962669726698266992670026701267022670326704267052670626707267082670926710267112671226713267142671526716267172671826719267202672126722267232672426725267262672726728267292673026731267322673326734267352673626737267382673926740267412674226743267442674526746267472674826749267502675126752267532675426755267562675726758267592676026761267622676326764267652676626767267682676926770267712677226773267742677526776267772677826779267802678126782267832678426785267862678726788267892679026791267922679326794267952679626797267982679926800268012680226803268042680526806268072680826809268102681126812268132681426815268162681726818268192682026821268222682326824268252682626827268282682926830268312683226833268342683526836268372683826839268402684126842268432684426845268462684726848268492685026851268522685326854268552685626857268582685926860268612686226863268642686526866268672686826869268702687126872268732687426875268762687726878268792688026881268822688326884268852688626887268882688926890268912689226893268942689526896268972689826899269002690126902269032690426905269062690726908269092691026911269122691326914269152691626917269182691926920269212692226923269242692526926269272692826929269302693126932269332693426935269362693726938269392694026941269422694326944269452694626947269482694926950269512695226953269542695526956269572695826959269602696126962269632696426965269662696726968269692697026971269722697326974269752697626977269782697926980269812698226983269842698526986269872698826989269902699126992269932699426995269962699726998269992700027001270022700327004270052700627007270082700927010270112701227013270142701527016270172701827019270202702127022270232702427025270262702727028270292703027031270322703327034270352703627037270382703927040270412704227043270442704527046270472704827049270502705127052270532705427055270562705727058270592706027061270622706327064270652706627067270682706927070270712707227073270742707527076270772707827079270802708127082270832708427085270862708727088270892709027091270922709327094270952709627097270982709927100271012710227103271042710527106271072710827109271102711127112271132711427115271162711727118271192712027121271222712327124271252712627127271282712927130271312713227133271342713527136271372713827139271402714127142271432714427145271462714727148271492715027151271522715327154271552715627157271582715927160271612716227163271642716527166271672716827169271702717127172271732717427175271762717727178271792718027181271822718327184271852718627187271882718927190271912719227193271942719527196271972719827199272002720127202272032720427205272062720727208272092721027211272122721327214272152721627217272182721927220272212722227223272242722527226272272722827229272302723127232272332723427235272362723727238272392724027241272422724327244272452724627247272482724927250272512725227253272542725527256272572725827259272602726127262272632726427265272662726727268272692727027271272722727327274272752727627277272782727927280272812728227283272842728527286272872728827289272902729127292272932729427295272962729727298272992730027301273022730327304273052730627307273082730927310273112731227313273142731527316273172731827319273202732127322273232732427325273262732727328273292733027331273322733327334273352733627337273382733927340273412734227343273442734527346273472734827349273502735127352273532735427355273562735727358273592736027361273622736327364273652736627367273682736927370273712737227373273742737527376273772737827379273802738127382273832738427385273862738727388273892739027391273922739327394273952739627397273982739927400274012740227403274042740527406274072740827409274102741127412274132741427415274162741727418274192742027421274222742327424274252742627427274282742927430274312743227433274342743527436274372743827439274402744127442274432744427445274462744727448274492745027451274522745327454274552745627457274582745927460274612746227463274642746527466274672746827469274702747127472274732747427475274762747727478274792748027481274822748327484274852748627487274882748927490274912749227493274942749527496274972749827499275002750127502275032750427505275062750727508275092751027511275122751327514275152751627517275182751927520275212752227523275242752527526275272752827529275302753127532275332753427535275362753727538275392754027541275422754327544275452754627547275482754927550275512755227553275542755527556275572755827559275602756127562275632756427565275662756727568275692757027571275722757327574275752757627577275782757927580275812758227583275842758527586275872758827589275902759127592275932759427595275962759727598275992760027601276022760327604276052760627607276082760927610276112761227613276142761527616276172761827619276202762127622276232762427625276262762727628276292763027631276322763327634276352763627637276382763927640276412764227643276442764527646276472764827649276502765127652276532765427655276562765727658276592766027661276622766327664276652766627667276682766927670276712767227673276742767527676276772767827679276802768127682276832768427685276862768727688276892769027691276922769327694276952769627697276982769927700277012770227703277042770527706277072770827709277102771127712277132771427715277162771727718277192772027721277222772327724277252772627727277282772927730277312773227733277342773527736277372773827739277402774127742277432774427745277462774727748277492775027751277522775327754277552775627757277582775927760277612776227763277642776527766277672776827769277702777127772277732777427775277762777727778277792778027781277822778327784277852778627787277882778927790277912779227793277942779527796277972779827799278002780127802278032780427805278062780727808278092781027811278122781327814278152781627817278182781927820278212782227823278242782527826278272782827829278302783127832278332783427835278362783727838278392784027841278422784327844278452784627847278482784927850278512785227853278542785527856278572785827859278602786127862278632786427865278662786727868278692787027871278722787327874278752787627877278782787927880278812788227883278842788527886278872788827889278902789127892278932789427895278962789727898278992790027901279022790327904279052790627907279082790927910279112791227913279142791527916279172791827919279202792127922279232792427925279262792727928279292793027931279322793327934279352793627937279382793927940279412794227943279442794527946279472794827949279502795127952279532795427955279562795727958279592796027961279622796327964279652796627967279682796927970279712797227973279742797527976279772797827979279802798127982279832798427985279862798727988279892799027991279922799327994279952799627997279982799928000280012800228003280042800528006280072800828009280102801128012280132801428015280162801728018280192802028021280222802328024280252802628027280282802928030280312803228033280342803528036280372803828039280402804128042280432804428045280462804728048280492805028051280522805328054280552805628057280582805928060280612806228063280642806528066280672806828069280702807128072280732807428075280762807728078280792808028081280822808328084280852808628087280882808928090280912809228093280942809528096280972809828099281002810128102281032810428105281062810728108281092811028111281122811328114281152811628117281182811928120281212812228123281242812528126281272812828129281302813128132281332813428135281362813728138281392814028141281422814328144281452814628147281482814928150281512815228153281542815528156281572815828159281602816128162281632816428165281662816728168281692817028171281722817328174281752817628177281782817928180281812818228183281842818528186281872818828189281902819128192281932819428195281962819728198281992820028201282022820328204282052820628207282082820928210282112821228213282142821528216282172821828219282202822128222282232822428225282262822728228282292823028231282322823328234282352823628237282382823928240282412824228243282442824528246282472824828249282502825128252282532825428255282562825728258282592826028261282622826328264282652826628267282682826928270282712827228273282742827528276282772827828279282802828128282282832828428285282862828728288282892829028291282922829328294282952829628297282982829928300283012830228303283042830528306283072830828309283102831128312283132831428315283162831728318283192832028321283222832328324283252832628327283282832928330283312833228333283342833528336283372833828339283402834128342283432834428345283462834728348283492835028351283522835328354283552835628357283582835928360283612836228363283642836528366283672836828369283702837128372283732837428375283762837728378283792838028381283822838328384283852838628387283882838928390283912839228393283942839528396283972839828399284002840128402284032840428405284062840728408284092841028411284122841328414284152841628417284182841928420284212842228423284242842528426284272842828429284302843128432284332843428435284362843728438284392844028441284422844328444284452844628447284482844928450284512845228453284542845528456284572845828459284602846128462284632846428465284662846728468284692847028471284722847328474284752847628477284782847928480284812848228483284842848528486284872848828489284902849128492284932849428495284962849728498284992850028501285022850328504285052850628507285082850928510285112851228513285142851528516285172851828519285202852128522285232852428525285262852728528285292853028531285322853328534285352853628537285382853928540285412854228543285442854528546285472854828549285502855128552285532855428555285562855728558285592856028561285622856328564285652856628567285682856928570285712857228573285742857528576285772857828579285802858128582285832858428585285862858728588285892859028591285922859328594285952859628597285982859928600286012860228603286042860528606286072860828609286102861128612286132861428615286162861728618286192862028621286222862328624286252862628627286282862928630286312863228633286342863528636286372863828639286402864128642286432864428645286462864728648286492865028651286522865328654286552865628657286582865928660286612866228663286642866528666286672866828669286702867128672286732867428675286762867728678286792868028681286822868328684286852868628687286882868928690286912869228693286942869528696286972869828699287002870128702287032870428705287062870728708287092871028711287122871328714287152871628717287182871928720287212872228723287242872528726287272872828729287302873128732287332873428735287362873728738287392874028741287422874328744287452874628747287482874928750287512875228753287542875528756287572875828759287602876128762287632876428765287662876728768287692877028771287722877328774287752877628777287782877928780287812878228783287842878528786287872878828789287902879128792287932879428795287962879728798287992880028801288022880328804288052880628807288082880928810288112881228813288142881528816288172881828819288202882128822288232882428825288262882728828288292883028831288322883328834288352883628837288382883928840288412884228843288442884528846288472884828849288502885128852288532885428855288562885728858288592886028861288622886328864288652886628867288682886928870288712887228873288742887528876288772887828879288802888128882288832888428885288862888728888288892889028891288922889328894288952889628897288982889928900289012890228903289042890528906289072890828909289102891128912289132891428915289162891728918289192892028921289222892328924289252892628927289282892928930289312893228933289342893528936289372893828939289402894128942289432894428945289462894728948289492895028951289522895328954289552895628957289582895928960289612896228963289642896528966289672896828969289702897128972289732897428975289762897728978289792898028981289822898328984289852898628987289882898928990289912899228993289942899528996289972899828999290002900129002290032900429005290062900729008290092901029011290122901329014290152901629017290182901929020290212902229023290242902529026290272902829029290302903129032290332903429035290362903729038290392904029041290422904329044290452904629047290482904929050290512905229053290542905529056290572905829059290602906129062290632906429065290662906729068290692907029071290722907329074290752907629077290782907929080290812908229083290842908529086290872908829089290902909129092290932909429095290962909729098290992910029101291022910329104291052910629107291082910929110291112911229113291142911529116291172911829119291202912129122291232912429125291262912729128291292913029131291322913329134291352913629137291382913929140291412914229143291442914529146291472914829149291502915129152291532915429155291562915729158291592916029161291622916329164291652916629167291682916929170291712917229173291742917529176291772917829179291802918129182291832918429185291862918729188291892919029191291922919329194291952919629197291982919929200292012920229203292042920529206292072920829209292102921129212292132921429215292162921729218292192922029221292222922329224292252922629227292282922929230292312923229233292342923529236292372923829239292402924129242292432924429245292462924729248292492925029251292522925329254292552925629257292582925929260292612926229263292642926529266292672926829269292702927129272292732927429275292762927729278292792928029281292822928329284292852928629287292882928929290292912929229293292942929529296292972929829299293002930129302293032930429305293062930729308293092931029311293122931329314293152931629317293182931929320293212932229323293242932529326293272932829329293302933129332293332933429335293362933729338293392934029341293422934329344293452934629347293482934929350293512935229353293542935529356293572935829359293602936129362293632936429365293662936729368293692937029371293722937329374293752937629377293782937929380293812938229383293842938529386293872938829389293902939129392293932939429395293962939729398293992940029401294022940329404294052940629407294082940929410294112941229413294142941529416294172941829419294202942129422294232942429425294262942729428294292943029431294322943329434294352943629437294382943929440294412944229443294442944529446294472944829449294502945129452294532945429455294562945729458294592946029461294622946329464294652946629467294682946929470294712947229473294742947529476294772947829479294802948129482294832948429485294862948729488294892949029491294922949329494294952949629497294982949929500295012950229503295042950529506295072950829509295102951129512295132951429515295162951729518295192952029521295222952329524295252952629527295282952929530295312953229533295342953529536295372953829539295402954129542295432954429545295462954729548295492955029551295522955329554295552955629557295582955929560295612956229563295642956529566295672956829569295702957129572295732957429575295762957729578295792958029581295822958329584295852958629587295882958929590295912959229593295942959529596295972959829599296002960129602296032960429605296062960729608296092961029611296122961329614296152961629617296182961929620296212962229623296242962529626296272962829629296302963129632296332963429635296362963729638296392964029641296422964329644296452964629647296482964929650296512965229653296542965529656296572965829659296602966129662296632966429665296662966729668296692967029671296722967329674296752967629677296782967929680296812968229683296842968529686296872968829689296902969129692296932969429695296962969729698296992970029701297022970329704297052970629707297082970929710297112971229713297142971529716297172971829719297202972129722297232972429725297262972729728297292973029731297322973329734297352973629737297382973929740297412974229743297442974529746297472974829749297502975129752297532975429755297562975729758297592976029761297622976329764297652976629767297682976929770297712977229773297742977529776297772977829779297802978129782297832978429785297862978729788297892979029791297922979329794297952979629797297982979929800298012980229803298042980529806298072980829809298102981129812298132981429815298162981729818298192982029821298222982329824298252982629827298282982929830298312983229833298342983529836298372983829839298402984129842298432984429845298462984729848298492985029851298522985329854298552985629857298582985929860298612986229863298642986529866298672986829869298702987129872298732987429875298762987729878298792988029881298822988329884298852988629887298882988929890298912989229893298942989529896298972989829899299002990129902299032990429905299062990729908299092991029911299122991329914299152991629917299182991929920299212992229923299242992529926299272992829929299302993129932299332993429935299362993729938299392994029941299422994329944299452994629947299482994929950299512995229953299542995529956299572995829959299602996129962299632996429965299662996729968299692997029971299722997329974299752997629977299782997929980299812998229983299842998529986299872998829989299902999129992299932999429995299962999729998299993000030001300023000330004300053000630007300083000930010300113001230013300143001530016300173001830019300203002130022300233002430025300263002730028300293003030031300323003330034300353003630037300383003930040300413004230043300443004530046300473004830049300503005130052300533005430055300563005730058300593006030061300623006330064300653006630067300683006930070300713007230073300743007530076300773007830079300803008130082300833008430085300863008730088300893009030091300923009330094300953009630097300983009930100301013010230103301043010530106301073010830109301103011130112301133011430115301163011730118301193012030121301223012330124301253012630127301283012930130301313013230133301343013530136301373013830139301403014130142301433014430145301463014730148301493015030151301523015330154301553015630157301583015930160301613016230163
  1. var __extends = this.__extends || function (d, b) {
  2. for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p];
  3. function __() { this.constructor = d; }
  4. __.prototype = b.prototype;
  5. d.prototype = new __();
  6. };var BABYLON;
  7. (function (BABYLON) {
  8. var Color3 = (function () {
  9. function Color3(r, g, b) {
  10. if (typeof r === "undefined") { r = 0; }
  11. if (typeof g === "undefined") { g = 0; }
  12. if (typeof b === "undefined") { b = 0; }
  13. this.r = r;
  14. this.g = g;
  15. this.b = b;
  16. }
  17. Color3.prototype.toString = function () {
  18. return "{R: " + this.r + " G:" + this.g + " B:" + this.b + "}";
  19. };
  20. // Operators
  21. Color3.prototype.toArray = function (array, index) {
  22. if (index === undefined) {
  23. index = 0;
  24. }
  25. array[index] = this.r;
  26. array[index + 1] = this.g;
  27. array[index + 2] = this.b;
  28. };
  29. Color3.prototype.toColor4 = function (alpha) {
  30. if (typeof alpha === "undefined") { alpha = 1; }
  31. return new Color4(this.r, this.g, this.b, alpha);
  32. };
  33. Color3.prototype.asArray = function () {
  34. var result = [];
  35. this.toArray(result, 0);
  36. return result;
  37. };
  38. Color3.prototype.toLuminance = function () {
  39. return this.r * 0.3 + this.g * 0.59 + this.b * 0.11;
  40. };
  41. Color3.prototype.multiply = function (otherColor) {
  42. return new Color3(this.r * otherColor.r, this.g * otherColor.g, this.b * otherColor.b);
  43. };
  44. Color3.prototype.multiplyToRef = function (otherColor, result) {
  45. result.r = this.r * otherColor.r;
  46. result.g = this.g * otherColor.g;
  47. result.b = this.b * otherColor.b;
  48. };
  49. Color3.prototype.equals = function (otherColor) {
  50. return otherColor && this.r === otherColor.r && this.g === otherColor.g && this.b === otherColor.b;
  51. };
  52. Color3.prototype.scale = function (scale) {
  53. return new Color3(this.r * scale, this.g * scale, this.b * scale);
  54. };
  55. Color3.prototype.scaleToRef = function (scale, result) {
  56. result.r = this.r * scale;
  57. result.g = this.g * scale;
  58. result.b = this.b * scale;
  59. };
  60. Color3.prototype.add = function (otherColor) {
  61. return new Color3(this.r + otherColor.r, this.g + otherColor.g, this.b + otherColor.b);
  62. };
  63. Color3.prototype.addToRef = function (otherColor, result) {
  64. result.r = this.r + otherColor.r;
  65. result.g = this.g + otherColor.g;
  66. result.b = this.b + otherColor.b;
  67. };
  68. Color3.prototype.subtract = function (otherColor) {
  69. return new Color3(this.r - otherColor.r, this.g - otherColor.g, this.b - otherColor.b);
  70. };
  71. Color3.prototype.subtractToRef = function (otherColor, result) {
  72. result.r = this.r - otherColor.r;
  73. result.g = this.g - otherColor.g;
  74. result.b = this.b - otherColor.b;
  75. };
  76. Color3.prototype.clone = function () {
  77. return new Color3(this.r, this.g, this.b);
  78. };
  79. Color3.prototype.copyFrom = function (source) {
  80. this.r = source.r;
  81. this.g = source.g;
  82. this.b = source.b;
  83. };
  84. Color3.prototype.copyFromFloats = function (r, g, b) {
  85. this.r = r;
  86. this.g = g;
  87. this.b = b;
  88. };
  89. // Statics
  90. Color3.FromArray = function (array) {
  91. return new Color3(array[0], array[1], array[2]);
  92. };
  93. Color3.FromInts = function (r, g, b) {
  94. return new Color3(r / 255.0, g / 255.0, b / 255.0);
  95. };
  96. Color3.Lerp = function (start, end, amount) {
  97. var r = start.r + ((end.r - start.r) * amount);
  98. var g = start.g + ((end.g - start.g) * amount);
  99. var b = start.b + ((end.b - start.b) * amount);
  100. return new Color3(r, g, b);
  101. };
  102. Color3.Red = function () {
  103. return new Color3(1, 0, 0);
  104. };
  105. Color3.Green = function () {
  106. return new Color3(0, 1, 0);
  107. };
  108. Color3.Blue = function () {
  109. return new Color3(0, 0, 1);
  110. };
  111. Color3.Black = function () {
  112. return new Color3(0, 0, 0);
  113. };
  114. Color3.White = function () {
  115. return new Color3(1, 1, 1);
  116. };
  117. Color3.Purple = function () {
  118. return new Color3(0.5, 0, 0.5);
  119. };
  120. Color3.Magenta = function () {
  121. return new Color3(1, 0, 1);
  122. };
  123. Color3.Yellow = function () {
  124. return new Color3(1, 1, 0);
  125. };
  126. Color3.Gray = function () {
  127. return new Color3(0.5, 0.5, 0.5);
  128. };
  129. return Color3;
  130. })();
  131. BABYLON.Color3 = Color3;
  132. var Color4 = (function () {
  133. function Color4(r, g, b, a) {
  134. this.r = r;
  135. this.g = g;
  136. this.b = b;
  137. this.a = a;
  138. }
  139. // Operators
  140. Color4.prototype.addInPlace = function (right) {
  141. this.r += right.r;
  142. this.g += right.g;
  143. this.b += right.b;
  144. this.a += right.a;
  145. };
  146. Color4.prototype.asArray = function () {
  147. var result = [];
  148. this.toArray(result, 0);
  149. return result;
  150. };
  151. Color4.prototype.toArray = function (array, index) {
  152. if (index === undefined) {
  153. index = 0;
  154. }
  155. array[index] = this.r;
  156. array[index + 1] = this.g;
  157. array[index + 2] = this.b;
  158. array[index + 3] = this.a;
  159. };
  160. Color4.prototype.add = function (right) {
  161. return new Color4(this.r + right.r, this.g + right.g, this.b + right.b, this.a + right.a);
  162. };
  163. Color4.prototype.subtract = function (right) {
  164. return new Color4(this.r - right.r, this.g - right.g, this.b - right.b, this.a - right.a);
  165. };
  166. Color4.prototype.subtractToRef = function (right, result) {
  167. result.r = this.r - right.r;
  168. result.g = this.g - right.g;
  169. result.b = this.b - right.b;
  170. result.a = this.a - right.a;
  171. };
  172. Color4.prototype.scale = function (scale) {
  173. return new Color4(this.r * scale, this.g * scale, this.b * scale, this.a * scale);
  174. };
  175. Color4.prototype.scaleToRef = function (scale, result) {
  176. result.r = this.r * scale;
  177. result.g = this.g * scale;
  178. result.b = this.b * scale;
  179. result.a = this.a * scale;
  180. };
  181. Color4.prototype.toString = function () {
  182. return "{R: " + this.r + " G:" + this.g + " B:" + this.b + " A:" + this.a + "}";
  183. };
  184. Color4.prototype.clone = function () {
  185. return new Color4(this.r, this.g, this.b, this.a);
  186. };
  187. // Statics
  188. Color4.Lerp = function (left, right, amount) {
  189. var result = new Color4(0, 0, 0, 0);
  190. BABYLON.Color4.LerpToRef(left, right, amount, result);
  191. return result;
  192. };
  193. Color4.LerpToRef = function (left, right, amount, result) {
  194. result.r = left.r + (right.r - left.r) * amount;
  195. result.g = left.g + (right.g - left.g) * amount;
  196. result.b = left.b + (right.b - left.b) * amount;
  197. result.a = left.a + (right.a - left.a) * amount;
  198. };
  199. Color4.FromArray = function (array, offset) {
  200. if (typeof offset === "undefined") { offset = 0; }
  201. return new Color4(array[offset], array[offset + 1], array[offset + 2], array[offset + 3]);
  202. };
  203. Color4.FromInts = function (r, g, b, a) {
  204. return new Color4(r / 255.0, g / 255.0, b / 255.0, a / 255.0);
  205. };
  206. return Color4;
  207. })();
  208. BABYLON.Color4 = Color4;
  209. var Vector2 = (function () {
  210. function Vector2(x, y) {
  211. this.x = x;
  212. this.y = y;
  213. }
  214. Vector2.prototype.toString = function () {
  215. return "{X: " + this.x + " Y:" + this.y + "}";
  216. };
  217. // Operators
  218. Vector2.prototype.toArray = function (array, index) {
  219. if (index === undefined) {
  220. index = 0;
  221. }
  222. array[index] = this.x;
  223. array[index + 1] = this.y;
  224. };
  225. Vector2.prototype.asArray = function () {
  226. var result = [];
  227. this.toArray(result, 0);
  228. return result;
  229. };
  230. Vector2.prototype.copyFrom = function (source) {
  231. this.x = source.x;
  232. this.y = source.y;
  233. };
  234. Vector2.prototype.copyFromFloats = function (x, y) {
  235. this.x = x;
  236. this.y = y;
  237. };
  238. Vector2.prototype.add = function (otherVector) {
  239. return new Vector2(this.x + otherVector.x, this.y + otherVector.y);
  240. };
  241. Vector2.prototype.addVector3 = function (otherVector) {
  242. return new Vector2(this.x + otherVector.x, this.y + otherVector.y);
  243. };
  244. Vector2.prototype.subtract = function (otherVector) {
  245. return new Vector2(this.x - otherVector.x, this.y - otherVector.y);
  246. };
  247. Vector2.prototype.subtractInPlace = function (otherVector) {
  248. this.x -= otherVector.x;
  249. this.y -= otherVector.y;
  250. };
  251. Vector2.prototype.multiplyInPlace = function (otherVector) {
  252. this.x *= otherVector.x;
  253. this.y *= otherVector.y;
  254. };
  255. Vector2.prototype.multiply = function (otherVector) {
  256. return new Vector2(this.x * otherVector.x, this.y * otherVector.y);
  257. };
  258. Vector2.prototype.multiplyToRef = function (otherVector, result) {
  259. result.x = this.x * otherVector.x;
  260. result.y = this.y * otherVector.y;
  261. };
  262. Vector2.prototype.multiplyByFloats = function (x, y) {
  263. return new Vector2(this.x * x, this.y * y);
  264. };
  265. Vector2.prototype.divide = function (otherVector) {
  266. return new Vector2(this.x / otherVector.x, this.y / otherVector.y);
  267. };
  268. Vector2.prototype.divideToRef = function (otherVector, result) {
  269. result.x = this.x / otherVector.x;
  270. result.y = this.y / otherVector.y;
  271. };
  272. Vector2.prototype.negate = function () {
  273. return new Vector2(-this.x, -this.y);
  274. };
  275. Vector2.prototype.scaleInPlace = function (scale) {
  276. this.x *= scale;
  277. this.y *= scale;
  278. return this;
  279. };
  280. Vector2.prototype.scale = function (scale) {
  281. return new Vector2(this.x * scale, this.y * scale);
  282. };
  283. Vector2.prototype.equals = function (otherVector) {
  284. return otherVector && this.x === otherVector.x && this.y === otherVector.y;
  285. };
  286. // Properties
  287. Vector2.prototype.length = function () {
  288. return Math.sqrt(this.x * this.x + this.y * this.y);
  289. };
  290. Vector2.prototype.lengthSquared = function () {
  291. return (this.x * this.x + this.y * this.y);
  292. };
  293. // Methods
  294. Vector2.prototype.normalize = function () {
  295. var len = this.length();
  296. if (len === 0)
  297. return this;
  298. var num = 1.0 / len;
  299. this.x *= num;
  300. this.y *= num;
  301. return this;
  302. };
  303. Vector2.prototype.clone = function () {
  304. return new Vector2(this.x, this.y);
  305. };
  306. // Statics
  307. Vector2.Zero = function () {
  308. return new Vector2(0, 0);
  309. };
  310. Vector2.FromArray = function (array, offset) {
  311. if (!offset) {
  312. offset = 0;
  313. }
  314. return new Vector2(array[offset], array[offset + 1]);
  315. };
  316. Vector2.FromArrayToRef = function (array, offset, result) {
  317. result.x = array[offset];
  318. result.y = array[offset + 1];
  319. };
  320. Vector2.CatmullRom = function (value1, value2, value3, value4, amount) {
  321. var squared = amount * amount;
  322. var cubed = amount * squared;
  323. var x = 0.5 * ((((2.0 * value2.x) + ((-value1.x + value3.x) * amount)) + (((((2.0 * value1.x) - (5.0 * value2.x)) + (4.0 * value3.x)) - value4.x) * squared)) + ((((-value1.x + (3.0 * value2.x)) - (3.0 * value3.x)) + value4.x) * cubed));
  324. var y = 0.5 * ((((2.0 * value2.y) + ((-value1.y + value3.y) * amount)) + (((((2.0 * value1.y) - (5.0 * value2.y)) + (4.0 * value3.y)) - value4.y) * squared)) + ((((-value1.y + (3.0 * value2.y)) - (3.0 * value3.y)) + value4.y) * cubed));
  325. return new Vector2(x, y);
  326. };
  327. Vector2.Clamp = function (value, min, max) {
  328. var x = value.x;
  329. x = (x > max.x) ? max.x : x;
  330. x = (x < min.x) ? min.x : x;
  331. var y = value.y;
  332. y = (y > max.y) ? max.y : y;
  333. y = (y < min.y) ? min.y : y;
  334. return new Vector2(x, y);
  335. };
  336. Vector2.Hermite = function (value1, tangent1, value2, tangent2, amount) {
  337. var squared = amount * amount;
  338. var cubed = amount * squared;
  339. var part1 = ((2.0 * cubed) - (3.0 * squared)) + 1.0;
  340. var part2 = (-2.0 * cubed) + (3.0 * squared);
  341. var part3 = (cubed - (2.0 * squared)) + amount;
  342. var part4 = cubed - squared;
  343. var x = (((value1.x * part1) + (value2.x * part2)) + (tangent1.x * part3)) + (tangent2.x * part4);
  344. var y = (((value1.y * part1) + (value2.y * part2)) + (tangent1.y * part3)) + (tangent2.y * part4);
  345. return new Vector2(x, y);
  346. };
  347. Vector2.Lerp = function (start, end, amount) {
  348. var x = start.x + ((end.x - start.x) * amount);
  349. var y = start.y + ((end.y - start.y) * amount);
  350. return new Vector2(x, y);
  351. };
  352. Vector2.Dot = function (left, right) {
  353. return left.x * right.x + left.y * right.y;
  354. };
  355. Vector2.Normalize = function (vector) {
  356. var newVector = vector.clone();
  357. newVector.normalize();
  358. return newVector;
  359. };
  360. Vector2.Minimize = function (left, right) {
  361. var x = (left.x < right.x) ? left.x : right.x;
  362. var y = (left.y < right.y) ? left.y : right.y;
  363. return new Vector2(x, y);
  364. };
  365. Vector2.Maximize = function (left, right) {
  366. var x = (left.x > right.x) ? left.x : right.x;
  367. var y = (left.y > right.y) ? left.y : right.y;
  368. return new Vector2(x, y);
  369. };
  370. Vector2.Transform = function (vector, transformation) {
  371. var x = (vector.x * transformation.m[0]) + (vector.y * transformation.m[4]);
  372. var y = (vector.x * transformation.m[1]) + (vector.y * transformation.m[5]);
  373. return new Vector2(x, y);
  374. };
  375. Vector2.Distance = function (value1, value2) {
  376. return Math.sqrt(Vector2.DistanceSquared(value1, value2));
  377. };
  378. Vector2.DistanceSquared = function (value1, value2) {
  379. var x = value1.x - value2.x;
  380. var y = value1.y - value2.y;
  381. return (x * x) + (y * y);
  382. };
  383. return Vector2;
  384. })();
  385. BABYLON.Vector2 = Vector2;
  386. var Vector3 = (function () {
  387. function Vector3(x, y, z) {
  388. this.x = x;
  389. this.y = y;
  390. this.z = z;
  391. }
  392. Vector3.prototype.toString = function () {
  393. return "{X: " + this.x + " Y:" + this.y + " Z:" + this.z + "}";
  394. };
  395. // Operators
  396. Vector3.prototype.asArray = function () {
  397. var result = [];
  398. this.toArray(result, 0);
  399. return result;
  400. };
  401. Vector3.prototype.toArray = function (array, index) {
  402. if (index === undefined) {
  403. index = 0;
  404. }
  405. array[index] = this.x;
  406. array[index + 1] = this.y;
  407. array[index + 2] = this.z;
  408. };
  409. Vector3.prototype.addInPlace = function (otherVector) {
  410. this.x += otherVector.x;
  411. this.y += otherVector.y;
  412. this.z += otherVector.z;
  413. };
  414. Vector3.prototype.add = function (otherVector) {
  415. return new Vector3(this.x + otherVector.x, this.y + otherVector.y, this.z + otherVector.z);
  416. };
  417. Vector3.prototype.addToRef = function (otherVector, result) {
  418. result.x = this.x + otherVector.x;
  419. result.y = this.y + otherVector.y;
  420. result.z = this.z + otherVector.z;
  421. };
  422. Vector3.prototype.subtractInPlace = function (otherVector) {
  423. this.x -= otherVector.x;
  424. this.y -= otherVector.y;
  425. this.z -= otherVector.z;
  426. };
  427. Vector3.prototype.subtract = function (otherVector) {
  428. return new Vector3(this.x - otherVector.x, this.y - otherVector.y, this.z - otherVector.z);
  429. };
  430. Vector3.prototype.subtractToRef = function (otherVector, result) {
  431. result.x = this.x - otherVector.x;
  432. result.y = this.y - otherVector.y;
  433. result.z = this.z - otherVector.z;
  434. };
  435. Vector3.prototype.subtractFromFloats = function (x, y, z) {
  436. return new Vector3(this.x - x, this.y - y, this.z - z);
  437. };
  438. Vector3.prototype.subtractFromFloatsToRef = function (x, y, z, result) {
  439. result.x = this.x - x;
  440. result.y = this.y - y;
  441. result.z = this.z - z;
  442. };
  443. Vector3.prototype.negate = function () {
  444. return new Vector3(-this.x, -this.y, -this.z);
  445. };
  446. Vector3.prototype.scaleInPlace = function (scale) {
  447. this.x *= scale;
  448. this.y *= scale;
  449. this.z *= scale;
  450. return this;
  451. };
  452. Vector3.prototype.scale = function (scale) {
  453. return new Vector3(this.x * scale, this.y * scale, this.z * scale);
  454. };
  455. Vector3.prototype.scaleToRef = function (scale, result) {
  456. result.x = this.x * scale;
  457. result.y = this.y * scale;
  458. result.z = this.z * scale;
  459. };
  460. Vector3.prototype.equals = function (otherVector) {
  461. return otherVector && this.x === otherVector.x && this.y === otherVector.y && this.z === otherVector.z;
  462. };
  463. Vector3.prototype.equalsWithEpsilon = function (otherVector) {
  464. return Math.abs(this.x - otherVector.x) < BABYLON.Engine.Epsilon && Math.abs(this.y - otherVector.y) < BABYLON.Engine.Epsilon && Math.abs(this.z - otherVector.z) < BABYLON.Engine.Epsilon;
  465. };
  466. Vector3.prototype.equalsToFloats = function (x, y, z) {
  467. return this.x === x && this.y === y && this.z === z;
  468. };
  469. Vector3.prototype.multiplyInPlace = function (otherVector) {
  470. this.x *= otherVector.x;
  471. this.y *= otherVector.y;
  472. this.z *= otherVector.z;
  473. };
  474. Vector3.prototype.multiply = function (otherVector) {
  475. return new Vector3(this.x * otherVector.x, this.y * otherVector.y, this.z * otherVector.z);
  476. };
  477. Vector3.prototype.multiplyToRef = function (otherVector, result) {
  478. result.x = this.x * otherVector.x;
  479. result.y = this.y * otherVector.y;
  480. result.z = this.z * otherVector.z;
  481. };
  482. Vector3.prototype.multiplyByFloats = function (x, y, z) {
  483. return new Vector3(this.x * x, this.y * y, this.z * z);
  484. };
  485. Vector3.prototype.divide = function (otherVector) {
  486. return new Vector3(this.x / otherVector.x, this.y / otherVector.y, this.z / otherVector.z);
  487. };
  488. Vector3.prototype.divideToRef = function (otherVector, result) {
  489. result.x = this.x / otherVector.x;
  490. result.y = this.y / otherVector.y;
  491. result.z = this.z / otherVector.z;
  492. };
  493. Vector3.prototype.MinimizeInPlace = function (other) {
  494. if (other.x < this.x)
  495. this.x = other.x;
  496. if (other.y < this.y)
  497. this.y = other.y;
  498. if (other.z < this.z)
  499. this.z = other.z;
  500. };
  501. Vector3.prototype.MaximizeInPlace = function (other) {
  502. if (other.x > this.x)
  503. this.x = other.x;
  504. if (other.y > this.y)
  505. this.y = other.y;
  506. if (other.z > this.z)
  507. this.z = other.z;
  508. };
  509. // Properties
  510. Vector3.prototype.length = function () {
  511. return Math.sqrt(this.x * this.x + this.y * this.y + this.z * this.z);
  512. };
  513. Vector3.prototype.lengthSquared = function () {
  514. return (this.x * this.x + this.y * this.y + this.z * this.z);
  515. };
  516. // Methods
  517. Vector3.prototype.normalize = function () {
  518. var len = this.length();
  519. if (len === 0)
  520. return this;
  521. var num = 1.0 / len;
  522. this.x *= num;
  523. this.y *= num;
  524. this.z *= num;
  525. return this;
  526. };
  527. Vector3.prototype.clone = function () {
  528. return new Vector3(this.x, this.y, this.z);
  529. };
  530. Vector3.prototype.copyFrom = function (source) {
  531. this.x = source.x;
  532. this.y = source.y;
  533. this.z = source.z;
  534. };
  535. Vector3.prototype.copyFromFloats = function (x, y, z) {
  536. this.x = x;
  537. this.y = y;
  538. this.z = z;
  539. };
  540. // Statics
  541. Vector3.FromArray = function (array, offset) {
  542. if (!offset) {
  543. offset = 0;
  544. }
  545. return new Vector3(array[offset], array[offset + 1], array[offset + 2]);
  546. };
  547. Vector3.FromArrayToRef = function (array, offset, result) {
  548. result.x = array[offset];
  549. result.y = array[offset + 1];
  550. result.z = array[offset + 2];
  551. };
  552. Vector3.FromFloatArrayToRef = function (array, offset, result) {
  553. result.x = array[offset];
  554. result.y = array[offset + 1];
  555. result.z = array[offset + 2];
  556. };
  557. Vector3.FromFloatsToRef = function (x, y, z, result) {
  558. result.x = x;
  559. result.y = y;
  560. result.z = z;
  561. };
  562. Vector3.Zero = function () {
  563. return new Vector3(0, 0, 0);
  564. };
  565. Vector3.Up = function () {
  566. return new Vector3(0, 1.0, 0);
  567. };
  568. Vector3.TransformCoordinates = function (vector, transformation) {
  569. var result = Vector3.Zero();
  570. Vector3.TransformCoordinatesToRef(vector, transformation, result);
  571. return result;
  572. };
  573. Vector3.TransformCoordinatesToRef = function (vector, transformation, result) {
  574. var x = (vector.x * transformation.m[0]) + (vector.y * transformation.m[4]) + (vector.z * transformation.m[8]) + transformation.m[12];
  575. var y = (vector.x * transformation.m[1]) + (vector.y * transformation.m[5]) + (vector.z * transformation.m[9]) + transformation.m[13];
  576. var z = (vector.x * transformation.m[2]) + (vector.y * transformation.m[6]) + (vector.z * transformation.m[10]) + transformation.m[14];
  577. var w = (vector.x * transformation.m[3]) + (vector.y * transformation.m[7]) + (vector.z * transformation.m[11]) + transformation.m[15];
  578. result.x = x / w;
  579. result.y = y / w;
  580. result.z = z / w;
  581. };
  582. Vector3.TransformCoordinatesFromFloatsToRef = function (x, y, z, transformation, result) {
  583. var rx = (x * transformation.m[0]) + (y * transformation.m[4]) + (z * transformation.m[8]) + transformation.m[12];
  584. var ry = (x * transformation.m[1]) + (y * transformation.m[5]) + (z * transformation.m[9]) + transformation.m[13];
  585. var rz = (x * transformation.m[2]) + (y * transformation.m[6]) + (z * transformation.m[10]) + transformation.m[14];
  586. var rw = (x * transformation.m[3]) + (y * transformation.m[7]) + (z * transformation.m[11]) + transformation.m[15];
  587. result.x = rx / rw;
  588. result.y = ry / rw;
  589. result.z = rz / rw;
  590. };
  591. Vector3.TransformNormal = function (vector, transformation) {
  592. var result = Vector3.Zero();
  593. Vector3.TransformNormalToRef(vector, transformation, result);
  594. return result;
  595. };
  596. Vector3.TransformNormalToRef = function (vector, transformation, result) {
  597. result.x = (vector.x * transformation.m[0]) + (vector.y * transformation.m[4]) + (vector.z * transformation.m[8]);
  598. result.y = (vector.x * transformation.m[1]) + (vector.y * transformation.m[5]) + (vector.z * transformation.m[9]);
  599. result.z = (vector.x * transformation.m[2]) + (vector.y * transformation.m[6]) + (vector.z * transformation.m[10]);
  600. };
  601. Vector3.TransformNormalFromFloatsToRef = function (x, y, z, transformation, result) {
  602. result.x = (x * transformation.m[0]) + (y * transformation.m[4]) + (z * transformation.m[8]);
  603. result.y = (x * transformation.m[1]) + (y * transformation.m[5]) + (z * transformation.m[9]);
  604. result.z = (x * transformation.m[2]) + (y * transformation.m[6]) + (z * transformation.m[10]);
  605. };
  606. Vector3.CatmullRom = function (value1, value2, value3, value4, amount) {
  607. var squared = amount * amount;
  608. var cubed = amount * squared;
  609. var x = 0.5 * ((((2.0 * value2.x) + ((-value1.x + value3.x) * amount)) + (((((2.0 * value1.x) - (5.0 * value2.x)) + (4.0 * value3.x)) - value4.x) * squared)) + ((((-value1.x + (3.0 * value2.x)) - (3.0 * value3.x)) + value4.x) * cubed));
  610. var y = 0.5 * ((((2.0 * value2.y) + ((-value1.y + value3.y) * amount)) + (((((2.0 * value1.y) - (5.0 * value2.y)) + (4.0 * value3.y)) - value4.y) * squared)) + ((((-value1.y + (3.0 * value2.y)) - (3.0 * value3.y)) + value4.y) * cubed));
  611. var z = 0.5 * ((((2.0 * value2.z) + ((-value1.z + value3.z) * amount)) + (((((2.0 * value1.z) - (5.0 * value2.z)) + (4.0 * value3.z)) - value4.z) * squared)) + ((((-value1.z + (3.0 * value2.z)) - (3.0 * value3.z)) + value4.z) * cubed));
  612. return new Vector3(x, y, z);
  613. };
  614. Vector3.Clamp = function (value, min, max) {
  615. var x = value.x;
  616. x = (x > max.x) ? max.x : x;
  617. x = (x < min.x) ? min.x : x;
  618. var y = value.y;
  619. y = (y > max.y) ? max.y : y;
  620. y = (y < min.y) ? min.y : y;
  621. var z = value.z;
  622. z = (z > max.z) ? max.z : z;
  623. z = (z < min.z) ? min.z : z;
  624. return new Vector3(x, y, z);
  625. };
  626. Vector3.Hermite = function (value1, tangent1, value2, tangent2, amount) {
  627. var squared = amount * amount;
  628. var cubed = amount * squared;
  629. var part1 = ((2.0 * cubed) - (3.0 * squared)) + 1.0;
  630. var part2 = (-2.0 * cubed) + (3.0 * squared);
  631. var part3 = (cubed - (2.0 * squared)) + amount;
  632. var part4 = cubed - squared;
  633. var x = (((value1.x * part1) + (value2.x * part2)) + (tangent1.x * part3)) + (tangent2.x * part4);
  634. var y = (((value1.y * part1) + (value2.y * part2)) + (tangent1.y * part3)) + (tangent2.y * part4);
  635. var z = (((value1.z * part1) + (value2.z * part2)) + (tangent1.z * part3)) + (tangent2.z * part4);
  636. return new Vector3(x, y, z);
  637. };
  638. Vector3.Lerp = function (start, end, amount) {
  639. var x = start.x + ((end.x - start.x) * amount);
  640. var y = start.y + ((end.y - start.y) * amount);
  641. var z = start.z + ((end.z - start.z) * amount);
  642. return new Vector3(x, y, z);
  643. };
  644. Vector3.Dot = function (left, right) {
  645. return (left.x * right.x + left.y * right.y + left.z * right.z);
  646. };
  647. Vector3.Cross = function (left, right) {
  648. var result = Vector3.Zero();
  649. Vector3.CrossToRef(left, right, result);
  650. return result;
  651. };
  652. Vector3.CrossToRef = function (left, right, result) {
  653. result.x = left.y * right.z - left.z * right.y;
  654. result.y = left.z * right.x - left.x * right.z;
  655. result.z = left.x * right.y - left.y * right.x;
  656. };
  657. Vector3.Normalize = function (vector) {
  658. var result = Vector3.Zero();
  659. Vector3.NormalizeToRef(vector, result);
  660. return result;
  661. };
  662. Vector3.NormalizeToRef = function (vector, result) {
  663. result.copyFrom(vector);
  664. result.normalize();
  665. };
  666. Vector3.Project = function (vector, world, transform, viewport) {
  667. var cw = viewport.width;
  668. var ch = viewport.height;
  669. var cx = viewport.x;
  670. var cy = viewport.y;
  671. var viewportMatrix = BABYLON.Matrix.FromValues(cw / 2.0, 0, 0, 0, 0, -ch / 2.0, 0, 0, 0, 0, 1, 0, cx + cw / 2.0, ch / 2.0 + cy, 0, 1);
  672. var finalMatrix = world.multiply(transform).multiply(viewportMatrix);
  673. return Vector3.TransformCoordinates(vector, finalMatrix);
  674. };
  675. Vector3.UnprojectFromTransform = function (source, viewportWidth, viewportHeight, world, transform) {
  676. var matrix = world.multiply(transform);
  677. matrix.invert();
  678. source.x = source.x / viewportWidth * 2 - 1;
  679. source.y = -(source.y / viewportHeight * 2 - 1);
  680. var vector = BABYLON.Vector3.TransformCoordinates(source, matrix);
  681. var num = source.x * matrix.m[3] + source.y * matrix.m[7] + source.z * matrix.m[11] + matrix.m[15];
  682. if (BABYLON.Tools.WithinEpsilon(num, 1.0)) {
  683. vector = vector.scale(1.0 / num);
  684. }
  685. return vector;
  686. };
  687. Vector3.Unproject = function (source, viewportWidth, viewportHeight, world, view, projection) {
  688. var matrix = world.multiply(view).multiply(projection);
  689. matrix.invert();
  690. source.x = source.x / viewportWidth * 2 - 1;
  691. source.y = -(source.y / viewportHeight * 2 - 1);
  692. var vector = BABYLON.Vector3.TransformCoordinates(source, matrix);
  693. var num = source.x * matrix.m[3] + source.y * matrix.m[7] + source.z * matrix.m[11] + matrix.m[15];
  694. if (BABYLON.Tools.WithinEpsilon(num, 1.0)) {
  695. vector = vector.scale(1.0 / num);
  696. }
  697. return vector;
  698. };
  699. Vector3.Minimize = function (left, right) {
  700. var min = left.clone();
  701. min.MinimizeInPlace(right);
  702. return min;
  703. };
  704. Vector3.Maximize = function (left, right) {
  705. var max = left.clone();
  706. max.MaximizeInPlace(right);
  707. return max;
  708. };
  709. Vector3.Distance = function (value1, value2) {
  710. return Math.sqrt(Vector3.DistanceSquared(value1, value2));
  711. };
  712. Vector3.DistanceSquared = function (value1, value2) {
  713. var x = value1.x - value2.x;
  714. var y = value1.y - value2.y;
  715. var z = value1.z - value2.z;
  716. return (x * x) + (y * y) + (z * z);
  717. };
  718. Vector3.Center = function (value1, value2) {
  719. var center = value1.add(value2);
  720. center.scaleInPlace(0.5);
  721. return center;
  722. };
  723. return Vector3;
  724. })();
  725. BABYLON.Vector3 = Vector3;
  726. //Vector4 class created for EulerAngle class conversion to Quaternion
  727. var Vector4 = (function () {
  728. function Vector4(x, y, z, w) {
  729. this.x = x;
  730. this.y = y;
  731. this.z = z;
  732. this.w = w;
  733. }
  734. Vector4.prototype.toString = function () {
  735. return "{X: " + this.x + " Y:" + this.y + " Z:" + this.z + "W:" + this.w + "}";
  736. };
  737. // Operators
  738. Vector4.prototype.asArray = function () {
  739. var result = [];
  740. this.toArray(result, 0);
  741. return result;
  742. };
  743. Vector4.prototype.toArray = function (array, index) {
  744. if (index === undefined) {
  745. index = 0;
  746. }
  747. array[index] = this.x;
  748. array[index + 1] = this.y;
  749. array[index + 2] = this.z;
  750. array[index + 3] = this.w;
  751. };
  752. Vector4.prototype.addInPlace = function (otherVector) {
  753. this.x += otherVector.x;
  754. this.y += otherVector.y;
  755. this.z += otherVector.z;
  756. this.w += otherVector.w;
  757. };
  758. Vector4.prototype.add = function (otherVector) {
  759. return new Vector4(this.x + otherVector.x, this.y + otherVector.y, this.z + otherVector.z, this.w + otherVector.w);
  760. };
  761. Vector4.prototype.addToRef = function (otherVector, result) {
  762. result.x = this.x + otherVector.x;
  763. result.y = this.y + otherVector.y;
  764. result.z = this.z + otherVector.z;
  765. result.w = this.w + otherVector.w;
  766. };
  767. Vector4.prototype.subtractInPlace = function (otherVector) {
  768. this.x -= otherVector.x;
  769. this.y -= otherVector.y;
  770. this.z -= otherVector.z;
  771. this.w -= otherVector.w;
  772. };
  773. Vector4.prototype.subtract = function (otherVector) {
  774. return new Vector4(this.x - otherVector.x, this.y - otherVector.y, this.z - otherVector.z, this.w - otherVector.w);
  775. };
  776. Vector4.prototype.subtractToRef = function (otherVector, result) {
  777. result.x = this.x - otherVector.x;
  778. result.y = this.y - otherVector.y;
  779. result.z = this.z - otherVector.z;
  780. result.w = this.w - otherVector.w;
  781. };
  782. Vector4.prototype.subtractFromFloats = function (x, y, z, w) {
  783. return new Vector4(this.x - x, this.y - y, this.z - z, this.w - w);
  784. };
  785. Vector4.prototype.subtractFromFloatsToRef = function (x, y, z, w, result) {
  786. result.x = this.x - x;
  787. result.y = this.y - y;
  788. result.z = this.z - z;
  789. result.w = this.w - w;
  790. };
  791. Vector4.prototype.negate = function () {
  792. return new Vector4(-this.x, -this.y, -this.z, -this.w);
  793. };
  794. Vector4.prototype.scaleInPlace = function (scale) {
  795. this.x *= scale;
  796. this.y *= scale;
  797. this.z *= scale;
  798. this.w *= scale;
  799. return this;
  800. };
  801. Vector4.prototype.scale = function (scale) {
  802. return new Vector4(this.x * scale, this.y * scale, this.z * scale, this.w * scale);
  803. };
  804. Vector4.prototype.scaleToRef = function (scale, result) {
  805. result.x = this.x * scale;
  806. result.y = this.y * scale;
  807. result.z = this.z * scale;
  808. result.w = this.w * scale;
  809. };
  810. Vector4.prototype.equals = function (otherVector) {
  811. return otherVector && this.x === otherVector.x && this.y === otherVector.y && this.z === otherVector.z && this.w === otherVector.w;
  812. };
  813. Vector4.prototype.equalsWithEpsilon = function (otherVector) {
  814. return Math.abs(this.x - otherVector.x) < BABYLON.Engine.Epsilon && Math.abs(this.y - otherVector.y) < BABYLON.Engine.Epsilon && Math.abs(this.z - otherVector.z) < BABYLON.Engine.Epsilon && Math.abs(this.w - otherVector.w) < BABYLON.Engine.Epsilon;
  815. };
  816. Vector4.prototype.equalsToFloats = function (x, y, z, w) {
  817. return this.x === x && this.y === y && this.z === z && this.w === w;
  818. };
  819. Vector4.prototype.multiplyInPlace = function (otherVector) {
  820. this.x *= otherVector.x;
  821. this.y *= otherVector.y;
  822. this.z *= otherVector.z;
  823. this.w *= otherVector.w;
  824. };
  825. Vector4.prototype.multiply = function (otherVector) {
  826. return new Vector4(this.x * otherVector.x, this.y * otherVector.y, this.z * otherVector.z, this.w * otherVector.w);
  827. };
  828. Vector4.prototype.multiplyToRef = function (otherVector, result) {
  829. result.x = this.x * otherVector.x;
  830. result.y = this.y * otherVector.y;
  831. result.z = this.z * otherVector.z;
  832. result.w = this.w * otherVector.w;
  833. };
  834. Vector4.prototype.multiplyByFloats = function (x, y, z, w) {
  835. return new Vector4(this.x * x, this.y * y, this.z * z, this.w * w);
  836. };
  837. Vector4.prototype.divide = function (otherVector) {
  838. return new Vector4(this.x / otherVector.x, this.y / otherVector.y, this.z / otherVector.z, this.w / otherVector.w);
  839. };
  840. Vector4.prototype.divideToRef = function (otherVector, result) {
  841. result.x = this.x / otherVector.x;
  842. result.y = this.y / otherVector.y;
  843. result.z = this.z / otherVector.z;
  844. result.w = this.w / otherVector.w;
  845. };
  846. Vector4.prototype.MinimizeInPlace = function (other) {
  847. if (other.x < this.x)
  848. this.x = other.x;
  849. if (other.y < this.y)
  850. this.y = other.y;
  851. if (other.z < this.z)
  852. this.z = other.z;
  853. if (other.w < this.w)
  854. this.w = other.w;
  855. };
  856. Vector4.prototype.MaximizeInPlace = function (other) {
  857. if (other.x > this.x)
  858. this.x = other.x;
  859. if (other.y > this.y)
  860. this.y = other.y;
  861. if (other.z > this.z)
  862. this.z = other.z;
  863. if (other.w > this.w)
  864. this.w = other.w;
  865. };
  866. // Properties
  867. Vector4.prototype.length = function () {
  868. return Math.sqrt(this.x * this.x + this.y * this.y + this.z * this.z + this.w * this.w);
  869. };
  870. Vector4.prototype.lengthSquared = function () {
  871. return (this.x * this.x + this.y * this.y + this.z * this.z + this.w * this.w);
  872. };
  873. // Methods
  874. Vector4.prototype.normalize = function () {
  875. var len = this.length();
  876. if (len === 0)
  877. return this;
  878. var num = 1.0 / len;
  879. this.x *= num;
  880. this.y *= num;
  881. this.z *= num;
  882. this.w *= num;
  883. return this;
  884. };
  885. Vector4.prototype.clone = function () {
  886. return new Vector4(this.x, this.y, this.z, this.w);
  887. };
  888. Vector4.prototype.copyFrom = function (source) {
  889. this.x = source.x;
  890. this.y = source.y;
  891. this.z = source.z;
  892. this.w = source.w;
  893. };
  894. Vector4.prototype.copyFromFloats = function (x, y, z, w) {
  895. this.x = x;
  896. this.y = y;
  897. this.z = z;
  898. this.w = w;
  899. };
  900. // Statics
  901. Vector4.FromArray = function (array, offset) {
  902. if (!offset) {
  903. offset = 0;
  904. }
  905. return new Vector4(array[offset], array[offset + 1], array[offset + 2], array[offset + 3]);
  906. };
  907. Vector4.FromArrayToRef = function (array, offset, result) {
  908. result.x = array[offset];
  909. result.y = array[offset + 1];
  910. result.z = array[offset + 2];
  911. result.w = array[offset + 3];
  912. };
  913. Vector4.FromFloatArrayToRef = function (array, offset, result) {
  914. result.x = array[offset];
  915. result.y = array[offset + 1];
  916. result.z = array[offset + 2];
  917. result.w = array[offset + 3];
  918. };
  919. Vector4.FromFloatsToRef = function (x, y, z, w, result) {
  920. result.x = x;
  921. result.y = y;
  922. result.z = z;
  923. result.w = w;
  924. };
  925. Vector4.Zero = function () {
  926. return new Vector4(0, 0, 0, 0);
  927. };
  928. Vector4.Normalize = function (vector) {
  929. var result = Vector4.Zero();
  930. Vector4.NormalizeToRef(vector, result);
  931. return result;
  932. };
  933. Vector4.NormalizeToRef = function (vector, result) {
  934. result.copyFrom(vector);
  935. result.normalize();
  936. };
  937. Vector4.Minimize = function (left, right) {
  938. var min = left.clone();
  939. min.MinimizeInPlace(right);
  940. return min;
  941. };
  942. Vector4.Maximize = function (left, right) {
  943. var max = left.clone();
  944. max.MaximizeInPlace(right);
  945. return max;
  946. };
  947. Vector4.Distance = function (value1, value2) {
  948. return Math.sqrt(Vector4.DistanceSquared(value1, value2));
  949. };
  950. Vector4.DistanceSquared = function (value1, value2) {
  951. var x = value1.x - value2.x;
  952. var y = value1.y - value2.y;
  953. var z = value1.z - value2.z;
  954. var w = value1.w - value2.w;
  955. return (x * x) + (y * y) + (z * z) + (w * w);
  956. };
  957. Vector4.Center = function (value1, value2) {
  958. var center = value1.add(value2);
  959. center.scaleInPlace(0.5);
  960. return center;
  961. };
  962. return Vector4;
  963. })();
  964. BABYLON.Vector4 = Vector4;
  965. var Quaternion = (function () {
  966. function Quaternion(x, y, z, w) {
  967. if (typeof x === "undefined") { x = 0; }
  968. if (typeof y === "undefined") { y = 0; }
  969. if (typeof z === "undefined") { z = 0; }
  970. if (typeof w === "undefined") { w = 1; }
  971. this.x = x;
  972. this.y = y;
  973. this.z = z;
  974. this.w = w;
  975. }
  976. Quaternion.prototype.toString = function () {
  977. return "{X: " + this.x + " Y:" + this.y + " Z:" + this.z + " W:" + this.w + "}";
  978. };
  979. Quaternion.prototype.asArray = function () {
  980. return [this.x, this.y, this.z, this.w];
  981. };
  982. Quaternion.prototype.equals = function (otherQuaternion) {
  983. return otherQuaternion && this.x === otherQuaternion.x && this.y === otherQuaternion.y && this.z === otherQuaternion.z && this.w === otherQuaternion.w;
  984. };
  985. Quaternion.prototype.clone = function () {
  986. return new Quaternion(this.x, this.y, this.z, this.w);
  987. };
  988. Quaternion.prototype.copyFrom = function (other) {
  989. this.x = other.x;
  990. this.y = other.y;
  991. this.z = other.z;
  992. this.w = other.w;
  993. };
  994. Quaternion.prototype.copyFromFloats = function (x, y, z, w) {
  995. this.x = x;
  996. this.y = y;
  997. this.z = z;
  998. this.w = w;
  999. };
  1000. Quaternion.prototype.add = function (other) {
  1001. return new Quaternion(this.x + other.x, this.y + other.y, this.z + other.z, this.w + other.w);
  1002. };
  1003. Quaternion.prototype.subtract = function (other) {
  1004. return new Quaternion(this.x - other.x, this.y - other.y, this.z - other.z, this.w - other.w);
  1005. };
  1006. Quaternion.prototype.scale = function (value) {
  1007. return new Quaternion(this.x * value, this.y * value, this.z * value, this.w * value);
  1008. };
  1009. Quaternion.prototype.multiply = function (q1) {
  1010. var result = new Quaternion(0, 0, 0, 1.0);
  1011. this.multiplyToRef(q1, result);
  1012. return result;
  1013. };
  1014. Quaternion.prototype.multiplyToRef = function (q1, result) {
  1015. result.x = this.x * q1.w + this.y * q1.z - this.z * q1.y + this.w * q1.x;
  1016. result.y = -this.x * q1.z + this.y * q1.w + this.z * q1.x + this.w * q1.y;
  1017. result.z = this.x * q1.y - this.y * q1.x + this.z * q1.w + this.w * q1.z;
  1018. result.w = -this.x * q1.x - this.y * q1.y - this.z * q1.z + this.w * q1.w;
  1019. };
  1020. Quaternion.prototype.length = function () {
  1021. return Math.sqrt((this.x * this.x) + (this.y * this.y) + (this.z * this.z) + (this.w * this.w));
  1022. };
  1023. Quaternion.prototype.normalize = function () {
  1024. var length = 1.0 / this.length();
  1025. this.x *= length;
  1026. this.y *= length;
  1027. this.z *= length;
  1028. this.w *= length;
  1029. };
  1030. Quaternion.prototype.toEulerAngles = function () {
  1031. var result = Vector3.Zero();
  1032. this.toEulerAnglesToRef(result);
  1033. return result;
  1034. };
  1035. Quaternion.prototype.toEulerAnglesToRef = function (result) {
  1036. //result is an EulerAngles in the in the z-x-z convention
  1037. var qx = this.x;
  1038. var qy = this.y;
  1039. var qz = this.z;
  1040. var qw = this.w;
  1041. var qxy = qx * qy;
  1042. var qxz = qx * qz;
  1043. var qwy = qw * qy;
  1044. var qwz = qw * qz;
  1045. var qwx = qw * qx;
  1046. var qyz = qy * qz;
  1047. var sqx = qx * qx;
  1048. var sqy = qy * qy;
  1049. var determinant = sqx + sqy;
  1050. if (determinant != 0.000 && determinant != 1.000) {
  1051. result.x = Math.atan2(qxz + qwy, qwx - qyz);
  1052. result.y = Math.acos(1 - 2 * determinant);
  1053. result.z = Math.atan2(qxz - qwy, qwx + qyz);
  1054. } else {
  1055. if (determinant == 0.000) {
  1056. result.x = 0.0;
  1057. result.y = 0.0;
  1058. result.z = Math.atan2(qxy - qwz, 0.5 - sqy - qz * qz); //actually, degeneracy gives us choice with x+z=Math.atan2(qxy-qwz,0.5-sqy-qz*qz)
  1059. } else {
  1060. result.x = Math.atan2(qxy - qwz, 0.5 - sqy - qz * qz); //actually, degeneracy gives us choice with x-z=Math.atan2(qxy-qwz,0.5-sqy-qz*qz)
  1061. result.y = Math.PI;
  1062. result.z = 0.0;
  1063. }
  1064. }
  1065. };
  1066. Quaternion.prototype.toRotationMatrix = function (result) {
  1067. var xx = this.x * this.x;
  1068. var yy = this.y * this.y;
  1069. var zz = this.z * this.z;
  1070. var xy = this.x * this.y;
  1071. var zw = this.z * this.w;
  1072. var zx = this.z * this.x;
  1073. var yw = this.y * this.w;
  1074. var yz = this.y * this.z;
  1075. var xw = this.x * this.w;
  1076. result.m[0] = 1.0 - (2.0 * (yy + zz));
  1077. result.m[1] = 2.0 * (xy + zw);
  1078. result.m[2] = 2.0 * (zx - yw);
  1079. result.m[3] = 0;
  1080. result.m[4] = 2.0 * (xy - zw);
  1081. result.m[5] = 1.0 - (2.0 * (zz + xx));
  1082. result.m[6] = 2.0 * (yz + xw);
  1083. result.m[7] = 0;
  1084. result.m[8] = 2.0 * (zx + yw);
  1085. result.m[9] = 2.0 * (yz - xw);
  1086. result.m[10] = 1.0 - (2.0 * (yy + xx));
  1087. result.m[11] = 0;
  1088. result.m[12] = 0;
  1089. result.m[13] = 0;
  1090. result.m[14] = 0;
  1091. result.m[15] = 1.0;
  1092. };
  1093. Quaternion.prototype.fromRotationMatrix = function (matrix) {
  1094. var data = matrix.m;
  1095. var m11 = data[0], m12 = data[4], m13 = data[8];
  1096. var m21 = data[1], m22 = data[5], m23 = data[9];
  1097. var m31 = data[2], m32 = data[6], m33 = data[10];
  1098. var trace = m11 + m22 + m33;
  1099. var s;
  1100. if (trace > 0) {
  1101. s = 0.5 / Math.sqrt(trace + 1.0);
  1102. this.w = 0.25 / s;
  1103. this.x = (m32 - m23) * s;
  1104. this.y = (m13 - m31) * s;
  1105. this.z = (m21 - m12) * s;
  1106. return;
  1107. }
  1108. if (m11 > m22 && m11 > m33) {
  1109. s = 2.0 * Math.sqrt(1.0 + m11 - m22 - m33);
  1110. this.w = (m32 - m23) / s;
  1111. this.x = 0.25 * s;
  1112. this.y = (m12 + m21) / s;
  1113. this.z = (m13 + m31) / s;
  1114. return;
  1115. }
  1116. if (m22 > m33) {
  1117. s = 2.0 * Math.sqrt(1.0 + m22 - m11 - m33);
  1118. this.w = (m13 - m31) / s;
  1119. this.x = (m12 + m21) / s;
  1120. this.y = 0.25 * s;
  1121. this.z = (m23 + m32) / s;
  1122. return;
  1123. }
  1124. s = 2.0 * Math.sqrt(1.0 + m33 - m11 - m22);
  1125. this.w = (m21 - m12) / s;
  1126. this.x = (m13 + m31) / s;
  1127. this.y = (m23 + m32) / s;
  1128. this.z = 0.25 * s;
  1129. };
  1130. // Statics
  1131. Quaternion.Inverse = function (q) {
  1132. return new Quaternion(-q.x, -q.y, -q.z, q.w);
  1133. };
  1134. Quaternion.RotationAxis = function (axis, angle) {
  1135. var result = new Quaternion();
  1136. var sin = Math.sin(angle / 2);
  1137. result.w = Math.cos(angle / 2);
  1138. result.x = axis.x * sin;
  1139. result.y = axis.y * sin;
  1140. result.z = axis.z * sin;
  1141. return result;
  1142. };
  1143. Quaternion.FromArray = function (array, offset) {
  1144. if (!offset) {
  1145. offset = 0;
  1146. }
  1147. return new Quaternion(array[offset], array[offset + 1], array[offset + 2], array[offset + 3]);
  1148. };
  1149. Quaternion.RotationYawPitchRoll = function (yaw, pitch, roll) {
  1150. var result = new Quaternion();
  1151. Quaternion.RotationYawPitchRollToRef(yaw, pitch, roll, result);
  1152. return result;
  1153. };
  1154. Quaternion.RotationYawPitchRollToRef = function (yaw, pitch, roll, result) {
  1155. var halfRoll = roll * 0.5;
  1156. var halfPitch = pitch * 0.5;
  1157. var halfYaw = yaw * 0.5;
  1158. var sinRoll = Math.sin(halfRoll);
  1159. var cosRoll = Math.cos(halfRoll);
  1160. var sinPitch = Math.sin(halfPitch);
  1161. var cosPitch = Math.cos(halfPitch);
  1162. var sinYaw = Math.sin(halfYaw);
  1163. var cosYaw = Math.cos(halfYaw);
  1164. result.x = (cosYaw * sinPitch * cosRoll) + (sinYaw * cosPitch * sinRoll);
  1165. result.y = (sinYaw * cosPitch * cosRoll) - (cosYaw * sinPitch * sinRoll);
  1166. result.z = (cosYaw * cosPitch * sinRoll) - (sinYaw * sinPitch * cosRoll);
  1167. result.w = (cosYaw * cosPitch * cosRoll) + (sinYaw * sinPitch * sinRoll);
  1168. };
  1169. Quaternion.Slerp = function (left, right, amount) {
  1170. var num2;
  1171. var num3;
  1172. var num = amount;
  1173. var num4 = (((left.x * right.x) + (left.y * right.y)) + (left.z * right.z)) + (left.w * right.w);
  1174. var flag = false;
  1175. if (num4 < 0) {
  1176. flag = true;
  1177. num4 = -num4;
  1178. }
  1179. if (num4 > 0.999999) {
  1180. num3 = 1 - num;
  1181. num2 = flag ? -num : num;
  1182. } else {
  1183. var num5 = Math.acos(num4);
  1184. var num6 = (1.0 / Math.sin(num5));
  1185. num3 = (Math.sin((1.0 - num) * num5)) * num6;
  1186. num2 = flag ? ((-Math.sin(num * num5)) * num6) : ((Math.sin(num * num5)) * num6);
  1187. }
  1188. return new Quaternion((num3 * left.x) + (num2 * right.x), (num3 * left.y) + (num2 * right.y), (num3 * left.z) + (num2 * right.z), (num3 * left.w) + (num2 * right.w));
  1189. };
  1190. return Quaternion;
  1191. })();
  1192. BABYLON.Quaternion = Quaternion;
  1193. var Matrix = (function () {
  1194. function Matrix() {
  1195. this.m = new Float32Array(16);
  1196. }
  1197. // Properties
  1198. Matrix.prototype.isIdentity = function () {
  1199. if (this.m[0] != 1.0 || this.m[5] != 1.0 || this.m[10] != 1.0 || this.m[15] != 1.0)
  1200. return false;
  1201. if (this.m[1] != 0.0 || this.m[2] != 0.0 || this.m[3] != 0.0 || this.m[4] != 0.0 || this.m[6] != 0.0 || this.m[7] != 0.0 || this.m[8] != 0.0 || this.m[9] != 0.0 || this.m[11] != 0.0 || this.m[12] != 0.0 || this.m[13] != 0.0 || this.m[14] != 0.0)
  1202. return false;
  1203. return true;
  1204. };
  1205. Matrix.prototype.determinant = function () {
  1206. var temp1 = (this.m[10] * this.m[15]) - (this.m[11] * this.m[14]);
  1207. var temp2 = (this.m[9] * this.m[15]) - (this.m[11] * this.m[13]);
  1208. var temp3 = (this.m[9] * this.m[14]) - (this.m[10] * this.m[13]);
  1209. var temp4 = (this.m[8] * this.m[15]) - (this.m[11] * this.m[12]);
  1210. var temp5 = (this.m[8] * this.m[14]) - (this.m[10] * this.m[12]);
  1211. var temp6 = (this.m[8] * this.m[13]) - (this.m[9] * this.m[12]);
  1212. return ((((this.m[0] * (((this.m[5] * temp1) - (this.m[6] * temp2)) + (this.m[7] * temp3))) - (this.m[1] * (((this.m[4] * temp1) - (this.m[6] * temp4)) + (this.m[7] * temp5)))) + (this.m[2] * (((this.m[4] * temp2) - (this.m[5] * temp4)) + (this.m[7] * temp6)))) - (this.m[3] * (((this.m[4] * temp3) - (this.m[5] * temp5)) + (this.m[6] * temp6))));
  1213. };
  1214. // Methods
  1215. Matrix.prototype.toArray = function () {
  1216. return this.m;
  1217. };
  1218. Matrix.prototype.asArray = function () {
  1219. return this.toArray();
  1220. };
  1221. Matrix.prototype.invert = function () {
  1222. this.invertToRef(this);
  1223. };
  1224. Matrix.prototype.invertToRef = function (other) {
  1225. var l1 = this.m[0];
  1226. var l2 = this.m[1];
  1227. var l3 = this.m[2];
  1228. var l4 = this.m[3];
  1229. var l5 = this.m[4];
  1230. var l6 = this.m[5];
  1231. var l7 = this.m[6];
  1232. var l8 = this.m[7];
  1233. var l9 = this.m[8];
  1234. var l10 = this.m[9];
  1235. var l11 = this.m[10];
  1236. var l12 = this.m[11];
  1237. var l13 = this.m[12];
  1238. var l14 = this.m[13];
  1239. var l15 = this.m[14];
  1240. var l16 = this.m[15];
  1241. var l17 = (l11 * l16) - (l12 * l15);
  1242. var l18 = (l10 * l16) - (l12 * l14);
  1243. var l19 = (l10 * l15) - (l11 * l14);
  1244. var l20 = (l9 * l16) - (l12 * l13);
  1245. var l21 = (l9 * l15) - (l11 * l13);
  1246. var l22 = (l9 * l14) - (l10 * l13);
  1247. var l23 = ((l6 * l17) - (l7 * l18)) + (l8 * l19);
  1248. var l24 = -(((l5 * l17) - (l7 * l20)) + (l8 * l21));
  1249. var l25 = ((l5 * l18) - (l6 * l20)) + (l8 * l22);
  1250. var l26 = -(((l5 * l19) - (l6 * l21)) + (l7 * l22));
  1251. var l27 = 1.0 / ((((l1 * l23) + (l2 * l24)) + (l3 * l25)) + (l4 * l26));
  1252. var l28 = (l7 * l16) - (l8 * l15);
  1253. var l29 = (l6 * l16) - (l8 * l14);
  1254. var l30 = (l6 * l15) - (l7 * l14);
  1255. var l31 = (l5 * l16) - (l8 * l13);
  1256. var l32 = (l5 * l15) - (l7 * l13);
  1257. var l33 = (l5 * l14) - (l6 * l13);
  1258. var l34 = (l7 * l12) - (l8 * l11);
  1259. var l35 = (l6 * l12) - (l8 * l10);
  1260. var l36 = (l6 * l11) - (l7 * l10);
  1261. var l37 = (l5 * l12) - (l8 * l9);
  1262. var l38 = (l5 * l11) - (l7 * l9);
  1263. var l39 = (l5 * l10) - (l6 * l9);
  1264. other.m[0] = l23 * l27;
  1265. other.m[4] = l24 * l27;
  1266. other.m[8] = l25 * l27;
  1267. other.m[12] = l26 * l27;
  1268. other.m[1] = -(((l2 * l17) - (l3 * l18)) + (l4 * l19)) * l27;
  1269. other.m[5] = (((l1 * l17) - (l3 * l20)) + (l4 * l21)) * l27;
  1270. other.m[9] = -(((l1 * l18) - (l2 * l20)) + (l4 * l22)) * l27;
  1271. other.m[13] = (((l1 * l19) - (l2 * l21)) + (l3 * l22)) * l27;
  1272. other.m[2] = (((l2 * l28) - (l3 * l29)) + (l4 * l30)) * l27;
  1273. other.m[6] = -(((l1 * l28) - (l3 * l31)) + (l4 * l32)) * l27;
  1274. other.m[10] = (((l1 * l29) - (l2 * l31)) + (l4 * l33)) * l27;
  1275. other.m[14] = -(((l1 * l30) - (l2 * l32)) + (l3 * l33)) * l27;
  1276. other.m[3] = -(((l2 * l34) - (l3 * l35)) + (l4 * l36)) * l27;
  1277. other.m[7] = (((l1 * l34) - (l3 * l37)) + (l4 * l38)) * l27;
  1278. other.m[11] = -(((l1 * l35) - (l2 * l37)) + (l4 * l39)) * l27;
  1279. other.m[15] = (((l1 * l36) - (l2 * l38)) + (l3 * l39)) * l27;
  1280. };
  1281. Matrix.prototype.setTranslation = function (vector3) {
  1282. this.m[12] = vector3.x;
  1283. this.m[13] = vector3.y;
  1284. this.m[14] = vector3.z;
  1285. };
  1286. Matrix.prototype.multiply = function (other) {
  1287. var result = new Matrix();
  1288. this.multiplyToRef(other, result);
  1289. return result;
  1290. };
  1291. Matrix.prototype.copyFrom = function (other) {
  1292. for (var index = 0; index < 16; index++) {
  1293. this.m[index] = other.m[index];
  1294. }
  1295. };
  1296. Matrix.prototype.copyToArray = function (array, offset) {
  1297. if (typeof offset === "undefined") { offset = 0; }
  1298. for (var index = 0; index < 16; index++) {
  1299. array[offset + index] = this.m[index];
  1300. }
  1301. };
  1302. Matrix.prototype.multiplyToRef = function (other, result) {
  1303. this.multiplyToArray(other, result.m, 0);
  1304. };
  1305. Matrix.prototype.multiplyToArray = function (other, result, offset) {
  1306. var tm0 = this.m[0];
  1307. var tm1 = this.m[1];
  1308. var tm2 = this.m[2];
  1309. var tm3 = this.m[3];
  1310. var tm4 = this.m[4];
  1311. var tm5 = this.m[5];
  1312. var tm6 = this.m[6];
  1313. var tm7 = this.m[7];
  1314. var tm8 = this.m[8];
  1315. var tm9 = this.m[9];
  1316. var tm10 = this.m[10];
  1317. var tm11 = this.m[11];
  1318. var tm12 = this.m[12];
  1319. var tm13 = this.m[13];
  1320. var tm14 = this.m[14];
  1321. var tm15 = this.m[15];
  1322. var om0 = other.m[0];
  1323. var om1 = other.m[1];
  1324. var om2 = other.m[2];
  1325. var om3 = other.m[3];
  1326. var om4 = other.m[4];
  1327. var om5 = other.m[5];
  1328. var om6 = other.m[6];
  1329. var om7 = other.m[7];
  1330. var om8 = other.m[8];
  1331. var om9 = other.m[9];
  1332. var om10 = other.m[10];
  1333. var om11 = other.m[11];
  1334. var om12 = other.m[12];
  1335. var om13 = other.m[13];
  1336. var om14 = other.m[14];
  1337. var om15 = other.m[15];
  1338. result[offset] = tm0 * om0 + tm1 * om4 + tm2 * om8 + tm3 * om12;
  1339. result[offset + 1] = tm0 * om1 + tm1 * om5 + tm2 * om9 + tm3 * om13;
  1340. result[offset + 2] = tm0 * om2 + tm1 * om6 + tm2 * om10 + tm3 * om14;
  1341. result[offset + 3] = tm0 * om3 + tm1 * om7 + tm2 * om11 + tm3 * om15;
  1342. result[offset + 4] = tm4 * om0 + tm5 * om4 + tm6 * om8 + tm7 * om12;
  1343. result[offset + 5] = tm4 * om1 + tm5 * om5 + tm6 * om9 + tm7 * om13;
  1344. result[offset + 6] = tm4 * om2 + tm5 * om6 + tm6 * om10 + tm7 * om14;
  1345. result[offset + 7] = tm4 * om3 + tm5 * om7 + tm6 * om11 + tm7 * om15;
  1346. result[offset + 8] = tm8 * om0 + tm9 * om4 + tm10 * om8 + tm11 * om12;
  1347. result[offset + 9] = tm8 * om1 + tm9 * om5 + tm10 * om9 + tm11 * om13;
  1348. result[offset + 10] = tm8 * om2 + tm9 * om6 + tm10 * om10 + tm11 * om14;
  1349. result[offset + 11] = tm8 * om3 + tm9 * om7 + tm10 * om11 + tm11 * om15;
  1350. result[offset + 12] = tm12 * om0 + tm13 * om4 + tm14 * om8 + tm15 * om12;
  1351. result[offset + 13] = tm12 * om1 + tm13 * om5 + tm14 * om9 + tm15 * om13;
  1352. result[offset + 14] = tm12 * om2 + tm13 * om6 + tm14 * om10 + tm15 * om14;
  1353. result[offset + 15] = tm12 * om3 + tm13 * om7 + tm14 * om11 + tm15 * om15;
  1354. };
  1355. Matrix.prototype.equals = function (value) {
  1356. return value && (this.m[0] === value.m[0] && this.m[1] === value.m[1] && this.m[2] === value.m[2] && this.m[3] === value.m[3] && this.m[4] === value.m[4] && this.m[5] === value.m[5] && this.m[6] === value.m[6] && this.m[7] === value.m[7] && this.m[8] === value.m[8] && this.m[9] === value.m[9] && this.m[10] === value.m[10] && this.m[11] === value.m[11] && this.m[12] === value.m[12] && this.m[13] === value.m[13] && this.m[14] === value.m[14] && this.m[15] === value.m[15]);
  1357. };
  1358. Matrix.prototype.clone = function () {
  1359. return Matrix.FromValues(this.m[0], this.m[1], this.m[2], this.m[3], this.m[4], this.m[5], this.m[6], this.m[7], this.m[8], this.m[9], this.m[10], this.m[11], this.m[12], this.m[13], this.m[14], this.m[15]);
  1360. };
  1361. // Statics
  1362. Matrix.FromArray = function (array, offset) {
  1363. var result = new Matrix();
  1364. if (!offset) {
  1365. offset = 0;
  1366. }
  1367. Matrix.FromArrayToRef(array, offset, result);
  1368. return result;
  1369. };
  1370. Matrix.FromArrayToRef = function (array, offset, result) {
  1371. for (var index = 0; index < 16; index++) {
  1372. result.m[index] = array[index + offset];
  1373. }
  1374. };
  1375. Matrix.FromValuesToRef = function (initialM11, initialM12, initialM13, initialM14, initialM21, initialM22, initialM23, initialM24, initialM31, initialM32, initialM33, initialM34, initialM41, initialM42, initialM43, initialM44, result) {
  1376. result.m[0] = initialM11;
  1377. result.m[1] = initialM12;
  1378. result.m[2] = initialM13;
  1379. result.m[3] = initialM14;
  1380. result.m[4] = initialM21;
  1381. result.m[5] = initialM22;
  1382. result.m[6] = initialM23;
  1383. result.m[7] = initialM24;
  1384. result.m[8] = initialM31;
  1385. result.m[9] = initialM32;
  1386. result.m[10] = initialM33;
  1387. result.m[11] = initialM34;
  1388. result.m[12] = initialM41;
  1389. result.m[13] = initialM42;
  1390. result.m[14] = initialM43;
  1391. result.m[15] = initialM44;
  1392. };
  1393. Matrix.FromValues = function (initialM11, initialM12, initialM13, initialM14, initialM21, initialM22, initialM23, initialM24, initialM31, initialM32, initialM33, initialM34, initialM41, initialM42, initialM43, initialM44) {
  1394. var result = new Matrix();
  1395. result.m[0] = initialM11;
  1396. result.m[1] = initialM12;
  1397. result.m[2] = initialM13;
  1398. result.m[3] = initialM14;
  1399. result.m[4] = initialM21;
  1400. result.m[5] = initialM22;
  1401. result.m[6] = initialM23;
  1402. result.m[7] = initialM24;
  1403. result.m[8] = initialM31;
  1404. result.m[9] = initialM32;
  1405. result.m[10] = initialM33;
  1406. result.m[11] = initialM34;
  1407. result.m[12] = initialM41;
  1408. result.m[13] = initialM42;
  1409. result.m[14] = initialM43;
  1410. result.m[15] = initialM44;
  1411. return result;
  1412. };
  1413. Matrix.Identity = function () {
  1414. return Matrix.FromValues(1.0, 0, 0, 0, 0, 1.0, 0, 0, 0, 0, 1.0, 0, 0, 0, 0, 1.0);
  1415. };
  1416. Matrix.IdentityToRef = function (result) {
  1417. Matrix.FromValuesToRef(1.0, 0, 0, 0, 0, 1.0, 0, 0, 0, 0, 1.0, 0, 0, 0, 0, 1.0, result);
  1418. };
  1419. Matrix.Zero = function () {
  1420. return Matrix.FromValues(0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0);
  1421. };
  1422. Matrix.RotationX = function (angle) {
  1423. var result = new Matrix();
  1424. Matrix.RotationXToRef(angle, result);
  1425. return result;
  1426. };
  1427. Matrix.Invert = function (source) {
  1428. var result = new Matrix();
  1429. source.invertToRef(result);
  1430. return result;
  1431. };
  1432. Matrix.RotationXToRef = function (angle, result) {
  1433. var s = Math.sin(angle);
  1434. var c = Math.cos(angle);
  1435. result.m[0] = 1.0;
  1436. result.m[15] = 1.0;
  1437. result.m[5] = c;
  1438. result.m[10] = c;
  1439. result.m[9] = -s;
  1440. result.m[6] = s;
  1441. result.m[1] = 0;
  1442. result.m[2] = 0;
  1443. result.m[3] = 0;
  1444. result.m[4] = 0;
  1445. result.m[7] = 0;
  1446. result.m[8] = 0;
  1447. result.m[11] = 0;
  1448. result.m[12] = 0;
  1449. result.m[13] = 0;
  1450. result.m[14] = 0;
  1451. };
  1452. Matrix.RotationY = function (angle) {
  1453. var result = new Matrix();
  1454. Matrix.RotationYToRef(angle, result);
  1455. return result;
  1456. };
  1457. Matrix.RotationYToRef = function (angle, result) {
  1458. var s = Math.sin(angle);
  1459. var c = Math.cos(angle);
  1460. result.m[5] = 1.0;
  1461. result.m[15] = 1.0;
  1462. result.m[0] = c;
  1463. result.m[2] = -s;
  1464. result.m[8] = s;
  1465. result.m[10] = c;
  1466. result.m[1] = 0;
  1467. result.m[3] = 0;
  1468. result.m[4] = 0;
  1469. result.m[6] = 0;
  1470. result.m[7] = 0;
  1471. result.m[9] = 0;
  1472. result.m[11] = 0;
  1473. result.m[12] = 0;
  1474. result.m[13] = 0;
  1475. result.m[14] = 0;
  1476. };
  1477. Matrix.RotationZ = function (angle) {
  1478. var result = new Matrix();
  1479. Matrix.RotationZToRef(angle, result);
  1480. return result;
  1481. };
  1482. Matrix.RotationZToRef = function (angle, result) {
  1483. var s = Math.sin(angle);
  1484. var c = Math.cos(angle);
  1485. result.m[10] = 1.0;
  1486. result.m[15] = 1.0;
  1487. result.m[0] = c;
  1488. result.m[1] = s;
  1489. result.m[4] = -s;
  1490. result.m[5] = c;
  1491. result.m[2] = 0;
  1492. result.m[3] = 0;
  1493. result.m[6] = 0;
  1494. result.m[7] = 0;
  1495. result.m[8] = 0;
  1496. result.m[9] = 0;
  1497. result.m[11] = 0;
  1498. result.m[12] = 0;
  1499. result.m[13] = 0;
  1500. result.m[14] = 0;
  1501. };
  1502. Matrix.RotationAxis = function (axis, angle) {
  1503. var s = Math.sin(-angle);
  1504. var c = Math.cos(-angle);
  1505. var c1 = 1 - c;
  1506. axis.normalize();
  1507. var result = Matrix.Zero();
  1508. result.m[0] = (axis.x * axis.x) * c1 + c;
  1509. result.m[1] = (axis.x * axis.y) * c1 - (axis.z * s);
  1510. result.m[2] = (axis.x * axis.z) * c1 + (axis.y * s);
  1511. result.m[3] = 0.0;
  1512. result.m[4] = (axis.y * axis.x) * c1 + (axis.z * s);
  1513. result.m[5] = (axis.y * axis.y) * c1 + c;
  1514. result.m[6] = (axis.y * axis.z) * c1 - (axis.x * s);
  1515. result.m[7] = 0.0;
  1516. result.m[8] = (axis.z * axis.x) * c1 - (axis.y * s);
  1517. result.m[9] = (axis.z * axis.y) * c1 + (axis.x * s);
  1518. result.m[10] = (axis.z * axis.z) * c1 + c;
  1519. result.m[11] = 0.0;
  1520. result.m[15] = 1.0;
  1521. return result;
  1522. };
  1523. Matrix.RotationYawPitchRoll = function (yaw, pitch, roll) {
  1524. var result = new Matrix();
  1525. Matrix.RotationYawPitchRollToRef(yaw, pitch, roll, result);
  1526. return result;
  1527. };
  1528. Matrix.RotationYawPitchRollToRef = function (yaw, pitch, roll, result) {
  1529. Quaternion.RotationYawPitchRollToRef(yaw, pitch, roll, this._tempQuaternion);
  1530. this._tempQuaternion.toRotationMatrix(result);
  1531. };
  1532. Matrix.Scaling = function (x, y, z) {
  1533. var result = Matrix.Zero();
  1534. Matrix.ScalingToRef(x, y, z, result);
  1535. return result;
  1536. };
  1537. Matrix.ScalingToRef = function (x, y, z, result) {
  1538. result.m[0] = x;
  1539. result.m[1] = 0;
  1540. result.m[2] = 0;
  1541. result.m[3] = 0;
  1542. result.m[4] = 0;
  1543. result.m[5] = y;
  1544. result.m[6] = 0;
  1545. result.m[7] = 0;
  1546. result.m[8] = 0;
  1547. result.m[9] = 0;
  1548. result.m[10] = z;
  1549. result.m[11] = 0;
  1550. result.m[12] = 0;
  1551. result.m[13] = 0;
  1552. result.m[14] = 0;
  1553. result.m[15] = 1.0;
  1554. };
  1555. Matrix.Translation = function (x, y, z) {
  1556. var result = Matrix.Identity();
  1557. Matrix.TranslationToRef(x, y, z, result);
  1558. return result;
  1559. };
  1560. Matrix.TranslationToRef = function (x, y, z, result) {
  1561. Matrix.FromValuesToRef(1.0, 0, 0, 0, 0, 1.0, 0, 0, 0, 0, 1.0, 0, x, y, z, 1.0, result);
  1562. };
  1563. Matrix.LookAtLH = function (eye, target, up) {
  1564. var result = Matrix.Zero();
  1565. Matrix.LookAtLHToRef(eye, target, up, result);
  1566. return result;
  1567. };
  1568. Matrix.LookAtLHToRef = function (eye, target, up, result) {
  1569. // Z axis
  1570. target.subtractToRef(eye, this._zAxis);
  1571. this._zAxis.normalize();
  1572. // X axis
  1573. Vector3.CrossToRef(up, this._zAxis, this._xAxis);
  1574. this._xAxis.normalize();
  1575. // Y axis
  1576. Vector3.CrossToRef(this._zAxis, this._xAxis, this._yAxis);
  1577. this._yAxis.normalize();
  1578. // Eye angles
  1579. var ex = -Vector3.Dot(this._xAxis, eye);
  1580. var ey = -Vector3.Dot(this._yAxis, eye);
  1581. var ez = -Vector3.Dot(this._zAxis, eye);
  1582. return Matrix.FromValuesToRef(this._xAxis.x, this._yAxis.x, this._zAxis.x, 0, this._xAxis.y, this._yAxis.y, this._zAxis.y, 0, this._xAxis.z, this._yAxis.z, this._zAxis.z, 0, ex, ey, ez, 1, result);
  1583. };
  1584. Matrix.OrthoLH = function (width, height, znear, zfar) {
  1585. var hw = 2.0 / width;
  1586. var hh = 2.0 / height;
  1587. var id = 1.0 / (zfar - znear);
  1588. var nid = znear / (znear - zfar);
  1589. return Matrix.FromValues(hw, 0, 0, 0, 0, hh, 0, 0, 0, 0, id, 0, 0, 0, nid, 1);
  1590. };
  1591. Matrix.OrthoOffCenterLH = function (left, right, bottom, top, znear, zfar) {
  1592. var matrix = Matrix.Zero();
  1593. Matrix.OrthoOffCenterLHToRef(left, right, bottom, top, znear, zfar, matrix);
  1594. return matrix;
  1595. };
  1596. Matrix.OrthoOffCenterLHToRef = function (left, right, bottom, top, znear, zfar, result) {
  1597. result.m[0] = 2.0 / (right - left);
  1598. result.m[1] = result.m[2] = result.m[3] = 0;
  1599. result.m[5] = 2.0 / (top - bottom);
  1600. result.m[4] = result.m[6] = result.m[7] = 0;
  1601. result.m[10] = -1.0 / (znear - zfar);
  1602. result.m[8] = result.m[9] = result.m[11] = 0;
  1603. result.m[12] = (left + right) / (left - right);
  1604. result.m[13] = (top + bottom) / (bottom - top);
  1605. result.m[14] = znear / (znear - zfar);
  1606. result.m[15] = 1.0;
  1607. };
  1608. Matrix.PerspectiveLH = function (width, height, znear, zfar) {
  1609. var matrix = Matrix.Zero();
  1610. matrix.m[0] = (2.0 * znear) / width;
  1611. matrix.m[1] = matrix.m[2] = matrix.m[3] = 0.0;
  1612. matrix.m[5] = (2.0 * znear) / height;
  1613. matrix.m[4] = matrix.m[6] = matrix.m[7] = 0.0;
  1614. matrix.m[10] = -zfar / (znear - zfar);
  1615. matrix.m[8] = matrix.m[9] = 0.0;
  1616. matrix.m[11] = 1.0;
  1617. matrix.m[12] = matrix.m[13] = matrix.m[15] = 0.0;
  1618. matrix.m[14] = (znear * zfar) / (znear - zfar);
  1619. return matrix;
  1620. };
  1621. Matrix.PerspectiveFovLH = function (fov, aspect, znear, zfar) {
  1622. var matrix = Matrix.Zero();
  1623. Matrix.PerspectiveFovLHToRef(fov, aspect, znear, zfar, matrix);
  1624. return matrix;
  1625. };
  1626. Matrix.PerspectiveFovLHToRef = function (fov, aspect, znear, zfar, result) {
  1627. var tan = 1.0 / (Math.tan(fov * 0.5));
  1628. result.m[0] = tan / aspect;
  1629. result.m[1] = result.m[2] = result.m[3] = 0.0;
  1630. result.m[5] = tan;
  1631. result.m[4] = result.m[6] = result.m[7] = 0.0;
  1632. result.m[8] = result.m[9] = 0.0;
  1633. result.m[10] = -zfar / (znear - zfar);
  1634. result.m[11] = 1.0;
  1635. result.m[12] = result.m[13] = result.m[15] = 0.0;
  1636. result.m[14] = (znear * zfar) / (znear - zfar);
  1637. };
  1638. Matrix.GetFinalMatrix = function (viewport, world, view, projection, zmin, zmax) {
  1639. var cw = viewport.width;
  1640. var ch = viewport.height;
  1641. var cx = viewport.x;
  1642. var cy = viewport.y;
  1643. var viewportMatrix = Matrix.FromValues(cw / 2.0, 0, 0, 0, 0, -ch / 2.0, 0, 0, 0, 0, zmax - zmin, 0, cx + cw / 2.0, ch / 2.0 + cy, zmin, 1);
  1644. return world.multiply(view).multiply(projection).multiply(viewportMatrix);
  1645. };
  1646. Matrix.Transpose = function (matrix) {
  1647. var result = new Matrix();
  1648. result.m[0] = matrix.m[0];
  1649. result.m[1] = matrix.m[4];
  1650. result.m[2] = matrix.m[8];
  1651. result.m[3] = matrix.m[12];
  1652. result.m[4] = matrix.m[1];
  1653. result.m[5] = matrix.m[5];
  1654. result.m[6] = matrix.m[9];
  1655. result.m[7] = matrix.m[13];
  1656. result.m[8] = matrix.m[2];
  1657. result.m[9] = matrix.m[6];
  1658. result.m[10] = matrix.m[10];
  1659. result.m[11] = matrix.m[14];
  1660. result.m[12] = matrix.m[3];
  1661. result.m[13] = matrix.m[7];
  1662. result.m[14] = matrix.m[11];
  1663. result.m[15] = matrix.m[15];
  1664. return result;
  1665. };
  1666. Matrix.Reflection = function (plane) {
  1667. var matrix = new Matrix();
  1668. Matrix.ReflectionToRef(plane, matrix);
  1669. return matrix;
  1670. };
  1671. Matrix.ReflectionToRef = function (plane, result) {
  1672. plane.normalize();
  1673. var x = plane.normal.x;
  1674. var y = plane.normal.y;
  1675. var z = plane.normal.z;
  1676. var temp = -2 * x;
  1677. var temp2 = -2 * y;
  1678. var temp3 = -2 * z;
  1679. result.m[0] = (temp * x) + 1;
  1680. result.m[1] = temp2 * x;
  1681. result.m[2] = temp3 * x;
  1682. result.m[3] = 0.0;
  1683. result.m[4] = temp * y;
  1684. result.m[5] = (temp2 * y) + 1;
  1685. result.m[6] = temp3 * y;
  1686. result.m[7] = 0.0;
  1687. result.m[8] = temp * z;
  1688. result.m[9] = temp2 * z;
  1689. result.m[10] = (temp3 * z) + 1;
  1690. result.m[11] = 0.0;
  1691. result.m[12] = temp * plane.d;
  1692. result.m[13] = temp2 * plane.d;
  1693. result.m[14] = temp3 * plane.d;
  1694. result.m[15] = 1.0;
  1695. };
  1696. Matrix._tempQuaternion = new Quaternion();
  1697. Matrix._xAxis = Vector3.Zero();
  1698. Matrix._yAxis = Vector3.Zero();
  1699. Matrix._zAxis = Vector3.Zero();
  1700. return Matrix;
  1701. })();
  1702. BABYLON.Matrix = Matrix;
  1703. var Plane = (function () {
  1704. function Plane(a, b, c, d) {
  1705. this.normal = new Vector3(a, b, c);
  1706. this.d = d;
  1707. }
  1708. Plane.prototype.asArray = function () {
  1709. return [this.normal.x, this.normal.y, this.normal.z, this.d];
  1710. };
  1711. // Methods
  1712. Plane.prototype.clone = function () {
  1713. return new Plane(this.normal.x, this.normal.y, this.normal.z, this.d);
  1714. };
  1715. Plane.prototype.normalize = function () {
  1716. var norm = (Math.sqrt((this.normal.x * this.normal.x) + (this.normal.y * this.normal.y) + (this.normal.z * this.normal.z)));
  1717. var magnitude = 0;
  1718. if (norm != 0) {
  1719. magnitude = 1.0 / norm;
  1720. }
  1721. this.normal.x *= magnitude;
  1722. this.normal.y *= magnitude;
  1723. this.normal.z *= magnitude;
  1724. this.d *= magnitude;
  1725. };
  1726. Plane.prototype.transform = function (transformation) {
  1727. var transposedMatrix = BABYLON.Matrix.Transpose(transformation);
  1728. var x = this.normal.x;
  1729. var y = this.normal.y;
  1730. var z = this.normal.z;
  1731. var d = this.d;
  1732. var normalX = (((x * transposedMatrix.m[0]) + (y * transposedMatrix.m[1])) + (z * transposedMatrix.m[2])) + (d * transposedMatrix.m[3]);
  1733. var normalY = (((x * transposedMatrix.m[4]) + (y * transposedMatrix.m[5])) + (z * transposedMatrix.m[6])) + (d * transposedMatrix.m[7]);
  1734. var normalZ = (((x * transposedMatrix.m[8]) + (y * transposedMatrix.m[9])) + (z * transposedMatrix.m[10])) + (d * transposedMatrix.m[11]);
  1735. var finalD = (((x * transposedMatrix.m[12]) + (y * transposedMatrix.m[13])) + (z * transposedMatrix.m[14])) + (d * transposedMatrix.m[15]);
  1736. return new BABYLON.Plane(normalX, normalY, normalZ, finalD);
  1737. };
  1738. Plane.prototype.dotCoordinate = function (point) {
  1739. return ((((this.normal.x * point.x) + (this.normal.y * point.y)) + (this.normal.z * point.z)) + this.d);
  1740. };
  1741. Plane.prototype.copyFromPoints = function (point1, point2, point3) {
  1742. var x1 = point2.x - point1.x;
  1743. var y1 = point2.y - point1.y;
  1744. var z1 = point2.z - point1.z;
  1745. var x2 = point3.x - point1.x;
  1746. var y2 = point3.y - point1.y;
  1747. var z2 = point3.z - point1.z;
  1748. var yz = (y1 * z2) - (z1 * y2);
  1749. var xz = (z1 * x2) - (x1 * z2);
  1750. var xy = (x1 * y2) - (y1 * x2);
  1751. var pyth = (Math.sqrt((yz * yz) + (xz * xz) + (xy * xy)));
  1752. var invPyth;
  1753. if (pyth != 0) {
  1754. invPyth = 1.0 / pyth;
  1755. } else {
  1756. invPyth = 0;
  1757. }
  1758. this.normal.x = yz * invPyth;
  1759. this.normal.y = xz * invPyth;
  1760. this.normal.z = xy * invPyth;
  1761. this.d = -((this.normal.x * point1.x) + (this.normal.y * point1.y) + (this.normal.z * point1.z));
  1762. };
  1763. Plane.prototype.isFrontFacingTo = function (direction, epsilon) {
  1764. var dot = Vector3.Dot(this.normal, direction);
  1765. return (dot <= epsilon);
  1766. };
  1767. Plane.prototype.signedDistanceTo = function (point) {
  1768. return Vector3.Dot(point, this.normal) + this.d;
  1769. };
  1770. // Statics
  1771. Plane.FromArray = function (array) {
  1772. return new BABYLON.Plane(array[0], array[1], array[2], array[3]);
  1773. };
  1774. Plane.FromPoints = function (point1, point2, point3) {
  1775. var result = new BABYLON.Plane(0, 0, 0, 0);
  1776. result.copyFromPoints(point1, point2, point3);
  1777. return result;
  1778. };
  1779. Plane.FromPositionAndNormal = function (origin, normal) {
  1780. var result = new BABYLON.Plane(0, 0, 0, 0);
  1781. normal.normalize();
  1782. result.normal = normal;
  1783. result.d = -(normal.x * origin.x + normal.y * origin.y + normal.z * origin.z);
  1784. return result;
  1785. };
  1786. Plane.SignedDistanceToPlaneFromPositionAndNormal = function (origin, normal, point) {
  1787. var d = -(normal.x * origin.x + normal.y * origin.y + normal.z * origin.z);
  1788. return Vector3.Dot(point, normal) + d;
  1789. };
  1790. return Plane;
  1791. })();
  1792. BABYLON.Plane = Plane;
  1793. var Viewport = (function () {
  1794. function Viewport(x, y, width, height) {
  1795. this.x = x;
  1796. this.y = y;
  1797. this.width = width;
  1798. this.height = height;
  1799. }
  1800. Viewport.prototype.toGlobal = function (engine) {
  1801. var width = engine.getRenderWidth();
  1802. var height = engine.getRenderHeight();
  1803. return new Viewport(this.x * width, this.y * height, this.width * width, this.height * height);
  1804. };
  1805. return Viewport;
  1806. })();
  1807. BABYLON.Viewport = Viewport;
  1808. var Frustum = (function () {
  1809. function Frustum() {
  1810. }
  1811. Frustum.GetPlanes = function (transform) {
  1812. var frustumPlanes = [];
  1813. for (var index = 0; index < 6; index++) {
  1814. frustumPlanes.push(new Plane(0, 0, 0, 0));
  1815. }
  1816. Frustum.GetPlanesToRef(transform, frustumPlanes);
  1817. return frustumPlanes;
  1818. };
  1819. Frustum.GetPlanesToRef = function (transform, frustumPlanes) {
  1820. // Near
  1821. frustumPlanes[0].normal.x = transform.m[3] + transform.m[2];
  1822. frustumPlanes[0].normal.y = transform.m[7] + transform.m[6];
  1823. frustumPlanes[0].normal.z = transform.m[10] + transform.m[10];
  1824. frustumPlanes[0].d = transform.m[15] + transform.m[14];
  1825. frustumPlanes[0].normalize();
  1826. // Far
  1827. frustumPlanes[1].normal.x = transform.m[3] - transform.m[2];
  1828. frustumPlanes[1].normal.y = transform.m[7] - transform.m[6];
  1829. frustumPlanes[1].normal.z = transform.m[11] - transform.m[10];
  1830. frustumPlanes[1].d = transform.m[15] - transform.m[14];
  1831. frustumPlanes[1].normalize();
  1832. // Left
  1833. frustumPlanes[2].normal.x = transform.m[3] + transform.m[0];
  1834. frustumPlanes[2].normal.y = transform.m[7] + transform.m[4];
  1835. frustumPlanes[2].normal.z = transform.m[11] + transform.m[8];
  1836. frustumPlanes[2].d = transform.m[15] + transform.m[12];
  1837. frustumPlanes[2].normalize();
  1838. // Right
  1839. frustumPlanes[3].normal.x = transform.m[3] - transform.m[0];
  1840. frustumPlanes[3].normal.y = transform.m[7] - transform.m[4];
  1841. frustumPlanes[3].normal.z = transform.m[11] - transform.m[8];
  1842. frustumPlanes[3].d = transform.m[15] - transform.m[12];
  1843. frustumPlanes[3].normalize();
  1844. // Top
  1845. frustumPlanes[4].normal.x = transform.m[3] - transform.m[1];
  1846. frustumPlanes[4].normal.y = transform.m[7] - transform.m[5];
  1847. frustumPlanes[4].normal.z = transform.m[11] - transform.m[9];
  1848. frustumPlanes[4].d = transform.m[15] - transform.m[13];
  1849. frustumPlanes[4].normalize();
  1850. // Bottom
  1851. frustumPlanes[5].normal.x = transform.m[3] + transform.m[1];
  1852. frustumPlanes[5].normal.y = transform.m[7] + transform.m[5];
  1853. frustumPlanes[5].normal.z = transform.m[11] + transform.m[9];
  1854. frustumPlanes[5].d = transform.m[15] + transform.m[13];
  1855. frustumPlanes[5].normalize();
  1856. };
  1857. return Frustum;
  1858. })();
  1859. BABYLON.Frustum = Frustum;
  1860. var Ray = (function () {
  1861. function Ray(origin, direction, length) {
  1862. if (typeof length === "undefined") { length = Number.MAX_VALUE; }
  1863. this.origin = origin;
  1864. this.direction = direction;
  1865. this.length = length;
  1866. }
  1867. // Methods
  1868. Ray.prototype.intersectsBoxMinMax = function (minimum, maximum) {
  1869. var d = 0.0;
  1870. var maxValue = Number.MAX_VALUE;
  1871. if (Math.abs(this.direction.x) < 0.0000001) {
  1872. if (this.origin.x < minimum.x || this.origin.x > maximum.x) {
  1873. return false;
  1874. }
  1875. } else {
  1876. var inv = 1.0 / this.direction.x;
  1877. var min = (minimum.x - this.origin.x) * inv;
  1878. var max = (maximum.x - this.origin.x) * inv;
  1879. if (max == -Infinity) {
  1880. max = Infinity;
  1881. }
  1882. if (min > max) {
  1883. var temp = min;
  1884. min = max;
  1885. max = temp;
  1886. }
  1887. d = Math.max(min, d);
  1888. maxValue = Math.min(max, maxValue);
  1889. if (d > maxValue) {
  1890. return false;
  1891. }
  1892. }
  1893. if (Math.abs(this.direction.y) < 0.0000001) {
  1894. if (this.origin.y < minimum.y || this.origin.y > maximum.y) {
  1895. return false;
  1896. }
  1897. } else {
  1898. inv = 1.0 / this.direction.y;
  1899. min = (minimum.y - this.origin.y) * inv;
  1900. max = (maximum.y - this.origin.y) * inv;
  1901. if (max == -Infinity) {
  1902. max = Infinity;
  1903. }
  1904. if (min > max) {
  1905. temp = min;
  1906. min = max;
  1907. max = temp;
  1908. }
  1909. d = Math.max(min, d);
  1910. maxValue = Math.min(max, maxValue);
  1911. if (d > maxValue) {
  1912. return false;
  1913. }
  1914. }
  1915. if (Math.abs(this.direction.z) < 0.0000001) {
  1916. if (this.origin.z < minimum.z || this.origin.z > maximum.z) {
  1917. return false;
  1918. }
  1919. } else {
  1920. inv = 1.0 / this.direction.z;
  1921. min = (minimum.z - this.origin.z) * inv;
  1922. max = (maximum.z - this.origin.z) * inv;
  1923. if (max == -Infinity) {
  1924. max = Infinity;
  1925. }
  1926. if (min > max) {
  1927. temp = min;
  1928. min = max;
  1929. max = temp;
  1930. }
  1931. d = Math.max(min, d);
  1932. maxValue = Math.min(max, maxValue);
  1933. if (d > maxValue) {
  1934. return false;
  1935. }
  1936. }
  1937. return true;
  1938. };
  1939. Ray.prototype.intersectsBox = function (box) {
  1940. return this.intersectsBoxMinMax(box.minimum, box.maximum);
  1941. };
  1942. Ray.prototype.intersectsSphere = function (sphere) {
  1943. var x = sphere.center.x - this.origin.x;
  1944. var y = sphere.center.y - this.origin.y;
  1945. var z = sphere.center.z - this.origin.z;
  1946. var pyth = (x * x) + (y * y) + (z * z);
  1947. var rr = sphere.radius * sphere.radius;
  1948. if (pyth <= rr) {
  1949. return true;
  1950. }
  1951. var dot = (x * this.direction.x) + (y * this.direction.y) + (z * this.direction.z);
  1952. if (dot < 0.0) {
  1953. return false;
  1954. }
  1955. var temp = pyth - (dot * dot);
  1956. return temp <= rr;
  1957. };
  1958. Ray.prototype.intersectsTriangle = function (vertex0, vertex1, vertex2) {
  1959. if (!this._edge1) {
  1960. this._edge1 = BABYLON.Vector3.Zero();
  1961. this._edge2 = BABYLON.Vector3.Zero();
  1962. this._pvec = BABYLON.Vector3.Zero();
  1963. this._tvec = BABYLON.Vector3.Zero();
  1964. this._qvec = BABYLON.Vector3.Zero();
  1965. }
  1966. vertex1.subtractToRef(vertex0, this._edge1);
  1967. vertex2.subtractToRef(vertex0, this._edge2);
  1968. BABYLON.Vector3.CrossToRef(this.direction, this._edge2, this._pvec);
  1969. var det = Vector3.Dot(this._edge1, this._pvec);
  1970. if (det === 0) {
  1971. return null;
  1972. }
  1973. var invdet = 1 / det;
  1974. this.origin.subtractToRef(vertex0, this._tvec);
  1975. var bu = Vector3.Dot(this._tvec, this._pvec) * invdet;
  1976. if (bu < 0 || bu > 1.0) {
  1977. return null;
  1978. }
  1979. Vector3.CrossToRef(this._tvec, this._edge1, this._qvec);
  1980. var bv = Vector3.Dot(this.direction, this._qvec) * invdet;
  1981. if (bv < 0 || bu + bv > 1.0) {
  1982. return null;
  1983. }
  1984. //check if the distance is longer than the predefined length.
  1985. var distance = Vector3.Dot(this._edge2, this._qvec) * invdet;
  1986. if (distance > this.length) {
  1987. return null;
  1988. }
  1989. return new BABYLON.IntersectionInfo(bu, bv, distance);
  1990. };
  1991. // Statics
  1992. Ray.CreateNew = function (x, y, viewportWidth, viewportHeight, world, view, projection) {
  1993. var start = BABYLON.Vector3.Unproject(new BABYLON.Vector3(x, y, 0), viewportWidth, viewportHeight, world, view, projection);
  1994. var end = BABYLON.Vector3.Unproject(new BABYLON.Vector3(x, y, 1), viewportWidth, viewportHeight, world, view, projection);
  1995. var direction = end.subtract(start);
  1996. direction.normalize();
  1997. return new Ray(start, direction);
  1998. };
  1999. /**
  2000. * Function will create a new transformed ray starting from origin and ending at the end point. Ray's length will be set, and ray will be
  2001. * transformed to the given world matrix.
  2002. * @param origin The origin point
  2003. * @param end The end point
  2004. * @param world a matrix to transform the ray to. Default is the identity matrix.
  2005. */
  2006. Ray.CreateNewFromTo = function (origin, end, world) {
  2007. if (typeof world === "undefined") { world = BABYLON.Matrix.Identity(); }
  2008. var direction = end.subtract(origin);
  2009. var length = Math.sqrt((direction.x * direction.x) + (direction.y * direction.y) + (direction.z * direction.z));
  2010. direction.normalize();
  2011. return Ray.Transform(new Ray(origin, direction, length), world);
  2012. };
  2013. Ray.Transform = function (ray, matrix) {
  2014. var newOrigin = BABYLON.Vector3.TransformCoordinates(ray.origin, matrix);
  2015. var newDirection = BABYLON.Vector3.TransformNormal(ray.direction, matrix);
  2016. return new Ray(newOrigin, newDirection, ray.length);
  2017. };
  2018. return Ray;
  2019. })();
  2020. BABYLON.Ray = Ray;
  2021. (function (Space) {
  2022. Space[Space["LOCAL"] = 0] = "LOCAL";
  2023. Space[Space["WORLD"] = 1] = "WORLD";
  2024. })(BABYLON.Space || (BABYLON.Space = {}));
  2025. var Space = BABYLON.Space;
  2026. var Axis = (function () {
  2027. function Axis() {
  2028. }
  2029. Axis.X = new BABYLON.Vector3(1, 0, 0);
  2030. Axis.Y = new BABYLON.Vector3(0, 1, 0);
  2031. Axis.Z = new BABYLON.Vector3(0, 0, 1);
  2032. return Axis;
  2033. })();
  2034. BABYLON.Axis = Axis;
  2035. ;
  2036. var BezierCurve = (function () {
  2037. function BezierCurve() {
  2038. }
  2039. BezierCurve.interpolate = function (t, x1, y1, x2, y2) {
  2040. // Extract X (which is equal to time here)
  2041. var f0 = 1 - 3 * x2 + 3 * x1;
  2042. var f1 = 3 * x2 - 6 * x1;
  2043. var f2 = 3 * x1;
  2044. var refinedT = t;
  2045. for (var i = 0; i < 5; i++) {
  2046. var refinedT2 = refinedT * refinedT;
  2047. var refinedT3 = refinedT2 * refinedT;
  2048. var x = f0 * refinedT3 + f1 * refinedT2 + f2 * refinedT;
  2049. var slope = 1.0 / (3.0 * f0 * refinedT2 + 2.0 * f1 * refinedT + f2);
  2050. refinedT -= (x - t) * slope;
  2051. refinedT = Math.min(1, Math.max(0, refinedT));
  2052. }
  2053. // Resolve cubic bezier for the given x
  2054. return 3 * Math.pow(1 - refinedT, 2) * refinedT * y1 + 3 * (1 - refinedT) * Math.pow(refinedT, 2) * y2 + Math.pow(refinedT, 3);
  2055. };
  2056. return BezierCurve;
  2057. })();
  2058. BABYLON.BezierCurve = BezierCurve;
  2059. })(BABYLON || (BABYLON = {}));
  2060. //# sourceMappingURL=babylon.math.js.map
  2061. var BABYLON;
  2062. (function (BABYLON) {
  2063. // Screenshots
  2064. var screenshotCanvas;
  2065. var cloneValue = function (source, destinationObject) {
  2066. if (!source)
  2067. return null;
  2068. if (source instanceof BABYLON.Mesh) {
  2069. return null;
  2070. }
  2071. if (source instanceof BABYLON.SubMesh) {
  2072. return source.clone(destinationObject);
  2073. } else if (source.clone) {
  2074. return source.clone();
  2075. }
  2076. return null;
  2077. };
  2078. var Tools = (function () {
  2079. function Tools() {
  2080. }
  2081. Tools.GetFilename = function (path) {
  2082. var index = path.lastIndexOf("/");
  2083. if (index < 0)
  2084. return path;
  2085. return path.substring(index + 1);
  2086. };
  2087. Tools.GetDOMTextContent = function (element) {
  2088. var result = "";
  2089. var child = element.firstChild;
  2090. while (child) {
  2091. if (child.nodeType == 3) {
  2092. result += child.textContent;
  2093. }
  2094. child = child.nextSibling;
  2095. }
  2096. return result;
  2097. };
  2098. Tools.ToDegrees = function (angle) {
  2099. return angle * 180 / Math.PI;
  2100. };
  2101. Tools.ToRadians = function (angle) {
  2102. return angle * Math.PI / 180;
  2103. };
  2104. Tools.ExtractMinAndMaxIndexed = function (positions, indices, indexStart, indexCount) {
  2105. var minimum = new BABYLON.Vector3(Number.MAX_VALUE, Number.MAX_VALUE, Number.MAX_VALUE);
  2106. var maximum = new BABYLON.Vector3(-Number.MAX_VALUE, -Number.MAX_VALUE, -Number.MAX_VALUE);
  2107. for (var index = indexStart; index < indexStart + indexCount; index++) {
  2108. var current = new BABYLON.Vector3(positions[indices[index] * 3], positions[indices[index] * 3 + 1], positions[indices[index] * 3 + 2]);
  2109. minimum = BABYLON.Vector3.Minimize(current, minimum);
  2110. maximum = BABYLON.Vector3.Maximize(current, maximum);
  2111. }
  2112. return {
  2113. minimum: minimum,
  2114. maximum: maximum
  2115. };
  2116. };
  2117. Tools.ExtractMinAndMax = function (positions, start, count) {
  2118. var minimum = new BABYLON.Vector3(Number.MAX_VALUE, Number.MAX_VALUE, Number.MAX_VALUE);
  2119. var maximum = new BABYLON.Vector3(-Number.MAX_VALUE, -Number.MAX_VALUE, -Number.MAX_VALUE);
  2120. for (var index = start; index < start + count; index++) {
  2121. var current = new BABYLON.Vector3(positions[index * 3], positions[index * 3 + 1], positions[index * 3 + 2]);
  2122. minimum = BABYLON.Vector3.Minimize(current, minimum);
  2123. maximum = BABYLON.Vector3.Maximize(current, maximum);
  2124. }
  2125. return {
  2126. minimum: minimum,
  2127. maximum: maximum
  2128. };
  2129. };
  2130. Tools.MakeArray = function (obj, allowsNullUndefined) {
  2131. if (allowsNullUndefined !== true && (obj === undefined || obj == null))
  2132. return undefined;
  2133. return Array.isArray(obj) ? obj : [obj];
  2134. };
  2135. // Misc.
  2136. Tools.GetPointerPrefix = function () {
  2137. var eventPrefix = "pointer";
  2138. // Check if hand.js is referenced or if the browser natively supports pointer events
  2139. if (!navigator.pointerEnabled) {
  2140. eventPrefix = "mouse";
  2141. }
  2142. return eventPrefix;
  2143. };
  2144. Tools.QueueNewFrame = function (func) {
  2145. if (window.requestAnimationFrame)
  2146. window.requestAnimationFrame(func);
  2147. else if (window.msRequestAnimationFrame)
  2148. window.msRequestAnimationFrame(func);
  2149. else if (window.webkitRequestAnimationFrame)
  2150. window.webkitRequestAnimationFrame(func);
  2151. else if (window.mozRequestAnimationFrame)
  2152. window.mozRequestAnimationFrame(func);
  2153. else if (window.oRequestAnimationFrame)
  2154. window.oRequestAnimationFrame(func);
  2155. else {
  2156. window.setTimeout(func, 16);
  2157. }
  2158. };
  2159. Tools.RequestFullscreen = function (element) {
  2160. if (element.requestFullscreen)
  2161. element.requestFullscreen();
  2162. else if (element.msRequestFullscreen)
  2163. element.msRequestFullscreen();
  2164. else if (element.webkitRequestFullscreen)
  2165. element.webkitRequestFullscreen();
  2166. else if (element.mozRequestFullScreen)
  2167. element.mozRequestFullScreen();
  2168. };
  2169. Tools.ExitFullscreen = function () {
  2170. if (document.exitFullscreen) {
  2171. document.exitFullscreen();
  2172. } else if (document.mozCancelFullScreen) {
  2173. document.mozCancelFullScreen();
  2174. } else if (document.webkitCancelFullScreen) {
  2175. document.webkitCancelFullScreen();
  2176. } else if (document.msCancelFullScreen) {
  2177. document.msCancelFullScreen();
  2178. }
  2179. };
  2180. // External files
  2181. Tools.CleanUrl = function (url) {
  2182. url = url.replace(/#/mg, "%23");
  2183. return url;
  2184. };
  2185. Tools.LoadImage = function (url, onload, onerror, database) {
  2186. url = Tools.CleanUrl(url);
  2187. var img = new Image();
  2188. if (url.substr(0, 5) != "data:")
  2189. img.crossOrigin = 'anonymous';
  2190. img.onload = function () {
  2191. onload(img);
  2192. };
  2193. img.onerror = function (err) {
  2194. onerror(img, err);
  2195. };
  2196. var noIndexedDB = function () {
  2197. img.src = url;
  2198. };
  2199. var loadFromIndexedDB = function () {
  2200. database.loadImageFromDB(url, img);
  2201. };
  2202. //ANY database to do!
  2203. if (database && database.enableTexturesOffline && BABYLON.Database.isUASupportingBlobStorage) {
  2204. database.openAsync(loadFromIndexedDB, noIndexedDB);
  2205. } else {
  2206. if (url.indexOf("file:") === -1) {
  2207. noIndexedDB();
  2208. } else {
  2209. try {
  2210. var textureName = url.substring(5);
  2211. var blobURL;
  2212. try {
  2213. blobURL = URL.createObjectURL(BABYLON.FilesInput.FilesTextures[textureName], { oneTimeOnly: true });
  2214. } catch (ex) {
  2215. // Chrome doesn't support oneTimeOnly parameter
  2216. blobURL = URL.createObjectURL(BABYLON.FilesInput.FilesTextures[textureName]);
  2217. }
  2218. img.src = blobURL;
  2219. } catch (e) {
  2220. Tools.Log("Error while trying to load texture: " + textureName);
  2221. img.src = null;
  2222. }
  2223. }
  2224. }
  2225. return img;
  2226. };
  2227. //ANY
  2228. Tools.LoadFile = function (url, callback, progressCallBack, database, useArrayBuffer, onError) {
  2229. url = Tools.CleanUrl(url);
  2230. var noIndexedDB = function () {
  2231. var request = new XMLHttpRequest();
  2232. var loadUrl = Tools.BaseUrl + url;
  2233. request.open('GET', loadUrl, true);
  2234. if (useArrayBuffer) {
  2235. request.responseType = "arraybuffer";
  2236. }
  2237. request.onprogress = progressCallBack;
  2238. request.onreadystatechange = function () {
  2239. if (request.readyState == 4) {
  2240. if (request.status == 200 || BABYLON.Tools.ValidateXHRData(request, !useArrayBuffer ? 1 : 6)) {
  2241. callback(!useArrayBuffer ? request.responseText : request.response);
  2242. } else {
  2243. if (onError) {
  2244. onError();
  2245. } else {
  2246. throw new Error("Error status: " + request.status + " - Unable to load " + loadUrl);
  2247. }
  2248. }
  2249. }
  2250. };
  2251. request.send(null);
  2252. };
  2253. var loadFromIndexedDB = function () {
  2254. database.loadFileFromDB(url, callback, progressCallBack, noIndexedDB, useArrayBuffer);
  2255. };
  2256. if (url.indexOf("file:") !== -1) {
  2257. var fileName = url.substring(5);
  2258. BABYLON.Tools.ReadFile(BABYLON.FilesInput.FilesToLoad[fileName], callback, progressCallBack, true);
  2259. } else {
  2260. // Caching all files
  2261. if (database && database.enableSceneOffline) {
  2262. database.openAsync(loadFromIndexedDB, noIndexedDB);
  2263. } else {
  2264. noIndexedDB();
  2265. }
  2266. }
  2267. };
  2268. Tools.ReadFileAsDataURL = function (fileToLoad, callback, progressCallback) {
  2269. var reader = new FileReader();
  2270. reader.onload = function (e) {
  2271. callback(e.target.result);
  2272. };
  2273. reader.onprogress = progressCallback;
  2274. reader.readAsDataURL(fileToLoad);
  2275. };
  2276. Tools.ReadFile = function (fileToLoad, callback, progressCallBack, useArrayBuffer) {
  2277. var reader = new FileReader();
  2278. reader.onload = function (e) {
  2279. callback(e.target.result);
  2280. };
  2281. reader.onprogress = progressCallBack;
  2282. if (!useArrayBuffer) {
  2283. // Asynchronous read
  2284. reader.readAsText(fileToLoad);
  2285. } else {
  2286. reader.readAsArrayBuffer(fileToLoad);
  2287. }
  2288. };
  2289. // Misc.
  2290. Tools.Clamp = function (value, min, max) {
  2291. if (typeof min === "undefined") { min = 0; }
  2292. if (typeof max === "undefined") { max = 1; }
  2293. return Math.min(max, Math.max(min, value));
  2294. };
  2295. Tools.Format = function (value, decimals) {
  2296. if (typeof decimals === "undefined") { decimals = 2; }
  2297. return value.toFixed(decimals);
  2298. };
  2299. Tools.CheckExtends = function (v, min, max) {
  2300. if (v.x < min.x)
  2301. min.x = v.x;
  2302. if (v.y < min.y)
  2303. min.y = v.y;
  2304. if (v.z < min.z)
  2305. min.z = v.z;
  2306. if (v.x > max.x)
  2307. max.x = v.x;
  2308. if (v.y > max.y)
  2309. max.y = v.y;
  2310. if (v.z > max.z)
  2311. max.z = v.z;
  2312. };
  2313. Tools.WithinEpsilon = function (a, b) {
  2314. var num = a - b;
  2315. return -1.401298E-45 <= num && num <= 1.401298E-45;
  2316. };
  2317. Tools.DeepCopy = function (source, destination, doNotCopyList, mustCopyList) {
  2318. for (var prop in source) {
  2319. if (prop[0] === "_" && (!mustCopyList || mustCopyList.indexOf(prop) === -1)) {
  2320. continue;
  2321. }
  2322. if (doNotCopyList && doNotCopyList.indexOf(prop) !== -1) {
  2323. continue;
  2324. }
  2325. var sourceValue = source[prop];
  2326. var typeOfSourceValue = typeof sourceValue;
  2327. if (typeOfSourceValue == "function") {
  2328. continue;
  2329. }
  2330. if (typeOfSourceValue == "object") {
  2331. if (sourceValue instanceof Array) {
  2332. destination[prop] = [];
  2333. if (sourceValue.length > 0) {
  2334. if (typeof sourceValue[0] == "object") {
  2335. for (var index = 0; index < sourceValue.length; index++) {
  2336. var clonedValue = cloneValue(sourceValue[index], destination);
  2337. if (destination[prop].indexOf(clonedValue) === -1) {
  2338. destination[prop].push(clonedValue);
  2339. }
  2340. }
  2341. } else {
  2342. destination[prop] = sourceValue.slice(0);
  2343. }
  2344. }
  2345. } else {
  2346. destination[prop] = cloneValue(sourceValue, destination);
  2347. }
  2348. } else {
  2349. destination[prop] = sourceValue;
  2350. }
  2351. }
  2352. };
  2353. Tools.IsEmpty = function (obj) {
  2354. for (var i in obj) {
  2355. return false;
  2356. }
  2357. return true;
  2358. };
  2359. Tools.RegisterTopRootEvents = function (events) {
  2360. for (var index = 0; index < events.length; index++) {
  2361. var event = events[index];
  2362. window.addEventListener(event.name, event.handler, false);
  2363. try {
  2364. if (window.parent) {
  2365. window.parent.addEventListener(event.name, event.handler, false);
  2366. }
  2367. } catch (e) {
  2368. // Silently fails...
  2369. }
  2370. }
  2371. };
  2372. Tools.UnregisterTopRootEvents = function (events) {
  2373. for (var index = 0; index < events.length; index++) {
  2374. var event = events[index];
  2375. window.removeEventListener(event.name, event.handler);
  2376. try {
  2377. if (window.parent) {
  2378. window.parent.removeEventListener(event.name, event.handler);
  2379. }
  2380. } catch (e) {
  2381. // Silently fails...
  2382. }
  2383. }
  2384. };
  2385. Tools.CreateScreenshot = function (engine, camera, size) {
  2386. var width;
  2387. var height;
  2388. var scene = camera.getScene();
  2389. var previousCamera = null;
  2390. if (scene.activeCamera !== camera) {
  2391. previousCamera = scene.activeCamera;
  2392. scene.activeCamera = camera;
  2393. }
  2394. //If a precision value is specified
  2395. if (size.precision) {
  2396. width = Math.round(engine.getRenderWidth() * size.precision);
  2397. height = Math.round(width / engine.getAspectRatio(camera));
  2398. size = { width: width, height: height };
  2399. } else if (size.width && size.height) {
  2400. width = size.width;
  2401. height = size.height;
  2402. } else if (size.width && !size.height) {
  2403. width = size.width;
  2404. height = Math.round(width / engine.getAspectRatio(camera));
  2405. size = { width: width, height: height };
  2406. } else if (size.height && !size.width) {
  2407. height = size.height;
  2408. width = Math.round(height * engine.getAspectRatio(camera));
  2409. size = { width: width, height: height };
  2410. } else if (!isNaN(size)) {
  2411. height = size;
  2412. width = size;
  2413. } else {
  2414. Tools.Error("Invalid 'size' parameter !");
  2415. return;
  2416. }
  2417. //At this point size can be a number, or an object (according to engine.prototype.createRenderTargetTexture method)
  2418. var texture = new BABYLON.RenderTargetTexture("screenShot", size, engine.scenes[0], false, false);
  2419. texture.renderList = engine.scenes[0].meshes;
  2420. texture.onAfterRender = function () {
  2421. // Read the contents of the framebuffer
  2422. var numberOfChannelsByLine = width * 4;
  2423. var halfHeight = height / 2;
  2424. //Reading datas from WebGL
  2425. var data = engine.readPixels(0, 0, width, height);
  2426. for (var i = 0; i < halfHeight; i++) {
  2427. for (var j = 0; j < numberOfChannelsByLine; j++) {
  2428. var currentCell = j + i * numberOfChannelsByLine;
  2429. var targetLine = height - i - 1;
  2430. var targetCell = j + targetLine * numberOfChannelsByLine;
  2431. var temp = data[currentCell];
  2432. data[currentCell] = data[targetCell];
  2433. data[targetCell] = temp;
  2434. }
  2435. }
  2436. // Create a 2D canvas to store the result
  2437. if (!screenshotCanvas) {
  2438. screenshotCanvas = document.createElement('canvas');
  2439. }
  2440. screenshotCanvas.width = width;
  2441. screenshotCanvas.height = height;
  2442. var context = screenshotCanvas.getContext('2d');
  2443. // Copy the pixels to a 2D canvas
  2444. var imageData = context.createImageData(width, height);
  2445. imageData.data.set(data);
  2446. context.putImageData(imageData, 0, 0);
  2447. var base64Image = screenshotCanvas.toDataURL();
  2448. //Creating a link if the browser have the download attribute on the a tag, to automatically start download generated image.
  2449. if (("download" in document.createElement("a"))) {
  2450. var a = window.document.createElement("a");
  2451. a.href = base64Image;
  2452. var date = new Date();
  2453. var stringDate = date.getFullYear() + "/" + date.getMonth() + "/" + date.getDate() + "-" + date.getHours() + ":" + date.getMinutes();
  2454. a.setAttribute("download", "screenshot-" + stringDate + ".png");
  2455. window.document.body.appendChild(a);
  2456. a.addEventListener("click", function () {
  2457. a.parentElement.removeChild(a);
  2458. });
  2459. a.click();
  2460. //Or opening a new tab with the image if it is not possible to automatically start download.
  2461. } else {
  2462. var newWindow = window.open("");
  2463. var img = newWindow.document.createElement("img");
  2464. img.src = base64Image;
  2465. newWindow.document.body.appendChild(img);
  2466. }
  2467. };
  2468. texture.render(true);
  2469. texture.dispose();
  2470. if (previousCamera) {
  2471. scene.activeCamera = previousCamera;
  2472. }
  2473. };
  2474. // XHR response validator for local file scenario
  2475. Tools.ValidateXHRData = function (xhr, dataType) {
  2476. if (typeof dataType === "undefined") { dataType = 7; }
  2477. try {
  2478. if (dataType & 1) {
  2479. if (xhr.responseText && xhr.responseText.length > 0) {
  2480. return true;
  2481. } else if (dataType === 1) {
  2482. return false;
  2483. }
  2484. }
  2485. if (dataType & 2) {
  2486. // Check header width and height since there is no "TGA" magic number
  2487. var tgaHeader = BABYLON.Internals.TGATools.GetTGAHeader(xhr.response);
  2488. if (tgaHeader.width && tgaHeader.height && tgaHeader.width > 0 && tgaHeader.height > 0) {
  2489. return true;
  2490. } else if (dataType === 2) {
  2491. return false;
  2492. }
  2493. }
  2494. if (dataType & 4) {
  2495. // Check for the "DDS" magic number
  2496. var ddsHeader = new Uint8Array(xhr.response, 0, 3);
  2497. if (ddsHeader[0] == 68 && ddsHeader[1] == 68 && ddsHeader[2] == 83) {
  2498. return true;
  2499. } else {
  2500. return false;
  2501. }
  2502. }
  2503. } catch (e) {
  2504. // Global protection
  2505. }
  2506. return false;
  2507. };
  2508. Object.defineProperty(Tools, "NoneLogLevel", {
  2509. get: function () {
  2510. return Tools._NoneLogLevel;
  2511. },
  2512. enumerable: true,
  2513. configurable: true
  2514. });
  2515. Object.defineProperty(Tools, "MessageLogLevel", {
  2516. get: function () {
  2517. return Tools._MessageLogLevel;
  2518. },
  2519. enumerable: true,
  2520. configurable: true
  2521. });
  2522. Object.defineProperty(Tools, "WarningLogLevel", {
  2523. get: function () {
  2524. return Tools._WarningLogLevel;
  2525. },
  2526. enumerable: true,
  2527. configurable: true
  2528. });
  2529. Object.defineProperty(Tools, "ErrorLogLevel", {
  2530. get: function () {
  2531. return Tools._ErrorLogLevel;
  2532. },
  2533. enumerable: true,
  2534. configurable: true
  2535. });
  2536. Object.defineProperty(Tools, "AllLogLevel", {
  2537. get: function () {
  2538. return Tools._MessageLogLevel | Tools._WarningLogLevel | Tools._ErrorLogLevel;
  2539. },
  2540. enumerable: true,
  2541. configurable: true
  2542. });
  2543. Tools._AddLogEntry = function (entry) {
  2544. Tools._LogCache = entry + Tools._LogCache;
  2545. if (Tools.OnNewCacheEntry) {
  2546. Tools.OnNewCacheEntry(entry);
  2547. }
  2548. };
  2549. Tools._FormatMessage = function (message) {
  2550. var padStr = function (i) {
  2551. return (i < 10) ? "0" + i : "" + i;
  2552. };
  2553. var date = new Date();
  2554. return "[" + padStr(date.getHours()) + ":" + padStr(date.getMinutes()) + ":" + padStr(date.getSeconds()) + "]: " + message;
  2555. };
  2556. Tools._LogDisabled = function (message) {
  2557. // nothing to do
  2558. };
  2559. Tools._LogEnabled = function (message) {
  2560. var formattedMessage = Tools._FormatMessage(message);
  2561. console.log("BJS - " + formattedMessage);
  2562. var entry = "<div style='color:white'>" + formattedMessage + "</div><br>";
  2563. Tools._AddLogEntry(entry);
  2564. };
  2565. Tools._WarnDisabled = function (message) {
  2566. // nothing to do
  2567. };
  2568. Tools._WarnEnabled = function (message) {
  2569. var formattedMessage = Tools._FormatMessage(message);
  2570. console.warn("BJS - " + formattedMessage);
  2571. var entry = "<div style='color:orange'>" + formattedMessage + "</div><br>";
  2572. Tools._AddLogEntry(entry);
  2573. };
  2574. Tools._ErrorDisabled = function (message) {
  2575. // nothing to do
  2576. };
  2577. Tools._ErrorEnabled = function (message) {
  2578. var formattedMessage = Tools._FormatMessage(message);
  2579. console.error("BJS - " + formattedMessage);
  2580. var entry = "<div style='color:red'>" + formattedMessage + "</div><br>";
  2581. Tools._AddLogEntry(entry);
  2582. };
  2583. Object.defineProperty(Tools, "LogCache", {
  2584. get: function () {
  2585. return Tools._LogCache;
  2586. },
  2587. enumerable: true,
  2588. configurable: true
  2589. });
  2590. Object.defineProperty(Tools, "LogLevels", {
  2591. set: function (level) {
  2592. if ((level & Tools.MessageLogLevel) === Tools.MessageLogLevel) {
  2593. Tools.Log = Tools._LogEnabled;
  2594. } else {
  2595. Tools.Log = Tools._LogDisabled;
  2596. }
  2597. if ((level & Tools.WarningLogLevel) === Tools.WarningLogLevel) {
  2598. Tools.Warn = Tools._WarnEnabled;
  2599. } else {
  2600. Tools.Warn = Tools._WarnDisabled;
  2601. }
  2602. if ((level & Tools.ErrorLogLevel) === Tools.ErrorLogLevel) {
  2603. Tools.Error = Tools._ErrorEnabled;
  2604. } else {
  2605. Tools.Error = Tools._ErrorDisabled;
  2606. }
  2607. },
  2608. enumerable: true,
  2609. configurable: true
  2610. });
  2611. Object.defineProperty(Tools, "PerformanceNoneLogLevel", {
  2612. get: function () {
  2613. return Tools._PerformanceNoneLogLevel;
  2614. },
  2615. enumerable: true,
  2616. configurable: true
  2617. });
  2618. Object.defineProperty(Tools, "PerformanceUserMarkLogLevel", {
  2619. get: function () {
  2620. return Tools._PerformanceUserMarkLogLevel;
  2621. },
  2622. enumerable: true,
  2623. configurable: true
  2624. });
  2625. Object.defineProperty(Tools, "PerformanceConsoleLogLevel", {
  2626. get: function () {
  2627. return Tools._PerformanceConsoleLogLevel;
  2628. },
  2629. enumerable: true,
  2630. configurable: true
  2631. });
  2632. Object.defineProperty(Tools, "PerformanceLogLevel", {
  2633. set: function (level) {
  2634. if ((level & Tools.PerformanceUserMarkLogLevel) === Tools.PerformanceUserMarkLogLevel) {
  2635. Tools.StartPerformanceCounter = Tools._StartUserMark;
  2636. Tools.EndPerformanceCounter = Tools._EndUserMark;
  2637. return;
  2638. }
  2639. if ((level & Tools.PerformanceConsoleLogLevel) === Tools.PerformanceConsoleLogLevel) {
  2640. Tools.StartPerformanceCounter = Tools._StartPerformanceConsole;
  2641. Tools.EndPerformanceCounter = Tools._EndPerformanceConsole;
  2642. return;
  2643. }
  2644. Tools.StartPerformanceCounter = Tools._StartPerformanceCounterDisabled;
  2645. Tools.EndPerformanceCounter = Tools._EndPerformanceCounterDisabled;
  2646. },
  2647. enumerable: true,
  2648. configurable: true
  2649. });
  2650. Tools._StartPerformanceCounterDisabled = function (counterName, condition) {
  2651. };
  2652. Tools._EndPerformanceCounterDisabled = function (counterName, condition) {
  2653. };
  2654. Tools._StartUserMark = function (counterName, condition) {
  2655. if (typeof condition === "undefined") { condition = true; }
  2656. if (!condition || !Tools._performance.mark) {
  2657. return;
  2658. }
  2659. Tools._performance.mark(counterName + "-Begin");
  2660. };
  2661. Tools._EndUserMark = function (counterName, condition) {
  2662. if (typeof condition === "undefined") { condition = true; }
  2663. if (!condition || !Tools._performance.mark) {
  2664. return;
  2665. }
  2666. Tools._performance.mark(counterName + "-End");
  2667. Tools._performance.measure(counterName, counterName + "-Begin", counterName + "-End");
  2668. };
  2669. Tools._StartPerformanceConsole = function (counterName, condition) {
  2670. if (typeof condition === "undefined") { condition = true; }
  2671. if (!condition) {
  2672. return;
  2673. }
  2674. Tools._StartUserMark(counterName, condition);
  2675. if (console.time) {
  2676. console.time(counterName);
  2677. }
  2678. };
  2679. Tools._EndPerformanceConsole = function (counterName, condition) {
  2680. if (typeof condition === "undefined") { condition = true; }
  2681. if (!condition) {
  2682. return;
  2683. }
  2684. Tools._EndUserMark(counterName, condition);
  2685. if (console.time) {
  2686. console.timeEnd(counterName);
  2687. }
  2688. };
  2689. Object.defineProperty(Tools, "Now", {
  2690. get: function () {
  2691. if (window.performance && window.performance.now) {
  2692. return window.performance.now();
  2693. }
  2694. return new Date().getTime();
  2695. },
  2696. enumerable: true,
  2697. configurable: true
  2698. });
  2699. // Deprecated
  2700. Tools.GetFps = function () {
  2701. Tools.Warn("Tools.GetFps() is deprecated. Please use engine.getFps() instead");
  2702. return 0;
  2703. };
  2704. Tools.BaseUrl = "";
  2705. Tools.GetExponantOfTwo = function (value, max) {
  2706. var count = 1;
  2707. do {
  2708. count *= 2;
  2709. } while(count < value);
  2710. if (count > max)
  2711. count = max;
  2712. return count;
  2713. };
  2714. Tools._NoneLogLevel = 0;
  2715. Tools._MessageLogLevel = 1;
  2716. Tools._WarningLogLevel = 2;
  2717. Tools._ErrorLogLevel = 4;
  2718. Tools._LogCache = "";
  2719. Tools.Log = Tools._LogEnabled;
  2720. Tools.Warn = Tools._WarnEnabled;
  2721. Tools.Error = Tools._ErrorEnabled;
  2722. Tools._PerformanceNoneLogLevel = 0;
  2723. Tools._PerformanceUserMarkLogLevel = 1;
  2724. Tools._PerformanceConsoleLogLevel = 2;
  2725. Tools._performance = window.performance;
  2726. Tools.StartPerformanceCounter = Tools._StartPerformanceCounterDisabled;
  2727. Tools.EndPerformanceCounter = Tools._EndPerformanceCounterDisabled;
  2728. return Tools;
  2729. })();
  2730. BABYLON.Tools = Tools;
  2731. })(BABYLON || (BABYLON = {}));
  2732. //# sourceMappingURL=babylon.tools.js.map
  2733. var BABYLON;
  2734. (function (BABYLON) {
  2735. var _DepthCullingState = (function () {
  2736. function _DepthCullingState() {
  2737. this._isDepthTestDirty = false;
  2738. this._isDepthMaskDirty = false;
  2739. this._isDepthFuncDirty = false;
  2740. this._isCullFaceDirty = false;
  2741. this._isCullDirty = false;
  2742. }
  2743. Object.defineProperty(_DepthCullingState.prototype, "isDirty", {
  2744. get: function () {
  2745. return this._isDepthFuncDirty || this._isDepthTestDirty || this._isDepthMaskDirty || this._isCullFaceDirty || this._isCullDirty;
  2746. },
  2747. enumerable: true,
  2748. configurable: true
  2749. });
  2750. Object.defineProperty(_DepthCullingState.prototype, "cullFace", {
  2751. get: function () {
  2752. return this._cullFace;
  2753. },
  2754. set: function (value) {
  2755. if (this._cullFace === value) {
  2756. return;
  2757. }
  2758. this._cullFace = value;
  2759. this._isCullFaceDirty = true;
  2760. },
  2761. enumerable: true,
  2762. configurable: true
  2763. });
  2764. Object.defineProperty(_DepthCullingState.prototype, "cull", {
  2765. get: function () {
  2766. return this._cull;
  2767. },
  2768. set: function (value) {
  2769. if (this._cull === value) {
  2770. return;
  2771. }
  2772. this._cull = value;
  2773. this._isCullDirty = true;
  2774. },
  2775. enumerable: true,
  2776. configurable: true
  2777. });
  2778. Object.defineProperty(_DepthCullingState.prototype, "depthFunc", {
  2779. get: function () {
  2780. return this._depthFunc;
  2781. },
  2782. set: function (value) {
  2783. if (this._depthFunc === value) {
  2784. return;
  2785. }
  2786. this._depthFunc = value;
  2787. this._isDepthFuncDirty = true;
  2788. },
  2789. enumerable: true,
  2790. configurable: true
  2791. });
  2792. Object.defineProperty(_DepthCullingState.prototype, "depthMask", {
  2793. get: function () {
  2794. return this._depthMask;
  2795. },
  2796. set: function (value) {
  2797. if (this._depthMask === value) {
  2798. return;
  2799. }
  2800. this._depthMask = value;
  2801. this._isDepthMaskDirty = true;
  2802. },
  2803. enumerable: true,
  2804. configurable: true
  2805. });
  2806. Object.defineProperty(_DepthCullingState.prototype, "depthTest", {
  2807. get: function () {
  2808. return this._depthTest;
  2809. },
  2810. set: function (value) {
  2811. if (this._depthTest === value) {
  2812. return;
  2813. }
  2814. this._depthTest = value;
  2815. this._isDepthTestDirty = true;
  2816. },
  2817. enumerable: true,
  2818. configurable: true
  2819. });
  2820. _DepthCullingState.prototype.reset = function () {
  2821. this._depthMask = true;
  2822. this._depthTest = true;
  2823. this._depthFunc = null;
  2824. this._cull = null;
  2825. this._cullFace = null;
  2826. this._isDepthTestDirty = true;
  2827. this._isDepthMaskDirty = true;
  2828. this._isDepthFuncDirty = false;
  2829. this._isCullFaceDirty = false;
  2830. this._isCullDirty = false;
  2831. };
  2832. _DepthCullingState.prototype.apply = function (gl) {
  2833. if (!this.isDirty) {
  2834. return;
  2835. }
  2836. // Cull
  2837. if (this._isCullDirty) {
  2838. if (this.cull === true) {
  2839. gl.enable(gl.CULL_FACE);
  2840. } else if (this.cull === false) {
  2841. gl.disable(gl.CULL_FACE);
  2842. }
  2843. this._isCullDirty = false;
  2844. }
  2845. // Cull face
  2846. if (this._isCullFaceDirty) {
  2847. gl.cullFace(this.cullFace);
  2848. this._isCullFaceDirty = false;
  2849. }
  2850. // Depth mask
  2851. if (this._isDepthMaskDirty) {
  2852. gl.depthMask(this.depthMask);
  2853. this._isDepthMaskDirty = false;
  2854. }
  2855. // Depth test
  2856. if (this._isDepthTestDirty) {
  2857. if (this.depthTest === true) {
  2858. gl.enable(gl.DEPTH_TEST);
  2859. } else if (this.depthTest === false) {
  2860. gl.disable(gl.DEPTH_TEST);
  2861. }
  2862. this._isDepthTestDirty = false;
  2863. }
  2864. // Depth func
  2865. if (this._isDepthFuncDirty) {
  2866. gl.depthFunc(this.depthFunc);
  2867. this._isDepthFuncDirty = false;
  2868. }
  2869. };
  2870. return _DepthCullingState;
  2871. })();
  2872. BABYLON._DepthCullingState = _DepthCullingState;
  2873. var _AlphaState = (function () {
  2874. function _AlphaState() {
  2875. this._isAlphaBlendDirty = false;
  2876. this._isBlendFunctionParametersDirty = false;
  2877. this._alphaBlend = false;
  2878. this._blendFunctionParameters = new Array(4);
  2879. }
  2880. Object.defineProperty(_AlphaState.prototype, "isDirty", {
  2881. get: function () {
  2882. return this._isAlphaBlendDirty || this._isBlendFunctionParametersDirty;
  2883. },
  2884. enumerable: true,
  2885. configurable: true
  2886. });
  2887. Object.defineProperty(_AlphaState.prototype, "alphaBlend", {
  2888. get: function () {
  2889. return this._alphaBlend;
  2890. },
  2891. set: function (value) {
  2892. if (this._alphaBlend === value) {
  2893. return;
  2894. }
  2895. this._alphaBlend = value;
  2896. this._isAlphaBlendDirty = true;
  2897. },
  2898. enumerable: true,
  2899. configurable: true
  2900. });
  2901. _AlphaState.prototype.setAlphaBlendFunctionParameters = function (value0, value1, value2, value3) {
  2902. if (this._blendFunctionParameters[0] === value0 && this._blendFunctionParameters[1] === value1 && this._blendFunctionParameters[2] === value2 && this._blendFunctionParameters[3] === value3) {
  2903. return;
  2904. }
  2905. this._blendFunctionParameters[0] = value0;
  2906. this._blendFunctionParameters[1] = value1;
  2907. this._blendFunctionParameters[2] = value2;
  2908. this._blendFunctionParameters[3] = value3;
  2909. this._isBlendFunctionParametersDirty = true;
  2910. };
  2911. _AlphaState.prototype.reset = function () {
  2912. this._alphaBlend = false;
  2913. this._blendFunctionParameters[0] = null;
  2914. this._blendFunctionParameters[1] = null;
  2915. this._blendFunctionParameters[2] = null;
  2916. this._blendFunctionParameters[3] = null;
  2917. this._isAlphaBlendDirty = true;
  2918. this._isBlendFunctionParametersDirty = false;
  2919. };
  2920. _AlphaState.prototype.apply = function (gl) {
  2921. if (!this.isDirty) {
  2922. return;
  2923. }
  2924. // Alpha blend
  2925. if (this._isAlphaBlendDirty) {
  2926. if (this._alphaBlend === true) {
  2927. gl.enable(gl.BLEND);
  2928. } else if (this._alphaBlend === false) {
  2929. gl.disable(gl.BLEND);
  2930. }
  2931. this._isAlphaBlendDirty = false;
  2932. }
  2933. // Alpha function
  2934. if (this._isBlendFunctionParametersDirty) {
  2935. gl.blendFuncSeparate(this._blendFunctionParameters[0], this._blendFunctionParameters[1], this._blendFunctionParameters[2], this._blendFunctionParameters[3]);
  2936. this._isBlendFunctionParametersDirty = false;
  2937. }
  2938. };
  2939. return _AlphaState;
  2940. })();
  2941. BABYLON._AlphaState = _AlphaState;
  2942. var compileShader = function (gl, source, type, defines) {
  2943. var shader = gl.createShader(type === "vertex" ? gl.VERTEX_SHADER : gl.FRAGMENT_SHADER);
  2944. gl.shaderSource(shader, (defines ? defines + "\n" : "") + source);
  2945. gl.compileShader(shader);
  2946. if (!gl.getShaderParameter(shader, gl.COMPILE_STATUS)) {
  2947. throw new Error(gl.getShaderInfoLog(shader));
  2948. }
  2949. return shader;
  2950. };
  2951. var getSamplingParameters = function (samplingMode, generateMipMaps, gl) {
  2952. var magFilter = gl.NEAREST;
  2953. var minFilter = gl.NEAREST;
  2954. if (samplingMode === BABYLON.Texture.BILINEAR_SAMPLINGMODE) {
  2955. magFilter = gl.LINEAR;
  2956. if (generateMipMaps) {
  2957. minFilter = gl.LINEAR_MIPMAP_NEAREST;
  2958. } else {
  2959. minFilter = gl.LINEAR;
  2960. }
  2961. } else if (samplingMode === BABYLON.Texture.TRILINEAR_SAMPLINGMODE) {
  2962. magFilter = gl.LINEAR;
  2963. if (generateMipMaps) {
  2964. minFilter = gl.LINEAR_MIPMAP_LINEAR;
  2965. } else {
  2966. minFilter = gl.LINEAR;
  2967. }
  2968. } else if (samplingMode === BABYLON.Texture.NEAREST_SAMPLINGMODE) {
  2969. magFilter = gl.NEAREST;
  2970. if (generateMipMaps) {
  2971. minFilter = gl.NEAREST_MIPMAP_LINEAR;
  2972. } else {
  2973. minFilter = gl.NEAREST;
  2974. }
  2975. }
  2976. return {
  2977. min: minFilter,
  2978. mag: magFilter
  2979. };
  2980. };
  2981. var prepareWebGLTexture = function (texture, gl, scene, width, height, invertY, noMipmap, isCompressed, processFunction, samplingMode) {
  2982. if (typeof samplingMode === "undefined") { samplingMode = BABYLON.Texture.TRILINEAR_SAMPLINGMODE; }
  2983. var engine = scene.getEngine();
  2984. var potWidth = BABYLON.Tools.GetExponantOfTwo(width, engine.getCaps().maxTextureSize);
  2985. var potHeight = BABYLON.Tools.GetExponantOfTwo(height, engine.getCaps().maxTextureSize);
  2986. gl.bindTexture(gl.TEXTURE_2D, texture);
  2987. gl.pixelStorei(gl.UNPACK_FLIP_Y_WEBGL, invertY === undefined ? 1 : (invertY ? 1 : 0));
  2988. processFunction(potWidth, potHeight);
  2989. var filters = getSamplingParameters(samplingMode, !noMipmap, gl);
  2990. gl.texParameteri(gl.TEXTURE_2D, gl.TEXTURE_MAG_FILTER, filters.mag);
  2991. gl.texParameteri(gl.TEXTURE_2D, gl.TEXTURE_MIN_FILTER, filters.min);
  2992. if (!noMipmap && !isCompressed) {
  2993. gl.generateMipmap(gl.TEXTURE_2D);
  2994. }
  2995. gl.bindTexture(gl.TEXTURE_2D, null);
  2996. engine._activeTexturesCache = [];
  2997. texture._baseWidth = width;
  2998. texture._baseHeight = height;
  2999. texture._width = potWidth;
  3000. texture._height = potHeight;
  3001. texture.isReady = true;
  3002. scene._removePendingData(texture);
  3003. };
  3004. var partialLoad = function (url, index, loadedImages, scene, onfinish) {
  3005. var img;
  3006. var onload = function () {
  3007. loadedImages[index] = img;
  3008. loadedImages._internalCount++;
  3009. scene._removePendingData(img);
  3010. if (loadedImages._internalCount == 6) {
  3011. onfinish(loadedImages);
  3012. }
  3013. };
  3014. var onerror = function () {
  3015. scene._removePendingData(img);
  3016. };
  3017. img = BABYLON.Tools.LoadImage(url, onload, onerror, scene.database);
  3018. scene._addPendingData(img);
  3019. };
  3020. var cascadeLoad = function (rootUrl, scene, onfinish, extensions) {
  3021. var loadedImages = [];
  3022. loadedImages._internalCount = 0;
  3023. for (var index = 0; index < 6; index++) {
  3024. partialLoad(rootUrl + extensions[index], index, loadedImages, scene, onfinish);
  3025. }
  3026. };
  3027. var EngineCapabilities = (function () {
  3028. function EngineCapabilities() {
  3029. }
  3030. return EngineCapabilities;
  3031. })();
  3032. BABYLON.EngineCapabilities = EngineCapabilities;
  3033. var Engine = (function () {
  3034. function Engine(canvas, antialias, options) {
  3035. var _this = this;
  3036. // Public members
  3037. this.isFullscreen = false;
  3038. this.isPointerLock = false;
  3039. this.cullBackFaces = true;
  3040. this.renderEvenInBackground = true;
  3041. this.scenes = new Array();
  3042. this._windowIsBackground = false;
  3043. this._loadingDivBackgroundColor = "black";
  3044. this._drawCalls = 0;
  3045. this._renderingQueueLaunched = false;
  3046. this._activeRenderLoops = [];
  3047. // FPS
  3048. this.fpsRange = 60;
  3049. this.previousFramesDuration = [];
  3050. this.fps = 60;
  3051. this.deltaTime = 0;
  3052. // States
  3053. this._depthCullingState = new _DepthCullingState();
  3054. this._alphaState = new _AlphaState();
  3055. this._alphaMode = Engine.ALPHA_DISABLE;
  3056. // Cache
  3057. this._loadedTexturesCache = new Array();
  3058. this._activeTexturesCache = new Array();
  3059. this._compiledEffects = {};
  3060. this._uintIndicesCurrentlySet = false;
  3061. this._renderingCanvas = canvas;
  3062. this._canvasClientRect = this._renderingCanvas.getBoundingClientRect();
  3063. options = options || {};
  3064. options.antialias = antialias;
  3065. try {
  3066. this._gl = canvas.getContext("webgl", options) || canvas.getContext("experimental-webgl", options);
  3067. } catch (e) {
  3068. throw new Error("WebGL not supported");
  3069. }
  3070. if (!this._gl) {
  3071. throw new Error("WebGL not supported");
  3072. }
  3073. this._onBlur = function () {
  3074. _this._windowIsBackground = true;
  3075. };
  3076. this._onFocus = function () {
  3077. _this._windowIsBackground = false;
  3078. };
  3079. window.addEventListener("blur", this._onBlur);
  3080. window.addEventListener("focus", this._onFocus);
  3081. // Textures
  3082. this._workingCanvas = document.createElement("canvas");
  3083. this._workingContext = this._workingCanvas.getContext("2d");
  3084. // Viewport
  3085. this._hardwareScalingLevel = 1.0 / (window.devicePixelRatio || 1.0);
  3086. this.resize();
  3087. // Caps
  3088. this._caps = new EngineCapabilities();
  3089. this._caps.maxTexturesImageUnits = this._gl.getParameter(this._gl.MAX_TEXTURE_IMAGE_UNITS);
  3090. this._caps.maxTextureSize = this._gl.getParameter(this._gl.MAX_TEXTURE_SIZE);
  3091. this._caps.maxCubemapTextureSize = this._gl.getParameter(this._gl.MAX_CUBE_MAP_TEXTURE_SIZE);
  3092. this._caps.maxRenderTextureSize = this._gl.getParameter(this._gl.MAX_RENDERBUFFER_SIZE);
  3093. // Extensions
  3094. this._caps.standardDerivatives = (this._gl.getExtension('OES_standard_derivatives') !== null);
  3095. this._caps.s3tc = this._gl.getExtension('WEBGL_compressed_texture_s3tc');
  3096. this._caps.textureFloat = (this._gl.getExtension('OES_texture_float') !== null);
  3097. this._caps.textureAnisotropicFilterExtension = this._gl.getExtension('EXT_texture_filter_anisotropic') || this._gl.getExtension('WEBKIT_EXT_texture_filter_anisotropic') || this._gl.getExtension('MOZ_EXT_texture_filter_anisotropic');
  3098. this._caps.maxAnisotropy = this._caps.textureAnisotropicFilterExtension ? this._gl.getParameter(this._caps.textureAnisotropicFilterExtension.MAX_TEXTURE_MAX_ANISOTROPY_EXT) : 0;
  3099. this._caps.instancedArrays = this._gl.getExtension('ANGLE_instanced_arrays');
  3100. this._caps.uintIndices = this._gl.getExtension('OES_element_index_uint') !== null;
  3101. // Depth buffer
  3102. this.setDepthBuffer(true);
  3103. this.setDepthFunctionToLessOrEqual();
  3104. this.setDepthWrite(true);
  3105. // Fullscreen
  3106. this._onFullscreenChange = function () {
  3107. if (document.fullscreen !== undefined) {
  3108. _this.isFullscreen = document.fullscreen;
  3109. } else if (document.mozFullScreen !== undefined) {
  3110. _this.isFullscreen = document.mozFullScreen;
  3111. } else if (document.webkitIsFullScreen !== undefined) {
  3112. _this.isFullscreen = document.webkitIsFullScreen;
  3113. } else if (document.msIsFullScreen !== undefined) {
  3114. _this.isFullscreen = document.msIsFullScreen;
  3115. }
  3116. // Pointer lock
  3117. if (_this.isFullscreen && _this._pointerLockRequested) {
  3118. canvas.requestPointerLock = canvas.requestPointerLock || canvas.msRequestPointerLock || canvas.mozRequestPointerLock || canvas.webkitRequestPointerLock;
  3119. if (canvas.requestPointerLock) {
  3120. canvas.requestPointerLock();
  3121. }
  3122. }
  3123. };
  3124. document.addEventListener("fullscreenchange", this._onFullscreenChange, false);
  3125. document.addEventListener("mozfullscreenchange", this._onFullscreenChange, false);
  3126. document.addEventListener("webkitfullscreenchange", this._onFullscreenChange, false);
  3127. document.addEventListener("msfullscreenchange", this._onFullscreenChange, false);
  3128. // Pointer lock
  3129. this._onPointerLockChange = function () {
  3130. _this.isPointerLock = (document.mozPointerLockElement === canvas || document.webkitPointerLockElement === canvas || document.msPointerLockElement === canvas || document.pointerLockElement === canvas);
  3131. };
  3132. document.addEventListener("pointerlockchange", this._onPointerLockChange, false);
  3133. document.addEventListener("mspointerlockchange", this._onPointerLockChange, false);
  3134. document.addEventListener("mozpointerlockchange", this._onPointerLockChange, false);
  3135. document.addEventListener("webkitpointerlockchange", this._onPointerLockChange, false);
  3136. this._audioEngine = new BABYLON.AudioEngine();
  3137. BABYLON.Tools.Log("Babylon.js engine (v" + Engine.Version + ") launched");
  3138. }
  3139. Object.defineProperty(Engine, "ALPHA_DISABLE", {
  3140. get: function () {
  3141. return Engine._ALPHA_DISABLE;
  3142. },
  3143. enumerable: true,
  3144. configurable: true
  3145. });
  3146. Object.defineProperty(Engine, "ALPHA_ADD", {
  3147. get: function () {
  3148. return Engine._ALPHA_ADD;
  3149. },
  3150. enumerable: true,
  3151. configurable: true
  3152. });
  3153. Object.defineProperty(Engine, "ALPHA_COMBINE", {
  3154. get: function () {
  3155. return Engine._ALPHA_COMBINE;
  3156. },
  3157. enumerable: true,
  3158. configurable: true
  3159. });
  3160. Object.defineProperty(Engine, "DELAYLOADSTATE_NONE", {
  3161. get: function () {
  3162. return Engine._DELAYLOADSTATE_NONE;
  3163. },
  3164. enumerable: true,
  3165. configurable: true
  3166. });
  3167. Object.defineProperty(Engine, "DELAYLOADSTATE_LOADED", {
  3168. get: function () {
  3169. return Engine._DELAYLOADSTATE_LOADED;
  3170. },
  3171. enumerable: true,
  3172. configurable: true
  3173. });
  3174. Object.defineProperty(Engine, "DELAYLOADSTATE_LOADING", {
  3175. get: function () {
  3176. return Engine._DELAYLOADSTATE_LOADING;
  3177. },
  3178. enumerable: true,
  3179. configurable: true
  3180. });
  3181. Object.defineProperty(Engine, "DELAYLOADSTATE_NOTLOADED", {
  3182. get: function () {
  3183. return Engine._DELAYLOADSTATE_NOTLOADED;
  3184. },
  3185. enumerable: true,
  3186. configurable: true
  3187. });
  3188. Object.defineProperty(Engine, "TEXTUREFORMAT_ALPHA", {
  3189. get: function () {
  3190. return Engine._TEXTUREFORMAT_ALPHA;
  3191. },
  3192. enumerable: true,
  3193. configurable: true
  3194. });
  3195. Object.defineProperty(Engine, "TEXTUREFORMAT_LUMINANCE", {
  3196. get: function () {
  3197. return Engine._TEXTUREFORMAT_LUMINANCE;
  3198. },
  3199. enumerable: true,
  3200. configurable: true
  3201. });
  3202. Object.defineProperty(Engine, "TEXTUREFORMAT_LUMINANCE_ALPHA", {
  3203. get: function () {
  3204. return Engine._TEXTUREFORMAT_LUMINANCE_ALPHA;
  3205. },
  3206. enumerable: true,
  3207. configurable: true
  3208. });
  3209. Object.defineProperty(Engine, "TEXTUREFORMAT_RGB", {
  3210. get: function () {
  3211. return Engine._TEXTUREFORMAT_RGB;
  3212. },
  3213. enumerable: true,
  3214. configurable: true
  3215. });
  3216. Object.defineProperty(Engine, "TEXTUREFORMAT_RGBA", {
  3217. get: function () {
  3218. return Engine._TEXTUREFORMAT_RGBA;
  3219. },
  3220. enumerable: true,
  3221. configurable: true
  3222. });
  3223. Object.defineProperty(Engine, "Version", {
  3224. get: function () {
  3225. return "2.0.0";
  3226. },
  3227. enumerable: true,
  3228. configurable: true
  3229. });
  3230. Engine.prototype.getAudioEngine = function () {
  3231. return this._audioEngine;
  3232. };
  3233. Engine.prototype.getAspectRatio = function (camera) {
  3234. var viewport = camera.viewport;
  3235. return (this.getRenderWidth() * viewport.width) / (this.getRenderHeight() * viewport.height);
  3236. };
  3237. Engine.prototype.getRenderWidth = function () {
  3238. if (this._currentRenderTarget) {
  3239. return this._currentRenderTarget._width;
  3240. }
  3241. return this._renderingCanvas.width;
  3242. };
  3243. Engine.prototype.getRenderHeight = function () {
  3244. if (this._currentRenderTarget) {
  3245. return this._currentRenderTarget._height;
  3246. }
  3247. return this._renderingCanvas.height;
  3248. };
  3249. Engine.prototype.getRenderingCanvas = function () {
  3250. return this._renderingCanvas;
  3251. };
  3252. Engine.prototype.getRenderingCanvasClientRect = function () {
  3253. return this._renderingCanvas.getBoundingClientRect();
  3254. };
  3255. Engine.prototype.setHardwareScalingLevel = function (level) {
  3256. this._hardwareScalingLevel = level;
  3257. this.resize();
  3258. };
  3259. Engine.prototype.getHardwareScalingLevel = function () {
  3260. return this._hardwareScalingLevel;
  3261. };
  3262. Engine.prototype.getLoadedTexturesCache = function () {
  3263. return this._loadedTexturesCache;
  3264. };
  3265. Engine.prototype.getCaps = function () {
  3266. return this._caps;
  3267. };
  3268. Object.defineProperty(Engine.prototype, "drawCalls", {
  3269. get: function () {
  3270. return this._drawCalls;
  3271. },
  3272. enumerable: true,
  3273. configurable: true
  3274. });
  3275. // Methods
  3276. Engine.prototype.resetDrawCalls = function () {
  3277. this._drawCalls = 0;
  3278. };
  3279. Engine.prototype.setDepthFunctionToGreater = function () {
  3280. this._depthCullingState.depthFunc = this._gl.GREATER;
  3281. };
  3282. Engine.prototype.setDepthFunctionToGreaterOrEqual = function () {
  3283. this._depthCullingState.depthFunc = this._gl.GEQUAL;
  3284. };
  3285. Engine.prototype.setDepthFunctionToLess = function () {
  3286. this._depthCullingState.depthFunc = this._gl.LESS;
  3287. };
  3288. Engine.prototype.setDepthFunctionToLessOrEqual = function () {
  3289. this._depthCullingState.depthFunc = this._gl.LEQUAL;
  3290. };
  3291. Engine.prototype.stopRenderLoop = function (renderFunction) {
  3292. if (!renderFunction) {
  3293. this._activeRenderLoops = [];
  3294. return;
  3295. }
  3296. var index = this._activeRenderLoops.indexOf(renderFunction);
  3297. if (index >= 0) {
  3298. this._activeRenderLoops.splice(index, 1);
  3299. }
  3300. };
  3301. Engine.prototype._renderLoop = function () {
  3302. var _this = this;
  3303. var shouldRender = true;
  3304. if (!this.renderEvenInBackground && this._windowIsBackground) {
  3305. shouldRender = false;
  3306. }
  3307. if (shouldRender) {
  3308. // Start new frame
  3309. this.beginFrame();
  3310. for (var index = 0; index < this._activeRenderLoops.length; index++) {
  3311. var renderFunction = this._activeRenderLoops[index];
  3312. renderFunction();
  3313. }
  3314. // Present
  3315. this.endFrame();
  3316. }
  3317. if (this._activeRenderLoops.length > 0) {
  3318. // Register new frame
  3319. BABYLON.Tools.QueueNewFrame(function () {
  3320. _this._renderLoop();
  3321. });
  3322. } else {
  3323. this._renderingQueueLaunched = false;
  3324. }
  3325. };
  3326. Engine.prototype.runRenderLoop = function (renderFunction) {
  3327. var _this = this;
  3328. if (this._activeRenderLoops.indexOf(renderFunction) !== -1) {
  3329. return;
  3330. }
  3331. this._activeRenderLoops.push(renderFunction);
  3332. if (!this._renderingQueueLaunched) {
  3333. this._renderingQueueLaunched = true;
  3334. BABYLON.Tools.QueueNewFrame(function () {
  3335. _this._renderLoop();
  3336. });
  3337. }
  3338. };
  3339. Engine.prototype.switchFullscreen = function (requestPointerLock) {
  3340. if (this.isFullscreen) {
  3341. BABYLON.Tools.ExitFullscreen();
  3342. } else {
  3343. this._pointerLockRequested = requestPointerLock;
  3344. BABYLON.Tools.RequestFullscreen(this._renderingCanvas);
  3345. }
  3346. };
  3347. Engine.prototype.clear = function (color, backBuffer, depthStencil) {
  3348. this.applyStates();
  3349. this._gl.clearColor(color.r, color.g, color.b, color.a !== undefined ? color.a : 1.0);
  3350. if (this._depthCullingState.depthMask) {
  3351. this._gl.clearDepth(1.0);
  3352. }
  3353. var mode = 0;
  3354. if (backBuffer)
  3355. mode |= this._gl.COLOR_BUFFER_BIT;
  3356. if (depthStencil && this._depthCullingState.depthMask)
  3357. mode |= this._gl.DEPTH_BUFFER_BIT;
  3358. this._gl.clear(mode);
  3359. };
  3360. Engine.prototype.setViewport = function (viewport, requiredWidth, requiredHeight) {
  3361. var width = requiredWidth || this._renderingCanvas.width;
  3362. var height = requiredHeight || this._renderingCanvas.height;
  3363. var x = viewport.x || 0;
  3364. var y = viewport.y || 0;
  3365. this._cachedViewport = viewport;
  3366. this._gl.viewport(x * width, y * height, width * viewport.width, height * viewport.height);
  3367. };
  3368. Engine.prototype.setDirectViewport = function (x, y, width, height) {
  3369. this._cachedViewport = null;
  3370. this._gl.viewport(x, y, width, height);
  3371. };
  3372. Engine.prototype.beginFrame = function () {
  3373. this._measureFps();
  3374. };
  3375. Engine.prototype.endFrame = function () {
  3376. this.flushFramebuffer();
  3377. };
  3378. Engine.prototype.resize = function () {
  3379. this.setSize(this._renderingCanvas.clientWidth / this._hardwareScalingLevel, this._renderingCanvas.clientHeight / this._hardwareScalingLevel);
  3380. };
  3381. Engine.prototype.setSize = function (width, height) {
  3382. this._renderingCanvas.width = width;
  3383. this._renderingCanvas.height = height;
  3384. this._canvasClientRect = this._renderingCanvas.getBoundingClientRect();
  3385. };
  3386. Engine.prototype.bindFramebuffer = function (texture) {
  3387. this._currentRenderTarget = texture;
  3388. var gl = this._gl;
  3389. gl.bindFramebuffer(gl.FRAMEBUFFER, texture._framebuffer);
  3390. this._gl.viewport(0, 0, texture._width, texture._height);
  3391. this.wipeCaches();
  3392. };
  3393. Engine.prototype.unBindFramebuffer = function (texture) {
  3394. this._currentRenderTarget = null;
  3395. if (texture.generateMipMaps) {
  3396. var gl = this._gl;
  3397. gl.bindTexture(gl.TEXTURE_2D, texture);
  3398. gl.generateMipmap(gl.TEXTURE_2D);
  3399. gl.bindTexture(gl.TEXTURE_2D, null);
  3400. }
  3401. this._gl.bindFramebuffer(this._gl.FRAMEBUFFER, null);
  3402. };
  3403. Engine.prototype.flushFramebuffer = function () {
  3404. // this._gl.flush();
  3405. };
  3406. Engine.prototype.restoreDefaultFramebuffer = function () {
  3407. this._currentRenderTarget = null;
  3408. this._gl.bindFramebuffer(this._gl.FRAMEBUFFER, null);
  3409. this.setViewport(this._cachedViewport);
  3410. this.wipeCaches();
  3411. };
  3412. // VBOs
  3413. Engine.prototype._resetVertexBufferBinding = function () {
  3414. this._gl.bindBuffer(this._gl.ARRAY_BUFFER, null);
  3415. this._cachedVertexBuffers = null;
  3416. };
  3417. Engine.prototype.createVertexBuffer = function (vertices) {
  3418. var vbo = this._gl.createBuffer();
  3419. this._gl.bindBuffer(this._gl.ARRAY_BUFFER, vbo);
  3420. this._gl.bufferData(this._gl.ARRAY_BUFFER, new Float32Array(vertices), this._gl.STATIC_DRAW);
  3421. this._resetVertexBufferBinding();
  3422. vbo.references = 1;
  3423. return vbo;
  3424. };
  3425. Engine.prototype.createDynamicVertexBuffer = function (capacity) {
  3426. var vbo = this._gl.createBuffer();
  3427. this._gl.bindBuffer(this._gl.ARRAY_BUFFER, vbo);
  3428. this._gl.bufferData(this._gl.ARRAY_BUFFER, capacity, this._gl.DYNAMIC_DRAW);
  3429. this._resetVertexBufferBinding();
  3430. vbo.references = 1;
  3431. return vbo;
  3432. };
  3433. Engine.prototype.updateDynamicVertexBuffer = function (vertexBuffer, vertices, offset) {
  3434. this._gl.bindBuffer(this._gl.ARRAY_BUFFER, vertexBuffer);
  3435. if (offset === undefined) {
  3436. offset = 0;
  3437. }
  3438. if (vertices instanceof Float32Array) {
  3439. this._gl.bufferSubData(this._gl.ARRAY_BUFFER, offset, vertices);
  3440. } else {
  3441. this._gl.bufferSubData(this._gl.ARRAY_BUFFER, offset, new Float32Array(vertices));
  3442. }
  3443. this._resetVertexBufferBinding();
  3444. };
  3445. Engine.prototype._resetIndexBufferBinding = function () {
  3446. this._gl.bindBuffer(this._gl.ELEMENT_ARRAY_BUFFER, null);
  3447. this._cachedIndexBuffer = null;
  3448. };
  3449. Engine.prototype.createIndexBuffer = function (indices) {
  3450. var vbo = this._gl.createBuffer();
  3451. this._gl.bindBuffer(this._gl.ELEMENT_ARRAY_BUFFER, vbo);
  3452. // Check for 32 bits indices
  3453. var arrayBuffer;
  3454. var need32Bits = false;
  3455. if (this._caps.uintIndices) {
  3456. for (var index = 0; index < indices.length; index++) {
  3457. if (indices[index] > 65535) {
  3458. need32Bits = true;
  3459. break;
  3460. }
  3461. }
  3462. arrayBuffer = need32Bits ? new Uint32Array(indices) : new Uint16Array(indices);
  3463. } else {
  3464. arrayBuffer = new Uint16Array(indices);
  3465. }
  3466. this._gl.bufferData(this._gl.ELEMENT_ARRAY_BUFFER, arrayBuffer, this._gl.STATIC_DRAW);
  3467. this._resetIndexBufferBinding();
  3468. vbo.references = 1;
  3469. vbo.is32Bits = need32Bits;
  3470. return vbo;
  3471. };
  3472. Engine.prototype.bindBuffers = function (vertexBuffer, indexBuffer, vertexDeclaration, vertexStrideSize, effect) {
  3473. if (this._cachedVertexBuffers !== vertexBuffer || this._cachedEffectForVertexBuffers !== effect) {
  3474. this._cachedVertexBuffers = vertexBuffer;
  3475. this._cachedEffectForVertexBuffers = effect;
  3476. this._gl.bindBuffer(this._gl.ARRAY_BUFFER, vertexBuffer);
  3477. var offset = 0;
  3478. for (var index = 0; index < vertexDeclaration.length; index++) {
  3479. var order = effect.getAttributeLocation(index);
  3480. if (order >= 0) {
  3481. this._gl.vertexAttribPointer(order, vertexDeclaration[index], this._gl.FLOAT, false, vertexStrideSize, offset);
  3482. }
  3483. offset += vertexDeclaration[index] * 4;
  3484. }
  3485. }
  3486. if (this._cachedIndexBuffer !== indexBuffer) {
  3487. this._cachedIndexBuffer = indexBuffer;
  3488. this._gl.bindBuffer(this._gl.ELEMENT_ARRAY_BUFFER, indexBuffer);
  3489. this._uintIndicesCurrentlySet = indexBuffer.is32Bits;
  3490. }
  3491. };
  3492. Engine.prototype.bindMultiBuffers = function (vertexBuffers, indexBuffer, effect) {
  3493. if (this._cachedVertexBuffers !== vertexBuffers || this._cachedEffectForVertexBuffers !== effect) {
  3494. this._cachedVertexBuffers = vertexBuffers;
  3495. this._cachedEffectForVertexBuffers = effect;
  3496. var attributes = effect.getAttributesNames();
  3497. for (var index = 0; index < attributes.length; index++) {
  3498. var order = effect.getAttributeLocation(index);
  3499. if (order >= 0) {
  3500. var vertexBuffer = vertexBuffers[attributes[index]];
  3501. if (!vertexBuffer) {
  3502. continue;
  3503. }
  3504. var stride = vertexBuffer.getStrideSize();
  3505. this._gl.bindBuffer(this._gl.ARRAY_BUFFER, vertexBuffer.getBuffer());
  3506. this._gl.vertexAttribPointer(order, stride, this._gl.FLOAT, false, stride * 4, 0);
  3507. }
  3508. }
  3509. }
  3510. if (indexBuffer != null && this._cachedIndexBuffer !== indexBuffer) {
  3511. this._cachedIndexBuffer = indexBuffer;
  3512. this._gl.bindBuffer(this._gl.ELEMENT_ARRAY_BUFFER, indexBuffer);
  3513. this._uintIndicesCurrentlySet = indexBuffer.is32Bits;
  3514. }
  3515. };
  3516. Engine.prototype._releaseBuffer = function (buffer) {
  3517. buffer.references--;
  3518. if (buffer.references === 0) {
  3519. this._gl.deleteBuffer(buffer);
  3520. return true;
  3521. }
  3522. return false;
  3523. };
  3524. Engine.prototype.createInstancesBuffer = function (capacity) {
  3525. var buffer = this._gl.createBuffer();
  3526. buffer.capacity = capacity;
  3527. this._gl.bindBuffer(this._gl.ARRAY_BUFFER, buffer);
  3528. this._gl.bufferData(this._gl.ARRAY_BUFFER, capacity, this._gl.DYNAMIC_DRAW);
  3529. return buffer;
  3530. };
  3531. Engine.prototype.deleteInstancesBuffer = function (buffer) {
  3532. this._gl.deleteBuffer(buffer);
  3533. };
  3534. Engine.prototype.updateAndBindInstancesBuffer = function (instancesBuffer, data, offsetLocations) {
  3535. this._gl.bindBuffer(this._gl.ARRAY_BUFFER, instancesBuffer);
  3536. this._gl.bufferSubData(this._gl.ARRAY_BUFFER, 0, data);
  3537. for (var index = 0; index < 4; index++) {
  3538. var offsetLocation = offsetLocations[index];
  3539. this._gl.enableVertexAttribArray(offsetLocation);
  3540. this._gl.vertexAttribPointer(offsetLocation, 4, this._gl.FLOAT, false, 64, index * 16);
  3541. this._caps.instancedArrays.vertexAttribDivisorANGLE(offsetLocation, 1);
  3542. }
  3543. };
  3544. Engine.prototype.unBindInstancesBuffer = function (instancesBuffer, offsetLocations) {
  3545. this._gl.bindBuffer(this._gl.ARRAY_BUFFER, instancesBuffer);
  3546. for (var index = 0; index < 4; index++) {
  3547. var offsetLocation = offsetLocations[index];
  3548. this._gl.disableVertexAttribArray(offsetLocation);
  3549. this._caps.instancedArrays.vertexAttribDivisorANGLE(offsetLocation, 0);
  3550. }
  3551. };
  3552. Engine.prototype.applyStates = function () {
  3553. this._depthCullingState.apply(this._gl);
  3554. this._alphaState.apply(this._gl);
  3555. };
  3556. Engine.prototype.draw = function (useTriangles, indexStart, indexCount, instancesCount) {
  3557. // Apply states
  3558. this.applyStates();
  3559. this._drawCalls++;
  3560. // Render
  3561. var indexFormat = this._uintIndicesCurrentlySet ? this._gl.UNSIGNED_INT : this._gl.UNSIGNED_SHORT;
  3562. if (instancesCount) {
  3563. this._caps.instancedArrays.drawElementsInstancedANGLE(useTriangles ? this._gl.TRIANGLES : this._gl.LINES, indexCount, indexFormat, indexStart * 2, instancesCount);
  3564. return;
  3565. }
  3566. this._gl.drawElements(useTriangles ? this._gl.TRIANGLES : this._gl.LINES, indexCount, indexFormat, indexStart * 2);
  3567. };
  3568. Engine.prototype.drawPointClouds = function (verticesStart, verticesCount, instancesCount) {
  3569. // Apply states
  3570. this.applyStates();
  3571. this._drawCalls++;
  3572. if (instancesCount) {
  3573. this._caps.instancedArrays.drawArraysInstancedANGLE(this._gl.POINTS, verticesStart, verticesCount, instancesCount);
  3574. return;
  3575. }
  3576. this._gl.drawArrays(this._gl.POINTS, verticesStart, verticesCount);
  3577. };
  3578. // Shaders
  3579. Engine.prototype._releaseEffect = function (effect) {
  3580. if (this._compiledEffects[effect._key]) {
  3581. delete this._compiledEffects[effect._key];
  3582. if (effect.getProgram()) {
  3583. this._gl.deleteProgram(effect.getProgram());
  3584. }
  3585. }
  3586. };
  3587. Engine.prototype.createEffect = function (baseName, attributesNames, uniformsNames, samplers, defines, fallbacks, onCompiled, onError) {
  3588. var vertex = baseName.vertexElement || baseName.vertex || baseName;
  3589. var fragment = baseName.fragmentElement || baseName.fragment || baseName;
  3590. var name = vertex + "+" + fragment + "@" + defines;
  3591. if (this._compiledEffects[name]) {
  3592. return this._compiledEffects[name];
  3593. }
  3594. var effect = new BABYLON.Effect(baseName, attributesNames, uniformsNames, samplers, this, defines, fallbacks, onCompiled, onError);
  3595. effect._key = name;
  3596. this._compiledEffects[name] = effect;
  3597. return effect;
  3598. };
  3599. Engine.prototype.createEffectForParticles = function (fragmentName, uniformsNames, samplers, defines, fallbacks, onCompiled, onError) {
  3600. if (typeof uniformsNames === "undefined") { uniformsNames = []; }
  3601. if (typeof samplers === "undefined") { samplers = []; }
  3602. if (typeof defines === "undefined") { defines = ""; }
  3603. return this.createEffect({
  3604. vertex: "particles",
  3605. fragmentElement: fragmentName
  3606. }, ["position", "color", "options"], ["view", "projection"].concat(uniformsNames), ["diffuseSampler"].concat(samplers), defines, fallbacks, onCompiled, onError);
  3607. };
  3608. Engine.prototype.createShaderProgram = function (vertexCode, fragmentCode, defines) {
  3609. var vertexShader = compileShader(this._gl, vertexCode, "vertex", defines);
  3610. var fragmentShader = compileShader(this._gl, fragmentCode, "fragment", defines);
  3611. var shaderProgram = this._gl.createProgram();
  3612. this._gl.attachShader(shaderProgram, vertexShader);
  3613. this._gl.attachShader(shaderProgram, fragmentShader);
  3614. this._gl.linkProgram(shaderProgram);
  3615. var linked = this._gl.getProgramParameter(shaderProgram, this._gl.LINK_STATUS);
  3616. if (!linked) {
  3617. var error = this._gl.getProgramInfoLog(shaderProgram);
  3618. if (error) {
  3619. throw new Error(error);
  3620. }
  3621. }
  3622. this._gl.deleteShader(vertexShader);
  3623. this._gl.deleteShader(fragmentShader);
  3624. return shaderProgram;
  3625. };
  3626. Engine.prototype.getUniforms = function (shaderProgram, uniformsNames) {
  3627. var results = [];
  3628. for (var index = 0; index < uniformsNames.length; index++) {
  3629. results.push(this._gl.getUniformLocation(shaderProgram, uniformsNames[index]));
  3630. }
  3631. return results;
  3632. };
  3633. Engine.prototype.getAttributes = function (shaderProgram, attributesNames) {
  3634. var results = [];
  3635. for (var index = 0; index < attributesNames.length; index++) {
  3636. try {
  3637. results.push(this._gl.getAttribLocation(shaderProgram, attributesNames[index]));
  3638. } catch (e) {
  3639. results.push(-1);
  3640. }
  3641. }
  3642. return results;
  3643. };
  3644. Engine.prototype.enableEffect = function (effect) {
  3645. if (!effect || !effect.getAttributesCount() || this._currentEffect === effect) {
  3646. if (effect && effect.onBind) {
  3647. effect.onBind(effect);
  3648. }
  3649. return;
  3650. }
  3651. this._vertexAttribArrays = this._vertexAttribArrays || [];
  3652. // Use program
  3653. this._gl.useProgram(effect.getProgram());
  3654. for (var i in this._vertexAttribArrays) {
  3655. if (i > this._gl.VERTEX_ATTRIB_ARRAY_ENABLED || !this._vertexAttribArrays[i]) {
  3656. continue;
  3657. }
  3658. this._vertexAttribArrays[i] = false;
  3659. this._gl.disableVertexAttribArray(i);
  3660. }
  3661. var attributesCount = effect.getAttributesCount();
  3662. for (var index = 0; index < attributesCount; index++) {
  3663. // Attributes
  3664. var order = effect.getAttributeLocation(index);
  3665. if (order >= 0) {
  3666. this._vertexAttribArrays[order] = true;
  3667. this._gl.enableVertexAttribArray(order);
  3668. }
  3669. }
  3670. this._currentEffect = effect;
  3671. if (effect.onBind) {
  3672. effect.onBind(effect);
  3673. }
  3674. };
  3675. Engine.prototype.setArray = function (uniform, array) {
  3676. if (!uniform)
  3677. return;
  3678. this._gl.uniform1fv(uniform, array);
  3679. };
  3680. Engine.prototype.setMatrices = function (uniform, matrices) {
  3681. if (!uniform)
  3682. return;
  3683. this._gl.uniformMatrix4fv(uniform, false, matrices);
  3684. };
  3685. Engine.prototype.setMatrix = function (uniform, matrix) {
  3686. if (!uniform)
  3687. return;
  3688. this._gl.uniformMatrix4fv(uniform, false, matrix.toArray());
  3689. };
  3690. Engine.prototype.setFloat = function (uniform, value) {
  3691. if (!uniform)
  3692. return;
  3693. this._gl.uniform1f(uniform, value);
  3694. };
  3695. Engine.prototype.setFloat2 = function (uniform, x, y) {
  3696. if (!uniform)
  3697. return;
  3698. this._gl.uniform2f(uniform, x, y);
  3699. };
  3700. Engine.prototype.setFloat3 = function (uniform, x, y, z) {
  3701. if (!uniform)
  3702. return;
  3703. this._gl.uniform3f(uniform, x, y, z);
  3704. };
  3705. Engine.prototype.setBool = function (uniform, bool) {
  3706. if (!uniform)
  3707. return;
  3708. this._gl.uniform1i(uniform, bool);
  3709. };
  3710. Engine.prototype.setFloat4 = function (uniform, x, y, z, w) {
  3711. if (!uniform)
  3712. return;
  3713. this._gl.uniform4f(uniform, x, y, z, w);
  3714. };
  3715. Engine.prototype.setColor3 = function (uniform, color3) {
  3716. if (!uniform)
  3717. return;
  3718. this._gl.uniform3f(uniform, color3.r, color3.g, color3.b);
  3719. };
  3720. Engine.prototype.setColor4 = function (uniform, color3, alpha) {
  3721. if (!uniform)
  3722. return;
  3723. this._gl.uniform4f(uniform, color3.r, color3.g, color3.b, alpha);
  3724. };
  3725. // States
  3726. Engine.prototype.setState = function (culling, force) {
  3727. // Culling
  3728. if (this._depthCullingState.cull !== culling || force) {
  3729. if (culling) {
  3730. this._depthCullingState.cullFace = this.cullBackFaces ? this._gl.BACK : this._gl.FRONT;
  3731. this._depthCullingState.cull = true;
  3732. } else {
  3733. this._depthCullingState.cull = false;
  3734. }
  3735. }
  3736. };
  3737. Engine.prototype.setDepthBuffer = function (enable) {
  3738. this._depthCullingState.depthTest = enable;
  3739. };
  3740. Engine.prototype.getDepthWrite = function () {
  3741. return this._depthCullingState.depthMask;
  3742. };
  3743. Engine.prototype.setDepthWrite = function (enable) {
  3744. this._depthCullingState.depthMask = enable;
  3745. };
  3746. Engine.prototype.setColorWrite = function (enable) {
  3747. this._gl.colorMask(enable, enable, enable, enable);
  3748. };
  3749. Engine.prototype.setAlphaMode = function (mode) {
  3750. switch (mode) {
  3751. case BABYLON.Engine.ALPHA_DISABLE:
  3752. this.setDepthWrite(true);
  3753. this._alphaState.alphaBlend = false;
  3754. break;
  3755. case BABYLON.Engine.ALPHA_COMBINE:
  3756. this.setDepthWrite(false);
  3757. this._alphaState.setAlphaBlendFunctionParameters(this._gl.SRC_ALPHA, this._gl.ONE_MINUS_SRC_ALPHA, this._gl.ONE, this._gl.ONE);
  3758. this._alphaState.alphaBlend = true;
  3759. break;
  3760. case BABYLON.Engine.ALPHA_ADD:
  3761. this.setDepthWrite(false);
  3762. this._alphaState.setAlphaBlendFunctionParameters(this._gl.ONE, this._gl.ONE, this._gl.ZERO, this._gl.ONE);
  3763. this._alphaState.alphaBlend = true;
  3764. break;
  3765. }
  3766. this._alphaMode = mode;
  3767. };
  3768. Engine.prototype.getAlphaMode = function () {
  3769. return this._alphaMode;
  3770. };
  3771. Engine.prototype.setAlphaTesting = function (enable) {
  3772. this._alphaTest = enable;
  3773. };
  3774. Engine.prototype.getAlphaTesting = function () {
  3775. return this._alphaTest;
  3776. };
  3777. // Textures
  3778. Engine.prototype.wipeCaches = function () {
  3779. this._activeTexturesCache = [];
  3780. this._currentEffect = null;
  3781. this._depthCullingState.reset();
  3782. this._alphaState.reset();
  3783. this._cachedVertexBuffers = null;
  3784. this._cachedIndexBuffer = null;
  3785. this._cachedEffectForVertexBuffers = null;
  3786. };
  3787. Engine.prototype.setSamplingMode = function (texture, samplingMode) {
  3788. var gl = this._gl;
  3789. gl.bindTexture(gl.TEXTURE_2D, texture);
  3790. var magFilter = gl.NEAREST;
  3791. var minFilter = gl.NEAREST;
  3792. if (samplingMode === BABYLON.Texture.BILINEAR_SAMPLINGMODE) {
  3793. magFilter = gl.LINEAR;
  3794. minFilter = gl.LINEAR;
  3795. } else if (samplingMode === BABYLON.Texture.TRILINEAR_SAMPLINGMODE) {
  3796. magFilter = gl.LINEAR;
  3797. minFilter = gl.LINEAR_MIPMAP_LINEAR;
  3798. }
  3799. gl.texParameteri(gl.TEXTURE_2D, gl.TEXTURE_MAG_FILTER, magFilter);
  3800. gl.texParameteri(gl.TEXTURE_2D, gl.TEXTURE_MIN_FILTER, minFilter);
  3801. gl.bindTexture(gl.TEXTURE_2D, null);
  3802. };
  3803. Engine.prototype.createTexture = function (url, noMipmap, invertY, scene, samplingMode, onLoad, onError, buffer) {
  3804. var _this = this;
  3805. if (typeof samplingMode === "undefined") { samplingMode = BABYLON.Texture.TRILINEAR_SAMPLINGMODE; }
  3806. if (typeof onLoad === "undefined") { onLoad = null; }
  3807. if (typeof onError === "undefined") { onError = null; }
  3808. if (typeof buffer === "undefined") { buffer = null; }
  3809. var texture = this._gl.createTexture();
  3810. var extension;
  3811. var fromData = false;
  3812. if (url.substr(0, 5) === "data:") {
  3813. fromData = true;
  3814. }
  3815. if (!fromData)
  3816. extension = url.substr(url.length - 4, 4).toLowerCase();
  3817. else {
  3818. var oldUrl = url;
  3819. fromData = oldUrl.split(':');
  3820. url = oldUrl;
  3821. extension = fromData[1].substr(fromData[1].length - 4, 4).toLowerCase();
  3822. }
  3823. var isDDS = this.getCaps().s3tc && (extension === ".dds");
  3824. var isTGA = (extension === ".tga");
  3825. scene._addPendingData(texture);
  3826. texture.url = url;
  3827. texture.noMipmap = noMipmap;
  3828. texture.references = 1;
  3829. this._loadedTexturesCache.push(texture);
  3830. var onerror = function () {
  3831. scene._removePendingData(texture);
  3832. if (onError) {
  3833. onError();
  3834. }
  3835. };
  3836. if (isTGA) {
  3837. var callback = function (arrayBuffer) {
  3838. var data = new Uint8Array(arrayBuffer);
  3839. var header = BABYLON.Internals.TGATools.GetTGAHeader(data);
  3840. prepareWebGLTexture(texture, _this._gl, scene, header.width, header.height, invertY, noMipmap, false, function () {
  3841. BABYLON.Internals.TGATools.UploadContent(_this._gl, data);
  3842. if (onLoad) {
  3843. onLoad();
  3844. }
  3845. }, samplingMode);
  3846. };
  3847. if (!(fromData instanceof Array))
  3848. BABYLON.Tools.LoadFile(url, function (arrayBuffer) {
  3849. callback(arrayBuffer);
  3850. }, onerror, scene.database, true);
  3851. else
  3852. callback(buffer);
  3853. } else if (isDDS) {
  3854. callback = function (data) {
  3855. var info = BABYLON.Internals.DDSTools.GetDDSInfo(data);
  3856. var loadMipmap = (info.isRGB || info.isLuminance || info.mipmapCount > 1) && !noMipmap && ((info.width >> (info.mipmapCount - 1)) == 1);
  3857. prepareWebGLTexture(texture, _this._gl, scene, info.width, info.height, invertY, !loadMipmap, info.isFourCC, function () {
  3858. BABYLON.Internals.DDSTools.UploadDDSLevels(_this._gl, _this.getCaps().s3tc, data, info, loadMipmap, 1);
  3859. if (onLoad) {
  3860. onLoad();
  3861. }
  3862. }, samplingMode);
  3863. };
  3864. if (!(fromData instanceof Array))
  3865. BABYLON.Tools.LoadFile(url, function (data) {
  3866. callback(data);
  3867. }, onerror, scene.database, true);
  3868. else
  3869. callback(buffer);
  3870. } else {
  3871. var onload = function (img) {
  3872. prepareWebGLTexture(texture, _this._gl, scene, img.width, img.height, invertY, noMipmap, false, function (potWidth, potHeight) {
  3873. var isPot = (img.width == potWidth && img.height == potHeight);
  3874. if (!isPot) {
  3875. _this._workingCanvas.width = potWidth;
  3876. _this._workingCanvas.height = potHeight;
  3877. _this._workingContext.drawImage(img, 0, 0, img.width, img.height, 0, 0, potWidth, potHeight);
  3878. }
  3879. _this._gl.texImage2D(_this._gl.TEXTURE_2D, 0, _this._gl.RGBA, _this._gl.RGBA, _this._gl.UNSIGNED_BYTE, isPot ? img : _this._workingCanvas);
  3880. if (onLoad) {
  3881. onLoad();
  3882. }
  3883. }, samplingMode);
  3884. };
  3885. if (!(fromData instanceof Array))
  3886. BABYLON.Tools.LoadImage(url, onload, onerror, scene.database);
  3887. else
  3888. BABYLON.Tools.LoadImage(buffer, onload, onerror, scene.database);
  3889. }
  3890. return texture;
  3891. };
  3892. Engine.prototype.createRawTexture = function (data, width, height, format, generateMipMaps, invertY, samplingMode) {
  3893. if (width !== BABYLON.Tools.GetExponantOfTwo(width, this._caps.maxTextureSize) || height !== BABYLON.Tools.GetExponantOfTwo(height, this._caps.maxTextureSize)) {
  3894. BABYLON.Tools.Error("Unable to create a BABYLON.RawTexture with specified resolution. You must define power of 2 size.");
  3895. return null;
  3896. }
  3897. var texture = this._gl.createTexture();
  3898. this._gl.bindTexture(this._gl.TEXTURE_2D, texture);
  3899. this._gl.pixelStorei(this._gl.UNPACK_FLIP_Y_WEBGL, invertY === undefined ? 1 : (invertY ? 1 : 0));
  3900. // Format
  3901. var internalFormat = this._gl.RGBA;
  3902. switch (format) {
  3903. case Engine.TEXTUREFORMAT_ALPHA:
  3904. internalFormat = this._gl.ALPHA;
  3905. break;
  3906. case Engine.TEXTUREFORMAT_LUMINANCE:
  3907. internalFormat = this._gl.LUMINANCE;
  3908. break;
  3909. case Engine.TEXTUREFORMAT_LUMINANCE_ALPHA:
  3910. internalFormat = this._gl.LUMINANCE_ALPHA;
  3911. break;
  3912. case Engine.TEXTUREFORMAT_RGB:
  3913. internalFormat = this._gl.RGB;
  3914. break;
  3915. case Engine.TEXTUREFORMAT_RGBA:
  3916. internalFormat = this._gl.RGBA;
  3917. break;
  3918. }
  3919. this._gl.texImage2D(this._gl.TEXTURE_2D, 0, internalFormat, width, height, 0, internalFormat, this._gl.UNSIGNED_BYTE, data);
  3920. if (generateMipMaps) {
  3921. this._gl.generateMipmap(this._gl.TEXTURE_2D);
  3922. }
  3923. // Filters
  3924. var filters = getSamplingParameters(samplingMode, generateMipMaps, this._gl);
  3925. this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_MAG_FILTER, filters.mag);
  3926. this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_MIN_FILTER, filters.min);
  3927. this._gl.bindTexture(this._gl.TEXTURE_2D, null);
  3928. this._activeTexturesCache = [];
  3929. texture._baseWidth = width;
  3930. texture._baseHeight = height;
  3931. texture._width = width;
  3932. texture._height = height;
  3933. texture.isReady = true;
  3934. texture.references = 1;
  3935. this._loadedTexturesCache.push(texture);
  3936. return texture;
  3937. };
  3938. Engine.prototype.createDynamicTexture = function (width, height, generateMipMaps, samplingMode) {
  3939. var texture = this._gl.createTexture();
  3940. width = BABYLON.Tools.GetExponantOfTwo(width, this._caps.maxTextureSize);
  3941. height = BABYLON.Tools.GetExponantOfTwo(height, this._caps.maxTextureSize);
  3942. this._gl.bindTexture(this._gl.TEXTURE_2D, texture);
  3943. var filters = getSamplingParameters(samplingMode, generateMipMaps, this._gl);
  3944. this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_MAG_FILTER, filters.mag);
  3945. this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_MIN_FILTER, filters.min);
  3946. this._gl.bindTexture(this._gl.TEXTURE_2D, null);
  3947. this._activeTexturesCache = [];
  3948. texture._baseWidth = width;
  3949. texture._baseHeight = height;
  3950. texture._width = width;
  3951. texture._height = height;
  3952. texture.isReady = false;
  3953. texture.generateMipMaps = generateMipMaps;
  3954. texture.references = 1;
  3955. this._loadedTexturesCache.push(texture);
  3956. return texture;
  3957. };
  3958. Engine.prototype.updateDynamicTexture = function (texture, canvas, invertY) {
  3959. this._gl.bindTexture(this._gl.TEXTURE_2D, texture);
  3960. this._gl.pixelStorei(this._gl.UNPACK_FLIP_Y_WEBGL, invertY ? 1 : 0);
  3961. this._gl.texImage2D(this._gl.TEXTURE_2D, 0, this._gl.RGBA, this._gl.RGBA, this._gl.UNSIGNED_BYTE, canvas);
  3962. if (texture.generateMipMaps) {
  3963. this._gl.generateMipmap(this._gl.TEXTURE_2D);
  3964. }
  3965. this._gl.bindTexture(this._gl.TEXTURE_2D, null);
  3966. this._activeTexturesCache = [];
  3967. texture.isReady = true;
  3968. };
  3969. Engine.prototype.updateVideoTexture = function (texture, video, invertY) {
  3970. this._gl.bindTexture(this._gl.TEXTURE_2D, texture);
  3971. this._gl.pixelStorei(this._gl.UNPACK_FLIP_Y_WEBGL, invertY ? 0 : 1); // Video are upside down by default
  3972. // Scale the video if it is a NPOT using the current working canvas
  3973. if (video.videoWidth !== texture._width || video.videoHeight !== texture._height) {
  3974. if (!texture._workingCanvas) {
  3975. texture._workingCanvas = document.createElement("canvas");
  3976. texture._workingContext = texture._workingCanvas.getContext("2d");
  3977. texture._workingCanvas.width = texture._width;
  3978. texture._workingCanvas.height = texture._height;
  3979. }
  3980. texture._workingContext.drawImage(video, 0, 0, video.videoWidth, video.videoHeight, 0, 0, texture._width, texture._height);
  3981. this._gl.texImage2D(this._gl.TEXTURE_2D, 0, this._gl.RGBA, this._gl.RGBA, this._gl.UNSIGNED_BYTE, texture._workingCanvas);
  3982. } else {
  3983. this._gl.texImage2D(this._gl.TEXTURE_2D, 0, this._gl.RGBA, this._gl.RGBA, this._gl.UNSIGNED_BYTE, video);
  3984. }
  3985. if (texture.generateMipMaps) {
  3986. this._gl.generateMipmap(this._gl.TEXTURE_2D);
  3987. }
  3988. this._gl.bindTexture(this._gl.TEXTURE_2D, null);
  3989. this._activeTexturesCache = [];
  3990. texture.isReady = true;
  3991. };
  3992. Engine.prototype.createRenderTargetTexture = function (size, options) {
  3993. // old version had a "generateMipMaps" arg instead of options.
