var __extends = this.__extends || function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; function __() { this.constructor = d; } __.prototype = b.prototype; d.prototype = new __(); };var BABYLON; (function (BABYLON) { var Color3 = (function () { function Color3(r, g, b) { if (typeof r === "undefined") { r = 0; } if (typeof g === "undefined") { g = 0; } if (typeof b === "undefined") { b = 0; } this.r = r; this.g = g; this.b = b; } Color3.prototype.toString = function () { return "{R: " + this.r + " G:" + this.g + " B:" + this.b + "}"; }; // Operators Color3.prototype.toArray = function (array, index) { if (index === undefined) { index = 0; } array[index] = this.r; array[index + 1] = this.g; array[index + 2] = this.b; }; Color3.prototype.toColor4 = function (alpha) { if (typeof alpha === "undefined") { alpha = 1; } return new Color4(this.r, this.g, this.b, alpha); }; Color3.prototype.asArray = function () { var result = []; this.toArray(result, 0); return result; }; Color3.prototype.toLuminance = function () { return this.r * 0.3 + this.g * 0.59 + this.b * 0.11; }; Color3.prototype.multiply = function (otherColor) { return new Color3(this.r * otherColor.r, this.g * otherColor.g, this.b * otherColor.b); }; Color3.prototype.multiplyToRef = function (otherColor, result) { result.r = this.r * otherColor.r; result.g = this.g * otherColor.g; result.b = this.b * otherColor.b; }; Color3.prototype.equals = function (otherColor) { return otherColor && this.r === otherColor.r && this.g === otherColor.g && this.b === otherColor.b; }; Color3.prototype.scale = function (scale) { return new Color3(this.r * scale, this.g * scale, this.b * scale); }; Color3.prototype.scaleToRef = function (scale, result) { result.r = this.r * scale; result.g = this.g * scale; result.b = this.b * scale; }; Color3.prototype.add = function (otherColor) { return new Color3(this.r + otherColor.r, this.g + otherColor.g, this.b + otherColor.b); }; Color3.prototype.addToRef = function (otherColor, result) { result.r = this.r + otherColor.r; result.g = this.g + otherColor.g; result.b = this.b + otherColor.b; }; Color3.prototype.subtract = function (otherColor) { return new Color3(this.r - otherColor.r, this.g - otherColor.g, this.b - otherColor.b); }; Color3.prototype.subtractToRef = function (otherColor, result) { result.r = this.r - otherColor.r; result.g = this.g - otherColor.g; result.b = this.b - otherColor.b; }; Color3.prototype.clone = function () { return new Color3(this.r, this.g, this.b); }; Color3.prototype.copyFrom = function (source) { this.r = source.r; this.g = source.g; this.b = source.b; }; Color3.prototype.copyFromFloats = function (r, g, b) { this.r = r; this.g = g; this.b = b; }; // Statics Color3.FromArray = function (array, offset) { if (typeof offset === "undefined") { offset = 0; } return new Color3(array[offset], array[offset + 1], array[offset + 2]); }; Color3.FromInts = function (r, g, b) { return new Color3(r / 255.0, g / 255.0, b / 255.0); }; Color3.Lerp = function (start, end, amount) { var r = start.r + ((end.r - start.r) * amount); var g = start.g + ((end.g - start.g) * amount); var b = start.b + ((end.b - start.b) * amount); return new Color3(r, g, b); }; Color3.Red = function () { return new Color3(1, 0, 0); }; Color3.Green = function () { return new Color3(0, 1, 0); }; Color3.Blue = function () { return new Color3(0, 0, 1); }; Color3.Black = function () { return new Color3(0, 0, 0); }; Color3.White = function () { return new Color3(1, 1, 1); }; Color3.Purple = function () { return new Color3(0.5, 0, 0.5); }; Color3.Magenta = function () { return new Color3(1, 0, 1); }; Color3.Yellow = function () { return new Color3(1, 1, 0); }; Color3.Gray = function () { return new Color3(0.5, 0.5, 0.5); }; return Color3; })(); BABYLON.Color3 = Color3; var Color4 = (function () { function Color4(r, g, b, a) { this.r = r; this.g = g; this.b = b; this.a = a; } // Operators Color4.prototype.addInPlace = function (right) { this.r += right.r; this.g += right.g; this.b += right.b; this.a += right.a; }; Color4.prototype.asArray = function () { var result = []; this.toArray(result, 0); return result; }; Color4.prototype.toArray = function (array, index) { if (index === undefined) { index = 0; } array[index] = this.r; array[index + 1] = this.g; array[index + 2] = this.b; array[index + 3] = this.a; }; Color4.prototype.add = function (right) { return new Color4(this.r + right.r, this.g + right.g, this.b + right.b, this.a + right.a); }; Color4.prototype.subtract = function (right) { return new Color4(this.r - right.r, this.g - right.g, this.b - right.b, this.a - right.a); }; Color4.prototype.subtractToRef = function (right, result) { result.r = this.r - right.r; result.g = this.g - right.g; result.b = this.b - right.b; result.a = this.a - right.a; }; Color4.prototype.scale = function (scale) { return new Color4(this.r * scale, this.g * scale, this.b * scale, this.a * scale); }; Color4.prototype.scaleToRef = function (scale, result) { result.r = this.r * scale; result.g = this.g * scale; result.b = this.b * scale; result.a = this.a * scale; }; Color4.prototype.toString = function () { return "{R: " + this.r + " G:" + this.g + " B:" + this.b + " A:" + this.a + "}"; }; Color4.prototype.clone = function () { return new Color4(this.r, this.g, this.b, this.a); }; Color4.prototype.copyFrom = function (source) { this.r = source.r; this.g = source.g; this.b = source.b; this.a = source.a; }; // Statics Color4.Lerp = function (left, right, amount) { var result = new Color4(0, 0, 0, 0); Color4.LerpToRef(left, right, amount, result); return result; }; Color4.LerpToRef = function (left, right, amount, result) { result.r = left.r + (right.r - left.r) * amount; result.g = left.g + (right.g - left.g) * amount; result.b = left.b + (right.b - left.b) * amount; result.a = left.a + (right.a - left.a) * amount; }; Color4.FromArray = function (array, offset) { if (typeof offset === "undefined") { offset = 0; } return new Color4(array[offset], array[offset + 1], array[offset + 2], array[offset + 3]); }; Color4.FromInts = function (r, g, b, a) { return new Color4(r / 255.0, g / 255.0, b / 255.0, a / 255.0); }; return Color4; })(); BABYLON.Color4 = Color4; var Vector2 = (function () { function Vector2(x, y) { this.x = x; this.y = y; } Vector2.prototype.toString = function () { return "{X: " + this.x + " Y:" + this.y + "}"; }; // Operators Vector2.prototype.toArray = function (array, index) { if (index === undefined) { index = 0; } array[index] = this.x; array[index + 1] = this.y; }; Vector2.prototype.asArray = function () { var result = []; this.toArray(result, 0); return result; }; Vector2.prototype.copyFrom = function (source) { this.x = source.x; this.y = source.y; }; Vector2.prototype.copyFromFloats = function (x, y) { this.x = x; this.y = y; }; Vector2.prototype.add = function (otherVector) { return new Vector2(this.x + otherVector.x, this.y + otherVector.y); }; Vector2.prototype.addVector3 = function (otherVector) { return new Vector2(this.x + otherVector.x, this.y + otherVector.y); }; Vector2.prototype.subtract = function (otherVector) { return new Vector2(this.x - otherVector.x, this.y - otherVector.y); }; Vector2.prototype.subtractInPlace = function (otherVector) { this.x -= otherVector.x; this.y -= otherVector.y; }; Vector2.prototype.multiplyInPlace = function (otherVector) { this.x *= otherVector.x; this.y *= otherVector.y; }; Vector2.prototype.multiply = function (otherVector) { return new Vector2(this.x * otherVector.x, this.y * otherVector.y); }; Vector2.prototype.multiplyToRef = function (otherVector, result) { result.x = this.x * otherVector.x; result.y = this.y * otherVector.y; }; Vector2.prototype.multiplyByFloats = function (x, y) { return new Vector2(this.x * x, this.y * y); }; Vector2.prototype.divide = function (otherVector) { return new Vector2(this.x / otherVector.x, this.y / otherVector.y); }; Vector2.prototype.divideToRef = function (otherVector, result) { result.x = this.x / otherVector.x; result.y = this.y / otherVector.y; }; Vector2.prototype.negate = function () { return new Vector2(-this.x, -this.y); }; Vector2.prototype.scaleInPlace = function (scale) { this.x *= scale; this.y *= scale; return this; }; Vector2.prototype.scale = function (scale) { return new Vector2(this.x * scale, this.y * scale); }; Vector2.prototype.equals = function (otherVector) { return otherVector && this.x === otherVector.x && this.y === otherVector.y; }; // Properties Vector2.prototype.length = function () { return Math.sqrt(this.x * this.x + this.y * this.y); }; Vector2.prototype.lengthSquared = function () { return (this.x * this.x + this.y * this.y); }; // Methods Vector2.prototype.normalize = function () { var len = this.length(); if (len === 0) return this; var num = 1.0 / len; this.x *= num; this.y *= num; return this; }; Vector2.prototype.clone = function () { return new Vector2(this.x, this.y); }; // Statics Vector2.Zero = function () { return new Vector2(0, 0); }; Vector2.FromArray = function (array, offset) { if (typeof offset === "undefined") { offset = 0; } return new Vector2(array[offset], array[offset + 1]); }; Vector2.FromArrayToRef = function (array, offset, result) { result.x = array[offset]; result.y = array[offset + 1]; }; Vector2.CatmullRom = function (value1, value2, value3, value4, amount) { var squared = amount * amount; var cubed = amount * squared; var x = 0.5 * ((((2.0 * value2.x) + ((-value1.x + value3.x) * amount)) + (((((2.0 * value1.x) - (5.0 * value2.x)) + (4.0 * value3.x)) - value4.x) * squared)) + ((((-value1.x + (3.0 * value2.x)) - (3.0 * value3.x)) + value4.x) * cubed)); var y = 0.5 * ((((2.0 * value2.y) + ((-value1.y + value3.y) * amount)) + (((((2.0 * value1.y) - (5.0 * value2.y)) + (4.0 * value3.y)) - value4.y) * squared)) + ((((-value1.y + (3.0 * value2.y)) - (3.0 * value3.y)) + value4.y) * cubed)); return new Vector2(x, y); }; Vector2.Clamp = function (value, min, max) { var x = value.x; x = (x > max.x) ? max.x : x; x = (x < min.x) ? min.x : x; var y = value.y; y = (y > max.y) ? max.y : y; y = (y < min.y) ? min.y : y; return new Vector2(x, y); }; Vector2.Hermite = function (value1, tangent1, value2, tangent2, amount) { var squared = amount * amount; var cubed = amount * squared; var part1 = ((2.0 * cubed) - (3.0 * squared)) + 1.0; var part2 = (-2.0 * cubed) + (3.0 * squared); var part3 = (cubed - (2.0 * squared)) + amount; var part4 = cubed - squared; var x = (((value1.x * part1) + (value2.x * part2)) + (tangent1.x * part3)) + (tangent2.x * part4); var y = (((value1.y * part1) + (value2.y * part2)) + (tangent1.y * part3)) + (tangent2.y * part4); return new Vector2(x, y); }; Vector2.Lerp = function (start, end, amount) { var x = start.x + ((end.x - start.x) * amount); var y = start.y + ((end.y - start.y) * amount); return new Vector2(x, y); }; Vector2.Dot = function (left, right) { return left.x * right.x + left.y * right.y; }; Vector2.Normalize = function (vector) { var newVector = vector.clone(); newVector.normalize(); return newVector; }; Vector2.Minimize = function (left, right) { var x = (left.x < right.x) ? left.x : right.x; var y = (left.y < right.y) ? left.y : right.y; return new Vector2(x, y); }; Vector2.Maximize = function (left, right) { var x = (left.x > right.x) ? left.x : right.x; var y = (left.y > right.y) ? left.y : right.y; return new Vector2(x, y); }; Vector2.Transform = function (vector, transformation) { var x = (vector.x * transformation.m[0]) + (vector.y * transformation.m[4]); var y = (vector.x * transformation.m[1]) + (vector.y * transformation.m[5]); return new Vector2(x, y); }; Vector2.Distance = function (value1, value2) { return Math.sqrt(Vector2.DistanceSquared(value1, value2)); }; Vector2.DistanceSquared = function (value1, value2) { var x = value1.x - value2.x; var y = value1.y - value2.y; return (x * x) + (y * y); }; return Vector2; })(); BABYLON.Vector2 = Vector2; var Vector3 = (function () { function Vector3(x, y, z) { this.x = x; this.y = y; this.z = z; } Vector3.prototype.toString = function () { return "{X: " + this.x + " Y:" + this.y + " Z:" + this.z + "}"; }; // Operators Vector3.prototype.asArray = function () { var result = []; this.toArray(result, 0); return result; }; Vector3.prototype.toArray = function (array, index) { if (index === undefined) { index = 0; } array[index] = this.x; array[index + 1] = this.y; array[index + 2] = this.z; }; Vector3.prototype.addInPlace = function (otherVector) { this.x += otherVector.x; this.y += otherVector.y; this.z += otherVector.z; }; Vector3.prototype.add = function (otherVector) { return new Vector3(this.x + otherVector.x, this.y + otherVector.y, this.z + otherVector.z); }; Vector3.prototype.addToRef = function (otherVector, result) { result.x = this.x + otherVector.x; result.y = this.y + otherVector.y; result.z = this.z + otherVector.z; }; Vector3.prototype.subtractInPlace = function (otherVector) { this.x -= otherVector.x; this.y -= otherVector.y; this.z -= otherVector.z; }; Vector3.prototype.subtract = function (otherVector) { return new Vector3(this.x - otherVector.x, this.y - otherVector.y, this.z - otherVector.z); }; Vector3.prototype.subtractToRef = function (otherVector, result) { result.x = this.x - otherVector.x; result.y = this.y - otherVector.y; result.z = this.z - otherVector.z; }; Vector3.prototype.subtractFromFloats = function (x, y, z) { return new Vector3(this.x - x, this.y - y, this.z - z); }; Vector3.prototype.subtractFromFloatsToRef = function (x, y, z, result) { result.x = this.x - x; result.y = this.y - y; result.z = this.z - z; }; Vector3.prototype.negate = function () { return new Vector3(-this.x, -this.y, -this.z); }; Vector3.prototype.scaleInPlace = function (scale) { this.x *= scale; this.y *= scale; this.z *= scale; return this; }; Vector3.prototype.scale = function (scale) { return new Vector3(this.x * scale, this.y * scale, this.z * scale); }; Vector3.prototype.scaleToRef = function (scale, result) { result.x = this.x * scale; result.y = this.y * scale; result.z = this.z * scale; }; Vector3.prototype.equals = function (otherVector) { return otherVector && this.x === otherVector.x && this.y === otherVector.y && this.z === otherVector.z; }; Vector3.prototype.equalsWithEpsilon = function (otherVector) { return Math.abs(this.x - otherVector.x) < BABYLON.Engine.Epsilon && Math.abs(this.y - otherVector.y) < BABYLON.Engine.Epsilon && Math.abs(this.z - otherVector.z) < BABYLON.Engine.Epsilon; }; Vector3.prototype.equalsToFloats = function (x, y, z) { return this.x === x && this.y === y && this.z === z; }; Vector3.prototype.multiplyInPlace = function (otherVector) { this.x *= otherVector.x; this.y *= otherVector.y; this.z *= otherVector.z; }; Vector3.prototype.multiply = function (otherVector) { return new Vector3(this.x * otherVector.x, this.y * otherVector.y, this.z * otherVector.z); }; Vector3.prototype.multiplyToRef = function (otherVector, result) { result.x = this.x * otherVector.x; result.y = this.y * otherVector.y; result.z = this.z * otherVector.z; }; Vector3.prototype.multiplyByFloats = function (x, y, z) { return new Vector3(this.x * x, this.y * y, this.z * z); }; Vector3.prototype.divide = function (otherVector) { return new Vector3(this.x / otherVector.x, this.y / otherVector.y, this.z / otherVector.z); }; Vector3.prototype.divideToRef = function (otherVector, result) { result.x = this.x / otherVector.x; result.y = this.y / otherVector.y; result.z = this.z / otherVector.z; }; Vector3.prototype.MinimizeInPlace = function (other) { if (other.x < this.x) this.x = other.x; if (other.y < this.y) this.y = other.y; if (other.z < this.z) this.z = other.z; }; Vector3.prototype.MaximizeInPlace = function (other) { if (other.x > this.x) this.x = other.x; if (other.y > this.y) this.y = other.y; if (other.z > this.z) this.z = other.z; }; // Properties Vector3.prototype.length = function () { return Math.sqrt(this.x * this.x + this.y * this.y + this.z * this.z); }; Vector3.prototype.lengthSquared = function () { return (this.x * this.x + this.y * this.y + this.z * this.z); }; // Methods Vector3.prototype.normalize = function () { var len = this.length(); if (len === 0) return this; var num = 1.0 / len; this.x *= num; this.y *= num; this.z *= num; return this; }; Vector3.prototype.clone = function () { return new Vector3(this.x, this.y, this.z); }; Vector3.prototype.copyFrom = function (source) { this.x = source.x; this.y = source.y; this.z = source.z; }; Vector3.prototype.copyFromFloats = function (x, y, z) { this.x = x; this.y = y; this.z = z; }; // Statics Vector3.FromArray = function (array, offset) { if (!offset) { offset = 0; } return new Vector3(array[offset], array[offset + 1], array[offset + 2]); }; Vector3.FromArrayToRef = function (array, offset, result) { result.x = array[offset]; result.y = array[offset + 1]; result.z = array[offset + 2]; }; Vector3.FromFloatArrayToRef = function (array, offset, result) { result.x = array[offset]; result.y = array[offset + 1]; result.z = array[offset + 2]; }; Vector3.FromFloatsToRef = function (x, y, z, result) { result.x = x; result.y = y; result.z = z; }; Vector3.Zero = function () { return new Vector3(0, 0, 0); }; Vector3.Up = function () { return new Vector3(0, 1.0, 0); }; Vector3.TransformCoordinates = function (vector, transformation) { var result = Vector3.Zero(); Vector3.TransformCoordinatesToRef(vector, transformation, result); return