  3994. // if options.generateMipMaps is undefined, consider that options itself if the generateMipmaps value
  3995. // in the same way, generateDepthBuffer is defaulted to true
  3996. var generateMipMaps = false;
  3997. var generateDepthBuffer = true;
  3998. var samplingMode = BABYLON.Texture.TRILINEAR_SAMPLINGMODE;
  3999. if (options !== undefined) {
  4000. generateMipMaps = options.generateMipMaps === undefined ? options : options.generateMipmaps;
  4001. generateDepthBuffer = options.generateDepthBuffer === undefined ? true : options.generateDepthBuffer;
  4002. if (options.samplingMode !== undefined) {
  4003. samplingMode = options.samplingMode;
  4004. }
  4005. }
  4006. var gl = this._gl;
  4007. var texture = gl.createTexture();
  4008. gl.bindTexture(gl.TEXTURE_2D, texture);
  4009. var width = size.width || size;
  4010. var height = size.height || size;
  4011. var filters = getSamplingParameters(samplingMode, generateMipMaps, gl);
  4012. gl.texParameteri(gl.TEXTURE_2D, gl.TEXTURE_MAG_FILTER, filters.mag);
  4013. gl.texParameteri(gl.TEXTURE_2D, gl.TEXTURE_MIN_FILTER, filters.min);
  4014. gl.texParameteri(gl.TEXTURE_2D, gl.TEXTURE_WRAP_S, gl.CLAMP_TO_EDGE);
  4015. gl.texParameteri(gl.TEXTURE_2D, gl.TEXTURE_WRAP_T, gl.CLAMP_TO_EDGE);
  4016. gl.texImage2D(gl.TEXTURE_2D, 0, gl.RGBA, width, height, 0, gl.RGBA, gl.UNSIGNED_BYTE, null);
  4017. var depthBuffer;
  4018. // Create the depth buffer
  4019. if (generateDepthBuffer) {
  4020. depthBuffer = gl.createRenderbuffer();
  4021. gl.bindRenderbuffer(gl.RENDERBUFFER, depthBuffer);
  4022. gl.renderbufferStorage(gl.RENDERBUFFER, gl.DEPTH_COMPONENT16, width, height);
  4023. }
  4024. // Create the framebuffer
  4025. var framebuffer = gl.createFramebuffer();
  4026. gl.bindFramebuffer(gl.FRAMEBUFFER, framebuffer);
  4027. gl.framebufferTexture2D(gl.FRAMEBUFFER, gl.COLOR_ATTACHMENT0, gl.TEXTURE_2D, texture, 0);
  4028. if (generateDepthBuffer) {
  4029. gl.framebufferRenderbuffer(gl.FRAMEBUFFER, gl.DEPTH_ATTACHMENT, gl.RENDERBUFFER, depthBuffer);
  4030. }
  4031. // Unbind
  4032. gl.bindTexture(gl.TEXTURE_2D, null);
  4033. gl.bindRenderbuffer(gl.RENDERBUFFER, null);
  4034. gl.bindFramebuffer(gl.FRAMEBUFFER, null);
  4035. texture._framebuffer = framebuffer;
  4036. if (generateDepthBuffer) {
  4037. texture._depthBuffer = depthBuffer;
  4038. }
  4039. texture._width = width;
  4040. texture._height = height;
  4041. texture.isReady = true;
  4042. texture.generateMipMaps = generateMipMaps;
  4043. texture.references = 1;
  4044. this._activeTexturesCache = [];
  4045. this._loadedTexturesCache.push(texture);
  4046. return texture;
  4047. };
  4048. Engine.prototype.createCubeTexture = function (rootUrl, scene, extensions, noMipmap) {
  4049. var _this = this;
  4050. var gl = this._gl;
  4051. var texture = gl.createTexture();
  4052. texture.isCube = true;
  4053. texture.url = rootUrl;
  4054. texture.references = 1;
  4055. this._loadedTexturesCache.push(texture);
  4056. var extension = rootUrl.substr(rootUrl.length - 4, 4).toLowerCase();
  4057. var isDDS = this.getCaps().s3tc && (extension === ".dds");
  4058. if (isDDS) {
  4059. BABYLON.Tools.LoadFile(rootUrl, function (data) {
  4060. var info = BABYLON.Internals.DDSTools.GetDDSInfo(data);
  4061. var loadMipmap = (info.isRGB || info.isLuminance || info.mipmapCount > 1) && !noMipmap;
  4062. gl.bindTexture(gl.TEXTURE_CUBE_MAP, texture);
  4063. gl.pixelStorei(gl.UNPACK_FLIP_Y_WEBGL, 1);
  4064. BABYLON.Internals.DDSTools.UploadDDSLevels(_this._gl, _this.getCaps().s3tc, data, info, loadMipmap, 6);
  4065. if (!noMipmap && !info.isFourCC && info.mipmapCount == 1) {
  4066. gl.generateMipmap(gl.TEXTURE_CUBE_MAP);
  4067. }
  4068. gl.texParameteri(gl.TEXTURE_CUBE_MAP, gl.TEXTURE_MAG_FILTER, gl.LINEAR);
  4069. gl.texParameteri(gl.TEXTURE_CUBE_MAP, gl.TEXTURE_MIN_FILTER, loadMipmap ? gl.LINEAR_MIPMAP_LINEAR : gl.LINEAR);
  4070. gl.texParameteri(gl.TEXTURE_CUBE_MAP, gl.TEXTURE_WRAP_S, gl.CLAMP_TO_EDGE);
  4071. gl.texParameteri(gl.TEXTURE_CUBE_MAP, gl.TEXTURE_WRAP_T, gl.CLAMP_TO_EDGE);
  4072. gl.bindTexture(gl.TEXTURE_CUBE_MAP, null);
  4073. _this._activeTexturesCache = [];
  4074. texture._width = info.width;
  4075. texture._height = info.height;
  4076. texture.isReady = true;
  4077. }, null, null, true);
  4078. } else {
  4079. cascadeLoad(rootUrl, scene, function (imgs) {
  4080. var width = BABYLON.Tools.GetExponantOfTwo(imgs[0].width, _this._caps.maxCubemapTextureSize);
  4081. var height = width;
  4082. _this._workingCanvas.width = width;
  4083. _this._workingCanvas.height = height;
  4084. var faces = [
  4085. gl.TEXTURE_CUBE_MAP_POSITIVE_X, gl.TEXTURE_CUBE_MAP_POSITIVE_Y, gl.TEXTURE_CUBE_MAP_POSITIVE_Z,
  4086. gl.TEXTURE_CUBE_MAP_NEGATIVE_X, gl.TEXTURE_CUBE_MAP_NEGATIVE_Y, gl.TEXTURE_CUBE_MAP_NEGATIVE_Z
  4087. ];
  4088. gl.bindTexture(gl.TEXTURE_CUBE_MAP, texture);
  4089. gl.pixelStorei(gl.UNPACK_FLIP_Y_WEBGL, 0);
  4090. for (var index = 0; index < faces.length; index++) {
  4091. _this._workingContext.drawImage(imgs[index], 0, 0, imgs[index].width, imgs[index].height, 0, 0, width, height);
  4092. gl.texImage2D(faces[index], 0, gl.RGBA, gl.RGBA, gl.UNSIGNED_BYTE, _this._workingCanvas);
  4093. }
  4094. if (!noMipmap) {
  4095. gl.generateMipmap(gl.TEXTURE_CUBE_MAP);
  4096. }
  4097. gl.texParameteri(gl.TEXTURE_CUBE_MAP, gl.TEXTURE_MAG_FILTER, gl.LINEAR);
  4098. gl.texParameteri(gl.TEXTURE_CUBE_MAP, gl.TEXTURE_MIN_FILTER, noMipmap ? gl.LINEAR : gl.LINEAR_MIPMAP_LINEAR);
  4099. gl.texParameteri(gl.TEXTURE_CUBE_MAP, gl.TEXTURE_WRAP_S, gl.CLAMP_TO_EDGE);
  4100. gl.texParameteri(gl.TEXTURE_CUBE_MAP, gl.TEXTURE_WRAP_T, gl.CLAMP_TO_EDGE);
  4101. gl.bindTexture(gl.TEXTURE_CUBE_MAP, null);
  4102. _this._activeTexturesCache = [];
  4103. texture._width = width;
  4104. texture._height = height;
  4105. texture.isReady = true;
  4106. }, extensions);
  4107. }
  4108. return texture;
  4109. };
  4110. Engine.prototype._releaseTexture = function (texture) {
  4111. var gl = this._gl;
  4112. if (texture._framebuffer) {
  4113. gl.deleteFramebuffer(texture._framebuffer);
  4114. }
  4115. if (texture._depthBuffer) {
  4116. gl.deleteRenderbuffer(texture._depthBuffer);
  4117. }
  4118. gl.deleteTexture(texture);
  4119. for (var channel = 0; channel < this._caps.maxTexturesImageUnits; channel++) {
  4120. this._gl.activeTexture(this._gl["TEXTURE" + channel]);
  4121. this._gl.bindTexture(this._gl.TEXTURE_2D, null);
  4122. this._gl.bindTexture(this._gl.TEXTURE_CUBE_MAP, null);
  4123. this._activeTexturesCache[channel] = null;
  4124. }
  4125. var index = this._loadedTexturesCache.indexOf(texture);
  4126. if (index !== -1) {
  4127. this._loadedTexturesCache.splice(index, 1);
  4128. }
  4129. };
  4130. Engine.prototype.bindSamplers = function (effect) {
  4131. this._gl.useProgram(effect.getProgram());
  4132. var samplers = effect.getSamplers();
  4133. for (var index = 0; index < samplers.length; index++) {
  4134. var uniform = effect.getUniform(samplers[index]);
  4135. this._gl.uniform1i(uniform, index);
  4136. }
  4137. this._currentEffect = null;
  4138. };
  4139. Engine.prototype._bindTexture = function (channel, texture) {
  4140. this._gl.activeTexture(this._gl["TEXTURE" + channel]);
  4141. this._gl.bindTexture(this._gl.TEXTURE_2D, texture);
  4142. this._activeTexturesCache[channel] = null;
  4143. };
  4144. Engine.prototype.setTextureFromPostProcess = function (channel, postProcess) {
  4145. this._bindTexture(channel, postProcess._textures.data[postProcess._currentRenderTextureInd]);
  4146. };
  4147. Engine.prototype.setTexture = function (channel, texture) {
  4148. if (channel < 0) {
  4149. return;
  4150. }
  4151. // Not ready?
  4152. if (!texture || !texture.isReady()) {
  4153. if (this._activeTexturesCache[channel] != null) {
  4154. this._gl.activeTexture(this._gl["TEXTURE" + channel]);
  4155. this._gl.bindTexture(this._gl.TEXTURE_2D, null);
  4156. this._gl.bindTexture(this._gl.TEXTURE_CUBE_MAP, null);
  4157. this._activeTexturesCache[channel] = null;
  4158. }
  4159. return;
  4160. }
  4161. // Video
  4162. if (texture instanceof BABYLON.VideoTexture) {
  4163. if (texture.update()) {
  4164. this._activeTexturesCache[channel] = null;
  4165. }
  4166. } else if (texture.delayLoadState == BABYLON.Engine.DELAYLOADSTATE_NOTLOADED) {
  4167. texture.delayLoad();
  4168. return;
  4169. }
  4170. if (this._activeTexturesCache[channel] == texture) {
  4171. return;
  4172. }
  4173. this._activeTexturesCache[channel] = texture;
  4174. var internalTexture = texture.getInternalTexture();
  4175. this._gl.activeTexture(this._gl["TEXTURE" + channel]);
  4176. if (internalTexture.isCube) {
  4177. this._gl.bindTexture(this._gl.TEXTURE_CUBE_MAP, internalTexture);
  4178. if (internalTexture._cachedCoordinatesMode !== texture.coordinatesMode) {
  4179. internalTexture._cachedCoordinatesMode = texture.coordinatesMode;
  4180. // CUBIC_MODE and SKYBOX_MODE both require CLAMP_TO_EDGE. All other modes use REPEAT.
  4181. var textureWrapMode = (texture.coordinatesMode !== BABYLON.Texture.CUBIC_MODE && texture.coordinatesMode !== BABYLON.Texture.SKYBOX_MODE) ? this._gl.REPEAT : this._gl.CLAMP_TO_EDGE;
  4182. this._gl.texParameteri(this._gl.TEXTURE_CUBE_MAP, this._gl.TEXTURE_WRAP_S, textureWrapMode);
  4183. this._gl.texParameteri(this._gl.TEXTURE_CUBE_MAP, this._gl.TEXTURE_WRAP_T, textureWrapMode);
  4184. }
  4185. this._setAnisotropicLevel(this._gl.TEXTURE_CUBE_MAP, texture);
  4186. } else {
  4187. this._gl.bindTexture(this._gl.TEXTURE_2D, internalTexture);
  4188. if (internalTexture._cachedWrapU !== texture.wrapU) {
  4189. internalTexture._cachedWrapU = texture.wrapU;
  4190. switch (texture.wrapU) {
  4191. case BABYLON.Texture.WRAP_ADDRESSMODE:
  4192. this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_WRAP_S, this._gl.REPEAT);
  4193. break;
  4194. case BABYLON.Texture.CLAMP_ADDRESSMODE:
  4195. this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_WRAP_S, this._gl.CLAMP_TO_EDGE);
  4196. break;
  4197. case BABYLON.Texture.MIRROR_ADDRESSMODE:
  4198. this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_WRAP_S, this._gl.MIRRORED_REPEAT);
  4199. break;
  4200. }
  4201. }
  4202. if (internalTexture._cachedWrapV !== texture.wrapV) {
  4203. internalTexture._cachedWrapV = texture.wrapV;
  4204. switch (texture.wrapV) {
  4205. case BABYLON.Texture.WRAP_ADDRESSMODE:
  4206. this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_WRAP_T, this._gl.REPEAT);
  4207. break;
  4208. case BABYLON.Texture.CLAMP_ADDRESSMODE:
  4209. this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_WRAP_T, this._gl.CLAMP_TO_EDGE);
  4210. break;
  4211. case BABYLON.Texture.MIRROR_ADDRESSMODE:
  4212. this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_WRAP_T, this._gl.MIRRORED_REPEAT);
  4213. break;
  4214. }
  4215. }
  4216. this._setAnisotropicLevel(this._gl.TEXTURE_2D, texture);
  4217. }
  4218. };
  4219. Engine.prototype._setAnisotropicLevel = function (key, texture) {
  4220. var anisotropicFilterExtension = this._caps.textureAnisotropicFilterExtension;
  4221. if (anisotropicFilterExtension && texture._cachedAnisotropicFilteringLevel !== texture.anisotropicFilteringLevel) {
  4222. this._gl.texParameterf(key, anisotropicFilterExtension.TEXTURE_MAX_ANISOTROPY_EXT, Math.min(texture.anisotropicFilteringLevel, this._caps.maxAnisotropy));
  4223. texture._cachedAnisotropicFilteringLevel = texture.anisotropicFilteringLevel;
  4224. }
  4225. };
  4226. Engine.prototype.readPixels = function (x, y, width, height) {
  4227. var data = new Uint8Array(height * width * 4);
  4228. this._gl.readPixels(0, 0, width, height, this._gl.RGBA, this._gl.UNSIGNED_BYTE, data);
  4229. return data;
  4230. };
  4231. // Dispose
  4232. Engine.prototype.dispose = function () {
  4233. this.hideLoadingUI();
  4234. this.stopRenderLoop();
  4235. while (this.scenes.length) {
  4236. this.scenes[0].dispose();
  4237. }
  4238. for (var name in this._compiledEffects) {
  4239. this._gl.deleteProgram(this._compiledEffects[name]._program);
  4240. }
  4241. for (var i in this._vertexAttribArrays) {
  4242. if (i > this._gl.VERTEX_ATTRIB_ARRAY_ENABLED || !this._vertexAttribArrays[i]) {
  4243. continue;
  4244. }
  4245. this._gl.disableVertexAttribArray(i);
  4246. }
  4247. // Events
  4248. window.removeEventListener("blur", this._onBlur);
  4249. window.removeEventListener("focus", this._onFocus);
  4250. document.removeEventListener("fullscreenchange", this._onFullscreenChange);
  4251. document.removeEventListener("mozfullscreenchange", this._onFullscreenChange);
  4252. document.removeEventListener("webkitfullscreenchange", this._onFullscreenChange);
  4253. document.removeEventListener("msfullscreenchange", this._onFullscreenChange);
  4254. document.removeEventListener("pointerlockchange", this._onPointerLockChange);
  4255. document.removeEventListener("mspointerlockchange", this._onPointerLockChange);
  4256. document.removeEventListener("mozpointerlockchange", this._onPointerLockChange);
  4257. document.removeEventListener("webkitpointerlockchange", this._onPointerLockChange);
  4258. };
  4259. // Loading screen
  4260. Engine.prototype.displayLoadingUI = function () {
  4261. var _this = this;
  4262. this._loadingDiv = document.createElement("div");
  4263. this._loadingDiv.style.opacity = "0";
  4264. this._loadingDiv.style.transition = "opacity 1.5s ease";
  4265. // Loading text
  4266. this._loadingTextDiv = document.createElement("div");
  4267. this._loadingTextDiv.style.position = "absolute";
  4268. this._loadingTextDiv.style.left = "0";
  4269. this._loadingTextDiv.style.top = "50%";
  4270. this._loadingTextDiv.style.marginTop = "80px";
  4271. this._loadingTextDiv.style.width = "100%";
  4272. this._loadingTextDiv.style.height = "20px";
  4273. this._loadingTextDiv.style.fontFamily = "Arial";
  4274. this._loadingTextDiv.style.fontSize = "14px";
  4275. this._loadingTextDiv.style.color = "white";
  4276. this._loadingTextDiv.style.textAlign = "center";
  4277. this._loadingTextDiv.innerHTML = "Loading";
  4278. this._loadingDiv.appendChild(this._loadingTextDiv);
  4279. // Loading img
  4280. var imgBack = new Image();
  4281. imgBack.src = "data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAGQAAABkCAYAAABw4pVUAAAAAXNSR0IArs4c6QAAAARnQU1BAACxjwv8YQUAAAAJcEhZcwAADsMAAA7DAcdvqGQAAAAYdEVYdFNvZnR3YXJlAHBhaW50Lm5ldCA0LjAuM4zml1AAAARbSURBVHhe7Z09aFNRFMc716kuLrq4FdyLq4Wi4CAoRQcR0UJBUBdRiuLSIYMo6CA4FF2sgw6CFAdFUOpSQYcWO4hD26UQCfXrIQrx/JJzw1OSWq3NPeL/B4Fy+0jg/HO+7j3vpUcI8b/Q39+/49ihfWdPHT94Yf/e3Se3bd263f8lus218TPn6vV6Ya8Wi/MzNRNmj18iusX9W1evmP1/EKNEIVG6CMbG6E3bt+fT++pHha8NoHdT72bLE8NDg7tGU64gLLndV4Wc4m8j/pS+vr4tGB/DT16v3Fyr8dvBe/jbit8BL0AES9LX1iPAz+BR/hFiLVCynj95dPzNy6fv3IZ/k4L3948Sq7FzYGBg4vLFGxitabuOFCbWNKGrMnbiUuo18KaV6tIHv6YtvL9/nOgE31jCktmrY7k6+/zhE4yP4Vf7hiNqh/BWWEl8mzDol4p22Lf7cIdvdUMEvv0Y2S9fE5S1hLzpqTsPkiep//gFGPnR3Yl7GL5p/xYFBrTwM+iXio3GqpwDGL5p/xYNIX7XG8Q6IJRgdIzf1KBBgafII7oMidhyQtVFaMA2Bt7il4huQRhaXphbcR2g4RXqBzKAGHiCCwGFVUAj/m/RTRDj29cvn10I0PZ3LghH5f4CL1EFlQmqqXK3jDDKFxmhQ3Yt6oQseUZGKmMnTpsOqc8o1F9kBOMjQlOLeqEeIyOc6JV6jYLJD/+XyIFvnzdgl9aXRQ5I2qZDK1SpospMqaoqON/wZZGDciLnMMiXRS7IF4hhqMTNTdk7CFu+LHLhR7BQqBvPDJUUQqCGvCMATHUgBmhWNgApmdOda9YpM+VwRYfuyyIXDK8hBlilNerLIheMZCKGwlUAyru6GlwOgPUbRxADdJ9FAChxXY864viyyEXqPxhc0M2TAfAbatSdRyHtXymhByEdRnE3ky+JnHAIhSA0h74kckETmHoQbSgGwJrCIRMEPSRIBCRIMAhZaYhaggQhJXUJEoRU9mofKwh+F22dLRRfEjlJM7w6KQwCoQpBOKTyJZETjmwRxKqtGV8SOSkNOGjKPQppBEgDDkFgpxdBVGkFgaYQQXRIFQSObk0P5ZFIpAZRHXsQ0r0hCluBWKkuvVbYCkQaCdL5ehBScudJP4yY+rLISdps1NBDEJKXMMmoSfggWC4ZQRR17oFYXph7hSiquIKQ+hJGTX1J5MYSPD/GVdNzsgLBwZVCVyAQAkF0ohiI/c1fS6tNXq9UfEnkhudmIQolsS+J3Hh/UtNDzQLhj42VKJFInqLwFYiUU5ToA+HdfI0JevUpQUAIn+vSz2lHIuUV/dJOIHhOY/IWVWGBIHQtzs88s9zyWBuTgcBLzGOmeNnfF/QslSDgMeQW85i3DOQxuipxAkCyZ8SIm4Omp+7MMlCB59j6sKZcMoM4iIEoeI2J9AKxrFobZx0v4vYInuHFS4J1GQRCAGaLEYQXfyMML5XSQgghhBBCCCH+cXp6vgNhKpSKX/XdOAAAAABJRU5ErkJggg==";
  4282. imgBack.style.position = "absolute";
  4283. imgBack.style.left = "50%";
  4284. imgBack.style.top = "50%";
  4285. imgBack.style.marginLeft = "-50px";
  4286. imgBack.style.marginTop = "-50px";
  4287. imgBack.style.transition = "transform 1.0s ease";
  4288. imgBack.style.webkitTransition = "-webkit-transform 1.0s ease";
  4289. var deg = 360;
  4290. var onTransitionEnd = function () {
  4291. deg += 360;
  4292. imgBack.style.transform = "rotateZ(" + deg + "deg)";
  4293. imgBack.style.webkitTransform = "rotateZ(" + deg + "deg)";
  4294. };
  4295. imgBack.addEventListener("transitionend", onTransitionEnd);
  4296. imgBack.addEventListener("webkitTransitionEnd", onTransitionEnd);
  4297. this._loadingDiv.appendChild(imgBack);
  4298. // front image
  4299. var imgFront = new Image();
  4300. imgFront.src = "data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAGQAAABkCAYAAABw4pVUAAAAAXNSR0IArs4c6QAAAARnQU1BAACxjwv8YQUAAAAJcEhZcwAADsMAAA7DAcdvqGQAAAAYdEVYdFNvZnR3YXJlAHBhaW50Lm5ldCA0LjAuM4zml1AAAAYJSURBVHhe7Zy/qx1FFMff/2Av2Nvbi4WFiiAEY/OQ2IgQsbCJQoqkCAgpFLXyoZURLfwBIiIpgqZJoYQYlWelNsIrNOxDJcrzfHe+G97dnTl75u7euzv7zgcWHrlnZmfOmXPmzI/NjuM4juM4juM4juM4juM4juM4juM4juM45fPic08/uHf5/CvffH7lnT8PfrtxdHS0n3p+/fHGl5+89/prr5599iEWd8bg0rkXHoFyqehKnlxQpjYSDHTm9JMPsGrHylOPPXofvICKXMcIGtXdf/76AYbm6xyNW9e/eAtKC7rbKLXnvHHx5Sf4auc4Ek7OQkFU1Dap/vv37k/wSjblZANFiFIGzw98hhizwqBgs04mCBdQRNCHidoAEtY+lLIvtSdoGFeyql2ZH57HBH4sE7O+o/r9l+8/ZXUni68+2jsHBQQ9qNRGeP/tSxdSYQX/roUcpL4/f3vtM9TD+jTq92n1LQ7jxF1hhGPtwWL3gGccy8JuS1r8sVWBGXNVdSKMYjBGPUJjCzooiGuSpnwlnnOGP2dhHRSLNgpHp2oMKIriK8TmG4Qh/rwW8D6pps9b9im+LDDipXOqMVJrAngBfg9i98gevWKA+/nnCod3Dr5GfaHaDgidVym6HKRjGIkpqthcAVKGxNqBImbEo66kjCih8AOpNmkUmbMuUrR8kEqiU6FvHZLGAPJ71JCYSyhiBqmwFE2GoD6jLGIfDHtG6EzoU4dK21PCqIRMEF0FGRjFzGDtIkXVAdATvsqfT9CJ0JcOFdYiFIsiMlqYy1YOFpQo2OddqBtyEaq9y+efoVh5oPHoROjLKn0j3JIE5Ka8UqZRtGrMnneX6yVofOhDh94MSbznTcpqmDOt1vyQzOgaJAF4F3JBfIXesrNEGWWmjIX7UBZ6jRJbBMLg/DmJiKUGVHleIpnVNTa+jakzkAviJqLhi4MC9XQGBrZeKJZESSrKy7ik0VGFWhQBRDTHIACKQ5l9nAjy75gya4a2w+Jhs0FJdc0xX/GwUbAqFBkZi7QpJ2w16WUbjFyK9MJF3KaoEM74KhVtLrQOrsmRxkbdHEqmSC/c+EuGnIFkjW7Ih2Kr4CCMIvNG2hrrgLpCjiFloooYCjyYrzCRyvhyBthkIPuQtsZGdnbMTezyDiU71KTC5zr7aVsHbsz2tllrEkS5UHwU1tq1HbtPW4UbeB0O7xx8R5EsMJql+BheUmHjkNVmIRP7LutoM3+D4O4tG7vCkNO9ESZ4lL3J6rKRMPx4qKbD/A0icf8CG7tC7kTahnMTwleuYSrsS7GatRAvfZh1tTm5BmmQCdZ8a0Sefe28xUrRBkmFLKy8KTIKUDRX0Y1xagPgwbaIdeFnQULmKak3xvwNMkVGgok/N5XNoehJvejRlCDl9escI28dJU0tZ++nBTJE9mEF647x5Ehbo4s5hDOKFIU0PdofeA5F5k1q63zIWmQqNI/P3ZubjFTqKxQ3jyjHAOX0RdlgVO9hzRFpczRcjZ3Gbxxpc7Qj6+5pTYF2OFXawNI+yDGf1k2NcvOlzBQeDQ/t7zD7DsEDpJ2xATXaNtDWUS4IzP4DS2ljajAVu57SUkYw245ptxZxA5JiZaJ0DswudGn3kYUy54426EjoT4dZfYbccxC2nI92cDkZHQr96jD4AGkMDKeSy/COBsRe6VTSKFN6irLeaCh3IteQjt1E5+oudsG/b/2DfZ5AqsYo8vMDK9LB1HzSsLWvlGThdxXvC6+NsqyPPWP0pMINtbdsajfVeC6f/GZ+cdAofQoB1d+Hf9waY98I7+RXWab3Lt4zYkjHtTnlOLXHYMsCh1zWeQYehu1zfNPOOiys/d91LAKEBSgh6MJMbSA82AaHofDgAIwbgvVvlLNS11nModMm4UZergLHZBZrodmBuA3lBB1thdorSjkOmATMDwg/UBQVtglqQyx6fbEJ+H3IWIapjYAjAfeIgeCMHldueJvFaqDaAHhwf8qNsEEQ1iQbOoUUGIbCLRc8+Bvfp4jyd2FEijuO4ziO4ziO4ziO4ziO4ziO4ziO4ziOUzw7O/8D0P7rcZ/GEboAAAAASUVORK5CYII=";
  4301. imgFront.style.position = "absolute";
  4302. imgFront.style.left = "50%";
  4303. imgFront.style.top = "50%";
  4304. imgFront.style.marginLeft = "-50px";
  4305. imgFront.style.marginTop = "-50px";
  4306. this._loadingDiv.appendChild(imgFront);
  4307. // Resize
  4308. this._resizeLoadingUI = function () {
  4309. var canvasRect = _this.getRenderingCanvasClientRect();
  4310. _this._loadingDiv.style.position = "absolute";
  4311. _this._loadingDiv.style.left = canvasRect.left + "px";
  4312. _this._loadingDiv.style.top = canvasRect.top + "px";
  4313. _this._loadingDiv.style.width = canvasRect.width + "px";
  4314. _this._loadingDiv.style.height = canvasRect.height + "px";
  4315. };
  4316. this._resizeLoadingUI();
  4317. window.addEventListener("resize", this._resizeLoadingUI);
  4318. this._loadingDiv.style.backgroundColor = this._loadingDivBackgroundColor;
  4319. document.body.appendChild(this._loadingDiv);
  4320. setTimeout(function () {
  4321. _this._loadingDiv.style.opacity = "1";
  4322. imgBack.style.transform = "rotateZ(360deg)";
  4323. imgBack.style.webkitTransform = "rotateZ(360deg)";
  4324. }, 0);
  4325. };
  4326. Object.defineProperty(Engine.prototype, "loadingUIText", {
  4327. set: function (text) {
  4328. if (!this._loadingDiv) {
  4329. return;
  4330. }
  4331. this._loadingTextDiv.innerHTML = text;
  4332. },
  4333. enumerable: true,
  4334. configurable: true
  4335. });
  4336. Object.defineProperty(Engine.prototype, "loadingUIBackgroundColor", {
  4337. get: function () {
  4338. return this._loadingDivBackgroundColor;
  4339. },
  4340. set: function (color) {
  4341. this._loadingDivBackgroundColor = color;
  4342. if (!this._loadingDiv) {
  4343. return;
  4344. }
  4345. this._loadingDiv.style.backgroundColor = this._loadingDivBackgroundColor;
  4346. },
  4347. enumerable: true,
  4348. configurable: true
  4349. });
  4350. Engine.prototype.hideLoadingUI = function () {
  4351. var _this = this;
  4352. if (!this._loadingDiv) {
  4353. return;
  4354. }
  4355. var onTransitionEnd = function () {
  4356. if (!_this._loadingDiv) {
  4357. return;
  4358. }
  4359. document.body.removeChild(_this._loadingDiv);
  4360. window.removeEventListener("resize", _this._resizeLoadingUI);
  4361. _this._loadingDiv = null;
  4362. };
  4363. this._loadingDiv.style.opacity = "0";
  4364. this._loadingDiv.addEventListener("transitionend", onTransitionEnd);
  4365. };
  4366. // FPS
  4367. Engine.prototype.getFps = function () {
  4368. return this.fps;
  4369. };
  4370. Engine.prototype.getDeltaTime = function () {
  4371. return this.deltaTime;
  4372. };
  4373. Engine.prototype._measureFps = function () {
  4374. this.previousFramesDuration.push(BABYLON.Tools.Now);
  4375. var length = this.previousFramesDuration.length;
  4376. if (length >= 2) {
  4377. this.deltaTime = this.previousFramesDuration[length - 1] - this.previousFramesDuration[length - 2];
  4378. }
  4379. if (length >= this.fpsRange) {
  4380. if (length > this.fpsRange) {
  4381. this.previousFramesDuration.splice(0, 1);
  4382. length = this.previousFramesDuration.length;
  4383. }
  4384. var sum = 0;
  4385. for (var id = 0; id < length - 1; id++) {
  4386. sum += this.previousFramesDuration[id + 1] - this.previousFramesDuration[id];
  4387. }
  4388. this.fps = 1000.0 / (sum / (length - 1));
  4389. }
  4390. };
  4391. // Statics
  4392. Engine.isSupported = function () {
  4393. try {
  4394. // Avoid creating an unsized context for CocoonJS, since size determined on first creation. Is not resizable
  4395. if (navigator.isCocoonJS) {
  4396. return true;
  4397. }
  4398. var tempcanvas = document.createElement("canvas");
  4399. var gl = tempcanvas.getContext("webgl") || tempcanvas.getContext("experimental-webgl");
  4400. return gl != null && !!window.WebGLRenderingContext;
  4401. } catch (e) {
  4402. return false;
  4403. }
  4404. };
  4405. Engine._ALPHA_DISABLE = 0;
  4406. Engine._ALPHA_ADD = 1;
  4407. Engine._ALPHA_COMBINE = 2;
  4408. Engine._DELAYLOADSTATE_NONE = 0;
  4409. Engine._DELAYLOADSTATE_LOADED = 1;
  4410. Engine._DELAYLOADSTATE_LOADING = 2;
  4411. Engine._DELAYLOADSTATE_NOTLOADED = 4;
  4412. Engine._TEXTUREFORMAT_ALPHA = 0;
  4413. Engine._TEXTUREFORMAT_LUMINANCE = 1;
  4414. Engine._TEXTUREFORMAT_LUMINANCE_ALPHA = 2;
  4415. Engine._TEXTUREFORMAT_RGB = 4;
  4416. Engine._TEXTUREFORMAT_RGBA = 4;
  4417. Engine.Epsilon = 0.001;
  4418. Engine.CollisionsEpsilon = 0.001;
  4419. Engine.ShadersRepository = "Babylon/Shaders/";
  4420. return Engine;
  4421. })();
  4422. BABYLON.Engine = Engine;
  4423. })(BABYLON || (BABYLON = {}));
  4424. //# sourceMappingURL=babylon.engine.js.map
  4425. var BABYLON;
  4426. (function (BABYLON) {
  4427. var Node = (function () {
  4428. function Node(name, scene) {
  4429. this.state = "";
  4430. this.animations = new Array();
  4431. this._childrenFlag = -1;
  4432. this._isEnabled = true;
  4433. this._isReady = true;
  4434. this._currentRenderId = -1;
  4435. this.name = name;
  4436. this.id = name;
  4437. this._scene = scene;
  4438. this._initCache();
  4439. }
  4440. Node.prototype.getScene = function () {
  4441. return this._scene;
  4442. };
  4443. Node.prototype.getEngine = function () {
  4444. return this._scene.getEngine();
  4445. };
  4446. // override it in derived class
  4447. Node.prototype.getWorldMatrix = function () {
  4448. return BABYLON.Matrix.Identity();
  4449. };
  4450. // override it in derived class if you add new variables to the cache
  4451. // and call the parent class method
  4452. Node.prototype._initCache = function () {
  4453. this._cache = {};
  4454. this._cache.parent = undefined;
  4455. };
  4456. Node.prototype.updateCache = function (force) {
  4457. if (!force && this.isSynchronized())
  4458. return;
  4459. this._cache.parent = this.parent;
  4460. this._updateCache();
  4461. };
  4462. // override it in derived class if you add new variables to the cache
  4463. // and call the parent class method if !ignoreParentClass
  4464. Node.prototype._updateCache = function (ignoreParentClass) {
  4465. };
  4466. // override it in derived class if you add new variables to the cache
  4467. Node.prototype._isSynchronized = function () {
  4468. return true;
  4469. };
  4470. Node.prototype.isSynchronizedWithParent = function () {
  4471. return this.parent ? this.parent._currentRenderId <= this._currentRenderId : true;
  4472. };
  4473. Node.prototype.isSynchronized = function (updateCache) {
  4474. var check = this.hasNewParent();
  4475. check = check || !this.isSynchronizedWithParent();
  4476. check = check || !this._isSynchronized();
  4477. if (updateCache)
  4478. this.updateCache(true);
  4479. return !check;
  4480. };
  4481. Node.prototype.hasNewParent = function (update) {
  4482. if (this._cache.parent === this.parent)
  4483. return false;
  4484. if (update)
  4485. this._cache.parent = this.parent;
  4486. return true;
  4487. };
  4488. Node.prototype.isReady = function () {
  4489. return this._isReady;
  4490. };
  4491. Node.prototype.isEnabled = function () {
  4492. if (!this._isEnabled) {
  4493. return false;
  4494. }
  4495. if (this.parent) {
  4496. return this.parent.isEnabled();
  4497. }
  4498. return true;
  4499. };
  4500. Node.prototype.setEnabled = function (value) {
  4501. this._isEnabled = value;
  4502. };
  4503. Node.prototype.isDescendantOf = function (ancestor) {
  4504. if (this.parent) {
  4505. if (this.parent === ancestor) {
  4506. return true;
  4507. }
  4508. return this.parent.isDescendantOf(ancestor);
  4509. }
  4510. return false;
  4511. };
  4512. Node.prototype._getDescendants = function (list, results) {
  4513. for (var index = 0; index < list.length; index++) {
  4514. var item = list[index];
  4515. if (item.isDescendantOf(this)) {
  4516. results.push(item);
  4517. }
  4518. }
  4519. };
  4520. Node.prototype.getDescendants = function () {
  4521. var results = [];
  4522. this._getDescendants(this._scene.meshes, results);
  4523. this._getDescendants(this._scene.lights, results);
  4524. this._getDescendants(this._scene.cameras, results);
  4525. return results;
  4526. };
  4527. Node.prototype._setReady = function (state) {
  4528. if (state == this._isReady) {
  4529. return;
  4530. }
  4531. if (!state) {
  4532. this._isReady = false;
  4533. return;
  4534. }
  4535. this._isReady = true;
  4536. if (this.onReady) {
  4537. this.onReady(this);
  4538. }
  4539. };
  4540. return Node;
  4541. })();
  4542. BABYLON.Node = Node;
  4543. })(BABYLON || (BABYLON = {}));
  4544. //# sourceMappingURL=babylon.node.js.map
  4545. var BABYLON;
  4546. (function (BABYLON) {
  4547. var BoundingSphere = (function () {
  4548. function BoundingSphere(minimum, maximum) {
  4549. this.minimum = minimum;
  4550. this.maximum = maximum;
  4551. this._tempRadiusVector = BABYLON.Vector3.Zero();
  4552. var distance = BABYLON.Vector3.Distance(minimum, maximum);
  4553. this.center = BABYLON.Vector3.Lerp(minimum, maximum, 0.5);
  4554. this.radius = distance * 0.5;
  4555. this.centerWorld = BABYLON.Vector3.Zero();
  4556. this._update(BABYLON.Matrix.Identity());
  4557. }
  4558. // Methods
  4559. BoundingSphere.prototype._update = function (world) {
  4560. BABYLON.Vector3.TransformCoordinatesToRef(this.center, world, this.centerWorld);
  4561. BABYLON.Vector3.TransformNormalFromFloatsToRef(1.0, 1.0, 1.0, world, this._tempRadiusVector);
  4562. this.radiusWorld = Math.max(Math.abs(this._tempRadiusVector.x), Math.abs(this._tempRadiusVector.y), Math.abs(this._tempRadiusVector.z)) * this.radius;
  4563. };
  4564. BoundingSphere.prototype.isInFrustum = function (frustumPlanes) {
  4565. for (var i = 0; i < 6; i++) {
  4566. if (frustumPlanes[i].dotCoordinate(this.centerWorld) <= -this.radiusWorld)
  4567. return false;
  4568. }
  4569. return true;
  4570. };
  4571. BoundingSphere.prototype.intersectsPoint = function (point) {
  4572. var x = this.centerWorld.x - point.x;
  4573. var y = this.centerWorld.y - point.y;
  4574. var z = this.centerWorld.z - point.z;
  4575. var distance = Math.sqrt((x * x) + (y * y) + (z * z));
  4576. if (Math.abs(this.radiusWorld - distance) < BABYLON.Engine.Epsilon)
  4577. return false;
  4578. return true;
  4579. };
  4580. // Statics
  4581. BoundingSphere.Intersects = function (sphere0, sphere1) {
  4582. var x = sphere0.centerWorld.x - sphere1.centerWorld.x;
  4583. var y = sphere0.centerWorld.y - sphere1.centerWorld.y;
  4584. var z = sphere0.centerWorld.z - sphere1.centerWorld.z;
  4585. var distance = Math.sqrt((x * x) + (y * y) + (z * z));
  4586. if (sphere0.radiusWorld + sphere1.radiusWorld < distance)
  4587. return false;
  4588. return true;
  4589. };
  4590. return BoundingSphere;
  4591. })();
  4592. BABYLON.BoundingSphere = BoundingSphere;
  4593. })(BABYLON || (BABYLON = {}));
  4594. //# sourceMappingURL=babylon.boundingSphere.js.map
  4595. var BABYLON;
  4596. (function (BABYLON) {
  4597. var BoundingBox = (function () {
  4598. function BoundingBox(minimum, maximum) {
  4599. this.minimum = minimum;
  4600. this.maximum = maximum;
  4601. this.vectors = new Array();
  4602. this.vectorsWorld = new Array();
  4603. // Bounding vectors
  4604. this.vectors.push(this.minimum.clone());
  4605. this.vectors.push(this.maximum.clone());
  4606. this.vectors.push(this.minimum.clone());
  4607. this.vectors[2].x = this.maximum.x;
  4608. this.vectors.push(this.minimum.clone());
  4609. this.vectors[3].y = this.maximum.y;
  4610. this.vectors.push(this.minimum.clone());
  4611. this.vectors[4].z = this.maximum.z;
  4612. this.vectors.push(this.maximum.clone());
  4613. this.vectors[5].z = this.minimum.z;
  4614. this.vectors.push(this.maximum.clone());
  4615. this.vectors[6].x = this.minimum.x;
  4616. this.vectors.push(this.maximum.clone());
  4617. this.vectors[7].y = this.minimum.y;
  4618. // OBB
  4619. this.center = this.maximum.add(this.minimum).scale(0.5);
  4620. this.extendSize = this.maximum.subtract(this.minimum).scale(0.5);
  4621. this.directions = [BABYLON.Vector3.Zero(), BABYLON.Vector3.Zero(), BABYLON.Vector3.Zero()];
  4622. for (var index = 0; index < this.vectors.length; index++) {
  4623. this.vectorsWorld[index] = BABYLON.Vector3.Zero();
  4624. }
  4625. this.minimumWorld = BABYLON.Vector3.Zero();
  4626. this.maximumWorld = BABYLON.Vector3.Zero();
  4627. this._update(BABYLON.Matrix.Identity());
  4628. }
  4629. // Methods
  4630. BoundingBox.prototype.getWorldMatrix = function () {
  4631. return this._worldMatrix;
  4632. };
  4633. BoundingBox.prototype._update = function (world) {
  4634. BABYLON.Vector3.FromFloatsToRef(Number.MAX_VALUE, Number.MAX_VALUE, Number.MAX_VALUE, this.minimumWorld);
  4635. BABYLON.Vector3.FromFloatsToRef(-Number.MAX_VALUE, -Number.MAX_VALUE, -Number.MAX_VALUE, this.maximumWorld);
  4636. for (var index = 0; index < this.vectors.length; index++) {
  4637. var v = this.vectorsWorld[index];
  4638. BABYLON.Vector3.TransformCoordinatesToRef(this.vectors[index], world, v);
  4639. if (v.x < this.minimumWorld.x)
  4640. this.minimumWorld.x = v.x;
  4641. if (v.y < this.minimumWorld.y)
  4642. this.minimumWorld.y = v.y;
  4643. if (v.z < this.minimumWorld.z)
  4644. this.minimumWorld.z = v.z;
  4645. if (v.x > this.maximumWorld.x)
  4646. this.maximumWorld.x = v.x;
  4647. if (v.y > this.maximumWorld.y)
  4648. this.maximumWorld.y = v.y;
  4649. if (v.z > this.maximumWorld.z)
  4650. this.maximumWorld.z = v.z;
  4651. }
  4652. // OBB
  4653. this.maximumWorld.addToRef(this.minimumWorld, this.center);
  4654. this.center.scaleInPlace(0.5);
  4655. BABYLON.Vector3.FromFloatArrayToRef(world.m, 0, this.directions[0]);
  4656. BABYLON.Vector3.FromFloatArrayToRef(world.m, 4, this.directions[1]);
  4657. BABYLON.Vector3.FromFloatArrayToRef(world.m, 8, this.directions[2]);
  4658. this._worldMatrix = world;
  4659. };
  4660. BoundingBox.prototype.isInFrustum = function (frustumPlanes) {
  4661. return BoundingBox.IsInFrustum(this.vectorsWorld, frustumPlanes);
  4662. };
  4663. BoundingBox.prototype.isCompletelyInFrustum = function (frustumPlanes) {
  4664. return BoundingBox.IsCompletelyInFrustum(this.vectorsWorld, frustumPlanes);
  4665. };
  4666. BoundingBox.prototype.intersectsPoint = function (point) {
  4667. var delta = BABYLON.Engine.Epsilon;
  4668. if (this.maximumWorld.x - point.x < delta || delta > point.x - this.minimumWorld.x)
  4669. return false;
  4670. if (this.maximumWorld.y - point.y < delta || delta > point.y - this.minimumWorld.y)
  4671. return false;
  4672. if (this.maximumWorld.z - point.z < delta || delta > point.z - this.minimumWorld.z)
  4673. return false;
  4674. return true;
  4675. };
  4676. BoundingBox.prototype.intersectsSphere = function (sphere) {
  4677. return BoundingBox.IntersectsSphere(this.minimumWorld, this.maximumWorld, sphere.centerWorld, sphere.radiusWorld);
  4678. };
  4679. BoundingBox.prototype.intersectsMinMax = function (min, max) {
  4680. if (this.maximumWorld.x < min.x || this.minimumWorld.x > max.x)
  4681. return false;
  4682. if (this.maximumWorld.y < min.y || this.minimumWorld.y > max.y)
  4683. return false;
  4684. if (this.maximumWorld.z < min.z || this.minimumWorld.z > max.z)
  4685. return false;
  4686. return true;
  4687. };
  4688. // Statics
  4689. BoundingBox.Intersects = function (box0, box1) {
  4690. if (box0.maximumWorld.x < box1.minimumWorld.x || box0.minimumWorld.x > box1.maximumWorld.x)
  4691. return false;
  4692. if (box0.maximumWorld.y < box1.minimumWorld.y || box0.minimumWorld.y > box1.maximumWorld.y)
  4693. return false;
  4694. if (box0.maximumWorld.z < box1.minimumWorld.z || box0.minimumWorld.z > box1.maximumWorld.z)
  4695. return false;
  4696. return true;
  4697. };
  4698. BoundingBox.IntersectsSphere = function (minPoint, maxPoint, sphereCenter, sphereRadius) {
  4699. var vector = BABYLON.Vector3.Clamp(sphereCenter, minPoint, maxPoint);
  4700. var num = BABYLON.Vector3.DistanceSquared(sphereCenter, vector);
  4701. return (num <= (sphereRadius * sphereRadius));
  4702. };
  4703. BoundingBox.IsCompletelyInFrustum = function (boundingVectors, frustumPlanes) {
  4704. for (var p = 0; p < 6; p++) {
  4705. for (var i = 0; i < 8; i++) {
  4706. if (frustumPlanes[p].dotCoordinate(boundingVectors[i]) < 0) {
  4707. return false;
  4708. }
  4709. }
  4710. }
  4711. return true;
  4712. };
  4713. BoundingBox.IsInFrustum = function (boundingVectors, frustumPlanes) {
  4714. for (var p = 0; p < 6; p++) {
  4715. var inCount = 8;
  4716. for (var i = 0; i < 8; i++) {
  4717. if (frustumPlanes[p].dotCoordinate(boundingVectors[i]) < 0) {
  4718. --inCount;
  4719. } else {
  4720. break;
  4721. }
  4722. }
  4723. if (inCount == 0)
  4724. return false;
  4725. }
  4726. return true;
  4727. };
  4728. return BoundingBox;
  4729. })();
  4730. BABYLON.BoundingBox = BoundingBox;
  4731. })(BABYLON || (BABYLON = {}));
  4732. //# sourceMappingURL=babylon.boundingBox.js.map
  4733. var BABYLON;
  4734. (function (BABYLON) {
  4735. var computeBoxExtents = function (axis, box) {
  4736. var p = BABYLON.Vector3.Dot(box.center, axis);
  4737. var r0 = Math.abs(BABYLON.Vector3.Dot(box.directions[0], axis)) * box.extendSize.x;
  4738. var r1 = Math.abs(BABYLON.Vector3.Dot(box.directions[1], axis)) * box.extendSize.y;
  4739. var r2 = Math.abs(BABYLON.Vector3.Dot(box.directions[2], axis)) * box.extendSize.z;
  4740. var r = r0 + r1 + r2;
  4741. return {
  4742. min: p - r,
  4743. max: p + r
  4744. };
  4745. };
  4746. var extentsOverlap = function (min0, max0, min1, max1) {
  4747. return !(min0 > max1 || min1 > max0);
  4748. };
  4749. var axisOverlap = function (axis, box0, box1) {
  4750. var result0 = computeBoxExtents(axis, box0);
  4751. var result1 = computeBoxExtents(axis, box1);
  4752. return extentsOverlap(result0.min, result0.max, result1.min, result1.max);
  4753. };
  4754. var BoundingInfo = (function () {
  4755. function BoundingInfo(minimum, maximum) {
  4756. this.minimum = minimum;
  4757. this.maximum = maximum;
  4758. this.boundingBox = new BABYLON.BoundingBox(minimum, maximum);
  4759. this.boundingSphere = new BABYLON.BoundingSphere(minimum, maximum);
  4760. }
  4761. // Methods
  4762. BoundingInfo.prototype._update = function (world) {
  4763. this.boundingBox._update(world);
  4764. this.boundingSphere._update(world);
  4765. };
  4766. BoundingInfo.prototype.isInFrustum = function (frustumPlanes) {
  4767. if (!this.boundingSphere.isInFrustum(frustumPlanes))
  4768. return false;
  4769. return this.boundingBox.isInFrustum(frustumPlanes);
  4770. };
  4771. BoundingInfo.prototype.isCompletelyInFrustum = function (frustumPlanes) {
  4772. return this.boundingBox.isCompletelyInFrustum(frustumPlanes);
  4773. };
  4774. BoundingInfo.prototype._checkCollision = function (collider) {
  4775. return collider._canDoCollision(this.boundingSphere.centerWorld, this.boundingSphere.radiusWorld, this.boundingBox.minimumWorld, this.boundingBox.maximumWorld);
  4776. };
  4777. BoundingInfo.prototype.intersectsPoint = function (point) {
  4778. if (!this.boundingSphere.centerWorld) {
  4779. return false;
  4780. }
  4781. if (!this.boundingSphere.intersectsPoint(point)) {
  4782. return false;
  4783. }
  4784. if (!this.boundingBox.intersectsPoint(point)) {
  4785. return false;
  4786. }
  4787. return true;
  4788. };
  4789. BoundingInfo.prototype.intersects = function (boundingInfo, precise) {
  4790. if (!this.boundingSphere.centerWorld || !boundingInfo.boundingSphere.centerWorld) {
  4791. return false;
  4792. }
  4793. if (!BABYLON.BoundingSphere.Intersects(this.boundingSphere, boundingInfo.boundingSphere)) {
  4794. return false;
  4795. }
  4796. if (!BABYLON.BoundingBox.Intersects(this.boundingBox, boundingInfo.boundingBox)) {
  4797. return false;
  4798. }
  4799. if (!precise) {
  4800. return true;
  4801. }
  4802. var box0 = this.boundingBox;
  4803. var box1 = boundingInfo.boundingBox;
  4804. if (!axisOverlap(box0.directions[0], box0, box1))
  4805. return false;
  4806. if (!axisOverlap(box0.directions[1], box0, box1))
  4807. return false;
  4808. if (!axisOverlap(box0.directions[2], box0, box1))
  4809. return false;
  4810. if (!axisOverlap(box1.directions[0], box0, box1))
  4811. return false;
  4812. if (!axisOverlap(box1.directions[1], box0, box1))
  4813. return false;
  4814. if (!axisOverlap(box1.directions[2], box0, box1))
  4815. return false;
  4816. if (!axisOverlap(BABYLON.Vector3.Cross(box0.directions[0], box1.directions[0]), box0, box1))
  4817. return false;
  4818. if (!axisOverlap(BABYLON.Vector3.Cross(box0.directions[0], box1.directions[1]), box0, box1))
  4819. return false;
  4820. if (!axisOverlap(BABYLON.Vector3.Cross(box0.directions[0], box1.directions[2]), box0, box1))
  4821. return false;
  4822. if (!axisOverlap(BABYLON.Vector3.Cross(box0.directions[1], box1.directions[0]), box0, box1))
  4823. return false;
  4824. if (!axisOverlap(BABYLON.Vector3.Cross(box0.directions[1], box1.directions[1]), box0, box1))
  4825. return false;
  4826. if (!axisOverlap(BABYLON.Vector3.Cross(box0.directions[1], box1.directions[2]), box0, box1))
  4827. return false;
  4828. if (!axisOverlap(BABYLON.Vector3.Cross(box0.directions[2], box1.directions[0]), box0, box1))
  4829. return false;
  4830. if (!axisOverlap(BABYLON.Vector3.Cross(box0.directions[2], box1.directions[1]), box0, box1))
  4831. return false;
  4832. if (!axisOverlap(BABYLON.Vector3.Cross(box0.directions[2], box1.directions[2]), box0, box1))
  4833. return false;
  4834. return true;
  4835. };
  4836. return BoundingInfo;
  4837. })();
  4838. BABYLON.BoundingInfo = BoundingInfo;
  4839. })(BABYLON || (BABYLON = {}));
  4840. //# sourceMappingURL=babylon.boundingInfo.js.map
  4841. var BABYLON;
  4842. (function (BABYLON) {
  4843. var Light = (function (_super) {
  4844. __extends(Light, _super);
  4845. function Light(name, scene) {
  4846. _super.call(this, name, scene);
  4847. this.diffuse = new BABYLON.Color3(1.0, 1.0, 1.0);
  4848. this.specular = new BABYLON.Color3(1.0, 1.0, 1.0);
  4849. this.intensity = 1.0;
  4850. this.range = Number.MAX_VALUE;
  4851. this.includedOnlyMeshes = new Array();
  4852. this.excludedMeshes = new Array();
  4853. this._excludedMeshesIds = new Array();
  4854. this._includedOnlyMeshesIds = new Array();
  4855. scene.lights.push(this);
  4856. }
  4857. Light.prototype.getShadowGenerator = function () {
  4858. return this._shadowGenerator;
  4859. };
  4860. Light.prototype.getAbsolutePosition = function () {
  4861. return BABYLON.Vector3.Zero();
  4862. };
  4863. Light.prototype.transferToEffect = function (effect, uniformName0, uniformName1) {
  4864. };
  4865. Light.prototype._getWorldMatrix = function () {
  4866. return BABYLON.Matrix.Identity();
  4867. };
  4868. Light.prototype.canAffectMesh = function (mesh) {
  4869. if (!mesh) {
  4870. return true;
  4871. }
  4872. if (this.includedOnlyMeshes.length > 0 && this.includedOnlyMeshes.indexOf(mesh) === -1) {
  4873. return false;
  4874. }
  4875. if (this.excludedMeshes.length > 0 && this.excludedMeshes.indexOf(mesh) !== -1) {
  4876. return false;
  4877. }
  4878. return true;
  4879. };
  4880. Light.prototype.getWorldMatrix = function () {
  4881. this._currentRenderId = this.getScene().getRenderId();
  4882. var worldMatrix = this._getWorldMatrix();
  4883. if (this.parent && this.parent.getWorldMatrix) {
  4884. if (!this._parentedWorldMatrix) {
  4885. this._parentedWorldMatrix = BABYLON.Matrix.Identity();
  4886. }
  4887. worldMatrix.multiplyToRef(this.parent.getWorldMatrix(), this._parentedWorldMatrix);
  4888. return this._parentedWorldMatrix;
  4889. }
  4890. return worldMatrix;
  4891. };
  4892. Light.prototype.dispose = function () {
  4893. if (this._shadowGenerator) {
  4894. this._shadowGenerator.dispose();
  4895. this._shadowGenerator = null;
  4896. }
  4897. // Remove from scene
  4898. var index = this.getScene().lights.indexOf(this);
  4899. this.getScene().lights.splice(index, 1);
  4900. };
  4901. return Light;
  4902. })(BABYLON.Node);
  4903. BABYLON.Light = Light;
  4904. })(BABYLON || (BABYLON = {}));
  4905. //# sourceMappingURL=babylon.light.js.map
  4906. var BABYLON;
  4907. (function (BABYLON) {
  4908. var PointLight = (function (_super) {
  4909. __extends(PointLight, _super);
  4910. function PointLight(name, position, scene) {
  4911. _super.call(this, name, scene);
  4912. this.position = position;
  4913. }
  4914. PointLight.prototype.getAbsolutePosition = function () {
  4915. return this._transformedPosition ? this._transformedPosition : this.position;
  4916. };
  4917. PointLight.prototype.transferToEffect = function (effect, positionUniformName) {
  4918. if (this.parent && this.parent.getWorldMatrix) {
  4919. if (!this._transformedPosition) {
  4920. this._transformedPosition = BABYLON.Vector3.Zero();
  4921. }
  4922. BABYLON.Vector3.TransformCoordinatesToRef(this.position, this.parent.getWorldMatrix(), this._transformedPosition);
  4923. effect.setFloat4(positionUniformName, this._transformedPosition.x, this._transformedPosition.y, this._transformedPosition.z, 0);
  4924. return;
  4925. }
  4926. effect.setFloat4(positionUniformName, this.position.x, this.position.y, this.position.z, 0);
  4927. };
  4928. PointLight.prototype.getShadowGenerator = function () {
  4929. return null;
  4930. };
  4931. PointLight.prototype._getWorldMatrix = function () {
  4932. if (!this._worldMatrix) {
  4933. this._worldMatrix = BABYLON.Matrix.Identity();
  4934. }
  4935. BABYLON.Matrix.TranslationToRef(this.position.x, this.position.y, this.position.z, this._worldMatrix);
  4936. return this._worldMatrix;
  4937. };
  4938. return PointLight;
  4939. })(BABYLON.Light);
  4940. BABYLON.PointLight = PointLight;
  4941. })(BABYLON || (BABYLON = {}));
  4942. //# sourceMappingURL=babylon.pointLight.js.map
  4943. var BABYLON;
  4944. (function (BABYLON) {
  4945. var SpotLight = (function (_super) {
  4946. __extends(SpotLight, _super);
  4947. function SpotLight(name, position, direction, angle, exponent, scene) {
  4948. _super.call(this, name, scene);
  4949. this.position = position;
  4950. this.direction = direction;
  4951. this.angle = angle;
  4952. this.exponent = exponent;
  4953. }
  4954. SpotLight.prototype.getAbsolutePosition = function () {
  4955. return this._transformedPosition ? this._transformedPosition : this.position;
  4956. };
  4957. SpotLight.prototype.setDirectionToTarget = function (target) {
  4958. this.direction = BABYLON.Vector3.Normalize(target.subtract(this.position));
  4959. return this.direction;
  4960. };
  4961. SpotLight.prototype.transferToEffect = function (effect, positionUniformName, directionUniformName) {
  4962. var normalizeDirection;
  4963. if (this.parent && this.parent.getWorldMatrix) {
  4964. if (!this._transformedDirection) {
  4965. this._transformedDirection = BABYLON.Vector3.Zero();
  4966. }
  4967. if (!this._transformedPosition) {
  4968. this._transformedPosition = BABYLON.Vector3.Zero();
  4969. }
  4970. var parentWorldMatrix = this.parent.getWorldMatrix();
  4971. BABYLON.Vector3.TransformCoordinatesToRef(this.position, parentWorldMatrix, this._transformedPosition);
  4972. BABYLON.Vector3.TransformNormalToRef(this.direction, parentWorldMatrix, this._transformedDirection);
  4973. effect.setFloat4(positionUniformName, this._transformedPosition.x, this._transformedPosition.y, this._transformedPosition.z, this.exponent);
  4974. normalizeDirection = BABYLON.Vector3.Normalize(this._transformedDirection);
  4975. } else {
  4976. effect.setFloat4(positionUniformName, this.position.x, this.position.y, this.position.z, this.exponent);
  4977. normalizeDirection = BABYLON.Vector3.Normalize(this.direction);
  4978. }
  4979. effect.setFloat4(directionUniformName, normalizeDirection.x, normalizeDirection.y, normalizeDirection.z, Math.cos(this.angle * 0.5));
  4980. };
  4981. SpotLight.prototype._getWorldMatrix = function () {
  4982. if (!this._worldMatrix) {
  4983. this._worldMatrix = BABYLON.Matrix.Identity();
  4984. }
  4985. BABYLON.Matrix.TranslationToRef(this.position.x, this.position.y, this.position.z, this._worldMatrix);
  4986. return this._worldMatrix;
  4987. };
  4988. return SpotLight;
  4989. })(BABYLON.Light);
  4990. BABYLON.SpotLight = SpotLight;
  4991. })(BABYLON || (BABYLON = {}));
  4992. //# sourceMappingURL=babylon.spotLight.js.map
  4993. var BABYLON;
  4994. (function (BABYLON) {
  4995. var DirectionalLight = (function (_super) {
  4996. __extends(DirectionalLight, _super);
  4997. function DirectionalLight(name, direction, scene) {
  4998. _super.call(this, name, scene);
  4999. this.direction = direction;
  5000. this.position = direction.scale(-1);
  5001. }
  5002. DirectionalLight.prototype.getAbsolutePosition = function () {
  5003. return this._transformedPosition ? this._transformedPosition : this.position;
  5004. };
  5005. DirectionalLight.prototype.setDirectionToTarget = function (target) {
  5006. this.direction = BABYLON.Vector3.Normalize(target.subtract(this.position));
  5007. return this.direction;
  5008. };
  5009. DirectionalLight.prototype._computeTransformedPosition = function () {
  5010. if (this.parent && this.parent.getWorldMatrix) {
  5011. if (!this._transformedPosition) {
  5012. this._transformedPosition = BABYLON.Vector3.Zero();
  5013. }
  5014. BABYLON.Vector3.TransformCoordinatesToRef(this.position, this.parent.getWorldMatrix(), this._transformedPosition);
  5015. return true;
  5016. }
  5017. return false;
  5018. };
  5019. DirectionalLight.prototype.transferToEffect = function (effect, directionUniformName) {
  5020. if (this.parent && this.parent.getWorldMatrix) {
  5021. if (!this._transformedDirection) {
  5022. this._transformedDirection = BABYLON.Vector3.Zero();
  5023. }
  5024. BABYLON.Vector3.TransformNormalToRef(this.direction, this.parent.getWorldMatrix(), this._transformedDirection);
  5025. effect.setFloat4(directionUniformName, this._transformedDirection.x, this._transformedDirection.y, this._transformedDirection.z, 1);
  5026. return;
  5027. }
  5028. effect.setFloat4(directionUniformName, this.direction.x, this.direction.y, this.direction.z, 1);
  5029. };
  5030. DirectionalLight.prototype._getWorldMatrix = function () {
  5031. if (!this._worldMatrix) {
  5032. this._worldMatrix = BABYLON.Matrix.Identity();
  5033. }
  5034. BABYLON.Matrix.TranslationToRef(this.position.x, this.position.y, this.position.z, this._worldMatrix);
  5035. return this._worldMatrix;
  5036. };
  5037. return DirectionalLight;
  5038. })(BABYLON.Light);
  5039. BABYLON.DirectionalLight = DirectionalLight;
  5040. })(BABYLON || (BABYLON = {}));
  5041. //# sourceMappingURL=babylon.directionalLight.js.map
  5042. var BABYLON;
  5043. (function (BABYLON) {
  5044. var ShadowGenerator = (function () {
  5045. function ShadowGenerator(mapSize, light) {
  5046. var _this = this;
  5047. // Members
  5048. this.filter = ShadowGenerator.FILTER_VARIANCESHADOWMAP;
  5049. this._darkness = 0;
  5050. this._transparencyShadow = false;
  5051. this._viewMatrix = BABYLON.Matrix.Zero();
  5052. this._projectionMatrix = BABYLON.Matrix.Zero();
  5053. this._transformMatrix = BABYLON.Matrix.Zero();
  5054. this._worldViewProjection = BABYLON.Matrix.Zero();
  5055. this._light = light;
  5056. this._scene = light.getScene();
  5057. light._shadowGenerator = this;
  5058. // Render target
  5059. this._shadowMap = new BABYLON.RenderTargetTexture(light.name + "_shadowMap", mapSize, this._scene, false);
  5060. this._shadowMap.wrapU = BABYLON.Texture.CLAMP_ADDRESSMODE;
  5061. this._shadowMap.wrapV = BABYLON.Texture.CLAMP_ADDRESSMODE;
  5062. this._shadowMap.renderParticles = false;
  5063. // Custom render function
  5064. var renderSubMesh = function (subMesh) {
  5065. var mesh = subMesh.getRenderingMesh();
  5066. var scene = _this._scene;
  5067. var engine = scene.getEngine();
  5068. // Culling
  5069. engine.setState(subMesh.getMaterial().backFaceCulling);
  5070. // Managing instances
  5071. var batch = mesh._getInstancesRenderList(subMesh._id);
  5072. if (batch.mustReturn) {
  5073. return;
  5074. }
  5075. var hardwareInstancedRendering = (engine.getCaps().instancedArrays !== null) && (batch.visibleInstances[subMesh._id] !== null);
  5076. if (_this.isReady(subMesh, hardwareInstancedRendering)) {
  5077. engine.enableEffect(_this._effect);
  5078. mesh._bind(subMesh, _this._effect, BABYLON.Material.TriangleFillMode);
  5079. var material = subMesh.getMaterial();
  5080. _this._effect.setMatrix("viewProjection", _this.getTransformMatrix());
  5081. // Alpha test
  5082. if (material && material.needAlphaTesting()) {
  5083. var alphaTexture = material.getAlphaTestTexture();
  5084. _this._effect.setTexture("diffuseSampler", alphaTexture);
  5085. _this._effect.setMatrix("diffuseMatrix", alphaTexture.getTextureMatrix());
  5086. }
  5087. // Bones
  5088. var useBones = mesh.skeleton && scene.skeletonsEnabled && mesh.isVerticesDataPresent(BABYLON.VertexBuffer.MatricesIndicesKind) && mesh.isVerticesDataPresent(BABYLON.VertexBuffer.MatricesWeightsKind);
  5089. if (useBones) {
  5090. _this._effect.setMatrices("mBones", mesh.skeleton.getTransformMatrices());
  5091. }
  5092. if (hardwareInstancedRendering) {
  5093. mesh._renderWithInstances(subMesh, BABYLON.Material.TriangleFillMode, batch, _this._effect, engine);
  5094. } else {
  5095. if (batch.renderSelf[subMesh._id]) {
  5096. _this._effect.setMatrix("world", mesh.getWorldMatrix());
  5097. // Draw
  5098. mesh._draw(subMesh, BABYLON.Material.TriangleFillMode);
  5099. }
  5100. if (batch.visibleInstances[subMesh._id]) {
  5101. for (var instanceIndex = 0; instanceIndex < batch.visibleInstances[subMesh._id].length; instanceIndex++) {
  5102. var instance = batch.visibleInstances[subMesh._id][instanceIndex];
  5103. _this._effect.setMatrix("world", instance.getWorldMatrix());
  5104. // Draw
  5105. mesh._draw(subMesh, BABYLON.Material.TriangleFillMode);
  5106. }
  5107. }
  5108. }
  5109. } else {
  5110. // Need to reset refresh rate of the shadowMap
  5111. _this._shadowMap.resetRefreshCounter();
  5112. }
  5113. };
  5114. this._shadowMap.customRenderFunction = function (opaqueSubMeshes, alphaTestSubMeshes, transparentSubMeshes) {
  5115. var index;
  5116. for (index = 0; index < opaqueSubMeshes.length; index++) {
  5117. renderSubMesh(opaqueSubMeshes.data[index]);
  5118. }
  5119. for (index = 0; index < alphaTestSubMeshes.length; index++) {
  5120. renderSubMesh(alphaTestSubMeshes.data[index]);
  5121. }
  5122. if (_this._transparencyShadow) {
  5123. for (index = 0; index < transparentSubMeshes.length; index++) {
  5124. renderSubMesh(transparentSubMeshes.data[index]);
  5125. }
  5126. }
  5127. };
  5128. }
  5129. Object.defineProperty(ShadowGenerator, "FILTER_NONE", {
  5130. // Static
  5131. get: function () {
  5132. return ShadowGenerator._FILTER_NONE;
  5133. },
  5134. enumerable: true,
  5135. configurable: true
  5136. });
  5137. Object.defineProperty(ShadowGenerator, "FILTER_VARIANCESHADOWMAP", {
  5138. get: function () {
  5139. return ShadowGenerator._FILTER_VARIANCESHADOWMAP;
  5140. },
  5141. enumerable: true,
  5142. configurable: true
  5143. });
  5144. Object.defineProperty(ShadowGenerator, "FILTER_POISSONSAMPLING", {
  5145. get: function () {
  5146. return ShadowGenerator._FILTER_POISSONSAMPLING;
  5147. },
  5148. enumerable: true,
  5149. configurable: true
  5150. });
  5151. Object.defineProperty(ShadowGenerator.prototype, "useVarianceShadowMap", {
  5152. get: function () {
  5153. return this.filter === ShadowGenerator.FILTER_VARIANCESHADOWMAP;
  5154. },
  5155. set: function (value) {
  5156. this.filter = (value ? ShadowGenerator.FILTER_VARIANCESHADOWMAP : ShadowGenerator.FILTER_NONE);
  5157. },
  5158. enumerable: true,
  5159. configurable: true
  5160. });
  5161. Object.defineProperty(ShadowGenerator.prototype, "usePoissonSampling", {
  5162. get: function () {
  5163. return this.filter === ShadowGenerator.FILTER_POISSONSAMPLING;
  5164. },
  5165. set: function (value) {
  5166. this.filter = (value ? ShadowGenerator.FILTER_POISSONSAMPLING : ShadowGenerator.FILTER_NONE);
  5167. },
  5168. enumerable: true,
  5169. configurable: true
  5170. });
  5171. ShadowGenerator.prototype.isReady = function (subMesh, useInstances) {
  5172. var defines = [];
  5173. if (this.useVarianceShadowMap) {
  5174. defines.push("#define VSM");
  5175. }
  5176. var attribs = [BABYLON.VertexBuffer.PositionKind];
  5177. var mesh = subMesh.getMesh();
  5178. var scene = mesh.getScene();
  5179. var material = subMesh.getMaterial();
  5180. // Alpha test
  5181. if (material && material.needAlphaTesting()) {
  5182. defines.push("#define ALPHATEST");
  5183. if (mesh.isVerticesDataPresent(BABYLON.VertexBuffer.UVKind)) {
  5184. attribs.push(BABYLON.VertexBuffer.UVKind);
  5185. defines.push("#define UV1");
  5186. }
  5187. if (mesh.isVerticesDataPresent(BABYLON.VertexBuffer.UV2Kind)) {
  5188. attribs.push(BABYLON.VertexBuffer.UV2Kind);
  5189. defines.push("#define UV2");
  5190. }
  5191. }
  5192. // Bones
  5193. if (mesh.skeleton && scene.skeletonsEnabled && mesh.isVerticesDataPresent(BABYLON.VertexBuffer.MatricesIndicesKind) && mesh.isVerticesDataPresent(BABYLON.VertexBuffer.MatricesWeightsKind)) {
  5194. attribs.push(BABYLON.VertexBuffer.MatricesIndicesKind);
  5195. attribs.push(BABYLON.VertexBuffer.MatricesWeightsKind);
  5196. defines.push("#define BONES");
  5197. defines.push("#define BonesPerMesh " + (mesh.skeleton.bones.length + 1));
  5198. }
  5199. // Instances
  5200. if (useInstances) {
  5201. defines.push("#define INSTANCES");
  5202. attribs.push("world0");
  5203. attribs.push("world1");
  5204. attribs.push("world2");
  5205. attribs.push("world3");
  5206. }
  5207. // Get correct effect
  5208. var join = defines.join("\n");
  5209. if (this._cachedDefines != join) {
  5210. this._cachedDefines = join;
  5211. this._effect = this._scene.getEngine().createEffect("shadowMap", attribs, ["world", "mBones", "viewProjection", "diffuseMatrix"], ["diffuseSampler"], join);
  5212. }
  5213. return this._effect.isReady();
  5214. };
  5215. ShadowGenerator.prototype.getShadowMap = function () {
  5216. return this._shadowMap;
  5217. };
  5218. ShadowGenerator.prototype.getLight = function () {
  5219. return this._light;
  5220. };
  5221. // Methods
  5222. ShadowGenerator.prototype.getTransformMatrix = function () {
  5223. var lightPosition = this._light.position;
  5224. var lightDirection = this._light.direction;
  5225. if (this._light._computeTransformedPosition()) {
  5226. lightPosition = this._light._transformedPosition;
  5227. }
  5228. if (!this._cachedPosition || !this._cachedDirection || !lightPosition.equals(this._cachedPosition) || !lightDirection.equals(this._cachedDirection)) {
  5229. this._cachedPosition = lightPosition.clone();
  5230. this._cachedDirection = lightDirection.clone();
  5231. var activeCamera = this._scene.activeCamera;
  5232. BABYLON.Matrix.LookAtLHToRef(lightPosition, this._light.position.add(lightDirection), BABYLON.Vector3.Up(), this._viewMatrix);
  5233. BABYLON.Matrix.PerspectiveFovLHToRef(Math.PI / 2.0, 1.0, activeCamera.minZ, activeCamera.maxZ, this._projectionMatrix);
  5234. this._viewMatrix.multiplyToRef(this._projectionMatrix, this._transformMatrix);
  5235. }
  5236. return this._transformMatrix;
  5237. };
  5238. ShadowGenerator.prototype.getDarkness = function () {
  5239. return this._darkness;
  5240. };
  5241. ShadowGenerator.prototype.setDarkness = function (darkness) {
  5242. if (darkness >= 1.0)
  5243. this._darkness = 1.0;
  5244. else if (darkness <= 0.0)
  5245. this._darkness = 0.0;
  5246. else
  5247. this._darkness = darkness;
  5248. };
  5249. ShadowGenerator.prototype.setTransparencyShadow = function (hasShadow) {
  5250. this._transparencyShadow = hasShadow;
  5251. };
  5252. ShadowGenerator.prototype.dispose = function () {
  5253. this._shadowMap.dispose();
  5254. };
  5255. ShadowGenerator._FILTER_NONE = 0;
  5256. ShadowGenerator._FILTER_VARIANCESHADOWMAP = 1;
  5257. ShadowGenerator._FILTER_POISSONSAMPLING = 2;
  5258. return ShadowGenerator;
  5259. })();
  5260. BABYLON.ShadowGenerator = ShadowGenerator;
  5261. })(BABYLON || (BABYLON = {}));
  5262. //# sourceMappingURL=babylon.shadowGenerator.js.map
  5263. var BABYLON;
  5264. (function (BABYLON) {
  5265. var HemisphericLight = (function (_super) {
  5266. __extends(HemisphericLight, _super);
  5267. function HemisphericLight(name, direction, scene) {
  5268. _super.call(this, name, scene);
  5269. this.direction = direction;
  5270. this.groundColor = new BABYLON.Color3(0.0, 0.0, 0.0);
  5271. }
  5272. HemisphericLight.prototype.setDirectionToTarget = function (target) {
  5273. this.direction = BABYLON.Vector3.Normalize(target.subtract(BABYLON.Vector3.Zero()));
  5274. return this.direction;
  5275. };
  5276. HemisphericLight.prototype.getShadowGenerator = function () {
  5277. return null;
  5278. };
  5279. HemisphericLight.prototype.transferToEffect = function (effect, directionUniformName, groundColorUniformName) {
  5280. var normalizeDirection = BABYLON.Vector3.Normalize(this.direction);
  5281. effect.setFloat4(directionUniformName, normalizeDirection.x, normalizeDirection.y, normalizeDirection.z, 0);
  5282. effect.setColor3(groundColorUniformName, this.groundColor.scale(this.intensity));
  5283. };
  5284. HemisphericLight.prototype._getWorldMatrix = function () {
  5285. if (!this._worldMatrix) {
  5286. this._worldMatrix = BABYLON.Matrix.Identity();
  5287. }
  5288. return this._worldMatrix;
  5289. };
  5290. return HemisphericLight;
  5291. })(BABYLON.Light);
  5292. BABYLON.HemisphericLight = HemisphericLight;
  5293. })(BABYLON || (BABYLON = {}));
  5294. //# sourceMappingURL=babylon.hemisphericLight.js.map
  5295. var BABYLON;
  5296. (function (BABYLON) {
  5297. var intersectBoxAASphere = function (boxMin, boxMax, sphereCenter, sphereRadius) {
  5298. if (boxMin.x > sphereCenter.x + sphereRadius)
  5299. return false;
  5300. if (sphereCenter.x - sphereRadius > boxMax.x)
  5301. return false;
  5302. if (boxMin.y > sphereCenter.y + sphereRadius)
  5303. return false;
  5304. if (sphereCenter.y - sphereRadius > boxMax.y)
  5305. return false;
  5306. if (boxMin.z > sphereCenter.z + sphereRadius)
  5307. return false;
  5308. if (sphereCenter.z - sphereRadius > boxMax.z)
  5309. return false;
  5310. return true;
  5311. };
  5312. var getLowestRoot = function (a, b, c, maxR) {
  5313. var determinant = b * b - 4.0 * a * c;
  5314. var result = { root: 0, found: false };
  5315. if (determinant < 0)
  5316. return result;
  5317. var sqrtD = Math.sqrt(determinant);
  5318. var r1 = (-b - sqrtD) / (2.0 * a);
  5319. var r2 = (-b + sqrtD) / (2.0 * a);
  5320. if (r1 > r2) {
  5321. var temp = r2;
  5322. r2 = r1;
  5323. r1 = temp;
  5324. }
  5325. if (r1 > 0 && r1 < maxR) {
  5326. result.root = r1;
  5327. result.found = true;
  5328. return result;
  5329. }
  5330. if (r2 > 0 && r2 < maxR) {
  5331. result.root = r2;
  5332. result.found = true;
  5333. return result;
  5334. }
  5335. return result;
  5336. };
  5337. var Collider = (function () {
  5338. function Collider() {
  5339. this.radius = new BABYLON.Vector3(1, 1, 1);
  5340. this.retry = 0;
  5341. this.basePointWorld = BABYLON.Vector3.Zero();
  5342. this.velocityWorld = BABYLON.Vector3.Zero();
  5343. this.normalizedVelocity = BABYLON.Vector3.Zero();
  5344. this._collisionPoint = BABYLON.Vector3.Zero();
  5345. this._planeIntersectionPoint = BABYLON.Vector3.Zero();
  5346. this._tempVector = BABYLON.Vector3.Zero();
  5347. this._tempVector2 = BABYLON.Vector3.Zero();
  5348. this._tempVector3 = BABYLON.Vector3.Zero();
  5349. this._tempVector4 = BABYLON.Vector3.Zero();
  5350. this._edge = BABYLON.Vector3.Zero();
  5351. this._baseToVertex = BABYLON.Vector3.Zero();
  5352. this._destinationPoint = BABYLON.Vector3.Zero();
  5353. this._slidePlaneNormal = BABYLON.Vector3.Zero();
  5354. this._displacementVector = BABYLON.Vector3.Zero();
  5355. }
  5356. // Methods
  5357. Collider.prototype._initialize = function (source, dir, e) {
  5358. this.velocity = dir;
  5359. BABYLON.Vector3.NormalizeToRef(dir, this.normalizedVelocity);
  5360. this.basePoint = source;
  5361. source.multiplyToRef(this.radius, this.basePointWorld);
  5362. dir.multiplyToRef(this.radius, this.velocityWorld);
  5363. this.velocityWorldLength = this.velocityWorld.length();
  5364. this.epsilon = e;
  5365. this.collisionFound = false;
  5366. };
  5367. Collider.prototype._checkPointInTriangle = function (point, pa, pb, pc, n) {
  5368. pa.subtractToRef(point, this._tempVector);
  5369. pb.subtractToRef(point, this._tempVector2);
  5370. BABYLON.Vector3.CrossToRef(this._tempVector, this._tempVector2, this._tempVector4);
  5371. var d = BABYLON.Vector3.Dot(this._tempVector4, n);
  5372. if (d < 0)
  5373. return false;
  5374. pc.subtractToRef(point, this._tempVector3);
  5375. BABYLON.Vector3.CrossToRef(this._tempVector2, this._tempVector3, this._tempVector4);
  5376. d = BABYLON.Vector3.Dot(this._tempVector4, n);
  5377. if (d < 0)
  5378. return false;
  5379. BABYLON.Vector3.CrossToRef(this._tempVector3, this._tempVector, this._tempVector4);
  5380. d = BABYLON.Vector3.Dot(this._tempVector4, n);
  5381. return d >= 0;
  5382. };
  5383. Collider.prototype._canDoCollision = function (sphereCenter, sphereRadius, vecMin, vecMax) {
  5384. var distance = BABYLON.Vector3.Distance(this.basePointWorld, sphereCenter);
  5385. var max = Math.max(this.radius.x, this.radius.y, this.radius.z);
  5386. if (distance > this.velocityWorldLength + max + sphereRadius) {
  5387. return false;
  5388. }
  5389. if (!intersectBoxAASphere(vecMin, vecMax, this.basePointWorld, this.velocityWorldLength + max))
  5390. return false;
  5391. return true;
  5392. };
  5393. Collider.prototype._testTriangle = function (faceIndex, subMesh, p1, p2, p3) {
  5394. var t0;
  5395. var embeddedInPlane = false;
  5396. if (!subMesh._trianglePlanes) {
  5397. subMesh._trianglePlanes = [];
  5398. }
  5399. if (!subMesh._trianglePlanes[faceIndex]) {
  5400. subMesh._trianglePlanes[faceIndex] = new BABYLON.Plane(0, 0, 0, 0);
  5401. subMesh._trianglePlanes[faceIndex].copyFromPoints(p1, p2, p3);
  5402. }
  5403. var trianglePlane = subMesh._trianglePlanes[faceIndex];
  5404. if ((!subMesh.getMaterial()) && !trianglePlane.isFrontFacingTo(this.normalizedVelocity, 0))
  5405. return;
  5406. var signedDistToTrianglePlane = trianglePlane.signedDistanceTo(this.basePoint);
  5407. var normalDotVelocity = BABYLON.Vector3.Dot(trianglePlane.normal, this.velocity);
  5408. if (normalDotVelocity == 0) {
  5409. if (Math.abs(signedDistToTrianglePlane) >= 1.0)
  5410. return;
  5411. embeddedInPlane = true;
  5412. t0 = 0;
  5413. } else {
  5414. t0 = (-1.0 - signedDistToTrianglePlane) / normalDotVelocity;
  5415. var t1 = (1.0 - signedDistToTrianglePlane) / normalDotVelocity;
  5416. if (t0 > t1) {
  5417. var temp = t1;
  5418. t1 = t0;
  5419. t0 = temp;
  5420. }
  5421. if (t0 > 1.0 || t1 < 0.0)
  5422. return;
  5423. if (t0 < 0)
  5424. t0 = 0;
  5425. if (t0 > 1.0)
  5426. t0 = 1.0;
  5427. }
  5428. this._collisionPoint.copyFromFloats(0, 0, 0);
  5429. var found = false;
  5430. var t = 1.0;
  5431. if (!embeddedInPlane) {
  5432. this.basePoint.subtractToRef(trianglePlane.normal, this._planeIntersectionPoint);
  5433. this.velocity.scaleToRef(t0, this._tempVector);
  5434. this._planeIntersectionPoint.addInPlace(this._tempVector);
  5435. if (this._checkPointInTriangle(this._planeIntersectionPoint, p1, p2, p3, trianglePlane.normal)) {
  5436. found = true;
  5437. t = t0;
  5438. this._collisionPoint.copyFrom(this._planeIntersectionPoint);
  5439. }
  5440. }
  5441. if (!found) {
  5442. var velocitySquaredLength = this.velocity.lengthSquared();
  5443. var a = velocitySquaredLength;
  5444. this.basePoint.subtractToRef(p1, this._tempVector);
  5445. var b = 2.0 * (BABYLON.Vector3.Dot(this.velocity, this._tempVector));
  5446. var c = this._tempVector.lengthSquared() - 1.0;
  5447. var lowestRoot = getLowestRoot(a, b, c, t);
  5448. if (lowestRoot.found) {
  5449. t = lowestRoot.root;
  5450. found = true;
  5451. this._collisionPoint.copyFrom(p1);
  5452. }
  5453. this.basePoint.subtractToRef(p2, this._tempVector);
  5454. b = 2.0 * (BABYLON.Vector3.Dot(this.velocity, this._tempVector));
  5455. c = this._tempVector.lengthSquared() - 1.0;
  5456. lowestRoot = getLowestRoot(a, b, c, t);
  5457. if (lowestRoot.found) {
  5458. t = lowestRoot.root;
  5459. found = true;
  5460. this._collisionPoint.copyFrom(p2);
  5461. }
  5462. this.basePoint.subtractToRef(p3, this._tempVector);
  5463. b = 2.0 * (BABYLON.Vector3.Dot(this.velocity, this._tempVector));
  5464. c = this._tempVector.lengthSquared() - 1.0;
  5465. lowestRoot = getLowestRoot(a, b, c, t);
  5466. if (lowestRoot.found) {
  5467. t = lowestRoot.root;
  5468. found = true;
  5469. this._collisionPoint.copyFrom(p3);
  5470. }
  5471. p2.subtractToRef(p1, this._edge);
  5472. p1.subtractToRef(this.basePoint, this._baseToVertex);
  5473. var edgeSquaredLength = this._edge.lengthSquared();
  5474. var edgeDotVelocity = BABYLON.Vector3.Dot(this._edge, this.velocity);
  5475. var edgeDotBaseToVertex = BABYLON.Vector3.Dot(this._edge, this._baseToVertex);
  5476. a = edgeSquaredLength * (-velocitySquaredLength) + edgeDotVelocity * edgeDotVelocity;
  5477. b = edgeSquaredLength * (2.0 * BABYLON.Vector3.Dot(this.velocity, this._baseToVertex)) - 2.0 * edgeDotVelocity * edgeDotBaseToVertex;
  5478. c = edgeSquaredLength * (1.0 - this._baseToVertex.lengthSquared()) + edgeDotBaseToVertex * edgeDotBaseToVertex;
  5479. lowestRoot = getLowestRoot(a, b, c, t);
  5480. if (lowestRoot.found) {
  5481. var f = (edgeDotVelocity * lowestRoot.root - edgeDotBaseToVertex) / edgeSquaredLength;
  5482. if (f >= 0.0 && f <= 1.0) {
  5483. t = lowestRoot.root;
  5484. found = true;
  5485. this._edge.scaleInPlace(f);
  5486. p1.addToRef(this._edge, this._collisionPoint);
  5487. }
  5488. }
  5489. p3.subtractToRef(p2, this._edge);
  5490. p2.subtractToRef(this.basePoint, this._baseToVertex);
  5491. edgeSquaredLength = this._edge.lengthSquared();
  5492. edgeDotVelocity = BABYLON.Vector3.Dot(this._edge, this.velocity);
  5493. edgeDotBaseToVertex = BABYLON.Vector3.Dot(this._edge, this._baseToVertex);
  5494. a = edgeSquaredLength * (-velocitySquaredLength) + edgeDotVelocity * edgeDotVelocity;
  5495. b = edgeSquaredLength * (2.0 * BABYLON.Vector3.Dot(this.velocity, this._baseToVertex)) - 2.0 * edgeDotVelocity * edgeDotBaseToVertex;
  5496. c = edgeSquaredLength * (1.0 - this._baseToVertex.lengthSquared()) + edgeDotBaseToVertex * edgeDotBaseToVertex;
  5497. lowestRoot = getLowestRoot(a, b, c, t);
  5498. if (lowestRoot.found) {
  5499. f = (edgeDotVelocity * lowestRoot.root - edgeDotBaseToVertex) / edgeSquaredLength;
  5500. if (f >= 0.0 && f <= 1.0) {
  5501. t = lowestRoot.root;
  5502. found = true;
  5503. this._edge.scaleInPlace(f);
  5504. p2.addToRef(this._edge, this._collisionPoint);
  5505. }
  5506. }
  5507. p1.subtractToRef(p3, this._edge);
  5508. p3.subtractToRef(this.basePoint, this._baseToVertex);
  5509. edgeSquaredLength = this._edge.lengthSquared();
  5510. edgeDotVelocity = BABYLON.Vector3.Dot(this._edge, this.velocity);
  5511. edgeDotBaseToVertex = BABYLON.Vector3.Dot(this._edge, this._baseToVertex);
  5512. a = edgeSquaredLength * (-velocitySquaredLength) + edgeDotVelocity * edgeDotVelocity;
  5513. b = edgeSquaredLength * (2.0 * BABYLON.Vector3.Dot(this.velocity, this._baseToVertex)) - 2.0 * edgeDotVelocity * edgeDotBaseToVertex;
  5514. c = edgeSquaredLength * (1.0 - this._baseToVertex.lengthSquared()) + edgeDotBaseToVertex * edgeDotBaseToVertex;
  5515. lowestRoot = getLowestRoot(a, b, c, t);
  5516. if (lowestRoot.found) {
  5517. f = (edgeDotVelocity * lowestRoot.root - edgeDotBaseToVertex) / edgeSquaredLength;
  5518. if (f >= 0.0 && f <= 1.0) {
  5519. t = lowestRoot.root;
  5520. found = true;
  5521. this._edge.scaleInPlace(f);
  5522. p3.addToRef(this._edge, this._collisionPoint);
  5523. }
  5524. }
  5525. }
  5526. if (found) {
  5527. var distToCollision = t * this.velocity.length();
  5528. if (!this.collisionFound || distToCollision < this.nearestDistance) {
  5529. if (!this.intersectionPoint) {
  5530. this.intersectionPoint = this._collisionPoint.clone();
  5531. } else {
  5532. this.intersectionPoint.copyFrom(this._collisionPoint);
  5533. }
  5534. this.nearestDistance = distToCollision;
  5535. this.collisionFound = true;
  5536. this.collidedMesh = subMesh.getMesh();
  5537. }
  5538. }
  5539. };
  5540. Collider.prototype._collide = function (subMesh, pts, indices, indexStart, indexEnd, decal) {
  5541. for (var i = indexStart; i < indexEnd; i += 3) {
  5542. var p1 = pts[indices[i] - decal];
  5543. var p2 = pts[indices[i + 1] - decal];
  5544. var p3 = pts[indices[i + 2] - decal];
  5545. this._testTriangle(i, subMesh, p3, p2, p1);
  5546. }
  5547. };
  5548. Collider.prototype._getResponse = function (pos, vel) {
  5549. pos.addToRef(vel, this._destinationPoint);
  5550. vel.scaleInPlace((this.nearestDistance / vel.length()));
  5551. this.basePoint.addToRef(vel, pos);
  5552. pos.subtractToRef(this.intersectionPoint, this._slidePlaneNormal);
  5553. this._slidePlaneNormal.normalize();
  5554. this._slidePlaneNormal.scaleToRef(this.epsilon, this._displacementVector);
  5555. pos.addInPlace(this._displacementVector);
  5556. this.intersectionPoint.addInPlace(this._displacementVector);
  5557. this._slidePlaneNormal.scaleInPlace(BABYLON.Plane.SignedDistanceToPlaneFromPositionAndNormal(this.intersectionPoint, this._slidePlaneNormal, this._destinationPoint));
  5558. this._destinationPoint.subtractInPlace(this._slidePlaneNormal);
  5559. this._destinationPoint.subtractToRef(this.intersectionPoint, vel);
  5560. };
  5561. return Collider;
  5562. })();
  5563. BABYLON.Collider = Collider;
  5564. })(BABYLON || (BABYLON = {}));
  5565. //# sourceMappingURL=babylon.collider.js.map
  5566. var BABYLON;
  5567. (function (BABYLON) {
  5568. var Camera = (function (_super) {
  5569. __extends(Camera, _super);
  5570. function Camera(name, position, scene) {
  5571. _super.call(this, name, scene);
  5572. this.position = position;
  5573. // Members
  5574. this.upVector = BABYLON.Vector3.Up();
  5575. this.orthoLeft = null;
  5576. this.orthoRight = null;
  5577. this.orthoBottom = null;
  5578. this.orthoTop = null;
  5579. this.fov = 0.8;
  5580. this.minZ = 1.0;
  5581. this.maxZ = 10000.0;
  5582. this.inertia = 0.9;
  5583. this.mode = Camera.PERSPECTIVE_CAMERA;
  5584. this.isIntermediate = false;
  5585. this.viewport = new BABYLON.Viewport(0, 0, 1.0, 1.0);
  5586. this.subCameras = [];
  5587. this.layerMask = 0xFFFFFFFF;
  5588. this._computedViewMatrix = BABYLON.Matrix.Identity();
  5589. this._projectionMatrix = new BABYLON.Matrix();
  5590. this._postProcesses = new Array();
  5591. this._postProcessesTakenIndices = [];
  5592. scene.cameras.push(this);
  5593. if (!scene.activeCamera) {
  5594. scene.activeCamera = this;
  5595. }
  5596. }
  5597. //Cache
  5598. Camera.prototype._initCache = function () {
  5599. _super.prototype._initCache.call(this);
  5600. this._cache.position = new BABYLON.Vector3(Number.MAX_VALUE, Number.MAX_VALUE, Number.MAX_VALUE);
  5601. this._cache.upVector = new BABYLON.Vector3(Number.MAX_VALUE, Number.MAX_VALUE, Number.MAX_VALUE);
  5602. this._cache.mode = undefined;
  5603. this._cache.minZ = undefined;
  5604. this._cache.maxZ = undefined;
  5605. this._cache.fov = undefined;
  5606. this._cache.aspectRatio = undefined;
  5607. this._cache.orthoLeft = undefined;
  5608. this._cache.orthoRight = undefined;
  5609. this._cache.orthoBottom = undefined;
  5610. this._cache.orthoTop = undefined;
  5611. this._cache.renderWidth = undefined;
  5612. this._cache.renderHeight = undefined;
  5613. };
  5614. Camera.prototype._updateCache = function (ignoreParentClass) {
  5615. if (!ignoreParentClass) {
  5616. _super.prototype._updateCache.call(this);
  5617. }
  5618. var engine = this.getEngine();
  5619. this._cache.position.copyFrom(this.position);
  5620. this._cache.upVector.copyFrom(this.upVector);
  5621. this._cache.mode = this.mode;
  5622. this._cache.minZ = this.minZ;
  5623. this._cache.maxZ = this.maxZ;
  5624. this._cache.fov = this.fov;
  5625. this._cache.aspectRatio = engine.getAspectRatio(this);
  5626. this._cache.orthoLeft = this.orthoLeft;
  5627. this._cache.orthoRight = this.orthoRight;
  5628. this._cache.orthoBottom = this.orthoBottom;
  5629. this._cache.orthoTop = this.orthoTop;
  5630. this._cache.renderWidth = engine.getRenderWidth();
  5631. this._cache.renderHeight = engine.getRenderHeight();
  5632. };
  5633. Camera.prototype._updateFromScene = function () {
  5634. this.updateCache();
  5635. this._update();
  5636. };
  5637. // Synchronized
  5638. Camera.prototype._isSynchronized = function () {
  5639. return this._isSynchronizedViewMatrix() && this._isSynchronizedProjectionMatrix();
  5640. };
  5641. Camera.prototype._isSynchronizedViewMatrix = function () {
  5642. if (!_super.prototype._isSynchronized.call(this))
  5643. return false;
  5644. return this._cache.position.equals(this.position) && this._cache.upVector.equals(this.upVector) && this.isSynchronizedWithParent();
  5645. };
  5646. Camera.prototype._isSynchronizedProjectionMatrix = function () {
  5647. var check = this._cache.mode === this.mode && this._cache.minZ === this.minZ && this._cache.maxZ === this.maxZ;
  5648. if (!check) {
  5649. return false;
  5650. }
  5651. var engine = this.getEngine();
  5652. if (this.mode === BABYLON.Camera.PERSPECTIVE_CAMERA) {
  5653. check = this._cache.fov === this.fov && this._cache.aspectRatio === engine.getAspectRatio(this);
  5654. } else {
  5655. check = this._cache.orthoLeft === this.orthoLeft && this._cache.orthoRight === this.orthoRight && this._cache.orthoBottom === this.orthoBottom && this._cache.orthoTop === this.orthoTop && this._cache.renderWidth === engine.getRenderWidth() && this._cache.renderHeight === engine.getRenderHeight();
  5656. }
  5657. return check;
  5658. };
  5659. // Controls
  5660. Camera.prototype.attachControl = function (element) {
  5661. };
  5662. Camera.prototype.detachControl = function (element) {
  5663. };
  5664. Camera.prototype._update = function () {
  5665. };
  5666. Camera.prototype.attachPostProcess = function (postProcess, insertAt) {
  5667. if (typeof insertAt === "undefined") { insertAt = null; }
  5668. if (!postProcess.isReusable() && this._postProcesses.indexOf(postProcess) > -1) {
  5669. BABYLON.Tools.Error("You're trying to reuse a post process not defined as reusable.");
  5670. return 0;
  5671. }
  5672. if (insertAt == null || insertAt < 0) {
  5673. this._postProcesses.push(postProcess);
  5674. this._postProcessesTakenIndices.push(this._postProcesses.length - 1);
  5675. return this._postProcesses.length - 1;
  5676. }
  5677. var add = 0;
  5678. if (this._postProcesses[insertAt]) {
  5679. var start = this._postProcesses.length - 1;
  5680. for (var i = start; i >= insertAt + 1; --i) {
  5681. this._postProcesses[i + 1] = this._postProcesses[i];
  5682. }
  5683. add = 1;
  5684. }
  5685. for (i = 0; i < this._postProcessesTakenIndices.length; ++i) {
  5686. if (this._postProcessesTakenIndices[i] < insertAt) {
  5687. continue;
  5688. }
  5689. start = this._postProcessesTakenIndices.length - 1;
  5690. for (var j = start; j >= i; --j) {
  5691. this._postProcessesTakenIndices[j + 1] = this._postProcessesTakenIndices[j] + add;
  5692. }
  5693. this._postProcessesTakenIndices[i] = insertAt;
  5694. break;
  5695. }
  5696. if (!add && this._postProcessesTakenIndices.indexOf(insertAt) == -1) {
  5697. this._postProcessesTakenIndices.push(insertAt);
  5698. }
  5699. var result = insertAt + add;
  5700. this._postProcesses[result] = postProcess;
  5701. return result;
  5702. };
  5703. Camera.prototype.detachPostProcess = function (postProcess, atIndices) {
  5704. if (typeof atIndices === "undefined") { atIndices = null; }
  5705. var result = [];
  5706. if (!atIndices) {
  5707. var length = this._postProcesses.length;
  5708. for (var i = 0; i < length; i++) {
  5709. if (this._postProcesses[i] !== postProcess) {
  5710. continue;
  5711. }
  5712. delete this._postProcesses[i];
  5713. var index = this._postProcessesTakenIndices.indexOf(i);
  5714. this._postProcessesTakenIndices.splice(index, 1);
  5715. }
  5716. } else {
  5717. atIndices = (atIndices instanceof Array) ? atIndices : [atIndices];
  5718. for (i = 0; i < atIndices.length; i++) {
  5719. var foundPostProcess = this._postProcesses[atIndices[i]];
  5720. if (foundPostProcess !== postProcess) {
  5721. result.push(i);
  5722. continue;
  5723. }
  5724. delete this._postProcesses[atIndices[i]];
  5725. index = this._postProcessesTakenIndices.indexOf(atIndices[i]);
  5726. this._postProcessesTakenIndices.splice(index, 1);
  5727. }
  5728. }
  5729. return result;
  5730. };
  5731. Camera.prototype.getWorldMatrix = function () {
  5732. if (!this._worldMatrix) {
  5733. this._worldMatrix = BABYLON.Matrix.Identity();
  5734. }
  5735. var viewMatrix = this.getViewMatrix();
  5736. viewMatrix.invertToRef(this._worldMatrix);
  5737. return this._worldMatrix;
  5738. };
  5739. Camera.prototype._getViewMatrix = function () {
  5740. return BABYLON.Matrix.Identity();
  5741. };
  5742. Camera.prototype.getViewMatrix = function () {
  5743. this._computedViewMatrix = this._computeViewMatrix();
  5744. if (!this.parent || !this.parent.getWorldMatrix || this.isSynchronized()) {
  5745. return this._computedViewMatrix;
  5746. }
  5747. if (!this._worldMatrix) {
  5748. this._worldMatrix = BABYLON.Matrix.Identity();
  5749. }
  5750. this._computedViewMatrix.invertToRef(this._worldMatrix);
  5751. this._worldMatrix.multiplyToRef(this.parent.getWorldMatrix(), this._computedViewMatrix);
  5752. this._computedViewMatrix.invert();
  5753. this._currentRenderId = this.getScene().getRenderId();
  5754. return this._computedViewMatrix;
  5755. };
  5756. Camera.prototype._computeViewMatrix = function (force) {
  5757. if (!force && this._isSynchronizedViewMatrix()) {
  5758. return this._computedViewMatrix;
  5759. }
  5760. this._computedViewMatrix = this._getViewMatrix();
  5761. if (!this.parent || !this.parent.getWorldMatrix) {
  5762. this._currentRenderId = this.getScene().getRenderId();
  5763. }
  5764. return this._computedViewMatrix;
  5765. };
  5766. Camera.prototype.getProjectionMatrix = function (force) {
  5767. if (!force && this._isSynchronizedProjectionMatrix()) {
  5768. return this._projectionMatrix;
  5769. }
  5770. var engine = this.getEngine();
  5771. if (this.mode === BABYLON.Camera.PERSPECTIVE_CAMERA) {
  5772. if (this.minZ <= 0) {
  5773. this.minZ = 0.1;
  5774. }
  5775. BABYLON.Matrix.PerspectiveFovLHToRef(this.fov, engine.getAspectRatio(this), this.minZ, this.maxZ, this._projectionMatrix);
  5776. return this._projectionMatrix;
  5777. }
  5778. var halfWidth = engine.getRenderWidth() / 2.0;
  5779. var halfHeight = engine.getRenderHeight() / 2.0;
  5780. BABYLON.Matrix.OrthoOffCenterLHToRef(this.orthoLeft || -halfWidth, this.orthoRight || halfWidth, this.orthoBottom || -halfHeight, this.orthoTop || halfHeight, this.minZ, this.maxZ, this._projectionMatrix);
  5781. return this._projectionMatrix;
  5782. };
  5783. Camera.prototype.dispose = function () {
  5784. // Remove from scene
  5785. var index = this.getScene().cameras.indexOf(this);
  5786. this.getScene().cameras.splice(index, 1);
  5787. for (var i = 0; i < this._postProcessesTakenIndices.length; ++i) {
  5788. this._postProcesses[this._postProcessesTakenIndices[i]].dispose(this);
  5789. }
  5790. };
  5791. Camera.PERSPECTIVE_CAMERA = 0;
  5792. Camera.ORTHOGRAPHIC_CAMERA = 1;
  5793. return Camera;
  5794. })(BABYLON.Node);
  5795. BABYLON.Camera = Camera;
  5796. })(BABYLON || (BABYLON = {}));
  5797. //# sourceMappingURL=babylon.camera.js.map
  5798. var BABYLON;
  5799. (function (BABYLON) {
  5800. var TargetCamera = (function (_super) {
  5801. __extends(TargetCamera, _super);
  5802. function TargetCamera(name, position, scene) {
  5803. _super.call(this, name, position, scene);
  5804. this.cameraDirection = new BABYLON.Vector3(0, 0, 0);
  5805. this.cameraRotation = new BABYLON.Vector2(0, 0);
  5806. this.rotation = new BABYLON.Vector3(0, 0, 0);
  5807. this.speed = 2.0;
  5808. this.noRotationConstraint = false;
  5809. this.lockedTarget = null;
  5810. this._currentTarget = BABYLON.Vector3.Zero();
  5811. this._viewMatrix = BABYLON.Matrix.Zero();
  5812. this._camMatrix = BABYLON.Matrix.Zero();
  5813. this._cameraTransformMatrix = BABYLON.Matrix.Zero();
  5814. this._cameraRotationMatrix = BABYLON.Matrix.Zero();
  5815. this._referencePoint = new BABYLON.Vector3(0, 0, 1);
  5816. this._transformedReferencePoint = BABYLON.Vector3.Zero();
  5817. this._lookAtTemp = BABYLON.Matrix.Zero();
  5818. this._tempMatrix = BABYLON.Matrix.Zero();
  5819. }
  5820. TargetCamera.prototype._getLockedTargetPosition = function () {
  5821. if (!this.lockedTarget) {
  5822. return null;
  5823. }
  5824. return this.lockedTarget.position || this.lockedTarget;
  5825. };
  5826. // Cache
  5827. TargetCamera.prototype._initCache = function () {
  5828. _super.prototype._initCache.call(this);
  5829. this._cache.lockedTarget = new BABYLON.Vector3(Number.MAX_VALUE, Number.MAX_VALUE, Number.MAX_VALUE);
  5830. this._cache.rotation = new BABYLON.Vector3(Number.MAX_VALUE, Number.MAX_VALUE, Number.MAX_VALUE);
  5831. };
  5832. TargetCamera.prototype._updateCache = function (ignoreParentClass) {
  5833. if (!ignoreParentClass) {
  5834. _super.prototype._updateCache.call(this);
  5835. }
  5836. var lockedTargetPosition = this._getLockedTargetPosition();
  5837. if (!lockedTargetPosition) {
  5838. this._cache.lockedTarget = null;
  5839. } else {
  5840. if (!this._cache.lockedTarget) {
  5841. this._cache.lockedTarget = lockedTargetPosition.clone();
  5842. } else {
  5843. this._cache.lockedTarget.copyFrom(lockedTargetPosition);
  5844. }
  5845. }
  5846. this._cache.rotation.copyFrom(this.rotation);
  5847. };
  5848. // Synchronized
  5849. TargetCamera.prototype._isSynchronizedViewMatrix = function () {
  5850. if (!_super.prototype._isSynchronizedViewMatrix.call(this)) {
  5851. return false;
  5852. }
  5853. var lockedTargetPosition = this._getLockedTargetPosition();
  5854. return (this._cache.lockedTarget ? this._cache.lockedTarget.equals(lockedTargetPosition) : !lockedTargetPosition) && this._cache.rotation.equals(this.rotation);
  5855. };
  5856. // Methods
  5857. TargetCamera.prototype._computeLocalCameraSpeed = function () {
  5858. var engine = this.getEngine();
  5859. return this.speed * ((engine.getDeltaTime() / (engine.getFps() * 10.0)));
  5860. };
  5861. // Target
  5862. TargetCamera.prototype.setTarget = function (target) {
  5863. this.upVector.normalize();
  5864. BABYLON.Matrix.LookAtLHToRef(this.position, target, this.upVector, this._camMatrix);
  5865. this._camMatrix.invert();
  5866. this.rotation.x = Math.atan(this._camMatrix.m[6] / this._camMatrix.m[10]);
  5867. var vDir = target.subtract(this.position);
  5868. if (vDir.x >= 0.0) {
  5869. this.rotation.y = (-Math.atan(vDir.z / vDir.x) + Math.PI / 2.0);
  5870. } else {
  5871. this.rotation.y = (-Math.atan(vDir.z / vDir.x) - Math.PI / 2.0);
  5872. }
  5873. this.rotation.z = -Math.acos(BABYLON.Vector3.Dot(new BABYLON.Vector3(0, 1.0, 0), this.upVector));
  5874. if (isNaN(this.rotation.x)) {
  5875. this.rotation.x = 0;
  5876. }
  5877. if (isNaN(this.rotation.y)) {
  5878. this.rotation.y = 0;
  5879. }
  5880. if (isNaN(this.rotation.z)) {
  5881. this.rotation.z = 0;
  5882. }
  5883. };
  5884. TargetCamera.prototype.getTarget = function () {
  5885. return this._currentTarget;
  5886. };
  5887. TargetCamera.prototype._decideIfNeedsToMove = function () {
  5888. return Math.abs(this.cameraDirection.x) > 0 || Math.abs(this.cameraDirection.y) > 0 || Math.abs(this.cameraDirection.z) > 0;
  5889. };
  5890. TargetCamera.prototype._updatePosition = function () {
  5891. this.position.addInPlace(this.cameraDirection);
  5892. };
  5893. TargetCamera.prototype._update = function () {
  5894. var needToMove = this._decideIfNeedsToMove();
  5895. var needToRotate = Math.abs(this.cameraRotation.x) > 0 || Math.abs(this.cameraRotation.y) > 0;
  5896. // Move
  5897. if (needToMove) {
  5898. this._updatePosition();
  5899. }
  5900. // Rotate
  5901. if (needToRotate) {
  5902. this.rotation.x += this.cameraRotation.x;
  5903. this.rotation.y += this.cameraRotation.y;
  5904. if (!this.noRotationConstraint) {
  5905. var limit = (Math.PI / 2) * 0.95;
  5906. if (this.rotation.x > limit)
  5907. this.rotation.x = limit;
  5908. if (this.rotation.x < -limit)
  5909. this.rotation.x = -limit;
  5910. }
  5911. }
  5912. // Inertia
  5913. if (needToMove) {
  5914. if (Math.abs(this.cameraDirection.x) < BABYLON.Engine.Epsilon) {
  5915. this.cameraDirection.x = 0;
  5916. }
  5917. if (Math.abs(this.cameraDirection.y) < BABYLON.Engine.Epsilon) {
  5918. this.cameraDirection.y = 0;
  5919. }
  5920. if (Math.abs(this.cameraDirection.z) < BABYLON.Engine.Epsilon) {
  5921. this.cameraDirection.z = 0;
  5922. }
  5923. this.cameraDirection.scaleInPlace(this.inertia);
  5924. }
  5925. if (needToRotate) {
  5926. if (Math.abs(this.cameraRotation.x) < BABYLON.Engine.Epsilon) {
  5927. this.cameraRotation.x = 0;
  5928. }
  5929. if (Math.abs(this.cameraRotation.y) < BABYLON.Engine.Epsilon) {
  5930. this.cameraRotation.y = 0;
  5931. }
  5932. this.cameraRotation.scaleInPlace(this.inertia);
  5933. }
  5934. };
  5935. TargetCamera.prototype._getViewMatrix = function () {
  5936. if (!this.lockedTarget) {
  5937. // Compute
  5938. if (this.upVector.x != 0 || this.upVector.y != 1.0 || this.upVector.z != 0) {
  5939. BABYLON.Matrix.LookAtLHToRef(BABYLON.Vector3.Zero(), this._referencePoint, this.upVector, this._lookAtTemp);
  5940. BABYLON.Matrix.RotationYawPitchRollToRef(this.rotation.y, this.rotation.x, this.rotation.z, this._cameraRotationMatrix);
  5941. this._lookAtTemp.multiplyToRef(this._cameraRotationMatrix, this._tempMatrix);
  5942. this._lookAtTemp.invert();
  5943. this._tempMatrix.multiplyToRef(this._lookAtTemp, this._cameraRotationMatrix);
  5944. } else {
  5945. BABYLON.Matrix.RotationYawPitchRollToRef(this.rotation.y, this.rotation.x, this.rotation.z, this._cameraRotationMatrix);
  5946. }
  5947. BABYLON.Vector3.TransformCoordinatesToRef(this._referencePoint, this._cameraRotationMatrix, this._transformedReferencePoint);
  5948. // Computing target and final matrix
  5949. this.position.addToRef(this._transformedReferencePoint, this._currentTarget);
  5950. } else {
  5951. this._currentTarget.copyFrom(this._getLockedTargetPosition());
  5952. }
  5953. BABYLON.Matrix.LookAtLHToRef(this.position, this._currentTarget, this.upVector, this._viewMatrix);
  5954. return this._viewMatrix;
  5955. };
  5956. return TargetCamera;
  5957. })(BABYLON.Camera);
  5958. BABYLON.TargetCamera = TargetCamera;
  5959. })(BABYLON || (BABYLON = {}));
  5960. //# sourceMappingURL=babylon.targetCamera.js.map
  5961. var BABYLON;
  5962. (function (BABYLON) {
  5963. var FollowCamera = (function (_super) {
  5964. __extends(FollowCamera, _super);
  5965. function FollowCamera(name, position, scene) {
  5966. _super.call(this, name, position, scene);
  5967. this.radius = 12;
  5968. this.rotationOffset = 0;
  5969. this.heightOffset = 4;
  5970. this.cameraAcceleration = 0.05;
  5971. this.maxCameraSpeed = 20;
  5972. }
  5973. FollowCamera.prototype.getRadians = function (degrees) {
  5974. return degrees * Math.PI / 180;
  5975. };
  5976. FollowCamera.prototype.follow = function (cameraTarget) {
  5977. if (!cameraTarget)
  5978. return;
  5979. var radians = this.getRadians(this.rotationOffset) + cameraTarget.rotation.y;
  5980. var targetX = cameraTarget.position.x + Math.sin(radians) * this.radius;
  5981. var targetZ = cameraTarget.position.z + Math.cos(radians) * this.radius;
  5982. var dx = targetX - this.position.x;
  5983. var dy = (cameraTarget.position.y + this.heightOffset) - this.position.y;
  5984. var dz = (targetZ) - this.position.z;
  5985. var vx = dx * this.cameraAcceleration * 2;
  5986. var vy = dy * this.cameraAcceleration;
  5987. var vz = dz * this.cameraAcceleration * 2;
  5988. if (vx > this.maxCameraSpeed || vx < -this.maxCameraSpeed) {
  5989. vx = vx < 1 ? -this.maxCameraSpeed : this.maxCameraSpeed;
  5990. }
  5991. if (vy > this.maxCameraSpeed || vy < -this.maxCameraSpeed) {
  5992. vy = vy < 1 ? -this.maxCameraSpeed : this.maxCameraSpeed;
  5993. }
  5994. if (vz > this.maxCameraSpeed || vz < -this.maxCameraSpeed) {
  5995. vz = vz < 1 ? -this.maxCameraSpeed : this.maxCameraSpeed;
  5996. }
  5997. this.position = new BABYLON.Vector3(this.position.x + vx, this.position.y + vy, this.position.z + vz);
  5998. this.setTarget(cameraTarget.position);
  5999. };
  6000. FollowCamera.prototype._update = function () {
  6001. _super.prototype._update.call(this);
  6002. this.follow(this.target);
  6003. };
  6004. return FollowCamera;
  6005. })(BABYLON.TargetCamera);
  6006. BABYLON.FollowCamera = FollowCamera;
  6007. })(BABYLON || (BABYLON = {}));
  6008. //# sourceMappingURL=babylon.followCamera.js.map
  6009. var BABYLON;
  6010. (function (BABYLON) {
  6011. var FreeCamera = (function (_super) {
  6012. __extends(FreeCamera, _super);
  6013. function FreeCamera(name, position, scene) {
  6014. _super.call(this, name, position, scene);
  6015. this.ellipsoid = new BABYLON.Vector3(0.5, 1, 0.5);
  6016. this.keysUp = [38];
  6017. this.keysDown = [40];
  6018. this.keysLeft = [37];
  6019. this.keysRight = [39];
  6020. this.checkCollisions = false;
  6021. this.applyGravity = false;
  6022. this.angularSensibility = 2000.0;
  6023. this._keys = [];
  6024. this._collider = new BABYLON.Collider();
  6025. this._needMoveForGravity = true;
  6026. this._oldPosition = BABYLON.Vector3.Zero();
  6027. this._diffPosition = BABYLON.Vector3.Zero();
  6028. this._newPosition = BABYLON.Vector3.Zero();
  6029. }
  6030. // Controls
  6031. FreeCamera.prototype.attachControl = function (element, noPreventDefault) {
  6032. var _this = this;
  6033. var previousPosition;
  6034. var engine = this.getEngine();
  6035. if (this._attachedElement) {
  6036. return;
  6037. }
  6038. this._attachedElement = element;
  6039. if (this._onMouseDown === undefined) {
  6040. this._onMouseDown = function (evt) {
  6041. previousPosition = {
  6042. x: evt.clientX,
  6043. y: evt.clientY
  6044. };
  6045. if (!noPreventDefault) {
  6046. evt.preventDefault();
  6047. }
  6048. };
  6049. this._onMouseUp = function (evt) {
  6050. previousPosition = null;
  6051. if (!noPreventDefault) {
  6052. evt.preventDefault();
  6053. }
  6054. };
  6055. this._onMouseOut = function (evt) {
  6056. previousPosition = null;
  6057. _this._keys = [];
  6058. if (!noPreventDefault) {
  6059. evt.preventDefault();
  6060. }
  6061. };
  6062. this._onMouseMove = function (evt) {
  6063. if (!previousPosition && !engine.isPointerLock) {
  6064. return;
  6065. }
  6066. var offsetX;
  6067. var offsetY;
  6068. if (!engine.isPointerLock) {
  6069. offsetX = evt.clientX - previousPosition.x;
  6070. offsetY = evt.clientY - previousPosition.y;
  6071. } else {
  6072. offsetX = evt.movementX || evt.mozMovementX || evt.webkitMovementX || evt.msMovementX || 0;
  6073. offsetY = evt.movementY || evt.mozMovementY || evt.webkitMovementY || evt.msMovementY || 0;
  6074. }
  6075. _this.cameraRotation.y += offsetX / _this.angularSensibility;
  6076. _this.cameraRotation.x += offsetY / _this.angularSensibility;
  6077. previousPosition = {
  6078. x: evt.clientX,
  6079. y: evt.clientY
  6080. };
  6081. if (!noPreventDefault) {
  6082. evt.preventDefault();
  6083. }
  6084. };
  6085. this._onKeyDown = function (evt) {
  6086. if (_this.keysUp.indexOf(evt.keyCode) !== -1 || _this.keysDown.indexOf(evt.keyCode) !== -1 || _this.keysLeft.indexOf(evt.keyCode) !== -1 || _this.keysRight.indexOf(evt.keyCode) !== -1) {
  6087. var index = _this._keys.indexOf(evt.keyCode);
  6088. if (index === -1) {
  6089. _this._keys.push(evt.keyCode);
  6090. }
  6091. if (!noPreventDefault) {
  6092. evt.preventDefault();
  6093. }
  6094. }
  6095. };
  6096. this._onKeyUp = function (evt) {
  6097. if (_this.keysUp.indexOf(evt.keyCode) !== -1 || _this.keysDown.indexOf(evt.keyCode) !== -1 || _this.keysLeft.indexOf(evt.keyCode) !== -1 || _this.keysRight.indexOf(evt.keyCode) !== -1) {
  6098. var index = _this._keys.indexOf(evt.keyCode);
  6099. if (index >= 0) {
  6100. _this._keys.splice(index, 1);
  6101. }
  6102. if (!noPreventDefault) {
  6103. evt.preventDefault();
  6104. }
  6105. }
  6106. };
  6107. this._onLostFocus = function () {
  6108. _this._keys = [];
  6109. };
  6110. this._reset = function () {
  6111. _this._keys = [];
  6112. previousPosition = null;
  6113. _this.cameraDirection = new BABYLON.Vector3(0, 0, 0);
  6114. _this.cameraRotation = new BABYLON.Vector2(0, 0);
  6115. };
  6116. }
  6117. element.addEventListener("mousedown", this._onMouseDown, false);
  6118. element.addEventListener("mouseup", this._onMouseUp, false);
  6119. element.addEventListener("mouseout", this._onMouseOut, false);
  6120. element.addEventListener("mousemove", this._onMouseMove, false);
  6121. BABYLON.Tools.RegisterTopRootEvents([
  6122. { name: "keydown", handler: this._onKeyDown },
  6123. { name: "keyup", handler: this._onKeyUp },
  6124. { name: "blur", handler: this._onLostFocus }
  6125. ]);
  6126. };
  6127. FreeCamera.prototype.detachControl = function (element) {
  6128. if (this._attachedElement != element) {
  6129. return;
  6130. }
  6131. element.removeEventListener("mousedown", this._onMouseDown);
  6132. element.removeEventListener("mouseup", this._onMouseUp);
  6133. element.removeEventListener("mouseout", this._onMouseOut);
  6134. element.removeEventListener("mousemove", this._onMouseMove);
  6135. BABYLON.Tools.UnregisterTopRootEvents([
  6136. { name: "keydown", handler: this._onKeyDown },
  6137. { name: "keyup", handler: this._onKeyUp },
  6138. { name: "blur", handler: this._onLostFocus }
  6139. ]);
  6140. this._attachedElement = null;
  6141. if (this._reset) {
  6142. this._reset();
  6143. }
  6144. };
  6145. FreeCamera.prototype._collideWithWorld = function (velocity) {
  6146. var globalPosition;
  6147. if (this.parent) {
  6148. globalPosition = BABYLON.Vector3.TransformCoordinates(this.position, this.parent.getWorldMatrix());
  6149. } else {
  6150. globalPosition = this.position;
  6151. }
  6152. globalPosition.subtractFromFloatsToRef(0, this.ellipsoid.y, 0, this._oldPosition);
  6153. this._collider.radius = this.ellipsoid;
  6154. this.getScene()._getNewPosition(this._oldPosition, velocity, this._collider, 3, this._newPosition);
  6155. this._newPosition.subtractToRef(this._oldPosition, this._diffPosition);
  6156. if (this._diffPosition.length() > BABYLON.Engine.CollisionsEpsilon) {
  6157. this.position.addInPlace(this._diffPosition);
  6158. if (this.onCollide) {
  6159. this.onCollide(this._collider.collidedMesh);
  6160. }
  6161. }
  6162. };
  6163. FreeCamera.prototype._checkInputs = function () {
  6164. if (!this._localDirection) {
  6165. this._localDirection = BABYLON.Vector3.Zero();
  6166. this._transformedDirection = BABYLON.Vector3.Zero();
  6167. }
  6168. for (var index = 0; index < this._keys.length; index++) {
  6169. var keyCode = this._keys[index];
  6170. var speed = this._computeLocalCameraSpeed();
  6171. if (this.keysLeft.indexOf(keyCode) !== -1) {
  6172. this._localDirection.copyFromFloats(-speed, 0, 0);
  6173. } else if (this.keysUp.indexOf(keyCode) !== -1) {
  6174. this._localDirection.copyFromFloats(0, 0, speed);
  6175. } else if (this.keysRight.indexOf(keyCode) !== -1) {
  6176. this._localDirection.copyFromFloats(speed, 0, 0);
  6177. } else if (this.keysDown.indexOf(keyCode) !== -1) {
  6178. this._localDirection.copyFromFloats(0, 0, -speed);
  6179. }
  6180. this.getViewMatrix().invertToRef(this._cameraTransformMatrix);
  6181. BABYLON.Vector3.TransformNormalToRef(this._localDirection, this._cameraTransformMatrix, this._transformedDirection);
  6182. this.cameraDirection.addInPlace(this._transformedDirection);
  6183. }
  6184. };
  6185. FreeCamera.prototype._decideIfNeedsToMove = function () {
  6186. return this._needMoveForGravity || Math.abs(this.cameraDirection.x) > 0 || Math.abs(this.cameraDirection.y) > 0 || Math.abs(this.cameraDirection.z) > 0;
  6187. };
  6188. FreeCamera.prototype._updatePosition = function () {
  6189. if (this.checkCollisions && this.getScene().collisionsEnabled) {
  6190. this._collideWithWorld(this.cameraDirection);
  6191. if (this.applyGravity) {
  6192. var oldPosition = this.position;
  6193. this._collideWithWorld(this.getScene().gravity);
  6194. this._needMoveForGravity = (BABYLON.Vector3.DistanceSquared(oldPosition, this.position) != 0);
  6195. }
  6196. } else {
  6197. this.position.addInPlace(this.cameraDirection);
  6198. }
  6199. };
  6200. FreeCamera.prototype._update = function () {
  6201. this._checkInputs();
  6202. _super.prototype._update.call(this);
  6203. };
  6204. return FreeCamera;
  6205. })(BABYLON.TargetCamera);
  6206. BABYLON.FreeCamera = FreeCamera;
  6207. })(BABYLON || (BABYLON = {}));
  6208. //# sourceMappingURL=babylon.freeCamera.js.map
  6209. var BABYLON;
  6210. (function (BABYLON) {
  6211. // We're mainly based on the logic defined into the FreeCamera code
  6212. var TouchCamera = (function (_super) {
  6213. __extends(TouchCamera, _super);
  6214. function TouchCamera(name, position, scene) {
  6215. _super.call(this, name, position, scene);
  6216. this._offsetX = null;
  6217. this._offsetY = null;
  6218. this._pointerCount = 0;
  6219. this._pointerPressed = [];
  6220. this.angularSensibility = 200000.0;
  6221. this.moveSensibility = 500.0;
  6222. }
  6223. TouchCamera.prototype.attachControl = function (canvas, noPreventDefault) {
  6224. var _this = this;
  6225. var previousPosition;
  6226. if (this._attachedCanvas) {
  6227. return;
  6228. }
  6229. this._attachedCanvas = canvas;
  6230. if (this._onPointerDown === undefined) {
  6231. this._onPointerDown = function (evt) {
  6232. if (!noPreventDefault) {
  6233. evt.preventDefault();
  6234. }
  6235. _this._pointerPressed.push(evt.pointerId);
  6236. if (_this._pointerPressed.length !== 1) {
  6237. return;
  6238. }
  6239. previousPosition = {
  6240. x: evt.clientX,
  6241. y: evt.clientY
  6242. };
  6243. };
  6244. this._onPointerUp = function (evt) {
  6245. if (!noPreventDefault) {
  6246. evt.preventDefault();
  6247. }
  6248. var index = _this._pointerPressed.indexOf(evt.pointerId);
  6249. if (index === -1) {
  6250. return;
  6251. }
  6252. _this._pointerPressed.splice(index, 1);
  6253. if (index != 0) {
  6254. return;
  6255. }
  6256. previousPosition = null;
  6257. _this._offsetX = null;
  6258. _this._offsetY = null;
  6259. };
  6260. this._onPointerMove = function (evt) {
  6261. if (!noPreventDefault) {
  6262. evt.preventDefault();
  6263. }
  6264. if (!previousPosition) {
  6265. return;
  6266. }
  6267. var index = _this._pointerPressed.indexOf(evt.pointerId);
  6268. if (index != 0) {
  6269. return;
  6270. }
  6271. _this._offsetX = evt.clientX - previousPosition.x;
  6272. _this._offsetY = -(evt.clientY - previousPosition.y);
  6273. };
  6274. this._onLostFocus = function () {
  6275. _this._offsetX = null;
  6276. _this._offsetY = null;
  6277. };
  6278. }
  6279. canvas.addEventListener("pointerdown", this._onPointerDown);
  6280. canvas.addEventListener("pointerup", this._onPointerUp);
  6281. canvas.addEventListener("pointerout", this._onPointerUp);
  6282. canvas.addEventListener("pointermove", this._onPointerMove);
  6283. BABYLON.Tools.RegisterTopRootEvents([
  6284. { name: "blur", handler: this._onLostFocus }
  6285. ]);
  6286. };
  6287. TouchCamera.prototype.detachControl = function (canvas) {
  6288. if (this._attachedCanvas != canvas) {
  6289. return;
  6290. }
  6291. canvas.removeEventListener("pointerdown", this._onPointerDown);
  6292. canvas.removeEventListener("pointerup", this._onPointerUp);
  6293. canvas.removeEventListener("pointerout", this._onPointerUp);
  6294. canvas.removeEventListener("pointermove", this._onPointerMove);
  6295. BABYLON.Tools.UnregisterTopRootEvents([
  6296. { name: "blur", handler: this._onLostFocus }
  6297. ]);
  6298. this._attachedCanvas = null;
  6299. };
  6300. TouchCamera.prototype._checkInputs = function () {
  6301. if (!this._offsetX) {
  6302. return;
  6303. }
  6304. this.cameraRotation.y += this._offsetX / this.angularSensibility;
  6305. if (this._pointerPressed.length > 1) {
  6306. this.cameraRotation.x += -this._offsetY / this.angularSensibility;
  6307. } else {
  6308. var speed = this._computeLocalCameraSpeed();
  6309. var direction = new BABYLON.Vector3(0, 0, speed * this._offsetY / this.moveSensibility);
  6310. BABYLON.Matrix.RotationYawPitchRollToRef(this.rotation.y, this.rotation.x, 0, this._cameraRotationMatrix);
  6311. this.cameraDirection.addInPlace(BABYLON.Vector3.TransformCoordinates(direction, this._cameraRotationMatrix));
  6312. }
  6313. };
  6314. return TouchCamera;
  6315. })(BABYLON.FreeCamera);
  6316. BABYLON.TouchCamera = TouchCamera;
  6317. })(BABYLON || (BABYLON = {}));
  6318. //# sourceMappingURL=babylon.touchCamera.js.map
  6319. var BABYLON;
  6320. (function (BABYLON) {
  6321. // We're mainly based on the logic defined into the FreeCamera code
  6322. var DeviceOrientationCamera = (function (_super) {
  6323. __extends(DeviceOrientationCamera, _super);
  6324. function DeviceOrientationCamera(name, position, scene) {
  6325. var _this = this;
  6326. _super.call(this, name, position, scene);
  6327. this._offsetX = null;
  6328. this._offsetY = null;
  6329. this._orientationGamma = 0;
  6330. this._orientationBeta = 0;
  6331. this._initialOrientationGamma = 0;
  6332. this._initialOrientationBeta = 0;
  6333. this.angularSensibility = 10000.0;
  6334. this.moveSensibility = 50.0;
  6335. window.addEventListener("resize", function () {
  6336. _this._initialOrientationGamma = null;
  6337. }, false);
  6338. }
  6339. DeviceOrientationCamera.prototype.attachControl = function (canvas, noPreventDefault) {
  6340. var _this = this;
  6341. if (this._attachedCanvas) {
  6342. return;
  6343. }
  6344. this._attachedCanvas = canvas;
  6345. if (!this._orientationChanged) {
  6346. this._orientationChanged = function (evt) {
  6347. if (!_this._initialOrientationGamma) {
  6348. _this._initialOrientationGamma = evt.gamma;
  6349. _this._initialOrientationBeta = evt.beta;
  6350. }
  6351. _this._orientationGamma = evt.gamma;
  6352. _this._orientationBeta = evt.beta;
  6353. _this._offsetY = (_this._initialOrientationBeta - _this._orientationBeta);
  6354. _this._offsetX = (_this._initialOrientationGamma - _this._orientationGamma);
  6355. };
  6356. }
  6357. window.addEventListener("deviceorientation", this._orientationChanged);
  6358. };
  6359. DeviceOrientationCamera.prototype.detachControl = function (canvas) {
  6360. if (this._attachedCanvas != canvas) {
  6361. return;
  6362. }
  6363. window.removeEventListener("deviceorientation", this._orientationChanged);
  6364. this._attachedCanvas = null;
  6365. this._orientationGamma = 0;
  6366. this._orientationBeta = 0;
  6367. this._initialOrientationGamma = 0;
  6368. this._initialOrientationBeta = 0;
  6369. };
  6370. DeviceOrientationCamera.prototype._checkInputs = function () {
  6371. if (!this._offsetX) {
  6372. return;
  6373. }
  6374. this.cameraRotation.y -= this._offsetX / this.angularSensibility;
  6375. var speed = this._computeLocalCameraSpeed();
  6376. var direction = new BABYLON.Vector3(0, 0, speed * this._offsetY / this.moveSensibility);
  6377. BABYLON.Matrix.RotationYawPitchRollToRef(this.rotation.y, this.rotation.x, 0, this._cameraRotationMatrix);
  6378. this.cameraDirection.addInPlace(BABYLON.Vector3.TransformCoordinates(direction, this._cameraRotationMatrix));
  6379. };
  6380. return DeviceOrientationCamera;
  6381. })(BABYLON.FreeCamera);
  6382. BABYLON.DeviceOrientationCamera = DeviceOrientationCamera;
  6383. })(BABYLON || (BABYLON = {}));
  6384. //# sourceMappingURL=babylon.deviceOrientationCamera.js.map
  6385. var BABYLON;
  6386. (function (BABYLON) {
  6387. var eventPrefix = BABYLON.Tools.GetPointerPrefix();
  6388. var ArcRotateCamera = (function (_super) {
  6389. __extends(ArcRotateCamera, _super);
  6390. function ArcRotateCamera(name, alpha, beta, radius, target, scene) {
  6391. _super.call(this, name, BABYLON.Vector3.Zero(), scene);
  6392. this.alpha = alpha;
  6393. this.beta = beta;
  6394. this.radius = radius;
  6395. this.target = target;
  6396. this.inertialAlphaOffset = 0;
  6397. this.inertialBetaOffset = 0;
  6398. this.inertialRadiusOffset = 0;
  6399. this.lowerAlphaLimit = null;
  6400. this.upperAlphaLimit = null;
  6401. this.lowerBetaLimit = 0.01;
  6402. this.upperBetaLimit = Math.PI;
  6403. this.lowerRadiusLimit = null;
  6404. this.upperRadiusLimit = null;
  6405. this.angularSensibility = 1000.0;
  6406. this.wheelPrecision = 3.0;
  6407. this.keysUp = [38];
  6408. this.keysDown = [40];
  6409. this.keysLeft = [37];
  6410. this.keysRight = [39];
  6411. this.zoomOnFactor = 1;
  6412. this.targetScreenOffset = BABYLON.Vector2.Zero();
  6413. this._keys = [];
  6414. this._viewMatrix = new BABYLON.Matrix();
  6415. this.checkCollisions = false;
  6416. this.collisionRadius = new BABYLON.Vector3(0.5, 0.5, 0.5);
  6417. this._collider = new BABYLON.Collider();
  6418. this._previousPosition = BABYLON.Vector3.Zero();
  6419. this._collisionVelocity = BABYLON.Vector3.Zero();
  6420. this._newPosition = BABYLON.Vector3.Zero();
  6421. // Pinch
  6422. // value for pinch step scaling
  6423. // set to 20 by default
  6424. this.pinchPrecision = 20;
  6425. this.getViewMatrix();
  6426. }
  6427. ArcRotateCamera.prototype._getTargetPosition = function () {
  6428. return this.target.position || this.target;
  6429. };
  6430. // Cache
  6431. ArcRotateCamera.prototype._initCache = function () {
  6432. _super.prototype._initCache.call(this);
  6433. this._cache.target = new BABYLON.Vector3(Number.MAX_VALUE, Number.MAX_VALUE, Number.MAX_VALUE);
  6434. this._cache.alpha = undefined;
  6435. this._cache.beta = undefined;
  6436. this._cache.radius = undefined;
  6437. this._cache.targetScreenOffset = undefined;
  6438. };
  6439. ArcRotateCamera.prototype._updateCache = function (ignoreParentClass) {
  6440. if (!ignoreParentClass) {
  6441. _super.prototype._updateCache.call(this);
  6442. }
  6443. this._cache.target.copyFrom(this._getTargetPosition());
  6444. this._cache.alpha = this.alpha;
  6445. this._cache.beta = this.beta;
  6446. this._cache.radius = this.radius;
  6447. this._cache.targetScreenOffset = this.targetScreenOffset.clone();
  6448. };
  6449. // Synchronized
  6450. ArcRotateCamera.prototype._isSynchronizedViewMatrix = function () {
  6451. if (!_super.prototype._isSynchronizedViewMatrix.call(this))
  6452. return false;
  6453. return this._cache.target.equals(this._getTargetPosition()) && this._cache.alpha === this.alpha && this._cache.beta === this.beta && this._cache.radius === this.radius && this._cache.targetScreenOffset.equals(this.targetScreenOffset);
  6454. };
  6455. // Methods
  6456. ArcRotateCamera.prototype.attachControl = function (element, noPreventDefault) {
  6457. var _this = this;
  6458. var previousPosition;
  6459. var pointerId;
  6460. // to know if pinch started
  6461. var pinchStarted = false;
  6462. // two pinch point on X
  6463. // that will use for find if user action is pinch open or pinch close
  6464. var pinchPointX1, pinchPointX2;
  6465. if (this._attachedElement) {
  6466. return;
  6467. }
  6468. this._attachedElement = element;
  6469. var engine = this.getEngine();
  6470. if (this._onPointerDown === undefined) {
  6471. this._onPointerDown = function (evt) {
  6472. if (pointerId) {
  6473. return;
  6474. }
  6475. pointerId = evt.pointerId;
  6476. previousPosition = {
  6477. x: evt.clientX,
  6478. y: evt.clientY
  6479. };
  6480. if (!noPreventDefault) {
  6481. evt.preventDefault();
  6482. }
  6483. };
  6484. this._onPointerUp = function (evt) {
  6485. previousPosition = null;
  6486. pointerId = null;
  6487. if (!noPreventDefault) {
  6488. evt.preventDefault();
  6489. }
  6490. };
  6491. this._onPointerMove = function (evt) {
  6492. if (!previousPosition) {
  6493. return;
  6494. }
  6495. if (pointerId !== evt.pointerId) {
  6496. return;
  6497. }
  6498. // return pinch is started
  6499. if (pinchStarted) {
  6500. return;
  6501. }
  6502. var offsetX = evt.clientX - previousPosition.x;
  6503. var offsetY = evt.clientY - previousPosition.y;
  6504. _this.inertialAlphaOffset -= offsetX / _this.angularSensibility;
  6505. _this.inertialBetaOffset -= offsetY / _this.angularSensibility;
  6506. previousPosition = {
  6507. x: evt.clientX,
  6508. y: evt.clientY
  6509. };
  6510. if (!noPreventDefault) {
  6511. evt.preventDefault();
  6512. }
  6513. };
  6514. this._onMouseMove = function (evt) {
  6515. if (!engine.isPointerLock) {
  6516. return;
  6517. }
  6518. // return pinch is started
  6519. if (pinchStarted) {
  6520. return;
  6521. }
  6522. var offsetX = evt.movementX || evt.mozMovementX || evt.webkitMovementX || evt.msMovementX || 0;
  6523. var offsetY = evt.movementY || evt.mozMovementY || evt.webkitMovementY || evt.msMovementY || 0;
  6524. _this.inertialAlphaOffset -= offsetX / _this.angularSensibility;
  6525. _this.inertialBetaOffset -= offsetY / _this.angularSensibility;
  6526. if (!noPreventDefault) {
  6527. evt.preventDefault();
  6528. }
  6529. };
  6530. this._wheel = function (event) {
  6531. var delta = 0;
  6532. if (event.wheelDelta) {
  6533. delta = event.wheelDelta / (_this.wheelPrecision * 40);
  6534. } else if (event.detail) {
  6535. delta = -event.detail / _this.wheelPrecision;
  6536. }
  6537. if (delta)
  6538. _this.inertialRadiusOffset += delta;
  6539. if (event.preventDefault) {
  6540. if (!noPreventDefault) {
  6541. event.preventDefault();
  6542. }
  6543. }
  6544. };
  6545. this._onKeyDown = function (evt) {
  6546. if (_this.keysUp.indexOf(evt.keyCode) !== -1 || _this.keysDown.indexOf(evt.keyCode) !== -1 || _this.keysLeft.indexOf(evt.keyCode) !== -1 || _this.keysRight.indexOf(evt.keyCode) !== -1) {
  6547. var index = _this._keys.indexOf(evt.keyCode);
  6548. if (index === -1) {
  6549. _this._keys.push(evt.keyCode);
  6550. }
  6551. if (evt.preventDefault) {
  6552. if (!noPreventDefault) {
  6553. evt.preventDefault();
  6554. }
  6555. }
  6556. }
  6557. };
  6558. this._onKeyUp = function (evt) {
  6559. if (_this.keysUp.indexOf(evt.keyCode) !== -1 || _this.keysDown.indexOf(evt.keyCode) !== -1 || _this.keysLeft.indexOf(evt.keyCode) !== -1 || _this.keysRight.indexOf(evt.keyCode) !== -1) {
  6560. var index = _this._keys.indexOf(evt.keyCode);
  6561. if (index >= 0) {
  6562. _this._keys.splice(index, 1);
  6563. }
  6564. if (evt.preventDefault) {
  6565. if (!noPreventDefault) {
  6566. evt.preventDefault();
  6567. }
  6568. }
  6569. }
  6570. };
  6571. this._onLostFocus = function () {
  6572. _this._keys = [];
  6573. pointerId = null;
  6574. };
  6575. this._onGestureStart = function (e) {
  6576. if (window.MSGesture === undefined) {
  6577. return;
  6578. }
  6579. if (!_this._MSGestureHandler) {
  6580. _this._MSGestureHandler = new MSGesture();
  6581. _this._MSGestureHandler.target = element;
  6582. }
  6583. _this._MSGestureHandler.addPointer(e.pointerId);
  6584. };
  6585. this._onGesture = function (e) {
  6586. _this.radius *= e.scale;
  6587. if (e.preventDefault) {
  6588. if (!noPreventDefault) {
  6589. e.stopPropagation();
  6590. e.preventDefault();
  6591. }
  6592. }
  6593. };
  6594. this._reset = function () {
  6595. _this._keys = [];
  6596. _this.inertialAlphaOffset = 0;
  6597. _this.inertialBetaOffset = 0;
  6598. _this.inertialRadiusOffset = 0;
  6599. previousPosition = null;
  6600. pointerId = null;
  6601. };
  6602. this._touchStart = function (event) {
  6603. if (event.touches.length == 2) {
  6604. //-- start pinch if two fingers on the screen
  6605. pinchStarted = true;
  6606. _this._pinchStart(event);
  6607. }
  6608. };
  6609. this._touchMove = function (event) {
  6610. if (pinchStarted) {
  6611. //-- make scaling
  6612. _this._pinchMove(event);
  6613. }
  6614. };
  6615. this._touchEnd = function (event) {
  6616. if (pinchStarted) {
  6617. //-- end of pinch
  6618. _this._pinchEnd(event);
  6619. }
  6620. };
  6621. this._pinchStart = function (event) {
  6622. // save origin touch point
  6623. pinchPointX1 = event.touches[0].clientX;
  6624. pinchPointX2 = event.touches[1].clientX;
  6625. // block the camera
  6626. // if not it rotate around target during pinch
  6627. pinchStarted = true;
  6628. };
  6629. this._pinchMove = function (event) {
  6630. // variable for new camera's radius
  6631. var delta = 0;
  6632. // variables to know if pinch open or pinch close
  6633. var direction = 1;
  6634. var distanceXOrigine, distanceXNow;
  6635. if (event.touches.length != 2)
  6636. return;
  6637. // calculate absolute distances of the two fingers
  6638. distanceXOrigine = Math.abs(pinchPointX1 - pinchPointX2);
  6639. distanceXNow = Math.abs(event.touches[0].clientX - event.touches[1].clientX);
  6640. // if distanceXNow < distanceXOrigine -> pinch close so direction = -1
  6641. if (distanceXNow < distanceXOrigine) {
  6642. direction = -1;
  6643. }
  6644. // calculate new radius
  6645. delta = (_this.pinchPrecision / (_this.wheelPrecision * 40)) * direction;
  6646. // set new radius
  6647. _this.inertialRadiusOffset += delta;
  6648. // save origin touch point
  6649. pinchPointX1 = event.touches[0].clientX;
  6650. pinchPointX2 = event.touches[1].clientX;
  6651. };
  6652. this._pinchEnd = function (event) {
  6653. // cancel pinch and deblock camera rotation
  6654. pinchStarted = false;
  6655. };
  6656. }
  6657. element.addEventListener(eventPrefix + "down", this._onPointerDown, false);
  6658. element.addEventListener(eventPrefix + "up", this._onPointerUp, false);
  6659. element.addEventListener(eventPrefix + "out", this._onPointerUp, false);
  6660. element.addEventListener(eventPrefix + "move", this._onPointerMove, false);
  6661. element.addEventListener("mousemove", this._onMouseMove, false);
  6662. element.addEventListener("MSPointerDown", this._onGestureStart, false);
  6663. element.addEventListener("MSGestureChange", this._onGesture, false);
  6664. element.addEventListener('mousewheel', this._wheel, false);
  6665. element.addEventListener('DOMMouseScroll', this._wheel, false);
  6666. // pinch
  6667. element.addEventListener('touchstart', this._touchStart, false);
  6668. element.addEventListener('touchmove', this._touchMove, false);
  6669. element.addEventListener('touchend', this._touchEnd, false);
  6670. BABYLON.Tools.RegisterTopRootEvents([
  6671. { name: "keydown", handler: this._onKeyDown },
  6672. { name: "keyup", handler: this._onKeyUp },
  6673. { name: "blur", handler: this._onLostFocus }
  6674. ]);
  6675. };
  6676. ArcRotateCamera.prototype.detachControl = function (element) {
  6677. if (this._attachedElement != element) {
  6678. return;
  6679. }
  6680. element.removeEventListener(eventPrefix + "down", this._onPointerDown);
  6681. element.removeEventListener(eventPrefix + "up", this._onPointerUp);
  6682. element.removeEventListener(eventPrefix + "out", this._onPointerUp);
  6683. element.removeEventListener(eventPrefix + "move", this._onPointerMove);
  6684. element.removeEventListener("mousemove", this._onMouseMove);
  6685. element.removeEventListener("MSPointerDown", this._onGestureStart);
  6686. element.removeEventListener("MSGestureChange", this._onGesture);
  6687. element.removeEventListener('mousewheel', this._wheel);
  6688. element.removeEventListener('DOMMouseScroll', this._wheel);
  6689. // pinch
  6690. element.removeEventListener('touchstart', this._touchStart);
  6691. element.removeEventListener('touchmove', this._touchMove);
  6692. element.removeEventListener('touchend', this._touchEnd);
  6693. BABYLON.Tools.UnregisterTopRootEvents([
  6694. { name: "keydown", handler: this._onKeyDown },
  6695. { name: "keyup", handler: this._onKeyUp },
  6696. { name: "blur", handler: this._onLostFocus }
  6697. ]);
  6698. this._MSGestureHandler = null;
  6699. this._attachedElement = null;
  6700. if (this._reset) {
  6701. this._reset();
  6702. }
  6703. };
  6704. ArcRotateCamera.prototype._update = function () {
  6705. for (var index = 0; index < this._keys.length; index++) {
  6706. var keyCode = this._keys[index];
  6707. if (this.keysLeft.indexOf(keyCode) !== -1) {
  6708. this.inertialAlphaOffset -= 0.01;
  6709. } else if (this.keysUp.indexOf(keyCode) !== -1) {
  6710. this.inertialBetaOffset -= 0.01;
  6711. } else if (this.keysRight.indexOf(keyCode) !== -1) {
  6712. this.inertialAlphaOffset += 0.01;
  6713. } else if (this.keysDown.indexOf(keyCode) !== -1) {
  6714. this.inertialBetaOffset += 0.01;
  6715. }
  6716. }
  6717. // Inertia
  6718. if (this.inertialAlphaOffset != 0 || this.inertialBetaOffset != 0 || this.inertialRadiusOffset != 0) {
  6719. this.alpha += this.inertialAlphaOffset;
  6720. this.beta += this.inertialBetaOffset;
  6721. this.radius -= this.inertialRadiusOffset;
  6722. this.inertialAlphaOffset *= this.inertia;
  6723. this.inertialBetaOffset *= this.inertia;
  6724. this.inertialRadiusOffset *= this.inertia;
  6725. if (Math.abs(this.inertialAlphaOffset) < BABYLON.Engine.Epsilon)
  6726. this.inertialAlphaOffset = 0;
  6727. if (Math.abs(this.inertialBetaOffset) < BABYLON.Engine.Epsilon)
  6728. this.inertialBetaOffset = 0;
  6729. if (Math.abs(this.inertialRadiusOffset) < BABYLON.Engine.Epsilon)
  6730. this.inertialRadiusOffset = 0;
  6731. }
  6732. // Limits
  6733. if (this.lowerAlphaLimit && this.alpha < this.lowerAlphaLimit) {
  6734. this.alpha = this.lowerAlphaLimit;
  6735. }
  6736. if (this.upperAlphaLimit && this.alpha > this.upperAlphaLimit) {
  6737. this.alpha = this.upperAlphaLimit;
  6738. }
  6739. if (this.lowerBetaLimit && this.beta < this.lowerBetaLimit) {
  6740. this.beta = this.lowerBetaLimit;
  6741. }
  6742. if (this.upperBetaLimit && this.beta > this.upperBetaLimit) {
  6743. this.beta = this.upperBetaLimit;
  6744. }
  6745. if (this.lowerRadiusLimit && this.radius < this.lowerRadiusLimit) {
  6746. this.radius = this.lowerRadiusLimit;
  6747. }
  6748. if (this.upperRadiusLimit && this.radius > this.upperRadiusLimit) {
  6749. this.radius = this.upperRadiusLimit;
  6750. }
  6751. };
  6752. ArcRotateCamera.prototype.setPosition = function (position) {
  6753. var radiusv3 = position.subtract(this._getTargetPosition());
  6754. this.radius = radiusv3.length();
  6755. // Alpha
  6756. this.alpha = Math.acos(radiusv3.x / Math.sqrt(Math.pow(radiusv3.x, 2) + Math.pow(radiusv3.z, 2)));
  6757. if (radiusv3.z < 0) {
  6758. this.alpha = 2 * Math.PI - this.alpha;
  6759. }
  6760. // Beta
  6761. this.beta = Math.acos(radiusv3.y / this.radius);
  6762. };
  6763. ArcRotateCamera.prototype._getViewMatrix = function () {
  6764. // Compute
  6765. var cosa = Math.cos(this.alpha);
  6766. var sina = Math.sin(this.alpha);
  6767. var cosb = Math.cos(this.beta);
  6768. var sinb = Math.sin(this.beta);
  6769. var target = this._getTargetPosition();
  6770. target.addToRef(new BABYLON.Vector3(this.radius * cosa * sinb, this.radius * cosb, this.radius * sina * sinb), this.position);
  6771. if (this.checkCollisions) {
  6772. this._collider.radius = this.collisionRadius;
  6773. this.position.subtractToRef(this._previousPosition, this._collisionVelocity);
  6774. this.getScene()._getNewPosition(this._previousPosition, this._collisionVelocity, this._collider, 3, this._newPosition);
  6775. if (!this._newPosition.equalsWithEpsilon(this.position)) {
  6776. this.position.copyFrom(this._previousPosition);
  6777. this.alpha = this._previousAlpha;
  6778. this.beta = this._previousBeta;
  6779. this.radius = this._previousRadius;
  6780. if (this.onCollide) {
  6781. this.onCollide(this._collider.collidedMesh);
  6782. }
  6783. }
  6784. }
  6785. BABYLON.Matrix.LookAtLHToRef(this.position, target, this.upVector, this._viewMatrix);
  6786. this._previousAlpha = this.alpha;
  6787. this._previousBeta = this.beta;
  6788. this._previousRadius = this.radius;
  6789. this._previousPosition.copyFrom(this.position);
  6790. this._viewMatrix.m[12] += this.targetScreenOffset.x;
  6791. this._viewMatrix.m[13] += this.targetScreenOffset.y;
  6792. return this._viewMatrix;
  6793. };
  6794. ArcRotateCamera.prototype.zoomOn = function (meshes) {
  6795. meshes = meshes || this.getScene().meshes;
  6796. var minMaxVector = BABYLON.Mesh.MinMax(meshes);
  6797. var distance = BABYLON.Vector3.Distance(minMaxVector.min, minMaxVector.max);
  6798. this.radius = distance * this.zoomOnFactor;
  6799. this.focusOn({ min: minMaxVector.min, max: minMaxVector.max, distance: distance });
  6800. };
  6801. ArcRotateCamera.prototype.focusOn = function (meshesOrMinMaxVectorAndDistance) {
  6802. var meshesOrMinMaxVector;
  6803. var distance;
  6804. if (meshesOrMinMaxVectorAndDistance.min === undefined) {
  6805. meshesOrMinMaxVector = meshesOrMinMaxVectorAndDistance || this.getScene().meshes;
  6806. meshesOrMinMaxVector = BABYLON.Mesh.MinMax(meshesOrMinMaxVector);
  6807. distance = BABYLON.Vector3.Distance(meshesOrMinMaxVector.min, meshesOrMinMaxVector.max);
  6808. } else {
  6809. meshesOrMinMaxVector = meshesOrMinMaxVectorAndDistance;
  6810. distance = meshesOrMinMaxVectorAndDistance.distance;
  6811. }
  6812. this.target = BABYLON.Mesh.Center(meshesOrMinMaxVector);
  6813. this.maxZ = distance * 2;
  6814. };
  6815. return ArcRotateCamera;
  6816. })(BABYLON.Camera);
  6817. BABYLON.ArcRotateCamera = ArcRotateCamera;
  6818. })(BABYLON || (BABYLON = {}));
  6819. //# sourceMappingURL=babylon.arcRotateCamera.js.map
  6820. var BABYLON;
  6821. (function (BABYLON) {
  6822. var Scene = (function () {
  6823. // Constructor
  6824. function Scene(engine) {
  6825. // Members
  6826. this.autoClear = true;
  6827. this.clearColor = new BABYLON.Color3(0.2, 0.2, 0.3);
  6828. this.ambientColor = new BABYLON.Color3(0, 0, 0);
  6829. this.forceWireframe = false;
  6830. this.forcePointsCloud = false;
  6831. this.forceShowBoundingBoxes = false;
  6832. this.animationsEnabled = true;
  6833. this.cameraToUseForPointers = null;
  6834. // Fog
  6835. this.fogEnabled = true;
  6836. this.fogMode = Scene.FOGMODE_NONE;
  6837. this.fogColor = new BABYLON.Color3(0.2, 0.2, 0.3);
  6838. this.fogDensity = 0.1;
  6839. this.fogStart = 0;
  6840. this.fogEnd = 1000.0;
  6841. // Lights
  6842. this.shadowsEnabled = true;
  6843. this.lightsEnabled = true;
  6844. this.lights = new Array();
  6845. // Cameras
  6846. this.cameras = new Array();
  6847. this.activeCameras = new Array();
  6848. // Meshes
  6849. this.meshes = new Array();
  6850. // Geometries
  6851. this._geometries = new Array();
  6852. this.materials = new Array();
  6853. this.multiMaterials = new Array();
  6854. this.defaultMaterial = new BABYLON.StandardMaterial("default material", this);
  6855. // Textures
  6856. this.texturesEnabled = true;
  6857. this.textures = new Array();
  6858. // Particles
  6859. this.particlesEnabled = true;
  6860. this.particleSystems = new Array();
  6861. // Sprites
  6862. this.spriteManagers = new Array();
  6863. // Layers
  6864. this.layers = new Array();
  6865. // Skeletons
  6866. this.skeletonsEnabled = true;
  6867. this.skeletons = new Array();
  6868. // Lens flares
  6869. this.lensFlaresEnabled = true;
  6870. this.lensFlareSystems = new Array();
  6871. // Collisions
  6872. this.collisionsEnabled = true;
  6873. this.gravity = new BABYLON.Vector3(0, -9.0, 0);
  6874. // Postprocesses
  6875. this.postProcessesEnabled = true;
  6876. // Customs render targets
  6877. this.renderTargetsEnabled = true;
  6878. this.customRenderTargets = new Array();
  6879. // Imported meshes
  6880. this.importedMeshesFiles = new Array();
  6881. this._actionManagers = new Array();
  6882. this._meshesForIntersections = new BABYLON.SmartArray(256);
  6883. // Procedural textures
  6884. this.proceduralTexturesEnabled = true;
  6885. this._proceduralTextures = new Array();
  6886. this.soundTracks = new Array();
  6887. this._totalVertices = 0;
  6888. this._activeVertices = 0;
  6889. this._activeParticles = 0;
  6890. this._lastFrameDuration = 0;
  6891. this._evaluateActiveMeshesDuration = 0;
  6892. this._renderTargetsDuration = 0;
  6893. this._particlesDuration = 0;
  6894. this._renderDuration = 0;
  6895. this._spritesDuration = 0;
  6896. this._animationRatio = 0;
  6897. this._renderId = 0;
  6898. this._executeWhenReadyTimeoutId = -1;
  6899. this._toBeDisposed = new BABYLON.SmartArray(256);
  6900. this._onReadyCallbacks = new Array();
  6901. this._pendingData = [];
  6902. this._onBeforeRenderCallbacks = new Array();
  6903. this._onAfterRenderCallbacks = new Array();
  6904. this._activeMeshes = new BABYLON.SmartArray(256);
  6905. this._processedMaterials = new BABYLON.SmartArray(256);
  6906. this._renderTargets = new BABYLON.SmartArray(256);
  6907. this._activeParticleSystems = new BABYLON.SmartArray(256);
  6908. this._activeSkeletons = new BABYLON.SmartArray(32);
  6909. this._activeBones = 0;
  6910. this._activeAnimatables = new Array();
  6911. this._transformMatrix = BABYLON.Matrix.Zero();
  6912. this._scaledPosition = BABYLON.Vector3.Zero();
  6913. this._scaledVelocity = BABYLON.Vector3.Zero();
  6914. this._engine = engine;
  6915. engine.scenes.push(this);
  6916. this._renderingManager = new BABYLON.RenderingManager(this);
  6917. this.postProcessManager = new BABYLON.PostProcessManager(this);
  6918. this.postProcessRenderPipelineManager = new BABYLON.PostProcessRenderPipelineManager();
  6919. this._boundingBoxRenderer = new BABYLON.BoundingBoxRenderer(this);
  6920. this._outlineRenderer = new BABYLON.OutlineRenderer(this);
  6921. this.attachControl();
  6922. this._debugLayer = new BABYLON.DebugLayer(this);
  6923. this.mainSoundTrack = new BABYLON.SoundTrack(this, { mainTrack: true });
  6924. }
  6925. Object.defineProperty(Scene.prototype, "debugLayer", {
  6926. // Properties
  6927. get: function () {
  6928. return this._debugLayer;
  6929. },
  6930. enumerable: true,
  6931. configurable: true
  6932. });
  6933. Object.defineProperty(Scene.prototype, "meshUnderPointer", {
  6934. get: function () {
  6935. return this._meshUnderPointer;
  6936. },
  6937. enumerable: true,
  6938. configurable: true
  6939. });
  6940. Object.defineProperty(Scene.prototype, "pointerX", {
  6941. get: function () {
  6942. return this._pointerX;
  6943. },
  6944. enumerable: true,
  6945. configurable: true
  6946. });
  6947. Object.defineProperty(Scene.prototype, "pointerY", {
  6948. get: function () {
  6949. return this._pointerY;
  6950. },
  6951. enumerable: true,
  6952. configurable: true
  6953. });
  6954. Scene.prototype.getCachedMaterial = function () {
  6955. return this._cachedMaterial;
  6956. };
  6957. Scene.prototype.getBoundingBoxRenderer = function () {
  6958. return this._boundingBoxRenderer;
  6959. };
  6960. Scene.prototype.getOutlineRenderer = function () {
  6961. return this._outlineRenderer;
  6962. };
  6963. Scene.prototype.getEngine = function () {
  6964. return this._engine;
  6965. };
  6966. Scene.prototype.getTotalVertices = function () {
  6967. return this._totalVertices;
  6968. };
  6969. Scene.prototype.getActiveVertices = function () {
  6970. return this._activeVertices;
  6971. };
  6972. Scene.prototype.getActiveParticles = function () {
  6973. return this._activeParticles;
  6974. };
  6975. Scene.prototype.getActiveBones = function () {
  6976. return this._activeBones;
  6977. };
  6978. // Stats
  6979. Scene.prototype.getLastFrameDuration = function () {
  6980. return this._lastFrameDuration;
  6981. };
  6982. Scene.prototype.getEvaluateActiveMeshesDuration = function () {
  6983. return this._evaluateActiveMeshesDuration;
  6984. };
  6985. Scene.prototype.getActiveMeshes = function () {
  6986. return this._activeMeshes;
  6987. };
  6988. Scene.prototype.getRenderTargetsDuration = function () {
  6989. return this._renderTargetsDuration;
  6990. };
  6991. Scene.prototype.getRenderDuration = function () {
  6992. return this._renderDuration;
  6993. };
  6994. Scene.prototype.getParticlesDuration = function () {
  6995. return this._particlesDuration;
  6996. };
  6997. Scene.prototype.getSpritesDuration = function () {
  6998. return this._spritesDuration;
  6999. };
  7000. Scene.prototype.getAnimationRatio = function () {
  7001. return this._animationRatio;
  7002. };
  7003. Scene.prototype.getRenderId = function () {
  7004. return this._renderId;
  7005. };
  7006. Scene.prototype._updatePointerPosition = function (evt) {
  7007. var canvasRect = this._engine.getRenderingCanvasClientRect();
  7008. this._pointerX = evt.clientX - canvasRect.left;
  7009. this._pointerY = evt.clientY - canvasRect.top;
  7010. if (this.cameraToUseForPointers) {
  7011. this._pointerX = this._pointerX - this.cameraToUseForPointers.viewport.x * this._engine.getRenderWidth();
  7012. this._pointerY = this._pointerY - this.cameraToUseForPointers.viewport.y * this._engine.getRenderHeight();
  7013. }
  7014. };
  7015. // Pointers handling
  7016. Scene.prototype.attachControl = function () {
  7017. var _this = this;
  7018. this._onPointerMove = function (evt) {
  7019. var canvas = _this._engine.getRenderingCanvas();
  7020. _this._updatePointerPosition(evt);
  7021. var pickResult = _this.pick(_this._pointerX, _this._pointerY, function (mesh) {
  7022. return mesh.isPickable && mesh.isVisible && mesh.isReady() && mesh.actionManager && mesh.actionManager.hasPointerTriggers;
  7023. }, false, _this.cameraToUseForPointers);
  7024. if (pickResult.hit) {
  7025. _this._meshUnderPointer = pickResult.pickedMesh;
  7026. _this.setPointerOverMesh(pickResult.pickedMesh);
  7027. canvas.style.cursor = "pointer";
  7028. } else {
  7029. _this.setPointerOverMesh(null);
  7030. canvas.style.cursor = "";
  7031. _this._meshUnderPointer = null;
  7032. }
  7033. };
  7034. this._onPointerDown = function (evt) {
  7035. var predicate = null;
  7036. if (!_this.onPointerDown) {
  7037. predicate = function (mesh) {