result; }; Vector3.TransformCoordinatesToRef = function (vector, transformation, result) { var x = (vector.x * transformation.m[0]) + (vector.y * transformation.m[4]) + (vector.z * transformation.m[8]) + transformation.m[12]; var y = (vector.x * transformation.m[1]) + (vector.y * transformation.m[5]) + (vector.z * transformation.m[9]) + transformation.m[13]; var z = (vector.x * transformation.m[2]) + (vector.y * transformation.m[6]) + (vector.z * transformation.m[10]) + transformation.m[14]; var w = (vector.x * transformation.m[3]) + (vector.y * transformation.m[7]) + (vector.z * transformation.m[11]) + transformation.m[15]; result.x = x / w; result.y = y / w; result.z = z / w; }; Vector3.TransformCoordinatesFromFloatsToRef = function (x, y, z, transformation, result) { var rx = (x * transformation.m[0]) + (y * transformation.m[4]) + (z * transformation.m[8]) + transformation.m[12]; var ry = (x * transformation.m[1]) + (y * transformation.m[5]) + (z * transformation.m[9]) + transformation.m[13]; var rz = (x * transformation.m[2]) + (y * transformation.m[6]) + (z * transformation.m[10]) + transformation.m[14]; var rw = (x * transformation.m[3]) + (y * transformation.m[7]) + (z * transformation.m[11]) + transformation.m[15]; result.x = rx / rw; result.y = ry / rw; result.z = rz / rw; }; Vector3.TransformNormal = function (vector, transformation) { var result = Vector3.Zero(); Vector3.TransformNormalToRef(vector, transformation, result); return result; }; Vector3.TransformNormalToRef = function (vector, transformation, result) { result.x = (vector.x * transformation.m[0]) + (vector.y * transformation.m[4]) + (vector.z * transformation.m[8]); result.y = (vector.x * transformation.m[1]) + (vector.y * transformation.m[5]) + (vector.z * transformation.m[9]); result.z = (vector.x * transformation.m[2]) + (vector.y * transformation.m[6]) + (vector.z * transformation.m[10]); }; Vector3.TransformNormalFromFloatsToRef = function (x, y, z, transformation, result) { result.x = (x * transformation.m[0]) + (y * transformation.m[4]) + (z * transformation.m[8]); result.y = (x * transformation.m[1]) + (y * transformation.m[5]) + (z * transformation.m[9]); result.z = (x * transformation.m[2]) + (y * transformation.m[6]) + (z * transformation.m[10]); }; Vector3.CatmullRom = function (value1, value2, value3, value4, amount) { var squared = amount * amount; var cubed = amount * squared; var x = 0.5 * ((((2.0 * value2.x) + ((-value1.x + value3.x) * amount)) + (((((2.0 * value1.x) - (5.0 * value2.x)) + (4.0 * value3.x)) - value4.x) * squared)) + ((((-value1.x + (3.0 * value2.x)) - (3.0 * value3.x)) + value4.x) * cubed)); var y = 0.5 * ((((2.0 * value2.y) + ((-value1.y + value3.y) * amount)) + (((((2.0 * value1.y) - (5.0 * value2.y)) + (4.0 * value3.y)) - value4.y) * squared)) + ((((-value1.y + (3.0 * value2.y)) - (3.0 * value3.y)) + value4.y) * cubed)); var z = 0.5 * ((((2.0 * value2.z) + ((-value1.z + value3.z) * amount)) + (((((2.0 * value1.z) - (5.0 * value2.z)) + (4.0 * value3.z)) - value4.z) * squared)) + ((((-value1.z + (3.0 * value2.z)) - (3.0 * value3.z)) + value4.z) * cubed)); return new Vector3(x, y, z); }; Vector3.Clamp = function (value, min, max) { var x = value.x; x = (x > max.x) ? max.x : x; x = (x < min.x) ? min.x : x; var y = value.y; y = (y > max.y) ? max.y : y; y = (y < min.y) ? min.y : y; var z = value.z; z = (z > max.z) ? max.z : z; z = (z < min.z) ? min.z : z; return new Vector3(x, y, z); }; Vector3.Hermite = function (value1, tangent1, value2, tangent2, amount) { var squared = amount * amount; var cubed = amount * squared; var part1 = ((2.0 * cubed) - (3.0 * squared)) + 1.0; var part2 = (-2.0 * cubed) + (3.0 * squared); var part3 = (cubed - (2.0 * squared)) + amount; var part4 = cubed - squared; var x = (((value1.x * part1) + (value2.x * part2)) + (tangent1.x * part3)) + (tangent2.x * part4); var y = (((value1.y * part1) + (value2.y * part2)) + (tangent1.y * part3)) + (tangent2.y * part4); var z = (((value1.z * part1) + (value2.z * part2)) + (tangent1.z * part3)) + (tangent2.z * part4); return new Vector3(x, y, z); }; Vector3.Lerp = function (start, end, amount) { var x = start.x + ((end.x - start.x) * amount); var y = start.y + ((end.y - start.y) * amount); var z = start.z + ((end.z - start.z) * amount); return new Vector3(x, y, z); }; Vector3.Dot = function (left, right) { return (left.x * right.x + left.y * right.y + left.z * right.z); }; Vector3.Cross = function (left, right) { var result = Vector3.Zero(); Vector3.CrossToRef(left, right, result); return result; }; Vector3.CrossToRef = function (left, right, result) { result.x = left.y * right.z - left.z * right.y; result.y = left.z * right.x - left.x * right.z; result.z = left.x * right.y - left.y * right.x; }; Vector3.Normalize = function (vector) { var result = Vector3.Zero(); Vector3.NormalizeToRef(vector, result); return result; }; Vector3.NormalizeToRef = function (vector, result) { result.copyFrom(vector); result.normalize(); }; Vector3.Project = function (vector, world, transform, viewport) { var cw = viewport.width; var ch = viewport.height; var cx = viewport.x; var cy = viewport.y; var viewportMatrix = Matrix.FromValues(cw / 2.0, 0, 0, 0, 0, -ch / 2.0, 0, 0, 0, 0, 1, 0, cx + cw / 2.0, ch / 2.0 + cy, 0, 1); var finalMatrix = world.multiply(transform).multiply(viewportMatrix); return Vector3.TransformCoordinates(vector, finalMatrix); }; Vector3.UnprojectFromTransform = function (source, viewportWidth, viewportHeight, world, transform) { var matrix = world.multiply(transform); matrix.invert(); source.x = source.x / viewportWidth * 2 - 1; source.y = -(source.y / viewportHeight * 2 - 1); var vector = Vector3.TransformCoordinates(source, matrix); var num = source.x * matrix.m[3] + source.y * matrix.m[7] + source.z * matrix.m[11] + matrix.m[15]; if (BABYLON.Tools.WithinEpsilon(num, 1.0)) { vector = vector.scale(1.0 / num); } return vector; }; Vector3.Unproject = function (source, viewportWidth, viewportHeight, world, view, projection) { var matrix = world.multiply(view).multiply(projection); matrix.invert(); source.x = source.x / viewportWidth * 2 - 1; source.y = -(source.y / viewportHeight * 2 - 1); var vector = Vector3.TransformCoordinates(source, matrix); var num = source.x * matrix.m[3] + source.y * matrix.m[7] + source.z * matrix.m[11] + matrix.m[15]; if (BABYLON.Tools.WithinEpsilon(num, 1.0)) { vector = vector.scale(1.0 / num); } return vector; }; Vector3.Minimize = function (left, right) { var min = left.clone(); min.MinimizeInPlace(right); return min; }; Vector3.Maximize = function (left, right) { var max = left.clone(); max.MaximizeInPlace(right); return max; }; Vector3.Distance = function (value1, value2) { return Math.sqrt(Vector3.DistanceSquared(value1, value2)); }; Vector3.DistanceSquared = function (value1, value2) { var x = value1.x - value2.x; var y = value1.y - value2.y; var z = value1.z - value2.z; return (x * x) + (y * y) + (z * z); }; Vector3.Center = function (value1, value2) { var center = value1.add(value2); center.scaleInPlace(0.5); return center; }; return Vector3; })(); BABYLON.Vector3 = Vector3; //Vector4 class created for EulerAngle class conversion to Quaternion var Vector4 = (function () { function Vector4(x, y, z, w) { this.x = x; this.y = y; this.z = z; this.w = w; } Vector4.prototype.toString = function () { return "{X: " + this.x + " Y:" + this.y + " Z:" + this.z + "W:" + this.w + "}"; }; // Operators Vector4.prototype.asArray = function () { var result = []; this.toArray(result, 0); return result; }; Vector4.prototype.toArray = function (array, index) { if (index === undefined) { index = 0; } array[index] = this.x; array[index + 1] = this.y; array[index + 2] = this.z; array[index + 3] = this.w; }; Vector4.prototype.addInPlace = function (otherVector) { this.x += otherVector.x; this.y += otherVector.y; this.z += otherVector.z; this.w += otherVector.w; }; Vector4.prototype.add = function (otherVector) { return new Vector4(this.x + otherVector.x, this.y + otherVector.y, this.z + otherVector.z, this.w + otherVector.w); }; Vector4.prototype.addToRef = function (otherVector, result) { result.x = this.x + otherVector.x; result.y = this.y + otherVector.y; result.z = this.z + otherVector.z; result.w = this.w + otherVector.w; }; Vector4.prototype.subtractInPlace = function (otherVector) { this.x -= otherVector.x; this.y -= otherVector.y; this.z -= otherVector.z; this.w -= otherVector.w; }; Vector4.prototype.subtract = function (otherVector) { return new Vector4(this.x - otherVector.x, this.y - otherVector.y, this.z - otherVector.z, this.w - otherVector.w); }; Vector4.prototype.subtractToRef = function (otherVector, result) { result.x = this.x - otherVector.x; result.y = this.y - otherVector.y; result.z = this.z - otherVector.z; result.w = this.w - otherVector.w; }; Vector4.prototype.subtractFromFloats = function (x, y, z, w) { return new Vector4(this.x - x, this.y - y, this.z - z, this.w - w); }; Vector4.prototype.subtractFromFloatsToRef = function (x, y, z, w, result) { result.x = this.x - x; result.y = this.y - y; result.z = this.z - z; result.w = this.w - w; }; Vector4.prototype.negate = function () { return new Vector4(-this.x, -this.y, -this.z, -this.w); }; Vector4.prototype.scaleInPlace = function (scale) { this.x *= scale; this.y *= scale; this.z *= scale; this.w *= scale; return this; }; Vector4.prototype.scale = function (scale) { return new Vector4(this.x * scale, this.y * scale, this.z * scale, this.w * scale); }; Vector4.prototype.scaleToRef = function (scale, result) { result.x = this.x * scale; result.y = this.y * scale; result.z = this.z * scale; result.w = this.w * scale; }; Vector4.prototype.equals = function (otherVector) { return otherVector && this.x === otherVector.x && this.y === otherVector.y && this.z === otherVector.z && this.w === otherVector.w; }; Vector4.prototype.equalsWithEpsilon = function (otherVector) { return Math.abs(this.x - otherVector.x) < BABYLON.Engine.Epsilon && Math.abs(this.y - otherVector.y) < BABYLON.Engine.Epsilon && Math.abs(this.z - otherVector.z) < BABYLON.Engine.Epsilon && Math.abs(this.w - otherVector.w) < BABYLON.Engine.Epsilon; }; Vector4.prototype.equalsToFloats = function (x, y, z, w) { return this.x === x && this.y === y && this.z === z && this.w === w; }; Vector4.prototype.multiplyInPlace = function (otherVector) { this.x *= otherVector.x; this.y *= otherVector.y; this.z *= otherVector.z; this.w *= otherVector.w; }; Vector4.prototype.multiply = function (otherVector) { return new Vector4(this.x * otherVector.x, this.y * otherVector.y, this.z * otherVector.z, this.w * otherVector.w); }; Vector4.prototype.multiplyToRef = function (otherVector, result) { result.x = this.x * otherVector.x; result.y = this.y * otherVector.y; result.z = this.z * otherVector.z; result.w = this.w * otherVector.w; }; Vector4.prototype.multiplyByFloats = function (x, y, z, w) { return new Vector4(this.x * x, this.y * y, this.z * z, this.w * w); }; Vector4.prototype.divide = function (otherVector) { return new Vector4(this.x / otherVector.x, this.y / otherVector.y, this.z / otherVector.z, this.w / otherVector.w); }; Vector4.prototype.divideToRef = function (otherVector, result) { result.x = this.x / otherVector.x; result.y = this.y / otherVector.y; result.z = this.z / otherVector.z; result.w = this.w / otherVector.w; }; Vector4.prototype.MinimizeInPlace = function (other) { if (other.x < this.x) this.x = other.x; if (other.y < this.y) this.y = other.y; if (other.z < this.z) this.z = other.z; if (other.w < this.w) this.w = other.w; }; Vector4.prototype.MaximizeInPlace = function (other) { if (other.x > this.x) this.x = other.x; if (other.y > this.y) this.y = other.y; if (other.z > this.z) this.z = other.z; if (other.w > this.w) this.w = other.w; }; // Properties Vector4.prototype.length = function () { return Math.sqrt(this.x * this.x + this.y * this.y + this.z * this.z + this.w * this.w); }; Vector4.prototype.lengthSquared = function () { return (this.x * this.x + this.y * this.y + this.z * this.z + this.w * this.w); }; // Methods Vector4.prototype.normalize = function () { var len = this.length(); if (len === 0) return this; var num = 1.0 / len; this.x *= num; this.y *= num; this.z *= num; this.w *= num; return this; }; Vector4.prototype.clone = function () { return new Vector4(this.x, this.y, this.z, this.w); }; Vector4.prototype.copyFrom = function (source) { this.x = source.x; this.y = source.y; this.z = source.z; this.w = source.w; }; Vector4.prototype.copyFromFloats = function (x, y, z, w) { this.x = x; this.y = y; this.z = z; this.w = w; }; // Statics Vector4.FromArray = function (array, offset) { if (!offset) { offset = 0; } return new Vector4(array[offset], array[offset + 1], array[offset + 2], array[offset + 3]); }; Vector4.FromArrayToRef = function (array, offset, result) { result.x = array[offset]; result.y = array[offset + 1]; result.z = array[offset + 2]; result.w = array[offset + 3]; }; Vector4.FromFloatArrayToRef = function (array, offset, result) { result.x = array[offset]; result.y = array[offset + 1]; result.z = array[offset + 2]; result.w = array[offset + 3]; }; Vector4.FromFloatsToRef = function (x, y, z, w, result) { result.x = x; result.y = y; result.z = z; result.w = w; }; Vector4.Zero = function () { return new Vector4(0, 0, 0, 0); }; Vector4.Normalize = function (vector) { var result = Vector4.Zero(); Vector4.NormalizeToRef(vector, result); return result; }; Vector4.NormalizeToRef = function (vector, result) { result.copyFrom(vector); result.normalize(); }; Vector4.Minimize = function (left, right) { var min = left.clone(); min.MinimizeInPlace(right); return min; }; Vector4.Maximize = function (left, right) { var max = left.clone(); max.MaximizeInPlace(right); return max; }; Vector4.Distance = function (value1, value2) { return Math.sqrt(Vector4.DistanceSquared(value1, value2)); }; Vector4.DistanceSquared = function (value1, value2) { var x = value1.x - value2.x; var y = value1.y - value2.y; var z = value1.z - value2.z; var w = value1.w - value2.w; return (x * x) + (y * y) + (z * z) + (w * w); }; Vector4.Center = function (value1, value2) { var center = value1.add(value2); center.scaleInPlace(0.5); return center; }; return Vector4; })(); BABYLON.Vector4 = Vector4; var Quaternion = (function () { function Quaternion(x, y, z, w) { if (typeof x === "undefined") { x = 0; } if (typeof y === "undefined") { y = 0; } if (typeof z === "undefined") { z = 0; } if (typeof w === "undefined") { w = 1; } this.x = x; this.y = y; this.z = z; this.w = w; } Quaternion.prototype.toString = function () { return "{X: " + this.x + " Y:" + this.y + " Z:" + this.z + " W:" + this.w + "}"; }; Quaternion.prototype.asArray = function () { return [this.x, this.y, this.z, this.w]; }; Quaternion.prototype.equals = function (otherQuaternion) { return otherQuaternion && this.x === otherQuaternion.x && this.y === otherQuaternion.y && this.z === otherQuaternion.z && this.w === otherQuaternion.w; }; Quaternion.prototype.clone = function () { return new Quaternion(this.x, this.y, this.z, this.w); }; Quaternion.prototype.copyFrom = function (other) { this.x = other.x; this.y = other.y; this.z = other.z; this.w = other.w; }; Quaternion.prototype.copyFromFloats = function (x, y, z, w) { this.x = x; this.y = y; this.z = z; this.w = w; }; Quaternion.prototype.add = function (other) { return new Quaternion(this.x + other.x, this.y + other.y, this.z + other.z, this.w + other.w); }; Quaternion.prototype.subtract = function (other) { return new Quaternion(this.x - other.x, this.y - other.y, this.z - other.z, this.w - other.w); }; Quaternion.prototype.scale = function (value) { return new Quaternion(this.x * value, this.y * value, this.z * value, this.w * value); }; Quaternion.prototype.multiply = function (q1) { var result = new Quaternion(0, 0, 0, 1.0); this.multiplyToRef(q1, result); return result; }; Quaternion.prototype.multiplyToRef = function (q1, result) { result.x = this.x * q1.w + this.y * q1.z - this.z * q1.y + this.w * q1.x; result.y = -this.x * q1.z + this.y * q1.w + this.z * q1.x + this.w * q1.y; result.z = this.x * q1.y - this.y * q1.x + this.z * q1.w + this.w * q1.z; result.w = -this.x * q1.x - this.y * q1.y - this.z * q1.z + this.w * q1.w; }; Quaternion.prototype.length = function () { return Math.sqrt((this.x * this.x) + (this.y * this.y) + (this.z * this.z) + (this.w * this.w)); }; Quaternion.prototype.normalize = function () { var length = 1.0 / this.length(); this.x *= length; this.y *= length; this.z *= length; this.w *= length; }; Quaternion.prototype.toEulerAngles = function () { var result = Vector3.Zero(); this.toEulerAnglesToRef(result); return result; }; Quaternion.prototype.toEulerAnglesToRef = function (result) { //result is an EulerAngles in the in the z-x-z convention var qx = this.x; var qy = this.y; var qz = this.z; var qw = this.w; var qxy = qx * qy; var qxz = qx * qz; var qwy = qw * qy; var qwz = qw * qz; var qwx = qw * qx; var qyz = qy * qz; var sqx = qx * qx; var sqy = qy * qy; var determinant = sqx + sqy; if (determinant !== 0.000 && determinant !