  7038. return mesh.isPickable && mesh.isVisible && mesh.isReady() && mesh.actionManager && mesh.actionManager.hasPickTriggers;
  7039. };
  7040. }
  7041. _this._updatePointerPosition(evt);
  7042. var pickResult = _this.pick(_this._pointerX, _this._pointerY, predicate, false, _this.cameraToUseForPointers);
  7043. if (pickResult.hit) {
  7044. if (pickResult.pickedMesh.actionManager) {
  7045. switch (evt.button) {
  7046. case 0:
  7047. pickResult.pickedMesh.actionManager.processTrigger(BABYLON.ActionManager.OnLeftPickTrigger, BABYLON.ActionEvent.CreateNew(pickResult.pickedMesh, evt));
  7048. break;
  7049. case 1:
  7050. pickResult.pickedMesh.actionManager.processTrigger(BABYLON.ActionManager.OnCenterPickTrigger, BABYLON.ActionEvent.CreateNew(pickResult.pickedMesh, evt));
  7051. break;
  7052. case 2:
  7053. pickResult.pickedMesh.actionManager.processTrigger(BABYLON.ActionManager.OnRightPickTrigger, BABYLON.ActionEvent.CreateNew(pickResult.pickedMesh, evt));
  7054. break;
  7055. }
  7056. pickResult.pickedMesh.actionManager.processTrigger(BABYLON.ActionManager.OnPickTrigger, BABYLON.ActionEvent.CreateNew(pickResult.pickedMesh, evt));
  7057. }
  7058. }
  7059. if (_this.onPointerDown) {
  7060. _this.onPointerDown(evt, pickResult);
  7061. }
  7062. };
  7063. this._onKeyDown = function (evt) {
  7064. if (_this.actionManager) {
  7065. _this.actionManager.processTrigger(BABYLON.ActionManager.OnKeyDownTrigger, BABYLON.ActionEvent.CreateNewFromScene(_this, evt));
  7066. }
  7067. };
  7068. this._onKeyUp = function (evt) {
  7069. if (_this.actionManager) {
  7070. _this.actionManager.processTrigger(BABYLON.ActionManager.OnKeyUpTrigger, BABYLON.ActionEvent.CreateNewFromScene(_this, evt));
  7071. }
  7072. };
  7073. var eventPrefix = BABYLON.Tools.GetPointerPrefix();
  7074. this._engine.getRenderingCanvas().addEventListener(eventPrefix + "move", this._onPointerMove, false);
  7075. this._engine.getRenderingCanvas().addEventListener(eventPrefix + "down", this._onPointerDown, false);
  7076. window.addEventListener("keydown", this._onKeyDown, false);
  7077. window.addEventListener("keyup", this._onKeyUp, false);
  7078. };
  7079. Scene.prototype.detachControl = function () {
  7080. var eventPrefix = BABYLON.Tools.GetPointerPrefix();
  7081. this._engine.getRenderingCanvas().removeEventListener(eventPrefix + "move", this._onPointerMove);
  7082. this._engine.getRenderingCanvas().removeEventListener(eventPrefix + "down", this._onPointerDown);
  7083. window.removeEventListener("keydown", this._onKeyDown);
  7084. window.removeEventListener("keyup", this._onKeyUp);
  7085. };
  7086. // Ready
  7087. Scene.prototype.isReady = function () {
  7088. if (this._pendingData.length > 0) {
  7089. return false;
  7090. }
  7091. for (var index = 0; index < this._geometries.length; index++) {
  7092. var geometry = this._geometries[index];
  7093. if (geometry.delayLoadState === BABYLON.Engine.DELAYLOADSTATE_LOADING) {
  7094. return false;
  7095. }
  7096. }
  7097. for (index = 0; index < this.meshes.length; index++) {
  7098. var mesh = this.meshes[index];
  7099. if (!mesh.isReady()) {
  7100. return false;
  7101. }
  7102. var mat = mesh.material;
  7103. if (mat) {
  7104. if (!mat.isReady(mesh)) {
  7105. return false;
  7106. }
  7107. }
  7108. }
  7109. return true;
  7110. };
  7111. Scene.prototype.resetCachedMaterial = function () {
  7112. this._cachedMaterial = null;
  7113. };
  7114. Scene.prototype.registerBeforeRender = function (func) {
  7115. this._onBeforeRenderCallbacks.push(func);
  7116. };
  7117. Scene.prototype.unregisterBeforeRender = function (func) {
  7118. var index = this._onBeforeRenderCallbacks.indexOf(func);
  7119. if (index > -1) {
  7120. this._onBeforeRenderCallbacks.splice(index, 1);
  7121. }
  7122. };
  7123. Scene.prototype.registerAfterRender = function (func) {
  7124. this._onAfterRenderCallbacks.push(func);
  7125. };
  7126. Scene.prototype.unregisterAfterRender = function (func) {
  7127. var index = this._onAfterRenderCallbacks.indexOf(func);
  7128. if (index > -1) {
  7129. this._onAfterRenderCallbacks.splice(index, 1);
  7130. }
  7131. };
  7132. Scene.prototype._addPendingData = function (data) {
  7133. this._pendingData.push(data);
  7134. };
  7135. Scene.prototype._removePendingData = function (data) {
  7136. var index = this._pendingData.indexOf(data);
  7137. if (index !== -1) {
  7138. this._pendingData.splice(index, 1);
  7139. }
  7140. };
  7141. Scene.prototype.getWaitingItemsCount = function () {
  7142. return this._pendingData.length;
  7143. };
  7144. Scene.prototype.executeWhenReady = function (func) {
  7145. var _this = this;
  7146. this._onReadyCallbacks.push(func);
  7147. if (this._executeWhenReadyTimeoutId !== -1) {
  7148. return;
  7149. }
  7150. this._executeWhenReadyTimeoutId = setTimeout(function () {
  7151. _this._checkIsReady();
  7152. }, 150);
  7153. };
  7154. Scene.prototype._checkIsReady = function () {
  7155. var _this = this;
  7156. if (this.isReady()) {
  7157. this._onReadyCallbacks.forEach(function (func) {
  7158. func();
  7159. });
  7160. this._onReadyCallbacks = [];
  7161. this._executeWhenReadyTimeoutId = -1;
  7162. return;
  7163. }
  7164. this._executeWhenReadyTimeoutId = setTimeout(function () {
  7165. _this._checkIsReady();
  7166. }, 150);
  7167. };
  7168. // Animations
  7169. Scene.prototype.beginAnimation = function (target, from, to, loop, speedRatio, onAnimationEnd, animatable) {
  7170. if (speedRatio === undefined) {
  7171. speedRatio = 1.0;
  7172. }
  7173. this.stopAnimation(target);
  7174. if (!animatable) {
  7175. animatable = new BABYLON.Animatable(this, target, from, to, loop, speedRatio, onAnimationEnd);
  7176. }
  7177. // Local animations
  7178. if (target.animations) {
  7179. animatable.appendAnimations(target, target.animations);
  7180. }
  7181. // Children animations
  7182. if (target.getAnimatables) {
  7183. var animatables = target.getAnimatables();
  7184. for (var index = 0; index < animatables.length; index++) {
  7185. this.beginAnimation(animatables[index], from, to, loop, speedRatio, onAnimationEnd, animatable);
  7186. }
  7187. }
  7188. return animatable;
  7189. };
  7190. Scene.prototype.beginDirectAnimation = function (target, animations, from, to, loop, speedRatio, onAnimationEnd) {
  7191. if (speedRatio === undefined) {
  7192. speedRatio = 1.0;
  7193. }
  7194. var animatable = new BABYLON.Animatable(this, target, from, to, loop, speedRatio, onAnimationEnd, animations);
  7195. return animatable;
  7196. };
  7197. Scene.prototype.getAnimatableByTarget = function (target) {
  7198. for (var index = 0; index < this._activeAnimatables.length; index++) {
  7199. if (this._activeAnimatables[index].target === target) {
  7200. return this._activeAnimatables[index];
  7201. }
  7202. }
  7203. return null;
  7204. };
  7205. Scene.prototype.stopAnimation = function (target) {
  7206. var animatable = this.getAnimatableByTarget(target);
  7207. if (animatable) {
  7208. animatable.stop();
  7209. }
  7210. };
  7211. Scene.prototype._animate = function () {
  7212. if (!this.animationsEnabled) {
  7213. return;
  7214. }
  7215. if (!this._animationStartDate) {
  7216. this._animationStartDate = BABYLON.Tools.Now;
  7217. }
  7218. // Getting time
  7219. var now = BABYLON.Tools.Now;
  7220. var delay = now - this._animationStartDate;
  7221. for (var index = 0; index < this._activeAnimatables.length; index++) {
  7222. if (!this._activeAnimatables[index]._animate(delay)) {
  7223. this._activeAnimatables.splice(index, 1);
  7224. index--;
  7225. }
  7226. }
  7227. };
  7228. // Matrix
  7229. Scene.prototype.getViewMatrix = function () {
  7230. return this._viewMatrix;
  7231. };
  7232. Scene.prototype.getProjectionMatrix = function () {
  7233. return this._projectionMatrix;
  7234. };
  7235. Scene.prototype.getTransformMatrix = function () {
  7236. return this._transformMatrix;
  7237. };
  7238. Scene.prototype.setTransformMatrix = function (view, projection) {
  7239. this._viewMatrix = view;
  7240. this._projectionMatrix = projection;
  7241. this._viewMatrix.multiplyToRef(this._projectionMatrix, this._transformMatrix);
  7242. };
  7243. // Methods
  7244. Scene.prototype.setActiveCameraByID = function (id) {
  7245. var camera = this.getCameraByID(id);
  7246. if (camera) {
  7247. this.activeCamera = camera;
  7248. return camera;
  7249. }
  7250. return null;
  7251. };
  7252. Scene.prototype.setActiveCameraByName = function (name) {
  7253. var camera = this.getCameraByName(name);
  7254. if (camera) {
  7255. this.activeCamera = camera;
  7256. return camera;
  7257. }
  7258. return null;
  7259. };
  7260. Scene.prototype.getMaterialByID = function (id) {
  7261. for (var index = 0; index < this.materials.length; index++) {
  7262. if (this.materials[index].id === id) {
  7263. return this.materials[index];
  7264. }
  7265. }
  7266. return null;
  7267. };
  7268. Scene.prototype.getMaterialByName = function (name) {
  7269. for (var index = 0; index < this.materials.length; index++) {
  7270. if (this.materials[index].name === name) {
  7271. return this.materials[index];
  7272. }
  7273. }
  7274. return null;
  7275. };
  7276. Scene.prototype.getCameraByID = function (id) {
  7277. for (var index = 0; index < this.cameras.length; index++) {
  7278. if (this.cameras[index].id === id) {
  7279. return this.cameras[index];
  7280. }
  7281. }
  7282. return null;
  7283. };
  7284. Scene.prototype.getCameraByName = function (name) {
  7285. for (var index = 0; index < this.cameras.length; index++) {
  7286. if (this.cameras[index].name === name) {
  7287. return this.cameras[index];
  7288. }
  7289. }
  7290. return null;
  7291. };
  7292. Scene.prototype.getLightByName = function (name) {
  7293. for (var index = 0; index < this.lights.length; index++) {
  7294. if (this.lights[index].name === name) {
  7295. return this.lights[index];
  7296. }
  7297. }
  7298. return null;
  7299. };
  7300. Scene.prototype.getLightByID = function (id) {
  7301. for (var index = 0; index < this.lights.length; index++) {
  7302. if (this.lights[index].id === id) {
  7303. return this.lights[index];
  7304. }
  7305. }
  7306. return null;
  7307. };
  7308. Scene.prototype.getGeometryByID = function (id) {
  7309. for (var index = 0; index < this._geometries.length; index++) {
  7310. if (this._geometries[index].id === id) {
  7311. return this._geometries[index];
  7312. }
  7313. }
  7314. return null;
  7315. };
  7316. Scene.prototype.pushGeometry = function (geometry, force) {
  7317. if (!force && this.getGeometryByID(geometry.id)) {
  7318. return false;
  7319. }
  7320. this._geometries.push(geometry);
  7321. return true;
  7322. };
  7323. Scene.prototype.getGeometries = function () {
  7324. return this._geometries;
  7325. };
  7326. Scene.prototype.getMeshByID = function (id) {
  7327. for (var index = 0; index < this.meshes.length; index++) {
  7328. if (this.meshes[index].id === id) {
  7329. return this.meshes[index];
  7330. }
  7331. }
  7332. return null;
  7333. };
  7334. Scene.prototype.getLastMeshByID = function (id) {
  7335. for (var index = this.meshes.length - 1; index >= 0; index--) {
  7336. if (this.meshes[index].id === id) {
  7337. return this.meshes[index];
  7338. }
  7339. }
  7340. return null;
  7341. };
  7342. Scene.prototype.getLastEntryByID = function (id) {
  7343. for (var index = this.meshes.length - 1; index >= 0; index--) {
  7344. if (this.meshes[index].id === id) {
  7345. return this.meshes[index];
  7346. }
  7347. }
  7348. for (index = this.cameras.length - 1; index >= 0; index--) {
  7349. if (this.cameras[index].id === id) {
  7350. return this.cameras[index];
  7351. }
  7352. }
  7353. for (index = this.lights.length - 1; index >= 0; index--) {
  7354. if (this.lights[index].id === id) {
  7355. return this.lights[index];
  7356. }
  7357. }
  7358. return null;
  7359. };
  7360. Scene.prototype.getMeshByName = function (name) {
  7361. for (var index = 0; index < this.meshes.length; index++) {
  7362. if (this.meshes[index].name === name) {
  7363. return this.meshes[index];
  7364. }
  7365. }
  7366. return null;
  7367. };
  7368. Scene.prototype.getLastSkeletonByID = function (id) {
  7369. for (var index = this.skeletons.length - 1; index >= 0; index--) {
  7370. if (this.skeletons[index].id === id) {
  7371. return this.skeletons[index];
  7372. }
  7373. }
  7374. return null;
  7375. };
  7376. Scene.prototype.getSkeletonById = function (id) {
  7377. for (var index = 0; index < this.skeletons.length; index++) {
  7378. if (this.skeletons[index].id === id) {
  7379. return this.skeletons[index];
  7380. }
  7381. }
  7382. return null;
  7383. };
  7384. Scene.prototype.getSkeletonByName = function (name) {
  7385. for (var index = 0; index < this.skeletons.length; index++) {
  7386. if (this.skeletons[index].name === name) {
  7387. return this.skeletons[index];
  7388. }
  7389. }
  7390. return null;
  7391. };
  7392. Scene.prototype.isActiveMesh = function (mesh) {
  7393. return (this._activeMeshes.indexOf(mesh) !== -1);
  7394. };
  7395. Scene.prototype._evaluateSubMesh = function (subMesh, mesh) {
  7396. if (mesh.subMeshes.length === 1 || subMesh.isInFrustum(this._frustumPlanes)) {
  7397. var material = subMesh.getMaterial();
  7398. if (mesh.showSubMeshesBoundingBox) {
  7399. this._boundingBoxRenderer.renderList.push(subMesh.getBoundingInfo().boundingBox);
  7400. }
  7401. if (material) {
  7402. // Render targets
  7403. if (material.getRenderTargetTextures) {
  7404. if (this._processedMaterials.indexOf(material) === -1) {
  7405. this._processedMaterials.push(material);
  7406. this._renderTargets.concat(material.getRenderTargetTextures());
  7407. }
  7408. }
  7409. // Dispatch
  7410. this._activeVertices += subMesh.indexCount;
  7411. this._renderingManager.dispatch(subMesh);
  7412. }
  7413. }
  7414. };
  7415. Scene.prototype._evaluateActiveMeshes = function () {
  7416. this._activeMeshes.reset();
  7417. this._renderingManager.reset();
  7418. this._processedMaterials.reset();
  7419. this._activeParticleSystems.reset();
  7420. this._activeSkeletons.reset();
  7421. this._boundingBoxRenderer.reset();
  7422. if (!this._frustumPlanes) {
  7423. this._frustumPlanes = BABYLON.Frustum.GetPlanes(this._transformMatrix);
  7424. } else {
  7425. BABYLON.Frustum.GetPlanesToRef(this._transformMatrix, this._frustumPlanes);
  7426. }
  7427. // Meshes
  7428. var meshes;
  7429. var len;
  7430. if (this._selectionOctree) {
  7431. var selection = this._selectionOctree.select(this._frustumPlanes);
  7432. meshes = selection.data;
  7433. len = selection.length;
  7434. } else {
  7435. len = this.meshes.length;
  7436. meshes = this.meshes;
  7437. }
  7438. for (var meshIndex = 0; meshIndex < len; meshIndex++) {
  7439. var mesh = meshes[meshIndex];
  7440. if (mesh.isBlocked) {
  7441. continue;
  7442. }
  7443. this._totalVertices += mesh.getTotalVertices();
  7444. if (!mesh.isReady()) {
  7445. continue;
  7446. }
  7447. mesh.computeWorldMatrix();
  7448. // Intersections
  7449. if (mesh.actionManager && mesh.actionManager.hasSpecificTriggers([BABYLON.ActionManager.OnIntersectionEnterTrigger, BABYLON.ActionManager.OnIntersectionExitTrigger])) {
  7450. this._meshesForIntersections.pushNoDuplicate(mesh);
  7451. }
  7452. // Switch to current LOD
  7453. var meshLOD = mesh.getLOD(this.activeCamera);
  7454. if (!meshLOD) {
  7455. continue;
  7456. }
  7457. mesh._preActivate();
  7458. if (mesh.isEnabled() && mesh.isVisible && mesh.visibility > 0 && ((mesh.layerMask & this.activeCamera.layerMask) !== 0) && mesh.isInFrustum(this._frustumPlanes)) {
  7459. this._activeMeshes.push(mesh);
  7460. mesh._activate(this._renderId);
  7461. this._activeMesh(meshLOD);
  7462. }
  7463. }
  7464. // Particle systems
  7465. var beforeParticlesDate = BABYLON.Tools.Now;
  7466. if (this.particlesEnabled) {
  7467. BABYLON.Tools.StartPerformanceCounter("Particles", this.particleSystems.length > 0);
  7468. for (var particleIndex = 0; particleIndex < this.particleSystems.length; particleIndex++) {
  7469. var particleSystem = this.particleSystems[particleIndex];
  7470. if (!particleSystem.isStarted()) {
  7471. continue;
  7472. }
  7473. if (!particleSystem.emitter.position || (particleSystem.emitter && particleSystem.emitter.isEnabled())) {
  7474. this._activeParticleSystems.push(particleSystem);
  7475. particleSystem.animate();
  7476. }
  7477. }
  7478. BABYLON.Tools.EndPerformanceCounter("Particles", this.particleSystems.length > 0);
  7479. }
  7480. this._particlesDuration += BABYLON.Tools.Now - beforeParticlesDate;
  7481. };
  7482. Scene.prototype._activeMesh = function (mesh) {
  7483. if (mesh.skeleton && this.skeletonsEnabled) {
  7484. this._activeSkeletons.pushNoDuplicate(mesh.skeleton);
  7485. }
  7486. if (mesh.showBoundingBox || this.forceShowBoundingBoxes) {
  7487. this._boundingBoxRenderer.renderList.push(mesh.getBoundingInfo().boundingBox);
  7488. }
  7489. if (mesh && mesh.subMeshes) {
  7490. // Submeshes Octrees
  7491. var len;
  7492. var subMeshes;
  7493. if (mesh._submeshesOctree && mesh.useOctreeForRenderingSelection) {
  7494. var intersections = mesh._submeshesOctree.select(this._frustumPlanes);
  7495. len = intersections.length;
  7496. subMeshes = intersections.data;
  7497. } else {
  7498. subMeshes = mesh.subMeshes;
  7499. len = subMeshes.length;
  7500. }
  7501. for (var subIndex = 0; subIndex < len; subIndex++) {
  7502. var subMesh = subMeshes[subIndex];
  7503. this._evaluateSubMesh(subMesh, mesh);
  7504. }
  7505. }
  7506. };
  7507. Scene.prototype.updateTransformMatrix = function (force) {
  7508. this.setTransformMatrix(this.activeCamera.getViewMatrix(), this.activeCamera.getProjectionMatrix(force));
  7509. };
  7510. Scene.prototype._renderForCamera = function (camera) {
  7511. var engine = this._engine;
  7512. this.activeCamera = camera;
  7513. if (!this.activeCamera)
  7514. throw new Error("Active camera not set");
  7515. BABYLON.Tools.StartPerformanceCounter("Rendering camera " + this.activeCamera.name);
  7516. // Viewport
  7517. engine.setViewport(this.activeCamera.viewport);
  7518. // Camera
  7519. this._renderId++;
  7520. this.updateTransformMatrix();
  7521. if (this.beforeCameraRender) {
  7522. this.beforeCameraRender(this.activeCamera);
  7523. }
  7524. // Meshes
  7525. var beforeEvaluateActiveMeshesDate = BABYLON.Tools.Now;
  7526. BABYLON.Tools.StartPerformanceCounter("Active meshes evaluation");
  7527. this._evaluateActiveMeshes();
  7528. this._evaluateActiveMeshesDuration += BABYLON.Tools.Now - beforeEvaluateActiveMeshesDate;
  7529. BABYLON.Tools.EndPerformanceCounter("Active meshes evaluation");
  7530. for (var skeletonIndex = 0; skeletonIndex < this._activeSkeletons.length; skeletonIndex++) {
  7531. var skeleton = this._activeSkeletons.data[skeletonIndex];
  7532. skeleton.prepare();
  7533. this._activeBones += skeleton.bones.length;
  7534. }
  7535. // Render targets
  7536. var beforeRenderTargetDate = BABYLON.Tools.Now;
  7537. if (this.renderTargetsEnabled) {
  7538. BABYLON.Tools.StartPerformanceCounter("Render targets", this._renderTargets.length > 0);
  7539. for (var renderIndex = 0; renderIndex < this._renderTargets.length; renderIndex++) {
  7540. var renderTarget = this._renderTargets.data[renderIndex];
  7541. if (renderTarget._shouldRender()) {
  7542. this._renderId++;
  7543. renderTarget.render();
  7544. }
  7545. }
  7546. BABYLON.Tools.EndPerformanceCounter("Render targets", this._renderTargets.length > 0);
  7547. this._renderId++;
  7548. }
  7549. if (this._renderTargets.length > 0) {
  7550. engine.restoreDefaultFramebuffer();
  7551. }
  7552. this._renderTargetsDuration += BABYLON.Tools.Now - beforeRenderTargetDate;
  7553. // Prepare Frame
  7554. this.postProcessManager._prepareFrame();
  7555. var beforeRenderDate = BABYLON.Tools.Now;
  7556. // Backgrounds
  7557. if (this.layers.length) {
  7558. engine.setDepthBuffer(false);
  7559. var layerIndex;
  7560. var layer;
  7561. for (layerIndex = 0; layerIndex < this.layers.length; layerIndex++) {
  7562. layer = this.layers[layerIndex];
  7563. if (layer.isBackground) {
  7564. layer.render();
  7565. }
  7566. }
  7567. engine.setDepthBuffer(true);
  7568. }
  7569. // Render
  7570. BABYLON.Tools.StartPerformanceCounter("Main render");
  7571. this._renderingManager.render(null, null, true, true);
  7572. BABYLON.Tools.EndPerformanceCounter("Main render");
  7573. // Bounding boxes
  7574. this._boundingBoxRenderer.render();
  7575. // Lens flares
  7576. if (this.lensFlaresEnabled) {
  7577. BABYLON.Tools.StartPerformanceCounter("Lens flares", this.lensFlareSystems.length > 0);
  7578. for (var lensFlareSystemIndex = 0; lensFlareSystemIndex < this.lensFlareSystems.length; lensFlareSystemIndex++) {
  7579. this.lensFlareSystems[lensFlareSystemIndex].render();
  7580. }
  7581. BABYLON.Tools.EndPerformanceCounter("Lens flares", this.lensFlareSystems.length > 0);
  7582. }
  7583. // Foregrounds
  7584. if (this.layers.length) {
  7585. engine.setDepthBuffer(false);
  7586. for (layerIndex = 0; layerIndex < this.layers.length; layerIndex++) {
  7587. layer = this.layers[layerIndex];
  7588. if (!layer.isBackground) {
  7589. layer.render();
  7590. }
  7591. }
  7592. engine.setDepthBuffer(true);
  7593. }
  7594. this._renderDuration += BABYLON.Tools.Now - beforeRenderDate;
  7595. // Finalize frame
  7596. this.postProcessManager._finalizeFrame(camera.isIntermediate);
  7597. // Update camera
  7598. this.activeCamera._updateFromScene();
  7599. // Reset some special arrays
  7600. this._renderTargets.reset();
  7601. if (this.afterCameraRender) {
  7602. this.afterCameraRender(this.activeCamera);
  7603. }
  7604. BABYLON.Tools.EndPerformanceCounter("Rendering camera " + this.activeCamera.name);
  7605. };
  7606. Scene.prototype._processSubCameras = function (camera) {
  7607. if (camera.subCameras.length === 0) {
  7608. this._renderForCamera(camera);
  7609. return;
  7610. }
  7611. for (var index = 0; index < camera.subCameras.length; index++) {
  7612. this._renderForCamera(camera.subCameras[index]);
  7613. }
  7614. this.activeCamera = camera;
  7615. this.setTransformMatrix(this.activeCamera.getViewMatrix(), this.activeCamera.getProjectionMatrix());
  7616. // Update camera
  7617. this.activeCamera._updateFromScene();
  7618. };
  7619. Scene.prototype._checkIntersections = function () {
  7620. for (var index = 0; index < this._meshesForIntersections.length; index++) {
  7621. var sourceMesh = this._meshesForIntersections.data[index];
  7622. for (var actionIndex = 0; actionIndex < sourceMesh.actionManager.actions.length; actionIndex++) {
  7623. var action = sourceMesh.actionManager.actions[actionIndex];
  7624. if (action.trigger === BABYLON.ActionManager.OnIntersectionEnterTrigger || action.trigger === BABYLON.ActionManager.OnIntersectionExitTrigger) {
  7625. var otherMesh = action.getTriggerParameter();
  7626. var areIntersecting = otherMesh.intersectsMesh(sourceMesh, false);
  7627. var currentIntersectionInProgress = sourceMesh._intersectionsInProgress.indexOf(otherMesh);
  7628. if (areIntersecting && currentIntersectionInProgress === -1 && action.trigger === BABYLON.ActionManager.OnIntersectionEnterTrigger) {
  7629. action._executeCurrent(BABYLON.ActionEvent.CreateNew(sourceMesh));
  7630. sourceMesh._intersectionsInProgress.push(otherMesh);
  7631. } else if (!areIntersecting && currentIntersectionInProgress > -1 && action.trigger === BABYLON.ActionManager.OnIntersectionExitTrigger) {
  7632. action._executeCurrent(BABYLON.ActionEvent.CreateNew(sourceMesh));
  7633. var indexOfOther = sourceMesh._intersectionsInProgress.indexOf(otherMesh);
  7634. if (indexOfOther > -1) {
  7635. sourceMesh._intersectionsInProgress.splice(indexOfOther, 1);
  7636. }
  7637. }
  7638. }
  7639. }
  7640. }
  7641. };
  7642. Scene.prototype.render = function () {
  7643. var startDate = BABYLON.Tools.Now;
  7644. this._particlesDuration = 0;
  7645. this._spritesDuration = 0;
  7646. this._activeParticles = 0;
  7647. this._renderDuration = 0;
  7648. this._renderTargetsDuration = 0;
  7649. this._evaluateActiveMeshesDuration = 0;
  7650. this._totalVertices = 0;
  7651. this._activeVertices = 0;
  7652. this._activeBones = 0;
  7653. this.getEngine().resetDrawCalls();
  7654. this._meshesForIntersections.reset();
  7655. this.resetCachedMaterial();
  7656. BABYLON.Tools.StartPerformanceCounter("Scene rendering");
  7657. // Actions
  7658. if (this.actionManager) {
  7659. this.actionManager.processTrigger(BABYLON.ActionManager.OnEveryFrameTrigger, null);
  7660. }
  7661. // Before render
  7662. if (this.beforeRender) {
  7663. this.beforeRender();
  7664. }
  7665. for (var callbackIndex = 0; callbackIndex < this._onBeforeRenderCallbacks.length; callbackIndex++) {
  7666. this._onBeforeRenderCallbacks[callbackIndex]();
  7667. }
  7668. // Animations
  7669. var deltaTime = Math.max(Scene.MinDeltaTime, Math.min(this._engine.getDeltaTime(), Scene.MaxDeltaTime));
  7670. this._animationRatio = deltaTime * (60.0 / 1000.0);
  7671. this._animate();
  7672. // Physics
  7673. if (this._physicsEngine) {
  7674. BABYLON.Tools.StartPerformanceCounter("Physics");
  7675. this._physicsEngine._runOneStep(deltaTime / 1000.0);
  7676. BABYLON.Tools.EndPerformanceCounter("Physics");
  7677. }
  7678. // Customs render targets
  7679. var beforeRenderTargetDate = BABYLON.Tools.Now;
  7680. var engine = this.getEngine();
  7681. if (this.renderTargetsEnabled) {
  7682. BABYLON.Tools.StartPerformanceCounter("Custom render targets", this.customRenderTargets.length > 0);
  7683. for (var customIndex = 0; customIndex < this.customRenderTargets.length; customIndex++) {
  7684. var renderTarget = this.customRenderTargets[customIndex];
  7685. if (renderTarget._shouldRender()) {
  7686. this._renderId++;
  7687. this.activeCamera = renderTarget.activeCamera || this.activeCamera;
  7688. if (!this.activeCamera)
  7689. throw new Error("Active camera not set");
  7690. // Viewport
  7691. engine.setViewport(this.activeCamera.viewport);
  7692. // Camera
  7693. this.updateTransformMatrix();
  7694. renderTarget.render();
  7695. }
  7696. }
  7697. BABYLON.Tools.EndPerformanceCounter("Custom render targets", this.customRenderTargets.length > 0);
  7698. this._renderId++;
  7699. }
  7700. if (this.customRenderTargets.length > 0) {
  7701. engine.restoreDefaultFramebuffer();
  7702. }
  7703. this._renderTargetsDuration += BABYLON.Tools.Now - beforeRenderTargetDate;
  7704. // Procedural textures
  7705. if (this.proceduralTexturesEnabled) {
  7706. BABYLON.Tools.StartPerformanceCounter("Procedural textures", this._proceduralTextures.length > 0);
  7707. for (var proceduralIndex = 0; proceduralIndex < this._proceduralTextures.length; proceduralIndex++) {
  7708. var proceduralTexture = this._proceduralTextures[proceduralIndex];
  7709. if (proceduralTexture._shouldRender()) {
  7710. proceduralTexture.render();
  7711. }
  7712. }
  7713. BABYLON.Tools.EndPerformanceCounter("Procedural textures", this._proceduralTextures.length > 0);
  7714. }
  7715. // Clear
  7716. this._engine.clear(this.clearColor, this.autoClear || this.forceWireframe || this.forcePointsCloud, true);
  7717. // Shadows
  7718. if (this.shadowsEnabled) {
  7719. for (var lightIndex = 0; lightIndex < this.lights.length; lightIndex++) {
  7720. var light = this.lights[lightIndex];
  7721. var shadowGenerator = light.getShadowGenerator();
  7722. if (light.isEnabled() && shadowGenerator && shadowGenerator.getShadowMap().getScene().textures.indexOf(shadowGenerator.getShadowMap()) !== -1) {
  7723. this._renderTargets.push(shadowGenerator.getShadowMap());
  7724. }
  7725. }
  7726. }
  7727. // RenderPipeline
  7728. this.postProcessRenderPipelineManager.update();
  7729. // Multi-cameras?
  7730. if (this.activeCameras.length > 0) {
  7731. var currentRenderId = this._renderId;
  7732. for (var cameraIndex = 0; cameraIndex < this.activeCameras.length; cameraIndex++) {
  7733. this._renderId = currentRenderId;
  7734. this._processSubCameras(this.activeCameras[cameraIndex]);
  7735. }
  7736. } else {
  7737. if (!this.activeCamera) {
  7738. throw new Error("No camera defined");
  7739. }
  7740. this._processSubCameras(this.activeCamera);
  7741. }
  7742. // Intersection checks
  7743. this._checkIntersections();
  7744. // Update the audio listener attached to the camera
  7745. this._updateAudioParameters();
  7746. // After render
  7747. if (this.afterRender) {
  7748. this.afterRender();
  7749. }
  7750. for (callbackIndex = 0; callbackIndex < this._onAfterRenderCallbacks.length; callbackIndex++) {
  7751. this._onAfterRenderCallbacks[callbackIndex]();
  7752. }
  7753. for (var index = 0; index < this._toBeDisposed.length; index++) {
  7754. this._toBeDisposed.data[index].dispose();
  7755. this._toBeDisposed[index] = null;
  7756. }
  7757. this._toBeDisposed.reset();
  7758. BABYLON.Tools.EndPerformanceCounter("Scene rendering");
  7759. this._lastFrameDuration = BABYLON.Tools.Now - startDate;
  7760. };
  7761. Scene.prototype._updateAudioParameters = function () {
  7762. var listeningCamera;
  7763. var audioEngine = this._engine.getAudioEngine();
  7764. if (this.activeCameras.length > 0) {
  7765. listeningCamera = this.activeCameras[0];
  7766. } else {
  7767. listeningCamera = this.activeCamera;
  7768. }
  7769. if (listeningCamera && audioEngine.canUseWebAudio) {
  7770. audioEngine.audioContext.listener.setPosition(listeningCamera.position.x, listeningCamera.position.y, listeningCamera.position.z);
  7771. var mat = BABYLON.Matrix.Invert(listeningCamera.getViewMatrix());
  7772. var cameraDirection = BABYLON.Vector3.TransformNormal(new BABYLON.Vector3(0, 0, -1), mat);
  7773. cameraDirection.normalize();
  7774. audioEngine.audioContext.listener.setOrientation(cameraDirection.x, cameraDirection.y, cameraDirection.z, 0, 1, 0);
  7775. for (var i = 0; i < this.mainSoundTrack.soundCollection.length; i++) {
  7776. var sound = this.mainSoundTrack.soundCollection[i];
  7777. if (sound.useBabylonJSAttenuation) {
  7778. sound.updateDistanceFromListener();
  7779. }
  7780. }
  7781. for (var i = 0; i < this.soundTracks.length; i++) {
  7782. for (var j = 0; i < this.soundTracks[i].soundCollection.length; j++) {
  7783. var sound = this.soundTracks[i].soundCollection[j];
  7784. if (sound.useBabylonJSAttenuation) {
  7785. sound.updateDistanceFromListener();
  7786. }
  7787. }
  7788. }
  7789. }
  7790. };
  7791. Scene.prototype.dispose = function () {
  7792. this.beforeRender = null;
  7793. this.afterRender = null;
  7794. this.skeletons = [];
  7795. this._boundingBoxRenderer.dispose();
  7796. // Debug layer
  7797. this.debugLayer.hide();
  7798. // Events
  7799. if (this.onDispose) {
  7800. this.onDispose();
  7801. }
  7802. this._onBeforeRenderCallbacks = [];
  7803. this._onAfterRenderCallbacks = [];
  7804. this.detachControl();
  7805. // Detach cameras
  7806. var canvas = this._engine.getRenderingCanvas();
  7807. var index;
  7808. for (index = 0; index < this.cameras.length; index++) {
  7809. this.cameras[index].detachControl(canvas);
  7810. }
  7811. while (this.lights.length) {
  7812. this.lights[0].dispose();
  7813. }
  7814. while (this.meshes.length) {
  7815. this.meshes[0].dispose(true);
  7816. }
  7817. while (this.cameras.length) {
  7818. this.cameras[0].dispose();
  7819. }
  7820. while (this.materials.length) {
  7821. this.materials[0].dispose();
  7822. }
  7823. while (this.particleSystems.length) {
  7824. this.particleSystems[0].dispose();
  7825. }
  7826. while (this.spriteManagers.length) {
  7827. this.spriteManagers[0].dispose();
  7828. }
  7829. while (this.layers.length) {
  7830. this.layers[0].dispose();
  7831. }
  7832. while (this.textures.length) {
  7833. this.textures[0].dispose();
  7834. }
  7835. // Post-processes
  7836. this.postProcessManager.dispose();
  7837. // Physics
  7838. if (this._physicsEngine) {
  7839. this.disablePhysicsEngine();
  7840. }
  7841. // Remove from engine
  7842. index = this._engine.scenes.indexOf(this);
  7843. if (index > -1) {
  7844. this._engine.scenes.splice(index, 1);
  7845. }
  7846. this._engine.wipeCaches();
  7847. };
  7848. // Collisions
  7849. Scene.prototype._getNewPosition = function (position, velocity, collider, maximumRetry, finalPosition, excludedMesh) {
  7850. if (typeof excludedMesh === "undefined") { excludedMesh = null; }
  7851. position.divideToRef(collider.radius, this._scaledPosition);
  7852. velocity.divideToRef(collider.radius, this._scaledVelocity);
  7853. collider.retry = 0;
  7854. collider.initialVelocity = this._scaledVelocity;
  7855. collider.initialPosition = this._scaledPosition;
  7856. this._collideWithWorld(this._scaledPosition, this._scaledVelocity, collider, maximumRetry, finalPosition, excludedMesh);
  7857. finalPosition.multiplyInPlace(collider.radius);
  7858. };
  7859. Scene.prototype._collideWithWorld = function (position, velocity, collider, maximumRetry, finalPosition, excludedMesh) {
  7860. if (typeof excludedMesh === "undefined") { excludedMesh = null; }
  7861. var closeDistance = BABYLON.Engine.CollisionsEpsilon * 10.0;
  7862. if (collider.retry >= maximumRetry) {
  7863. finalPosition.copyFrom(position);
  7864. return;
  7865. }
  7866. collider._initialize(position, velocity, closeDistance);
  7867. for (var index = 0; index < this.meshes.length; index++) {
  7868. var mesh = this.meshes[index];
  7869. if (mesh.isEnabled() && mesh.checkCollisions && mesh.subMeshes && mesh !== excludedMesh) {
  7870. mesh._checkCollision(collider);
  7871. }
  7872. }
  7873. if (!collider.collisionFound) {
  7874. position.addToRef(velocity, finalPosition);
  7875. return;
  7876. }
  7877. if (velocity.x !== 0 || velocity.y !== 0 || velocity.z !== 0) {
  7878. collider._getResponse(position, velocity);
  7879. }
  7880. if (velocity.length() <= closeDistance) {
  7881. finalPosition.copyFrom(position);
  7882. return;
  7883. }
  7884. collider.retry++;
  7885. this._collideWithWorld(position, velocity, collider, maximumRetry, finalPosition, excludedMesh);
  7886. };
  7887. // Octrees
  7888. Scene.prototype.createOrUpdateSelectionOctree = function (maxCapacity, maxDepth) {
  7889. if (typeof maxCapacity === "undefined") { maxCapacity = 64; }
  7890. if (typeof maxDepth === "undefined") { maxDepth = 2; }
  7891. if (!this._selectionOctree) {
  7892. this._selectionOctree = new BABYLON.Octree(BABYLON.Octree.CreationFuncForMeshes, maxCapacity, maxDepth);
  7893. }
  7894. var min = new BABYLON.Vector3(Number.MAX_VALUE, Number.MAX_VALUE, Number.MAX_VALUE);
  7895. var max = new BABYLON.Vector3(-Number.MAX_VALUE, -Number.MAX_VALUE, -Number.MAX_VALUE);
  7896. for (var index = 0; index < this.meshes.length; index++) {
  7897. var mesh = this.meshes[index];
  7898. mesh.computeWorldMatrix(true);
  7899. var minBox = mesh.getBoundingInfo().boundingBox.minimumWorld;
  7900. var maxBox = mesh.getBoundingInfo().boundingBox.maximumWorld;
  7901. BABYLON.Tools.CheckExtends(minBox, min, max);
  7902. BABYLON.Tools.CheckExtends(maxBox, min, max);
  7903. }
  7904. // Update octree
  7905. this._selectionOctree.update(min, max, this.meshes);
  7906. return this._selectionOctree;
  7907. };
  7908. // Picking
  7909. Scene.prototype.createPickingRay = function (x, y, world, camera) {
  7910. var engine = this._engine;
  7911. if (!camera) {
  7912. if (!this.activeCamera)
  7913. throw new Error("Active camera not set");
  7914. camera = this.activeCamera;
  7915. }
  7916. var cameraViewport = camera.viewport;
  7917. var viewport = cameraViewport.toGlobal(engine);
  7918. // Moving coordinates to local viewport world
  7919. x = x / this._engine.getHardwareScalingLevel() - viewport.x;
  7920. y = y / this._engine.getHardwareScalingLevel() - (this._engine.getRenderHeight() - viewport.y - viewport.height);
  7921. return BABYLON.Ray.CreateNew(x, y, viewport.width, viewport.height, world ? world : BABYLON.Matrix.Identity(), camera.getViewMatrix(), camera.getProjectionMatrix());
  7922. // return BABYLON.Ray.CreateNew(x / window.devicePixelRatio, y / window.devicePixelRatio, viewport.width, viewport.height, world ? world : BABYLON.Matrix.Identity(), camera.getViewMatrix(), camera.getProjectionMatrix());
  7923. };
  7924. Scene.prototype._internalPick = function (rayFunction, predicate, fastCheck) {
  7925. var pickingInfo = null;
  7926. for (var meshIndex = 0; meshIndex < this.meshes.length; meshIndex++) {
  7927. var mesh = this.meshes[meshIndex];
  7928. if (predicate) {
  7929. if (!predicate(mesh)) {
  7930. continue;
  7931. }
  7932. } else if (!mesh.isEnabled() || !mesh.isVisible || !mesh.isPickable) {
  7933. continue;
  7934. }
  7935. var world = mesh.getWorldMatrix();
  7936. var ray = rayFunction(world);
  7937. var result = mesh.intersects(ray, fastCheck);
  7938. if (!result || !result.hit)
  7939. continue;
  7940. if (!fastCheck && pickingInfo != null && result.distance >= pickingInfo.distance)
  7941. continue;
  7942. pickingInfo = result;
  7943. if (fastCheck) {
  7944. break;
  7945. }
  7946. }
  7947. return pickingInfo || new BABYLON.PickingInfo();
  7948. };
  7949. Scene.prototype.pick = function (x, y, predicate, fastCheck, camera) {
  7950. var _this = this;
  7951. /// <summary>Launch a ray to try to pick a mesh in the scene</summary>
  7952. /// <param name="x">X position on screen</param>
  7953. /// <param name="y">Y position on screen</param>
  7954. /// <param name="predicate">Predicate function used to determine eligible meshes. Can be set to null. In this case, a mesh must be enabled, visible and with isPickable set to true</param>
  7955. /// <param name="fastCheck">Launch a fast check only using the bounding boxes. Can be set to null.</param>
  7956. /// <param name="camera">camera to use for computing the picking ray. Can be set to null. In this case, the scene.activeCamera will be used</param>
  7957. return this._internalPick(function (world) {
  7958. return _this.createPickingRay(x, y, world, camera);
  7959. }, predicate, fastCheck);
  7960. };
  7961. Scene.prototype.pickWithRay = function (ray, predicate, fastCheck) {
  7962. var _this = this;
  7963. return this._internalPick(function (world) {
  7964. if (!_this._pickWithRayInverseMatrix) {
  7965. _this._pickWithRayInverseMatrix = BABYLON.Matrix.Identity();
  7966. }
  7967. world.invertToRef(_this._pickWithRayInverseMatrix);
  7968. return BABYLON.Ray.Transform(ray, _this._pickWithRayInverseMatrix);
  7969. }, predicate, fastCheck);
  7970. };
  7971. Scene.prototype.setPointerOverMesh = function (mesh) {
  7972. if (this._pointerOverMesh === mesh) {
  7973. return;
  7974. }
  7975. if (this._pointerOverMesh && this._pointerOverMesh.actionManager) {
  7976. this._pointerOverMesh.actionManager.processTrigger(BABYLON.ActionManager.OnPointerOutTrigger, BABYLON.ActionEvent.CreateNew(this._pointerOverMesh));
  7977. }
  7978. this._pointerOverMesh = mesh;
  7979. if (this._pointerOverMesh && this._pointerOverMesh.actionManager) {
  7980. this._pointerOverMesh.actionManager.processTrigger(BABYLON.ActionManager.OnPointerOverTrigger, BABYLON.ActionEvent.CreateNew(this._pointerOverMesh));
  7981. }
  7982. };
  7983. Scene.prototype.getPointerOverMesh = function () {
  7984. return this._pointerOverMesh;
  7985. };
  7986. // Physics
  7987. Scene.prototype.getPhysicsEngine = function () {
  7988. return this._physicsEngine;
  7989. };
  7990. Scene.prototype.enablePhysics = function (gravity, plugin) {
  7991. if (this._physicsEngine) {
  7992. return true;
  7993. }
  7994. this._physicsEngine = new BABYLON.PhysicsEngine(plugin);
  7995. if (!this._physicsEngine.isSupported()) {
  7996. this._physicsEngine = null;
  7997. return false;
  7998. }
  7999. this._physicsEngine._initialize(gravity);
  8000. return true;
  8001. };
  8002. Scene.prototype.disablePhysicsEngine = function () {
  8003. if (!this._physicsEngine) {
  8004. return;
  8005. }
  8006. this._physicsEngine.dispose();
  8007. this._physicsEngine = undefined;
  8008. };
  8009. Scene.prototype.isPhysicsEnabled = function () {
  8010. return this._physicsEngine !== undefined;
  8011. };
  8012. Scene.prototype.setGravity = function (gravity) {
  8013. if (!this._physicsEngine) {
  8014. return;
  8015. }
  8016. this._physicsEngine._setGravity(gravity);
  8017. };
  8018. Scene.prototype.createCompoundImpostor = function (parts, options) {
  8019. if (parts.parts) {
  8020. options = parts;
  8021. parts = parts.parts;
  8022. }
  8023. if (!this._physicsEngine) {
  8024. return null;
  8025. }
  8026. for (var index = 0; index < parts.length; index++) {
  8027. var mesh = parts[index].mesh;
  8028. mesh._physicImpostor = parts[index].impostor;
  8029. mesh._physicsMass = options.mass / parts.length;
  8030. mesh._physicsFriction = options.friction;
  8031. mesh._physicRestitution = options.restitution;
  8032. }
  8033. return this._physicsEngine._registerMeshesAsCompound(parts, options);
  8034. };
  8035. //ANY
  8036. Scene.prototype.deleteCompoundImpostor = function (compound) {
  8037. for (var index = 0; index < compound.parts.length; index++) {
  8038. var mesh = compound.parts[index].mesh;
  8039. mesh._physicImpostor = BABYLON.PhysicsEngine.NoImpostor;
  8040. this._physicsEngine._unregisterMesh(mesh);
  8041. }
  8042. };
  8043. // Tags
  8044. Scene.prototype._getByTags = function (list, tagsQuery) {
  8045. if (tagsQuery === undefined) {
  8046. // returns the complete list (could be done with BABYLON.Tags.MatchesQuery but no need to have a for-loop here)
  8047. return list;
  8048. }
  8049. var listByTags = [];
  8050. for (var i in list) {
  8051. var item = list[i];
  8052. if (BABYLON.Tags.MatchesQuery(item, tagsQuery)) {
  8053. listByTags.push(item);
  8054. }
  8055. }
  8056. return listByTags;
  8057. };
  8058. Scene.prototype.getMeshesByTags = function (tagsQuery) {
  8059. return this._getByTags(this.meshes, tagsQuery);
  8060. };
  8061. Scene.prototype.getCamerasByTags = function (tagsQuery) {
  8062. return this._getByTags(this.cameras, tagsQuery);
  8063. };
  8064. Scene.prototype.getLightsByTags = function (tagsQuery) {
  8065. return this._getByTags(this.lights, tagsQuery);
  8066. };
  8067. Scene.prototype.getMaterialByTags = function (tagsQuery) {
  8068. return this._getByTags(this.materials, tagsQuery).concat(this._getByTags(this.multiMaterials, tagsQuery));
  8069. };
  8070. Scene.FOGMODE_NONE = 0;
  8071. Scene.FOGMODE_EXP = 1;
  8072. Scene.FOGMODE_EXP2 = 2;
  8073. Scene.FOGMODE_LINEAR = 3;
  8074. Scene.MinDeltaTime = 1.0;
  8075. Scene.MaxDeltaTime = 1000.0;
  8076. return Scene;
  8077. })();
  8078. BABYLON.Scene = Scene;
  8079. })(BABYLON || (BABYLON = {}));
  8080. //# sourceMappingURL=babylon.scene.js.map
  8081. var BABYLON;
  8082. (function (BABYLON) {
  8083. var VertexBuffer = (function () {
  8084. function VertexBuffer(engine, data, kind, updatable, postponeInternalCreation, stride) {
  8085. if (engine instanceof BABYLON.Mesh) {
  8086. this._engine = engine.getScene().getEngine();
  8087. } else {
  8088. this._engine = engine;
  8089. }
  8090. this._updatable = updatable;
  8091. this._data = data;
  8092. if (!postponeInternalCreation) {
  8093. this.create();
  8094. }
  8095. this._kind = kind;
  8096. if (stride) {
  8097. this._strideSize = stride;
  8098. return;
  8099. }
  8100. switch (kind) {
  8101. case VertexBuffer.PositionKind:
  8102. this._strideSize = 3;
  8103. break;
  8104. case VertexBuffer.NormalKind:
  8105. this._strideSize = 3;
  8106. break;
  8107. case VertexBuffer.UVKind:
  8108. this._strideSize = 2;
  8109. break;
  8110. case VertexBuffer.UV2Kind:
  8111. this._strideSize = 2;
  8112. break;
  8113. case VertexBuffer.ColorKind:
  8114. this._strideSize = 4;
  8115. break;
  8116. case VertexBuffer.MatricesIndicesKind:
  8117. this._strideSize = 4;
  8118. break;
  8119. case VertexBuffer.MatricesWeightsKind:
  8120. this._strideSize = 4;
  8121. break;
  8122. }
  8123. }
  8124. // Properties
  8125. VertexBuffer.prototype.isUpdatable = function () {
  8126. return this._updatable;
  8127. };
  8128. VertexBuffer.prototype.getData = function () {
  8129. return this._data;
  8130. };
  8131. VertexBuffer.prototype.getBuffer = function () {
  8132. return this._buffer;
  8133. };
  8134. VertexBuffer.prototype.getStrideSize = function () {
  8135. return this._strideSize;
  8136. };
  8137. // Methods
  8138. VertexBuffer.prototype.create = function (data) {
  8139. if (!data && this._buffer) {
  8140. return;
  8141. }
  8142. data = data || this._data;
  8143. if (!this._buffer) {
  8144. if (this._updatable) {
  8145. this._buffer = this._engine.createDynamicVertexBuffer(data.length * 4);
  8146. } else {
  8147. this._buffer = this._engine.createVertexBuffer(data);
  8148. }
  8149. }
  8150. if (this._updatable) {
  8151. this._engine.updateDynamicVertexBuffer(this._buffer, data);
  8152. this._data = data;
  8153. }
  8154. };
  8155. VertexBuffer.prototype.update = function (data) {
  8156. this.create(data);
  8157. };
  8158. VertexBuffer.prototype.updateDirectly = function (data, offset) {
  8159. if (!this._buffer) {
  8160. return;
  8161. }
  8162. if (this._updatable) {
  8163. this._engine.updateDynamicVertexBuffer(this._buffer, data, offset);
  8164. this._data = null;
  8165. }
  8166. };
  8167. VertexBuffer.prototype.dispose = function () {
  8168. if (!this._buffer) {
  8169. return;
  8170. }
  8171. if (this._engine._releaseBuffer(this._buffer)) {
  8172. this._buffer = null;
  8173. }
  8174. };
  8175. Object.defineProperty(VertexBuffer, "PositionKind", {
  8176. get: function () {
  8177. return VertexBuffer._PositionKind;
  8178. },
  8179. enumerable: true,
  8180. configurable: true
  8181. });
  8182. Object.defineProperty(VertexBuffer, "NormalKind", {
  8183. get: function () {
  8184. return VertexBuffer._NormalKind;
  8185. },
  8186. enumerable: true,
  8187. configurable: true
  8188. });
  8189. Object.defineProperty(VertexBuffer, "UVKind", {
  8190. get: function () {
  8191. return VertexBuffer._UVKind;
  8192. },
  8193. enumerable: true,
  8194. configurable: true
  8195. });
  8196. Object.defineProperty(VertexBuffer, "UV2Kind", {
  8197. get: function () {
  8198. return VertexBuffer._UV2Kind;
  8199. },
  8200. enumerable: true,
  8201. configurable: true
  8202. });
  8203. Object.defineProperty(VertexBuffer, "ColorKind", {
  8204. get: function () {
  8205. return VertexBuffer._ColorKind;
  8206. },
  8207. enumerable: true,
  8208. configurable: true
  8209. });
  8210. Object.defineProperty(VertexBuffer, "MatricesIndicesKind", {
  8211. get: function () {
  8212. return VertexBuffer._MatricesIndicesKind;
  8213. },
  8214. enumerable: true,
  8215. configurable: true
  8216. });
  8217. Object.defineProperty(VertexBuffer, "MatricesWeightsKind", {
  8218. get: function () {
  8219. return VertexBuffer._MatricesWeightsKind;
  8220. },
  8221. enumerable: true,
  8222. configurable: true
  8223. });
  8224. VertexBuffer._PositionKind = "position";
  8225. VertexBuffer._NormalKind = "normal";
  8226. VertexBuffer._UVKind = "uv";
  8227. VertexBuffer._UV2Kind = "uv2";
  8228. VertexBuffer._ColorKind = "color";
  8229. VertexBuffer._MatricesIndicesKind = "matricesIndices";
  8230. VertexBuffer._MatricesWeightsKind = "matricesWeights";
  8231. return VertexBuffer;
  8232. })();
  8233. BABYLON.VertexBuffer = VertexBuffer;
  8234. })(BABYLON || (BABYLON = {}));
  8235. //# sourceMappingURL=babylon.vertexBuffer.js.map
  8236. var BABYLON;
  8237. (function (BABYLON) {
  8238. var AbstractMesh = (function (_super) {
  8239. __extends(AbstractMesh, _super);
  8240. function AbstractMesh(name, scene) {
  8241. _super.call(this, name, scene);
  8242. // Properties
  8243. this.position = new BABYLON.Vector3(0, 0, 0);
  8244. this.rotation = new BABYLON.Vector3(0, 0, 0);
  8245. this.scaling = new BABYLON.Vector3(1, 1, 1);
  8246. this.billboardMode = AbstractMesh.BILLBOARDMODE_NONE;
  8247. this.visibility = 1.0;
  8248. this.alphaIndex = Number.MAX_VALUE;
  8249. this.infiniteDistance = false;
  8250. this.isVisible = true;
  8251. this.isPickable = true;
  8252. this.showBoundingBox = false;
  8253. this.showSubMeshesBoundingBox = false;
  8254. this.onDispose = null;
  8255. this.checkCollisions = false;
  8256. this.isBlocker = false;
  8257. this.renderingGroupId = 0;
  8258. this.receiveShadows = false;
  8259. this.renderOutline = false;
  8260. this.outlineColor = BABYLON.Color3.Red();
  8261. this.outlineWidth = 0.02;
  8262. this.renderOverlay = false;
  8263. this.overlayColor = BABYLON.Color3.Red();
  8264. this.overlayAlpha = 0.5;
  8265. this.hasVertexAlpha = false;
  8266. this.useVertexColors = true;
  8267. this.applyFog = true;
  8268. this.useOctreeForRenderingSelection = true;
  8269. this.useOctreeForPicking = true;
  8270. this.useOctreeForCollisions = true;
  8271. this.layerMask = 0xFFFFFFFF;
  8272. // Physics
  8273. this._physicImpostor = BABYLON.PhysicsEngine.NoImpostor;
  8274. // Collisions
  8275. this.ellipsoid = new BABYLON.Vector3(0.5, 1, 0.5);
  8276. this.ellipsoidOffset = new BABYLON.Vector3(0, 0, 0);
  8277. this._collider = new BABYLON.Collider();
  8278. this._oldPositionForCollisions = new BABYLON.Vector3(0, 0, 0);
  8279. this._diffPositionForCollisions = new BABYLON.Vector3(0, 0, 0);
  8280. this._newPositionForCollisions = new BABYLON.Vector3(0, 0, 0);
  8281. // Cache
  8282. this._localScaling = BABYLON.Matrix.Zero();
  8283. this._localRotation = BABYLON.Matrix.Zero();
  8284. this._localTranslation = BABYLON.Matrix.Zero();
  8285. this._localBillboard = BABYLON.Matrix.Zero();
  8286. this._localPivotScaling = BABYLON.Matrix.Zero();
  8287. this._localPivotScalingRotation = BABYLON.Matrix.Zero();
  8288. this._localWorld = BABYLON.Matrix.Zero();
  8289. this._worldMatrix = BABYLON.Matrix.Zero();
  8290. this._rotateYByPI = BABYLON.Matrix.RotationY(Math.PI);
  8291. this._absolutePosition = BABYLON.Vector3.Zero();
  8292. this._collisionsTransformMatrix = BABYLON.Matrix.Zero();
  8293. this._collisionsScalingMatrix = BABYLON.Matrix.Zero();
  8294. this._isDirty = false;
  8295. this._pivotMatrix = BABYLON.Matrix.Identity();
  8296. this._isDisposed = false;
  8297. this._renderId = 0;
  8298. this._intersectionsInProgress = new Array();
  8299. this._onAfterWorldMatrixUpdate = new Array();
  8300. scene.meshes.push(this);
  8301. }
  8302. Object.defineProperty(AbstractMesh, "BILLBOARDMODE_NONE", {
  8303. get: function () {
  8304. return AbstractMesh._BILLBOARDMODE_NONE;
  8305. },
  8306. enumerable: true,
  8307. configurable: true
  8308. });
  8309. Object.defineProperty(AbstractMesh, "BILLBOARDMODE_X", {
  8310. get: function () {
  8311. return AbstractMesh._BILLBOARDMODE_X;
  8312. },
  8313. enumerable: true,
  8314. configurable: true
  8315. });
  8316. Object.defineProperty(AbstractMesh, "BILLBOARDMODE_Y", {
  8317. get: function () {
  8318. return AbstractMesh._BILLBOARDMODE_Y;
  8319. },
  8320. enumerable: true,
  8321. configurable: true
  8322. });
  8323. Object.defineProperty(AbstractMesh, "BILLBOARDMODE_Z", {
  8324. get: function () {
  8325. return AbstractMesh._BILLBOARDMODE_Z;
  8326. },
  8327. enumerable: true,
  8328. configurable: true
  8329. });
  8330. Object.defineProperty(AbstractMesh, "BILLBOARDMODE_ALL", {
  8331. get: function () {
  8332. return AbstractMesh._BILLBOARDMODE_ALL;
  8333. },
  8334. enumerable: true,
  8335. configurable: true
  8336. });
  8337. Object.defineProperty(AbstractMesh.prototype, "isBlocked", {
  8338. // Methods
  8339. get: function () {
  8340. return false;
  8341. },
  8342. enumerable: true,
  8343. configurable: true
  8344. });
  8345. AbstractMesh.prototype.getLOD = function (camera) {
  8346. return this;
  8347. };
  8348. AbstractMesh.prototype.getTotalVertices = function () {
  8349. return 0;
  8350. };
  8351. AbstractMesh.prototype.getIndices = function () {
  8352. return null;
  8353. };
  8354. AbstractMesh.prototype.getVerticesData = function (kind) {
  8355. return null;
  8356. };
  8357. AbstractMesh.prototype.isVerticesDataPresent = function (kind) {
  8358. return false;
  8359. };
  8360. AbstractMesh.prototype.getBoundingInfo = function () {
  8361. if (this._masterMesh) {
  8362. return this._masterMesh.getBoundingInfo();
  8363. }
  8364. if (!this._boundingInfo) {
  8365. this._updateBoundingInfo();
  8366. }
  8367. return this._boundingInfo;
  8368. };
  8369. AbstractMesh.prototype._preActivate = function () {
  8370. };
  8371. AbstractMesh.prototype._activate = function (renderId) {
  8372. this._renderId = renderId;
  8373. };
  8374. AbstractMesh.prototype.getWorldMatrix = function () {
  8375. if (this._masterMesh) {
  8376. return this._masterMesh.getWorldMatrix();
  8377. }
  8378. if (this._currentRenderId !== this.getScene().getRenderId()) {
  8379. this.computeWorldMatrix();
  8380. }
  8381. return this._worldMatrix;
  8382. };
  8383. Object.defineProperty(AbstractMesh.prototype, "worldMatrixFromCache", {
  8384. get: function () {
  8385. return this._worldMatrix;
  8386. },
  8387. enumerable: true,
  8388. configurable: true
  8389. });
  8390. Object.defineProperty(AbstractMesh.prototype, "absolutePosition", {
  8391. get: function () {
  8392. return this._absolutePosition;
  8393. },
  8394. enumerable: true,
  8395. configurable: true
  8396. });
  8397. AbstractMesh.prototype.rotate = function (axis, amount, space) {
  8398. if (!this.rotationQuaternion) {
  8399. this.rotationQuaternion = BABYLON.Quaternion.RotationYawPitchRoll(this.rotation.y, this.rotation.x, this.rotation.z);
  8400. this.rotation = BABYLON.Vector3.Zero();
  8401. }
  8402. if (!space || space == 0 /* LOCAL */) {
  8403. var rotationQuaternion = BABYLON.Quaternion.RotationAxis(axis, amount);
  8404. this.rotationQuaternion = this.rotationQuaternion.multiply(rotationQuaternion);
  8405. } else {
  8406. if (this.parent) {
  8407. var invertParentWorldMatrix = this.parent.getWorldMatrix().clone();
  8408. invertParentWorldMatrix.invert();
  8409. axis = BABYLON.Vector3.TransformNormal(axis, invertParentWorldMatrix);
  8410. }
  8411. rotationQuaternion = BABYLON.Quaternion.RotationAxis(axis, amount);
  8412. this.rotationQuaternion = rotationQuaternion.multiply(this.rotationQuaternion);
  8413. }
  8414. };
  8415. AbstractMesh.prototype.translate = function (axis, distance, space) {
  8416. var displacementVector = axis.scale(distance);
  8417. if (!space || space == 0 /* LOCAL */) {
  8418. var tempV3 = this.getPositionExpressedInLocalSpace().add(displacementVector);
  8419. this.setPositionWithLocalVector(tempV3);
  8420. } else {
  8421. this.setAbsolutePosition(this.getAbsolutePosition().add(displacementVector));
  8422. }
  8423. };
  8424. AbstractMesh.prototype.getAbsolutePosition = function () {
  8425. this.computeWorldMatrix();
  8426. return this._absolutePosition;
  8427. };
  8428. AbstractMesh.prototype.setAbsolutePosition = function (absolutePosition) {
  8429. if (!absolutePosition) {
  8430. return;
  8431. }
  8432. var absolutePositionX;
  8433. var absolutePositionY;
  8434. var absolutePositionZ;
  8435. if (absolutePosition.x === undefined) {
  8436. if (arguments.length < 3) {
  8437. return;
  8438. }
  8439. absolutePositionX = arguments[0];
  8440. absolutePositionY = arguments[1];
  8441. absolutePositionZ = arguments[2];
  8442. } else {
  8443. absolutePositionX = absolutePosition.x;
  8444. absolutePositionY = absolutePosition.y;
  8445. absolutePositionZ = absolutePosition.z;
  8446. }
  8447. if (this.parent) {
  8448. var invertParentWorldMatrix = this.parent.getWorldMatrix().clone();
  8449. invertParentWorldMatrix.invert();
  8450. var worldPosition = new BABYLON.Vector3(absolutePositionX, absolutePositionY, absolutePositionZ);
  8451. this.position = BABYLON.Vector3.TransformCoordinates(worldPosition, invertParentWorldMatrix);
  8452. } else {
  8453. this.position.x = absolutePositionX;
  8454. this.position.y = absolutePositionY;
  8455. this.position.z = absolutePositionZ;
  8456. }
  8457. };
  8458. AbstractMesh.prototype.setPivotMatrix = function (matrix) {
  8459. this._pivotMatrix = matrix;
  8460. this._cache.pivotMatrixUpdated = true;
  8461. };
  8462. AbstractMesh.prototype.getPivotMatrix = function () {
  8463. return this._pivotMatrix;
  8464. };
  8465. AbstractMesh.prototype._isSynchronized = function () {
  8466. if (this._isDirty) {
  8467. return false;
  8468. }
  8469. if (this.billboardMode !== AbstractMesh.BILLBOARDMODE_NONE)
  8470. return false;
  8471. if (this._cache.pivotMatrixUpdated) {
  8472. return false;
  8473. }
  8474. if (this.infiniteDistance) {
  8475. return false;
  8476. }
  8477. if (!this._cache.position.equals(this.position))
  8478. return false;
  8479. if (this.rotationQuaternion) {
  8480. if (!this._cache.rotationQuaternion.equals(this.rotationQuaternion))
  8481. return false;
  8482. } else {
  8483. if (!this._cache.rotation.equals(this.rotation))
  8484. return false;
  8485. }
  8486. if (!this._cache.scaling.equals(this.scaling))
  8487. return false;
  8488. return true;
  8489. };
  8490. AbstractMesh.prototype._initCache = function () {
  8491. _super.prototype._initCache.call(this);
  8492. this._cache.localMatrixUpdated = false;
  8493. this._cache.position = BABYLON.Vector3.Zero();
  8494. this._cache.scaling = BABYLON.Vector3.Zero();
  8495. this._cache.rotation = BABYLON.Vector3.Zero();
  8496. this._cache.rotationQuaternion = new BABYLON.Quaternion(0, 0, 0, 0);
  8497. };
  8498. AbstractMesh.prototype.markAsDirty = function (property) {
  8499. if (property === "rotation") {
  8500. this.rotationQuaternion = null;
  8501. }
  8502. this._currentRenderId = Number.MAX_VALUE;
  8503. this._isDirty = true;
  8504. };
  8505. AbstractMesh.prototype._updateBoundingInfo = function () {
  8506. this._boundingInfo = this._boundingInfo || new BABYLON.BoundingInfo(this.absolutePosition, this.absolutePosition);
  8507. this._boundingInfo._update(this.worldMatrixFromCache);
  8508. this._updateSubMeshesBoundingInfo(this.worldMatrixFromCache);
  8509. };
  8510. AbstractMesh.prototype._updateSubMeshesBoundingInfo = function (matrix) {
  8511. if (!this.subMeshes) {
  8512. return;
  8513. }
  8514. for (var subIndex = 0; subIndex < this.subMeshes.length; subIndex++) {
  8515. var subMesh = this.subMeshes[subIndex];
  8516. subMesh.updateBoundingInfo(matrix);
  8517. }
  8518. };
  8519. AbstractMesh.prototype.computeWorldMatrix = function (force) {
  8520. if (!force && (this._currentRenderId == this.getScene().getRenderId() || this.isSynchronized(true))) {
  8521. return this._worldMatrix;
  8522. }
  8523. this._cache.position.copyFrom(this.position);
  8524. this._cache.scaling.copyFrom(this.scaling);
  8525. this._cache.pivotMatrixUpdated = false;
  8526. this._currentRenderId = this.getScene().getRenderId();
  8527. this._isDirty = false;
  8528. // Scaling
  8529. BABYLON.Matrix.ScalingToRef(this.scaling.x, this.scaling.y, this.scaling.z, this._localScaling);
  8530. // Rotation
  8531. if (this.rotationQuaternion) {
  8532. this.rotationQuaternion.toRotationMatrix(this._localRotation);
  8533. this._cache.rotationQuaternion.copyFrom(this.rotationQuaternion);
  8534. } else {
  8535. BABYLON.Matrix.RotationYawPitchRollToRef(this.rotation.y, this.rotation.x, this.rotation.z, this._localRotation);
  8536. this._cache.rotation.copyFrom(this.rotation);
  8537. }
  8538. // Translation
  8539. if (this.infiniteDistance && !this.parent) {
  8540. var camera = this.getScene().activeCamera;
  8541. var cameraWorldMatrix = camera.getWorldMatrix();
  8542. var cameraGlobalPosition = new BABYLON.Vector3(cameraWorldMatrix.m[12], cameraWorldMatrix.m[13], cameraWorldMatrix.m[14]);
  8543. BABYLON.Matrix.TranslationToRef(this.position.x + cameraGlobalPosition.x, this.position.y + cameraGlobalPosition.y, this.position.z + cameraGlobalPosition.z, this._localTranslation);
  8544. } else {
  8545. BABYLON.Matrix.TranslationToRef(this.position.x, this.position.y, this.position.z, this._localTranslation);
  8546. }
  8547. // Composing transformations
  8548. this._pivotMatrix.multiplyToRef(this._localScaling, this._localPivotScaling);
  8549. this._localPivotScaling.multiplyToRef(this._localRotation, this._localPivotScalingRotation);
  8550. // Billboarding
  8551. if (this.billboardMode !== AbstractMesh.BILLBOARDMODE_NONE && this.getScene().activeCamera) {
  8552. var localPosition = this.position.clone();
  8553. var zero = this.getScene().activeCamera.position.clone();
  8554. if (this.parent && this.parent.position) {
  8555. localPosition.addInPlace(this.parent.position);
  8556. BABYLON.Matrix.TranslationToRef(localPosition.x, localPosition.y, localPosition.z, this._localTranslation);
  8557. }
  8558. if ((this.billboardMode & AbstractMesh.BILLBOARDMODE_ALL) === AbstractMesh.BILLBOARDMODE_ALL) {
  8559. zero = this.getScene().activeCamera.position;
  8560. } else {
  8561. if (this.billboardMode & BABYLON.AbstractMesh.BILLBOARDMODE_X)
  8562. zero.x = localPosition.x + BABYLON.Engine.Epsilon;
  8563. if (this.billboardMode & BABYLON.AbstractMesh.BILLBOARDMODE_Y)
  8564. zero.y = localPosition.y + 0.001;
  8565. if (this.billboardMode & BABYLON.AbstractMesh.BILLBOARDMODE_Z)
  8566. zero.z = localPosition.z + 0.001;
  8567. }
  8568. BABYLON.Matrix.LookAtLHToRef(localPosition, zero, BABYLON.Vector3.Up(), this._localBillboard);
  8569. this._localBillboard.m[12] = this._localBillboard.m[13] = this._localBillboard.m[14] = 0;
  8570. this._localBillboard.invert();
  8571. this._localPivotScalingRotation.multiplyToRef(this._localBillboard, this._localWorld);
  8572. this._rotateYByPI.multiplyToRef(this._localWorld, this._localPivotScalingRotation);
  8573. }
  8574. // Local world
  8575. this._localPivotScalingRotation.multiplyToRef(this._localTranslation, this._localWorld);
  8576. // Parent
  8577. if (this.parent && this.parent.getWorldMatrix && this.billboardMode === BABYLON.AbstractMesh.BILLBOARDMODE_NONE) {
  8578. this._localWorld.multiplyToRef(this.parent.getWorldMatrix(), this._worldMatrix);
  8579. } else {
  8580. this._worldMatrix.copyFrom(this._localWorld);
  8581. }
  8582. // Bounding info
  8583. this._updateBoundingInfo();
  8584. // Absolute position
  8585. this._absolutePosition.copyFromFloats(this._worldMatrix.m[12], this._worldMatrix.m[13], this._worldMatrix.m[14]);
  8586. for (var callbackIndex = 0; callbackIndex < this._onAfterWorldMatrixUpdate.length; callbackIndex++) {
  8587. this._onAfterWorldMatrixUpdate[callbackIndex](this);
  8588. }
  8589. return this._worldMatrix;
  8590. };
  8591. /**
  8592. * If you'd like to be callbacked after the mesh position, rotation or scaling has been updated
  8593. * @param func: callback function to add
  8594. */
  8595. AbstractMesh.prototype.registerAfterWorldMatrixUpdate = function (func) {
  8596. this._onAfterWorldMatrixUpdate.push(func);
  8597. };
  8598. AbstractMesh.prototype.unregisterAfterWorldMatrixUpdate = function (func) {
  8599. var index = this._onAfterWorldMatrixUpdate.indexOf(func);
  8600. if (index > -1) {
  8601. this._onAfterWorldMatrixUpdate.splice(index, 1);
  8602. }
  8603. };
  8604. AbstractMesh.prototype.setPositionWithLocalVector = function (vector3) {
  8605. this.computeWorldMatrix();
  8606. this.position = BABYLON.Vector3.TransformNormal(vector3, this._localWorld);
  8607. };
  8608. AbstractMesh.prototype.getPositionExpressedInLocalSpace = function () {
  8609. this.computeWorldMatrix();
  8610. var invLocalWorldMatrix = this._localWorld.clone();
  8611. invLocalWorldMatrix.invert();
  8612. return BABYLON.Vector3.TransformNormal(this.position, invLocalWorldMatrix);
  8613. };
  8614. AbstractMesh.prototype.locallyTranslate = function (vector3) {
  8615. this.computeWorldMatrix();
  8616. this.position = BABYLON.Vector3.TransformCoordinates(vector3, this._localWorld);
  8617. };
  8618. AbstractMesh.prototype.lookAt = function (targetPoint, yawCor, pitchCor, rollCor) {
  8619. /// <summary>Orients a mesh towards a target point. Mesh must be drawn facing user.</summary>
  8620. /// <param name="targetPoint" type="BABYLON.Vector3">The position (must be in same space as current mesh) to look at</param>
  8621. /// <param name="yawCor" type="Number">optional yaw (y-axis) correction in radians</param>
  8622. /// <param name="pitchCor" type="Number">optional pitch (x-axis) correction in radians</param>
  8623. /// <param name="rollCor" type="Number">optional roll (z-axis) correction in radians</param>
  8624. /// <returns>Mesh oriented towards targetMesh</returns>
  8625. yawCor = yawCor || 0; // default to zero if undefined
  8626. pitchCor = pitchCor || 0;
  8627. rollCor = rollCor || 0;
  8628. var dv = targetPoint.subtract(this.position);
  8629. var yaw = -Math.atan2(dv.z, dv.x) - Math.PI / 2;
  8630. var len = Math.sqrt(dv.x * dv.x + dv.z * dv.z);
  8631. var pitch = Math.atan2(dv.y, len);
  8632. this.rotationQuaternion = BABYLON.Quaternion.RotationYawPitchRoll(yaw + yawCor, pitch + pitchCor, rollCor);
  8633. };
  8634. AbstractMesh.prototype.isInFrustum = function (frustumPlanes) {
  8635. if (!this._boundingInfo.isInFrustum(frustumPlanes)) {
  8636. return false;
  8637. }
  8638. return true;
  8639. };
  8640. AbstractMesh.prototype.isCompletelyInFrustum = function (camera) {
  8641. if (!camera) {
  8642. camera = this.getScene().activeCamera;
  8643. }
  8644. var transformMatrix = camera.getViewMatrix().multiply(camera.getProjectionMatrix());
  8645. if (!this._boundingInfo.isCompletelyInFrustum(BABYLON.Frustum.GetPlanes(transformMatrix))) {
  8646. return false;
  8647. }
  8648. return true;
  8649. };
  8650. AbstractMesh.prototype.intersectsMesh = function (mesh, precise) {
  8651. if (!this._boundingInfo || !mesh._boundingInfo) {
  8652. return false;
  8653. }
  8654. return this._boundingInfo.intersects(mesh._boundingInfo, precise);
  8655. };
  8656. AbstractMesh.prototype.intersectsPoint = function (point) {
  8657. if (!this._boundingInfo) {
  8658. return false;
  8659. }
  8660. return this._boundingInfo.intersectsPoint(point);
  8661. };
  8662. // Physics
  8663. AbstractMesh.prototype.setPhysicsState = function (impostor, options) {
  8664. var physicsEngine = this.getScene().getPhysicsEngine();
  8665. if (!physicsEngine) {
  8666. return;
  8667. }
  8668. if (impostor.impostor) {
  8669. // Old API
  8670. options = impostor;
  8671. impostor = impostor.impostor;
  8672. }
  8673. impostor = impostor || BABYLON.PhysicsEngine.NoImpostor;
  8674. if (impostor === BABYLON.PhysicsEngine.NoImpostor) {
  8675. physicsEngine._unregisterMesh(this);
  8676. return;
  8677. }
  8678. options.mass = options.mass || 0;
  8679. options.friction = options.friction || 0.2;
  8680. options.restitution = options.restitution || 0.2;
  8681. this._physicImpostor = impostor;
  8682. this._physicsMass = options.mass;
  8683. this._physicsFriction = options.friction;
  8684. this._physicRestitution = options.restitution;
  8685. return physicsEngine._registerMesh(this, impostor, options);
  8686. };
  8687. AbstractMesh.prototype.getPhysicsImpostor = function () {
  8688. if (!this._physicImpostor) {
  8689. return BABYLON.PhysicsEngine.NoImpostor;
  8690. }
  8691. return this._physicImpostor;
  8692. };
  8693. AbstractMesh.prototype.getPhysicsMass = function () {
  8694. if (!this._physicsMass) {
  8695. return 0;
  8696. }
  8697. return this._physicsMass;
  8698. };
  8699. AbstractMesh.prototype.getPhysicsFriction = function () {
  8700. if (!this._physicsFriction) {
  8701. return 0;
  8702. }
  8703. return this._physicsFriction;
  8704. };
  8705. AbstractMesh.prototype.getPhysicsRestitution = function () {
  8706. if (!this._physicRestitution) {
  8707. return 0;
  8708. }
  8709. return this._physicRestitution;
  8710. };
  8711. AbstractMesh.prototype.getPositionInCameraSpace = function (camera) {
  8712. if (!camera) {
  8713. camera = this.getScene().activeCamera;
  8714. }
  8715. return BABYLON.Vector3.TransformCoordinates(this.absolutePosition, camera.getViewMatrix());
  8716. };
  8717. AbstractMesh.prototype.getDistanceToCamera = function (camera) {
  8718. if (!camera) {
  8719. camera = this.getScene().activeCamera;
  8720. }
  8721. return this.absolutePosition.subtract(camera.position).length();
  8722. };
  8723. AbstractMesh.prototype.applyImpulse = function (force, contactPoint) {
  8724. if (!this._physicImpostor) {
  8725. return;
  8726. }
  8727. this.getScene().getPhysicsEngine()._applyImpulse(this, force, contactPoint);
  8728. };
  8729. AbstractMesh.prototype.setPhysicsLinkWith = function (otherMesh, pivot1, pivot2, options) {
  8730. if (!this._physicImpostor) {
  8731. return;
  8732. }
  8733. this.getScene().getPhysicsEngine()._createLink(this, otherMesh, pivot1, pivot2, options);
  8734. };
  8735. AbstractMesh.prototype.updatePhysicsBodyPosition = function () {
  8736. if (!this._physicImpostor) {
  8737. return;
  8738. }
  8739. this.getScene().getPhysicsEngine()._updateBodyPosition(this);
  8740. };
  8741. // Collisions
  8742. AbstractMesh.prototype.moveWithCollisions = function (velocity) {
  8743. var globalPosition = this.getAbsolutePosition();
  8744. globalPosition.subtractFromFloatsToRef(0, this.ellipsoid.y, 0, this._oldPositionForCollisions);
  8745. this._oldPositionForCollisions.addInPlace(this.ellipsoidOffset);
  8746. this._collider.radius = this.ellipsoid;
  8747. this.getScene()._getNewPosition(this._oldPositionForCollisions, velocity, this._collider, 3, this._newPositionForCollisions, this);
  8748. this._newPositionForCollisions.subtractToRef(this._oldPositionForCollisions, this._diffPositionForCollisions);
  8749. if (this._diffPositionForCollisions.length() > BABYLON.Engine.CollisionsEpsilon) {
  8750. this.position.addInPlace(this._diffPositionForCollisions);
  8751. }
  8752. };
  8753. // Submeshes octree
  8754. /**
  8755. * This function will create an octree to help select the right submeshes for rendering, picking and collisions
  8756. * Please note that you must have a decent number of submeshes to get performance improvements when using octree
  8757. */
  8758. AbstractMesh.prototype.createOrUpdateSubmeshesOctree = function (maxCapacity, maxDepth) {
  8759. if (typeof maxCapacity === "undefined") { maxCapacity = 64; }
  8760. if (typeof maxDepth === "undefined") { maxDepth = 2; }
  8761. if (!this._submeshesOctree) {
  8762. this._submeshesOctree = new BABYLON.Octree(BABYLON.Octree.CreationFuncForSubMeshes, maxCapacity, maxDepth);
  8763. }
  8764. this.computeWorldMatrix(true);
  8765. // Update octree
  8766. var bbox = this.getBoundingInfo().boundingBox;
  8767. this._submeshesOctree.update(bbox.minimumWorld, bbox.maximumWorld, this.subMeshes);
  8768. return this._submeshesOctree;
  8769. };
  8770. // Collisions
  8771. AbstractMesh.prototype._collideForSubMesh = function (subMesh, transformMatrix, collider) {
  8772. this._generatePointsArray();
  8773. // Transformation
  8774. if (!subMesh._lastColliderWorldVertices || !subMesh._lastColliderTransformMatrix.equals(transformMatrix)) {
  8775. subMesh._lastColliderTransformMatrix = transformMatrix.clone();
  8776. subMesh._lastColliderWorldVertices = [];
  8777. subMesh._trianglePlanes = [];
  8778. var start = subMesh.verticesStart;
  8779. var end = (subMesh.verticesStart + subMesh.verticesCount);
  8780. for (var i = start; i < end; i++) {
  8781. subMesh._lastColliderWorldVertices.push(BABYLON.Vector3.TransformCoordinates(this._positions[i], transformMatrix));
  8782. }
  8783. }
  8784. // Collide
  8785. collider._collide(subMesh, subMesh._lastColliderWorldVertices, this.getIndices(), subMesh.indexStart, subMesh.indexStart + subMesh.indexCount, subMesh.verticesStart);
  8786. };
  8787. AbstractMesh.prototype._processCollisionsForSubMeshes = function (collider, transformMatrix) {
  8788. var subMeshes;
  8789. var len;
  8790. // Octrees
  8791. if (this._submeshesOctree && this.useOctreeForCollisions) {
  8792. var radius = collider.velocityWorldLength + Math.max(collider.radius.x, collider.radius.y, collider.radius.z);
  8793. var intersections = this._submeshesOctree.intersects(collider.basePointWorld, radius);
  8794. len = intersections.length;
  8795. subMeshes = intersections.data;
  8796. } else {
  8797. subMeshes = this.subMeshes;
  8798. len = subMeshes.length;
  8799. }
  8800. for (var index = 0; index < len; index++) {
  8801. var subMesh = subMeshes[index];
  8802. // Bounding test
  8803. if (len > 1 && !subMesh._checkCollision(collider))
  8804. continue;
  8805. this._collideForSubMesh(subMesh, transformMatrix, collider);
  8806. }
  8807. };
  8808. AbstractMesh.prototype._checkCollision = function (collider) {
  8809. // Bounding box test
  8810. if (!this._boundingInfo._checkCollision(collider))
  8811. return;
  8812. // Transformation matrix
  8813. BABYLON.Matrix.ScalingToRef(1.0 / collider.radius.x, 1.0 / collider.radius.y, 1.0 / collider.radius.z, this._collisionsScalingMatrix);
  8814. this.worldMatrixFromCache.multiplyToRef(this._collisionsScalingMatrix, this._collisionsTransformMatrix);
  8815. this._processCollisionsForSubMeshes(collider, this._collisionsTransformMatrix);
  8816. };
  8817. // Picking
  8818. AbstractMesh.prototype._generatePointsArray = function () {
  8819. return false;
  8820. };
  8821. AbstractMesh.prototype.intersects = function (ray, fastCheck) {
  8822. var pickingInfo = new BABYLON.PickingInfo();
  8823. if (!this.subMeshes || !this._boundingInfo || !ray.intersectsSphere(this._boundingInfo.boundingSphere) || !ray.intersectsBox(this._boundingInfo.boundingBox)) {
  8824. return pickingInfo;
  8825. }
  8826. if (!this._generatePointsArray()) {
  8827. return pickingInfo;
  8828. }
  8829. var intersectInfo = null;
  8830. // Octrees
  8831. var subMeshes;
  8832. var len;
  8833. if (this._submeshesOctree && this.useOctreeForPicking) {
  8834. var worldRay = BABYLON.Ray.Transform(ray, this.getWorldMatrix());
  8835. var intersections = this._submeshesOctree.intersectsRay(worldRay);
  8836. len = intersections.length;
  8837. subMeshes = intersections.data;
  8838. } else {
  8839. subMeshes = this.subMeshes;
  8840. len = subMeshes.length;
  8841. }
  8842. for (var index = 0; index < len; index++) {
  8843. var subMesh = subMeshes[index];
  8844. // Bounding test
  8845. if (len > 1 && !subMesh.canIntersects(ray))
  8846. continue;
  8847. var currentIntersectInfo = subMesh.intersects(ray, this._positions, this.getIndices(), fastCheck);
  8848. if (currentIntersectInfo) {
  8849. if (fastCheck || !intersectInfo || currentIntersectInfo.distance < intersectInfo.distance) {
  8850. intersectInfo = currentIntersectInfo;
  8851. if (fastCheck) {
  8852. break;
  8853. }
  8854. }
  8855. }
  8856. }
  8857. if (intersectInfo) {
  8858. // Get picked point
  8859. var world = this.getWorldMatrix();
  8860. var worldOrigin = BABYLON.Vector3.TransformCoordinates(ray.origin, world);
  8861. var direction = ray.direction.clone();
  8862. direction.normalize();
  8863. direction = direction.scale(intersectInfo.distance);
  8864. var worldDirection = BABYLON.Vector3.TransformNormal(direction, world);
  8865. var pickedPoint = worldOrigin.add(worldDirection);
  8866. // Return result
  8867. pickingInfo.hit = true;
  8868. pickingInfo.distance = BABYLON.Vector3.Distance(worldOrigin, pickedPoint);
  8869. pickingInfo.pickedPoint = pickedPoint;
  8870. pickingInfo.pickedMesh = this;
  8871. pickingInfo.bu = intersectInfo.bu;
  8872. pickingInfo.bv = intersectInfo.bv;
  8873. pickingInfo.faceId = intersectInfo.faceId;
  8874. return pickingInfo;
  8875. }
  8876. return pickingInfo;
  8877. };
  8878. AbstractMesh.prototype.clone = function (name, newParent, doNotCloneChildren) {
  8879. return null;
  8880. };
  8881. AbstractMesh.prototype.releaseSubMeshes = function () {
  8882. if (this.subMeshes) {
  8883. while (this.subMeshes.length) {
  8884. this.subMeshes[0].dispose();
  8885. }
  8886. } else {
  8887. this.subMeshes = new Array();
  8888. }
  8889. };
  8890. AbstractMesh.prototype.dispose = function (doNotRecurse) {
  8891. // Physics
  8892. if (this.getPhysicsImpostor() != BABYLON.PhysicsEngine.NoImpostor) {
  8893. this.setPhysicsState(BABYLON.PhysicsEngine.NoImpostor);
  8894. }
  8895. for (index = 0; index < this._intersectionsInProgress.length; index++) {
  8896. var other = this._intersectionsInProgress[index];
  8897. var pos = other._intersectionsInProgress.indexOf(this);
  8898. other._intersectionsInProgress.splice(pos, 1);
  8899. }
  8900. this._intersectionsInProgress = [];
  8901. // SubMeshes
  8902. this.releaseSubMeshes();
  8903. // Remove from scene
  8904. var index = this.getScene().meshes.indexOf(this);
  8905. if (index != -1) {
  8906. // Remove from the scene if mesh found
  8907. this.getScene().meshes.splice(index, 1);
  8908. }
  8909. if (!doNotRecurse) {
  8910. for (index = 0; index < this.getScene().particleSystems.length; index++) {
  8911. if (this.getScene().particleSystems[index].emitter == this) {
  8912. this.getScene().particleSystems[index].dispose();
  8913. index--;
  8914. }
  8915. }
  8916. // Children
  8917. var objects = this.getScene().meshes.slice(0);
  8918. for (index = 0; index < objects.length; index++) {
  8919. if (objects[index].parent == this) {
  8920. objects[index].dispose();
  8921. }
  8922. }
  8923. } else {
  8924. for (index = 0; index < this.getScene().meshes.length; index++) {
  8925. var obj = this.getScene().meshes[index];
  8926. if (obj.parent === this) {
  8927. obj.parent = null;
  8928. obj.computeWorldMatrix(true);
  8929. }
  8930. }
  8931. }
  8932. this._onAfterWorldMatrixUpdate = [];
  8933. this._isDisposed = true;
  8934. // Callback
  8935. if (this.onDispose) {
  8936. this.onDispose();
  8937. }
  8938. };
  8939. AbstractMesh._BILLBOARDMODE_NONE = 0;
  8940. AbstractMesh._BILLBOARDMODE_X = 1;
  8941. AbstractMesh._BILLBOARDMODE_Y = 2;
  8942. AbstractMesh._BILLBOARDMODE_Z = 4;
  8943. AbstractMesh._BILLBOARDMODE_ALL = 7;
  8944. return AbstractMesh;
  8945. })(BABYLON.Node);
  8946. BABYLON.AbstractMesh = AbstractMesh;
  8947. })(BABYLON || (BABYLON = {}));
  8948. //# sourceMappingURL=babylon.abstractMesh.js.map
  8949. var BABYLON;
  8950. (function (BABYLON) {
  8951. var _InstancesBatch = (function () {
  8952. function _InstancesBatch() {
  8953. this.mustReturn = false;
  8954. this.visibleInstances = new Array();
  8955. this.renderSelf = new Array();
  8956. }
  8957. return _InstancesBatch;
  8958. })();
  8959. BABYLON._InstancesBatch = _InstancesBatch;
  8960. var Mesh = (function (_super) {
  8961. __extends(Mesh, _super);
  8962. function Mesh(name, scene) {
  8963. _super.call(this, name, scene);
  8964. // Members
  8965. this.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_NONE;
  8966. this.instances = new Array();
  8967. this._LODLevels = new Array();
  8968. this._onBeforeRenderCallbacks = new Array();
  8969. this._onAfterRenderCallbacks = new Array();
  8970. this._visibleInstances = {};
  8971. this._renderIdForInstances = new Array();
  8972. this._batchCache = new _InstancesBatch();
  8973. this._instancesBufferSize = 32 * 16 * 4;
  8974. }
  8975. Object.defineProperty(Mesh.prototype, "hasLODLevels", {
  8976. // Methods
  8977. get: function () {
  8978. return this._LODLevels.length > 0;
  8979. },
  8980. enumerable: true,
  8981. configurable: true
  8982. });
  8983. Mesh.prototype._sortLODLevels = function () {
  8984. this._LODLevels.sort(function (a, b) {
  8985. if (a.distance < b.distance) {
  8986. return 1;
  8987. }
  8988. if (a.distance > b.distance) {
  8989. return -1;
  8990. }
  8991. return 0;
  8992. });
  8993. };
  8994. Mesh.prototype.addLODLevel = function (distance, mesh) {
  8995. if (mesh && mesh._masterMesh) {
  8996. BABYLON.Tools.Warn("You cannot use a mesh as LOD level twice");
  8997. return this;
  8998. }
  8999. var level = new BABYLON.Internals.MeshLODLevel(distance, mesh);
  9000. this._LODLevels.push(level);
  9001. if (mesh) {
  9002. mesh._masterMesh = this;
  9003. }
  9004. this._sortLODLevels();
  9005. return this;
  9006. };
  9007. Mesh.prototype.removeLODLevel = function (mesh) {
  9008. for (var index = 0; index < this._LODLevels.length; index++) {
  9009. if (this._LODLevels[index].mesh === mesh) {
  9010. this._LODLevels.splice(index, 1);
  9011. if (mesh) {
  9012. mesh._masterMesh = null;
  9013. }
  9014. }
  9015. }
  9016. this._sortLODLevels();
  9017. return this;
  9018. };
  9019. Mesh.prototype.getLOD = function (camera, boundingSphere) {
  9020. if (!this._LODLevels || this._LODLevels.length === 0) {
  9021. return this;
  9022. }
  9023. var distanceToCamera = (boundingSphere ? boundingSphere : this.getBoundingInfo().boundingSphere).centerWorld.subtract(camera.position).length();
  9024. if (this._LODLevels[this._LODLevels.length - 1].distance > distanceToCamera) {
  9025. return this;
  9026. }
  9027. for (var index = 0; index < this._LODLevels.length; index++) {
  9028. var level = this._LODLevels[index];
  9029. if (level.distance < distanceToCamera) {
  9030. if (level.mesh) {
  9031. level.mesh._preActivate();
  9032. level.mesh._updateSubMeshesBoundingInfo(this.worldMatrixFromCache);
  9033. }
  9034. return level.mesh;
  9035. }
  9036. }
  9037. return this;
  9038. };
  9039. Object.defineProperty(Mesh.prototype, "geometry", {
  9040. get: function () {
  9041. return this._geometry;
  9042. },
  9043. enumerable: true,
  9044. configurable: true
  9045. });
  9046. Mesh.prototype.getTotalVertices = function () {
  9047. if (!this._geometry) {
  9048. return 0;
  9049. }
  9050. return this._geometry.getTotalVertices();
  9051. };
  9052. Mesh.prototype.getVerticesData = function (kind) {
  9053. if (!this._geometry) {
  9054. return null;
  9055. }
  9056. return this._geometry.getVerticesData(kind);
  9057. };
  9058. Mesh.prototype.getVertexBuffer = function (kind) {
  9059. if (!this._geometry) {
  9060. return undefined;
  9061. }
  9062. return this._geometry.getVertexBuffer(kind);
  9063. };
  9064. Mesh.prototype.isVerticesDataPresent = function (kind) {
  9065. if (!this._geometry) {
  9066. if (this._delayInfo) {
  9067. return this._delayInfo.indexOf(kind) !== -1;
  9068. }
  9069. return false;
  9070. }
  9071. return this._geometry.isVerticesDataPresent(kind);
  9072. };
  9073. Mesh.prototype.getVerticesDataKinds = function () {
  9074. if (!this._geometry) {
  9075. var result = [];
  9076. if (this._delayInfo) {
  9077. for (var kind in this._delayInfo) {
  9078. result.push(kind);
  9079. }
  9080. }
  9081. return result;
  9082. }
  9083. return this._geometry.getVerticesDataKinds();
  9084. };
  9085. Mesh.prototype.getTotalIndices = function () {
  9086. if (!this._geometry) {
  9087. return 0;
  9088. }
  9089. return this._geometry.getTotalIndices();
  9090. };
  9091. Mesh.prototype.getIndices = function () {
  9092. if (!this._geometry) {
  9093. return [];
  9094. }
  9095. return this._geometry.getIndices();
  9096. };
  9097. Object.defineProperty(Mesh.prototype, "isBlocked", {
  9098. get: function () {
  9099. return this._masterMesh !== null && this._masterMesh !== undefined;
  9100. },
  9101. enumerable: true,
  9102. configurable: true
  9103. });
  9104. Mesh.prototype.isReady = function () {
  9105. if (this.delayLoadState === BABYLON.Engine.DELAYLOADSTATE_LOADING) {
  9106. return false;
  9107. }
  9108. return _super.prototype.isReady.call(this);
  9109. };
  9110. Mesh.prototype.isDisposed = function () {
  9111. return this._isDisposed;
  9112. };
  9113. // Methods
  9114. Mesh.prototype._preActivate = function () {
  9115. var sceneRenderId = this.getScene().getRenderId();
  9116. if (this._preActivateId == sceneRenderId) {
  9117. return;
  9118. }
  9119. this._preActivateId = sceneRenderId;
  9120. this._visibleInstances = null;
  9121. };
  9122. Mesh.prototype._registerInstanceForRenderId = function (instance, renderId) {
  9123. if (!this._visibleInstances) {
  9124. this._visibleInstances = {};
  9125. this._visibleInstances.defaultRenderId = renderId;
  9126. this._visibleInstances.selfDefaultRenderId = this._renderId;
  9127. }
  9128. if (!this._visibleInstances[renderId]) {
  9129. this._visibleInstances[renderId] = new Array();
  9130. }
  9131. this._visibleInstances[renderId].push(instance);
  9132. };
  9133. Mesh.prototype.refreshBoundingInfo = function () {
  9134. var data = this.getVerticesData(BABYLON.VertexBuffer.PositionKind);
  9135. if (data) {
  9136. var extend = BABYLON.Tools.ExtractMinAndMax(data, 0, this.getTotalVertices());
  9137. this._boundingInfo = new BABYLON.BoundingInfo(extend.minimum, extend.maximum);
  9138. }
  9139. if (this.subMeshes) {
  9140. for (var index = 0; index < this.subMeshes.length; index++) {
  9141. this.subMeshes[index].refreshBoundingInfo();
  9142. }
  9143. }
  9144. this._updateBoundingInfo();
  9145. };
  9146. Mesh.prototype._createGlobalSubMesh = function () {
  9147. var totalVertices = this.getTotalVertices();
  9148. if (!totalVertices || !this.getIndices()) {
  9149. return null;
  9150. }
  9151. this.releaseSubMeshes();
  9152. return new BABYLON.SubMesh(0, 0, totalVertices, 0, this.getTotalIndices(), this);
  9153. };
  9154. Mesh.prototype.subdivide = function (count) {
  9155. if (count < 1) {
  9156. return;
  9157. }
  9158. var totalIndices = this.getTotalIndices();
  9159. var subdivisionSize = (totalIndices / count) | 0;
  9160. var offset = 0;
  9161. while (subdivisionSize % 3 != 0) {
  9162. subdivisionSize++;
  9163. }
  9164. this.releaseSubMeshes();
  9165. for (var index = 0; index < count; index++) {
  9166. if (offset >= totalIndices) {
  9167. break;
  9168. }
  9169. BABYLON.SubMesh.CreateFromIndices(0, offset, Math.min(subdivisionSize, totalIndices - offset), this);
  9170. offset += subdivisionSize;
  9171. }
  9172. this.synchronizeInstances();
  9173. };
  9174. Mesh.prototype.setVerticesData = function (kind, data, updatable, stride) {
  9175. if (kind instanceof Array) {
  9176. var temp = data;
  9177. data = kind;
  9178. kind = temp;
  9179. BABYLON.Tools.Warn("Deprecated usage of setVerticesData detected (since v1.12). Current signature is setVerticesData(kind, data, updatable).");
  9180. }
  9181. if (!this._geometry) {
  9182. var vertexData = new BABYLON.VertexData();
  9183. vertexData.set(data, kind);
  9184. var scene = this.getScene();
  9185. new BABYLON.Geometry(BABYLON.Geometry.RandomId(), scene, vertexData, updatable, this);
  9186. } else {
  9187. this._geometry.setVerticesData(kind, data, updatable, stride);
  9188. }
  9189. };
  9190. Mesh.prototype.updateVerticesData = function (kind, data, updateExtends, makeItUnique) {
  9191. if (!this._geometry) {
  9192. return;
  9193. }
  9194. if (!makeItUnique) {
  9195. this._geometry.updateVerticesData(kind, data, updateExtends);
  9196. } else {
  9197. this.makeGeometryUnique();
  9198. this.updateVerticesData(kind, data, updateExtends, false);
  9199. }
  9200. };
  9201. Mesh.prototype.updateVerticesDataDirectly = function (kind, data, offset, makeItUnique) {
  9202. if (!this._geometry) {
  9203. return;
  9204. }
  9205. if (!makeItUnique) {
  9206. this._geometry.updateVerticesDataDirectly(kind, data, offset);
  9207. } else {
  9208. this.makeGeometryUnique();
  9209. this.updateVerticesDataDirectly(kind, data, offset, false);
  9210. }
  9211. };
  9212. Mesh.prototype.makeGeometryUnique = function () {
  9213. if (!this._geometry) {
  9214. return;
  9215. }
  9216. var geometry = this._geometry.copy(BABYLON.Geometry.RandomId());
  9217. geometry.applyToMesh(this);
  9218. };
  9219. Mesh.prototype.setIndices = function (indices, totalVertices) {
  9220. if (!this._geometry) {
  9221. var vertexData = new BABYLON.VertexData();
  9222. vertexData.indices = indices;
  9223. var scene = this.getScene();
  9224. new BABYLON.Geometry(BABYLON.Geometry.RandomId(), scene, vertexData, false, this);
  9225. } else {
  9226. this._geometry.setIndices(indices, totalVertices);
  9227. }
  9228. };
  9229. Mesh.prototype._bind = function (subMesh, effect, fillMode) {
  9230. var engine = this.getScene().getEngine();
  9231. // Wireframe
  9232. var indexToBind;
  9233. switch (fillMode) {
  9234. case BABYLON.Material.PointFillMode:
  9235. indexToBind = null;
  9236. break;
  9237. case BABYLON.Material.WireFrameFillMode:
  9238. indexToBind = subMesh.getLinesIndexBuffer(this.getIndices(), engine);
  9239. break;
  9240. default:
  9241. case BABYLON.Material.TriangleFillMode:
  9242. indexToBind = this._geometry.getIndexBuffer();
  9243. break;
  9244. }
  9245. // VBOs
  9246. engine.bindMultiBuffers(this._geometry.getVertexBuffers(), indexToBind, effect);
  9247. };
  9248. Mesh.prototype._draw = function (subMesh, fillMode, instancesCount) {
  9249. if (!this._geometry || !this._geometry.getVertexBuffers() || !this._geometry.getIndexBuffer()) {
  9250. return;
  9251. }
  9252. var engine = this.getScene().getEngine();
  9253. switch (fillMode) {
  9254. case BABYLON.Material.PointFillMode:
  9255. engine.drawPointClouds(subMesh.verticesStart, subMesh.verticesCount, instancesCount);
  9256. break;
  9257. case BABYLON.Material.WireFrameFillMode:
  9258. engine.draw(false, 0, subMesh.linesIndexCount, instancesCount);
  9259. break;
  9260. default:
  9261. engine.draw(true, subMesh.indexStart, subMesh.indexCount, instancesCount);
  9262. }
  9263. };
  9264. Mesh.prototype.registerBeforeRender = function (func) {
  9265. this._onBeforeRenderCallbacks.push(func);
  9266. };
  9267. Mesh.prototype.unregisterBeforeRender = function (func) {
  9268. var index = this._onBeforeRenderCallbacks.indexOf(func);
  9269. if (index > -1) {
  9270. this._onBeforeRenderCallbacks.splice(index, 1);
  9271. }
  9272. };
  9273. Mesh.prototype.registerAfterRender = function (func) {
  9274. this._onAfterRenderCallbacks.push(func);
  9275. };
  9276. Mesh.prototype.unregisterAfterRender = function (func) {
  9277. var index = this._onAfterRenderCallbacks.indexOf(func);
  9278. if (index > -1) {
  9279. this._onAfterRenderCallbacks.splice(index, 1);
  9280. }
  9281. };
  9282. Mesh.prototype._getInstancesRenderList = function (subMeshId) {
  9283. var scene = this.getScene();
  9284. this._batchCache.mustReturn = false;
  9285. this._batchCache.renderSelf[subMeshId] = this.isEnabled() && this.isVisible;
  9286. this._batchCache.visibleInstances[subMeshId] = null;
  9287. if (this._visibleInstances) {
  9288. var currentRenderId = scene.getRenderId();
  9289. this._batchCache.visibleInstances[subMeshId] = this._visibleInstances[currentRenderId];
  9290. var selfRenderId = this._renderId;
  9291. if (!this._batchCache.visibleInstances[subMeshId] && this._visibleInstances.defaultRenderId) {
  9292. this._batchCache.visibleInstances[subMeshId] = this._visibleInstances[this._visibleInstances.defaultRenderId];
  9293. currentRenderId = Math.max(this._visibleInstances.defaultRenderId, currentRenderId);
  9294. selfRenderId = Math.max(this._visibleInstances.selfDefaultRenderId, currentRenderId);
  9295. }
  9296. if (this._batchCache.visibleInstances[subMeshId] && this._batchCache.visibleInstances[subMeshId].length) {
  9297. if (this._renderIdForInstances[subMeshId] === currentRenderId) {
  9298. this._batchCache.mustReturn = true;
  9299. return this._batchCache;
  9300. }
  9301. if (currentRenderId !== selfRenderId) {
  9302. this._batchCache.renderSelf[subMeshId] = false;
  9303. }
  9304. }
  9305. this._renderIdForInstances[subMeshId] = currentRenderId;
  9306. }
  9307. return this._batchCache;
  9308. };
  9309. Mesh.prototype._renderWithInstances = function (subMesh, fillMode, batch, effect, engine) {
  9310. var visibleInstances = batch.visibleInstances[subMesh._id];
  9311. var matricesCount = visibleInstances.length + 1;
  9312. var bufferSize = matricesCount * 16 * 4;
  9313. while (this._instancesBufferSize < bufferSize) {
  9314. this._instancesBufferSize *= 2;
  9315. }
  9316. if (!this._worldMatricesInstancesBuffer || this._worldMatricesInstancesBuffer.capacity < this._instancesBufferSize) {
  9317. if (this._worldMatricesInstancesBuffer) {
  9318. engine.deleteInstancesBuffer(this._worldMatricesInstancesBuffer);
  9319. }
  9320. this._worldMatricesInstancesBuffer = engine.createInstancesBuffer(this._instancesBufferSize);
  9321. this._worldMatricesInstancesArray = new Float32Array(this._instancesBufferSize / 4);
  9322. }
  9323. var offset = 0;
  9324. var instancesCount = 0;
  9325. var world = this.getWorldMatrix();
  9326. if (batch.renderSelf[subMesh._id]) {
  9327. world.copyToArray(this._worldMatricesInstancesArray, offset);
  9328. offset += 16;
  9329. instancesCount++;
  9330. }
  9331. if (visibleInstances) {
  9332. for (var instanceIndex = 0; instanceIndex < visibleInstances.length; instanceIndex++) {
  9333. var instance = visibleInstances[instanceIndex];
  9334. instance.getWorldMatrix().copyToArray(this._worldMatricesInstancesArray, offset);
  9335. offset += 16;
  9336. instancesCount++;
  9337. }
  9338. }
  9339. var offsetLocation0 = effect.getAttributeLocationByName("world0");
  9340. var offsetLocation1 = effect.getAttributeLocationByName("world1");
  9341. var offsetLocation2 = effect.getAttributeLocationByName("world2");
  9342. var offsetLocation3 = effect.getAttributeLocationByName("world3");
  9343. var offsetLocations = [offsetLocation0, offsetLocation1, offsetLocation2, offsetLocation3];
  9344. engine.updateAndBindInstancesBuffer(this._worldMatricesInstancesBuffer, this._worldMatricesInstancesArray, offsetLocations);
  9345. this._draw(subMesh, fillMode, instancesCount);
  9346. engine.unBindInstancesBuffer(this._worldMatricesInstancesBuffer, offsetLocations);
  9347. };
  9348. Mesh.prototype.render = function (subMesh) {
  9349. var scene = this.getScene();
  9350. // Managing instances
  9351. var batch = this._getInstancesRenderList(subMesh._id);
  9352. if (batch.mustReturn) {
  9353. return;
  9354. }
  9355. // Checking geometry state
  9356. if (!this._geometry || !this._geometry.getVertexBuffers() || !this._geometry.getIndexBuffer()) {
  9357. return;
  9358. }
  9359. for (var callbackIndex = 0; callbackIndex < this._onBeforeRenderCallbacks.length; callbackIndex++) {
  9360. this._onBeforeRenderCallbacks[callbackIndex]();
  9361. }
  9362. var engine = scene.getEngine();
  9363. var hardwareInstancedRendering = (engine.getCaps().instancedArrays !== null) && (batch.visibleInstances[subMesh._id] !== null) && (batch.visibleInstances[subMesh._id] !== undefined);
  9364. // Material
  9365. var effectiveMaterial = subMesh.getMaterial();
  9366. if (!effectiveMaterial || !effectiveMaterial.isReady(this, hardwareInstancedRendering)) {
  9367. return;
  9368. }
  9369. // Outline - step 1
  9370. var savedDepthWrite = engine.getDepthWrite();
  9371. if (this.renderOutline) {
  9372. engine.setDepthWrite(false);
  9373. scene.getOutlineRenderer().render(subMesh, batch);
  9374. engine.setDepthWrite(savedDepthWrite);
  9375. }
  9376. effectiveMaterial._preBind();
  9377. var effect = effectiveMaterial.getEffect();
  9378. // Bind
  9379. var fillMode = scene.forcePointsCloud ? BABYLON.Material.PointFillMode : (scene.forceWireframe ? BABYLON.Material.WireFrameFillMode : effectiveMaterial.fillMode);
  9380. this._bind(subMesh, effect, fillMode);
  9381. var world = this.getWorldMatrix();
  9382. effectiveMaterial.bind(world, this);
  9383. // Instances rendering
  9384. if (hardwareInstancedRendering) {
  9385. this._renderWithInstances(subMesh, fillMode, batch, effect, engine);
  9386. } else {
  9387. if (batch.renderSelf[subMesh._id]) {
  9388. // Draw
  9389. this._draw(subMesh, fillMode);
  9390. }
  9391. if (batch.visibleInstances[subMesh._id]) {
  9392. for (var instanceIndex = 0; instanceIndex < batch.visibleInstances[subMesh._id].length; instanceIndex++) {
  9393. var instance = batch.visibleInstances[subMesh._id][instanceIndex];
  9394. // World
  9395. world = instance.getWorldMatrix();
  9396. effectiveMaterial.bindOnlyWorldMatrix(world);
  9397. // Draw
  9398. this._draw(subMesh, fillMode);
  9399. }
  9400. }
  9401. }
  9402. // Unbind
  9403. effectiveMaterial.unbind();
  9404. // Outline - step 2
  9405. if (this.renderOutline && savedDepthWrite) {
  9406. engine.setDepthWrite(true);
  9407. engine.setColorWrite(false);
  9408. scene.getOutlineRenderer().render(subMesh, batch);
  9409. engine.setColorWrite(true);
  9410. }
  9411. // Overlay
  9412. if (this.renderOverlay) {
  9413. var currentMode = engine.getAlphaMode();
  9414. engine.setAlphaMode(BABYLON.Engine.ALPHA_COMBINE);
  9415. scene.getOutlineRenderer().render(subMesh, batch, true);
  9416. engine.setAlphaMode(currentMode);
  9417. }
  9418. for (callbackIndex = 0; callbackIndex < this._onAfterRenderCallbacks.length; callbackIndex++) {
  9419. this._onAfterRenderCallbacks[callbackIndex]();
  9420. }
  9421. };
  9422. Mesh.prototype.getEmittedParticleSystems = function () {
  9423. var results = new Array();
  9424. for (var index = 0; index < this.getScene().particleSystems.length; index++) {
  9425. var particleSystem = this.getScene().particleSystems[index];
  9426. if (particleSystem.emitter === this) {
  9427. results.push(particleSystem);
  9428. }
  9429. }
  9430. return results;
  9431. };
  9432. Mesh.prototype.getHierarchyEmittedParticleSystems = function () {
  9433. var results = new Array();
  9434. var descendants = this.getDescendants();
  9435. descendants.push(this);
  9436. for (var index = 0; index < this.getScene().particleSystems.length; index++) {
  9437. var particleSystem = this.getScene().particleSystems[index];
  9438. if (descendants.indexOf(particleSystem.emitter) !== -1) {
  9439. results.push(particleSystem);
  9440. }
  9441. }
  9442. return results;
  9443. };
  9444. Mesh.prototype.getChildren = function () {
  9445. var results = [];
  9446. for (var index = 0; index < this.getScene().meshes.length; index++) {
  9447. var mesh = this.getScene().meshes[index];
  9448. if (mesh.parent == this) {
  9449. results.push(mesh);
  9450. }
  9451. }
  9452. return results;
  9453. };
  9454. Mesh.prototype._checkDelayState = function () {
  9455. var _this = this;
  9456. var that = this;
  9457. var scene = this.getScene();
  9458. if (this._geometry) {
  9459. this._geometry.load(scene);
  9460. } else if (that.delayLoadState === BABYLON.Engine.DELAYLOADSTATE_NOTLOADED) {
  9461. that.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_LOADING;
  9462. scene._addPendingData(that);
  9463. var getBinaryData = (this.delayLoadingFile.indexOf(".babylonbinarymeshdata") !== -1) ? true : false;
  9464. BABYLON.Tools.LoadFile(this.delayLoadingFile, function (data) {
  9465. if (data instanceof ArrayBuffer) {
  9466. _this._delayLoadingFunction(data, _this);
  9467. } else {
  9468. _this._delayLoadingFunction(JSON.parse(data), _this);
  9469. }
  9470. _this.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_LOADED;
  9471. scene._removePendingData(_this);
  9472. }, function () {
  9473. }, scene.database, getBinaryData);
  9474. }
  9475. };
  9476. Mesh.prototype.isInFrustum = function (frustumPlanes) {
  9477. if (this.delayLoadState === BABYLON.Engine.DELAYLOADSTATE_LOADING) {
  9478. return false;
  9479. }
  9480. if (!_super.prototype.isInFrustum.call(this, frustumPlanes)) {
  9481. return false;
  9482. }
  9483. this._checkDelayState();
  9484. return true;
  9485. };
  9486. Mesh.prototype.setMaterialByID = function (id) {
  9487. var materials = this.getScene().materials;
  9488. for (var index = 0; index < materials.length; index++) {
  9489. if (materials[index].id == id) {
  9490. this.material = materials[index];
  9491. return;
  9492. }
  9493. }
  9494. // Multi
  9495. var multiMaterials = this.getScene().multiMaterials;
  9496. for (index = 0; index < multiMaterials.length; index++) {
  9497. if (multiMaterials[index].id == id) {
  9498. this.material = multiMaterials[index];
  9499. return;
  9500. }
  9501. }
  9502. };
  9503. Mesh.prototype.getAnimatables = function () {
  9504. var results = [];
  9505. if (this.material) {
  9506. results.push(this.material);
  9507. }
  9508. if (this.skeleton) {
  9509. results.push(this.skeleton);
  9510. }
  9511. return results;
  9512. };
  9513. // Geometry
  9514. Mesh.prototype.bakeTransformIntoVertices = function (transform) {
  9515. // Position
  9516. if (!this.isVerticesDataPresent(BABYLON.VertexBuffer.PositionKind)) {
  9517. return;
  9518. }
  9519. this._resetPointsArrayCache();
  9520. var data = this.getVerticesData(BABYLON.VertexBuffer.PositionKind);
  9521. var temp = [];
  9522. for (var index = 0; index < data.length; index += 3) {
  9523. BABYLON.Vector3.TransformCoordinates(BABYLON.Vector3.FromArray(data, index), transform).toArray(temp, index);
  9524. }
  9525. this.setVerticesData(BABYLON.VertexBuffer.PositionKind, temp, this.getVertexBuffer(BABYLON.VertexBuffer.PositionKind).isUpdatable());
  9526. // Normals
  9527. if (!this.isVerticesDataPresent(BABYLON.VertexBuffer.NormalKind)) {
  9528. return;
  9529. }
  9530. data = this.getVerticesData(BABYLON.VertexBuffer.NormalKind);
  9531. for (index = 0; index < data.length; index += 3) {
  9532. BABYLON.Vector3.TransformNormal(BABYLON.Vector3.FromArray(data, index), transform).toArray(temp, index);
  9533. }
  9534. this.setVerticesData(BABYLON.VertexBuffer.NormalKind, temp, this.getVertexBuffer(BABYLON.VertexBuffer.NormalKind).isUpdatable());
  9535. };
  9536. // Cache
  9537. Mesh.prototype._resetPointsArrayCache = function () {
  9538. this._positions = null;
  9539. };
  9540. Mesh.prototype._generatePointsArray = function () {
  9541. if (this._positions)
  9542. return true;
  9543. this._positions = [];
  9544. var data = this.getVerticesData(BABYLON.VertexBuffer.PositionKind);
  9545. if (!data) {
  9546. return false;
  9547. }
  9548. for (var index = 0; index < data.length; index += 3) {
  9549. this._positions.push(BABYLON.Vector3.FromArray(data, index));
  9550. }
  9551. return true;
  9552. };
  9553. // Clone
  9554. Mesh.prototype.clone = function (name, newParent, doNotCloneChildren) {
  9555. var result = new BABYLON.Mesh(name, this.getScene());
  9556. // Geometry
  9557. if (this._geometry) {
  9558. this._geometry.applyToMesh(result);
  9559. }
  9560. // Deep copy
  9561. BABYLON.Tools.DeepCopy(this, result, ["name", "material", "skeleton"], []);
  9562. // Material
  9563. result.material = this.material;
  9564. // Parent
  9565. if (newParent) {
  9566. result.parent = newParent;
  9567. }
  9568. if (!doNotCloneChildren) {
  9569. for (var index = 0; index < this.getScene().meshes.length; index++) {
  9570. var mesh = this.getScene().meshes[index];
  9571. if (mesh.parent == this) {
  9572. mesh.clone(mesh.name, result);
  9573. }
  9574. }
  9575. }
  9576. for (index = 0; index < this.getScene().particleSystems.length; index++) {
  9577. var system = this.getScene().particleSystems[index];
  9578. if (system.emitter == this) {
  9579. system.clone(system.name, result);
  9580. }
  9581. }
  9582. result.computeWorldMatrix(true);
  9583. return result;
  9584. };
  9585. // Dispose
  9586. Mesh.prototype.dispose = function (doNotRecurse) {
  9587. if (this._geometry) {
  9588. this._geometry.releaseForMesh(this, true);
  9589. }
  9590. // Instances
  9591. if (this._worldMatricesInstancesBuffer) {
  9592. this.getEngine().deleteInstancesBuffer(this._worldMatricesInstancesBuffer);
  9593. this._worldMatricesInstancesBuffer = null;
  9594. }
  9595. while (this.instances.length) {
  9596. this.instances[0].dispose();
  9597. }
  9598. _super.prototype.dispose.call(this, doNotRecurse);
  9599. };
  9600. // Geometric tools
  9601. Mesh.prototype.applyDisplacementMap = function (url, minHeight, maxHeight) {
  9602. var _this = this;
  9603. var scene = this.getScene();
  9604. var onload = function (img) {
  9605. // Getting height map data
  9606. var canvas = document.createElement("canvas");
  9607. var context = canvas.getContext("2d");
  9608. var heightMapWidth = img.width;
  9609. var heightMapHeight = img.height;
  9610. canvas.width = heightMapWidth;
  9611. canvas.height = heightMapHeight;
  9612. context.drawImage(img, 0, 0);
  9613. // Create VertexData from map data
  9614. var buffer = context.getImageData(0, 0, heightMapWidth, heightMapHeight).data;
  9615. _this.applyDisplacementMapFromBuffer(buffer, heightMapWidth, heightMapHeight, minHeight, maxHeight);
  9616. };
  9617. BABYLON.Tools.LoadImage(url, onload, function () {
  9618. }, scene.database);
  9619. };
  9620. Mesh.prototype.applyDisplacementMapFromBuffer = function (buffer, heightMapWidth, heightMapHeight, minHeight, maxHeight) {
  9621. if (!this.isVerticesDataPresent(BABYLON.VertexBuffer.PositionKind) || !this.isVerticesDataPresent(BABYLON.VertexBuffer.NormalKind) || !this.isVerticesDataPresent(BABYLON.VertexBuffer.UVKind)) {
  9622. BABYLON.Tools.Warn("Cannot call applyDisplacementMap: Given mesh is not complete. Position, Normal or UV are missing");
  9623. return;
  9624. }
  9625. var positions = this.getVerticesData(BABYLON.VertexBuffer.PositionKind);
  9626. var normals = this.getVerticesData(BABYLON.VertexBuffer.NormalKind);
  9627. var uvs = this.getVerticesData(BABYLON.VertexBuffer.UVKind);
  9628. var position = BABYLON.Vector3.Zero();
  9629. var normal = BABYLON.Vector3.Zero();
  9630. var uv = BABYLON.Vector2.Zero();
  9631. for (var index = 0; index < positions.length; index += 3) {
  9632. BABYLON.Vector3.FromArrayToRef(positions, index, position);
  9633. BABYLON.Vector3.FromArrayToRef(normals, index, normal);
  9634. BABYLON.Vector2.FromArrayToRef(uvs, (index / 3) * 2, uv);
  9635. // Compute height
  9636. var u = ((Math.abs(uv.x) * heightMapWidth) % heightMapWidth) | 0;
  9637. var v = ((Math.abs(uv.y) * heightMapHeight) % heightMapHeight) | 0;
  9638. var pos = (u + v * heightMapWidth) * 4;
  9639. var r = buffer[pos] / 255.0;
  9640. var g = buffer[pos + 1] / 255.0;
  9641. var b = buffer[pos + 2] / 255.0;
  9642. var gradient = r * 0.3 + g * 0.59 + b * 0.11;
  9643. normal.normalize();
  9644. normal.scaleInPlace(minHeight + (maxHeight - minHeight) * gradient);
  9645. position = position.add(normal);
  9646. position.toArray(positions, index);
  9647. }
  9648. BABYLON.VertexData.ComputeNormals(positions, this.getIndices(), normals);
  9649. this.updateVerticesData(BABYLON.VertexBuffer.PositionKind, positions);
  9650. this.updateVerticesData(BABYLON.VertexBuffer.NormalKind, normals);
  9651. };
  9652. Mesh.prototype.convertToFlatShadedMesh = function () {
  9653. /// <summary>Update normals and vertices to get a flat shading rendering.</summary>
  9654. /// <summary>Warning: This may imply adding vertices to the mesh in order to get exactly 3 vertices per face</summary>
  9655. var kinds = this.getVerticesDataKinds();
  9656. var vbs = [];
  9657. var data = [];
  9658. var newdata = [];
  9659. var updatableNormals = false;
  9660. for (var kindIndex = 0; kindIndex < kinds.length; kindIndex++) {
  9661. var kind = kinds[kindIndex];
  9662. var vertexBuffer = this.getVertexBuffer(kind);
  9663. if (kind === BABYLON.VertexBuffer.NormalKind) {
  9664. updatableNormals = vertexBuffer.isUpdatable();
  9665. kinds.splice(kindIndex, 1);
  9666. kindIndex--;
  9667. continue;
  9668. }
  9669. vbs[kind] = vertexBuffer;
  9670. data[kind] = vbs[kind].getData();
  9671. newdata[kind] = [];
  9672. }
  9673. // Save previous submeshes
  9674. var previousSubmeshes = this.subMeshes.slice(0);
  9675. var indices = this.getIndices();
  9676. var totalIndices = this.getTotalIndices();
  9677. for (index = 0; index < totalIndices; index++) {
  9678. var vertexIndex = indices[index];
  9679. for (kindIndex = 0; kindIndex < kinds.length; kindIndex++) {
  9680. kind = kinds[kindIndex];
  9681. var stride = vbs[kind].getStrideSize();
  9682. for (var offset = 0; offset < stride; offset++) {
  9683. newdata[kind].push(data[kind][vertexIndex * stride + offset]);
  9684. }
  9685. }
  9686. }
  9687. // Updating faces & normal
  9688. var normals = [];
  9689. var positions = newdata[BABYLON.VertexBuffer.PositionKind];
  9690. for (var index = 0; index < totalIndices; index += 3) {
  9691. indices[index] = index;
  9692. indices[index + 1] = index + 1;
  9693. indices[index + 2] = index + 2;
  9694. var p1 = BABYLON.Vector3.FromArray(positions, index * 3);
  9695. var p2 = BABYLON.Vector3.FromArray(positions, (index + 1) * 3);
  9696. var p3 = BABYLON.Vector3.FromArray(positions, (index + 2) * 3);
  9697. var p1p2 = p1.subtract(p2);
  9698. var p3p2 = p3.subtract(p2);
  9699. var normal = BABYLON.Vector3.Normalize(BABYLON.Vector3.Cross(p1p2, p3p2));
  9700. for (var localIndex = 0; localIndex < 3; localIndex++) {
  9701. normals.push(normal.x);
  9702. normals.push(normal.y);
  9703. normals.push(normal.z);
  9704. }
  9705. }
  9706. this.setIndices(indices);
  9707. this.setVerticesData(BABYLON.VertexBuffer.NormalKind, normals, updatableNormals);
  9708. for (kindIndex = 0; kindIndex < kinds.length; kindIndex++) {
  9709. kind = kinds[kindIndex];
  9710. this.setVerticesData(kind, newdata[kind], vbs[kind].isUpdatable());
  9711. }
  9712. // Updating submeshes
  9713. this.releaseSubMeshes();
  9714. for (var submeshIndex = 0; submeshIndex < previousSubmeshes.length; submeshIndex++) {
  9715. var previousOne = previousSubmeshes[submeshIndex];
  9716. var subMesh = new BABYLON.SubMesh(previousOne.materialIndex, previousOne.indexStart, previousOne.indexCount, previousOne.indexStart, previousOne.indexCount, this);
  9717. }
  9718. this.synchronizeInstances();
  9719. };
  9720. // Instances
  9721. Mesh.prototype.createInstance = function (name) {
  9722. return new BABYLON.InstancedMesh(name, this);
  9723. };
  9724. Mesh.prototype.synchronizeInstances = function () {
  9725. for (var instanceIndex = 0; instanceIndex < this.instances.length; instanceIndex++) {
  9726. var instance = this.instances[instanceIndex];
  9727. instance._syncSubMeshes();
  9728. }
  9729. };
  9730. // Statics
  9731. Mesh.CreateBox = function (name, size, scene, updatable) {
  9732. var box = new BABYLON.Mesh(name, scene);
  9733. var vertexData = BABYLON.VertexData.CreateBox(size);
  9734. vertexData.applyToMesh(box, updatable);
  9735. return box;
  9736. };
  9737. Mesh.CreateSphere = function (name, segments, diameter, scene, updatable) {
  9738. var sphere = new BABYLON.Mesh(name, scene);
  9739. var vertexData = BABYLON.VertexData.CreateSphere(segments, diameter);
  9740. vertexData.applyToMesh(sphere, updatable);
  9741. return sphere;
  9742. };
  9743. // Cylinder and cone (Code inspired by SharpDX.org)
  9744. Mesh.CreateCylinder = function (name, height, diameterTop, diameterBottom, tessellation, subdivisions, scene, updatable) {
  9745. // subdivisions is a new parameter, we need to support old signature
  9746. if (scene === undefined || !(scene instanceof BABYLON.Scene)) {
  9747. if (scene !== undefined) {
  9748. updatable = scene;
  9749. }
  9750. scene = subdivisions;
  9751. subdivisions = 1;
  9752. }
  9753. var cylinder = new BABYLON.Mesh(name, scene);
  9754. var vertexData = BABYLON.VertexData.CreateCylinder(height, diameterTop, diameterBottom, tessellation, subdivisions);
  9755. vertexData.applyToMesh(cylinder, updatable);
  9756. return cylinder;
  9757. };
  9758. // Torus (Code from SharpDX.org)
  9759. Mesh.CreateTorus = function (name, diameter, thickness, tessellation, scene, updatable) {
  9760. var torus = new BABYLON.Mesh(name, scene);
  9761. var vertexData = BABYLON.VertexData.CreateTorus(diameter, thickness, tessellation);
  9762. vertexData.applyToMesh(torus, updatable);
  9763. return torus;
  9764. };
  9765. Mesh.CreateTorusKnot = function (name, radius, tube, radialSegments, tubularSegments, p, q, scene, updatable) {
  9766. var torusKnot = new BABYLON.Mesh(name, scene);
  9767. var vertexData = BABYLON.VertexData.CreateTorusKnot(radius, tube, radialSegments, tubularSegments, p, q);
  9768. vertexData.applyToMesh(torusKnot, updatable);
  9769. return torusKnot;
  9770. };
  9771. // Lines
  9772. Mesh.CreateLines = function (name, points, scene, updatable) {
  9773. var lines = new BABYLON.LinesMesh(name, scene, updatable);
  9774. var vertexData = BABYLON.VertexData.CreateLines(points);
  9775. vertexData.applyToMesh(lines, updatable);
  9776. return lines;
  9777. };
  9778. // Plane & ground
  9779. Mesh.CreatePlane = function (name, size, scene, updatable) {
  9780. var plane = new BABYLON.Mesh(name, scene);
  9781. var vertexData = BABYLON.VertexData.CreatePlane(size);
  9782. vertexData.applyToMesh(plane, updatable);
  9783. return plane;
  9784. };
  9785. Mesh.CreateGround = function (name, width, height, subdivisions, scene, updatable) {
  9786. var ground = new BABYLON.GroundMesh(name, scene);
  9787. ground._setReady(false);
  9788. ground._subdivisions = subdivisions;
  9789. var vertexData = BABYLON.VertexData.CreateGround(width, height, subdivisions);
  9790. vertexData.applyToMesh(ground, updatable);
  9791. ground._setReady(true);
  9792. return ground;
  9793. };
  9794. Mesh.CreateTiledGround = function (name, xmin, zmin, xmax, zmax, subdivisions, precision, scene, updatable) {
  9795. var tiledGround = new BABYLON.Mesh(name, scene);
  9796. var vertexData = BABYLON.VertexData.CreateTiledGround(xmin, zmin, xmax, zmax, subdivisions, precision);
  9797. vertexData.applyToMesh(tiledGround, updatable);
  9798. return tiledGround;
  9799. };
  9800. Mesh.CreateGroundFromHeightMap = function (name, url, width, height, subdivisions, minHeight, maxHeight, scene, updatable) {
  9801. var ground = new BABYLON.GroundMesh(name, scene);
  9802. ground._subdivisions = subdivisions;
  9803. ground._setReady(false);
  9804. var onload = function (img) {
  9805. // Getting height map data
  9806. var canvas = document.createElement("canvas");
  9807. var context = canvas.getContext("2d");
  9808. var heightMapWidth = img.width;
  9809. var heightMapHeight = img.height;
  9810. canvas.width = heightMapWidth;
  9811. canvas.height = heightMapHeight;
  9812. context.drawImage(img, 0, 0);
  9813. // Create VertexData from map data
  9814. var buffer = context.getImageData(0, 0, heightMapWidth, heightMapHeight).data;
  9815. var vertexData = BABYLON.VertexData.CreateGroundFromHeightMap(width, height, subdivisions, minHeight, maxHeight, buffer, heightMapWidth, heightMapHeight);
  9816. vertexData.applyToMesh(ground, updatable);
  9817. ground._setReady(true);
  9818. };
  9819. BABYLON.Tools.LoadImage(url, onload, function () {
  9820. }, scene.database);
  9821. return ground;
  9822. };
  9823. // Tools
  9824. Mesh.MinMax = function (meshes) {
  9825. var minVector = null;
  9826. var maxVector = null;
  9827. for (var i in meshes) {
  9828. var mesh = meshes[i];
  9829. var boundingBox = mesh.getBoundingInfo().boundingBox;
  9830. if (!minVector) {
  9831. minVector = boundingBox.minimumWorld;
  9832. maxVector = boundingBox.maximumWorld;
  9833. continue;
  9834. }
  9835. minVector.MinimizeInPlace(boundingBox.minimumWorld);
  9836. maxVector.MaximizeInPlace(boundingBox.maximumWorld);
  9837. }
  9838. return {
  9839. min: minVector,
  9840. max: maxVector
  9841. };
  9842. };
  9843. Mesh.Center = function (meshesOrMinMaxVector) {
  9844. var minMaxVector = meshesOrMinMaxVector.min !== undefined ? meshesOrMinMaxVector : BABYLON.Mesh.MinMax(meshesOrMinMaxVector);
  9845. return BABYLON.Vector3.Center(minMaxVector.min, minMaxVector.max);
  9846. };
  9847. Mesh.MergeMeshes = function (meshes, disposeSource, allow32BitsIndices) {
  9848. if (typeof disposeSource === "undefined") { disposeSource = true; }
  9849. var source = meshes[0];
  9850. var material = source.material;
  9851. var scene = source.getScene();
  9852. if (!allow32BitsIndices) {
  9853. var totalVertices = 0;
  9854. for (var index = 0; index < meshes.length; index++) {
  9855. totalVertices += meshes[index].getTotalVertices();
  9856. if (totalVertices > 65536) {
  9857. BABYLON.Tools.Warn("Cannot merge meshes because resulting mesh will have more than 65536 vertices. Please use allow32BitsIndices = true to use 32 bits indices");
  9858. return null;
  9859. }
  9860. }
  9861. }
  9862. // Merge
  9863. var vertexData = BABYLON.VertexData.ExtractFromMesh(source);
  9864. vertexData.transform(source.getWorldMatrix());
  9865. for (index = 1; index < meshes.length; index++) {
  9866. var otherVertexData = BABYLON.VertexData.ExtractFromMesh(meshes[index]);
  9867. otherVertexData.transform(meshes[index].getWorldMatrix());
  9868. vertexData.merge(otherVertexData);
  9869. }
  9870. var newMesh = new Mesh(source.name + "_merged", scene);
  9871. vertexData.applyToMesh(newMesh);
  9872. // Setting properties
  9873. newMesh.material = material;
  9874. newMesh.checkCollisions = source.checkCollisions;
  9875. // Cleaning
  9876. if (disposeSource) {
  9877. for (index = 0; index < meshes.length; index++) {
  9878. meshes[index].dispose();
  9879. }
  9880. }
  9881. return newMesh;
  9882. };
  9883. return Mesh;
  9884. })(BABYLON.AbstractMesh);
  9885. BABYLON.Mesh = Mesh;
  9886. })(BABYLON || (BABYLON = {}));
  9887. //# sourceMappingURL=babylon.mesh.js.map
  9888. var BABYLON;
  9889. (function (BABYLON) {
  9890. var GroundMesh = (function (_super) {
  9891. __extends(GroundMesh, _super);
  9892. function GroundMesh(name, scene) {
  9893. _super.call(this, name, scene);
  9894. this.generateOctree = false;
  9895. this._worldInverse = new BABYLON.Matrix();
  9896. }
  9897. Object.defineProperty(GroundMesh.prototype, "subdivisions", {
  9898. get: function () {
  9899. return this._subdivisions;
  9900. },
  9901. enumerable: true,
  9902. configurable: true
  9903. });
  9904. GroundMesh.prototype.optimize = function (chunksCount) {
  9905. this.subdivide(this._subdivisions);
  9906. this.createOrUpdateSubmeshesOctree(32);
  9907. };
  9908. GroundMesh.prototype.getHeightAtCoordinates = function (x, z) {
  9909. var ray = new BABYLON.Ray(new BABYLON.Vector3(x, this.getBoundingInfo().boundingBox.maximumWorld.y + 1, z), new BABYLON.Vector3(0, -1, 0));
  9910. this.getWorldMatrix().invertToRef(this._worldInverse);
  9911. ray = BABYLON.Ray.Transform(ray, this._worldInverse);
  9912. var pickInfo = this.intersects(ray);
  9913. if (pickInfo.hit) {
  9914. return pickInfo.pickedPoint.y;
  9915. }
  9916. return 0;
  9917. };
  9918. return GroundMesh;
  9919. })(BABYLON.Mesh);
  9920. BABYLON.GroundMesh = GroundMesh;
  9921. })(BABYLON || (BABYLON = {}));
  9922. //# sourceMappingURL=babylon.groundMesh.js.map
  9923. var BABYLON;
  9924. (function (BABYLON) {
  9925. var InstancedMesh = (function (_super) {
  9926. __extends(InstancedMesh, _super);
  9927. function InstancedMesh(name, source) {
  9928. _super.call(this, name, source.getScene());
  9929. source.instances.push(this);
  9930. this._sourceMesh = source;
  9931. this.position.copyFrom(source.position);
  9932. this.rotation.copyFrom(source.rotation);
  9933. this.scaling.copyFrom(source.scaling);
  9934. if (source.rotationQuaternion) {
  9935. this.rotationQuaternion = source.rotationQuaternion.clone();
  9936. }
  9937. this.infiniteDistance = source.infiniteDistance;
  9938. this.setPivotMatrix(source.getPivotMatrix());
  9939. this.refreshBoundingInfo();
  9940. this._syncSubMeshes();
  9941. }
  9942. Object.defineProperty(InstancedMesh.prototype, "receiveShadows", {
  9943. // Methods
  9944. get: function () {
  9945. return this._sourceMesh.receiveShadows;
  9946. },
  9947. enumerable: true,
  9948. configurable: true
  9949. });
  9950. Object.defineProperty(InstancedMesh.prototype, "material", {
  9951. get: function () {
  9952. return this._sourceMesh.material;
  9953. },
  9954. enumerable: true,
  9955. configurable: true
  9956. });
  9957. Object.defineProperty(InstancedMesh.prototype, "visibility", {
  9958. get: function () {
  9959. return this._sourceMesh.visibility;
  9960. },
  9961. enumerable: true,
  9962. configurable: true
  9963. });
  9964. Object.defineProperty(InstancedMesh.prototype, "skeleton", {
  9965. get: function () {
  9966. return this._sourceMesh.skeleton;
  9967. },
  9968. enumerable: true,
  9969. configurable: true
  9970. });
  9971. InstancedMesh.prototype.getTotalVertices = function () {
  9972. return this._sourceMesh.getTotalVertices();
  9973. };
  9974. Object.defineProperty(InstancedMesh.prototype, "sourceMesh", {
  9975. get: function () {
  9976. return this._sourceMesh;
  9977. },
  9978. enumerable: true,
  9979. configurable: true
  9980. });
  9981. InstancedMesh.prototype.getVerticesData = function (kind) {
  9982. return this._sourceMesh.getVerticesData(kind);
  9983. };
  9984. InstancedMesh.prototype.isVerticesDataPresent = function (kind) {
  9985. return this._sourceMesh.isVerticesDataPresent(kind);
  9986. };
  9987. InstancedMesh.prototype.getIndices = function () {
  9988. return this._sourceMesh.getIndices();
  9989. };
  9990. Object.defineProperty(InstancedMesh.prototype, "_positions", {
  9991. get: function () {
  9992. return this._sourceMesh._positions;
  9993. },
  9994. enumerable: true,
  9995. configurable: true
  9996. });
  9997. InstancedMesh.prototype.refreshBoundingInfo = function () {
  9998. var data = this._sourceMesh.getVerticesData(BABYLON.VertexBuffer.PositionKind);
  9999. if (data) {
  10000. var extend = BABYLON.Tools.ExtractMinAndMax(data, 0, this._sourceMesh.getTotalVertices());
  10001. this._boundingInfo = new BABYLON.BoundingInfo(extend.minimum, extend.maximum);
  10002. }
  10003. this._updateBoundingInfo();
  10004. };
  10005. InstancedMesh.prototype._preActivate = function () {
  10006. if (this._currentLOD) {
  10007. this._currentLOD._preActivate();
  10008. }
  10009. };
  10010. InstancedMesh.prototype._activate = function (renderId) {
  10011. if (this._currentLOD) {
  10012. this._currentLOD._registerInstanceForRenderId(this, renderId);
  10013. }
  10014. };
  10015. InstancedMesh.prototype.getLOD = function (camera) {
  10016. this._currentLOD = this.sourceMesh.getLOD(this.getScene().activeCamera, this.getBoundingInfo().boundingSphere);
  10017. return this._currentLOD;
  10018. };
  10019. InstancedMesh.prototype._syncSubMeshes = function () {
  10020. this.releaseSubMeshes();
  10021. for (var index = 0; index < this._sourceMesh.subMeshes.length; index++) {
  10022. this._sourceMesh.subMeshes[index].clone(this, this._sourceMesh);
  10023. }
  10024. };
  10025. InstancedMesh.prototype._generatePointsArray = function () {
  10026. return this._sourceMesh._generatePointsArray();
  10027. };
  10028. // Clone
  10029. InstancedMesh.prototype.clone = function (name, newParent, doNotCloneChildren) {
  10030. var result = this._sourceMesh.createInstance(name);
  10031. // Deep copy
  10032. BABYLON.Tools.DeepCopy(this, result, ["name"], []);
  10033. // Bounding info
  10034. this.refreshBoundingInfo();
  10035. // Parent
  10036. if (newParent) {
  10037. result.parent = newParent;
  10038. }
  10039. if (!doNotCloneChildren) {
  10040. for (var index = 0; index < this.getScene().meshes.length; index++) {
  10041. var mesh = this.getScene().meshes[index];
  10042. if (mesh.parent == this) {
  10043. mesh.clone(mesh.name, result);
  10044. }
  10045. }
  10046. }
  10047. result.computeWorldMatrix(true);
  10048. return result;
  10049. };
  10050. // Dispoe
  10051. InstancedMesh.prototype.dispose = function (doNotRecurse) {
  10052. // Remove from mesh
  10053. var index = this._sourceMesh.instances.indexOf(this);
  10054. this._sourceMesh.instances.splice(index, 1);
  10055. _super.prototype.dispose.call(this, doNotRecurse);
  10056. };
  10057. return InstancedMesh;
  10058. })(BABYLON.AbstractMesh);
  10059. BABYLON.InstancedMesh = InstancedMesh;
  10060. })(BABYLON || (BABYLON = {}));
  10061. //# sourceMappingURL=babylon.instancedMesh.js.map
  10062. var BABYLON;
  10063. (function (BABYLON) {
  10064. var SubMesh = (function () {
  10065. function SubMesh(materialIndex, verticesStart, verticesCount, indexStart, indexCount, mesh, renderingMesh, createBoundingBox) {
  10066. if (typeof createBoundingBox === "undefined") { createBoundingBox = true; }
  10067. this.materialIndex = materialIndex;
  10068. this.verticesStart = verticesStart;
  10069. this.verticesCount = verticesCount;
  10070. this.indexStart = indexStart;
  10071. this.indexCount = indexCount;
  10072. this._renderId = 0;
  10073. this._mesh = mesh;
  10074. this._renderingMesh = renderingMesh || mesh;
  10075. mesh.subMeshes.push(this);
  10076. this._id = mesh.subMeshes.length - 1;
  10077. if (createBoundingBox) {
  10078. this.refreshBoundingInfo();
  10079. }
  10080. }
  10081. SubMesh.prototype.getBoundingInfo = function () {
  10082. return this._boundingInfo;
  10083. };
  10084. SubMesh.prototype.getMesh = function () {
  10085. return this._mesh;
  10086. };
  10087. SubMesh.prototype.getRenderingMesh = function () {
  10088. return this._renderingMesh;
  10089. };
  10090. SubMesh.prototype.getMaterial = function () {
  10091. var rootMaterial = this._renderingMesh.material;
  10092. if (rootMaterial && rootMaterial instanceof BABYLON.MultiMaterial) {
  10093. var multiMaterial = rootMaterial;
  10094. return multiMaterial.getSubMaterial(this.materialIndex);
  10095. }
  10096. if (!rootMaterial) {
  10097. return this._mesh.getScene().defaultMaterial;
  10098. }
  10099. return rootMaterial;
  10100. };
  10101. // Methods
  10102. SubMesh.prototype.refreshBoundingInfo = function () {
  10103. var data = this._renderingMesh.getVerticesData(BABYLON.VertexBuffer.PositionKind);
  10104. if (!data) {
  10105. this._boundingInfo = this._mesh._boundingInfo;
  10106. return;
  10107. }
  10108. var indices = this._renderingMesh.getIndices();
  10109. var extend;
  10110. if (this.indexStart === 0 && this.indexCount === indices.length) {
  10111. extend = BABYLON.Tools.ExtractMinAndMax(data, this.verticesStart, this.verticesCount);
  10112. } else {
  10113. extend = BABYLON.Tools.ExtractMinAndMaxIndexed(data, indices, this.indexStart, this.indexCount);
  10114. }
  10115. this._boundingInfo = new BABYLON.BoundingInfo(extend.minimum, extend.maximum);
  10116. };
  10117. SubMesh.prototype._checkCollision = function (collider) {
  10118. return this._boundingInfo._checkCollision(collider);
  10119. };
  10120. SubMesh.prototype.updateBoundingInfo = function (world) {
  10121. if (!this._boundingInfo) {
  10122. this.refreshBoundingInfo();
  10123. }
  10124. this._boundingInfo._update(world);
  10125. };
  10126. SubMesh.prototype.isInFrustum = function (frustumPlanes) {
  10127. return this._boundingInfo.isInFrustum(frustumPlanes);
  10128. };
  10129. SubMesh.prototype.render = function () {
  10130. this._renderingMesh.render(this);
  10131. };
  10132. SubMesh.prototype.getLinesIndexBuffer = function (indices, engine) {
  10133. if (!this._linesIndexBuffer) {
  10134. var linesIndices = [];
  10135. for (var index = this.indexStart; index < this.indexStart + this.indexCount; index += 3) {
  10136. linesIndices.push(indices[index], indices[index + 1], indices[index + 1], indices[index + 2], indices[index + 2], indices[index]);
  10137. }
  10138. this._linesIndexBuffer = engine.createIndexBuffer(linesIndices);
  10139. this.linesIndexCount = linesIndices.length;
  10140. }
  10141. return this._linesIndexBuffer;
  10142. };
  10143. SubMesh.prototype.canIntersects = function (ray) {
  10144. return ray.intersectsBox(this._boundingInfo.boundingBox);
  10145. };
  10146. SubMesh.prototype.intersects = function (ray, positions, indices, fastCheck) {
  10147. var intersectInfo = null;
  10148. for (var index = this.indexStart; index < this.indexStart + this.indexCount; index += 3) {
  10149. var p0 = positions[indices[index]];
  10150. var p1 = positions[indices[index + 1]];
  10151. var p2 = positions[indices[index + 2]];
  10152. var currentIntersectInfo = ray.intersectsTriangle(p0, p1, p2);
  10153. if (currentIntersectInfo) {
  10154. if (fastCheck || !intersectInfo || currentIntersectInfo.distance < intersectInfo.distance) {
  10155. intersectInfo = currentIntersectInfo;
  10156. intersectInfo.faceId = index / 3;
  10157. if (fastCheck) {
  10158. break;
  10159. }
  10160. }
  10161. }
  10162. }
  10163. return intersectInfo;
  10164. };
  10165. // Clone
  10166. SubMesh.prototype.clone = function (newMesh, newRenderingMesh) {
  10167. var result = new SubMesh(this.materialIndex, this.verticesStart, this.verticesCount, this.indexStart, this.indexCount, newMesh, newRenderingMesh, false);
  10168. result._boundingInfo = new BABYLON.BoundingInfo(this._boundingInfo.minimum, this._boundingInfo.maximum);
  10169. return result;
  10170. };
  10171. // Dispose
  10172. SubMesh.prototype.dispose = function () {
  10173. if (this._linesIndexBuffer) {
  10174. this._mesh.getScene().getEngine()._releaseBuffer(this._linesIndexBuffer);
  10175. this._linesIndexBuffer = null;
  10176. }
  10177. // Remove from mesh
  10178. var index = this._mesh.subMeshes.indexOf(this);
  10179. this._mesh.subMeshes.splice(index, 1);
  10180. };
  10181. // Statics
  10182. SubMesh.CreateFromIndices = function (materialIndex, startIndex, indexCount, mesh, renderingMesh) {
  10183. var minVertexIndex = Number.MAX_VALUE;
  10184. var maxVertexIndex = -Number.MAX_VALUE;
  10185. renderingMesh = renderingMesh || mesh;
  10186. var indices = renderingMesh.getIndices();
  10187. for (var index = startIndex; index < startIndex + indexCount; index++) {
  10188. var vertexIndex = indices[index];
  10189. if (vertexIndex < minVertexIndex)
  10190. minVertexIndex = vertexIndex;
  10191. if (vertexIndex > maxVertexIndex)
  10192. maxVertexIndex = vertexIndex;
  10193. }
  10194. return new BABYLON.SubMesh(materialIndex, minVertexIndex, maxVertexIndex - minVertexIndex + 1, startIndex, indexCount, mesh, renderingMesh);
  10195. };
  10196. return SubMesh;
  10197. })();
  10198. BABYLON.SubMesh = SubMesh;
  10199. })(BABYLON || (BABYLON = {}));
  10200. //# sourceMappingURL=babylon.subMesh.js.map
  10201. var BABYLON;
  10202. (function (BABYLON) {
  10203. var BaseTexture = (function () {
  10204. function BaseTexture(scene) {
  10205. this.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_NONE;
  10206. this.hasAlpha = false;
  10207. this.getAlphaFromRGB = false;
  10208. this.level = 1;
  10209. this.isCube = false;
  10210. this.isRenderTarget = false;
  10211. this.animations = new Array();
  10212. this.coordinatesIndex = 0;
  10213. this.coordinatesMode = BABYLON.Texture.EXPLICIT_MODE;
  10214. this.wrapU = BABYLON.Texture.WRAP_ADDRESSMODE;
  10215. this.wrapV = BABYLON.Texture.WRAP_ADDRESSMODE;
  10216. this.anisotropicFilteringLevel = 4;
  10217. this._scene = scene;
  10218. this._scene.textures.push(this);
  10219. }
  10220. BaseTexture.prototype.getScene = function () {
  10221. return this._scene;
  10222. };
  10223. BaseTexture.prototype.getTextureMatrix = function () {
  10224. return null;
  10225. };
  10226. BaseTexture.prototype.getReflectionTextureMatrix = function () {
  10227. return null;
  10228. };
  10229. BaseTexture.prototype.getInternalTexture = function () {
  10230. return this._texture;
  10231. };
  10232. BaseTexture.prototype.isReady = function () {
  10233. if (this.delayLoadState === BABYLON.Engine.DELAYLOADSTATE_NOTLOADED) {
  10234. return true;
  10235. }
  10236. if (this._texture) {
  10237. return this._texture.isReady;
  10238. }
  10239. return false;
  10240. };
  10241. BaseTexture.prototype.getSize = function () {
  10242. if (this._texture._width) {
  10243. return { width: this._texture._width, height: this._texture._height };
  10244. }
  10245. if (this._texture._size) {
  10246. return { width: this._texture._size, height: this._texture._size };
  10247. }
  10248. return { width: 0, height: 0 };
  10249. };
  10250. BaseTexture.prototype.getBaseSize = function () {
  10251. if (!this.isReady())
  10252. return { width: 0, height: 0 };
  10253. if (this._texture._size) {
  10254. return { width: this._texture._size, height: this._texture._size };
  10255. }
  10256. return { width: this._texture._baseWidth, height: this._texture._baseHeight };
  10257. };
  10258. BaseTexture.prototype.scale = function (ratio) {
  10259. };
  10260. Object.defineProperty(BaseTexture.prototype, "canRescale", {
  10261. get: function () {
  10262. return false;
  10263. },
  10264. enumerable: true,
  10265. configurable: true
  10266. });
  10267. BaseTexture.prototype._removeFromCache = function (url, noMipmap) {
  10268. var texturesCache = this._scene.getEngine().getLoadedTexturesCache();
  10269. for (var index = 0; index < texturesCache.length; index++) {
  10270. var texturesCacheEntry = texturesCache[index];
  10271. if (texturesCacheEntry.url === url && texturesCacheEntry.noMipmap === noMipmap) {
  10272. texturesCache.splice(index, 1);
  10273. return;
  10274. }
  10275. }
  10276. };
  10277. BaseTexture.prototype._getFromCache = function (url, noMipmap) {
  10278. var texturesCache = this._scene.getEngine().getLoadedTexturesCache();
  10279. for (var index = 0; index < texturesCache.length; index++) {
  10280. var texturesCacheEntry = texturesCache[index];
  10281. if (texturesCacheEntry.url === url && texturesCacheEntry.noMipmap === noMipmap) {
  10282. texturesCacheEntry.references++;
  10283. return texturesCacheEntry;
  10284. }
  10285. }
  10286. return null;
  10287. };
  10288. BaseTexture.prototype.delayLoad = function () {
  10289. };
  10290. BaseTexture.prototype.releaseInternalTexture = function () {
  10291. if (!this._texture) {
  10292. return;
  10293. }
  10294. var texturesCache = this._scene.getEngine().getLoadedTexturesCache();
  10295. this._texture.references--;
  10296. // Final reference ?