== 1.000) { result.x = Math.atan2(qxz + qwy, qwx - qyz); result.y = Math.acos(1 - 2 * determinant); result.z = Math.atan2(qxz - qwy, qwx + qyz); } else { if (determinant === 0.0) { result.x = 0.0; result.y = 0.0; result.z = Math.atan2(qxy - qwz, 0.5 - sqy - qz * qz); //actually, degeneracy gives us choice with x+z=Math.atan2(qxy-qwz,0.5-sqy-qz*qz) } else { result.x = Math.atan2(qxy - qwz, 0.5 - sqy - qz * qz); //actually, degeneracy gives us choice with x-z=Math.atan2(qxy-qwz,0.5-sqy-qz*qz) result.y = Math.PI; result.z = 0.0; } } }; Quaternion.prototype.toRotationMatrix = function (result) { var xx = this.x * this.x; var yy = this.y * this.y; var zz = this.z * this.z; var xy = this.x * this.y; var zw = this.z * this.w; var zx = this.z * this.x; var yw = this.y * this.w; var yz = this.y * this.z; var xw = this.x * this.w; result.m[0] = 1.0 - (2.0 * (yy + zz)); result.m[1] = 2.0 * (xy + zw); result.m[2] = 2.0 * (zx - yw); result.m[3] = 0; result.m[4] = 2.0 * (xy - zw); result.m[5] = 1.0 - (2.0 * (zz + xx)); result.m[6] = 2.0 * (yz + xw); result.m[7] = 0; result.m[8] = 2.0 * (zx + yw); result.m[9] = 2.0 * (yz - xw); result.m[10] = 1.0 - (2.0 * (yy + xx)); result.m[11] = 0; result.m[12] = 0; result.m[13] = 0; result.m[14] = 0; result.m[15] = 1.0; }; Quaternion.prototype.fromRotationMatrix = function (matrix) { var data = matrix.m; var m11 = data[0], m12 = data[4], m13 = data[8]; var m21 = data[1], m22 = data[5], m23 = data[9]; var m31 = data[2], m32 = data[6], m33 = data[10]; var trace = m11 + m22 + m33; var s; if (trace > 0) { s = 0.5 / Math.sqrt(trace + 1.0); this.w = 0.25 / s; this.x = (m32 - m23) * s; this.y = (m13 - m31) * s; this.z = (m21 - m12) * s; return; } if (m11 > m22 && m11 > m33) { s = 2.0 * Math.sqrt(1.0 + m11 - m22 - m33); this.w = (m32 - m23) / s; this.x = 0.25 * s; this.y = (m12 + m21) / s; this.z = (m13 + m31) / s; return; } if (m22 > m33) { s = 2.0 * Math.sqrt(1.0 + m22 - m11 - m33); this.w = (m13 - m31) / s; this.x = (m12 + m21) / s; this.y = 0.25 * s; this.z = (m23 + m32) / s; return; } s = 2.0 * Math.sqrt(1.0 + m33 - m11 - m22); this.w = (m21 - m12) / s; this.x = (m13 + m31) / s; this.y = (m23 + m32) / s; this.z = 0.25 * s; }; // Statics Quaternion.Inverse = function (q) { return new Quaternion(-q.x, -q.y, -q.z, q.w); }; Quaternion.Identity = function () { return new Quaternion(0, 0, 0, 1); }; Quaternion.RotationAxis = function (axis, angle) { var result = new Quaternion(); var sin = Math.sin(angle / 2); result.w = Math.cos(angle / 2); result.x = axis.x * sin; result.y = axis.y * sin; result.z = axis.z * sin; return result; }; Quaternion.FromArray = function (array, offset) { if (!offset) { offset = 0; } return new Quaternion(array[offset], array[offset + 1], array[offset + 2], array[offset + 3]); }; Quaternion.RotationYawPitchRoll = function (yaw, pitch, roll) { var result = new Quaternion(); Quaternion.RotationYawPitchRollToRef(yaw, pitch, roll, result); return result; }; Quaternion.RotationYawPitchRollToRef = function (yaw, pitch, roll, result) { var halfRoll = roll * 0.5; var halfPitch = pitch * 0.5; var halfYaw = yaw * 0.5; var sinRoll = Math.sin(halfRoll); var cosRoll = Math.cos(halfRoll); var sinPitch = Math.sin(halfPitch); var cosPitch = Math.cos(halfPitch); var sinYaw = Math.sin(halfYaw); var cosYaw = Math.cos(halfYaw); result.x = (cosYaw * sinPitch * cosRoll) + (sinYaw * cosPitch * sinRoll); result.y = (sinYaw * cosPitch * cosRoll) - (cosYaw * sinPitch * sinRoll); result.z = (cosYaw * cosPitch * sinRoll) - (sinYaw * sinPitch * cosRoll); result.w = (cosYaw * cosPitch * cosRoll) + (sinYaw * sinPitch * sinRoll); }; Quaternion.Slerp = function (left, right, amount) { var num2; var num3; var num = amount; var num4 = (((left.x * right.x) + (left.y * right.y)) + (left.z * right.z)) + (left.w * right.w); var flag = false; if (num4 < 0) { flag = true; num4 = -num4; } if (num4 > 0.999999) { num3 = 1 - num; num2 = flag ? -num : num; } else { var num5 = Math.acos(num4); var num6 = (1.0 / Math.sin(num5)); num3 = (Math.sin((1.0 - num) * num5)) * num6; num2 = flag ? ((-Math.sin(num * num5)) * num6) : ((Math.sin(num * num5)) * num6); } return new Quaternion((num3 * left.x) + (num2 * right.x), (num3 * left.y) + (num2 * right.y), (num3 * left.z) + (num2 * right.z), (num3 * left.w) + (num2 * right.w)); }; return Quaternion; })(); BABYLON.Quaternion = Quaternion; var Matrix = (function () { function Matrix() { this.m = new Float32Array(16); } // Properties Matrix.prototype.isIdentity = function () { if (this.m[0] !== 1.0 || this.m[5] !== 1.0 || this.m[10] !== 1.0 || this.m[15] !== 1.0) return false; if (this.m[1] !== 0.0 || this.m[2] !== 0.0 || this.m[3] !== 0.0 || this.m[4] !== 0.0 || this.m[6] !== 0.0 || this.m[7] !== 0.0 || this.m[8] !== 0.0 || this.m[9] !== 0.0 || this.m[11] !== 0.0 || this.m[12] !== 0.0 || this.m[13] !== 0.0 || this.m[14] !== 0.0) return false; return true; }; Matrix.prototype.determinant = function () { var temp1 = (this.m[10] * this.m[15]) - (this.m[11] * this.m[14]); var temp2 = (this.m[9] * this.m[15]) - (this.m[11] * this.m[13]); var temp3 = (this.m[9] * this.m[14]) - (this.m[10] * this.m[13]); var temp4 = (this.m[8] * this.m[15]) - (this.m[11] * this.m[12]); var temp5 = (this.m[8] * this.m[14]) - (this.m[10] * this.m[12]); var temp6 = (this.m[8] * this.m[13]) - (this.m[9] * this.m[12]); return ((((this.m[0] * (((this.m[5] * temp1) - (this.m[6] * temp2)) + (this.m[7] * temp3))) - (this.m[1] * (((this.m[4] * temp1) - (this.m[6] * temp4)) + (this.m[7] * temp5)))) + (this.m[2] * (((this.m[4] * temp2) - (this.m[5] * temp4)) + (this.m[7] * temp6)))) - (this.m[3] * (((this.m[4] * temp3) - (this.m[5] * temp5)) + (this.m[6] * temp6)))); }; // Methods Matrix.prototype.toArray = function () { return this.m; }; Matrix.prototype.asArray = function () { return this.toArray(); }; Matrix.prototype.invert = function () { this.invertToRef(this); }; Matrix.prototype.invertToRef = function (other) { var l1 = this.m[0]; var l2 = this.m[1]; var l3 = this.m[2]; var l4 = this.m[3]; var l5 = this.m[4]; var l6 = this.m[5]; var l7 = this.m[6]; var l8 = this.m[7]; var l9 = this.m[8]; var l10 = this.m[9]; var l11 = this.m[10]; var l12 = this.m[11]; var l13 = this.m[12]; var l14 = this.m[13]; var l15 = this.m[14]; var l16 = this.m[15]; var l17 = (l11 * l16) - (l12 * l15); var l18 = (l10 * l16) - (l12 * l14); var l19 = (l10 * l15) - (l11 * l14); var l20 = (l9 * l16) - (l12 * l13); var l21 = (l9 * l15) - (l11 * l13); var l22 = (l9 * l14) - (l10 * l13); var l23 = ((l6 * l17) - (l7 * l18)) + (l8 * l19); var l24 = -(((l5 * l17) - (l7 * l20)) + (l8 * l21)); var l25 = ((l5 * l18) - (l6 * l20)) + (l8 * l22); var l26 = -(((l5 * l19) - (l6 * l21)) + (l7 * l22)); var l27 = 1.0 / ((((l1 * l23) + (l2 * l24)) + (l3 * l25)) + (l4 * l26)); var l28 = (l7 * l16) - (l8 * l15); var l29 = (l6 * l16) - (l8 * l14); var l30 = (l6 * l15) - (l7 * l14); var l31 = (l5 * l16) - (l8 * l13); var l32 = (l5 * l15) - (l7 * l13); var l33 = (l5 * l14) - (l6 * l13); var l34 = (l7 * l12) - (l8 * l11); var l35 = (l6 * l12) - (l8 * l10); var l36 = (l6 * l11) - (l7 * l10); var l37 = (l5 * l12) - (l8 * l9); var l38 = (l5 * l11) - (l7 * l9); var l39 = (l5 * l10) - (l6 * l9); other.m[0] = l23 * l27; other.m[4] = l24 * l27; other.m[8] = l25 * l27; other.m[12] = l26 * l27; other.m[1] = -(((l2 * l17) - (l3 * l18)) + (l4 * l19)) * l27; other.m[5] = (((l1 * l17) - (l3 * l20)) + (l4 * l21)) * l27; other.m[9] = -(((l1 * l18) - (l2 * l20)) + (l4 * l22)) * l27; other.m[13] = (((l1 * l19) - (l2 * l21)) + (l3 * l22)) * l27; other.m[2] = (((l2 * l28) - (l3 * l29)) + (l4 * l30)) * l27; other.m[6] = -(((l1 * l28) - (l3 * l31)) + (l4 * l32)) * l27; other.m[10] = (((l1 * l29) - (l2 * l31)) + (l4 * l33)) * l27; other.m[14] = -(((l1 * l30) - (l2 * l32)) + (l3 * l33)) * l27; other.m[3] = -(((l2 * l34) - (l3 * l35)) + (l4 * l36)) * l27; other.m[7] = (((l1 * l34) - (l3 * l37)) + (l4 * l38)) * l27; other.m[11] = -(((l1 * l35) - (l2 * l37)) + (l4 * l39)) * l27; other.m[15] = (((l1 * l36) - (l2 * l38)) + (l3 * l39)) * l27; }; Matrix.prototype.setTranslation = function (vector3) { this.m[12] = vector3.x; this.m[13] = vector3.y; this.m[14] = vector3.z; }; Matrix.prototype.multiply = function (other) { var result = new Matrix(); this.multiplyToRef(other, result); return result; }; Matrix.prototype.copyFrom = function (other) { for (var index = 0; index < 16; index++) { this.m[index] = other.m[index]; } }; Matrix.prototype.copyToArray = function (array, offset) { if (typeof offset === "undefined") { offset = 0; } for (var index = 0; index < 16; index++) { array[offset + index] = this.m[index]; } }; Matrix.prototype.multiplyToRef = function (other, result) { this.multiplyToArray(other, result.m, 0); }; Matrix.prototype.multiplyToArray = function (other, result, offset) { var tm0 = this.m[0]; var tm1 = this.m[1]; var tm2 = this.m[2]; var tm3 = this.m[3]; var tm4 = this.m[4]; var tm5 = this.m[5]; var tm6 = this.m[6]; var tm7 = this.m[7]; var tm8 = this.m[8]; var tm9 = this.m[9]; var tm10 = this.m[10]; var tm11 = this.m[11]; var tm12 = this.m[12]; var tm13 = this.m[13]; var tm14 = this.m[14]; var tm15 = this.m[15]; var om0 = other.m[0]; var om1 = other.m[1]; var om2 = other.m[2]; var om3 = other.m[3]; var om4 = other.m[4]; var om5 = other.m[5]; var om6 = other.m[6]; var om7 = other.m[7]; var om8 = other.m[8]; var om9 = other.m[9]; var om10 = other.m[10]; var om11 = other.m[11]; var om12 = other.m[12]; var om13 = other.m[13]; var om14 = other.m[14]; var om15 = other.m[15]; result[offset] = tm0 * om0 + tm1 * om4 + tm2 * om8 + tm3 * om12; result[offset + 1] = tm0 * om1 + tm1 * om5 + tm2 * om9 + tm3 * om13; result[offset + 2] = tm0 * om2 + tm1 * om6 + tm2 * om10 + tm3 * om14; result[offset + 3] = tm0 * om3 + tm1 * om7 + tm2 * om11 + tm3 * om15; result[offset + 4] = tm4 * om0 + tm5 * om4 + tm6 * om8 + tm7 * om12; result[offset + 5] = tm4 * om1 + tm5 * om5 + tm6 * om9 + tm7 * om13; result[offset + 6] = tm4 * om2 + tm5 * om6 + tm6 * om10 + tm7 * om14; result[offset + 7] = tm4 * om3 + tm5 * om7 + tm6 * om11 + tm7 * om15; result[offset + 8] = tm8 * om0 + tm9 * om4 + tm10 * om8 + tm11 * om12; result[offset + 9] = tm8 * om1 + tm9 * om5 + tm10 * om9 + tm11 * om13; result[offset + 10] = tm8 * om2 + tm9 * om6 + tm10 * om10 + tm11 * om14; result[offset + 11] = tm8 * om3 + tm9 * om7 + tm10 * om11 + tm11 * om15; result[offset + 12] = tm12 * om0 + tm13 * om4 + tm14 * om8 + tm15 * om12; result[offset + 13] = tm12 * om1 + tm13 * om5 + tm14 * om9 + tm15 * om13; result[offset + 14] = tm12 * om2 + tm13 * om6 + tm14 * om10 + tm15 * om14; result[offset + 15] = tm12 * om3 + tm13 * om7 + tm14 * om11 + tm15 * om15; }; Matrix.prototype.equals = function (value) { return value && (this.m[0] === value.m[0] && this.m[1] === value.m[1] && this.m[2] === value.m[2] && this.m[3] === value.m[3] && this.m[4] === value.m[4] && this.m[5] === value.m[5] && this.m[6] === value.m[6] && this.m[7] === value.m[7] && this.m[8] === value.m[8] && this.m[9] === value.m[9] && this.m[10] === value.m[10] && this.m[11] === value.m[11] && this.m[12] === value.m[12] && this.m[13] === value.m[13] && this.m[14] === value.m[14] && this.m[15] === value.m[15]); }; Matrix.prototype.clone = function () { return Matrix.FromValues(this.m[0], this.m[1], this.m[2], this.m[3], this.m[4], this.m[5], this.m[6], this.m[7], this.m[8], this.m[9], this.m[10], this.m[11], this.m[12], this.m[13], this.m[14], this.m[15]); }; Matrix.prototype.decompose = function (scale, rotation, translation) { translation.x = this.m[12]; translation.y = this.m[13]; translation.z = this.m[14]; var xs = BABYLON.Tools.Sign(this.m[0] * this.m[1] * this.m[2] * this.m[3]) < 0 ? -1 : 1; var ys = BABYLON.Tools.Sign(this.m[4] * this.m[5] * this.m[6] * this.m[7]) < 0 ? -1 : 1; var zs = BABYLON.Tools.Sign(this.m[8] * this.m[9] * this.m[10] * this.m[11]) < 0 ? -1 : 1; scale.x = xs * Math.sqrt(this.m[0] * this.m[0] + this.m[1] * this.m[1] + this.m[2] * this.m[2]); scale.y = ys * Math.sqrt(this.m[4] * this.m[4] + this.m[5] * this.m[5] + this.m[6] * this.m[6]); scale.z = zs * Math.sqrt(this.m[8] * this.m[8] + this.m[9] * this.m[9] + this.m[10] * this.m[10]); if (scale.x == 0 || scale.y == 0 || scale.z == 0) { rotation.x = 0; rotation.y = 0; rotation.z = 0; rotation.w = 1; return false; } var rotationMatrix = BABYLON.Matrix.FromValues(this.m[0] / scale.x, this.m[1] / scale.x, this.m[2] / scale.x, 0, this.m[4] / scale.y, this.m[5] / scale.y, this.m[6] / scale.y, 0, this.m[8] / scale.z, this.m[9] / scale.z, this.m[10] / scale.z, 0, 0, 0, 0, 1); rotation.fromRotationMatrix(rotationMatrix); return true; }; // Statics Matrix.FromArray = function (array, offset) { var result = new Matrix(); if (!offset) { offset = 0; } Matrix.FromArrayToRef(array, offset, result); return result; }; Matrix.FromArrayToRef = function (array, offset, result) { for (var index = 0; index < 16; index++) { result.m[index] = array[index + offset]; } }; Matrix.FromValuesToRef = function (initialM11, initialM12, initialM13, initialM14, initialM21, initialM22, initialM23, initialM24, initialM31, initialM32, initialM33, initialM34, initialM41, initialM42, initialM43, initialM44, result) { result.m[0] = initialM11; result.m[1] = initialM12; result.m[2] = initialM13; result.m[3] = initialM14; result.m[4] = initialM21; result.m[5] = initialM22; result.m[6] = initialM23; result.m[7] = initialM24; result.m[8] = initialM31; result.m[9] = initialM32; result.m[10] = initialM33; result.m[11] = initialM34; result.m[12] = initialM41; result.m[13] = initialM42; result.m[14] = initialM43; result.m[15] = initialM44; }; Matrix.FromValues = function (initialM11, initialM12, initialM13, initialM14, initialM21, initialM22, initialM23, initialM24, initialM31, initialM32, initialM33, initialM34, initialM41, initialM42, initialM43, initialM44) { var result = new Matrix(); result.m[0] = initialM11; result.m[1] = initialM12; result.m[2] = initialM13; result.m[3] = initialM14; result.m[4] = initialM21; result.m[5] = initialM22; result.m[6] = initialM23; result.m[7] = initialM24; result.m[8] = initialM31; result.m[9] = initialM32; result.m[10] = initialM33; result.m[11] = initialM34; result.m[12] = initialM41; result.m[13] = initialM42; result.m[14] = initialM43; result.m[15] = initialM44; return result; }; Matrix.Compose = function (scale, rotation, translation) { var result = Matrix.FromValues(scale.x, 0, 0, 0, 0, scale.y, 0, 0, 0, 0, scale.z, 0, 0, 0, 0, 1); var rotationMatrix = Matrix.Identity(); rotation.toRotationMatrix(rotationMatrix); result = result.multiply(rotationMatrix); result.setTranslation(translation); return result; }; Matrix.Identity = function () { return Matrix.FromValues(1.0, 0, 0, 0, 0, 1.0, 0, 0, 0, 0, 1.0, 0, 0, 0, 0, 1.0); }; Matrix.IdentityToRef = function (result) { Matrix.FromValuesToRef(1.0, 0, 0, 0, 0, 1.0, 0, 0, 0, 0, 1.0, 0, 0, 0, 0, 1.0, result); }; Matrix.Zero = function () { return Matrix.FromValues(0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0); }; Matrix.RotationX = function (angle) { var result = new Matrix(); Matrix.RotationXToRef(angle, result); return result; }; Matrix.Invert = function (source) { var result = new Matrix(); source.invertToRef(result); return result; }; Matrix.RotationXToRef = function (angle, result) { var s = Math.sin(angle); var c = Math.cos(angle); result.m[0] = 1.0; result.m[15] = 1.0; result.m[5] = c; result.m[10] = c; result.m[9] = -s; result.m[6] = s; result.m[1] = 0; result.m[2] = 0; result.m[3] = 0; result.m[4] = 0; result.m[7] = 0; result.m[8] = 0; result.m[11] = 0; result.m[12] = 0; result.m[13] = 0; result.m[14] = 0; }; Matrix.RotationY = function (angle) { var result = new Matrix(); Matrix.RotationYToRef(angle, result); return result; }; Matrix.RotationYToRef = function (angle, result) { var s = Math.sin(angle); var c = Math.cos(angle); result.m[5] = 1.0; result.m[15] = 1.0; result.m[0] = c; result.m[2] = -s; result.m[8] = s; result.m[10] = c; result.m[1] = 0; result.m[3] = 0; result.m[4] = 0; result.m[6] = 0; result.m[7] = 0; result.m[9] = 0; result.m[11] = 0; result.m[12] = 0; result.m[13] = 0; result.m[14] = 0; }; Matrix.RotationZ = function (angle) { var result = new Matrix(); Matrix.RotationZToRef(angle, result); return result; }; Matrix.RotationZToRef = function (angle, result) { var s = Math.sin(angle); var c = Math.cos(angle); result.m[10] = 1.0; result.m[15] = 1.0; result.m[0] = c; result.m[1] = s; result.m[4] = -s; result.m[5] = c; result.m[2] = 0; result.m[3] = 0; result.m[6] = 0; result.m[7] = 0; result.m[8] = 0; result.m[9] = 0; result.m[11] = 0; result.m[12] = 0; result.m[13] = 0; result.m[14] = 0; }; Matrix.RotationAxis = function (axis, angle) { var s = Math.sin(-angle); var c = Math.cos(-angle); var c1 = 1 - c; axis.normalize(); var result = Matrix.Zero(); result.m[0] = (axis.x * axis.x) * c1 + c; result.m[1] = (axis.x * axis.y) * c1 - (axis.z * s); result.m[2] = (axis.x * axis.z) * c1 + (axis.y * s); result.m[3] = 0.0; result.m[4] = (axis.y * axis.x) * c1 + (axis.z * s); result.m[5] = (axis.y * axis.y) * c1 + c; result.m[6] = (axis.y * axis.z) * c1 - (axis.x * s); result.m[7] = 0.0; result.m[8] = (axis.z * axis.x) * c1 - (axis.y * s); result.m[9] = (axis.z * axis.y) * c1 + (axis.x * s); result.m[10] = (axis.z * axis.z) * c1 + c; result.m[11] = 0.0; result.m[15] = 1.0; return result; }; Matrix.RotationYawPitchRoll = function (yaw, pitch, roll) { var result = new Matrix(); Matrix.RotationYawPitchRollToRef(yaw, pitch, roll, result); return result; }; Matrix.RotationYawPitchRollToRef = function (yaw, pitch, roll, result) { Quaternion.RotationYawPitchRollToRef(yaw, pitch, roll, this._tempQuaternion); this._tempQuaternion.toRotationMatrix(result); }; Matrix.Scaling = function (x, y, z) { var result = Matrix.Zero(); Matrix.ScalingToRef(x, y, z, result); return result; }; Matrix.ScalingToRef = function (x, y, z, result) { result.m[0] = x; result.m[1] = 0; result.m[2] = 0; result.m[3] = 0; result.m[4] = 0; result.m[5] = y; result.m[6] = 0; result.m[7] = 0; result.m[8] = 0; result.m[9] = 0; result.m[10] = z; result.m[11] = 0; result.m[12] = 0; result.m[13] = 0; result.m[14] = 0; result.m[15] = 1.0; }; Matrix.Translation = function (x, y, z) { var result = Matrix.Identity(); Matrix.TranslationToRef(x, y, z, result); return result; }; Matrix.TranslationToRef = function (x, y, z, result) { Matrix.FromValuesToRef(1.0, 0, 0, 0, 0, 1.0, 0, 0, 0, 0, 1.0, 0, x, y, z, 1.0, result); }; Matrix.LookAtLH = function (eye, target, up) { var result = Matrix.Zero(); Matrix.LookAtLHToRef(eye, target, up, result); return result; }; Matrix.LookAtLHToRef = function (eye, target, up, result) { // Z axis target.subtractToRef(eye, this._zAxis); this._zAxis.normalize(); // X axis Vector3.CrossToRef(up, this._zAxis, this._xAxis); this._xAxis.normalize(); // Y axis Vector3.CrossToRef(this._zAxis, this._xAxis, this._yAxis); this._yAxis.normalize(); // Eye angles var ex = -Vector3.Dot(this._xAxis, eye); var ey = -Vector3.Dot(this._yAxis, eye); var ez = -Vector3.Dot(this._zAxis, eye); return Matrix.FromValuesToRef(this._xAxis.x, this._yAxis.x, this._zAxis.x, 0, this._xAxis.y, this._yAxis.y, this._zAxis.y, 0, this._xAxis.z, this._yAxis.z, this._zAxis.z, 0, ex, ey, ez, 1, result); }; Matrix.OrthoLH = function (width, height, znear, zfar) { var hw = 2.0 / width; var hh = 2.0 / height; var id = 1.0 / (zfar - znear); var nid = znear / (znear - zfar); return Matrix.FromValues(hw, 0, 0, 0, 0, hh, 0, 0, 0, 0, id, 0, 0, 0, nid, 1); }; Matrix.OrthoOffCenterLH = function (left, right, bottom, top, znear, zfar) { var matrix = Matrix.Zero(); Matrix.OrthoOffCenterLHToRef(left, right, bottom, top, znear, zfar, matrix); return matrix; }; Matrix.OrthoOffCenterLHToRef = function (left, right, bottom, top, znear, zfar, result) { result.m[0] = 2.0 / (right - left); result.m[1] = result.m[2] = result.m[3] = 0; result.m[5] = 2.0 / (top - bottom); result.m[4] = result.m[6] = result.m[7] = 0; result.m[10] = -1.0 / (znear - zfar); result.m[8] = result.m[9] = result.m[11] = 0; result.m[12] = (left + right) / (left - right); result.m[13] = (top + bottom) / (bottom - top); result.m[14] = znear / (znear - zfar); result.m[15] = 1.0; }; Matrix.PerspectiveLH = function (width, height, znear, zfar) { var matrix = Matrix.Zero(); matrix.m[0] = (2.0 * znear) / width; matrix.m[1] = matrix.m[2] = matrix.m[3] = 0.0; matrix.m[5] = (2.0 * znear) / height; matrix.m[4] = matrix.m[6] = matrix.m[7] = 0.0; matrix.m[10] = -zfar / (znear - zfar); matrix.m[8] = matrix.m[9] = 0.0; matrix.m[11] = 1.0; matrix.m[12] = matrix.m[13] = matrix.m[15] = 0.0; matrix.m[14] = (znear * zfar) / (znear - zfar); return matrix; }; Matrix.PerspectiveFovLH = function (fov, aspect, znear, zfar) { var matrix = Matrix.Zero(); Matrix.PerspectiveFovLHToRef(fov, aspect, znear, zfar, matrix); return matrix; }; Matrix.PerspectiveFovLHToRef = function (fov, aspect, znear, zfar, result) { var tan = 1.0 / (Math.tan(fov * 0.5)); result.m[0] = tan / aspect; result.m[1] = result.m[2] = result.m[3] = 0.0; result.m[5] = tan; result.m[4] = result.m[6] = result.m[7] = 0.0; result.m[8] = result.m[9] = 0.0; result.m[10] = -zfar / (znear - zfar); result.m[11] = 1.0; result.m[12] = result.m[13] = result.m[15] = 0.0; result.m[14] = (znear * zfar) / (znear - zfar); }; Matrix.GetFinalMatrix = function (viewport, world, view, projection, zmin, zmax) { var cw = viewport.width; var ch = viewport.height; var cx = viewport.x; var cy = viewport.y; var viewportMatrix = Matrix.FromValues(cw / 2.0, 0, 0, 0, 0, -ch / 2.0, 0, 0, 0, 0, zmax - zmin, 0, cx + cw / 2.0, ch / 2.0 + cy, zmin, 1); return world.multiply(view).multiply(projection).multiply(viewportMatrix); }; Matrix.Transpose = function (matrix) { var result = new Matrix(); result.m[0] = matrix.m[0]; result.m[1] = matrix.m[4]; result.m[2] = matrix.m[8]; result.m[3] = matrix.m[12]; result.m[4] = matrix.m[1]; result.m[5] = matrix.m[5]; result.m[6] = matrix.m[9]; result.m[7] = matrix.m[13]; result.m[8] = matrix.m[2]; result.m[9] = matrix.m[6]; result.m[10] = matrix.m[10]; result.m[11] = matrix.m[14]; result.m[12] = matrix.m[3]; result.m[13] = matrix.m[7]; result.m[14] = matrix.m[11]; result.m[15] = matrix.m[15]; return result; }; Matrix.Reflection = function (plane) { var matrix = new Matrix(); Matrix.ReflectionToRef(plane, matrix); return matrix; }; Matrix.ReflectionToRef = function (plane, result) { plane.normalize(); var x = plane.normal.x; var y = plane.normal.y; var z = plane.normal.z; var temp = -2 * x; var temp2 = -2 * y; var temp3 = -2 * z; result.m[0] = (temp * x) + 1; result.m[1] = temp2 * x; result.m[2] = temp3 * x; result.m[3] = 0.0; result.m[4] = temp * y; result.m[5] = (temp2 * y) + 1; result.m[6] = temp3 * y; result.m[7] = 0.0; result.m[8] = temp * z; result.m[9] = temp2 * z; result.m[10] = (temp3 * z) + 1; result.m[11] = 0.0; result.m[12] = temp * plane.d; result.m[13] = temp2 * plane.d; result.m[14] = temp3 * plane.d; result.m[15] = 1.0; }; Matrix._tempQuaternion = new Quaternion(); Matrix._xAxis = Vector3.Zero(); Matrix._yAxis = Vector3.Zero(); Matrix._zAxis = Vector3.Zero(); return Matrix; })(); BABYLON.Matrix = Matrix; var Plane = (function () { function Plane(a, b, c, d) { this.normal = new Vector3(a, b, c); this.d = d; } Plane.prototype.asArray = function () { return [this.normal.x, this.normal.y, this.normal.z, this.d]; }; // Methods Plane.prototype.clone = function () { return new Plane(this.normal.x, this.normal.y, this.normal.z, this.d); }; Plane.prototype.normalize = function () { var norm = (Math.sqrt((this.normal.x * this.normal.x) + (this.normal.y * this.normal.y) + (this.normal.z * this.normal.z))); var magnitude = 0; if (norm !== 0) { magnitude = 1.0 / norm; } this.normal.x *= magnitude; this.normal.y *= magnitude; this.normal.z *= magnitude; this.d *= magnitude; }; Plane.prototype.transform = function (transformation) { var transposedMatrix = Matrix.Transpose(transformation); var x = this.normal.x; var y = this.normal.y; var z = this.normal.z; var d = this.d; var normalX = (((x * transposedMatrix.m[0]) + (y * transposedMatrix.m[1])) + (z * transposedMatrix.m[2])) + (d * transposedMatrix.m[3]); var normalY = (((x * transposedMatrix.m[4]) + (y * transposedMatrix.m[5])) + (z * transposedMatrix.m[6])) + (d * transposedMatrix.m[7]); var normalZ = (((x * transposedMatrix.m[8]) + (y * transposedMatrix.m[9])) + (z * transposedMatrix.m[10])) + (d * transposedMatrix.m[11]); var finalD = (((x * transposedMatrix.m[12]) + (y * transposedMatrix.m[13])) + (z * transposedMatrix.m[14])) + (d * transposedMatrix.m[15]); return new Plane(normalX, normalY, normalZ, finalD); }; Plane.prototype.dotCoordinate = function (point) { return ((((this.normal.x * point.x) + (this.normal.y * point.y)) + (this.normal.z * point.z)) + this.d); }; Plane.prototype.copyFromPoints = function (point1, point2, point3) { var x1 = point2.x - point1.x; var y1 = point2.y - point1.y; var z1 = point2.z - point1.z; var x2 = point3.x - point1.x; var y2 = point3.y - point1.y; var z2 = point3.z - point1.z; var yz = (y1 * z2) - (z1 * y2); var xz = (z1 * x2) - (x1 * z2); var xy = (x1 * y2) - (y1 * x2); var pyth = (Math.sqrt((yz * yz) + (xz * xz) + (xy * xy))); var invPyth; if (pyth !== 0) { invPyth = 1.0 / pyth; } else { invPyth = 0; } this.normal.x = yz * invPyth; this.normal.y = xz * invPyth; this.normal.z = xy * invPyth; this.d = -((this.normal.x * point1.x) + (this.normal.y * point1.y) + (this.normal.z * point1.z)); }; Plane.prototype.isFrontFacingTo = function (direction, epsilon) { var dot = Vector3.Dot(this.normal, direction); return (dot <= epsilon); }; Plane.prototype.signedDistanceTo = function (point) { return Vector3.Dot(point, this.normal) + this.d; }; // Statics Plane.FromArray = function (array) { return new Plane(array[0], array[1], array[2], array[3]); }; Plane.FromPoints = function (point1, point2, point3) { var result = new Plane(0, 0, 0, 0); result.copyFromPoints(point1, point2, point3); return result; }; Plane.FromPositionAndNormal = function (origin, normal) { var result = new Plane(0, 0, 0, 0); normal.normalize(); result.normal = normal; result.d = -(normal.x * origin.x + normal.y * origin.y + normal.z * origin.z); return result; }; Plane.SignedDistanceToPlaneFromPositionAndNormal = function (origin, normal, point) { var d = -(normal.x * origin.x + normal.y * origin.y + normal.z * origin.z); return Vector3.Dot(point, normal) + d; }; return Plane; })(); BABYLON.Plane = Plane; var Viewport = (function () { function Viewport(x, y, width, height) { this.x = x; this.y = y; this.width = width; this.height = height; } Viewport.prototype.toGlobal = function (engine) { var width = engine.getRenderWidth(); var height = engine.getRenderHeight(); return new Viewport(this.x * width, this.y * height, this.width * width, this.height * height); }; return Viewport; })(); BABYLON.Viewport = Viewport; var Frustum = (function () { function Frustum() { } Frustum.GetPlanes = function (transform) { var frustumPlanes = []; for (var index = 0; index < 6; index++) { frustumPlanes.push(new Plane(0, 0, 0, 0)); } Frustum.GetPlanesToRef(transform, frustumPlanes); return frustumPlanes; }; Frustum.GetPlanesToRef = function (transform, frustumPlanes) { // Near frustumPlanes[0].normal.x = transform.m[3] + transform.m[2]; frustumPlanes[0].normal.y = transform.m[7] + transform.m[6]; frustumPlanes[0].normal.z = transform.m[10] + transform.m[10]; frustumPlanes[0].d = transform.m[15] + transform.m[14]; frustumPlanes[0].normalize(); // Far frustumPlanes[1].normal.x = transform.m[3] - transform.m[2]; frustumPlanes[1].normal.y = transform.m[7] - transform.m[6]; frustumPlanes[1].normal.z = transform.m[11] - transform.m[10]; frustumPlanes[1].d = transform.m[15] - transform.m[14]; frustumPlanes[1].normalize(); // Left frustumPlanes[2].normal.x = transform.m[3] + transform.m[0]; frustumPlanes[2].normal.y = transform.m[7] + transform.m[4]; frustumPlanes[2].normal.z = transform.m[11] + transform.m[8]; frustumPlanes[2].d = transform.m[15] + transform.m[12]; frustumPlanes[2].normalize(); // Right frustumPlanes[3].normal.x = transform.m[3] - transform.m[0]; frustumPlanes[3].normal.y = transform.m[7] - transform.m[4]; frustumPlanes[3].normal.z = transform.m[11] - transform.m[8]; frustumPlanes[3].d = transform.m[15] - transform.m[12]; frustumPlanes[3].normalize(); // Top frustumPlanes[4].normal.x = transform.m[3] - transform.m[1]; frustumPlanes[4].normal.y = transform.m[7] - transform.m[5]; frustumPlanes[4].normal.z = transform.m[11] - transform.m[9]; frustumPlanes[4].d = transform.m[15] - transform.m[13]; frustumPlanes[4].normalize(); // Bottom frustumPlanes[5].normal.x = transform.m[3] + transform.m[1]; frustumPlanes[5].normal.y = transform.m[7] + transform.m[5]; frustumPlanes[5].normal.z = transform.m[11] + transform.m[9]; frustumPlanes[5].d = transform.m[15] + transform.m[13]; frustumPlanes[5].normalize(); }; return Frustum; })(); BABYLON.Frustum = Frustum; var Ray = (function () { function Ray(origin, direction, length) { if (typeof length === "undefined") { length = Number.MAX_VALUE; } this.origin = origin; this.direction = direction; this.length = length; } // Methods Ray.prototype.intersectsBoxMinMax = function (minimum, maximum) { var d = 0.0; var maxValue = Number.MAX_VALUE; if (Math.abs(this.direction.x) < 0.0000001) { if (this.origin.x < minimum.x || this.origin.x > maximum.x) { return false; } } else { var inv = 1.0 / this.direction.x; var min = (minimum.x - this.origin.x) * inv; var max = (maximum.x - this.origin.x) * inv; if (max === -Infinity) { max = Infinity; } if (min > max) { var temp = min; min = max; max = temp; } d = Math.max(min, d); maxValue = Math.min(max, maxValue); if (d > maxValue) { return false; } } if (Math.abs(this.direction.y) < 0.0000001) { if (this.origin.y < minimum.y || this.origin.y > maximum.y) { return false; } } else { inv = 1.0 / this.direction.y; min = (minimum.y - this.origin.y) * inv; max = (maximum.y - this.origin.y) * inv; if (max === -Infinity) { max = Infinity; } if (min > max) { temp = min; min = max; max = temp; } d = Math.max(min, d); maxValue = Math.min(max, maxValue); if (d > maxValue) { return false; } } if (Math.abs(this.direction.z) < 0.0000001) { if (this.origin.z < minimum.z || this.origin.z > maximum.z) { return false; } } else { inv = 1.0 / this.direction.z; min = (minimum.z - this.origin.z) * inv; max = (maximum.z - this.origin.z) * inv; if (max === -Infinity) { max = Infinity; } if (min > max) { temp = min; min = max; max = temp; } d = Math.max(min, d); maxValue = Math.min(max, maxValue); if (d > maxValue) { return false; } } return true; }; Ray.prototype.intersectsBox = function (box) { return this.intersectsBoxMinMax(box.minimum, box.maximum); }; Ray.prototype.intersectsSphere = function (sphere) { var x = sphere.center.x - this.origin.x; var y = sphere.center.y - this.origin.y; var z = sphere.center.z - this.origin.z; var pyth = (x * x) + (y * y) + (z * z); var rr = sphere.radius * sphere.radius; if (pyth <= rr) { return true; } var dot = (x * this.direction.x) + (y * this.direction.y) + (z * this.direction.z); if (dot < 0.0) { return false; } var temp = pyth - (dot * dot); return temp <= rr; }; Ray.prototype.intersectsTriangle = function (vertex0, vertex1, vertex2) { if (!this._edge1) { this._edge1 = Vector3.Zero(); this._edge2 = Vector3.Zero(); this._pvec = Vector3.Zero(); this._tvec = Vector3.Zero(); this._qvec = Vector3.Zero(); } vertex1.subtractToRef(vertex0, this._edge1); vertex2.subtractToRef(vertex0, this._edge2); Vector3.CrossToRef(this.direction, this._edge2, this._pvec); var det = Vector3.Dot(this._edge1, this._pvec); if (det === 0) { return null; } var invdet = 1 / det; this.origin.subtractToRef(vertex0, this._tvec); var bu = Vector3.Dot(this._tvec, this._pvec) * invdet; if (bu < 0 || bu > 1.0) { return null; } Vector3.CrossToRef(this._tvec, this._edge1, this._qvec); var bv = Vector3.Dot(this.direction, this._qvec) * invdet; if (bv < 0 || bu + bv > 1.0) { return null; } //check if the distance is longer than the predefined length. var distance = Vector3.Dot(this._edge2, this._qvec) * invdet; if (distance > this.length) { return null; } return new BABYLON.IntersectionInfo(bu, bv, distance); }; // Statics Ray.CreateNew = function (x, y, viewportWidth, viewportHeight, world, view, projection) { var start = Vector3.Unproject(new Vector3(x, y, 0), viewportWidth, viewportHeight, world, view, projection); var end = Vector3.Unproject(new Vector3(x, y, 1), viewportWidth, viewportHeight, world, view, projection); var direction = end.subtract(start); direction.normalize(); return new Ray(start, direction); }; /** * Function will create a new transformed ray starting from origin and ending at the end point. Ray's length will be set, and ray will be * transformed to the given world matrix. * @param origin The origin point * @param end The end point * @param world a matrix to transform the ray to. Default is the identity matrix. */ Ray.CreateNewFromTo = function (origin, end, world) { if (typeof world === "undefined") { world = Matrix.Identity(); } var direction = end.subtract(origin); var length = Math.sqrt((direction.x * direction.x) + (direction.y * direction.y) + (direction.z * direction.z)); direction.normalize(); return Ray.Transform(new Ray(origin, direction, length), world); }; Ray.Transform = function (ray, matrix) { var newOrigin = Vector3.TransformCoordinates(ray.origin, matrix); var newDirection = Vector3.TransformNormal(ray.direction, matrix); return new Ray(newOrigin, newDirection, ray.length); }; return Ray; })(); BABYLON.Ray = Ray; (function (Space) { Space[Space["LOCAL"] = 0] = "LOCAL"; Space[Space["WORLD"] = 1] = "WORLD"; })(BABYLON.Space || (BABYLON.Space = {})); var Space = BABYLON.Space; var Axis = (function () { function Axis() { } Axis.X = new Vector3(1, 0, 0); Axis.Y = new Vector3(0, 1, 0); Axis.Z = new Vector3(0, 0, 1); return Axis; })(); BABYLON.Axis = Axis; ; var BezierCurve = (function () { function BezierCurve() { } BezierCurve.interpolate = function (t, x1, y1, x2, y2) { // Extract X (which is equal to time here) var f0 = 1 - 3 * x2 + 3 * x1; var f1 = 3 * x2 - 6 * x1; var f2 = 3 * x1; var refinedT = t; for (var i = 0; i < 5; i++) { var refinedT2 = refinedT * refinedT; var refinedT3 = refinedT2 * refinedT; var x = f0 * refinedT3 + f1 * refinedT2 + f2 * refinedT; var slope = 1.0 / (3.0 * f0 * refinedT2 + 2.0 * f1 * refinedT + f2); refinedT -= (x - t) * slope; refinedT = Math.min(1, Math.max(0, refinedT)); } // Resolve cubic bezier for the given x return 3 * Math.pow(1 - refinedT, 2) * refinedT * y1 + 3 * (1 - refinedT) * Math.pow(refinedT, 2) * y2 + Math.pow(refinedT, 3); }; return BezierCurve; })(); BABYLON.BezierCurve = BezierCurve; (function (Orientation) { Orientation[Orientation["CW"] = 0] = "CW"; Orientation[Orientation["CCW"] = 1] = "CCW"; })(BABYLON.Orientation || (BABYLON.Orientation = {})); var Orientation = BABYLON.Orientation; var Angle = (function () { function Angle(radians) { var _this = this; this.degrees = function () { return _this._radians * 180 / Math.PI; }; this.radians = function () { return _this._radians; }; this._radians = radians; if (this._radians < 0) this._radians += (2 * Math.PI); } Angle.BetweenTwoPoints = function (a, b) { var delta = b.subtract(a); var theta = Math.atan2(delta.y, delta.x); return new Angle(theta); }; Angle.FromRadians = function (radians) { return new Angle(radians); }; Angle.FromDegrees = function (degrees) { return new Angle(degrees * Math.PI / 180); }; return Angle; })(); BABYLON.Angle = Angle; var Arc2 = (function () { function Arc2(startPoint, midPoint, endPoint) { this.startPoint = startPoint; this.midPoint = midPoint; this.endPoint = endPoint; var temp = Math.pow(midPoint.x, 2) + Math.pow(midPoint.y, 2); var startToMid = (Math.pow(startPoint.x, 2) + Math.pow(startPoint.y, 2) - temp) / 2.; var midToEnd = (temp - Math.pow(endPoint.x, 2) - Math.pow(endPoint.y, 2)) / 2.; var det = (startPoint.x - midPoint.x) * (midPoint.y - endPoint.y) - (midPoint.x - endPoint.x) * (startPoint.y - midPoint.y); this.centerPoint = new Vector2((startToMid * (midPoint.y - endPoint.y) - midToEnd * (startPoint.y - midPoint.y)) / det, ((startPoint.x - midPoint.x) * midToEnd - (midPoint.x - endPoint.x) * startToMid) / det); this.radius = this.centerPoint.subtract(this.startPoint).length(); this.startAngle = Angle.BetweenTwoPoints(this.centerPoint, this.startPoint); var a1 = this.startAngle.degrees(); var a2 = Angle.BetweenTwoPoints(this.centerPoint, this.midPoint).degrees(); var a3 = Angle.BetweenTwoPoints(this.centerPoint, this.endPoint).degrees(); // angles correction if (a2 - a1 > +180.0) a2 -= 360.0; if (a2 - a1 < -180.0) a2 += 360.0; if (a3 - a2 > +180.0) a3 -= 360.0; if (a3 - a2 < -180.0) a3 += 360.0; this.orientation = (a2 - a1) < 0 ? 