  10297. if (this._texture.references === 0) {
  10298. var index = texturesCache.indexOf(this._texture);
  10299. texturesCache.splice(index, 1);
  10300. this._scene.getEngine()._releaseTexture(this._texture);
  10301. delete this._texture;
  10302. }
  10303. };
  10304. BaseTexture.prototype.clone = function () {
  10305. return null;
  10306. };
  10307. BaseTexture.prototype.dispose = function () {
  10308. // Remove from scene
  10309. var index = this._scene.textures.indexOf(this);
  10310. if (index >= 0) {
  10311. this._scene.textures.splice(index, 1);
  10312. }
  10313. if (this._texture === undefined) {
  10314. return;
  10315. }
  10316. this.releaseInternalTexture();
  10317. // Callback
  10318. if (this.onDispose) {
  10319. this.onDispose();
  10320. }
  10321. };
  10322. return BaseTexture;
  10323. })();
  10324. BABYLON.BaseTexture = BaseTexture;
  10325. })(BABYLON || (BABYLON = {}));
  10326. //# sourceMappingURL=babylon.baseTexture.js.map
  10327. var BABYLON;
  10328. (function (BABYLON) {
  10329. var RenderingGroup = (function () {
  10330. function RenderingGroup(index, scene) {
  10331. this.index = index;
  10332. this._opaqueSubMeshes = new BABYLON.SmartArray(256);
  10333. this._transparentSubMeshes = new BABYLON.SmartArray(256);
  10334. this._alphaTestSubMeshes = new BABYLON.SmartArray(256);
  10335. this._scene = scene;
  10336. }
  10337. RenderingGroup.prototype.render = function (customRenderFunction) {
  10338. if (customRenderFunction) {
  10339. customRenderFunction(this._opaqueSubMeshes, this._alphaTestSubMeshes, this._transparentSubMeshes);
  10340. return true;
  10341. }
  10342. if (this._opaqueSubMeshes.length === 0 && this._alphaTestSubMeshes.length === 0 && this._transparentSubMeshes.length === 0) {
  10343. return false;
  10344. }
  10345. var engine = this._scene.getEngine();
  10346. // Opaque
  10347. var subIndex;
  10348. var submesh;
  10349. for (subIndex = 0; subIndex < this._opaqueSubMeshes.length; subIndex++) {
  10350. submesh = this._opaqueSubMeshes.data[subIndex];
  10351. submesh.render();
  10352. }
  10353. // Alpha test
  10354. engine.setAlphaTesting(true);
  10355. for (subIndex = 0; subIndex < this._alphaTestSubMeshes.length; subIndex++) {
  10356. submesh = this._alphaTestSubMeshes.data[subIndex];
  10357. submesh.render();
  10358. }
  10359. engine.setAlphaTesting(false);
  10360. // Transparent
  10361. if (this._transparentSubMeshes.length) {
  10362. for (subIndex = 0; subIndex < this._transparentSubMeshes.length; subIndex++) {
  10363. submesh = this._transparentSubMeshes.data[subIndex];
  10364. submesh._alphaIndex = submesh.getMesh().alphaIndex;
  10365. submesh._distanceToCamera = submesh.getBoundingInfo().boundingSphere.centerWorld.subtract(this._scene.activeCamera.position).length();
  10366. }
  10367. var sortedArray = this._transparentSubMeshes.data.slice(0, this._transparentSubMeshes.length);
  10368. sortedArray.sort(function (a, b) {
  10369. // Alpha index first
  10370. if (a._alphaIndex > b._alphaIndex) {
  10371. return 1;
  10372. }
  10373. if (a._alphaIndex < b._alphaIndex) {
  10374. return -1;
  10375. }
  10376. // Then distance to camera
  10377. if (a._distanceToCamera < b._distanceToCamera) {
  10378. return 1;
  10379. }
  10380. if (a._distanceToCamera > b._distanceToCamera) {
  10381. return -1;
  10382. }
  10383. return 0;
  10384. });
  10385. // Rendering
  10386. engine.setAlphaMode(BABYLON.Engine.ALPHA_COMBINE);
  10387. for (subIndex = 0; subIndex < sortedArray.length; subIndex++) {
  10388. submesh = sortedArray[subIndex];
  10389. submesh.render();
  10390. }
  10391. engine.setAlphaMode(BABYLON.Engine.ALPHA_DISABLE);
  10392. }
  10393. return true;
  10394. };
  10395. RenderingGroup.prototype.prepare = function () {
  10396. this._opaqueSubMeshes.reset();
  10397. this._transparentSubMeshes.reset();
  10398. this._alphaTestSubMeshes.reset();
  10399. };
  10400. RenderingGroup.prototype.dispatch = function (subMesh) {
  10401. var material = subMesh.getMaterial();
  10402. var mesh = subMesh.getMesh();
  10403. if (material.needAlphaBlending() || mesh.visibility < 1.0 || mesh.hasVertexAlpha) {
  10404. this._transparentSubMeshes.push(subMesh);
  10405. } else if (material.needAlphaTesting()) {
  10406. this._alphaTestSubMeshes.push(subMesh);
  10407. } else {
  10408. this._opaqueSubMeshes.push(subMesh); // Opaque
  10409. }
  10410. };
  10411. return RenderingGroup;
  10412. })();
  10413. BABYLON.RenderingGroup = RenderingGroup;
  10414. })(BABYLON || (BABYLON = {}));
  10415. //# sourceMappingURL=babylon.renderingGroup.js.map
  10416. var BABYLON;
  10417. (function (BABYLON) {
  10418. var RenderingManager = (function () {
  10419. function RenderingManager(scene) {
  10420. this._renderingGroups = new Array();
  10421. this._scene = scene;
  10422. }
  10423. RenderingManager.prototype._renderParticles = function (index, activeMeshes) {
  10424. if (this._scene._activeParticleSystems.length === 0) {
  10425. return;
  10426. }
  10427. // Particles
  10428. var beforeParticlesDate = BABYLON.Tools.Now;
  10429. for (var particleIndex = 0; particleIndex < this._scene._activeParticleSystems.length; particleIndex++) {
  10430. var particleSystem = this._scene._activeParticleSystems.data[particleIndex];
  10431. if (particleSystem.renderingGroupId !== index) {
  10432. continue;
  10433. }
  10434. this._clearDepthBuffer();
  10435. if (!particleSystem.emitter.position || !activeMeshes || activeMeshes.indexOf(particleSystem.emitter) !== -1) {
  10436. this._scene._activeParticles += particleSystem.render();
  10437. }
  10438. }
  10439. this._scene._particlesDuration += BABYLON.Tools.Now - beforeParticlesDate;
  10440. };
  10441. RenderingManager.prototype._renderSprites = function (index) {
  10442. if (this._scene.spriteManagers.length === 0) {
  10443. return;
  10444. }
  10445. // Sprites
  10446. var beforeSpritessDate = BABYLON.Tools.Now;
  10447. for (var id = 0; id < this._scene.spriteManagers.length; id++) {
  10448. var spriteManager = this._scene.spriteManagers[id];
  10449. if (spriteManager.renderingGroupId === index) {
  10450. this._clearDepthBuffer();
  10451. spriteManager.render();
  10452. }
  10453. }
  10454. this._scene._spritesDuration += BABYLON.Tools.Now - beforeSpritessDate;
  10455. };
  10456. RenderingManager.prototype._clearDepthBuffer = function () {
  10457. if (this._depthBufferAlreadyCleaned) {
  10458. return;
  10459. }
  10460. this._scene.getEngine().clear(0, false, true);
  10461. this._depthBufferAlreadyCleaned = true;
  10462. };
  10463. RenderingManager.prototype.render = function (customRenderFunction, activeMeshes, renderParticles, renderSprites) {
  10464. for (var index = 0; index < BABYLON.RenderingManager.MAX_RENDERINGGROUPS; index++) {
  10465. this._depthBufferAlreadyCleaned = false;
  10466. var renderingGroup = this._renderingGroups[index];
  10467. if (renderingGroup) {
  10468. this._clearDepthBuffer();
  10469. if (!renderingGroup.render(customRenderFunction)) {
  10470. this._renderingGroups.splice(index, 1);
  10471. }
  10472. }
  10473. this._renderSprites(index);
  10474. if (renderParticles) {
  10475. this._renderParticles(index, activeMeshes);
  10476. }
  10477. }
  10478. };
  10479. RenderingManager.prototype.reset = function () {
  10480. for (var index in this._renderingGroups) {
  10481. var renderingGroup = this._renderingGroups[index];
  10482. renderingGroup.prepare();
  10483. }
  10484. };
  10485. RenderingManager.prototype.dispatch = function (subMesh) {
  10486. var mesh = subMesh.getMesh();
  10487. var renderingGroupId = mesh.renderingGroupId || 0;
  10488. if (!this._renderingGroups[renderingGroupId]) {
  10489. this._renderingGroups[renderingGroupId] = new BABYLON.RenderingGroup(renderingGroupId, this._scene);
  10490. }
  10491. this._renderingGroups[renderingGroupId].dispatch(subMesh);
  10492. };
  10493. RenderingManager.MAX_RENDERINGGROUPS = 4;
  10494. return RenderingManager;
  10495. })();
  10496. BABYLON.RenderingManager = RenderingManager;
  10497. })(BABYLON || (BABYLON = {}));
  10498. //# sourceMappingURL=babylon.renderingManager.js.map
  10499. var BABYLON;
  10500. (function (BABYLON) {
  10501. var Texture = (function (_super) {
  10502. __extends(Texture, _super);
  10503. function Texture(url, scene, noMipmap, invertY, samplingMode, onLoad, onError, buffer, deleteBuffer) {
  10504. if (typeof samplingMode === "undefined") { samplingMode = Texture.TRILINEAR_SAMPLINGMODE; }
  10505. if (typeof onLoad === "undefined") { onLoad = null; }
  10506. if (typeof onError === "undefined") { onError = null; }
  10507. if (typeof buffer === "undefined") { buffer = null; }
  10508. if (typeof deleteBuffer === "undefined") { deleteBuffer = false; }
  10509. _super.call(this, scene);
  10510. this.uOffset = 0;
  10511. this.vOffset = 0;
  10512. this.uScale = 1.0;
  10513. this.vScale = 1.0;
  10514. this.uAng = 0;
  10515. this.vAng = 0;
  10516. this.wAng = 0;
  10517. this.name = url;
  10518. this.url = url;
  10519. this._noMipmap = noMipmap;
  10520. this._invertY = invertY;
  10521. this._samplingMode = samplingMode;
  10522. this._buffer = buffer;
  10523. this._deleteBuffer = deleteBuffer;
  10524. if (!url) {
  10525. return;
  10526. }
  10527. this._texture = this._getFromCache(url, noMipmap);
  10528. if (!this._texture) {
  10529. if (!scene.useDelayedTextureLoading) {
  10530. this._texture = scene.getEngine().createTexture(url, noMipmap, invertY, scene, this._samplingMode, onLoad, onError, this._buffer);
  10531. if (deleteBuffer) {
  10532. delete this._buffer;
  10533. }
  10534. } else {
  10535. this.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_NOTLOADED;
  10536. }
  10537. }
  10538. }
  10539. Texture.prototype.delayLoad = function () {
  10540. if (this.delayLoadState != BABYLON.Engine.DELAYLOADSTATE_NOTLOADED) {
  10541. return;
  10542. }
  10543. this.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_LOADED;
  10544. this._texture = this._getFromCache(this.url, this._noMipmap);
  10545. if (!this._texture) {
  10546. this._texture = this.getScene().getEngine().createTexture(this.url, this._noMipmap, this._invertY, this.getScene(), this._samplingMode, null, null, this._buffer);
  10547. if (this._deleteBuffer) {
  10548. delete this._buffer;
  10549. }
  10550. }
  10551. };
  10552. Texture.prototype._prepareRowForTextureGeneration = function (x, y, z, t) {
  10553. x -= this.uOffset + 0.5;
  10554. y -= this.vOffset + 0.5;
  10555. z -= 0.5;
  10556. BABYLON.Vector3.TransformCoordinatesFromFloatsToRef(x, y, z, this._rowGenerationMatrix, t);
  10557. t.x *= this.uScale;
  10558. t.y *= this.vScale;
  10559. t.x += 0.5;
  10560. t.y += 0.5;
  10561. t.z += 0.5;
  10562. };
  10563. Texture.prototype.getTextureMatrix = function () {
  10564. if (this.uOffset === this._cachedUOffset && this.vOffset === this._cachedVOffset && this.uScale === this._cachedUScale && this.vScale === this._cachedVScale && this.uAng === this._cachedUAng && this.vAng === this._cachedVAng && this.wAng === this._cachedWAng) {
  10565. return this._cachedTextureMatrix;
  10566. }
  10567. this._cachedUOffset = this.uOffset;
  10568. this._cachedVOffset = this.vOffset;
  10569. this._cachedUScale = this.uScale;
  10570. this._cachedVScale = this.vScale;
  10571. this._cachedUAng = this.uAng;
  10572. this._cachedVAng = this.vAng;
  10573. this._cachedWAng = this.wAng;
  10574. if (!this._cachedTextureMatrix) {
  10575. this._cachedTextureMatrix = BABYLON.Matrix.Zero();
  10576. this._rowGenerationMatrix = new BABYLON.Matrix();
  10577. this._t0 = BABYLON.Vector3.Zero();
  10578. this._t1 = BABYLON.Vector3.Zero();
  10579. this._t2 = BABYLON.Vector3.Zero();
  10580. }
  10581. BABYLON.Matrix.RotationYawPitchRollToRef(this.vAng, this.uAng, this.wAng, this._rowGenerationMatrix);
  10582. this._prepareRowForTextureGeneration(0, 0, 0, this._t0);
  10583. this._prepareRowForTextureGeneration(1.0, 0, 0, this._t1);
  10584. this._prepareRowForTextureGeneration(0, 1.0, 0, this._t2);
  10585. this._t1.subtractInPlace(this._t0);
  10586. this._t2.subtractInPlace(this._t0);
  10587. BABYLON.Matrix.IdentityToRef(this._cachedTextureMatrix);
  10588. this._cachedTextureMatrix.m[0] = this._t1.x;
  10589. this._cachedTextureMatrix.m[1] = this._t1.y;
  10590. this._cachedTextureMatrix.m[2] = this._t1.z;
  10591. this._cachedTextureMatrix.m[4] = this._t2.x;
  10592. this._cachedTextureMatrix.m[5] = this._t2.y;
  10593. this._cachedTextureMatrix.m[6] = this._t2.z;
  10594. this._cachedTextureMatrix.m[8] = this._t0.x;
  10595. this._cachedTextureMatrix.m[9] = this._t0.y;
  10596. this._cachedTextureMatrix.m[10] = this._t0.z;
  10597. return this._cachedTextureMatrix;
  10598. };
  10599. Texture.prototype.getReflectionTextureMatrix = function () {
  10600. if (this.uOffset === this._cachedUOffset && this.vOffset === this._cachedVOffset && this.uScale === this._cachedUScale && this.vScale === this._cachedVScale && this.coordinatesMode === this._cachedCoordinatesMode) {
  10601. return this._cachedTextureMatrix;
  10602. }
  10603. if (!this._cachedTextureMatrix) {
  10604. this._cachedTextureMatrix = BABYLON.Matrix.Zero();
  10605. this._projectionModeMatrix = BABYLON.Matrix.Zero();
  10606. }
  10607. this._cachedCoordinatesMode = this.coordinatesMode;
  10608. switch (this.coordinatesMode) {
  10609. case BABYLON.Texture.SPHERICAL_MODE:
  10610. BABYLON.Matrix.IdentityToRef(this._cachedTextureMatrix);
  10611. this._cachedTextureMatrix[0] = -0.5 * this.uScale;
  10612. this._cachedTextureMatrix[5] = -0.5 * this.vScale;
  10613. this._cachedTextureMatrix[12] = 0.5 + this.uOffset;
  10614. this._cachedTextureMatrix[13] = 0.5 + this.vOffset;
  10615. break;
  10616. case BABYLON.Texture.PLANAR_MODE:
  10617. BABYLON.Matrix.IdentityToRef(this._cachedTextureMatrix);
  10618. this._cachedTextureMatrix[0] = this.uScale;
  10619. this._cachedTextureMatrix[5] = this.vScale;
  10620. this._cachedTextureMatrix[12] = this.uOffset;
  10621. this._cachedTextureMatrix[13] = this.vOffset;
  10622. break;
  10623. case BABYLON.Texture.PROJECTION_MODE:
  10624. BABYLON.Matrix.IdentityToRef(this._projectionModeMatrix);
  10625. this._projectionModeMatrix.m[0] = 0.5;
  10626. this._projectionModeMatrix.m[5] = -0.5;
  10627. this._projectionModeMatrix.m[10] = 0.0;
  10628. this._projectionModeMatrix.m[12] = 0.5;
  10629. this._projectionModeMatrix.m[13] = 0.5;
  10630. this._projectionModeMatrix.m[14] = 1.0;
  10631. this._projectionModeMatrix.m[15] = 1.0;
  10632. this.getScene().getProjectionMatrix().multiplyToRef(this._projectionModeMatrix, this._cachedTextureMatrix);
  10633. break;
  10634. default:
  10635. BABYLON.Matrix.IdentityToRef(this._cachedTextureMatrix);
  10636. break;
  10637. }
  10638. return this._cachedTextureMatrix;
  10639. };
  10640. Texture.prototype.clone = function () {
  10641. var newTexture = new BABYLON.Texture(this._texture.url, this.getScene(), this._noMipmap, this._invertY);
  10642. // Base texture
  10643. newTexture.hasAlpha = this.hasAlpha;
  10644. newTexture.level = this.level;
  10645. newTexture.wrapU = this.wrapU;
  10646. newTexture.wrapV = this.wrapV;
  10647. newTexture.coordinatesIndex = this.coordinatesIndex;
  10648. newTexture.coordinatesMode = this.coordinatesMode;
  10649. // Texture
  10650. newTexture.uOffset = this.uOffset;
  10651. newTexture.vOffset = this.vOffset;
  10652. newTexture.uScale = this.uScale;
  10653. newTexture.vScale = this.vScale;
  10654. newTexture.uAng = this.uAng;
  10655. newTexture.vAng = this.vAng;
  10656. newTexture.wAng = this.wAng;
  10657. return newTexture;
  10658. };
  10659. // Statics
  10660. Texture.CreateFromBase64String = function (data, name, scene, noMipmap, invertY, samplingMode, onLoad, onError) {
  10661. if (typeof samplingMode === "undefined") { samplingMode = Texture.TRILINEAR_SAMPLINGMODE; }
  10662. if (typeof onLoad === "undefined") { onLoad = null; }
  10663. if (typeof onError === "undefined") { onError = null; }
  10664. return new Texture("data:" + name, scene, noMipmap, invertY, samplingMode, onLoad, onError, data);
  10665. };
  10666. Texture.NEAREST_SAMPLINGMODE = 1;
  10667. Texture.BILINEAR_SAMPLINGMODE = 2;
  10668. Texture.TRILINEAR_SAMPLINGMODE = 3;
  10669. Texture.EXPLICIT_MODE = 0;
  10670. Texture.SPHERICAL_MODE = 1;
  10671. Texture.PLANAR_MODE = 2;
  10672. Texture.CUBIC_MODE = 3;
  10673. Texture.PROJECTION_MODE = 4;
  10674. Texture.SKYBOX_MODE = 5;
  10675. Texture.CLAMP_ADDRESSMODE = 0;
  10676. Texture.WRAP_ADDRESSMODE = 1;
  10677. Texture.MIRROR_ADDRESSMODE = 2;
  10678. return Texture;
  10679. })(BABYLON.BaseTexture);
  10680. BABYLON.Texture = Texture;
  10681. })(BABYLON || (BABYLON = {}));
  10682. //# sourceMappingURL=babylon.texture.js.map
  10683. var BABYLON;
  10684. (function (BABYLON) {
  10685. var CubeTexture = (function (_super) {
  10686. __extends(CubeTexture, _super);
  10687. function CubeTexture(rootUrl, scene, extensions, noMipmap) {
  10688. _super.call(this, scene);
  10689. this.coordinatesMode = BABYLON.Texture.CUBIC_MODE;
  10690. this.name = rootUrl;
  10691. this.url = rootUrl;
  10692. this._noMipmap = noMipmap;
  10693. this.hasAlpha = false;
  10694. this._texture = this._getFromCache(rootUrl, noMipmap);
  10695. if (!extensions) {
  10696. extensions = ["_px.jpg", "_py.jpg", "_pz.jpg", "_nx.jpg", "_ny.jpg", "_nz.jpg"];
  10697. }
  10698. this._extensions = extensions;
  10699. if (!this._texture) {
  10700. if (!scene.useDelayedTextureLoading) {
  10701. this._texture = scene.getEngine().createCubeTexture(rootUrl, scene, extensions, noMipmap);
  10702. } else {
  10703. this.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_NOTLOADED;
  10704. }
  10705. }
  10706. this.isCube = true;
  10707. this._textureMatrix = BABYLON.Matrix.Identity();
  10708. }
  10709. CubeTexture.prototype.clone = function () {
  10710. var newTexture = new BABYLON.CubeTexture(this.url, this.getScene(), this._extensions, this._noMipmap);
  10711. // Base texture
  10712. newTexture.level = this.level;
  10713. newTexture.wrapU = this.wrapU;
  10714. newTexture.wrapV = this.wrapV;
  10715. newTexture.coordinatesIndex = this.coordinatesIndex;
  10716. newTexture.coordinatesMode = this.coordinatesMode;
  10717. return newTexture;
  10718. };
  10719. // Methods
  10720. CubeTexture.prototype.delayLoad = function () {
  10721. if (this.delayLoadState != BABYLON.Engine.DELAYLOADSTATE_NOTLOADED) {
  10722. return;
  10723. }
  10724. this.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_LOADED;
  10725. this._texture = this._getFromCache(this.url, this._noMipmap);
  10726. if (!this._texture) {
  10727. this._texture = this.getScene().getEngine().createCubeTexture(this.url, this.getScene(), this._extensions);
  10728. }
  10729. };
  10730. CubeTexture.prototype.getReflectionTextureMatrix = function () {
  10731. return this._textureMatrix;
  10732. };
  10733. return CubeTexture;
  10734. })(BABYLON.BaseTexture);
  10735. BABYLON.CubeTexture = CubeTexture;
  10736. })(BABYLON || (BABYLON = {}));
  10737. //# sourceMappingURL=babylon.cubeTexture.js.map
  10738. var BABYLON;
  10739. (function (BABYLON) {
  10740. var RenderTargetTexture = (function (_super) {
  10741. __extends(RenderTargetTexture, _super);
  10742. function RenderTargetTexture(name, size, scene, generateMipMaps, doNotChangeAspectRatio) {
  10743. if (typeof doNotChangeAspectRatio === "undefined") { doNotChangeAspectRatio = true; }
  10744. _super.call(this, null, scene, !generateMipMaps);
  10745. this.renderList = new Array();
  10746. this.renderParticles = true;
  10747. this.renderSprites = false;
  10748. this.coordinatesMode = BABYLON.Texture.PROJECTION_MODE;
  10749. this._currentRefreshId = -1;
  10750. this._refreshRate = 1;
  10751. this.name = name;
  10752. this.isRenderTarget = true;
  10753. this._size = size;
  10754. this._generateMipMaps = generateMipMaps;
  10755. this._doNotChangeAspectRatio = doNotChangeAspectRatio;
  10756. this._texture = scene.getEngine().createRenderTargetTexture(size, generateMipMaps);
  10757. // Rendering groups
  10758. this._renderingManager = new BABYLON.RenderingManager(scene);
  10759. }
  10760. RenderTargetTexture.prototype.resetRefreshCounter = function () {
  10761. this._currentRefreshId = -1;
  10762. };
  10763. Object.defineProperty(RenderTargetTexture.prototype, "refreshRate", {
  10764. get: function () {
  10765. return this._refreshRate;
  10766. },
  10767. // Use 0 to render just once, 1 to render on every frame, 2 to render every two frames and so on...
  10768. set: function (value) {
  10769. this._refreshRate = value;
  10770. this.resetRefreshCounter();
  10771. },
  10772. enumerable: true,
  10773. configurable: true
  10774. });
  10775. RenderTargetTexture.prototype._shouldRender = function () {
  10776. if (this._currentRefreshId === -1) {
  10777. this._currentRefreshId = 1;
  10778. return true;
  10779. }
  10780. if (this.refreshRate == this._currentRefreshId) {
  10781. this._currentRefreshId = 1;
  10782. return true;
  10783. }
  10784. this._currentRefreshId++;
  10785. return false;
  10786. };
  10787. RenderTargetTexture.prototype.isReady = function () {
  10788. if (!this.getScene().renderTargetsEnabled) {
  10789. return false;
  10790. }
  10791. return _super.prototype.isReady.call(this);
  10792. };
  10793. RenderTargetTexture.prototype.getRenderSize = function () {
  10794. return this._size;
  10795. };
  10796. Object.defineProperty(RenderTargetTexture.prototype, "canRescale", {
  10797. get: function () {
  10798. return true;
  10799. },
  10800. enumerable: true,
  10801. configurable: true
  10802. });
  10803. RenderTargetTexture.prototype.scale = function (ratio) {
  10804. var newSize = this._size * ratio;
  10805. this.resize(newSize, this._generateMipMaps);
  10806. };
  10807. RenderTargetTexture.prototype.resize = function (size, generateMipMaps) {
  10808. this.releaseInternalTexture();
  10809. this._texture = this.getScene().getEngine().createRenderTargetTexture(size, generateMipMaps);
  10810. };
  10811. RenderTargetTexture.prototype.render = function (useCameraPostProcess) {
  10812. var scene = this.getScene();
  10813. var engine = scene.getEngine();
  10814. if (this._waitingRenderList) {
  10815. this.renderList = [];
  10816. for (var index = 0; index < this._waitingRenderList.length; index++) {
  10817. var id = this._waitingRenderList[index];
  10818. this.renderList.push(scene.getMeshByID(id));
  10819. }
  10820. delete this._waitingRenderList;
  10821. }
  10822. if (!this.renderList) {
  10823. return;
  10824. }
  10825. // Bind
  10826. if (!useCameraPostProcess || !scene.postProcessManager._prepareFrame(this._texture)) {
  10827. engine.bindFramebuffer(this._texture);
  10828. }
  10829. // Clear
  10830. engine.clear(scene.clearColor, true, true);
  10831. this._renderingManager.reset();
  10832. for (var meshIndex = 0; meshIndex < this.renderList.length; meshIndex++) {
  10833. var mesh = this.renderList[meshIndex];
  10834. if (mesh) {
  10835. if (!mesh.isReady() || (mesh.material && !mesh.material.isReady())) {
  10836. // Reset _currentRefreshId
  10837. this.resetRefreshCounter();
  10838. continue;
  10839. }
  10840. if (mesh.isEnabled() && mesh.isVisible && mesh.subMeshes && ((mesh.layerMask & scene.activeCamera.layerMask) != 0)) {
  10841. mesh._activate(scene.getRenderId());
  10842. for (var subIndex = 0; subIndex < mesh.subMeshes.length; subIndex++) {
  10843. var subMesh = mesh.subMeshes[subIndex];
  10844. scene._activeVertices += subMesh.indexCount;
  10845. this._renderingManager.dispatch(subMesh);
  10846. }
  10847. }
  10848. }
  10849. }
  10850. if (!this._doNotChangeAspectRatio) {
  10851. scene.updateTransformMatrix(true);
  10852. }
  10853. if (this.onBeforeRender) {
  10854. this.onBeforeRender();
  10855. }
  10856. // Render
  10857. this._renderingManager.render(this.customRenderFunction, this.renderList, this.renderParticles, this.renderSprites);
  10858. if (useCameraPostProcess) {
  10859. scene.postProcessManager._finalizeFrame(false, this._texture);
  10860. }
  10861. if (this.onAfterRender) {
  10862. this.onAfterRender();
  10863. }
  10864. // Unbind
  10865. engine.unBindFramebuffer(this._texture);
  10866. if (!this._doNotChangeAspectRatio) {
  10867. scene.updateTransformMatrix(true);
  10868. }
  10869. };
  10870. RenderTargetTexture.prototype.clone = function () {
  10871. var textureSize = this.getSize();
  10872. var newTexture = new BABYLON.RenderTargetTexture(this.name, textureSize.width, this.getScene(), this._generateMipMaps);
  10873. // Base texture
  10874. newTexture.hasAlpha = this.hasAlpha;
  10875. newTexture.level = this.level;
  10876. // RenderTarget Texture
  10877. newTexture.coordinatesMode = this.coordinatesMode;
  10878. newTexture.renderList = this.renderList.slice(0);
  10879. return newTexture;
  10880. };
  10881. return RenderTargetTexture;
  10882. })(BABYLON.Texture);
  10883. BABYLON.RenderTargetTexture = RenderTargetTexture;
  10884. })(BABYLON || (BABYLON = {}));
  10885. //# sourceMappingURL=babylon.renderTargetTexture.js.map
  10886. var BABYLON;
  10887. (function (BABYLON) {
  10888. var ProceduralTexture = (function (_super) {
  10889. __extends(ProceduralTexture, _super);
  10890. function ProceduralTexture(name, size, fragment, scene, fallbackTexture, generateMipMaps) {
  10891. if (typeof generateMipMaps === "undefined") { generateMipMaps = true; }
  10892. _super.call(this, null, scene, !generateMipMaps);
  10893. this._currentRefreshId = -1;
  10894. this._refreshRate = 1;
  10895. this._vertexDeclaration = [2];
  10896. this._vertexStrideSize = 2 * 4;
  10897. this._uniforms = new Array();
  10898. this._samplers = new Array();
  10899. this._textures = new Array();
  10900. this._floats = new Array();
  10901. this._floatsArrays = {};
  10902. this._colors3 = new Array();
  10903. this._colors4 = new Array();
  10904. this._vectors2 = new Array();
  10905. this._vectors3 = new Array();
  10906. this._matrices = new Array();
  10907. this._fallbackTextureUsed = false;
  10908. scene._proceduralTextures.push(this);
  10909. this.name = name;
  10910. this.isRenderTarget = true;
  10911. this._size = size;
  10912. this._generateMipMaps = generateMipMaps;
  10913. this.setFragment(fragment);
  10914. this._fallbackTexture = fallbackTexture;
  10915. this._texture = scene.getEngine().createRenderTargetTexture(size, generateMipMaps);
  10916. // VBO
  10917. var vertices = [];
  10918. vertices.push(1, 1);
  10919. vertices.push(-1, 1);
  10920. vertices.push(-1, -1);
  10921. vertices.push(1, -1);
  10922. this._vertexBuffer = scene.getEngine().createVertexBuffer(vertices);
  10923. // Indices
  10924. var indices = [];
  10925. indices.push(0);
  10926. indices.push(1);
  10927. indices.push(2);
  10928. indices.push(0);
  10929. indices.push(2);
  10930. indices.push(3);
  10931. this._indexBuffer = scene.getEngine().createIndexBuffer(indices);
  10932. }
  10933. ProceduralTexture.prototype.reset = function () {
  10934. if (this._effect === undefined) {
  10935. return;
  10936. }
  10937. var engine = this.getScene().getEngine();
  10938. engine._releaseEffect(this._effect);
  10939. };
  10940. ProceduralTexture.prototype.isReady = function () {
  10941. var _this = this;
  10942. var engine = this.getScene().getEngine();
  10943. var shaders;
  10944. if (!this._fragment) {
  10945. return false;
  10946. }
  10947. if (this._fallbackTextureUsed) {
  10948. return true;
  10949. }
  10950. if (this._fragment.fragmentElement !== undefined) {
  10951. shaders = { vertex: "procedural", fragmentElement: this._fragment.fragmentElement };
  10952. } else {
  10953. shaders = { vertex: "procedural", fragment: this._fragment };
  10954. }
  10955. this._effect = engine.createEffect(shaders, ["position"], this._uniforms, this._samplers, "", null, null, function () {
  10956. _this.releaseInternalTexture();
  10957. if (_this._fallbackTexture) {
  10958. _this._texture = _this._fallbackTexture._texture;
  10959. _this._texture.references++;
  10960. }
  10961. _this._fallbackTextureUsed = true;
  10962. });
  10963. return this._effect.isReady();
  10964. };
  10965. ProceduralTexture.prototype.resetRefreshCounter = function () {
  10966. this._currentRefreshId = -1;
  10967. };
  10968. ProceduralTexture.prototype.setFragment = function (fragment) {
  10969. this._fragment = fragment;
  10970. };
  10971. Object.defineProperty(ProceduralTexture.prototype, "refreshRate", {
  10972. get: function () {
  10973. return this._refreshRate;
  10974. },
  10975. // Use 0 to render just once, 1 to render on every frame, 2 to render every two frames and so on...
  10976. set: function (value) {
  10977. this._refreshRate = value;
  10978. this.resetRefreshCounter();
  10979. },
  10980. enumerable: true,
  10981. configurable: true
  10982. });
  10983. ProceduralTexture.prototype._shouldRender = function () {
  10984. if (!this.isReady() || !this._texture) {
  10985. return false;
  10986. }
  10987. if (this._fallbackTextureUsed) {
  10988. return false;
  10989. }
  10990. if (this._currentRefreshId === -1) {
  10991. this._currentRefreshId = 1;
  10992. return true;
  10993. }
  10994. if (this.refreshRate === this._currentRefreshId) {
  10995. this._currentRefreshId = 1;
  10996. return true;
  10997. }
  10998. this._currentRefreshId++;
  10999. return false;
  11000. };
  11001. ProceduralTexture.prototype.getRenderSize = function () {
  11002. return this._size;
  11003. };
  11004. ProceduralTexture.prototype.resize = function (size, generateMipMaps) {
  11005. if (this._fallbackTextureUsed) {
  11006. return;
  11007. }
  11008. this.releaseInternalTexture();
  11009. this._texture = this.getScene().getEngine().createRenderTargetTexture(size, generateMipMaps);
  11010. };
  11011. ProceduralTexture.prototype._checkUniform = function (uniformName) {
  11012. if (this._uniforms.indexOf(uniformName) === -1) {
  11013. this._uniforms.push(uniformName);
  11014. }
  11015. };
  11016. ProceduralTexture.prototype.setTexture = function (name, texture) {
  11017. if (this._samplers.indexOf(name) === -1) {
  11018. this._samplers.push(name);
  11019. }
  11020. this._textures[name] = texture;
  11021. return this;
  11022. };
  11023. ProceduralTexture.prototype.setFloat = function (name, value) {
  11024. this._checkUniform(name);
  11025. this._floats[name] = value;
  11026. return this;
  11027. };
  11028. ProceduralTexture.prototype.setFloats = function (name, value) {
  11029. this._checkUniform(name);
  11030. this._floatsArrays[name] = value;
  11031. return this;
  11032. };
  11033. ProceduralTexture.prototype.setColor3 = function (name, value) {
  11034. this._checkUniform(name);
  11035. this._colors3[name] = value;
  11036. return this;
  11037. };
  11038. ProceduralTexture.prototype.setColor4 = function (name, value) {
  11039. this._checkUniform(name);
  11040. this._colors4[name] = value;
  11041. return this;
  11042. };
  11043. ProceduralTexture.prototype.setVector2 = function (name, value) {
  11044. this._checkUniform(name);
  11045. this._vectors2[name] = value;
  11046. return this;
  11047. };
  11048. ProceduralTexture.prototype.setVector3 = function (name, value) {
  11049. this._checkUniform(name);
  11050. this._vectors3[name] = value;
  11051. return this;
  11052. };
  11053. ProceduralTexture.prototype.setMatrix = function (name, value) {
  11054. this._checkUniform(name);
  11055. this._matrices[name] = value;
  11056. return this;
  11057. };
  11058. ProceduralTexture.prototype.render = function (useCameraPostProcess) {
  11059. var scene = this.getScene();
  11060. var engine = scene.getEngine();
  11061. engine.bindFramebuffer(this._texture);
  11062. // Clear
  11063. engine.clear(scene.clearColor, true, true);
  11064. // Render
  11065. engine.enableEffect(this._effect);
  11066. engine.setState(false);
  11067. for (var name in this._textures) {
  11068. this._effect.setTexture(name, this._textures[name]);
  11069. }
  11070. for (name in this._floats) {
  11071. this._effect.setFloat(name, this._floats[name]);
  11072. }
  11073. for (name in this._floatsArrays) {
  11074. this._effect.setArray(name, this._floatsArrays[name]);
  11075. }
  11076. for (name in this._colors3) {
  11077. this._effect.setColor3(name, this._colors3[name]);
  11078. }
  11079. for (name in this._colors4) {
  11080. var color = this._colors4[name];
  11081. this._effect.setFloat4(name, color.r, color.g, color.b, color.a);
  11082. }
  11083. for (name in this._vectors2) {
  11084. this._effect.setVector2(name, this._vectors2[name]);
  11085. }
  11086. for (name in this._vectors3) {
  11087. this._effect.setVector3(name, this._vectors3[name]);
  11088. }
  11089. for (name in this._matrices) {
  11090. this._effect.setMatrix(name, this._matrices[name]);
  11091. }
  11092. // VBOs
  11093. engine.bindBuffers(this._vertexBuffer, this._indexBuffer, this._vertexDeclaration, this._vertexStrideSize, this._effect);
  11094. // Draw order
  11095. engine.draw(true, 0, 6);
  11096. // Unbind
  11097. engine.unBindFramebuffer(this._texture);
  11098. };
  11099. ProceduralTexture.prototype.clone = function () {
  11100. var textureSize = this.getSize();
  11101. var newTexture = new ProceduralTexture(this.name, textureSize.width, this._fragment, this.getScene(), this._fallbackTexture, this._generateMipMaps);
  11102. // Base texture
  11103. newTexture.hasAlpha = this.hasAlpha;
  11104. newTexture.level = this.level;
  11105. // RenderTarget Texture
  11106. newTexture.coordinatesMode = this.coordinatesMode;
  11107. return newTexture;
  11108. };
  11109. ProceduralTexture.prototype.dispose = function () {
  11110. var index = this.getScene()._proceduralTextures.indexOf(this);
  11111. if (index >= 0) {
  11112. this.getScene()._proceduralTextures.splice(index, 1);
  11113. }
  11114. _super.prototype.dispose.call(this);
  11115. };
  11116. return ProceduralTexture;
  11117. })(BABYLON.Texture);
  11118. BABYLON.ProceduralTexture = ProceduralTexture;
  11119. })(BABYLON || (BABYLON = {}));
  11120. //# sourceMappingURL=babylon.proceduralTexture.js.map
  11121. var BABYLON;
  11122. (function (BABYLON) {
  11123. var WoodProceduralTexture = (function (_super) {
  11124. __extends(WoodProceduralTexture, _super);
  11125. function WoodProceduralTexture(name, size, scene, fallbackTexture, generateMipMaps) {
  11126. _super.call(this, name, size, "wood", scene, fallbackTexture, generateMipMaps);
  11127. this._ampScale = 100.0;
  11128. this._woodColor = new BABYLON.Color3(0.32, 0.17, 0.09);
  11129. this.updateShaderUniforms();
  11130. this.refreshRate = 0;
  11131. }
  11132. WoodProceduralTexture.prototype.updateShaderUniforms = function () {
  11133. this.setFloat("ampScale", this._ampScale);
  11134. this.setColor3("woodColor", this._woodColor);
  11135. };
  11136. Object.defineProperty(WoodProceduralTexture.prototype, "ampScale", {
  11137. get: function () {
  11138. return this._ampScale;
  11139. },
  11140. set: function (value) {
  11141. this._ampScale = value;
  11142. this.updateShaderUniforms();
  11143. },
  11144. enumerable: true,
  11145. configurable: true
  11146. });
  11147. Object.defineProperty(WoodProceduralTexture.prototype, "woodColor", {
  11148. get: function () {
  11149. return this._woodColor;
  11150. },
  11151. set: function (value) {
  11152. this._woodColor = value;
  11153. this.updateShaderUniforms();
  11154. },
  11155. enumerable: true,
  11156. configurable: true
  11157. });
  11158. return WoodProceduralTexture;
  11159. })(BABYLON.ProceduralTexture);
  11160. BABYLON.WoodProceduralTexture = WoodProceduralTexture;
  11161. var FireProceduralTexture = (function (_super) {
  11162. __extends(FireProceduralTexture, _super);
  11163. function FireProceduralTexture(name, size, scene, fallbackTexture, generateMipMaps) {
  11164. _super.call(this, name, size, "fire", scene, fallbackTexture, generateMipMaps);
  11165. this._time = 0.0;
  11166. this._speed = new BABYLON.Vector2(0.5, 0.3);
  11167. this._shift = 1.6;
  11168. this._autoGenerateTime = true;
  11169. this._alphaThreshold = 0.5;
  11170. this._fireColors = FireProceduralTexture.RedFireColors;
  11171. this.updateShaderUniforms();
  11172. this.refreshRate = 1;
  11173. }
  11174. FireProceduralTexture.prototype.updateShaderUniforms = function () {
  11175. this.setFloat("time", this._time);
  11176. this.setVector2("speed", this._speed);
  11177. this.setFloat("shift", this._shift);
  11178. this.setColor3("c1", this._fireColors[0]);
  11179. this.setColor3("c2", this._fireColors[1]);
  11180. this.setColor3("c3", this._fireColors[2]);
  11181. this.setColor3("c4", this._fireColors[3]);
  11182. this.setColor3("c5", this._fireColors[4]);
  11183. this.setColor3("c6", this._fireColors[5]);
  11184. this.setFloat("alphaThreshold", this._alphaThreshold);
  11185. };
  11186. FireProceduralTexture.prototype.render = function (useCameraPostProcess) {
  11187. if (this._autoGenerateTime) {
  11188. this._time += this.getScene().getAnimationRatio() * 0.03;
  11189. this.updateShaderUniforms();
  11190. }
  11191. _super.prototype.render.call(this, useCameraPostProcess);
  11192. };
  11193. Object.defineProperty(FireProceduralTexture, "PurpleFireColors", {
  11194. get: function () {
  11195. return [
  11196. new BABYLON.Color3(0.5, 0.0, 1.0),
  11197. new BABYLON.Color3(0.9, 0.0, 1.0),
  11198. new BABYLON.Color3(0.2, 0.0, 1.0),
  11199. new BABYLON.Color3(1.0, 0.9, 1.0),
  11200. new BABYLON.Color3(0.1, 0.1, 1.0),
  11201. new BABYLON.Color3(0.9, 0.9, 1.0)
  11202. ];
  11203. },
  11204. enumerable: true,
  11205. configurable: true
  11206. });
  11207. Object.defineProperty(FireProceduralTexture, "GreenFireColors", {
  11208. get: function () {
  11209. return [
  11210. new BABYLON.Color3(0.5, 1.0, 0.0),
  11211. new BABYLON.Color3(0.5, 1.0, 0.0),
  11212. new BABYLON.Color3(0.3, 0.4, 0.0),
  11213. new BABYLON.Color3(0.5, 1.0, 0.0),
  11214. new BABYLON.Color3(0.2, 0.0, 0.0),
  11215. new BABYLON.Color3(0.5, 1.0, 0.0)
  11216. ];
  11217. },
  11218. enumerable: true,
  11219. configurable: true
  11220. });
  11221. Object.defineProperty(FireProceduralTexture, "RedFireColors", {
  11222. get: function () {
  11223. return [
  11224. new BABYLON.Color3(0.5, 0.0, 0.1),
  11225. new BABYLON.Color3(0.9, 0.0, 0.0),
  11226. new BABYLON.Color3(0.2, 0.0, 0.0),
  11227. new BABYLON.Color3(1.0, 0.9, 0.0),
  11228. new BABYLON.Color3(0.1, 0.1, 0.1),
  11229. new BABYLON.Color3(0.9, 0.9, 0.9)
  11230. ];
  11231. },
  11232. enumerable: true,
  11233. configurable: true
  11234. });
  11235. Object.defineProperty(FireProceduralTexture, "BlueFireColors", {
  11236. get: function () {
  11237. return [
  11238. new BABYLON.Color3(0.1, 0.0, 0.5),
  11239. new BABYLON.Color3(0.0, 0.0, 0.5),
  11240. new BABYLON.Color3(0.1, 0.0, 0.2),
  11241. new BABYLON.Color3(0.0, 0.0, 1.0),
  11242. new BABYLON.Color3(0.1, 0.2, 0.3),
  11243. new BABYLON.Color3(0.0, 0.2, 0.9)
  11244. ];
  11245. },
  11246. enumerable: true,
  11247. configurable: true
  11248. });
  11249. Object.defineProperty(FireProceduralTexture.prototype, "fireColors", {
  11250. get: function () {
  11251. return this._fireColors;
  11252. },
  11253. set: function (value) {
  11254. this._fireColors = value;
  11255. this.updateShaderUniforms();
  11256. },
  11257. enumerable: true,
  11258. configurable: true
  11259. });
  11260. Object.defineProperty(FireProceduralTexture.prototype, "time", {
  11261. get: function () {
  11262. return this._time;
  11263. },
  11264. set: function (value) {
  11265. this._time = value;
  11266. this.updateShaderUniforms();
  11267. },
  11268. enumerable: true,
  11269. configurable: true
  11270. });
  11271. Object.defineProperty(FireProceduralTexture.prototype, "speed", {
  11272. get: function () {
  11273. return this._speed;
  11274. },
  11275. set: function (value) {
  11276. this._speed = value;
  11277. this.updateShaderUniforms();
  11278. },
  11279. enumerable: true,
  11280. configurable: true
  11281. });
  11282. Object.defineProperty(FireProceduralTexture.prototype, "shift", {
  11283. get: function () {
  11284. return this._shift;
  11285. },
  11286. set: function (value) {
  11287. this._shift = value;
  11288. this.updateShaderUniforms();
  11289. },
  11290. enumerable: true,
  11291. configurable: true
  11292. });
  11293. Object.defineProperty(FireProceduralTexture.prototype, "alphaThreshold", {
  11294. get: function () {
  11295. return this._alphaThreshold;
  11296. },
  11297. set: function (value) {
  11298. this._alphaThreshold = value;
  11299. this.updateShaderUniforms();
  11300. },
  11301. enumerable: true,
  11302. configurable: true
  11303. });
  11304. return FireProceduralTexture;
  11305. })(BABYLON.ProceduralTexture);
  11306. BABYLON.FireProceduralTexture = FireProceduralTexture;
  11307. var CloudProceduralTexture = (function (_super) {
  11308. __extends(CloudProceduralTexture, _super);
  11309. function CloudProceduralTexture(name, size, scene, fallbackTexture, generateMipMaps) {
  11310. _super.call(this, name, size, "cloud", scene, fallbackTexture, generateMipMaps);
  11311. this._skyColor = new BABYLON.Color3(0.15, 0.68, 1.0);
  11312. this._cloudColor = new BABYLON.Color3(1, 1, 1);
  11313. this.updateShaderUniforms();
  11314. this.refreshRate = 0;
  11315. }
  11316. CloudProceduralTexture.prototype.updateShaderUniforms = function () {
  11317. this.setColor3("skyColor", this._skyColor);
  11318. this.setColor3("cloudColor", this._cloudColor);
  11319. };
  11320. Object.defineProperty(CloudProceduralTexture.prototype, "skyColor", {
  11321. get: function () {
  11322. return this._skyColor;
  11323. },
  11324. set: function (value) {
  11325. this._skyColor = value;
  11326. this.updateShaderUniforms();
  11327. },
  11328. enumerable: true,
  11329. configurable: true
  11330. });
  11331. Object.defineProperty(CloudProceduralTexture.prototype, "cloudColor", {
  11332. get: function () {
  11333. return this._cloudColor;
  11334. },
  11335. set: function (value) {
  11336. this._cloudColor = value;
  11337. this.updateShaderUniforms();
  11338. },
  11339. enumerable: true,
  11340. configurable: true
  11341. });
  11342. return CloudProceduralTexture;
  11343. })(BABYLON.ProceduralTexture);
  11344. BABYLON.CloudProceduralTexture = CloudProceduralTexture;
  11345. var GrassProceduralTexture = (function (_super) {
  11346. __extends(GrassProceduralTexture, _super);
  11347. function GrassProceduralTexture(name, size, scene, fallbackTexture, generateMipMaps) {
  11348. _super.call(this, name, size, "grass", scene, fallbackTexture, generateMipMaps);
  11349. this._herb1 = new BABYLON.Color3(0.29, 0.38, 0.02);
  11350. this._herb2 = new BABYLON.Color3(0.36, 0.49, 0.09);
  11351. this._herb3 = new BABYLON.Color3(0.51, 0.6, 0.28);
  11352. this._groundColor = new BABYLON.Color3(1, 1, 1);
  11353. this._grassColors = [
  11354. new BABYLON.Color3(0.29, 0.38, 0.02),
  11355. new BABYLON.Color3(0.36, 0.49, 0.09),
  11356. new BABYLON.Color3(0.51, 0.6, 0.28)
  11357. ];
  11358. this.updateShaderUniforms();
  11359. this.refreshRate = 0;
  11360. }
  11361. GrassProceduralTexture.prototype.updateShaderUniforms = function () {
  11362. this.setColor3("herb1Color", this._grassColors[0]);
  11363. this.setColor3("herb2Color", this._grassColors[1]);
  11364. this.setColor3("herb3Color", this._grassColors[2]);
  11365. this.setColor3("groundColor", this._groundColor);
  11366. };
  11367. Object.defineProperty(GrassProceduralTexture.prototype, "grassColors", {
  11368. get: function () {
  11369. return this._grassColors;
  11370. },
  11371. set: function (value) {
  11372. this._grassColors = value;
  11373. this.updateShaderUniforms();
  11374. },
  11375. enumerable: true,
  11376. configurable: true
  11377. });
  11378. Object.defineProperty(GrassProceduralTexture.prototype, "groundColor", {
  11379. get: function () {
  11380. return this._groundColor;
  11381. },
  11382. set: function (value) {
  11383. this.groundColor = value;
  11384. this.updateShaderUniforms();
  11385. },
  11386. enumerable: true,
  11387. configurable: true
  11388. });
  11389. return GrassProceduralTexture;
  11390. })(BABYLON.ProceduralTexture);
  11391. BABYLON.GrassProceduralTexture = GrassProceduralTexture;
  11392. var RoadProceduralTexture = (function (_super) {
  11393. __extends(RoadProceduralTexture, _super);
  11394. function RoadProceduralTexture(name, size, scene, fallbackTexture, generateMipMaps) {
  11395. _super.call(this, name, size, "road", scene, fallbackTexture, generateMipMaps);
  11396. this._roadColor = new BABYLON.Color3(0.53, 0.53, 0.53);
  11397. this.updateShaderUniforms();
  11398. this.refreshRate = 0;
  11399. }
  11400. RoadProceduralTexture.prototype.updateShaderUniforms = function () {
  11401. this.setColor3("roadColor", this._roadColor);
  11402. };
  11403. Object.defineProperty(RoadProceduralTexture.prototype, "roadColor", {
  11404. get: function () {
  11405. return this._roadColor;
  11406. },
  11407. set: function (value) {
  11408. this._roadColor = value;
  11409. this.updateShaderUniforms();
  11410. },
  11411. enumerable: true,
  11412. configurable: true
  11413. });
  11414. return RoadProceduralTexture;
  11415. })(BABYLON.ProceduralTexture);
  11416. BABYLON.RoadProceduralTexture = RoadProceduralTexture;
  11417. var BrickProceduralTexture = (function (_super) {
  11418. __extends(BrickProceduralTexture, _super);
  11419. function BrickProceduralTexture(name, size, scene, fallbackTexture, generateMipMaps) {
  11420. _super.call(this, name, size, "brick", scene, fallbackTexture, generateMipMaps);
  11421. this._numberOfBricksHeight = 15;
  11422. this._numberOfBricksWidth = 5;
  11423. this._jointColor = new BABYLON.Color3(0.72, 0.72, 0.72);
  11424. this._brickColor = new BABYLON.Color3(0.77, 0.47, 0.40);
  11425. this.updateShaderUniforms();
  11426. this.refreshRate = 0;
  11427. }
  11428. BrickProceduralTexture.prototype.updateShaderUniforms = function () {
  11429. this.setFloat("numberOfBricksHeight", this._numberOfBricksHeight);
  11430. this.setFloat("numberOfBricksWidth", this._numberOfBricksWidth);
  11431. this.setColor3("brickColor", this._brickColor);
  11432. this.setColor3("jointColor", this._jointColor);
  11433. };
  11434. Object.defineProperty(BrickProceduralTexture.prototype, "numberOfBricksHeight", {
  11435. get: function () {
  11436. return this._numberOfBricksHeight;
  11437. },
  11438. enumerable: true,
  11439. configurable: true
  11440. });
  11441. Object.defineProperty(BrickProceduralTexture.prototype, "cloudColor", {
  11442. set: function (value) {
  11443. this._numberOfBricksHeight = value;
  11444. this.updateShaderUniforms();
  11445. },
  11446. enumerable: true,
  11447. configurable: true
  11448. });
  11449. Object.defineProperty(BrickProceduralTexture.prototype, "numberOfBricksWidth", {
  11450. get: function () {
  11451. return this._numberOfBricksWidth;
  11452. },
  11453. set: function (value) {
  11454. this._numberOfBricksHeight = value;
  11455. this.updateShaderUniforms();
  11456. },
  11457. enumerable: true,
  11458. configurable: true
  11459. });
  11460. Object.defineProperty(BrickProceduralTexture.prototype, "jointColor", {
  11461. get: function () {
  11462. return this._jointColor;
  11463. },
  11464. set: function (value) {
  11465. this._jointColor = value;
  11466. this.updateShaderUniforms();
  11467. },
  11468. enumerable: true,
  11469. configurable: true
  11470. });
  11471. Object.defineProperty(BrickProceduralTexture.prototype, "brickColor", {
  11472. get: function () {
  11473. return this._brickColor;
  11474. },
  11475. set: function (value) {
  11476. this._brickColor = value;
  11477. this.updateShaderUniforms();
  11478. },
  11479. enumerable: true,
  11480. configurable: true
  11481. });
  11482. return BrickProceduralTexture;
  11483. })(BABYLON.ProceduralTexture);
  11484. BABYLON.BrickProceduralTexture = BrickProceduralTexture;
  11485. var MarbleProceduralTexture = (function (_super) {
  11486. __extends(MarbleProceduralTexture, _super);
  11487. function MarbleProceduralTexture(name, size, scene, fallbackTexture, generateMipMaps) {
  11488. _super.call(this, name, size, "marble", scene, fallbackTexture, generateMipMaps);
  11489. this._numberOfTilesHeight = 3;
  11490. this._numberOfTilesWidth = 3;
  11491. this._amplitude = 9.0;
  11492. this._marbleColor = new BABYLON.Color3(0.77, 0.47, 0.40);
  11493. this._jointColor = new BABYLON.Color3(0.72, 0.72, 0.72);
  11494. this.updateShaderUniforms();
  11495. this.refreshRate = 0;
  11496. }
  11497. MarbleProceduralTexture.prototype.updateShaderUniforms = function () {
  11498. this.setFloat("numberOfTilesHeight", this._numberOfTilesHeight);
  11499. this.setFloat("numberOfTilesWidth", this._numberOfTilesWidth);
  11500. this.setFloat("amplitude", this._amplitude);
  11501. this.setColor3("marbleColor", this._marbleColor);
  11502. this.setColor3("jointColor", this._jointColor);
  11503. };
  11504. Object.defineProperty(MarbleProceduralTexture.prototype, "numberOfTilesHeight", {
  11505. get: function () {
  11506. return this._numberOfTilesHeight;
  11507. },
  11508. set: function (value) {
  11509. this._numberOfTilesHeight = value;
  11510. this.updateShaderUniforms();
  11511. },
  11512. enumerable: true,
  11513. configurable: true
  11514. });
  11515. Object.defineProperty(MarbleProceduralTexture.prototype, "numberOfTilesWidth", {
  11516. get: function () {
  11517. return this._numberOfTilesWidth;
  11518. },
  11519. set: function (value) {
  11520. this._numberOfTilesWidth = value;
  11521. this.updateShaderUniforms();
  11522. },
  11523. enumerable: true,
  11524. configurable: true
  11525. });
  11526. Object.defineProperty(MarbleProceduralTexture.prototype, "jointColor", {
  11527. get: function () {
  11528. return this._jointColor;
  11529. },
  11530. set: function (value) {
  11531. this._jointColor = value;
  11532. this.updateShaderUniforms();
  11533. },
  11534. enumerable: true,
  11535. configurable: true
  11536. });
  11537. Object.defineProperty(MarbleProceduralTexture.prototype, "marbleColor", {
  11538. get: function () {
  11539. return this._marbleColor;
  11540. },
  11541. set: function (value) {
  11542. this._marbleColor = value;
  11543. this.updateShaderUniforms();
  11544. },
  11545. enumerable: true,
  11546. configurable: true
  11547. });
  11548. return MarbleProceduralTexture;
  11549. })(BABYLON.ProceduralTexture);
  11550. BABYLON.MarbleProceduralTexture = MarbleProceduralTexture;
  11551. })(BABYLON || (BABYLON = {}));
  11552. //# sourceMappingURL=babylon.standardProceduralTexture.js.map
  11553. var BABYLON;
  11554. (function (BABYLON) {
  11555. var CustomProceduralTexture = (function (_super) {
  11556. __extends(CustomProceduralTexture, _super);
  11557. function CustomProceduralTexture(name, texturePath, size, scene, fallbackTexture, generateMipMaps) {
  11558. _super.call(this, name, size, null, scene, fallbackTexture, generateMipMaps);
  11559. this._animate = true;
  11560. this._time = 0;
  11561. this._texturePath = texturePath;
  11562. //Try to load json
  11563. this.loadJson(texturePath);
  11564. this.refreshRate = 1;
  11565. }
  11566. CustomProceduralTexture.prototype.loadJson = function (jsonUrl) {
  11567. var _this = this;
  11568. var that = this;
  11569. function noConfigFile() {
  11570. BABYLON.Tools.Log("No config file found in " + jsonUrl + " trying to use ShaderStore or DOM element");
  11571. try {
  11572. that.setFragment(that._texturePath);
  11573. } catch (ex) {
  11574. BABYLON.Tools.Error("No json or ShaderStore or DOM element found for CustomProceduralTexture");
  11575. }
  11576. }
  11577. var configFileUrl = jsonUrl + "/config.json";
  11578. var xhr = new XMLHttpRequest();
  11579. xhr.open("GET", configFileUrl, true);
  11580. xhr.addEventListener("load", function () {
  11581. if (xhr.status === 200 || BABYLON.Tools.ValidateXHRData(xhr, 1)) {
  11582. try {
  11583. _this._config = JSON.parse(xhr.response);
  11584. _this.updateShaderUniforms();
  11585. _this.updateTextures();
  11586. _this.setFragment(_this._texturePath + "/custom");
  11587. _this._animate = _this._config.animate;
  11588. _this.refreshRate = _this._config.refreshrate;
  11589. } catch (ex) {
  11590. noConfigFile();
  11591. }
  11592. } else {
  11593. noConfigFile();
  11594. }
  11595. }, false);
  11596. xhr.addEventListener("error", function (event) {
  11597. noConfigFile();
  11598. }, false);
  11599. try {
  11600. xhr.send();
  11601. } catch (ex) {
  11602. BABYLON.Tools.Error("CustomProceduralTexture: Error on XHR send request.");
  11603. }
  11604. };
  11605. CustomProceduralTexture.prototype.isReady = function () {
  11606. if (!_super.prototype.isReady.call(this)) {
  11607. return false;
  11608. }
  11609. for (var name in this._textures) {
  11610. var texture = this._textures[name];
  11611. if (!texture.isReady()) {
  11612. return false;
  11613. }
  11614. }
  11615. return true;
  11616. };
  11617. CustomProceduralTexture.prototype.render = function (useCameraPostProcess) {
  11618. if (this._animate) {
  11619. this._time += this.getScene().getAnimationRatio() * 0.03;
  11620. this.updateShaderUniforms();
  11621. }
  11622. _super.prototype.render.call(this, useCameraPostProcess);
  11623. };
  11624. CustomProceduralTexture.prototype.updateTextures = function () {
  11625. for (var i = 0; i < this._config.sampler2Ds.length; i++) {
  11626. this.setTexture(this._config.sampler2Ds[i].sample2Dname, new BABYLON.Texture(this._texturePath + "/" + this._config.sampler2Ds[i].textureRelativeUrl, this.getScene()));
  11627. }
  11628. };
  11629. CustomProceduralTexture.prototype.updateShaderUniforms = function () {
  11630. if (this._config) {
  11631. for (var j = 0; j < this._config.uniforms.length; j++) {
  11632. var uniform = this._config.uniforms[j];
  11633. switch (uniform.type) {
  11634. case "float":
  11635. this.setFloat(uniform.name, uniform.value);
  11636. break;
  11637. case "color3":
  11638. this.setColor3(uniform.name, new BABYLON.Color3(uniform.r, uniform.g, uniform.b));
  11639. break;
  11640. case "color4":
  11641. this.setColor4(uniform.name, new BABYLON.Color4(uniform.r, uniform.g, uniform.b, uniform.a));
  11642. break;
  11643. case "vector2":
  11644. this.setVector2(uniform.name, new BABYLON.Vector2(uniform.x, uniform.y));
  11645. break;
  11646. case "vector3":
  11647. this.setVector3(uniform.name, new BABYLON.Vector3(uniform.x, uniform.y, uniform.z));
  11648. break;
  11649. }
  11650. }
  11651. }
  11652. this.setFloat("time", this._time);
  11653. };
  11654. Object.defineProperty(CustomProceduralTexture.prototype, "animate", {
  11655. get: function () {
  11656. return this._animate;
  11657. },
  11658. set: function (value) {
  11659. this._animate = value;
  11660. },
  11661. enumerable: true,
  11662. configurable: true
  11663. });
  11664. return CustomProceduralTexture;
  11665. })(BABYLON.ProceduralTexture);
  11666. BABYLON.CustomProceduralTexture = CustomProceduralTexture;
  11667. })(BABYLON || (BABYLON = {}));
  11668. //# sourceMappingURL=babylon.customProceduralTexture.js.map
  11669. var BABYLON;
  11670. (function (BABYLON) {
  11671. var MirrorTexture = (function (_super) {
  11672. __extends(MirrorTexture, _super);
  11673. function MirrorTexture(name, size, scene, generateMipMaps) {
  11674. var _this = this;
  11675. _super.call(this, name, size, scene, generateMipMaps, true);
  11676. this.mirrorPlane = new BABYLON.Plane(0, 1, 0, 1);
  11677. this._transformMatrix = BABYLON.Matrix.Zero();
  11678. this._mirrorMatrix = BABYLON.Matrix.Zero();
  11679. this.onBeforeRender = function () {
  11680. BABYLON.Matrix.ReflectionToRef(_this.mirrorPlane, _this._mirrorMatrix);
  11681. _this._savedViewMatrix = scene.getViewMatrix();
  11682. _this._mirrorMatrix.multiplyToRef(_this._savedViewMatrix, _this._transformMatrix);
  11683. scene.setTransformMatrix(_this._transformMatrix, scene.getProjectionMatrix());
  11684. scene.clipPlane = _this.mirrorPlane;
  11685. scene.getEngine().cullBackFaces = false;
  11686. };
  11687. this.onAfterRender = function () {
  11688. scene.setTransformMatrix(_this._savedViewMatrix, scene.getProjectionMatrix());
  11689. scene.getEngine().cullBackFaces = true;
  11690. delete scene.clipPlane;
  11691. };
  11692. }
  11693. MirrorTexture.prototype.clone = function () {
  11694. var textureSize = this.getSize();
  11695. var newTexture = new BABYLON.MirrorTexture(this.name, textureSize.width, this.getScene(), this._generateMipMaps);
  11696. // Base texture
  11697. newTexture.hasAlpha = this.hasAlpha;
  11698. newTexture.level = this.level;
  11699. // Mirror Texture
  11700. newTexture.mirrorPlane = this.mirrorPlane.clone();
  11701. newTexture.renderList = this.renderList.slice(0);
  11702. return newTexture;
  11703. };
  11704. return MirrorTexture;
  11705. })(BABYLON.RenderTargetTexture);
  11706. BABYLON.MirrorTexture = MirrorTexture;
  11707. })(BABYLON || (BABYLON = {}));
  11708. //# sourceMappingURL=babylon.mirrorTexture.js.map
  11709. var BABYLON;
  11710. (function (BABYLON) {
  11711. var DynamicTexture = (function (_super) {
  11712. __extends(DynamicTexture, _super);
  11713. function DynamicTexture(name, options, scene, generateMipMaps, samplingMode) {
  11714. if (typeof samplingMode === "undefined") { samplingMode = BABYLON.Texture.TRILINEAR_SAMPLINGMODE; }
  11715. _super.call(this, null, scene, !generateMipMaps);
  11716. this.name = name;
  11717. this.wrapU = BABYLON.Texture.CLAMP_ADDRESSMODE;
  11718. this.wrapV = BABYLON.Texture.CLAMP_ADDRESSMODE;
  11719. this._generateMipMaps = generateMipMaps;
  11720. if (options.getContext) {
  11721. this._canvas = options;
  11722. this._texture = scene.getEngine().createDynamicTexture(options.width, options.height, generateMipMaps, samplingMode);
  11723. } else {
  11724. this._canvas = document.createElement("canvas");
  11725. if (options.width) {
  11726. this._texture = scene.getEngine().createDynamicTexture(options.width, options.height, generateMipMaps, samplingMode);
  11727. } else {
  11728. this._texture = scene.getEngine().createDynamicTexture(options, options, generateMipMaps, samplingMode);
  11729. }
  11730. }
  11731. var textureSize = this.getSize();
  11732. this._canvas.width = textureSize.width;
  11733. this._canvas.height = textureSize.height;
  11734. this._context = this._canvas.getContext("2d");
  11735. }
  11736. Object.defineProperty(DynamicTexture.prototype, "canRescale", {
  11737. get: function () {
  11738. return true;
  11739. },
  11740. enumerable: true,
  11741. configurable: true
  11742. });
  11743. DynamicTexture.prototype.scale = function (ratio) {
  11744. var textureSize = this.getSize();
  11745. textureSize.width *= ratio;
  11746. textureSize.height *= ratio;
  11747. this._canvas.width = textureSize.width;
  11748. this._canvas.height = textureSize.height;
  11749. this.releaseInternalTexture();
  11750. this._texture = this.getScene().getEngine().createDynamicTexture(textureSize.width, textureSize.height, this._generateMipMaps, this._samplingMode);
  11751. };
  11752. DynamicTexture.prototype.getContext = function () {
  11753. return this._context;
  11754. };
  11755. DynamicTexture.prototype.update = function (invertY) {
  11756. this.getScene().getEngine().updateDynamicTexture(this._texture, this._canvas, invertY === undefined ? true : invertY);
  11757. };
  11758. DynamicTexture.prototype.drawText = function (text, x, y, font, color, clearColor, invertY) {
  11759. var size = this.getSize();
  11760. if (clearColor) {
  11761. this._context.fillStyle = clearColor;
  11762. this._context.fillRect(0, 0, size.width, size.height);
  11763. }
  11764. this._context.font = font;
  11765. if (x === null) {
  11766. var textSize = this._context.measureText(text);
  11767. x = (size.width - textSize.width) / 2;
  11768. }
  11769. this._context.fillStyle = color;
  11770. this._context.fillText(text, x, y);
  11771. this.update(invertY);
  11772. };
  11773. DynamicTexture.prototype.clone = function () {
  11774. var textureSize = this.getSize();
  11775. var newTexture = new BABYLON.DynamicTexture(this.name, textureSize.width, this.getScene(), this._generateMipMaps);
  11776. // Base texture
  11777. newTexture.hasAlpha = this.hasAlpha;
  11778. newTexture.level = this.level;
  11779. // Dynamic Texture
  11780. newTexture.wrapU = this.wrapU;
  11781. newTexture.wrapV = this.wrapV;
  11782. return newTexture;
  11783. };
  11784. return DynamicTexture;
  11785. })(BABYLON.Texture);
  11786. BABYLON.DynamicTexture = DynamicTexture;
  11787. })(BABYLON || (BABYLON = {}));
  11788. //# sourceMappingURL=babylon.dynamicTexture.js.map
  11789. var BABYLON;
  11790. (function (BABYLON) {
  11791. var VideoTexture = (function (_super) {
  11792. __extends(VideoTexture, _super);
  11793. function VideoTexture(name, urls, size, scene, generateMipMaps, invertY, samplingMode) {
  11794. if (typeof samplingMode === "undefined") { samplingMode = BABYLON.Texture.TRILINEAR_SAMPLINGMODE; }
  11795. var _this = this;
  11796. _super.call(this, null, scene, !generateMipMaps, invertY);
  11797. this._autoLaunch = true;
  11798. this.name = name;
  11799. this.wrapU = BABYLON.Texture.WRAP_ADDRESSMODE;
  11800. this.wrapV = BABYLON.Texture.WRAP_ADDRESSMODE;
  11801. var requiredWidth = size.width || size;
  11802. var requiredHeight = size.height || size;
  11803. this._texture = scene.getEngine().createDynamicTexture(requiredWidth, requiredHeight, generateMipMaps, samplingMode);
  11804. var textureSize = this.getSize();
  11805. this.video = document.createElement("video");
  11806. this.video.width = textureSize.width;
  11807. this.video.height = textureSize.height;
  11808. this.video.autoplay = false;
  11809. this.video.loop = true;
  11810. this.video.addEventListener("canplaythrough", function () {
  11811. if (_this._texture) {
  11812. _this._texture.isReady = true;
  11813. }
  11814. });
  11815. urls.forEach(function (url) {
  11816. var source = document.createElement("source");
  11817. source.src = url;
  11818. _this.video.appendChild(source);
  11819. });
  11820. this._lastUpdate = BABYLON.Tools.Now;
  11821. }
  11822. VideoTexture.prototype.update = function () {
  11823. if (this._autoLaunch) {
  11824. this._autoLaunch = false;
  11825. this.video.play();
  11826. }
  11827. var now = BABYLON.Tools.Now;
  11828. if (now - this._lastUpdate < 15) {
  11829. return false;
  11830. }
  11831. this._lastUpdate = now;
  11832. this.getScene().getEngine().updateVideoTexture(this._texture, this.video, this._invertY);
  11833. return true;
  11834. };
  11835. return VideoTexture;
  11836. })(BABYLON.Texture);
  11837. BABYLON.VideoTexture = VideoTexture;
  11838. })(BABYLON || (BABYLON = {}));
  11839. //# sourceMappingURL=babylon.videoTexture.js.map
  11840. var BABYLON;
  11841. (function (BABYLON) {
  11842. var EffectFallbacks = (function () {
  11843. function EffectFallbacks() {
  11844. this._defines = {};
  11845. this._currentRank = 32;
  11846. this._maxRank = -1;
  11847. }
  11848. EffectFallbacks.prototype.addFallback = function (rank, define) {
  11849. if (!this._defines[rank]) {
  11850. if (rank < this._currentRank) {
  11851. this._currentRank = rank;
  11852. }
  11853. if (rank > this._maxRank) {
  11854. this._maxRank = rank;
  11855. }
  11856. this._defines[rank] = new Array();
  11857. }
  11858. this._defines[rank].push(define);
  11859. };
  11860. Object.defineProperty(EffectFallbacks.prototype, "isMoreFallbacks", {
  11861. get: function () {
  11862. return this._currentRank <= this._maxRank;
  11863. },
  11864. enumerable: true,
  11865. configurable: true
  11866. });
  11867. EffectFallbacks.prototype.reduce = function (currentDefines) {
  11868. var currentFallbacks = this._defines[this._currentRank];
  11869. for (var index = 0; index < currentFallbacks.length; index++) {
  11870. currentDefines = currentDefines.replace("#define " + currentFallbacks[index], "");
  11871. }
  11872. this._currentRank++;
  11873. return currentDefines;
  11874. };
  11875. return EffectFallbacks;
  11876. })();
  11877. BABYLON.EffectFallbacks = EffectFallbacks;
  11878. var Effect = (function () {
  11879. function Effect(baseName, attributesNames, uniformsNames, samplers, engine, defines, fallbacks, onCompiled, onError) {
  11880. var _this = this;
  11881. this._isReady = false;
  11882. this._compilationError = "";
  11883. this._valueCache = [];
  11884. this._engine = engine;
  11885. this.name = baseName;
  11886. this.defines = defines;
  11887. this._uniformsNames = uniformsNames.concat(samplers);
  11888. this._samplers = samplers;
  11889. this._attributesNames = attributesNames;
  11890. this.onError = onError;
  11891. this.onCompiled = onCompiled;
  11892. var vertexSource;
  11893. var fragmentSource;
  11894. if (baseName.vertexElement) {
  11895. vertexSource = document.getElementById(baseName.vertexElement);
  11896. if (!vertexSource) {
  11897. vertexSource = baseName.vertexElement;
  11898. }
  11899. } else {
  11900. vertexSource = baseName.vertex || baseName;
  11901. }
  11902. if (baseName.fragmentElement) {
  11903. fragmentSource = document.getElementById(baseName.fragmentElement);
  11904. if (!fragmentSource) {
  11905. fragmentSource = baseName.fragmentElement;
  11906. }
  11907. } else {
  11908. fragmentSource = baseName.fragment || baseName;
  11909. }
  11910. this._loadVertexShader(vertexSource, function (vertexCode) {
  11911. _this._loadFragmentShader(fragmentSource, function (fragmentCode) {
  11912. _this._prepareEffect(vertexCode, fragmentCode, attributesNames, defines, fallbacks);
  11913. });
  11914. });
  11915. }
  11916. // Properties
  11917. Effect.prototype.isReady = function () {
  11918. return this._isReady;
  11919. };
  11920. Effect.prototype.getProgram = function () {
  11921. return this._program;
  11922. };
  11923. Effect.prototype.getAttributesNames = function () {
  11924. return this._attributesNames;
  11925. };
  11926. Effect.prototype.getAttributeLocation = function (index) {
  11927. return this._attributes[index];
  11928. };
  11929. Effect.prototype.getAttributeLocationByName = function (name) {
  11930. var index = this._attributesNames.indexOf(name);
  11931. return this._attributes[index];
  11932. };
  11933. Effect.prototype.getAttributesCount = function () {
  11934. return this._attributes.length;
  11935. };
  11936. Effect.prototype.getUniformIndex = function (uniformName) {
  11937. return this._uniformsNames.indexOf(uniformName);
  11938. };
  11939. Effect.prototype.getUniform = function (uniformName) {
  11940. return this._uniforms[this._uniformsNames.indexOf(uniformName)];
  11941. };
  11942. Effect.prototype.getSamplers = function () {
  11943. return this._samplers;
  11944. };
  11945. Effect.prototype.getCompilationError = function () {
  11946. return this._compilationError;
  11947. };
  11948. // Methods
  11949. Effect.prototype._loadVertexShader = function (vertex, callback) {
  11950. // DOM element ?
  11951. if (vertex instanceof HTMLElement) {
  11952. var vertexCode = BABYLON.Tools.GetDOMTextContent(vertex);
  11953. callback(vertexCode);
  11954. return;
  11955. }
  11956. // Is in local store ?
  11957. if (Effect.ShadersStore[vertex + "VertexShader"]) {
  11958. callback(Effect.ShadersStore[vertex + "VertexShader"]);
  11959. return;
  11960. }
  11961. var vertexShaderUrl;
  11962. if (vertex[0] === ".") {
  11963. vertexShaderUrl = vertex;
  11964. } else {
  11965. vertexShaderUrl = BABYLON.Engine.ShadersRepository + vertex;
  11966. }
  11967. // Vertex shader
  11968. BABYLON.Tools.LoadFile(vertexShaderUrl + ".vertex.fx", callback);
  11969. };
  11970. Effect.prototype._loadFragmentShader = function (fragment, callback) {
  11971. // DOM element ?
  11972. if (fragment instanceof HTMLElement) {
  11973. var fragmentCode = BABYLON.Tools.GetDOMTextContent(fragment);
  11974. callback(fragmentCode);
  11975. return;
  11976. }
  11977. // Is in local store ?
  11978. if (Effect.ShadersStore[fragment + "PixelShader"]) {
  11979. callback(Effect.ShadersStore[fragment + "PixelShader"]);
  11980. return;
  11981. }
  11982. if (Effect.ShadersStore[fragment + "FragmentShader"]) {
  11983. callback(Effect.ShadersStore[fragment + "FragmentShader"]);
  11984. return;
  11985. }
  11986. var fragmentShaderUrl;
  11987. if (fragment[0] === ".") {
  11988. fragmentShaderUrl = fragment;
  11989. } else {
  11990. fragmentShaderUrl = BABYLON.Engine.ShadersRepository + fragment;
  11991. }
  11992. // Fragment shader
  11993. BABYLON.Tools.LoadFile(fragmentShaderUrl + ".fragment.fx", callback);
  11994. };
  11995. Effect.prototype._prepareEffect = function (vertexSourceCode, fragmentSourceCode, attributesNames, defines, fallbacks) {
  11996. try {
  11997. var engine = this._engine;
  11998. this._program = engine.createShaderProgram(vertexSourceCode, fragmentSourceCode, defines);
  11999. this._uniforms = engine.getUniforms(this._program, this._uniformsNames);
  12000. this._attributes = engine.getAttributes(this._program, attributesNames);
  12001. for (var index = 0; index < this._samplers.length; index++) {
  12002. var sampler = this.getUniform(this._samplers[index]);
  12003. if (sampler == null) {
  12004. this._samplers.splice(index, 1);
  12005. index--;
  12006. }
  12007. }
  12008. engine.bindSamplers(this);
  12009. this._isReady = true;
  12010. if (this.onCompiled) {
  12011. this.onCompiled(this);
  12012. }
  12013. } catch (e) {
  12014. // Is it a problem with precision?
  12015. if (e.message.indexOf("highp") !== -1) {
  12016. vertexSourceCode = vertexSourceCode.replace("precision highp float", "precision mediump float");
  12017. fragmentSourceCode = fragmentSourceCode.replace("precision highp float", "precision mediump float");
  12018. this._prepareEffect(vertexSourceCode, fragmentSourceCode, attributesNames, defines, fallbacks);
  12019. return;
  12020. }
  12021. // Let's go through fallbacks then
  12022. if (fallbacks && fallbacks.isMoreFallbacks) {
  12023. defines = fallbacks.reduce(defines);
  12024. this._prepareEffect(vertexSourceCode, fragmentSourceCode, attributesNames, defines, fallbacks);
  12025. } else {
  12026. BABYLON.Tools.Error("Unable to compile effect: " + this.name);
  12027. BABYLON.Tools.Error("Defines: " + defines);
  12028. BABYLON.Tools.Error("Error: " + e.message);
  12029. this._compilationError = e.message;
  12030. if (this.onError) {
  12031. this.onError(this, this._compilationError);
  12032. }
  12033. }
  12034. }
  12035. };
  12036. Effect.prototype._bindTexture = function (channel, texture) {
  12037. this._engine._bindTexture(this._samplers.indexOf(channel), texture);
  12038. };
  12039. Effect.prototype.setTexture = function (channel, texture) {
  12040. this._engine.setTexture(this._samplers.indexOf(channel), texture);
  12041. };
  12042. Effect.prototype.setTextureFromPostProcess = function (channel, postProcess) {
  12043. this._engine.setTextureFromPostProcess(this._samplers.indexOf(channel), postProcess);
  12044. };
  12045. //public _cacheMatrix(uniformName, matrix) {
  12046. // if (!this._valueCache[uniformName]) {
  12047. // this._valueCache[uniformName] = new BABYLON.Matrix();
  12048. // }
  12049. // for (var index = 0; index < 16; index++) {
  12050. // this._valueCache[uniformName].m[index] = matrix.m[index];
  12051. // }
  12052. //};
  12053. Effect.prototype._cacheFloat2 = function (uniformName, x, y) {
  12054. if (!this._valueCache[uniformName]) {
  12055. this._valueCache[uniformName] = [x, y];
  12056. return;
  12057. }
  12058. this._valueCache[uniformName][0] = x;
  12059. this._valueCache[uniformName][1] = y;
  12060. };
  12061. Effect.prototype._cacheFloat3 = function (uniformName, x, y, z) {
  12062. if (!this._valueCache[uniformName]) {
  12063. this._valueCache[uniformName] = [x, y, z];
  12064. return;
  12065. }
  12066. this._valueCache[uniformName][0] = x;
  12067. this._valueCache[uniformName][1] = y;
  12068. this._valueCache[uniformName][2] = z;
  12069. };
  12070. Effect.prototype._cacheFloat4 = function (uniformName, x, y, z, w) {
  12071. if (!this._valueCache[uniformName]) {
  12072. this._valueCache[uniformName] = [x, y, z, w];
  12073. return;
  12074. }
  12075. this._valueCache[uniformName][0] = x;
  12076. this._valueCache[uniformName][1] = y;
  12077. this._valueCache[uniformName][2] = z;
  12078. this._valueCache[uniformName][3] = w;
  12079. };
  12080. Effect.prototype.setArray = function (uniformName, array) {
  12081. this._engine.setArray(this.getUniform(uniformName), array);
  12082. return this;
  12083. };
  12084. Effect.prototype.setMatrices = function (uniformName, matrices) {
  12085. this._engine.setMatrices(this.getUniform(uniformName), matrices);
  12086. return this;
  12087. };
  12088. Effect.prototype.setMatrix = function (uniformName, matrix) {
  12089. //if (this._valueCache[uniformName] && this._valueCache[uniformName].equals(matrix))
  12090. // return;
  12091. //this._cacheMatrix(uniformName, matrix);
  12092. this._engine.setMatrix(this.getUniform(uniformName), matrix);
  12093. return this;
  12094. };
  12095. Effect.prototype.setFloat = function (uniformName, value) {
  12096. if (this._valueCache[uniformName] && this._valueCache[uniformName] === value)
  12097. return this;
  12098. this._valueCache[uniformName] = value;
  12099. this._engine.setFloat(this.getUniform(uniformName), value);
  12100. return this;
  12101. };
  12102. Effect.prototype.setBool = function (uniformName, bool) {
  12103. if (this._valueCache[uniformName] && this._valueCache[uniformName] === bool)
  12104. return this;
  12105. this._valueCache[uniformName] = bool;
  12106. this._engine.setBool(this.getUniform(uniformName), bool ? 1 : 0);
  12107. return this;
  12108. };
  12109. Effect.prototype.setVector2 = function (uniformName, vector2) {
  12110. if (this._valueCache[uniformName] && this._valueCache[uniformName][0] === vector2.x && this._valueCache[uniformName][1] === vector2.y)
  12111. return this;
  12112. this._cacheFloat2(uniformName, vector2.x, vector2.y);
  12113. this._engine.setFloat2(this.getUniform(uniformName), vector2.x, vector2.y);
  12114. return this;
  12115. };
  12116. Effect.prototype.setFloat2 = function (uniformName, x, y) {
  12117. if (this._valueCache[uniformName] && this._valueCache[uniformName][0] === x && this._valueCache[uniformName][1] === y)
  12118. return this;
  12119. this._cacheFloat2(uniformName, x, y);
  12120. this._engine.setFloat2(this.getUniform(uniformName), x, y);
  12121. return this;
  12122. };
  12123. Effect.prototype.setVector3 = function (uniformName, vector3) {
  12124. if (this._valueCache[uniformName] && this._valueCache[uniformName][0] === vector3.x && this._valueCache[uniformName][1] === vector3.y && this._valueCache[uniformName][2] === vector3.z)
  12125. return this;
  12126. this._cacheFloat3(uniformName, vector3.x, vector3.y, vector3.z);
  12127. this._engine.setFloat3(this.getUniform(uniformName), vector3.x, vector3.y, vector3.z);
  12128. return this;
  12129. };
  12130. Effect.prototype.setFloat3 = function (uniformName, x, y, z) {
  12131. if (this._valueCache[uniformName] && this._valueCache[uniformName][0] === x && this._valueCache[uniformName][1] === y && this._valueCache[uniformName][2] === z)
  12132. return this;
  12133. this._cacheFloat3(uniformName, x, y, z);
  12134. this._engine.setFloat3(this.getUniform(uniformName), x, y, z);
  12135. return this;
  12136. };
  12137. Effect.prototype.setFloat4 = function (uniformName, x, y, z, w) {
  12138. if (this._valueCache[uniformName] && this._valueCache[uniformName][0] === x && this._valueCache[uniformName][1] === y && this._valueCache[uniformName][2] === z && this._valueCache[uniformName][3] === w)
  12139. return this;
  12140. this._cacheFloat4(uniformName, x, y, z, w);
  12141. this._engine.setFloat4(this.getUniform(uniformName), x, y, z, w);
  12142. return this;
  12143. };
  12144. Effect.prototype.setColor3 = function (uniformName, color3) {
  12145. if (this._valueCache[uniformName] && this._valueCache[uniformName][0] === color3.r && this._valueCache[uniformName][1] === color3.g && this._valueCache[uniformName][2] === color3.b)
  12146. return this;
  12147. this._cacheFloat3(uniformName, color3.r, color3.g, color3.b);
  12148. this._engine.setColor3(this.getUniform(uniformName), color3);
  12149. return this;
  12150. };
  12151. Effect.prototype.setColor4 = function (uniformName, color3, alpha) {
  12152. if (this._valueCache[uniformName] && this._valueCache[uniformName][0] === color3.r && this._valueCache[uniformName][1] === color3.g && this._valueCache[uniformName][2] === color3.b && this._valueCache[uniformName][3] === alpha)
  12153. return this;
  12154. this._cacheFloat4(uniformName, color3.r, color3.g, color3.b, alpha);
  12155. this._engine.setColor4(this.getUniform(uniformName), color3, alpha);
  12156. return this;
  12157. };
  12158. Effect.ShadersStore={anaglyphPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Samplers\nvarying vec2 vUV;\nuniform sampler2D textureSampler;\nuniform sampler2D leftSampler;\n\nvoid main(void)\n{\n vec4 leftFrag = texture2D(leftSampler, vUV);\n leftFrag = vec4(1.0, leftFrag.g, leftFrag.b, 1.0);\n\n vec4 rightFrag = texture2D(textureSampler, vUV);\n rightFrag = vec4(rightFrag.r, 1.0, 1.0, 1.0);\n\n gl_FragColor = vec4(rightFrag.rgb * leftFrag.rgb, 1.0);\n}",
  12159. blackAndWhitePixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Samplers\nvarying vec2 vUV;\nuniform sampler2D textureSampler;\n\nvoid main(void) \n{\n float luminance = dot(texture2D(textureSampler, vUV).rgb, vec3(0.3, 0.59, 0.11));\n gl_FragColor = vec4(luminance, luminance, luminance, 1.0);\n}",
  12160. blurPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Samplers\nvarying vec2 vUV;\nuniform sampler2D textureSampler;\n\n// Parameters\nuniform vec2 screenSize;\nuniform vec2 direction;\nuniform float blurWidth;\n\nvoid main(void)\n{\n float weights[7];\n weights[0] = 0.05;\n weights[1] = 0.1;\n weights[2] = 0.2;\n weights[3] = 0.3;\n weights[4] = 0.2;\n weights[5] = 0.1;\n weights[6] = 0.05;\n\n vec2 texelSize = vec2(1.0 / screenSize.x, 1.0 / screenSize.y);\n vec2 texelStep = texelSize * direction * blurWidth;\n vec2 start = vUV - 3.0 * texelStep;\n\n vec4 baseColor = vec4(0., 0., 0., 0.);\n vec2 texelOffset = vec2(0., 0.);\n\n for (int i = 0; i < 7; i++)\n {\n baseColor += texture2D(textureSampler, start + texelOffset) * weights[i];\n texelOffset += texelStep;\n }\n\n gl_FragColor = baseColor;\n}",
  12161. brickPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\nvarying vec2 vPosition;\nvarying vec2 vUV;\n\nuniform float numberOfBricksHeight;\nuniform float numberOfBricksWidth;\nuniform vec3 brickColor;\nuniform vec3 jointColor;\n\nfloat rand(vec2 n) {\n return fract(cos(dot(n, vec2(12.9898, 4.1414))) * 43758.5453);\n}\n\nfloat noise(vec2 n) {\n const vec2 d = vec2(0.0, 1.0);\n vec2 b = floor(n), f = smoothstep(vec2(0.0), vec2(1.0), fract(n));\n return mix(mix(rand(b), rand(b + d.yx), f.x), mix(rand(b + d.xy), rand(b + d.yy), f.x), f.y);\n}\n\nfloat fbm(vec2 n) {\n float total = 0.0, amplitude = 1.0;\n for (int i = 0; i < 4; i++) {\n total += noise(n) * amplitude;\n n += n;\n amplitude *= 0.5;\n }\n return total;\n}\n\nfloat round(float number){\n return sign(number)*floor(abs(number) + 0.5);\n}\n\nvoid main(void)\n{\n float brickW = 1.0 / numberOfBricksWidth;\n float brickH = 1.0 / numberOfBricksHeight;\n float jointWPercentage = 0.01;\n float jointHPercentage = 0.05;\n vec3 color = brickColor;\n float yi = vUV.y / brickH;\n float nyi = round(yi);\n float xi = vUV.x / brickW;\n\n if (mod(floor(yi), 2.0) == 0.0){\n xi = xi - 0.5;\n }\n\n float nxi = round(xi);\n vec2 brickvUV = vec2((xi - floor(xi)) / brickH, (yi - floor(yi)) / brickW);\n\n if (yi < nyi + jointHPercentage && yi > nyi - jointHPercentage){\n color = mix(jointColor, vec3(0.37, 0.25, 0.25), (yi - nyi) / jointHPercentage + 0.2);\n }\n else if (xi < nxi + jointWPercentage && xi > nxi - jointWPercentage){\n color = mix(jointColor, vec3(0.44, 0.44, 0.44), (xi - nxi) / jointWPercentage + 0.2);\n }\n else {\n float brickColorSwitch = mod(floor(yi) + floor(xi), 3.0);\n\n if (brickColorSwitch == 0.0)\n color = mix(color, vec3(0.33, 0.33, 0.33), 0.3);\n else if (brickColorSwitch == 2.0)\n color = mix(color, vec3(0.11, 0.11, 0.11), 0.3);\n }\n\n gl_FragColor = vec4(color, 1.0);\n}",
  12162. cloudPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\nvarying vec2 vUV;\n\nuniform vec3 skyColor;\nuniform vec3 cloudColor;\n\nfloat rand(vec2 n) {\n return fract(cos(dot(n, vec2(12.9898, 4.1414))) * 43758.5453);\n}\n\nfloat noise(vec2 n) {\n const vec2 d = vec2(0.0, 1.0);\n vec2 b = floor(n), f = smoothstep(vec2(0.0), vec2(1.0), fract(n));\n return mix(mix(rand(b), rand(b + d.yx), f.x), mix(rand(b + d.xy), rand(b + d.yy), f.x), f.y);\n}\n\nfloat fbm(vec2 n) {\n float total = 0.0, amplitude = 1.0;\n for (int i = 0; i < 4; i++) {\n total += noise(n) * amplitude;\n n += n;\n amplitude *= 0.5;\n }\n return total;\n}\n\nvoid main() {\n\n vec2 p = vUV * 12.0;\n vec3 c = mix(skyColor, cloudColor, fbm(p));\n gl_FragColor = vec4(c, 1);\n\n}",
  12163. colorPixelShader:"precision highp float;\n\nuniform vec4 color;\n\nvoid main(void) {\n gl_FragColor = color;\n}",
  12164. colorVertexShader:"precision highp float;\n\n// Attributes\nattribute vec3 position;\n\n// Uniforms\nuniform mat4 worldViewProjection;\n\nvoid main(void) {\n gl_Position = worldViewProjection * vec4(position, 1.0);\n}",
  12165. convolutionPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Samplers\nvarying vec2 vUV;\nuniform sampler2D textureSampler;\n\nuniform vec2 screenSize;\nuniform float kernel[9];\n\nvoid main(void)\n{\n vec2 onePixel = vec2(1.0, 1.0) / screenSize;\n vec4 colorSum =\n texture2D(textureSampler, vUV + onePixel * vec2(-1, -1)) * kernel[0] +\n texture2D(textureSampler, vUV + onePixel * vec2(0, -1)) * kernel[1] +\n texture2D(textureSampler, vUV + onePixel * vec2(1, -1)) * kernel[2] +\n texture2D(textureSampler, vUV + onePixel * vec2(-1, 0)) * kernel[3] +\n texture2D(textureSampler, vUV + onePixel * vec2(0, 0)) * kernel[4] +\n texture2D(textureSampler, vUV + onePixel * vec2(1, 0)) * kernel[5] +\n texture2D(textureSampler, vUV + onePixel * vec2(-1, 1)) * kernel[6] +\n texture2D(textureSampler, vUV + onePixel * vec2(0, 1)) * kernel[7] +\n texture2D(textureSampler, vUV + onePixel * vec2(1, 1)) * kernel[8];\n\n float kernelWeight =\n kernel[0] +\n kernel[1] +\n kernel[2] +\n kernel[3] +\n kernel[4] +\n kernel[5] +\n kernel[6] +\n kernel[7] +\n kernel[8];\n\n if (kernelWeight <= 0.0) {\n kernelWeight = 1.0;\n }\n\n gl_FragColor = vec4((colorSum / kernelWeight).rgb, 1);\n}",
  12166. defaultPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n#define MAP_EXPLICIT 0.\n#define MAP_SPHERICAL 1.\n#define MAP_PLANAR 2.\n#define MAP_CUBIC 3.\n#define MAP_PROJECTION 4.\n#define MAP_SKYBOX 5.\n\n// Constants\nuniform vec3 vEyePosition;\nuniform vec3 vAmbientColor;\nuniform vec4 vDiffuseColor;\nuniform vec4 vSpecularColor;\nuniform vec3 vEmissiveColor;\n\n// Input\nvarying vec3 vPositionW;\nvarying vec3 vNormalW;\n\n#ifdef VERTEXCOLOR\nvarying vec4 vColor;\n#endif\n\n// Lights\n#ifdef LIGHT0\nuniform vec4 vLightData0;\nuniform vec4 vLightDiffuse0;\nuniform vec3 vLightSpecular0;\n#ifdef SHADOW0\nvarying vec4 vPositionFromLight0;\nuniform sampler2D shadowSampler0;\nuniform float darkness0;\n#endif\n#ifdef SPOTLIGHT0\nuniform vec4 vLightDirection0;\n#endif\n#ifdef HEMILIGHT0\nuniform vec3 vLightGround0;\n#endif\n#endif\n\n#ifdef LIGHT1\nuniform vec4 vLightData1;\nuniform vec4 vLightDiffuse1;\nuniform vec3 vLightSpecular1;\n#ifdef SHADOW1\nvarying vec4 vPositionFromLight1;\nuniform sampler2D shadowSampler1;\nuniform float darkness1;\n#endif\n#ifdef SPOTLIGHT1\nuniform vec4 vLightDirection1;\n#endif\n#ifdef HEMILIGHT1\nuniform vec3 vLightGround1;\n#endif\n#endif\n\n#ifdef LIGHT2\nuniform vec4 vLightData2;\nuniform vec4 vLightDiffuse2;\nuniform vec3 vLightSpecular2;\n#ifdef SHADOW2\nvarying vec4 vPositionFromLight2;\nuniform sampler2D shadowSampler2;\nuniform float darkness2;\n#endif\n#ifdef SPOTLIGHT2\nuniform vec4 vLightDirection2;\n#endif\n#ifdef HEMILIGHT2\nuniform vec3 vLightGround2;\n#endif\n#endif\n\n#ifdef LIGHT3\nuniform vec4 vLightData3;\nuniform vec4 vLightDiffuse3;\nuniform vec3 vLightSpecular3;\n#ifdef SHADOW3\nvarying vec4 vPositionFromLight3;\nuniform sampler2D shadowSampler3;\nuniform float darkness3;\n#endif\n#ifdef SPOTLIGHT3\nuniform vec4 vLightDirection3;\n#endif\n#ifdef HEMILIGHT3\nuniform vec3 vLightGround3;\n#endif\n#endif\n\n// Samplers\n#ifdef DIFFUSE\nvarying vec2 vDiffuseUV;\nuniform sampler2D diffuseSampler;\nuniform vec2 vDiffuseInfos;\n#endif\n\n#ifdef AMBIENT\nvarying vec2 vAmbientUV;\nuniform sampler2D ambientSampler;\nuniform vec2 vAmbientInfos;\n#endif\n\n#ifdef OPACITY \nvarying vec2 vOpacityUV;\nuniform sampler2D opacitySampler;\nuniform vec2 vOpacityInfos;\n#endif\n\n#ifdef EMISSIVE\nvarying vec2 vEmissiveUV;\nuniform vec2 vEmissiveInfos;\nuniform sampler2D emissiveSampler;\n#endif\n\n#ifdef SPECULAR\nvarying vec2 vSpecularUV;\nuniform vec2 vSpecularInfos;\nuniform sampler2D specularSampler;\n#endif\n\n// Fresnel\n#ifdef FRESNEL\nfloat computeFresnelTerm(vec3 viewDirection, vec3 worldNormal, float bias, float power)\n{\n float fresnelTerm = pow(bias + abs(dot(viewDirection, worldNormal)), power);\n return clamp(fresnelTerm, 0., 1.);\n}\n#endif\n\n#ifdef DIFFUSEFRESNEL\nuniform vec4 diffuseLeftColor;\nuniform vec4 diffuseRightColor;\n#endif\n\n#ifdef OPACITYFRESNEL\nuniform vec4 opacityParts;\n#endif\n\n#ifdef REFLECTIONFRESNEL\nuniform vec4 reflectionLeftColor;\nuniform vec4 reflectionRightColor;\n#endif\n\n#ifdef EMISSIVEFRESNEL\nuniform vec4 emissiveLeftColor;\nuniform vec4 emissiveRightColor;\n#endif\n\n// Reflection\n#ifdef REFLECTION\nvarying vec3 vPositionUVW;\nuniform samplerCube reflectionCubeSampler;\nuniform sampler2D reflection2DSampler;\nuniform vec3 vReflectionInfos;\nuniform mat4 reflectionMatrix;\nuniform mat4 view;\n\nvec3 computeReflectionCoords(float mode, vec4 worldPos, vec3 worldNormal)\n{\n if (mode == MAP_SPHERICAL)\n {\n vec3 coords = vec3(view * vec4(worldNormal, 0.0));\n\n return vec3(reflectionMatrix * vec4(coords, 1.0));\n }\n else if (mode == MAP_PLANAR)\n {\n vec3 viewDir = worldPos.xyz - vEyePosition;\n vec3 coords = normalize(reflect(viewDir, worldNormal));\n\n return vec3(reflectionMatrix * vec4(coords, 1));\n }\n else if (mode == MAP_CUBIC)\n {\n vec3 viewDir = worldPos.xyz - vEyePosition;\n vec3 coords = reflect(viewDir, worldNormal);\n\n return vec3(reflectionMatrix * vec4(coords, 0));\n }\n else if (mode == MAP_PROJECTION)\n {\n return vec3(reflectionMatrix * (view * worldPos));\n }\n else if (mode == MAP_SKYBOX)\n {\n return vPositionUVW;\n }\n\n return vec3(0, 0, 0);\n}\n#endif\n\n// Shadows\n#ifdef SHADOWS\n\nfloat unpack(vec4 color)\n{\n const vec4 bitShift = vec4(1. / (255. * 255. * 255.), 1. / (255. * 255.), 1. / 255., 1.);\n return dot(color, bitShift);\n}\n\nfloat unpackHalf(vec2 color)\n{\n return color.x + (color.y / 255.0);\n}\n\nfloat computeShadow(vec4 vPositionFromLight, sampler2D shadowSampler, float darkness)\n{\n vec3 depth = vPositionFromLight.xyz / vPositionFromLight.w;\n vec2 uv = 0.5 * depth.xy + vec2(0.5, 0.5);\n\n if (uv.x < 0. || uv.x > 1.0 || uv.y < 0. || uv.y > 1.0)\n {\n return 1.0;\n }\n\n float shadow = unpack(texture2D(shadowSampler, uv));\n\n if (depth.z > shadow)\n {\n return darkness;\n }\n return 1.;\n}\n\nfloat computeShadowWithPCF(vec4 vPositionFromLight, sampler2D shadowSampler)\n{\n vec3 depth = vPositionFromLight.xyz / vPositionFromLight.w;\n vec2 uv = 0.5 * depth.xy + vec2(0.5, 0.5);\n\n if (uv.x < 0. || uv.x > 1.0 || uv.y < 0. || uv.y > 1.0)\n {\n return 1.0;\n }\n\n float visibility = 1.;\n\n vec2 poissonDisk[4];\n poissonDisk[0] = vec2(-0.94201624, -0.39906216);\n poissonDisk[1] = vec2(0.94558609, -0.76890725);\n poissonDisk[2] = vec2(-0.094184101, -0.92938870);\n poissonDisk[3] = vec2(0.34495938, 0.29387760);\n\n // Poisson Sampling\n if (unpack(texture2D(shadowSampler, uv + poissonDisk[0] / 1500.0)) < depth.z) visibility -= 0.2;\n if (unpack(texture2D(shadowSampler, uv + poissonDisk[1] / 1500.0)) < depth.z) visibility -= 0.2;\n if (unpack(texture2D(shadowSampler, uv + poissonDisk[2] / 1500.0)) < depth.z) visibility -= 0.2;\n if (unpack(texture2D(shadowSampler, uv + poissonDisk[3] / 1500.0)) < depth.z) visibility -= 0.2;\n\n return visibility;\n}\n\n// Thanks to http://devmaster.net/\nfloat ChebychevInequality(vec2 moments, float t)\n{\n if (t <= moments.x)\n {\n return 1.0;\n }\n\n float variance = moments.y - (moments.x * moments.x);\n variance = max(variance, 0.);\n\n float d = t - moments.x;\n return variance / (variance + d * d);\n}\n\nfloat computeShadowWithVSM(vec4 vPositionFromLight, sampler2D shadowSampler)\n{\n vec3 depth = vPositionFromLight.xyz / vPositionFromLight.w;\n vec2 uv = 0.5 * depth.xy + vec2(0.5, 0.5);\n\n if (uv.x < 0. || uv.x > 1.0 || uv.y < 0. || uv.y > 1.0)\n {\n return 1.0;\n }\n\n vec4 texel = texture2D(shadowSampler, uv);\n\n vec2 moments = vec2(unpackHalf(texel.xy), unpackHalf(texel.zw));\n return clamp(1.3 - ChebychevInequality(moments, depth.z), 0., 1.0);\n}\n#endif\n\n// Bump\n#ifdef BUMP\n#extension GL_OES_standard_derivatives : enable\nvarying vec2 vBumpUV;\nuniform vec2 vBumpInfos;\nuniform sampler2D bumpSampler;\n\n// Thanks to http://www.thetenthplanet.de/archives/1180\nmat3 cotangent_frame(vec3 normal, vec3 p, vec2 uv)\n{\n // get edge vectors of the pixel triangle\n vec3 dp1 = dFdx(p);\n vec3 dp2 = dFdy(p);\n vec2 duv1 = dFdx(uv);\n vec2 duv2 = dFdy(uv);\n\n // solve the linear system\n vec3 dp2perp = cross(dp2, normal);\n vec3 dp1perp = cross(normal, dp1);\n vec3 tangent = dp2perp * duv1.x + dp1perp * duv2.x;\n vec3 binormal = dp2perp * duv1.y + dp1perp * duv2.y;\n\n // construct a scale-invariant frame \n float invmax = inversesqrt(max(dot(tangent, tangent), dot(binormal, binormal)));\n return mat3(tangent * invmax, binormal * invmax, normal);\n}\n\nvec3 perturbNormal(vec3 viewDir)\n{\n vec3 map = texture2D(bumpSampler, vBumpUV).xyz;\n map = map * 255. / 127. - 128. / 127.;\n mat3 TBN = cotangent_frame(vNormalW * vBumpInfos.y, -viewDir, vBumpUV);\n return normalize(TBN * map);\n}\n#endif\n\n#ifdef CLIPPLANE\nvarying float fClipDistance;\n#endif\n\n// Fog\n#ifdef FOG\n\n#define FOGMODE_NONE 0.\n#define FOGMODE_EXP 1.\n#define FOGMODE_EXP2 2.\n#define FOGMODE_LINEAR 3.\n#define E 2.71828\n\nuniform vec4 vFogInfos;\nuniform vec3 vFogColor;\nvarying float fFogDistance;\n\nfloat CalcFogFactor()\n{\n float fogCoeff = 1.0;\n float fogStart = vFogInfos.y;\n float fogEnd = vFogInfos.z;\n float fogDensity = vFogInfos.w;\n\n if (FOGMODE_LINEAR == vFogInfos.x)\n {\n fogCoeff = (fogEnd - fFogDistance) / (fogEnd - fogStart);\n }\n else if (FOGMODE_EXP == vFogInfos.x)\n {\n fogCoeff = 1.0 / pow(E, fFogDistance * fogDensity);\n }\n else if (FOGMODE_EXP2 == vFogInfos.x)\n {\n fogCoeff = 1.0 / pow(E, fFogDistance * fFogDistance * fogDensity * fogDensity);\n }\n\n return clamp(fogCoeff, 0.0, 1.0);\n}\n#endif\n\n// Light Computing\nstruct lightingInfo\n{\n vec3 diffuse;\n vec3 specular;\n};\n\nlightingInfo computeLighting(vec3 viewDirectionW, vec3 vNormal, vec4 lightData, vec3 diffuseColor, vec3 specularColor, float range) {\n lightingInfo result;\n\n vec3 lightVectorW;\n float attenuation = 1.0;\n if (lightData.w == 0.)\n {\n vec3 direction = lightData.xyz - vPositionW;\n\n attenuation = max(0., 1.0 - length(direction) / range);\n lightVectorW = normalize(direction);\n }\n else\n {\n lightVectorW = normalize(-lightData.xyz);\n }\n\n // diffuse\n float ndl = max(0., dot(vNormal, lightVectorW));\n\n // Specular\n vec3 angleW = normalize(viewDirectionW + lightVectorW);\n float specComp = max(0., dot(vNormal, angleW));\n specComp = pow(specComp, max(1., vSpecularColor.a));\n\n result.diffuse = ndl * diffuseColor * attenuation;\n result.specular = specComp * specularColor * attenuation;\n\n return result;\n}\n\nlightingInfo computeSpotLighting(vec3 viewDirectionW, vec3 vNormal, vec4 lightData, vec4 lightDirection, vec3 diffuseColor, vec3 specularColor, float range) {\n lightingInfo result;\n\n vec3 direction = lightData.xyz - vPositionW;\n vec3 lightVectorW = normalize(direction);\n float attenuation = max(0., 1.0 - length(direction) / range);\n\n // diffuse\n float cosAngle = max(0., dot(-lightDirection.xyz, lightVectorW));\n float spotAtten = 0.0;\n\n if (cosAngle >= lightDirection.w)\n {\n cosAngle = max(0., pow(cosAngle, lightData.w));\n spotAtten = max(0., (cosAngle - lightDirection.w) / (1. - cosAngle));\n\n // Diffuse\n float ndl = max(0., dot(vNormal, -lightDirection.xyz));\n\n // Specular\n vec3 angleW = normalize(viewDirectionW - lightDirection.xyz);\n float specComp = max(0., dot(vNormal, angleW));\n specComp = pow(specComp, vSpecularColor.a);\n\n result.diffuse = ndl * spotAtten * diffuseColor * attenuation;\n result.specular = specComp * specularColor * spotAtten * attenuation;\n\n return result;\n }\n\n result.diffuse = vec3(0.);\n result.specular = vec3(0.);\n\n return result;\n}\n\nlightingInfo computeHemisphericLighting(vec3 viewDirectionW, vec3 vNormal, vec4 lightData, vec3 diffuseColor, vec3 specularColor, vec3 groundColor) {\n lightingInfo result;\n\n // Diffuse\n float ndl = dot(vNormal, lightData.xyz) * 0.5 + 0.5;\n\n // Specular\n vec3 angleW = normalize(viewDirectionW + lightData.xyz);\n float specComp = max(0., dot(vNormal, angleW));\n specComp = pow(specComp, vSpecularColor.a);\n\n result.diffuse = mix(groundColor, diffuseColor, ndl);\n result.specular = specComp * specularColor;\n\n return result;\n}\n\nvoid main(void) {\n // Clip plane\n#ifdef CLIPPLANE\n if (fClipDistance > 0.0)\n discard;\n#endif\n\n vec3 viewDirectionW = normalize(vEyePosition - vPositionW);\n\n // Base color\n vec4 baseColor = vec4(1., 1., 1., 1.);\n vec3 diffuseColor = vDiffuseColor.rgb;\n\n // Alpha\n float alpha = vDiffuseColor.a;\n\n#ifdef VERTEXCOLOR\n baseColor.rgb *= vColor.rgb;\n#endif\n\n#ifdef DIFFUSE\n baseColor = texture2D(diffuseSampler, vDiffuseUV);\n\n#ifdef ALPHATEST\n if (baseColor.a < 0.4)\n discard;\n#endif\n\n#ifdef ALPHAFROMDIFFUSE\n alpha *= baseColor.a;\n#endif\n\n baseColor.rgb *= vDiffuseInfos.y;\n#endif\n\n // Bump\n vec3 normalW = normalize(vNormalW);\n\n#ifdef BUMP\n normalW = perturbNormal(viewDirectionW);\n#endif\n\n // Ambient color\n vec3 baseAmbientColor = vec3(1., 1., 1.);\n\n#ifdef AMBIENT\n baseAmbientColor = texture2D(ambientSampler, vAmbientUV).rgb * vAmbientInfos.y;\n#endif\n\n // Lighting\n vec3 diffuseBase = vec3(0., 0., 0.);\n vec3 specularBase = vec3(0., 0., 0.);\n float shadow = 1.;\n\n#ifdef LIGHT0\n#ifdef SPOTLIGHT0\n lightingInfo info = computeSpotLighting(viewDirectionW, normalW, vLightData0, vLightDirection0, vLightDiffuse0.rgb, vLightSpecular0, vLightDiffuse0.a);\n#endif\n#ifdef HEMILIGHT0\n lightingInfo info = computeHemisphericLighting(viewDirectionW, normalW, vLightData0, vLightDiffuse0.rgb, vLightSpecular0, vLightGround0);\n#endif\n#ifdef POINTDIRLIGHT0\n lightingInfo info = computeLighting(viewDirectionW, normalW, vLightData0, vLightDiffuse0.rgb, vLightSpecular0, vLightDiffuse0.a);\n#endif\n#ifdef SHADOW0\n#ifdef SHADOWVSM0\n shadow = computeShadowWithVSM(vPositionFromLight0, shadowSampler0);\n#else\n #ifdef SHADOWPCF0\n shadow = computeShadowWithPCF(vPositionFromLight0, shadowSampler0);\n #else\n shadow = computeShadow(vPositionFromLight0, shadowSampler0, darkness0);\n #endif\n#endif\n#else\n shadow = 1.;\n#endif\n diffuseBase += info.diffuse * shadow;\n specularBase += info.specular * shadow;\n#endif\n\n#ifdef LIGHT1\n#ifdef SPOTLIGHT1\n info = computeSpotLighting(viewDirectionW, normalW, vLightData1, vLightDirection1, vLightDiffuse1.rgb, vLightSpecular1, vLightDiffuse1.a);\n#endif\n#ifdef HEMILIGHT1\n info = computeHemisphericLighting(viewDirectionW, normalW, vLightData1, vLightDiffuse1.rgb, vLightSpecular1, vLightGround1);\n#endif\n#ifdef POINTDIRLIGHT1\n info = computeLighting(viewDirectionW, normalW, vLightData1, vLightDiffuse1.rgb, vLightSpecular1, vLightDiffuse1.a);\n#endif\n#ifdef SHADOW1\n#ifdef SHADOWVSM1\n shadow = computeShadowWithVSM(vPositionFromLight1, shadowSampler1);\n#else\n #ifdef SHADOWPCF1\n shadow = computeShadowWithPCF(vPositionFromLight1, shadowSampler1);\n #else\n shadow = computeShadow(vPositionFromLight1, shadowSampler1, darkness1);\n #endif\n#endif\n#else\n shadow = 1.;\n#endif\n diffuseBase += info.diffuse * shadow;\n specularBase += info.specular * shadow;\n#endif\n\n#ifdef LIGHT2\n#ifdef SPOTLIGHT2\n info = computeSpotLighting(viewDirectionW, normalW, vLightData2, vLightDirection2, vLightDiffuse2.rgb, vLightSpecular2, vLightDiffuse2.a);\n#endif\n#ifdef HEMILIGHT2\n info = computeHemisphericLighting(viewDirectionW, normalW, vLightData2, vLightDiffuse2.rgb, vLightSpecular2, vLightGround2);\n#endif\n#ifdef POINTDIRLIGHT2\n info = computeLighting(viewDirectionW, normalW, vLightData2, vLightDiffuse2.rgb, vLightSpecular2, vLightDiffuse2.a);\n#endif\n#ifdef SHADOW2\n#ifdef SHADOWVSM2\n shadow = computeShadowWithVSM(vPositionFromLight2, shadowSampler2);\n#else\n #ifdef SHADOWPCF2\n shadow = computeShadowWithPCF(vPositionFromLight2, shadowSampler2);\n #else\n shadow = computeShadow(vPositionFromLight2, shadowSampler2, darkness2);\n #endif \n#endif \n#else\n shadow = 1.;\n#endif\n diffuseBase += info.diffuse * shadow;\n specularBase += info.specular * shadow;\n#endif\n\n#ifdef LIGHT3\n#ifdef SPOTLIGHT3\n info = computeSpotLighting(viewDirectionW, normalW, vLightData3, vLightDirection3, vLightDiffuse3.rgb, vLightSpecular3, vLightDiffuse3.a);\n#endif\n#ifdef HEMILIGHT3\n info = computeHemisphericLighting(viewDirectionW, normalW, vLightData3, vLightDiffuse3.rgb, vLightSpecular3, vLightGround3);\n#endif\n#ifdef POINTDIRLIGHT3\n info = computeLighting(viewDirectionW, normalW, vLightData3, vLightDiffuse3.rgb, vLightSpecular3, vLightDiffuse3.a);\n#endif\n#ifdef SHADOW3\n#ifdef SHADOWVSM3\n shadow = computeShadowWithVSM(vPositionFromLight3, shadowSampler3);\n#else\n #ifdef SHADOWPCF3\n shadow = computeShadowWithPCF(vPositionFromLight3, shadowSampler3);\n #else\n shadow = computeShadow(vPositionFromLight3, shadowSampler3, darkness3);\n #endif \n#endif \n#else\n shadow = 1.;\n#endif\n diffuseBase += info.diffuse * shadow;\n specularBase += info.specular * shadow;\n#endif\n\n // Reflection\n vec3 reflectionColor = vec3(0., 0., 0.);\n\n#ifdef REFLECTION\n vec3 vReflectionUVW = computeReflectionCoords(vReflectionInfos.x, vec4(vPositionW, 1.0), normalW);\n\n if (vReflectionInfos.z != 0.0)\n {\n reflectionColor = textureCube(reflectionCubeSampler, vReflectionUVW).rgb * vReflectionInfos.y * shadow;\n }\n else\n {\n vec2 coords = vReflectionUVW.xy;\n\n if (vReflectionInfos.x == MAP_PROJECTION)\n {\n coords /= vReflectionUVW.z;\n }\n\n coords.y = 1.0 - coords.y;\n\n reflectionColor = texture2D(reflection2DSampler, coords).rgb * vReflectionInfos.y * shadow;\n }\n\n#ifdef REFLECTIONFRESNEL\n float reflectionFresnelTerm = computeFresnelTerm(viewDirectionW, normalW, reflectionRightColor.a, reflectionLeftColor.a);\n\n reflectionColor *= reflectionLeftColor.rgb * (1.0 - reflectionFresnelTerm) + reflectionFresnelTerm * reflectionRightColor.rgb;\n#endif\n#endif\n\n#ifdef OPACITY\n vec4 opacityMap = texture2D(opacitySampler, vOpacityUV);\n\n#ifdef OPACITYRGB\n opacityMap.rgb = opacityMap.rgb * vec3(0.3, 0.59, 0.11);\n alpha *= (opacityMap.x + opacityMap.y + opacityMap.z)* vOpacityInfos.y;\n#else\n alpha *= opacityMap.a * vOpacityInfos.y;\n#endif\n\n#endif\n\n#ifdef VERTEXALPHA\n alpha *= vColor.a;\n#endif\n\n#ifdef OPACITYFRESNEL\n float opacityFresnelTerm = computeFresnelTerm(viewDirectionW, normalW, opacityParts.z, opacityParts.w);\n\n alpha += opacityParts.x * (1.0 - opacityFresnelTerm) + opacityFresnelTerm * opacityParts.y;\n#endif\n\n // Emissive\n vec3 emissiveColor = vEmissiveColor;\n#ifdef EMISSIVE\n emissiveColor += texture2D(emissiveSampler, vEmissiveUV).rgb * vEmissiveInfos.y;\n#endif\n\n#ifdef EMISSIVEFRESNEL\n float emissiveFresnelTerm = computeFresnelTerm(viewDirectionW, normalW, emissiveRightColor.a, emissiveLeftColor.a);\n\n emissiveColor *= emissiveLeftColor.rgb * (1.0 - emissiveFresnelTerm) + emissiveFresnelTerm * emissiveRightColor.rgb;\n#endif\n\n // Specular map\n vec3 specularColor = vSpecularColor.rgb;\n#ifdef SPECULAR\n specularColor = texture2D(specularSampler, vSpecularUV).rgb * vSpecularInfos.y;\n#endif\n\n // Fresnel\n#ifdef DIFFUSEFRESNEL\n float diffuseFresnelTerm = computeFresnelTerm(viewDirectionW, normalW, diffuseRightColor.a, diffuseLeftColor.a);\n\n diffuseBase *= diffuseLeftColor.rgb * (1.0 - diffuseFresnelTerm) + diffuseFresnelTerm * diffuseRightColor.rgb;\n#endif\n\n // Composition\n vec3 finalDiffuse = clamp(diffuseBase * diffuseColor + emissiveColor + vAmbientColor, 0.0, 1.0) * baseColor.rgb;\n vec3 finalSpecular = specularBase * specularColor;\n\n#ifdef SPECULAROVERALPHA\n alpha = clamp(alpha + dot(finalSpecular, vec3(0.3, 0.59, 0.11)), 0., 1.);\n#endif\n\n vec4 color = vec4(finalDiffuse * baseAmbientColor + finalSpecular + reflectionColor, alpha);\n\n#ifdef FOG\n float fog = CalcFogFactor();\n color.rgb = fog * color.rgb + (1.0 - fog) * vFogColor;\n#endif\n\n gl_FragColor = color;\n}",
  12167. defaultVertexShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Attributes\nattribute vec3 position;\nattribute vec3 normal;\n#ifdef UV1\nattribute vec2 uv;\n#endif\n#ifdef UV2\nattribute vec2 uv2;\n#endif\n#ifdef VERTEXCOLOR\nattribute vec4 color;\n#endif\n#ifdef BONES\nattribute vec4 matricesIndices;\nattribute vec4 matricesWeights;\n#endif\n\n// Uniforms\n\n#ifdef INSTANCES\nattribute vec4 world0;\nattribute vec4 world1;\nattribute vec4 world2;\nattribute vec4 world3;\n#else\nuniform mat4 world;\n#endif\n\nuniform mat4 view;\nuniform mat4 viewProjection;\n\n#ifdef DIFFUSE\nvarying vec2 vDiffuseUV;\nuniform mat4 diffuseMatrix;\nuniform vec2 vDiffuseInfos;\n#endif\n\n#ifdef AMBIENT\nvarying vec2 vAmbientUV;\nuniform mat4 ambientMatrix;\nuniform vec2 vAmbientInfos;\n#endif\n\n#ifdef OPACITY\nvarying vec2 vOpacityUV;\nuniform mat4 opacityMatrix;\nuniform vec2 vOpacityInfos;\n#endif\n\n#ifdef EMISSIVE\nvarying vec2 vEmissiveUV;\nuniform vec2 vEmissiveInfos;\nuniform mat4 emissiveMatrix;\n#endif\n\n#ifdef SPECULAR\nvarying vec2 vSpecularUV;\nuniform vec2 vSpecularInfos;\nuniform mat4 specularMatrix;\n#endif\n\n#ifdef BUMP\nvarying vec2 vBumpUV;\nuniform vec2 vBumpInfos;\nuniform mat4 bumpMatrix;\n#endif\n\n#ifdef BONES\nuniform mat4 mBones[BonesPerMesh];\n#endif\n\n#ifdef POINTSIZE\nuniform float pointSize;\n#endif\n\n// Output\nvarying vec3 vPositionW;\nvarying vec3 vNormalW;\n\n#ifdef VERTEXCOLOR\nvarying vec4 vColor;\n#endif\n\n#ifdef CLIPPLANE\nuniform vec4 vClipPlane;\nvarying float fClipDistance;\n#endif\n\n#ifdef FOG\nvarying float fFogDistance;\n#endif\n\n#ifdef SHADOWS\n#ifdef LIGHT0\nuniform mat4 lightMatrix0;\nvarying vec4 vPositionFromLight0;\n#endif\n#ifdef LIGHT1\nuniform mat4 lightMatrix1;\nvarying vec4 vPositionFromLight1;\n#endif\n#ifdef LIGHT2\nuniform mat4 lightMatrix2;\nvarying vec4 vPositionFromLight2;\n#endif\n#ifdef LIGHT3\nuniform mat4 lightMatrix3;\nvarying vec4 vPositionFromLight3;\n#endif\n#endif\n\n#ifdef REFLECTION\nvarying vec3 vPositionUVW;\n#endif\n\nvoid main(void) {\n mat4 finalWorld;\n\n#ifdef REFLECTION\n vPositionUVW = position;\n#endif \n\n#ifdef INSTANCES\n finalWorld = mat4(world0, world1, world2, world3);\n#else\n finalWorld = world;\n#endif\n\n#ifdef BONES\n mat4 m0 = mBones[int(matricesIndices.x)] * matricesWeights.x;\n mat4 m1 = mBones[int(matricesIndices.y)] * matricesWeights.y;\n mat4 m2 = mBones[int(matricesIndices.z)] * matricesWeights.z;\n\n#ifdef BONES4\n mat4 m3 = mBones[int(matricesIndices.w)] * matricesWeights.w;\n finalWorld = finalWorld * (m0 + m1 + m2 + m3);\n#else\n finalWorld = finalWorld * (m0 + m1 + m2);\n#endif \n\n#endif\n gl_Position = viewProjection * finalWorld * vec4(position, 1.0);\n\n vec4 worldPos = finalWorld * vec4(position, 1.0);\n vPositionW = vec3(worldPos);\n vNormalW = normalize(vec3(finalWorld * vec4(normal, 0.0)));\n\n // Texture coordinates\n#ifndef UV1\n vec2 uv = vec2(0., 0.);\n#endif\n#ifndef UV2\n vec2 uv2 = vec2(0., 0.);\n#endif\n\n#ifdef DIFFUSE\n if (vDiffuseInfos.x == 0.)\n {\n vDiffuseUV = vec2(diffuseMatrix * vec4(uv, 1.0, 0.0));\n }\n else\n {\n vDiffuseUV = vec2(diffuseMatrix * vec4(uv2, 1.0, 0.0));\n }\n#endif\n\n#ifdef AMBIENT\n if (vAmbientInfos.x == 0.)\n {\n vAmbientUV = vec2(ambientMatrix * vec4(uv, 1.0, 0.0));\n }\n else\n {\n vAmbientUV = vec2(ambientMatrix * vec4(uv2, 1.0, 0.0));\n }\n#endif\n\n#ifdef OPACITY\n if (vOpacityInfos.x == 0.)\n {\n vOpacityUV = vec2(opacityMatrix * vec4(uv, 1.0, 0.0));\n }\n else\n {\n vOpacityUV = vec2(opacityMatrix * vec4(uv2, 1.0, 0.0));\n }\n#endif\n\n#ifdef EMISSIVE\n if (vEmissiveInfos.x == 0.)\n {\n vEmissiveUV = vec2(emissiveMatrix * vec4(uv, 1.0, 0.0));\n }\n else\n {\n vEmissiveUV = vec2(emissiveMatrix * vec4(uv2, 1.0, 0.0));\n }\n#endif\n\n#ifdef SPECULAR\n if (vSpecularInfos.x == 0.)\n {\n vSpecularUV = vec2(specularMatrix * vec4(uv, 1.0, 0.0));\n }\n else\n {\n vSpecularUV = vec2(specularMatrix * vec4(uv2, 1.0, 0.0));\n }\n#endif\n\n#ifdef BUMP\n if (vBumpInfos.x == 0.)\n {\n vBumpUV = vec2(bumpMatrix * vec4(uv, 1.0, 0.0));\n }\n else\n {\n vBumpUV = vec2(bumpMatrix * vec4(uv2, 1.0, 0.0));\n }\n#endif\n\n // Clip plane\n#ifdef CLIPPLANE\n fClipDistance = dot(worldPos, vClipPlane);\n#endif\n\n // Fog\n#ifdef FOG\n fFogDistance = (view * worldPos).z;\n#endif\n\n // Shadows\n#ifdef SHADOWS\n#ifdef LIGHT0\n vPositionFromLight0 = lightMatrix0 * worldPos;\n#endif\n#ifdef LIGHT1\n vPositionFromLight1 = lightMatrix1 * worldPos;\n#endif\n#ifdef LIGHT2\n vPositionFromLight2 = lightMatrix2 * worldPos;\n#endif\n#ifdef LIGHT3\n vPositionFromLight3 = lightMatrix3 * worldPos;\n#endif\n#endif\n\n // Vertex color\n#ifdef VERTEXCOLOR\n vColor = color;\n#endif\n\n // Point size\n#ifdef POINTSIZE\n gl_PointSize = pointSize;\n#endif\n}",
  12168. displayPassPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Samplers\nvarying vec2 vUV;\nuniform sampler2D textureSampler;\nuniform sampler2D passSampler;\n\nvoid main(void)\n{\n gl_FragColor = texture2D(passSampler, vUV);\n}",
  12169. filterPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Samplers\nvarying vec2 vUV;\nuniform sampler2D textureSampler;\n\nuniform mat4 kernelMatrix;\n\nvoid main(void)\n{\n vec3 baseColor = texture2D(textureSampler, vUV).rgb;\n vec3 updatedColor = (kernelMatrix * vec4(baseColor, 1.0)).rgb;\n\n gl_FragColor = vec4(updatedColor, 1.0);\n}",
  12170. firePixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\nuniform float time;\nuniform vec3 c1;\nuniform vec3 c2;\nuniform vec3 c3;\nuniform vec3 c4;\nuniform vec3 c5;\nuniform vec3 c6;\nuniform vec2 speed;\nuniform float shift;\nuniform float alphaThreshold;\n\nvarying vec2 vUV;\n\nfloat rand(vec2 n) {\n return fract(cos(dot(n, vec2(12.9898, 4.1414))) * 43758.5453);\n}\n\nfloat noise(vec2 n) {\n const vec2 d = vec2(0.0, 1.0);\n vec2 b = floor(n), f = smoothstep(vec2(0.0), vec2(1.0), fract(n));\n return mix(mix(rand(b), rand(b + d.yx), f.x), mix(rand(b + d.xy), rand(b + d.yy), f.x), f.y);\n}\n\nfloat fbm(vec2 n) {\n float total = 0.0, amplitude = 1.0;\n for (int i = 0; i < 4; i++) {\n total += noise(n) * amplitude;\n n += n;\n amplitude *= 0.5;\n }\n return total;\n}\n\nvoid main() {\n vec2 p = vUV * 8.0;\n float q = fbm(p - time * 0.1);\n vec2 r = vec2(fbm(p + q + time * speed.x - p.x - p.y), fbm(p + q - time * speed.y));\n vec3 c = mix(c1, c2, fbm(p + r)) + mix(c3, c4, r.x) - mix(c5, c6, r.y);\n vec3 color = c * cos(shift * vUV.y);\n float luminance = dot(color.rgb, vec3(0.3, 0.59, 0.11));\n\n gl_FragColor = vec4(color, luminance * alphaThreshold + (1.0 - alphaThreshold));\n}",
  12171. fxaaPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n#define FXAA_REDUCE_MIN (1.0/128.0)\n#define FXAA_REDUCE_MUL (1.0/8.0)\n#define FXAA_SPAN_MAX 8.0\n\nvarying vec2 vUV;\nuniform sampler2D textureSampler;\nuniform vec2 texelSize;\n\nvoid main(){\n vec2 localTexelSize = texelSize;\n vec4 rgbNW = texture2D(textureSampler, (vUV + vec2(-1.0, -1.0) * localTexelSize));\n vec4 rgbNE = texture2D(textureSampler, (vUV + vec2(1.0, -1.0) * localTexelSize));\n vec4 rgbSW = texture2D(textureSampler, (vUV + vec2(-1.0, 1.0) * localTexelSize));\n vec4 rgbSE = texture2D(textureSampler, (vUV + vec2(1.0, 1.0) * localTexelSize));\n vec4 rgbM = texture2D(textureSampler, vUV);\n vec4 luma = vec4(0.299, 0.587, 0.114, 1.0);\n float lumaNW = dot(rgbNW, luma);\n float lumaNE = dot(rgbNE, luma);\n float lumaSW = dot(rgbSW, luma);\n float lumaSE = dot(rgbSE, luma);\n float lumaM = dot(rgbM, luma);\n float lumaMin = min(lumaM, min(min(lumaNW, lumaNE), min(lumaSW, lumaSE)));\n float lumaMax = max(lumaM, max(max(lumaNW, lumaNE), max(lumaSW, lumaSE)));\n\n vec2 dir = vec2(-((lumaNW + lumaNE) - (lumaSW + lumaSE)), ((lumaNW + lumaSW) - (lumaNE + lumaSE)));\n\n float dirReduce = max(\n (lumaNW + lumaNE + lumaSW + lumaSE) * (0.25 * FXAA_REDUCE_MUL),\n FXAA_REDUCE_MIN);\n\n float rcpDirMin = 1.0 / (min(abs(dir.x), abs(dir.y)) + dirReduce);\n dir = min(vec2(FXAA_SPAN_MAX, FXAA_SPAN_MAX),\n max(vec2(-FXAA_SPAN_MAX, -FXAA_SPAN_MAX),\n dir * rcpDirMin)) * localTexelSize;\n\n vec4 rgbA = 0.5 * (\n texture2D(textureSampler, vUV + dir * (1.0 / 3.0 - 0.5)) +\n texture2D(textureSampler, vUV + dir * (2.0 / 3.0 - 0.5)));\n\n vec4 rgbB = rgbA * 0.5 + 0.25 * (\n texture2D(textureSampler, vUV + dir * -0.5) +\n texture2D(textureSampler, vUV + dir * 0.5));\n float lumaB = dot(rgbB, luma);\n if ((lumaB < lumaMin) || (lumaB > lumaMax)) {\n gl_FragColor = rgbA;\n }\n else {\n gl_FragColor = rgbB;\n }\n}",
  12172. grassPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\nvarying vec2 vPosition;\nvarying vec2 vUV;\n\nuniform vec3 herb1Color;\nuniform vec3 herb2Color;\nuniform vec3 herb3Color;\nuniform vec3 groundColor;\n\nfloat rand(vec2 n) {\n return fract(cos(dot(n, vec2(12.9898, 4.1414))) * 43758.5453);\n}\n\nfloat noise(vec2 n) {\n const vec2 d = vec2(0.0, 1.0);\n vec2 b = floor(n), f = smoothstep(vec2(0.0), vec2(1.0), fract(n));\n return mix(mix(rand(b), rand(b + d.yx), f.x), mix(rand(b + d.xy), rand(b + d.yy), f.x), f.y);\n}\n\nfloat fbm(vec2 n) {\n float total = 0.0, amplitude = 1.0;\n for (int i = 0; i < 4; i++) {\n total += noise(n) * amplitude;\n n += n;\n amplitude *= 0.5;\n }\n return total;\n}\n\nvoid main(void) {\n vec3 color = mix(groundColor, herb1Color, rand(gl_FragCoord.xy * 4.0));\n color = mix(color, herb2Color, rand(gl_FragCoord.xy * 8.0));\n color = mix(color, herb3Color, rand(gl_FragCoord.xy));\n color = mix(color, herb1Color, fbm(gl_FragCoord.xy * 16.0));\n gl_FragColor = vec4(color, 1.0);\n}",
  12173. layerPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Samplers\nvarying vec2 vUV;\nuniform sampler2D textureSampler;\n\n// Color\nuniform vec4 color;\n\nvoid main(void) {\n vec4 baseColor = texture2D(textureSampler, vUV);\n\n gl_FragColor = baseColor * color;\n}",
  12174. layerVertexShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Attributes\nattribute vec2 position;\n\n// Uniforms\nuniform mat4 textureMatrix;\n\n// Output\nvarying vec2 vUV;\n\nconst vec2 madd = vec2(0.5, 0.5);\n\nvoid main(void) { \n\n vUV = vec2(textureMatrix * vec4(position * madd + madd, 1.0, 0.0));\n gl_Position = vec4(position, 0.0, 1.0);\n}",
  12175. legacydefaultPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n#define MAP_PROJECTION 4.\n\n// Constants\nuniform vec3 vEyePosition;\nuniform vec3 vAmbientColor;\nuniform vec4 vDiffuseColor;\nuniform vec4 vSpecularColor;\nuniform vec3 vEmissiveColor;\n\n// Input\nvarying vec3 vPositionW;\nvarying vec3 vNormalW;\n\n#ifdef VERTEXCOLOR\nvarying vec4 vColor;\n#endif\n\n// Lights\n#ifdef LIGHT0\nuniform vec4 vLightData0;\nuniform vec4 vLightDiffuse0;\nuniform vec3 vLightSpecular0;\n#ifdef SHADOW0\nvarying vec4 vPositionFromLight0;\nuniform sampler2D shadowSampler0;\n#endif\n#ifdef SPOTLIGHT0\nuniform vec4 vLightDirection0;\n#endif\n#ifdef HEMILIGHT0\nuniform vec3 vLightGround0;\n#endif\n#endif\n\n#ifdef LIGHT1\nuniform vec4 vLightData1;\nuniform vec4 vLightDiffuse1;\nuniform vec3 vLightSpecular1;\n#ifdef SHADOW1\nvarying vec4 vPositionFromLight1;\nuniform sampler2D shadowSampler1;\n#endif\n#ifdef SPOTLIGHT1\nuniform vec4 vLightDirection1;\n#endif\n#ifdef HEMILIGHT1\nuniform vec3 vLightGround1;\n#endif\n#endif\n\n#ifdef LIGHT2\nuniform vec4 vLightData2;\nuniform vec4 vLightDiffuse2;\nuniform vec3 vLightSpecular2;\n#ifdef SHADOW2\nvarying vec4 vPositionFromLight2;\nuniform sampler2D shadowSampler2;\n#endif\n#ifdef SPOTLIGHT2\nuniform vec4 vLightDirection2;\n#endif\n#ifdef HEMILIGHT2\nuniform vec3 vLightGround2;\n#endif\n#endif\n\n#ifdef LIGHT3\nuniform vec4 vLightData3;\nuniform vec4 vLightDiffuse3;\nuniform vec3 vLightSpecular3;\n#ifdef SHADOW3\nvarying vec4 vPositionFromLight3;\nuniform sampler2D shadowSampler3;\n#endif\n#ifdef SPOTLIGHT3\nuniform vec4 vLightDirection3;\n#endif\n#ifdef HEMILIGHT3\nuniform vec3 vLightGround3;\n#endif\n#endif\n\n// Samplers\n#ifdef DIFFUSE\nvarying vec2 vDiffuseUV;\nuniform sampler2D diffuseSampler;\nuniform vec2 vDiffuseInfos;\n#endif\n\n#ifdef AMBIENT\nvarying vec2 vAmbientUV;\nuniform sampler2D ambientSampler;\nuniform vec2 vAmbientInfos;\n#endif\n\n#ifdef OPACITY \nvarying vec2 vOpacityUV;\nuniform sampler2D opacitySampler;\nuniform vec2 vOpacityInfos;\n#endif\n\n#ifdef REFLECTION\nvarying vec3 vReflectionUVW;\nuniform samplerCube reflectionCubeSampler;\nuniform sampler2D reflection2DSampler;\nuniform vec3 vReflectionInfos;\n#endif\n\n#ifdef EMISSIVE\nvarying vec2 vEmissiveUV;\nuniform vec2 vEmissiveInfos;\nuniform sampler2D emissiveSampler;\n#endif\n\n#ifdef SPECULAR\nvarying vec2 vSpecularUV;\nuniform vec2 vSpecularInfos;\nuniform sampler2D specularSampler;\n#endif\n\n// Fresnel\n#ifdef FRESNEL\nfloat computeFresnelTerm(vec3 viewDirection, vec3 worldNormal, float bias, float power)\n{\n float fresnelTerm = pow(bias + abs(dot(viewDirection, worldNormal)), power);\n return clamp(fresnelTerm, 0., 1.);\n}\n#endif\n\n#ifdef DIFFUSEFRESNEL\nuniform vec4 diffuseLeftColor;\nuniform vec4 diffuseRightColor;\n#endif\n\n#ifdef OPACITYFRESNEL\nuniform vec4 opacityParts;\n#endif\n\n#ifdef REFLECTIONFRESNEL\nuniform vec4 reflectionLeftColor;\nuniform vec4 reflectionRightColor;\n#endif\n\n#ifdef EMISSIVEFRESNEL\nuniform vec4 emissiveLeftColor;\nuniform vec4 emissiveRightColor;\n#endif\n\n// Shadows\n#ifdef SHADOWS\n\nfloat unpack(vec4 color)\n{\n const vec4 bitShift = vec4(1. / (255. * 255. * 255.), 1. / (255. * 255.), 1. / 255., 1.);\n return dot(color, bitShift);\n}\n\nfloat unpackHalf(vec2 color)\n{\n return color.x + (color.y / 255.0);\n}\n\nfloat computeShadow(vec4 vPositionFromLight, sampler2D shadowSampler)\n{\n vec3 depth = vPositionFromLight.xyz / vPositionFromLight.w;\n vec2 uv = 0.5 * depth.xy + vec2(0.5, 0.5);\n\n if (uv.x < 0. || uv.x > 1.0 || uv.y < 0. || uv.y > 1.0)\n {\n return 1.0;\n }\n\n float shadow = unpack(texture2D(shadowSampler, uv));\n\n if (depth.z > shadow)\n {\n return 0.;\n }\n return 1.;\n}\n\n// Thanks to http://devmaster.net/\nfloat ChebychevInequality(vec2 moments, float t)\n{\n if (t <= moments.x)\n {\n return 1.0;\n }\n\n float variance = moments.y - (moments.x * moments.x);\n variance = max(variance, 0.);\n\n float d = t - moments.x;\n return variance / (variance + d * d);\n}\n\nfloat computeShadowWithVSM(vec4 vPositionFromLight, sampler2D shadowSampler)\n{\n vec3 depth = vPositionFromLight.xyz / vPositionFromLight.w;\n vec2 uv = 0.5 * depth.xy + vec2(0.5, 0.5);\n\n if (uv.x < 0. || uv.x > 1.0 || uv.y < 0. || uv.y > 1.0)\n {\n return 1.0;\n }\n\n vec4 texel = texture2D(shadowSampler, uv);\n\n vec2 moments = vec2(unpackHalf(texel.xy), unpackHalf(texel.zw));\n return clamp(1.3 - ChebychevInequality(moments, depth.z), 0., 1.0);\n}\n#endif\n\n#ifdef CLIPPLANE\nvarying float fClipDistance;\n#endif\n\n// Fog\n#ifdef FOG\n\n#define FOGMODE_NONE 0.\n#define FOGMODE_EXP 1.\n#define FOGMODE_EXP2 2.\n#define FOGMODE_LINEAR 3.\n#define E 2.71828\n\nuniform vec4 vFogInfos;\nuniform vec3 vFogColor;\nvarying float fFogDistance;\n\nfloat CalcFogFactor()\n{\n float fogCoeff = 1.0;\n float fogStart = vFogInfos.y;\n float fogEnd = vFogInfos.z;\n float fogDensity = vFogInfos.w;\n\n if (FOGMODE_LINEAR == vFogInfos.x)\n {\n fogCoeff = (fogEnd - fFogDistance) / (fogEnd - fogStart);\n }\n else if (FOGMODE_EXP == vFogInfos.x)\n {\n fogCoeff = 1.0 / pow(E, fFogDistance * fogDensity);\n }\n else if (FOGMODE_EXP2 == vFogInfos.x)\n {\n fogCoeff = 1.0 / pow(E, fFogDistance * fFogDistance * fogDensity * fogDensity);\n }\n\n return clamp(fogCoeff, 0.0, 1.0);\n}\n#endif\n\n// Light Computing\nmat3 computeLighting(vec3 viewDirectionW, vec3 vNormal, vec4 lightData, vec4 diffuseColor, vec3 specularColor) {\n mat3 result;\n\n vec3 lightVectorW;\n if (lightData.w == 0.)\n {\n lightVectorW = normalize(lightData.xyz - vPositionW);\n }\n else\n {\n lightVectorW = normalize(-lightData.xyz);\n }\n\n // diffuse\n float ndl = max(0., dot(vNormal, lightVectorW));\n\n // Specular\n vec3 angleW = normalize(viewDirectionW + lightVectorW);\n float specComp = max(0., dot(vNormal, angleW));\n specComp = max(0., pow(specComp, max(1.0, vSpecularColor.a)));\n\n result[0] = ndl * diffuseColor.rgb;\n result[1] = specComp * specularColor;\n result[2] = vec3(0.);\n\n return result;\n}\n\nmat3 computeSpotLighting(vec3 viewDirectionW, vec3 vNormal, vec4 lightData, vec4 lightDirection, vec4 diffuseColor, vec3 specularColor) {\n mat3 result;\n\n vec3 lightVectorW = normalize(lightData.xyz - vPositionW);\n\n // diffuse\n float cosAngle = max(0., dot(-lightDirection.xyz, lightVectorW));\n float spotAtten = 0.0;\n\n if (cosAngle >= lightDirection.w)\n {\n cosAngle = max(0., pow(cosAngle, lightData.w));\n spotAtten = max(0., (cosAngle - lightDirection.w) / (1. - cosAngle));\n\n // Diffuse\n float ndl = max(0., dot(vNormal, -lightDirection.xyz));\n\n // Specular\n vec3 angleW = normalize(viewDirectionW - lightDirection.xyz);\n float specComp = max(0., dot(vNormal, angleW));\n specComp = pow(specComp, vSpecularColor.a);\n\n result[0] = ndl * spotAtten * diffuseColor.rgb;\n result[1] = specComp * specularColor * spotAtten;\n result[2] = vec3(0.);\n\n return result;\n }\n\n result[0] = vec3(0.);\n result[1] = vec3(0.);\n result[2] = vec3(0.);\n\n return result;\n}\n\nmat3 computeHemisphericLighting(vec3 viewDirectionW, vec3 vNormal, vec4 lightData, vec4 diffuseColor, vec3 specularColor, vec3 groundColor) {\n mat3 result;\n\n // Diffuse\n float ndl = dot(vNormal, lightData.xyz) * 0.5 + 0.5;\n\n // Specular\n vec3 angleW = normalize(viewDirectionW + lightData.xyz);\n float specComp = max(0., dot(vNormal, angleW));\n specComp = pow(specComp, vSpecularColor.a);\n\n result[0] = mix(groundColor, diffuseColor.rgb, ndl);\n result[1] = specComp * specularColor;\n result[2] = vec3(0.);\n\n return result;\n}\n\nvoid main(void) {\n // Clip plane\n#ifdef CLIPPLANE\n if (fClipDistance > 0.0)\n discard;\n#endif\n\n vec3 viewDirectionW = normalize(vEyePosition - vPositionW);\n\n // Base color\n vec4 baseColor = vec4(1., 1., 1., 1.);\n vec3 diffuseColor = vDiffuseColor.rgb;\n\n#ifdef VERTEXCOLOR\n baseColor.rgb *= vColor.rgb;\n#endif\n\n#ifdef DIFFUSE\n baseColor = texture2D(diffuseSampler, vDiffuseUV);\n\n#ifdef ALPHATEST\n if (baseColor.a < 0.4)\n discard;\n#endif\n\n baseColor.rgb *= vDiffuseInfos.y;\n#endif\n\n // Bump\n vec3 normalW = normalize(vNormalW);\n\n // Ambient color\n vec3 baseAmbientColor = vec3(1., 1., 1.);\n\n#ifdef AMBIENT\n baseAmbientColor = texture2D(ambientSampler, vAmbientUV).rgb * vAmbientInfos.y;\n#endif\n\n // Lighting\n vec3 diffuseBase = vec3(0., 0., 0.);\n vec3 specularBase = vec3(0., 0., 0.);\n float shadow = 1.;\n\n#ifdef LIGHT0\n#ifdef SPOTLIGHT0\n mat3 info = computeSpotLighting(viewDirectionW, normalW, vLightData0, vLightDirection0, vLightDiffuse0, vLightSpecular0);\n#endif\n#ifdef HEMILIGHT0\n mat3 info = computeHemisphericLighting(viewDirectionW, normalW, vLightData0, vLightDiffuse0, vLightSpecular0, vLightGround0);\n#endif\n#ifdef POINTDIRLIGHT0\n mat3 info = computeLighting(viewDirectionW, normalW, vLightData0, vLightDiffuse0, vLightSpecular0);\n#endif\n#ifdef SHADOW0\n#ifdef SHADOWVSM0\n shadow = computeShadowWithVSM(vPositionFromLight0, shadowSampler0);\n#else\n shadow = computeShadow(vPositionFromLight0, shadowSampler0);\n#endif\n#else\n shadow = 1.;\n#endif\n diffuseBase += info[0] * shadow;\n specularBase += info[1] * shadow;\n#endif\n\n#ifdef LIGHT1\n#ifdef SPOTLIGHT1\n info = computeSpotLighting(viewDirectionW, normalW, vLightData1, vLightDirection1, vLightDiffuse1, vLightSpecular1);\n#endif\n#ifdef HEMILIGHT1\n info = computeHemisphericLighting(viewDirectionW, normalW, vLightData1, vLightDiffuse1, vLightSpecular1, vLightGround1);\n#endif\n#ifdef POINTDIRLIGHT1\n info = computeLighting(viewDirectionW, normalW, vLightData1, vLightDiffuse1, vLightSpecular1);\n#endif\n#ifdef SHADOW1\n#ifdef SHADOWVSM1\n shadow = computeShadowWithVSM(vPositionFromLight1, shadowSampler1);\n#else\n shadow = computeShadow(vPositionFromLight1, shadowSampler1);\n#endif\n#else\n shadow = 1.;\n#endif\n diffuseBase += info[0] * shadow;\n specularBase += info[1] * shadow;\n#endif\n\n#ifdef LIGHT2\n#ifdef SPOTLIGHT2\n info = computeSpotLighting(viewDirectionW, normalW, vLightData2, vLightDirection2, vLightDiffuse2, vLightSpecular2);\n#endif\n#ifdef HEMILIGHT2\n info = computeHemisphericLighting(viewDirectionW, normalW, vLightData2, vLightDiffuse2, vLightSpecular2, vLightGround2);\n#endif\n#ifdef POINTDIRLIGHT2\n info = computeLighting(viewDirectionW, normalW, vLightData2, vLightDiffuse2, vLightSpecular2);\n#endif\n#ifdef SHADOW2\n#ifdef SHADOWVSM2\n shadow = computeShadowWithVSM(vPositionFromLight2, shadowSampler2);\n#else\n shadow = computeShadow(vPositionFromLight2, shadowSampler2);\n#endif \n#else\n shadow = 1.;\n#endif\n diffuseBase += info[0] * shadow;\n specularBase += info[1] * shadow;\n#endif\n\n#ifdef LIGHT3\n#ifdef SPOTLIGHT3\n info = computeSpotLighting(viewDirectionW, normalW, vLightData3, vLightDirection3, vLightDiffuse3, vLightSpecular3);\n#endif\n#ifdef HEMILIGHT3\n info = computeHemisphericLighting(viewDirectionW, normalW, vLightData3, vLightDiffuse3, vLightSpecular3, vLightGround3);\n#endif\n#ifdef POINTDIRLIGHT3\n info = computeLighting(viewDirectionW, normalW, vLightData3, vLightDiffuse3, vLightSpecular3);\n#endif\n#ifdef SHADOW3\n#ifdef SHADOWVSM3\n shadow = computeShadowWithVSM(vPositionFromLight3, shadowSampler3);\n#else\n shadow = computeShadow(vPositionFromLight3, shadowSampler3);\n#endif \n#else\n shadow = 1.;\n#endif\n diffuseBase += info[0] * shadow;\n specularBase += info[1] * shadow;\n#endif\n\n // Reflection\n vec3 reflectionColor = vec3(0., 0., 0.);\n\n#ifdef REFLECTION\n if (vReflectionInfos.z != 0.0)\n {\n reflectionColor = textureCube(reflectionCubeSampler, vReflectionUVW).rgb * vReflectionInfos.y;\n }\n else\n {\n vec2 coords = vReflectionUVW.xy;\n\n if (vReflectionInfos.x == MAP_PROJECTION)\n {\n coords /= vReflectionUVW.z;\n }\n\n coords.y = 1.0 - coords.y;\n\n reflectionColor = texture2D(reflection2DSampler, coords).rgb * vReflectionInfos.y;\n }\n\n#ifdef REFLECTIONFRESNEL\n float reflectionFresnelTerm = computeFresnelTerm(viewDirectionW, normalW, reflectionRightColor.a, reflectionLeftColor.a);\n\n reflectionColor *= reflectionLeftColor.rgb * (1.0 - reflectionFresnelTerm) + reflectionFresnelTerm * reflectionRightColor.rgb;\n#endif\n#endif\n\n // Alpha\n float alpha = vDiffuseColor.a;\n\n#ifdef OPACITY\n vec4 opacityMap = texture2D(opacitySampler, vOpacityUV);\n#ifdef OPACITYRGB\n opacityMap.rgb = opacityMap.rgb * vec3(0.3, 0.59, 0.11);\n alpha *= (opacityMap.x + opacityMap.y + opacityMap.z)* vOpacityInfos.y;\n#else\n alpha *= opacityMap.a * vOpacityInfos.y;\n#endif\n#endif\n\n#ifdef VERTEXALPHA\n alpha *= vColor.a;\n#endif\n\n#ifdef OPACITYFRESNEL\n float opacityFresnelTerm = computeFresnelTerm(viewDirectionW, normalW, opacityParts.z, opacityParts.w);\n\n alpha += opacityParts.x * (1.0 - opacityFresnelTerm) + opacityFresnelTerm * opacityParts.y;\n#endif\n\n // Emissive\n vec3 emissiveColor = vEmissiveColor;\n#ifdef EMISSIVE\n emissiveColor += texture2D(emissiveSampler, vEmissiveUV).rgb * vEmissiveInfos.y;\n#endif\n\n#ifdef EMISSIVEFRESNEL\n float emissiveFresnelTerm = computeFresnelTerm(viewDirectionW, normalW, emissiveRightColor.a, emissiveLeftColor.a);\n\n emissiveColor *= emissiveLeftColor.rgb * (1.0 - emissiveFresnelTerm) + emissiveFresnelTerm * emissiveRightColor.rgb;\n#endif\n\n // Specular map\n vec3 specularColor = vSpecularColor.rgb;\n#ifdef SPECULAR\n specularColor = texture2D(specularSampler, vSpecularUV).rgb * vSpecularInfos.y;\n#endif\n\n // Fresnel\n#ifdef DIFFUSEFRESNEL\n float diffuseFresnelTerm = computeFresnelTerm(viewDirectionW, normalW, diffuseRightColor.a, diffuseLeftColor.a);\n\n diffuseBase *= diffuseLeftColor.rgb * (1.0 - diffuseFresnelTerm) + diffuseFresnelTerm * diffuseRightColor.rgb;\n#endif\n\n // Composition\n vec3 finalDiffuse = clamp(diffuseBase * diffuseColor + emissiveColor + vAmbientColor, 0.0, 1.0) * baseColor.rgb;\n vec3 finalSpecular = specularBase * specularColor;\n\n vec4 color = vec4(finalDiffuse * baseAmbientColor + finalSpecular + reflectionColor, alpha);\n\n#ifdef FOG\n float fog = CalcFogFactor();\n color.rgb = fog * color.rgb + (1.0 - fog) * vFogColor;\n#endif\n\n gl_FragColor = color;\n}",
  12176. legacydefaultVertexShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n#define MAP_EXPLICIT 0.\n#define MAP_SPHERICAL 1.\n#define MAP_PLANAR 2.\n#define MAP_CUBIC 3.\n#define MAP_PROJECTION 4.\n#define MAP_SKYBOX 5.\n\n// Attributes\nattribute vec3 position;\nattribute vec3 normal;\n#ifdef UV1\nattribute vec2 uv;\n#endif\n#ifdef UV2\nattribute vec2 uv2;\n#endif\n#ifdef VERTEXCOLOR\nattribute vec4 color;\n#endif\n#ifdef BONES\nattribute vec4 matricesIndices;\nattribute vec4 matricesWeights;\n#endif\n\n// Uniforms\nuniform mat4 world;\nuniform mat4 view;\nuniform mat4 viewProjection;\n\n#ifdef DIFFUSE\nvarying vec2 vDiffuseUV;\nuniform mat4 diffuseMatrix;\nuniform vec2 vDiffuseInfos;\n#endif\n\n#ifdef AMBIENT\nvarying vec2 vAmbientUV;\nuniform mat4 ambientMatrix;\nuniform vec2 vAmbientInfos;\n#endif\n\n#ifdef OPACITY\nvarying vec2 vOpacityUV;\nuniform mat4 opacityMatrix;\nuniform vec2 vOpacityInfos;\n#endif\n\n#ifdef REFLECTION\nuniform vec3 vEyePosition;\nvarying vec3 vReflectionUVW;\nuniform vec3 vReflectionInfos;\nuniform mat4 reflectionMatrix;\n#endif\n\n#ifdef EMISSIVE\nvarying vec2 vEmissiveUV;\nuniform vec2 vEmissiveInfos;\nuniform mat4 emissiveMatrix;\n#endif\n\n#ifdef SPECULAR\nvarying vec2 vSpecularUV;\nuniform vec2 vSpecularInfos;\nuniform mat4 specularMatrix;\n#endif\n\n#ifdef BUMP\nvarying vec2 vBumpUV;\nuniform vec2 vBumpInfos;\nuniform mat4 bumpMatrix;\n#endif\n\n#ifdef BONES\nuniform mat4 mBones[BonesPerMesh];\n#endif\n\n// Output\nvarying vec3 vPositionW;\nvarying vec3 vNormalW;\n\n#ifdef VERTEXCOLOR\nvarying vec4 vColor;\n#endif\n\n#ifdef CLIPPLANE\nuniform vec4 vClipPlane;\nvarying float fClipDistance;\n#endif\n\n#ifdef FOG\nvarying float fFogDistance;\n#endif\n\n#ifdef SHADOWS\n#ifdef LIGHT0\nuniform mat4 lightMatrix0;\nvarying vec4 vPositionFromLight0;\n#endif\n#ifdef LIGHT1\nuniform mat4 lightMatrix1;\nvarying vec4 vPositionFromLight1;\n#endif\n#ifdef LIGHT2\nuniform mat4 lightMatrix2;\nvarying vec4 vPositionFromLight2;\n#endif\n#ifdef LIGHT3\nuniform mat4 lightMatrix3;\nvarying vec4 vPositionFromLight3;\n#endif\n#endif\n\n#ifdef REFLECTION\nvec3 computeReflectionCoords(float mode, vec4 worldPos, vec3 worldNormal)\n{\n if (mode == MAP_SPHERICAL)\n {\n vec3 coords = vec3(view * vec4(worldNormal, 0.0));\n\n return vec3(reflectionMatrix * vec4(coords, 1.0));\n }\n else if (mode == MAP_PLANAR)\n {\n vec3 viewDir = worldPos.xyz - vEyePosition;\n vec3 coords = normalize(reflect(viewDir, worldNormal));\n\n return vec3(reflectionMatrix * vec4(coords, 1));\n }\n else if (mode == MAP_CUBIC)\n {\n vec3 viewDir = worldPos.xyz - vEyePosition;\n vec3 coords = reflect(viewDir, worldNormal);\n\n return vec3(reflectionMatrix * vec4(coords, 0));\n }\n else if (mode == MAP_PROJECTION)\n {\n return vec3(reflectionMatrix * (view * worldPos));\n }\n else if (mode == MAP_SKYBOX)\n {\n return position;\n }\n\n return vec3(0, 0, 0);\n}\n#endif\n\nvoid main(void) {\n mat4 finalWorld;\n\n#ifdef BONES\n mat4 m0 = mBones[int(matricesIndices.x)] * matricesWeights.x;\n mat4 m1 = mBones[int(matricesIndices.y)] * matricesWeights.y;\n mat4 m2 = mBones[int(matricesIndices.z)] * matricesWeights.z;\n\n#ifdef BONES4\n mat4 m3 = mBones[int(matricesIndices.w)] * matricesWeights.w;\n finalWorld = world * (m0 + m1 + m2 + m3);\n#else\n finalWorld = world * (m0 + m1 + m2);\n#endif \n\n#else\n finalWorld = world;\n#endif\n\n gl_Position = viewProjection * finalWorld * vec4(position, 1.0);\n\n vec4 worldPos = finalWorld * vec4(position, 1.0);\n vPositionW = vec3(worldPos);\n vNormalW = normalize(vec3(finalWorld * vec4(normal, 0.0)));\n\n // Texture coordinates\n#ifndef UV1\n vec2 uv = vec2(0., 0.);\n#endif\n#ifndef UV2\n vec2 uv2 = vec2(0., 0.);\n#endif\n\n#ifdef DIFFUSE\n if (vDiffuseInfos.x == 0.)\n {\n vDiffuseUV = vec2(diffuseMatrix * vec4(uv, 1.0, 0.0));\n }\n else\n {\n vDiffuseUV = vec2(diffuseMatrix * vec4(uv2, 1.0, 0.0));\n }\n#endif\n\n#ifdef AMBIENT\n if (vAmbientInfos.x == 0.)\n {\n vAmbientUV = vec2(ambientMatrix * vec4(uv, 1.0, 0.0));\n }\n else\n {\n vAmbientUV = vec2(ambientMatrix * vec4(uv2, 1.0, 0.0));\n }\n#endif\n\n#ifdef OPACITY\n if (vOpacityInfos.x == 0.)\n {\n vOpacityUV = vec2(opacityMatrix * vec4(uv, 1.0, 0.0));\n }\n else\n {\n vOpacityUV = vec2(opacityMatrix * vec4(uv2, 1.0, 0.0));\n }\n#endif\n\n#ifdef REFLECTION\n vReflectionUVW = computeReflectionCoords(vReflectionInfos.x, vec4(vPositionW, 1.0), vNormalW);\n#endif\n\n#ifdef EMISSIVE\n if (vEmissiveInfos.x == 0.)\n {\n vEmissiveUV = vec2(emissiveMatrix * vec4(uv, 1.0, 0.0));\n }\n else\n {\n vEmissiveUV = vec2(emissiveMatrix * vec4(uv2, 1.0, 0.0));\n }\n#endif\n\n#ifdef SPECULAR\n if (vSpecularInfos.x == 0.)\n {\n vSpecularUV = vec2(specularMatrix * vec4(uv, 1.0, 0.0));\n }\n else\n {\n vSpecularUV = vec2(specularMatrix * vec4(uv2, 1.0, 0.0));\n }\n#endif\n\n#ifdef BUMP\n if (vBumpInfos.x == 0.)\n {\n vBumpUV = vec2(bumpMatrix * vec4(uv, 1.0, 0.0));\n }\n else\n {\n vBumpUV = vec2(bumpMatrix * vec4(uv2, 1.0, 0.0));\n }\n#endif\n\n // Clip plane\n#ifdef CLIPPLANE\n fClipDistance = dot(worldPos, vClipPlane);\n#endif\n\n // Fog\n#ifdef FOG\n fFogDistance = (view * worldPos).z;\n#endif\n\n // Shadows\n#ifdef SHADOWS\n#ifdef LIGHT0\n vPositionFromLight0 = lightMatrix0 * worldPos;\n#endif\n#ifdef LIGHT1\n vPositionFromLight1 = lightMatrix1 * worldPos;\n#endif\n#ifdef LIGHT2\n vPositionFromLight2 = lightMatrix2 * worldPos;\n#endif\n#ifdef LIGHT3\n vPositionFromLight3 = lightMatrix3 * worldPos;\n#endif\n#endif\n\n // Vertex color\n#ifdef VERTEXCOLOR\n vColor = color;\n#endif\n}",
  12177. lensFlarePixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Samplers\nvarying vec2 vUV;\nuniform sampler2D textureSampler;\n\n// Color\nuniform vec4 color;\n\nvoid main(void) {\n vec4 baseColor = texture2D(textureSampler, vUV);\n\n gl_FragColor = baseColor * color;\n}",
  12178. lensFlareVertexShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Attributes\nattribute vec2 position;\n\n// Uniforms\nuniform mat4 viewportMatrix;\n\n// Output\nvarying vec2 vUV;\n\nconst vec2 madd = vec2(0.5, 0.5);\n\nvoid main(void) { \n\n vUV = position * madd + madd;\n gl_Position = viewportMatrix * vec4(position, 0.0, 1.0);\n}",
  12179. marblePixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\nvarying vec2 vPosition;\nvarying vec2 vUV;\n\nuniform float numberOfTilesHeight;\nuniform float numberOfTilesWidth;\nuniform float amplitude;\nuniform vec3 brickColor;\nuniform vec3 jointColor;\n\nconst vec3 tileSize = vec3(1.1, 1.0, 1.1);\nconst vec3 tilePct = vec3(0.98, 1.0, 0.98);\n\nfloat rand(vec2 n) {\n return fract(cos(dot(n, vec2(12.9898, 4.1414))) * 43758.5453);\n}\n\nfloat noise(vec2 n) {\n const vec2 d = vec2(0.0, 1.0);\n vec2 b = floor(n), f = smoothstep(vec2(0.0), vec2(1.0), fract(n));\n return mix(mix(rand(b), rand(b + d.yx), f.x), mix(rand(b + d.xy), rand(b + d.yy), f.x), f.y);\n}\n\nfloat turbulence(vec2 P)\n{\n float val = 0.0;\n float freq = 1.0;\n for (int i = 0; i < 4; i++)\n {\n val += abs(noise(P*freq) / freq);\n freq *= 2.07;\n }\n return val;\n}\n\nfloat round(float number){\n return sign(number)*floor(abs(number) + 0.5);\n}\n\nvec3 marble_color(float x)\n{\n vec3 col;\n x = 0.5*(x + 1.);\n x = sqrt(x); \n x = sqrt(x);\n x = sqrt(x);\n col = vec3(.2 + .75*x); \n col.b *= 0.95; \n return col;\n}\n\nvoid main()\n{\n float brickW = 1.0 / numberOfTilesWidth;\n float brickH = 1.0 / numberOfTilesHeight;\n float jointWPercentage = 0.01;\n float jointHPercentage = 0.01;\n vec3 color = brickColor;\n float yi = vUV.y / brickH;\n float nyi = round(yi);\n float xi = vUV.x / brickW;\n\n if (mod(floor(yi), 2.0) == 0.0){\n xi = xi - 0.5;\n }\n\n float nxi = round(xi);\n vec2 brickvUV = vec2((xi - floor(xi)) / brickH, (yi - floor(yi)) / brickW);\n\n if (yi < nyi + jointHPercentage && yi > nyi - jointHPercentage){\n color = mix(jointColor, vec3(0.37, 0.25, 0.25), (yi - nyi) / jointHPercentage + 0.2);\n }\n else if (xi < nxi + jointWPercentage && xi > nxi - jointWPercentage){\n color = mix(jointColor, vec3(0.44, 0.44, 0.44), (xi - nxi) / jointWPercentage + 0.2);\n }\n else {\n float t = 6.28 * brickvUV.x / (tileSize.x + noise(vec2(vUV)*6.0));\n t += amplitude * turbulence(brickvUV.xy);\n t = sin(t);\n color = marble_color(t);\n }\n\n gl_FragColor = vec4(color, 0.0);\n}",
  12180. oculusDistortionCorrectionPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Samplers\nvarying vec2 vUV;\nuniform sampler2D textureSampler;\nuniform vec2 LensCenter;\nuniform vec2 Scale;\nuniform vec2 ScaleIn;\nuniform vec4 HmdWarpParam;\n\nvec2 HmdWarp(vec2 in01) {\n\n vec2 theta = (in01 - LensCenter) * ScaleIn; // Scales to [-1, 1]\n float rSq = theta.x * theta.x + theta.y * theta.y;\n vec2 rvector = theta * (HmdWarpParam.x + HmdWarpParam.y * rSq + HmdWarpParam.z * rSq * rSq + HmdWarpParam.w * rSq * rSq * rSq);\n return LensCenter + Scale * rvector;\n}\n\nvoid main(void)\n{\n vec2 tc = HmdWarp(vUV);\n if (tc.x <0.0 || tc.x>1.0 || tc.y<0.0 || tc.y>1.0)\n gl_FragColor = vec4(0.0, 0.0, 0.0, 1.0);\n else{\n gl_FragColor = vec4(texture2D(textureSampler, tc).rgb, 1.0);\n }\n}",
  12181. outlinePixelShader:"precision highp float;\n\nuniform vec4 color;\n\n#ifdef ALPHATEST\nvarying vec2 vUV;\nuniform sampler2D diffuseSampler;\n#endif\n\nvoid main(void) {\n#ifdef ALPHATEST\n if (texture2D(diffuseSampler, vUV).a < 0.4)\n discard;\n#endif\n\n gl_FragColor = color;\n}",
  12182. outlineVertexShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Attribute\nattribute vec3 position;\nattribute vec3 normal;\n\n#ifdef BONES\nattribute vec4 matricesIndices;\nattribute vec4 matricesWeights;\n#endif\n\n// Uniform\nuniform float offset;\n\n#ifdef INSTANCES\nattribute vec4 world0;\nattribute vec4 world1;\nattribute vec4 world2;\nattribute vec4 world3;\n#else\nuniform mat4 world;\n#endif\n\nuniform mat4 viewProjection;\n#ifdef BONES\nuniform mat4 mBones[BonesPerMesh];\n#endif\n\n#ifdef ALPHATEST\nvarying vec2 vUV;\nuniform mat4 diffuseMatrix;\n#ifdef UV1\nattribute vec2 uv;\n#endif\n#ifdef UV2\nattribute vec2 uv2;\n#endif\n#endif\n\nvoid main(void)\n{\n#ifdef INSTANCES\n mat4 finalWorld = mat4(world0, world1, world2, world3);\n#else\n mat4 finalWorld = world;\n#endif\n\n vec3 offsetPosition = position + normal * offset;\n\n#ifdef BONES\n mat4 m0 = mBones[int(matricesIndices.x)] * matricesWeights.x;\n mat4 m1 = mBones[int(matricesIndices.y)] * matricesWeights.y;\n mat4 m2 = mBones[int(matricesIndices.z)] * matricesWeights.z;\n mat4 m3 = mBones[int(matricesIndices.w)] * matricesWeights.w;\n finalWorld = finalWorld * (m0 + m1 + m2 + m3);\n gl_Position = viewProjection * finalWorld * vec4(offsetPosition, 1.0);\n#else\n gl_Position = viewProjection * finalWorld * vec4(offsetPosition, 1.0);\n#endif\n\n#ifdef ALPHATEST\n#ifdef UV1\n vUV = vec2(diffuseMatrix * vec4(uv, 1.0, 0.0));\n#endif\n#ifdef UV2\n vUV = vec2(diffuseMatrix * vec4(uv2, 1.0, 0.0));\n#endif\n#endif\n}",
  12183. particlesPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Samplers\nvarying vec2 vUV;\nvarying vec4 vColor;\nuniform vec4 textureMask;\nuniform sampler2D diffuseSampler;\n\n#ifdef CLIPPLANE\nvarying float fClipDistance;\n#endif\n\nvoid main(void) {\n#ifdef CLIPPLANE\n if (fClipDistance > 0.0)\n discard;\n#endif\n vec4 baseColor = texture2D(diffuseSampler, vUV);\n\n gl_FragColor = (baseColor * textureMask + (vec4(1., 1., 1., 1.) - textureMask)) * vColor;\n}",
  12184. particlesVertexShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Attributes\nattribute vec3 position;\nattribute vec4 color;\nattribute vec4 options;\n\n// Uniforms\nuniform mat4 view;\nuniform mat4 projection;\n\n// Output\nvarying vec2 vUV;\nvarying vec4 vColor;\n\n#ifdef CLIPPLANE\nuniform vec4 vClipPlane;\nuniform mat4 invView;\nvarying float fClipDistance;\n#endif\n\nvoid main(void) { \n vec3 viewPos = (view * vec4(position, 1.0)).xyz; \n vec3 cornerPos;\n float size = options.y;\n float angle = options.x;\n vec2 offset = options.zw;\n\n cornerPos = vec3(offset.x - 0.5, offset.y - 0.5, 0.) * size;\n\n // Rotate\n vec3 rotatedCorner;\n rotatedCorner.x = cornerPos.x * cos(angle) - cornerPos.y * sin(angle);\n rotatedCorner.y = cornerPos.x * sin(angle) + cornerPos.y * cos(angle);\n rotatedCorner.z = 0.;\n\n // Position\n viewPos += rotatedCorner;\n gl_Position = projection * vec4(viewPos, 1.0); \n \n vColor = color;\n vUV = offset;\n\n // Clip plane\n#ifdef CLIPPLANE\n vec4 worldPos = invView * vec4(viewPos, 1.0);\n fClipDistance = dot(worldPos, vClipPlane);\n#endif\n}",