0 /* CW */ : 1 /* CCW */; this.angle = Angle.FromDegrees(this.orientation === 0 /* CW */ ? a1 - a3 : a3 - a1); } return Arc2; })(); BABYLON.Arc2 = Arc2; var PathCursor = (function () { function PathCursor(path) { this.path = path; this._onchange = new Array(); this.value = 0; this.animations = new Array(); } PathCursor.prototype.getPoint = function () { var point = this.path.getPointAtLengthPosition(this.value); return new Vector3(point.x, 0, point.y); }; PathCursor.prototype.moveAhead = function (step) { if (typeof step === "undefined") { step = 0.002; } this.move(step); }; PathCursor.prototype.moveBack = function (step) { if (typeof step === "undefined") { step = 0.002; } this.move(-step); }; PathCursor.prototype.move = function (step) { if (Math.abs(step) > 1) { throw "step size should be less than 1."; } this.value += step; this.ensureLimits(); this.raiseOnChange(); }; PathCursor.prototype.ensureLimits = function () { while (this.value > 1) { this.value -= 1; } while (this.value < 0) { this.value += 1; } }; // used by animation engine PathCursor.prototype.markAsDirty = function (propertyName) { this.ensureLimits(); this.raiseOnChange(); }; PathCursor.prototype.raiseOnChange = function () { var _this = this; this._onchange.forEach(function (f) { return f(_this); }); }; PathCursor.prototype.onchange = function (f) { this._onchange.push(f); }; return PathCursor; })(); BABYLON.PathCursor = PathCursor; var Path2 = (function () { function Path2(x, y) { this._points = []; this._length = 0; this.closed = false; this._points.push(new Vector2(x, y)); } Path2.prototype.addLineTo = function (x, y) { if (closed) { BABYLON.Tools.Error("cannot add lines to closed paths"); return this; } var newPoint = new Vector2(x, y); var previousPoint = this._points[this._points.length - 1]; this._points.push(newPoint); this._length += newPoint.subtract(previousPoint).length(); return this; }; Path2.prototype.addArcTo = function (midX, midY, endX, endY, numberOfSegments) { if (typeof numberOfSegments === "undefined") { numberOfSegments = 36; } if (closed) { BABYLON.Tools.Error("cannot add arcs to closed paths"); return this; } var startPoint = this._points[this._points.length - 1]; var midPoint = new Vector2(midX, midY); var endPoint = new Vector2(endX, endY); var arc = new Arc2(startPoint, midPoint, endPoint); var increment = arc.angle.radians() / numberOfSegments; if (arc.orientation === 0 /* CW */) increment *= -1; var currentAngle = arc.startAngle.radians() + increment; for (var i = 0; i < numberOfSegments; i++) { var x = Math.cos(currentAngle) * arc.radius + arc.centerPoint.x; var y = Math.sin(currentAngle) * arc.radius + arc.centerPoint.y; this.addLineTo(x, y); currentAngle += increment; } return this; }; Path2.prototype.close = function () { this.closed = true; return this; }; Path2.prototype.length = function () { var result = this._length; if (!this.closed) { var lastPoint = this._points[this._points.length - 1]; var firstPoint = this._points[0]; result += (firstPoint.subtract(lastPoint).length()); } return result; }; Path2.prototype.getPoints = function () { return this._points; }; Path2.prototype.getPointAtLengthPosition = function (normalizedLengthPosition) { if (normalizedLengthPosition < 0 || normalizedLengthPosition > 1) { BABYLON.Tools.Error("normalized length position should be between 0 and 1."); return; } var lengthPosition = normalizedLengthPosition * this.length(); var previousOffset = 0; for (var i = 0; i < this._points.length; i++) { var j = (i + 1) % this._points.length; var a = this._points[i]; var b = this._points[j]; var bToA = b.subtract(a); var nextOffset = (bToA.length() + previousOffset); if (lengthPosition >= previousOffset && lengthPosition <= nextOffset) { var dir = bToA.normalize(); var localOffset = lengthPosition - previousOffset; return new Vector2(a.x + (dir.x * localOffset), a.y + (dir.y * localOffset)); } previousOffset = nextOffset; } BABYLON.Tools.Error("internal error"); }; Path2.StartingAt = function (x, y) { return new Path2(x, y); }; return Path2; })(); BABYLON.Path2 = Path2; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.math.js.map var BABYLON; (function (BABYLON) { // Screenshots var screenshotCanvas; var cloneValue = function (source, destinationObject) { if (!source) return null; if (source instanceof BABYLON.Mesh) { return null; } if (source instanceof BABYLON.SubMesh) { return source.clone(destinationObject); } else if (source.clone) { return source.clone(); } return null; }; var Tools = (function () { function Tools() { } Tools.GetFilename = function (path) { var index = path.lastIndexOf("/"); if (index < 0) return path; return path.substring(index + 1); }; Tools.GetDOMTextContent = function (element) { var result = ""; var child = element.firstChild; while (child) { if (child.nodeType == 3) { result += child.textContent; } child = child.nextSibling; } return result; }; Tools.ToDegrees = function (angle) { return angle * 180 / Math.PI; }; Tools.ToRadians = function (angle) { return angle * Math.PI / 180; }; Tools.ExtractMinAndMaxIndexed = function (positions, indices, indexStart, indexCount) { var minimum = new BABYLON.Vector3(Number.MAX_VALUE, Number.MAX_VALUE, Number.MAX_VALUE); var maximum = new BABYLON.Vector3(-Number.MAX_VALUE, -Number.MAX_VALUE, -Number.MAX_VALUE); for (var index = indexStart; index < indexStart + indexCount; index++) { var current = new BABYLON.Vector3(positions[indices[index] * 3], positions[indices[index] * 3 + 1], positions[indices[index] * 3 + 2]); minimum = BABYLON.Vector3.Minimize(current, minimum); maximum = BABYLON.Vector3.Maximize(current, maximum); } return { minimum: minimum, maximum: maximum }; }; Tools.ExtractMinAndMax = function (positions, start, count) { var minimum = new BABYLON.Vector3(Number.MAX_VALUE, Number.MAX_VALUE, Number.MAX_VALUE); var maximum = new BABYLON.Vector3(-Number.MAX_VALUE, -Number.MAX_VALUE, -Number.MAX_VALUE); for (var index = start; index < start + count; index++) { var current = new BABYLON.Vector3(positions[index * 3], positions[index * 3 + 1], positions[index * 3 + 2]); minimum = BABYLON.Vector3.Minimize(current, minimum); maximum = BABYLON.Vector3.Maximize(current, maximum); } return { minimum: minimum, maximum: maximum }; }; Tools.MakeArray = function (obj, allowsNullUndefined) { if (allowsNullUndefined !== true && (obj === undefined || obj == null)) return undefined; return Array.isArray(obj) ? obj : [obj]; }; // Misc. Tools.GetPointerPrefix = function () { var eventPrefix = "pointer"; // Check if hand.js is referenced or if the browser natively supports pointer events if (!navigator.pointerEnabled) { eventPrefix = "mouse"; } return eventPrefix; }; Tools.QueueNewFrame = function (func) { if (window.requestAnimationFrame) window.requestAnimationFrame(func); else if (window.msRequestAnimationFrame) window.msRequestAnimationFrame(func); else if (window.webkitRequestAnimationFrame) window.webkitRequestAnimationFrame(func); else if (window.mozRequestAnimationFrame) window.mozRequestAnimationFrame(func); else if (window.oRequestAnimationFrame) window.oRequestAnimationFrame(func); else { window.setTimeout(func, 16); } }; Tools.RequestFullscreen = function (element) { if (element.requestFullscreen) element.requestFullscreen(); else if (element.msRequestFullscreen) element.msRequestFullscreen(); else if (element.webkitRequestFullscreen) element.webkitRequestFullscreen(); else if (element.mozRequestFullScreen) element.mozRequestFullScreen(); }; Tools.ExitFullscreen = function () { if (document.exitFullscreen) { document.exitFullscreen(); } else if (document.mozCancelFullScreen) { document.mozCancelFullScreen(); } else if (document.webkitCancelFullScreen) { document.webkitCancelFullScreen(); } else if (document.msCancelFullScreen) { document.msCancelFullScreen(); } }; // External files Tools.CleanUrl = function (url) { url = url.replace(/#/mg, "%23"); return url; }; Tools.LoadImage = function (url, onload, onerror, database) { url = Tools.CleanUrl(url); var img = new Image(); if (url.substr(0, 5) != "data:") img.crossOrigin = 'anonymous'; img.onload = function () { onload(img); }; img.onerror = function (err) { onerror(img, err); }; var noIndexedDB = function () { img.src = url; }; var loadFromIndexedDB = function () { database.loadImageFromDB(url, img); }; //ANY database to do! if (database && database.enableTexturesOffline && BABYLON.Database.isUASupportingBlobStorage) { database.openAsync(loadFromIndexedDB, noIndexedDB); } else { if (url.indexOf("file:") === -1) { noIndexedDB(); } else { try { var textureName = url.substring(5); var blobURL; try { blobURL = URL.createObjectURL(BABYLON.FilesInput.FilesTextures[textureName], { oneTimeOnly: true }); } catch (ex) { // Chrome doesn't support oneTimeOnly parameter blobURL = URL.createObjectURL(BABYLON.FilesInput.FilesTextures[textureName]); } img.src = blobURL; } catch (e) { Tools.Log("Error while trying to load texture: " + textureName); img.src = null; } } } return img; }; //ANY Tools.LoadFile = function (url, callback, progressCallBack, database, useArrayBuffer, onError) { url = Tools.CleanUrl(url); var noIndexedDB = function () { var request = new XMLHttpRequest(); var loadUrl = Tools.BaseUrl + url; request.open('GET', loadUrl, true); if (useArrayBuffer) { request.responseType = "arraybuffer"; } request.onprogress = progressCallBack; request.onreadystatechange = function () { if (request.readyState == 4) { if (request.status == 200 || BABYLON.Tools.ValidateXHRData(request, !useArrayBuffer ? 1 : 6)) { callback(!useArrayBuffer ? request.responseText : request.response); } else { if (onError) { onError(); } else { throw new Error("Error status: " + request.status + " - Unable to load " + loadUrl); } } } }; request.send(null); }; var loadFromIndexedDB = function () { database.loadFileFromDB(url, callback, progressCallBack, noIndexedDB, useArrayBuffer); }; if (url.indexOf("file:") !== -1) { var fileName = url.substring(5); BABYLON.Tools.ReadFile(BABYLON.FilesInput.FilesToLoad[fileName], callback, progressCallBack, true); } else { // Caching all files if (database && database.enableSceneOffline) { database.openAsync(loadFromIndexedDB, noIndexedDB); } else { noIndexedDB(); } } }; Tools.ReadFileAsDataURL = function (fileToLoad, callback, progressCallback) { var reader = new FileReader(); reader.onload = function (e) { callback(e.target.result); }; reader.onprogress = progressCallback; reader.readAsDataURL(fileToLoad); }; Tools.ReadFile = function (fileToLoad, callback, progressCallBack, useArrayBuffer) { var reader = new FileReader(); reader.onload = function (e) { callback(e.target.result); }; reader.onprogress = progressCallBack; if (!useArrayBuffer) { // Asynchronous read reader.readAsText(fileToLoad); } else { reader.readAsArrayBuffer(fileToLoad); } }; // Misc. Tools.Clamp = function (value, min, max) { if (typeof min === "undefined") { min = 0; } if (typeof max === "undefined") { max = 1; } return Math.min(max, Math.max(min, value)); }; // Returns -1 when value is a negative number and // +1 when value is a positive number. Tools.Sign = function (value) { value = +value; // convert to a number if (value === 0 || isNaN(value)) return value; return value > 0 ? 1 : -1; }; Tools.Format = function (value, decimals) { if (typeof decimals === "undefined") { decimals = 2; } return value.toFixed(decimals); }; Tools.CheckExtends = function (v, min, max) { if (v.x < min.x) min.x = v.x; if (v.y < min.y) min.y = v.y; if (v.z < min.z) min.z = v.z; if (v.x > max.x) max.x = v.x; if (v.y > max.y) max.y = v.y; if (v.z > max.z) max.z = v.z; }; Tools.WithinEpsilon = function (a, b, epsilon) { if (typeof epsilon === "undefined") { epsilon = 1.401298E-45; } var num = a - b; return -epsilon <= num && num <= epsilon; }; Tools.DeepCopy = function (source, destination, doNotCopyList, mustCopyList) { for (var prop in source) { if (prop[0] === "_" && (!mustCopyList || mustCopyList.indexOf(prop) === -1)) { continue; } if (doNotCopyList && doNotCopyList.indexOf(prop) !== -1) { continue; } var sourceValue = source[prop]; var typeOfSourceValue = typeof sourceValue; if (typeOfSourceValue == "function") { continue; } if (typeOfSourceValue == "object") { if (sourceValue instanceof Array) { destination[prop] = []; if (sourceValue.length > 0) { if (typeof sourceValue[0] == "object") { for (var index = 0; index < sourceValue.length; index++) { var clonedValue = cloneValue(sourceValue[index], destination); if (destination[prop].indexOf(clonedValue) === -1) { destination[prop].push(clonedValue); } } } else { destination[prop] = sourceValue.slice(0); } } } else { destination[prop] = cloneValue(sourceValue, destination); } } else { destination[prop] = sourceValue; } } }; Tools.IsEmpty = function (obj) { for (var i in obj) { return false; } return true; }; Tools.RegisterTopRootEvents = function (events) { for (var index = 0; index < events.length; index++) { var event = events[index]; window.addEventListener(event.name, event.handler, false); try { if (window.parent) { window.parent.addEventListener(event.name, event.handler, false); } } catch (e) { // Silently fails... } } }; Tools.UnregisterTopRootEvents = function (events) { for (var index = 0; index < events.length; index++) { var event = events[index]; window.removeEventListener(event.name, event.handler); try { if (window.parent) { window.parent.removeEventListener(event.name, event.handler); } } catch (e) { // Silently fails... } } }; Tools.CreateScreenshot = function (engine, camera, size) { var width; var height; var scene = camera.getScene(); var previousCamera = null; if (scene.activeCamera !== camera) { previousCamera = scene.activeCamera; scene.activeCamera = camera; } //If a precision value is specified if (size.precision) { width = Math.round(engine.getRenderWidth() * size.precision); height = Math.round(width / engine.getAspectRatio(camera)); size = { width: width, height: height }; } else if (size.width && size.height) { width = size.width; height = size.height; } else if (size.width && !size.height) { width = size.width; height = Math.round(width / engine.getAspectRatio(camera)); size = { width: width, height: height }; } else if (size.height && !size.width) { height = size.height; width = Math.round(height * engine.getAspectRatio(camera)); size = { width: width, height: height }; } else if (!isNaN(size)) { height = size; width = size; } else { Tools.Error("Invalid 'size' parameter !"); return; } //At this point size can be a number, or an object (according to engine.prototype.createRenderTargetTexture method) var texture = new BABYLON.RenderTargetTexture("screenShot", size, scene, false, false); texture.renderList = scene.meshes; texture.onAfterRender = function () { // Read the contents of the framebuffer var numberOfChannelsByLine = width * 4; var halfHeight = height / 2; //Reading datas from WebGL var data = engine.readPixels(0, 0, width, height); for (var i = 0; i < halfHeight; i++) { for (var j = 0; j < numberOfChannelsByLine; j++) { var currentCell = j + i * numberOfChannelsByLine; var targetLine = height - i - 1; var targetCell = j + targetLine * numberOfChannelsByLine; var temp = data[currentCell]; data[currentCell] = data[targetCell]; data[targetCell] = temp; } } // Create a 2D canvas to store the result if (!screenshotCanvas) { screenshotCanvas = document.createElement('canvas'); } screenshotCanvas.width = width; screenshotCanvas.height = height; var context = screenshotCanvas.getContext('2d'); // Copy the pixels to a 2D canvas var imageData = context.createImageData(width, height); imageData.data.set(data); context.putImageData(imageData, 0, 0); var base64Image = screenshotCanvas.toDataURL(); //Creating a link if the browser have the download attribute on the a tag, to automatically start download generated image. if (("download" in document.createElement("a"))) { var a = window.document.createElement("a"); a.href = base64Image; var date = new Date(); var stringDate = date.getFullYear() + "/" + date.getMonth() + "/" + date.getDate() + "-" + date.getHours() + ":" + date.getMinutes(); a.setAttribute("download", "screenshot-" + stringDate + ".png"); window.document.body.appendChild(a); a.addEventListener("click", function () { a.parentElement.removeChild(a); }); a.click(); //Or opening a new tab with the image if it is not possible to automatically start download. } else { var newWindow = window.open(""); var img = newWindow.document.createElement("img"); img.src = base64Image; newWindow.document.body.appendChild(img); } }; texture.render(true); texture.dispose(); if (previousCamera) { scene.activeCamera = previousCamera; } }; // XHR response validator for local file scenario Tools.ValidateXHRData = function (xhr, dataType) { if (typeof dataType === "undefined") { dataType = 7; } try { if (dataType & 1) { if (xhr.responseText && xhr.responseText.length > 0) { return true; } else if (dataType === 1) { return false; } } if (dataType & 2) { // Check header width and height since there is no "TGA" magic number var tgaHeader = BABYLON.Internals.TGATools.GetTGAHeader(xhr.response); if (tgaHeader.width && tgaHeader.height && tgaHeader.width > 0 && tgaHeader.height > 0) { return true; } else if (dataType === 2) { return false; } } if (dataType & 4) { // Check for the "DDS" magic number var ddsHeader = new Uint8Array(xhr.response, 0, 3); if (ddsHeader[0] == 68 && ddsHeader[1] == 68 && ddsHeader[2] == 83) { return true; } else { return false; } } } catch (e) { // Global protection } return false; }; Object.defineProperty(Tools, "NoneLogLevel", { get: function () { return Tools._NoneLogLevel; }, enumerable: true, configurable: true }); Object.defineProperty(Tools, "MessageLogLevel", { get: function () { return Tools._MessageLogLevel; }, enumerable: true, configurable: true }); Object.defineProperty(Tools, "WarningLogLevel", { get: function () { return Tools._WarningLogLevel; }, enumerable: true, configurable: true }); Object.defineProperty(Tools, "ErrorLogLevel", { get: function () { return Tools._ErrorLogLevel; }, enumerable: true, configurable: true }); Object.defineProperty(Tools, "AllLogLevel", { get: function () { return Tools._MessageLogLevel | Tools._WarningLogLevel | Tools._ErrorLogLevel; }, enumerable: true, configurable: true }); Tools._AddLogEntry = function (entry) { Tools._LogCache = entry + Tools._LogCache; if (Tools.OnNewCacheEntry) { Tools.OnNewCacheEntry(entry); } }; Tools._FormatMessage = function (message) { var padStr = function (i) { return (i < 10) ? "0" + i : "" + i; }; var date = new Date(); return "[" + padStr(date.getHours()) + ":" + padStr(date.getMinutes()) + ":" + padStr(date.getSeconds()) + "]: " + message; }; Tools._LogDisabled = function (message) { // nothing to do }; Tools._LogEnabled = function (message) { var formattedMessage = Tools._FormatMessage(message); console.log("BJS - " + formattedMessage); var entry = "
" + formattedMessage + "

"; Tools._AddLogEntry(entry); }; Tools._WarnDisabled = function (message) { // nothing to do }; Tools._WarnEnabled = function (message) { var formattedMessage = Tools._FormatMessage(message); console.warn("BJS - " + formattedMessage); var entry = "
" + formattedMessage + "

"; Tools._AddLogEntry(entry); }; Tools._ErrorDisabled = function (message) { // nothing to do }; Tools._ErrorEnabled = function (message) { var formattedMessage = Tools._FormatMessage(message); console.error("BJS - " + formattedMessage); var entry = "
" + formattedMessage + "

"; Tools._AddLogEntry(entry); }; Object.defineProperty(Tools, "LogCache", { get: function () { return Tools._LogCache; }, enumerable: true, configurable: true }); Object.defineProperty(Tools, "LogLevels", { set: function (level) { if ((level & Tools.MessageLogLevel) === Tools.MessageLogLevel) { Tools.Log = Tools._LogEnabled; } else { Tools.Log = Tools._LogDisabled; } if ((level & Tools.WarningLogLevel) === Tools.WarningLogLevel) { Tools.Warn = Tools._WarnEnabled; } else { Tools.Warn = Tools._WarnDisabled; } if ((level & Tools.ErrorLogLevel) === Tools.ErrorLogLevel) { Tools.Error = Tools._ErrorEnabled; } else { Tools.Error = Tools._ErrorDisabled; } }, enumerable: true, configurable: true }); Object.defineProperty(Tools, "PerformanceNoneLogLevel", { get: function () { return Tools._PerformanceNoneLogLevel; }, enumerable: true, configurable: true }); Object.defineProperty(Tools, "PerformanceUserMarkLogLevel", { get: function () { return Tools._PerformanceUserMarkLogLevel; }, enumerable: true, configurable: true }); Object.defineProperty(Tools, "PerformanceConsoleLogLevel", { get: function () { return Tools._PerformanceConsoleLogLevel; }, enumerable: true, configurable: true }); Object.defineProperty(Tools, "PerformanceLogLevel", { set: function (level) { if ((level & Tools.PerformanceUserMarkLogLevel) === Tools.PerformanceUserMarkLogLevel) { Tools.StartPerformanceCounter = Tools._StartUserMark; Tools.EndPerformanceCounter = Tools._EndUserMark; return; } if ((level & Tools.PerformanceConsoleLogLevel) === Tools.PerformanceConsoleLogLevel) { Tools.StartPerformanceCounter = Tools._StartPerformanceConsole; Tools.EndPerformanceCounter = Tools._EndPerformanceConsole; return; } Tools.StartPerformanceCounter = Tools._StartPerformanceCounterDisabled; Tools.EndPerformanceCounter = Tools._EndPerformanceCounterDisabled; }, enumerable: true, configurable: true }); Tools._StartPerformanceCounterDisabled = function (counterName, condition) { }; Tools._EndPerformanceCounterDisabled = function (counterName, condition) { }; Tools._StartUserMark = function (counterName, condition) { if (typeof condition === "undefined") { condition = true; } if (!condition || !Tools._performance.mark) { return; } Tools._performance.mark(counterName + "-Begin"); }; Tools._EndUserMark = function (counterName, condition) { if (typeof condition === "undefined") { condition = true; } if (!condition || !Tools._performance.mark) { return; } Tools._performance.mark(counterName + "-End"); Tools._performance.measure(counterName, counterName + "-Begin", counterName + "-End"); }; Tools._StartPerformanceConsole = function (counterName, condition) { if (typeof condition === "undefined") { condition = true; } if (!condition) { return; } Tools._StartUserMark(counterName, condition); if (console.time) { console.time(counterName); } }; Tools._EndPerformanceConsole = function (counterName, condition) { if (typeof condition === "undefined") { condition = true; } if (!condition) { return; } Tools._EndUserMark(counterName, condition); if (console.time) { console.timeEnd(counterName); } }; Object.defineProperty(Tools, "Now", { get: function () { if (window.performance && window.performance.now) { return window.performance.now(); } return new Date().getTime(); }, enumerable: true, configurable: true }); // Deprecated Tools.GetFps = function () { Tools.Warn("Tools.GetFps() is deprecated. Please use engine.getFps() instead"); return 0; }; Tools.BaseUrl = ""; Tools.GetExponantOfTwo = function (value, max) { var count = 1; do { count *= 2; } while(count < value); if (count > max) count = max; return count; }; Tools._NoneLogLevel = 0; Tools._MessageLogLevel = 1; Tools._WarningLogLevel = 2; Tools._ErrorLogLevel = 4; Tools._LogCache = ""; Tools.Log = Tools._LogEnabled; Tools.Warn = Tools._WarnEnabled; Tools.Error = Tools._ErrorEnabled; Tools._PerformanceNoneLogLevel = 0; Tools._PerformanceUserMarkLogLevel = 1; Tools._PerformanceConsoleLogLevel = 2; Tools._performance = window.performance; Tools.StartPerformanceCounter = Tools._StartPerformanceCounterDisabled; Tools.EndPerformanceCounter = Tools._EndPerformanceCounterDisabled; return Tools; })(); BABYLON.Tools = Tools; /** * An implementation of a loop for asynchronous functions. */ var AsyncLoop = (function () { /** * Constroctor. * @param iterations the number of iterations. * @param _fn the function to run each iteration * @param _successCallback the callback that will be called upon succesful execution * @param offset starting offset. */ function AsyncLoop(iterations, _fn, _successCallback, offset) { if (typeof offset === "undefined") { offset = 0; } this.iterations = iterations; this._fn = _fn; this._successCallback = _successCallback; this.index = offset - 1; this._done = false; } /** * Execute the next iteration. Must be called after the last iteration was finished. */ AsyncLoop.prototype.executeNext = function () { if (!this._done) { if (this.index + 1 < this.iterations) { ++this.index; this._fn(this); } else { this.breakLoop(); } } }; /** * Break the loop and run the success callback. */ AsyncLoop.prototype.breakLoop = function () { this._done = true; this._successCallback(); }; /** * Helper function */ AsyncLoop.Run = function (iterations, _fn, _successCallback, offset) { if (typeof offset === "undefined") { offset = 0; } var loop = new AsyncLoop(iterations, _fn, _successCallback, offset); loop.executeNext(); return loop; }; /** * A for-loop that will run a given number of iterations synchronous and the rest async. * @param iterations total number of iterations * @param syncedIterations number of synchronous iterations in each async iteration. * @param fn the function to call each iteration. * @param callback a success call back that will be called when iterating stops. * @param breakFunction a break condition (optional) * @param timeout timeout settings for the setTimeout function. default - 0. * @constructor */ AsyncLoop.SyncAsyncForLoop = function (iterations, syncedIterations, fn, callback, breakFunction, timeout) { if (typeof timeout === "undefined") { timeout = 0; } AsyncLoop.Run(Math.ceil(iterations / syncedIterations), function (loop) { if (breakFunction && breakFunction()) loop.breakLoop(); else { setTimeout(function () { for (var i = 0; i < syncedIterations; ++i) { var iteration = (loop.index * syncedIterations) + i; if (iteration >= iterations) break; fn(iteration); if (breakFunction && breakFunction()) { loop.breakLoop(); break; } } loop.executeNext(); }, timeout); } }, callback); }; return AsyncLoop; })(); BABYLON.AsyncLoop = AsyncLoop; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.tools.js.map var BABYLON; (function (BABYLON) { var _DepthCullingState = (function () { function _DepthCullingState() { this._isDepthTestDirty = false; this._isDepthMaskDirty = false; this._isDepthFuncDirty = false; this._isCullFaceDirty = false; this._isCullDirty = false; } Object.defineProperty(_DepthCullingState.prototype, "isDirty", { get: function () { return this._isDepthFuncDirty || this._isDepthTestDirty || this._isDepthMaskDirty || this._isCullFaceDirty || this._isCullDirty; }, enumerable: true, configurable: true }); Object.defineProperty(_DepthCullingState.prototype, "cullFace", { get: function () { return this._cullFace; }, set: function (value) { if (this._cullFace === value) { return; } this._cullFace = value; this._isCullFaceDirty = true; }, enumerable: true, configurable: true }); Object.defineProperty(_DepthCullingState.prototype, "cull", { get: function () { return this._cull; }, set: function (value) { if (this._cull === value) { return; } this._cull = value; this._isCullDirty = true; }, enumerable: true, configurable: true }); Object.defineProperty(_DepthCullingState.prototype, "depthFunc", { get: function () { return this._depthFunc; }, set: function (value) { if (this._depthFunc === value) { return; } this._depthFunc = value; this._isDepthFuncDirty = true; }, enumerable: true, configurable: true }); Object.defineProperty(_DepthCullingState.prototype, "depthMask", { get: function () { return this._depthMask; }, set: function (value) { if (this._depthMask === value) { return; } this._depthMask = value; this._isDepthMaskDirty = true; }, enumerable: true, configurable: true }); Object.defineProperty(_DepthCullingState.prototype, "depthTest", { get: function () { return this._depthTest; }, set: function (value) { if (this._depthTest === value) { return; } this._depthTest = value; this._isDepthTestDirty = true; }, enumerable: true, configurable: true }); _DepthCullingState.prototype.reset = function () { this._depthMask = true; this._depthTest = true; this._depthFunc = null; this._cull = null; this._cullFace = null; this._isDepthTestDirty = true; this._isDepthMaskDirty = true; this._isDepthFuncDirty = false; this._isCullFaceDirty = false; this._isCullDirty = false; }; _DepthCullingState.prototype.apply = function (gl) { if (!this.isDirty) { return; } // Cull if (this._isCullDirty) { if (this.cull) { gl.enable(gl.CULL_FACE); } else { gl.disable(gl.CULL_FACE); } this._isCullDirty = false; } // Cull face if (this._isCullFaceDirty) { gl.cullFace(this.cullFace); this._isCullFaceDirty = false; } // Depth mask if (this._isDepthMaskDirty) { gl.depthMask(this.depthMask); this._isDepthMaskDirty = false; } // Depth test if (this._isDepthTestDirty) { if (this.depthTest) { gl.enable(gl.DEPTH_TEST); } else { gl.disable(gl.DEPTH_TEST); } this._isDepthTestDirty = false; } // Depth func if (this._isDepthFuncDirty) { gl.depthFunc(this.depthFunc); this._isDepthFuncDirty = false; } }; return _DepthCullingState; })(); BABYLON._DepthCullingState = _DepthCullingState; var _AlphaState = (function () { function _AlphaState() { this._isAlphaBlendDirty = false; this._isBlendFunctionParametersDirty = false; this._alphaBlend = false; this._blendFunctionParameters = new Array(4); } Object.defineProperty(_AlphaState.prototype, "isDirty", { get: function () { return this._isAlphaBlendDirty || this._isBlendFunctionParametersDirty; }, enumerable: true, configurable: true }); Object.defineProperty(_AlphaState.prototype, "alphaBlend", { get: function () { return this._alphaBlend; }, set: function (value) { if (this._alphaBlend === value) { return; } this._alphaBlend = value; this._isAlphaBlendDirty = true; }, enumerable: true, configurable: true }); _AlphaState.prototype.setAlphaBlendFunctionParameters = function (value0, value1, value2, value3) { if (this._blendFunctionParameters[0] === value0 && this._blendFunctionParameters[1] === value1 && this._blendFunctionParameters[2] === value2 && this._blendFunctionParameters[3] === value3) { return; } this._blendFunctionParameters[0] = value0; this._blendFunctionParameters[1] = value1; this._blendFunctionParameters[2] = value2; this._blendFunctionParameters[3] = value3; this._isBlendFunctionParametersDirty = true; }; _AlphaState.prototype.reset = function () { this._alphaBlend = false; this._blendFunctionParameters[0] = null; this._blendFunctionParameters[1] = null; this._blendFunctionParameters[2] = null; this._blendFunctionParameters[3] = null; this._isAlphaBlendDirty = true; this._isBlendFunctionParametersDirty = false; }; _AlphaState.prototype.apply = function (gl) { if (!this.isDirty) { return; } // Alpha blend if (this._isAlphaBlendDirty) { if (this._alphaBlend) { gl.enable(gl.BLEND); } else { gl.disable(gl.BLEND); } this._isAlphaBlendDirty = false; } // Alpha function if (this._isBlendFunctionParametersDirty) { gl.blendFuncSeparate(this._blendFunctionParameters[0], this._blendFunctionParameters[1], this._blendFunctionParameters[2], this._blendFunctionParameters[3]); this._isBlendFunctionParametersDirty = false; } }; return _AlphaState; })(); BABYLON._AlphaState = _AlphaState; var compileShader = function (gl, source, type, defines) { var shader = gl.createShader(type === "vertex" ? gl.VERTEX_SHADER : gl.FRAGMENT_SHADER); gl.shaderSource(shader, (defines ? defines + "\n" : "") + source); gl.compileShader(shader); if (!gl.getShaderParameter(shader, gl.COMPILE_STATUS)) { throw new Error(gl.getShaderInfoLog(shader)); } return shader; }; var getSamplingParameters = function (samplingMode, generateMipMaps, gl) { var magFilter = gl.NEAREST; var minFilter = gl.NEAREST; if (samplingMode === BABYLON.Texture.BILINEAR_SAMPLINGMODE) { magFilter = gl.LINEAR; if (generateMipMaps) { minFilter = gl.LINEAR_MIPMAP_NEAREST; } else { minFilter = gl.LINEAR; } } else if (samplingMode === BABYLON.Texture.TRILINEAR_SAMPLINGMODE) { magFilter = gl.LINEAR; if (generateMipMaps) { minFilter = gl.LINEAR_MIPMAP_LINEAR; } else { minFilter = gl.LINEAR; } } else if (samplingMode === BABYLON.Texture.NEAREST_SAMPLINGMODE) { magFilter = gl.NEAREST; if (generateMipMaps) { minFilter = gl.NEAREST_MIPMAP_LINEAR; } else { minFilter = gl.NEAREST; } } return { min: minFilter, mag: magFilter }; }; var prepareWebGLTexture = function (texture, gl, scene, width, height, invertY, noMipmap, isCompressed, processFunction, samplingMode) { if (typeof samplingMode === "undefined") { samplingMode = BABYLON.Texture.TRILINEAR_SAMPLINGMODE; } var engine = scene.getEngine(); var potWidth = BABYLON.Tools.GetExponantOfTwo(width, engine.getCaps().maxTextureSize); var potHeight = BABYLON.Tools.GetExponantOfTwo(height, engine.getCaps().maxTextureSize); gl.bindTexture(gl.TEXTURE_2D, texture); gl.pixelStorei(gl.UNPACK_FLIP_Y_WEBGL, invertY === undefined ? 1 : (invertY ? 