  12185. passPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Samplers\nvarying vec2 vUV;\nuniform sampler2D textureSampler;\n\nvoid main(void) \n{\n gl_FragColor = texture2D(textureSampler, vUV);\n}",
  12186. postprocessVertexShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Attributes\nattribute vec2 position;\n\n// Output\nvarying vec2 vUV;\n\nconst vec2 madd = vec2(0.5, 0.5);\n\nvoid main(void) { \n\n vUV = position * madd + madd;\n gl_Position = vec4(position, 0.0, 1.0);\n}",
  12187. proceduralVertexShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Attributes\nattribute vec2 position;\n\n// Output\nvarying vec2 vPosition;\nvarying vec2 vUV;\n\nconst vec2 madd = vec2(0.5, 0.5);\n\nvoid main(void) { \n vPosition = position;\n vUV = position * madd + madd;\n gl_Position = vec4(position, 0.0, 1.0);\n}",
  12188. refractionPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Samplers\nvarying vec2 vUV;\nuniform sampler2D textureSampler;\nuniform sampler2D refractionSampler;\n\n// Parameters\nuniform vec3 baseColor;\nuniform float depth;\nuniform float colorLevel;\n\nvoid main() {\n float ref = 1.0 - texture2D(refractionSampler, vUV).r;\n\n vec2 uv = vUV - vec2(0.5);\n vec2 offset = uv * depth * ref;\n vec3 sourceColor = texture2D(textureSampler, vUV - offset).rgb;\n\n gl_FragColor = vec4(sourceColor + sourceColor * ref * colorLevel, 1.0);\n}",
  12189. roadPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\nvarying vec2 vUV; \nuniform vec3 roadColor;\n\nfloat rand(vec2 n) {\n return fract(cos(dot(n, vec2(12.9898, 4.1414))) * 43758.5453);\n}\n\nfloat noise(vec2 n) {\n const vec2 d = vec2(0.0, 1.0);\n vec2 b = floor(n), f = smoothstep(vec2(0.0), vec2(1.0), fract(n));\n return mix(mix(rand(b), rand(b + d.yx), f.x), mix(rand(b + d.xy), rand(b + d.yy), f.x), f.y);\n}\n\nfloat fbm(vec2 n) {\n float total = 0.0, amplitude = 1.0;\n for (int i = 0; i < 4; i++) {\n total += noise(n) * amplitude;\n n += n;\n amplitude *= 0.5;\n }\n return total;\n}\n\nvoid main(void) {\n float ratioy = mod(gl_FragCoord.y * 100.0 , fbm(vUV * 2.0));\n vec3 color = roadColor * ratioy;\n gl_FragColor = vec4(color, 1.0);\n}",
  12190. shadowMapPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\nvec4 pack(float depth)\n{\n const vec4 bitOffset = vec4(255. * 255. * 255., 255. * 255., 255., 1.);\n const vec4 bitMask = vec4(0., 1. / 255., 1. / 255., 1. / 255.);\n \n vec4 comp = mod(depth * bitOffset * vec4(254.), vec4(255.)) / vec4(254.);\n comp -= comp.xxyz * bitMask;\n \n return comp;\n}\n\n// Thanks to http://devmaster.net/\nvec2 packHalf(float depth) \n{ \n const vec2 bitOffset = vec2(1.0 / 255., 0.);\n vec2 color = vec2(depth, fract(depth * 255.));\n\n return color - (color.yy * bitOffset);\n}\n\n#ifndef VSM\nvarying vec4 vPosition;\n#endif\n\n#ifdef ALPHATEST\nvarying vec2 vUV;\nuniform sampler2D diffuseSampler;\n#endif\n\nvoid main(void)\n{\n#ifdef ALPHATEST\n if (texture2D(diffuseSampler, vUV).a < 0.4)\n discard;\n#endif\n\n#ifdef VSM\n float moment1 = gl_FragCoord.z / gl_FragCoord.w;\n float moment2 = moment1 * moment1;\n gl_FragColor = vec4(packHalf(moment1), packHalf(moment2));\n#else\n gl_FragColor = pack(vPosition.z / vPosition.w);\n#endif\n}",
  12191. shadowMapVertexShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Attribute\nattribute vec3 position;\n#ifdef BONES\nattribute vec4 matricesIndices;\nattribute vec4 matricesWeights;\n#endif\n\n// Uniform\n#ifdef INSTANCES\nattribute vec4 world0;\nattribute vec4 world1;\nattribute vec4 world2;\nattribute vec4 world3;\n#else\nuniform mat4 world;\n#endif\n\nuniform mat4 viewProjection;\n#ifdef BONES\nuniform mat4 mBones[BonesPerMesh];\n#endif\n\n#ifndef VSM\nvarying vec4 vPosition;\n#endif\n\n#ifdef ALPHATEST\nvarying vec2 vUV;\nuniform mat4 diffuseMatrix;\n#ifdef UV1\nattribute vec2 uv;\n#endif\n#ifdef UV2\nattribute vec2 uv2;\n#endif\n#endif\n\nvoid main(void)\n{\n#ifdef INSTANCES\n mat4 finalWorld = mat4(world0, world1, world2, world3);\n#else\n mat4 finalWorld = world;\n#endif\n\n#ifdef BONES\n mat4 m0 = mBones[int(matricesIndices.x)] * matricesWeights.x;\n mat4 m1 = mBones[int(matricesIndices.y)] * matricesWeights.y;\n mat4 m2 = mBones[int(matricesIndices.z)] * matricesWeights.z;\n mat4 m3 = mBones[int(matricesIndices.w)] * matricesWeights.w;\n finalWorld = finalWorld * (m0 + m1 + m2 + m3);\n gl_Position = viewProjection * finalWorld * vec4(position, 1.0);\n#else\n#ifndef VSM\n vPosition = viewProjection * finalWorld * vec4(position, 1.0);\n#endif\n gl_Position = viewProjection * finalWorld * vec4(position, 1.0);\n#endif\n\n#ifdef ALPHATEST\n#ifdef UV1\n vUV = vec2(diffuseMatrix * vec4(uv, 1.0, 0.0));\n#endif\n#ifdef UV2\n vUV = vec2(diffuseMatrix * vec4(uv2, 1.0, 0.0));\n#endif\n#endif\n}",
  12192. spritesPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\nuniform bool alphaTest;\n\nvarying vec4 vColor;\n\n// Samplers\nvarying vec2 vUV;\nuniform sampler2D diffuseSampler;\n\n// Fog\n#ifdef FOG\n\n#define FOGMODE_NONE 0.\n#define FOGMODE_EXP 1.\n#define FOGMODE_EXP2 2.\n#define FOGMODE_LINEAR 3.\n#define E 2.71828\n\nuniform vec4 vFogInfos;\nuniform vec3 vFogColor;\nvarying float fFogDistance;\n\nfloat CalcFogFactor()\n{\n float fogCoeff = 1.0;\n float fogStart = vFogInfos.y;\n float fogEnd = vFogInfos.z;\n float fogDensity = vFogInfos.w;\n\n if (FOGMODE_LINEAR == vFogInfos.x)\n {\n fogCoeff = (fogEnd - fFogDistance) / (fogEnd - fogStart);\n }\n else if (FOGMODE_EXP == vFogInfos.x)\n {\n fogCoeff = 1.0 / pow(E, fFogDistance * fogDensity);\n }\n else if (FOGMODE_EXP2 == vFogInfos.x)\n {\n fogCoeff = 1.0 / pow(E, fFogDistance * fFogDistance * fogDensity * fogDensity);\n }\n\n return min(1., max(0., fogCoeff));\n}\n#endif\n\n\nvoid main(void) {\n vec4 baseColor = texture2D(diffuseSampler, vUV);\n\n if (alphaTest) \n {\n if (baseColor.a < 0.95)\n discard;\n }\n\n baseColor *= vColor;\n\n#ifdef FOG\n float fog = CalcFogFactor();\n baseColor.rgb = fog * baseColor.rgb + (1.0 - fog) * vFogColor;\n#endif\n\n gl_FragColor = baseColor;\n}",
  12193. spritesVertexShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Attributes\nattribute vec3 position;\nattribute vec4 options;\nattribute vec4 cellInfo;\nattribute vec4 color;\n\n// Uniforms\nuniform vec2 textureInfos;\nuniform mat4 view;\nuniform mat4 projection;\n\n// Output\nvarying vec2 vUV;\nvarying vec4 vColor;\n\n#ifdef FOG\nvarying float fFogDistance;\n#endif\n\nvoid main(void) { \n vec3 viewPos = (view * vec4(position, 1.0)).xyz; \n vec3 cornerPos;\n \n float angle = options.x;\n float size = options.y;\n vec2 offset = options.zw;\n vec2 uvScale = textureInfos.xy;\n\n cornerPos = vec3(offset.x - 0.5, offset.y - 0.5, 0.) * size;\n\n // Rotate\n vec3 rotatedCorner;\n rotatedCorner.x = cornerPos.x * cos(angle) - cornerPos.y * sin(angle);\n rotatedCorner.y = cornerPos.x * sin(angle) + cornerPos.y * cos(angle);\n rotatedCorner.z = 0.;\n\n // Position\n viewPos += rotatedCorner;\n gl_Position = projection * vec4(viewPos, 1.0); \n\n // Color\n vColor = color;\n \n // Texture\n vec2 uvOffset = vec2(abs(offset.x - cellInfo.x), 1.0 - abs(offset.y - cellInfo.y));\n\n vUV = (uvOffset + cellInfo.zw) * uvScale;\n\n // Fog\n#ifdef FOG\n fFogDistance = viewPos.z;\n#endif\n}",
  12194. woodPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\nvarying vec2 vPosition;\nvarying vec2 vUV;\n\nuniform float ampScale;\nuniform vec3 woodColor;\n\nfloat rand(vec2 n) {\n return fract(cos(dot(n, vec2(12.9898, 4.1414))) * 43758.5453);\n}\n\nfloat noise(vec2 n) {\n const vec2 d = vec2(0.0, 1.0);\n vec2 b = floor(n), f = smoothstep(vec2(0.0), vec2(1.0), fract(n));\n return mix(mix(rand(b), rand(b + d.yx), f.x), mix(rand(b + d.xy), rand(b + d.yy), f.x), f.y);\n}\n\nfloat fbm(vec2 n) {\n float total = 0.0, amplitude = 1.0;\n for (int i = 0; i < 4; i++) {\n total += noise(n) * amplitude;\n n += n;\n amplitude *= 0.5;\n }\n return total;\n}\n\nvoid main(void) {\n float ratioy = mod(vUV.x * ampScale, 2.0 + fbm(vUV * 0.8));\n vec3 wood = woodColor * ratioy;\n gl_FragColor = vec4(wood, 1.0);\n}",
  12195. };
  12196. return Effect;
  12197. })();
  12198. BABYLON.Effect = Effect;
  12199. })(BABYLON || (BABYLON = {}));
  12200. //# sourceMappingURL=babylon.effect.js.map
  12201. var BABYLON;
  12202. (function (BABYLON) {
  12203. var Material = (function () {
  12204. function Material(name, scene, doNotAdd) {
  12205. this.name = name;
  12206. this.checkReadyOnEveryCall = true;
  12207. this.checkReadyOnlyOnce = false;
  12208. this.state = "";
  12209. this.alpha = 1.0;
  12210. this.backFaceCulling = true;
  12211. this._wasPreviouslyReady = false;
  12212. this._fillMode = Material.TriangleFillMode;
  12213. this.pointSize = 1.0;
  12214. this.id = name;
  12215. this._scene = scene;
  12216. if (!doNotAdd) {
  12217. scene.materials.push(this);
  12218. }
  12219. }
  12220. Object.defineProperty(Material, "TriangleFillMode", {
  12221. get: function () {
  12222. return Material._TriangleFillMode;
  12223. },
  12224. enumerable: true,
  12225. configurable: true
  12226. });
  12227. Object.defineProperty(Material, "WireFrameFillMode", {
  12228. get: function () {
  12229. return Material._WireFrameFillMode;
  12230. },
  12231. enumerable: true,
  12232. configurable: true
  12233. });
  12234. Object.defineProperty(Material, "PointFillMode", {
  12235. get: function () {
  12236. return Material._PointFillMode;
  12237. },
  12238. enumerable: true,
  12239. configurable: true
  12240. });
  12241. Object.defineProperty(Material.prototype, "wireframe", {
  12242. get: function () {
  12243. return this._fillMode === Material.WireFrameFillMode;
  12244. },
  12245. set: function (value) {
  12246. this._fillMode = (value ? Material.WireFrameFillMode : Material.TriangleFillMode);
  12247. },
  12248. enumerable: true,
  12249. configurable: true
  12250. });
  12251. Object.defineProperty(Material.prototype, "pointsCloud", {
  12252. get: function () {
  12253. return this._fillMode === Material.PointFillMode;
  12254. },
  12255. set: function (value) {
  12256. this._fillMode = (value ? Material.PointFillMode : Material.TriangleFillMode);
  12257. },
  12258. enumerable: true,
  12259. configurable: true
  12260. });
  12261. Object.defineProperty(Material.prototype, "fillMode", {
  12262. get: function () {
  12263. return this._fillMode;
  12264. },
  12265. set: function (value) {
  12266. this._fillMode = value;
  12267. },
  12268. enumerable: true,
  12269. configurable: true
  12270. });
  12271. Material.prototype.isReady = function (mesh, useInstances) {
  12272. return true;
  12273. };
  12274. Material.prototype.getEffect = function () {
  12275. return this._effect;
  12276. };
  12277. Material.prototype.getScene = function () {
  12278. return this._scene;
  12279. };
  12280. Material.prototype.needAlphaBlending = function () {
  12281. return (this.alpha < 1.0);
  12282. };
  12283. Material.prototype.needAlphaTesting = function () {
  12284. return false;
  12285. };
  12286. Material.prototype.getAlphaTestTexture = function () {
  12287. return null;
  12288. };
  12289. Material.prototype.trackCreation = function (onCompiled, onError) {
  12290. };
  12291. Material.prototype._preBind = function () {
  12292. var engine = this._scene.getEngine();
  12293. engine.enableEffect(this._effect);
  12294. engine.setState(this.backFaceCulling);
  12295. };
  12296. Material.prototype.bind = function (world, mesh) {
  12297. this._scene._cachedMaterial = this;
  12298. if (this.onBind) {
  12299. this.onBind(this);
  12300. }
  12301. };
  12302. Material.prototype.bindOnlyWorldMatrix = function (world) {
  12303. };
  12304. Material.prototype.unbind = function () {
  12305. };
  12306. Material.prototype.dispose = function (forceDisposeEffect) {
  12307. // Remove from scene
  12308. var index = this._scene.materials.indexOf(this);
  12309. this._scene.materials.splice(index, 1);
  12310. // Shader are kept in cache for further use but we can get rid of this by using forceDisposeEffect
  12311. if (forceDisposeEffect && this._effect) {
  12312. this._scene.getEngine()._releaseEffect(this._effect);
  12313. this._effect = null;
  12314. }
  12315. // Callback
  12316. if (this.onDispose) {
  12317. this.onDispose();
  12318. }
  12319. };
  12320. Material._TriangleFillMode = 0;
  12321. Material._WireFrameFillMode = 1;
  12322. Material._PointFillMode = 2;
  12323. return Material;
  12324. })();
  12325. BABYLON.Material = Material;
  12326. })(BABYLON || (BABYLON = {}));
  12327. //# sourceMappingURL=babylon.material.js.map
  12328. var BABYLON;
  12329. (function (BABYLON) {
  12330. var maxSimultaneousLights = 4;
  12331. var FresnelParameters = (function () {
  12332. function FresnelParameters() {
  12333. this.isEnabled = true;
  12334. this.leftColor = BABYLON.Color3.White();
  12335. this.rightColor = BABYLON.Color3.Black();
  12336. this.bias = 0;
  12337. this.power = 1;
  12338. }
  12339. return FresnelParameters;
  12340. })();
  12341. BABYLON.FresnelParameters = FresnelParameters;
  12342. var StandardMaterial = (function (_super) {
  12343. __extends(StandardMaterial, _super);
  12344. function StandardMaterial(name, scene) {
  12345. var _this = this;
  12346. _super.call(this, name, scene);
  12347. this.ambientColor = new BABYLON.Color3(0, 0, 0);
  12348. this.diffuseColor = new BABYLON.Color3(1, 1, 1);
  12349. this.specularColor = new BABYLON.Color3(1, 1, 1);
  12350. this.specularPower = 64;
  12351. this.emissiveColor = new BABYLON.Color3(0, 0, 0);
  12352. this.useAlphaFromDiffuseTexture = false;
  12353. this.useSpecularOverAlpha = true;
  12354. this.fogEnabled = true;
  12355. this._cachedDefines = null;
  12356. this._renderTargets = new BABYLON.SmartArray(16);
  12357. this._worldViewProjectionMatrix = BABYLON.Matrix.Zero();
  12358. this._globalAmbientColor = new BABYLON.Color3(0, 0, 0);
  12359. this._scaledDiffuse = new BABYLON.Color3();
  12360. this._scaledSpecular = new BABYLON.Color3();
  12361. this.getRenderTargetTextures = function () {
  12362. _this._renderTargets.reset();
  12363. if (_this.reflectionTexture && _this.reflectionTexture.isRenderTarget) {
  12364. _this._renderTargets.push(_this.reflectionTexture);
  12365. }
  12366. return _this._renderTargets;
  12367. };
  12368. }
  12369. StandardMaterial.prototype.needAlphaBlending = function () {
  12370. return (this.alpha < 1.0) || (this.opacityTexture != null) || this._shouldUseAlphaFromDiffuseTexture() || this.opacityFresnelParameters && this.opacityFresnelParameters.isEnabled;
  12371. };
  12372. StandardMaterial.prototype.needAlphaTesting = function () {
  12373. return this.diffuseTexture != null && this.diffuseTexture.hasAlpha && !this.diffuseTexture.getAlphaFromRGB;
  12374. };
  12375. StandardMaterial.prototype._shouldUseAlphaFromDiffuseTexture = function () {
  12376. return this.diffuseTexture != null && this.diffuseTexture.hasAlpha && this.useAlphaFromDiffuseTexture;
  12377. };
  12378. StandardMaterial.prototype.getAlphaTestTexture = function () {
  12379. return this.diffuseTexture;
  12380. };
  12381. // Methods
  12382. StandardMaterial.prototype.isReady = function (mesh, useInstances) {
  12383. if (this.checkReadyOnlyOnce) {
  12384. if (this._wasPreviouslyReady) {
  12385. return true;
  12386. }
  12387. }
  12388. var scene = this.getScene();
  12389. if (!this.checkReadyOnEveryCall) {
  12390. if (this._renderId === scene.getRenderId()) {
  12391. return true;
  12392. }
  12393. }
  12394. var engine = scene.getEngine();
  12395. var defines = [];
  12396. var fallbacks = new BABYLON.EffectFallbacks();
  12397. // Textures
  12398. if (scene.texturesEnabled) {
  12399. if (this.diffuseTexture && StandardMaterial.DiffuseTextureEnabled) {
  12400. if (!this.diffuseTexture.isReady()) {
  12401. return false;
  12402. } else {
  12403. defines.push("#define DIFFUSE");
  12404. }
  12405. }
  12406. if (this.ambientTexture && StandardMaterial.AmbientTextureEnabled) {
  12407. if (!this.ambientTexture.isReady()) {
  12408. return false;
  12409. } else {
  12410. defines.push("#define AMBIENT");
  12411. }
  12412. }
  12413. if (this.opacityTexture && StandardMaterial.OpacityTextureEnabled) {
  12414. if (!this.opacityTexture.isReady()) {
  12415. return false;
  12416. } else {
  12417. defines.push("#define OPACITY");
  12418. if (this.opacityTexture.getAlphaFromRGB) {
  12419. defines.push("#define OPACITYRGB");
  12420. }
  12421. }
  12422. }
  12423. if (this.reflectionTexture && StandardMaterial.ReflectionTextureEnabled) {
  12424. if (!this.reflectionTexture.isReady()) {
  12425. return false;
  12426. } else {
  12427. defines.push("#define REFLECTION");
  12428. fallbacks.addFallback(0, "REFLECTION");
  12429. }
  12430. }
  12431. if (this.emissiveTexture && StandardMaterial.EmissiveTextureEnabled) {
  12432. if (!this.emissiveTexture.isReady()) {
  12433. return false;
  12434. } else {
  12435. defines.push("#define EMISSIVE");
  12436. }
  12437. }
  12438. if (this.specularTexture && StandardMaterial.SpecularTextureEnabled) {
  12439. if (!this.specularTexture.isReady()) {
  12440. return false;
  12441. } else {
  12442. defines.push("#define SPECULAR");
  12443. fallbacks.addFallback(0, "SPECULAR");
  12444. }
  12445. }
  12446. }
  12447. if (scene.getEngine().getCaps().standardDerivatives && this.bumpTexture && StandardMaterial.BumpTextureEnabled) {
  12448. if (!this.bumpTexture.isReady()) {
  12449. return false;
  12450. } else {
  12451. defines.push("#define BUMP");
  12452. fallbacks.addFallback(0, "BUMP");
  12453. }
  12454. }
  12455. // Effect
  12456. if (this.useSpecularOverAlpha) {
  12457. defines.push("#define SPECULAROVERALPHA");
  12458. fallbacks.addFallback(0, "SPECULAROVERALPHA");
  12459. }
  12460. if (scene.clipPlane) {
  12461. defines.push("#define CLIPPLANE");
  12462. }
  12463. if (engine.getAlphaTesting()) {
  12464. defines.push("#define ALPHATEST");
  12465. }
  12466. if (this._shouldUseAlphaFromDiffuseTexture()) {
  12467. defines.push("#define ALPHAFROMDIFFUSE");
  12468. }
  12469. // Point size
  12470. if (this.pointsCloud || scene.forcePointsCloud) {
  12471. defines.push("#define POINTSIZE");
  12472. }
  12473. // Fog
  12474. if (scene.fogEnabled && mesh && mesh.applyFog && scene.fogMode !== BABYLON.Scene.FOGMODE_NONE && this.fogEnabled) {
  12475. defines.push("#define FOG");
  12476. fallbacks.addFallback(1, "FOG");
  12477. }
  12478. var shadowsActivated = false;
  12479. var lightIndex = 0;
  12480. if (scene.lightsEnabled) {
  12481. for (var index = 0; index < scene.lights.length; index++) {
  12482. var light = scene.lights[index];
  12483. if (!light.isEnabled()) {
  12484. continue;
  12485. }
  12486. // Excluded check
  12487. if (light._excludedMeshesIds.length > 0) {
  12488. for (var excludedIndex = 0; excludedIndex < light._excludedMeshesIds.length; excludedIndex++) {
  12489. var excludedMesh = scene.getMeshByID(light._excludedMeshesIds[excludedIndex]);
  12490. if (excludedMesh) {
  12491. light.excludedMeshes.push(excludedMesh);
  12492. }
  12493. }
  12494. light._excludedMeshesIds = [];
  12495. }
  12496. // Included check
  12497. if (light._includedOnlyMeshesIds.length > 0) {
  12498. for (var includedOnlyIndex = 0; includedOnlyIndex < light._includedOnlyMeshesIds.length; includedOnlyIndex++) {
  12499. var includedOnlyMesh = scene.getMeshByID(light._includedOnlyMeshesIds[includedOnlyIndex]);
  12500. if (includedOnlyMesh) {
  12501. light.includedOnlyMeshes.push(includedOnlyMesh);
  12502. }
  12503. }
  12504. light._includedOnlyMeshesIds = [];
  12505. }
  12506. if (!light.canAffectMesh(mesh)) {
  12507. continue;
  12508. }
  12509. defines.push("#define LIGHT" + lightIndex);
  12510. if (lightIndex > 0) {
  12511. fallbacks.addFallback(lightIndex, "LIGHT" + lightIndex);
  12512. }
  12513. var type;
  12514. if (light instanceof BABYLON.SpotLight) {
  12515. type = "#define SPOTLIGHT" + lightIndex;
  12516. } else if (light instanceof BABYLON.HemisphericLight) {
  12517. type = "#define HEMILIGHT" + lightIndex;
  12518. } else {
  12519. type = "#define POINTDIRLIGHT" + lightIndex;
  12520. }
  12521. defines.push(type);
  12522. if (lightIndex > 0) {
  12523. fallbacks.addFallback(lightIndex, type.replace("#define ", ""));
  12524. }
  12525. // Shadows
  12526. if (scene.shadowsEnabled) {
  12527. var shadowGenerator = light.getShadowGenerator();
  12528. if (mesh && mesh.receiveShadows && shadowGenerator) {
  12529. defines.push("#define SHADOW" + lightIndex);
  12530. fallbacks.addFallback(0, "SHADOW" + lightIndex);
  12531. if (!shadowsActivated) {
  12532. defines.push("#define SHADOWS");
  12533. shadowsActivated = true;
  12534. }
  12535. if (shadowGenerator.useVarianceShadowMap) {
  12536. defines.push("#define SHADOWVSM" + lightIndex);
  12537. if (lightIndex > 0) {
  12538. fallbacks.addFallback(0, "SHADOWVSM" + lightIndex);
  12539. }
  12540. }
  12541. if (shadowGenerator.usePoissonSampling) {
  12542. defines.push("#define SHADOWPCF" + lightIndex);
  12543. if (lightIndex > 0) {
  12544. fallbacks.addFallback(0, "SHADOWPCF" + lightIndex);
  12545. }
  12546. }
  12547. }
  12548. }
  12549. lightIndex++;
  12550. if (lightIndex === maxSimultaneousLights)
  12551. break;
  12552. }
  12553. }
  12554. if (StandardMaterial.FresnelEnabled) {
  12555. // Fresnel
  12556. if (this.diffuseFresnelParameters && this.diffuseFresnelParameters.isEnabled || this.opacityFresnelParameters && this.opacityFresnelParameters.isEnabled || this.emissiveFresnelParameters && this.emissiveFresnelParameters.isEnabled || this.reflectionFresnelParameters && this.reflectionFresnelParameters.isEnabled) {
  12557. var fresnelRank = 1;
  12558. if (this.diffuseFresnelParameters && this.diffuseFresnelParameters.isEnabled) {
  12559. defines.push("#define DIFFUSEFRESNEL");
  12560. fallbacks.addFallback(fresnelRank, "DIFFUSEFRESNEL");
  12561. fresnelRank++;
  12562. }
  12563. if (this.opacityFresnelParameters && this.opacityFresnelParameters.isEnabled) {
  12564. defines.push("#define OPACITYFRESNEL");
  12565. fallbacks.addFallback(fresnelRank, "OPACITYFRESNEL");
  12566. fresnelRank++;
  12567. }
  12568. if (this.reflectionFresnelParameters && this.reflectionFresnelParameters.isEnabled) {
  12569. defines.push("#define REFLECTIONFRESNEL");
  12570. fallbacks.addFallback(fresnelRank, "REFLECTIONFRESNEL");
  12571. fresnelRank++;
  12572. }
  12573. if (this.emissiveFresnelParameters && this.emissiveFresnelParameters.isEnabled) {
  12574. defines.push("#define EMISSIVEFRESNEL");
  12575. fallbacks.addFallback(fresnelRank, "EMISSIVEFRESNEL");
  12576. fresnelRank++;
  12577. }
  12578. defines.push("#define FRESNEL");
  12579. fallbacks.addFallback(fresnelRank - 1, "FRESNEL");
  12580. }
  12581. }
  12582. // Attribs
  12583. var attribs = [BABYLON.VertexBuffer.PositionKind, BABYLON.VertexBuffer.NormalKind];
  12584. if (mesh) {
  12585. if (mesh.isVerticesDataPresent(BABYLON.VertexBuffer.UVKind)) {
  12586. attribs.push(BABYLON.VertexBuffer.UVKind);
  12587. defines.push("#define UV1");
  12588. }
  12589. if (mesh.isVerticesDataPresent(BABYLON.VertexBuffer.UV2Kind)) {
  12590. attribs.push(BABYLON.VertexBuffer.UV2Kind);
  12591. defines.push("#define UV2");
  12592. }
  12593. if (mesh.useVertexColors && mesh.isVerticesDataPresent(BABYLON.VertexBuffer.ColorKind)) {
  12594. attribs.push(BABYLON.VertexBuffer.ColorKind);
  12595. defines.push("#define VERTEXCOLOR");
  12596. if (mesh.hasVertexAlpha) {
  12597. defines.push("#define VERTEXALPHA");
  12598. }
  12599. }
  12600. if (mesh.skeleton && scene.skeletonsEnabled && mesh.isVerticesDataPresent(BABYLON.VertexBuffer.MatricesIndicesKind) && mesh.isVerticesDataPresent(BABYLON.VertexBuffer.MatricesWeightsKind)) {
  12601. attribs.push(BABYLON.VertexBuffer.MatricesIndicesKind);
  12602. attribs.push(BABYLON.VertexBuffer.MatricesWeightsKind);
  12603. defines.push("#define BONES");
  12604. defines.push("#define BonesPerMesh " + (mesh.skeleton.bones.length + 1));
  12605. defines.push("#define BONES4");
  12606. fallbacks.addFallback(0, "BONES4");
  12607. }
  12608. // Instances
  12609. if (useInstances) {
  12610. defines.push("#define INSTANCES");
  12611. attribs.push("world0");
  12612. attribs.push("world1");
  12613. attribs.push("world2");
  12614. attribs.push("world3");
  12615. }
  12616. }
  12617. // Get correct effect
  12618. var join = defines.join("\n");
  12619. if (this._cachedDefines !== join) {
  12620. this._cachedDefines = join;
  12621. scene.resetCachedMaterial();
  12622. // Legacy browser patch
  12623. var shaderName = "default";
  12624. if (!scene.getEngine().getCaps().standardDerivatives) {
  12625. shaderName = "legacydefault";
  12626. }
  12627. this._effect = scene.getEngine().createEffect(shaderName, attribs, [
  12628. "world", "view", "viewProjection", "vEyePosition", "vLightsType", "vAmbientColor", "vDiffuseColor", "vSpecularColor", "vEmissiveColor",
  12629. "vLightData0", "vLightDiffuse0", "vLightSpecular0", "vLightDirection0", "vLightGround0", "lightMatrix0",
  12630. "vLightData1", "vLightDiffuse1", "vLightSpecular1", "vLightDirection1", "vLightGround1", "lightMatrix1",
  12631. "vLightData2", "vLightDiffuse2", "vLightSpecular2", "vLightDirection2", "vLightGround2", "lightMatrix2",
  12632. "vLightData3", "vLightDiffuse3", "vLightSpecular3", "vLightDirection3", "vLightGround3", "lightMatrix3",
  12633. "vFogInfos", "vFogColor", "pointSize",
  12634. "vDiffuseInfos", "vAmbientInfos", "vOpacityInfos", "vReflectionInfos", "vEmissiveInfos", "vSpecularInfos", "vBumpInfos",
  12635. "mBones",
  12636. "vClipPlane", "diffuseMatrix", "ambientMatrix", "opacityMatrix", "reflectionMatrix", "emissiveMatrix", "specularMatrix", "bumpMatrix",
  12637. "darkness0", "darkness1", "darkness2", "darkness3",
  12638. "diffuseLeftColor", "diffuseRightColor", "opacityParts", "reflectionLeftColor", "reflectionRightColor", "emissiveLeftColor", "emissiveRightColor"
  12639. ], [
  12640. "diffuseSampler", "ambientSampler", "opacitySampler", "reflectionCubeSampler", "reflection2DSampler", "emissiveSampler", "specularSampler", "bumpSampler",
  12641. "shadowSampler0", "shadowSampler1", "shadowSampler2", "shadowSampler3"
  12642. ], join, fallbacks, this.onCompiled, this.onError);
  12643. }
  12644. if (!this._effect.isReady()) {
  12645. return false;
  12646. }
  12647. this._renderId = scene.getRenderId();
  12648. this._wasPreviouslyReady = true;
  12649. return true;
  12650. };
  12651. StandardMaterial.prototype.unbind = function () {
  12652. if (this.reflectionTexture && this.reflectionTexture.isRenderTarget) {
  12653. this._effect.setTexture("reflection2DSampler", null);
  12654. }
  12655. };
  12656. StandardMaterial.prototype.bindOnlyWorldMatrix = function (world) {
  12657. this._effect.setMatrix("world", world);
  12658. };
  12659. StandardMaterial.prototype.bind = function (world, mesh) {
  12660. var scene = this.getScene();
  12661. // Matrices
  12662. this.bindOnlyWorldMatrix(world);
  12663. this._effect.setMatrix("viewProjection", scene.getTransformMatrix());
  12664. // Bones
  12665. if (mesh.skeleton && scene.skeletonsEnabled && mesh.isVerticesDataPresent(BABYLON.VertexBuffer.MatricesIndicesKind) && mesh.isVerticesDataPresent(BABYLON.VertexBuffer.MatricesWeightsKind)) {
  12666. this._effect.setMatrices("mBones", mesh.skeleton.getTransformMatrices());
  12667. }
  12668. if (scene.getCachedMaterial() !== this) {
  12669. if (StandardMaterial.FresnelEnabled) {
  12670. // Fresnel
  12671. if (this.diffuseFresnelParameters && this.diffuseFresnelParameters.isEnabled) {
  12672. this._effect.setColor4("diffuseLeftColor", this.diffuseFresnelParameters.leftColor, this.diffuseFresnelParameters.power);
  12673. this._effect.setColor4("diffuseRightColor", this.diffuseFresnelParameters.rightColor, this.diffuseFresnelParameters.bias);
  12674. }
  12675. if (this.opacityFresnelParameters && this.opacityFresnelParameters.isEnabled) {
  12676. this._effect.setColor4("opacityParts", new BABYLON.Color3(this.opacityFresnelParameters.leftColor.toLuminance(), this.opacityFresnelParameters.rightColor.toLuminance(), this.opacityFresnelParameters.bias), this.opacityFresnelParameters.power);
  12677. }
  12678. if (this.reflectionFresnelParameters && this.reflectionFresnelParameters.isEnabled) {
  12679. this._effect.setColor4("reflectionLeftColor", this.reflectionFresnelParameters.leftColor, this.reflectionFresnelParameters.power);
  12680. this._effect.setColor4("reflectionRightColor", this.reflectionFresnelParameters.rightColor, this.reflectionFresnelParameters.bias);
  12681. }
  12682. if (this.emissiveFresnelParameters && this.emissiveFresnelParameters.isEnabled) {
  12683. this._effect.setColor4("emissiveLeftColor", this.emissiveFresnelParameters.leftColor, this.emissiveFresnelParameters.power);
  12684. this._effect.setColor4("emissiveRightColor", this.emissiveFresnelParameters.rightColor, this.emissiveFresnelParameters.bias);
  12685. }
  12686. }
  12687. // Textures
  12688. if (this.diffuseTexture && StandardMaterial.DiffuseTextureEnabled) {
  12689. this._effect.setTexture("diffuseSampler", this.diffuseTexture);
  12690. this._effect.setFloat2("vDiffuseInfos", this.diffuseTexture.coordinatesIndex, this.diffuseTexture.level);
  12691. this._effect.setMatrix("diffuseMatrix", this.diffuseTexture.getTextureMatrix());
  12692. }
  12693. if (this.ambientTexture && StandardMaterial.AmbientTextureEnabled) {
  12694. this._effect.setTexture("ambientSampler", this.ambientTexture);
  12695. this._effect.setFloat2("vAmbientInfos", this.ambientTexture.coordinatesIndex, this.ambientTexture.level);
  12696. this._effect.setMatrix("ambientMatrix", this.ambientTexture.getTextureMatrix());
  12697. }
  12698. if (this.opacityTexture && StandardMaterial.OpacityTextureEnabled) {
  12699. this._effect.setTexture("opacitySampler", this.opacityTexture);
  12700. this._effect.setFloat2("vOpacityInfos", this.opacityTexture.coordinatesIndex, this.opacityTexture.level);
  12701. this._effect.setMatrix("opacityMatrix", this.opacityTexture.getTextureMatrix());
  12702. }
  12703. if (this.reflectionTexture && StandardMaterial.ReflectionTextureEnabled) {
  12704. if (this.reflectionTexture.isCube) {
  12705. this._effect.setTexture("reflectionCubeSampler", this.reflectionTexture);
  12706. } else {
  12707. this._effect.setTexture("reflection2DSampler", this.reflectionTexture);
  12708. }
  12709. this._effect.setMatrix("reflectionMatrix", this.reflectionTexture.getReflectionTextureMatrix());
  12710. this._effect.setFloat3("vReflectionInfos", this.reflectionTexture.coordinatesMode, this.reflectionTexture.level, this.reflectionTexture.isCube ? 1 : 0);
  12711. }
  12712. if (this.emissiveTexture && StandardMaterial.EmissiveTextureEnabled) {
  12713. this._effect.setTexture("emissiveSampler", this.emissiveTexture);
  12714. this._effect.setFloat2("vEmissiveInfos", this.emissiveTexture.coordinatesIndex, this.emissiveTexture.level);
  12715. this._effect.setMatrix("emissiveMatrix", this.emissiveTexture.getTextureMatrix());
  12716. }
  12717. if (this.specularTexture && StandardMaterial.SpecularTextureEnabled) {
  12718. this._effect.setTexture("specularSampler", this.specularTexture);
  12719. this._effect.setFloat2("vSpecularInfos", this.specularTexture.coordinatesIndex, this.specularTexture.level);
  12720. this._effect.setMatrix("specularMatrix", this.specularTexture.getTextureMatrix());
  12721. }
  12722. if (this.bumpTexture && scene.getEngine().getCaps().standardDerivatives && StandardMaterial.BumpTextureEnabled) {
  12723. this._effect.setTexture("bumpSampler", this.bumpTexture);
  12724. this._effect.setFloat2("vBumpInfos", this.bumpTexture.coordinatesIndex, 1.0 / this.bumpTexture.level);
  12725. this._effect.setMatrix("bumpMatrix", this.bumpTexture.getTextureMatrix());
  12726. }
  12727. // Clip plane
  12728. if (scene.clipPlane) {
  12729. var clipPlane = scene.clipPlane;
  12730. this._effect.setFloat4("vClipPlane", clipPlane.normal.x, clipPlane.normal.y, clipPlane.normal.z, clipPlane.d);
  12731. }
  12732. // Point size
  12733. if (this.pointsCloud) {
  12734. this._effect.setFloat("pointSize", this.pointSize);
  12735. }
  12736. // Colors
  12737. scene.ambientColor.multiplyToRef(this.ambientColor, this._globalAmbientColor);
  12738. // Scaling down color according to emissive
  12739. this._scaledSpecular.r = this.specularColor.r * BABYLON.Tools.Clamp(1.0 - this.emissiveColor.r);
  12740. this._scaledSpecular.g = this.specularColor.g * BABYLON.Tools.Clamp(1.0 - this.emissiveColor.g);
  12741. this._scaledSpecular.b = this.specularColor.b * BABYLON.Tools.Clamp(1.0 - this.emissiveColor.b);
  12742. this._effect.setVector3("vEyePosition", scene.activeCamera.position);
  12743. this._effect.setColor3("vAmbientColor", this._globalAmbientColor);
  12744. this._effect.setColor4("vSpecularColor", this._scaledSpecular, this.specularPower);
  12745. this._effect.setColor3("vEmissiveColor", this.emissiveColor);
  12746. }
  12747. // Scaling down color according to emissive
  12748. this._scaledDiffuse.r = this.diffuseColor.r * BABYLON.Tools.Clamp(1.0 - this.emissiveColor.r);
  12749. this._scaledDiffuse.g = this.diffuseColor.g * BABYLON.Tools.Clamp(1.0 - this.emissiveColor.g);
  12750. this._scaledDiffuse.b = this.diffuseColor.b * BABYLON.Tools.Clamp(1.0 - this.emissiveColor.b);
  12751. this._effect.setColor4("vDiffuseColor", this._scaledDiffuse, this.alpha * mesh.visibility);
  12752. if (scene.lightsEnabled) {
  12753. var lightIndex = 0;
  12754. for (var index = 0; index < scene.lights.length; index++) {
  12755. var light = scene.lights[index];
  12756. if (!light.isEnabled()) {
  12757. continue;
  12758. }
  12759. if (!light.canAffectMesh(mesh)) {
  12760. continue;
  12761. }
  12762. if (light instanceof BABYLON.PointLight) {
  12763. // Point Light
  12764. light.transferToEffect(this._effect, "vLightData" + lightIndex);
  12765. } else if (light instanceof BABYLON.DirectionalLight) {
  12766. // Directional Light
  12767. light.transferToEffect(this._effect, "vLightData" + lightIndex);
  12768. } else if (light instanceof BABYLON.SpotLight) {
  12769. // Spot Light
  12770. light.transferToEffect(this._effect, "vLightData" + lightIndex, "vLightDirection" + lightIndex);
  12771. } else if (light instanceof BABYLON.HemisphericLight) {
  12772. // Hemispheric Light
  12773. light.transferToEffect(this._effect, "vLightData" + lightIndex, "vLightGround" + lightIndex);
  12774. }
  12775. light.diffuse.scaleToRef(light.intensity, this._scaledDiffuse);
  12776. light.specular.scaleToRef(light.intensity, this._scaledSpecular);
  12777. this._effect.setColor4("vLightDiffuse" + lightIndex, this._scaledDiffuse, light.range);
  12778. this._effect.setColor3("vLightSpecular" + lightIndex, this._scaledSpecular);
  12779. // Shadows
  12780. if (scene.shadowsEnabled) {
  12781. var shadowGenerator = light.getShadowGenerator();
  12782. if (mesh.receiveShadows && shadowGenerator) {
  12783. this._effect.setMatrix("lightMatrix" + lightIndex, shadowGenerator.getTransformMatrix());
  12784. this._effect.setTexture("shadowSampler" + lightIndex, shadowGenerator.getShadowMap());
  12785. this._effect.setFloat("darkness" + lightIndex, shadowGenerator.getDarkness());
  12786. }
  12787. }
  12788. lightIndex++;
  12789. if (lightIndex === maxSimultaneousLights)
  12790. break;
  12791. }
  12792. }
  12793. // View
  12794. if (scene.fogEnabled && mesh.applyFog && scene.fogMode !== BABYLON.Scene.FOGMODE_NONE || this.reflectionTexture) {
  12795. this._effect.setMatrix("view", scene.getViewMatrix());
  12796. }
  12797. // Fog
  12798. if (scene.fogEnabled && mesh.applyFog && scene.fogMode !== BABYLON.Scene.FOGMODE_NONE) {
  12799. this._effect.setFloat4("vFogInfos", scene.fogMode, scene.fogStart, scene.fogEnd, scene.fogDensity);
  12800. this._effect.setColor3("vFogColor", scene.fogColor);
  12801. }
  12802. _super.prototype.bind.call(this, world, mesh);
  12803. };
  12804. StandardMaterial.prototype.getAnimatables = function () {
  12805. var results = [];
  12806. if (this.diffuseTexture && this.diffuseTexture.animations && this.diffuseTexture.animations.length > 0) {
  12807. results.push(this.diffuseTexture);
  12808. }
  12809. if (this.ambientTexture && this.ambientTexture.animations && this.ambientTexture.animations.length > 0) {
  12810. results.push(this.ambientTexture);
  12811. }
  12812. if (this.opacityTexture && this.opacityTexture.animations && this.opacityTexture.animations.length > 0) {
  12813. results.push(this.opacityTexture);
  12814. }
  12815. if (this.reflectionTexture && this.reflectionTexture.animations && this.reflectionTexture.animations.length > 0) {
  12816. results.push(this.reflectionTexture);
  12817. }
  12818. if (this.emissiveTexture && this.emissiveTexture.animations && this.emissiveTexture.animations.length > 0) {
  12819. results.push(this.emissiveTexture);
  12820. }
  12821. if (this.specularTexture && this.specularTexture.animations && this.specularTexture.animations.length > 0) {
  12822. results.push(this.specularTexture);
  12823. }
  12824. if (this.bumpTexture && this.bumpTexture.animations && this.bumpTexture.animations.length > 0) {
  12825. results.push(this.bumpTexture);
  12826. }
  12827. return results;
  12828. };
  12829. StandardMaterial.prototype.dispose = function (forceDisposeEffect) {
  12830. if (this.diffuseTexture) {
  12831. this.diffuseTexture.dispose();
  12832. }
  12833. if (this.ambientTexture) {
  12834. this.ambientTexture.dispose();
  12835. }
  12836. if (this.opacityTexture) {
  12837. this.opacityTexture.dispose();
  12838. }
  12839. if (this.reflectionTexture) {
  12840. this.reflectionTexture.dispose();
  12841. }
  12842. if (this.emissiveTexture) {
  12843. this.emissiveTexture.dispose();
  12844. }
  12845. if (this.specularTexture) {
  12846. this.specularTexture.dispose();
  12847. }
  12848. if (this.bumpTexture) {
  12849. this.bumpTexture.dispose();
  12850. }
  12851. _super.prototype.dispose.call(this, forceDisposeEffect);
  12852. };
  12853. StandardMaterial.prototype.clone = function (name) {
  12854. var newStandardMaterial = new StandardMaterial(name, this.getScene());
  12855. // Base material
  12856. newStandardMaterial.checkReadyOnEveryCall = this.checkReadyOnEveryCall;
  12857. newStandardMaterial.alpha = this.alpha;
  12858. newStandardMaterial.fillMode = this.fillMode;
  12859. newStandardMaterial.backFaceCulling = this.backFaceCulling;
  12860. // Standard material
  12861. if (this.diffuseTexture && this.diffuseTexture.clone) {
  12862. newStandardMaterial.diffuseTexture = this.diffuseTexture.clone();
  12863. }
  12864. if (this.ambientTexture && this.ambientTexture.clone) {
  12865. newStandardMaterial.ambientTexture = this.ambientTexture.clone();
  12866. }
  12867. if (this.opacityTexture && this.opacityTexture.clone) {
  12868. newStandardMaterial.opacityTexture = this.opacityTexture.clone();
  12869. }
  12870. if (this.reflectionTexture && this.reflectionTexture.clone) {
  12871. newStandardMaterial.reflectionTexture = this.reflectionTexture.clone();
  12872. }
  12873. if (this.emissiveTexture && this.emissiveTexture.clone) {
  12874. newStandardMaterial.emissiveTexture = this.emissiveTexture.clone();
  12875. }
  12876. if (this.specularTexture && this.specularTexture.clone) {
  12877. newStandardMaterial.specularTexture = this.specularTexture.clone();
  12878. }
  12879. if (this.bumpTexture && this.bumpTexture.clone) {
  12880. newStandardMaterial.bumpTexture = this.bumpTexture.clone();
  12881. }
  12882. newStandardMaterial.ambientColor = this.ambientColor.clone();
  12883. newStandardMaterial.diffuseColor = this.diffuseColor.clone();
  12884. newStandardMaterial.specularColor = this.specularColor.clone();
  12885. newStandardMaterial.specularPower = this.specularPower;
  12886. newStandardMaterial.emissiveColor = this.emissiveColor.clone();
  12887. return newStandardMaterial;
  12888. };
  12889. StandardMaterial.DiffuseTextureEnabled = true;
  12890. StandardMaterial.AmbientTextureEnabled = true;
  12891. StandardMaterial.OpacityTextureEnabled = true;
  12892. StandardMaterial.ReflectionTextureEnabled = true;
  12893. StandardMaterial.EmissiveTextureEnabled = true;
  12894. StandardMaterial.SpecularTextureEnabled = true;
  12895. StandardMaterial.BumpTextureEnabled = true;
  12896. StandardMaterial.FresnelEnabled = true;
  12897. return StandardMaterial;
  12898. })(BABYLON.Material);
  12899. BABYLON.StandardMaterial = StandardMaterial;
  12900. })(BABYLON || (BABYLON = {}));
  12901. //# sourceMappingURL=babylon.standardMaterial.js.map
  12902. var BABYLON;
  12903. (function (BABYLON) {
  12904. var MultiMaterial = (function (_super) {
  12905. __extends(MultiMaterial, _super);
  12906. function MultiMaterial(name, scene) {
  12907. _super.call(this, name, scene, true);
  12908. this.subMaterials = new Array();
  12909. scene.multiMaterials.push(this);
  12910. }
  12911. // Properties
  12912. MultiMaterial.prototype.getSubMaterial = function (index) {
  12913. if (index < 0 || index >= this.subMaterials.length) {
  12914. return this.getScene().defaultMaterial;
  12915. }
  12916. return this.subMaterials[index];
  12917. };
  12918. // Methods
  12919. MultiMaterial.prototype.isReady = function (mesh) {
  12920. for (var index = 0; index < this.subMaterials.length; index++) {
  12921. var subMaterial = this.subMaterials[index];
  12922. if (subMaterial) {
  12923. if (!this.subMaterials[index].isReady(mesh)) {
  12924. return false;
  12925. }
  12926. }
  12927. }
  12928. return true;
  12929. };
  12930. return MultiMaterial;
  12931. })(BABYLON.Material);
  12932. BABYLON.MultiMaterial = MultiMaterial;
  12933. })(BABYLON || (BABYLON = {}));
  12934. //# sourceMappingURL=babylon.multiMaterial.js.map
  12935. var BABYLON;
  12936. (function (BABYLON) {
  12937. var Database = (function () {
  12938. function Database(urlToScene, callbackManifestChecked) {
  12939. // Handling various flavors of prefixed version of IndexedDB
  12940. this.idbFactory = (window.indexedDB || window.mozIndexedDB || window.webkitIndexedDB || window.msIndexedDB);
  12941. this.callbackManifestChecked = callbackManifestChecked;
  12942. this.currentSceneUrl = BABYLON.Database.ReturnFullUrlLocation(urlToScene);
  12943. this.db = null;
  12944. this.enableSceneOffline = false;
  12945. this.enableTexturesOffline = false;
  12946. this.manifestVersionFound = 0;
  12947. this.mustUpdateRessources = false;
  12948. this.hasReachedQuota = false;
  12949. this.checkManifestFile();
  12950. }
  12951. Database.prototype.checkManifestFile = function () {
  12952. var _this = this;
  12953. function noManifestFile() {
  12954. BABYLON.Tools.Log("Valid manifest file not found. Scene & textures will be loaded directly from the web server.");
  12955. that.enableSceneOffline = false;
  12956. that.enableTexturesOffline = false;
  12957. that.callbackManifestChecked(false);
  12958. }
  12959. var that = this;
  12960. var manifestURL = this.currentSceneUrl + ".manifest";
  12961. var xhr = new XMLHttpRequest();
  12962. var manifestURLTimeStamped = manifestURL + (manifestURL.match(/\?/) == null ? "?" : "&") + (new Date()).getTime();
  12963. xhr.open("GET", manifestURLTimeStamped, true);
  12964. xhr.addEventListener("load", function () {
  12965. if (xhr.status === 200 || BABYLON.Tools.ValidateXHRData(xhr, 1)) {
  12966. try {
  12967. var manifestFile = JSON.parse(xhr.response);
  12968. _this.enableSceneOffline = manifestFile.enableSceneOffline;
  12969. _this.enableTexturesOffline = manifestFile.enableTexturesOffline;
  12970. if (manifestFile.version && !isNaN(parseInt(manifestFile.version))) {
  12971. _this.manifestVersionFound = manifestFile.version;
  12972. }
  12973. if (_this.callbackManifestChecked) {
  12974. _this.callbackManifestChecked(true);
  12975. }
  12976. } catch (ex) {
  12977. noManifestFile();
  12978. }
  12979. } else {
  12980. noManifestFile();
  12981. }
  12982. }, false);
  12983. xhr.addEventListener("error", function (event) {
  12984. noManifestFile();
  12985. }, false);
  12986. try {
  12987. xhr.send();
  12988. } catch (ex) {
  12989. BABYLON.Tools.Error("Error on XHR send request.");
  12990. that.callbackManifestChecked(false);
  12991. }
  12992. };
  12993. Database.prototype.openAsync = function (successCallback, errorCallback) {
  12994. var _this = this;
  12995. function handleError() {
  12996. that.isSupported = false;
  12997. if (errorCallback)
  12998. errorCallback();
  12999. }
  13000. var that = this;
  13001. if (!this.idbFactory || !(this.enableSceneOffline || this.enableTexturesOffline)) {
  13002. // Your browser doesn't support IndexedDB
  13003. this.isSupported = false;
  13004. if (errorCallback)
  13005. errorCallback();
  13006. } else {
  13007. // If the DB hasn't been opened or created yet
  13008. if (!this.db) {
  13009. this.hasReachedQuota = false;
  13010. this.isSupported = true;
  13011. var request = this.idbFactory.open("babylonjs", 1);
  13012. // Could occur if user is blocking the quota for the DB and/or doesn't grant access to IndexedDB
  13013. request.onerror = function (event) {
  13014. handleError();
  13015. };
  13016. // executes when a version change transaction cannot complete due to other active transactions
  13017. request.onblocked = function (event) {
  13018. BABYLON.Tools.Error("IDB request blocked. Please reload the page.");
  13019. handleError();
  13020. };
  13021. // DB has been opened successfully
  13022. request.onsuccess = function (event) {
  13023. _this.db = request.result;
  13024. successCallback();
  13025. };
  13026. // Initialization of the DB. Creating Scenes & Textures stores
  13027. request.onupgradeneeded = function (event) {
  13028. _this.db = (event.target).result;
  13029. try {
  13030. var scenesStore = _this.db.createObjectStore("scenes", { keyPath: "sceneUrl" });
  13031. var versionsStore = _this.db.createObjectStore("versions", { keyPath: "sceneUrl" });
  13032. var texturesStore = _this.db.createObjectStore("textures", { keyPath: "textureUrl" });
  13033. } catch (ex) {
  13034. BABYLON.Tools.Error("Error while creating object stores. Exception: " + ex.message);
  13035. handleError();
  13036. }
  13037. };
  13038. } else {
  13039. if (successCallback)
  13040. successCallback();
  13041. }
  13042. }
  13043. };
  13044. Database.prototype.loadImageFromDB = function (url, image) {
  13045. var _this = this;
  13046. var completeURL = BABYLON.Database.ReturnFullUrlLocation(url);
  13047. var saveAndLoadImage = function () {
  13048. if (!_this.hasReachedQuota && _this.db !== null) {
  13049. // the texture is not yet in the DB, let's try to save it
  13050. _this._saveImageIntoDBAsync(completeURL, image);
  13051. } else {
  13052. image.src = url;
  13053. }
  13054. };
  13055. if (!this.mustUpdateRessources) {
  13056. this._loadImageFromDBAsync(completeURL, image, saveAndLoadImage);
  13057. } else {
  13058. saveAndLoadImage();
  13059. }
  13060. };
  13061. Database.prototype._loadImageFromDBAsync = function (url, image, notInDBCallback) {
  13062. if (this.isSupported && this.db !== null) {
  13063. var texture;
  13064. var transaction = this.db.transaction(["textures"]);
  13065. transaction.onabort = function (event) {
  13066. image.src = url;
  13067. };
  13068. transaction.oncomplete = function (event) {
  13069. var blobTextureURL;
  13070. if (texture) {
  13071. var URL = window.URL || window.webkitURL;
  13072. blobTextureURL = URL.createObjectURL(texture.data, { oneTimeOnly: true });
  13073. image.onerror = function () {
  13074. BABYLON.Tools.Error("Error loading image from blob URL: " + blobTextureURL + " switching back to web url: " + url);
  13075. image.src = url;
  13076. };
  13077. image.src = blobTextureURL;
  13078. } else {
  13079. notInDBCallback();
  13080. }
  13081. };
  13082. var getRequest = transaction.objectStore("textures").get(url);
  13083. getRequest.onsuccess = function (event) {
  13084. texture = (event.target).result;
  13085. };
  13086. getRequest.onerror = function (event) {
  13087. BABYLON.Tools.Error("Error loading texture " + url + " from DB.");
  13088. image.src = url;
  13089. };
  13090. } else {
  13091. BABYLON.Tools.Error("Error: IndexedDB not supported by your browser or BabylonJS Database is not open.");
  13092. image.src = url;
  13093. }
  13094. };
  13095. Database.prototype._saveImageIntoDBAsync = function (url, image) {
  13096. var _this = this;
  13097. if (this.isSupported) {
  13098. // In case of error (type not supported or quota exceeded), we're at least sending back XHR data to allow texture loading later on
  13099. var generateBlobUrl = function () {
  13100. var blobTextureURL;
  13101. if (blob) {
  13102. var URL = window.URL || window.webkitURL;
  13103. try {
  13104. blobTextureURL = URL.createObjectURL(blob, { oneTimeOnly: true });
  13105. } catch (ex) {
  13106. blobTextureURL = URL.createObjectURL(blob);
  13107. }
  13108. }
  13109. image.src = blobTextureURL;
  13110. };
  13111. if (BABYLON.Database.isUASupportingBlobStorage) {
  13112. var xhr = new XMLHttpRequest(), blob;
  13113. xhr.open("GET", url, true);
  13114. xhr.responseType = "blob";
  13115. xhr.addEventListener("load", function () {
  13116. if (xhr.status === 200) {
  13117. // Blob as response (XHR2)
  13118. blob = xhr.response;
  13119. var transaction = _this.db.transaction(["textures"], "readwrite");
  13120. // the transaction could abort because of a QuotaExceededError error
  13121. transaction.onabort = function (event) {
  13122. try {
  13123. if (event.srcElement.error.name === "QuotaExceededError") {
  13124. this.hasReachedQuota = true;
  13125. }
  13126. } catch (ex) {
  13127. }
  13128. generateBlobUrl();
  13129. };
  13130. transaction.oncomplete = function (event) {
  13131. generateBlobUrl();
  13132. };
  13133. var newTexture = { textureUrl: url, data: blob };
  13134. try {
  13135. // Put the blob into the dabase
  13136. var addRequest = transaction.objectStore("textures").put(newTexture);
  13137. addRequest.onsuccess = function (event) {
  13138. };
  13139. addRequest.onerror = function (event) {
  13140. generateBlobUrl();
  13141. };
  13142. } catch (ex) {
  13143. // "DataCloneError" generated by Chrome when you try to inject blob into IndexedDB
  13144. if (ex.code === 25) {
  13145. BABYLON.Database.isUASupportingBlobStorage = false;
  13146. }
  13147. image.src = url;
  13148. }
  13149. } else {
  13150. image.src = url;
  13151. }
  13152. }, false);
  13153. xhr.addEventListener("error", function (event) {
  13154. BABYLON.Tools.Error("Error in XHR request in BABYLON.Database.");
  13155. image.src = url;
  13156. }, false);
  13157. xhr.send();
  13158. } else {
  13159. image.src = url;
  13160. }
  13161. } else {
  13162. BABYLON.Tools.Error("Error: IndexedDB not supported by your browser or BabylonJS Database is not open.");
  13163. image.src = url;
  13164. }
  13165. };
  13166. Database.prototype._checkVersionFromDB = function (url, versionLoaded) {
  13167. var _this = this;
  13168. var updateVersion = function (event) {
  13169. // the version is not yet in the DB or we need to update it
  13170. _this._saveVersionIntoDBAsync(url, versionLoaded);
  13171. };
  13172. this._loadVersionFromDBAsync(url, versionLoaded, updateVersion);
  13173. };
  13174. Database.prototype._loadVersionFromDBAsync = function (url, callback, updateInDBCallback) {
  13175. var _this = this;
  13176. if (this.isSupported) {
  13177. var version;
  13178. try {
  13179. var transaction = this.db.transaction(["versions"]);
  13180. transaction.oncomplete = function (event) {
  13181. if (version) {
  13182. // If the version in the JSON file is > than the version in DB
  13183. if (_this.manifestVersionFound > version.data) {
  13184. _this.mustUpdateRessources = true;
  13185. updateInDBCallback();
  13186. } else {
  13187. callback(version.data);
  13188. }
  13189. } else {
  13190. _this.mustUpdateRessources = true;
  13191. updateInDBCallback();
  13192. }
  13193. };
  13194. transaction.onabort = function (event) {
  13195. callback(-1);
  13196. };
  13197. var getRequest = transaction.objectStore("versions").get(url);
  13198. getRequest.onsuccess = function (event) {
  13199. version = (event.target).result;
  13200. };
  13201. getRequest.onerror = function (event) {
  13202. BABYLON.Tools.Error("Error loading version for scene " + url + " from DB.");
  13203. callback(-1);
  13204. };
  13205. } catch (ex) {
  13206. BABYLON.Tools.Error("Error while accessing 'versions' object store (READ OP). Exception: " + ex.message);
  13207. callback(-1);
  13208. }
  13209. } else {
  13210. BABYLON.Tools.Error("Error: IndexedDB not supported by your browser or BabylonJS Database is not open.");
  13211. callback(-1);
  13212. }
  13213. };
  13214. Database.prototype._saveVersionIntoDBAsync = function (url, callback) {
  13215. var _this = this;
  13216. if (this.isSupported && !this.hasReachedQuota) {
  13217. try {
  13218. // Open a transaction to the database
  13219. var transaction = this.db.transaction(["versions"], "readwrite");
  13220. // the transaction could abort because of a QuotaExceededError error
  13221. transaction.onabort = function (event) {
  13222. try {
  13223. if (event.srcElement.error.name === "QuotaExceededError") {
  13224. _this.hasReachedQuota = true;
  13225. }
  13226. } catch (ex) {
  13227. }
  13228. callback(-1);
  13229. };
  13230. transaction.oncomplete = function (event) {
  13231. callback(_this.manifestVersionFound);
  13232. };
  13233. var newVersion = { sceneUrl: url, data: this.manifestVersionFound };
  13234. // Put the scene into the database
  13235. var addRequest = transaction.objectStore("versions").put(newVersion);
  13236. addRequest.onsuccess = function (event) {
  13237. };
  13238. addRequest.onerror = function (event) {
  13239. BABYLON.Tools.Error("Error in DB add version request in BABYLON.Database.");
  13240. };
  13241. } catch (ex) {
  13242. BABYLON.Tools.Error("Error while accessing 'versions' object store (WRITE OP). Exception: " + ex.message);
  13243. callback(-1);
  13244. }
  13245. } else {
  13246. callback(-1);
  13247. }
  13248. };
  13249. Database.prototype.loadFileFromDB = function (url, sceneLoaded, progressCallBack, errorCallback, useArrayBuffer) {
  13250. var _this = this;
  13251. var completeUrl = BABYLON.Database.ReturnFullUrlLocation(url);
  13252. var saveAndLoadFile = function (event) {
  13253. // the scene is not yet in the DB, let's try to save it
  13254. _this._saveFileIntoDBAsync(completeUrl, sceneLoaded, progressCallBack);
  13255. };
  13256. this._checkVersionFromDB(completeUrl, function (version) {
  13257. if (version !== -1) {
  13258. if (!_this.mustUpdateRessources) {
  13259. _this._loadFileFromDBAsync(completeUrl, sceneLoaded, saveAndLoadFile, useArrayBuffer);
  13260. } else {
  13261. _this._saveFileIntoDBAsync(completeUrl, sceneLoaded, progressCallBack, useArrayBuffer);
  13262. }
  13263. } else {
  13264. errorCallback();
  13265. }
  13266. });
  13267. };
  13268. Database.prototype._loadFileFromDBAsync = function (url, callback, notInDBCallback, useArrayBuffer) {
  13269. if (this.isSupported) {
  13270. var targetStore;
  13271. if (url.indexOf(".babylon") !== -1) {
  13272. targetStore = "scenes";
  13273. } else {
  13274. targetStore = "textures";
  13275. }
  13276. var file;
  13277. var transaction = this.db.transaction([targetStore]);
  13278. transaction.oncomplete = function (event) {
  13279. if (file) {
  13280. callback(file.data);
  13281. } else {
  13282. notInDBCallback();
  13283. }
  13284. };
  13285. transaction.onabort = function (event) {
  13286. notInDBCallback();
  13287. };
  13288. var getRequest = transaction.objectStore(targetStore).get(url);
  13289. getRequest.onsuccess = function (event) {
  13290. file = (event.target).result;
  13291. };
  13292. getRequest.onerror = function (event) {
  13293. BABYLON.Tools.Error("Error loading file " + url + " from DB.");
  13294. notInDBCallback();
  13295. };
  13296. } else {
  13297. BABYLON.Tools.Error("Error: IndexedDB not supported by your browser or BabylonJS Database is not open.");
  13298. callback();
  13299. }
  13300. };
  13301. Database.prototype._saveFileIntoDBAsync = function (url, callback, progressCallback, useArrayBuffer) {
  13302. var _this = this;
  13303. if (this.isSupported) {
  13304. var targetStore;
  13305. if (url.indexOf(".babylon") !== -1) {
  13306. targetStore = "scenes";
  13307. } else {
  13308. targetStore = "textures";
  13309. }
  13310. // Create XHR
  13311. var xhr = new XMLHttpRequest(), fileData;
  13312. xhr.open("GET", url, true);
  13313. if (useArrayBuffer) {
  13314. xhr.responseType = "arraybuffer";
  13315. }
  13316. xhr.onprogress = progressCallback;
  13317. xhr.addEventListener("load", function () {
  13318. if (xhr.status === 200 || BABYLON.Tools.ValidateXHRData(xhr, !useArrayBuffer ? 1 : 6)) {
  13319. // Blob as response (XHR2)
  13320. //fileData = xhr.responseText;
  13321. fileData = !useArrayBuffer ? xhr.responseText : xhr.response;
  13322. if (!_this.hasReachedQuota) {
  13323. // Open a transaction to the database
  13324. var transaction = _this.db.transaction([targetStore], "readwrite");
  13325. // the transaction could abort because of a QuotaExceededError error
  13326. transaction.onabort = function (event) {
  13327. try {
  13328. if (event.srcElement.error.name === "QuotaExceededError") {
  13329. this.hasReachedQuota = true;
  13330. }
  13331. } catch (ex) {
  13332. }
  13333. callback(fileData);
  13334. };
  13335. transaction.oncomplete = function (event) {
  13336. callback(fileData);
  13337. };
  13338. var newFile;
  13339. if (targetStore === "scenes") {
  13340. newFile = { sceneUrl: url, data: fileData, version: _this.manifestVersionFound };
  13341. } else {
  13342. newFile = { textureUrl: url, data: fileData };
  13343. }
  13344. try {
  13345. // Put the scene into the database
  13346. var addRequest = transaction.objectStore(targetStore).put(newFile);
  13347. addRequest.onsuccess = function (event) {
  13348. };
  13349. addRequest.onerror = function (event) {
  13350. BABYLON.Tools.Error("Error in DB add file request in BABYLON.Database.");
  13351. };
  13352. } catch (ex) {
  13353. callback(fileData);
  13354. }
  13355. } else {
  13356. callback(fileData);
  13357. }
  13358. } else {
  13359. callback();
  13360. }
  13361. }, false);
  13362. xhr.addEventListener("error", function (event) {
  13363. BABYLON.Tools.Error("error on XHR request.");
  13364. callback();
  13365. }, false);
  13366. xhr.send();
  13367. } else {
  13368. BABYLON.Tools.Error("Error: IndexedDB not supported by your browser or BabylonJS Database is not open.");
  13369. callback();
  13370. }
  13371. };
  13372. Database.isUASupportingBlobStorage = true;
  13373. Database.parseURL = function (url) {
  13374. var a = document.createElement('a');
  13375. a.href = url;
  13376. var urlWithoutHash = url.substring(0, url.lastIndexOf("#"));
  13377. var fileName = url.substring(urlWithoutHash.lastIndexOf("/") + 1, url.length);
  13378. var absLocation = url.substring(0, url.indexOf(fileName, 0));
  13379. return absLocation;
  13380. };
  13381. Database.ReturnFullUrlLocation = function (url) {
  13382. if (url.indexOf("http:/") === -1) {
  13383. return (BABYLON.Database.parseURL(window.location.href) + url);
  13384. } else {
  13385. return url;
  13386. }
  13387. };
  13388. return Database;
  13389. })();
  13390. BABYLON.Database = Database;
  13391. })(BABYLON || (BABYLON = {}));
  13392. //# sourceMappingURL=babylon.database.js.map
  13393. var BABYLON;
  13394. (function (BABYLON) {
  13395. var SpriteManager = (function () {
  13396. function SpriteManager(name, imgUrl, capacity, cellSize, scene, epsilon) {
  13397. this.name = name;
  13398. this.cellSize = cellSize;
  13399. this.sprites = new Array();
  13400. this.renderingGroupId = 0;
  13401. this.fogEnabled = true;
  13402. this._vertexDeclaration = [3, 4, 4, 4];
  13403. this._vertexStrideSize = 15 * 4;
  13404. this._capacity = capacity;
  13405. this._spriteTexture = new BABYLON.Texture(imgUrl, scene, true, false);
  13406. this._spriteTexture.wrapU = BABYLON.Texture.CLAMP_ADDRESSMODE;
  13407. this._spriteTexture.wrapV = BABYLON.Texture.CLAMP_ADDRESSMODE;
  13408. this._epsilon = epsilon === undefined ? 0.01 : epsilon;
  13409. this._scene = scene;
  13410. this._scene.spriteManagers.push(this);
  13411. // VBO
  13412. this._vertexDeclaration = [3, 4, 4, 4];
  13413. this._vertexStrideSize = 15 * 4;
  13414. this._vertexBuffer = scene.getEngine().createDynamicVertexBuffer(capacity * this._vertexStrideSize * 4);
  13415. var indices = [];
  13416. var index = 0;
  13417. for (var count = 0; count < capacity; count++) {
  13418. indices.push(index);
  13419. indices.push(index + 1);
  13420. indices.push(index + 2);
  13421. indices.push(index);
  13422. indices.push(index + 2);
  13423. indices.push(index + 3);
  13424. index += 4;
  13425. }
  13426. this._indexBuffer = scene.getEngine().createIndexBuffer(indices);
  13427. this._vertices = new Float32Array(capacity * this._vertexStrideSize);
  13428. // Effects
  13429. this._effectBase = this._scene.getEngine().createEffect("sprites", ["position", "options", "cellInfo", "color"], ["view", "projection", "textureInfos", "alphaTest"], ["diffuseSampler"], "");
  13430. this._effectFog = this._scene.getEngine().createEffect("sprites", ["position", "options", "cellInfo", "color"], ["view", "projection", "textureInfos", "alphaTest", "vFogInfos", "vFogColor"], ["diffuseSampler"], "#define FOG");
  13431. }
  13432. SpriteManager.prototype._appendSpriteVertex = function (index, sprite, offsetX, offsetY, rowSize) {
  13433. var arrayOffset = index * 15;
  13434. if (offsetX == 0)
  13435. offsetX = this._epsilon;
  13436. else if (offsetX == 1)
  13437. offsetX = 1 - this._epsilon;
  13438. if (offsetY == 0)
  13439. offsetY = this._epsilon;
  13440. else if (offsetY == 1)
  13441. offsetY = 1 - this._epsilon;
  13442. this._vertices[arrayOffset] = sprite.position.x;
  13443. this._vertices[arrayOffset + 1] = sprite.position.y;
  13444. this._vertices[arrayOffset + 2] = sprite.position.z;
  13445. this._vertices[arrayOffset + 3] = sprite.angle;
  13446. this._vertices[arrayOffset + 4] = sprite.size;
  13447. this._vertices[arrayOffset + 5] = offsetX;
  13448. this._vertices[arrayOffset + 6] = offsetY;
  13449. this._vertices[arrayOffset + 7] = sprite.invertU ? 1 : 0;
  13450. this._vertices[arrayOffset + 8] = sprite.invertV ? 1 : 0;
  13451. var offset = (sprite.cellIndex / rowSize) >> 0;
  13452. this._vertices[arrayOffset + 9] = sprite.cellIndex - offset * rowSize;
  13453. this._vertices[arrayOffset + 10] = offset;
  13454. // Color
  13455. this._vertices[arrayOffset + 11] = sprite.color.r;
  13456. this._vertices[arrayOffset + 12] = sprite.color.g;
  13457. this._vertices[arrayOffset + 13] = sprite.color.b;
  13458. this._vertices[arrayOffset + 14] = sprite.color.a;
  13459. };
  13460. SpriteManager.prototype.render = function () {
  13461. // Check
  13462. if (!this._effectBase.isReady() || !this._effectFog.isReady() || !this._spriteTexture || !this._spriteTexture.isReady())
  13463. return;
  13464. var engine = this._scene.getEngine();
  13465. var baseSize = this._spriteTexture.getBaseSize();
  13466. // Sprites
  13467. var deltaTime = engine.getDeltaTime();
  13468. var max = Math.min(this._capacity, this.sprites.length);
  13469. var rowSize = baseSize.width / this.cellSize;
  13470. var offset = 0;
  13471. for (var index = 0; index < max; index++) {
  13472. var sprite = this.sprites[index];
  13473. if (!sprite) {
  13474. continue;
  13475. }
  13476. sprite._animate(deltaTime);
  13477. this._appendSpriteVertex(offset++, sprite, 0, 0, rowSize);
  13478. this._appendSpriteVertex(offset++, sprite, 1, 0, rowSize);
  13479. this._appendSpriteVertex(offset++, sprite, 1, 1, rowSize);
  13480. this._appendSpriteVertex(offset++, sprite, 0, 1, rowSize);
  13481. }
  13482. engine.updateDynamicVertexBuffer(this._vertexBuffer, this._vertices);
  13483. // Render
  13484. var effect = this._effectBase;
  13485. if (this._scene.fogEnabled && this._scene.fogMode !== BABYLON.Scene.FOGMODE_NONE && this.fogEnabled) {
  13486. effect = this._effectFog;
  13487. }
  13488. engine.enableEffect(effect);
  13489. var viewMatrix = this._scene.getViewMatrix();
  13490. effect.setTexture("diffuseSampler", this._spriteTexture);
  13491. effect.setMatrix("view", viewMatrix);
  13492. effect.setMatrix("projection", this._scene.getProjectionMatrix());
  13493. effect.setFloat2("textureInfos", this.cellSize / baseSize.width, this.cellSize / baseSize.height);
  13494. // Fog
  13495. if (this._scene.fogEnabled && this._scene.fogMode !== BABYLON.Scene.FOGMODE_NONE && this.fogEnabled) {
  13496. effect.setFloat4("vFogInfos", this._scene.fogMode, this._scene.fogStart, this._scene.fogEnd, this._scene.fogDensity);
  13497. effect.setColor3("vFogColor", this._scene.fogColor);
  13498. }
  13499. // VBOs
  13500. engine.bindBuffers(this._vertexBuffer, this._indexBuffer, this._vertexDeclaration, this._vertexStrideSize, effect);
  13501. // Draw order
  13502. effect.setBool("alphaTest", true);
  13503. engine.setColorWrite(false);
  13504. engine.draw(true, 0, max * 6);
  13505. engine.setColorWrite(true);
  13506. effect.setBool("alphaTest", false);
  13507. engine.setAlphaMode(BABYLON.Engine.ALPHA_COMBINE);
  13508. engine.draw(true, 0, max * 6);
  13509. engine.setAlphaMode(BABYLON.Engine.ALPHA_DISABLE);
  13510. };
  13511. SpriteManager.prototype.dispose = function () {
  13512. if (this._vertexBuffer) {
  13513. this._scene.getEngine()._releaseBuffer(this._vertexBuffer);
  13514. this._vertexBuffer = null;
  13515. }
  13516. if (this._indexBuffer) {
  13517. this._scene.getEngine()._releaseBuffer(this._indexBuffer);
  13518. this._indexBuffer = null;
  13519. }
  13520. if (this._spriteTexture) {
  13521. this._spriteTexture.dispose();
  13522. this._spriteTexture = null;
  13523. }
  13524. // Remove from scene
  13525. var index = this._scene.spriteManagers.indexOf(this);
  13526. this._scene.spriteManagers.splice(index, 1);
  13527. // Callback
  13528. if (this.onDispose) {
  13529. this.onDispose();
  13530. }
  13531. };
  13532. return SpriteManager;
  13533. })();
  13534. BABYLON.SpriteManager = SpriteManager;
  13535. })(BABYLON || (BABYLON = {}));
  13536. //# sourceMappingURL=babylon.spriteManager.js.map
  13537. var BABYLON;
  13538. (function (BABYLON) {
  13539. var Sprite = (function () {
  13540. function Sprite(name, manager) {
  13541. this.name = name;
  13542. this.color = new BABYLON.Color4(1.0, 1.0, 1.0, 1.0);
  13543. this.size = 1.0;
  13544. this.angle = 0;
  13545. this.cellIndex = 0;
  13546. this.invertU = 0;
  13547. this.invertV = 0;
  13548. this.animations = new Array();
  13549. this._animationStarted = false;
  13550. this._loopAnimation = false;
  13551. this._fromIndex = 0;
  13552. this._toIndex = 0;
  13553. this._delay = 0;
  13554. this._direction = 1;
  13555. this._frameCount = 0;
  13556. this._time = 0;
  13557. this._manager = manager;
  13558. this._manager.sprites.push(this);
  13559. this.position = BABYLON.Vector3.Zero();
  13560. }
  13561. Sprite.prototype.playAnimation = function (from, to, loop, delay) {
  13562. this._fromIndex = from;
  13563. this._toIndex = to;
  13564. this._loopAnimation = loop;
  13565. this._delay = delay;
  13566. this._animationStarted = true;
  13567. this._direction = from < to ? 1 : -1;
  13568. this.cellIndex = from;
  13569. this._time = 0;
  13570. };
  13571. Sprite.prototype.stopAnimation = function () {
  13572. this._animationStarted = false;
  13573. };
  13574. Sprite.prototype._animate = function (deltaTime) {
  13575. if (!this._animationStarted)
  13576. return;
  13577. this._time += deltaTime;
  13578. if (this._time > this._delay) {
  13579. this._time = this._time % this._delay;
  13580. this.cellIndex += this._direction;
  13581. if (this.cellIndex == this._toIndex) {
  13582. if (this._loopAnimation) {
  13583. this.cellIndex = this._fromIndex;
  13584. } else {
  13585. this._animationStarted = false;
  13586. if (this.disposeWhenFinishedAnimating) {
  13587. this.dispose();
  13588. }
  13589. }
  13590. }
  13591. }
  13592. };
  13593. Sprite.prototype.dispose = function () {
  13594. for (var i = 0; i < this._manager.sprites.length; i++) {
  13595. if (this._manager.sprites[i] == this) {
  13596. this._manager.sprites.splice(i, 1);
  13597. }
  13598. }
  13599. };
  13600. return Sprite;
  13601. })();
  13602. BABYLON.Sprite = Sprite;
  13603. })(BABYLON || (BABYLON = {}));
  13604. //# sourceMappingURL=babylon.sprite.js.map
  13605. var BABYLON;
  13606. (function (BABYLON) {
  13607. var Layer = (function () {
  13608. function Layer(name, imgUrl, scene, isBackground, color) {
  13609. this.name = name;
  13610. this._vertexDeclaration = [2];
  13611. this._vertexStrideSize = 2 * 4;
  13612. this.texture = imgUrl ? new BABYLON.Texture(imgUrl, scene, true) : null;
  13613. this.isBackground = isBackground === undefined ? true : isBackground;
  13614. this.color = color === undefined ? new BABYLON.Color4(1, 1, 1, 1) : color;
  13615. this._scene = scene;
  13616. this._scene.layers.push(this);
  13617. // VBO
  13618. var vertices = [];
  13619. vertices.push(1, 1);
  13620. vertices.push(-1, 1);
  13621. vertices.push(-1, -1);
  13622. vertices.push(1, -1);
  13623. this._vertexBuffer = scene.getEngine().createVertexBuffer(vertices);
  13624. // Indices
  13625. var indices = [];
  13626. indices.push(0);
  13627. indices.push(1);
  13628. indices.push(2);
  13629. indices.push(0);
  13630. indices.push(2);
  13631. indices.push(3);
  13632. this._indexBuffer = scene.getEngine().createIndexBuffer(indices);
  13633. // Effects
  13634. this._effect = this._scene.getEngine().createEffect("layer", ["position"], ["textureMatrix", "color"], ["textureSampler"], "");
  13635. }
  13636. Layer.prototype.render = function () {
  13637. // Check
  13638. if (!this._effect.isReady() || !this.texture || !this.texture.isReady())
  13639. return;
  13640. var engine = this._scene.getEngine();
  13641. // Render
  13642. engine.enableEffect(this._effect);
  13643. engine.setState(false);
  13644. // Texture
  13645. this._effect.setTexture("textureSampler", this.texture);
  13646. this._effect.setMatrix("textureMatrix", this.texture.getTextureMatrix());
  13647. // Color
  13648. this._effect.setFloat4("color", this.color.r, this.color.g, this.color.b, this.color.a);
  13649. // VBOs
  13650. engine.bindBuffers(this._vertexBuffer, this._indexBuffer, this._vertexDeclaration, this._vertexStrideSize, this._effect);
  13651. // Draw order
  13652. engine.setAlphaMode(BABYLON.Engine.ALPHA_COMBINE);
  13653. engine.draw(true, 0, 6);
  13654. engine.setAlphaMode(BABYLON.Engine.ALPHA_DISABLE);
  13655. };
  13656. Layer.prototype.dispose = function () {
  13657. if (this._vertexBuffer) {
  13658. this._scene.getEngine()._releaseBuffer(this._vertexBuffer);
  13659. this._vertexBuffer = null;
  13660. }
  13661. if (this._indexBuffer) {
  13662. this._scene.getEngine()._releaseBuffer(this._indexBuffer);
  13663. this._indexBuffer = null;
  13664. }
  13665. if (this.texture) {
  13666. this.texture.dispose();
  13667. this.texture = null;
  13668. }
  13669. // Remove from scene
  13670. var index = this._scene.layers.indexOf(this);
  13671. this._scene.layers.splice(index, 1);
  13672. // Callback
  13673. if (this.onDispose) {
  13674. this.onDispose();
  13675. }
  13676. };
  13677. return Layer;
  13678. })();
  13679. BABYLON.Layer = Layer;
  13680. })(BABYLON || (BABYLON = {}));
  13681. //# sourceMappingURL=babylon.layer.js.map
  13682. var BABYLON;
  13683. (function (BABYLON) {
  13684. var Particle = (function () {
  13685. function Particle() {
  13686. this.position = BABYLON.Vector3.Zero();
  13687. this.direction = BABYLON.Vector3.Zero();
  13688. this.color = new BABYLON.Color4(0, 0, 0, 0);
  13689. this.colorStep = new BABYLON.Color4(0, 0, 0, 0);
  13690. this.lifeTime = 1.0;
  13691. this.age = 0;
  13692. this.size = 0;
  13693. this.angle = 0;
  13694. this.angularSpeed = 0;
  13695. }
  13696. return Particle;
  13697. })();
  13698. BABYLON.Particle = Particle;
  13699. })(BABYLON || (BABYLON = {}));
  13700. //# sourceMappingURL=babylon.particle.js.map
  13701. var BABYLON;
  13702. (function (BABYLON) {
  13703. var randomNumber = function (min, max) {
  13704. if (min === max) {
  13705. return (min);
  13706. }
  13707. var random = Math.random();
  13708. return ((random * (max - min)) + min);
  13709. };
  13710. var ParticleSystem = (function () {
  13711. function ParticleSystem(name, capacity, scene, customEffect) {
  13712. var _this = this;
  13713. this.name = name;
  13714. this.renderingGroupId = 0;
  13715. this.emitter = null;
  13716. this.emitRate = 10;
  13717. this.manualEmitCount = -1;
  13718. this.updateSpeed = 0.01;
  13719. this.targetStopDuration = 0;
  13720. this.disposeOnStop = false;
  13721. this.minEmitPower = 1;
  13722. this.maxEmitPower = 1;
  13723. this.minLifeTime = 1;
  13724. this.maxLifeTime = 1;
  13725. this.minSize = 1;
  13726. this.maxSize = 1;
  13727. this.minAngularSpeed = 0;
  13728. this.maxAngularSpeed = 0;
  13729. this.blendMode = ParticleSystem.BLENDMODE_ONEONE;
  13730. this.forceDepthWrite = false;
  13731. this.gravity = BABYLON.Vector3.Zero();
  13732. this.direction1 = new BABYLON.Vector3(0, 1.0, 0);
  13733. this.direction2 = new BABYLON.Vector3(0, 1.0, 0);
  13734. this.minEmitBox = new BABYLON.Vector3(-0.5, -0.5, -0.5);
  13735. this.maxEmitBox = new BABYLON.Vector3(0.5, 0.5, 0.5);
  13736. this.color1 = new BABYLON.Color4(1.0, 1.0, 1.0, 1.0);
  13737. this.color2 = new BABYLON.Color4(1.0, 1.0, 1.0, 1.0);
  13738. this.colorDead = new BABYLON.Color4(0, 0, 0, 1.0);
  13739. this.textureMask = new BABYLON.Color4(1.0, 1.0, 1.0, 1.0);
  13740. this.particles = new Array();
  13741. this._vertexDeclaration = [3, 4, 4];
  13742. this._vertexStrideSize = 11 * 4;
  13743. this._stockParticles = new Array();
  13744. this._newPartsExcess = 0;
  13745. this._scaledColorStep = new BABYLON.Color4(0, 0, 0, 0);
  13746. this._colorDiff = new BABYLON.Color4(0, 0, 0, 0);
  13747. this._scaledDirection = BABYLON.Vector3.Zero();
  13748. this._scaledGravity = BABYLON.Vector3.Zero();
  13749. this._currentRenderId = -1;
  13750. this._started = false;
  13751. this._stopped = false;
  13752. this._actualFrame = 0;
  13753. this.id = name;
  13754. this._capacity = capacity;
  13755. this._scene = scene;
  13756. this._customEffect = customEffect;
  13757. scene.particleSystems.push(this);
  13758. // VBO
  13759. this._vertexBuffer = scene.getEngine().createDynamicVertexBuffer(capacity * this._vertexStrideSize * 4);
  13760. var indices = [];
  13761. var index = 0;
  13762. for (var count = 0; count < capacity; count++) {
  13763. indices.push(index);
  13764. indices.push(index + 1);
  13765. indices.push(index + 2);
  13766. indices.push(index);
  13767. indices.push(index + 2);
  13768. indices.push(index + 3);
  13769. index += 4;
  13770. }
  13771. this._indexBuffer = scene.getEngine().createIndexBuffer(indices);
  13772. this._vertices = new Float32Array(capacity * this._vertexStrideSize);
  13773. // Default behaviors
  13774. this.startDirectionFunction = function (emitPower, worldMatrix, directionToUpdate) {
  13775. var randX = randomNumber(_this.direction1.x, _this.direction2.x);
  13776. var randY = randomNumber(_this.direction1.y, _this.direction2.y);
  13777. var randZ = randomNumber(_this.direction1.z, _this.direction2.z);
  13778. BABYLON.Vector3.TransformNormalFromFloatsToRef(randX * emitPower, randY * emitPower, randZ * emitPower, worldMatrix, directionToUpdate);
  13779. };
  13780. this.startPositionFunction = function (worldMatrix, positionToUpdate) {
  13781. var randX = randomNumber(_this.minEmitBox.x, _this.maxEmitBox.x);
  13782. var randY = randomNumber(_this.minEmitBox.y, _this.maxEmitBox.y);
  13783. var randZ = randomNumber(_this.minEmitBox.z, _this.maxEmitBox.z);
  13784. BABYLON.Vector3.TransformCoordinatesFromFloatsToRef(randX, randY, randZ, worldMatrix, positionToUpdate);
  13785. };
  13786. this.updateFunction = function (particles) {
  13787. for (var index = 0; index < particles.length; index++) {
  13788. var particle = particles[index];
  13789. particle.age += _this._scaledUpdateSpeed;
  13790. if (particle.age >= particle.lifeTime) {
  13791. particles.splice(index, 1);
  13792. _this._stockParticles.push(particle);
  13793. index--;
  13794. continue;
  13795. } else {
  13796. particle.colorStep.scaleToRef(_this._scaledUpdateSpeed, _this._scaledColorStep);
  13797. particle.color.addInPlace(_this._scaledColorStep);
  13798. if (particle.color.a < 0)
  13799. particle.color.a = 0;
  13800. particle.angle += particle.angularSpeed * _this._scaledUpdateSpeed;
  13801. particle.direction.scaleToRef(_this._scaledUpdateSpeed, _this._scaledDirection);
  13802. particle.position.addInPlace(_this._scaledDirection);
  13803. _this.gravity.scaleToRef(_this._scaledUpdateSpeed, _this._scaledGravity);
  13804. particle.direction.addInPlace(_this._scaledGravity);
  13805. }
  13806. }
  13807. };
  13808. }
  13809. ParticleSystem.prototype.getCapacity = function () {
  13810. return this._capacity;
  13811. };
  13812. ParticleSystem.prototype.isAlive = function () {
  13813. return this._alive;
  13814. };
  13815. ParticleSystem.prototype.isStarted = function () {
  13816. return this._started;
  13817. };
  13818. ParticleSystem.prototype.start = function () {
  13819. this._started = true;
  13820. this._stopped = false;
  13821. this._actualFrame = 0;
  13822. };
  13823. ParticleSystem.prototype.stop = function () {
  13824. this._stopped = true;
  13825. };
  13826. ParticleSystem.prototype._appendParticleVertex = function (index, particle, offsetX, offsetY) {
  13827. var offset = index * 11;
  13828. this._vertices[offset] = particle.position.x;
  13829. this._vertices[offset + 1] = particle.position.y;
  13830. this._vertices[offset + 2] = particle.position.z;
  13831. this._vertices[offset + 3] = particle.color.r;
  13832. this._vertices[offset + 4] = particle.color.g;
  13833. this._vertices[offset + 5] = particle.color.b;
  13834. this._vertices[offset + 6] = particle.color.a;
  13835. this._vertices[offset + 7] = particle.angle;
  13836. this._vertices[offset + 8] = particle.size;
  13837. this._vertices[offset + 9] = offsetX;
  13838. this._vertices[offset + 10] = offsetY;
  13839. };
  13840. ParticleSystem.prototype._update = function (newParticles) {
  13841. // Update current
  13842. this._alive = this.particles.length > 0;
  13843. this.updateFunction(this.particles);
  13844. // Add new ones
  13845. var worldMatrix;
  13846. if (this.emitter.position) {
  13847. worldMatrix = this.emitter.getWorldMatrix();
  13848. } else {
  13849. worldMatrix = BABYLON.Matrix.Translation(this.emitter.x, this.emitter.y, this.emitter.z);
  13850. }
  13851. for (var index = 0; index < newParticles; index++) {
  13852. if (this.particles.length === this._capacity) {
  13853. break;
  13854. }
  13855. if (this._stockParticles.length !== 0) {
  13856. var particle = this._stockParticles.pop();
  13857. particle.age = 0;
  13858. } else {
  13859. particle = new BABYLON.Particle();
  13860. }
  13861. this.particles.push(particle);
  13862. var emitPower = randomNumber(this.minEmitPower, this.maxEmitPower);
  13863. this.startDirectionFunction(emitPower, worldMatrix, particle.direction);
  13864. particle.lifeTime = randomNumber(this.minLifeTime, this.maxLifeTime);
  13865. particle.size = randomNumber(this.minSize, this.maxSize);
  13866. particle.angularSpeed = randomNumber(this.minAngularSpeed, this.maxAngularSpeed);
  13867. this.startPositionFunction(worldMatrix, particle.position);
  13868. var step = randomNumber(0, 1.0);
  13869. BABYLON.Color4.LerpToRef(this.color1, this.color2, step, particle.color);
  13870. this.colorDead.subtractToRef(particle.color, this._colorDiff);
  13871. this._colorDiff.scaleToRef(1.0 / particle.lifeTime, particle.colorStep);
  13872. }
  13873. };
  13874. ParticleSystem.prototype._getEffect = function () {
  13875. if (this._customEffect) {
  13876. return this._customEffect;
  13877. }
  13878. ;
  13879. var defines = [];
  13880. if (this._scene.clipPlane) {
  13881. defines.push("#define CLIPPLANE");
  13882. }
  13883. // Effect
  13884. var join = defines.join("\n");
  13885. if (this._cachedDefines !== join) {
  13886. this._cachedDefines = join;
  13887. this._effect = this._scene.getEngine().createEffect("particles", ["position", "color", "options"], ["invView", "view", "projection", "vClipPlane", "textureMask"], ["diffuseSampler"], join);
  13888. }
  13889. return this._effect;
  13890. };
  13891. ParticleSystem.prototype.animate = function () {
  13892. if (!this._started)
  13893. return;
  13894. var effect = this._getEffect();
  13895. // Check
  13896. if (!this.emitter || !effect.isReady() || !this.particleTexture || !this.particleTexture.isReady())
  13897. return;
  13898. if (this._currentRenderId === this._scene.getRenderId()) {
  13899. return;
  13900. }
  13901. this._currentRenderId = this._scene.getRenderId();
  13902. this._scaledUpdateSpeed = this.updateSpeed * this._scene.getAnimationRatio();
  13903. // determine the number of particles we need to create
  13904. var emitCout;
  13905. if (this.manualEmitCount > -1) {
  13906. emitCout = this.manualEmitCount;
  13907. this.manualEmitCount = 0;
  13908. } else {
  13909. emitCout = this.emitRate;
  13910. }
  13911. var newParticles = ((emitCout * this._scaledUpdateSpeed) >> 0);
  13912. this._newPartsExcess += emitCout * this._scaledUpdateSpeed - newParticles;
  13913. if (this._newPartsExcess > 1.0) {
  13914. newParticles += this._newPartsExcess >> 0;
  13915. this._newPartsExcess -= this._newPartsExcess >> 0;
  13916. }
  13917. this._alive = false;
  13918. if (!this._stopped) {
  13919. this._actualFrame += this._scaledUpdateSpeed;
  13920. if (this.targetStopDuration && this._actualFrame >= this.targetStopDuration)
  13921. this.stop();
  13922. } else {
  13923. newParticles = 0;
  13924. }
  13925. this._update(newParticles);
  13926. // Stopped?
  13927. if (this._stopped) {
  13928. if (!this._alive) {
  13929. this._started = false;
  13930. if (this.disposeOnStop) {
  13931. this._scene._toBeDisposed.push(this);
  13932. }
  13933. }
  13934. }
  13935. // Update VBO
  13936. var offset = 0;
  13937. for (var index = 0; index < this.particles.length; index++) {
  13938. var particle = this.particles[index];
  13939. this._appendParticleVertex(offset++, particle, 0, 0);
  13940. this._appendParticleVertex(offset++, particle, 1, 0);
  13941. this._appendParticleVertex(offset++, particle, 1, 1);
  13942. this._appendParticleVertex(offset++, particle, 0, 1);
  13943. }
  13944. var engine = this._scene.getEngine();
  13945. engine.updateDynamicVertexBuffer(this._vertexBuffer, this._vertices);
  13946. };
  13947. ParticleSystem.prototype.render = function () {
  13948. var effect = this._getEffect();
  13949. // Check
  13950. if (!this.emitter || !effect.isReady() || !this.particleTexture || !this.particleTexture.isReady() || !this.particles.length)
  13951. return 0;
  13952. var engine = this._scene.getEngine();
  13953. // Render
  13954. engine.enableEffect(effect);
  13955. engine.setState(false);
  13956. var viewMatrix = this._scene.getViewMatrix();
  13957. effect.setTexture("diffuseSampler", this.particleTexture);
  13958. effect.setMatrix("view", viewMatrix);
  13959. effect.setMatrix("projection", this._scene.getProjectionMatrix());
  13960. effect.setFloat4("textureMask", this.textureMask.r, this.textureMask.g, this.textureMask.b, this.textureMask.a);
  13961. if (this._scene.clipPlane) {
  13962. var clipPlane = this._scene.clipPlane;
  13963. var invView = viewMatrix.clone();
  13964. invView.invert();
  13965. effect.setMatrix("invView", invView);
  13966. effect.setFloat4("vClipPlane", clipPlane.normal.x, clipPlane.normal.y, clipPlane.normal.z, clipPlane.d);
  13967. }
  13968. // VBOs
  13969. engine.bindBuffers(this._vertexBuffer, this._indexBuffer, this._vertexDeclaration, this._vertexStrideSize, effect);
  13970. // Draw order
  13971. if (this.blendMode === ParticleSystem.BLENDMODE_ONEONE) {
  13972. engine.setAlphaMode(BABYLON.Engine.ALPHA_ADD);
  13973. } else {
  13974. engine.setAlphaMode(BABYLON.Engine.ALPHA_COMBINE);
  13975. }
  13976. if (this.forceDepthWrite) {
  13977. engine.setDepthWrite(true);
  13978. }
  13979. engine.draw(true, 0, this.particles.length * 6);
  13980. engine.setAlphaMode(BABYLON.Engine.ALPHA_DISABLE);
  13981. return this.particles.length;
  13982. };
  13983. ParticleSystem.prototype.dispose = function () {
  13984. if (this._vertexBuffer) {
  13985. this._scene.getEngine()._releaseBuffer(this._vertexBuffer);
  13986. this._vertexBuffer = null;
  13987. }
  13988. if (this._indexBuffer) {
  13989. this._scene.getEngine()._releaseBuffer(this._indexBuffer);
  13990. this._indexBuffer = null;
  13991. }
  13992. if (this.particleTexture) {
  13993. this.particleTexture.dispose();
  13994. this.particleTexture = null;
  13995. }
  13996. // Remove from scene
  13997. var index = this._scene.particleSystems.indexOf(this);
  13998. this._scene.particleSystems.splice(index, 1);
  13999. // Callback
  14000. if (this.onDispose) {
  14001. this.onDispose();
  14002. }
  14003. };
  14004. // Clone
  14005. ParticleSystem.prototype.clone = function (name, newEmitter) {
  14006. var result = new ParticleSystem(name, this._capacity, this._scene);
  14007. BABYLON.Tools.DeepCopy(this, result, ["particles"], ["_vertexDeclaration", "_vertexStrideSize"]);
  14008. if (newEmitter === undefined) {
  14009. newEmitter = this.emitter;
  14010. }
  14011. result.emitter = newEmitter;
  14012. if (this.particleTexture) {
  14013. result.particleTexture = new BABYLON.Texture(this.particleTexture.url, this._scene);
  14014. }
  14015. result.start();
  14016. return result;
  14017. };
  14018. ParticleSystem.BLENDMODE_ONEONE = 0;
  14019. ParticleSystem.BLENDMODE_STANDARD = 1;
  14020. return ParticleSystem;
  14021. })();
  14022. BABYLON.ParticleSystem = ParticleSystem;
  14023. })(BABYLON || (BABYLON = {}));
  14024. //# sourceMappingURL=babylon.particleSystem.js.map
  14025. var BABYLON;
  14026. (function (BABYLON) {
  14027. var Animation = (function () {
  14028. function Animation(name, targetProperty, framePerSecond, dataType, loopMode) {
  14029. this.name = name;
  14030. this.targetProperty = targetProperty;
  14031. this.framePerSecond = framePerSecond;
  14032. this.dataType = dataType;
  14033. this.loopMode = loopMode;
  14034. this._offsetsCache = {};
  14035. this._highLimitsCache = {};
  14036. this._stopped = false;
  14037. this.targetPropertyPath = targetProperty.split(".");
  14038. this.dataType = dataType;
  14039. this.loopMode = loopMode === undefined ? Animation.ANIMATIONLOOPMODE_CYCLE : loopMode;
  14040. }
  14041. Animation.CreateAndStartAnimation = function (name, mesh, tartgetProperty, framePerSecond, totalFrame, from, to, loopMode) {
  14042. var dataType = undefined;
  14043. if (!isNaN(parseFloat(from)) && isFinite(from)) {
  14044. dataType = Animation.ANIMATIONTYPE_FLOAT;
  14045. } else if (from instanceof BABYLON.Quaternion) {
  14046. dataType = Animation.ANIMATIONTYPE_QUATERNION;
  14047. } else if (from instanceof BABYLON.Vector3) {
  14048. dataType = Animation.ANIMATIONTYPE_VECTOR3;
  14049. } else if (from instanceof BABYLON.Vector2) {
  14050. dataType = Animation.ANIMATIONTYPE_VECTOR2;
  14051. } else if (from instanceof BABYLON.Color3) {
  14052. dataType = Animation.ANIMATIONTYPE_COLOR3;
  14053. }
  14054. if (dataType == undefined) {
  14055. return;
  14056. }
  14057. var animation = new Animation(name, tartgetProperty, framePerSecond, dataType, loopMode);
  14058. var keys = [];
  14059. keys.push({ frame: 0, value: from });
  14060. keys.push({ frame: totalFrame, value: to });
  14061. animation.setKeys(keys);
  14062. mesh.animations.push(animation);
  14063. mesh.getScene().beginAnimation(mesh, 0, totalFrame, (animation.loopMode == 1));
  14064. };
  14065. // Methods
  14066. Animation.prototype.isStopped = function () {
  14067. return this._stopped;
  14068. };
  14069. Animation.prototype.getKeys = function () {
  14070. return this._keys;
  14071. };
  14072. Animation.prototype.getEasingFunction = function () {
  14073. return this._easingFunction;
  14074. };
  14075. Animation.prototype.setEasingFunction = function (easingFunction) {
  14076. this._easingFunction = easingFunction;
  14077. };
  14078. Animation.prototype.floatInterpolateFunction = function (startValue, endValue, gradient) {
  14079. return startValue + (endValue - startValue) * gradient;
  14080. };
  14081. Animation.prototype.quaternionInterpolateFunction = function (startValue, endValue, gradient) {
  14082. return BABYLON.Quaternion.Slerp(startValue, endValue, gradient);
  14083. };
  14084. Animation.prototype.vector3InterpolateFunction = function (startValue, endValue, gradient) {
  14085. return BABYLON.Vector3.Lerp(startValue, endValue, gradient);
  14086. };
  14087. Animation.prototype.vector2InterpolateFunction = function (startValue, endValue, gradient) {
  14088. return BABYLON.Vector2.Lerp(startValue, endValue, gradient);
  14089. };
  14090. Animation.prototype.color3InterpolateFunction = function (startValue, endValue, gradient) {
  14091. return BABYLON.Color3.Lerp(startValue, endValue, gradient);
  14092. };
  14093. Animation.prototype.clone = function () {
  14094. var clone = new Animation(this.name, this.targetPropertyPath.join("."), this.framePerSecond, this.dataType, this.loopMode);
  14095. clone.setKeys(this._keys);
  14096. return clone;
  14097. };
  14098. Animation.prototype.setKeys = function (values) {
  14099. this._keys = values.slice(0);
  14100. this._offsetsCache = {};
  14101. this._highLimitsCache = {};
  14102. };
  14103. Animation.prototype._interpolate = function (currentFrame, repeatCount, loopMode, offsetValue, highLimitValue) {
  14104. if (loopMode === Animation.ANIMATIONLOOPMODE_CONSTANT && repeatCount > 0) {
  14105. return highLimitValue.clone ? highLimitValue.clone() : highLimitValue;
  14106. }
  14107. this.currentFrame = currentFrame;
  14108. for (var key = 0; key < this._keys.length; key++) {
  14109. // for each frame, we need the key just before the frame superior
  14110. if (this._keys[key + 1].frame >= currentFrame) {
  14111. var startValue = this._keys[key].value;
  14112. var endValue = this._keys[key + 1].value;
  14113. // gradient : percent of currentFrame between the frame inf and the frame sup
  14114. var gradient = (currentFrame - this._keys[key].frame) / (this._keys[key + 1].frame - this._keys[key].frame);
  14115. // check for easingFunction and correction of gradient
  14116. if (this._easingFunction != null) {
  14117. gradient = this._easingFunction.ease(gradient);
  14118. }
  14119. switch (this.dataType) {
  14120. case Animation.ANIMATIONTYPE_FLOAT:
  14121. switch (loopMode) {
  14122. case Animation.ANIMATIONLOOPMODE_CYCLE:
  14123. case Animation.ANIMATIONLOOPMODE_CONSTANT:
  14124. return this.floatInterpolateFunction(startValue, endValue, gradient);
  14125. case Animation.ANIMATIONLOOPMODE_RELATIVE:
  14126. return offsetValue * repeatCount + this.floatInterpolateFunction(startValue, endValue, gradient);
  14127. }
  14128. break;
  14129. case Animation.ANIMATIONTYPE_QUATERNION:
  14130. var quaternion = null;
  14131. switch (loopMode) {
  14132. case Animation.ANIMATIONLOOPMODE_CYCLE:
  14133. case Animation.ANIMATIONLOOPMODE_CONSTANT:
  14134. quaternion = this.quaternionInterpolateFunction(startValue, endValue, gradient);
  14135. break;
  14136. case Animation.ANIMATIONLOOPMODE_RELATIVE:
  14137. quaternion = this.quaternionInterpolateFunction(startValue, endValue, gradient).add(offsetValue.scale(repeatCount));
  14138. break;
  14139. }
  14140. return quaternion;
  14141. case Animation.ANIMATIONTYPE_VECTOR3:
  14142. switch (loopMode) {
  14143. case Animation.ANIMATIONLOOPMODE_CYCLE:
  14144. case Animation.ANIMATIONLOOPMODE_CONSTANT:
  14145. return this.vector3InterpolateFunction(startValue, endValue, gradient);
  14146. case Animation.ANIMATIONLOOPMODE_RELATIVE:
  14147. return this.vector3InterpolateFunction(startValue, endValue, gradient).add(offsetValue.scale(repeatCount));
  14148. }
  14149. case Animation.ANIMATIONTYPE_VECTOR2:
  14150. switch (loopMode) {
  14151. case Animation.ANIMATIONLOOPMODE_CYCLE:
  14152. case Animation.ANIMATIONLOOPMODE_CONSTANT:
  14153. return this.vector2InterpolateFunction(startValue, endValue, gradient);
  14154. case Animation.ANIMATIONLOOPMODE_RELATIVE:
  14155. return this.vector2InterpolateFunction(startValue, endValue, gradient).add(offsetValue.scale(repeatCount));
  14156. }
  14157. case Animation.ANIMATIONTYPE_COLOR3:
  14158. switch (loopMode) {
  14159. case Animation.ANIMATIONLOOPMODE_CYCLE:
  14160. case Animation.ANIMATIONLOOPMODE_CONSTANT:
  14161. return this.color3InterpolateFunction(startValue, endValue, gradient);
  14162. case Animation.ANIMATIONLOOPMODE_RELATIVE:
  14163. return this.color3InterpolateFunction(startValue, endValue, gradient).add(offsetValue.scale(repeatCount));
  14164. }
  14165. case Animation.ANIMATIONTYPE_MATRIX:
  14166. switch (loopMode) {
  14167. case Animation.ANIMATIONLOOPMODE_CYCLE:
  14168. case Animation.ANIMATIONLOOPMODE_CONSTANT:
  14169. case Animation.ANIMATIONLOOPMODE_RELATIVE:
  14170. return startValue;
  14171. }
  14172. default:
  14173. break;
  14174. }
  14175. break;
  14176. }
  14177. }
  14178. return this._keys[this._keys.length - 1].value;
  14179. };
  14180. Animation.prototype.animate = function (delay, from, to, loop, speedRatio) {
  14181. if (!this.targetPropertyPath || this.targetPropertyPath.length < 1) {
  14182. this._stopped = true;
  14183. return false;
  14184. }
  14185. var returnValue = true;
  14186. // Adding a start key at frame 0 if missing
  14187. if (this._keys[0].frame != 0) {
  14188. var newKey = { frame: 0, value: this._keys[0].value };
  14189. this._keys.splice(0, 0, newKey);
  14190. }
  14191. // Check limits
  14192. if (from < this._keys[0].frame || from > this._keys[this._keys.length - 1].frame) {
  14193. from = this._keys[0].frame;
  14194. }
  14195. if (to < this._keys[0].frame || to > this._keys[this._keys.length - 1].frame) {
  14196. to = this._keys[this._keys.length - 1].frame;
  14197. }
  14198. // Compute ratio
  14199. var range = to - from;
  14200. var offsetValue;
  14201. // ratio represents the frame delta between from and to
  14202. var ratio = delay * (this.framePerSecond * speedRatio) / 1000.0;
  14203. if (ratio > range && !loop) {
  14204. returnValue = false;
  14205. highLimitValue = this._keys[this._keys.length - 1].value;
  14206. } else {
  14207. // Get max value if required
  14208. var highLimitValue = 0;
  14209. if (this.loopMode != Animation.ANIMATIONLOOPMODE_CYCLE) {
  14210. var keyOffset = to.toString() + from.toString();
  14211. if (!this._offsetsCache[keyOffset]) {
  14212. var fromValue = this._interpolate(from, 0, Animation.ANIMATIONLOOPMODE_CYCLE);
  14213. var toValue = this._interpolate(to, 0, Animation.ANIMATIONLOOPMODE_CYCLE);
  14214. switch (this.dataType) {
  14215. case Animation.ANIMATIONTYPE_FLOAT:
  14216. this._offsetsCache[keyOffset] = toValue - fromValue;
  14217. break;
  14218. case Animation.ANIMATIONTYPE_QUATERNION:
  14219. this._offsetsCache[keyOffset] = toValue.subtract(fromValue);
  14220. break;
  14221. case Animation.ANIMATIONTYPE_VECTOR3:
  14222. this._offsetsCache[keyOffset] = toValue.subtract(fromValue);
  14223. case Animation.ANIMATIONTYPE_VECTOR2:
  14224. this._offsetsCache[keyOffset] = toValue.subtract(fromValue);
  14225. case Animation.ANIMATIONTYPE_COLOR3:
  14226. this._offsetsCache[keyOffset] = toValue.subtract(fromValue);
  14227. default:
  14228. break;
  14229. }
  14230. this._highLimitsCache[keyOffset] = toValue;
  14231. }
  14232. highLimitValue = this._highLimitsCache[keyOffset];
  14233. offsetValue = this._offsetsCache[keyOffset];
  14234. }
  14235. }
  14236. if (offsetValue === undefined) {
  14237. switch (this.dataType) {
  14238. case Animation.ANIMATIONTYPE_FLOAT:
  14239. offsetValue = 0;
  14240. break;
  14241. case Animation.ANIMATIONTYPE_QUATERNION:
  14242. offsetValue = new BABYLON.Quaternion(0, 0, 0, 0);
  14243. break;
  14244. case Animation.ANIMATIONTYPE_VECTOR3:
  14245. offsetValue = BABYLON.Vector3.Zero();
  14246. break;
  14247. case Animation.ANIMATIONTYPE_VECTOR2:
  14248. offsetValue = BABYLON.Vector2.Zero();
  14249. break;
  14250. case Animation.ANIMATIONTYPE_COLOR3:
  14251. offsetValue = BABYLON.Color3.Black();
  14252. }
  14253. }
  14254. // Compute value
  14255. var repeatCount = (ratio / range) >> 0;
  14256. var currentFrame = returnValue ? from + ratio % range : to;
  14257. var currentValue = this._interpolate(currentFrame, repeatCount, this.loopMode, offsetValue, highLimitValue);
  14258. // Set value
  14259. if (this.targetPropertyPath.length > 1) {
  14260. var property = this._target[this.targetPropertyPath[0]];
  14261. for (var index = 1; index < this.targetPropertyPath.length - 1; index++) {
  14262. property = property[this.targetPropertyPath[index]];
  14263. }
  14264. property[this.targetPropertyPath[this.targetPropertyPath.length - 1]] = currentValue;
  14265. } else {
  14266. this._target[this.targetPropertyPath[0]] = currentValue;
  14267. }
  14268. if (this._target.markAsDirty) {
  14269. this._target.markAsDirty(this.targetProperty);
  14270. }
  14271. if (!returnValue) {
  14272. this._stopped = true;
  14273. }
  14274. return returnValue;
  14275. };
  14276. Object.defineProperty(Animation, "ANIMATIONTYPE_FLOAT", {
  14277. get: function () {
  14278. return Animation._ANIMATIONTYPE_FLOAT;
  14279. },
  14280. enumerable: true,
  14281. configurable: true
  14282. });
  14283. Object.defineProperty(Animation, "ANIMATIONTYPE_VECTOR3", {
  14284. get: function () {
  14285. return Animation._ANIMATIONTYPE_VECTOR3;
  14286. },
  14287. enumerable: true,
  14288. configurable: true
  14289. });
  14290. Object.defineProperty(Animation, "ANIMATIONTYPE_VECTOR2", {
  14291. get: function () {
  14292. return Animation._ANIMATIONTYPE_VECTOR2;
  14293. },
  14294. enumerable: true,
  14295. configurable: true
  14296. });
  14297. Object.defineProperty(Animation, "ANIMATIONTYPE_QUATERNION", {
  14298. get: function () {
  14299. return Animation._ANIMATIONTYPE_QUATERNION;
  14300. },
  14301. enumerable: true,
  14302. configurable: true
  14303. });
  14304. Object.defineProperty(Animation, "ANIMATIONTYPE_MATRIX", {
  14305. get: function () {
  14306. return Animation._ANIMATIONTYPE_MATRIX;
  14307. },
  14308. enumerable: true,
  14309. configurable: true
  14310. });
  14311. Object.defineProperty(Animation, "ANIMATIONTYPE_COLOR3", {
  14312. get: function () {
  14313. return Animation._ANIMATIONTYPE_COLOR3;
  14314. },
  14315. enumerable: true,
  14316. configurable: true
  14317. });
  14318. Object.defineProperty(Animation, "ANIMATIONLOOPMODE_RELATIVE", {
  14319. get: function () {
  14320. return Animation._ANIMATIONLOOPMODE_RELATIVE;
  14321. },
  14322. enumerable: true,
  14323. configurable: true
  14324. });
  14325. Object.defineProperty(Animation, "ANIMATIONLOOPMODE_CYCLE", {
  14326. get: function () {
  14327. return Animation._ANIMATIONLOOPMODE_CYCLE;
  14328. },
  14329. enumerable: true,
  14330. configurable: true
  14331. });
  14332. Object.defineProperty(Animation, "ANIMATIONLOOPMODE_CONSTANT", {
  14333. get: function () {
  14334. return Animation._ANIMATIONLOOPMODE_CONSTANT;
  14335. },
  14336. enumerable: true,
  14337. configurable: true
  14338. });
  14339. Animation._ANIMATIONTYPE_FLOAT = 0;
  14340. Animation._ANIMATIONTYPE_VECTOR3 = 1;
  14341. Animation._ANIMATIONTYPE_QUATERNION = 2;
  14342. Animation._ANIMATIONTYPE_MATRIX = 3;
  14343. Animation._ANIMATIONTYPE_COLOR3 = 4;
  14344. Animation._ANIMATIONTYPE_VECTOR2 = 5;
  14345. Animation._ANIMATIONLOOPMODE_RELATIVE = 0;
  14346. Animation._ANIMATIONLOOPMODE_CYCLE = 1;
  14347. Animation._ANIMATIONLOOPMODE_CONSTANT = 2;
  14348. return Animation;
  14349. })();
  14350. BABYLON.Animation = Animation;
  14351. })(BABYLON || (BABYLON = {}));
  14352. //# sourceMappingURL=babylon.animation.js.map
  14353. var BABYLON;
  14354. (function (BABYLON) {
  14355. var Animatable = (function () {
  14356. function Animatable(scene, target, fromFrame, toFrame, loopAnimation, speedRatio, onAnimationEnd, animations) {
  14357. if (typeof fromFrame === "undefined") { fromFrame = 0; }
  14358. if (typeof toFrame === "undefined") { toFrame = 100; }
  14359. if (typeof loopAnimation === "undefined") { loopAnimation = false; }
  14360. if (typeof speedRatio === "undefined") { speedRatio = 1.0; }
  14361. this.target = target;
  14362. this.fromFrame = fromFrame;
  14363. this.toFrame = toFrame;
  14364. this.loopAnimation = loopAnimation;
  14365. this.speedRatio = speedRatio;
  14366. this.onAnimationEnd = onAnimationEnd;
  14367. this._animations = new Array();
  14368. this._paused = false;
  14369. this.animationStarted = false;
  14370. if (animations) {
  14371. this.appendAnimations(target, animations);
  14372. }
  14373. this._scene = scene;
  14374. scene._activeAnimatables.push(this);
  14375. }
  14376. // Methods
  14377. Animatable.prototype.appendAnimations = function (target, animations) {
  14378. for (var index = 0; index < animations.length; index++) {
  14379. var animation = animations[index];
  14380. animation._target = target;
  14381. this._animations.push(animation);
  14382. }
  14383. };
  14384. Animatable.prototype.getAnimationByTargetProperty = function (property) {
  14385. var animations = this._animations;
  14386. for (var index = 0; index < animations.length; index++) {
  14387. if (animations[index].targetProperty === property) {
  14388. return animations[index];
  14389. }
  14390. }
  14391. return null;
  14392. };
  14393. Animatable.prototype.pause = function () {
  14394. if (this._paused) {
  14395. return;
  14396. }
  14397. this._paused = true;
  14398. };
  14399. Animatable.prototype.restart = function () {
  14400. this._paused = false;
  14401. };
  14402. Animatable.prototype.stop = function () {
  14403. var index = this._scene._activeAnimatables.indexOf(this);
  14404. if (index > -1) {
  14405. this._scene._activeAnimatables.splice(index, 1);
  14406. }
  14407. if (this.onAnimationEnd) {
  14408. this.onAnimationEnd();
  14409. }
  14410. };
  14411. Animatable.prototype._animate = function (delay) {
  14412. if (this._paused) {
  14413. if (!this._pausedDelay) {
  14414. this._pausedDelay = delay;
  14415. }
  14416. return true;
  14417. }
  14418. if (!this._localDelayOffset) {
  14419. this._localDelayOffset = delay;
  14420. } else if (this._pausedDelay) {
  14421. this._localDelayOffset += delay - this._pausedDelay;
  14422. this._pausedDelay = null;
  14423. }
  14424. // Animating
  14425. var running = false;
  14426. var animations = this._animations;
  14427. for (var index = 0; index < animations.length; index++) {
  14428. var animation = animations[index];
  14429. var isRunning = animation.animate(delay - this._localDelayOffset, this.fromFrame, this.toFrame, this.loopAnimation, this.speedRatio);
  14430. running = running || isRunning;
  14431. }
  14432. if (!running && this.onAnimationEnd) {
  14433. this.onAnimationEnd();
  14434. }
  14435. return running;
  14436. };
  14437. return Animatable;
  14438. })();
  14439. BABYLON.Animatable = Animatable;
  14440. })(BABYLON || (BABYLON = {}));
  14441. //# sourceMappingURL=babylon.animatable.js.map
  14442. var BABYLON;
  14443. (function (BABYLON) {
  14444. var EasingFunction = (function () {
  14445. function EasingFunction() {
  14446. // Properties
  14447. this._easingMode = EasingFunction.EASINGMODE_EASEIN;
  14448. }
  14449. Object.defineProperty(EasingFunction, "EASINGMODE_EASEIN", {
  14450. get: function () {
  14451. return EasingFunction._EASINGMODE_EASEIN;
  14452. },
  14453. enumerable: true,
  14454. configurable: true
  14455. });
  14456. Object.defineProperty(EasingFunction, "EASINGMODE_EASEOUT", {
  14457. get: function () {
  14458. return EasingFunction._EASINGMODE_EASEOUT;
  14459. },
  14460. enumerable: true,
  14461. configurable: true
  14462. });
  14463. Object.defineProperty(EasingFunction, "EASINGMODE_EASEINOUT", {
  14464. get: function () {
  14465. return EasingFunction._EASINGMODE_EASEINOUT;
  14466. },
  14467. enumerable: true,
  14468. configurable: true
  14469. });
  14470. EasingFunction.prototype.setEasingMode = function (easingMode) {
  14471. var n = Math.min(Math.max(easingMode, 0), 2);
  14472. this._easingMode = n;
  14473. };
  14474. EasingFunction.prototype.getEasingMode = function () {
  14475. return this._easingMode;
  14476. };
  14477. EasingFunction.prototype.easeInCore = function (gradient) {
  14478. throw new Error('You must implement this method');
  14479. };
  14480. EasingFunction.prototype.ease = function (gradient) {
  14481. switch (this._easingMode) {
  14482. case EasingFunction.EASINGMODE_EASEIN:
  14483. return this.easeInCore(gradient);
  14484. case EasingFunction.EASINGMODE_EASEOUT:
  14485. return (1 - this.easeInCore(1 - gradient));
  14486. }
  14487. if (gradient >= 0.5) {
  14488. return (((1 - this.easeInCore((1 - gradient) * 2)) * 0.5) + 0.5);
  14489. }
  14490. return (this.easeInCore(gradient * 2) * 0.5);
  14491. };
  14492. EasingFunction._EASINGMODE_EASEIN = 0;
  14493. EasingFunction._EASINGMODE_EASEOUT = 1;
  14494. EasingFunction._EASINGMODE_EASEINOUT = 2;
  14495. return EasingFunction;
  14496. })();
  14497. BABYLON.EasingFunction = EasingFunction;
  14498. var CircleEase = (function (_super) {
  14499. __extends(CircleEase, _super);
  14500. function CircleEase() {
  14501. _super.apply(this, arguments);
  14502. }
  14503. CircleEase.prototype.easeInCore = function (gradient) {
  14504. gradient = Math.max(0, Math.min(1, gradient));
  14505. return (1.0 - Math.sqrt(1.0 - (gradient * gradient)));
  14506. };
  14507. return CircleEase;
  14508. })(EasingFunction);
  14509. BABYLON.CircleEase = CircleEase;
  14510. var BackEase = (function (_super) {
  14511. __extends(BackEase, _super);
  14512. function BackEase(amplitude) {
  14513. if (typeof amplitude === "undefined") { amplitude = 1; }
  14514. _super.call(this);
  14515. this.amplitude = amplitude;
  14516. }
  14517. BackEase.prototype.easeInCore = function (gradient) {
  14518. var num = Math.max(0, this.amplitude);
  14519. return (Math.pow(gradient, 3.0) - ((gradient * num) * Math.sin(3.1415926535897931 * gradient)));
  14520. };
  14521. return BackEase;
  14522. })(EasingFunction);
  14523. BABYLON.BackEase = BackEase;
  14524. var BounceEase = (function (_super) {
  14525. __extends(BounceEase, _super);
  14526. function BounceEase(bounces, bounciness) {
  14527. if (typeof bounces === "undefined") { bounces = 3; }
  14528. if (typeof bounciness === "undefined") { bounciness = 2; }
  14529. _super.call(this);
  14530. this.bounces = bounces;
  14531. this.bounciness = bounciness;
  14532. }
  14533. BounceEase.prototype.easeInCore = function (gradient) {
  14534. var y = Math.max(0.0, this.bounces);
  14535. var bounciness = this.bounciness;
  14536. if (bounciness <= 1.0) {
  14537. bounciness = 1.001;
  14538. }
  14539. var num9 = Math.pow(bounciness, y);
  14540. var num5 = 1.0 - bounciness;
  14541. var num4 = ((1.0 - num9) / num5) + (num9 * 0.5);
  14542. var num15 = gradient * num4;
  14543. var num65 = Math.log((-num15 * (1.0 - bounciness)) + 1.0) / Math.log(bounciness);
  14544. var num3 = Math.floor(num65);
  14545. var num13 = num3 + 1.0;
  14546. var num8 = (1.0 - Math.pow(bounciness, num3)) / (num5 * num4);
  14547. var num12 = (1.0 - Math.pow(bounciness, num13)) / (num5 * num4);
  14548. var num7 = (num8 + num12) * 0.5;
  14549. var num6 = gradient - num7;
  14550. var num2 = num7 - num8;
  14551. return (((-Math.pow(1.0 / bounciness, y - num3) / (num2 * num2)) * (num6 - num2)) * (num6 + num2));
  14552. };
  14553. return BounceEase;
  14554. })(EasingFunction);
  14555. BABYLON.BounceEase = BounceEase;
  14556. var CubicEase = (function (_super) {
  14557. __extends(CubicEase, _super);
  14558. function CubicEase() {
  14559. _super.apply(this, arguments);
  14560. }
  14561. CubicEase.prototype.easeInCore = function (gradient) {
  14562. return (gradient * gradient * gradient);
  14563. };
  14564. return CubicEase;
  14565. })(EasingFunction);
  14566. BABYLON.CubicEase = CubicEase;
  14567. var ElasticEase = (function (_super) {
  14568. __extends(ElasticEase, _super);
  14569. function ElasticEase(oscillations, springiness) {
  14570. if (typeof oscillations === "undefined") { oscillations = 3; }
  14571. if (typeof springiness === "undefined") { springiness = 3; }
  14572. _super.call(this);
  14573. this.oscillations = oscillations;
  14574. this.springiness = springiness;
  14575. }
  14576. ElasticEase.prototype.easeInCore = function (gradient) {
  14577. var num2;
  14578. var num3 = Math.max(0.0, this.oscillations);
  14579. var num = Math.max(0.0, this.springiness);
  14580. if (num == 0) {
  14581. num2 = gradient;
  14582. } else {
  14583. num2 = (Math.exp(num * gradient) - 1.0) / (Math.exp(num) - 1.0);
  14584. }
  14585. return (num2 * Math.sin(((6.2831853071795862 * num3) + 1.5707963267948966) * gradient));
  14586. };
  14587. return ElasticEase;
  14588. })(EasingFunction);
  14589. BABYLON.ElasticEase = ElasticEase;
  14590. var ExponentialEase = (function (_super) {
  14591. __extends(ExponentialEase, _super);
  14592. function ExponentialEase(exponent) {
  14593. if (typeof exponent === "undefined") { exponent = 2; }
  14594. _super.call(this);
  14595. this.exponent = exponent;
  14596. }
  14597. ExponentialEase.prototype.easeInCore = function (gradient) {
  14598. if (this.exponent <= 0) {
  14599. return gradient;
  14600. }
  14601. return ((Math.exp(this.exponent * gradient) - 1.0) / (Math.exp(this.exponent) - 1.0));
  14602. };
  14603. return ExponentialEase;
  14604. })(EasingFunction);
  14605. BABYLON.ExponentialEase = ExponentialEase;
  14606. var PowerEase = (function (_super) {
  14607. __extends(PowerEase, _super);
  14608. function PowerEase(power) {
  14609. if (typeof power === "undefined") { power = 2; }
  14610. _super.call(this);
  14611. this.power = power;
  14612. }
  14613. PowerEase.prototype.easeInCore = function (gradient) {
  14614. var y = Math.max(0.0, this.power);
  14615. return Math.pow(gradient, y);
  14616. };
  14617. return PowerEase;
  14618. })(EasingFunction);
  14619. BABYLON.PowerEase = PowerEase;
  14620. var QuadraticEase = (function (_super) {
  14621. __extends(QuadraticEase, _super);
  14622. function QuadraticEase() {
  14623. _super.apply(this, arguments);
  14624. }
  14625. QuadraticEase.prototype.easeInCore = function (gradient) {
  14626. return (gradient * gradient);
  14627. };
  14628. return QuadraticEase;
  14629. })(EasingFunction);
  14630. BABYLON.QuadraticEase = QuadraticEase;
  14631. var QuarticEase = (function (_super) {
  14632. __extends(QuarticEase, _super);
  14633. function QuarticEase() {
  14634. _super.apply(this, arguments);
  14635. }
  14636. QuarticEase.prototype.easeInCore = function (gradient) {
  14637. return (gradient * gradient * gradient * gradient);
  14638. };
  14639. return QuarticEase;
  14640. })(EasingFunction);
  14641. BABYLON.QuarticEase = QuarticEase;
  14642. var QuinticEase = (function (_super) {
  14643. __extends(QuinticEase, _super);
  14644. function QuinticEase() {
  14645. _super.apply(this, arguments);
  14646. }
  14647. QuinticEase.prototype.easeInCore = function (gradient) {
  14648. return (gradient * gradient * gradient * gradient * gradient);
  14649. };
  14650. return QuinticEase;
  14651. })(EasingFunction);
  14652. BABYLON.QuinticEase = QuinticEase;
  14653. var SineEase = (function (_super) {
  14654. __extends(SineEase, _super);
  14655. function SineEase() {
  14656. _super.apply(this, arguments);
  14657. }
  14658. SineEase.prototype.easeInCore = function (gradient) {
  14659. return (1.0 - Math.sin(1.5707963267948966 * (1.0 - gradient)));
  14660. };
  14661. return SineEase;
  14662. })(EasingFunction);
  14663. BABYLON.SineEase = SineEase;
  14664. var BezierCurveEase = (function (_super) {
  14665. __extends(BezierCurveEase, _super);
  14666. function BezierCurveEase(x1, y1, x2, y2) {
  14667. if (typeof x1 === "undefined") { x1 = 0; }
  14668. if (typeof y1 === "undefined") { y1 = 0; }
  14669. if (typeof x2 === "undefined") { x2 = 1; }
  14670. if (typeof y2 === "undefined") { y2 = 1; }
  14671. _super.call(this);
  14672. this.x1 = x1;
  14673. this.y1 = y1;
  14674. this.x2 = x2;
  14675. this.y2 = y2;
  14676. }
  14677. BezierCurveEase.prototype.easeInCore = function (gradient) {
  14678. return BABYLON.BezierCurve.interpolate(gradient, this.x1, this.y1, this.x2, this.y2);
  14679. };
  14680. return BezierCurveEase;
  14681. })(EasingFunction);
  14682. BABYLON.BezierCurveEase = BezierCurveEase;
  14683. })(BABYLON || (BABYLON = {}));
  14684. //# sourceMappingURL=babylon.easing.js.map
  14685. var BABYLON;
  14686. (function (BABYLON) {
  14687. var Octree = (function () {
  14688. function Octree(creationFunc, maxBlockCapacity, maxDepth) {
  14689. if (typeof maxDepth === "undefined") { maxDepth = 2; }
  14690. this.maxDepth = maxDepth;
  14691. this.dynamicContent = new Array();
  14692. this._maxBlockCapacity = maxBlockCapacity || 64;
  14693. this._selectionContent = new BABYLON.SmartArray(1024);
  14694. this._creationFunc = creationFunc;
  14695. }
  14696. // Methods
  14697. Octree.prototype.update = function (worldMin, worldMax, entries) {
  14698. Octree._CreateBlocks(worldMin, worldMax, entries, this._maxBlockCapacity, 0, this.maxDepth, this, this._creationFunc);
  14699. };
  14700. Octree.prototype.addMesh = function (entry) {
  14701. for (var index = 0; index < this.blocks.length; index++) {
  14702. var block = this.blocks[index];
  14703. block.addEntry(entry);
  14704. }
  14705. };
  14706. Octree.prototype.select = function (frustumPlanes, allowDuplicate) {
  14707. this._selectionContent.reset();
  14708. for (var index = 0; index < this.blocks.length; index++) {
  14709. var block = this.blocks[index];
  14710. block.select(frustumPlanes, this._selectionContent, allowDuplicate);
  14711. }
  14712. if (allowDuplicate) {
  14713. this._selectionContent.concat(this.dynamicContent);
  14714. } else {
  14715. this._selectionContent.concatWithNoDuplicate(this.dynamicContent);
  14716. }
  14717. return this._selectionContent;
  14718. };
  14719. Octree.prototype.intersects = function (sphereCenter, sphereRadius, allowDuplicate) {
  14720. this._selectionContent.reset();
  14721. for (var index = 0; index < this.blocks.length; index++) {
  14722. var block = this.blocks[index];
  14723. block.intersects(sphereCenter, sphereRadius, this._selectionContent, allowDuplicate);
  14724. }
  14725. if (allowDuplicate) {
  14726. this._selectionContent.concat(this.dynamicContent);
  14727. } else {
  14728. this._selectionContent.concatWithNoDuplicate(this.dynamicContent);
  14729. }
  14730. return this._selectionContent;
  14731. };
  14732. Octree.prototype.intersectsRay = function (ray) {
  14733. this._selectionContent.reset();
  14734. for (var index = 0; index < this.blocks.length; index++) {
  14735. var block = this.blocks[index];
  14736. block.intersectsRay(ray, this._selectionContent);
  14737. }
  14738. this._selectionContent.concatWithNoDuplicate(this.dynamicContent);
  14739. return this._selectionContent;
  14740. };
  14741. Octree._CreateBlocks = function (worldMin, worldMax, entries, maxBlockCapacity, currentDepth, maxDepth, target, creationFunc) {
  14742. target.blocks = new Array();
  14743. var blockSize = new BABYLON.Vector3((worldMax.x - worldMin.x) / 2, (worldMax.y - worldMin.y) / 2, (worldMax.z - worldMin.z) / 2);
  14744. for (var x = 0; x < 2; x++) {
  14745. for (var y = 0; y < 2; y++) {
  14746. for (var z = 0; z < 2; z++) {
  14747. var localMin = worldMin.add(blockSize.multiplyByFloats(x, y, z));
  14748. var localMax = worldMin.add(blockSize.multiplyByFloats(x + 1, y + 1, z + 1));
  14749. var block = new BABYLON.OctreeBlock(localMin, localMax, maxBlockCapacity, currentDepth + 1, maxDepth, creationFunc);
  14750. block.addEntries(entries);
  14751. target.blocks.push(block);
  14752. }
  14753. }
  14754. }
  14755. };
  14756. Octree.CreationFuncForMeshes = function (entry, block) {
  14757. if (!entry.isBlocked && entry.getBoundingInfo().boundingBox.intersectsMinMax(block.minPoint, block.maxPoint)) {
  14758. block.entries.push(entry);
  14759. }
  14760. };
  14761. Octree.CreationFuncForSubMeshes = function (entry, block) {
  14762. if (entry.getBoundingInfo().boundingBox.intersectsMinMax(block.minPoint, block.maxPoint)) {
  14763. block.entries.push(entry);
  14764. }
  14765. };
  14766. return Octree;
  14767. })();
  14768. BABYLON.Octree = Octree;
  14769. })(BABYLON || (BABYLON = {}));
  14770. //# sourceMappingURL=babylon.octree.js.map
  14771. var BABYLON;
  14772. (function (BABYLON) {
  14773. var OctreeBlock = (function () {
  14774. function OctreeBlock(minPoint, maxPoint, capacity, depth, maxDepth, creationFunc) {
  14775. this.entries = new Array();
  14776. this._boundingVectors = new Array();
  14777. this._capacity = capacity;
  14778. this._depth = depth;
  14779. this._maxDepth = maxDepth;
  14780. this._creationFunc = creationFunc;
  14781. this._minPoint = minPoint;
  14782. this._maxPoint = maxPoint;
  14783. this._boundingVectors.push(minPoint.clone());
  14784. this._boundingVectors.push(maxPoint.clone());
  14785. this._boundingVectors.push(minPoint.clone());
  14786. this._boundingVectors[2].x = maxPoint.x;
  14787. this._boundingVectors.push(minPoint.clone());
  14788. this._boundingVectors[3].y = maxPoint.y;
  14789. this._boundingVectors.push(minPoint.clone());
  14790. this._boundingVectors[4].z = maxPoint.z;
  14791. this._boundingVectors.push(maxPoint.clone());
  14792. this._boundingVectors[5].z = minPoint.z;
  14793. this._boundingVectors.push(maxPoint.clone());
  14794. this._boundingVectors[6].x = minPoint.x;
  14795. this._boundingVectors.push(maxPoint.clone());
  14796. this._boundingVectors[7].y = minPoint.y;
  14797. }
  14798. Object.defineProperty(OctreeBlock.prototype, "capacity", {
  14799. // Property
  14800. get: function () {
  14801. return this._capacity;
  14802. },
  14803. enumerable: true,
  14804. configurable: true
  14805. });
  14806. Object.defineProperty(OctreeBlock.prototype, "minPoint", {
  14807. get: function () {
  14808. return this._minPoint;
  14809. },
  14810. enumerable: true,
  14811. configurable: true
  14812. });
  14813. Object.defineProperty(OctreeBlock.prototype, "maxPoint", {
  14814. get: function () {
  14815. return this._maxPoint;
  14816. },
  14817. enumerable: true,
  14818. configurable: true
  14819. });
  14820. // Methods
  14821. OctreeBlock.prototype.addEntry = function (entry) {
  14822. if (this.blocks) {
  14823. for (var index = 0; index < this.blocks.length; index++) {
  14824. var block = this.blocks[index];
  14825. block.addEntry(entry);
  14826. }
  14827. return;
  14828. }
  14829. this._creationFunc(entry, this);
  14830. if (this.entries.length > this.capacity && this._depth < this._maxDepth) {
  14831. this.createInnerBlocks();
  14832. }
  14833. };
  14834. OctreeBlock.prototype.addEntries = function (entries) {
  14835. for (var index = 0; index < entries.length; index++) {
  14836. var mesh = entries[index];
  14837. this.addEntry(mesh);
  14838. }
  14839. };
  14840. OctreeBlock.prototype.select = function (frustumPlanes, selection, allowDuplicate) {
  14841. if (BABYLON.BoundingBox.IsInFrustum(this._boundingVectors, frustumPlanes)) {
  14842. if (this.blocks) {
  14843. for (var index = 0; index < this.blocks.length; index++) {
  14844. var block = this.blocks[index];
  14845. block.select(frustumPlanes, selection, allowDuplicate);
  14846. }
  14847. return;
  14848. }
  14849. if (allowDuplicate) {
  14850. selection.concat(this.entries);
  14851. } else {
  14852. selection.concatWithNoDuplicate(this.entries);
  14853. }
  14854. }
  14855. };
  14856. OctreeBlock.prototype.intersects = function (sphereCenter, sphereRadius, selection, allowDuplicate) {
  14857. if (BABYLON.BoundingBox.IntersectsSphere(this._minPoint, this._maxPoint, sphereCenter, sphereRadius)) {
  14858. if (this.blocks) {
  14859. for (var index = 0; index < this.blocks.length; index++) {
  14860. var block = this.blocks[index];
  14861. block.intersects(sphereCenter, sphereRadius, selection, allowDuplicate);
  14862. }
  14863. return;
  14864. }
  14865. if (allowDuplicate) {
  14866. selection.concat(this.entries);
  14867. } else {
  14868. selection.concatWithNoDuplicate(this.entries);
  14869. }
  14870. }
  14871. };
  14872. OctreeBlock.prototype.intersectsRay = function (ray, selection) {
  14873. if (ray.intersectsBoxMinMax(this._minPoint, this._maxPoint)) {
  14874. if (this.blocks) {
  14875. for (var index = 0; index < this.blocks.length; index++) {
  14876. var block = this.blocks[index];
  14877. block.intersectsRay(ray, selection);
  14878. }
  14879. return;
  14880. }
  14881. selection.concatWithNoDuplicate(this.entries);
  14882. }
  14883. };
  14884. OctreeBlock.prototype.createInnerBlocks = function () {
  14885. BABYLON.Octree._CreateBlocks(this._minPoint, this._maxPoint, this.entries, this._capacity, this._depth, this._maxDepth, this, this._creationFunc);
  14886. };
  14887. return OctreeBlock;
  14888. })();
  14889. BABYLON.OctreeBlock = OctreeBlock;
  14890. })(BABYLON || (BABYLON = {}));
  14891. //# sourceMappingURL=babylon.octreeBlock.js.map
  14892. var BABYLON;
  14893. (function (BABYLON) {
  14894. var Bone = (function () {
  14895. function Bone(name, skeleton, parentBone, matrix) {
  14896. this.name = name;
  14897. this.children = new Array();
  14898. this.animations = new Array();
  14899. this._worldTransform = new BABYLON.Matrix();
  14900. this._absoluteTransform = new BABYLON.Matrix();
  14901. this._invertedAbsoluteTransform = new BABYLON.Matrix();
  14902. this._skeleton = skeleton;
  14903. this._matrix = matrix;
  14904. this._baseMatrix = matrix;
  14905. skeleton.bones.push(this);
  14906. if (parentBone) {
  14907. this._parent = parentBone;
  14908. parentBone.children.push(this);
  14909. } else {
  14910. this._parent = null;
  14911. }
  14912. this._updateDifferenceMatrix();
  14913. }
  14914. // Members
  14915. Bone.prototype.getParent = function () {
  14916. return this._parent;
  14917. };
  14918. Bone.prototype.getLocalMatrix = function () {
  14919. return this._matrix;
  14920. };
  14921. Bone.prototype.getBaseMatrix = function () {
  14922. return this._baseMatrix;
  14923. };
  14924. Bone.prototype.getWorldMatrix = function () {
  14925. return this._worldTransform;
  14926. };
  14927. Bone.prototype.getInvertedAbsoluteTransform = function () {
  14928. return this._invertedAbsoluteTransform;
  14929. };
  14930. Bone.prototype.getAbsoluteMatrix = function () {
  14931. var matrix = this._matrix.clone();
  14932. var parent = this._parent;
  14933. while (parent) {
  14934. matrix = matrix.multiply(parent.getLocalMatrix());
  14935. parent = parent.getParent();
  14936. }
  14937. return matrix;
  14938. };
  14939. // Methods
  14940. Bone.prototype.updateMatrix = function (matrix) {
  14941. this._matrix = matrix;
  14942. this._skeleton._markAsDirty();
  14943. this._updateDifferenceMatrix();
  14944. };
  14945. Bone.prototype._updateDifferenceMatrix = function () {
  14946. if (this._parent) {
  14947. this._matrix.multiplyToRef(this._parent._absoluteTransform, this._absoluteTransform);
  14948. } else {
  14949. this._absoluteTransform.copyFrom(this._matrix);
  14950. }
  14951. this._absoluteTransform.invertToRef(this._invertedAbsoluteTransform);
  14952. for (var index = 0; index < this.children.length; index++) {
  14953. this.children[index]._updateDifferenceMatrix();
  14954. }
  14955. };
  14956. Bone.prototype.markAsDirty = function () {
  14957. this._skeleton._markAsDirty();
  14958. };
  14959. return Bone;
  14960. })();
  14961. BABYLON.Bone = Bone;
  14962. })(BABYLON || (BABYLON = {}));
  14963. //# sourceMappingURL=babylon.bone.js.map
  14964. var BABYLON;
  14965. (function (BABYLON) {
  14966. var Skeleton = (function () {
  14967. function Skeleton(name, id, scene) {
  14968. this.name = name;
  14969. this.id = id;
  14970. this.bones = new Array();
  14971. this._isDirty = true;
  14972. this._identity = BABYLON.Matrix.Identity();
  14973. this.bones = [];
  14974. this._scene = scene;
  14975. scene.skeletons.push(this);
  14976. }
  14977. // Members
  14978. Skeleton.prototype.getTransformMatrices = function () {
  14979. return this._transformMatrices;
  14980. };
  14981. // Methods
  14982. Skeleton.prototype._markAsDirty = function () {
  14983. this._isDirty = true;
  14984. };
  14985. Skeleton.prototype.prepare = function () {
  14986. if (!this._isDirty) {
  14987. return;
  14988. }
  14989. if (!this._transformMatrices || this._transformMatrices.length !== 16 * (this.bones.length + 1)) {
  14990. this._transformMatrices = new Float32Array(16 * (this.bones.length + 1));
  14991. }
  14992. for (var index = 0; index < this.bones.length; index++) {
  14993. var bone = this.bones[index];
  14994. var parentBone = bone.getParent();
  14995. if (parentBone) {
  14996. bone.getLocalMatrix().multiplyToRef(parentBone.getWorldMatrix(), bone.getWorldMatrix());
  14997. } else {
  14998. bone.getWorldMatrix().copyFrom(bone.getLocalMatrix());
  14999. }
  15000. bone.getInvertedAbsoluteTransform().multiplyToArray(bone.getWorldMatrix(), this._transformMatrices, index * 16);
  15001. }
  15002. this._identity.copyToArray(this._transformMatrices, this.bones.length * 16);
  15003. this._isDirty = false;
  15004. };
  15005. Skeleton.prototype.getAnimatables = function () {
  15006. if (!this._animatables || this._animatables.length != this.bones.length) {
  15007. this._animatables = [];
  15008. for (var index = 0; index < this.bones.length; index++) {
  15009. this._animatables.push(this.bones[index]);
  15010. }
  15011. }
  15012. return this._animatables;
  15013. };
  15014. Skeleton.prototype.clone = function (name, id) {
  15015. var result = new BABYLON.Skeleton(name, id || name, this._scene);
  15016. for (var index = 0; index < this.bones.length; index++) {
  15017. var source = this.bones[index];
  15018. var parentBone = null;
  15019. if (source.getParent()) {
  15020. var parentIndex = this.bones.indexOf(source.getParent());
  15021. parentBone = result.bones[parentIndex];
  15022. }
  15023. var bone = new BABYLON.Bone(source.name, result, parentBone, source.getBaseMatrix());
  15024. BABYLON.Tools.DeepCopy(source.animations, bone.animations);
  15025. }
  15026. return result;
  15027. };
  15028. return Skeleton;
  15029. })();
  15030. BABYLON.Skeleton = Skeleton;
  15031. })(BABYLON || (BABYLON = {}));
  15032. //# sourceMappingURL=babylon.skeleton.js.map
  15033. var BABYLON;
  15034. (function (BABYLON) {
  15035. var PostProcess = (function () {
  15036. function PostProcess(name, fragmentUrl, parameters, samplers, ratio, camera, samplingMode, engine, reusable) {
  15037. this.name = name;
  15038. this.width = -1;
  15039. this.height = -1;
  15040. this._reusable = false;
  15041. this._textures = new BABYLON.SmartArray(2);
  15042. this._currentRenderTextureInd = 0;
  15043. if (camera != null) {
  15044. this._camera = camera;
  15045. this._scene = camera.getScene();
  15046. camera.attachPostProcess(this);
  15047. this._engine = this._scene.getEngine();
  15048. } else {
  15049. this._engine = engine;
  15050. }
  15051. this._renderRatio = ratio;
  15052. this.renderTargetSamplingMode = samplingMode ? samplingMode : BABYLON.Texture.NEAREST_SAMPLINGMODE;
  15053. this._reusable = reusable || false;
  15054. samplers = samplers || [];
  15055. samplers.push("textureSampler");
  15056. this._effect = this._engine.createEffect({ vertex: "postprocess", fragment: fragmentUrl }, ["position"], parameters || [], samplers, "");
  15057. }
  15058. PostProcess.prototype.isReusable = function () {
  15059. return this._reusable;
  15060. };
  15061. PostProcess.prototype.activate = function (camera, sourceTexture) {
  15062. camera = camera || this._camera;
  15063. var scene = camera.getScene();
  15064. var maxSize = camera.getEngine().getCaps().maxTextureSize;
  15065. var desiredWidth = ((sourceTexture ? sourceTexture._width : this._engine.getRenderingCanvas().width) * this._renderRatio) | 0;
  15066. var desiredHeight = ((sourceTexture ? sourceTexture._height : this._engine.getRenderingCanvas().height) * this._renderRatio) | 0;
  15067. desiredWidth = BABYLON.Tools.GetExponantOfTwo(desiredWidth, maxSize);
  15068. desiredHeight = BABYLON.Tools.GetExponantOfTwo(desiredHeight, maxSize);
  15069. if (this.width !== desiredWidth || this.height !== desiredHeight) {
  15070. if (this._textures.length > 0) {
  15071. for (var i = 0; i < this._textures.length; i++) {
  15072. this._engine._releaseTexture(this._textures.data[i]);
  15073. }
  15074. this._textures.reset();
  15075. }
  15076. this.width = desiredWidth;
  15077. this.height = desiredHeight;
  15078. this._textures.push(this._engine.createRenderTargetTexture({ width: this.width, height: this.height }, { generateMipMaps: false, generateDepthBuffer: camera._postProcesses.indexOf(this) === camera._postProcessesTakenIndices[0], samplingMode: this.renderTargetSamplingMode }));
  15079. if (this._reusable) {
  15080. this._textures.push(this._engine.createRenderTargetTexture({ width: this.width, height: this.height }, { generateMipMaps: false, generateDepthBuffer: camera._postProcesses.indexOf(this) === camera._postProcessesTakenIndices[0], samplingMode: this.renderTargetSamplingMode }));
  15081. }
  15082. if (this.onSizeChanged) {
  15083. this.onSizeChanged();
  15084. }
  15085. }
  15086. this._engine.bindFramebuffer(this._textures.data[this._currentRenderTextureInd]);
  15087. if (this.onActivate) {
  15088. this.onActivate(camera);
  15089. }
  15090. // Clear
  15091. this._engine.clear(scene.clearColor, scene.autoClear || scene.forceWireframe, true);
  15092. if (this._reusable) {
  15093. this._currentRenderTextureInd = (this._currentRenderTextureInd + 1) % 2;
  15094. }
  15095. };
  15096. PostProcess.prototype.apply = function () {
  15097. // Check
  15098. if (!this._effect.isReady())
  15099. return null;
  15100. // States
  15101. this._engine.enableEffect(this._effect);
  15102. this._engine.setState(false);
  15103. this._engine.setAlphaMode(BABYLON.Engine.ALPHA_DISABLE);
  15104. this._engine.setDepthBuffer(false);
  15105. this._engine.setDepthWrite(false);
  15106. // Texture
  15107. this._effect._bindTexture("textureSampler", this._textures.data[this._currentRenderTextureInd]);
  15108. // Parameters
  15109. if (this.onApply) {
  15110. this.onApply(this._effect);
  15111. }
  15112. return this._effect;
  15113. };
  15114. PostProcess.prototype.dispose = function (camera) {
  15115. camera = camera || this._camera;
  15116. if (this._textures.length > 0) {
  15117. for (var i = 0; i < this._textures.length; i++) {
  15118. this._engine._releaseTexture(this._textures.data[i]);
  15119. }
  15120. this._textures.reset();
  15121. }
  15122. camera.detachPostProcess(this);
  15123. var index = camera._postProcesses.indexOf(this);
  15124. if (index === camera._postProcessesTakenIndices[0] && camera._postProcessesTakenIndices.length > 0) {
  15125. this._camera._postProcesses[camera._postProcessesTakenIndices[0]].width = -1; // invalidate frameBuffer to hint the postprocess to create a depth buffer
  15126. }
  15127. };
  15128. return PostProcess;
  15129. })();
  15130. BABYLON.PostProcess = PostProcess;
  15131. })(BABYLON || (BABYLON = {}));
  15132. //# sourceMappingURL=babylon.postProcess.js.map
  15133. var BABYLON;
  15134. (function (BABYLON) {
  15135. var PostProcessManager = (function () {
  15136. function PostProcessManager(scene) {
  15137. this._vertexDeclaration = [2];
  15138. this._vertexStrideSize = 2 * 4;
  15139. this._scene = scene;
  15140. // VBO
  15141. var vertices = [];
  15142. vertices.push(1, 1);
  15143. vertices.push(-1, 1);
  15144. vertices.push(-1, -1);
  15145. vertices.push(1, -1);
  15146. this._vertexBuffer = scene.getEngine().createVertexBuffer(vertices);
  15147. // Indices
  15148. var indices = [];
  15149. indices.push(0);
  15150. indices.push(1);
  15151. indices.push(2);
  15152. indices.push(0);
  15153. indices.push(2);
  15154. indices.push(3);
  15155. this._indexBuffer = scene.getEngine().createIndexBuffer(indices);
  15156. }
  15157. // Methods
  15158. PostProcessManager.prototype._prepareFrame = function (sourceTexture) {
  15159. var postProcesses = this._scene.activeCamera._postProcesses;
  15160. var postProcessesTakenIndices = this._scene.activeCamera._postProcessesTakenIndices;
  15161. if (postProcessesTakenIndices.length === 0 || !this._scene.postProcessesEnabled) {
  15162. return false;
  15163. }
  15164. postProcesses[this._scene.activeCamera._postProcessesTakenIndices[0]].activate(this._scene.activeCamera, sourceTexture);
  15165. return true;
  15166. };
  15167. PostProcessManager.prototype._finalizeFrame = function (doNotPresent, targetTexture) {
  15168. var postProcesses = this._scene.activeCamera._postProcesses;
  15169. var postProcessesTakenIndices = this._scene.activeCamera._postProcessesTakenIndices;
  15170. if (postProcessesTakenIndices.length === 0 || !this._scene.postProcessesEnabled) {
  15171. return;
  15172. }
  15173. var engine = this._scene.getEngine();
  15174. for (var index = 0; index < postProcessesTakenIndices.length; index++) {
  15175. if (index < postProcessesTakenIndices.length - 1) {
  15176. postProcesses[postProcessesTakenIndices[index + 1]].activate(this._scene.activeCamera);
  15177. } else {
  15178. if (targetTexture) {
  15179. engine.bindFramebuffer(targetTexture);
  15180. } else {
  15181. engine.restoreDefaultFramebuffer();
  15182. }
  15183. }
  15184. if (doNotPresent) {
  15185. break;
  15186. }
  15187. var pp = postProcesses[postProcessesTakenIndices[index]];
  15188. var effect = pp.apply();
  15189. if (effect) {
  15190. if (pp.onBeforeRender) {
  15191. pp.onBeforeRender(effect);
  15192. }
  15193. // VBOs
  15194. engine.bindBuffers(this._vertexBuffer, this._indexBuffer, this._vertexDeclaration, this._vertexStrideSize, effect);
  15195. // Draw order
  15196. engine.draw(true, 0, 6);
  15197. }
  15198. }
  15199. // Restore depth buffer
  15200. engine.setDepthBuffer(true);
  15201. engine.setDepthWrite(true);
  15202. };
  15203. PostProcessManager.prototype.dispose = function () {
  15204. if (this._vertexBuffer) {
  15205. this._scene.getEngine()._releaseBuffer(this._vertexBuffer);
  15206. this._vertexBuffer = null;
  15207. }
  15208. if (this._indexBuffer) {
  15209. this._scene.getEngine()._releaseBuffer(this._indexBuffer);
  15210. this._indexBuffer = null;
  15211. }
  15212. };
  15213. return PostProcessManager;
  15214. })();
  15215. BABYLON.PostProcessManager = PostProcessManager;
  15216. })(BABYLON || (BABYLON = {}));
  15217. //# sourceMappingURL=babylon.postProcessManager.js.map
  15218. var BABYLON;
  15219. (function (BABYLON) {
  15220. var PassPostProcess = (function (_super) {
  15221. __extends(PassPostProcess, _super);
  15222. function PassPostProcess(name, ratio, camera, samplingMode, engine, reusable) {
  15223. _super.call(this, name, "pass", null, null, ratio, camera, samplingMode, engine, reusable);
  15224. }
  15225. return PassPostProcess;
  15226. })(BABYLON.PostProcess);
  15227. BABYLON.PassPostProcess = PassPostProcess;
  15228. })(BABYLON || (BABYLON = {}));
  15229. //# sourceMappingURL=babylon.passPostProcess.js.map
  15230. var BABYLON;
  15231. (function (BABYLON) {
  15232. var BlurPostProcess = (function (_super) {
  15233. __extends(BlurPostProcess, _super);
  15234. function BlurPostProcess(name, direction, blurWidth, ratio, camera, samplingMode, engine, reusable) {
  15235. if (typeof samplingMode === "undefined") { samplingMode = BABYLON.Texture.BILINEAR_SAMPLINGMODE; }
  15236. var _this = this;
  15237. _super.call(this, name, "blur", ["screenSize", "direction", "blurWidth"], null, ratio, camera, samplingMode, engine, reusable);
  15238. this.direction = direction;
  15239. this.blurWidth = blurWidth;
  15240. this.onApply = function (effect) {
  15241. effect.setFloat2("screenSize", _this.width, _this.height);
  15242. effect.setVector2("direction", _this.direction);
  15243. effect.setFloat("blurWidth", _this.blurWidth);
  15244. };
  15245. }
  15246. return BlurPostProcess;
  15247. })(BABYLON.PostProcess);
  15248. BABYLON.BlurPostProcess = BlurPostProcess;
  15249. })(BABYLON || (BABYLON = {}));
  15250. //# sourceMappingURL=babylon.blurPostProcess.js.map
  15251. var BABYLON;
  15252. (function (BABYLON) {
  15253. var FilterPostProcess = (function (_super) {
  15254. __extends(FilterPostProcess, _super);
  15255. function FilterPostProcess(name, kernelMatrix, ratio, camera, samplingMode, engine, reusable) {
  15256. var _this = this;
  15257. _super.call(this, name, "filter", ["kernelMatrix"], null, ratio, camera, samplingMode, engine, reusable);
  15258. this.kernelMatrix = kernelMatrix;
  15259. this.onApply = function (effect) {
  15260. effect.setMatrix("kernelMatrix", _this.kernelMatrix);
  15261. };
  15262. }
  15263. return FilterPostProcess;
  15264. })(BABYLON.PostProcess);
  15265. BABYLON.FilterPostProcess = FilterPostProcess;
  15266. })(BABYLON || (BABYLON = {}));
  15267. //# sourceMappingURL=babylon.filterPostProcess.js.map
  15268. var BABYLON;
  15269. (function (BABYLON) {
  15270. var RefractionPostProcess = (function (_super) {
  15271. __extends(RefractionPostProcess, _super);
  15272. function RefractionPostProcess(name, refractionTextureUrl, color, depth, colorLevel, ratio, camera, samplingMode, engine, reusable) {
  15273. var _this = this;
  15274. _super.call(this, name, "refraction", ["baseColor", "depth", "colorLevel"], ["refractionSampler"], ratio, camera, samplingMode, engine, reusable);
  15275. this.color = color;
  15276. this.depth = depth;
  15277. this.colorLevel = colorLevel;
  15278. this.onActivate = function (cam) {
  15279. _this._refRexture = _this._refRexture || new BABYLON.Texture(refractionTextureUrl, cam.getScene());
  15280. };
  15281. this.onApply = function (effect) {
  15282. effect.setColor3("baseColor", _this.color);
  15283. effect.setFloat("depth", _this.depth);
  15284. effect.setFloat("colorLevel", _this.colorLevel);
  15285. effect.setTexture("refractionSampler", _this._refRexture);
  15286. };
  15287. }
  15288. // Methods
  15289. RefractionPostProcess.prototype.dispose = function (camera) {
  15290. if (this._refRexture) {
  15291. this._refRexture.dispose();
  15292. }
  15293. _super.prototype.dispose.call(this, camera);
  15294. };
  15295. return RefractionPostProcess;
  15296. })(BABYLON.PostProcess);
  15297. BABYLON.RefractionPostProcess = RefractionPostProcess;
  15298. })(BABYLON || (BABYLON = {}));
  15299. //# sourceMappingURL=babylon.refractionPostProcess.js.map
  15300. var BABYLON;
  15301. (function (BABYLON) {
  15302. var BlackAndWhitePostProcess = (function (_super) {
  15303. __extends(BlackAndWhitePostProcess, _super);
  15304. function BlackAndWhitePostProcess(name, ratio, camera, samplingMode, engine, reusable) {
  15305. _super.call(this, name, "blackAndWhite", null, null, ratio, camera, samplingMode, engine, reusable);
  15306. }
  15307. return BlackAndWhitePostProcess;
  15308. })(BABYLON.PostProcess);
  15309. BABYLON.BlackAndWhitePostProcess = BlackAndWhitePostProcess;
  15310. })(BABYLON || (BABYLON = {}));
  15311. //# sourceMappingURL=babylon.blackAndWhitePostProcess.js.map
  15312. var BABYLON;
  15313. (function (BABYLON) {
  15314. var ConvolutionPostProcess = (function (_super) {
  15315. __extends(ConvolutionPostProcess, _super);
  15316. function ConvolutionPostProcess(name, kernel, ratio, camera, samplingMode, engine, reusable) {
  15317. var _this = this;
  15318. _super.call(this, name, "convolution", ["kernel", "screenSize"], null, ratio, camera, samplingMode, engine, reusable);
  15319. this.kernel = kernel;
  15320. this.onApply = function (effect) {
  15321. effect.setFloat2("screenSize", _this.width, _this.height);
  15322. effect.setArray("kernel", _this.kernel);
  15323. };
  15324. }
  15325. ConvolutionPostProcess.EdgeDetect0Kernel = [1, 0, -1, 0, 0, 0, -1, 0, 1];
  15326. ConvolutionPostProcess.EdgeDetect1Kernel = [0, 1, 0, 1, -4, 1, 0, 1, 0];
  15327. ConvolutionPostProcess.EdgeDetect2Kernel = [-1, -1, -1, -1, 8, -1, -1, -1, -1];
  15328. ConvolutionPostProcess.SharpenKernel = [0, -1, 0, -1, 5, -1, 0, -1, 0];
  15329. ConvolutionPostProcess.EmbossKernel = [-2, -1, 0, -1, 1, 1, 0, 1, 2];
  15330. ConvolutionPostProcess.GaussianKernel = [0, 1, 0, 1, 1, 1, 0, 1, 0];
  15331. return ConvolutionPostProcess;
  15332. })(BABYLON.PostProcess);
  15333. BABYLON.ConvolutionPostProcess = ConvolutionPostProcess;
  15334. })(BABYLON || (BABYLON = {}));
  15335. //# sourceMappingURL=babylon.convolutionPostProcess.js.map
  15336. var BABYLON;
  15337. (function (BABYLON) {
  15338. var FxaaPostProcess = (function (_super) {
  15339. __extends(FxaaPostProcess, _super);
  15340. function FxaaPostProcess(name, ratio, camera, samplingMode, engine, reusable) {
  15341. var _this = this;
  15342. _super.call(this, name, "fxaa", ["texelSize"], null, ratio, camera, samplingMode, engine, reusable);
  15343. this.onSizeChanged = function () {
  15344. _this.texelWidth = 1.0 / _this.width;
  15345. _this.texelHeight = 1.0 / _this.height;
  15346. };
  15347. this.onApply = function (effect) {
  15348. effect.setFloat2("texelSize", _this.texelWidth, _this.texelHeight);
  15349. };
  15350. }
  15351. return FxaaPostProcess;
  15352. })(BABYLON.PostProcess);
  15353. BABYLON.FxaaPostProcess = FxaaPostProcess;
  15354. })(BABYLON || (BABYLON = {}));
  15355. //# sourceMappingURL=babylon.fxaaPostProcess.js.map
  15356. var BABYLON;
  15357. (function (BABYLON) {
  15358. var LensFlare = (function () {
  15359. function LensFlare(size, position, color, imgUrl, system) {
  15360. this.size = size;
  15361. this.position = position;
  15362. this.dispose = function () {
  15363. if (this.texture) {
  15364. this.texture.dispose();
  15365. }
  15366. // Remove from scene
  15367. var index = this._system.lensFlares.indexOf(this);
  15368. this._system.lensFlares.splice(index, 1);
  15369. };
  15370. this.color = color || new BABYLON.Color3(1, 1, 1);
  15371. this.texture = imgUrl ? new BABYLON.Texture(imgUrl, system.getScene(), true) : null;
  15372. this._system = system;
  15373. system.lensFlares.push(this);
  15374. }
  15375. return LensFlare;
  15376. })();
  15377. BABYLON.LensFlare = LensFlare;
  15378. })(BABYLON || (BABYLON = {}));
  15379. //# sourceMappingURL=babylon.lensFlare.js.map
  15380. var BABYLON;
  15381. (function (BABYLON) {
  15382. var LensFlareSystem = (function () {
  15383. function LensFlareSystem(name, emitter, scene) {
  15384. this.name = name;
  15385. this.lensFlares = new Array();
  15386. this.borderLimit = 300;
  15387. this._vertexDeclaration = [2];
  15388. this._vertexStrideSize = 2 * 4;
  15389. this._isEnabled = true;
  15390. this._scene = scene;
  15391. this._emitter = emitter;
  15392. scene.lensFlareSystems.push(this);
  15393. this.meshesSelectionPredicate = function (m) {
  15394. return m.material && m.isVisible && m.isEnabled() && m.isBlocker && ((m.layerMask & scene.activeCamera.layerMask) != 0);
  15395. };
  15396. // VBO
  15397. var vertices = [];
  15398. vertices.push(1, 1);
  15399. vertices.push(-1, 1);
  15400. vertices.push(-1, -1);
  15401. vertices.push(1, -1);
  15402. this._vertexBuffer = scene.getEngine().createVertexBuffer(vertices);
  15403. // Indices
  15404. var indices = [];
  15405. indices.push(0);
  15406. indices.push(1);
  15407. indices.push(2);
  15408. indices.push(0);
  15409. indices.push(2);
  15410. indices.push(3);
  15411. this._indexBuffer = scene.getEngine().createIndexBuffer(indices);
  15412. // Effects
  15413. this._effect = this._scene.getEngine().createEffect("lensFlare", ["position"], ["color", "viewportMatrix"], ["textureSampler"], "");
  15414. }
  15415. Object.defineProperty(LensFlareSystem.prototype, "isEnabled", {
  15416. get: function () {
  15417. return this._isEnabled;
  15418. },
  15419. set: function (value) {
  15420. this._isEnabled = value;
  15421. },
  15422. enumerable: true,
  15423. configurable: true
  15424. });
  15425. LensFlareSystem.prototype.getScene = function () {
  15426. return this._scene;
  15427. };
  15428. LensFlareSystem.prototype.getEmitter = function () {
  15429. return this._emitter;
  15430. };
  15431. LensFlareSystem.prototype.getEmitterPosition = function () {
  15432. return this._emitter.getAbsolutePosition ? this._emitter.getAbsolutePosition() : this._emitter.position;
  15433. };
  15434. LensFlareSystem.prototype.computeEffectivePosition = function (globalViewport) {
  15435. var position = this.getEmitterPosition();
  15436. position = BABYLON.Vector3.Project(position, BABYLON.Matrix.Identity(), this._scene.getTransformMatrix(), globalViewport);
  15437. this._positionX = position.x;
  15438. this._positionY = position.y;
  15439. position = BABYLON.Vector3.TransformCoordinates(this.getEmitterPosition(), this._scene.getViewMatrix());
  15440. if (position.z > 0) {
  15441. if ((this._positionX > globalViewport.x) && (this._positionX < globalViewport.x + globalViewport.width)) {
  15442. if ((this._positionY > globalViewport.y) && (this._positionY < globalViewport.y + globalViewport.height))
  15443. return true;
  15444. }
  15445. }
  15446. return false;
  15447. };
  15448. LensFlareSystem.prototype._isVisible = function () {
  15449. if (!this._isEnabled) {
  15450. return false;
  15451. }
  15452. var emitterPosition = this.getEmitterPosition();
  15453. var direction = emitterPosition.subtract(this._scene.activeCamera.position);
  15454. var distance = direction.length();
  15455. direction.normalize();
  15456. var ray = new BABYLON.Ray(this._scene.activeCamera.position, direction);
  15457. var pickInfo = this._scene.pickWithRay(ray, this.meshesSelectionPredicate, true);
  15458. return !pickInfo.hit || pickInfo.distance > distance;
  15459. };
  15460. LensFlareSystem.prototype.render = function () {
  15461. if (!this._effect.isReady())
  15462. return false;
  15463. var engine = this._scene.getEngine();
  15464. var viewport = this._scene.activeCamera.viewport;
  15465. var globalViewport = viewport.toGlobal(engine);
  15466. // Position
  15467. if (!this.computeEffectivePosition(globalViewport)) {
  15468. return false;
  15469. }
  15470. // Visibility
  15471. if (!this._isVisible()) {
  15472. return false;
  15473. }
  15474. // Intensity
  15475. var awayX;
  15476. var awayY;
  15477. if (this._positionX < this.borderLimit + globalViewport.x) {
  15478. awayX = this.borderLimit + globalViewport.x - this._positionX;
  15479. } else if (this._positionX > globalViewport.x + globalViewport.width - this.borderLimit) {
  15480. awayX = this._positionX - globalViewport.x - globalViewport.width + this.borderLimit;
  15481. } else {
  15482. awayX = 0;
  15483. }
  15484. if (this._positionY < this.borderLimit + globalViewport.y) {
  15485. awayY = this.borderLimit + globalViewport.y - this._positionY;
  15486. } else if (this._positionY > globalViewport.y + globalViewport.height - this.borderLimit) {
  15487. awayY = this._positionY - globalViewport.y - globalViewport.height + this.borderLimit;
  15488. } else {
  15489. awayY = 0;
  15490. }
  15491. var away = (awayX > awayY) ? awayX : awayY;
  15492. if (away > this.borderLimit) {
  15493. away = this.borderLimit;
  15494. }
  15495. var intensity = 1.0 - (away / this.borderLimit);
  15496. if (intensity < 0) {
  15497. return false;
  15498. }
  15499. if (intensity > 1.0) {
  15500. intensity = 1.0;
  15501. }
  15502. // Position
  15503. var centerX = globalViewport.x + globalViewport.width / 2;
  15504. var centerY = globalViewport.y + globalViewport.height / 2;
  15505. var distX = centerX - this._positionX;
  15506. var distY = centerY - this._positionY;
  15507. // Effects
  15508. engine.enableEffect(this._effect);
  15509. engine.setState(false);
  15510. engine.setDepthBuffer(false);
  15511. engine.setAlphaMode(BABYLON.Engine.ALPHA_ADD);
  15512. // VBOs
  15513. engine.bindBuffers(this._vertexBuffer, this._indexBuffer, this._vertexDeclaration, this._vertexStrideSize, this._effect);
  15514. for (var index = 0; index < this.lensFlares.length; index++) {
  15515. var flare = this.lensFlares[index];
  15516. var x = centerX - (distX * flare.position);
  15517. var y = centerY - (distY * flare.position);
  15518. var cw = flare.size;
  15519. var ch = flare.size * engine.getAspectRatio(this._scene.activeCamera);
  15520. var cx = 2 * (x / globalViewport.width) - 1.0;
  15521. var cy = 1.0 - 2 * (y / globalViewport.height);
  15522. var viewportMatrix = BABYLON.Matrix.FromValues(cw / 2, 0, 0, 0, 0, ch / 2, 0, 0, 0, 0, 1, 0, cx, cy, 0, 1);
  15523. this._effect.setMatrix("viewportMatrix", viewportMatrix);
  15524. // Texture
  15525. this._effect.setTexture("textureSampler", flare.texture);
  15526. // Color
  15527. this._effect.setFloat4("color", flare.color.r * intensity, flare.color.g * intensity, flare.color.b * intensity, 1.0);
  15528. // Draw order
  15529. engine.draw(true, 0, 6);
  15530. }
  15531. engine.setDepthBuffer(true);
  15532. engine.setAlphaMode(BABYLON.Engine.ALPHA_DISABLE);
  15533. return true;
  15534. };
  15535. LensFlareSystem.prototype.dispose = function () {
  15536. if (this._vertexBuffer) {
  15537. this._scene.getEngine()._releaseBuffer(this._vertexBuffer);
  15538. this._vertexBuffer = null;
  15539. }
  15540. if (this._indexBuffer) {
  15541. this._scene.getEngine()._releaseBuffer(this._indexBuffer);
  15542. this._indexBuffer = null;
  15543. }
  15544. while (this.lensFlares.length) {
  15545. this.lensFlares[0].dispose();
  15546. }
  15547. // Remove from scene
  15548. var index = this._scene.lensFlareSystems.indexOf(this);
  15549. this._scene.lensFlareSystems.splice(index, 1);
  15550. };
  15551. return LensFlareSystem;
  15552. })();
  15553. BABYLON.LensFlareSystem = LensFlareSystem;
  15554. })(BABYLON || (BABYLON = {}));
  15555. //# sourceMappingURL=babylon.lensFlareSystem.js.map
  15556. var BABYLON;
  15557. (function (BABYLON) {
  15558. var IntersectionInfo = (function () {
  15559. function IntersectionInfo(bu, bv, distance) {
  15560. this.bu = bu;
  15561. this.bv = bv;
  15562. this.distance = distance;
  15563. this.faceId = 0;
  15564. }
  15565. return IntersectionInfo;
  15566. })();
  15567. BABYLON.IntersectionInfo = IntersectionInfo;
  15568. var PickingInfo = (function () {
  15569. function PickingInfo() {
  15570. this.hit = false;
  15571. this.distance = 0;
  15572. this.pickedPoint = null;
  15573. this.pickedMesh = null;
  15574. this.bu = 0;
  15575. this.bv = 0;
  15576. this.faceId = -1;
  15577. }
  15578. // Methods
  15579. PickingInfo.prototype.getNormal = function () {
  15580. if (!this.pickedMesh || !this.pickedMesh.isVerticesDataPresent(BABYLON.VertexBuffer.NormalKind)) {
  15581. return null;
  15582. }
  15583. var indices = this.pickedMesh.getIndices();
  15584. var normals = this.pickedMesh.getVerticesData(BABYLON.VertexBuffer.NormalKind);
  15585. var normal0 = BABYLON.Vector3.FromArray(normals, indices[this.faceId * 3] * 3);
  15586. var normal1 = BABYLON.Vector3.FromArray(normals, indices[this.faceId * 3 + 1] * 3);
  15587. var normal2 = BABYLON.Vector3.FromArray(normals, indices[this.faceId * 3 + 2] * 3);
  15588. normal0 = normal0.scale(this.bu);
  15589. normal1 = normal1.scale(this.bv);
  15590. normal2 = normal2.scale(1.0 - this.bu - this.bv);
  15591. return new BABYLON.Vector3(normal0.x + normal1.x + normal2.x, normal0.y + normal1.y + normal2.y, normal0.z + normal1.z + normal2.z);
  15592. };
  15593. PickingInfo.prototype.getTextureCoordinates = function () {
  15594. if (!this.pickedMesh || !this.pickedMesh.isVerticesDataPresent(BABYLON.VertexBuffer.UVKind)) {
  15595. return null;
  15596. }
  15597. var indices = this.pickedMesh.getIndices();
  15598. var uvs = this.pickedMesh.getVerticesData(BABYLON.VertexBuffer.UVKind);
  15599. var uv0 = BABYLON.Vector2.FromArray(uvs, indices[this.faceId * 3] * 2);
  15600. var uv1 = BABYLON.Vector2.FromArray(uvs, indices[this.faceId * 3 + 1] * 2);
  15601. var uv2 = BABYLON.Vector2.FromArray(uvs, indices[this.faceId * 3 + 2] * 2);
  15602. uv0 = uv0.scale(this.bu);
  15603. uv1 = uv1.scale(this.bv);
  15604. uv2 = uv2.scale(1.0 - this.bu - this.bv);
  15605. return new BABYLON.Vector2(uv0.x + uv1.x + uv2.x, uv0.y + uv1.y + uv2.y);
  15606. };
  15607. return PickingInfo;
  15608. })();
  15609. BABYLON.PickingInfo = PickingInfo;
  15610. })(BABYLON || (BABYLON = {}));
  15611. //# sourceMappingURL=babylon.pickingInfo.js.map
  15612. var BABYLON;
  15613. (function (BABYLON) {
  15614. var FilesInput = (function () {
  15615. /// Register to core BabylonJS object: engine, scene, rendering canvas, callback function when the scene will be loaded,
  15616. /// loading progress callback and optionnal addionnal logic to call in the rendering loop
  15617. function FilesInput(p_engine, p_scene, p_canvas, p_sceneLoadedCallback, p_progressCallback, p_additionnalRenderLoopLogicCallback, p_textureLoadingCallback, p_startingProcessingFilesCallback) {
  15618. this.engine = p_engine;
  15619. this.canvas = p_canvas;
  15620. this.currentScene = p_scene;
  15621. this.sceneLoadedCallback = p_sceneLoadedCallback;
  15622. this.progressCallback = p_progressCallback;
  15623. this.additionnalRenderLoopLogicCallback = p_additionnalRenderLoopLogicCallback;
  15624. this.textureLoadingCallback = p_textureLoadingCallback;
  15625. this.startingProcessingFilesCallback = p_startingProcessingFilesCallback;
  15626. }
  15627. FilesInput.prototype.monitorElementForDragNDrop = function (p_elementToMonitor) {
  15628. var _this = this;
  15629. if (p_elementToMonitor) {
  15630. this.elementToMonitor = p_elementToMonitor;
  15631. this.elementToMonitor.addEventListener("dragenter", function (e) {
  15632. _this.drag(e);
  15633. }, false);
  15634. this.elementToMonitor.addEventListener("dragover", function (e) {
  15635. _this.drag(e);
  15636. }, false);
  15637. this.elementToMonitor.addEventListener("drop", function (e) {
  15638. _this.drop(e);
  15639. }, false);
  15640. }
  15641. };
  15642. FilesInput.prototype.renderFunction = function () {
  15643. if (this.additionnalRenderLoopLogicCallback) {
  15644. this.additionnalRenderLoopLogicCallback();
  15645. }
  15646. if (this.currentScene) {
  15647. if (this.textureLoadingCallback) {
  15648. var remaining = this.currentScene.getWaitingItemsCount();
  15649. if (remaining > 0) {
  15650. this.textureLoadingCallback(remaining);
  15651. }
  15652. }
  15653. this.currentScene.render();
  15654. }
  15655. };
  15656. FilesInput.prototype.drag = function (e) {
  15657. e.stopPropagation();
  15658. e.preventDefault();
  15659. };
  15660. FilesInput.prototype.drop = function (eventDrop) {
  15661. eventDrop.stopPropagation();
  15662. eventDrop.preventDefault();
  15663. this.loadFiles(eventDrop);
  15664. };
  15665. FilesInput.prototype.loadFiles = function (event) {
  15666. var _this = this;
  15667. var that = this;
  15668. if (this.startingProcessingFilesCallback)
  15669. this.startingProcessingFilesCallback();
  15670. var sceneFileToLoad;
  15671. var filesToLoad;
  15672. // Handling data transfer via drag'n'drop
  15673. if (event && event.dataTransfer && event.dataTransfer.files) {
  15674. filesToLoad = event.dataTransfer.files;
  15675. }
  15676. // Handling files from input files
  15677. if (event && event.target && event.target.files) {
  15678. filesToLoad = event.target.files;
  15679. }
  15680. if (filesToLoad && filesToLoad.length > 0) {
  15681. for (var i = 0; i < filesToLoad.length; i++) {
  15682. switch (filesToLoad[i].type) {
  15683. case "image/jpeg":
  15684. case "image/png":
  15685. BABYLON.FilesInput.FilesTextures[filesToLoad[i].name] = filesToLoad[i];
  15686. break;
  15687. case "image/targa":
  15688. case "image/vnd.ms-dds":
  15689. BABYLON.FilesInput.FilesToLoad[filesToLoad[i].name] = filesToLoad[i];
  15690. break;
  15691. default:
  15692. if (filesToLoad[i].name.indexOf(".babylon") !== -1 && filesToLoad[i].name.indexOf(".manifest") === -1 && filesToLoad[i].name.indexOf(".incremental") === -1 && filesToLoad[i].name.indexOf(".babylonmeshdata") === -1 && filesToLoad[i].name.indexOf(".babylongeometrydata") === -1) {
  15693. sceneFileToLoad = filesToLoad[i];
  15694. }
  15695. break;
  15696. }
  15697. }
  15698. // If a ".babylon" file has been provided
  15699. if (sceneFileToLoad) {
  15700. if (this.currentScene) {
  15701. this.engine.stopRenderLoop();
  15702. this.currentScene.dispose();
  15703. }
  15704. BABYLON.SceneLoader.Load("file:", sceneFileToLoad, this.engine, function (newScene) {
  15705. that.currentScene = newScene;
  15706. // Wait for textures and shaders to be ready
  15707. that.currentScene.executeWhenReady(function () {
  15708. // Attach camera to canvas inputs
  15709. if (that.currentScene.activeCamera) {
  15710. that.currentScene.activeCamera.attachControl(that.canvas);
  15711. }
  15712. if (that.sceneLoadedCallback) {
  15713. that.sceneLoadedCallback(sceneFileToLoad, that.currentScene);
  15714. }
  15715. that.engine.runRenderLoop(function () {
  15716. that.renderFunction();
  15717. });
  15718. });
  15719. }, function (progress) {
  15720. if (_this.progressCallback) {
  15721. _this.progressCallback(progress);
  15722. }
  15723. });
  15724. } else {
  15725. BABYLON.Tools.Error("Please provide a valid .babylon file.");
  15726. }
  15727. }
  15728. };
  15729. FilesInput.FilesTextures = new Array();
  15730. FilesInput.FilesToLoad = new Array();
  15731. return FilesInput;
  15732. })();
  15733. BABYLON.FilesInput = FilesInput;
  15734. })(BABYLON || (BABYLON = {}));
  15735. //# sourceMappingURL=babylon.filesInput.js.map
  15736. var BABYLON;
  15737. (function (BABYLON) {
  15738. var OimoJSPlugin = (function () {
  15739. function OimoJSPlugin() {
  15740. this._registeredMeshes = [];
  15741. /**
  15742. * Update the body position according to the mesh position
  15743. * @param mesh
  15744. */
  15745. this.updateBodyPosition = function (mesh) {
  15746. for (var index = 0; index < this._registeredMeshes.length; index++) {
  15747. var registeredMesh = this._registeredMeshes[index];
  15748. if (registeredMesh.mesh === mesh || registeredMesh.mesh === mesh.parent) {
  15749. var body = registeredMesh.body.body;
  15750. mesh.computeWorldMatrix(true);
  15751. var center = mesh.getBoundingInfo().boundingBox.center;
  15752. body.setPosition(center.x, center.y, center.z);
  15753. body.setOrientation(mesh.rotation.x, mesh.rotation.y, mesh.rotation.z);
  15754. return;
  15755. }
  15756. // Case where the parent has been updated
  15757. if (registeredMesh.mesh.parent === mesh) {
  15758. mesh.computeWorldMatrix(true);
  15759. registeredMesh.mesh.computeWorldMatrix(true);
  15760. var absolutePosition = registeredMesh.mesh.getAbsolutePosition();
  15761. var absoluteRotation = mesh.rotation;
  15762. body = registeredMesh.body.body;
  15763. body.setPosition(absolutePosition.x, absolutePosition.y, absolutePosition.z);
  15764. body.setOrientation(absoluteRotation.x, absoluteRotation.y, absoluteRotation.z);
  15765. return;
  15766. }
  15767. }
  15768. };
  15769. }
  15770. OimoJSPlugin.prototype._checkWithEpsilon = function (value) {
  15771. return value < BABYLON.PhysicsEngine.Epsilon ? BABYLON.PhysicsEngine.Epsilon : value;
  15772. };
  15773. OimoJSPlugin.prototype.initialize = function (iterations) {
  15774. this._world = new OIMO.World();
  15775. this._world.clear();
  15776. };
  15777. OimoJSPlugin.prototype.setGravity = function (gravity) {
  15778. this._world.gravity = gravity;
  15779. };
  15780. OimoJSPlugin.prototype.registerMesh = function (mesh, impostor, options) {
  15781. var body = null;
  15782. this.unregisterMesh(mesh);
  15783. mesh.computeWorldMatrix(true);
  15784. switch (impostor) {
  15785. case BABYLON.PhysicsEngine.SphereImpostor:
  15786. var bbox = mesh.getBoundingInfo().boundingBox;
  15787. var radiusX = bbox.maximumWorld.x - bbox.minimumWorld.x;
  15788. var radiusY = bbox.maximumWorld.y - bbox.minimumWorld.y;
  15789. var radiusZ = bbox.maximumWorld.z - bbox.minimumWorld.z;
  15790. var size = Math.max(this._checkWithEpsilon(radiusX), this._checkWithEpsilon(radiusY), this._checkWithEpsilon(radiusZ)) / 2;
  15791. // The delta between the mesh position and the mesh bounding box center
  15792. var deltaPosition = mesh.position.subtract(bbox.center);
  15793. body = new OIMO.Body({
  15794. type: 'sphere',
  15795. size: [size],
  15796. pos: [bbox.center.x, bbox.center.y, bbox.center.z],
  15797. rot: [mesh.rotation.x / OIMO.TO_RAD, mesh.rotation.y / OIMO.TO_RAD, mesh.rotation.z / OIMO.TO_RAD],
  15798. move: options.mass != 0,
  15799. config: [options.mass, options.friction, options.restitution],
  15800. world: this._world
  15801. });
  15802. this._registeredMeshes.push({
  15803. mesh: mesh,
  15804. body: body,
  15805. delta: deltaPosition
  15806. });
  15807. break;
  15808. case BABYLON.PhysicsEngine.PlaneImpostor:
  15809. case BABYLON.PhysicsEngine.BoxImpostor:
  15810. bbox = mesh.getBoundingInfo().boundingBox;
  15811. var min = bbox.minimumWorld;
  15812. var max = bbox.maximumWorld;
  15813. var box = max.subtract(min);
  15814. var sizeX = this._checkWithEpsilon(box.x);
  15815. var sizeY = this._checkWithEpsilon(box.y);
  15816. var sizeZ = this._checkWithEpsilon(box.z);
  15817. // The delta between the mesh position and the mesh boudning box center
  15818. var deltaPosition = mesh.position.subtract(bbox.center);
  15819. body = new OIMO.Body({
  15820. type: 'box',
  15821. size: [sizeX, sizeY, sizeZ],
  15822. pos: [bbox.center.x, bbox.center.y, bbox.center.z],
  15823. rot: [mesh.rotation.x / OIMO.TO_RAD, mesh.rotation.y / OIMO.TO_RAD, mesh.rotation.z / OIMO.TO_RAD],
  15824. move: options.mass != 0,
  15825. config: [options.mass, options.friction, options.restitution],
  15826. world: this._world
  15827. });
  15828. this._registeredMeshes.push({
  15829. mesh: mesh,
  15830. body: body,
  15831. delta: deltaPosition
  15832. });
  15833. break;
  15834. }
  15835. return body;
  15836. };
  15837. OimoJSPlugin.prototype.registerMeshesAsCompound = function (parts, options) {
  15838. var types = [], sizes = [], positions = [], rotations = [];
  15839. var initialMesh = parts[0].mesh;
  15840. for (var index = 0; index < parts.length; index++) {
  15841. var part = parts[index];
  15842. var bodyParameters = this._createBodyAsCompound(part, options, initialMesh);
  15843. types.push(bodyParameters.type);
  15844. sizes.push.apply(sizes, bodyParameters.size);
  15845. positions.push.apply(positions, bodyParameters.pos);
  15846. rotations.push.apply(rotations, bodyParameters.rot);
  15847. }
  15848. var body = new OIMO.Body({
  15849. type: types,
  15850. size: sizes,
  15851. pos: positions,
  15852. rot: rotations,
  15853. move: options.mass != 0,
  15854. config: [options.mass, options.friction, options.restitution],
  15855. world: this._world
  15856. });
  15857. this._registeredMeshes.push({
  15858. mesh: initialMesh,
  15859. body: body
  15860. });
  15861. return body;
  15862. };
  15863. OimoJSPlugin.prototype._createBodyAsCompound = function (part, options, initialMesh) {
  15864. var bodyParameters = null;
  15865. var mesh = part.mesh;
  15866. switch (part.impostor) {
  15867. case BABYLON.PhysicsEngine.SphereImpostor:
  15868. var bbox = mesh.getBoundingInfo().boundingBox;
  15869. var radiusX = bbox.maximumWorld.x - bbox.minimumWorld.x;
  15870. var radiusY = bbox.maximumWorld.y - bbox.minimumWorld.y;
  15871. var radiusZ = bbox.maximumWorld.z - bbox.minimumWorld.z;
  15872. var size = Math.max(this._checkWithEpsilon(radiusX), this._checkWithEpsilon(radiusY), this._checkWithEpsilon(radiusZ)) / 2;
  15873. bodyParameters = {
  15874. type: 'sphere',
  15875. /* bug with oimo : sphere needs 3 sizes in this case */
  15876. size: [size, -1, -1],
  15877. pos: [mesh.position.x, mesh.position.y, mesh.position.z],
  15878. rot: [mesh.rotation.x / OIMO.TO_RAD, mesh.rotation.y / OIMO.TO_RAD, mesh.rotation.z / OIMO.TO_RAD]
  15879. };
  15880. break;
  15881. case BABYLON.PhysicsEngine.PlaneImpostor:
  15882. case BABYLON.PhysicsEngine.BoxImpostor:
  15883. bbox = mesh.getBoundingInfo().boundingBox;
  15884. var min = bbox.minimumWorld;
  15885. var max = bbox.maximumWorld;
  15886. var box = max.subtract(min);
  15887. var sizeX = this._checkWithEpsilon(box.x);
  15888. var sizeY = this._checkWithEpsilon(box.y);
  15889. var sizeZ = this._checkWithEpsilon(box.z);
  15890. var relativePosition = mesh.position;
  15891. bodyParameters = {
  15892. type: 'box',
  15893. size: [sizeX, sizeY, sizeZ],
  15894. pos: [relativePosition.x, relativePosition.y, relativePosition.z],
  15895. rot: [mesh.rotation.x / OIMO.TO_RAD, mesh.rotation.y / OIMO.TO_RAD, mesh.rotation.z / OIMO.TO_RAD]
  15896. };
  15897. break;
  15898. }
  15899. return bodyParameters;
  15900. };
  15901. OimoJSPlugin.prototype.unregisterMesh = function (mesh) {
  15902. for (var index = 0; index < this._registeredMeshes.length; index++) {
  15903. var registeredMesh = this._registeredMeshes[index];
  15904. if (registeredMesh.mesh === mesh || registeredMesh.mesh === mesh.parent) {
  15905. if (registeredMesh.body) {
  15906. this._world.removeRigidBody(registeredMesh.body.body);
  15907. this._unbindBody(registeredMesh.body);
  15908. }
  15909. this._registeredMeshes.splice(index, 1);
  15910. return;
  15911. }
  15912. }
  15913. };
  15914. OimoJSPlugin.prototype._unbindBody = function (body) {
  15915. for (var index = 0; index < this._registeredMeshes.length; index++) {
  15916. var registeredMesh = this._registeredMeshes[index];
  15917. if (registeredMesh.body === body) {
  15918. registeredMesh.body = null;
  15919. }
  15920. }
  15921. };
  15922. OimoJSPlugin.prototype.applyImpulse = function (mesh, force, contactPoint) {
  15923. for (var index = 0; index < this._registeredMeshes.length; index++) {
  15924. var registeredMesh = this._registeredMeshes[index];
  15925. if (registeredMesh.mesh === mesh || registeredMesh.mesh === mesh.parent) {
  15926. // Get object mass to have a behaviour similar to cannon.js
  15927. var mass = registeredMesh.body.body.massInfo.mass;
  15928. // The force is scaled with the mass of object
  15929. registeredMesh.body.body.applyImpulse(contactPoint.scale(OIMO.INV_SCALE), force.scale(OIMO.INV_SCALE * mass));
  15930. return;
  15931. }
  15932. }
  15933. };
  15934. OimoJSPlugin.prototype.createLink = function (mesh1, mesh2, pivot1, pivot2, options) {
  15935. var body1 = null, body2 = null;
  15936. for (var index = 0; index < this._registeredMeshes.length; index++) {
  15937. var registeredMesh = this._registeredMeshes[index];
  15938. if (registeredMesh.mesh === mesh1) {
  15939. body1 = registeredMesh.body.body;
  15940. } else if (registeredMesh.mesh === mesh2) {
  15941. body2 = registeredMesh.body.body;
  15942. }
  15943. }
  15944. if (!body1 || !body2) {
  15945. return false;
  15946. }
  15947. if (!options) {
  15948. options = {};
  15949. }
  15950. new OIMO.Link({
  15951. type: options.type,
  15952. body1: body1,
  15953. body2: body2,
  15954. min: options.min,
  15955. max: options.max,
  15956. axe1: options.axe1,
  15957. axe2: options.axe2,
  15958. pos1: [pivot1.x, pivot1.y, pivot1.z],
  15959. pos2: [pivot2.x, pivot2.y, pivot2.z],
  15960. collision: options.collision,
  15961. spring: options.spring,
  15962. world: this._world
  15963. });
  15964. return true;
  15965. };
  15966. OimoJSPlugin.prototype.dispose = function () {
  15967. this._world.clear();
  15968. while (this._registeredMeshes.length) {
  15969. this.unregisterMesh(this._registeredMeshes[0].mesh);
  15970. }
  15971. };
  15972. OimoJSPlugin.prototype.isSupported = function () {
  15973. return OIMO !== undefined;
  15974. };
  15975. OimoJSPlugin.prototype._getLastShape = function (body) {
  15976. var lastShape = body.shapes;
  15977. while (lastShape.next) {
  15978. lastShape = lastShape.next;
  15979. }
  15980. return lastShape;
  15981. };
  15982. OimoJSPlugin.prototype.runOneStep = function (time) {
  15983. this._world.step();
  15984. // Update the position of all registered meshes
  15985. var i = this._registeredMeshes.length;
  15986. var m;
  15987. while (i--) {
  15988. var body = this._registeredMeshes[i].body.body;
  15989. var mesh = this._registeredMeshes[i].mesh;
  15990. var delta = this._registeredMeshes[i].delta;
  15991. if (!body.sleeping) {
  15992. if (body.shapes.next) {
  15993. var parentShape = this._getLastShape(body);
  15994. mesh.position.x = parentShape.position.x * OIMO.WORLD_SCALE;
  15995. mesh.position.y = parentShape.position.y * OIMO.WORLD_SCALE;
  15996. mesh.position.z = parentShape.position.z * OIMO.WORLD_SCALE;
  15997. var mtx = BABYLON.Matrix.FromArray(body.getMatrix());
  15998. if (!mesh.rotationQuaternion) {
  15999. mesh.rotationQuaternion = new BABYLON.Quaternion(0, 0, 0, 1);
  16000. }
  16001. mesh.rotationQuaternion.fromRotationMatrix(mtx);
  16002. mesh.computeWorldMatrix();
  16003. } else {
  16004. m = body.getMatrix();
  16005. mtx = BABYLON.Matrix.FromArray(m);
  16006. // Body position
  16007. var bodyX = mtx.m[12], bodyY = mtx.m[13], bodyZ = mtx.m[14];
  16008. if (!delta) {
  16009. mesh.position.x = bodyX;
  16010. mesh.position.y = bodyY;
  16011. mesh.position.z = bodyZ;
  16012. } else {
  16013. mesh.position.x = bodyX + delta.x;
  16014. mesh.position.y = bodyY + delta.y;
  16015. mesh.position.z = bodyZ + delta.z;
  16016. }
  16017. if (!mesh.rotationQuaternion) {
  16018. mesh.rotationQuaternion = new BABYLON.Quaternion(0, 0, 0, 1);
  16019. }
  16020. mesh.rotationQuaternion.fromRotationMatrix(mtx);
  16021. mesh.computeWorldMatrix();
  16022. }
  16023. }
  16024. }
  16025. };
  16026. return OimoJSPlugin;
  16027. })();
  16028. BABYLON.OimoJSPlugin = OimoJSPlugin;
  16029. })(BABYLON || (BABYLON = {}));
  16030. //# sourceMappingURL=babylon.oimoJSPlugin.js.map
  16031. var BABYLON;
  16032. (function (BABYLON) {
  16033. var PhysicsEngine = (function () {
  16034. function PhysicsEngine(plugin) {
  16035. this._currentPlugin = plugin || new BABYLON.OimoJSPlugin();
  16036. }
  16037. PhysicsEngine.prototype._initialize = function (gravity) {
  16038. this._currentPlugin.initialize();
  16039. this._setGravity(gravity);
  16040. };
  16041. PhysicsEngine.prototype._runOneStep = function (delta) {
  16042. if (delta > 0.1) {
  16043. delta = 0.1;
  16044. } else if (delta <= 0) {
  16045. delta = 1.0 / 60.0;
  16046. }
  16047. this._currentPlugin.runOneStep(delta);
  16048. };
  16049. PhysicsEngine.prototype._setGravity = function (gravity) {
  16050. this.gravity = gravity || new BABYLON.Vector3(0, -9.82, 0);
  16051. this._currentPlugin.setGravity(this.gravity);
  16052. };
  16053. PhysicsEngine.prototype._registerMesh = function (mesh, impostor, options) {
  16054. return this._currentPlugin.registerMesh(mesh, impostor, options);
  16055. };
  16056. PhysicsEngine.prototype._registerMeshesAsCompound = function (parts, options) {
  16057. return this._currentPlugin.registerMeshesAsCompound(parts, options);
  16058. };
  16059. PhysicsEngine.prototype._unregisterMesh = function (mesh) {
  16060. this._currentPlugin.unregisterMesh(mesh);
  16061. };
  16062. PhysicsEngine.prototype._applyImpulse = function (mesh, force, contactPoint) {
  16063. this._currentPlugin.applyImpulse(mesh, force, contactPoint);
  16064. };
  16065. PhysicsEngine.prototype._createLink = function (mesh1, mesh2, pivot1, pivot2, options) {
  16066. return this._currentPlugin.createLink(mesh1, mesh2, pivot1, pivot2, options);
  16067. };
  16068. PhysicsEngine.prototype._updateBodyPosition = function (mesh) {
  16069. this._currentPlugin.updateBodyPosition(mesh);
  16070. };
  16071. PhysicsEngine.prototype.dispose = function () {
  16072. this._currentPlugin.dispose();
  16073. };
  16074. PhysicsEngine.prototype.isSupported = function () {
  16075. return this._currentPlugin.isSupported();
  16076. };
  16077. PhysicsEngine.NoImpostor = 0;
  16078. PhysicsEngine.SphereImpostor = 1;
  16079. PhysicsEngine.BoxImpostor = 2;
  16080. PhysicsEngine.PlaneImpostor = 3;
  16081. PhysicsEngine.MeshImpostor = 4;
  16082. PhysicsEngine.CapsuleImpostor = 5;
  16083. PhysicsEngine.ConeImpostor = 6;
  16084. PhysicsEngine.CylinderImpostor = 7;
  16085. PhysicsEngine.ConvexHullImpostor = 8;
  16086. PhysicsEngine.Epsilon = 0.001;
  16087. return PhysicsEngine;
  16088. })();
  16089. BABYLON.PhysicsEngine = PhysicsEngine;
  16090. })(BABYLON || (BABYLON = {}));
  16091. //# sourceMappingURL=babylon.physicsEngine.js.map
  16092. var BABYLON;
  16093. (function (BABYLON) {
  16094. var serializeLight = function (light) {
  16095. var serializationObject = {};
  16096. serializationObject.name = light.name;
  16097. serializationObject.id = light.id;
  16098. serializationObject.tags = BABYLON.Tags.GetTags(light);
  16099. if (light instanceof BABYLON.PointLight) {
  16100. serializationObject.type = 0;
  16101. serializationObject.position = light.position.asArray();
  16102. } else if (light instanceof BABYLON.DirectionalLight) {
  16103. serializationObject.type = 1;
  16104. var directionalLight = light;
  16105. serializationObject.position = directionalLight.position.asArray();
  16106. serializationObject.direction = directionalLight.direction.asArray();
  16107. } else if (light instanceof BABYLON.SpotLight) {
  16108. serializationObject.type = 2;
  16109. var spotLight = light;
  16110. serializationObject.position = spotLight.position.asArray();
  16111. serializationObject.direction = spotLight.position.asArray();
  16112. serializationObject.angle = spotLight.angle;
  16113. serializationObject.exponent = spotLight.exponent;
  16114. } else if (light instanceof BABYLON.HemisphericLight) {
  16115. serializationObject.type = 3;
  16116. var hemisphericLight = light;
  16117. serializationObject.direction = hemisphericLight.direction.asArray();
  16118. serializationObject.groundColor = hemisphericLight.groundColor.asArray();
  16119. }
  16120. if (light.intensity) {
  16121. serializationObject.intensity = light.intensity;
  16122. }
  16123. serializationObject.range = light.range;
  16124. serializationObject.diffuse = light.diffuse.asArray();
  16125. serializationObject.specular = light.specular.asArray();
  16126. return serializationObject;
  16127. };
  16128. var serializeFresnelParameter = function (fresnelParameter) {
  16129. var serializationObject = {};
  16130. serializationObject.isEnabled = fresnelParameter.isEnabled;
  16131. serializationObject.leftColor = fresnelParameter.leftColor;
  16132. serializationObject.rightColor = fresnelParameter.rightColor;
  16133. serializationObject.bias = fresnelParameter.bias;
  16134. serializationObject.power = fresnelParameter.power;
  16135. return serializationObject;
  16136. };
  16137. var serializeCamera = function (camera) {
  16138. var serializationObject = {};
  16139. serializationObject.name = camera.name;
  16140. serializationObject.tags = BABYLON.Tags.GetTags(camera);
  16141. serializationObject.id = camera.id;
  16142. serializationObject.position = camera.position.asArray();
  16143. // Parent
  16144. if (camera.parent) {
  16145. serializationObject.parentId = camera.parent.id;
  16146. }
  16147. // Target
  16148. serializationObject.rotation = camera.rotation.asArray();
  16149. // Locked target
  16150. if (camera.lockedTarget && camera.lockedTarget.id) {
  16151. serializationObject.lockedTargetId = camera.lockedTarget.id;
  16152. }
  16153. serializationObject.fov = camera.fov;
  16154. serializationObject.minZ = camera.minZ;
  16155. serializationObject.maxZ = camera.maxZ;
  16156. serializationObject.speed = camera.speed;
  16157. serializationObject.inertia = camera.inertia;
  16158. serializationObject.checkCollisions = camera.checkCollisions;
  16159. serializationObject.applyGravity = camera.applyGravity;
  16160. if (camera.ellipsoid) {
  16161. serializationObject.ellipsoid = camera.ellipsoid.asArray();
  16162. }
  16163. // Animations
  16164. appendAnimations(camera, serializationObject);
  16165. // Layer mask
  16166. serializationObject.layerMask = camera.layerMask;
  16167. return serializationObject;
  16168. };
  16169. var appendAnimations = function (source, destination) {
  16170. if (source.animations) {
  16171. destination.animations = [];
  16172. for (var animationIndex = 0; animationIndex < source.animations.length; animationIndex++) {
  16173. var animation = source.animations[animationIndex];
  16174. destination.animations.push(serializeAnimation(animation));
  16175. }
  16176. }
  16177. };
  16178. var serializeAnimation = function (animation) {
  16179. var serializationObject = {};
  16180. serializationObject.name = animation.name;
  16181. serializationObject.property = animation.targetProperty;
  16182. serializationObject.framePerSecond = animation.framePerSecond;
  16183. serializationObject.dataType = animation.dataType;
  16184. serializationObject.loopBehavior = animation.loopMode;
  16185. var dataType = animation.dataType;
  16186. serializationObject.keys = [];
  16187. var keys = animation.getKeys();
  16188. for (var index = 0; index < keys.length; index++) {
  16189. var animationKey = keys[index];
  16190. var key = {};
  16191. key.frame = animationKey.frame;
  16192. switch (dataType) {
  16193. case BABYLON.Animation.ANIMATIONTYPE_FLOAT:
  16194. key.values = [animationKey.value];
  16195. break;
  16196. case BABYLON.Animation.ANIMATIONTYPE_QUATERNION:
  16197. case BABYLON.Animation.ANIMATIONTYPE_MATRIX:
  16198. case BABYLON.Animation.ANIMATIONTYPE_VECTOR3:
  16199. key.values = animationKey.value.asArray();
  16200. break;
  16201. }
  16202. serializationObject.keys.push(key);
  16203. }
  16204. return serializationObject;
  16205. };
  16206. var serializeMultiMaterial = function (material) {
  16207. var serializationObject = {};
  16208. serializationObject.name = material.name;
  16209. serializationObject.id = material.id;
  16210. serializationObject.tags = BABYLON.Tags.GetTags(material);
  16211. serializationObject.materials = [];
  16212. for (var matIndex = 0; matIndex < material.subMaterials.length; matIndex++) {
  16213. var subMat = material.subMaterials[matIndex];
  16214. if (subMat) {
  16215. serializationObject.materials.push(subMat.id);
  16216. } else {
  16217. serializationObject.materials.push(null);
  16218. }
  16219. }
  16220. return serializationObject;
  16221. };
  16222. var serializeMaterial = function (material) {
  16223. var serializationObject = {};
  16224. serializationObject.name = material.name;
  16225. serializationObject.ambient = material.ambientColor.asArray();
  16226. serializationObject.diffuse = material.diffuseColor.asArray();
  16227. serializationObject.specular = material.specularColor.asArray();
  16228. serializationObject.specularPower = material.specularPower;
  16229. serializationObject.emissive = material.emissiveColor.asArray();
  16230. serializationObject.alpha = material.alpha;
  16231. serializationObject.id = material.id;
  16232. serializationObject.tags = BABYLON.Tags.GetTags(material);
  16233. serializationObject.backFaceCulling = material.backFaceCulling;
  16234. if (material.diffuseTexture) {
  16235. serializationObject.diffuseTexture = serializeTexture(material.diffuseTexture);
  16236. }
  16237. if (material.diffuseFresnelParameters) {
  16238. serializationObject.diffuseFresnelParameters = serializeFresnelParameter(material.diffuseFresnelParameters);
  16239. }
  16240. if (material.ambientTexture) {
  16241. serializationObject.ambientTexture = serializeTexture(material.ambientTexture);
  16242. }
  16243. if (material.opacityTexture) {
  16244. serializationObject.opacityTexture = serializeTexture(material.opacityTexture);
  16245. }
  16246. if (material.opacityFresnelParameters) {
  16247. serializationObject.opacityFresnelParameters = serializeFresnelParameter(material.opacityFresnelParameters);
  16248. }
  16249. if (material.reflectionTexture) {
  16250. serializationObject.reflectionTexture = serializeTexture(material.reflectionTexture);
  16251. }
  16252. if (material.reflectionFresnelParameters) {
  16253. serializationObject.reflectionFresnelParameters = serializeFresnelParameter(material.reflectionFresnelParameters);
  16254. }
  16255. if (material.emissiveTexture) {
  16256. serializationObject.emissiveTexture = serializeTexture(material.emissiveTexture);
  16257. }
  16258. if (material.emissiveFresnelParameters) {
  16259. serializationObject.emissiveFresnelParameters = serializeFresnelParameter(material.emissiveFresnelParameters);
  16260. }
  16261. if (material.specularTexture) {
  16262. serializationObject.specularTexture = serializeTexture(material.specularTexture);
  16263. }
  16264. if (material.bumpTexture) {
  16265. serializationObject.bumpTexture = serializeTexture(material.bumpTexture);
  16266. }
  16267. return serializationObject;
  16268. };
  16269. var serializeTexture = function (texture) {
  16270. var serializationObject = {};
  16271. if (!texture.name) {
  16272. return null;
  16273. }
  16274. if (texture instanceof BABYLON.CubeTexture) {
  16275. serializationObject.name = texture.name;
  16276. serializationObject.hasAlpha = texture.hasAlpha;
  16277. serializationObject.level = texture.level;
  16278. serializationObject.coordinatesMode = texture.coordinatesMode;
  16279. return serializationObject;
  16280. }
  16281. if (texture instanceof BABYLON.MirrorTexture) {
  16282. var mirrorTexture = texture;
  16283. serializationObject.renderTargetSize = mirrorTexture.getRenderSize();
  16284. serializationObject.renderList = [];
  16285. for (var index = 0; index < mirrorTexture.renderList.length; index++) {
  16286. serializationObject.renderList.push(mirrorTexture.renderList[index].id);
  16287. }
  16288. serializationObject.mirrorPlane = mirrorTexture.mirrorPlane.asArray();
  16289. } else if (texture instanceof BABYLON.RenderTargetTexture) {
  16290. var renderTargetTexture = texture;
  16291. serializationObject.renderTargetSize = renderTargetTexture.getRenderSize();
  16292. serializationObject.renderList = [];
  16293. for (index = 0; index < renderTargetTexture.renderList.length; index++) {
  16294. serializationObject.renderList.push(renderTargetTexture.renderList[index].id);
  16295. }
  16296. }
  16297. var regularTexture = texture;
  16298. serializationObject.name = texture.name;
  16299. serializationObject.hasAlpha = texture.hasAlpha;
  16300. serializationObject.level = texture.level;
  16301. serializationObject.coordinatesIndex = texture.coordinatesIndex;
  16302. serializationObject.coordinatesMode = texture.coordinatesMode;
  16303. serializationObject.uOffset = regularTexture.uOffset;
  16304. serializationObject.vOffset = regularTexture.vOffset;
  16305. serializationObject.uScale = regularTexture.uScale;
  16306. serializationObject.vScale = regularTexture.vScale;
  16307. serializationObject.uAng = regularTexture.uAng;
  16308. serializationObject.vAng = regularTexture.vAng;
  16309. serializationObject.wAng = regularTexture.wAng;
  16310. serializationObject.wrapU = texture.wrapU;
  16311. serializationObject.wrapV = texture.wrapV;
  16312. // Animations
  16313. appendAnimations(texture, serializationObject);
  16314. return serializationObject;
  16315. };
  16316. var serializeSkeleton = function (skeleton) {
  16317. var serializationObject = {};
  16318. serializationObject.name = skeleton.name;
  16319. serializationObject.id = skeleton.id;
  16320. serializationObject.bones = [];
  16321. for (var index = 0; index < skeleton.bones.length; index++) {
  16322. var bone = skeleton.bones[index];
  16323. var serializedBone = {
  16324. parentBoneIndex: bone.getParent() ? skeleton.bones.indexOf(bone.getParent()) : -1,
  16325. name: bone.name,
  16326. matrix: bone.getLocalMatrix().toArray()
  16327. };
  16328. serializationObject.bones.push(serializedBone);
  16329. if (bone.animations && bone.animations.length > 0) {
  16330. serializedBone.animation = serializeAnimation(bone.animations[0]);
  16331. }
  16332. }
  16333. return serializationObject;
  16334. };
  16335. var serializeParticleSystem = function (particleSystem) {
  16336. var serializationObject = {};
  16337. serializationObject.emitterId = particleSystem.emitter.id;
  16338. serializationObject.capacity = particleSystem.getCapacity();
  16339. if (particleSystem.particleTexture) {
  16340. serializationObject.textureName = particleSystem.particleTexture.name;
  16341. }
  16342. serializationObject.minAngularSpeed = particleSystem.minAngularSpeed;
  16343. serializationObject.maxAngularSpeed = particleSystem.maxAngularSpeed;
  16344. serializationObject.minSize = particleSystem.minSize;
  16345. serializationObject.maxSize = particleSystem.maxSize;
  16346. serializationObject.minLifeTime = particleSystem.minLifeTime;
  16347. serializationObject.maxLifeTime = particleSystem.maxLifeTime;
  16348. serializationObject.emitRate = particleSystem.emitRate;
  16349. serializationObject.minEmitBox = particleSystem.minEmitBox.asArray();
  16350. serializationObject.maxEmitBox = particleSystem.maxEmitBox.asArray();
  16351. serializationObject.gravity = particleSystem.gravity.asArray();
  16352. serializationObject.direction1 = particleSystem.direction1.asArray();
  16353. serializationObject.direction2 = particleSystem.direction2.asArray();
  16354. serializationObject.color1 = particleSystem.color1.asArray();
  16355. serializationObject.color2 = particleSystem.color2.asArray();
  16356. serializationObject.colorDead = particleSystem.colorDead.asArray();
  16357. serializationObject.updateSpeed = particleSystem.updateSpeed;
  16358. serializationObject.targetStopDuration = particleSystem.targetStopDuration;
  16359. serializationObject.textureMask = particleSystem.textureMask.asArray();
  16360. serializationObject.blendMode = particleSystem.blendMode;
  16361. return serializationObject;
  16362. };
  16363. var serializeLensFlareSystem = function (lensFlareSystem) {
  16364. var serializationObject = {};
  16365. serializationObject.emitterId = lensFlareSystem.getEmitter().id;
  16366. serializationObject.borderLimit = lensFlareSystem.borderLimit;
  16367. serializationObject.flares = [];
  16368. for (var index = 0; index < lensFlareSystem.lensFlares.length; index++) {
  16369. var flare = lensFlareSystem.lensFlares[index];
  16370. serializationObject.flares.push({
  16371. size: flare.size,
  16372. position: flare.position,
  16373. color: flare.color.asArray(),
  16374. textureName: BABYLON.Tools.GetFilename(flare.texture.name)
  16375. });
  16376. }
  16377. return serializationObject;
  16378. };
  16379. var serializeShadowGenerator = function (light) {
  16380. var serializationObject = {};
  16381. var shadowGenerator = light.getShadowGenerator();
  16382. serializationObject.lightId = light.id;
  16383. serializationObject.mapSize = shadowGenerator.getShadowMap().getRenderSize();
  16384. serializationObject.useVarianceShadowMap = shadowGenerator.useVarianceShadowMap;
  16385. serializationObject.usePoissonSampling = shadowGenerator.usePoissonSampling;
  16386. serializationObject.renderList = [];
  16387. for (var meshIndex = 0; meshIndex < shadowGenerator.getShadowMap().renderList.length; meshIndex++) {
  16388. var mesh = shadowGenerator.getShadowMap().renderList[meshIndex];
  16389. serializationObject.renderList.push(mesh.id);
  16390. }
  16391. return serializationObject;
  16392. };
  16393. var serializedGeometries = [];
  16394. var serializeGeometry = function (geometry, serializationGeometries) {
  16395. if (serializedGeometries[geometry.id]) {
  16396. return;
  16397. }
  16398. if (geometry instanceof BABYLON.Geometry.Primitives.Box) {
  16399. serializationGeometries.boxes.push(serializeBox(geometry));
  16400. } else if (geometry instanceof BABYLON.Geometry.Primitives.Sphere) {
  16401. serializationGeometries.spheres.push(serializeSphere(geometry));
  16402. } else if (geometry instanceof BABYLON.Geometry.Primitives.Cylinder) {
  16403. serializationGeometries.cylinders.push(serializeCylinder(geometry));
  16404. } else if (geometry instanceof BABYLON.Geometry.Primitives.Torus) {
  16405. serializationGeometries.toruses.push(serializeTorus(geometry));
  16406. } else if (geometry instanceof BABYLON.Geometry.Primitives.Ground) {
  16407. serializationGeometries.grounds.push(serializeGround(geometry));
  16408. } else if (geometry instanceof BABYLON.Geometry.Primitives.Plane) {
  16409. serializationGeometries.planes.push(serializePlane(geometry));
  16410. } else if (geometry instanceof BABYLON.Geometry.Primitives.TorusKnot) {
  16411. serializationGeometries.torusKnots.push(serializeTorusKnot(geometry));
  16412. } else if (geometry instanceof BABYLON.Geometry.Primitives._Primitive) {
  16413. throw new Error("Unknow primitive type");
  16414. } else {
  16415. serializationGeometries.vertexData.push(serializeVertexData(geometry));
  16416. }
  16417. serializedGeometries[geometry.id] = true;
  16418. };
  16419. var serializeGeometryBase = function (geometry) {
  16420. var serializationObject = {};
  16421. serializationObject.id = geometry.id;
  16422. if (BABYLON.Tags.HasTags(geometry)) {
  16423. serializationObject.tags = BABYLON.Tags.GetTags(geometry);
  16424. }
  16425. return serializationObject;
  16426. };
  16427. var serializeVertexData = function (vertexData) {
  16428. var serializationObject = serializeGeometryBase(vertexData);
  16429. if (vertexData.isVerticesDataPresent(BABYLON.VertexBuffer.PositionKind)) {
  16430. serializationObject.positions = vertexData.getVerticesData(BABYLON.VertexBuffer.PositionKind);
  16431. }
  16432. if (vertexData.isVerticesDataPresent(BABYLON.VertexBuffer.NormalKind)) {
  16433. serializationObject.normals = vertexData.getVerticesData(BABYLON.VertexBuffer.NormalKind);
  16434. }
  16435. if (vertexData.isVerticesDataPresent(BABYLON.VertexBuffer.UVKind)) {
  16436. serializationObject.uvs = vertexData.getVerticesData(BABYLON.VertexBuffer.UVKind);
  16437. }
  16438. if (vertexData.isVerticesDataPresent(BABYLON.VertexBuffer.UV2Kind)) {
  16439. serializationObject.uvs2 = vertexData.getVerticesData(BABYLON.VertexBuffer.UV2Kind);
  16440. }
  16441. if (vertexData.isVerticesDataPresent(BABYLON.VertexBuffer.ColorKind)) {
  16442. serializationObject.colors = vertexData.getVerticesData(BABYLON.VertexBuffer.ColorKind);
  16443. }
  16444. if (vertexData.isVerticesDataPresent(BABYLON.VertexBuffer.MatricesIndicesKind)) {
  16445. serializationObject.matricesIndices = vertexData.getVerticesData(BABYLON.VertexBuffer.MatricesIndicesKind);
  16446. serializationObject.matricesIndices._isExpanded = true;
  16447. }
  16448. if (vertexData.isVerticesDataPresent(BABYLON.VertexBuffer.MatricesWeightsKind)) {
  16449. serializationObject.matricesWeights = vertexData.getVerticesData(BABYLON.VertexBuffer.MatricesWeightsKind);
  16450. }
  16451. serializationObject.indices = vertexData.getIndices();
  16452. return serializationObject;
  16453. };
  16454. var serializePrimitive = function (primitive) {
  16455. var serializationObject = serializeGeometryBase(primitive);
  16456. serializationObject.canBeRegenerated = primitive.canBeRegenerated();
  16457. return serializationObject;
  16458. };
  16459. var serializeBox = function (box) {
  16460. var serializationObject = serializePrimitive(box);
  16461. serializationObject.size = box.size;
  16462. return serializationObject;
  16463. };
  16464. var serializeSphere = function (sphere) {
  16465. var serializationObject = serializePrimitive(sphere);
  16466. serializationObject.segments = sphere.segments;
  16467. serializationObject.diameter = sphere.diameter;
  16468. return serializationObject;
  16469. };
  16470. var serializeCylinder = function (cylinder) {
  16471. var serializationObject = serializePrimitive(cylinder);
  16472. serializationObject.height = cylinder.height;
  16473. serializationObject.diameterTop = cylinder.diameterTop;
  16474. serializationObject.diameterBottom = cylinder.diameterBottom;
  16475. serializationObject.tessellation = cylinder.tessellation;
  16476. return serializationObject;
  16477. };
  16478. var serializeTorus = function (torus) {
  16479. var serializationObject = serializePrimitive(torus);
  16480. serializationObject.diameter = torus.diameter;
  16481. serializationObject.thickness = torus.thickness;
  16482. serializationObject.tessellation = torus.tessellation;
  16483. return serializationObject;
  16484. };
  16485. var serializeGround = function (ground) {
  16486. var serializationObject = serializePrimitive(ground);
  16487. serializationObject.width = ground.width;
  16488. serializationObject.height = ground.height;
  16489. serializationObject.subdivisions = ground.subdivisions;
  16490. return serializationObject;
  16491. };
  16492. var serializePlane = function (plane) {
  16493. var serializationObject = serializePrimitive(plane);
  16494. serializationObject.size = plane.size;
  16495. return serializationObject;
  16496. };
  16497. var serializeTorusKnot = function (torusKnot) {
  16498. var serializationObject = serializePrimitive(torusKnot);
  16499. serializationObject.radius = torusKnot.radius;
  16500. serializationObject.tube = torusKnot.tube;
  16501. serializationObject.radialSegments = torusKnot.radialSegments;
  16502. serializationObject.tubularSegments = torusKnot.tubularSegments;
  16503. serializationObject.p = torusKnot.p;
  16504. serializationObject.q = torusKnot.q;
  16505. return serializationObject;
  16506. };
  16507. var serializeMesh = function (mesh, serializationScene) {
  16508. var serializationObject = {};
  16509. serializationObject.name = mesh.name;
  16510. serializationObject.id = mesh.id;
  16511. if (BABYLON.Tags.HasTags(mesh)) {
  16512. serializationObject.tags = BABYLON.Tags.GetTags(mesh);
  16513. }
  16514. serializationObject.position = mesh.position.asArray();
  16515. if (mesh.rotationQuaternion) {
  16516. serializationObject.rotationQuaternion = mesh.rotationQuaternion.asArray();
  16517. } else if (mesh.rotation) {
  16518. serializationObject.rotation = mesh.rotation.asArray();
  16519. }
  16520. serializationObject.scaling = mesh.scaling.asArray();
  16521. serializationObject.localMatrix = mesh.getPivotMatrix().asArray();
  16522. serializationObject.isEnabled = mesh.isEnabled();
  16523. serializationObject.isVisible = mesh.isVisible;
  16524. serializationObject.infiniteDistance = mesh.infiniteDistance;
  16525. serializationObject.pickable = mesh.isPickable;
  16526. serializationObject.receiveShadows = mesh.receiveShadows;
  16527. serializationObject.billboardMode = mesh.billboardMode;
  16528. serializationObject.visibility = mesh.visibility;
  16529. serializationObject.checkCollisions = mesh.checkCollisions;
  16530. // Parent
  16531. if (mesh.parent) {
  16532. serializationObject.parentId = mesh.parent.id;
  16533. }
  16534. // Geometry
  16535. var geometry = mesh._geometry;
  16536. if (geometry) {
  16537. var geometryId = geometry.id;
  16538. serializationObject.geometryId = geometryId;
  16539. if (!mesh.getScene().getGeometryByID(geometryId)) {
  16540. // geometry was in the memory but not added to the scene, nevertheless it's better to serialize too be able to reload the mesh with its geometry
  16541. serializeGeometry(geometry, serializationScene.geometries);
  16542. }
  16543. // SubMeshes
  16544. serializationObject.subMeshes = [];
  16545. for (var subIndex = 0; subIndex < mesh.subMeshes.length; subIndex++) {
  16546. var subMesh = mesh.subMeshes[subIndex];
  16547. serializationObject.subMeshes.push({
  16548. materialIndex: subMesh.materialIndex,
  16549. verticesStart: subMesh.verticesStart,
  16550. verticesCount: subMesh.verticesCount,
  16551. indexStart: subMesh.indexStart,
  16552. indexCount: subMesh.indexCount
  16553. });
  16554. }
  16555. }
  16556. // Material
  16557. if (mesh.material) {
  16558. serializationObject.materialId = mesh.material.id;
  16559. } else {
  16560. mesh.material = null;
  16561. }
  16562. // Skeleton
  16563. if (mesh.skeleton) {
  16564. serializationObject.skeletonId = mesh.skeleton.id;
  16565. }
  16566. // Physics
  16567. if (mesh.getPhysicsImpostor() !== BABYLON.PhysicsEngine.NoImpostor) {
  16568. serializationObject.physicsMass = mesh.getPhysicsMass();
  16569. serializationObject.physicsFriction = mesh.getPhysicsFriction();
  16570. serializationObject.physicsRestitution = mesh.getPhysicsRestitution();
  16571. switch (mesh.getPhysicsImpostor()) {
  16572. case BABYLON.PhysicsEngine.BoxImpostor:
  16573. serializationObject.physicsImpostor = 1;
  16574. break;
  16575. case BABYLON.PhysicsEngine.SphereImpostor:
  16576. serializationObject.physicsImpostor = 2;
  16577. break;
  16578. }
  16579. }
  16580. // Instances
  16581. serializationObject.instances = [];
  16582. for (var index = 0; index < mesh.instances.length; index++) {
  16583. var instance = mesh.instances[index];
  16584. var serializationInstance = {
  16585. name: instance.name,
  16586. position: instance.position,
  16587. rotation: instance.rotation,
  16588. rotationQuaternion: instance.rotationQuaternion,
  16589. scaling: instance.scaling
  16590. };
  16591. serializationObject.instances.push(serializationInstance);
  16592. // Animations
  16593. appendAnimations(instance, serializationInstance);
  16594. }
  16595. // Animations
  16596. appendAnimations(mesh, serializationObject);
  16597. // Layer mask
  16598. serializationObject.layerMask = mesh.layerMask;
  16599. return serializationObject;
  16600. };
  16601. var SceneSerializer = (function () {
  16602. function SceneSerializer() {
  16603. }
  16604. SceneSerializer.Serialize = function (scene) {
  16605. var serializationObject = {};
  16606. // Scene
  16607. serializationObject.useDelayedTextureLoading = scene.useDelayedTextureLoading;
  16608. serializationObject.autoClear = scene.autoClear;
  16609. serializationObject.clearColor = scene.clearColor.asArray();
  16610. serializationObject.ambientColor = scene.ambientColor.asArray();
  16611. serializationObject.gravity = scene.gravity.asArray();
  16612. // Fog
  16613. if (scene.fogMode && scene.fogMode !== 0) {
  16614. serializationObject.fogMode = scene.fogMode;
  16615. serializationObject.fogColor = scene.fogColor.asArray();
  16616. serializationObject.fogStart = scene.fogStart;
  16617. serializationObject.fogEnd = scene.fogEnd;
  16618. serializationObject.fogDensity = scene.fogDensity;
  16619. }
  16620. // Lights
  16621. serializationObject.lights = [];
  16622. for (var index = 0; index < scene.lights.length; index++) {
  16623. var light = scene.lights[index];
  16624. serializationObject.lights.push(serializeLight(light));
  16625. }
  16626. // Cameras
  16627. serializationObject.cameras = [];
  16628. for (index = 0; index < scene.cameras.length; index++) {
  16629. var camera = scene.cameras[index];
  16630. if (camera instanceof BABYLON.FreeCamera) {
  16631. serializationObject.cameras.push(serializeCamera(camera));
  16632. }
  16633. }
  16634. if (scene.activeCamera) {
  16635. serializationObject.activeCameraID = scene.activeCamera.id;
  16636. }
  16637. // Materials
  16638. serializationObject.materials = [];
  16639. serializationObject.multiMaterials = [];
  16640. for (index = 0; index < scene.materials.length; index++) {
  16641. var material = scene.materials[index];
  16642. if (material instanceof BABYLON.StandardMaterial) {
  16643. serializationObject.materials.push(serializeMaterial(material));
  16644. } else if (material instanceof BABYLON.MultiMaterial) {
  16645. serializationObject.multiMaterials.push(serializeMultiMaterial(material));
  16646. }
  16647. }
  16648. // Skeletons
  16649. serializationObject.skeletons = [];
  16650. for (index = 0; index < scene.skeletons.length; index++) {
  16651. serializationObject.skeletons.push(serializeSkeleton(scene.skeletons[index]));
  16652. }
  16653. // Geometries
  16654. serializationObject.geometries = {};
  16655. serializationObject.geometries.boxes = [];
  16656. serializationObject.geometries.spheres = [];
  16657. serializationObject.geometries.cylinders = [];
  16658. serializationObject.geometries.toruses = [];
  16659. serializationObject.geometries.grounds = [];
  16660. serializationObject.geometries.planes = [];
  16661. serializationObject.geometries.torusKnots = [];
  16662. serializationObject.geometries.vertexData = [];
  16663. serializedGeometries = [];
  16664. var geometries = scene.getGeometries();
  16665. for (var index = 0; index < geometries.length; index++) {
  16666. var geometry = geometries[index];
  16667. if (geometry.isReady()) {
  16668. serializeGeometry(geometry, serializationObject.geometries);
  16669. }
  16670. }
  16671. // Meshes
  16672. serializationObject.meshes = [];
  16673. for (index = 0; index < scene.meshes.length; index++) {
  16674. var abstractMesh = scene.meshes[index];
  16675. if (abstractMesh instanceof BABYLON.Mesh) {
  16676. var mesh = abstractMesh;
  16677. if (mesh.delayLoadState === BABYLON.Engine.DELAYLOADSTATE_LOADED || mesh.delayLoadState === BABYLON.Engine.DELAYLOADSTATE_NONE) {
  16678. serializationObject.meshes.push(serializeMesh(mesh, serializationObject));
  16679. }
  16680. }
  16681. }
  16682. // Particles Systems
  16683. serializationObject.particleSystems = [];
  16684. for (index = 0; index < scene.particleSystems.length; index++) {
  16685. serializationObject.particleSystems.push(serializeParticleSystem(scene.particleSystems[index]));
  16686. }
  16687. // Lens flares
  16688. serializationObject.lensFlareSystems = [];
  16689. for (index = 0; index < scene.lensFlareSystems.length; index++) {
  16690. serializationObject.lensFlareSystems.push(serializeLensFlareSystem(scene.lensFlareSystems[index]));
  16691. }
  16692. // Shadows
  16693. serializationObject.shadowGenerators = [];
  16694. for (index = 0; index < scene.lights.length; index++) {
  16695. light = scene.lights[index];
  16696. if (light.getShadowGenerator()) {
  16697. serializationObject.shadowGenerators.push(serializeShadowGenerator(light));
  16698. }
  16699. }
  16700. return serializationObject;
  16701. };
  16702. return SceneSerializer;
  16703. })();
  16704. BABYLON.SceneSerializer = SceneSerializer;
  16705. })(BABYLON || (BABYLON = {}));
  16706. //# sourceMappingURL=babylon.sceneSerializer.js.map
  16707. var BABYLON;
  16708. (function (BABYLON) {
  16709. var SceneLoader = (function () {
  16710. function SceneLoader() {
  16711. }
  16712. Object.defineProperty(SceneLoader, "ForceFullSceneLoadingForIncremental", {
  16713. get: function () {
  16714. return SceneLoader._ForceFullSceneLoadingForIncremental;
  16715. },
  16716. set: function (value) {
  16717. SceneLoader._ForceFullSceneLoadingForIncremental = value;
  16718. },
  16719. enumerable: true,
  16720. configurable: true
  16721. });
  16722. Object.defineProperty(SceneLoader, "ShowLoadingScreen", {
  16723. get: function () {
  16724. return SceneLoader._ShowLoadingScreen;
  16725. },
  16726. set: function (value) {
  16727. SceneLoader._ShowLoadingScreen = value;
  16728. },
  16729. enumerable: true,
  16730. configurable: true
  16731. });
  16732. SceneLoader._getPluginForFilename = function (sceneFilename) {
  16733. var dotPosition = sceneFilename.lastIndexOf(".");
  16734. var queryStringPosition = sceneFilename.indexOf("?");
  16735. var extension = sceneFilename.substring(dotPosition, queryStringPosition).toLowerCase();
  16736. for (var index = 0; index < this._registeredPlugins.length; index++) {
  16737. var plugin = this._registeredPlugins[index];
  16738. if (plugin.extensions.indexOf(extension) !== -1) {
  16739. return plugin;
  16740. }
  16741. }
  16742. return this._registeredPlugins[this._registeredPlugins.length - 1];
  16743. };
  16744. // Public functions
  16745. SceneLoader.RegisterPlugin = function (plugin) {
  16746. plugin.extensions = plugin.extensions.toLowerCase();
  16747. SceneLoader._registeredPlugins.push(plugin);
  16748. };
  16749. SceneLoader.ImportMesh = function (meshesNames, rootUrl, sceneFilename, scene, onsuccess, progressCallBack, onerror) {
  16750. var manifestChecked = function (success) {
  16751. scene.database = database;
  16752. var plugin = SceneLoader._getPluginForFilename(sceneFilename);
  16753. var importMeshFromData = function (data) {
  16754. var meshes = [];
  16755. var particleSystems = [];
  16756. var skeletons = [];
  16757. try {
  16758. if (!plugin.importMesh(meshesNames, scene, data, rootUrl, meshes, particleSystems, skeletons)) {
  16759. if (onerror) {
  16760. onerror(scene, 'unable to load the scene');
  16761. }
  16762. return;
  16763. }
  16764. } catch (e) {
  16765. if (onerror) {
  16766. onerror(scene, e);
  16767. }
  16768. return;
  16769. }
  16770. if (onsuccess) {
  16771. scene.importedMeshesFiles.push(rootUrl + sceneFilename);
  16772. onsuccess(meshes, particleSystems, skeletons);
  16773. }
  16774. };
  16775. if (sceneFilename.substr && sceneFilename.substr(0, 5) === "data:") {
  16776. // Direct load
  16777. importMeshFromData(sceneFilename.substr(5));
  16778. return;
  16779. }
  16780. BABYLON.Tools.LoadFile(rootUrl + sceneFilename, function (data) {
  16781. importMeshFromData(data);
  16782. }, progressCallBack, database);
  16783. };
  16784. // Checking if a manifest file has been set for this scene and if offline mode has been requested
  16785. var database = new BABYLON.Database(rootUrl + sceneFilename, manifestChecked);
  16786. };
  16787. /**
  16788. * Load a scene
  16789. * @param rootUrl a string that defines the root url for scene and resources
  16790. * @param sceneFilename a string that defines the name of the scene file. can start with "data:" following by the stringified version of the scene
  16791. * @param engine is the instance of BABYLON.Engine to use to create the scene
  16792. */
  16793. SceneLoader.Load = function (rootUrl, sceneFilename, engine, onsuccess, progressCallBack, onerror) {
  16794. SceneLoader.Append(rootUrl, sceneFilename, new BABYLON.Scene(engine), onsuccess, progressCallBack, onerror);
  16795. };
  16796. /**
  16797. * Append a scene
  16798. * @param rootUrl a string that defines the root url for scene and resources
  16799. * @param sceneFilename a string that defines the name of the scene file. can start with "data:" following by the stringified version of the scene
  16800. * @param scene is the instance of BABYLON.Scene to append to
  16801. */
  16802. SceneLoader.Append = function (rootUrl, sceneFilename, scene, onsuccess, progressCallBack, onerror) {
  16803. var plugin = this._getPluginForFilename(sceneFilename.name || sceneFilename);
  16804. var database;
  16805. if (SceneLoader.ShowLoadingScreen) {
  16806. scene.getEngine().displayLoadingUI();
  16807. }
  16808. var loadSceneFromData = function (data) {
  16809. scene.database = database;
  16810. if (!plugin.load(scene, data, rootUrl)) {
  16811. if (onerror) {
  16812. onerror(scene);
  16813. }
  16814. scene.getEngine().hideLoadingUI();
  16815. return;
  16816. }
  16817. if (onsuccess) {
  16818. onsuccess(scene);
  16819. }
  16820. if (SceneLoader.ShowLoadingScreen) {
  16821. scene.executeWhenReady(function () {
  16822. scene.getEngine().hideLoadingUI();
  16823. });
  16824. }
  16825. };
  16826. var manifestChecked = function (success) {
  16827. BABYLON.Tools.LoadFile(rootUrl + sceneFilename, loadSceneFromData, progressCallBack, database);
  16828. };
  16829. if (sceneFilename.substr && sceneFilename.substr(0, 5) === "data:") {
  16830. // Direct load
  16831. loadSceneFromData(sceneFilename.substr(5));
  16832. return;
  16833. }
  16834. if (rootUrl.indexOf("file:") === -1) {
  16835. // Checking if a manifest file has been set for this scene and if offline mode has been requested
  16836. database = new BABYLON.Database(rootUrl + sceneFilename, manifestChecked);
  16837. } else {
  16838. BABYLON.Tools.ReadFile(sceneFilename, loadSceneFromData, progressCallBack);
  16839. }
  16840. };
  16841. SceneLoader._ForceFullSceneLoadingForIncremental = false;
  16842. SceneLoader._ShowLoadingScreen = true;
  16843. SceneLoader._registeredPlugins = new Array();
  16844. return SceneLoader;
  16845. })();
  16846. BABYLON.SceneLoader = SceneLoader;
  16847. ;
  16848. })(BABYLON || (BABYLON = {}));
  16849. //# sourceMappingURL=babylon.sceneLoader.js.map
  16850. var BABYLON;
  16851. (function (BABYLON) {
  16852. (function (Internals) {
  16853. var checkColors4 = function (colors, count) {
  16854. // Check if color3 was used
  16855. if (colors.length === count * 3) {
  16856. var colors4 = [];
  16857. for (var index = 0; index < colors.length; index += 3) {
  16858. var newIndex = (index / 3) * 4;
  16859. colors4[newIndex] = colors[index];
  16860. colors4[newIndex + 1] = colors[index + 1];
  16861. colors4[newIndex + 2] = colors[index + 2];
  16862. colors4[newIndex + 3] = 1.0;
  16863. }
  16864. return colors4;
  16865. }
  16866. return colors;
  16867. };
  16868. var loadCubeTexture = function (rootUrl, parsedTexture, scene) {
  16869. var texture = new BABYLON.CubeTexture(rootUrl + parsedTexture.name, scene);
  16870. texture.name = parsedTexture.name;
  16871. texture.hasAlpha = parsedTexture.hasAlpha;
  16872. texture.level = parsedTexture.level;
  16873. texture.coordinatesMode = parsedTexture.coordinatesMode;
  16874. return texture;
  16875. };
  16876. var loadTexture = function (rootUrl, parsedTexture, scene) {
  16877. if (!parsedTexture.name && !parsedTexture.isRenderTarget) {
  16878. return null;
  16879. }
  16880. if (parsedTexture.isCube) {
  16881. return loadCubeTexture(rootUrl, parsedTexture, scene);
  16882. }
  16883. var texture;
  16884. if (parsedTexture.mirrorPlane) {
  16885. texture = new BABYLON.MirrorTexture(parsedTexture.name, parsedTexture.renderTargetSize, scene);
  16886. texture._waitingRenderList = parsedTexture.renderList;
  16887. texture.mirrorPlane = BABYLON.Plane.FromArray(parsedTexture.mirrorPlane);
  16888. } else if (parsedTexture.isRenderTarget) {
  16889. texture = new BABYLON.RenderTargetTexture(parsedTexture.name, parsedTexture.renderTargetSize, scene);
  16890. texture._waitingRenderList = parsedTexture.renderList;
  16891. } else {
  16892. texture = new BABYLON.Texture(rootUrl + parsedTexture.name, scene);
  16893. }
  16894. texture.name = parsedTexture.name;
  16895. texture.hasAlpha = parsedTexture.hasAlpha;
  16896. texture.getAlphaFromRGB = parsedTexture.getAlphaFromRGB;
  16897. texture.level = parsedTexture.level;
  16898. texture.coordinatesIndex = parsedTexture.coordinatesIndex;
  16899. texture.coordinatesMode = parsedTexture.coordinatesMode;
  16900. texture.uOffset = parsedTexture.uOffset;
  16901. texture.vOffset = parsedTexture.vOffset;
  16902. texture.uScale = parsedTexture.uScale;
  16903. texture.vScale = parsedTexture.vScale;
  16904. texture.uAng = parsedTexture.uAng;
  16905. texture.vAng = parsedTexture.vAng;
  16906. texture.wAng = parsedTexture.wAng;
  16907. texture.wrapU = parsedTexture.wrapU;
  16908. texture.wrapV = parsedTexture.wrapV;
  16909. // Animations
  16910. if (parsedTexture.animations) {
  16911. for (var animationIndex = 0; animationIndex < parsedTexture.animations.length; animationIndex++) {
  16912. var parsedAnimation = parsedTexture.animations[animationIndex];
  16913. texture.animations.push(parseAnimation(parsedAnimation));
  16914. }
  16915. }
  16916. return texture;
  16917. };
  16918. var parseSkeleton = function (parsedSkeleton, scene) {
  16919. var skeleton = new BABYLON.Skeleton(parsedSkeleton.name, parsedSkeleton.id, scene);
  16920. for (var index = 0; index < parsedSkeleton.bones.length; index++) {
  16921. var parsedBone = parsedSkeleton.bones[index];
  16922. var parentBone = null;
  16923. if (parsedBone.parentBoneIndex > -1) {
  16924. parentBone = skeleton.bones[parsedBone.parentBoneIndex];
  16925. }
  16926. var bone = new BABYLON.Bone(parsedBone.name, skeleton, parentBone, BABYLON.Matrix.FromArray(parsedBone.matrix));
  16927. if (parsedBone.animation) {
  16928. bone.animations.push(parseAnimation(parsedBone.animation));
  16929. }
  16930. }
  16931. return skeleton;
  16932. };
  16933. var parseFresnelParameters = function (parsedFresnelParameters) {
  16934. var fresnelParameters = new BABYLON.FresnelParameters();
  16935. fresnelParameters.isEnabled = parsedFresnelParameters.isEnabled;
  16936. fresnelParameters.leftColor = BABYLON.Color3.FromArray(parsedFresnelParameters.leftColor);
  16937. fresnelParameters.rightColor = BABYLON.Color3.FromArray(parsedFresnelParameters.rightColor);
  16938. fresnelParameters.bias = parsedFresnelParameters.bias;
  16939. fresnelParameters.power = parsedFresnelParameters.power || 1.0;
  16940. return fresnelParameters;
  16941. };
  16942. var parseMaterial = function (parsedMaterial, scene, rootUrl) {
  16943. var material;
  16944. material = new BABYLON.StandardMaterial(parsedMaterial.name, scene);
  16945. material.ambientColor = BABYLON.Color3.FromArray(parsedMaterial.ambient);
  16946. material.diffuseColor = BABYLON.Color3.FromArray(parsedMaterial.diffuse);
  16947. material.specularColor = BABYLON.Color3.FromArray(parsedMaterial.specular);
  16948. material.specularPower = parsedMaterial.specularPower;
  16949. material.emissiveColor = BABYLON.Color3.FromArray(parsedMaterial.emissive);
  16950. material.alpha = parsedMaterial.alpha;
  16951. material.id = parsedMaterial.id;
  16952. BABYLON.Tags.AddTagsTo(material, parsedMaterial.tags);
  16953. material.backFaceCulling = parsedMaterial.backFaceCulling;
  16954. material.wireframe = parsedMaterial.wireframe;
  16955. if (parsedMaterial.diffuseTexture) {
  16956. material.diffuseTexture = loadTexture(rootUrl, parsedMaterial.diffuseTexture, scene);
  16957. }
  16958. if (parsedMaterial.diffuseFresnelParameters) {
  16959. material.diffuseFresnelParameters = parseFresnelParameters(parsedMaterial.diffuseFresnelParameters);
  16960. }
  16961. if (parsedMaterial.ambientTexture) {
  16962. material.ambientTexture = loadTexture(rootUrl, parsedMaterial.ambientTexture, scene);
  16963. }
  16964. if (parsedMaterial.opacityTexture) {
  16965. material.opacityTexture = loadTexture(rootUrl, parsedMaterial.opacityTexture, scene);
  16966. }
  16967. if (parsedMaterial.opacityFresnelParameters) {
  16968. material.opacityFresnelParameters = parseFresnelParameters(parsedMaterial.opacityFresnelParameters);
  16969. }
  16970. if (parsedMaterial.reflectionTexture) {
  16971. material.reflectionTexture = loadTexture(rootUrl, parsedMaterial.reflectionTexture, scene);
  16972. }
  16973. if (parsedMaterial.reflectionFresnelParameters) {
  16974. material.reflectionFresnelParameters = parseFresnelParameters(parsedMaterial.reflectionFresnelParameters);
  16975. }
  16976. if (parsedMaterial.emissiveTexture) {
  16977. material.emissiveTexture = loadTexture(rootUrl, parsedMaterial.emissiveTexture, scene);
  16978. }
  16979. if (parsedMaterial.emissiveFresnelParameters) {
  16980. material.emissiveFresnelParameters = parseFresnelParameters(parsedMaterial.emissiveFresnelParameters);
  16981. }
  16982. if (parsedMaterial.specularTexture) {
  16983. material.specularTexture = loadTexture(rootUrl, parsedMaterial.specularTexture, scene);
  16984. }
  16985. if (parsedMaterial.bumpTexture) {
  16986. material.bumpTexture = loadTexture(rootUrl, parsedMaterial.bumpTexture, scene);
  16987. }
  16988. return material;
  16989. };
  16990. var parseMaterialById = function (id, parsedData, scene, rootUrl) {
  16991. for (var index = 0; index < parsedData.materials.length; index++) {
  16992. var parsedMaterial = parsedData.materials[index];
  16993. if (parsedMaterial.id === id) {
  16994. return parseMaterial(parsedMaterial, scene, rootUrl);
  16995. }
  16996. }
  16997. return null;
  16998. };
  16999. var parseMultiMaterial = function (parsedMultiMaterial, scene) {
  17000. var multiMaterial = new BABYLON.MultiMaterial(parsedMultiMaterial.name, scene);
  17001. multiMaterial.id = parsedMultiMaterial.id;
  17002. BABYLON.Tags.AddTagsTo(multiMaterial, parsedMultiMaterial.tags);
  17003. for (var matIndex = 0; matIndex < parsedMultiMaterial.materials.length; matIndex++) {
  17004. var subMatId = parsedMultiMaterial.materials[matIndex];
  17005. if (subMatId) {
  17006. multiMaterial.subMaterials.push(scene.getMaterialByID(subMatId));
  17007. } else {
  17008. multiMaterial.subMaterials.push(null);
  17009. }
  17010. }
  17011. return multiMaterial;
  17012. };
  17013. var parseLensFlareSystem = function (parsedLensFlareSystem, scene, rootUrl) {
  17014. var emitter = scene.getLastEntryByID(parsedLensFlareSystem.emitterId);
  17015. var lensFlareSystem = new BABYLON.LensFlareSystem("lensFlareSystem#" + parsedLensFlareSystem.emitterId, emitter, scene);
  17016. lensFlareSystem.borderLimit = parsedLensFlareSystem.borderLimit;
  17017. for (var index = 0; index < parsedLensFlareSystem.flares.length; index++) {
  17018. var parsedFlare = parsedLensFlareSystem.flares[index];
  17019. var flare = new BABYLON.LensFlare(parsedFlare.size, parsedFlare.position, BABYLON.Color3.FromArray(parsedFlare.color), rootUrl + parsedFlare.textureName, lensFlareSystem);
  17020. }
  17021. return lensFlareSystem;
  17022. };
  17023. var parseParticleSystem = function (parsedParticleSystem, scene, rootUrl) {
  17024. var emitter = scene.getLastMeshByID(parsedParticleSystem.emitterId);
  17025. var particleSystem = new BABYLON.ParticleSystem("particles#" + emitter.name, parsedParticleSystem.capacity, scene);
  17026. if (parsedParticleSystem.textureName) {
  17027. particleSystem.particleTexture = new BABYLON.Texture(rootUrl + parsedParticleSystem.textureName, scene);
  17028. particleSystem.particleTexture.name = parsedParticleSystem.textureName;
  17029. }
  17030. particleSystem.minAngularSpeed = parsedParticleSystem.minAngularSpeed;
  17031. particleSystem.maxAngularSpeed = parsedParticleSystem.maxAngularSpeed;
  17032. particleSystem.minSize = parsedParticleSystem.minSize;
  17033. particleSystem.maxSize = parsedParticleSystem.maxSize;
  17034. particleSystem.minLifeTime = parsedParticleSystem.minLifeTime;
  17035. particleSystem.maxLifeTime = parsedParticleSystem.maxLifeTime;
  17036. particleSystem.emitter = emitter;
  17037. particleSystem.emitRate = parsedParticleSystem.emitRate;
  17038. particleSystem.minEmitBox = BABYLON.Vector3.FromArray(parsedParticleSystem.minEmitBox);
  17039. particleSystem.maxEmitBox = BABYLON.Vector3.FromArray(parsedParticleSystem.maxEmitBox);
  17040. particleSystem.gravity = BABYLON.Vector3.FromArray(parsedParticleSystem.gravity);
  17041. particleSystem.direction1 = BABYLON.Vector3.FromArray(parsedParticleSystem.direction1);
  17042. particleSystem.direction2 = BABYLON.Vector3.FromArray(parsedParticleSystem.direction2);
  17043. particleSystem.color1 = BABYLON.Color4.FromArray(parsedParticleSystem.color1);
  17044. particleSystem.color2 = BABYLON.Color4.FromArray(parsedParticleSystem.color2);
  17045. particleSystem.colorDead = BABYLON.Color4.FromArray(parsedParticleSystem.colorDead);
  17046. particleSystem.updateSpeed = parsedParticleSystem.updateSpeed;
  17047. particleSystem.targetStopDuration = parsedParticleSystem.targetStopFrame;
  17048. particleSystem.textureMask = BABYLON.Color4.FromArray(parsedParticleSystem.textureMask);
  17049. particleSystem.blendMode = parsedParticleSystem.blendMode;
  17050. particleSystem.start();
  17051. return particleSystem;
  17052. };
  17053. var parseShadowGenerator = function (parsedShadowGenerator, scene) {
  17054. var light = scene.getLightByID(parsedShadowGenerator.lightId);
  17055. var shadowGenerator = new BABYLON.ShadowGenerator(parsedShadowGenerator.mapSize, light);
  17056. for (var meshIndex = 0; meshIndex < parsedShadowGenerator.renderList.length; meshIndex++) {
  17057. var mesh = scene.getMeshByID(parsedShadowGenerator.renderList[meshIndex]);
  17058. shadowGenerator.getShadowMap().renderList.push(mesh);
  17059. }
  17060. if (parsedShadowGenerator.usePoissonSampling) {
  17061. shadowGenerator.usePoissonSampling = true;
  17062. } else {
  17063. shadowGenerator.useVarianceShadowMap = parsedShadowGenerator.useVarianceShadowMap;
  17064. }
  17065. return shadowGenerator;
  17066. };
  17067. var parseAnimation = function (parsedAnimation) {
  17068. var animation = new BABYLON.Animation(parsedAnimation.name, parsedAnimation.property, parsedAnimation.framePerSecond, parsedAnimation.dataType, parsedAnimation.loopBehavior);
  17069. var dataType = parsedAnimation.dataType;
  17070. var keys = [];
  17071. for (var index = 0; index < parsedAnimation.keys.length; index++) {
  17072. var key = parsedAnimation.keys[index];
  17073. var data;
  17074. switch (dataType) {
  17075. case BABYLON.Animation.ANIMATIONTYPE_FLOAT:
  17076. data = key.values[0];
  17077. break;
  17078. case BABYLON.Animation.ANIMATIONTYPE_QUATERNION:
  17079. data = BABYLON.Quaternion.FromArray(key.values);
  17080. break;
  17081. case BABYLON.Animation.ANIMATIONTYPE_MATRIX:
  17082. data = BABYLON.Matrix.FromArray(key.values);
  17083. break;
  17084. case BABYLON.Animation.ANIMATIONTYPE_VECTOR3:
  17085. default:
  17086. data = BABYLON.Vector3.FromArray(key.values);
  17087. break;
  17088. }
  17089. keys.push({
  17090. frame: key.frame,
  17091. value: data
  17092. });
  17093. }
  17094. animation.setKeys(keys);
  17095. return animation;
  17096. };
  17097. var parseLight = function (parsedLight, scene) {
  17098. var light;
  17099. switch (parsedLight.type) {
  17100. case 0:
  17101. light = new BABYLON.PointLight(parsedLight.name, BABYLON.Vector3.FromArray(parsedLight.position), scene);
  17102. break;
  17103. case 1:
  17104. light = new BABYLON.DirectionalLight(parsedLight.name, BABYLON.Vector3.FromArray(parsedLight.direction), scene);
  17105. light.position = BABYLON.Vector3.FromArray(parsedLight.position);
  17106. break;
  17107. case 2:
  17108. light = new BABYLON.SpotLight(parsedLight.name, BABYLON.Vector3.FromArray(parsedLight.position), BABYLON.Vector3.FromArray(parsedLight.direction), parsedLight.angle, parsedLight.exponent, scene);
  17109. break;
  17110. case 3:
  17111. light = new BABYLON.HemisphericLight(parsedLight.name, BABYLON.Vector3.FromArray(parsedLight.direction), scene);
  17112. light.groundColor = BABYLON.Color3.FromArray(parsedLight.groundColor);
  17113. break;
  17114. }
  17115. light.id = parsedLight.id;
  17116. BABYLON.Tags.AddTagsTo(light, parsedLight.tags);
  17117. if (parsedLight.intensity !== undefined) {
  17118. light.intensity = parsedLight.intensity;
  17119. }
  17120. if (parsedLight.range) {
  17121. light.range = parsedLight.range;
  17122. }
  17123. light.diffuse = BABYLON.Color3.FromArray(parsedLight.diffuse);
  17124. light.specular = BABYLON.Color3.FromArray(parsedLight.specular);
  17125. if (parsedLight.excludedMeshesIds) {
  17126. light._excludedMeshesIds = parsedLight.excludedMeshesIds;
  17127. }
  17128. // Parent
  17129. if (parsedLight.parentId) {
  17130. light._waitingParentId = parsedLight.parentId;
  17131. }
  17132. if (parsedLight.includedOnlyMeshesIds) {
  17133. light._includedOnlyMeshesIds = parsedLight.includedOnlyMeshesIds;
  17134. }
  17135. // Animations
  17136. if (parsedLight.animations) {
  17137. for (var animationIndex = 0; animationIndex < parsedLight.animations.length; animationIndex++) {
  17138. var parsedAnimation = parsedLight.animations[animationIndex];
  17139. light.animations.push(parseAnimation(parsedAnimation));
  17140. }
  17141. }
  17142. if (parsedLight.autoAnimate) {
  17143. scene.beginAnimation(light, parsedLight.autoAnimateFrom, parsedLight.autoAnimateTo, parsedLight.autoAnimateLoop, 1.0);
  17144. }
  17145. };
  17146. var parseCamera = function (parsedCamera, scene) {
  17147. var camera;
  17148. var position = BABYLON.Vector3.FromArray(parsedCamera.position);
  17149. var lockedTargetMesh = (parsedCamera.lockedTargetId) ? scene.getLastMeshByID(parsedCamera.lockedTargetId) : null;
  17150. if (parsedCamera.type === "AnaglyphArcRotateCamera" || parsedCamera.type === "ArcRotateCamera") {
  17151. var alpha = parsedCamera.alpha;
  17152. var beta = parsedCamera.beta;
  17153. var radius = parsedCamera.radius;
  17154. if (parsedCamera.type === "AnaglyphArcRotateCamera") {
  17155. var eye_space = parsedCamera.eye_space;
  17156. camera = new BABYLON.AnaglyphArcRotateCamera(parsedCamera.name, alpha, beta, radius, lockedTargetMesh, eye_space, scene);
  17157. } else {
  17158. camera = new BABYLON.ArcRotateCamera(parsedCamera.name, alpha, beta, radius, lockedTargetMesh, scene);
  17159. }
  17160. } else if (parsedCamera.type === "AnaglyphFreeCamera") {
  17161. var eye_space = parsedCamera.eye_space;
  17162. camera = new BABYLON.AnaglyphFreeCamera(parsedCamera.name, position, eye_space, scene);
  17163. } else if (parsedCamera.type === "DeviceOrientationCamera") {
  17164. camera = new BABYLON.DeviceOrientationCamera(parsedCamera.name, position, scene);
  17165. } else if (parsedCamera.type === "FollowCamera") {
  17166. camera = new BABYLON.FollowCamera(parsedCamera.name, position, scene);
  17167. camera.heightOffset = parsedCamera.heightOffset;
  17168. camera.radius = parsedCamera.radius;
  17169. camera.rotationOffset = parsedCamera.rotationOffset;
  17170. if (lockedTargetMesh)
  17171. camera.target = lockedTargetMesh;
  17172. } else if (parsedCamera.type === "GamepadCamera") {
  17173. camera = new BABYLON.GamepadCamera(parsedCamera.name, position, scene);
  17174. } else if (parsedCamera.type === "OculusCamera") {
  17175. camera = new BABYLON.OculusCamera(parsedCamera.name, position, scene);
  17176. } else if (parsedCamera.type === "OculusGamepadCamera") {
  17177. camera = new BABYLON.OculusGamepadCamera(parsedCamera.name, position, scene);
  17178. } else if (parsedCamera.type === "TouchCamera") {
  17179. camera = new BABYLON.TouchCamera(parsedCamera.name, position, scene);
  17180. } else if (parsedCamera.type === "VirtualJoysticksCamera") {
  17181. camera = new BABYLON.VirtualJoysticksCamera(parsedCamera.name, position, scene);
  17182. } else if (parsedCamera.type === "WebVRCamera") {
  17183. camera = new BABYLON.WebVRCamera(parsedCamera.name, position, scene);
  17184. } else if (parsedCamera.type === "VRDeviceOrientationCamera") {
  17185. camera = new BABYLON.VRDeviceOrientationCamera(parsedCamera.name, position, scene);
  17186. } else {
  17187. // Free Camera is the default value
  17188. camera = new BABYLON.FreeCamera(parsedCamera.name, position, scene);
  17189. }
  17190. // Test for lockedTargetMesh & FreeCamera outside of if-else-if nest, since things like GamepadCamera extend FreeCamera
  17191. if (lockedTargetMesh && camera instanceof BABYLON.FreeCamera) {
  17192. camera.lockedTarget = lockedTargetMesh;
  17193. }
  17194. camera.id = parsedCamera.id;
  17195. BABYLON.Tags.AddTagsTo(camera, parsedCamera.tags);
  17196. // Parent
  17197. if (parsedCamera.parentId) {
  17198. camera._waitingParentId = parsedCamera.parentId;
  17199. }
  17200. // Target
  17201. if (parsedCamera.target) {
  17202. camera.setTarget(BABYLON.Vector3.FromArray(parsedCamera.target));
  17203. } else {
  17204. camera.rotation = BABYLON.Vector3.FromArray(parsedCamera.rotation);
  17205. }
  17206. camera.fov = parsedCamera.fov;
  17207. camera.minZ = parsedCamera.minZ;
  17208. camera.maxZ = parsedCamera.maxZ;
  17209. camera.speed = parsedCamera.speed;
  17210. camera.inertia = parsedCamera.inertia;
  17211. camera.checkCollisions = parsedCamera.checkCollisions;
  17212. camera.applyGravity = parsedCamera.applyGravity;
  17213. if (parsedCamera.ellipsoid) {
  17214. camera.ellipsoid = BABYLON.Vector3.FromArray(parsedCamera.ellipsoid);
  17215. }
  17216. // Animations
  17217. if (parsedCamera.animations) {
  17218. for (var animationIndex = 0; animationIndex < parsedCamera.animations.length; animationIndex++) {
  17219. var parsedAnimation = parsedCamera.animations[animationIndex];
  17220. camera.animations.push(parseAnimation(parsedAnimation));
  17221. }
  17222. }
  17223. if (parsedCamera.autoAnimate) {
  17224. scene.beginAnimation(camera, parsedCamera.autoAnimateFrom, parsedCamera.autoAnimateTo, parsedCamera.autoAnimateLoop, 1.0);
  17225. }
  17226. // Layer Mask
  17227. if (parsedCamera.layerMask && (!isNaN(parsedCamera.layerMask))) {
  17228. camera.layerMask = Math.abs(parseInt(parsedCamera.layerMask));
  17229. } else {
  17230. camera.layerMask = 0xFFFFFFFF;
  17231. }
  17232. return camera;
  17233. };
  17234. var parseGeometry = function (parsedGeometry, scene) {
  17235. var id = parsedGeometry.id;
  17236. return scene.getGeometryByID(id);
  17237. };
  17238. var parseBox = function (parsedBox, scene) {
  17239. if (parseGeometry(parsedBox, scene)) {
  17240. return null;
  17241. }
  17242. var box = new BABYLON.Geometry.Primitives.Box(parsedBox.id, scene, parsedBox.size, parsedBox.canBeRegenerated, null);
  17243. BABYLON.Tags.AddTagsTo(box, parsedBox.tags);
  17244. scene.pushGeometry(box, true);
  17245. return box;
  17246. };
  17247. var parseSphere = function (parsedSphere, scene) {
  17248. if (parseGeometry(parsedSphere, scene)) {
  17249. return null;
  17250. }
  17251. var sphere = new BABYLON.Geometry.Primitives.Sphere(parsedSphere.id, scene, parsedSphere.segments, parsedSphere.diameter, parsedSphere.canBeRegenerated, null);
  17252. BABYLON.Tags.AddTagsTo(sphere, parsedSphere.tags);
  17253. scene.pushGeometry(sphere, true);
  17254. return sphere;
  17255. };
  17256. var parseCylinder = function (parsedCylinder, scene) {
  17257. if (parseGeometry(parsedCylinder, scene)) {
  17258. return null;
  17259. }
  17260. var cylinder = new BABYLON.Geometry.Primitives.Cylinder(parsedCylinder.id, scene, parsedCylinder.height, parsedCylinder.diameterTop, parsedCylinder.diameterBottom, parsedCylinder.tessellation, parsedCylinder.subdivisions, parsedCylinder.canBeRegenerated, null);
  17261. BABYLON.Tags.AddTagsTo(cylinder, parsedCylinder.tags);
  17262. scene.pushGeometry(cylinder, true);
  17263. return cylinder;
  17264. };
  17265. var parseTorus = function (parsedTorus, scene) {
  17266. if (parseGeometry(parsedTorus, scene)) {
  17267. return null;
  17268. }
  17269. var torus = new BABYLON.Geometry.Primitives.Torus(parsedTorus.id, scene, parsedTorus.diameter, parsedTorus.thickness, parsedTorus.tessellation, parsedTorus.canBeRegenerated, null);
  17270. BABYLON.Tags.AddTagsTo(torus, parsedTorus.tags);
  17271. scene.pushGeometry(torus, true);
  17272. return torus;
  17273. };
  17274. var parseGround = function (parsedGround, scene) {
  17275. if (parseGeometry(parsedGround, scene)) {
  17276. return null;
  17277. }
  17278. var ground = new BABYLON.Geometry.Primitives.Ground(parsedGround.id, scene, parsedGround.width, parsedGround.height, parsedGround.subdivisions, parsedGround.canBeRegenerated, null);
  17279. BABYLON.Tags.AddTagsTo(ground, parsedGround.tags);
  17280. scene.pushGeometry(ground, true);
  17281. return ground;
  17282. };
  17283. var parsePlane = function (parsedPlane, scene) {
  17284. if (parseGeometry(parsedPlane, scene)) {
  17285. return null;
  17286. }
  17287. var plane = new BABYLON.Geometry.Primitives.Plane(parsedPlane.id, scene, parsedPlane.size, parsedPlane.canBeRegenerated, null);
  17288. BABYLON.Tags.AddTagsTo(plane, parsedPlane.tags);
  17289. scene.pushGeometry(plane, true);
  17290. return plane;
  17291. };
  17292. var parseTorusKnot = function (parsedTorusKnot, scene) {
  17293. if (parseGeometry(parsedTorusKnot, scene)) {
  17294. return null;
  17295. }
  17296. var torusKnot = new BABYLON.Geometry.Primitives.TorusKnot(parsedTorusKnot.id, scene, parsedTorusKnot.radius, parsedTorusKnot.tube, parsedTorusKnot.radialSegments, parsedTorusKnot.tubularSegments, parsedTorusKnot.p, parsedTorusKnot.q, parsedTorusKnot.canBeRegenerated, null);
  17297. BABYLON.Tags.AddTagsTo(torusKnot, parsedTorusKnot.tags);
  17298. scene.pushGeometry(torusKnot, true);
  17299. return torusKnot;
  17300. };
  17301. var parseVertexData = function (parsedVertexData, scene, rootUrl) {
  17302. if (parseGeometry(parsedVertexData, scene)) {
  17303. return null;
  17304. }
  17305. var geometry = new BABYLON.Geometry(parsedVertexData.id, scene);
  17306. BABYLON.Tags.AddTagsTo(geometry, parsedVertexData.tags);
  17307. if (parsedVertexData.delayLoadingFile) {
  17308. geometry.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_NOTLOADED;
  17309. geometry.delayLoadingFile = rootUrl + parsedVertexData.delayLoadingFile;
  17310. geometry._boundingInfo = new BABYLON.BoundingInfo(BABYLON.Vector3.FromArray(parsedVertexData.boundingBoxMinimum), BABYLON.Vector3.FromArray(parsedVertexData.boundingBoxMaximum));
  17311. geometry._delayInfo = [];
  17312. if (parsedVertexData.hasUVs) {
  17313. geometry._delayInfo.push(BABYLON.VertexBuffer.UVKind);
  17314. }
  17315. if (parsedVertexData.hasUVs2) {
  17316. geometry._delayInfo.push(BABYLON.VertexBuffer.UV2Kind);
  17317. }
  17318. if (parsedVertexData.hasColors) {
  17319. geometry._delayInfo.push(BABYLON.VertexBuffer.ColorKind);
  17320. }
  17321. if (parsedVertexData.hasMatricesIndices) {
  17322. geometry._delayInfo.push(BABYLON.VertexBuffer.MatricesIndicesKind);
  17323. }
  17324. if (parsedVertexData.hasMatricesWeights) {
  17325. geometry._delayInfo.push(BABYLON.VertexBuffer.MatricesWeightsKind);
  17326. }
  17327. geometry._delayLoadingFunction = importVertexData;
  17328. } else {
  17329. importVertexData(parsedVertexData, geometry);
  17330. }
  17331. scene.pushGeometry(geometry, true);
  17332. return geometry;
  17333. };
  17334. var parseMesh = function (parsedMesh, scene, rootUrl) {
  17335. var mesh = new BABYLON.Mesh(parsedMesh.name, scene);
  17336. mesh.id = parsedMesh.id;
  17337. BABYLON.Tags.AddTagsTo(mesh, parsedMesh.tags);
  17338. mesh.position = BABYLON.Vector3.FromArray(parsedMesh.position);
  17339. if (parsedMesh.rotationQuaternion) {
  17340. mesh.rotationQuaternion = BABYLON.Quaternion.FromArray(parsedMesh.rotationQuaternion);
  17341. } else if (parsedMesh.rotation) {
  17342. mesh.rotation = BABYLON.Vector3.FromArray(parsedMesh.rotation);
  17343. }
  17344. mesh.scaling = BABYLON.Vector3.FromArray(parsedMesh.scaling);
  17345. if (parsedMesh.localMatrix) {
  17346. mesh.setPivotMatrix(BABYLON.Matrix.FromArray(parsedMesh.localMatrix));
  17347. } else if (parsedMesh.pivotMatrix) {
  17348. mesh.setPivotMatrix(BABYLON.Matrix.FromArray(parsedMesh.pivotMatrix));
  17349. }
  17350. mesh.setEnabled(parsedMesh.isEnabled);
  17351. mesh.isVisible = parsedMesh.isVisible;
  17352. mesh.infiniteDistance = parsedMesh.infiniteDistance;
  17353. mesh.showBoundingBox = parsedMesh.showBoundingBox;
  17354. mesh.showSubMeshesBoundingBox = parsedMesh.showSubMeshesBoundingBox;
  17355. if (parsedMesh.applyFog !== undefined) {
  17356. mesh.applyFog = parsedMesh.applyFog;
  17357. }
  17358. if (parsedMesh.pickable !== undefined) {
  17359. mesh.isPickable = parsedMesh.pickable;
  17360. }
  17361. if (parsedMesh.alphaIndex !== undefined) {
  17362. mesh.alphaIndex = parsedMesh.alphaIndex;
  17363. }
  17364. mesh.receiveShadows = parsedMesh.receiveShadows;
  17365. mesh.billboardMode = parsedMesh.billboardMode;
  17366. if (parsedMesh.visibility !== undefined) {
  17367. mesh.visibility = parsedMesh.visibility;
  17368. }
  17369. mesh.checkCollisions = parsedMesh.checkCollisions;
  17370. mesh._shouldGenerateFlatShading = parsedMesh.useFlatShading;
  17371. // Parent
  17372. if (parsedMesh.parentId) {
  17373. mesh._waitingParentId = parsedMesh.parentId;
  17374. }
  17375. // Geometry
  17376. mesh.hasVertexAlpha = parsedMesh.hasVertexAlpha;
  17377. if (parsedMesh.delayLoadingFile) {
  17378. mesh.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_NOTLOADED;
  17379. mesh.delayLoadingFile = rootUrl + parsedMesh.delayLoadingFile;
  17380. mesh._boundingInfo = new BABYLON.BoundingInfo(BABYLON.Vector3.FromArray(parsedMesh.boundingBoxMinimum), BABYLON.Vector3.FromArray(parsedMesh.boundingBoxMaximum));
  17381. if (parsedMesh._binaryInfo) {
  17382. mesh._binaryInfo = parsedMesh._binaryInfo;
  17383. }
  17384. mesh._delayInfo = [];
  17385. if (parsedMesh.hasUVs) {
  17386. mesh._delayInfo.push(BABYLON.VertexBuffer.UVKind);
  17387. }
  17388. if (parsedMesh.hasUVs2) {
  17389. mesh._delayInfo.push(BABYLON.VertexBuffer.UV2Kind);
  17390. }
  17391. if (parsedMesh.hasColors) {
  17392. mesh._delayInfo.push(BABYLON.VertexBuffer.ColorKind);
  17393. }
  17394. if (parsedMesh.hasMatricesIndices) {
  17395. mesh._delayInfo.push(BABYLON.VertexBuffer.MatricesIndicesKind);
  17396. }
  17397. if (parsedMesh.hasMatricesWeights) {
  17398. mesh._delayInfo.push(BABYLON.VertexBuffer.MatricesWeightsKind);
  17399. }
  17400. mesh._delayLoadingFunction = importGeometry;
  17401. if (BABYLON.SceneLoader.ForceFullSceneLoadingForIncremental) {
  17402. mesh._checkDelayState();
  17403. }
  17404. } else {
  17405. importGeometry(parsedMesh, mesh);
  17406. }
  17407. // Material
  17408. if (parsedMesh.materialId) {
  17409. mesh.setMaterialByID(parsedMesh.materialId);
  17410. } else {
  17411. mesh.material = null;
  17412. }
  17413. // Skeleton
  17414. if (parsedMesh.skeletonId > -1) {
  17415. mesh.skeleton = scene.getLastSkeletonByID(parsedMesh.skeletonId);
  17416. }
  17417. // Physics
  17418. if (parsedMesh.physicsImpostor) {
  17419. if (!scene.isPhysicsEnabled()) {
  17420. scene.enablePhysics();
  17421. }
  17422. mesh.setPhysicsState({ impostor: parsedMesh.physicsImpostor, mass: parsedMesh.physicsMass, friction: parsedMesh.physicsFriction, restitution: parsedMesh.physicsRestitution });
  17423. }
  17424. // Animations
  17425. if (parsedMesh.animations) {
  17426. for (var animationIndex = 0; animationIndex < parsedMesh.animations.length; animationIndex++) {
  17427. var parsedAnimation = parsedMesh.animations[animationIndex];
  17428. mesh.animations.push(parseAnimation(parsedAnimation));
  17429. }
  17430. }
  17431. if (parsedMesh.autoAnimate) {
  17432. scene.beginAnimation(mesh, parsedMesh.autoAnimateFrom, parsedMesh.autoAnimateTo, parsedMesh.autoAnimateLoop, 1.0);
  17433. }
  17434. // Layer Mask
  17435. if (parsedMesh.layerMask && (!isNaN(parsedMesh.layerMask))) {
  17436. mesh.layerMask = Math.abs(parseInt(parsedMesh.layerMask));
  17437. } else {
  17438. mesh.layerMask = 0xFFFFFFFF;
  17439. }
  17440. // Instances
  17441. if (parsedMesh.instances) {
  17442. for (var index = 0; index < parsedMesh.instances.length; index++) {
  17443. var parsedInstance = parsedMesh.instances[index];
  17444. var instance = mesh.createInstance(parsedInstance.name);
  17445. BABYLON.Tags.AddTagsTo(instance, parsedInstance.tags);
  17446. instance.position = BABYLON.Vector3.FromArray(parsedInstance.position);
  17447. if (parsedInstance.rotationQuaternion) {
  17448. instance.rotationQuaternion = BABYLON.Quaternion.FromArray(parsedInstance.rotationQuaternion);
  17449. } else if (parsedInstance.rotation) {
  17450. instance.rotation = BABYLON.Vector3.FromArray(parsedInstance.rotation);
  17451. }
  17452. instance.scaling = BABYLON.Vector3.FromArray(parsedInstance.scaling);
  17453. instance.checkCollisions = mesh.checkCollisions;
  17454. if (parsedMesh.animations) {
  17455. for (animationIndex = 0; animationIndex < parsedMesh.animations.length; animationIndex++) {
  17456. parsedAnimation = parsedMesh.animations[animationIndex];
  17457. instance.animations.push(parseAnimation(parsedAnimation));
  17458. }
  17459. }
  17460. }
  17461. }
  17462. return mesh;
  17463. };
  17464. var isDescendantOf = function (mesh, names, hierarchyIds) {
  17465. names = (names instanceof Array) ? names : [names];
  17466. for (var i in names) {
  17467. if (mesh.name === names[i]) {
  17468. hierarchyIds.push(mesh.id);
  17469. return true;
  17470. }
  17471. }
  17472. if (mesh.parentId && hierarchyIds.indexOf(mesh.parentId) !== -1) {
  17473. hierarchyIds.push(mesh.id);
  17474. return true;
  17475. }
  17476. return false;
  17477. };
  17478. var importVertexData = function (parsedVertexData, geometry) {
  17479. var vertexData = new BABYLON.VertexData();
  17480. // positions
  17481. var positions = parsedVertexData.positions;
  17482. if (positions) {
  17483. vertexData.set(positions, BABYLON.VertexBuffer.PositionKind);
  17484. }
  17485. // normals
  17486. var normals = parsedVertexData.normals;
  17487. if (normals) {
  17488. vertexData.set(normals, BABYLON.VertexBuffer.NormalKind);
  17489. }
  17490. // uvs
  17491. var uvs = parsedVertexData.uvs;
  17492. if (uvs) {
  17493. vertexData.set(uvs, BABYLON.VertexBuffer.UVKind);
  17494. }
  17495. // uv2s
  17496. var uv2s = parsedVertexData.uv2s;
  17497. if (uv2s) {
  17498. vertexData.set(uv2s, BABYLON.VertexBuffer.UV2Kind);
  17499. }
  17500. // colors
  17501. var colors = parsedVertexData.colors;
  17502. if (colors) {
  17503. vertexData.set(checkColors4(colors, positions.length / 3), BABYLON.VertexBuffer.ColorKind);
  17504. }
  17505. // matricesIndices
  17506. var matricesIndices = parsedVertexData.matricesIndices;
  17507. if (matricesIndices) {
  17508. vertexData.set(matricesIndices, BABYLON.VertexBuffer.MatricesIndicesKind);
  17509. }
  17510. // matricesWeights
  17511. var matricesWeights = parsedVertexData.matricesWeights;
  17512. if (matricesWeights) {
  17513. vertexData.set(matricesWeights, BABYLON.VertexBuffer.MatricesWeightsKind);
  17514. }
  17515. // indices
  17516. var indices = parsedVertexData.indices;
  17517. if (indices) {
  17518. vertexData.indices = indices;
  17519. }
  17520. geometry.setAllVerticesData(vertexData, parsedVertexData.updatable);
  17521. };
  17522. var importGeometry = function (parsedGeometry, mesh) {
  17523. var scene = mesh.getScene();
  17524. // Geometry
  17525. var geometryId = parsedGeometry.geometryId;
  17526. if (geometryId) {
  17527. var geometry = scene.getGeometryByID(geometryId);
  17528. if (geometry) {
  17529. geometry.applyToMesh(mesh);
  17530. }
  17531. } else if (parsedGeometry instanceof ArrayBuffer) {
  17532. var binaryInfo = mesh._binaryInfo;
  17533. if (binaryInfo.positionsAttrDesc && binaryInfo.positionsAttrDesc.count > 0) {
  17534. var positionsData = new Float32Array(parsedGeometry, binaryInfo.positionsAttrDesc.offset, binaryInfo.positionsAttrDesc.count);
  17535. mesh.setVerticesData(BABYLON.VertexBuffer.PositionKind, positionsData, false);
  17536. }
  17537. if (binaryInfo.normalsAttrDesc && binaryInfo.normalsAttrDesc.count > 0) {
  17538. var normalsData = new Float32Array(parsedGeometry, binaryInfo.normalsAttrDesc.offset, binaryInfo.normalsAttrDesc.count);
  17539. mesh.setVerticesData(BABYLON.VertexBuffer.NormalKind, normalsData, false);
  17540. }
  17541. if (binaryInfo.uvsAttrDesc && binaryInfo.uvsAttrDesc.count > 0) {
  17542. var uvsData = new Float32Array(parsedGeometry, binaryInfo.uvsAttrDesc.offset, binaryInfo.uvsAttrDesc.count);
  17543. mesh.setVerticesData(BABYLON.VertexBuffer.UVKind, uvsData, false);
  17544. }
  17545. if (binaryInfo.uvs2AttrDesc && binaryInfo.uvs2AttrDesc.count > 0) {
  17546. var uvs2Data = new Float32Array(parsedGeometry, binaryInfo.uvs2AttrDesc.offset, binaryInfo.uvs2AttrDesc.count);
  17547. mesh.setVerticesData(BABYLON.VertexBuffer.UV2Kind, uvs2Data, false);
  17548. }
  17549. if (binaryInfo.colorsAttrDesc && binaryInfo.colorsAttrDesc.count > 0) {
  17550. var colorsData = new Float32Array(parsedGeometry, binaryInfo.colorsAttrDesc.offset, binaryInfo.colorsAttrDesc.count);
  17551. mesh.setVerticesData(BABYLON.VertexBuffer.ColorKind, colorsData, false);
  17552. }
  17553. if (binaryInfo.matricesIndicesAttrDesc && binaryInfo.matricesIndicesAttrDesc.count > 0) {
  17554. var matricesIndicesData = new Int32Array(parsedGeometry, binaryInfo.matricesIndicesAttrDesc.offset, binaryInfo.matricesIndicesAttrDesc.count);
  17555. mesh.setVerticesData(BABYLON.VertexBuffer.MatricesIndicesKind, matricesIndicesData, false);
  17556. }
  17557. if (binaryInfo.matricesWeightsAttrDesc && binaryInfo.matricesWeightsAttrDesc.count > 0) {
  17558. var matricesWeightsData = new Float32Array(parsedGeometry, binaryInfo.matricesWeightsAttrDesc.offset, binaryInfo.matricesWeightsAttrDesc.count);
  17559. mesh.setVerticesData(BABYLON.VertexBuffer.MatricesWeightsKind, matricesWeightsData, false);
  17560. }
  17561. if (binaryInfo.indicesAttrDesc && binaryInfo.indicesAttrDesc.count > 0) {
  17562. var indicesData = new Int32Array(parsedGeometry, binaryInfo.indicesAttrDesc.offset, binaryInfo.indicesAttrDesc.count);
  17563. mesh.setIndices(indicesData);
  17564. }
  17565. if (binaryInfo.subMeshesAttrDesc && binaryInfo.subMeshesAttrDesc.count > 0) {
  17566. var subMeshesData = new Int32Array(parsedGeometry, binaryInfo.subMeshesAttrDesc.offset, binaryInfo.subMeshesAttrDesc.count * 5);
  17567. mesh.subMeshes = [];
  17568. for (var i = 0; i < binaryInfo.subMeshesAttrDesc.count; i++) {
  17569. var materialIndex = subMeshesData[(i * 5) + 0];
  17570. var verticesStart = subMeshesData[(i * 5) + 1];
  17571. var verticesCount = subMeshesData[(i * 5) + 2];
  17572. var indexStart = subMeshesData[(i * 5) + 3];
  17573. var indexCount = subMeshesData[(i * 5) + 4];
  17574. var subMesh = new BABYLON.SubMesh(materialIndex, verticesStart, verticesCount, indexStart, indexCount, mesh);
  17575. }
  17576. }
  17577. } else if (parsedGeometry.positions && parsedGeometry.normals && parsedGeometry.indices) {
  17578. mesh.setVerticesData(BABYLON.VertexBuffer.PositionKind, parsedGeometry.positions, false);
  17579. mesh.setVerticesData(BABYLON.VertexBuffer.NormalKind, parsedGeometry.normals, false);
  17580. if (parsedGeometry.uvs) {
  17581. mesh.setVerticesData(BABYLON.VertexBuffer.UVKind, parsedGeometry.uvs, false);
  17582. }
  17583. if (parsedGeometry.uvs2) {
  17584. mesh.setVerticesData(BABYLON.VertexBuffer.UV2Kind, parsedGeometry.uvs2, false);
  17585. }
  17586. if (parsedGeometry.colors) {
  17587. mesh.setVerticesData(BABYLON.VertexBuffer.ColorKind, checkColors4(parsedGeometry.colors, parsedGeometry.positions.length / 3), false);
  17588. }
  17589. if (parsedGeometry.matricesIndices) {
  17590. if (!parsedGeometry.matricesIndices._isExpanded) {
  17591. var floatIndices = [];
  17592. for (var i = 0; i < parsedGeometry.matricesIndices.length; i++) {
  17593. var matricesIndex = parsedGeometry.matricesIndices[i];
  17594. floatIndices.push(matricesIndex & 0x000000FF);
  17595. floatIndices.push((matricesIndex & 0x0000FF00) >> 8);
  17596. floatIndices.push((matricesIndex & 0x00FF0000) >> 16);
  17597. floatIndices.push(matricesIndex >> 24);
  17598. }
  17599. mesh.setVerticesData(BABYLON.VertexBuffer.MatricesIndicesKind, floatIndices, false);
  17600. } else {
  17601. delete parsedGeometry.matricesIndices._isExpanded;
  17602. mesh.setVerticesData(BABYLON.VertexBuffer.MatricesIndicesKind, parsedGeometry.matricesIndices, false);
  17603. }
  17604. }
  17605. if (parsedGeometry.matricesWeights) {
  17606. mesh.setVerticesData(BABYLON.VertexBuffer.MatricesWeightsKind, parsedGeometry.matricesWeights, false);
  17607. }
  17608. mesh.setIndices(parsedGeometry.indices);
  17609. // SubMeshes
  17610. if (parsedGeometry.subMeshes) {
  17611. mesh.subMeshes = [];
  17612. for (var subIndex = 0; subIndex < parsedGeometry.subMeshes.length; subIndex++) {
  17613. var parsedSubMesh = parsedGeometry.subMeshes[subIndex];
  17614. var subMesh = new BABYLON.SubMesh(parsedSubMesh.materialIndex, parsedSubMesh.verticesStart, parsedSubMesh.verticesCount, parsedSubMesh.indexStart, parsedSubMesh.indexCount, mesh);
  17615. }
  17616. }
  17617. }
  17618. // Flat shading
  17619. if (mesh._shouldGenerateFlatShading) {
  17620. mesh.convertToFlatShadedMesh();
  17621. delete mesh._shouldGenerateFlatShading;
  17622. }
  17623. // Update
  17624. mesh.computeWorldMatrix(true);
  17625. // Octree
  17626. if (scene._selectionOctree) {
  17627. scene._selectionOctree.addMesh(mesh);
  17628. }
  17629. };
  17630. BABYLON.SceneLoader.RegisterPlugin({
  17631. extensions: ".babylon",
  17632. importMesh: function (meshesNames, scene, data, rootUrl, meshes, particleSystems, skeletons) {
  17633. var parsedData = JSON.parse(data);
  17634. var loadedSkeletonsIds = [];
  17635. var loadedMaterialsIds = [];
  17636. var hierarchyIds = [];
  17637. for (var index = 0; index < parsedData.meshes.length; index++) {
  17638. var parsedMesh = parsedData.meshes[index];
  17639. if (!meshesNames || isDescendantOf(parsedMesh, meshesNames, hierarchyIds)) {
  17640. if (meshesNames instanceof Array) {
  17641. // Remove found mesh name from list.
  17642. delete meshesNames[meshesNames.indexOf(parsedMesh.name)];
  17643. }
  17644. // Material ?
  17645. if (parsedMesh.materialId) {
  17646. var materialFound = (loadedMaterialsIds.indexOf(parsedMesh.materialId) !== -1);
  17647. if (!materialFound) {
  17648. for (var multimatIndex = 0; multimatIndex < parsedData.multiMaterials.length; multimatIndex++) {
  17649. var parsedMultiMaterial = parsedData.multiMaterials[multimatIndex];
  17650. if (parsedMultiMaterial.id == parsedMesh.materialId) {
  17651. for (var matIndex = 0; matIndex < parsedMultiMaterial.materials.length; matIndex++) {
  17652. var subMatId = parsedMultiMaterial.materials[matIndex];
  17653. loadedMaterialsIds.push(subMatId);
  17654. parseMaterialById(subMatId, parsedData, scene, rootUrl);
  17655. }
  17656. loadedMaterialsIds.push(parsedMultiMaterial.id);
  17657. parseMultiMaterial(parsedMultiMaterial, scene);
  17658. materialFound = true;
  17659. break;
  17660. }
  17661. }
  17662. }
  17663. if (!materialFound) {
  17664. loadedMaterialsIds.push(parsedMesh.materialId);
  17665. parseMaterialById(parsedMesh.materialId, parsedData, scene, rootUrl);
  17666. }
  17667. }
  17668. // Skeleton ?
  17669. if (parsedMesh.skeletonId > -1 && scene.skeletons) {
  17670. var skeletonAlreadyLoaded = (loadedSkeletonsIds.indexOf(parsedMesh.skeletonId) > -1);
  17671. if (!skeletonAlreadyLoaded) {
  17672. for (var skeletonIndex = 0; skeletonIndex < parsedData.skeletons.length; skeletonIndex++) {
  17673. var parsedSkeleton = parsedData.skeletons[skeletonIndex];
  17674. if (parsedSkeleton.id === parsedMesh.skeletonId) {
  17675. skeletons.push(parseSkeleton(parsedSkeleton, scene));
  17676. loadedSkeletonsIds.push(parsedSkeleton.id);
  17677. }
  17678. }
  17679. }
  17680. }
  17681. var mesh = parseMesh(parsedMesh, scene, rootUrl);
  17682. meshes.push(mesh);
  17683. }
  17684. }
  17685. for (index = 0; index < scene.meshes.length; index++) {
  17686. var currentMesh = scene.meshes[index];
  17687. if (currentMesh._waitingParentId) {
  17688. currentMesh.parent = scene.getLastEntryByID(currentMesh._waitingParentId);
  17689. currentMesh._waitingParentId = undefined;
  17690. }
  17691. }
  17692. // Particles
  17693. if (parsedData.particleSystems) {
  17694. for (index = 0; index < parsedData.particleSystems.length; index++) {
  17695. var parsedParticleSystem = parsedData.particleSystems[index];
  17696. if (hierarchyIds.indexOf(parsedParticleSystem.emitterId) !== -1) {
  17697. particleSystems.push(parseParticleSystem(parsedParticleSystem, scene, rootUrl));
  17698. }
  17699. }
  17700. }
  17701. return true;
  17702. },
  17703. load: function (scene, data, rootUrl) {
  17704. var parsedData = JSON.parse(data);
  17705. // Scene
  17706. scene.useDelayedTextureLoading = parsedData.useDelayedTextureLoading && !BABYLON.SceneLoader.ForceFullSceneLoadingForIncremental;
  17707. scene.autoClear = parsedData.autoClear;
  17708. scene.clearColor = BABYLON.Color3.FromArray(parsedData.clearColor);
  17709. scene.ambientColor = BABYLON.Color3.FromArray(parsedData.ambientColor);
  17710. scene.gravity = BABYLON.Vector3.FromArray(parsedData.gravity);
  17711. // Fog
  17712. if (parsedData.fogMode && parsedData.fogMode !== 0) {
  17713. scene.fogMode = parsedData.fogMode;
  17714. scene.fogColor = BABYLON.Color3.FromArray(parsedData.fogColor);
  17715. scene.fogStart = parsedData.fogStart;
  17716. scene.fogEnd = parsedData.fogEnd;
  17717. scene.fogDensity = parsedData.fogDensity;
  17718. }
  17719. for (var index = 0; index < parsedData.lights.length; index++) {
  17720. var parsedLight = parsedData.lights[index];
  17721. parseLight(parsedLight, scene);
  17722. }
  17723. // Materials
  17724. if (parsedData.materials) {
  17725. for (index = 0; index < parsedData.materials.length; index++) {
  17726. var parsedMaterial = parsedData.materials[index];
  17727. parseMaterial(parsedMaterial, scene, rootUrl);
  17728. }
  17729. }
  17730. if (parsedData.multiMaterials) {
  17731. for (index = 0; index < parsedData.multiMaterials.length; index++) {
  17732. var parsedMultiMaterial = parsedData.multiMaterials[index];
  17733. parseMultiMaterial(parsedMultiMaterial, scene);
  17734. }
  17735. }
  17736. // Skeletons
  17737. if (parsedData.skeletons) {
  17738. for (index = 0; index < parsedData.skeletons.length; index++) {
  17739. var parsedSkeleton = parsedData.skeletons[index];
  17740. parseSkeleton(parsedSkeleton, scene);
  17741. }
  17742. }
  17743. // Geometries
  17744. var geometries = parsedData.geometries;
  17745. if (geometries) {
  17746. // Boxes
  17747. var boxes = geometries.boxes;
  17748. if (boxes) {
  17749. for (index = 0; index < boxes.length; index++) {
  17750. var parsedBox = boxes[index];
  17751. parseBox(parsedBox, scene);
  17752. }
  17753. }
  17754. // Spheres
  17755. var spheres = geometries.spheres;
  17756. if (spheres) {
  17757. for (index = 0; index < spheres.length; index++) {
  17758. var parsedSphere = spheres[index];
  17759. parseSphere(parsedSphere, scene);
  17760. }
  17761. }
  17762. // Cylinders
  17763. var cylinders = geometries.cylinders;
  17764. if (cylinders) {
  17765. for (index = 0; index < cylinders.length; index++) {
  17766. var parsedCylinder = cylinders[index];
  17767. parseCylinder(parsedCylinder, scene);
  17768. }
  17769. }
  17770. // Toruses
  17771. var toruses = geometries.toruses;
  17772. if (toruses) {
  17773. for (index = 0; index < toruses.length; index++) {
  17774. var parsedTorus = toruses[index];
  17775. parseTorus(parsedTorus, scene);
  17776. }
  17777. }
  17778. // Grounds
  17779. var grounds = geometries.grounds;
  17780. if (grounds) {
  17781. for (index = 0; index < grounds.length; index++) {
  17782. var parsedGround = grounds[index];
  17783. parseGround(parsedGround, scene);
  17784. }
  17785. }
  17786. // Planes
  17787. var planes = geometries.planes;
  17788. if (planes) {
  17789. for (index = 0; index < planes.length; index++) {
  17790. var parsedPlane = planes[index];
  17791. parsePlane(parsedPlane, scene);
  17792. }
  17793. }
  17794. // TorusKnots
  17795. var torusKnots = geometries.torusKnots;
  17796. if (torusKnots) {
  17797. for (index = 0; index < torusKnots.length; index++) {
  17798. var parsedTorusKnot = torusKnots[index];
  17799. parseTorusKnot(parsedTorusKnot, scene);
  17800. }
  17801. }
  17802. // VertexData
  17803. var vertexData = geometries.vertexData;
  17804. if (vertexData) {
  17805. for (index = 0; index < vertexData.length; index++) {
  17806. var parsedVertexData = vertexData[index];
  17807. parseVertexData(parsedVertexData, scene, rootUrl);
  17808. }
  17809. }
  17810. }
  17811. for (index = 0; index < parsedData.meshes.length; index++) {
  17812. var parsedMesh = parsedData.meshes[index];
  17813. parseMesh(parsedMesh, scene, rootUrl);
  17814. }
  17815. for (index = 0; index < parsedData.cameras.length; index++) {
  17816. var parsedCamera = parsedData.cameras[index];
  17817. parseCamera(parsedCamera, scene);
  17818. }
  17819. if (parsedData.activeCameraID) {
  17820. scene.setActiveCameraByID(parsedData.activeCameraID);
  17821. }
  17822. for (index = 0; index < scene.cameras.length; index++) {
  17823. var camera = scene.cameras[index];
  17824. if (camera._waitingParentId) {
  17825. camera.parent = scene.getLastEntryByID(camera._waitingParentId);
  17826. camera._waitingParentId = undefined;
  17827. }
  17828. }
  17829. for (index = 0; index < scene.lights.length; index++) {
  17830. var light = scene.lights[index];
  17831. if (light._waitingParentId) {
  17832. light.parent = scene.getLastEntryByID(light._waitingParentId);
  17833. light._waitingParentId = undefined;
  17834. }
  17835. }
  17836. for (index = 0; index < scene.meshes.length; index++) {
  17837. var mesh = scene.meshes[index];
  17838. if (mesh._waitingParentId) {
  17839. mesh.parent = scene.getLastEntryByID(mesh._waitingParentId);
  17840. mesh._waitingParentId = undefined;
  17841. }
  17842. }
  17843. // Particles Systems
  17844. if (parsedData.particleSystems) {
  17845. for (index = 0; index < parsedData.particleSystems.length; index++) {
  17846. var parsedParticleSystem = parsedData.particleSystems[index];
  17847. parseParticleSystem(parsedParticleSystem, scene, rootUrl);
  17848. }
  17849. }
  17850. // Lens flares
  17851. if (parsedData.lensFlareSystems) {
  17852. for (index = 0; index < parsedData.lensFlareSystems.length; index++) {
  17853. var parsedLensFlareSystem = parsedData.lensFlareSystems[index];
  17854. parseLensFlareSystem(parsedLensFlareSystem, scene, rootUrl);
  17855. }
  17856. }
  17857. // Shadows
  17858. if (parsedData.shadowGenerators) {
  17859. for (index = 0; index < parsedData.shadowGenerators.length; index++) {
  17860. var parsedShadowGenerator = parsedData.shadowGenerators[index];
  17861. parseShadowGenerator(parsedShadowGenerator, scene);
  17862. }
  17863. }
  17864. // Finish
  17865. return true;
  17866. }
  17867. });
  17868. })(BABYLON.Internals || (BABYLON.Internals = {}));
  17869. var Internals = BABYLON.Internals;
  17870. })(BABYLON || (BABYLON = {}));
  17871. //# sourceMappingURL=babylon.babylonFileLoader.js.map
  17872. var BABYLON;
  17873. (function (BABYLON) {
  17874. // Unique ID when we import meshes from Babylon to CSG
  17875. var currentCSGMeshId = 0;
  17876. // # class Vertex
  17877. // Represents a vertex of a polygon. Use your own vertex class instead of this
  17878. // one to provide additional features like texture coordinates and vertex
  17879. // colors. Custom vertex classes need to provide a `pos` property and `clone()`,
  17880. // `flip()`, and `interpolate()` methods that behave analogous to the ones
  17881. // defined by `BABYLON.CSG.Vertex`. This class provides `normal` so convenience
  17882. // functions like `BABYLON.CSG.sphere()` can return a smooth vertex normal, but `normal`
  17883. // is not used anywhere else.
  17884. // Same goes for uv, it allows to keep the original vertex uv coordinates of the 2 meshes
  17885. var Vertex = (function () {
  17886. function Vertex(pos, normal, uv) {
  17887. this.pos = pos;
  17888. this.normal = normal;
  17889. this.uv = uv;
  17890. }
  17891. Vertex.prototype.clone = function () {
  17892. return new Vertex(this.pos.clone(), this.normal.clone(), this.uv.clone());
  17893. };
  17894. // Invert all orientation-specific data (e.g. vertex normal). Called when the
  17895. // orientation of a polygon is flipped.
  17896. Vertex.prototype.flip = function () {
  17897. this.normal = this.normal.scale(-1);
  17898. };
  17899. // Create a new vertex between this vertex and `other` by linearly
  17900. // interpolating all properties using a parameter of `t`. Subclasses should
  17901. // override this to interpolate additional properties.
  17902. Vertex.prototype.interpolate = function (other, t) {
  17903. return new Vertex(BABYLON.Vector3.Lerp(this.pos, other.pos, t), BABYLON.Vector3.Lerp(this.normal, other.normal, t), BABYLON.Vector2.Lerp(this.uv, other.uv, t));
  17904. };
  17905. return Vertex;
  17906. })();
  17907. // # class Plane
  17908. // Represents a plane in 3D space.
  17909. var Plane = (function () {
  17910. function Plane(normal, w) {
  17911. this.normal = normal;
  17912. this.w = w;
  17913. }
  17914. Plane.FromPoints = function (a, b, c) {
  17915. var v0 = c.subtract(a);
  17916. var v1 = b.subtract(a);
  17917. if (v0.lengthSquared() === 0 || v1.lengthSquared() === 0) {
  17918. return null;
  17919. }
  17920. var n = BABYLON.Vector3.Normalize(BABYLON.Vector3.Cross(v0, v1));
  17921. return new Plane(n, BABYLON.Vector3.Dot(n, a));
  17922. };
  17923. Plane.prototype.clone = function () {
  17924. return new Plane(this.normal.clone(), this.w);
  17925. };
  17926. Plane.prototype.flip = function () {
  17927. this.normal.scaleInPlace(-1);
  17928. this.w = -this.w;
  17929. };
  17930. // Split `polygon` by this plane if needed, then put the polygon or polygon
  17931. // fragments in the appropriate lists. Coplanar polygons go into either
  17932. // `coplanarFront` or `coplanarBack` depending on their orientation with
  17933. // respect to this plane. Polygons in front or in back of this plane go into
  17934. // either `front` or `back`.
  17935. Plane.prototype.splitPolygon = function (polygon, coplanarFront, coplanarBack, front, back) {
  17936. var COPLANAR = 0;
  17937. var FRONT = 1;
  17938. var BACK = 2;
  17939. var SPANNING = 3;
  17940. // Classify each point as well as the entire polygon into one of the above
  17941. // four classes.
  17942. var polygonType = 0;
  17943. var types = [];
  17944. for (var i = 0; i < polygon.vertices.length; i++) {
  17945. var t = BABYLON.Vector3.Dot(this.normal, polygon.vertices[i].pos) - this.w;
  17946. var type = (t < -Plane.EPSILON) ? BACK : (t > Plane.EPSILON) ? FRONT : COPLANAR;
  17947. polygonType |= type;
  17948. types.push(type);
  17949. }
  17950. switch (polygonType) {
  17951. case COPLANAR:
  17952. (BABYLON.Vector3.Dot(this.normal, polygon.plane.normal) > 0 ? coplanarFront : coplanarBack).push(polygon);
  17953. break;
  17954. case FRONT:
  17955. front.push(polygon);
  17956. break;
  17957. case BACK:
  17958. back.push(polygon);
  17959. break;
  17960. case SPANNING:
  17961. var f = [], b = [];
  17962. for (i = 0; i < polygon.vertices.length; i++) {
  17963. var j = (i + 1) % polygon.vertices.length;
  17964. var ti = types[i], tj = types[j];
  17965. var vi = polygon.vertices[i], vj = polygon.vertices[j];
  17966. if (ti != BACK)
  17967. f.push(vi);
  17968. if (ti != FRONT)
  17969. b.push(ti != BACK ? vi.clone() : vi);
  17970. if ((ti | tj) == SPANNING) {
  17971. t = (this.w - BABYLON.Vector3.Dot(this.normal, vi.pos)) / BABYLON.Vector3.Dot(this.normal, vj.pos.subtract(vi.pos));
  17972. var v = vi.interpolate(vj, t);
  17973. f.push(v);
  17974. b.push(v.clone());
  17975. }
  17976. }
  17977. if (f.length >= 3) {
  17978. var poly = new Polygon(f, polygon.shared);
  17979. if (poly.plane)
  17980. front.push(poly);
  17981. }
  17982. if (b.length >= 3) {
  17983. poly = new Polygon(b, polygon.shared);
  17984. if (poly.plane)
  17985. back.push(poly);
  17986. }
  17987. break;
  17988. }
  17989. };
  17990. Plane.EPSILON = 1e-5;
  17991. return Plane;
  17992. })();
  17993. // # class Polygon
  17994. // Represents a convex polygon. The vertices used to initialize a polygon must
  17995. // be coplanar and form a convex loop.
  17996. //
  17997. // Each convex polygon has a `shared` property, which is shared between all
  17998. // polygons that are clones of each other or were split from the same polygon.
  17999. // This can be used to define per-polygon properties (such as surface color).
  18000. var Polygon = (function () {
  18001. function Polygon(vertices, shared) {
  18002. this.vertices = vertices;
  18003. this.shared = shared;
  18004. this.plane = Plane.FromPoints(vertices[0].pos, vertices[1].pos, vertices[2].pos);
  18005. }
  18006. Polygon.prototype.clone = function () {
  18007. var vertices = this.vertices.map(function (v) {
  18008. return v.clone();
  18009. });
  18010. return new Polygon(vertices, this.shared);
  18011. };
  18012. Polygon.prototype.flip = function () {
  18013. this.vertices.reverse().map(function (v) {
  18014. v.flip();
  18015. });
  18016. this.plane.flip();
  18017. };
  18018. return Polygon;
  18019. })();
  18020. // # class Node
  18021. // Holds a node in a BSP tree. A BSP tree is built from a collection of polygons
  18022. // by picking a polygon to split along. That polygon (and all other coplanar
  18023. // polygons) are added directly to that node and the other polygons are added to
  18024. // the front and/or back subtrees. This is not a leafy BSP tree since there is
  18025. // no distinction between internal and leaf nodes.
  18026. var Node = (function () {
  18027. function Node(polygons) {
  18028. this.plane = null;
  18029. this.front = null;
  18030. this.back = null;
  18031. this.polygons = [];
  18032. if (polygons) {
  18033. this.build(polygons);
  18034. }
  18035. }
  18036. Node.prototype.clone = function () {
  18037. var node = new Node();
  18038. node.plane = this.plane && this.plane.clone();
  18039. node.front = this.front && this.front.clone();
  18040. node.back = this.back && this.back.clone();
  18041. node.polygons = this.polygons.map(function (p) {
  18042. return p.clone();
  18043. });
  18044. return node;
  18045. };
  18046. // Convert solid space to empty space and empty space to solid space.
  18047. Node.prototype.invert = function () {
  18048. for (var i = 0; i < this.polygons.length; i++) {
  18049. this.polygons[i].flip();
  18050. }
  18051. if (this.plane) {
  18052. this.plane.flip();
  18053. }
  18054. if (this.front) {
  18055. this.front.invert();
  18056. }
  18057. if (this.back) {
  18058. this.back.invert();
  18059. }
  18060. var temp = this.front;
  18061. this.front = this.back;
  18062. this.back = temp;
  18063. };
  18064. // Recursively remove all polygons in `polygons` that are inside this BSP
  18065. // tree.
  18066. Node.prototype.clipPolygons = function (polygons) {
  18067. if (!this.plane)
  18068. return polygons.slice();
  18069. var front = [], back = [];
  18070. for (var i = 0; i < polygons.length; i++) {
  18071. this.plane.splitPolygon(polygons[i], front, back, front, back);
  18072. }
  18073. if (this.front) {
  18074. front = this.front.clipPolygons(front);
  18075. }
  18076. if (this.back) {
  18077. back = this.back.clipPolygons(back);
  18078. } else {
  18079. back = [];
  18080. }
  18081. return front.concat(back);
  18082. };
  18083. // Remove all polygons in this BSP tree that are inside the other BSP tree
  18084. // `bsp`.
  18085. Node.prototype.clipTo = function (bsp) {
  18086. this.polygons = bsp.clipPolygons(this.polygons);
  18087. if (this.front)
  18088. this.front.clipTo(bsp);
  18089. if (this.back)
  18090. this.back.clipTo(bsp);
  18091. };
  18092. // Return a list of all polygons in this BSP tree.
  18093. Node.prototype.allPolygons = function () {
  18094. var polygons = this.polygons.slice();
  18095. if (this.front)
  18096. polygons = polygons.concat(this.front.allPolygons());
  18097. if (this.back)
  18098. polygons = polygons.concat(this.back.allPolygons());
  18099. return polygons;
  18100. };
  18101. // Build a BSP tree out of `polygons`. When called on an existing tree, the
  18102. // new polygons are filtered down to the bottom of the tree and become new
  18103. // nodes there. Each set of polygons is partitioned using the first polygon
  18104. // (no heuristic is used to pick a good split).
  18105. Node.prototype.build = function (polygons) {
  18106. if (!polygons.length)
  18107. return;
  18108. if (!this.plane)
  18109. this.plane = polygons[0].plane.clone();
  18110. var front = [], back = [];
  18111. for (var i = 0; i < polygons.length; i++) {
  18112. this.plane.splitPolygon(polygons[i], this.polygons, this.polygons, front, back);
  18113. }
  18114. if (front.length) {
  18115. if (!this.front)
  18116. this.front = new Node();
  18117. this.front.build(front);
  18118. }
  18119. if (back.length) {
  18120. if (!this.back)
  18121. this.back = new Node();
  18122. this.back.build(back);
  18123. }
  18124. };
  18125. return Node;
  18126. })();
  18127. var CSG = (function () {
  18128. function CSG() {
  18129. this.polygons = new Array();
  18130. }
  18131. // Convert BABYLON.Mesh to BABYLON.CSG
  18132. CSG.FromMesh = function (mesh) {
  18133. var vertex, normal, uv, position, polygon, polygons = [], vertices;
  18134. if (mesh instanceof BABYLON.Mesh) {
  18135. mesh.computeWorldMatrix(true);
  18136. var matrix = mesh.getWorldMatrix();
  18137. var meshPosition = mesh.position.clone();
  18138. var meshRotation = mesh.rotation.clone();
  18139. var meshScaling = mesh.scaling.clone();
  18140. } else {
  18141. throw 'BABYLON.CSG: Wrong Mesh type, must be BABYLON.Mesh';
  18142. }
  18143. var indices = mesh.getIndices(), positions = mesh.getVerticesData(BABYLON.VertexBuffer.PositionKind), normals = mesh.getVerticesData(BABYLON.VertexBuffer.NormalKind), uvs = mesh.getVerticesData(BABYLON.VertexBuffer.UVKind);
  18144. var subMeshes = mesh.subMeshes;
  18145. for (var sm = 0, sml = subMeshes.length; sm < sml; sm++) {
  18146. for (var i = subMeshes[sm].indexStart, il = subMeshes[sm].indexCount + subMeshes[sm].indexStart; i < il; i += 3) {
  18147. vertices = [];
  18148. for (var j = 0; j < 3; j++) {
  18149. var sourceNormal = new BABYLON.Vector3(normals[indices[i + j] * 3], normals[indices[i + j] * 3 + 1], normals[indices[i + j] * 3 + 2]);
  18150. uv = new BABYLON.Vector2(uvs[indices[i + j] * 2], uvs[indices[i + j] * 2 + 1]);
  18151. var sourcePosition = new BABYLON.Vector3(positions[indices[i + j] * 3], positions[indices[i + j] * 3 + 1], positions[indices[i + j] * 3 + 2]);
  18152. position = BABYLON.Vector3.TransformCoordinates(sourcePosition, matrix);
  18153. normal = BABYLON.Vector3.TransformNormal(sourceNormal, matrix);
  18154. vertex = new Vertex(position, normal, uv);
  18155. vertices.push(vertex);
  18156. }
  18157. polygon = new Polygon(vertices, { subMeshId: sm, meshId: currentCSGMeshId, materialIndex: subMeshes[sm].materialIndex });
  18158. // To handle the case of degenerated triangle
  18159. // polygon.plane == null <=> the polygon does not represent 1 single plane <=> the triangle is degenerated
  18160. if (polygon.plane)
  18161. polygons.push(polygon);
  18162. }
  18163. }
  18164. var csg = CSG.FromPolygons(polygons);
  18165. csg.matrix = matrix;
  18166. csg.position = meshPosition;
  18167. csg.rotation = meshRotation;
  18168. csg.scaling = meshScaling;
  18169. currentCSGMeshId++;
  18170. return csg;
  18171. };
  18172. // Construct a BABYLON.CSG solid from a list of `BABYLON.CSG.Polygon` instances.
  18173. CSG.FromPolygons = function (polygons) {
  18174. var csg = new BABYLON.CSG();
  18175. csg.polygons = polygons;
  18176. return csg;
  18177. };
  18178. CSG.prototype.clone = function () {
  18179. var csg = new BABYLON.CSG();
  18180. csg.polygons = this.polygons.map(function (p) {
  18181. return p.clone();
  18182. });
  18183. csg.copyTransformAttributes(this);
  18184. return csg;
  18185. };
  18186. CSG.prototype.toPolygons = function () {
  18187. return this.polygons;
  18188. };
  18189. CSG.prototype.union = function (csg) {
  18190. var a = new Node(this.clone().polygons);
  18191. var b = new Node(csg.clone().polygons);
  18192. a.clipTo(b);
  18193. b.clipTo(a);
  18194. b.invert();
  18195. b.clipTo(a);
  18196. b.invert();
  18197. a.build(b.allPolygons());
  18198. return CSG.FromPolygons(a.allPolygons()).copyTransformAttributes(this);
  18199. };
  18200. CSG.prototype.unionInPlace = function (csg) {
  18201. var a = new Node(this.polygons);
  18202. var b = new Node(csg.polygons);
  18203. a.clipTo(b);
  18204. b.clipTo(a);
  18205. b.invert();
  18206. b.clipTo(a);
  18207. b.invert();
  18208. a.build(b.allPolygons());
  18209. this.polygons = a.allPolygons();
  18210. };
  18211. CSG.prototype.subtract = function (csg) {
  18212. var a = new Node(this.clone().polygons);
  18213. var b = new Node(csg.clone().polygons);
  18214. a.invert();
  18215. a.clipTo(b);
  18216. b.clipTo(a);
  18217. b.invert();
  18218. b.clipTo(a);
  18219. b.invert();
  18220. a.build(b.allPolygons());
  18221. a.invert();
  18222. return CSG.FromPolygons(a.allPolygons()).copyTransformAttributes(this);
  18223. };
  18224. CSG.prototype.subtractInPlace = function (csg) {
  18225. var a = new Node(this.polygons);
  18226. var b = new Node(csg.polygons);
  18227. a.invert();
  18228. a.clipTo(b);
  18229. b.clipTo(a);
  18230. b.invert();
  18231. b.clipTo(a);
  18232. b.invert();
  18233. a.build(b.allPolygons());
  18234. a.invert();
  18235. this.polygons = a.allPolygons();
  18236. };
  18237. CSG.prototype.intersect = function (csg) {
  18238. var a = new Node(this.clone().polygons);
  18239. var b = new Node(csg.clone().polygons);
  18240. a.invert();
  18241. b.clipTo(a);
  18242. b.invert();
  18243. a.clipTo(b);
  18244. b.clipTo(a);
  18245. a.build(b.allPolygons());
  18246. a.invert();
  18247. return CSG.FromPolygons(a.allPolygons()).copyTransformAttributes(this);
  18248. };
  18249. CSG.prototype.intersectInPlace = function (csg) {
  18250. var a = new Node(this.polygons);
  18251. var b = new Node(csg.polygons);
  18252. a.invert();
  18253. b.clipTo(a);
  18254. b.invert();
  18255. a.clipTo(b);
  18256. b.clipTo(a);
  18257. a.build(b.allPolygons());
  18258. a.invert();
  18259. this.polygons = a.allPolygons();
  18260. };
  18261. // Return a new BABYLON.CSG solid with solid and empty space switched. This solid is
  18262. // not modified.