1 : 0)); processFunction(potWidth, potHeight); var filters = getSamplingParameters(samplingMode, !noMipmap, gl); gl.texParameteri(gl.TEXTURE_2D, gl.TEXTURE_MAG_FILTER, filters.mag); gl.texParameteri(gl.TEXTURE_2D, gl.TEXTURE_MIN_FILTER, filters.min); if (!noMipmap && !isCompressed) { gl.generateMipmap(gl.TEXTURE_2D); } gl.bindTexture(gl.TEXTURE_2D, null); engine._activeTexturesCache = []; texture._baseWidth = width; texture._baseHeight = height; texture._width = potWidth; texture._height = potHeight; texture.isReady = true; texture.samplingMode = samplingMode; scene._removePendingData(texture); }; var partialLoad = function (url, index, loadedImages, scene, onfinish) { var onload = function () { loadedImages[index] = img; loadedImages._internalCount++; scene._removePendingData(img); if (loadedImages._internalCount === 6) { onfinish(loadedImages); } }; var onerror = function () { scene._removePendingData(img); }; var img = BABYLON.Tools.LoadImage(url, onload, onerror, scene.database); scene._addPendingData(img); }; var cascadeLoad = function (rootUrl, scene, onfinish, extensions) { var loadedImages = []; loadedImages._internalCount = 0; for (var index = 0; index < 6; index++) { partialLoad(rootUrl + extensions[index], index, loadedImages, scene, onfinish); } }; var EngineCapabilities = (function () { function EngineCapabilities() { } return EngineCapabilities; })(); BABYLON.EngineCapabilities = EngineCapabilities; var Engine = (function () { function Engine(canvas, antialias, options) { var _this = this; // Public members this.isFullscreen = false; this.isPointerLock = false; this.cullBackFaces = true; this.renderEvenInBackground = true; this.scenes = new Array(); this._windowIsBackground = false; this._loadingDivBackgroundColor = "black"; this._drawCalls = 0; this._renderingQueueLaunched = false; this._activeRenderLoops = []; // FPS this.fpsRange = 60; this.previousFramesDuration = []; this.fps = 60; this.deltaTime = 0; // States this._depthCullingState = new _DepthCullingState(); this._alphaState = new _AlphaState(); this._alphaMode = Engine.ALPHA_DISABLE; // Cache this._loadedTexturesCache = new Array(); this._activeTexturesCache = new Array(); this._compiledEffects = {}; this._uintIndicesCurrentlySet = false; this._renderingCanvas = canvas; this._canvasClientRect = this._renderingCanvas.getBoundingClientRect(); options = options || {}; options.antialias = antialias; try { this._gl = canvas.getContext("webgl", options) || canvas.getContext("experimental-webgl", options); } catch (e) { throw new Error("WebGL not supported"); } if (!this._gl) { throw new Error("WebGL not supported"); } this._onBlur = function () { _this._windowIsBackground = true; }; this._onFocus = function () { _this._windowIsBackground = false; }; window.addEventListener("blur", this._onBlur); window.addEventListener("focus", this._onFocus); // Textures this._workingCanvas = document.createElement("canvas"); this._workingContext = this._workingCanvas.getContext("2d"); // Viewport this._hardwareScalingLevel = 1.0 / (window.devicePixelRatio || 1.0); this.resize(); // Caps this._caps = new EngineCapabilities(); this._caps.maxTexturesImageUnits = this._gl.getParameter(this._gl.MAX_TEXTURE_IMAGE_UNITS); this._caps.maxTextureSize = this._gl.getParameter(this._gl.MAX_TEXTURE_SIZE); this._caps.maxCubemapTextureSize = this._gl.getParameter(this._gl.MAX_CUBE_MAP_TEXTURE_SIZE); this._caps.maxRenderTextureSize = this._gl.getParameter(this._gl.MAX_RENDERBUFFER_SIZE); // Infos this._glVersion = this._gl.getParameter(this._gl.VERSION); var rendererInfo = this._gl.getExtension("WEBGL_debug_renderer_info"); if (rendererInfo != null) { this._glRenderer = this._gl.getParameter(rendererInfo.UNMASKED_RENDERER_WEBGL); this._glVendor = this._gl.getParameter(rendererInfo.UNMASKED_VENDOR_WEBGL); } if (!this._glVendor) { this._glVendor = "Unknown vendor"; } if (!this._glRenderer) { this._glRenderer = "Unknown renderer"; } // Extensions this._caps.standardDerivatives = (this._gl.getExtension('OES_standard_derivatives') !== null); this._caps.s3tc = this._gl.getExtension('WEBGL_compressed_texture_s3tc'); this._caps.textureFloat = (this._gl.getExtension('OES_texture_float') !== null); this._caps.textureAnisotropicFilterExtension = this._gl.getExtension('EXT_texture_filter_anisotropic') || this._gl.getExtension('WEBKIT_EXT_texture_filter_anisotropic') || this._gl.getExtension('MOZ_EXT_texture_filter_anisotropic'); this._caps.maxAnisotropy = this._caps.textureAnisotropicFilterExtension ? this._gl.getParameter(this._caps.textureAnisotropicFilterExtension.MAX_TEXTURE_MAX_ANISOTROPY_EXT) : 0; this._caps.instancedArrays = this._gl.getExtension('ANGLE_instanced_arrays'); this._caps.uintIndices = this._gl.getExtension('OES_element_index_uint') !== null; // Depth buffer this.setDepthBuffer(true); this.setDepthFunctionToLessOrEqual(); this.setDepthWrite(true); // Fullscreen this._onFullscreenChange = function () { if (document.fullscreen !== undefined) { _this.isFullscreen = document.fullscreen; } else if (document.mozFullScreen !== undefined) { _this.isFullscreen = document.mozFullScreen; } else if (document.webkitIsFullScreen !== undefined) { _this.isFullscreen = document.webkitIsFullScreen; } else if (document.msIsFullScreen !== undefined) { _this.isFullscreen = document.msIsFullScreen; } // Pointer lock if (_this.isFullscreen && _this._pointerLockRequested) { canvas.requestPointerLock = canvas.requestPointerLock || canvas.msRequestPointerLock || canvas.mozRequestPointerLock || canvas.webkitRequestPointerLock; if (canvas.requestPointerLock) { canvas.requestPointerLock(); } } }; document.addEventListener("fullscreenchange", this._onFullscreenChange, false); document.addEventListener("mozfullscreenchange", this._onFullscreenChange, false); document.addEventListener("webkitfullscreenchange", this._onFullscreenChange, false); document.addEventListener("msfullscreenchange", this._onFullscreenChange, false); // Pointer lock this._onPointerLockChange = function () { _this.isPointerLock = (document.mozPointerLockElement === canvas || document.webkitPointerLockElement === canvas || document.msPointerLockElement === canvas || document.pointerLockElement === canvas); }; document.addEventListener("pointerlockchange", this._onPointerLockChange, false); document.addEventListener("mspointerlockchange", this._onPointerLockChange, false); document.addEventListener("mozpointerlockchange", this._onPointerLockChange, false); document.addEventListener("webkitpointerlockchange", this._onPointerLockChange, false); this._audioEngine = new BABYLON.AudioEngine(); BABYLON.Tools.Log("Babylon.js engine (v" + Engine.Version + ") launched"); } Object.defineProperty(Engine, "ALPHA_DISABLE", { get: function () { return Engine._ALPHA_DISABLE; }, enumerable: true, configurable: true }); Object.defineProperty(Engine, "ALPHA_ADD", { get: function () { return Engine._ALPHA_ADD; }, enumerable: true, configurable: true }); Object.defineProperty(Engine, "ALPHA_COMBINE", { get: function () { return Engine._ALPHA_COMBINE; }, enumerable: true, configurable: true }); Object.defineProperty(Engine, "DELAYLOADSTATE_NONE", { get: function () { return Engine._DELAYLOADSTATE_NONE; }, enumerable: true, configurable: true }); Object.defineProperty(Engine, "DELAYLOADSTATE_LOADED", { get: function () { return Engine._DELAYLOADSTATE_LOADED; }, enumerable: true, configurable: true }); Object.defineProperty(Engine, "DELAYLOADSTATE_LOADING", { get: function () { return Engine._DELAYLOADSTATE_LOADING; }, enumerable: true, configurable: true }); Object.defineProperty(Engine, "DELAYLOADSTATE_NOTLOADED", { get: function () { return Engine._DELAYLOADSTATE_NOTLOADED; }, enumerable: true, configurable: true }); Object.defineProperty(Engine, "TEXTUREFORMAT_ALPHA", { get: function () { return Engine._TEXTUREFORMAT_ALPHA; }, enumerable: true, configurable: true }); Object.defineProperty(Engine, "TEXTUREFORMAT_LUMINANCE", { get: function () { return Engine._TEXTUREFORMAT_LUMINANCE; }, enumerable: true, configurable: true }); Object.defineProperty(Engine, "TEXTUREFORMAT_LUMINANCE_ALPHA", { get: function () { return Engine._TEXTUREFORMAT_LUMINANCE_ALPHA; }, enumerable: true, configurable: true }); Object.defineProperty(Engine, "TEXTUREFORMAT_RGB", { get: function () { return Engine._TEXTUREFORMAT_RGB; }, enumerable: true, configurable: true }); Object.defineProperty(Engine, "TEXTUREFORMAT_RGBA", { get: function () { return Engine._TEXTUREFORMAT_RGBA; }, enumerable: true, configurable: true }); Object.defineProperty(Engine, "Version", { get: function () { return "2.0.0"; }, enumerable: true, configurable: true }); Engine.prototype.getGlInfo = function () { return { vendor: this._glVendor, renderer: this._glRenderer, version: this._glVersion }; }; Engine.prototype.getAudioEngine = function () { return this._audioEngine; }; Engine.prototype.getAspectRatio = function (camera) { var viewport = camera.viewport; return (this.getRenderWidth() * viewport.width) / (this.getRenderHeight() * viewport.height); }; Engine.prototype.getRenderWidth = function () { if (this._currentRenderTarget) { return this._currentRenderTarget._width; } return this._renderingCanvas.width; }; Engine.prototype.getRenderHeight = function () { if (this._currentRenderTarget) { return this._currentRenderTarget._height; } return this._renderingCanvas.height; }; Engine.prototype.getRenderingCanvas = function () { return this._renderingCanvas; }; Engine.prototype.getRenderingCanvasClientRect = function () { return this._renderingCanvas.getBoundingClientRect(); }; Engine.prototype.setHardwareScalingLevel = function (level) { this._hardwareScalingLevel = level; this.resize(); }; Engine.prototype.getHardwareScalingLevel = function () { return this._hardwareScalingLevel; }; Engine.prototype.getLoadedTexturesCache = function () { return this._loadedTexturesCache; }; Engine.prototype.getCaps = function () { return this._caps; }; Object.defineProperty(Engine.prototype, "drawCalls", { get: function () { return this._drawCalls; }, enumerable: true, configurable: true }); // Methods Engine.prototype.resetDrawCalls = function () { this._drawCalls = 0; }; Engine.prototype.setDepthFunctionToGreater = function () { this._depthCullingState.depthFunc = this._gl.GREATER; }; Engine.prototype.setDepthFunctionToGreaterOrEqual = function () { this._depthCullingState.depthFunc = this._gl.GEQUAL; }; Engine.prototype.setDepthFunctionToLess = function () { this._depthCullingState.depthFunc = this._gl.LESS; }; Engine.prototype.setDepthFunctionToLessOrEqual = function () { this._depthCullingState.depthFunc = this._gl.LEQUAL; }; Engine.prototype.stopRenderLoop = function (renderFunction) { if (!renderFunction) { this._activeRenderLoops = []; return; } var index = this._activeRenderLoops.indexOf(renderFunction); if (index >= 0) { this._activeRenderLoops.splice(index, 1); } }; Engine.prototype._renderLoop = function () { var _this = this; var shouldRender = true; if (!this.renderEvenInBackground && this._windowIsBackground) { shouldRender = false; } if (shouldRender) { // Start new frame this.beginFrame(); for (var index = 0; index < this._activeRenderLoops.length; index++) { var renderFunction = this._activeRenderLoops[index]; renderFunction(); } // Present this.endFrame(); } if (this._activeRenderLoops.length > 0) { // Register new frame BABYLON.Tools.QueueNewFrame(function () { _this._renderLoop(); }); } else { this._renderingQueueLaunched = false; } }; Engine.prototype.runRenderLoop = function (renderFunction) { var _this = this; if (this._activeRenderLoops.indexOf(renderFunction) !== -1) { return; } this._activeRenderLoops.push(renderFunction); if (!this._renderingQueueLaunched) { this._renderingQueueLaunched = true; BABYLON.Tools.QueueNewFrame(function () { _this._renderLoop(); }); } }; Engine.prototype.switchFullscreen = function (requestPointerLock) { if (this.isFullscreen) { BABYLON.Tools.ExitFullscreen(); } else { this._pointerLockRequested = requestPointerLock; BABYLON.Tools.RequestFullscreen(this._renderingCanvas); } }; Engine.prototype.clear = function (color, backBuffer, depthStencil) { this.applyStates(); this._gl.clearColor(color.r, color.g, color.b, color.a !== undefined ? color.a : 1.0); if (this._depthCullingState.depthMask) { this._gl.clearDepth(1.0); } var mode = 0; if (backBuffer) mode |= this._gl.COLOR_BUFFER_BIT; if (depthStencil && this._depthCullingState.depthMask) mode |= this._gl.DEPTH_BUFFER_BIT; this._gl.clear(mode); }; Engine.prototype.setViewport = function (viewport, requiredWidth, requiredHeight) { var width = requiredWidth || this._renderingCanvas.width; var height = requiredHeight || this._renderingCanvas.height; var x = viewport.x || 0; var y = viewport.y || 0; this._cachedViewport = viewport; this._gl.viewport(x * width, y * height, width * viewport.width, height * viewport.height); }; Engine.prototype.setDirectViewport = function (x, y, width, height) { this._cachedViewport = null; this._gl.viewport(x, y, width, height); }; Engine.prototype.beginFrame = function () { this._measureFps(); }; Engine.prototype.endFrame = function () { this.flushFramebuffer(); }; Engine.prototype.resize = function () { this.setSize(this._renderingCanvas.clientWidth / this._hardwareScalingLevel, this._renderingCanvas.clientHeight / this._hardwareScalingLevel); }; Engine.prototype.setSize = function (width, height) { this._renderingCanvas.width = width; this._renderingCanvas.height = height; this._canvasClientRect = this._renderingCanvas.getBoundingClientRect(); }; Engine.prototype.bindFramebuffer = function (texture) { this._currentRenderTarget = texture; var gl = this._gl; gl.bindFramebuffer(gl.FRAMEBUFFER, texture._framebuffer); this._gl.viewport(0, 0, texture._width, texture._height); this.wipeCaches(); }; Engine.prototype.unBindFramebuffer = function (texture) { this._currentRenderTarget = null; if (texture.generateMipMaps) { var gl = this._gl; gl.bindTexture(gl.TEXTURE_2D, texture); gl.generateMipmap(gl.TEXTURE_2D); gl.bindTexture(gl.TEXTURE_2D, null); } this._gl.bindFramebuffer(this._gl.FRAMEBUFFER, null); }; Engine.prototype.flushFramebuffer = function () { // this._gl.flush(); }; Engine.prototype.restoreDefaultFramebuffer = function () { this._currentRenderTarget = null; this._gl.bindFramebuffer(this._gl.FRAMEBUFFER, null); this.setViewport(this._cachedViewport); this.wipeCaches(); }; // VBOs Engine.prototype._resetVertexBufferBinding = function () { this._gl.bindBuffer(this._gl.ARRAY_BUFFER, null); this._cachedVertexBuffers = null; }; Engine.prototype.createVertexBuffer = function (vertices) { var vbo = this._gl.createBuffer(); this._gl.bindBuffer(this._gl.ARRAY_BUFFER, vbo); this._gl.bufferData(this._gl.ARRAY_BUFFER, new Float32Array(vertices), this._gl.STATIC_DRAW); this._resetVertexBufferBinding(); vbo.references = 1; return vbo; }; Engine.prototype.createDynamicVertexBuffer = function (capacity) { var vbo = this._gl.createBuffer(); this._gl.bindBuffer(this._gl.ARRAY_BUFFER, vbo); this._gl.bufferData(this._gl.ARRAY_BUFFER, capacity, this._gl.DYNAMIC_DRAW); this._resetVertexBufferBinding(); vbo.references = 1; return vbo; }; Engine.prototype.updateDynamicVertexBuffer = function (vertexBuffer, vertices, offset) { this._gl.bindBuffer(this._gl.ARRAY_BUFFER, vertexBuffer); if (offset === undefined) { offset = 0; } if (vertices instanceof Float32Array) { this._gl.bufferSubData(this._gl.ARRAY_BUFFER, offset, vertices); } else { this._gl.bufferSubData(this._gl.ARRAY_BUFFER, offset, new Float32Array(vertices)); } this._resetVertexBufferBinding(); }; Engine.prototype._resetIndexBufferBinding = function () { this._gl.bindBuffer(this._gl.ELEMENT_ARRAY_BUFFER, null); this._cachedIndexBuffer = null; }; Engine.prototype.createIndexBuffer = function (indices) { var vbo = this._gl.createBuffer(); this._gl.bindBuffer(this._gl.ELEMENT_ARRAY_BUFFER, vbo); // Check for 32 bits indices var arrayBuffer; var need32Bits = false; if (this._caps.uintIndices) { for (var index = 0; index < indices.length; index++) { if (indices[index] > 65535) { need32Bits = true; break; } } arrayBuffer = need32Bits ? new Uint32Array(indices) : new Uint16Array(indices); } else { arrayBuffer = new Uint16Array(indices); } this._gl.bufferData(this._gl.ELEMENT_ARRAY_BUFFER, arrayBuffer, this._gl.STATIC_DRAW); this._resetIndexBufferBinding(); vbo.references = 1; vbo.is32Bits = need32Bits; return vbo; }; Engine.prototype.bindBuffers = function (vertexBuffer, indexBuffer, vertexDeclaration, vertexStrideSize, effect) { if (this._cachedVertexBuffers !== vertexBuffer || this._cachedEffectForVertexBuffers !== effect) { this._cachedVertexBuffers = vertexBuffer; this._cachedEffectForVertexBuffers = effect; this._gl.bindBuffer(this._gl.ARRAY_BUFFER, vertexBuffer); var offset = 0; for (var index = 0; index < vertexDeclaration.length; index++) { var order = effect.getAttributeLocation(index); if (order >= 0) { this._gl.vertexAttribPointer(order, vertexDeclaration[index], this._gl.FLOAT, false, vertexStrideSize, offset); } offset += vertexDeclaration[index] * 4; } } if (this._cachedIndexBuffer !== indexBuffer) { this._cachedIndexBuffer = indexBuffer; this._gl.bindBuffer(this._gl.ELEMENT_ARRAY_BUFFER, indexBuffer); this._uintIndicesCurrentlySet = indexBuffer.is32Bits; } }; Engine.prototype.bindMultiBuffers = function (vertexBuffers, indexBuffer, effect) { if (this._cachedVertexBuffers !== vertexBuffers || this._cachedEffectForVertexBuffers !