  18263. CSG.prototype.inverse = function () {
  18264. var csg = this.clone();
  18265. csg.inverseInPlace();
  18266. return csg;
  18267. };
  18268. CSG.prototype.inverseInPlace = function () {
  18269. this.polygons.map(function (p) {
  18270. p.flip();
  18271. });
  18272. };
  18273. // This is used to keep meshes transformations so they can be restored
  18274. // when we build back a Babylon Mesh
  18275. // NB : All CSG operations are performed in world coordinates
  18276. CSG.prototype.copyTransformAttributes = function (csg) {
  18277. this.matrix = csg.matrix;
  18278. this.position = csg.position;
  18279. this.rotation = csg.rotation;
  18280. this.scaling = csg.scaling;
  18281. return this;
  18282. };
  18283. // Build Raw mesh from CSG
  18284. // Coordinates here are in world space
  18285. CSG.prototype.buildMeshGeometry = function (name, scene, keepSubMeshes) {
  18286. var matrix = this.matrix.clone();
  18287. matrix.invert();
  18288. var mesh = new BABYLON.Mesh(name, scene), vertices = [], indices = [], normals = [], uvs = [], vertex = BABYLON.Vector3.Zero(), normal = BABYLON.Vector3.Zero(), uv = BABYLON.Vector2.Zero(), polygons = this.polygons, polygonIndices = [0, 0, 0], polygon, vertice_dict = {}, vertex_idx, currentIndex = 0, subMesh_dict = {}, subMesh_obj;
  18289. if (keepSubMeshes) {
  18290. // Sort Polygons, since subMeshes are indices range
  18291. polygons.sort(function (a, b) {
  18292. if (a.shared.meshId === b.shared.meshId) {
  18293. return a.shared.subMeshId - b.shared.subMeshId;
  18294. } else {
  18295. return a.shared.meshId - b.shared.meshId;
  18296. }
  18297. });
  18298. }
  18299. for (var i = 0, il = polygons.length; i < il; i++) {
  18300. polygon = polygons[i];
  18301. // Building SubMeshes
  18302. if (!subMesh_dict[polygon.shared.meshId]) {
  18303. subMesh_dict[polygon.shared.meshId] = {};
  18304. }
  18305. if (!subMesh_dict[polygon.shared.meshId][polygon.shared.subMeshId]) {
  18306. subMesh_dict[polygon.shared.meshId][polygon.shared.subMeshId] = {
  18307. indexStart: +Infinity,
  18308. indexEnd: -Infinity,
  18309. materialIndex: polygon.shared.materialIndex
  18310. };
  18311. }
  18312. subMesh_obj = subMesh_dict[polygon.shared.meshId][polygon.shared.subMeshId];
  18313. for (var j = 2, jl = polygon.vertices.length; j < jl; j++) {
  18314. polygonIndices[0] = 0;
  18315. polygonIndices[1] = j - 1;
  18316. polygonIndices[2] = j;
  18317. for (var k = 0; k < 3; k++) {
  18318. vertex.copyFrom(polygon.vertices[polygonIndices[k]].pos);
  18319. normal.copyFrom(polygon.vertices[polygonIndices[k]].normal);
  18320. uv.copyFrom(polygon.vertices[polygonIndices[k]].uv);
  18321. var localVertex = BABYLON.Vector3.TransformCoordinates(vertex, matrix);
  18322. var localNormal = BABYLON.Vector3.TransformNormal(normal, matrix);
  18323. vertex_idx = vertice_dict[localVertex.x + ',' + localVertex.y + ',' + localVertex.z];
  18324. // Check if 2 points can be merged
  18325. if (!(typeof vertex_idx !== 'undefined' && normals[vertex_idx * 3] === localNormal.x && normals[vertex_idx * 3 + 1] === localNormal.y && normals[vertex_idx * 3 + 2] === localNormal.z && uvs[vertex_idx * 2] === uv.x && uvs[vertex_idx * 2 + 1] === uv.y)) {
  18326. vertices.push(localVertex.x, localVertex.y, localVertex.z);
  18327. uvs.push(uv.x, uv.y);
  18328. normals.push(normal.x, normal.y, normal.z);
  18329. vertex_idx = vertice_dict[localVertex.x + ',' + localVertex.y + ',' + localVertex.z] = (vertices.length / 3) - 1;
  18330. }
  18331. indices.push(vertex_idx);
  18332. subMesh_obj.indexStart = Math.min(currentIndex, subMesh_obj.indexStart);
  18333. subMesh_obj.indexEnd = Math.max(currentIndex, subMesh_obj.indexEnd);
  18334. currentIndex++;
  18335. }
  18336. }
  18337. }
  18338. mesh.setVerticesData(BABYLON.VertexBuffer.PositionKind, vertices);
  18339. mesh.setVerticesData(BABYLON.VertexBuffer.NormalKind, normals);
  18340. mesh.setVerticesData(BABYLON.VertexBuffer.UVKind, uvs);
  18341. mesh.setIndices(indices);
  18342. if (keepSubMeshes) {
  18343. // We offset the materialIndex by the previous number of materials in the CSG mixed meshes
  18344. var materialIndexOffset = 0, materialMaxIndex;
  18345. mesh.subMeshes.length = 0;
  18346. for (var m in subMesh_dict) {
  18347. materialMaxIndex = -1;
  18348. for (var sm in subMesh_dict[m]) {
  18349. subMesh_obj = subMesh_dict[m][sm];
  18350. BABYLON.SubMesh.CreateFromIndices(subMesh_obj.materialIndex + materialIndexOffset, subMesh_obj.indexStart, subMesh_obj.indexEnd - subMesh_obj.indexStart + 1, mesh);
  18351. materialMaxIndex = Math.max(subMesh_obj.materialIndex, materialMaxIndex);
  18352. }
  18353. materialIndexOffset += ++materialMaxIndex;
  18354. }
  18355. }
  18356. return mesh;
  18357. };
  18358. // Build Mesh from CSG taking material and transforms into account
  18359. CSG.prototype.toMesh = function (name, material, scene, keepSubMeshes) {
  18360. var mesh = this.buildMeshGeometry(name, scene, keepSubMeshes);
  18361. mesh.material = material;
  18362. mesh.position.copyFrom(this.position);
  18363. mesh.rotation.copyFrom(this.rotation);
  18364. mesh.scaling.copyFrom(this.scaling);
  18365. mesh.computeWorldMatrix(true);
  18366. return mesh;
  18367. };
  18368. return CSG;
  18369. })();
  18370. BABYLON.CSG = CSG;
  18371. })(BABYLON || (BABYLON = {}));
  18372. //# sourceMappingURL=babylon.csg.js.map
  18373. var BABYLON;
  18374. (function (BABYLON) {
  18375. var OculusDistortionCorrectionPostProcess = (function (_super) {
  18376. __extends(OculusDistortionCorrectionPostProcess, _super);
  18377. //ANY
  18378. function OculusDistortionCorrectionPostProcess(name, camera, isRightEye, cameraSettings) {
  18379. var _this = this;
  18380. _super.call(this, name, "oculusDistortionCorrection", [
  18381. 'LensCenter',
  18382. 'Scale',
  18383. 'ScaleIn',
  18384. 'HmdWarpParam'
  18385. ], null, cameraSettings.PostProcessScaleFactor, camera, BABYLON.Texture.BILINEAR_SAMPLINGMODE, null, null);
  18386. this._isRightEye = isRightEye;
  18387. this._distortionFactors = cameraSettings.DistortionK;
  18388. this._postProcessScaleFactor = cameraSettings.PostProcessScaleFactor;
  18389. this._lensCenterOffset = cameraSettings.LensCenterOffset;
  18390. this.onSizeChanged = function () {
  18391. _this.aspectRatio = _this.width * .5 / _this.height;
  18392. _this._scaleIn = new BABYLON.Vector2(2, 2 / _this.aspectRatio);
  18393. _this._scaleFactor = new BABYLON.Vector2(.5 * (1 / _this._postProcessScaleFactor), .5 * (1 / _this._postProcessScaleFactor) * _this.aspectRatio);
  18394. _this._lensCenter = new BABYLON.Vector2(_this._isRightEye ? 0.5 - _this._lensCenterOffset * 0.5 : 0.5 + _this._lensCenterOffset * 0.5, 0.5);
  18395. };
  18396. this.onApply = function (effect) {
  18397. effect.setFloat2("LensCenter", _this._lensCenter.x, _this._lensCenter.y);
  18398. effect.setFloat2("Scale", _this._scaleFactor.x, _this._scaleFactor.y);
  18399. effect.setFloat2("ScaleIn", _this._scaleIn.x, _this._scaleIn.y);
  18400. effect.setFloat4("HmdWarpParam", _this._distortionFactors[0], _this._distortionFactors[1], _this._distortionFactors[2], _this._distortionFactors[3]);
  18401. };
  18402. }
  18403. return OculusDistortionCorrectionPostProcess;
  18404. })(BABYLON.PostProcess);
  18405. BABYLON.OculusDistortionCorrectionPostProcess = OculusDistortionCorrectionPostProcess;
  18406. })(BABYLON || (BABYLON = {}));
  18407. //# sourceMappingURL=babylon.oculusDistortionCorrectionPostProcess.js.map
  18408. // Mainly based on these 2 articles :
  18409. // Creating an universal virtual touch joystick working for all Touch models thanks to Hand.JS : http://blogs.msdn.com/b/davrous/archive/2013/02/22/creating-an-universal-virtual-touch-joystick-working-for-all-touch-models-thanks-to-hand-js.aspx
  18410. // & on Seb Lee-Delisle original work: http://seb.ly/2011/04/multi-touch-game-controller-in-javascripthtml5-for-ipad/
  18411. var BABYLON;
  18412. (function (BABYLON) {
  18413. (function (JoystickAxis) {
  18414. JoystickAxis[JoystickAxis["X"] = 0] = "X";
  18415. JoystickAxis[JoystickAxis["Y"] = 1] = "Y";
  18416. JoystickAxis[JoystickAxis["Z"] = 2] = "Z";
  18417. })(BABYLON.JoystickAxis || (BABYLON.JoystickAxis = {}));
  18418. var JoystickAxis = BABYLON.JoystickAxis;
  18419. var VirtualJoystick = (function () {
  18420. function VirtualJoystick(leftJoystick) {
  18421. var _this = this;
  18422. if (leftJoystick) {
  18423. this._leftJoystick = true;
  18424. } else {
  18425. this._leftJoystick = false;
  18426. }
  18427. this._joystickIndex = VirtualJoystick._globalJoystickIndex;
  18428. VirtualJoystick._globalJoystickIndex++;
  18429. // By default left & right arrow keys are moving the X
  18430. // and up & down keys are moving the Y
  18431. this._axisTargetedByLeftAndRight = 0 /* X */;
  18432. this._axisTargetedByUpAndDown = 1 /* Y */;
  18433. this.reverseLeftRight = false;
  18434. this.reverseUpDown = false;
  18435. // collections of pointers
  18436. this._touches = new BABYLON.VirtualJoystick.Collection();
  18437. this.deltaPosition = BABYLON.Vector3.Zero();
  18438. this._joystickSensibility = 25;
  18439. this._inversedSensibility = 1 / (this._joystickSensibility / 1000);
  18440. this._rotationSpeed = 25;
  18441. this._inverseRotationSpeed = 1 / (this._rotationSpeed / 1000);
  18442. this._rotateOnAxisRelativeToMesh = false;
  18443. // injecting a canvas element on top of the canvas 3D game
  18444. if (!VirtualJoystick.vjCanvas) {
  18445. window.addEventListener("resize", function () {
  18446. VirtualJoystick.vjCanvasWidth = window.innerWidth;
  18447. VirtualJoystick.vjCanvasHeight = window.innerHeight;
  18448. VirtualJoystick.vjCanvas.width = VirtualJoystick.vjCanvasWidth;
  18449. VirtualJoystick.vjCanvas.height = VirtualJoystick.vjCanvasHeight;
  18450. VirtualJoystick.halfWidth = VirtualJoystick.vjCanvasWidth / 2;
  18451. VirtualJoystick.halfHeight = VirtualJoystick.vjCanvasHeight / 2;
  18452. }, false);
  18453. VirtualJoystick.vjCanvas = document.createElement("canvas");
  18454. VirtualJoystick.vjCanvasWidth = window.innerWidth;
  18455. VirtualJoystick.vjCanvasHeight = window.innerHeight;
  18456. VirtualJoystick.vjCanvas.width = window.innerWidth;
  18457. VirtualJoystick.vjCanvas.height = window.innerHeight;
  18458. VirtualJoystick.vjCanvas.style.width = "100%";
  18459. VirtualJoystick.vjCanvas.style.height = "100%";
  18460. VirtualJoystick.vjCanvas.style.position = "absolute";
  18461. VirtualJoystick.vjCanvas.style.backgroundColor = "transparent";
  18462. VirtualJoystick.vjCanvas.style.top = "0px";
  18463. VirtualJoystick.vjCanvas.style.left = "0px";
  18464. VirtualJoystick.vjCanvas.style.zIndex = "5";
  18465. VirtualJoystick.vjCanvas.style.msTouchAction = "none";
  18466. VirtualJoystick.vjCanvasContext = VirtualJoystick.vjCanvas.getContext('2d');
  18467. VirtualJoystick.vjCanvasContext.strokeStyle = "#ffffff";
  18468. VirtualJoystick.vjCanvasContext.lineWidth = 2;
  18469. document.body.appendChild(VirtualJoystick.vjCanvas);
  18470. }
  18471. VirtualJoystick.halfWidth = VirtualJoystick.vjCanvas.width / 2;
  18472. VirtualJoystick.halfHeight = VirtualJoystick.vjCanvas.height / 2;
  18473. this.pressed = false;
  18474. // default joystick color
  18475. this._joystickColor = "cyan";
  18476. this._joystickPointerID = -1;
  18477. // current joystick position
  18478. this._joystickPointerPos = new BABYLON.Vector2(0, 0);
  18479. // origin joystick position
  18480. this._joystickPointerStartPos = new BABYLON.Vector2(0, 0);
  18481. this._deltaJoystickVector = new BABYLON.Vector2(0, 0);
  18482. VirtualJoystick.vjCanvas.addEventListener('pointerdown', function (evt) {
  18483. _this._onPointerDown(evt);
  18484. }, false);
  18485. VirtualJoystick.vjCanvas.addEventListener('pointermove', function (evt) {
  18486. _this._onPointerMove(evt);
  18487. }, false);
  18488. VirtualJoystick.vjCanvas.addEventListener('pointerup', function (evt) {
  18489. _this._onPointerUp(evt);
  18490. }, false);
  18491. VirtualJoystick.vjCanvas.addEventListener('pointerout', function (evt) {
  18492. _this._onPointerUp(evt);
  18493. }, false);
  18494. VirtualJoystick.vjCanvas.addEventListener("contextmenu", function (evt) {
  18495. evt.preventDefault(); // Disables system menu
  18496. }, false);
  18497. requestAnimationFrame(function () {
  18498. _this._drawVirtualJoystick();
  18499. });
  18500. }
  18501. VirtualJoystick.prototype.setJoystickSensibility = function (newJoystickSensibility) {
  18502. this._joystickSensibility = newJoystickSensibility;
  18503. this._inversedSensibility = 1 / (this._joystickSensibility / 1000);
  18504. };
  18505. VirtualJoystick.prototype._onPointerDown = function (e) {
  18506. var positionOnScreenCondition;
  18507. e.preventDefault();
  18508. if (this._leftJoystick === true) {
  18509. positionOnScreenCondition = (e.clientX < VirtualJoystick.halfWidth);
  18510. } else {
  18511. positionOnScreenCondition = (e.clientX > VirtualJoystick.halfWidth);
  18512. }
  18513. if (positionOnScreenCondition && this._joystickPointerID < 0) {
  18514. // First contact will be dedicated to the virtual joystick
  18515. this._joystickPointerID = e.pointerId;
  18516. this._joystickPointerStartPos.x = e.clientX;
  18517. this._joystickPointerStartPos.y = e.clientY;
  18518. this._joystickPointerPos = this._joystickPointerStartPos.clone();
  18519. this._deltaJoystickVector.x = 0;
  18520. this._deltaJoystickVector.y = 0;
  18521. this.pressed = true;
  18522. this._touches.add(e.pointerId.toString(), e);
  18523. } else {
  18524. // You can only trigger the action buttons with a joystick declared
  18525. if (VirtualJoystick._globalJoystickIndex < 2 && this._action) {
  18526. this._action();
  18527. this._touches.add(e.pointerId.toString(), e);
  18528. }
  18529. }
  18530. };
  18531. VirtualJoystick.prototype._onPointerMove = function (e) {
  18532. // If the current pointer is the one associated to the joystick (first touch contact)
  18533. if (this._joystickPointerID == e.pointerId) {
  18534. this._joystickPointerPos.x = e.clientX;
  18535. this._joystickPointerPos.y = e.clientY;
  18536. this._deltaJoystickVector = this._joystickPointerPos.clone();
  18537. this._deltaJoystickVector = this._deltaJoystickVector.subtract(this._joystickPointerStartPos);
  18538. var directionLeftRight = this.reverseLeftRight ? -1 : 1;
  18539. var deltaJoystickX = directionLeftRight * this._deltaJoystickVector.x / this._inversedSensibility;
  18540. switch (this._axisTargetedByLeftAndRight) {
  18541. case 0 /* X */:
  18542. this.deltaPosition.x = Math.min(1, Math.max(-1, deltaJoystickX));
  18543. break;
  18544. case 1 /* Y */:
  18545. this.deltaPosition.y = Math.min(1, Math.max(-1, deltaJoystickX));
  18546. break;
  18547. case 2 /* Z */:
  18548. this.deltaPosition.z = Math.min(1, Math.max(-1, deltaJoystickX));
  18549. break;
  18550. }
  18551. var directionUpDown = this.reverseUpDown ? 1 : -1;
  18552. var deltaJoystickY = directionUpDown * this._deltaJoystickVector.y / this._inversedSensibility;
  18553. switch (this._axisTargetedByUpAndDown) {
  18554. case 0 /* X */:
  18555. this.deltaPosition.x = Math.min(1, Math.max(-1, deltaJoystickY));
  18556. break;
  18557. case 1 /* Y */:
  18558. this.deltaPosition.y = Math.min(1, Math.max(-1, deltaJoystickY));
  18559. break;
  18560. case 2 /* Z */:
  18561. this.deltaPosition.z = Math.min(1, Math.max(-1, deltaJoystickY));
  18562. break;
  18563. }
  18564. } else {
  18565. if (this._touches.item(e.pointerId.toString())) {
  18566. this._touches.item(e.pointerId.toString()).x = e.clientX;
  18567. this._touches.item(e.pointerId.toString()).y = e.clientY;
  18568. }
  18569. }
  18570. };
  18571. VirtualJoystick.prototype._onPointerUp = function (e) {
  18572. this._clearCanvas();
  18573. if (this._joystickPointerID == e.pointerId) {
  18574. this._joystickPointerID = -1;
  18575. this.pressed = false;
  18576. }
  18577. this._deltaJoystickVector.x = 0;
  18578. this._deltaJoystickVector.y = 0;
  18579. this._touches.remove(e.pointerId.toString());
  18580. };
  18581. /**
  18582. * Change the color of the virtual joystick
  18583. * @param newColor a string that must be a CSS color value (like "red") or the hexa value (like "#FF0000")
  18584. */
  18585. VirtualJoystick.prototype.setJoystickColor = function (newColor) {
  18586. this._joystickColor = newColor;
  18587. };
  18588. VirtualJoystick.prototype.setActionOnTouch = function (action) {
  18589. this._action = action;
  18590. };
  18591. // Define which axis you'd like to control for left & right
  18592. VirtualJoystick.prototype.setAxisForLeftRight = function (axis) {
  18593. switch (axis) {
  18594. case 0 /* X */:
  18595. case 1 /* Y */:
  18596. case 2 /* Z */:
  18597. this._axisTargetedByLeftAndRight = axis;
  18598. break;
  18599. default:
  18600. this._axisTargetedByLeftAndRight = 0 /* X */;
  18601. break;
  18602. }
  18603. };
  18604. // Define which axis you'd like to control for up & down
  18605. VirtualJoystick.prototype.setAxisForUpDown = function (axis) {
  18606. switch (axis) {
  18607. case 0 /* X */:
  18608. case 1 /* Y */:
  18609. case 2 /* Z */:
  18610. this._axisTargetedByUpAndDown = axis;
  18611. break;
  18612. default:
  18613. this._axisTargetedByUpAndDown = 1 /* Y */;
  18614. break;
  18615. }
  18616. };
  18617. VirtualJoystick.prototype._clearCanvas = function () {
  18618. if (this._leftJoystick) {
  18619. VirtualJoystick.vjCanvasContext.clearRect(0, 0, VirtualJoystick.vjCanvasWidth / 2, VirtualJoystick.vjCanvasHeight);
  18620. } else {
  18621. VirtualJoystick.vjCanvasContext.clearRect(VirtualJoystick.vjCanvasWidth / 2, 0, VirtualJoystick.vjCanvasWidth, VirtualJoystick.vjCanvasHeight);
  18622. }
  18623. };
  18624. VirtualJoystick.prototype._drawVirtualJoystick = function () {
  18625. var _this = this;
  18626. if (this.pressed) {
  18627. this._clearCanvas();
  18628. this._touches.forEach(function (touch) {
  18629. if (touch.pointerId === _this._joystickPointerID) {
  18630. VirtualJoystick.vjCanvasContext.beginPath();
  18631. VirtualJoystick.vjCanvasContext.strokeStyle = _this._joystickColor;
  18632. VirtualJoystick.vjCanvasContext.lineWidth = 6;
  18633. VirtualJoystick.vjCanvasContext.arc(_this._joystickPointerStartPos.x, _this._joystickPointerStartPos.y, 40, 0, Math.PI * 2, true);
  18634. VirtualJoystick.vjCanvasContext.stroke();
  18635. VirtualJoystick.vjCanvasContext.beginPath();
  18636. VirtualJoystick.vjCanvasContext.strokeStyle = _this._joystickColor;
  18637. VirtualJoystick.vjCanvasContext.lineWidth = 2;
  18638. VirtualJoystick.vjCanvasContext.arc(_this._joystickPointerStartPos.x, _this._joystickPointerStartPos.y, 60, 0, Math.PI * 2, true);
  18639. VirtualJoystick.vjCanvasContext.stroke();
  18640. VirtualJoystick.vjCanvasContext.beginPath();
  18641. VirtualJoystick.vjCanvasContext.strokeStyle = _this._joystickColor;
  18642. VirtualJoystick.vjCanvasContext.arc(_this._joystickPointerPos.x, _this._joystickPointerPos.y, 40, 0, Math.PI * 2, true);
  18643. VirtualJoystick.vjCanvasContext.stroke();
  18644. } else {
  18645. VirtualJoystick.vjCanvasContext.beginPath();
  18646. VirtualJoystick.vjCanvasContext.fillStyle = "white";
  18647. VirtualJoystick.vjCanvasContext.beginPath();
  18648. VirtualJoystick.vjCanvasContext.strokeStyle = "red";
  18649. VirtualJoystick.vjCanvasContext.lineWidth = 6;
  18650. VirtualJoystick.vjCanvasContext.arc(touch.x, touch.y, 40, 0, Math.PI * 2, true);
  18651. VirtualJoystick.vjCanvasContext.stroke();
  18652. }
  18653. ;
  18654. });
  18655. }
  18656. requestAnimationFrame(function () {
  18657. _this._drawVirtualJoystick();
  18658. });
  18659. };
  18660. VirtualJoystick.prototype.releaseCanvas = function () {
  18661. if (VirtualJoystick.vjCanvas) {
  18662. document.body.removeChild(VirtualJoystick.vjCanvas);
  18663. VirtualJoystick.vjCanvas = null;
  18664. }
  18665. };
  18666. VirtualJoystick._globalJoystickIndex = 0;
  18667. return VirtualJoystick;
  18668. })();
  18669. BABYLON.VirtualJoystick = VirtualJoystick;
  18670. })(BABYLON || (BABYLON = {}));
  18671. var BABYLON;
  18672. (function (BABYLON) {
  18673. (function (VirtualJoystick) {
  18674. var Collection = (function () {
  18675. function Collection() {
  18676. this._count = 0;
  18677. this._collection = new Array();
  18678. }
  18679. Collection.prototype.Count = function () {
  18680. return this._count;
  18681. };
  18682. Collection.prototype.add = function (key, item) {
  18683. if (this._collection[key] != undefined) {
  18684. return undefined;
  18685. }
  18686. this._collection[key] = item;
  18687. return ++this._count;
  18688. };
  18689. Collection.prototype.remove = function (key) {
  18690. if (this._collection[key] == undefined) {
  18691. return undefined;
  18692. }
  18693. delete this._collection[key];
  18694. return --this._count;
  18695. };
  18696. Collection.prototype.item = function (key) {
  18697. return this._collection[key];
  18698. };
  18699. Collection.prototype.forEach = function (block) {
  18700. var key;
  18701. for (key in this._collection) {
  18702. if (this._collection.hasOwnProperty(key)) {
  18703. block(this._collection[key]);
  18704. }
  18705. }
  18706. };
  18707. return Collection;
  18708. })();
  18709. VirtualJoystick.Collection = Collection;
  18710. })(BABYLON.VirtualJoystick || (BABYLON.VirtualJoystick = {}));
  18711. var VirtualJoystick = BABYLON.VirtualJoystick;
  18712. })(BABYLON || (BABYLON = {}));
  18713. //# sourceMappingURL=babylon.virtualJoystick.js.map
  18714. var BABYLON;
  18715. (function (BABYLON) {
  18716. var OculusRiftDevKit2013_Metric = {
  18717. HResolution: 1280,
  18718. VResolution: 800,
  18719. HScreenSize: 0.149759993,
  18720. VScreenSize: 0.0935999975,
  18721. VScreenCenter: 0.0467999987,
  18722. EyeToScreenDistance: 0.0410000011,
  18723. LensSeparationDistance: 0.0635000020,
  18724. InterpupillaryDistance: 0.0640000030,
  18725. DistortionK: [1.0, 0.219999999, 0.239999995, 0.0],
  18726. ChromaAbCorrection: [0.995999992, -0.00400000019, 1.01400006, 0.0],
  18727. PostProcessScaleFactor: 1.714605507808412,
  18728. LensCenterOffset: 0.151976421
  18729. };
  18730. var _OculusInnerCamera = (function (_super) {
  18731. __extends(_OculusInnerCamera, _super);
  18732. function _OculusInnerCamera(name, position, scene, isLeftEye) {
  18733. _super.call(this, name, position, scene);
  18734. this._workMatrix = new BABYLON.Matrix();
  18735. this._actualUp = new BABYLON.Vector3(0, 0, 0);
  18736. // Constants
  18737. this._aspectRatioAspectRatio = OculusRiftDevKit2013_Metric.HResolution / (2 * OculusRiftDevKit2013_Metric.VResolution);
  18738. this._aspectRatioFov = (2 * Math.atan((OculusRiftDevKit2013_Metric.PostProcessScaleFactor * OculusRiftDevKit2013_Metric.VScreenSize) / (2 * OculusRiftDevKit2013_Metric.EyeToScreenDistance)));
  18739. var hMeters = (OculusRiftDevKit2013_Metric.HScreenSize / 4) - (OculusRiftDevKit2013_Metric.LensSeparationDistance / 2);
  18740. var h = (4 * hMeters) / OculusRiftDevKit2013_Metric.HScreenSize;
  18741. this._hMatrix = BABYLON.Matrix.Translation(isLeftEye ? h : -h, 0, 0);
  18742. this.viewport = new BABYLON.Viewport(isLeftEye ? 0 : 0.5, 0, 0.5, 1.0);
  18743. this._preViewMatrix = BABYLON.Matrix.Translation(isLeftEye ? .5 * OculusRiftDevKit2013_Metric.InterpupillaryDistance : -.5 * OculusRiftDevKit2013_Metric.InterpupillaryDistance, 0, 0);
  18744. // Postprocess
  18745. var postProcess = new BABYLON.OculusDistortionCorrectionPostProcess("Oculus Distortion", this, !isLeftEye, OculusRiftDevKit2013_Metric);
  18746. }
  18747. _OculusInnerCamera.prototype.getProjectionMatrix = function () {
  18748. BABYLON.Matrix.PerspectiveFovLHToRef(this._aspectRatioFov, this._aspectRatioAspectRatio, this.minZ, this.maxZ, this._workMatrix);
  18749. this._workMatrix.multiplyToRef(this._hMatrix, this._projectionMatrix);
  18750. return this._projectionMatrix;
  18751. };
  18752. _OculusInnerCamera.prototype._getViewMatrix = function () {
  18753. BABYLON.Matrix.RotationYawPitchRollToRef(this.rotation.y, this.rotation.x, this.rotation.z, this._cameraRotationMatrix);
  18754. BABYLON.Vector3.TransformCoordinatesToRef(this._referencePoint, this._cameraRotationMatrix, this._transformedReferencePoint);
  18755. BABYLON.Vector3.TransformNormalToRef(this.upVector, this._cameraRotationMatrix, this._actualUp);
  18756. // Computing target and final matrix
  18757. this.position.addToRef(this._transformedReferencePoint, this._currentTarget);
  18758. BABYLON.Matrix.LookAtLHToRef(this.position, this._currentTarget, this._actualUp, this._workMatrix);
  18759. this._workMatrix.multiplyToRef(this._preViewMatrix, this._viewMatrix);
  18760. return this._viewMatrix;
  18761. };
  18762. return _OculusInnerCamera;
  18763. })(BABYLON.FreeCamera);
  18764. var OculusCamera = (function (_super) {
  18765. __extends(OculusCamera, _super);
  18766. function OculusCamera(name, position, scene) {
  18767. _super.call(this, name, position, scene);
  18768. this._leftCamera = new _OculusInnerCamera(name + "_left", position.clone(), scene, true);
  18769. this._rightCamera = new _OculusInnerCamera(name + "_right", position.clone(), scene, false);
  18770. this.subCameras.push(this._leftCamera);
  18771. this.subCameras.push(this._rightCamera);
  18772. this._deviceOrientationHandler = this._onOrientationEvent.bind(this);
  18773. }
  18774. OculusCamera.prototype._update = function () {
  18775. this._leftCamera.position.copyFrom(this.position);
  18776. this._rightCamera.position.copyFrom(this.position);
  18777. this._updateCamera(this._leftCamera);
  18778. this._updateCamera(this._rightCamera);
  18779. _super.prototype._update.call(this);
  18780. };
  18781. OculusCamera.prototype._updateCamera = function (camera) {
  18782. camera.minZ = this.minZ;
  18783. camera.maxZ = this.maxZ;
  18784. camera.rotation.x = this.rotation.x;
  18785. camera.rotation.y = this.rotation.y;
  18786. camera.rotation.z = this.rotation.z;
  18787. };
  18788. // Oculus events
  18789. OculusCamera.prototype._onOrientationEvent = function (evt) {
  18790. var yaw = evt.alpha / 180 * Math.PI;
  18791. var pitch = evt.beta / 180 * Math.PI;
  18792. var roll = evt.gamma / 180 * Math.PI;
  18793. if (!this._offsetOrientation) {
  18794. this._offsetOrientation = {
  18795. yaw: yaw,
  18796. pitch: pitch,
  18797. roll: roll
  18798. };
  18799. return;
  18800. } else {
  18801. this.rotation.y += yaw - this._offsetOrientation.yaw;
  18802. this.rotation.x += pitch - this._offsetOrientation.pitch;
  18803. this.rotation.z += this._offsetOrientation.roll - roll;
  18804. this._offsetOrientation.yaw = yaw;
  18805. this._offsetOrientation.pitch = pitch;
  18806. this._offsetOrientation.roll = roll;
  18807. }
  18808. };
  18809. OculusCamera.prototype.attachControl = function (element, noPreventDefault) {
  18810. _super.prototype.attachControl.call(this, element, noPreventDefault);
  18811. window.addEventListener("deviceorientation", this._deviceOrientationHandler);
  18812. };
  18813. OculusCamera.prototype.detachControl = function (element) {
  18814. _super.prototype.detachControl.call(this, element);
  18815. window.removeEventListener("deviceorientation", this._deviceOrientationHandler);
  18816. };
  18817. return OculusCamera;
  18818. })(BABYLON.FreeCamera);
  18819. BABYLON.OculusCamera = OculusCamera;
  18820. })(BABYLON || (BABYLON = {}));
  18821. //# sourceMappingURL=babylon.oculusCamera.js.map
  18822. var BABYLON;
  18823. (function (BABYLON) {
  18824. var OculusRiftDevKit2013_Metric = {
  18825. HResolution: 1280,
  18826. VResolution: 800,
  18827. HScreenSize: 0.149759993,
  18828. VScreenSize: 0.0935999975,
  18829. VScreenCenter: 0.0467999987,
  18830. EyeToScreenDistance: 0.0410000011,
  18831. LensSeparationDistance: 0.0635000020,
  18832. InterpupillaryDistance: 0.0640000030,
  18833. DistortionK: [1.0, 0.219999999, 0.239999995, 0.0],
  18834. ChromaAbCorrection: [0.995999992, -0.00400000019, 1.01400006, 0.0],
  18835. PostProcessScaleFactor: 1.714605507808412,
  18836. LensCenterOffset: 0.151976421
  18837. };
  18838. var _OculusInnerGamepadCamera = (function (_super) {
  18839. __extends(_OculusInnerGamepadCamera, _super);
  18840. function _OculusInnerGamepadCamera(name, position, scene, isLeftEye) {
  18841. _super.call(this, name, position, scene);
  18842. this._workMatrix = new BABYLON.Matrix();
  18843. this._actualUp = new BABYLON.Vector3(0, 0, 0);
  18844. // Constants
  18845. this._aspectRatioAspectRatio = OculusRiftDevKit2013_Metric.HResolution / (2 * OculusRiftDevKit2013_Metric.VResolution);
  18846. this._aspectRatioFov = (2 * Math.atan((OculusRiftDevKit2013_Metric.PostProcessScaleFactor * OculusRiftDevKit2013_Metric.VScreenSize) / (2 * OculusRiftDevKit2013_Metric.EyeToScreenDistance)));
  18847. var hMeters = (OculusRiftDevKit2013_Metric.HScreenSize / 4) - (OculusRiftDevKit2013_Metric.LensSeparationDistance / 2);
  18848. var h = (4 * hMeters) / OculusRiftDevKit2013_Metric.HScreenSize;
  18849. this._hMatrix = BABYLON.Matrix.Translation(isLeftEye ? h : -h, 0, 0);
  18850. this.viewport = new BABYLON.Viewport(isLeftEye ? 0 : 0.5, 0, 0.5, 1.0);
  18851. this._preViewMatrix = BABYLON.Matrix.Translation(isLeftEye ? .5 * OculusRiftDevKit2013_Metric.InterpupillaryDistance : -.5 * OculusRiftDevKit2013_Metric.InterpupillaryDistance, 0, 0);
  18852. // Postprocess
  18853. var postProcess = new BABYLON.OculusDistortionCorrectionPostProcess("Oculus Distortion", this, !isLeftEye, OculusRiftDevKit2013_Metric);
  18854. }
  18855. _OculusInnerGamepadCamera.prototype.getProjectionMatrix = function () {
  18856. BABYLON.Matrix.PerspectiveFovLHToRef(this._aspectRatioFov, this._aspectRatioAspectRatio, this.minZ, this.maxZ, this._workMatrix);
  18857. this._workMatrix.multiplyToRef(this._hMatrix, this._projectionMatrix);
  18858. return this._projectionMatrix;
  18859. };
  18860. _OculusInnerGamepadCamera.prototype._getViewMatrix = function () {
  18861. BABYLON.Matrix.RotationYawPitchRollToRef(this.rotation.y, this.rotation.x, this.rotation.z, this._cameraRotationMatrix);
  18862. BABYLON.Vector3.TransformCoordinatesToRef(this._referencePoint, this._cameraRotationMatrix, this._transformedReferencePoint);
  18863. BABYLON.Vector3.TransformNormalToRef(this.upVector, this._cameraRotationMatrix, this._actualUp);
  18864. // Computing target and final matrix
  18865. this.position.addToRef(this._transformedReferencePoint, this._currentTarget);
  18866. BABYLON.Matrix.LookAtLHToRef(this.position, this._currentTarget, this._actualUp, this._workMatrix);
  18867. this._workMatrix.multiplyToRef(this._preViewMatrix, this._viewMatrix);
  18868. return this._viewMatrix;
  18869. };
  18870. return _OculusInnerGamepadCamera;
  18871. })(BABYLON.FreeCamera);
  18872. var OculusGamepadCamera = (function (_super) {
  18873. __extends(OculusGamepadCamera, _super);
  18874. function OculusGamepadCamera(name, position, scene) {
  18875. var _this = this;
  18876. _super.call(this, name, position, scene);
  18877. this.angularSensibility = 200;
  18878. this.moveSensibility = 75;
  18879. this._leftCamera = new _OculusInnerGamepadCamera(name + "_left", position.clone(), scene, true);
  18880. this._rightCamera = new _OculusInnerGamepadCamera(name + "_right", position.clone(), scene, false);
  18881. this.subCameras.push(this._leftCamera);
  18882. this.subCameras.push(this._rightCamera);
  18883. this._deviceOrientationHandler = this._onOrientationEvent.bind(this);
  18884. this._gamepads = new BABYLON.Gamepads(function (gamepad) {
  18885. _this._onNewGameConnected(gamepad);
  18886. });
  18887. }
  18888. OculusGamepadCamera.prototype._onNewGameConnected = function (gamepad) {
  18889. // Only the first gamepad can control the camera
  18890. if (gamepad.index === 0) {
  18891. this._gamepad = gamepad;
  18892. }
  18893. };
  18894. OculusGamepadCamera.prototype._update = function () {
  18895. this._leftCamera.position.copyFrom(this.position);
  18896. this._rightCamera.position.copyFrom(this.position);
  18897. this._updateCamera(this._leftCamera);
  18898. this._updateCamera(this._rightCamera);
  18899. _super.prototype._update.call(this);
  18900. };
  18901. OculusGamepadCamera.prototype._checkInputs = function () {
  18902. if (!this._gamepad) {
  18903. return;
  18904. }
  18905. var LSValues = this._gamepad.leftStick;
  18906. var normalizedLX = LSValues.x / this.moveSensibility;
  18907. var normalizedLY = LSValues.y / this.moveSensibility;
  18908. LSValues.x = Math.abs(normalizedLX) > 0.005 ? 0 + normalizedLX : 0;
  18909. LSValues.y = Math.abs(normalizedLY) > 0.005 ? 0 + normalizedLY : 0;
  18910. var cameraTransform = BABYLON.Matrix.RotationYawPitchRoll(this.rotation.y, this.rotation.x, 0);
  18911. var deltaTransform = BABYLON.Vector3.TransformCoordinates(new BABYLON.Vector3(LSValues.x, 0, -LSValues.y), cameraTransform);
  18912. this.cameraDirection = this.cameraDirection.add(deltaTransform);
  18913. };
  18914. OculusGamepadCamera.prototype._updateCamera = function (camera) {
  18915. camera.minZ = this.minZ;
  18916. camera.maxZ = this.maxZ;
  18917. camera.rotation.x = this.rotation.x;
  18918. camera.rotation.y = this.rotation.y;
  18919. camera.rotation.z = this.rotation.z;
  18920. };
  18921. // Oculus events
  18922. OculusGamepadCamera.prototype._onOrientationEvent = function (evt) {
  18923. var yaw = evt.alpha / 180 * Math.PI;
  18924. var pitch = evt.beta / 180 * Math.PI;
  18925. var roll = evt.gamma / 180 * Math.PI;
  18926. if (!this._offsetOrientation) {
  18927. this._offsetOrientation = {
  18928. yaw: yaw,
  18929. pitch: pitch,
  18930. roll: roll
  18931. };
  18932. return;
  18933. } else {
  18934. this.rotation.y += yaw - this._offsetOrientation.yaw;
  18935. this.rotation.x += pitch - this._offsetOrientation.pitch;
  18936. this.rotation.z += this._offsetOrientation.roll - roll;
  18937. this._offsetOrientation.yaw = yaw;
  18938. this._offsetOrientation.pitch = pitch;
  18939. this._offsetOrientation.roll = roll;
  18940. }
  18941. };
  18942. OculusGamepadCamera.prototype.attachControl = function (element, noPreventDefault) {
  18943. _super.prototype.attachControl.call(this, element, noPreventDefault);
  18944. window.addEventListener("deviceorientation", this._deviceOrientationHandler);
  18945. };
  18946. OculusGamepadCamera.prototype.detachControl = function (element) {
  18947. _super.prototype.detachControl.call(this, element);
  18948. window.removeEventListener("deviceorientation", this._deviceOrientationHandler);
  18949. };
  18950. OculusGamepadCamera.prototype.dispose = function () {
  18951. this._gamepads.dispose();
  18952. _super.prototype.dispose.call(this);
  18953. };
  18954. return OculusGamepadCamera;
  18955. })(BABYLON.FreeCamera);
  18956. BABYLON.OculusGamepadCamera = OculusGamepadCamera;
  18957. })(BABYLON || (BABYLON = {}));
  18958. //# sourceMappingURL=babylon.oculusGamepadCamera.js.map
  18959. var BABYLON;
  18960. (function (BABYLON) {
  18961. // We're mainly based on the logic defined into the FreeCamera code
  18962. var VirtualJoysticksCamera = (function (_super) {
  18963. __extends(VirtualJoysticksCamera, _super);
  18964. function VirtualJoysticksCamera(name, position, scene) {
  18965. _super.call(this, name, position, scene);
  18966. this._leftjoystick = new BABYLON.VirtualJoystick(true);
  18967. this._leftjoystick.setAxisForUpDown(2 /* Z */);
  18968. this._leftjoystick.setAxisForLeftRight(0 /* X */);
  18969. this._leftjoystick.setJoystickSensibility(0.15);
  18970. this._rightjoystick = new BABYLON.VirtualJoystick(false);
  18971. this._rightjoystick.setAxisForUpDown(0 /* X */);
  18972. this._rightjoystick.setAxisForLeftRight(1 /* Y */);
  18973. this._rightjoystick.reverseUpDown = true;
  18974. this._rightjoystick.setJoystickSensibility(0.05);
  18975. this._rightjoystick.setJoystickColor("yellow");
  18976. }
  18977. VirtualJoysticksCamera.prototype._checkInputs = function () {
  18978. var cameraTransform = BABYLON.Matrix.RotationYawPitchRoll(this.rotation.y, this.rotation.x, 0);
  18979. var deltaTransform = BABYLON.Vector3.TransformCoordinates(this._leftjoystick.deltaPosition, cameraTransform);
  18980. this.cameraDirection = this.cameraDirection.add(deltaTransform);
  18981. this.cameraRotation = this.cameraRotation.addVector3(this._rightjoystick.deltaPosition);
  18982. if (!this._leftjoystick.pressed) {
  18983. this._leftjoystick.deltaPosition = this._leftjoystick.deltaPosition.scale(0.9);
  18984. }
  18985. if (!this._rightjoystick.pressed) {
  18986. this._rightjoystick.deltaPosition = this._rightjoystick.deltaPosition.scale(0.9);
  18987. }
  18988. };
  18989. VirtualJoysticksCamera.prototype.dispose = function () {
  18990. this._leftjoystick.releaseCanvas();
  18991. _super.prototype.dispose.call(this);
  18992. };
  18993. return VirtualJoysticksCamera;
  18994. })(BABYLON.FreeCamera);
  18995. BABYLON.VirtualJoysticksCamera = VirtualJoysticksCamera;
  18996. })(BABYLON || (BABYLON = {}));
  18997. //# sourceMappingURL=babylon.virtualJoysticksCamera.js.map
  18998. var BABYLON;
  18999. (function (BABYLON) {
  19000. var ShaderMaterial = (function (_super) {
  19001. __extends(ShaderMaterial, _super);
  19002. function ShaderMaterial(name, scene, shaderPath, options) {
  19003. _super.call(this, name, scene);
  19004. this._textures = new Array();
  19005. this._floats = new Array();
  19006. this._floatsArrays = {};
  19007. this._colors3 = new Array();
  19008. this._colors4 = new Array();
  19009. this._vectors2 = new Array();
  19010. this._vectors3 = new Array();
  19011. this._matrices = new Array();
  19012. this._cachedWorldViewMatrix = new BABYLON.Matrix();
  19013. this._shaderPath = shaderPath;
  19014. options.needAlphaBlending = options.needAlphaBlending || false;
  19015. options.needAlphaTesting = options.needAlphaTesting || false;
  19016. options.attributes = options.attributes || ["position", "normal", "uv"];
  19017. options.uniforms = options.uniforms || ["worldViewProjection"];
  19018. options.samplers = options.samplers || [];
  19019. this._options = options;
  19020. }
  19021. ShaderMaterial.prototype.needAlphaBlending = function () {
  19022. return this._options.needAlphaBlending;
  19023. };
  19024. ShaderMaterial.prototype.needAlphaTesting = function () {
  19025. return this._options.needAlphaTesting;
  19026. };
  19027. ShaderMaterial.prototype._checkUniform = function (uniformName) {
  19028. if (this._options.uniforms.indexOf(uniformName) === -1) {
  19029. this._options.uniforms.push(uniformName);
  19030. }
  19031. };
  19032. ShaderMaterial.prototype.setTexture = function (name, texture) {
  19033. if (this._options.samplers.indexOf(name) === -1) {
  19034. this._options.samplers.push(name);
  19035. }
  19036. this._textures[name] = texture;
  19037. return this;
  19038. };
  19039. ShaderMaterial.prototype.setFloat = function (name, value) {
  19040. this._checkUniform(name);
  19041. this._floats[name] = value;
  19042. return this;
  19043. };
  19044. ShaderMaterial.prototype.setFloats = function (name, value) {
  19045. this._checkUniform(name);
  19046. this._floatsArrays[name] = value;
  19047. return this;
  19048. };
  19049. ShaderMaterial.prototype.setColor3 = function (name, value) {
  19050. this._checkUniform(name);
  19051. this._colors3[name] = value;
  19052. return this;
  19053. };
  19054. ShaderMaterial.prototype.setColor4 = function (name, value) {
  19055. this._checkUniform(name);
  19056. this._colors4[name] = value;
  19057. return this;
  19058. };
  19059. ShaderMaterial.prototype.setVector2 = function (name, value) {
  19060. this._checkUniform(name);
  19061. this._vectors2[name] = value;
  19062. return this;
  19063. };
  19064. ShaderMaterial.prototype.setVector3 = function (name, value) {
  19065. this._checkUniform(name);
  19066. this._vectors3[name] = value;
  19067. return this;
  19068. };
  19069. ShaderMaterial.prototype.setMatrix = function (name, value) {
  19070. this._checkUniform(name);
  19071. this._matrices[name] = value;
  19072. return this;
  19073. };
  19074. ShaderMaterial.prototype.isReady = function () {
  19075. var scene = this.getScene();
  19076. var engine = scene.getEngine();
  19077. if (!this.checkReadyOnEveryCall) {
  19078. if (this._renderId === scene.getRenderId()) {
  19079. return true;
  19080. }
  19081. }
  19082. var previousEffect = this._effect;
  19083. this._effect = engine.createEffect(this._shaderPath, this._options.attributes, this._options.uniforms, this._options.samplers, "", null, this.onCompiled, this.onError);
  19084. if (!this._effect.isReady()) {
  19085. return false;
  19086. }
  19087. if (previousEffect !== this._effect) {
  19088. scene.resetCachedMaterial();
  19089. }
  19090. this._renderId = scene.getRenderId();
  19091. return true;
  19092. };
  19093. ShaderMaterial.prototype.bindOnlyWorldMatrix = function (world) {
  19094. var scene = this.getScene();
  19095. if (this._options.uniforms.indexOf("world") !== -1) {
  19096. this._effect.setMatrix("world", world);
  19097. }
  19098. if (this._options.uniforms.indexOf("worldView") !== -1) {
  19099. world.multiplyToRef(scene.getViewMatrix(), this._cachedWorldViewMatrix);
  19100. this._effect.setMatrix("worldView", this._cachedWorldViewMatrix);
  19101. }
  19102. if (this._options.uniforms.indexOf("worldViewProjection") !== -1) {
  19103. this._effect.setMatrix("worldViewProjection", world.multiply(scene.getTransformMatrix()));
  19104. }
  19105. };
  19106. ShaderMaterial.prototype.bind = function (world) {
  19107. // Std values
  19108. this.bindOnlyWorldMatrix(world);
  19109. if (this.getScene().getCachedMaterial() !== this) {
  19110. if (this._options.uniforms.indexOf("view") !== -1) {
  19111. this._effect.setMatrix("view", this.getScene().getViewMatrix());
  19112. }
  19113. if (this._options.uniforms.indexOf("projection") !== -1) {
  19114. this._effect.setMatrix("projection", this.getScene().getProjectionMatrix());
  19115. }
  19116. if (this._options.uniforms.indexOf("viewProjection") !== -1) {
  19117. this._effect.setMatrix("viewProjection", this.getScene().getTransformMatrix());
  19118. }
  19119. for (var name in this._textures) {
  19120. this._effect.setTexture(name, this._textures[name]);
  19121. }
  19122. for (name in this._floats) {
  19123. this._effect.setFloat(name, this._floats[name]);
  19124. }
  19125. for (name in this._floatsArrays) {
  19126. this._effect.setArray(name, this._floatsArrays[name]);
  19127. }
  19128. for (name in this._colors3) {
  19129. this._effect.setColor3(name, this._colors3[name]);
  19130. }
  19131. for (name in this._colors4) {
  19132. var color = this._colors4[name];
  19133. this._effect.setFloat4(name, color.r, color.g, color.b, color.a);
  19134. }
  19135. for (name in this._vectors2) {
  19136. this._effect.setVector2(name, this._vectors2[name]);
  19137. }
  19138. for (name in this._vectors3) {
  19139. this._effect.setVector3(name, this._vectors3[name]);
  19140. }
  19141. for (name in this._matrices) {
  19142. this._effect.setMatrix(name, this._matrices[name]);
  19143. }
  19144. }
  19145. _super.prototype.bind.call(this, world, null);
  19146. };
  19147. ShaderMaterial.prototype.dispose = function (forceDisposeEffect) {
  19148. for (var name in this._textures) {
  19149. this._textures[name].dispose();
  19150. }
  19151. this._textures = [];
  19152. _super.prototype.dispose.call(this, forceDisposeEffect);
  19153. };
  19154. return ShaderMaterial;
  19155. })(BABYLON.Material);
  19156. BABYLON.ShaderMaterial = ShaderMaterial;
  19157. })(BABYLON || (BABYLON = {}));
  19158. //# sourceMappingURL=babylon.shaderMaterial.js.map
  19159. var BABYLON;
  19160. (function (BABYLON) {
  19161. var VertexData = (function () {
  19162. function VertexData() {
  19163. }
  19164. VertexData.prototype.set = function (data, kind) {
  19165. switch (kind) {
  19166. case BABYLON.VertexBuffer.PositionKind:
  19167. this.positions = data;
  19168. break;
  19169. case BABYLON.VertexBuffer.NormalKind:
  19170. this.normals = data;
  19171. break;
  19172. case BABYLON.VertexBuffer.UVKind:
  19173. this.uvs = data;
  19174. break;
  19175. case BABYLON.VertexBuffer.UV2Kind:
  19176. this.uv2s = data;
  19177. break;
  19178. case BABYLON.VertexBuffer.ColorKind:
  19179. this.colors = data;
  19180. break;
  19181. case BABYLON.VertexBuffer.MatricesIndicesKind:
  19182. this.matricesIndices = data;
  19183. break;
  19184. case BABYLON.VertexBuffer.MatricesWeightsKind:
  19185. this.matricesWeights = data;
  19186. break;
  19187. }
  19188. };
  19189. VertexData.prototype.applyToMesh = function (mesh, updatable) {
  19190. this._applyTo(mesh, updatable);
  19191. };
  19192. VertexData.prototype.applyToGeometry = function (geometry, updatable) {
  19193. this._applyTo(geometry, updatable);
  19194. };
  19195. VertexData.prototype.updateMesh = function (mesh, updateExtends, makeItUnique) {
  19196. this._update(mesh);
  19197. };
  19198. VertexData.prototype.updateGeometry = function (geometry, updateExtends, makeItUnique) {
  19199. this._update(geometry);
  19200. };
  19201. VertexData.prototype._applyTo = function (meshOrGeometry, updatable) {
  19202. if (this.positions) {
  19203. meshOrGeometry.setVerticesData(BABYLON.VertexBuffer.PositionKind, this.positions, updatable);
  19204. }
  19205. if (this.normals) {
  19206. meshOrGeometry.setVerticesData(BABYLON.VertexBuffer.NormalKind, this.normals, updatable);
  19207. }
  19208. if (this.uvs) {
  19209. meshOrGeometry.setVerticesData(BABYLON.VertexBuffer.UVKind, this.uvs, updatable);
  19210. }
  19211. if (this.uv2s) {
  19212. meshOrGeometry.setVerticesData(BABYLON.VertexBuffer.UV2Kind, this.uv2s, updatable);
  19213. }
  19214. if (this.colors) {
  19215. meshOrGeometry.setVerticesData(BABYLON.VertexBuffer.ColorKind, this.colors, updatable);
  19216. }
  19217. if (this.matricesIndices) {
  19218. meshOrGeometry.setVerticesData(BABYLON.VertexBuffer.MatricesIndicesKind, this.matricesIndices, updatable);
  19219. }
  19220. if (this.matricesWeights) {
  19221. meshOrGeometry.setVerticesData(BABYLON.VertexBuffer.MatricesWeightsKind, this.matricesWeights, updatable);
  19222. }
  19223. if (this.indices) {
  19224. meshOrGeometry.setIndices(this.indices);
  19225. }
  19226. };
  19227. VertexData.prototype._update = function (meshOrGeometry, updateExtends, makeItUnique) {
  19228. if (this.positions) {
  19229. meshOrGeometry.updateVerticesData(BABYLON.VertexBuffer.PositionKind, this.positions, updateExtends, makeItUnique);
  19230. }
  19231. if (this.normals) {
  19232. meshOrGeometry.updateVerticesData(BABYLON.VertexBuffer.NormalKind, this.normals, updateExtends, makeItUnique);
  19233. }
  19234. if (this.uvs) {
  19235. meshOrGeometry.updateVerticesData(BABYLON.VertexBuffer.UVKind, this.uvs, updateExtends, makeItUnique);
  19236. }
  19237. if (this.uv2s) {
  19238. meshOrGeometry.updateVerticesData(BABYLON.VertexBuffer.UV2Kind, this.uv2s, updateExtends, makeItUnique);
  19239. }
  19240. if (this.colors) {
  19241. meshOrGeometry.updateVerticesData(BABYLON.VertexBuffer.ColorKind, this.colors, updateExtends, makeItUnique);
  19242. }
  19243. if (this.matricesIndices) {
  19244. meshOrGeometry.updateVerticesData(BABYLON.VertexBuffer.MatricesIndicesKind, this.matricesIndices, updateExtends, makeItUnique);
  19245. }
  19246. if (this.matricesWeights) {
  19247. meshOrGeometry.updateVerticesData(BABYLON.VertexBuffer.MatricesWeightsKind, this.matricesWeights, updateExtends, makeItUnique);
  19248. }
  19249. if (this.indices) {
  19250. meshOrGeometry.setIndices(this.indices);
  19251. }
  19252. };
  19253. VertexData.prototype.transform = function (matrix) {
  19254. var transformed = BABYLON.Vector3.Zero();
  19255. if (this.positions) {
  19256. var position = BABYLON.Vector3.Zero();
  19257. for (var index = 0; index < this.positions.length; index += 3) {
  19258. BABYLON.Vector3.FromArrayToRef(this.positions, index, position);
  19259. BABYLON.Vector3.TransformCoordinatesToRef(position, matrix, transformed);
  19260. this.positions[index] = transformed.x;
  19261. this.positions[index + 1] = transformed.y;
  19262. this.positions[index + 2] = transformed.z;
  19263. }
  19264. }
  19265. if (this.normals) {
  19266. var normal = BABYLON.Vector3.Zero();
  19267. for (index = 0; index < this.normals.length; index += 3) {
  19268. BABYLON.Vector3.FromArrayToRef(this.normals, index, normal);
  19269. BABYLON.Vector3.TransformNormalToRef(normal, matrix, transformed);
  19270. this.normals[index] = transformed.x;
  19271. this.normals[index + 1] = transformed.y;
  19272. this.normals[index + 2] = transformed.z;
  19273. }
  19274. }
  19275. };
  19276. VertexData.prototype.merge = function (other) {
  19277. if (other.indices) {
  19278. if (!this.indices) {
  19279. this.indices = [];
  19280. }
  19281. var offset = this.positions ? this.positions.length / 3 : 0;
  19282. for (var index = 0; index < other.indices.length; index++) {
  19283. this.indices.push(other.indices[index] + offset);
  19284. }
  19285. }
  19286. if (other.positions) {
  19287. if (!this.positions) {
  19288. this.positions = [];
  19289. }
  19290. for (index = 0; index < other.positions.length; index++) {
  19291. this.positions.push(other.positions[index]);
  19292. }
  19293. }
  19294. if (other.normals) {
  19295. if (!this.normals) {
  19296. this.normals = [];
  19297. }
  19298. for (index = 0; index < other.normals.length; index++) {
  19299. this.normals.push(other.normals[index]);
  19300. }
  19301. }
  19302. if (other.uvs) {
  19303. if (!this.uvs) {
  19304. this.uvs = [];
  19305. }
  19306. for (index = 0; index < other.uvs.length; index++) {
  19307. this.uvs.push(other.uvs[index]);
  19308. }
  19309. }
  19310. if (other.uv2s) {
  19311. if (!this.uv2s) {
  19312. this.uv2s = [];
  19313. }
  19314. for (index = 0; index < other.uv2s.length; index++) {
  19315. this.uv2s.push(other.uv2s[index]);
  19316. }
  19317. }
  19318. if (other.matricesIndices) {
  19319. if (!this.matricesIndices) {
  19320. this.matricesIndices = [];
  19321. }
  19322. for (index = 0; index < other.matricesIndices.length; index++) {
  19323. this.matricesIndices.push(other.matricesIndices[index]);
  19324. }
  19325. }
  19326. if (other.matricesWeights) {
  19327. if (!this.matricesWeights) {
  19328. this.matricesWeights = [];
  19329. }
  19330. for (index = 0; index < other.matricesWeights.length; index++) {
  19331. this.matricesWeights.push(other.matricesWeights[index]);
  19332. }
  19333. }
  19334. if (other.colors) {
  19335. if (!this.colors) {
  19336. this.colors = [];
  19337. }
  19338. for (index = 0; index < other.colors.length; index++) {
  19339. this.colors.push(other.colors[index]);
  19340. }
  19341. }
  19342. };
  19343. // Statics
  19344. VertexData.ExtractFromMesh = function (mesh) {
  19345. return VertexData._ExtractFrom(mesh);
  19346. };
  19347. VertexData.ExtractFromGeometry = function (geometry) {
  19348. return VertexData._ExtractFrom(geometry);
  19349. };
  19350. VertexData._ExtractFrom = function (meshOrGeometry) {
  19351. var result = new BABYLON.VertexData();
  19352. if (meshOrGeometry.isVerticesDataPresent(BABYLON.VertexBuffer.PositionKind)) {
  19353. result.positions = meshOrGeometry.getVerticesData(BABYLON.VertexBuffer.PositionKind);
  19354. }
  19355. if (meshOrGeometry.isVerticesDataPresent(BABYLON.VertexBuffer.NormalKind)) {
  19356. result.normals = meshOrGeometry.getVerticesData(BABYLON.VertexBuffer.NormalKind);
  19357. }
  19358. if (meshOrGeometry.isVerticesDataPresent(BABYLON.VertexBuffer.UVKind)) {
  19359. result.uvs = meshOrGeometry.getVerticesData(BABYLON.VertexBuffer.UVKind);
  19360. }
  19361. if (meshOrGeometry.isVerticesDataPresent(BABYLON.VertexBuffer.UV2Kind)) {
  19362. result.uv2s = meshOrGeometry.getVerticesData(BABYLON.VertexBuffer.UV2Kind);
  19363. }
  19364. if (meshOrGeometry.isVerticesDataPresent(BABYLON.VertexBuffer.ColorKind)) {
  19365. result.colors = meshOrGeometry.getVerticesData(BABYLON.VertexBuffer.ColorKind);
  19366. }
  19367. if (meshOrGeometry.isVerticesDataPresent(BABYLON.VertexBuffer.MatricesIndicesKind)) {
  19368. result.matricesIndices = meshOrGeometry.getVerticesData(BABYLON.VertexBuffer.MatricesIndicesKind);
  19369. }
  19370. if (meshOrGeometry.isVerticesDataPresent(BABYLON.VertexBuffer.MatricesWeightsKind)) {
  19371. result.matricesWeights = meshOrGeometry.getVerticesData(BABYLON.VertexBuffer.MatricesWeightsKind);
  19372. }
  19373. result.indices = meshOrGeometry.getIndices();
  19374. return result;
  19375. };
  19376. VertexData.CreateBox = function (size) {
  19377. var normalsSource = [
  19378. new BABYLON.Vector3(0, 0, 1),
  19379. new BABYLON.Vector3(0, 0, -1),
  19380. new BABYLON.Vector3(1, 0, 0),
  19381. new BABYLON.Vector3(-1, 0, 0),
  19382. new BABYLON.Vector3(0, 1, 0),
  19383. new BABYLON.Vector3(0, -1, 0)
  19384. ];
  19385. var indices = [];
  19386. var positions = [];
  19387. var normals = [];
  19388. var uvs = [];
  19389. size = size || 1;
  19390. for (var index = 0; index < normalsSource.length; index++) {
  19391. var normal = normalsSource[index];
  19392. // Get two vectors perpendicular to the face normal and to each other.
  19393. var side1 = new BABYLON.Vector3(normal.y, normal.z, normal.x);
  19394. var side2 = BABYLON.Vector3.Cross(normal, side1);
  19395. // Six indices (two triangles) per face.
  19396. var verticesLength = positions.length / 3;
  19397. indices.push(verticesLength);
  19398. indices.push(verticesLength + 1);
  19399. indices.push(verticesLength + 2);
  19400. indices.push(verticesLength);
  19401. indices.push(verticesLength + 2);
  19402. indices.push(verticesLength + 3);
  19403. // Four vertices per face.
  19404. var vertex = normal.subtract(side1).subtract(side2).scale(size / 2);
  19405. positions.push(vertex.x, vertex.y, vertex.z);
  19406. normals.push(normal.x, normal.y, normal.z);
  19407. uvs.push(1.0, 1.0);
  19408. vertex = normal.subtract(side1).add(side2).scale(size / 2);
  19409. positions.push(vertex.x, vertex.y, vertex.z);
  19410. normals.push(normal.x, normal.y, normal.z);
  19411. uvs.push(0.0, 1.0);
  19412. vertex = normal.add(side1).add(side2).scale(size / 2);
  19413. positions.push(vertex.x, vertex.y, vertex.z);
  19414. normals.push(normal.x, normal.y, normal.z);
  19415. uvs.push(0.0, 0.0);
  19416. vertex = normal.add(side1).subtract(side2).scale(size / 2);
  19417. positions.push(vertex.x, vertex.y, vertex.z);
  19418. normals.push(normal.x, normal.y, normal.z);
  19419. uvs.push(1.0, 0.0);
  19420. }
  19421. // Result
  19422. var vertexData = new BABYLON.VertexData();
  19423. vertexData.indices = indices;
  19424. vertexData.positions = positions;
  19425. vertexData.normals = normals;
  19426. vertexData.uvs = uvs;
  19427. return vertexData;
  19428. };
  19429. VertexData.CreateSphere = function (segments, diameter) {
  19430. segments = segments || 32;
  19431. diameter = diameter || 1;
  19432. var radius = diameter / 2;
  19433. var totalZRotationSteps = 2 + segments;
  19434. var totalYRotationSteps = 2 * totalZRotationSteps;
  19435. var indices = [];
  19436. var positions = [];
  19437. var normals = [];
  19438. var uvs = [];
  19439. for (var zRotationStep = 0; zRotationStep <= totalZRotationSteps; zRotationStep++) {
  19440. var normalizedZ = zRotationStep / totalZRotationSteps;
  19441. var angleZ = (normalizedZ * Math.PI);
  19442. for (var yRotationStep = 0; yRotationStep <= totalYRotationSteps; yRotationStep++) {
  19443. var normalizedY = yRotationStep / totalYRotationSteps;
  19444. var angleY = normalizedY * Math.PI * 2;
  19445. var rotationZ = BABYLON.Matrix.RotationZ(-angleZ);
  19446. var rotationY = BABYLON.Matrix.RotationY(angleY);
  19447. var afterRotZ = BABYLON.Vector3.TransformCoordinates(BABYLON.Vector3.Up(), rotationZ);
  19448. var complete = BABYLON.Vector3.TransformCoordinates(afterRotZ, rotationY);
  19449. var vertex = complete.scale(radius);
  19450. var normal = BABYLON.Vector3.Normalize(vertex);
  19451. positions.push(vertex.x, vertex.y, vertex.z);
  19452. normals.push(normal.x, normal.y, normal.z);
  19453. uvs.push(normalizedZ, normalizedY);
  19454. }
  19455. if (zRotationStep > 0) {
  19456. var verticesCount = positions.length / 3;
  19457. for (var firstIndex = verticesCount - 2 * (totalYRotationSteps + 1); (firstIndex + totalYRotationSteps + 2) < verticesCount; firstIndex++) {
  19458. indices.push((firstIndex));
  19459. indices.push((firstIndex + 1));
  19460. indices.push(firstIndex + totalYRotationSteps + 1);
  19461. indices.push((firstIndex + totalYRotationSteps + 1));
  19462. indices.push((firstIndex + 1));
  19463. indices.push((firstIndex + totalYRotationSteps + 2));
  19464. }
  19465. }
  19466. }
  19467. // Result
  19468. var vertexData = new BABYLON.VertexData();
  19469. vertexData.indices = indices;
  19470. vertexData.positions = positions;
  19471. vertexData.normals = normals;
  19472. vertexData.uvs = uvs;
  19473. return vertexData;
  19474. };
  19475. VertexData.CreateCylinder = function (height, diameterTop, diameterBottom, tessellation, subdivisions) {
  19476. if (typeof subdivisions === "undefined") { subdivisions = 1; }
  19477. var radiusTop = diameterTop / 2;
  19478. var radiusBottom = diameterBottom / 2;
  19479. var indices = [];
  19480. var positions = [];
  19481. var normals = [];
  19482. var uvs = [];
  19483. height = height || 1;
  19484. diameterTop = diameterTop || 0.5;
  19485. diameterBottom = diameterBottom || 1;
  19486. tessellation = tessellation || 16;
  19487. subdivisions = subdivisions || 1;
  19488. subdivisions = (subdivisions < 1) ? 1 : subdivisions;
  19489. var getCircleVector = function (i) {
  19490. var angle = (i * 2.0 * Math.PI / tessellation);
  19491. var dx = Math.cos(angle);
  19492. var dz = Math.sin(angle);
  19493. return new BABYLON.Vector3(dx, 0, dz);
  19494. };
  19495. var createCylinderCap = function (isTop) {
  19496. var radius = isTop ? radiusTop : radiusBottom;
  19497. if (radius == 0) {
  19498. return;
  19499. }
  19500. var vbase = positions.length / 3;
  19501. var offset = new BABYLON.Vector3(0, height / 2, 0);
  19502. var textureScale = new BABYLON.Vector2(0.5, 0.5);
  19503. if (!isTop) {
  19504. offset.scaleInPlace(-1);
  19505. textureScale.x = -textureScale.x;
  19506. }
  19507. for (i = 0; i < tessellation; i++) {
  19508. var circleVector = getCircleVector(i);
  19509. var position = circleVector.scale(radius).add(offset);
  19510. var textureCoordinate = new BABYLON.Vector2(circleVector.x * textureScale.x + 0.5, circleVector.z * textureScale.y + 0.5);
  19511. positions.push(position.x, position.y, position.z);
  19512. uvs.push(textureCoordinate.x, textureCoordinate.y);
  19513. }
  19514. for (var i = 0; i < tessellation - 2; i++) {
  19515. if (!isTop) {
  19516. indices.push(vbase);
  19517. indices.push(vbase + (i + 2) % tessellation);
  19518. indices.push(vbase + (i + 1) % tessellation);
  19519. } else {
  19520. indices.push(vbase);
  19521. indices.push(vbase + (i + 1) % tessellation);
  19522. indices.push(vbase + (i + 2) % tessellation);
  19523. }
  19524. }
  19525. };
  19526. var base = new BABYLON.Vector3(0, -1, 0).scale(height / 2);
  19527. var offset = new BABYLON.Vector3(0, 1, 0).scale(height / subdivisions);
  19528. var stride = tessellation + 1;
  19529. for (var i = 0; i <= tessellation; i++) {
  19530. var circleVector = getCircleVector(i);
  19531. var textureCoordinate = new BABYLON.Vector2(i / tessellation, 0);
  19532. var position, radius = radiusBottom;
  19533. for (var s = 0; s <= subdivisions; s++) {
  19534. // Update variables
  19535. position = circleVector.scale(radius);
  19536. position.addInPlace(base.add(offset.scale(s)));
  19537. textureCoordinate.y += 1 / subdivisions;
  19538. radius += (radiusTop - radiusBottom) / subdivisions;
  19539. // Push in arrays
  19540. positions.push(position.x, position.y, position.z);
  19541. uvs.push(textureCoordinate.x, textureCoordinate.y);
  19542. }
  19543. }
  19544. subdivisions += 1;
  19545. for (var s = 0; s < subdivisions - 1; s++) {
  19546. for (var i = 0; i <= tessellation; i++) {
  19547. indices.push(i * subdivisions + s);
  19548. indices.push((i * subdivisions + (s + subdivisions)) % (stride * subdivisions));
  19549. indices.push(i * subdivisions + (s + 1));
  19550. indices.push(i * subdivisions + (s + 1));
  19551. indices.push((i * subdivisions + (s + subdivisions)) % (stride * subdivisions));
  19552. indices.push((i * subdivisions + (s + subdivisions + 1)) % (stride * subdivisions));
  19553. }
  19554. }
  19555. // Create flat triangle fan caps to seal the top and bottom.
  19556. createCylinderCap(true);
  19557. createCylinderCap(false);
  19558. // Normals
  19559. BABYLON.VertexData.ComputeNormals(positions, indices, normals);
  19560. // Result
  19561. var vertexData = new BABYLON.VertexData();
  19562. vertexData.indices = indices;
  19563. vertexData.positions = positions;
  19564. vertexData.normals = normals;
  19565. vertexData.uvs = uvs;
  19566. return vertexData;
  19567. };
  19568. VertexData.CreateTorus = function (diameter, thickness, tessellation) {
  19569. var indices = [];
  19570. var positions = [];
  19571. var normals = [];
  19572. var uvs = [];
  19573. diameter = diameter || 1;
  19574. thickness = thickness || 0.5;
  19575. tessellation = tessellation || 16;
  19576. var stride = tessellation + 1;
  19577. for (var i = 0; i <= tessellation; i++) {
  19578. var u = i / tessellation;
  19579. var outerAngle = i * Math.PI * 2.0 / tessellation - Math.PI / 2.0;
  19580. var transform = BABYLON.Matrix.Translation(diameter / 2.0, 0, 0).multiply(BABYLON.Matrix.RotationY(outerAngle));
  19581. for (var j = 0; j <= tessellation; j++) {
  19582. var v = 1 - j / tessellation;
  19583. var innerAngle = j * Math.PI * 2.0 / tessellation + Math.PI;
  19584. var dx = Math.cos(innerAngle);
  19585. var dy = Math.sin(innerAngle);
  19586. // Create a vertex.
  19587. var normal = new BABYLON.Vector3(dx, dy, 0);
  19588. var position = normal.scale(thickness / 2);
  19589. var textureCoordinate = new BABYLON.Vector2(u, v);
  19590. position = BABYLON.Vector3.TransformCoordinates(position, transform);
  19591. normal = BABYLON.Vector3.TransformNormal(normal, transform);
  19592. positions.push(position.x, position.y, position.z);
  19593. normals.push(normal.x, normal.y, normal.z);
  19594. uvs.push(textureCoordinate.x, textureCoordinate.y);
  19595. // And create indices for two triangles.
  19596. var nextI = (i + 1) % stride;
  19597. var nextJ = (j + 1) % stride;
  19598. indices.push(i * stride + j);
  19599. indices.push(i * stride + nextJ);
  19600. indices.push(nextI * stride + j);
  19601. indices.push(i * stride + nextJ);
  19602. indices.push(nextI * stride + nextJ);
  19603. indices.push(nextI * stride + j);
  19604. }
  19605. }
  19606. // Result
  19607. var vertexData = new BABYLON.VertexData();
  19608. vertexData.indices = indices;
  19609. vertexData.positions = positions;
  19610. vertexData.normals = normals;
  19611. vertexData.uvs = uvs;
  19612. return vertexData;
  19613. };
  19614. VertexData.CreateLines = function (points) {
  19615. var indices = [];
  19616. var positions = [];
  19617. for (var index = 0; index < points.length; index++) {
  19618. positions.push(points[index].x, points[index].y, points[index].z);
  19619. if (index > 0) {
  19620. indices.push(index - 1);
  19621. indices.push(index);
  19622. }
  19623. }
  19624. // Result
  19625. var vertexData = new BABYLON.VertexData();
  19626. vertexData.indices = indices;
  19627. vertexData.positions = positions;
  19628. return vertexData;
  19629. };
  19630. VertexData.CreateGround = function (width, height, subdivisions) {
  19631. var indices = [];
  19632. var positions = [];
  19633. var normals = [];
  19634. var uvs = [];
  19635. var row, col;
  19636. width = width || 1;
  19637. height = height || 1;
  19638. subdivisions = subdivisions || 1;
  19639. for (row = 0; row <= subdivisions; row++) {
  19640. for (col = 0; col <= subdivisions; col++) {
  19641. var position = new BABYLON.Vector3((col * width) / subdivisions - (width / 2.0), 0, ((subdivisions - row) * height) / subdivisions - (height / 2.0));
  19642. var normal = new BABYLON.Vector3(0, 1.0, 0);
  19643. positions.push(position.x, position.y, position.z);
  19644. normals.push(normal.x, normal.y, normal.z);
  19645. uvs.push(col / subdivisions, 1.0 - row / subdivisions);
  19646. }
  19647. }
  19648. for (row = 0; row < subdivisions; row++) {
  19649. for (col = 0; col < subdivisions; col++) {
  19650. indices.push(col + 1 + (row + 1) * (subdivisions + 1));
  19651. indices.push(col + 1 + row * (subdivisions + 1));
  19652. indices.push(col + row * (subdivisions + 1));
  19653. indices.push(col + (row + 1) * (subdivisions + 1));
  19654. indices.push(col + 1 + (row + 1) * (subdivisions + 1));
  19655. indices.push(col + row * (subdivisions + 1));
  19656. }
  19657. }
  19658. // Result
  19659. var vertexData = new BABYLON.VertexData();
  19660. vertexData.indices = indices;
  19661. vertexData.positions = positions;
  19662. vertexData.normals = normals;
  19663. vertexData.uvs = uvs;
  19664. return vertexData;
  19665. };
  19666. VertexData.CreateTiledGround = function (xmin, zmin, xmax, zmax, subdivisions, precision) {
  19667. if (typeof subdivisions === "undefined") { subdivisions = { w: 1, h: 1 }; }
  19668. if (typeof precision === "undefined") { precision = { w: 1, h: 1 }; }
  19669. var indices = [];
  19670. var positions = [];
  19671. var normals = [];
  19672. var uvs = [];
  19673. var row, col, tileRow, tileCol;
  19674. subdivisions.h = (subdivisions.w < 1) ? 1 : subdivisions.h;
  19675. subdivisions.w = (subdivisions.w < 1) ? 1 : subdivisions.w;
  19676. precision.w = (precision.w < 1) ? 1 : precision.w;
  19677. precision.h = (precision.h < 1) ? 1 : precision.h;
  19678. var tileSize = {
  19679. 'w': (xmax - xmin) / subdivisions.w,
  19680. 'h': (zmax - zmin) / subdivisions.h
  19681. };
  19682. for (tileRow = 0; tileRow < subdivisions.h; tileRow++) {
  19683. for (tileCol = 0; tileCol < subdivisions.w; tileCol++) {
  19684. applyTile(xmin + tileCol * tileSize.w, zmin + tileRow * tileSize.h, xmin + (tileCol + 1) * tileSize.w, zmin + (tileRow + 1) * tileSize.h);
  19685. }
  19686. }
  19687. function applyTile(xTileMin, zTileMin, xTileMax, zTileMax) {
  19688. // Indices
  19689. var base = positions.length / 3;
  19690. var rowLength = precision.w + 1;
  19691. for (row = 0; row < precision.h; row++) {
  19692. for (col = 0; col < precision.w; col++) {
  19693. var square = [
  19694. base + col + row * rowLength,
  19695. base + (col + 1) + row * rowLength,
  19696. base + (col + 1) + (row + 1) * rowLength,
  19697. base + col + (row + 1) * rowLength
  19698. ];
  19699. indices.push(square[1]);
  19700. indices.push(square[2]);
  19701. indices.push(square[3]);
  19702. indices.push(square[0]);
  19703. indices.push(square[1]);
  19704. indices.push(square[3]);
  19705. }
  19706. }
  19707. // Position, normals and uvs
  19708. var position = BABYLON.Vector3.Zero();
  19709. var normal = new BABYLON.Vector3(0, 1.0, 0);
  19710. for (row = 0; row <= precision.h; row++) {
  19711. position.z = (row * (zTileMax - zTileMin)) / precision.h + zTileMin;
  19712. for (col = 0; col <= precision.w; col++) {
  19713. position.x = (col * (xTileMax - xTileMin)) / precision.w + xTileMin;
  19714. position.y = 0;
  19715. positions.push(position.x, position.y, position.z);
  19716. normals.push(normal.x, normal.y, normal.z);
  19717. uvs.push(col / precision.w, row / precision.h);
  19718. }
  19719. }
  19720. }
  19721. // Result
  19722. var vertexData = new BABYLON.VertexData();
  19723. vertexData.indices = indices;
  19724. vertexData.positions = positions;
  19725. vertexData.normals = normals;
  19726. vertexData.uvs = uvs;
  19727. return vertexData;
  19728. };
  19729. VertexData.CreateGroundFromHeightMap = function (width, height, subdivisions, minHeight, maxHeight, buffer, bufferWidth, bufferHeight) {
  19730. var indices = [];
  19731. var positions = [];
  19732. var normals = [];
  19733. var uvs = [];
  19734. var row, col;
  19735. for (row = 0; row <= subdivisions; row++) {
  19736. for (col = 0; col <= subdivisions; col++) {
  19737. var position = new BABYLON.Vector3((col * width) / subdivisions - (width / 2.0), 0, ((subdivisions - row) * height) / subdivisions - (height / 2.0));
  19738. // Compute height
  19739. var heightMapX = (((position.x + width / 2) / width) * (bufferWidth - 1)) | 0;
  19740. var heightMapY = ((1.0 - (position.z + height / 2) / height) * (bufferHeight - 1)) | 0;
  19741. var pos = (heightMapX + heightMapY * bufferWidth) * 4;
  19742. var r = buffer[pos] / 255.0;
  19743. var g = buffer[pos + 1] / 255.0;
  19744. var b = buffer[pos + 2] / 255.0;
  19745. var gradient = r * 0.3 + g * 0.59 + b * 0.11;
  19746. position.y = minHeight + (maxHeight - minHeight) * gradient;
  19747. // Add vertex
  19748. positions.push(position.x, position.y, position.z);
  19749. normals.push(0, 0, 0);
  19750. uvs.push(col / subdivisions, 1.0 - row / subdivisions);
  19751. }
  19752. }
  19753. for (row = 0; row < subdivisions; row++) {
  19754. for (col = 0; col < subdivisions; col++) {
  19755. indices.push(col + 1 + (row + 1) * (subdivisions + 1));
  19756. indices.push(col + 1 + row * (subdivisions + 1));
  19757. indices.push(col + row * (subdivisions + 1));
  19758. indices.push(col + (row + 1) * (subdivisions + 1));
  19759. indices.push(col + 1 + (row + 1) * (subdivisions + 1));
  19760. indices.push(col + row * (subdivisions + 1));
  19761. }
  19762. }
  19763. // Normals
  19764. BABYLON.VertexData.ComputeNormals(positions, indices, normals);
  19765. // Result
  19766. var vertexData = new BABYLON.VertexData();
  19767. vertexData.indices = indices;
  19768. vertexData.positions = positions;
  19769. vertexData.normals = normals;
  19770. vertexData.uvs = uvs;
  19771. return vertexData;
  19772. };
  19773. VertexData.CreatePlane = function (size) {
  19774. var indices = [];
  19775. var positions = [];
  19776. var normals = [];
  19777. var uvs = [];
  19778. size = size || 1;
  19779. // Vertices
  19780. var halfSize = size / 2.0;
  19781. positions.push(-halfSize, -halfSize, 0);
  19782. normals.push(0, 0, -1.0);
  19783. uvs.push(0.0, 0.0);
  19784. positions.push(halfSize, -halfSize, 0);
  19785. normals.push(0, 0, -1.0);
  19786. uvs.push(1.0, 0.0);
  19787. positions.push(halfSize, halfSize, 0);
  19788. normals.push(0, 0, -1.0);
  19789. uvs.push(1.0, 1.0);
  19790. positions.push(-halfSize, halfSize, 0);
  19791. normals.push(0, 0, -1.0);
  19792. uvs.push(0.0, 1.0);
  19793. // Indices
  19794. indices.push(0);
  19795. indices.push(1);
  19796. indices.push(2);
  19797. indices.push(0);
  19798. indices.push(2);
  19799. indices.push(3);
  19800. // Result
  19801. var vertexData = new BABYLON.VertexData();
  19802. vertexData.indices = indices;
  19803. vertexData.positions = positions;
  19804. vertexData.normals = normals;
  19805. vertexData.uvs = uvs;
  19806. return vertexData;
  19807. };
  19808. // based on http://code.google.com/p/away3d/source/browse/trunk/fp10/Away3D/src/away3d/primitives/TorusKnot.as?spec=svn2473&r=2473
  19809. VertexData.CreateTorusKnot = function (radius, tube, radialSegments, tubularSegments, p, q) {
  19810. var indices = [];
  19811. var positions = [];
  19812. var normals = [];
  19813. var uvs = [];
  19814. radius = radius || 2;
  19815. tube = tube || 0.5;
  19816. radialSegments = radialSegments || 32;
  19817. tubularSegments = tubularSegments || 32;
  19818. p = p || 2;
  19819. q = q || 3;
  19820. // Helper
  19821. var getPos = function (angle) {
  19822. var cu = Math.cos(angle);
  19823. var su = Math.sin(angle);
  19824. var quOverP = q / p * angle;
  19825. var cs = Math.cos(quOverP);
  19826. var tx = radius * (2 + cs) * 0.5 * cu;
  19827. var ty = radius * (2 + cs) * su * 0.5;
  19828. var tz = radius * Math.sin(quOverP) * 0.5;
  19829. return new BABYLON.Vector3(tx, ty, tz);
  19830. };
  19831. for (var i = 0; i <= radialSegments; i++) {
  19832. var modI = i % radialSegments;
  19833. var u = modI / radialSegments * 2 * p * Math.PI;
  19834. var p1 = getPos(u);
  19835. var p2 = getPos(u + 0.01);
  19836. var tang = p2.subtract(p1);
  19837. var n = p2.add(p1);
  19838. var bitan = BABYLON.Vector3.Cross(tang, n);
  19839. n = BABYLON.Vector3.Cross(bitan, tang);
  19840. bitan.normalize();
  19841. n.normalize();
  19842. for (var j = 0; j < tubularSegments; j++) {
  19843. var modJ = j % tubularSegments;
  19844. var v = modJ / tubularSegments * 2 * Math.PI;
  19845. var cx = -tube * Math.cos(v);
  19846. var cy = tube * Math.sin(v);
  19847. positions.push(p1.x + cx * n.x + cy * bitan.x);
  19848. positions.push(p1.y + cx * n.y + cy * bitan.y);
  19849. positions.push(p1.z + cx * n.z + cy * bitan.z);
  19850. uvs.push(i / radialSegments);
  19851. uvs.push(j / tubularSegments);
  19852. }
  19853. }
  19854. for (i = 0; i < radialSegments; i++) {
  19855. for (j = 0; j < tubularSegments; j++) {
  19856. var jNext = (j + 1) % tubularSegments;
  19857. var a = i * tubularSegments + j;
  19858. var b = (i + 1) * tubularSegments + j;
  19859. var c = (i + 1) * tubularSegments + jNext;
  19860. var d = i * tubularSegments + jNext;
  19861. indices.push(d);
  19862. indices.push(b);
  19863. indices.push(a);
  19864. indices.push(d);
  19865. indices.push(c);
  19866. indices.push(b);
  19867. }
  19868. }
  19869. // Normals
  19870. BABYLON.VertexData.ComputeNormals(positions, indices, normals);
  19871. // Result
  19872. var vertexData = new BABYLON.VertexData();
  19873. vertexData.indices = indices;
  19874. vertexData.positions = positions;
  19875. vertexData.normals = normals;
  19876. vertexData.uvs = uvs;
  19877. return vertexData;
  19878. };
  19879. // Tools
  19880. VertexData.ComputeNormals = function (positions, indices, normals) {
  19881. var positionVectors = [];
  19882. var facesOfVertices = [];
  19883. var index;
  19884. for (index = 0; index < positions.length; index += 3) {
  19885. var vector3 = new BABYLON.Vector3(positions[index], positions[index + 1], positions[index + 2]);
  19886. positionVectors.push(vector3);
  19887. facesOfVertices.push([]);
  19888. }
  19889. // Compute normals
  19890. var facesNormals = [];
  19891. for (index = 0; index < indices.length / 3; index++) {
  19892. var i1 = indices[index * 3];
  19893. var i2 = indices[index * 3 + 1];
  19894. var i3 = indices[index * 3 + 2];
  19895. var p1 = positionVectors[i1];
  19896. var p2 = positionVectors[i2];
  19897. var p3 = positionVectors[i3];
  19898. var p1p2 = p1.subtract(p2);
  19899. var p3p2 = p3.subtract(p2);
  19900. facesNormals[index] = BABYLON.Vector3.Normalize(BABYLON.Vector3.Cross(p1p2, p3p2));
  19901. facesOfVertices[i1].push(index);
  19902. facesOfVertices[i2].push(index);
  19903. facesOfVertices[i3].push(index);
  19904. }
  19905. for (index = 0; index < positionVectors.length; index++) {
  19906. var faces = facesOfVertices[index];
  19907. var normal = BABYLON.Vector3.Zero();
  19908. for (var faceIndex = 0; faceIndex < faces.length; faceIndex++) {
  19909. normal.addInPlace(facesNormals[faces[faceIndex]]);
  19910. }
  19911. normal = BABYLON.Vector3.Normalize(normal.scale(1.0 / faces.length));
  19912. normals[index * 3] = normal.x;
  19913. normals[index * 3 + 1] = normal.y;
  19914. normals[index * 3 + 2] = normal.z;
  19915. }
  19916. };
  19917. return VertexData;
  19918. })();
  19919. BABYLON.VertexData = VertexData;
  19920. })(BABYLON || (BABYLON = {}));
  19921. //# sourceMappingURL=babylon.mesh.vertexData.js.map
  19922. var BABYLON;
  19923. (function (BABYLON) {
  19924. var buildCamera = function (that, name) {
  19925. that._leftCamera.isIntermediate = true;
  19926. that.subCameras.push(that._leftCamera);
  19927. that.subCameras.push(that._rightCamera);
  19928. that._leftTexture = new BABYLON.PassPostProcess(name + "_leftTexture", 1.0, that._leftCamera);
  19929. that._anaglyphPostProcess = new BABYLON.AnaglyphPostProcess(name + "_anaglyph", 1.0, that._rightCamera);
  19930. that._anaglyphPostProcess.onApply = function (effect) {
  19931. effect.setTextureFromPostProcess("leftSampler", that._leftTexture);
  19932. };
  19933. that._update();
  19934. };
  19935. var AnaglyphArcRotateCamera = (function (_super) {
  19936. __extends(AnaglyphArcRotateCamera, _super);
  19937. // ANY
  19938. function AnaglyphArcRotateCamera(name, alpha, beta, radius, target, eyeSpace, scene) {
  19939. _super.call(this, name, alpha, beta, radius, target, scene);
  19940. this._eyeSpace = BABYLON.Tools.ToRadians(eyeSpace);
  19941. this._leftCamera = new BABYLON.ArcRotateCamera(name + "_left", alpha - this._eyeSpace, beta, radius, target, scene);
  19942. this._rightCamera = new BABYLON.ArcRotateCamera(name + "_right", alpha + this._eyeSpace, beta, radius, target, scene);
  19943. buildCamera(this, name);
  19944. }
  19945. AnaglyphArcRotateCamera.prototype._update = function () {
  19946. this._updateCamera(this._leftCamera);
  19947. this._updateCamera(this._rightCamera);
  19948. this._leftCamera.alpha = this.alpha - this._eyeSpace;
  19949. this._rightCamera.alpha = this.alpha + this._eyeSpace;
  19950. _super.prototype._update.call(this);
  19951. };
  19952. AnaglyphArcRotateCamera.prototype._updateCamera = function (camera) {
  19953. camera.beta = this.beta;
  19954. camera.radius = this.radius;
  19955. camera.minZ = this.minZ;
  19956. camera.maxZ = this.maxZ;
  19957. camera.fov = this.fov;
  19958. camera.target = this.target;
  19959. };
  19960. return AnaglyphArcRotateCamera;
  19961. })(BABYLON.ArcRotateCamera);
  19962. BABYLON.AnaglyphArcRotateCamera = AnaglyphArcRotateCamera;
  19963. var AnaglyphFreeCamera = (function (_super) {
  19964. __extends(AnaglyphFreeCamera, _super);
  19965. function AnaglyphFreeCamera(name, position, eyeSpace, scene) {
  19966. _super.call(this, name, position, scene);
  19967. this._eyeSpace = BABYLON.Tools.ToRadians(eyeSpace);
  19968. this._transformMatrix = new BABYLON.Matrix();
  19969. this._leftCamera = new BABYLON.FreeCamera(name + "_left", position.clone(), scene);
  19970. this._rightCamera = new BABYLON.FreeCamera(name + "_right", position.clone(), scene);
  19971. buildCamera(this, name);
  19972. }
  19973. AnaglyphFreeCamera.prototype._getSubCameraPosition = function (eyeSpace, result) {
  19974. var target = this.getTarget();
  19975. BABYLON.Matrix.Translation(-target.x, -target.y, -target.z).multiplyToRef(BABYLON.Matrix.RotationY(eyeSpace), this._transformMatrix);
  19976. this._transformMatrix = this._transformMatrix.multiply(BABYLON.Matrix.Translation(target.x, target.y, target.z));
  19977. BABYLON.Vector3.TransformCoordinatesToRef(this.position, this._transformMatrix, result);
  19978. };
  19979. AnaglyphFreeCamera.prototype._update = function () {
  19980. this._getSubCameraPosition(-this._eyeSpace, this._leftCamera.position);
  19981. this._getSubCameraPosition(this._eyeSpace, this._rightCamera.position);
  19982. this._updateCamera(this._leftCamera);
  19983. this._updateCamera(this._rightCamera);
  19984. _super.prototype._update.call(this);
  19985. };
  19986. AnaglyphFreeCamera.prototype._updateCamera = function (camera) {
  19987. camera.minZ = this.minZ;
  19988. camera.maxZ = this.maxZ;
  19989. camera.fov = this.fov;
  19990. camera.viewport = this.viewport;
  19991. camera.setTarget(this.getTarget());
  19992. };
  19993. return AnaglyphFreeCamera;
  19994. })(BABYLON.FreeCamera);
  19995. BABYLON.AnaglyphFreeCamera = AnaglyphFreeCamera;
  19996. })(BABYLON || (BABYLON = {}));
  19997. //# sourceMappingURL=babylon.anaglyphCamera.js.map
  19998. var BABYLON;
  19999. (function (BABYLON) {
  20000. var AnaglyphPostProcess = (function (_super) {
  20001. __extends(AnaglyphPostProcess, _super);
  20002. function AnaglyphPostProcess(name, ratio, camera, samplingMode, engine, reusable) {
  20003. _super.call(this, name, "anaglyph", null, ["leftSampler"], ratio, camera, samplingMode, engine, reusable);
  20004. }
  20005. return AnaglyphPostProcess;
  20006. })(BABYLON.PostProcess);
  20007. BABYLON.AnaglyphPostProcess = AnaglyphPostProcess;
  20008. })(BABYLON || (BABYLON = {}));
  20009. //# sourceMappingURL=babylon.anaglyphPostProcess.js.map
  20010. var BABYLON;
  20011. (function (BABYLON) {
  20012. var Tags = (function () {
  20013. function Tags() {
  20014. }
  20015. Tags.EnableFor = function (obj) {
  20016. obj._tags = obj._tags || {};
  20017. obj.hasTags = function () {
  20018. return Tags.HasTags(obj);
  20019. };
  20020. obj.addTags = function (tagsString) {
  20021. return Tags.AddTagsTo(obj, tagsString);
  20022. };
  20023. obj.removeTags = function (tagsString) {
  20024. return Tags.RemoveTagsFrom(obj, tagsString);
  20025. };
  20026. obj.matchesTagsQuery = function (tagsQuery) {
  20027. return Tags.MatchesQuery(obj, tagsQuery);
  20028. };
  20029. };
  20030. Tags.DisableFor = function (obj) {
  20031. delete obj._tags;
  20032. delete obj.hasTags;
  20033. delete obj.addTags;
  20034. delete obj.removeTags;
  20035. delete obj.matchesTagsQuery;
  20036. };
  20037. Tags.HasTags = function (obj) {
  20038. if (!obj._tags) {
  20039. return false;
  20040. }
  20041. return !BABYLON.Tools.IsEmpty(obj._tags);
  20042. };
  20043. Tags.GetTags = function (obj) {
  20044. if (!obj._tags) {
  20045. return null;
  20046. }
  20047. return obj._tags;
  20048. };
  20049. // the tags 'true' and 'false' are reserved and cannot be used as tags
  20050. // a tag cannot start with '||', '&&', and '!'
  20051. // it cannot contain whitespaces
  20052. Tags.AddTagsTo = function (obj, tagsString) {
  20053. if (!tagsString) {
  20054. return;
  20055. }
  20056. var tags = tagsString.split(" ");
  20057. for (var t in tags) {
  20058. Tags._AddTagTo(obj, tags[t]);
  20059. }
  20060. };
  20061. Tags._AddTagTo = function (obj, tag) {
  20062. tag = tag.trim();
  20063. if (tag === "" || tag === "true" || tag === "false") {
  20064. return;
  20065. }
  20066. if (tag.match(/[\s]/) || tag.match(/^([!]|([|]|[&]){2})/)) {
  20067. return;
  20068. }
  20069. Tags.EnableFor(obj);
  20070. obj._tags[tag] = true;
  20071. };
  20072. Tags.RemoveTagsFrom = function (obj, tagsString) {
  20073. if (!Tags.HasTags(obj)) {
  20074. return;
  20075. }
  20076. var tags = tagsString.split(" ");
  20077. for (var t in tags) {
  20078. Tags._RemoveTagFrom(obj, tags[t]);
  20079. }
  20080. };
  20081. Tags._RemoveTagFrom = function (obj, tag) {
  20082. delete obj._tags[tag];
  20083. };
  20084. Tags.MatchesQuery = function (obj, tagsQuery) {
  20085. if (tagsQuery === undefined) {
  20086. return true;
  20087. }
  20088. if (tagsQuery === "") {
  20089. return Tags.HasTags(obj);
  20090. }
  20091. return BABYLON.Internals.AndOrNotEvaluator.Eval(tagsQuery, function (r) {
  20092. return Tags.HasTags(obj) && obj._tags[r];
  20093. });
  20094. };
  20095. return Tags;
  20096. })();
  20097. BABYLON.Tags = Tags;
  20098. })(BABYLON || (BABYLON = {}));
  20099. //# sourceMappingURL=babylon.tags.js.map
  20100. var BABYLON;
  20101. (function (BABYLON) {
  20102. (function (Internals) {
  20103. var AndOrNotEvaluator = (function () {
  20104. function AndOrNotEvaluator() {
  20105. }
  20106. AndOrNotEvaluator.Eval = function (query, evaluateCallback) {
  20107. if (!query.match(/\([^\(\)]*\)/g)) {
  20108. query = AndOrNotEvaluator._HandleParenthesisContent(query, evaluateCallback);
  20109. } else {
  20110. query = query.replace(/\([^\(\)]*\)/g, function (r) {
  20111. // remove parenthesis
  20112. r = r.slice(1, r.length - 1);
  20113. return AndOrNotEvaluator._HandleParenthesisContent(r, evaluateCallback);
  20114. });
  20115. }
  20116. if (query === "true") {
  20117. return true;
  20118. }
  20119. if (query === "false") {
  20120. return false;
  20121. }
  20122. return AndOrNotEvaluator.Eval(query, evaluateCallback);
  20123. };
  20124. AndOrNotEvaluator._HandleParenthesisContent = function (parenthesisContent, evaluateCallback) {
  20125. evaluateCallback = evaluateCallback || (function (r) {
  20126. return r === "true" ? true : false;
  20127. });
  20128. var result;
  20129. var or = parenthesisContent.split("||");
  20130. for (var i in or) {
  20131. var ori = AndOrNotEvaluator._SimplifyNegation(or[i].trim());
  20132. var and = ori.split("&&");
  20133. if (and.length > 1) {
  20134. for (var j = 0; j < and.length; ++j) {
  20135. var andj = AndOrNotEvaluator._SimplifyNegation(and[j].trim());
  20136. if (andj !== "true" && andj !== "false") {
  20137. if (andj[0] === "!") {
  20138. result = !evaluateCallback(andj.substring(1));
  20139. } else {
  20140. result = evaluateCallback(andj);
  20141. }
  20142. } else {
  20143. result = andj === "true" ? true : false;
  20144. }
  20145. if (!result) {
  20146. ori = "false";
  20147. break;
  20148. }
  20149. }
  20150. }
  20151. if (result || ori === "true") {
  20152. result = true;
  20153. break;
  20154. }
  20155. // result equals false (or undefined)
  20156. if (ori !== "true" && ori !== "false") {
  20157. if (ori[0] === "!") {
  20158. result = !evaluateCallback(ori.substring(1));
  20159. } else {
  20160. result = evaluateCallback(ori);
  20161. }
  20162. } else {
  20163. result = ori === "true" ? true : false;
  20164. }
  20165. }
  20166. // the whole parenthesis scope is replaced by 'true' or 'false'
  20167. return result ? "true" : "false";
  20168. };
  20169. AndOrNotEvaluator._SimplifyNegation = function (booleanString) {
  20170. booleanString = booleanString.replace(/^[\s!]+/, function (r) {
  20171. // remove whitespaces
  20172. r = r.replace(/[\s]/g, function () {
  20173. return "";
  20174. });
  20175. return r.length % 2 ? "!" : "";
  20176. });
  20177. booleanString = booleanString.trim();
  20178. if (booleanString === "!true") {
  20179. booleanString = "false";
  20180. } else if (booleanString === "!false") {
  20181. booleanString = "true";
  20182. }
  20183. return booleanString;
  20184. };
  20185. return AndOrNotEvaluator;
  20186. })();
  20187. Internals.AndOrNotEvaluator = AndOrNotEvaluator;
  20188. })(BABYLON.Internals || (BABYLON.Internals = {}));
  20189. var Internals = BABYLON.Internals;
  20190. })(BABYLON || (BABYLON = {}));
  20191. //# sourceMappingURL=babylon.andOrNotEvaluator.js.map
  20192. var BABYLON;
  20193. (function (BABYLON) {
  20194. var PostProcessRenderPass = (function () {
  20195. function PostProcessRenderPass(scene, name, size, renderList, beforeRender, afterRender) {
  20196. this._enabled = true;
  20197. this._refCount = 0;
  20198. this._name = name;
  20199. this._renderTexture = new BABYLON.RenderTargetTexture(name, size, scene);
  20200. this.setRenderList(renderList);
  20201. this._renderTexture.onBeforeRender = beforeRender;
  20202. this._renderTexture.onAfterRender = afterRender;
  20203. this._scene = scene;
  20204. this._renderList = renderList;
  20205. }
  20206. // private
  20207. PostProcessRenderPass.prototype._incRefCount = function () {
  20208. if (this._refCount === 0) {
  20209. this._scene.customRenderTargets.push(this._renderTexture);
  20210. }
  20211. return ++this._refCount;
  20212. };
  20213. PostProcessRenderPass.prototype._decRefCount = function () {
  20214. this._refCount--;
  20215. if (this._refCount <= 0) {
  20216. this._scene.customRenderTargets.splice(this._scene.customRenderTargets.indexOf(this._renderTexture), 1);
  20217. }
  20218. return this._refCount;
  20219. };
  20220. PostProcessRenderPass.prototype._update = function () {
  20221. this.setRenderList(this._renderList);
  20222. };
  20223. // public
  20224. PostProcessRenderPass.prototype.setRenderList = function (renderList) {
  20225. this._renderTexture.renderList = renderList;
  20226. };
  20227. PostProcessRenderPass.prototype.getRenderTexture = function () {
  20228. return this._renderTexture;
  20229. };
  20230. return PostProcessRenderPass;
  20231. })();
  20232. BABYLON.PostProcessRenderPass = PostProcessRenderPass;
  20233. })(BABYLON || (BABYLON = {}));
  20234. //# sourceMappingURL=babylon.postProcessRenderPass.js.map
  20235. var BABYLON;
  20236. (function (BABYLON) {
  20237. var PostProcessRenderEffect = (function () {
  20238. function PostProcessRenderEffect(engine, name, getPostProcess, singleInstance) {
  20239. this._engine = engine;
  20240. this._name = name;
  20241. this._singleInstance = singleInstance || true;
  20242. this._getPostProcess = getPostProcess;
  20243. this._cameras = [];
  20244. this._indicesForCamera = [];
  20245. this._postProcesses = {};
  20246. this._renderPasses = {};
  20247. this._renderEffectAsPasses = {};
  20248. }
  20249. PostProcessRenderEffect.prototype._update = function () {
  20250. for (var renderPassName in this._renderPasses) {
  20251. this._renderPasses[renderPassName]._update();
  20252. }
  20253. };
  20254. PostProcessRenderEffect.prototype.addPass = function (renderPass) {
  20255. this._renderPasses[renderPass._name] = renderPass;
  20256. this._linkParameters();
  20257. };
  20258. PostProcessRenderEffect.prototype.removePass = function (renderPass) {
  20259. delete this._renderPasses[renderPass._name];
  20260. this._linkParameters();
  20261. };
  20262. PostProcessRenderEffect.prototype.addRenderEffectAsPass = function (renderEffect) {
  20263. this._renderEffectAsPasses[renderEffect._name] = renderEffect;
  20264. this._linkParameters();
  20265. };
  20266. PostProcessRenderEffect.prototype.getPass = function (passName) {
  20267. for (var renderPassName in this._renderPasses) {
  20268. if (renderPassName === passName) {
  20269. return this._renderPasses[passName];
  20270. }
  20271. }
  20272. };
  20273. PostProcessRenderEffect.prototype.emptyPasses = function () {
  20274. this._renderPasses = {};
  20275. this._linkParameters();
  20276. };
  20277. PostProcessRenderEffect.prototype._attachCameras = function (cameras) {
  20278. var cameraKey;
  20279. var _cam = BABYLON.Tools.MakeArray(cameras || this._cameras);
  20280. for (var i = 0; i < _cam.length; i++) {
  20281. var camera = _cam[i];
  20282. var cameraName = camera.name;
  20283. if (this._singleInstance) {
  20284. cameraKey = 0;
  20285. } else {
  20286. cameraKey = cameraName;
  20287. }
  20288. this._postProcesses[cameraKey] = this._postProcesses[cameraKey] || this._getPostProcess();
  20289. var index = camera.attachPostProcess(this._postProcesses[cameraKey]);
  20290. if (!this._indicesForCamera[cameraName]) {
  20291. this._indicesForCamera[cameraName] = [];
  20292. }
  20293. this._indicesForCamera[cameraName].push(index);
  20294. if (this._cameras.indexOf(camera) === -1) {
  20295. this._cameras[cameraName] = camera;
  20296. }
  20297. for (var passName in this._renderPasses) {
  20298. this._renderPasses[passName]._incRefCount();
  20299. }
  20300. }
  20301. this._linkParameters();
  20302. };
  20303. PostProcessRenderEffect.prototype._detachCameras = function (cameras) {
  20304. var _cam = BABYLON.Tools.MakeArray(cameras || this._cameras);
  20305. for (var i = 0; i < _cam.length; i++) {
  20306. var camera = _cam[i];
  20307. var cameraName = camera.name;
  20308. camera.detachPostProcess(this._postProcesses[this._singleInstance ? 0 : cameraName], this._indicesForCamera[cameraName]);
  20309. var index = this._cameras.indexOf(cameraName);
  20310. this._indicesForCamera.splice(index, 1);
  20311. this._cameras.splice(index, 1);
  20312. for (var passName in this._renderPasses) {
  20313. this._renderPasses[passName]._decRefCount();
  20314. }
  20315. }
  20316. };
  20317. PostProcessRenderEffect.prototype._enable = function (cameras) {
  20318. var _cam = BABYLON.Tools.MakeArray(cameras || this._cameras);
  20319. for (var i = 0; i < _cam.length; i++) {
  20320. var camera = _cam[i];
  20321. var cameraName = camera.name;
  20322. for (var j = 0; j < this._indicesForCamera[cameraName].length; j++) {
  20323. if (camera._postProcesses[this._indicesForCamera[cameraName][j]] === undefined) {
  20324. cameras[i].attachPostProcess(this._postProcesses[this._singleInstance ? 0 : cameraName], this._indicesForCamera[cameraName][j]);
  20325. }
  20326. }
  20327. for (var passName in this._renderPasses) {
  20328. this._renderPasses[passName]._incRefCount();
  20329. }
  20330. }
  20331. };
  20332. PostProcessRenderEffect.prototype._disable = function (cameras) {
  20333. var _cam = BABYLON.Tools.MakeArray(cameras || this._cameras);
  20334. for (var i = 0; i < _cam.length; i++) {
  20335. var camera = _cam[i];
  20336. var cameraName = camera.Name;
  20337. camera.detachPostProcess(this._postProcesses[this._singleInstance ? 0 : cameraName], this._indicesForCamera[cameraName]);
  20338. for (var passName in this._renderPasses) {
  20339. this._renderPasses[passName]._decRefCount();
  20340. }
  20341. }
  20342. };
  20343. PostProcessRenderEffect.prototype.getPostProcess = function (camera) {
  20344. if (this._singleInstance) {
  20345. return this._postProcesses[0];
  20346. } else {
  20347. return this._postProcesses[camera.name];
  20348. }
  20349. };
  20350. PostProcessRenderEffect.prototype._linkParameters = function () {
  20351. var _this = this;
  20352. for (var index in this._postProcesses) {
  20353. if (this.applyParameters) {
  20354. this.applyParameters(this._postProcesses[index]);
  20355. }
  20356. this._postProcesses[index].onBeforeRender = function (effect) {
  20357. _this._linkTextures(effect);
  20358. };
  20359. }
  20360. };
  20361. PostProcessRenderEffect.prototype._linkTextures = function (effect) {
  20362. for (var renderPassName in this._renderPasses) {
  20363. effect.setTexture(renderPassName, this._renderPasses[renderPassName].getRenderTexture());
  20364. }
  20365. for (var renderEffectName in this._renderEffectAsPasses) {
  20366. effect.setTextureFromPostProcess(renderEffectName + "Sampler", this._renderEffectAsPasses[renderEffectName].getPostProcess());
  20367. }
  20368. };
  20369. return PostProcessRenderEffect;
  20370. })();
  20371. BABYLON.PostProcessRenderEffect = PostProcessRenderEffect;
  20372. })(BABYLON || (BABYLON = {}));
  20373. //# sourceMappingURL=babylon.postProcessRenderEffect.js.map
  20374. var BABYLON;
  20375. (function (BABYLON) {
  20376. var PostProcessRenderPipeline = (function () {
  20377. function PostProcessRenderPipeline(engine, name) {
  20378. this._engine = engine;
  20379. this._name = name;
  20380. this._renderEffects = {};
  20381. this._renderEffectsForIsolatedPass = {};
  20382. this._cameras = [];
  20383. }
  20384. PostProcessRenderPipeline.prototype.addEffect = function (renderEffect) {
  20385. this._renderEffects[renderEffect._name] = renderEffect;
  20386. };
  20387. PostProcessRenderPipeline.prototype._enableEffect = function (renderEffectName, cameras) {
  20388. var renderEffects = this._renderEffects[renderEffectName];
  20389. if (!renderEffects) {
  20390. return;
  20391. }
  20392. renderEffects._enable(BABYLON.Tools.MakeArray(cameras || this._cameras));
  20393. };
  20394. PostProcessRenderPipeline.prototype._disableEffect = function (renderEffectName, cameras) {
  20395. var renderEffects = this._renderEffects[renderEffectName];
  20396. if (!renderEffects) {
  20397. return;
  20398. }
  20399. renderEffects._disable(BABYLON.Tools.MakeArray(cameras || this._cameras));
  20400. };
  20401. PostProcessRenderPipeline.prototype._attachCameras = function (cameras, unique) {
  20402. var _cam = BABYLON.Tools.MakeArray(cameras || this._cameras);
  20403. var indicesToDelete = [];
  20404. for (var i = 0; i < _cam.length; i++) {
  20405. var camera = _cam[i];
  20406. var cameraName = camera.name;
  20407. if (this._cameras.indexOf(camera) === -1) {
  20408. this._cameras[cameraName] = camera;
  20409. } else if (unique) {
  20410. indicesToDelete.push(i);
  20411. }
  20412. }
  20413. for (var i = 0; i < indicesToDelete.length; i++) {
  20414. cameras.splice(indicesToDelete[i], 1);
  20415. }
  20416. for (var renderEffectName in this._renderEffects) {
  20417. this._renderEffects[renderEffectName]._attachCameras(_cam);
  20418. }
  20419. };
  20420. PostProcessRenderPipeline.prototype._detachCameras = function (cameras) {
  20421. var _cam = BABYLON.Tools.MakeArray(cameras || this._cameras);
  20422. for (var renderEffectName in this._renderEffects) {
  20423. this._renderEffects[renderEffectName]._detachCameras(_cam);
  20424. }
  20425. for (var i = 0; i < _cam.length; i++) {
  20426. this._cameras.splice(this._cameras.indexOf(_cam[i]), 1);
  20427. }
  20428. };
  20429. PostProcessRenderPipeline.prototype._enableDisplayOnlyPass = function (passName, cameras) {
  20430. var _this = this;
  20431. var _cam = BABYLON.Tools.MakeArray(cameras || this._cameras);
  20432. var pass = null;
  20433. for (var renderEffectName in this._renderEffects) {
  20434. pass = this._renderEffects[renderEffectName].getPass(passName);
  20435. if (pass != null) {
  20436. break;
  20437. }
  20438. }
  20439. if (pass === null) {
  20440. return;
  20441. }
  20442. for (var renderEffectName in this._renderEffects) {
  20443. this._renderEffects[renderEffectName]._disable(_cam);
  20444. }
  20445. pass._name = PostProcessRenderPipeline.PASS_SAMPLER_NAME;
  20446. for (var i = 0; i < _cam.length; i++) {
  20447. var camera = _cam[i];
  20448. var cameraName = camera.name;
  20449. this._renderEffectsForIsolatedPass[cameraName] = this._renderEffectsForIsolatedPass[cameraName] || new BABYLON.PostProcessRenderEffect(this._engine, PostProcessRenderPipeline.PASS_EFFECT_NAME, function () {
  20450. return new BABYLON.DisplayPassPostProcess(PostProcessRenderPipeline.PASS_EFFECT_NAME, 1.0, null, null, _this._engine, true);
  20451. });
  20452. this._renderEffectsForIsolatedPass[cameraName].emptyPasses();
  20453. this._renderEffectsForIsolatedPass[cameraName].addPass(pass);
  20454. this._renderEffectsForIsolatedPass[cameraName]._attachCameras(camera);
  20455. }
  20456. };
  20457. PostProcessRenderPipeline.prototype._disableDisplayOnlyPass = function (cameras) {
  20458. var _this = this;
  20459. var _cam = BABYLON.Tools.MakeArray(cameras || this._cameras);
  20460. for (var i = 0; i < _cam.length; i++) {
  20461. var camera = _cam[i];
  20462. var cameraName = camera.name;
  20463. this._renderEffectsForIsolatedPass[cameraName] = this._renderEffectsForIsolatedPass[cameraName] || new BABYLON.PostProcessRenderEffect(this._engine, PostProcessRenderPipeline.PASS_EFFECT_NAME, function () {
  20464. return new BABYLON.DisplayPassPostProcess(PostProcessRenderPipeline.PASS_EFFECT_NAME, 1.0, null, null, _this._engine, true);
  20465. });
  20466. this._renderEffectsForIsolatedPass[cameraName]._disable(camera);
  20467. }
  20468. for (var renderEffectName in this._renderEffects) {
  20469. this._renderEffects[renderEffectName]._enable(_cam);
  20470. }
  20471. };
  20472. PostProcessRenderPipeline.prototype._update = function () {
  20473. for (var renderEffectName in this._renderEffects) {
  20474. this._renderEffects[renderEffectName]._update();
  20475. }
  20476. for (var i = 0; i < this._cameras.length; i++) {
  20477. var cameraName = this._cameras[i].name;
  20478. if (this._renderEffectsForIsolatedPass[cameraName]) {
  20479. this._renderEffectsForIsolatedPass[cameraName]._update();
  20480. }
  20481. }
  20482. };
  20483. PostProcessRenderPipeline.PASS_EFFECT_NAME = "passEffect";
  20484. PostProcessRenderPipeline.PASS_SAMPLER_NAME = "passSampler";
  20485. return PostProcessRenderPipeline;
  20486. })();
  20487. BABYLON.PostProcessRenderPipeline = PostProcessRenderPipeline;
  20488. })(BABYLON || (BABYLON = {}));
  20489. //# sourceMappingURL=babylon.postProcessRenderPipeline.js.map
  20490. var BABYLON;
  20491. (function (BABYLON) {
  20492. var PostProcessRenderPipelineManager = (function () {
  20493. function PostProcessRenderPipelineManager() {
  20494. this._renderPipelines = {};
  20495. }
  20496. PostProcessRenderPipelineManager.prototype.addPipeline = function (renderPipeline) {
  20497. this._renderPipelines[renderPipeline._name] = renderPipeline;
  20498. };
  20499. PostProcessRenderPipelineManager.prototype.attachCamerasToRenderPipeline = function (renderPipelineName, cameras, unique) {
  20500. var renderPipeline = this._renderPipelines[renderPipelineName];
  20501. if (!renderPipeline) {
  20502. return;
  20503. }
  20504. renderPipeline._attachCameras(cameras, unique);
  20505. };
  20506. PostProcessRenderPipelineManager.prototype.detachCamerasFromRenderPipeline = function (renderPipelineName, cameras) {
  20507. var renderPipeline = this._renderPipelines[renderPipelineName];
  20508. if (!renderPipeline) {
  20509. return;
  20510. }
  20511. renderPipeline._detachCameras(cameras);
  20512. };
  20513. PostProcessRenderPipelineManager.prototype.enableEffectInPipeline = function (renderPipelineName, renderEffectName, cameras) {
  20514. var renderPipeline = this._renderPipelines[renderPipelineName];
  20515. if (!renderPipeline) {
  20516. return;
  20517. }
  20518. renderPipeline._enableEffect(renderEffectName, cameras);
  20519. };
  20520. PostProcessRenderPipelineManager.prototype.disableEffectInPipeline = function (renderPipelineName, renderEffectName, cameras) {
  20521. var renderPipeline = this._renderPipelines[renderPipelineName];
  20522. if (!renderPipeline) {
  20523. return;
  20524. }
  20525. renderPipeline._disableEffect(renderEffectName, cameras);
  20526. };
  20527. PostProcessRenderPipelineManager.prototype.enableDisplayOnlyPassInPipeline = function (renderPipelineName, passName, cameras) {
  20528. var renderPipeline = this._renderPipelines[renderPipelineName];
  20529. if (!renderPipeline) {
  20530. return;
  20531. }
  20532. renderPipeline._enableDisplayOnlyPass(passName, cameras);
  20533. };
  20534. PostProcessRenderPipelineManager.prototype.disableDisplayOnlyPassInPipeline = function (renderPipelineName, cameras) {
  20535. var renderPipeline = this._renderPipelines[renderPipelineName];
  20536. if (!renderPipeline) {
  20537. return;
  20538. }
  20539. renderPipeline._disableDisplayOnlyPass(cameras);
  20540. };
  20541. PostProcessRenderPipelineManager.prototype.update = function () {
  20542. for (var renderPipelineName in this._renderPipelines) {
  20543. this._renderPipelines[renderPipelineName]._update();
  20544. }
  20545. };
  20546. return PostProcessRenderPipelineManager;
  20547. })();
  20548. BABYLON.PostProcessRenderPipelineManager = PostProcessRenderPipelineManager;
  20549. })(BABYLON || (BABYLON = {}));
  20550. //# sourceMappingURL=babylon.postProcessRenderPipelineManager.js.map
  20551. var BABYLON;
  20552. (function (BABYLON) {
  20553. var DisplayPassPostProcess = (function (_super) {
  20554. __extends(DisplayPassPostProcess, _super);
  20555. function DisplayPassPostProcess(name, ratio, camera, samplingMode, engine, reusable) {
  20556. _super.call(this, name, "displayPass", ["passSampler"], ["passSampler"], ratio, camera, samplingMode, engine, reusable);
  20557. }
  20558. return DisplayPassPostProcess;
  20559. })(BABYLON.PostProcess);
  20560. BABYLON.DisplayPassPostProcess = DisplayPassPostProcess;
  20561. })(BABYLON || (BABYLON = {}));
  20562. //# sourceMappingURL=babylon.displayPassPostProcess.js.map
  20563. var BABYLON;
  20564. (function (BABYLON) {
  20565. var BoundingBoxRenderer = (function () {
  20566. function BoundingBoxRenderer(scene) {
  20567. this.frontColor = new BABYLON.Color3(1, 1, 1);
  20568. this.backColor = new BABYLON.Color3(0.1, 0.1, 0.1);
  20569. this.showBackLines = true;
  20570. this.renderList = new BABYLON.SmartArray(32);
  20571. this._scene = scene;
  20572. this._colorShader = new BABYLON.ShaderMaterial("colorShader", scene, "color", {
  20573. attributes: ["position"],
  20574. uniforms: ["worldViewProjection", "color"]
  20575. });
  20576. var engine = this._scene.getEngine();
  20577. var boxdata = BABYLON.VertexData.CreateBox(1.0);
  20578. this._vb = new BABYLON.VertexBuffer(engine, boxdata.positions, BABYLON.VertexBuffer.PositionKind, false);
  20579. this._ib = engine.createIndexBuffer([0, 1, 1, 2, 2, 3, 3, 0, 4, 5, 5, 6, 6, 7, 7, 4, 0, 7, 1, 6, 2, 5, 3, 4]);
  20580. }
  20581. BoundingBoxRenderer.prototype.reset = function () {
  20582. this.renderList.reset();
  20583. };
  20584. BoundingBoxRenderer.prototype.render = function () {
  20585. if (this.renderList.length === 0 || !this._colorShader.isReady()) {
  20586. return;
  20587. }
  20588. var engine = this._scene.getEngine();
  20589. engine.setDepthWrite(false);
  20590. this._colorShader._preBind();
  20591. for (var boundingBoxIndex = 0; boundingBoxIndex < this.renderList.length; boundingBoxIndex++) {
  20592. var boundingBox = this.renderList.data[boundingBoxIndex];
  20593. var min = boundingBox.minimum;
  20594. var max = boundingBox.maximum;
  20595. var diff = max.subtract(min);
  20596. var median = min.add(diff.scale(0.5));
  20597. var worldMatrix = BABYLON.Matrix.Scaling(diff.x, diff.y, diff.z).multiply(BABYLON.Matrix.Translation(median.x, median.y, median.z)).multiply(boundingBox.getWorldMatrix());
  20598. // VBOs
  20599. engine.bindBuffers(this._vb.getBuffer(), this._ib, [3], 3 * 4, this._colorShader.getEffect());
  20600. if (this.showBackLines) {
  20601. // Back
  20602. engine.setDepthFunctionToGreaterOrEqual();
  20603. this._scene.resetCachedMaterial();
  20604. this._colorShader.setColor4("color", this.backColor.toColor4());
  20605. this._colorShader.bind(worldMatrix);
  20606. // Draw order
  20607. engine.draw(false, 0, 24);
  20608. }
  20609. // Front
  20610. engine.setDepthFunctionToLess();
  20611. this._scene.resetCachedMaterial();
  20612. this._colorShader.setColor4("color", this.frontColor.toColor4());
  20613. this._colorShader.bind(worldMatrix);
  20614. // Draw order
  20615. engine.draw(false, 0, 24);
  20616. }
  20617. this._colorShader.unbind();
  20618. engine.setDepthFunctionToLessOrEqual();
  20619. engine.setDepthWrite(true);
  20620. };
  20621. BoundingBoxRenderer.prototype.dispose = function () {
  20622. this._colorShader.dispose();
  20623. this._vb.dispose();
  20624. this._scene.getEngine()._releaseBuffer(this._ib);
  20625. };
  20626. return BoundingBoxRenderer;
  20627. })();
  20628. BABYLON.BoundingBoxRenderer = BoundingBoxRenderer;
  20629. })(BABYLON || (BABYLON = {}));
  20630. //# sourceMappingURL=babylon.boundingBoxRenderer.js.map
  20631. /**
  20632. * Based on jsTGALoader - Javascript loader for TGA file
  20633. * By Vincent Thibault
  20634. * @blog http://blog.robrowser.com/javascript-tga-loader.html
  20635. */
  20636. var BABYLON;
  20637. (function (BABYLON) {
  20638. (function (Internals) {
  20639. var TGATools = (function () {
  20640. function TGATools() {
  20641. }
  20642. TGATools.GetTGAHeader = function (data) {
  20643. var offset = 0;
  20644. var header = {
  20645. id_length: data[offset++],
  20646. colormap_type: data[offset++],
  20647. image_type: data[offset++],
  20648. colormap_index: data[offset++] | data[offset++] << 8,
  20649. colormap_length: data[offset++] | data[offset++] << 8,
  20650. colormap_size: data[offset++],
  20651. origin: [
  20652. data[offset++] | data[offset++] << 8,
  20653. data[offset++] | data[offset++] << 8
  20654. ],
  20655. width: data[offset++] | data[offset++] << 8,
  20656. height: data[offset++] | data[offset++] << 8,
  20657. pixel_size: data[offset++],
  20658. flags: data[offset++]
  20659. };
  20660. return header;
  20661. };
  20662. TGATools.UploadContent = function (gl, data) {
  20663. // Not enough data to contain header ?
  20664. if (data.length < 19) {
  20665. BABYLON.Tools.Error("Unable to load TGA file - Not enough data to contain header");
  20666. return;
  20667. }
  20668. // Read Header
  20669. var offset = 18;
  20670. var header = TGATools.GetTGAHeader(data);
  20671. // Assume it's a valid Targa file.
  20672. if (header.id_length + offset > data.length) {
  20673. BABYLON.Tools.Error("Unable to load TGA file - Not enough data");
  20674. return;
  20675. }
  20676. // Skip not needed data
  20677. offset += header.id_length;
  20678. var use_rle = false;
  20679. var use_pal = false;
  20680. var use_rgb = false;
  20681. var use_grey = false;
  20682. switch (header.image_type) {
  20683. case TGATools._TYPE_RLE_INDEXED:
  20684. use_rle = true;
  20685. case TGATools._TYPE_INDEXED:
  20686. use_pal = true;
  20687. break;
  20688. case TGATools._TYPE_RLE_RGB:
  20689. use_rle = true;
  20690. case TGATools._TYPE_RGB:
  20691. use_rgb = true;
  20692. break;
  20693. case TGATools._TYPE_RLE_GREY:
  20694. use_rle = true;
  20695. case TGATools._TYPE_GREY:
  20696. use_grey = true;
  20697. break;
  20698. }
  20699. var pixel_data;
  20700. var numAlphaBits = header.flags & 0xf;
  20701. var pixel_size = header.pixel_size >> 3;
  20702. var pixel_total = header.width * header.height * pixel_size;
  20703. // Read palettes
  20704. var palettes;
  20705. if (use_pal) {
  20706. palettes = data.subarray(offset, offset += header.colormap_length * (header.colormap_size >> 3));
  20707. }
  20708. // Read LRE
  20709. if (use_rle) {
  20710. pixel_data = new Uint8Array(pixel_total);
  20711. var c, count, i;
  20712. var localOffset = 0;
  20713. var pixels = new Uint8Array(pixel_size);
  20714. while (offset < pixel_total && localOffset < pixel_total) {
  20715. c = data[offset++];
  20716. count = (c & 0x7f) + 1;
  20717. // RLE pixels
  20718. if (c & 0x80) {
  20719. for (i = 0; i < pixel_size; ++i) {
  20720. pixels[i] = data[offset++];
  20721. }
  20722. for (i = 0; i < count; ++i) {
  20723. pixel_data.set(pixels, localOffset + i * pixel_size);
  20724. }
  20725. localOffset += pixel_size * count;
  20726. } else {
  20727. count *= pixel_size;
  20728. for (i = 0; i < count; ++i) {
  20729. pixel_data[localOffset + i] = data[offset++];
  20730. }
  20731. localOffset += count;
  20732. }
  20733. }
  20734. } else {
  20735. pixel_data = data.subarray(offset, offset += (use_pal ? header.width * header.height : pixel_total));
  20736. }
  20737. // Load to texture
  20738. var x_start, y_start, x_step, y_step, y_end, x_end;
  20739. switch ((header.flags & TGATools._ORIGIN_MASK) >> TGATools._ORIGIN_SHIFT) {
  20740. default:
  20741. case TGATools._ORIGIN_UL:
  20742. x_start = 0;
  20743. x_step = 1;
  20744. x_end = header.width;
  20745. y_start = 0;
  20746. y_step = 1;
  20747. y_end = header.height;
  20748. break;
  20749. case TGATools._ORIGIN_BL:
  20750. x_start = 0;
  20751. x_step = 1;
  20752. x_end = header.width;
  20753. y_start = header.height - 1;
  20754. y_step = -1;
  20755. y_end = -1;
  20756. break;
  20757. case TGATools._ORIGIN_UR:
  20758. x_start = header.width - 1;
  20759. x_step = -1;
  20760. x_end = -1;
  20761. y_start = 0;
  20762. y_step = 1;
  20763. y_end = header.height;
  20764. break;
  20765. case TGATools._ORIGIN_BR:
  20766. x_start = header.width - 1;
  20767. x_step = -1;
  20768. x_end = -1;
  20769. y_start = header.height - 1;
  20770. y_step = -1;
  20771. y_end = -1;
  20772. break;
  20773. }
  20774. // Load the specify method
  20775. var func = '_getImageData' + (use_grey ? 'Grey' : '') + (header.pixel_size) + 'bits';
  20776. var imageData = TGATools[func](header, palettes, pixel_data, y_start, y_step, y_end, x_start, x_step, x_end);
  20777. gl.texImage2D(gl.TEXTURE_2D, 0, gl.RGBA, header.width, header.height, 0, gl.RGBA, gl.UNSIGNED_BYTE, imageData);
  20778. };
  20779. TGATools._getImageData8bits = function (header, palettes, pixel_data, y_start, y_step, y_end, x_start, x_step, x_end) {
  20780. var image = pixel_data, colormap = palettes;
  20781. var width = header.width, height = header.height;
  20782. var color, i = 0, x, y;
  20783. var imageData = new Uint8Array(width * height * 4);
  20784. for (y = y_start; y !== y_end; y += y_step) {
  20785. for (x = x_start; x !== x_end; x += x_step, i++) {
  20786. color = image[i];
  20787. imageData[(x + width * y) * 4 + 3] = 255;
  20788. imageData[(x + width * y) * 4 + 2] = colormap[(color * 3) + 0];
  20789. imageData[(x + width * y) * 4 + 1] = colormap[(color * 3) + 1];
  20790. imageData[(x + width * y) * 4 + 0] = colormap[(color * 3) + 2];
  20791. }
  20792. }
  20793. return imageData;
  20794. };
  20795. TGATools._getImageData16bits = function (header, palettes, pixel_data, y_start, y_step, y_end, x_start, x_step, x_end) {
  20796. var image = pixel_data;
  20797. var width = header.width, height = header.height;
  20798. var color, i = 0, x, y;
  20799. var imageData = new Uint8Array(width * height * 4);
  20800. for (y = y_start; y !== y_end; y += y_step) {
  20801. for (x = x_start; x !== x_end; x += x_step, i += 2) {
  20802. color = image[i + 0] + (image[i + 1] << 8); // Inversed ?
  20803. imageData[(x + width * y) * 4 + 0] = (color & 0x7C00) >> 7;
  20804. imageData[(x + width * y) * 4 + 1] = (color & 0x03E0) >> 2;
  20805. imageData[(x + width * y) * 4 + 2] = (color & 0x001F) >> 3;
  20806. imageData[(x + width * y) * 4 + 3] = (color & 0x8000) ? 0 : 255;
  20807. }
  20808. }
  20809. return imageData;
  20810. };
  20811. TGATools._getImageData24bits = function (header, palettes, pixel_data, y_start, y_step, y_end, x_start, x_step, x_end) {
  20812. var image = pixel_data;
  20813. var width = header.width, height = header.height;
  20814. var i = 0, x, y;
  20815. var imageData = new Uint8Array(width * height * 4);
  20816. for (y = y_start; y !== y_end; y += y_step) {
  20817. for (x = x_start; x !== x_end; x += x_step, i += 3) {
  20818. imageData[(x + width * y) * 4 + 3] = 255;
  20819. imageData[(x + width * y) * 4 + 2] = image[i + 0];
  20820. imageData[(x + width * y) * 4 + 1] = image[i + 1];
  20821. imageData[(x + width * y) * 4 + 0] = image[i + 2];
  20822. }
  20823. }
  20824. return imageData;
  20825. };
  20826. TGATools._getImageData32bits = function (header, palettes, pixel_data, y_start, y_step, y_end, x_start, x_step, x_end) {
  20827. var image = pixel_data;
  20828. var width = header.width, height = header.height;
  20829. var i = 0, x, y;
  20830. var imageData = new Uint8Array(width * height * 4);
  20831. for (y = y_start; y !== y_end; y += y_step) {
  20832. for (x = x_start; x !== x_end; x += x_step, i += 4) {
  20833. imageData[(x + width * y) * 4 + 2] = image[i + 0];
  20834. imageData[(x + width * y) * 4 + 1] = image[i + 1];
  20835. imageData[(x + width * y) * 4 + 0] = image[i + 2];
  20836. imageData[(x + width * y) * 4 + 3] = image[i + 3];
  20837. }
  20838. }
  20839. return imageData;
  20840. };
  20841. TGATools._getImageDataGrey8bits = function (header, palettes, pixel_data, y_start, y_step, y_end, x_start, x_step, x_end) {
  20842. var image = pixel_data;
  20843. var width = header.width, height = header.height;
  20844. var color, i = 0, x, y;
  20845. var imageData = new Uint8Array(width * height * 4);
  20846. for (y = y_start; y !== y_end; y += y_step) {
  20847. for (x = x_start; x !== x_end; x += x_step, i++) {
  20848. color = image[i];
  20849. imageData[(x + width * y) * 4 + 0] = color;
  20850. imageData[(x + width * y) * 4 + 1] = color;
  20851. imageData[(x + width * y) * 4 + 2] = color;
  20852. imageData[(x + width * y) * 4 + 3] = 255;
  20853. }
  20854. }
  20855. return imageData;
  20856. };
  20857. TGATools._getImageDataGrey16bits = function (header, palettes, pixel_data, y_start, y_step, y_end, x_start, x_step, x_end) {
  20858. var image = pixel_data;
  20859. var width = header.width, height = header.height;
  20860. var i = 0, x, y;
  20861. var imageData = new Uint8Array(width * height * 4);
  20862. for (y = y_start; y !== y_end; y += y_step) {
  20863. for (x = x_start; x !== x_end; x += x_step, i += 2) {
  20864. imageData[(x + width * y) * 4 + 0] = image[i + 0];
  20865. imageData[(x + width * y) * 4 + 1] = image[i + 0];
  20866. imageData[(x + width * y) * 4 + 2] = image[i + 0];
  20867. imageData[(x + width * y) * 4 + 3] = image[i + 1];
  20868. }
  20869. }
  20870. return imageData;
  20871. };
  20872. TGATools._TYPE_NO_DATA = 0;
  20873. TGATools._TYPE_INDEXED = 1;
  20874. TGATools._TYPE_RGB = 2;
  20875. TGATools._TYPE_GREY = 3;
  20876. TGATools._TYPE_RLE_INDEXED = 9;
  20877. TGATools._TYPE_RLE_RGB = 10;
  20878. TGATools._TYPE_RLE_GREY = 11;
  20879. TGATools._ORIGIN_MASK = 0x30;
  20880. TGATools._ORIGIN_SHIFT = 0x04;
  20881. TGATools._ORIGIN_BL = 0x00;
  20882. TGATools._ORIGIN_BR = 0x01;
  20883. TGATools._ORIGIN_UL = 0x02;
  20884. TGATools._ORIGIN_UR = 0x03;
  20885. return TGATools;
  20886. })();
  20887. Internals.TGATools = TGATools;
  20888. })(BABYLON.Internals || (BABYLON.Internals = {}));
  20889. var Internals = BABYLON.Internals;
  20890. })(BABYLON || (BABYLON = {}));
  20891. //# sourceMappingURL=babylon.tools.tga.js.map
  20892. var BABYLON;
  20893. (function (BABYLON) {
  20894. (function (Internals) {
  20895. // Based on demo done by Brandon Jones - http://media.tojicode.com/webgl-samples/dds.html
  20896. // All values and structures referenced from:
  20897. // http://msdn.microsoft.com/en-us/library/bb943991.aspx/
  20898. var DDS_MAGIC = 0x20534444;
  20899. var DDSD_CAPS = 0x1, DDSD_HEIGHT = 0x2, DDSD_WIDTH = 0x4, DDSD_PITCH = 0x8, DDSD_PIXELFORMAT = 0x1000, DDSD_MIPMAPCOUNT = 0x20000, DDSD_LINEARSIZE = 0x80000, DDSD_DEPTH = 0x800000;
  20900. var DDSCAPS_COMPLEX = 0x8, DDSCAPS_MIPMAP = 0x400000, DDSCAPS_TEXTURE = 0x1000;
  20901. var DDSCAPS2_CUBEMAP = 0x200, DDSCAPS2_CUBEMAP_POSITIVEX = 0x400, DDSCAPS2_CUBEMAP_NEGATIVEX = 0x800, DDSCAPS2_CUBEMAP_POSITIVEY = 0x1000, DDSCAPS2_CUBEMAP_NEGATIVEY = 0x2000, DDSCAPS2_CUBEMAP_POSITIVEZ = 0x4000, DDSCAPS2_CUBEMAP_NEGATIVEZ = 0x8000, DDSCAPS2_VOLUME = 0x200000;
  20902. var DDPF_ALPHAPIXELS = 0x1, DDPF_ALPHA = 0x2, DDPF_FOURCC = 0x4, DDPF_RGB = 0x40, DDPF_YUV = 0x200, DDPF_LUMINANCE = 0x20000;
  20903. function FourCCToInt32(value) {
  20904. return value.charCodeAt(0) + (value.charCodeAt(1) << 8) + (value.charCodeAt(2) << 16) + (value.charCodeAt(3) << 24);
  20905. }
  20906. function Int32ToFourCC(value) {
  20907. return String.fromCharCode(value & 0xff, (value >> 8) & 0xff, (value >> 16) & 0xff, (value >> 24) & 0xff);
  20908. }
  20909. var FOURCC_DXT1 = FourCCToInt32("DXT1");
  20910. var FOURCC_DXT3 = FourCCToInt32("DXT3");
  20911. var FOURCC_DXT5 = FourCCToInt32("DXT5");
  20912. var headerLengthInt = 31;
  20913. // Offsets into the header array
  20914. var off_magic = 0;
  20915. var off_size = 1;
  20916. var off_flags = 2;
  20917. var off_height = 3;
  20918. var off_width = 4;
  20919. var off_mipmapCount = 7;
  20920. var off_pfFlags = 20;
  20921. var off_pfFourCC = 21;
  20922. var off_RGBbpp = 22;
  20923. var off_RMask = 23;
  20924. var off_GMask = 24;
  20925. var off_BMask = 25;
  20926. var off_AMask = 26;
  20927. var off_caps1 = 27;
  20928. var off_caps2 = 28;
  20929. ;
  20930. var DDSTools = (function () {
  20931. function DDSTools() {
  20932. }
  20933. DDSTools.GetDDSInfo = function (arrayBuffer) {
  20934. var header = new Int32Array(arrayBuffer, 0, headerLengthInt);
  20935. var mipmapCount = 1;
  20936. if (header[off_flags] & DDSD_MIPMAPCOUNT) {
  20937. mipmapCount = Math.max(1, header[off_mipmapCount]);
  20938. }
  20939. return {
  20940. width: header[off_width],
  20941. height: header[off_height],
  20942. mipmapCount: mipmapCount,
  20943. isFourCC: (header[off_pfFlags] & DDPF_FOURCC) === DDPF_FOURCC,
  20944. isRGB: (header[off_pfFlags] & DDPF_RGB) === DDPF_RGB,
  20945. isLuminance: (header[off_pfFlags] & DDPF_LUMINANCE) === DDPF_LUMINANCE,
  20946. isCube: (header[off_caps2] & DDSCAPS2_CUBEMAP) === DDSCAPS2_CUBEMAP
  20947. };
  20948. };
  20949. DDSTools.GetRGBAArrayBuffer = function (width, height, dataOffset, dataLength, arrayBuffer) {
  20950. var byteArray = new Uint8Array(dataLength);
  20951. var srcData = new Uint8Array(arrayBuffer);
  20952. var index = 0;
  20953. for (var y = height - 1; y >= 0; y--) {
  20954. for (var x = 0; x < width; x++) {
  20955. var srcPos = dataOffset + (x + y * width) * 4;
  20956. byteArray[index + 2] = srcData[srcPos];
  20957. byteArray[index + 1] = srcData[srcPos + 1];
  20958. byteArray[index] = srcData[srcPos + 2];
  20959. byteArray[index + 3] = srcData[srcPos + 3];
  20960. index += 4;
  20961. }
  20962. }
  20963. return byteArray;
  20964. };
  20965. DDSTools.GetRGBArrayBuffer = function (width, height, dataOffset, dataLength, arrayBuffer) {
  20966. var byteArray = new Uint8Array(dataLength);
  20967. var srcData = new Uint8Array(arrayBuffer);
  20968. var index = 0;
  20969. for (var y = height - 1; y >= 0; y--) {
  20970. for (var x = 0; x < width; x++) {
  20971. var srcPos = dataOffset + (x + y * width) * 3;
  20972. byteArray[index + 2] = srcData[srcPos];
  20973. byteArray[index + 1] = srcData[srcPos + 1];
  20974. byteArray[index] = srcData[srcPos + 2];
  20975. index += 3;
  20976. }
  20977. }
  20978. return byteArray;
  20979. };
  20980. DDSTools.GetLuminanceArrayBuffer = function (width, height, dataOffset, dataLength, arrayBuffer) {
  20981. var byteArray = new Uint8Array(dataLength);
  20982. var srcData = new Uint8Array(arrayBuffer);
  20983. var index = 0;
  20984. for (var y = height - 1; y >= 0; y--) {
  20985. for (var x = 0; x < width; x++) {
  20986. var srcPos = dataOffset + (x + y * width);
  20987. byteArray[index] = srcData[srcPos];
  20988. index++;
  20989. }
  20990. }
  20991. return byteArray;
  20992. };
  20993. DDSTools.UploadDDSLevels = function (gl, ext, arrayBuffer, info, loadMipmaps, faces) {
  20994. var header = new Int32Array(arrayBuffer, 0, headerLengthInt), fourCC, blockBytes, internalFormat, width, height, dataLength, dataOffset, byteArray, mipmapCount, i;
  20995. if (header[off_magic] != DDS_MAGIC) {
  20996. BABYLON.Tools.Error("Invalid magic number in DDS header");
  20997. return;
  20998. }
  20999. if (!info.isFourCC && !info.isRGB && !info.isLuminance) {
  21000. BABYLON.Tools.Error("Unsupported format, must contain a FourCC, RGB or LUMINANCE code");
  21001. return;
  21002. }
  21003. if (info.isFourCC) {
  21004. fourCC = header[off_pfFourCC];
  21005. switch (fourCC) {
  21006. case FOURCC_DXT1:
  21007. blockBytes = 8;
  21008. internalFormat = ext.COMPRESSED_RGBA_S3TC_DXT1_EXT;
  21009. break;
  21010. case FOURCC_DXT3:
  21011. blockBytes = 16;
  21012. internalFormat = ext.COMPRESSED_RGBA_S3TC_DXT3_EXT;
  21013. break;
  21014. case FOURCC_DXT5:
  21015. blockBytes = 16;
  21016. internalFormat = ext.COMPRESSED_RGBA_S3TC_DXT5_EXT;
  21017. break;
  21018. default:
  21019. console.error("Unsupported FourCC code:", Int32ToFourCC(fourCC));
  21020. return;
  21021. }
  21022. }
  21023. mipmapCount = 1;
  21024. if (header[off_flags] & DDSD_MIPMAPCOUNT && loadMipmaps !== false) {
  21025. mipmapCount = Math.max(1, header[off_mipmapCount]);
  21026. }
  21027. var bpp = header[off_RGBbpp];
  21028. for (var face = 0; face < faces; face++) {
  21029. var sampler = faces == 1 ? gl.TEXTURE_2D : (gl.TEXTURE_CUBE_MAP_POSITIVE_X + face);
  21030. width = header[off_width];
  21031. height = header[off_height];
  21032. dataOffset = header[off_size] + 4;
  21033. for (i = 0; i < mipmapCount; ++i) {
  21034. if (info.isRGB) {
  21035. if (bpp == 24) {
  21036. dataLength = width * height * 3;
  21037. byteArray = DDSTools.GetRGBArrayBuffer(width, height, dataOffset, dataLength, arrayBuffer);
  21038. gl.texImage2D(sampler, i, gl.RGB, width, height, 0, gl.RGB, gl.UNSIGNED_BYTE, byteArray);
  21039. } else {
  21040. dataLength = width * height * 4;
  21041. byteArray = DDSTools.GetRGBAArrayBuffer(width, height, dataOffset, dataLength, arrayBuffer);
  21042. gl.texImage2D(sampler, i, gl.RGBA, width, height, 0, gl.RGBA, gl.UNSIGNED_BYTE, byteArray);
  21043. }
  21044. } else if (info.isLuminance) {
  21045. var unpackAlignment = gl.getParameter(gl.UNPACK_ALIGNMENT);
  21046. var unpaddedRowSize = width;
  21047. var paddedRowSize = Math.floor((width + unpackAlignment - 1) / unpackAlignment) * unpackAlignment;
  21048. dataLength = paddedRowSize * (height - 1) + unpaddedRowSize;
  21049. byteArray = DDSTools.GetLuminanceArrayBuffer(width, height, dataOffset, dataLength, arrayBuffer);
  21050. gl.texImage2D(sampler, i, gl.LUMINANCE, width, height, 0, gl.LUMINANCE, gl.UNSIGNED_BYTE, byteArray);
  21051. } else {
  21052. dataLength = Math.max(4, width) / 4 * Math.max(4, height) / 4 * blockBytes;
  21053. byteArray = new Uint8Array(arrayBuffer, dataOffset, dataLength);
  21054. gl.compressedTexImage2D(sampler, i, internalFormat, width, height, 0, byteArray);
  21055. }
  21056. dataOffset += dataLength;
  21057. width *= 0.5;
  21058. height *= 0.5;
  21059. width = Math.max(1.0, width);
  21060. height = Math.max(1.0, height);
  21061. }
  21062. }
  21063. };
  21064. return DDSTools;
  21065. })();
  21066. Internals.DDSTools = DDSTools;
  21067. })(BABYLON.Internals || (BABYLON.Internals = {}));
  21068. var Internals = BABYLON.Internals;
  21069. })(BABYLON || (BABYLON = {}));
  21070. //# sourceMappingURL=babylon.tools.dds.js.map
  21071. var BABYLON;
  21072. (function (BABYLON) {
  21073. var SmartArray = (function () {
  21074. function SmartArray(capacity) {
  21075. this.length = 0;
  21076. this._duplicateId = 0;
  21077. this.data = new Array(capacity);
  21078. this._id = SmartArray._GlobalId++;
  21079. }
  21080. SmartArray.prototype.push = function (value) {
  21081. this.data[this.length++] = value;
  21082. if (this.length > this.data.length) {
  21083. this.data.length *= 2;
  21084. }
  21085. if (!value.__smartArrayFlags) {
  21086. value.__smartArrayFlags = {};
  21087. }
  21088. value.__smartArrayFlags[this._id] = this._duplicateId;
  21089. };
  21090. SmartArray.prototype.pushNoDuplicate = function (value) {
  21091. if (value.__smartArrayFlags && value.__smartArrayFlags[this._id] === this._duplicateId) {
  21092. return;
  21093. }
  21094. this.push(value);
  21095. };
  21096. SmartArray.prototype.sort = function (compareFn) {
  21097. this.data.sort(compareFn);
  21098. };
  21099. SmartArray.prototype.reset = function () {
  21100. this.length = 0;
  21101. this._duplicateId++;
  21102. };
  21103. SmartArray.prototype.concat = function (array) {
  21104. if (array.length === 0) {
  21105. return;
  21106. }
  21107. if (this.length + array.length > this.data.length) {
  21108. this.data.length = (this.length + array.length) * 2;
  21109. }
  21110. for (var index = 0; index < array.length; index++) {
  21111. this.data[this.length++] = (array.data || array)[index];
  21112. }
  21113. };
  21114. SmartArray.prototype.concatWithNoDuplicate = function (array) {
  21115. if (array.length === 0) {
  21116. return;
  21117. }
  21118. if (this.length + array.length > this.data.length) {
  21119. this.data.length = (this.length + array.length) * 2;
  21120. }
  21121. for (var index = 0; index < array.length; index++) {
  21122. var item = (array.data || array)[index];
  21123. this.pushNoDuplicate(item);
  21124. }
  21125. };
  21126. SmartArray.prototype.indexOf = function (value) {
  21127. var position = this.data.indexOf(value);
  21128. if (position >= this.length) {
  21129. return -1;
  21130. }
  21131. return position;
  21132. };
  21133. SmartArray._GlobalId = 0;
  21134. return SmartArray;
  21135. })();
  21136. BABYLON.SmartArray = SmartArray;
  21137. })(BABYLON || (BABYLON = {}));
  21138. //# sourceMappingURL=babylon.smartArray.js.map
  21139. var BABYLON;
  21140. (function (BABYLON) {
  21141. var CannonJSPlugin = (function () {
  21142. function CannonJSPlugin() {
  21143. this._registeredMeshes = [];
  21144. this._physicsMaterials = [];
  21145. this.updateBodyPosition = function (mesh) {
  21146. for (var index = 0; index < this._registeredMeshes.length; index++) {
  21147. var registeredMesh = this._registeredMeshes[index];
  21148. if (registeredMesh.mesh === mesh || registeredMesh.mesh === mesh.parent) {
  21149. var body = registeredMesh.body;
  21150. var center = mesh.getBoundingInfo().boundingBox.center;
  21151. body.position.set(center.x, center.z, center.y);
  21152. body.quaternion.x = mesh.rotationQuaternion.x;
  21153. body.quaternion.z = mesh.rotationQuaternion.y;
  21154. body.quaternion.y = mesh.rotationQuaternion.z;
  21155. body.quaternion.w = -mesh.rotationQuaternion.w;
  21156. return;
  21157. }
  21158. }
  21159. };
  21160. }
  21161. CannonJSPlugin.prototype.initialize = function (iterations) {
  21162. if (typeof iterations === "undefined") { iterations = 10; }
  21163. this._world = new CANNON.World();
  21164. this._world.broadphase = new CANNON.NaiveBroadphase();
  21165. this._world.solver.iterations = iterations;
  21166. };
  21167. CannonJSPlugin.prototype._checkWithEpsilon = function (value) {
  21168. return value < BABYLON.PhysicsEngine.Epsilon ? BABYLON.PhysicsEngine.Epsilon : value;
  21169. };
  21170. CannonJSPlugin.prototype.runOneStep = function (delta) {
  21171. this._world.step(delta);
  21172. for (var index = 0; index < this._registeredMeshes.length; index++) {
  21173. var registeredMesh = this._registeredMeshes[index];
  21174. if (registeredMesh.isChild) {
  21175. continue;
  21176. }
  21177. // Body position
  21178. var bodyX = registeredMesh.body.position.x, bodyY = registeredMesh.body.position.y, bodyZ = registeredMesh.body.position.z;
  21179. var deltaPos = registeredMesh.delta;
  21180. if (deltaPos) {
  21181. registeredMesh.mesh.position.x = bodyX + deltaPos.x;
  21182. registeredMesh.mesh.position.y = bodyZ + deltaPos.y;
  21183. registeredMesh.mesh.position.z = bodyY + deltaPos.z;
  21184. } else {
  21185. registeredMesh.mesh.position.x = bodyX;
  21186. registeredMesh.mesh.position.y = bodyZ;
  21187. registeredMesh.mesh.position.z = bodyY;
  21188. }
  21189. if (!registeredMesh.mesh.rotationQuaternion) {
  21190. registeredMesh.mesh.rotationQuaternion = new BABYLON.Quaternion(0, 0, 0, 1);
  21191. }
  21192. registeredMesh.mesh.rotationQuaternion.x = registeredMesh.body.quaternion.x;
  21193. registeredMesh.mesh.rotationQuaternion.y = registeredMesh.body.quaternion.z;
  21194. registeredMesh.mesh.rotationQuaternion.z = registeredMesh.body.quaternion.y;
  21195. registeredMesh.mesh.rotationQuaternion.w = -registeredMesh.body.quaternion.w;
  21196. }
  21197. };
  21198. CannonJSPlugin.prototype.setGravity = function (gravity) {
  21199. this._world.gravity.set(gravity.x, gravity.z, gravity.y);
  21200. };
  21201. CannonJSPlugin.prototype.registerMesh = function (mesh, impostor, options) {
  21202. this.unregisterMesh(mesh);
  21203. mesh.computeWorldMatrix(true);
  21204. switch (impostor) {
  21205. case BABYLON.PhysicsEngine.SphereImpostor:
  21206. var bbox = mesh.getBoundingInfo().boundingBox;
  21207. var radiusX = bbox.maximumWorld.x - bbox.minimumWorld.x;
  21208. var radiusY = bbox.maximumWorld.y - bbox.minimumWorld.y;
  21209. var radiusZ = bbox.maximumWorld.z - bbox.minimumWorld.z;
  21210. return this._createSphere(Math.max(this._checkWithEpsilon(radiusX), this._checkWithEpsilon(radiusY), this._checkWithEpsilon(radiusZ)) / 2, mesh, options);
  21211. case BABYLON.PhysicsEngine.BoxImpostor:
  21212. bbox = mesh.getBoundingInfo().boundingBox;
  21213. var min = bbox.minimumWorld;
  21214. var max = bbox.maximumWorld;
  21215. var box = max.subtract(min).scale(0.5);
  21216. return this._createBox(this._checkWithEpsilon(box.x), this._checkWithEpsilon(box.y), this._checkWithEpsilon(box.z), mesh, options);
  21217. case BABYLON.PhysicsEngine.PlaneImpostor:
  21218. return this._createPlane(mesh, options);
  21219. case BABYLON.PhysicsEngine.MeshImpostor:
  21220. var rawVerts = mesh.getVerticesData(BABYLON.VertexBuffer.PositionKind);
  21221. var rawFaces = mesh.getIndices();
  21222. return this._createConvexPolyhedron(rawVerts, rawFaces, mesh, options);
  21223. }
  21224. return null;
  21225. };
  21226. CannonJSPlugin.prototype._createSphere = function (radius, mesh, options) {
  21227. var shape = new CANNON.Sphere(radius);
  21228. if (!options) {
  21229. return shape;
  21230. }
  21231. return this._createRigidBodyFromShape(shape, mesh, options.mass, options.friction, options.restitution);
  21232. };
  21233. CannonJSPlugin.prototype._createBox = function (x, y, z, mesh, options) {
  21234. var shape = new CANNON.Box(new CANNON.Vec3(x, z, y));
  21235. if (!options) {
  21236. return shape;
  21237. }
  21238. return this._createRigidBodyFromShape(shape, mesh, options.mass, options.friction, options.restitution);
  21239. };
  21240. CannonJSPlugin.prototype._createPlane = function (mesh, options) {
  21241. var shape = new CANNON.Plane();
  21242. if (!options) {
  21243. return shape;
  21244. }
  21245. return this._createRigidBodyFromShape(shape, mesh, options.mass, options.friction, options.restitution);
  21246. };
  21247. CannonJSPlugin.prototype._createConvexPolyhedron = function (rawVerts, rawFaces, mesh, options) {
  21248. var verts = [], faces = [];
  21249. mesh.computeWorldMatrix(true);
  21250. for (var i = 0; i < rawVerts.length; i += 3) {
  21251. var transformed = BABYLON.Vector3.Zero();
  21252. BABYLON.Vector3.TransformNormalFromFloatsToRef(rawVerts[i], rawVerts[i + 1], rawVerts[i + 2], mesh.getWorldMatrix(), transformed);
  21253. verts.push(new CANNON.Vec3(transformed.x, transformed.z, transformed.y));
  21254. }
  21255. for (var j = 0; j < rawFaces.length; j += 3) {
  21256. faces.push([rawFaces[j], rawFaces[j + 2], rawFaces[j + 1]]);
  21257. }
  21258. var shape = new CANNON.ConvexPolyhedron(verts, faces);
  21259. if (!options) {
  21260. return shape;
  21261. }
  21262. return this._createRigidBodyFromShape(shape, mesh, options.mass, options.friction, options.restitution);
  21263. };
  21264. CannonJSPlugin.prototype._addMaterial = function (friction, restitution) {
  21265. var index;
  21266. var mat;
  21267. for (index = 0; index < this._physicsMaterials.length; index++) {
  21268. mat = this._physicsMaterials[index];
  21269. if (mat.friction === friction && mat.restitution === restitution) {
  21270. return mat;
  21271. }
  21272. }
  21273. var currentMat = new CANNON.Material();
  21274. currentMat.friction = friction;
  21275. currentMat.restitution = restitution;
  21276. this._physicsMaterials.push(currentMat);
  21277. for (index = 0; index < this._physicsMaterials.length; index++) {
  21278. mat = this._physicsMaterials[index];
  21279. var contactMaterial = new CANNON.ContactMaterial(mat, currentMat, mat.friction * currentMat.friction, mat.restitution * currentMat.restitution);
  21280. contactMaterial.contactEquationStiffness = 1e10;
  21281. contactMaterial.contactEquationRegularizationTime = 10;
  21282. this._world.addContactMaterial(contactMaterial);
  21283. }
  21284. return currentMat;
  21285. };
  21286. CannonJSPlugin.prototype._createRigidBodyFromShape = function (shape, mesh, mass, friction, restitution) {
  21287. var initialRotation = null;
  21288. if (mesh.rotationQuaternion) {
  21289. initialRotation = mesh.rotationQuaternion.clone();
  21290. mesh.rotationQuaternion = new BABYLON.Quaternion(0, 0, 0, 1);
  21291. }
  21292. // The delta between the mesh position and the mesh bounding box center
  21293. var bbox = mesh.getBoundingInfo().boundingBox;
  21294. var deltaPosition = mesh.position.subtract(bbox.center);
  21295. var material = this._addMaterial(friction, restitution);
  21296. var body = new CANNON.RigidBody(mass, shape, material);
  21297. if (initialRotation) {
  21298. body.quaternion.x = initialRotation.x;
  21299. body.quaternion.z = initialRotation.y;
  21300. body.quaternion.y = initialRotation.z;
  21301. body.quaternion.w = -initialRotation.w;
  21302. }
  21303. body.position.set(bbox.center.x, bbox.center.z, bbox.center.y);
  21304. this._world.add(body);
  21305. this._registeredMeshes.push({ mesh: mesh, body: body, material: material, delta: deltaPosition });
  21306. return body;
  21307. };
  21308. CannonJSPlugin.prototype.registerMeshesAsCompound = function (parts, options) {
  21309. var compoundShape = new CANNON.Compound();
  21310. for (var index = 0; index < parts.length; index++) {
  21311. var mesh = parts[index].mesh;
  21312. var shape = this.registerMesh(mesh, parts[index].impostor);
  21313. if (index == 0) {
  21314. compoundShape.addChild(shape, new CANNON.Vec3(0, 0, 0));
  21315. } else {
  21316. compoundShape.addChild(shape, new CANNON.Vec3(mesh.position.x, mesh.position.z, mesh.position.y));
  21317. }
  21318. }
  21319. var initialMesh = parts[0].mesh;
  21320. var body = this._createRigidBodyFromShape(compoundShape, initialMesh, options.mass, options.friction, options.restitution);
  21321. body.parts = parts;
  21322. return body;
  21323. };
  21324. CannonJSPlugin.prototype._unbindBody = function (body) {
  21325. for (var index = 0; index < this._registeredMeshes.length; index++) {
  21326. var registeredMesh = this._registeredMeshes[index];
  21327. if (registeredMesh.body === body) {
  21328. registeredMesh.body = null;
  21329. registeredMesh.delta = 0;
  21330. }
  21331. }
  21332. };
  21333. CannonJSPlugin.prototype.unregisterMesh = function (mesh) {
  21334. for (var index = 0; index < this._registeredMeshes.length; index++) {
  21335. var registeredMesh = this._registeredMeshes[index];
  21336. if (registeredMesh.mesh === mesh) {
  21337. // Remove body
  21338. if (registeredMesh.body) {
  21339. this._world.remove(registeredMesh.body);
  21340. this._unbindBody(registeredMesh.body);
  21341. }
  21342. this._registeredMeshes.splice(index, 1);
  21343. return;
  21344. }
  21345. }
  21346. };
  21347. CannonJSPlugin.prototype.applyImpulse = function (mesh, force, contactPoint) {
  21348. var worldPoint = new CANNON.Vec3(contactPoint.x, contactPoint.z, contactPoint.y);
  21349. var impulse = new CANNON.Vec3(force.x, force.z, force.y);
  21350. for (var index = 0; index < this._registeredMeshes.length; index++) {
  21351. var registeredMesh = this._registeredMeshes[index];
  21352. if (registeredMesh.mesh === mesh) {
  21353. registeredMesh.body.applyImpulse(impulse, worldPoint);
  21354. return;
  21355. }
  21356. }
  21357. };
  21358. CannonJSPlugin.prototype.createLink = function (mesh1, mesh2, pivot1, pivot2) {
  21359. var body1 = null, body2 = null;
  21360. for (var index = 0; index < this._registeredMeshes.length; index++) {
  21361. var registeredMesh = this._registeredMeshes[index];
  21362. if (registeredMesh.mesh === mesh1) {
  21363. body1 = registeredMesh.body;
  21364. } else if (registeredMesh.mesh === mesh2) {
  21365. body2 = registeredMesh.body;
  21366. }
  21367. }
  21368. if (!body1 || !body2) {
  21369. return false;
  21370. }
  21371. var constraint = new CANNON.PointToPointConstraint(body1, new CANNON.Vec3(pivot1.x, pivot1.z, pivot1.y), body2, new CANNON.Vec3(pivot2.x, pivot2.z, pivot2.y));
  21372. this._world.addConstraint(constraint);
  21373. return true;
  21374. };
  21375. CannonJSPlugin.prototype.dispose = function () {
  21376. while (this._registeredMeshes.length) {
  21377. this.unregisterMesh(this._registeredMeshes[0].mesh);
  21378. }
  21379. };
  21380. CannonJSPlugin.prototype.isSupported = function () {
  21381. return window.CANNON !== undefined;
  21382. };
  21383. return CannonJSPlugin;
  21384. })();
  21385. BABYLON.CannonJSPlugin = CannonJSPlugin;
  21386. })(BABYLON || (BABYLON = {}));
  21387. //# sourceMappingURL=babylon.cannonJSPlugin.js.map
  21388. var BABYLON;
  21389. (function (BABYLON) {
  21390. var Condition = (function () {
  21391. function Condition(actionManager) {
  21392. this._actionManager = actionManager;
  21393. }
  21394. Condition.prototype.isValid = function () {
  21395. return true;
  21396. };
  21397. Condition.prototype._getProperty = function (propertyPath) {
  21398. return this._actionManager._getProperty(propertyPath);
  21399. };
  21400. Condition.prototype._getEffectiveTarget = function (target, propertyPath) {
  21401. return this._actionManager._getEffectiveTarget(target, propertyPath);
  21402. };
  21403. return Condition;
  21404. })();
  21405. BABYLON.Condition = Condition;
  21406. var ValueCondition = (function (_super) {
  21407. __extends(ValueCondition, _super);
  21408. function ValueCondition(actionManager, target, propertyPath, value, operator) {
  21409. if (typeof operator === "undefined") { operator = ValueCondition.IsEqual; }
  21410. _super.call(this, actionManager);
  21411. this.propertyPath = propertyPath;
  21412. this.value = value;
  21413. this.operator = operator;
  21414. this._target = this._getEffectiveTarget(target, this.propertyPath);
  21415. this._property = this._getProperty(this.propertyPath);
  21416. }
  21417. Object.defineProperty(ValueCondition, "IsEqual", {
  21418. get: function () {
  21419. return ValueCondition._IsEqual;
  21420. },
  21421. enumerable: true,
  21422. configurable: true
  21423. });
  21424. Object.defineProperty(ValueCondition, "IsDifferent", {
  21425. get: function () {
  21426. return ValueCondition._IsDifferent;
  21427. },
  21428. enumerable: true,
  21429. configurable: true
  21430. });
  21431. Object.defineProperty(ValueCondition, "IsGreater", {
  21432. get: function () {
  21433. return ValueCondition._IsGreater;
  21434. },
  21435. enumerable: true,
  21436. configurable: true
  21437. });
  21438. Object.defineProperty(ValueCondition, "IsLesser", {
  21439. get: function () {
  21440. return ValueCondition._IsLesser;
  21441. },
  21442. enumerable: true,
  21443. configurable: true
  21444. });
  21445. // Methods
  21446. ValueCondition.prototype.isValid = function () {
  21447. switch (this.operator) {
  21448. case ValueCondition.IsGreater:
  21449. return this._target[this._property] > this.value;
  21450. case ValueCondition.IsLesser:
  21451. return this._target[this._property] < this.value;
  21452. case ValueCondition.IsEqual:
  21453. case ValueCondition.IsDifferent:
  21454. var check;
  21455. if (this.value.equals) {
  21456. check = this.value.equals(this._target[this._property]);
  21457. } else {
  21458. check = this.value === this._target[this._property];
  21459. }
  21460. return this.operator === ValueCondition.IsEqual ? check : !check;
  21461. }
  21462. return false;
  21463. };
  21464. ValueCondition._IsEqual = 0;
  21465. ValueCondition._IsDifferent = 1;
  21466. ValueCondition._IsGreater = 2;
  21467. ValueCondition._IsLesser = 3;
  21468. return ValueCondition;
  21469. })(Condition);
  21470. BABYLON.ValueCondition = ValueCondition;
  21471. var PredicateCondition = (function (_super) {
  21472. __extends(PredicateCondition, _super);
  21473. function PredicateCondition(actionManager, predicate) {
  21474. _super.call(this, actionManager);
  21475. this.predicate = predicate;
  21476. }
  21477. PredicateCondition.prototype.isValid = function () {
  21478. return this.predicate();
  21479. };
  21480. return PredicateCondition;
  21481. })(Condition);
  21482. BABYLON.PredicateCondition = PredicateCondition;
  21483. var StateCondition = (function (_super) {
  21484. __extends(StateCondition, _super);
  21485. function StateCondition(actionManager, target, value) {
  21486. _super.call(this, actionManager);
  21487. this.value = value;
  21488. this._target = target;
  21489. }
  21490. // Methods
  21491. StateCondition.prototype.isValid = function () {
  21492. return this._target.state === this.value;
  21493. };
  21494. return StateCondition;
  21495. })(Condition);
  21496. BABYLON.StateCondition = StateCondition;
  21497. })(BABYLON || (BABYLON = {}));
  21498. //# sourceMappingURL=babylon.condition.js.map
  21499. var BABYLON;
  21500. (function (BABYLON) {
  21501. var Action = (function () {
  21502. function Action(triggerOptions, condition) {
  21503. this.triggerOptions = triggerOptions;
  21504. if (triggerOptions.parameter) {
  21505. this.trigger = triggerOptions.trigger;
  21506. this._triggerParameter = triggerOptions.parameter;
  21507. } else {
  21508. this.trigger = triggerOptions;
  21509. }
  21510. this._nextActiveAction = this;
  21511. this._condition = condition;
  21512. }
  21513. // Methods
  21514. Action.prototype._prepare = function () {
  21515. };
  21516. Action.prototype.getTriggerParameter = function () {
  21517. return this._triggerParameter;
  21518. };
  21519. Action.prototype._executeCurrent = function (evt) {
  21520. if (this._condition) {
  21521. var currentRenderId = this._actionManager.getScene().getRenderId();
  21522. // We cache the current evaluation for the current frame
  21523. if (this._condition._evaluationId === currentRenderId) {
  21524. if (!this._condition._currentResult) {
  21525. return;
  21526. }
  21527. } else {
  21528. this._condition._evaluationId = currentRenderId;
  21529. if (!this._condition.isValid()) {
  21530. this._condition._currentResult = false;
  21531. return;
  21532. }
  21533. this._condition._currentResult = true;
  21534. }
  21535. }
  21536. this._nextActiveAction.execute(evt);
  21537. if (this._nextActiveAction._child) {
  21538. if (!this._nextActiveAction._child._actionManager) {
  21539. this._nextActiveAction._child._actionManager = this._actionManager;
  21540. }
  21541. this._nextActiveAction = this._nextActiveAction._child;
  21542. } else {
  21543. this._nextActiveAction = this;
  21544. }
  21545. };
  21546. Action.prototype.execute = function (evt) {
  21547. };
  21548. Action.prototype.then = function (action) {
  21549. this._child = action;
  21550. action._actionManager = this._actionManager;
  21551. action._prepare();
  21552. return action;
  21553. };
  21554. Action.prototype._getProperty = function (propertyPath) {
  21555. return this._actionManager._getProperty(propertyPath);
  21556. };
  21557. Action.prototype._getEffectiveTarget = function (target, propertyPath) {
  21558. return this._actionManager._getEffectiveTarget(target, propertyPath);
  21559. };
  21560. return Action;
  21561. })();
  21562. BABYLON.Action = Action;
  21563. })(BABYLON || (BABYLON = {}));
  21564. //# sourceMappingURL=babylon.action.js.map
  21565. var BABYLON;
  21566. (function (BABYLON) {
  21567. var ActionEvent = (function () {
  21568. function ActionEvent(source, pointerX, pointerY, meshUnderPointer, sourceEvent) {
  21569. this.source = source;
  21570. this.pointerX = pointerX;
  21571. this.pointerY = pointerY;
  21572. this.meshUnderPointer = meshUnderPointer;
  21573. this.sourceEvent = sourceEvent;
  21574. }
  21575. ActionEvent.CreateNew = function (source, evt) {
  21576. var scene = source.getScene();
  21577. return new ActionEvent(source, scene.pointerX, scene.pointerY, scene.meshUnderPointer, evt);
  21578. };
  21579. ActionEvent.CreateNewFromScene = function (scene, evt) {
  21580. return new ActionEvent(null, scene.pointerX, scene.pointerY, scene.meshUnderPointer, evt);
  21581. };
  21582. return ActionEvent;
  21583. })();
  21584. BABYLON.ActionEvent = ActionEvent;
  21585. var ActionManager = (function () {
  21586. function ActionManager(scene) {
  21587. // Members
  21588. this.actions = new Array();
  21589. this._scene = scene;
  21590. scene._actionManagers.push(this);
  21591. }
  21592. Object.defineProperty(ActionManager, "NothingTrigger", {
  21593. get: function () {
  21594. return ActionManager._NothingTrigger;
  21595. },
  21596. enumerable: true,
  21597. configurable: true
  21598. });
  21599. Object.defineProperty(ActionManager, "OnPickTrigger", {
  21600. get: function () {
  21601. return ActionManager._OnPickTrigger;
  21602. },
  21603. enumerable: true,
  21604. configurable: true
  21605. });
  21606. Object.defineProperty(ActionManager, "OnLeftPickTrigger", {
  21607. get: function () {
  21608. return ActionManager._OnLeftPickTrigger;
  21609. },
  21610. enumerable: true,
  21611. configurable: true
  21612. });
  21613. Object.defineProperty(ActionManager, "OnRightPickTrigger", {
  21614. get: function () {
  21615. return ActionManager._OnRightPickTrigger;
  21616. },
  21617. enumerable: true,
  21618. configurable: true
  21619. });
  21620. Object.defineProperty(ActionManager, "OnCenterPickTrigger", {
  21621. get: function () {
  21622. return ActionManager._OnCenterPickTrigger;
  21623. },
  21624. enumerable: true,
  21625. configurable: true
  21626. });
  21627. Object.defineProperty(ActionManager, "OnPointerOverTrigger", {
  21628. get: function () {
  21629. return ActionManager._OnPointerOverTrigger;
  21630. },
  21631. enumerable: true,
  21632. configurable: true
  21633. });
  21634. Object.defineProperty(ActionManager, "OnPointerOutTrigger", {
  21635. get: function () {
  21636. return ActionManager._OnPointerOutTrigger;
  21637. },
  21638. enumerable: true,
  21639. configurable: true
  21640. });
  21641. Object.defineProperty(ActionManager, "OnEveryFrameTrigger", {
  21642. get: function () {
  21643. return ActionManager._OnEveryFrameTrigger;
  21644. },
  21645. enumerable: true,
  21646. configurable: true
  21647. });
  21648. Object.defineProperty(ActionManager, "OnIntersectionEnterTrigger", {
  21649. get: function () {
  21650. return ActionManager._OnIntersectionEnterTrigger;
  21651. },
  21652. enumerable: true,
  21653. configurable: true
  21654. });
  21655. Object.defineProperty(ActionManager, "OnIntersectionExitTrigger", {
  21656. get: function () {
  21657. return ActionManager._OnIntersectionExitTrigger;
  21658. },
  21659. enumerable: true,
  21660. configurable: true
  21661. });
  21662. Object.defineProperty(ActionManager, "OnKeyDownTrigger", {
  21663. get: function () {
  21664. return ActionManager._OnKeyDownTrigger;
  21665. },
  21666. enumerable: true,
  21667. configurable: true
  21668. });
  21669. Object.defineProperty(ActionManager, "OnKeyUpTrigger", {
  21670. get: function () {
  21671. return ActionManager._OnKeyUpTrigger;
  21672. },
  21673. enumerable: true,
  21674. configurable: true
  21675. });
  21676. // Methods
  21677. ActionManager.prototype.dispose = function () {
  21678. var index = this._scene._actionManagers.indexOf(this);
  21679. if (index > -1) {
  21680. this._scene._actionManagers.splice(index, 1);
  21681. }
  21682. };
  21683. ActionManager.prototype.getScene = function () {
  21684. return this._scene;
  21685. };
  21686. ActionManager.prototype.hasSpecificTriggers = function (triggers) {
  21687. for (var index = 0; index < this.actions.length; index++) {
  21688. var action = this.actions[index];
  21689. if (triggers.indexOf(action.trigger) > -1) {
  21690. return true;
  21691. }
  21692. }
  21693. return false;
  21694. };
  21695. Object.defineProperty(ActionManager.prototype, "hasPointerTriggers", {
  21696. get: function () {
  21697. for (var index = 0; index < this.actions.length; index++) {
  21698. var action = this.actions[index];
  21699. if (action.trigger >= ActionManager._OnPickTrigger && action.trigger <= ActionManager._OnPointerOutTrigger) {
  21700. return true;
  21701. }
  21702. }
  21703. return false;
  21704. },
  21705. enumerable: true,
  21706. configurable: true
  21707. });
  21708. Object.defineProperty(ActionManager.prototype, "hasPickTriggers", {
  21709. get: function () {
  21710. for (var index = 0; index < this.actions.length; index++) {
  21711. var action = this.actions[index];
  21712. if (action.trigger >= ActionManager._OnPickTrigger && action.trigger <= ActionManager._OnCenterPickTrigger) {
  21713. return true;
  21714. }
  21715. }
  21716. return false;
  21717. },
  21718. enumerable: true,
  21719. configurable: true
  21720. });
  21721. ActionManager.prototype.registerAction = function (action) {
  21722. if (action.trigger === ActionManager.OnEveryFrameTrigger) {
  21723. if (this.getScene().actionManager !== this) {
  21724. BABYLON.Tools.Warn("OnEveryFrameTrigger can only be used with scene.actionManager");
  21725. return null;
  21726. }
  21727. }
  21728. this.actions.push(action);
  21729. action._actionManager = this;
  21730. action._prepare();
  21731. return action;
  21732. };
  21733. ActionManager.prototype.processTrigger = function (trigger, evt) {
  21734. for (var index = 0; index < this.actions.length; index++) {
  21735. var action = this.actions[index];
  21736. if (action.trigger === trigger) {
  21737. if (trigger === ActionManager.OnKeyUpTrigger || trigger === ActionManager.OnKeyDownTrigger) {
  21738. var parameter = action.getTriggerParameter();
  21739. if (parameter) {
  21740. if (evt.sourceEvent.key !== parameter) {
  21741. continue;
  21742. }
  21743. }
  21744. }
  21745. action._executeCurrent(evt);
  21746. }
  21747. }
  21748. };
  21749. ActionManager.prototype._getEffectiveTarget = function (target, propertyPath) {
  21750. var properties = propertyPath.split(".");
  21751. for (var index = 0; index < properties.length - 1; index++) {
  21752. target = target[properties[index]];
  21753. }
  21754. return target;
  21755. };
  21756. ActionManager.prototype._getProperty = function (propertyPath) {
  21757. var properties = propertyPath.split(".");
  21758. return properties[properties.length - 1];
  21759. };
  21760. ActionManager._NothingTrigger = 0;
  21761. ActionManager._OnPickTrigger = 1;
  21762. ActionManager._OnLeftPickTrigger = 2;
  21763. ActionManager._OnRightPickTrigger = 3;
  21764. ActionManager._OnCenterPickTrigger = 4;
  21765. ActionManager._OnPointerOverTrigger = 5;
  21766. ActionManager._OnPointerOutTrigger = 6;
  21767. ActionManager._OnEveryFrameTrigger = 7;
  21768. ActionManager._OnIntersectionEnterTrigger = 8;
  21769. ActionManager._OnIntersectionExitTrigger = 9;
  21770. ActionManager._OnKeyDownTrigger = 10;
  21771. ActionManager._OnKeyUpTrigger = 11;
  21772. return ActionManager;
  21773. })();
  21774. BABYLON.ActionManager = ActionManager;
  21775. })(BABYLON || (BABYLON = {}));
  21776. //# sourceMappingURL=babylon.actionManager.js.map
  21777. var BABYLON;
  21778. (function (BABYLON) {
  21779. var InterpolateValueAction = (function (_super) {
  21780. __extends(InterpolateValueAction, _super);
  21781. function InterpolateValueAction(triggerOptions, target, propertyPath, value, duration, condition, stopOtherAnimations) {
  21782. if (typeof duration === "undefined") { duration = 1000; }
  21783. _super.call(this, triggerOptions, condition);
  21784. this.propertyPath = propertyPath;
  21785. this.value = value;
  21786. this.duration = duration;
  21787. this.stopOtherAnimations = stopOtherAnimations;
  21788. this._target = target;
  21789. }
  21790. InterpolateValueAction.prototype._prepare = function () {
  21791. this._target = this._getEffectiveTarget(this._target, this.propertyPath);
  21792. this._property = this._getProperty(this.propertyPath);
  21793. };
  21794. InterpolateValueAction.prototype.execute = function () {
  21795. var scene = this._actionManager.getScene();
  21796. var keys = [
  21797. {
  21798. frame: 0,
  21799. value: this._target[this._property]
  21800. }, {
  21801. frame: 100,
  21802. value: this.value
  21803. }
  21804. ];
  21805. var dataType;
  21806. if (typeof this.value === "number") {
  21807. dataType = BABYLON.Animation.ANIMATIONTYPE_FLOAT;
  21808. } else if (this.value instanceof BABYLON.Color3) {
  21809. dataType = BABYLON.Animation.ANIMATIONTYPE_COLOR3;
  21810. } else if (this.value instanceof BABYLON.Vector3) {
  21811. dataType = BABYLON.Animation.ANIMATIONTYPE_VECTOR3;
  21812. } else if (this.value instanceof BABYLON.Matrix) {
  21813. dataType = BABYLON.Animation.ANIMATIONTYPE_MATRIX;
  21814. } else if (this.value instanceof BABYLON.Quaternion) {
  21815. dataType = BABYLON.Animation.ANIMATIONTYPE_QUATERNION;
  21816. } else {
  21817. BABYLON.Tools.Warn("InterpolateValueAction: Unsupported type (" + typeof this.value + ")");
  21818. return;
  21819. }
  21820. var animation = new BABYLON.Animation("InterpolateValueAction", this._property, 100 * (1000.0 / this.duration), dataType, BABYLON.Animation.ANIMATIONLOOPMODE_CONSTANT);
  21821. animation.setKeys(keys);
  21822. if (this.stopOtherAnimations) {
  21823. scene.stopAnimation(this._target);
  21824. }
  21825. scene.beginDirectAnimation(this._target, [animation], 0, 100);
  21826. };
  21827. return InterpolateValueAction;
  21828. })(BABYLON.Action);
  21829. BABYLON.InterpolateValueAction = InterpolateValueAction;
  21830. })(BABYLON || (BABYLON = {}));
  21831. //# sourceMappingURL=babylon.interpolateValueAction.js.map
  21832. var BABYLON;
  21833. (function (BABYLON) {
  21834. var SwitchBooleanAction = (function (_super) {
  21835. __extends(SwitchBooleanAction, _super);
  21836. function SwitchBooleanAction(triggerOptions, target, propertyPath, condition) {
  21837. _super.call(this, triggerOptions, condition);
  21838. this.propertyPath = propertyPath;
  21839. this._target = target;
  21840. }
  21841. SwitchBooleanAction.prototype._prepare = function () {
  21842. this._target = this._getEffectiveTarget(this._target, this.propertyPath);
  21843. this._property = this._getProperty(this.propertyPath);
  21844. };
  21845. SwitchBooleanAction.prototype.execute = function () {
  21846. this._target[this._property] = !this._target[this._property];
  21847. };
  21848. return SwitchBooleanAction;
  21849. })(BABYLON.Action);
  21850. BABYLON.SwitchBooleanAction = SwitchBooleanAction;
  21851. var SetStateAction = (function (_super) {
  21852. __extends(SetStateAction, _super);
  21853. function SetStateAction(triggerOptions, target, value, condition) {
  21854. _super.call(this, triggerOptions, condition);
  21855. this.value = value;
  21856. this._target = target;
  21857. }
  21858. SetStateAction.prototype.execute = function () {
  21859. this._target.state = this.value;
  21860. };
  21861. return SetStateAction;
  21862. })(BABYLON.Action);
  21863. BABYLON.SetStateAction = SetStateAction;
  21864. var SetValueAction = (function (_super) {
  21865. __extends(SetValueAction, _super);
  21866. function SetValueAction(triggerOptions, target, propertyPath, value, condition) {
  21867. _super.call(this, triggerOptions, condition);
  21868. this.propertyPath = propertyPath;
  21869. this.value = value;
  21870. this._target = target;
  21871. }
  21872. SetValueAction.prototype._prepare = function () {
  21873. this._target = this._getEffectiveTarget(this._target, this.propertyPath);
  21874. this._property = this._getProperty(this.propertyPath);
  21875. };
  21876. SetValueAction.prototype.execute = function () {
  21877. this._target[this._property] = this.value;
  21878. };
  21879. return SetValueAction;
  21880. })(BABYLON.Action);
  21881. BABYLON.SetValueAction = SetValueAction;
  21882. var IncrementValueAction = (function (_super) {
  21883. __extends(IncrementValueAction, _super);
  21884. function IncrementValueAction(triggerOptions, target, propertyPath, value, condition) {
  21885. _super.call(this, triggerOptions, condition);
  21886. this.propertyPath = propertyPath;
  21887. this.value = value;
  21888. this._target = target;
  21889. }
  21890. IncrementValueAction.prototype._prepare = function () {
  21891. this._target = this._getEffectiveTarget(this._target, this.propertyPath);
  21892. this._property = this._getProperty(this.propertyPath);
  21893. if (typeof this._target[this._property] !== "number") {
  21894. BABYLON.Tools.Warn("Warning: IncrementValueAction can only be used with number values");
  21895. }
  21896. };
  21897. IncrementValueAction.prototype.execute = function () {
  21898. this._target[this._property] += this.value;
  21899. };
  21900. return IncrementValueAction;
  21901. })(BABYLON.Action);
  21902. BABYLON.IncrementValueAction = IncrementValueAction;
  21903. var PlayAnimationAction = (function (_super) {
  21904. __extends(PlayAnimationAction, _super);
  21905. function PlayAnimationAction(triggerOptions, target, from, to, loop, condition) {
  21906. _super.call(this, triggerOptions, condition);
  21907. this.from = from;
  21908. this.to = to;
  21909. this.loop = loop;
  21910. this._target = target;
  21911. }
  21912. PlayAnimationAction.prototype._prepare = function () {
  21913. };
  21914. PlayAnimationAction.prototype.execute = function () {
  21915. var scene = this._actionManager.getScene();
  21916. scene.beginAnimation(this._target, this.from, this.to, this.loop);
  21917. };
  21918. return PlayAnimationAction;
  21919. })(BABYLON.Action);
  21920. BABYLON.PlayAnimationAction = PlayAnimationAction;
  21921. var StopAnimationAction = (function (_super) {
  21922. __extends(StopAnimationAction, _super);
  21923. function StopAnimationAction(triggerOptions, target, condition) {
  21924. _super.call(this, triggerOptions, condition);
  21925. this._target = target;
  21926. }
  21927. StopAnimationAction.prototype._prepare = function () {
  21928. };
  21929. StopAnimationAction.prototype.execute = function () {
  21930. var scene = this._actionManager.getScene();
  21931. scene.stopAnimation(this._target);
  21932. };
  21933. return StopAnimationAction;
  21934. })(BABYLON.Action);
  21935. BABYLON.StopAnimationAction = StopAnimationAction;
  21936. var DoNothingAction = (function (_super) {
  21937. __extends(DoNothingAction, _super);
  21938. function DoNothingAction(triggerOptions, condition) {
  21939. if (typeof triggerOptions === "undefined") { triggerOptions = BABYLON.ActionManager.NothingTrigger; }
  21940. _super.call(this, triggerOptions, condition);
  21941. }
  21942. DoNothingAction.prototype.execute = function () {
  21943. };
  21944. return DoNothingAction;
  21945. })(BABYLON.Action);
  21946. BABYLON.DoNothingAction = DoNothingAction;
  21947. var CombineAction = (function (_super) {
  21948. __extends(CombineAction, _super);
  21949. function CombineAction(triggerOptions, children, condition) {
  21950. _super.call(this, triggerOptions, condition);
  21951. this.children = children;
  21952. }
  21953. CombineAction.prototype._prepare = function () {
  21954. for (var index = 0; index < this.children.length; index++) {
  21955. this.children[index]._actionManager = this._actionManager;
  21956. this.children[index]._prepare();
  21957. }
  21958. };
  21959. CombineAction.prototype.execute = function (evt) {
  21960. for (var index = 0; index < this.children.length; index++) {
  21961. this.children[index].execute(evt);
  21962. }
  21963. };
  21964. return CombineAction;
  21965. })(BABYLON.Action);
  21966. BABYLON.CombineAction = CombineAction;
  21967. var ExecuteCodeAction = (function (_super) {
  21968. __extends(ExecuteCodeAction, _super);
  21969. function ExecuteCodeAction(triggerOptions, func, condition) {
  21970. _super.call(this, triggerOptions, condition);
  21971. this.func = func;
  21972. }
  21973. ExecuteCodeAction.prototype.execute = function (evt) {
  21974. this.func(evt);
  21975. };
  21976. return ExecuteCodeAction;
  21977. })(BABYLON.Action);
  21978. BABYLON.ExecuteCodeAction = ExecuteCodeAction;
  21979. var SetParentAction = (function (_super) {
  21980. __extends(SetParentAction, _super);
  21981. function SetParentAction(triggerOptions, target, parent, condition) {
  21982. _super.call(this, triggerOptions, condition);
  21983. this._target = target;
  21984. this._parent = parent;
  21985. }
  21986. SetParentAction.prototype._prepare = function () {
  21987. };
  21988. SetParentAction.prototype.execute = function () {
  21989. if (this._target.parent === this._parent) {
  21990. return;
  21991. }
  21992. var invertParentWorldMatrix = this._parent.getWorldMatrix().clone();
  21993. invertParentWorldMatrix.invert();
  21994. this._target.position = BABYLON.Vector3.TransformCoordinates(this._target.position, invertParentWorldMatrix);
  21995. this._target.parent = this._parent;
  21996. };
  21997. return SetParentAction;
  21998. })(BABYLON.Action);
  21999. BABYLON.SetParentAction = SetParentAction;
  22000. })(BABYLON || (BABYLON = {}));
  22001. //# sourceMappingURL=babylon.directActions.js.map
  22002. var BABYLON;
  22003. (function (BABYLON) {
  22004. var Geometry = (function () {
  22005. function Geometry(id, scene, vertexData, updatable, mesh) {
  22006. this.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_NONE;
  22007. this._totalVertices = 0;
  22008. this._indices = [];
  22009. this.id = id;
  22010. this._engine = scene.getEngine();
  22011. this._meshes = [];
  22012. this._scene = scene;
  22013. // vertexData
  22014. if (vertexData) {
  22015. this.setAllVerticesData(vertexData, updatable);
  22016. } else {
  22017. this._totalVertices = 0;
  22018. this._indices = [];
  22019. }
  22020. // applyToMesh
  22021. if (mesh) {
  22022. this.applyToMesh(mesh);
  22023. }
  22024. }
  22025. Geometry.prototype.getScene = function () {
  22026. return this._scene;
  22027. };
  22028. Geometry.prototype.getEngine = function () {
  22029. return this._engine;
  22030. };
  22031. Geometry.prototype.isReady = function () {
  22032. return this.delayLoadState === BABYLON.Engine.DELAYLOADSTATE_LOADED || this.delayLoadState === BABYLON.Engine.DELAYLOADSTATE_NONE;
  22033. };
  22034. Geometry.prototype.setAllVerticesData = function (vertexData, updatable) {
  22035. vertexData.applyToGeometry(this, updatable);
  22036. };
  22037. Geometry.prototype.setVerticesData = function (kind, data, updatable, stride) {
  22038. this._vertexBuffers = this._vertexBuffers || {};
  22039. if (this._vertexBuffers[kind]) {
  22040. this._vertexBuffers[kind].dispose();
  22041. }
  22042. this._vertexBuffers[kind] = new BABYLON.VertexBuffer(this._engine, data, kind, updatable, this._meshes.length === 0, stride);
  22043. if (kind === BABYLON.VertexBuffer.PositionKind) {
  22044. stride = this._vertexBuffers[kind].getStrideSize();
  22045. this._totalVertices = data.length / stride;
  22046. var extend = BABYLON.Tools.ExtractMinAndMax(data, 0, this._totalVertices);
  22047. var meshes = this._meshes;
  22048. var numOfMeshes = meshes.length;
  22049. for (var index = 0; index < numOfMeshes; index++) {
  22050. var mesh = meshes[index];
  22051. mesh._resetPointsArrayCache();
  22052. mesh._boundingInfo = new BABYLON.BoundingInfo(extend.minimum, extend.maximum);
  22053. mesh._createGlobalSubMesh();
  22054. mesh.computeWorldMatrix(true);
  22055. }
  22056. }
  22057. };
  22058. Geometry.prototype.updateVerticesDataDirectly = function (kind, data, offset) {
  22059. var vertexBuffer = this.getVertexBuffer(kind);
  22060. if (!vertexBuffer) {
  22061. return;
  22062. }
  22063. vertexBuffer.updateDirectly(data, offset);
  22064. };
  22065. Geometry.prototype.updateVerticesData = function (kind, data, updateExtends) {
  22066. var vertexBuffer = this.getVertexBuffer(kind);
  22067. if (!vertexBuffer) {
  22068. return;
  22069. }
  22070. vertexBuffer.update(data);
  22071. if (kind === BABYLON.VertexBuffer.PositionKind) {
  22072. var extend;
  22073. var stride = vertexBuffer.getStrideSize();
  22074. this._totalVertices = data.length / stride;
  22075. if (updateExtends) {
  22076. extend = BABYLON.Tools.ExtractMinAndMax(data, 0, this._totalVertices);
  22077. }
  22078. var meshes = this._meshes;
  22079. var numOfMeshes = meshes.length;
  22080. for (var index = 0; index < numOfMeshes; index++) {
  22081. var mesh = meshes[index];
  22082. mesh._resetPointsArrayCache();
  22083. if (updateExtends) {
  22084. mesh._boundingInfo = new BABYLON.BoundingInfo(extend.minimum, extend.maximum);
  22085. }
  22086. }
  22087. }
  22088. };
  22089. Geometry.prototype.getTotalVertices = function () {
  22090. if (!this.isReady()) {
  22091. return 0;
  22092. }
  22093. return this._totalVertices;
  22094. };
  22095. Geometry.prototype.getVerticesData = function (kind) {
  22096. var vertexBuffer = this.getVertexBuffer(kind);
  22097. if (!vertexBuffer) {
  22098. return null;
  22099. }
  22100. return vertexBuffer.getData();
  22101. };
  22102. Geometry.prototype.getVertexBuffer = function (kind) {
  22103. if (!this.isReady()) {
  22104. return null;
  22105. }
  22106. return this._vertexBuffers[kind];
  22107. };
  22108. Geometry.prototype.getVertexBuffers = function () {
  22109. if (!this.isReady()) {
  22110. return null;
  22111. }
  22112. return this._vertexBuffers;
  22113. };
  22114. Geometry.prototype.isVerticesDataPresent = function (kind) {
  22115. if (!this._vertexBuffers) {
  22116. if (this._delayInfo) {
  22117. return this._delayInfo.indexOf(kind) !== -1;
  22118. }
  22119. return false;
  22120. }
  22121. return this._vertexBuffers[kind] !== undefined;
  22122. };
  22123. Geometry.prototype.getVerticesDataKinds = function () {
  22124. var result = [];
  22125. if (!this._vertexBuffers && this._delayInfo) {
  22126. for (var kind in this._delayInfo) {
  22127. result.push(kind);
  22128. }
  22129. } else {
  22130. for (kind in this._vertexBuffers) {
  22131. result.push(kind);
  22132. }
  22133. }
  22134. return result;
  22135. };
  22136. Geometry.prototype.setIndices = function (indices, totalVertices) {
  22137. if (this._indexBuffer) {
  22138. this._engine._releaseBuffer(this._indexBuffer);
  22139. }
  22140. this._indices = indices;
  22141. if (this._meshes.length !== 0 && this._indices) {
  22142. this._indexBuffer = this._engine.createIndexBuffer(this._indices);
  22143. }
  22144. if (totalVertices !== undefined) {
  22145. this._totalVertices = totalVertices;
  22146. }
  22147. var meshes = this._meshes;
  22148. var numOfMeshes = meshes.length;
  22149. for (var index = 0; index < numOfMeshes; index++) {
  22150. meshes[index]._createGlobalSubMesh();
  22151. }
  22152. };
  22153. Geometry.prototype.getTotalIndices = function () {
  22154. if (!this.isReady()) {
  22155. return 0;
  22156. }
  22157. return this._indices.length;
  22158. };
  22159. Geometry.prototype.getIndices = function () {
  22160. if (!this.isReady()) {
  22161. return null;
  22162. }
  22163. return this._indices;
  22164. };
  22165. Geometry.prototype.getIndexBuffer = function () {
  22166. if (!this.isReady()) {
  22167. return null;
  22168. }
  22169. return this._indexBuffer;
  22170. };
  22171. Geometry.prototype.releaseForMesh = function (mesh, shouldDispose) {
  22172. var meshes = this._meshes;
  22173. var index = meshes.indexOf(mesh);
  22174. if (index === -1) {
  22175. return;
  22176. }
  22177. for (var kind in this._vertexBuffers) {
  22178. this._vertexBuffers[kind].dispose();
  22179. }
  22180. if (this._indexBuffer && this._engine._releaseBuffer(this._indexBuffer)) {
  22181. this._indexBuffer = null;
  22182. }
  22183. meshes.splice(index, 1);
  22184. mesh._geometry = null;
  22185. if (meshes.length == 0 && shouldDispose) {
  22186. this.dispose();
  22187. }
  22188. };
  22189. Geometry.prototype.applyToMesh = function (mesh) {
  22190. if (mesh._geometry === this) {
  22191. return;
  22192. }
  22193. var previousGeometry = mesh._geometry;
  22194. if (previousGeometry) {
  22195. previousGeometry.releaseForMesh(mesh);
  22196. }
  22197. var meshes = this._meshes;
  22198. // must be done before setting vertexBuffers because of mesh._createGlobalSubMesh()
  22199. mesh._geometry = this;
  22200. this._scene.pushGeometry(this);
  22201. meshes.push(mesh);
  22202. if (this.isReady()) {
  22203. this._applyToMesh(mesh);
  22204. } else {
  22205. mesh._boundingInfo = this._boundingInfo;
  22206. }
  22207. };
  22208. Geometry.prototype._applyToMesh = function (mesh) {
  22209. var numOfMeshes = this._meshes.length;
  22210. for (var kind in this._vertexBuffers) {
  22211. if (numOfMeshes === 1) {
  22212. this._vertexBuffers[kind].create();
  22213. }
  22214. this._vertexBuffers[kind]._buffer.references = numOfMeshes;
  22215. if (kind === BABYLON.VertexBuffer.PositionKind) {
  22216. mesh._resetPointsArrayCache();
  22217. var extend = BABYLON.Tools.ExtractMinAndMax(this._vertexBuffers[kind].getData(), 0, this._totalVertices);
  22218. mesh._boundingInfo = new BABYLON.BoundingInfo(extend.minimum, extend.maximum);
  22219. mesh._createGlobalSubMesh();
  22220. }
  22221. }
  22222. // indexBuffer
  22223. if (numOfMeshes === 1 && this._indices) {
  22224. this._indexBuffer = this._engine.createIndexBuffer(this._indices);
  22225. }
  22226. if (this._indexBuffer) {
  22227. this._indexBuffer.references = numOfMeshes;
  22228. }
  22229. };
  22230. Geometry.prototype.load = function (scene, onLoaded) {
  22231. var _this = this;
  22232. if (this.delayLoadState === BABYLON.Engine.DELAYLOADSTATE_LOADING) {
  22233. return;
  22234. }
  22235. if (this.isReady()) {
  22236. if (onLoaded) {
  22237. onLoaded();
  22238. }
  22239. return;
  22240. }
  22241. this.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_LOADING;
  22242. scene._addPendingData(this);
  22243. BABYLON.Tools.LoadFile(this.delayLoadingFile, function (data) {
  22244. _this._delayLoadingFunction(JSON.parse(data), _this);
  22245. _this.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_LOADED;
  22246. _this._delayInfo = [];
  22247. scene._removePendingData(_this);
  22248. var meshes = _this._meshes;
  22249. var numOfMeshes = meshes.length;
  22250. for (var index = 0; index < numOfMeshes; index++) {
  22251. _this._applyToMesh(meshes[index]);
  22252. }
  22253. if (onLoaded) {
  22254. onLoaded();
  22255. }
  22256. }, function () {
  22257. }, scene.database);
  22258. };
  22259. Geometry.prototype.dispose = function () {
  22260. var meshes = this._meshes;
  22261. var numOfMeshes = meshes.length;
  22262. for (var index = 0; index < numOfMeshes; index++) {
  22263. this.releaseForMesh(meshes[index]);
  22264. }
  22265. this._meshes = [];
  22266. for (var kind in this._vertexBuffers) {
  22267. this._vertexBuffers[kind].dispose();
  22268. }
  22269. this._vertexBuffers = [];
  22270. this._totalVertices = 0;
  22271. if (this._indexBuffer) {
  22272. this._engine._releaseBuffer(this._indexBuffer);
  22273. }
  22274. this._indexBuffer = null;
  22275. this._indices = [];
  22276. this.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_NONE;
  22277. this.delayLoadingFile = null;
  22278. this._delayLoadingFunction = null;
  22279. this._delayInfo = [];
  22280. this._boundingInfo = null; // todo: .dispose()
  22281. var geometries = this._scene.getGeometries();
  22282. index = geometries.indexOf(this);
  22283. if (index > -1) {
  22284. geometries.splice(index, 1);
  22285. }
  22286. };
  22287. Geometry.prototype.copy = function (id) {
  22288. var vertexData = new BABYLON.VertexData();
  22289. vertexData.indices = [];
  22290. var indices = this.getIndices();
  22291. for (var index = 0; index < indices.length; index++) {
  22292. vertexData.indices.push(indices[index]);
  22293. }
  22294. var updatable = false;
  22295. var stopChecking = false;
  22296. for (var kind in this._vertexBuffers) {
  22297. vertexData.set(this.getVerticesData(kind), kind);
  22298. if (!stopChecking) {
  22299. updatable = this.getVertexBuffer(kind).isUpdatable();
  22300. stopChecking = !updatable;
  22301. }
  22302. }
  22303. var geometry = new BABYLON.Geometry(id, this._scene, vertexData, updatable, null);
  22304. geometry.delayLoadState = this.delayLoadState;
  22305. geometry.delayLoadingFile = this.delayLoadingFile;
  22306. geometry._delayLoadingFunction = this._delayLoadingFunction;
  22307. for (kind in this._delayInfo) {
  22308. geometry._delayInfo = geometry._delayInfo || [];
  22309. geometry._delayInfo.push(kind);
  22310. }
  22311. // Bounding info
  22312. var extend = BABYLON.Tools.ExtractMinAndMax(this.getVerticesData(BABYLON.VertexBuffer.PositionKind), 0, this.getTotalVertices());
  22313. geometry._boundingInfo = new BABYLON.BoundingInfo(extend.minimum, extend.maximum);
  22314. return geometry;
  22315. };
  22316. // Statics
  22317. Geometry.ExtractFromMesh = function (mesh, id) {
  22318. var geometry = mesh._geometry;
  22319. if (!geometry) {
  22320. return null;
  22321. }
  22322. return geometry.copy(id);
  22323. };
  22324. // from http://stackoverflow.com/questions/105034/how-to-create-a-guid-uuid-in-javascript/2117523#answer-2117523
  22325. // be aware Math.random() could cause collisions
  22326. Geometry.RandomId = function () {
  22327. return 'xxxxxxxx-xxxx-4xxx-yxxx-xxxxxxxxxxxx'.replace(/[xy]/g, function (c) {
  22328. var r = Math.random() * 16 | 0, v = c == 'x' ? r : (r & 0x3 | 0x8);
  22329. return v.toString(16);
  22330. });
  22331. };
  22332. return Geometry;
  22333. })();
  22334. BABYLON.Geometry = Geometry;
  22335. (function (Geometry) {
  22336. /////// Primitives //////////////////////////////////////////////
  22337. (function (Primitives) {
  22338. /// Abstract class
  22339. var _Primitive = (function (_super) {
  22340. __extends(_Primitive, _super);
  22341. function _Primitive(id, scene, vertexData, canBeRegenerated, mesh) {
  22342. this._beingRegenerated = true;
  22343. this._canBeRegenerated = canBeRegenerated;
  22344. _super.call(this, id, scene, vertexData, false, mesh); // updatable = false to be sure not to update vertices
  22345. this._beingRegenerated = false;
  22346. }
  22347. _Primitive.prototype.canBeRegenerated = function () {
  22348. return this._canBeRegenerated;
  22349. };
  22350. _Primitive.prototype.regenerate = function () {
  22351. if (!this._canBeRegenerated) {
  22352. return;
  22353. }
  22354. this._beingRegenerated = true;
  22355. this.setAllVerticesData(this._regenerateVertexData(), false);
  22356. this._beingRegenerated = false;
  22357. };
  22358. _Primitive.prototype.asNewGeometry = function (id) {
  22359. return _super.prototype.copy.call(this, id);
  22360. };
  22361. // overrides
  22362. _Primitive.prototype.setAllVerticesData = function (vertexData, updatable) {
  22363. if (!this._beingRegenerated) {
  22364. return;
  22365. }
  22366. _super.prototype.setAllVerticesData.call(this, vertexData, false);
  22367. };
  22368. _Primitive.prototype.setVerticesData = function (kind, data, updatable) {
  22369. if (!this._beingRegenerated) {
  22370. return;
  22371. }
  22372. _super.prototype.setVerticesData.call(this, kind, data, false);
  22373. };
  22374. // to override
  22375. // protected
  22376. _Primitive.prototype._regenerateVertexData = function () {
  22377. throw new Error("Abstract method");
  22378. };
  22379. _Primitive.prototype.copy = function (id) {
  22380. throw new Error("Must be overriden in sub-classes.");
  22381. };
  22382. return _Primitive;
  22383. })(Geometry);
  22384. Primitives._Primitive = _Primitive;
  22385. var Box = (function (_super) {
  22386. __extends(Box, _super);
  22387. function Box(id, scene, size, canBeRegenerated, mesh) {
  22388. this.size = size;
  22389. _super.call(this, id, scene, this._regenerateVertexData(), canBeRegenerated, mesh);
  22390. }
  22391. Box.prototype._regenerateVertexData = function () {
  22392. return BABYLON.VertexData.CreateBox(this.size);
  22393. };
  22394. Box.prototype.copy = function (id) {
  22395. return new Box(id, this.getScene(), this.size, this.canBeRegenerated(), null);
  22396. };
  22397. return Box;
  22398. })(_Primitive);
  22399. Primitives.Box = Box;
  22400. var Sphere = (function (_super) {
  22401. __extends(Sphere, _super);
  22402. function Sphere(id, scene, segments, diameter, canBeRegenerated, mesh) {
  22403. this.segments = segments;
  22404. this.diameter = diameter;
  22405. _super.call(this, id, scene, this._regenerateVertexData(), canBeRegenerated, mesh);
  22406. }
  22407. Sphere.prototype._regenerateVertexData = function () {
  22408. return BABYLON.VertexData.CreateSphere(this.segments, this.diameter);
  22409. };
  22410. Sphere.prototype.copy = function (id) {
  22411. return new Sphere(id, this.getScene(), this.segments, this.diameter, this.canBeRegenerated(), null);
  22412. };
  22413. return Sphere;
  22414. })(_Primitive);
  22415. Primitives.Sphere = Sphere;
  22416. var Cylinder = (function (_super) {
  22417. __extends(Cylinder, _super);
  22418. function Cylinder(id, scene, height, diameterTop, diameterBottom, tessellation, subdivisions, canBeRegenerated, mesh) {
  22419. if (typeof subdivisions === "undefined") { subdivisions = 1; }
  22420. this.height = height;
  22421. this.diameterTop = diameterTop;
  22422. this.diameterBottom = diameterBottom;
  22423. this.tessellation = tessellation;
  22424. this.subdivisions = subdivisions;
  22425. _super.call(this, id, scene, this._regenerateVertexData(), canBeRegenerated, mesh);
  22426. }
  22427. Cylinder.prototype._regenerateVertexData = function () {
  22428. return BABYLON.VertexData.CreateCylinder(this.height, this.diameterTop, this.diameterBottom, this.tessellation, this.subdivisions);
  22429. };
  22430. Cylinder.prototype.copy = function (id) {
  22431. return new Cylinder(id, this.getScene(), this.height, this.diameterTop, this.diameterBottom, this.tessellation, this.subdivisions, this.canBeRegenerated(), null);
  22432. };
  22433. return Cylinder;
  22434. })(_Primitive);
  22435. Primitives.Cylinder = Cylinder;
  22436. var Torus = (function (_super) {
  22437. __extends(Torus, _super);
  22438. function Torus(id, scene, diameter, thickness, tessellation, canBeRegenerated, mesh) {
  22439. this.diameter = diameter;
  22440. this.thickness = thickness;
  22441. this.tessellation = tessellation;
  22442. _super.call(this, id, scene, this._regenerateVertexData(), canBeRegenerated, mesh);
  22443. }
  22444. Torus.prototype._regenerateVertexData = function () {
  22445. return BABYLON.VertexData.CreateTorus(this.diameter, this.thickness, this.tessellation);
  22446. };
  22447. Torus.prototype.copy = function (id) {
  22448. return new Torus(id, this.getScene(), this.diameter, this.thickness, this.tessellation, this.canBeRegenerated(), null);
  22449. };
  22450. return Torus;
  22451. })(_Primitive);
  22452. Primitives.Torus = Torus;
  22453. var Ground = (function (_super) {
  22454. __extends(Ground, _super);
  22455. function Ground(id, scene, width, height, subdivisions, canBeRegenerated, mesh) {
  22456. this.width = width;
  22457. this.height = height;
  22458. this.subdivisions = subdivisions;
  22459. _super.call(this, id, scene, this._regenerateVertexData(), canBeRegenerated, mesh);
  22460. }
  22461. Ground.prototype._regenerateVertexData = function () {
  22462. return BABYLON.VertexData.CreateGround(this.width, this.height, this.subdivisions);
  22463. };
  22464. Ground.prototype.copy = function (id) {
  22465. return new Ground(id, this.getScene(), this.width, this.height, this.subdivisions, this.canBeRegenerated(), null);
  22466. };
  22467. return Ground;
  22468. })(_Primitive);
  22469. Primitives.Ground = Ground;
  22470. var TiledGround = (function (_super) {
  22471. __extends(TiledGround, _super);
  22472. function TiledGround(id, scene, xmin, zmin, xmax, zmax, subdivisions, precision, canBeRegenerated, mesh) {
  22473. this.xmin = xmin;
  22474. this.zmin = zmin;
  22475. this.xmax = xmax;
  22476. this.zmax = zmax;
  22477. this.subdivisions = subdivisions;
  22478. this.precision = precision;
  22479. _super.call(this, id, scene, this._regenerateVertexData(), canBeRegenerated, mesh);
  22480. }
  22481. TiledGround.prototype._regenerateVertexData = function () {
  22482. return BABYLON.VertexData.CreateTiledGround(this.xmin, this.zmin, this.xmax, this.zmax, this.subdivisions, this.precision);
  22483. };
  22484. TiledGround.prototype.copy = function (id) {
  22485. return new TiledGround(id, this.getScene(), this.xmin, this.zmin, this.xmax, this.zmax, this.subdivisions, this.precision, this.canBeRegenerated(), null);
  22486. };
  22487. return TiledGround;
  22488. })(_Primitive);
  22489. Primitives.TiledGround = TiledGround;
  22490. var Plane = (function (_super) {
  22491. __extends(Plane, _super);
  22492. function Plane(id, scene, size, canBeRegenerated, mesh) {
  22493. this.size = size;
  22494. _super.call(this, id, scene, this._regenerateVertexData(), canBeRegenerated, mesh);
  22495. }
  22496. Plane.prototype._regenerateVertexData = function () {
  22497. return BABYLON.VertexData.CreatePlane(this.size);
  22498. };
  22499. Plane.prototype.copy = function (id) {
  22500. return new Plane(id, this.getScene(), this.size, this.canBeRegenerated(), null);
  22501. };
  22502. return Plane;
  22503. })(_Primitive);
  22504. Primitives.Plane = Plane;
  22505. var TorusKnot = (function (_super) {
  22506. __extends(TorusKnot, _super);
  22507. function TorusKnot(id, scene, radius, tube, radialSegments, tubularSegments, p, q, canBeRegenerated, mesh) {
  22508. this.radius = radius;
  22509. this.tube = tube;
  22510. this.radialSegments = radialSegments;
  22511. this.tubularSegments = tubularSegments;
  22512. this.p = p;
  22513. this.q = q;
  22514. _super.call(this, id, scene, this._regenerateVertexData(), canBeRegenerated, mesh);
  22515. }
  22516. TorusKnot.prototype._regenerateVertexData = function () {
  22517. return BABYLON.VertexData.CreateTorusKnot(this.radius, this.tube, this.radialSegments, this.tubularSegments, this.p, this.q);
  22518. };
  22519. TorusKnot.prototype.copy = function (id) {
  22520. return new TorusKnot(id, this.getScene(), this.radius, this.tube, this.radialSegments, this.tubularSegments, this.p, this.q, this.canBeRegenerated(), null);
  22521. };
  22522. return TorusKnot;
  22523. })(_Primitive);
  22524. Primitives.TorusKnot = TorusKnot;
  22525. })(Geometry.Primitives || (Geometry.Primitives = {}));
  22526. var Primitives = Geometry.Primitives;
  22527. })(BABYLON.Geometry || (BABYLON.Geometry = {}));
  22528. var Geometry = BABYLON.Geometry;
  22529. })(BABYLON || (BABYLON = {}));
  22530. //# sourceMappingURL=babylon.geometry.js.map
  22531. var BABYLON;
  22532. (function (BABYLON) {
  22533. var Gamepads = (function () {
  22534. function Gamepads(ongamedpadconnected) {
  22535. var _this = this;
  22536. this.babylonGamepads = [];
  22537. this.oneGamepadConnected = false;
  22538. this.isMonitoring = false;
  22539. this.gamepadEventSupported = 'GamepadEvent' in window;
  22540. this.gamepadSupportAvailable = (navigator.getGamepads || !!navigator.webkitGetGamepads || !!navigator.msGetGamepads || !!navigator.webkitGamepads);
  22541. this.buttonADataURL = "data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAEAAAABACAYAAACqaXHeAAAABGdBTUEAAK/INwWK6QAAABl0RVh0U29mdHdhcmUAQWRvYmUgSW1hZ2VSZWFkeXHJZTwAAA9aSURBVHja7FtpbBzneX7m3otcihSpm9Z9UJalxPKhVLZlp6ktNzEaxE0CtAnQAgnSoPWPBi3syuiPwordFi5Qt2haFygCoylSV4Vby6os1I3kOLYrS65kXXQoypJJSaFEUTyXy925+rzfzC6HFFlL1kpAIe7i5czO7H7zPs97ft8MtTAMcSu/dNzirxkCZgiYIWCGgBkCZgi4hV/mDR5fSxAt+0ZiX0ucDxMSTJLK+f83BFSA6TFgK75OclshouKBFbA+xaV4k7Z+fD6sNRlmjYFXQMu4NiUVS/oHe5/ecnHo3MYxd7QthN9UcsdW6FqEPwgDOFbqpAajL2VlTrTULzj4Ow8+s4+nipSxWMoxIUkyrl/pGswFtIR7WzHgDCX77K7vfHNkbOA+AryjYZadb27OIJdzCNZBKmXw4kbk35qPsTEfJbeEkZESentHMdBfGtY142gu1bDvqV/925f4tQJlNCaj4hXX7RHXS0AFuJEAXvfHr/zmk67vPjir0V68aFEe8xtuQ6O1FHlrEXLmHBiaDUtzYBlpNYjrF+GFZfhhCcPeBQy53ehzT+H8QBe6uwfRf7l8xjKsvX/y5X98jl8fThDhJ4i46QQkrS5I6v7oX7/++77vPtLUlFnZtnIRlubvxRxnHbJmE79sxD/SqG0oZk8MFarRqufUkQAFrxcXSkfx0eB+nOggKX2jHYZhvf79r/z4L2IiipO84aYRkASfefnAX695p3P3c9mM/UufuaMVdzRvxVx7A0xaWdOMqVULJ6Z3TZv6KmHo0ztK6CkfxpHe3Th0pAuF0fLbn1u+9cmv3vW77bE3fGoSPi0BVfAvvPEHm9rPv//iooWz5m9Z/wCWZx+Go9UrN48QTD9IGMZ1cJIzTPisRQclPMrhME4W9mDfB2+i+2z/+TXz7/z2E7/85+9OIuGGE6BV3H77zm/d33nx6Ktr18zFg2t+DQude2n1tLJ8tcJ90vDhpG5Am7qTkJAQErywiLOld7G3/d9xvL0Hy1vWPbbtS3//00Q4hDeaAFXintrx1fu7+jp2r13bgofX/gaazbVkJQdLT9P6VqRFDSu2hIgXlBUBLgtCr3cce47/CMePX0Rr08qtzz7+8k8TpfKGtcKq1jPZre7oObyjdWkGd628l7AXwvMCeL7HjO6qrS8S1E5kTE9tfbiur665ccU9EB1EF9Ep0WXesEZIJb9j5/b/XUtzNrt29Rw0og2lchmBVqLo8LSAHlCixbTpddGm8Y7pjkttCCUP+JQy3FiatNuxdvUx9F4ayopO/OL9sQeEN4oA/eHn577oWPbGVes11PsrUBxjDafze1Te1VzouqnK2TgmLQljQqmrnAsT+iaPVb5b2co7EC+QhBgUeM1R1AcrsGp9Jy6+4W8U3fZ8r+e3EnOI2uaAX3l+zgNB4O9rW5/B8tY5WGo9BtOrJ4uMfUl+uj0B8HTmPXj8Pex86xVEnTDBBSE2r78fX9i09RPyZfT2A5ceIMSPwDOH8JH7Kk5+fAHtR0Zh6MZ9e7534Wc3wgO0sXLhD9OpFOa0egjGMhguD8BgTJooMfPbV1h/umz25ondcFP90IzY2iTgrfY9uH31aqSc9CeSEHkBEyITv28M8XMGc2/z0HGCpWCs8BS/9sWrDYOrJuCBZ+vu5sUfXbicia5kYGzUw4DWTwJKbApSjHuTBBjT2H68zg0MD4KlEwabZi0Y7wd85u/3O9/B6sVrPlEXeiF9nMmRxPt6Qf4y/HyIbh3HwkdF1zefGt5fUwK8wP2WAGwh02MFE/5ogYr3Qg/STL0W3d8aB1ppa+Pw0uI2Tz6/134Mg+UoIGZlZ2HMLaJYHkPICr6//RBamvPj/UA4dYKsegGrXqAXMaqNsDT6SreOY5Gu/FptCeBFN+caAphGiKFiGaOjA3AJHoGt6r7GgNbjqjo5yQkBUVHQ8PaJExjiaZ2yue12nO27gCNdHSptvf/xGdw11I2UZSmvCIJgQiJMhoEfeqpNDvUSRvUB5hMX9fUecg0aBi+Hm2uaAz633bmbm1VN8+h07LfKJdkOkQB2fL4BTlsj8No4YLG2putMSjwjp3QNvZdH8YsiExV501isFjU30lpF7D8dVfCA8sFHp7BuWYtaIwiCsCrCSDVhh9IX8k0CoHsoMQ84FrfFAE3zQAK0VaLzO9tK79XKAxSj+aYALt3XLfNipZD1v492YexrE/sP0zBgUIQIoYaflAXbz16CzyY6YKqYl8uheTarRioD7xAxCQHUpv18L1Yud+Iloujtk4zQo9WZcKURqjbHclzKvj0Gvcw8UA6oY2WqonSuGQGb5I+TJgEFEsB4daXzc0eopabcX13W0BXwgAnRZL4Q62s8ppnR/pFz/QjF+tRvxeIsY/cizGwRt83P4czACL8HdA1JUivCNGVogvdkNkgaGDNe4CvXFyJ8n+B5XGLJ1FmJXJ53AzjZKgGbatkKL5c/liNWIPO8uM/4VO2uKCQZjLmBqQAGJ4EmI8NMabDTOuyUobYXmPlCEpiqA1IkYdWSBpjpEDl6wsrF9aAjqHNOPXDyXAGprAknY5B0btOGGk/GlfE1taqofCNuuYNIJ+omOiZ1rpUHtEYWjkpWoP5EWV2sb5isA7aIQTHHxaIniNADui8PIs0Eb6SY/Z0UQc+j+mXYuoM7Vy/Age7zkBUyCZGLhRLSOYcWpfXFA1wPhqup8JNKq5UkKeoqSHxPLSoqnUQtw5ioc60IyE/VkOji8mYE2nZELNgCXLaOkGDFJBg4OzCMDEcxCfAzS1pQX5fHSNDLClLGwmwzls6vQ09hGFJYegdZ1hha2bqIBNelB5Qjog02TzpFNVEquYpMuTSYr/lcQPKPJHoRQ8W1GYO3lDgpO9pPWTEZEQGnuodg5Hyk66Lyd8fKOQQ6gqyWict7GeuWz8HQyWEFw+bB7ksF3Nk2V1nfpZTLQqSLslzXlDmHpsQ1osVoy/Solwf/GpdErpaAQUqjWxL2GWcWaSfAMIis7RBwiuCdtD1OgmNHBJCg7r4uZBnbdjaaq+3YewB+USYicY8juYPnMtloqdCjG3f39eO+3JKIAFadSiiZigBdgdcqItMxsmZbIbvUIKlzzQjoEgLGRjU2KTp8AjRCkzEnAG0mtQh8Ku0oAqok8JzP+Lw0MkB3jpKjKpapaL5WKZxafDdBqoC6O8LtyMAQhoZdzG7MwLU8FUYKPINcl+qimismRj26v2I71I3jDxfdpM41I6CTsmG4X0djKyc8RYu9t0Vl2QJbBJ5xFPiICJIg1hdhR3fs5HnWeldleZXABLA98b7Y5HtjkgwNEtbTN4iFC5oI3I1CTsAbsfVjAizJB3Qbx9HphRp6eqr3TDprSYA0FI/3ntOxbpUNM2OjpEcE6HYEWkhIKw+ICeBxi+T09F1WZU+iJq2n8fRDf4Ymu3XSrcOIgg8H9uOFn31fNUVC0oddZ7B5YxtDwlTgo66SEici2fokwCJjju0hw7J54WypQsB7tSRAza+H+nld30Y+m2b7SS+Qn9PKFl1egRciHIfWpxC8x+7tdA97+3zUcNyWX4Ci/THOoD2x/hmlQTox+3gDjWYeg/4gmF853xjBpUsjaGnJR24fu36FNzX5pmfY7EPStlSLIgb6gwk616QRYk8tS88/l/2PT/loyqbQkEmhPpNGNp1CmvtieQHvONGtL4sdy9Hjp5kkpTWmSzM7L529hErHs0cCpt2qW00BymDV3JXSU8HkAXKIjtNnedxS48m4Mr5cR9YlMrx+XTqNRmbP2ZkMOjvHKir/PNa5pouiitFjH44iZ6YwO5tFAy+eo6SdpOUJyhBQTJR+HT9HYLJaFve0PqQmTQLaVOCdmIRIWE+wrmWTzG8iAugF7qgWjSWkGbYa32EjJQTkGFv5dBZNJKCeHdb77UPXZP1rWhKLZ4Rqjv2Fz86lLMNlpusCY9BnqTNUIyTgrVhhs7rVq2KoW2TSxWlXLOCqWX4svmpzZdEjWvgQcdVWPnu+i4ClUS+HyLIFnsVf/9eBduw8eKYy2D1XMxO8Jg+IB9wl+3s/uAC3qKMpXY88m/ecnUHaSis3Na8Ab1UtaCh3j1y+sm8m9o0J+9Fv9MR4Zhw6DufTWasOebsOs+xZKHJOtvtQtertulrwV+0BtH5yWvyW7CxubsCTX9+KUQZ4ga7qmdGUFmrya8QWHwcxlReMF8Mw4QETrR8oy7tq2ivH5Tvya8n8aXZMGc4An/nRDpy52FfR8b5KCJCImt8YkYF/KDtnegfwz3sPodGajQajCTk9z/4mQ6iphMWv9AA9IeMWdyYdn+gBkVc5amwHWV6lHvVaI2YZzfinN95Ngv/htcT/p31CRNbdV8l8e++xD5HPNeHxhx5Bgf18kTN5T1kvjBfEjGjBJCai4gnjHqAnlvqS8e9NeujEjEul/NokDbai4V/2voafHD1S0evdWLeb8ojMNyly5fS//ffbcD0L33j4K4RX4rtMh/UUGLXmr6BWXN9MEFAhYfzmZ6hcXI+TpISRH8061Ui68gTWGUJP4aU9P8ZrB39S+Xkx1ummPSMkbebnJcxU1jm4D5eGhvB7j32HJcpUJHhxLIfxTZpxwGa8eKrHC51a9Tmp+N5P1RsQ01cJAwEflHw8/+pfYn/HgaQ+n7/a1vd6k+BUS2XvVD401TXhu488gQ0r71QUuLJsrWT8mSYtfkBMm0BAmFhNrgDX4oRqqeaJMw4c6TyIv/qPP0Xf8KUJ6sXuP1XluuEEyGsD5TXKgsqBNQvW4RtbnkDb4ttJQlGt/IQqLMJE7tWqOSBZCSrL6dFSqq3AnzhzDC/tewHt5w4nr3suvgN0+P8o3TeegFe3vYDHtj+xhLt/Q3kkeW5d693YuuHXsWHZPcixW4tCwo+trVU9QEs8G6HFqW5kdBiHTu3H64dfxpGuK8r665Tv7tz2D6e/tP23cT0E1OA5QR2iiIbs1i9u/9qTPPC12CtwlIofjZVvW/BZ3LVsC5bPW4u5DQuxaPay2NpRIuy61IkLA+dw8hdHceDUPpw49z9TXUysvWPXtl3bQ4yQtMJ1a18DAsbvRO/atvM5DXXPPbp9yzP8+GXBXTkngKYBdTWvE5RXdm87+HQEfLh2T57UIAdM95Js9+04LKSDbLzG31+Omxpx9xfxKR6AukkhMP0aKuUHsag5VEzE3fGSddsUVu6KFzIE+H/iJry0mX+bu8VfMwTMEDBDwAwBMwTMEHALv/5XgAEASpR5N6rB30UAAAAASUVORK5CYII=";
  22542. this._callbackGamepadConnected = ongamedpadconnected;
  22543. if (this.gamepadSupportAvailable) {
  22544. // Checking if the gamepad connected event is supported (like in Firefox)
  22545. if (this.gamepadEventSupported) {
  22546. window.addEventListener('gamepadconnected', function (evt) {
  22547. _this._onGamepadConnected(evt);
  22548. }, false);
  22549. window.addEventListener('gamepaddisconnected', function (evt) {
  22550. _this._onGamepadDisconnected(evt);
  22551. }, false);
  22552. } else {
  22553. this._startMonitoringGamepads();
  22554. }
  22555. if (!this.oneGamepadConnected) {
  22556. this._insertGamepadDOMInstructions();
  22557. }
  22558. } else {
  22559. this._insertGamepadDOMNotSupported();
  22560. }
  22561. }
  22562. Gamepads.prototype._insertGamepadDOMInstructions = function () {
  22563. Gamepads.gamepadDOMInfo = document.createElement("div");
  22564. var buttonAImage = document.createElement("img");
  22565. buttonAImage.src = this.buttonADataURL;
  22566. var spanMessage = document.createElement("span");
  22567. spanMessage.innerHTML = "<strong>to activate gamepad</strong>";
  22568. Gamepads.gamepadDOMInfo.appendChild(buttonAImage);
  22569. Gamepads.gamepadDOMInfo.appendChild(spanMessage);
  22570. Gamepads.gamepadDOMInfo.style.position = "absolute";
  22571. Gamepads.gamepadDOMInfo.style.width = "100%";
  22572. Gamepads.gamepadDOMInfo.style.height = "48px";
  22573. Gamepads.gamepadDOMInfo.style.bottom = "0px";
  22574. Gamepads.gamepadDOMInfo.style.backgroundColor = "rgba(1, 1, 1, 0.15)";
  22575. Gamepads.gamepadDOMInfo.style.textAlign = "center";
  22576. Gamepads.gamepadDOMInfo.style.zIndex = "10";
  22577. buttonAImage.style.position = "relative";
  22578. buttonAImage.style.bottom = "8px";
  22579. spanMessage.style.position = "relative";
  22580. spanMessage.style.fontSize = "32px";
  22581. spanMessage.style.bottom = "32px";
  22582. spanMessage.style.color = "green";
  22583. document.body.appendChild(Gamepads.gamepadDOMInfo);
  22584. };
  22585. Gamepads.prototype._insertGamepadDOMNotSupported = function () {
  22586. Gamepads.gamepadDOMInfo = document.createElement("div");
  22587. var spanMessage = document.createElement("span");
  22588. spanMessage.innerHTML = "<strong>gamepad not supported</strong>";
  22589. Gamepads.gamepadDOMInfo.appendChild(spanMessage);
  22590. Gamepads.gamepadDOMInfo.style.position = "absolute";
  22591. Gamepads.gamepadDOMInfo.style.width = "100%";
  22592. Gamepads.gamepadDOMInfo.style.height = "40px";
  22593. Gamepads.gamepadDOMInfo.style.bottom = "0px";
  22594. Gamepads.gamepadDOMInfo.style.backgroundColor = "rgba(1, 1, 1, 0.15)";
  22595. Gamepads.gamepadDOMInfo.style.textAlign = "center";
  22596. Gamepads.gamepadDOMInfo.style.zIndex = "10";
  22597. spanMessage.style.position = "relative";
  22598. spanMessage.style.fontSize = "32px";
  22599. spanMessage.style.color = "red";
  22600. document.body.appendChild(Gamepads.gamepadDOMInfo);
  22601. };
  22602. Gamepads.prototype.dispose = function () {
  22603. document.body.removeChild(Gamepads.gamepadDOMInfo);
  22604. };
  22605. Gamepads.prototype._onGamepadConnected = function (evt) {
  22606. var newGamepad = this._addNewGamepad(evt.gamepad);
  22607. if (this._callbackGamepadConnected)
  22608. this._callbackGamepadConnected(newGamepad);
  22609. this._startMonitoringGamepads();
  22610. };
  22611. Gamepads.prototype._addNewGamepad = function (gamepad) {
  22612. if (!this.oneGamepadConnected) {
  22613. this.oneGamepadConnected = true;
  22614. if (Gamepads.gamepadDOMInfo) {
  22615. document.body.removeChild(Gamepads.gamepadDOMInfo);
  22616. Gamepads.gamepadDOMInfo = null;
  22617. }
  22618. }
  22619. var newGamepad;
  22620. if (gamepad.id.search("Xbox 360") !== -1 || gamepad.id.search("xinput") !== -1) {
  22621. newGamepad = new BABYLON.Xbox360Pad(gamepad.id, gamepad.index, gamepad);
  22622. } else {
  22623. newGamepad = new BABYLON.GenericPad(gamepad.id, gamepad.index, gamepad);
  22624. }
  22625. this.babylonGamepads.push(newGamepad);
  22626. return newGamepad;
  22627. };
  22628. Gamepads.prototype._onGamepadDisconnected = function (evt) {
  22629. for (var i in this.babylonGamepads) {
  22630. if (this.babylonGamepads[i].index == evt.gamepad.index) {
  22631. this.babylonGamepads.splice(i, 1);
  22632. break;
  22633. }
  22634. }
  22635. // If no gamepads are left, stop the polling loop.
  22636. if (this.babylonGamepads.length == 0) {
  22637. this._stopMonitoringGamepads();
  22638. }
  22639. };
  22640. Gamepads.prototype._startMonitoringGamepads = function () {
  22641. if (!this.isMonitoring) {
  22642. this.isMonitoring = true;
  22643. this._checkGamepadsStatus();
  22644. }
  22645. };
  22646. Gamepads.prototype._stopMonitoringGamepads = function () {
  22647. this.isMonitoring = false;
  22648. };
  22649. Gamepads.prototype._checkGamepadsStatus = function () {
  22650. var _this = this;
  22651. // updating gamepad objects
  22652. this._updateGamepadObjects();
  22653. for (var i in this.babylonGamepads) {
  22654. this.babylonGamepads[i].update();
  22655. }
  22656. if (this.isMonitoring) {
  22657. if (window.requestAnimationFrame) {
  22658. window.requestAnimationFrame(function () {
  22659. _this._checkGamepadsStatus();
  22660. });
  22661. } else if (window.mozRequestAnimationFrame) {
  22662. window.mozRequestAnimationFrame(function () {
  22663. _this._checkGamepadsStatus();
  22664. });
  22665. } else if (window.webkitRequestAnimationFrame) {
  22666. window.webkitRequestAnimationFrame(function () {
  22667. _this._checkGamepadsStatus();
  22668. });
  22669. }
  22670. }
  22671. };
  22672. // This function is called only on Chrome, which does not yet support
  22673. // connection/disconnection events, but requires you to monitor
  22674. // an array for changes.
  22675. Gamepads.prototype._updateGamepadObjects = function () {
  22676. var gamepads = navigator.getGamepads ? navigator.getGamepads() : (navigator.webkitGetGamepads ? navigator.webkitGetGamepads() : []);
  22677. for (var i = 0; i < gamepads.length; i++) {
  22678. if (gamepads[i]) {
  22679. if (!(gamepads[i].index in this.babylonGamepads)) {
  22680. var newGamepad = this._addNewGamepad(gamepads[i]);
  22681. if (this._callbackGamepadConnected) {
  22682. this._callbackGamepadConnected(newGamepad);
  22683. }
  22684. } else {
  22685. this.babylonGamepads[i].browserGamepad = gamepads[i];
  22686. }
  22687. }
  22688. }
  22689. };
  22690. return Gamepads;
  22691. })();
  22692. BABYLON.Gamepads = Gamepads;
  22693. var StickValues = (function () {
  22694. function StickValues(x, y) {
  22695. this.x = x;
  22696. this.y = y;
  22697. }
  22698. return StickValues;
  22699. })();
  22700. BABYLON.StickValues = StickValues;
  22701. var Gamepad = (function () {
  22702. function Gamepad(id, index, browserGamepad) {
  22703. this.id = id;
  22704. this.index = index;
  22705. this.browserGamepad = browserGamepad;
  22706. if (this.browserGamepad.axes.length >= 2) {
  22707. this._leftStick = { x: this.browserGamepad.axes[0], y: this.browserGamepad.axes[1] };
  22708. }
  22709. if (this.browserGamepad.axes.length >= 4) {
  22710. this._rightStick = { x: this.browserGamepad.axes[2], y: this.browserGamepad.axes[3] };
  22711. }
  22712. }
  22713. Gamepad.prototype.onleftstickchanged = function (callback) {
  22714. this._onleftstickchanged = callback;
  22715. };
  22716. Gamepad.prototype.onrightstickchanged = function (callback) {
  22717. this._onrightstickchanged = callback;
  22718. };
  22719. Object.defineProperty(Gamepad.prototype, "leftStick", {
  22720. get: function () {
  22721. return this._leftStick;
  22722. },
  22723. set: function (newValues) {
  22724. if (this._onleftstickchanged && (this._leftStick.x !== newValues.x || this._leftStick.y !== newValues.y)) {
  22725. this._onleftstickchanged(newValues);
  22726. }
  22727. this._leftStick = newValues;
  22728. },
  22729. enumerable: true,
  22730. configurable: true
  22731. });
  22732. Object.defineProperty(Gamepad.prototype, "rightStick", {
  22733. get: function () {
  22734. return this._rightStick;
  22735. },
  22736. set: function (newValues) {
  22737. if (this._onrightstickchanged && (this._rightStick.x !== newValues.x || this._rightStick.y !== newValues.y)) {
  22738. this._onrightstickchanged(newValues);
  22739. }
  22740. this._rightStick = newValues;
  22741. },
  22742. enumerable: true,
  22743. configurable: true
  22744. });
  22745. Gamepad.prototype.update = function () {
  22746. if (this._leftStick) {
  22747. this.leftStick = { x: this.browserGamepad.axes[0], y: this.browserGamepad.axes[1] };
  22748. }
  22749. if (this._rightStick) {
  22750. this.rightStick = { x: this.browserGamepad.axes[2], y: this.browserGamepad.axes[3] };
  22751. }
  22752. };
  22753. return Gamepad;
  22754. })();
  22755. BABYLON.Gamepad = Gamepad;
  22756. var GenericPad = (function (_super) {
  22757. __extends(GenericPad, _super);
  22758. function GenericPad(id, index, gamepad) {
  22759. _super.call(this, id, index, gamepad);
  22760. this.id = id;
  22761. this.index = index;
  22762. this.gamepad = gamepad;
  22763. this._buttons = new Array(gamepad.buttons.length);
  22764. }
  22765. GenericPad.prototype.onbuttondown = function (callback) {
  22766. this._onbuttondown = callback;
  22767. };
  22768. GenericPad.prototype.onbuttonup = function (callback) {
  22769. this._onbuttonup = callback;
  22770. };
  22771. GenericPad.prototype._setButtonValue = function (newValue, currentValue, buttonIndex) {
  22772. if (newValue !== currentValue) {
  22773. if (this._onbuttondown && newValue === 1) {
  22774. this._onbuttondown(buttonIndex);
  22775. }
  22776. if (this._onbuttonup && newValue === 0) {
  22777. this._onbuttonup(buttonIndex);
  22778. }
  22779. }
  22780. return newValue;
  22781. };
  22782. GenericPad.prototype.update = function () {
  22783. _super.prototype.update.call(this);
  22784. for (var index = 0; index < this._buttons.length; index++) {
  22785. this._buttons[index] = this._setButtonValue(this.gamepad.buttons[index].value, this._buttons[index], index);
  22786. }
  22787. };
  22788. return GenericPad;
  22789. })(Gamepad);
  22790. BABYLON.GenericPad = GenericPad;
  22791. (function (Xbox360Button) {
  22792. Xbox360Button[Xbox360Button["A"] = 0] = "A";
  22793. Xbox360Button[Xbox360Button["B"] = 1] = "B";
  22794. Xbox360Button[Xbox360Button["X"] = 2] = "X";
  22795. Xbox360Button[Xbox360Button["Y"] = 3] = "Y";
  22796. Xbox360Button[Xbox360Button["Start"] = 4] = "Start";
  22797. Xbox360Button[Xbox360Button["Back"] = 5] = "Back";
  22798. Xbox360Button[Xbox360Button["LB"] = 6] = "LB";
  22799. Xbox360Button[Xbox360Button["RB"] = 7] = "RB";
  22800. Xbox360Button[Xbox360Button["LeftStick"] = 8] = "LeftStick";
  22801. Xbox360Button[Xbox360Button["RightStick"] = 9] = "RightStick";
  22802. })(BABYLON.Xbox360Button || (BABYLON.Xbox360Button = {}));
  22803. var Xbox360Button = BABYLON.Xbox360Button;
  22804. (function (Xbox360Dpad) {
  22805. Xbox360Dpad[Xbox360Dpad["Up"] = 0] = "Up";
  22806. Xbox360Dpad[Xbox360Dpad["Down"] = 1] = "Down";
  22807. Xbox360Dpad[Xbox360Dpad["Left"] = 2] = "Left";
  22808. Xbox360Dpad[Xbox360Dpad["Right"] = 3] = "Right";
  22809. })(BABYLON.Xbox360Dpad || (BABYLON.Xbox360Dpad = {}));
  22810. var Xbox360Dpad = BABYLON.Xbox360Dpad;
  22811. var Xbox360Pad = (function (_super) {
  22812. __extends(Xbox360Pad, _super);
  22813. function Xbox360Pad() {
  22814. _super.apply(this, arguments);
  22815. this._leftTrigger = 0;
  22816. this._rightTrigger = 0;
  22817. this._buttonA = 0;
  22818. this._buttonB = 0;
  22819. this._buttonX = 0;
  22820. this._buttonY = 0;
  22821. this._buttonBack = 0;
  22822. this._buttonStart = 0;
  22823. this._buttonLB = 0;
  22824. this._buttonRB = 0;
  22825. this._buttonLeftStick = 0;
  22826. this._buttonRightStick = 0;
  22827. this._dPadUp = 0;
  22828. this._dPadDown = 0;
  22829. this._dPadLeft = 0;
  22830. this._dPadRight = 0;
  22831. }
  22832. Xbox360Pad.prototype.onlefttriggerchanged = function (callback) {
  22833. this._onlefttriggerchanged = callback;
  22834. };
  22835. Xbox360Pad.prototype.onrighttriggerchanged = function (callback) {
  22836. this._onrighttriggerchanged = callback;
  22837. };
  22838. Object.defineProperty(Xbox360Pad.prototype, "leftTrigger", {
  22839. get: function () {
  22840. return this._leftTrigger;
  22841. },
  22842. set: function (newValue) {
  22843. if (this._onlefttriggerchanged && this._leftTrigger !== newValue) {
  22844. this._onlefttriggerchanged(newValue);
  22845. }
  22846. this._leftTrigger = newValue;
  22847. },
  22848. enumerable: true,
  22849. configurable: true
  22850. });
  22851. Object.defineProperty(Xbox360Pad.prototype, "rightTrigger", {
  22852. get: function () {
  22853. return this._rightTrigger;
  22854. },
  22855. set: function (newValue) {
  22856. if (this._onrighttriggerchanged && this._rightTrigger !== newValue) {
  22857. this._onrighttriggerchanged(newValue);
  22858. }
  22859. this._rightTrigger = newValue;
  22860. },
  22861. enumerable: true,
  22862. configurable: true
  22863. });
  22864. Xbox360Pad.prototype.onbuttondown = function (callback) {
  22865. this._onbuttondown = callback;
  22866. };
  22867. Xbox360Pad.prototype.onbuttonup = function (callback) {
  22868. this._onbuttonup = callback;
  22869. };
  22870. Xbox360Pad.prototype.ondpaddown = function (callback) {
  22871. this._ondpaddown = callback;
  22872. };
  22873. Xbox360Pad.prototype.ondpadup = function (callback) {
  22874. this._ondpadup = callback;
  22875. };
  22876. Xbox360Pad.prototype._setButtonValue = function (newValue, currentValue, buttonType) {
  22877. if (newValue !== currentValue) {
  22878. if (this._onbuttondown && newValue === 1) {
  22879. this._onbuttondown(buttonType);
  22880. }
  22881. if (this._onbuttonup && newValue === 0) {
  22882. this._onbuttonup(buttonType);
  22883. }
  22884. }
  22885. return newValue;
  22886. };
  22887. Xbox360Pad.prototype._setDPadValue = function (newValue, currentValue, buttonType) {
  22888. if (newValue !== currentValue) {
  22889. if (this._ondpaddown && newValue === 1) {
  22890. this._ondpaddown(buttonType);
  22891. }
  22892. if (this._ondpadup && newValue === 0) {
  22893. this._ondpadup(buttonType);
  22894. }
  22895. }
  22896. return newValue;
  22897. };
  22898. Object.defineProperty(Xbox360Pad.prototype, "buttonA", {
  22899. get: function () {
  22900. return this._buttonA;
  22901. },
  22902. set: function (value) {
  22903. this._buttonA = this._setButtonValue(value, this._buttonA, 0 /* A */);
  22904. },
  22905. enumerable: true,
  22906. configurable: true
  22907. });
  22908. Object.defineProperty(Xbox360Pad.prototype, "buttonB", {
  22909. get: function () {
  22910. return this._buttonB;
  22911. },
  22912. set: function (value) {
  22913. this._buttonB = this._setButtonValue(value, this._buttonB, 1 /* B */);
  22914. },
  22915. enumerable: true,
  22916. configurable: true
  22917. });
  22918. Object.defineProperty(Xbox360Pad.prototype, "buttonX", {
  22919. get: function () {
  22920. return this._buttonX;
  22921. },
  22922. set: function (value) {
  22923. this._buttonX = this._setButtonValue(value, this._buttonX, 2 /* X */);
  22924. },
  22925. enumerable: true,
  22926. configurable: true
  22927. });
  22928. Object.defineProperty(Xbox360Pad.prototype, "buttonY", {
  22929. get: function () {
  22930. return this._buttonY;
  22931. },
  22932. set: function (value) {
  22933. this._buttonY = this._setButtonValue(value, this._buttonY, 3 /* Y */);
  22934. },
  22935. enumerable: true,
  22936. configurable: true
  22937. });
  22938. Object.defineProperty(Xbox360Pad.prototype, "buttonStart", {
  22939. get: function () {
  22940. return this._buttonStart;
  22941. },
  22942. set: function (value) {
  22943. this._buttonStart = this._setButtonValue(value, this._buttonStart, 4 /* Start */);
  22944. },
  22945. enumerable: true,
  22946. configurable: true
  22947. });
  22948. Object.defineProperty(Xbox360Pad.prototype, "buttonBack", {
  22949. get: function () {
  22950. return this._buttonBack;
  22951. },
  22952. set: function (value) {
  22953. this._buttonBack = this._setButtonValue(value, this._buttonBack, 5 /* Back */);
  22954. },
  22955. enumerable: true,
  22956. configurable: true
  22957. });
  22958. Object.defineProperty(Xbox360Pad.prototype, "buttonLB", {
  22959. get: function () {
  22960. return this._buttonLB;
  22961. },
  22962. set: function (value) {
  22963. this._buttonLB = this._setButtonValue(value, this._buttonLB, 6 /* LB */);
  22964. },
  22965. enumerable: true,
  22966. configurable: true
  22967. });
  22968. Object.defineProperty(Xbox360Pad.prototype, "buttonRB", {
  22969. get: function () {
  22970. return this._buttonRB;
  22971. },
  22972. set: function (value) {
  22973. this._buttonRB = this._setButtonValue(value, this._buttonRB, 7 /* RB */);
  22974. },
  22975. enumerable: true,
  22976. configurable: true
  22977. });
  22978. Object.defineProperty(Xbox360Pad.prototype, "buttonLeftStick", {
  22979. get: function () {
  22980. return this._buttonLeftStick;
  22981. },
  22982. set: function (value) {
  22983. this._buttonLeftStick = this._setButtonValue(value, this._buttonLeftStick, 8 /* LeftStick */);
  22984. },
  22985. enumerable: true,
  22986. configurable: true
  22987. });
  22988. Object.defineProperty(Xbox360Pad.prototype, "buttonRightStick", {
  22989. get: function () {
  22990. return this._buttonRightStick;
  22991. },
  22992. set: function (value) {
  22993. this._buttonRightStick = this._setButtonValue(value, this._buttonRightStick, 9 /* RightStick */);
  22994. },
  22995. enumerable: true,
  22996. configurable: true
  22997. });
  22998. Object.defineProperty(Xbox360Pad.prototype, "dPadUp", {
  22999. get: function () {
  23000. return this._dPadUp;
  23001. },
  23002. set: function (value) {
  23003. this._dPadUp = this._setDPadValue(value, this._dPadUp, 0 /* Up */);
  23004. },
  23005. enumerable: true,
  23006. configurable: true
  23007. });
  23008. Object.defineProperty(Xbox360Pad.prototype, "dPadDown", {
  23009. get: function () {
  23010. return this._dPadDown;
  23011. },
  23012. set: function (value) {
  23013. this._dPadDown = this._setDPadValue(value, this._dPadDown, 1 /* Down */);
  23014. },
  23015. enumerable: true,
  23016. configurable: true
  23017. });
  23018. Object.defineProperty(Xbox360Pad.prototype, "dPadLeft", {
  23019. get: function () {
  23020. return this._dPadLeft;
  23021. },
  23022. set: function (value) {
  23023. this._dPadLeft = this._setDPadValue(value, this._dPadLeft, 2 /* Left */);
  23024. },
  23025. enumerable: true,
  23026. configurable: true
  23027. });
  23028. Object.defineProperty(Xbox360Pad.prototype, "dPadRight", {
  23029. get: function () {
  23030. return this._dPadRight;
  23031. },
  23032. set: function (value) {
  23033. this._dPadRight = this._setDPadValue(value, this._dPadRight, 3 /* Right */);
  23034. },
  23035. enumerable: true,
  23036. configurable: true
  23037. });
  23038. Xbox360Pad.prototype.update = function () {
  23039. _super.prototype.update.call(this);
  23040. this.buttonA = this.browserGamepad.buttons[0].value;
  23041. this.buttonB = this.browserGamepad.buttons[1].value;
  23042. this.buttonX = this.browserGamepad.buttons[2].value;
  23043. this.buttonY = this.browserGamepad.buttons[3].value;
  23044. this.buttonLB = this.browserGamepad.buttons[4].value;
  23045. this.buttonRB = this.browserGamepad.buttons[5].value;
  23046. this.leftTrigger = this.browserGamepad.buttons[6].value;
  23047. this.rightTrigger = this.browserGamepad.buttons[7].value;
  23048. this.buttonBack = this.browserGamepad.buttons[8].value;
  23049. this.buttonStart = this.browserGamepad.buttons[9].value;
  23050. this.buttonLeftStick = this.browserGamepad.buttons[10].value;
  23051. this.buttonRightStick = this.browserGamepad.buttons[11].value;
  23052. this.dPadUp = this.browserGamepad.buttons[12].value;
  23053. this.dPadDown = this.browserGamepad.buttons[13].value;
  23054. this.dPadLeft = this.browserGamepad.buttons[14].value;
  23055. this.dPadRight = this.browserGamepad.buttons[15].value;
  23056. };
  23057. return Xbox360Pad;
  23058. })(Gamepad);
  23059. BABYLON.Xbox360Pad = Xbox360Pad;
  23060. })(BABYLON || (BABYLON = {}));
  23061. //# sourceMappingURL=babylon.gamepads.js.map
  23062. var BABYLON;
  23063. (function (BABYLON) {
  23064. // We're mainly based on the logic defined into the FreeCamera code
  23065. var GamepadCamera = (function (_super) {
  23066. __extends(GamepadCamera, _super);
  23067. function GamepadCamera(name, position, scene) {
  23068. var _this = this;
  23069. _super.call(this, name, position, scene);
  23070. this.angularSensibility = 200;
  23071. this.moveSensibility = 75;
  23072. this._gamepads = new BABYLON.Gamepads(function (gamepad) {
  23073. _this._onNewGameConnected(gamepad);
  23074. });
  23075. }
  23076. GamepadCamera.prototype._onNewGameConnected = function (gamepad) {
  23077. // Only the first gamepad can control the camera
  23078. if (gamepad.index === 0) {
  23079. this._gamepad = gamepad;
  23080. }
  23081. };
  23082. GamepadCamera.prototype._checkInputs = function () {
  23083. if (!this._gamepad) {
  23084. return;
  23085. }
  23086. var LSValues = this._gamepad.leftStick;
  23087. var normalizedLX = LSValues.x / this.moveSensibility;
  23088. var normalizedLY = LSValues.y / this.moveSensibility;
  23089. LSValues.x = Math.abs(normalizedLX) > 0.005 ? 0 + normalizedLX : 0;
  23090. LSValues.y = Math.abs(normalizedLY) > 0.005 ? 0 + normalizedLY : 0;
  23091. var RSValues = this._gamepad.rightStick;
  23092. var normalizedRX = RSValues.x / this.angularSensibility;
  23093. var normalizedRY = RSValues.y / this.angularSensibility;
  23094. RSValues.x = Math.abs(normalizedRX) > 0.001 ? 0 + normalizedRX : 0;
  23095. RSValues.y = Math.abs(normalizedRY) > 0.001 ? 0 + normalizedRY : 0;
  23096. ;
  23097. var cameraTransform = BABYLON.Matrix.RotationYawPitchRoll(this.rotation.y, this.rotation.x, 0);
  23098. var deltaTransform = BABYLON.Vector3.TransformCoordinates(new BABYLON.Vector3(LSValues.x, 0, -LSValues.y), cameraTransform);
  23099. this.cameraDirection = this.cameraDirection.add(deltaTransform);
  23100. this.cameraRotation = this.cameraRotation.add(new BABYLON.Vector2(RSValues.y, RSValues.x));
  23101. };
  23102. GamepadCamera.prototype.dispose = function () {
  23103. this._gamepads.dispose();
  23104. _super.prototype.dispose.call(this);
  23105. };
  23106. return GamepadCamera;
  23107. })(BABYLON.FreeCamera);
  23108. BABYLON.GamepadCamera = GamepadCamera;
  23109. })(BABYLON || (BABYLON = {}));
  23110. //# sourceMappingURL=babylon.gamepadCamera.js.map
  23111. var BABYLON;
  23112. (function (BABYLON) {
  23113. var LinesMesh = (function (_super) {
  23114. __extends(LinesMesh, _super);
  23115. function LinesMesh(name, scene, updatable) {
  23116. if (typeof updatable === "undefined") { updatable = false; }
  23117. _super.call(this, name, scene);
  23118. this.color = new BABYLON.Color3(1, 1, 1);
  23119. this.alpha = 1;
  23120. this._indices = new Array();
  23121. this._colorShader = new BABYLON.ShaderMaterial("colorShader", scene, "color", {
  23122. attributes: ["position"],
  23123. uniforms: ["worldViewProjection", "color"],
  23124. needAlphaBlending: true
  23125. });
  23126. }
  23127. Object.defineProperty(LinesMesh.prototype, "material", {
  23128. get: function () {
  23129. return this._colorShader;
  23130. },
  23131. enumerable: true,
  23132. configurable: true
  23133. });
  23134. Object.defineProperty(LinesMesh.prototype, "isPickable", {
  23135. get: function () {
  23136. return false;
  23137. },
  23138. enumerable: true,
  23139. configurable: true
  23140. });
  23141. Object.defineProperty(LinesMesh.prototype, "checkCollisions", {
  23142. get: function () {
  23143. return false;
  23144. },
  23145. enumerable: true,
  23146. configurable: true
  23147. });
  23148. LinesMesh.prototype._bind = function (subMesh, effect, fillMode) {
  23149. var engine = this.getScene().getEngine();
  23150. var indexToBind = this._geometry.getIndexBuffer();
  23151. // VBOs
  23152. engine.bindBuffers(this._geometry.getVertexBuffer(BABYLON.VertexBuffer.PositionKind).getBuffer(), indexToBind, [3], 3 * 4, this._colorShader.getEffect());
  23153. // Color
  23154. this._colorShader.setColor4("color", this.color.toColor4(this.alpha));
  23155. };
  23156. LinesMesh.prototype._draw = function (subMesh, fillMode, instancesCount) {
  23157. if (!this._geometry || !this._geometry.getVertexBuffers() || !this._geometry.getIndexBuffer()) {
  23158. return;
  23159. }
  23160. var engine = this.getScene().getEngine();
  23161. // Draw order
  23162. engine.draw(false, subMesh.indexStart, subMesh.indexCount);
  23163. };
  23164. LinesMesh.prototype.intersects = function (ray, fastCheck) {
  23165. return null;
  23166. };
  23167. LinesMesh.prototype.dispose = function (doNotRecurse) {
  23168. this._colorShader.dispose();
  23169. _super.prototype.dispose.call(this, doNotRecurse);
  23170. };
  23171. return LinesMesh;
  23172. })(BABYLON.Mesh);
  23173. BABYLON.LinesMesh = LinesMesh;
  23174. })(BABYLON || (BABYLON = {}));
  23175. //# sourceMappingURL=babylon.linesMesh.js.map
  23176. var BABYLON;
  23177. (function (BABYLON) {
  23178. var OutlineRenderer = (function () {
  23179. function OutlineRenderer(scene) {
  23180. this._scene = scene;
  23181. }
  23182. OutlineRenderer.prototype.render = function (subMesh, batch, useOverlay) {
  23183. if (typeof useOverlay === "undefined") { useOverlay = false; }
  23184. var scene = this._scene;
  23185. var engine = this._scene.getEngine();
  23186. var hardwareInstancedRendering = (engine.getCaps().instancedArrays !== null) && (batch.visibleInstances[subMesh._id] !== null) && (batch.visibleInstances[subMesh._id] !== undefined);
  23187. if (!this.isReady(subMesh, hardwareInstancedRendering)) {
  23188. return;
  23189. }
  23190. var mesh = subMesh.getRenderingMesh();
  23191. var material = subMesh.getMaterial();
  23192. engine.enableEffect(this._effect);
  23193. this._effect.setFloat("offset", useOverlay ? 0 : mesh.outlineWidth);
  23194. this._effect.setColor4("color", useOverlay ? mesh.overlayColor : mesh.outlineColor, useOverlay ? mesh.overlayAlpha : 1.0);
  23195. this._effect.setMatrix("viewProjection", scene.getTransformMatrix());
  23196. // Bones
  23197. var useBones = mesh.skeleton && scene.skeletonsEnabled && mesh.isVerticesDataPresent(BABYLON.VertexBuffer.MatricesIndicesKind) && mesh.isVerticesDataPresent(BABYLON.VertexBuffer.MatricesWeightsKind);
  23198. if (useBones) {
  23199. this._effect.setMatrices("mBones", mesh.skeleton.getTransformMatrices());
  23200. }
  23201. mesh._bind(subMesh, this._effect, BABYLON.Material.TriangleFillMode);
  23202. // Alpha test
  23203. if (material && material.needAlphaTesting()) {
  23204. var alphaTexture = material.getAlphaTestTexture();
  23205. this._effect.setTexture("diffuseSampler", alphaTexture);
  23206. this._effect.setMatrix("diffuseMatrix", alphaTexture.getTextureMatrix());
  23207. }
  23208. if (hardwareInstancedRendering) {
  23209. mesh._renderWithInstances(subMesh, BABYLON.Material.TriangleFillMode, batch, this._effect, engine);
  23210. } else {
  23211. if (batch.renderSelf[subMesh._id]) {
  23212. this._effect.setMatrix("world", mesh.getWorldMatrix());
  23213. // Draw
  23214. mesh._draw(subMesh, BABYLON.Material.TriangleFillMode);
  23215. }
  23216. if (batch.visibleInstances[subMesh._id]) {
  23217. for (var instanceIndex = 0; instanceIndex < batch.visibleInstances[subMesh._id].length; instanceIndex++) {
  23218. var instance = batch.visibleInstances[subMesh._id][instanceIndex];
  23219. this._effect.setMatrix("world", instance.getWorldMatrix());
  23220. // Draw
  23221. mesh._draw(subMesh, BABYLON.Material.TriangleFillMode);
  23222. }
  23223. }
  23224. }
  23225. };
  23226. OutlineRenderer.prototype.isReady = function (subMesh, useInstances) {
  23227. var defines = [];
  23228. var attribs = [BABYLON.VertexBuffer.PositionKind, BABYLON.VertexBuffer.NormalKind];
  23229. var mesh = subMesh.getMesh();
  23230. var material = subMesh.getMaterial();
  23231. // Alpha test
  23232. if (material && material.needAlphaTesting()) {
  23233. defines.push("#define ALPHATEST");
  23234. if (mesh.isVerticesDataPresent(BABYLON.VertexBuffer.UVKind)) {
  23235. attribs.push(BABYLON.VertexBuffer.UVKind);
  23236. defines.push("#define UV1");
  23237. }
  23238. if (mesh.isVerticesDataPresent(BABYLON.VertexBuffer.UV2Kind)) {
  23239. attribs.push(BABYLON.VertexBuffer.UV2Kind);
  23240. defines.push("#define UV2");
  23241. }
  23242. }
  23243. // Bones
  23244. if (mesh.skeleton && mesh.isVerticesDataPresent(BABYLON.VertexBuffer.MatricesIndicesKind) && mesh.isVerticesDataPresent(BABYLON.VertexBuffer.MatricesWeightsKind)) {
  23245. attribs.push(BABYLON.VertexBuffer.MatricesIndicesKind);
  23246. attribs.push(BABYLON.VertexBuffer.MatricesWeightsKind);
  23247. defines.push("#define BONES");
  23248. defines.push("#define BonesPerMesh " + (mesh.skeleton.bones.length + 1));
  23249. }
  23250. // Instances
  23251. if (useInstances) {
  23252. defines.push("#define INSTANCES");
  23253. attribs.push("world0");
  23254. attribs.push("world1");
  23255. attribs.push("world2");
  23256. attribs.push("world3");
  23257. }
  23258. // Get correct effect
  23259. var join = defines.join("\n");
  23260. if (this._cachedDefines != join) {
  23261. this._cachedDefines = join;
  23262. this._effect = this._scene.getEngine().createEffect("outline", attribs, ["world", "mBones", "viewProjection", "diffuseMatrix", "offset", "color"], ["diffuseSampler"], join);
  23263. }
  23264. return this._effect.isReady();
  23265. };
  23266. return OutlineRenderer;
  23267. })();
  23268. BABYLON.OutlineRenderer = OutlineRenderer;
  23269. })(BABYLON || (BABYLON = {}));
  23270. //# sourceMappingURL=babylon.outlineRenderer.js.map
  23271. var BABYLON;
  23272. (function (BABYLON) {
  23273. var MeshAssetTask = (function () {
  23274. function MeshAssetTask(name, meshesNames, rootUrl, sceneFilename) {
  23275. this.name = name;
  23276. this.meshesNames = meshesNames;
  23277. this.rootUrl = rootUrl;
  23278. this.sceneFilename = sceneFilename;
  23279. this.isCompleted = false;
  23280. }
  23281. MeshAssetTask.prototype.run = function (scene, onSuccess, onError) {
  23282. var _this = this;
  23283. BABYLON.SceneLoader.ImportMesh(this.meshesNames, this.rootUrl, this.sceneFilename, scene, function (meshes, particleSystems, skeletons) {
  23284. _this.loadedMeshes = meshes;
  23285. _this.loadedParticleSystems = particleSystems;
  23286. _this.loadedSkeletons = skeletons;
  23287. _this.isCompleted = true;
  23288. if (_this.onSuccess) {
  23289. _this.onSuccess(_this);
  23290. }
  23291. onSuccess();
  23292. }, null, function () {
  23293. if (_this.onError) {
  23294. _this.onError(_this);
  23295. }
  23296. onError();
  23297. });
  23298. };
  23299. return MeshAssetTask;
  23300. })();
  23301. BABYLON.MeshAssetTask = MeshAssetTask;
  23302. var TextFileAssetTask = (function () {
  23303. function TextFileAssetTask(name, url) {
  23304. this.name = name;
  23305. this.url = url;
  23306. this.isCompleted = false;
  23307. }
  23308. TextFileAssetTask.prototype.run = function (scene, onSuccess, onError) {
  23309. var _this = this;
  23310. BABYLON.Tools.LoadFile(this.url, function (data) {
  23311. _this.text = data;
  23312. _this.isCompleted = true;
  23313. if (_this.onSuccess) {
  23314. _this.onSuccess(_this);
  23315. }
  23316. onSuccess();
  23317. }, null, scene.database, false, function () {
  23318. if (_this.onError) {
  23319. _this.onError(_this);
  23320. }
  23321. onError();
  23322. });
  23323. };
  23324. return TextFileAssetTask;
  23325. })();
  23326. BABYLON.TextFileAssetTask = TextFileAssetTask;
  23327. var BinaryFileAssetTask = (function () {
  23328. function BinaryFileAssetTask(name, url) {
  23329. this.name = name;
  23330. this.url = url;
  23331. this.isCompleted = false;
  23332. }
  23333. BinaryFileAssetTask.prototype.run = function (scene, onSuccess, onError) {
  23334. var _this = this;
  23335. BABYLON.Tools.LoadFile(this.url, function (data) {
  23336. _this.data = data;
  23337. _this.isCompleted = true;
  23338. if (_this.onSuccess) {
  23339. _this.onSuccess(_this);
  23340. }
  23341. onSuccess();
  23342. }, null, scene.database, true, function () {
  23343. if (_this.onError) {
  23344. _this.onError(_this);
  23345. }
  23346. onError();
  23347. });
  23348. };
  23349. return BinaryFileAssetTask;
  23350. })();
  23351. BABYLON.BinaryFileAssetTask = BinaryFileAssetTask;
  23352. var ImageAssetTask = (function () {
  23353. function ImageAssetTask(name, url) {
  23354. this.name = name;
  23355. this.url = url;
  23356. this.isCompleted = false;
  23357. }
  23358. ImageAssetTask.prototype.run = function (scene, onSuccess, onError) {
  23359. var _this = this;
  23360. var img = new Image();
  23361. img.onload = function () {
  23362. _this.image = img;
  23363. _this.isCompleted = true;
  23364. if (_this.onSuccess) {
  23365. _this.onSuccess(_this);
  23366. }
  23367. onSuccess();
  23368. };
  23369. img.onerror = function () {
  23370. if (_this.onError) {
  23371. _this.onError(_this);
  23372. }
  23373. onError();
  23374. };
  23375. img.src = this.url;
  23376. };
  23377. return ImageAssetTask;
  23378. })();
  23379. BABYLON.ImageAssetTask = ImageAssetTask;
  23380. var TextureAssetTask = (function () {
  23381. function TextureAssetTask(name, url, noMipmap, invertY, samplingMode) {
  23382. if (typeof samplingMode === "undefined") { samplingMode = BABYLON.Texture.TRILINEAR_SAMPLINGMODE; }
  23383. this.name = name;
  23384. this.url = url;
  23385. this.noMipmap = noMipmap;
  23386. this.invertY = invertY;
  23387. this.samplingMode = samplingMode;
  23388. this.isCompleted = false;
  23389. }
  23390. TextureAssetTask.prototype.run = function (scene, onSuccess, onError) {
  23391. var _this = this;
  23392. var onload = function () {
  23393. _this.isCompleted = true;
  23394. if (_this.onSuccess) {
  23395. _this.onSuccess(_this);
  23396. }
  23397. onSuccess();
  23398. };
  23399. var onerror = function () {
  23400. if (_this.onError) {
  23401. _this.onError(_this);
  23402. }
  23403. onError();
  23404. };
  23405. this.texture = new BABYLON.Texture(this.url, scene, this.noMipmap, this.invertY, this.samplingMode, onload, onError);
  23406. };
  23407. return TextureAssetTask;
  23408. })();
  23409. BABYLON.TextureAssetTask = TextureAssetTask;
  23410. var AssetsManager = (function () {
  23411. function AssetsManager(scene) {
  23412. this._tasks = new Array();
  23413. this._waitingTasksCount = 0;
  23414. this.useDefaultLoadingScreen = true;
  23415. this._scene = scene;
  23416. }
  23417. AssetsManager.prototype.addMeshTask = function (taskName, meshesNames, rootUrl, sceneFilename) {
  23418. var task = new MeshAssetTask(taskName, meshesNames, rootUrl, sceneFilename);
  23419. this._tasks.push(task);
  23420. return task;
  23421. };
  23422. AssetsManager.prototype.addTextFileTask = function (taskName, url) {
  23423. var task = new TextFileAssetTask(taskName, url);
  23424. this._tasks.push(task);
  23425. return task;
  23426. };
  23427. AssetsManager.prototype.addBinaryFileTask = function (taskName, url) {
  23428. var task = new BinaryFileAssetTask(taskName, url);
  23429. this._tasks.push(task);
  23430. return task;
  23431. };
  23432. AssetsManager.prototype.addImageTask = function (taskName, url) {
  23433. var task = new ImageAssetTask(taskName, url);
  23434. this._tasks.push(task);
  23435. return task;
  23436. };
  23437. AssetsManager.prototype.addTextureTask = function (taskName, url, noMipmap, invertY, samplingMode) {
  23438. if (typeof samplingMode === "undefined") { samplingMode = BABYLON.Texture.TRILINEAR_SAMPLINGMODE; }
  23439. var task = new TextureAssetTask(taskName, url, noMipmap, invertY, samplingMode);
  23440. this._tasks.push(task);
  23441. return task;
  23442. };
  23443. AssetsManager.prototype._decreaseWaitingTasksCount = function () {
  23444. this._waitingTasksCount--;
  23445. if (this._waitingTasksCount === 0) {
  23446. if (this.onFinish) {
  23447. this.onFinish(this._tasks);
  23448. }
  23449. this._scene.getEngine().hideLoadingUI();
  23450. }
  23451. };
  23452. AssetsManager.prototype._runTask = function (task) {
  23453. var _this = this;
  23454. task.run(this._scene, function () {
  23455. if (_this.onTaskSuccess) {
  23456. _this.onTaskSuccess(task);
  23457. }
  23458. _this._decreaseWaitingTasksCount();
  23459. }, function () {
  23460. if (_this.onTaskError) {
  23461. _this.onTaskError(task);
  23462. }
  23463. _this._decreaseWaitingTasksCount();
  23464. });
  23465. };
  23466. AssetsManager.prototype.reset = function () {
  23467. this._tasks = new Array();
  23468. return this;
  23469. };
  23470. AssetsManager.prototype.load = function () {
  23471. this._waitingTasksCount = this._tasks.length;
  23472. if (this._waitingTasksCount === 0) {
  23473. if (this.onFinish) {
  23474. this.onFinish(this._tasks);
  23475. }
  23476. return this;
  23477. }
  23478. if (this.useDefaultLoadingScreen) {
  23479. this._scene.getEngine().displayLoadingUI();
  23480. }
  23481. for (var index = 0; index < this._tasks.length; index++) {
  23482. var task = this._tasks[index];
  23483. this._runTask(task);
  23484. }
  23485. return this;
  23486. };
  23487. return AssetsManager;
  23488. })();
  23489. BABYLON.AssetsManager = AssetsManager;
  23490. })(BABYLON || (BABYLON = {}));
  23491. //# sourceMappingURL=babylon.assetsManager.js.map
  23492. var BABYLON;
  23493. (function (BABYLON) {
  23494. var VRDeviceOrientationCamera = (function (_super) {
  23495. __extends(VRDeviceOrientationCamera, _super);
  23496. function VRDeviceOrientationCamera(name, position, scene) {
  23497. _super.call(this, name, position, scene);
  23498. this._alpha = 0;
  23499. this._beta = 0;
  23500. this._gamma = 0;
  23501. }
  23502. VRDeviceOrientationCamera.prototype._onOrientationEvent = function (evt) {
  23503. this._alpha = +evt.alpha | 0;
  23504. this._beta = +evt.beta | 0;
  23505. this._gamma = +evt.gamma | 0;
  23506. if (this._gamma < 0) {
  23507. this._gamma = 90 + this._gamma;
  23508. } else {
  23509. // Incline it in the correct angle.
  23510. this._gamma = 270 - this._gamma;
  23511. }
  23512. this.rotation.x = this._gamma / 180.0 * Math.PI;
  23513. this.rotation.y = -this._alpha / 180.0 * Math.PI;
  23514. this.rotation.z = this._beta / 180.0 * Math.PI;
  23515. };
  23516. return VRDeviceOrientationCamera;
  23517. })(BABYLON.OculusCamera);
  23518. BABYLON.VRDeviceOrientationCamera = VRDeviceOrientationCamera;
  23519. })(BABYLON || (BABYLON = {}));
  23520. //# sourceMappingURL=babylon.vrDeviceOrientationCamera.js.map
  23521. var BABYLON;
  23522. (function (BABYLON) {
  23523. var WebVRCamera = (function (_super) {
  23524. __extends(WebVRCamera, _super);
  23525. function WebVRCamera(name, position, scene) {
  23526. _super.call(this, name, position, scene);
  23527. this._hmdDevice = null;
  23528. this._sensorDevice = null;
  23529. this._cacheState = null;
  23530. this._cacheQuaternion = new BABYLON.Quaternion();
  23531. this._cacheRotation = BABYLON.Vector3.Zero();
  23532. this._vrEnabled = false;
  23533. this._getWebVRDevices = this._getWebVRDevices.bind(this);
  23534. }
  23535. WebVRCamera.prototype._getWebVRDevices = function (devices) {
  23536. var size = devices.length;
  23537. var i = 0;
  23538. // Reset devices.
  23539. this._sensorDevice = null;
  23540. this._hmdDevice = null;
  23541. while (i < size && this._hmdDevice === null) {
  23542. if (devices[i] instanceof HMDVRDevice) {
  23543. this._hmdDevice = devices[i];
  23544. }
  23545. i++;
  23546. }
  23547. i = 0;
  23548. while (i < size && this._sensorDevice === null) {
  23549. if (devices[i] instanceof PositionSensorVRDevice && (!this._hmdDevice || devices[i].hardwareUnitId === this._hmdDevice.hardwareUnitId)) {
  23550. this._sensorDevice = devices[i];
  23551. }
  23552. i++;
  23553. }
  23554. this._vrEnabled = this._sensorDevice && this._hmdDevice ? true : false;
  23555. };
  23556. WebVRCamera.prototype._update = function () {
  23557. if (this._vrEnabled) {
  23558. this._cacheState = this._sensorDevice.getState();
  23559. this._cacheQuaternion.copyFromFloats(this._cacheState.orientation.x, this._cacheState.orientation.y, this._cacheState.orientation.z, this._cacheState.orientation.w);
  23560. this._cacheQuaternion.toEulerAnglesToRef(this._cacheRotation);
  23561. this.rotation.x = -this._cacheRotation.z;
  23562. this.rotation.y = -this._cacheRotation.y;
  23563. this.rotation.z = this._cacheRotation.x;
  23564. }
  23565. _super.prototype._update.call(this);
  23566. };
  23567. WebVRCamera.prototype.attachControl = function (element, noPreventDefault) {
  23568. _super.prototype.attachControl.call(this, element, noPreventDefault);
  23569. if (navigator.getVRDevices) {
  23570. navigator.getVRDevices().then(this._getWebVRDevices);
  23571. } else if (navigator.mozGetVRDevices) {
  23572. navigator.mozGetVRDevices(this._getWebVRDevices);
  23573. }
  23574. };
  23575. WebVRCamera.prototype.detachControl = function (element) {
  23576. _super.prototype.detachControl.call(this, element);
  23577. this._vrEnabled = false;
  23578. };
  23579. return WebVRCamera;
  23580. })(BABYLON.OculusCamera);
  23581. BABYLON.WebVRCamera = WebVRCamera;
  23582. })(BABYLON || (BABYLON = {}));
  23583. //# sourceMappingURL=babylon.webVRCamera.js.map
  23584. var BABYLON;
  23585. (function (BABYLON) {
  23586. // Standard optimizations
  23587. var SceneOptimization = (function () {
  23588. function SceneOptimization(priority) {
  23589. if (typeof priority === "undefined") { priority = 0; }
  23590. this.priority = priority;
  23591. this.apply = function (scene) {
  23592. return true;
  23593. };
  23594. }
  23595. return SceneOptimization;
  23596. })();
  23597. BABYLON.SceneOptimization = SceneOptimization;
  23598. var TextureOptimization = (function (_super) {
  23599. __extends(TextureOptimization, _super);
  23600. function TextureOptimization(priority, maximumSize) {
  23601. if (typeof priority === "undefined") { priority = 0; }
  23602. if (typeof maximumSize === "undefined") { maximumSize = 1024; }
  23603. var _this = this;
  23604. _super.call(this, priority);
  23605. this.priority = priority;
  23606. this.maximumSize = maximumSize;
  23607. this.apply = function (scene) {
  23608. var allDone = true;
  23609. for (var index = 0; index < scene.textures.length; index++) {
  23610. var texture = scene.textures[index];
  23611. if (!texture.canRescale) {
  23612. continue;
  23613. }
  23614. var currentSize = texture.getSize();
  23615. var maxDimension = Math.max(currentSize.width, currentSize.height);
  23616. if (maxDimension > _this.maximumSize) {
  23617. texture.scale(0.5);
  23618. allDone = false;
  23619. }
  23620. }
  23621. return allDone;
  23622. };
  23623. }
  23624. return TextureOptimization;
  23625. })(SceneOptimization);
  23626. BABYLON.TextureOptimization = TextureOptimization;
  23627. var HardwareScalingOptimization = (function (_super) {
  23628. __extends(HardwareScalingOptimization, _super);
  23629. function HardwareScalingOptimization(priority, maximumScale) {
  23630. if (typeof priority === "undefined") { priority = 0; }
  23631. if (typeof maximumScale === "undefined") { maximumScale = 2; }
  23632. var _this = this;
  23633. _super.call(this, priority);
  23634. this.priority = priority;
  23635. this.maximumScale = maximumScale;
  23636. this._currentScale = 1;
  23637. this.apply = function (scene) {
  23638. _this._currentScale++;
  23639. scene.getEngine().setHardwareScalingLevel(_this._currentScale);
  23640. return _this._currentScale >= _this.maximumScale;
  23641. };
  23642. }
  23643. return HardwareScalingOptimization;
  23644. })(SceneOptimization);
  23645. BABYLON.HardwareScalingOptimization = HardwareScalingOptimization;
  23646. var ShadowsOptimization = (function (_super) {
  23647. __extends(ShadowsOptimization, _super);
  23648. function ShadowsOptimization() {
  23649. _super.apply(this, arguments);
  23650. this.apply = function (scene) {
  23651. scene.shadowsEnabled = false;
  23652. return true;
  23653. };
  23654. }
  23655. return ShadowsOptimization;
  23656. })(SceneOptimization);
  23657. BABYLON.ShadowsOptimization = ShadowsOptimization;
  23658. var PostProcessesOptimization = (function (_super) {
  23659. __extends(PostProcessesOptimization, _super);
  23660. function PostProcessesOptimization() {
  23661. _super.apply(this, arguments);
  23662. this.apply = function (scene) {
  23663. scene.postProcessesEnabled = false;
  23664. return true;
  23665. };
  23666. }
  23667. return PostProcessesOptimization;
  23668. })(SceneOptimization);
  23669. BABYLON.PostProcessesOptimization = PostProcessesOptimization;
  23670. var LensFlaresOptimization = (function (_super) {
  23671. __extends(LensFlaresOptimization, _super);
  23672. function LensFlaresOptimization() {
  23673. _super.apply(this, arguments);
  23674. this.apply = function (scene) {
  23675. scene.lensFlaresEnabled = false;
  23676. return true;
  23677. };
  23678. }
  23679. return LensFlaresOptimization;
  23680. })(SceneOptimization);
  23681. BABYLON.LensFlaresOptimization = LensFlaresOptimization;
  23682. var ParticlesOptimization = (function (_super) {
  23683. __extends(ParticlesOptimization, _super);
  23684. function ParticlesOptimization() {
  23685. _super.apply(this, arguments);
  23686. this.apply = function (scene) {
  23687. scene.particlesEnabled = false;
  23688. return true;
  23689. };
  23690. }
  23691. return ParticlesOptimization;
  23692. })(SceneOptimization);
  23693. BABYLON.ParticlesOptimization = ParticlesOptimization;
  23694. var RenderTargetsOptimization = (function (_super) {
  23695. __extends(RenderTargetsOptimization, _super);
  23696. function RenderTargetsOptimization() {
  23697. _super.apply(this, arguments);
  23698. this.apply = function (scene) {
  23699. scene.renderTargetsEnabled = false;
  23700. return true;
  23701. };
  23702. }
  23703. return RenderTargetsOptimization;
  23704. })(SceneOptimization);
  23705. BABYLON.RenderTargetsOptimization = RenderTargetsOptimization;
  23706. var MergeMeshesOptimization = (function (_super) {
  23707. __extends(MergeMeshesOptimization, _super);
  23708. function MergeMeshesOptimization() {
  23709. _super.apply(this, arguments);
  23710. var _this = this;
  23711. this._canBeMerged = function (abstractMesh) {
  23712. if (!(abstractMesh instanceof BABYLON.Mesh)) {
  23713. return false;
  23714. }
  23715. var mesh = abstractMesh;
  23716. if (!mesh.isVisible || !mesh.isEnabled()) {
  23717. return false;
  23718. }
  23719. if (mesh.instances.length > 0) {
  23720. return false;
  23721. }
  23722. if (mesh.skeleton || mesh.hasLODLevels) {
  23723. return false;
  23724. }
  23725. return true;
  23726. };
  23727. this.apply = function (scene) {
  23728. var globalPool = scene.meshes.slice(0);
  23729. var globalLength = globalPool.length;
  23730. for (var index = 0; index < globalLength; index++) {
  23731. var currentPool = new Array();
  23732. var current = globalPool[index];
  23733. // Checks
  23734. if (!_this._canBeMerged(current)) {
  23735. continue;
  23736. }
  23737. currentPool.push(current);
  23738. for (var subIndex = index + 1; subIndex < globalLength; subIndex++) {
  23739. var otherMesh = globalPool[subIndex];
  23740. if (!_this._canBeMerged(otherMesh)) {
  23741. continue;
  23742. }
  23743. if (otherMesh.material !== current.material) {
  23744. continue;
  23745. }
  23746. if (otherMesh.checkCollisions !== current.checkCollisions) {
  23747. continue;
  23748. }
  23749. currentPool.push(otherMesh);
  23750. globalLength--;
  23751. globalPool.splice(subIndex, 1);
  23752. subIndex--;
  23753. }
  23754. if (currentPool.length < 2) {
  23755. continue;
  23756. }
  23757. // Merge meshes
  23758. BABYLON.Mesh.MergeMeshes(currentPool);
  23759. }
  23760. return true;
  23761. };
  23762. }
  23763. return MergeMeshesOptimization;
  23764. })(SceneOptimization);
  23765. BABYLON.MergeMeshesOptimization = MergeMeshesOptimization;
  23766. // Options
  23767. var SceneOptimizerOptions = (function () {
  23768. function SceneOptimizerOptions(targetFrameRate, trackerDuration) {
  23769. if (typeof targetFrameRate === "undefined") { targetFrameRate = 60; }
  23770. if (typeof trackerDuration === "undefined") { trackerDuration = 2000; }
  23771. this.targetFrameRate = targetFrameRate;
  23772. this.trackerDuration = trackerDuration;
  23773. this.optimizations = new Array();
  23774. }
  23775. SceneOptimizerOptions.LowDegradationAllowed = function (targetFrameRate) {
  23776. var result = new SceneOptimizerOptions(targetFrameRate);
  23777. var priority = 0;
  23778. result.optimizations.push(new MergeMeshesOptimization(priority));
  23779. result.optimizations.push(new ShadowsOptimization(priority));
  23780. result.optimizations.push(new LensFlaresOptimization(priority));
  23781. // Next priority
  23782. priority++;
  23783. result.optimizations.push(new PostProcessesOptimization(priority));
  23784. result.optimizations.push(new ParticlesOptimization(priority));
  23785. // Next priority
  23786. priority++;
  23787. result.optimizations.push(new TextureOptimization(priority, 1024));
  23788. return result;
  23789. };
  23790. SceneOptimizerOptions.ModerateDegradationAllowed = function (targetFrameRate) {
  23791. var result = new SceneOptimizerOptions(targetFrameRate);
  23792. var priority = 0;
  23793. result.optimizations.push(new MergeMeshesOptimization(priority));
  23794. result.optimizations.push(new ShadowsOptimization(priority));
  23795. result.optimizations.push(new LensFlaresOptimization(priority));
  23796. // Next priority
  23797. priority++;
  23798. result.optimizations.push(new PostProcessesOptimization(priority));
  23799. result.optimizations.push(new ParticlesOptimization(priority));
  23800. // Next priority
  23801. priority++;
  23802. result.optimizations.push(new TextureOptimization(priority, 512));
  23803. // Next priority
  23804. priority++;
  23805. result.optimizations.push(new RenderTargetsOptimization(priority));
  23806. // Next priority
  23807. priority++;
  23808. result.optimizations.push(new HardwareScalingOptimization(priority, 2));
  23809. return result;
  23810. };
  23811. SceneOptimizerOptions.HighDegradationAllowed = function (targetFrameRate) {
  23812. var result = new SceneOptimizerOptions(targetFrameRate);
  23813. var priority = 0;
  23814. result.optimizations.push(new MergeMeshesOptimization(priority));
  23815. result.optimizations.push(new ShadowsOptimization(priority));
  23816. result.optimizations.push(new LensFlaresOptimization(priority));
  23817. // Next priority
  23818. priority++;
  23819. result.optimizations.push(new PostProcessesOptimization(priority));
  23820. result.optimizations.push(new ParticlesOptimization(priority));
  23821. // Next priority
  23822. priority++;
  23823. result.optimizations.push(new TextureOptimization(priority, 256));
  23824. // Next priority
  23825. priority++;
  23826. result.optimizations.push(new RenderTargetsOptimization(priority));
  23827. // Next priority
  23828. priority++;
  23829. result.optimizations.push(new HardwareScalingOptimization(priority, 4));
  23830. return result;
  23831. };
  23832. return SceneOptimizerOptions;
  23833. })();
  23834. BABYLON.SceneOptimizerOptions = SceneOptimizerOptions;
  23835. // Scene optimizer tool
  23836. var SceneOptimizer = (function () {
  23837. function SceneOptimizer() {
  23838. }
  23839. SceneOptimizer._CheckCurrentState = function (scene, options, currentPriorityLevel, onSuccess, onFailure) {
  23840. // TODO: add an epsilon
  23841. if (scene.getEngine().getFps() >= options.targetFrameRate) {
  23842. if (onSuccess) {
  23843. onSuccess();
  23844. }
  23845. return;
  23846. }
  23847. // Apply current level of optimizations
  23848. var allDone = true;
  23849. var noOptimizationApplied = true;
  23850. for (var index = 0; index < options.optimizations.length; index++) {
  23851. var optimization = options.optimizations[index];
  23852. if (optimization.priority === currentPriorityLevel) {
  23853. noOptimizationApplied = false;
  23854. allDone = allDone && optimization.apply(scene);
  23855. }
  23856. }
  23857. // If no optimization was applied, this is a failure :(
  23858. if (noOptimizationApplied) {
  23859. if (onFailure) {
  23860. onFailure();
  23861. }
  23862. return;
  23863. }
  23864. // If all optimizations were done, move to next level
  23865. if (allDone) {
  23866. currentPriorityLevel++;
  23867. }
  23868. // Let's the system running for a specific amount of time before checking FPS
  23869. scene.executeWhenReady(function () {
  23870. setTimeout(function () {
  23871. SceneOptimizer._CheckCurrentState(scene, options, currentPriorityLevel, onSuccess, onFailure);
  23872. }, options.trackerDuration);
  23873. });
  23874. };
  23875. SceneOptimizer.OptimizeAsync = function (scene, options, onSuccess, onFailure) {
  23876. if (!options) {
  23877. options = SceneOptimizerOptions.ModerateDegradationAllowed();
  23878. }
  23879. // Let's the system running for a specific amount of time before checking FPS
  23880. scene.executeWhenReady(function () {
  23881. setTimeout(function () {
  23882. SceneOptimizer._CheckCurrentState(scene, options, 0, onSuccess, onFailure);
  23883. }, options.trackerDuration);
  23884. });
  23885. };
  23886. return SceneOptimizer;
  23887. })();
  23888. BABYLON.SceneOptimizer = SceneOptimizer;
  23889. })(BABYLON || (BABYLON = {}));
  23890. //# sourceMappingURL=babylon.sceneOptimizer.js.map
  23891. var BABYLON;
  23892. (function (BABYLON) {
  23893. (function (Internals) {
  23894. var MeshLODLevel = (function () {
  23895. function MeshLODLevel(distance, mesh) {
  23896. this.distance = distance;
  23897. this.mesh = mesh;
  23898. }
  23899. return MeshLODLevel;
  23900. })();
  23901. Internals.MeshLODLevel = MeshLODLevel;
  23902. })(BABYLON.Internals || (BABYLON.Internals = {}));
  23903. var Internals = BABYLON.Internals;
  23904. })(BABYLON || (BABYLON = {}));
  23905. //# sourceMappingURL=babylon.meshLODLevel.js.map
  23906. var BABYLON;
  23907. (function (BABYLON) {
  23908. var AudioEngine = (function () {
  23909. function AudioEngine() {
  23910. this.audioContext = null;
  23911. this.canUseWebAudio = false;
  23912. try {
  23913. if (typeof AudioContext !== 'undefined') {
  23914. this.audioContext = new AudioContext();
  23915. this.canUseWebAudio = true;
  23916. } else if (typeof webkitAudioContext !== 'undefined') {
  23917. this.audioContext = new webkitAudioContext();
  23918. this.canUseWebAudio = true;
  23919. }
  23920. } catch (e) {
  23921. this.canUseWebAudio = false;
  23922. }
  23923. // create a global volume gain node
  23924. if (this.canUseWebAudio) {
  23925. this.masterGain = this.audioContext.createGain();
  23926. this.masterGain.gain.value = 1;
  23927. this.masterGain.connect(this.audioContext.destination);
  23928. }
  23929. }
  23930. AudioEngine.prototype.getGlobalVolume = function () {
  23931. if (this.canUseWebAudio) {
  23932. return this.masterGain.gain.value;
  23933. } else {
  23934. return -1;
  23935. }
  23936. };
  23937. AudioEngine.prototype.setGlobalVolume = function (newVolume) {
  23938. if (this.canUseWebAudio) {
  23939. this.masterGain.gain.value = newVolume;
  23940. }
  23941. };
  23942. return AudioEngine;
  23943. })();
  23944. BABYLON.AudioEngine = AudioEngine;
  23945. })(BABYLON || (BABYLON = {}));
  23946. //# sourceMappingURL=babylon.audioengine.js.map
  23947. var BABYLON;
  23948. (function (BABYLON) {
  23949. var Sound = (function () {
  23950. /**
  23951. * Create a sound and attach it to a scene
  23952. * @param name Name of your sound
  23953. * @param url Url to the sound to load async
  23954. * @param readyToPlayCallback Provide a callback function if you'd like to load your code once the sound is ready to be played
  23955. * @param options Objects to provide with the current available options: autoplay, loop, distanceMax
  23956. */
  23957. function Sound(name, url, scene, readyToPlayCallback, options) {
  23958. var _this = this;
  23959. this.maxDistance = 20;
  23960. this.autoplay = false;
  23961. this.loop = false;
  23962. this.useBabylonJSAttenuation = true;
  23963. this._position = BABYLON.Vector3.Zero();
  23964. this._localDirection = new BABYLON.Vector3(1, 0, 0);
  23965. this._volume = 1;
  23966. this._isLoaded = false;
  23967. this._isReadyToPlay = false;
  23968. this._isPlaying = false;
  23969. this._isDirectional = false;
  23970. // Used if you'd like to create a directional sound.
  23971. // If not set, the sound will be omnidirectional
  23972. this._coneInnerAngle = null;
  23973. this._coneOuterAngle = null;
  23974. this._coneOuterGain = null;
  23975. this._name = name;
  23976. this._scene = scene;
  23977. this._audioEngine = this._scene.getEngine().getAudioEngine();
  23978. this._readyToPlayCallback = readyToPlayCallback;
  23979. if (options) {
  23980. if (options.maxDistance) {
  23981. this.maxDistance = options.maxDistance;
  23982. }
  23983. if (options.autoplay) {
  23984. this.autoplay = options.autoplay;
  23985. }
  23986. if (options.loop) {
  23987. this.loop = options.loop;
  23988. }
  23989. if (options.volume) {
  23990. this._volume = options.volume;
  23991. }
  23992. if (options.useBabylonJSAttenuation) {
  23993. this.useBabylonJSAttenuation = options.useBabylonJSAttenuation;
  23994. }
  23995. }
  23996. if (this._audioEngine.canUseWebAudio) {
  23997. this._soundGain = this._audioEngine.audioContext.createGain();
  23998. this._soundGain.gain.value = this._volume;
  23999. //this._soundGain.connect(this._audioEngine.masterGain);
  24000. this._soundPanner = this._audioEngine.audioContext.createPanner();
  24001. this._soundPanner.connect(this._soundGain);
  24002. this._scene.mainSoundTrack.AddSound(this);
  24003. BABYLON.Tools.LoadFile(url, function (data) {
  24004. _this._soundLoaded(data);
  24005. }, null, null, true);
  24006. }
  24007. }
  24008. Sound.prototype.connectToSoundTrackAudioNode = function (soundTrackAudioNode) {
  24009. if (this._audioEngine.canUseWebAudio) {
  24010. this._soundGain.disconnect();
  24011. this._soundGain.connect(soundTrackAudioNode);
  24012. }
  24013. };
  24014. /**
  24015. * Transform this sound into a directional source
  24016. * @param coneInnerAngle Size of the inner cone in degree
  24017. * @param coneOuterAngle Size of the outer cone in degree
  24018. * @param coneOuterGain Volume of the sound outside the outer cone (between 0.0 and 1.0)
  24019. */
  24020. Sound.prototype.setDirectionalCone = function (coneInnerAngle, coneOuterAngle, coneOuterGain) {
  24021. if (coneOuterAngle < coneInnerAngle) {
  24022. BABYLON.Tools.Error("setDirectionalCone(): outer angle of the cone must be superior or equal to the inner angle.");
  24023. return;
  24024. }
  24025. this._coneInnerAngle = coneInnerAngle;
  24026. this._coneOuterAngle = coneOuterAngle;
  24027. this._coneOuterGain = coneOuterGain;
  24028. this._isDirectional = true;
  24029. if (this._isPlaying && this.loop) {
  24030. this.stop();
  24031. this.play();
  24032. }
  24033. };
  24034. Sound.prototype.setPosition = function (newPosition) {
  24035. this._position = newPosition;
  24036. if (this._isPlaying) {
  24037. this._soundPanner.setPosition(this._position.x, this._position.y, this._position.z);
  24038. }
  24039. };
  24040. Sound.prototype.setLocalDirectionToMesh = function (newLocalDirection) {
  24041. this._localDirection = newLocalDirection;
  24042. if (this._connectedMesh && this._isPlaying) {
  24043. this._updateDirection();
  24044. }
  24045. };
  24046. Sound.prototype._updateDirection = function () {
  24047. var mat = this._connectedMesh.getWorldMatrix();
  24048. var direction = BABYLON.Vector3.TransformNormal(this._localDirection, mat);
  24049. direction.normalize();
  24050. this._soundPanner.setOrientation(direction.x, direction.y, direction.z);
  24051. };
  24052. Sound.prototype.updateDistanceFromListener = function () {
  24053. if (this._connectedMesh) {
  24054. var distance = this._connectedMesh.getDistanceToCamera(this._scene.activeCamera);
  24055. if (distance < 1)
  24056. distance = 1;
  24057. if (this.useBabylonJSAttenuation) {
  24058. if (distance < this.maxDistance) {
  24059. this._soundGain.gain.value = this._volume / distance;
  24060. } else {
  24061. this._soundGain.gain.value = 0;
  24062. }
  24063. }
  24064. }
  24065. };
  24066. /**
  24067. * Play the sound
  24068. * @param time (optional) Start the sound after X seconds. Start immediately (0) by default.
  24069. */
  24070. Sound.prototype.play = function (time) {
  24071. if (this._isReadyToPlay) {
  24072. try {
  24073. var startTime = time ? this._audioEngine.audioContext.currentTime + time : 0;
  24074. this._soundSource = this._audioEngine.audioContext.createBufferSource();
  24075. this._soundSource.buffer = this._audioBuffer;
  24076. this._soundPanner.setPosition(this._position.x, this._position.y, this._position.z);
  24077. if (this._isDirectional) {
  24078. this._soundPanner.coneInnerAngle = this._coneInnerAngle;
  24079. this._soundPanner.coneOuterAngle = this._coneOuterAngle;
  24080. this._soundPanner.coneOuterGain = this._coneOuterGain;
  24081. this._soundPanner.setOrientation(this._localDirection.x, this._localDirection.y, this._localDirection.z);
  24082. }
  24083. this._soundSource.connect(this._soundPanner);
  24084. this._soundSource.loop = this.loop;
  24085. this._soundSource.start(startTime);
  24086. this._isPlaying = true;
  24087. } catch (ex) {
  24088. BABYLON.Tools.Error("Error while trying to play audio: " + this._name + ", " + ex.message);
  24089. }
  24090. }
  24091. };
  24092. /**
  24093. * Stop the sound
  24094. * @param time (optional) Stop the sound after X seconds. Stop immediately (0) by default.
  24095. */
  24096. Sound.prototype.stop = function (time) {
  24097. var stopTime = time ? this._audioEngine.audioContext.currentTime + time : 0;
  24098. this._soundSource.stop(stopTime);
  24099. this._isPlaying = false;
  24100. };
  24101. Sound.prototype.pause = function () {
  24102. //this._soundSource.p
  24103. };
  24104. Sound.prototype.setVolume = function (newVolume) {
  24105. this._volume = newVolume;
  24106. };
  24107. Sound.prototype.getVolume = function () {
  24108. return this._volume;
  24109. };
  24110. Sound.prototype.attachToMesh = function (meshToConnectTo) {
  24111. var _this = this;
  24112. this._connectedMesh = meshToConnectTo;
  24113. meshToConnectTo.registerAfterWorldMatrixUpdate(function (connectedMesh) {
  24114. return _this._onRegisterAfterWorldMatrixUpdate(connectedMesh);
  24115. });
  24116. };
  24117. Sound.prototype._onRegisterAfterWorldMatrixUpdate = function (connectedMesh) {
  24118. this.setPosition(connectedMesh.position);
  24119. if (this._isDirectional && this._isPlaying) {
  24120. this._updateDirection();
  24121. }
  24122. };
  24123. Sound.prototype._soundLoaded = function (audioData) {
  24124. var _this = this;
  24125. this._isLoaded = true;
  24126. this._audioEngine.audioContext.decodeAudioData(audioData, function (buffer) {
  24127. _this._audioBuffer = buffer;
  24128. _this._isReadyToPlay = true;
  24129. if (_this.autoplay) {
  24130. _this.play();
  24131. }
  24132. if (_this._readyToPlayCallback) {
  24133. _this._readyToPlayCallback();
  24134. }
  24135. }, function (error) {
  24136. BABYLON.Tools.Error("Error while decoding audio data: " + error.err);
  24137. });
  24138. };
  24139. return Sound;
  24140. })();
  24141. BABYLON.Sound = Sound;
  24142. })(BABYLON || (BABYLON = {}));
  24143. //# sourceMappingURL=babylon.sound.js.map
  24144. var BABYLON;
  24145. (function (BABYLON) {
  24146. var SoundTrack = (function () {
  24147. function SoundTrack(scene, options) {
  24148. this.id = -1;
  24149. this._isMainTrack = false;
  24150. this._scene = scene;
  24151. this._audioEngine = scene.getEngine().getAudioEngine();
  24152. this.soundCollection = new Array();
  24153. if (this._audioEngine.canUseWebAudio) {
  24154. this._trackGain = this._audioEngine.audioContext.createGain();
  24155. //this._trackConvolver = this._audioEngine.audioContext.createConvolver();
  24156. //this._trackConvolver.connect(this._trackGain);
  24157. this._trackGain.connect(this._audioEngine.masterGain);
  24158. if (options) {
  24159. if (options.volume) {
  24160. this._trackGain.gain.value = options.volume;
  24161. }
  24162. if (options.mainTrack) {
  24163. this._isMainTrack = options.mainTrack;
  24164. }
  24165. }
  24166. }
  24167. if (!this._isMainTrack) {
  24168. this._scene.soundTracks.push(this);
  24169. this.id = this._scene.soundTracks.length - 1;
  24170. }
  24171. }
  24172. SoundTrack.prototype.AddSound = function (sound) {
  24173. sound.connectToSoundTrackAudioNode(this._trackGain);
  24174. if (sound.soundTrackId) {
  24175. if (sound.soundTrackId === -1) {
  24176. this._scene.mainSoundTrack.RemoveSound(sound);
  24177. } else {
  24178. this._scene.soundTracks[sound.soundTrackId].RemoveSound(sound);
  24179. }
  24180. }
  24181. this.soundCollection.push(sound);
  24182. sound.soundTrackId = this.id;
  24183. };
  24184. SoundTrack.prototype.RemoveSound = function (sound) {
  24185. var index = this.soundCollection.indexOf(sound);
  24186. if (index !== -1) {
  24187. this.soundCollection.splice(index, 1);
  24188. }
  24189. };
  24190. SoundTrack.prototype.setVolume = function (newVolume) {
  24191. if (this._audioEngine.canUseWebAudio) {
  24192. this._trackGain.gain.value = newVolume;
  24193. }
  24194. };
  24195. return SoundTrack;
  24196. })();
  24197. BABYLON.SoundTrack = SoundTrack;
  24198. })(BABYLON || (BABYLON = {}));
  24199. //# sourceMappingURL=babylon.soundtrack.js.map
  24200. var BABYLON;
  24201. (function (BABYLON) {
  24202. var DebugLayer = (function () {
  24203. function DebugLayer(scene) {
  24204. var _this = this;
  24205. this._enabled = false;
  24206. this._labelsEnabled = false;
  24207. this._displayStatistics = true;
  24208. this._displayTree = false;
  24209. this._displayLogs = false;
  24210. this._identityMatrix = BABYLON.Matrix.Identity();
  24211. this.axisRatio = 0.02;
  24212. this._scene = scene;
  24213. this._syncPositions = function () {
  24214. var engine = _this._scene.getEngine();
  24215. var canvasRect = engine.getRenderingCanvasClientRect();
  24216. if (_this._showUI) {
  24217. _this._statsDiv.style.left = (canvasRect.width - 310) + "px";
  24218. _this._statsDiv.style.top = (canvasRect.height - 370) + "px";
  24219. _this._statsDiv.style.width = "300px";
  24220. _this._statsDiv.style.height = "360px";
  24221. _this._statsSubsetDiv.style.maxHeight = (canvasRect.height - 60) + "px";
  24222. _this._optionsDiv.style.left = "0px";
  24223. _this._optionsDiv.style.top = "10px";
  24224. _this._optionsDiv.style.width = "200px";
  24225. _this._optionsDiv.style.height = "auto";
  24226. _this._optionsSubsetDiv.style.maxHeight = (canvasRect.height - 225) + "px";
  24227. _this._logDiv.style.left = "0px";
  24228. _this._logDiv.style.top = (canvasRect.height - 170) + "px";
  24229. _this._logDiv.style.width = "600px";
  24230. _this._logDiv.style.height = "160px";
  24231. _this._treeDiv.style.left = (canvasRect.width - 310) + "px";
  24232. _this._treeDiv.style.top = "10px";
  24233. _this._treeDiv.style.width = "300px";
  24234. _this._treeDiv.style.height = "auto";
  24235. _this._treeSubsetDiv.style.maxHeight = (canvasRect.height - 490) + "px";
  24236. }
  24237. _this._globalDiv.style.left = canvasRect.left + "px";
  24238. _this._globalDiv.style.top = canvasRect.top + "px";
  24239. _this._drawingCanvas.style.left = "0px";
  24240. _this._drawingCanvas.style.top = "0px";
  24241. _this._drawingCanvas.style.width = engine.getRenderWidth() + "px";
  24242. _this._drawingCanvas.style.height = engine.getRenderHeight() + "px";
  24243. var devicePixelRatio = window.devicePixelRatio || 1;
  24244. var context = _this._drawingContext;
  24245. var backingStoreRatio = context.webkitBackingStorePixelRatio || context.mozBackingStorePixelRatio || context.msBackingStorePixelRatio || context.oBackingStorePixelRatio || context.backingStorePixelRatio || 1;
  24246. _this._ratio = devicePixelRatio / backingStoreRatio;
  24247. _this._drawingCanvas.width = engine.getRenderWidth() * _this._ratio;
  24248. _this._drawingCanvas.height = engine.getRenderHeight() * _this._ratio;
  24249. };
  24250. this._onCanvasClick = function (evt) {
  24251. _this._clickPosition = {
  24252. x: evt.clientX * _this._ratio,
  24253. y: evt.clientY * _this._ratio
  24254. };
  24255. };
  24256. this._syncData = function () {
  24257. if (_this._showUI) {
  24258. if (_this._displayStatistics) {
  24259. _this._displayStats();
  24260. _this._statsDiv.style.display = "";
  24261. } else {
  24262. _this._statsDiv.style.display = "none";
  24263. }
  24264. if (_this._displayLogs) {
  24265. _this._logDiv.style.display = "";
  24266. } else {
  24267. _this._logDiv.style.display = "none";
  24268. }
  24269. if (_this._displayTree) {
  24270. _this._treeDiv.style.display = "";
  24271. if (_this._needToRefreshMeshesTree) {
  24272. _this._needToRefreshMeshesTree = false;
  24273. _this._refreshMeshesTreeContent();
  24274. }
  24275. } else {
  24276. _this._treeDiv.style.display = "none";
  24277. }
  24278. }
  24279. if (_this._labelsEnabled || !_this._showUI) {
  24280. _this._drawingContext.clearRect(0, 0, _this._drawingCanvas.width, _this._drawingCanvas.height);
  24281. var engine = _this._scene.getEngine();
  24282. var viewport = _this._scene.activeCamera.viewport;
  24283. var globalViewport = viewport.toGlobal(engine);
  24284. // Meshes
  24285. var meshes = _this._scene.getActiveMeshes();
  24286. for (var index = 0; index < meshes.length; index++) {
  24287. var mesh = meshes.data[index];
  24288. var position = mesh.getBoundingInfo().boundingSphere.center;
  24289. var projectedPosition = BABYLON.Vector3.Project(position, mesh.getWorldMatrix(), _this._scene.getTransformMatrix(), globalViewport);
  24290. if (mesh.renderOverlay || _this.shouldDisplayAxis && _this.shouldDisplayAxis(mesh)) {
  24291. _this._renderAxis(projectedPosition, mesh, globalViewport);
  24292. }
  24293. if (!_this.shouldDisplayLabel || _this.shouldDisplayLabel(mesh)) {
  24294. _this._renderLabel(mesh.name, projectedPosition, 12, function () {
  24295. mesh.renderOverlay = !mesh.renderOverlay;
  24296. }, function () {
  24297. return mesh.renderOverlay ? 'red' : 'black';
  24298. });
  24299. }
  24300. }
  24301. // Cameras
  24302. var cameras = _this._scene.cameras;
  24303. for (index = 0; index < cameras.length; index++) {
  24304. var camera = cameras[index];
  24305. if (camera === _this._scene.activeCamera) {
  24306. continue;
  24307. }
  24308. projectedPosition = BABYLON.Vector3.Project(BABYLON.Vector3.Zero(), camera.getWorldMatrix(), _this._scene.getTransformMatrix(), globalViewport);
  24309. if (!_this.shouldDisplayLabel || _this.shouldDisplayLabel(camera)) {
  24310. _this._renderLabel(camera.name, projectedPosition, 12, function () {
  24311. _this._scene.activeCamera.detachControl(engine.getRenderingCanvas());
  24312. _this._scene.activeCamera = camera;
  24313. _this._scene.activeCamera.attachControl(engine.getRenderingCanvas());
  24314. }, function () {
  24315. return "purple";
  24316. });
  24317. }
  24318. }
  24319. // Lights
  24320. var lights = _this._scene.lights;
  24321. for (index = 0; index < lights.length; index++) {
  24322. var light = lights[index];
  24323. if (light.position) {
  24324. projectedPosition = BABYLON.Vector3.Project(light.getAbsolutePosition(), _this._identityMatrix, _this._scene.getTransformMatrix(), globalViewport);
  24325. if (!_this.shouldDisplayLabel || _this.shouldDisplayLabel(light)) {
  24326. _this._renderLabel(light.name, projectedPosition, -20, function () {
  24327. light.setEnabled(!light.isEnabled());
  24328. }, function () {
  24329. return light.isEnabled() ? "orange" : "gray";
  24330. });
  24331. }
  24332. }
  24333. }
  24334. }
  24335. _this._clickPosition = undefined;
  24336. };
  24337. }
  24338. DebugLayer.prototype._refreshMeshesTreeContent = function () {
  24339. // Add meshes
  24340. var sortedArray = this._scene.meshes.slice(0, this._scene.meshes.length);
  24341. sortedArray.sort(function (a, b) {
  24342. if (a.name === b.name) {
  24343. return 0;
  24344. }
  24345. return (a.name > b.name) ? 1 : -1;
  24346. });
  24347. for (var index = 0; index < sortedArray.length; index++) {
  24348. var mesh = sortedArray[index];
  24349. if (!mesh.isEnabled()) {
  24350. continue;
  24351. }
  24352. this._generateAdvancedCheckBox(this._treeSubsetDiv, mesh.name, mesh.getTotalVertices() + " verts", mesh.isVisible, function (element, mesh) {
  24353. mesh.isVisible = element.checked;
  24354. }, mesh);
  24355. }
  24356. };
  24357. DebugLayer.prototype._renderSingleAxis = function (zero, unit, unitText, label, color) {
  24358. this._drawingContext.beginPath();
  24359. this._drawingContext.moveTo(zero.x, zero.y);
  24360. this._drawingContext.lineTo(unit.x, unit.y);
  24361. this._drawingContext.strokeStyle = color;
  24362. this._drawingContext.lineWidth = 4;
  24363. this._drawingContext.stroke();
  24364. this._drawingContext.font = "normal 14px Segoe UI";
  24365. this._drawingContext.fillStyle = color;
  24366. this._drawingContext.fillText(label, unitText.x, unitText.y);
  24367. };
  24368. DebugLayer.prototype._renderAxis = function (projectedPosition, mesh, globalViewport) {
  24369. var position = mesh.getBoundingInfo().boundingSphere.center;
  24370. var worldMatrix = mesh.getWorldMatrix();
  24371. var unprojectedVector = BABYLON.Vector3.UnprojectFromTransform(projectedPosition.add(new BABYLON.Vector3(this._drawingCanvas.width * this.axisRatio, 0, 0)), globalViewport.width, globalViewport.height, worldMatrix, this._scene.getTransformMatrix());
  24372. var unit = (unprojectedVector.subtract(position)).length();
  24373. var xAxis = BABYLON.Vector3.Project(position.add(new BABYLON.Vector3(unit, 0, 0)), worldMatrix, this._scene.getTransformMatrix(), globalViewport);
  24374. var xAxisText = BABYLON.Vector3.Project(position.add(new BABYLON.Vector3(unit * 1.5, 0, 0)), worldMatrix, this._scene.getTransformMatrix(), globalViewport);
  24375. this._renderSingleAxis(projectedPosition, xAxis, xAxisText, "x", "#FF0000");
  24376. var yAxis = BABYLON.Vector3.Project(position.add(new BABYLON.Vector3(0, unit, 0)), worldMatrix, this._scene.getTransformMatrix(), globalViewport);
  24377. var yAxisText = BABYLON.Vector3.Project(position.add(new BABYLON.Vector3(0, unit * 1.5, 0)), worldMatrix, this._scene.getTransformMatrix(), globalViewport);
  24378. this._renderSingleAxis(projectedPosition, yAxis, yAxisText, "y", "#00FF00");
  24379. var zAxis = BABYLON.Vector3.Project(position.add(new BABYLON.Vector3(0, 0, unit)), worldMatrix, this._scene.getTransformMatrix(), globalViewport);
  24380. var zAxisText = BABYLON.Vector3.Project(position.add(new BABYLON.Vector3(0, 0, unit * 1.5)), worldMatrix, this._scene.getTransformMatrix(), globalViewport);
  24381. this._renderSingleAxis(projectedPosition, zAxis, zAxisText, "z", "#0000FF");
  24382. };
  24383. DebugLayer.prototype._renderLabel = function (text, projectedPosition, labelOffset, onClick, getFillStyle) {
  24384. if (projectedPosition.z > 0 && projectedPosition.z < 1.0) {
  24385. this._drawingContext.font = "normal 12px Segoe UI";
  24386. var textMetrics = this._drawingContext.measureText(text);
  24387. var centerX = projectedPosition.x - textMetrics.width / 2;
  24388. var centerY = projectedPosition.y;
  24389. if (this._isClickInsideRect(centerX - 5, centerY - labelOffset - 12, textMetrics.width + 10, 17)) {
  24390. onClick();
  24391. }
  24392. this._drawingContext.beginPath();
  24393. this._drawingContext.rect(centerX - 5, centerY - labelOffset - 12, textMetrics.width + 10, 17);
  24394. this._drawingContext.fillStyle = getFillStyle();
  24395. this._drawingContext.globalAlpha = 0.5;
  24396. this._drawingContext.fill();
  24397. this._drawingContext.globalAlpha = 1.0;
  24398. this._drawingContext.strokeStyle = '#FFFFFF';
  24399. this._drawingContext.lineWidth = 1;
  24400. this._drawingContext.stroke();
  24401. this._drawingContext.fillStyle = "#FFFFFF";
  24402. this._drawingContext.fillText(text, centerX, centerY - labelOffset);
  24403. this._drawingContext.beginPath();
  24404. this._drawingContext.arc(projectedPosition.x, centerY, 5, 0, 2 * Math.PI, false);
  24405. this._drawingContext.fill();
  24406. }
  24407. };
  24408. DebugLayer.prototype._isClickInsideRect = function (x, y, width, height) {
  24409. if (!this._clickPosition) {
  24410. return false;
  24411. }
  24412. if (this._clickPosition.x < x || this._clickPosition.x > x + width) {
  24413. return false;
  24414. }
  24415. if (this._clickPosition.y < y || this._clickPosition.y > y + height) {
  24416. return false;
  24417. }
  24418. return true;
  24419. };
  24420. DebugLayer.prototype.isVisible = function () {
  24421. return this._enabled;
  24422. };
  24423. DebugLayer.prototype.hide = function () {
  24424. if (!this._enabled) {
  24425. return;
  24426. }
  24427. this._enabled = false;
  24428. var engine = this._scene.getEngine();
  24429. this._scene.unregisterAfterRender(this._syncData);
  24430. document.body.removeChild(this._globalDiv);
  24431. window.removeEventListener("resize", this._syncPositions);
  24432. this._scene.forceShowBoundingBoxes = false;
  24433. this._scene.forceWireframe = false;
  24434. BABYLON.StandardMaterial.DiffuseTextureEnabled = true;
  24435. BABYLON.StandardMaterial.AmbientTextureEnabled = true;
  24436. BABYLON.StandardMaterial.SpecularTextureEnabled = true;
  24437. BABYLON.StandardMaterial.EmissiveTextureEnabled = true;
  24438. BABYLON.StandardMaterial.BumpTextureEnabled = true;
  24439. BABYLON.StandardMaterial.OpacityTextureEnabled = true;
  24440. BABYLON.StandardMaterial.ReflectionTextureEnabled = true;
  24441. this._scene.shadowsEnabled = true;
  24442. this._scene.particlesEnabled = true;
  24443. this._scene.postProcessesEnabled = true;
  24444. this._scene.collisionsEnabled = true;
  24445. this._scene.lightsEnabled = true;
  24446. this._scene.texturesEnabled = true;
  24447. this._scene.lensFlaresEnabled = true;
  24448. this._scene.proceduralTexturesEnabled = true;
  24449. this._scene.renderTargetsEnabled = true;
  24450. engine.getRenderingCanvas().removeEventListener("click", this._onCanvasClick);
  24451. };
  24452. DebugLayer.prototype.show = function (showUI) {
  24453. if (typeof showUI === "undefined") { showUI = true; }
  24454. if (this._enabled) {
  24455. return;
  24456. }
  24457. this._enabled = true;
  24458. this._showUI = showUI;
  24459. var engine = this._scene.getEngine();
  24460. this._globalDiv = document.createElement("div");
  24461. document.body.appendChild(this._globalDiv);
  24462. this._generateDOMelements();
  24463. window.addEventListener("resize", this._syncPositions);
  24464. engine.getRenderingCanvas().addEventListener("click", this._onCanvasClick);
  24465. this._syncPositions();
  24466. this._scene.registerAfterRender(this._syncData);
  24467. };
  24468. DebugLayer.prototype._clearLabels = function () {
  24469. this._drawingContext.clearRect(0, 0, this._drawingCanvas.width, this._drawingCanvas.height);
  24470. for (var index = 0; index < this._scene.meshes.length; index++) {
  24471. var mesh = this._scene.meshes[index];
  24472. mesh.renderOverlay = false;
  24473. }
  24474. };
  24475. DebugLayer.prototype._generateheader = function (root, text) {
  24476. var header = document.createElement("div");
  24477. header.innerHTML = text + "&nbsp;";
  24478. header.style.textAlign = "right";
  24479. header.style.width = "100%";
  24480. header.style.color = "white";
  24481. header.style.backgroundColor = "Black";
  24482. header.style.padding = "5px 5px 4px 0px";
  24483. header.style.marginLeft = "-5px";
  24484. root.appendChild(header);
  24485. };
  24486. DebugLayer.prototype._generateTexBox = function (root, title) {
  24487. var label = document.createElement("label");
  24488. label.innerHTML = title;
  24489. root.appendChild(label);
  24490. root.appendChild(document.createElement("br"));
  24491. };
  24492. DebugLayer.prototype._generateAdvancedCheckBox = function (root, leftTitle, rightTitle, initialState, task, tag) {
  24493. if (typeof tag === "undefined") { tag = null; }
  24494. var label = document.createElement("label");
  24495. var boundingBoxesCheckbox = document.createElement("input");
  24496. boundingBoxesCheckbox.type = "checkbox";
  24497. boundingBoxesCheckbox.checked = initialState;
  24498. boundingBoxesCheckbox.addEventListener("change", function (evt) {
  24499. task(evt.target, tag);
  24500. });
  24501. label.appendChild(boundingBoxesCheckbox);
  24502. var container = document.createElement("span");
  24503. var leftPart = document.createElement("span");
  24504. var rightPart = document.createElement("span");
  24505. rightPart.style.cssFloat = "right";
  24506. leftPart.innerHTML = leftTitle;
  24507. rightPart.innerHTML = rightTitle;
  24508. rightPart.style.maxWidth = "200px";
  24509. container.appendChild(leftPart);
  24510. container.appendChild(rightPart);
  24511. label.appendChild(container);
  24512. root.appendChild(label);
  24513. root.appendChild(document.createElement("br"));
  24514. };
  24515. DebugLayer.prototype._generateCheckBox = function (root, title, initialState, task, tag) {
  24516. if (typeof tag === "undefined") { tag = null; }
  24517. var label = document.createElement("label");
  24518. var boundingBoxesCheckbox = document.createElement("input");
  24519. boundingBoxesCheckbox.type = "checkbox";
  24520. boundingBoxesCheckbox.checked = initialState;
  24521. boundingBoxesCheckbox.addEventListener("change", function (evt) {
  24522. task(evt.target, tag);
  24523. });
  24524. label.appendChild(boundingBoxesCheckbox);
  24525. label.appendChild(document.createTextNode(title));
  24526. root.appendChild(label);
  24527. root.appendChild(document.createElement("br"));
  24528. };
  24529. DebugLayer.prototype._generateRadio = function (root, title, name, initialState, task, tag) {
  24530. if (typeof tag === "undefined") { tag = null; }
  24531. var label = document.createElement("label");
  24532. var boundingBoxesRadio = document.createElement("input");
  24533. boundingBoxesRadio.type = "radio";
  24534. boundingBoxesRadio.name = name;
  24535. boundingBoxesRadio.checked = initialState;
  24536. boundingBoxesRadio.addEventListener("change", function (evt) {
  24537. task(evt.target, tag);
  24538. });
  24539. label.appendChild(boundingBoxesRadio);
  24540. label.appendChild(document.createTextNode(title));
  24541. root.appendChild(label);
  24542. root.appendChild(document.createElement("br"));
  24543. };
  24544. DebugLayer.prototype._generateDOMelements = function () {
  24545. var _this = this;
  24546. this._globalDiv.id = "DebugLayer";
  24547. this._globalDiv.style.position = "absolute";
  24548. this._globalDiv.style.fontFamily = "Segoe UI, Arial";
  24549. this._globalDiv.style.fontSize = "14px";
  24550. this._globalDiv.style.color = "white";
  24551. // Drawing canvas
  24552. this._drawingCanvas = document.createElement("canvas");
  24553. this._drawingCanvas.id = "DebugLayerDrawingCanvas";
  24554. this._drawingCanvas.style.position = "absolute";
  24555. this._drawingCanvas.style.pointerEvents = "none";
  24556. this._drawingContext = this._drawingCanvas.getContext("2d");
  24557. this._globalDiv.appendChild(this._drawingCanvas);
  24558. if (this._showUI) {
  24559. var background = "rgba(128, 128, 128, 0.4)";
  24560. var border = "rgb(180, 180, 180) solid 1px";
  24561. // Stats
  24562. this._statsDiv = document.createElement("div");
  24563. this._statsDiv.id = "DebugLayerStats";
  24564. this._statsDiv.style.border = border;
  24565. this._statsDiv.style.position = "absolute";
  24566. this._statsDiv.style.background = background;
  24567. this._statsDiv.style.padding = "0px 0px 0px 5px";
  24568. this._statsDiv.style.pointerEvents = "none";
  24569. this._statsDiv.style.overflowY = "auto";
  24570. this._generateheader(this._statsDiv, "Statistics");
  24571. this._statsSubsetDiv = document.createElement("div");
  24572. this._statsSubsetDiv.style.paddingTop = "5px";
  24573. this._statsSubsetDiv.style.paddingBottom = "5px";
  24574. this._statsDiv.appendChild(this._statsSubsetDiv);
  24575. // Tree
  24576. this._treeDiv = document.createElement("div");
  24577. this._treeDiv.id = "DebugLayerTree";
  24578. this._treeDiv.style.border = border;
  24579. this._treeDiv.style.position = "absolute";
  24580. this._treeDiv.style.background = background;
  24581. this._treeDiv.style.padding = "0px 0px 0px 5px";
  24582. this._treeDiv.style.display = "none";
  24583. this._generateheader(this._treeDiv, "Meshes tree");
  24584. this._treeSubsetDiv = document.createElement("div");
  24585. this._treeSubsetDiv.style.paddingTop = "5px";
  24586. this._treeSubsetDiv.style.paddingRight = "5px";
  24587. this._treeSubsetDiv.style.overflowY = "auto";
  24588. this._treeSubsetDiv.style.maxHeight = "300px";
  24589. this._treeDiv.appendChild(this._treeSubsetDiv);
  24590. this._needToRefreshMeshesTree = true;
  24591. // Logs
  24592. this._logDiv = document.createElement("div");
  24593. this._logDiv.style.border = border;
  24594. this._logDiv.id = "DebugLayerLogs";
  24595. this._logDiv.style.position = "absolute";
  24596. this._logDiv.style.background = background;
  24597. this._logDiv.style.padding = "0px 0px 0px 5px";
  24598. this._logDiv.style.display = "none";
  24599. this._generateheader(this._logDiv, "Logs");
  24600. this._logSubsetDiv = document.createElement("div");
  24601. this._logSubsetDiv.style.height = "127px";
  24602. this._logSubsetDiv.style.paddingTop = "5px";
  24603. this._logSubsetDiv.style.overflowY = "auto";
  24604. this._logSubsetDiv.style.fontSize = "12px";
  24605. this._logSubsetDiv.style.fontFamily = "consolas";
  24606. this._logSubsetDiv.innerHTML = BABYLON.Tools.LogCache;
  24607. this._logDiv.appendChild(this._logSubsetDiv);
  24608. BABYLON.Tools.OnNewCacheEntry = function (entry) {
  24609. _this._logSubsetDiv.innerHTML = entry + _this._logSubsetDiv.innerHTML;
  24610. };
  24611. // Options
  24612. this._optionsDiv = document.createElement("div");
  24613. this._optionsDiv.id = "DebugLayerOptions";
  24614. this._optionsDiv.style.border = border;
  24615. this._optionsDiv.style.position = "absolute";
  24616. this._optionsDiv.style.background = background;
  24617. this._optionsDiv.style.padding = "0px 0px 0px 5px";
  24618. this._optionsDiv.style.overflowY = "auto";
  24619. this._generateheader(this._optionsDiv, "Options");
  24620. this._optionsSubsetDiv = document.createElement("div");
  24621. this._optionsSubsetDiv.style.paddingTop = "5px";
  24622. this._optionsSubsetDiv.style.paddingBottom = "5px";
  24623. this._optionsSubsetDiv.style.overflowY = "auto";
  24624. this._optionsSubsetDiv.style.maxHeight = "200px";
  24625. this._optionsDiv.appendChild(this._optionsSubsetDiv);
  24626. this._generateTexBox(this._optionsSubsetDiv, "<b>General:</b>");
  24627. this._generateCheckBox(this._optionsSubsetDiv, "Statistics", this._displayStatistics, function (element) {
  24628. _this._displayStatistics = element.checked;
  24629. });
  24630. this._generateCheckBox(this._optionsSubsetDiv, "Logs", this._displayLogs, function (element) {
  24631. _this._displayLogs = element.checked;
  24632. });
  24633. this._generateCheckBox(this._optionsSubsetDiv, "Meshes tree", this._displayTree, function (element) {
  24634. _this._displayTree = element.checked;
  24635. _this._needToRefreshMeshesTree = true;
  24636. });
  24637. this._generateCheckBox(this._optionsSubsetDiv, "Bounding boxes", this._scene.forceShowBoundingBoxes, function (element) {
  24638. _this._scene.forceShowBoundingBoxes = element.checked;
  24639. });
  24640. this._generateCheckBox(this._optionsSubsetDiv, "Clickable labels", this._labelsEnabled, function (element) {
  24641. _this._labelsEnabled = element.checked;
  24642. if (!_this._labelsEnabled) {
  24643. _this._clearLabels();
  24644. }
  24645. });
  24646. this._generateCheckBox(this._optionsSubsetDiv, "Generate user marks", BABYLON.Tools.PerformanceLogLevel === BABYLON.Tools.PerformanceUserMarkLogLevel, function (element) {
  24647. if (element.checked) {
  24648. BABYLON.Tools.PerformanceLogLevel = BABYLON.Tools.PerformanceUserMarkLogLevel;
  24649. } else {
  24650. BABYLON.Tools.PerformanceLogLevel = BABYLON.Tools.PerformanceNoneLogLevel;
  24651. }
  24652. });
  24653. ;
  24654. this._optionsSubsetDiv.appendChild(document.createElement("br"));
  24655. this._generateTexBox(this._optionsSubsetDiv, "<b>Rendering mode:</b>");
  24656. this._generateRadio(this._optionsSubsetDiv, "Solid", "renderMode", !this._scene.forceWireframe && !this._scene.forcePointsCloud, function (element) {
  24657. if (element.checked) {
  24658. _this._scene.forceWireframe = false;
  24659. _this._scene.forcePointsCloud = false;
  24660. }
  24661. });
  24662. this._generateRadio(this._optionsSubsetDiv, "Wireframe", "renderMode", this._scene.forceWireframe, function (element) {
  24663. if (element.checked) {
  24664. _this._scene.forceWireframe = true;
  24665. _this._scene.forcePointsCloud = false;
  24666. }
  24667. });
  24668. this._generateRadio(this._optionsSubsetDiv, "Point", "renderMode", this._scene.forcePointsCloud, function (element) {
  24669. if (element.checked) {
  24670. _this._scene.forceWireframe = false;
  24671. _this._scene.forcePointsCloud = true;
  24672. }
  24673. });
  24674. this._optionsSubsetDiv.appendChild(document.createElement("br"));
  24675. this._generateTexBox(this._optionsSubsetDiv, "<b>Texture channels:</b>");
  24676. this._generateCheckBox(this._optionsSubsetDiv, "Diffuse", BABYLON.StandardMaterial.DiffuseTextureEnabled, function (element) {
  24677. BABYLON.StandardMaterial.DiffuseTextureEnabled = element.checked;
  24678. });
  24679. this._generateCheckBox(this._optionsSubsetDiv, "Ambient", BABYLON.StandardMaterial.AmbientTextureEnabled, function (element) {
  24680. BABYLON.StandardMaterial.AmbientTextureEnabled = element.checked;
  24681. });
  24682. this._generateCheckBox(this._optionsSubsetDiv, "Specular", BABYLON.StandardMaterial.SpecularTextureEnabled, function (element) {
  24683. BABYLON.StandardMaterial.SpecularTextureEnabled = element.checked;
  24684. });
  24685. this._generateCheckBox(this._optionsSubsetDiv, "Emissive", BABYLON.StandardMaterial.EmissiveTextureEnabled, function (element) {
  24686. BABYLON.StandardMaterial.EmissiveTextureEnabled = element.checked;
  24687. });
  24688. this._generateCheckBox(this._optionsSubsetDiv, "Bump", BABYLON.StandardMaterial.BumpTextureEnabled, function (element) {
  24689. BABYLON.StandardMaterial.BumpTextureEnabled = element.checked;
  24690. });
  24691. this._generateCheckBox(this._optionsSubsetDiv, "Opacity", BABYLON.StandardMaterial.OpacityTextureEnabled, function (element) {
  24692. BABYLON.StandardMaterial.OpacityTextureEnabled = element.checked;
  24693. });
  24694. this._generateCheckBox(this._optionsSubsetDiv, "Reflection", BABYLON.StandardMaterial.ReflectionTextureEnabled, function (element) {
  24695. BABYLON.StandardMaterial.ReflectionTextureEnabled = element.checked;
  24696. });
  24697. this._generateCheckBox(this._optionsSubsetDiv, "Fresnel", BABYLON.StandardMaterial.FresnelEnabled, function (element) {
  24698. BABYLON.StandardMaterial.FresnelEnabled = element.checked;
  24699. });
  24700. this._optionsSubsetDiv.appendChild(document.createElement("br"));
  24701. this._generateTexBox(this._optionsSubsetDiv, "<b>Options:</b>");
  24702. this._generateCheckBox(this._optionsSubsetDiv, "Animations", this._scene.animationsEnabled, function (element) {
  24703. _this._scene.animationsEnabled = element.checked;
  24704. });
  24705. this._generateCheckBox(this._optionsSubsetDiv, "Collisions", this._scene.collisionsEnabled, function (element) {
  24706. _this._scene.collisionsEnabled = element.checked;
  24707. });
  24708. this._generateCheckBox(this._optionsSubsetDiv, "Fog", this._scene.fogEnabled, function (element) {
  24709. _this._scene.fogEnabled = element.checked;
  24710. });
  24711. this._generateCheckBox(this._optionsSubsetDiv, "Lens flares", this._scene.lensFlaresEnabled, function (element) {
  24712. _this._scene.lensFlaresEnabled = element.checked;
  24713. });
  24714. this._generateCheckBox(this._optionsSubsetDiv, "Lights", this._scene.lightsEnabled, function (element) {
  24715. _this._scene.lightsEnabled = element.checked;
  24716. });
  24717. this._generateCheckBox(this._optionsSubsetDiv, "Particles", this._scene.particlesEnabled, function (element) {
  24718. _this._scene.particlesEnabled = element.checked;
  24719. });
  24720. this._generateCheckBox(this._optionsSubsetDiv, "Post-processes", this._scene.postProcessesEnabled, function (element) {
  24721. _this._scene.postProcessesEnabled = element.checked;
  24722. });
  24723. this._generateCheckBox(this._optionsSubsetDiv, "Procedural textures", this._scene.proceduralTexturesEnabled, function (element) {
  24724. _this._scene.proceduralTexturesEnabled = element.checked;
  24725. });
  24726. this._generateCheckBox(this._optionsSubsetDiv, "Render targets", this._scene.renderTargetsEnabled, function (element) {
  24727. _this._scene.renderTargetsEnabled = element.checked;
  24728. });
  24729. this._generateCheckBox(this._optionsSubsetDiv, "Shadows", this._scene.shadowsEnabled, function (element) {
  24730. _this._scene.shadowsEnabled = element.checked;
  24731. });
  24732. this._generateCheckBox(this._optionsSubsetDiv, "Skeletons", this._scene.skeletonsEnabled, function (element) {
  24733. _this._scene.skeletonsEnabled = element.checked;
  24734. });
  24735. this._generateCheckBox(this._optionsSubsetDiv, "Textures", this._scene.texturesEnabled, function (element) {
  24736. _this._scene.texturesEnabled = element.checked;
  24737. });
  24738. this._globalDiv.appendChild(this._statsDiv);
  24739. this._globalDiv.appendChild(this._logDiv);
  24740. this._globalDiv.appendChild(this._optionsDiv);
  24741. this._globalDiv.appendChild(this._treeDiv);
  24742. }
  24743. };
  24744. DebugLayer.prototype._displayStats = function () {
  24745. var scene = this._scene;
  24746. var engine = scene.getEngine();
  24747. this._statsSubsetDiv.innerHTML = "Babylon.js v" + BABYLON.Engine.Version + " - <b>" + BABYLON.Tools.Format(engine.getFps(), 0) + " fps</b><br><br>" + "Total meshes: " + scene.meshes.length + "<br>" + "Total vertices: " + scene.getTotalVertices() + "<br>" + "Active meshes: " + scene.getActiveMeshes().length + "<br>" + "Active vertices: " + scene.getActiveVertices() + "<br>" + "Active bones: " + scene.getActiveBones() + "<br>" + "Active particles: " + scene.getActiveParticles() + "<br><br>" + "Frame duration: " + BABYLON.Tools.Format(scene.getLastFrameDuration()) + " ms<br>" + "<b>Draw calls: " + engine.drawCalls + "</b><br><br>" + "<i>Evaluate Active Meshes duration:</i> " + BABYLON.Tools.Format(scene.getEvaluateActiveMeshesDuration()) + " ms<br>" + "<i>Render Targets duration:</i> " + BABYLON.Tools.Format(scene.getRenderTargetsDuration()) + " ms<br>" + "<i>Particles duration:</i> " + BABYLON.Tools.Format(scene.getParticlesDuration()) + " ms<br>" + "<i>Sprites duration:</i> " + BABYLON.Tools.Format(scene.getSpritesDuration()) + " ms<br>" + "<i>Render duration:</i> <b>" + BABYLON.Tools.Format(scene.getRenderDuration()) + " ms</b>";
  24748. };
  24749. return DebugLayer;
  24750. })();
  24751. BABYLON.DebugLayer = DebugLayer;
  24752. })(BABYLON || (BABYLON = {}));
  24753. //# sourceMappingURL=babylon.debugLayer.js.map
  24754. var BABYLON;
  24755. (function (BABYLON) {
  24756. var RawTexture = (function (_super) {
  24757. __extends(RawTexture, _super);
  24758. function RawTexture(data, width, height, format, scene, generateMipMaps, invertY, samplingMode) {
  24759. if (typeof generateMipMaps === "undefined") { generateMipMaps = true; }
  24760. if (typeof invertY === "undefined") { invertY = false; }
  24761. if (typeof samplingMode === "undefined") { samplingMode = BABYLON.Texture.TRILINEAR_SAMPLINGMODE; }
  24762. _super.call(this, null, scene, !generateMipMaps, invertY);
  24763. this._texture = scene.getEngine().createRawTexture(data, width, height, format, generateMipMaps, invertY, samplingMode);
  24764. }
  24765. // Statics
  24766. RawTexture.CreateLuminanceTexture = function (data, width, height, scene, generateMipMaps, invertY, samplingMode) {
  24767. if (typeof generateMipMaps === "undefined") { generateMipMaps = true; }
  24768. if (typeof invertY === "undefined") { invertY = false; }
  24769. if (typeof samplingMode === "undefined") { samplingMode = BABYLON.Texture.TRILINEAR_SAMPLINGMODE; }
  24770. return new RawTexture(data, width, height, BABYLON.Engine.TEXTUREFORMAT_LUMINANCE, scene, generateMipMaps, invertY, samplingMode);
  24771. };
  24772. RawTexture.CreateLuminanceAlphaTexture = function (data, width, height, scene, generateMipMaps, invertY, samplingMode) {
  24773. if (typeof generateMipMaps === "undefined") { generateMipMaps = true; }
  24774. if (typeof invertY === "undefined") { invertY = false; }
  24775. if (typeof samplingMode === "undefined") { samplingMode = BABYLON.Texture.TRILINEAR_SAMPLINGMODE; }
  24776. return new RawTexture(data, width, height, BABYLON.Engine.TEXTUREFORMAT_LUMINANCE_ALPHA, scene, generateMipMaps, invertY, samplingMode);
  24777. };
  24778. RawTexture.CreateAlphaTexture = function (data, width, height, scene, generateMipMaps, invertY, samplingMode) {
  24779. if (typeof generateMipMaps === "undefined") { generateMipMaps = true; }
  24780. if (typeof invertY === "undefined") { invertY = false; }
  24781. if (typeof samplingMode === "undefined") { samplingMode = BABYLON.Texture.TRILINEAR_SAMPLINGMODE; }
  24782. return new RawTexture(data, width, height, BABYLON.Engine.TEXTUREFORMAT_ALPHA, scene, generateMipMaps, invertY, samplingMode);
  24783. };
  24784. RawTexture.CreateRGBTexture = function (data, width, height, scene, generateMipMaps, invertY, samplingMode) {
  24785. if (typeof generateMipMaps === "undefined") { generateMipMaps = true; }
  24786. if (typeof invertY === "undefined") { invertY = false; }
  24787. if (typeof samplingMode === "undefined") { samplingMode = BABYLON.Texture.TRILINEAR_SAMPLINGMODE; }
  24788. return new RawTexture(data, width, height, BABYLON.Engine.TEXTUREFORMAT_RGB, scene, generateMipMaps, invertY, samplingMode);
  24789. };
  24790. RawTexture.CreateRGBATexture = function (data, width, height, scene, generateMipMaps, invertY, samplingMode) {
  24791. if (typeof generateMipMaps === "undefined") { generateMipMaps = true; }
  24792. if (typeof invertY === "undefined") { invertY = false; }
  24793. if (typeof samplingMode === "undefined") { samplingMode = BABYLON.Texture.TRILINEAR_SAMPLINGMODE; }
  24794. return new RawTexture(data, width, height, BABYLON.Engine.TEXTUREFORMAT_RGBA, scene, generateMipMaps, invertY, samplingMode);
  24795. };
  24796. return RawTexture;
  24797. })(BABYLON.Texture);
  24798. BABYLON.RawTexture = RawTexture;
  24799. })(BABYLON || (BABYLON = {}));
  24800. //# sourceMappingURL=babylon.rawTexture.js.map