== effect) { this._cachedVertexBuffers = vertexBuffers; this._cachedEffectForVertexBuffers = effect; var attributes = effect.getAttributesNames(); for (var index = 0; index < attributes.length; index++) { var order = effect.getAttributeLocation(index); if (order >= 0) { var vertexBuffer = vertexBuffers[attributes[index]]; if (!vertexBuffer) { continue; } var stride = vertexBuffer.getStrideSize(); this._gl.bindBuffer(this._gl.ARRAY_BUFFER, vertexBuffer.getBuffer()); this._gl.vertexAttribPointer(order, stride, this._gl.FLOAT, false, stride * 4, 0); } } } if (indexBuffer != null && this._cachedIndexBuffer !== indexBuffer) { this._cachedIndexBuffer = indexBuffer; this._gl.bindBuffer(this._gl.ELEMENT_ARRAY_BUFFER, indexBuffer); this._uintIndicesCurrentlySet = indexBuffer.is32Bits; } }; Engine.prototype._releaseBuffer = function (buffer) { buffer.references--; if (buffer.references === 0) { this._gl.deleteBuffer(buffer); return true; } return false; }; Engine.prototype.createInstancesBuffer = function (capacity) { var buffer = this._gl.createBuffer(); buffer.capacity = capacity; this._gl.bindBuffer(this._gl.ARRAY_BUFFER, buffer); this._gl.bufferData(this._gl.ARRAY_BUFFER, capacity, this._gl.DYNAMIC_DRAW); return buffer; }; Engine.prototype.deleteInstancesBuffer = function (buffer) { this._gl.deleteBuffer(buffer); }; Engine.prototype.updateAndBindInstancesBuffer = function (instancesBuffer, data, offsetLocations) { this._gl.bindBuffer(this._gl.ARRAY_BUFFER, instancesBuffer); this._gl.bufferSubData(this._gl.ARRAY_BUFFER, 0, data); for (var index = 0; index < 4; index++) { var offsetLocation = offsetLocations[index]; this._gl.enableVertexAttribArray(offsetLocation); this._gl.vertexAttribPointer(offsetLocation, 4, this._gl.FLOAT, false, 64, index * 16); this._caps.instancedArrays.vertexAttribDivisorANGLE(offsetLocation, 1); } }; Engine.prototype.unBindInstancesBuffer = function (instancesBuffer, offsetLocations) { this._gl.bindBuffer(this._gl.ARRAY_BUFFER, instancesBuffer); for (var index = 0; index < 4; index++) { var offsetLocation = offsetLocations[index]; this._gl.disableVertexAttribArray(offsetLocation); this._caps.instancedArrays.vertexAttribDivisorANGLE(offsetLocation, 0); } }; Engine.prototype.applyStates = function () { this._depthCullingState.apply(this._gl); this._alphaState.apply(this._gl); }; Engine.prototype.draw = function (useTriangles, indexStart, indexCount, instancesCount) { // Apply states this.applyStates(); this._drawCalls++; // Render var indexFormat = this._uintIndicesCurrentlySet ? this._gl.UNSIGNED_INT : this._gl.UNSIGNED_SHORT; if (instancesCount) { this._caps.instancedArrays.drawElementsInstancedANGLE(useTriangles ? this._gl.TRIANGLES : this._gl.LINES, indexCount, indexFormat, indexStart * 2, instancesCount); return; } this._gl.drawElements(useTriangles ? this._gl.TRIANGLES : this._gl.LINES, indexCount, indexFormat, indexStart * 2); }; Engine.prototype.drawPointClouds = function (verticesStart, verticesCount, instancesCount) { // Apply states this.applyStates(); this._drawCalls++; if (instancesCount) { this._caps.instancedArrays.drawArraysInstancedANGLE(this._gl.POINTS, verticesStart, verticesCount, instancesCount); return; } this._gl.drawArrays(this._gl.POINTS, verticesStart, verticesCount); }; // Shaders Engine.prototype._releaseEffect = function (effect) { if (this._compiledEffects[effect._key]) { delete this._compiledEffects[effect._key]; if (effect.getProgram()) { this._gl.deleteProgram(effect.getProgram()); } } }; Engine.prototype.createEffect = function (baseName, attributesNames, uniformsNames, samplers, defines, fallbacks, onCompiled, onError) { var vertex = baseName.vertexElement || baseName.vertex || baseName; var fragment = baseName.fragmentElement || baseName.fragment || baseName; var name = vertex + "+" + fragment + "@" + defines; if (this._compiledEffects[name]) { return this._compiledEffects[name]; } var effect = new BABYLON.Effect(baseName, attributesNames, uniformsNames, samplers, this, defines, fallbacks, onCompiled, onError); effect._key = name; this._compiledEffects[name] = effect; return effect; }; Engine.prototype.createEffectForParticles = function (fragmentName, uniformsNames, samplers, defines, fallbacks, onCompiled, onError) { if (typeof uniformsNames === "undefined") { uniformsNames = []; } if (typeof samplers === "undefined") { samplers = []; } if (typeof defines === "undefined") { defines = ""; } return this.createEffect({ vertex: "particles", fragmentElement: fragmentName }, ["position", "color", "options"], ["view", "projection"].concat(uniformsNames), ["diffuseSampler"].concat(samplers), defines, fallbacks, onCompiled, onError); }; Engine.prototype.createShaderProgram = function (vertexCode, fragmentCode, defines) { var vertexShader = compileShader(this._gl, vertexCode, "vertex", defines); var fragmentShader = compileShader(this._gl, fragmentCode, "fragment", defines); var shaderProgram = this._gl.createProgram(); this._gl.attachShader(shaderProgram, vertexShader); this._gl.attachShader(shaderProgram, fragmentShader); this._gl.linkProgram(shaderProgram); var linked = this._gl.getProgramParameter(shaderProgram, this._gl.LINK_STATUS); if (!linked) { var error = this._gl.getProgramInfoLog(shaderProgram); if (error) { throw new Error(error); } } this._gl.deleteShader(vertexShader); this._gl.deleteShader(fragmentShader); return shaderProgram; }; Engine.prototype.getUniforms = function (shaderProgram, uniformsNames) { var results = []; for (var index = 0; index < uniformsNames.length; index++) { results.push(this._gl.getUniformLocation(shaderProgram, uniformsNames[index])); } return results; }; Engine.prototype.getAttributes = function (shaderProgram, attributesNames) { var results = []; for (var index = 0; index < attributesNames.length; index++) { try { results.push(this._gl.getAttribLocation(shaderProgram, attributesNames[index])); } catch (e) { results.push(-1); } } return results; }; Engine.prototype.enableEffect = function (effect) { if (!effect || !effect.getAttributesCount() || this._currentEffect === effect) { if (effect && effect.onBind) { effect.onBind(effect); } return; } this._vertexAttribArrays = this._vertexAttribArrays || []; // Use program this._gl.useProgram(effect.getProgram()); for (var i in this._vertexAttribArrays) { if (i > this._gl.VERTEX_ATTRIB_ARRAY_ENABLED || !this._vertexAttribArrays[i]) { continue; } this._vertexAttribArrays[i] = false; this._gl.disableVertexAttribArray(i); } var attributesCount = effect.getAttributesCount(); for (var index = 0; index < attributesCount; index++) { // Attributes var order = effect.getAttributeLocation(index); if (order >= 0) { this._vertexAttribArrays[order] = true; this._gl.enableVertexAttribArray(order); } } this._currentEffect = effect; if (effect.onBind) { effect.onBind(effect); } }; Engine.prototype.setArray = function (uniform, array) { if (!uniform) return; this._gl.uniform1fv(uniform, array); }; Engine.prototype.setMatrices = function (uniform, matrices) { if (!uniform) return; this._gl.uniformMatrix4fv(uniform, false, matrices); }; Engine.prototype.setMatrix = function (uniform, matrix) { if (!uniform) return; this._gl.uniformMatrix4fv(uniform, false, matrix.toArray()); }; Engine.prototype.setFloat = function (uniform, value) { if (!uniform) return; this._gl.uniform1f(uniform, value); }; Engine.prototype.setFloat2 = function (uniform, x, y) { if (!uniform) return; this._gl.uniform2f(uniform, x, y); }; Engine.prototype.setFloat3 = function (uniform, x, y, z) { if (!uniform) return; this._gl.uniform3f(uniform, x, y, z); }; Engine.prototype.setBool = function (uniform, bool) { if (!uniform) return; this._gl.uniform1i(uniform, bool); }; Engine.prototype.setFloat4 = function (uniform, x, y, z, w) { if (!uniform) return; this._gl.uniform4f(uniform, x, y, z, w); }; Engine.prototype.setColor3 = function (uniform, color3) { if (!uniform) return; this._gl.uniform3f(uniform, color3.r, color3.g, color3.b); }; Engine.prototype.setColor4 = function (uniform, color3, alpha) { if (!uniform) return; this._gl.uniform4f(uniform, color3.r, color3.g, color3.b, alpha); }; // States Engine.prototype.setState = function (culling, force) { // Culling if (this._depthCullingState.cull !== culling || force) { if (culling) { this._depthCullingState.cullFace = this.cullBackFaces ? this._gl.BACK : this._gl.FRONT; this._depthCullingState.cull = true; } else { this._depthCullingState.cull = false; } } }; Engine.prototype.setDepthBuffer = function (enable) { this._depthCullingState.depthTest = enable; }; Engine.prototype.getDepthWrite = function () { return this._depthCullingState.depthMask; }; Engine.prototype.setDepthWrite = function (enable) { this._depthCullingState.depthMask = enable; }; Engine.prototype.setColorWrite = function (enable) { this._gl.colorMask(enable, enable, enable, enable); }; Engine.prototype.setAlphaMode = function (mode) { switch (mode) { case Engine.ALPHA_DISABLE: this.setDepthWrite(true); this._alphaState.alphaBlend = false; break; case Engine.ALPHA_COMBINE: this.setDepthWrite(false); this._alphaState.setAlphaBlendFunctionParameters(this._gl.SRC_ALPHA, this._gl.ONE_MINUS_SRC_ALPHA, this._gl.ONE, this._gl.ONE); this._alphaState.alphaBlend = true; break; case Engine.ALPHA_ADD: this.setDepthWrite(false); this._alphaState.setAlphaBlendFunctionParameters(this._gl.ONE, this._gl.ONE, this._gl.ZERO, this._gl.ONE); this._alphaState.alphaBlend = true; break; } this._alphaMode = mode; }; Engine.prototype.getAlphaMode = function () { return this._alphaMode; }; Engine.prototype.setAlphaTesting = function (enable) { this._alphaTest = enable; }; Engine.prototype.getAlphaTesting = function () { return this._alphaTest; }; // Textures Engine.prototype.wipeCaches = function () { this._activeTexturesCache = []; this._currentEffect = null; this._depthCullingState.reset(); this._alphaState.reset(); this._cachedVertexBuffers = null; this._cachedIndexBuffer = null; this._cachedEffectForVertexBuffers = null; }; Engine.prototype.setSamplingMode = function (texture, samplingMode) { var gl = this._gl; gl.bindTexture(gl.TEXTURE_2D, texture); var magFilter = gl.NEAREST; var minFilter = gl.NEAREST; if (samplingMode === BABYLON.Texture.BILINEAR_SAMPLINGMODE) { magFilter = gl.LINEAR; minFilter = gl.LINEAR; } else if (samplingMode === BABYLON.Texture.TRILINEAR_SAMPLINGMODE) { magFilter = gl.LINEAR; minFilter = gl.LINEAR_MIPMAP_LINEAR; } gl.texParameteri(gl.TEXTURE_2D, gl.TEXTURE_MAG_FILTER, magFilter); gl.texParameteri(gl.TEXTURE_2D, gl.TEXTURE_MIN_FILTER, minFilter); gl.bindTexture(gl.TEXTURE_2D, null); texture.samplingMode = samplingMode; }; Engine.prototype.createTexture = function (url, noMipmap, invertY, scene, samplingMode, onLoad, onError, buffer) { var _this = this; if (typeof samplingMode === "undefined") { samplingMode = BABYLON.Texture.TRILINEAR_SAMPLINGMODE; } if (typeof onLoad === "undefined") { onLoad = null; } if (typeof onError === "undefined") { onError = null; } if (typeof buffer === "undefined") { buffer = null; } var texture = this._gl.createTexture(); var extension; var fromData = false; if (url.substr(0, 5) === "data:") { fromData = true; } if (!fromData) extension = url.substr(url.length - 4, 4).toLowerCase(); else { var oldUrl = url; fromData = oldUrl.split(':'); url = oldUrl; extension = fromData[1].substr(fromData[1].length - 4, 4).toLowerCase(); } var isDDS = this.getCaps().s3tc && (extension === ".dds"); var isTGA = (extension === ".tga"); scene._addPendingData(texture); texture.url = url; texture.noMipmap = noMipmap; texture.references = 1; this._loadedTexturesCache.push(texture); var onerror = function () { scene._removePendingData(texture); if (onError) { onError(); } }; if (isTGA) { var callback = function (arrayBuffer) { var data = new Uint8Array(arrayBuffer); var header = BABYLON.Internals.TGATools.GetTGAHeader(data); prepareWebGLTexture(texture, _this._gl, scene, header.width, header.height, invertY, noMipmap, false, function () { BABYLON.Internals.TGATools.UploadContent(_this._gl, data); if (onLoad) { onLoad(); } }, samplingMode); }; if (!(fromData instanceof Array)) BABYLON.Tools.LoadFile(url, function (arrayBuffer) { callback(arrayBuffer); }, onerror, scene.database, true); else callback(buffer); } else if (isDDS) { callback = function (data) { var info = BABYLON.Internals.DDSTools.GetDDSInfo(data); var loadMipmap = (info.isRGB || info.isLuminance || info.mipmapCount > 1) && !noMipmap && ((info.width >> (info.mipmapCount - 1)) === 1); prepareWebGLTexture(texture, _this._gl, scene, info.width, info.height, invertY, !loadMipmap, info.isFourCC, function () { BABYLON.Internals.DDSTools.UploadDDSLevels(_this._gl, _this.getCaps().s3tc, data, info, loadMipmap, 1); if (onLoad) { onLoad(); } }, samplingMode); }; if (!(fromData instanceof Array)) BABYLON.Tools.LoadFile(url, function (data) { callback(data); }, onerror, scene.database, true); else callback(buffer); } else { var onload = function (img) { prepareWebGLTexture(texture, _this._gl, scene, img.width, img.height, invertY, noMipmap, false, function (potWidth, potHeight) { var isPot = (img.width === potWidth && img.height === potHeight); if (!isPot) { _this._workingCanvas.width = potWidth; _this._workingCanvas.height = potHeight; if (samplingMode === BABYLON.Texture.NEAREST_SAMPLINGMODE) { _this._workingContext.imageSmoothingEnabled = false; _this._workingContext.mozImageSmoothingEnabled = false; _this._workingContext.oImageSmoothingEnabled = false; _this._workingContext.webkitImageSmoothingEnabled = false; _this._workingContext.msImageSmoothingEnabled = false; } _this._workingContext.drawImage(img, 0, 0, img.width, img.height, 0, 0, potWidth, potHeight); if (samplingMode === BABYLON.Texture.NEAREST_SAMPLINGMODE) { _this._workingContext.imageSmoothingEnabled = true; _this._workingContext.mozImageSmoothingEnabled = true; _this._workingContext.oImageSmoothingEnabled = true; _this._workingContext.webkitImageSmoothingEnabled = true; _this._workingContext.msImageSmoothingEnabled = true; } } _this._gl.texImage2D(_this._gl.TEXTURE_2D, 0, _this._gl.RGBA, _this._gl.RGBA, _this._gl.UNSIGNED_BYTE, isPot ? img : _this._workingCanvas); if (onLoad) { onLoad(); } }, samplingMode); }; if (!(fromData instanceof Array)) BABYLON.Tools.LoadImage(url, onload, onerror, scene.database); else BABYLON.Tools.LoadImage(buffer, onload, onerror, scene.database); } return texture; }; Engine.prototype.createRawTexture = function (data, width, height, format, generateMipMaps, invertY, samplingMode) { var texture = this._gl.createTexture(); this._gl.bindTexture(this._gl.TEXTURE_2D, texture); this._gl.pixelStorei(this._gl.UNPACK_FLIP_Y_WEBGL, invertY === undefined ? 1 : (invertY ? 1 : 0)); // Format var internalFormat = this._gl.RGBA; switch (format) { case Engine.TEXTUREFORMAT_ALPHA: internalFormat = this._gl.ALPHA; break; case Engine.TEXTUREFORMAT_LUMINANCE: internalFormat = this._gl.LUMINANCE; break; case Engine.TEXTUREFORMAT_LUMINANCE_ALPHA: internalFormat = this._gl.LUMINANCE_ALPHA; break; case Engine.TEXTUREFORMAT_RGB: internalFormat = this._gl.RGB; break; case Engine.TEXTUREFORMAT_RGBA: internalFormat = this._gl.RGBA; break; } this._gl.texImage2D(this._gl.TEXTURE_2D, 0, internalFormat, width, height, 0, internalFormat, this._gl.UNSIGNED_BYTE, data); if (generateMipMaps) { this._gl.generateMipmap(this._gl.TEXTURE_2D); } // Filters var filters = getSamplingParameters(samplingMode, generateMipMaps, this._gl); this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_MAG_FILTER, filters.mag); this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_MIN_FILTER, filters.min); this._gl.bindTexture(this._gl.TEXTURE_2D, null); this._activeTexturesCache = []; texture._baseWidth = width; texture._baseHeight = height; texture._width = width; texture._height = height; texture.isReady = true; texture.references = 1; texture.samplingMode = samplingMode; this._loadedTexturesCache.push(texture); return texture; }; Engine.prototype.createDynamicTexture = function (width, height, generateMipMaps, samplingMode) { var texture = this._gl.createTexture(); width = BABYLON.Tools.GetExponantOfTwo(width, this._caps.maxTextureSize); height = BABYLON.Tools.GetExponantOfTwo(height, this._caps.maxTextureSize); this._gl.bindTexture(this._gl.TEXTURE_2D, texture); var filters = getSamplingParameters(samplingMode, generateMipMaps, this._gl); this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_MAG_FILTER, filters.mag); this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_MIN_FILTER, filters.min); this._gl.bindTexture(this._gl.TEXTURE_2D, null); this._activeTexturesCache = []; texture._baseWidth = width; texture._baseHeight = height; texture._width = width; texture._height = height; texture.isReady = false; texture.generateMipMaps = generateMipMaps; texture.references = 1; texture.samplingMode = samplingMode; this._loadedTexturesCache.push(texture); return texture; }; Engine.prototype.updateDynamicTexture = function (texture, canvas, invertY) { this._gl.bindTexture(this._gl.TEXTURE_2D, texture); this._gl.pixelStorei(this._gl.UNPACK_FLIP_Y_WEBGL, invertY ? 1 : 0); this._gl.texImage2D(this._gl.TEXTURE_2D, 0, this._gl.RGBA, this._gl.RGBA, this._gl.UNSIGNED_BYTE, canvas); if (texture.generateMipMaps) { this._gl.generateMipmap(this._gl.TEXTURE_2D); } this._gl.bindTexture(this._gl.TEXTURE_2D, null); this._activeTexturesCache = []; texture.isReady = true; }; Engine.prototype.updateVideoTexture = function (texture, video, invertY) { this._gl.bindTexture(this._gl.TEXTURE_2D, texture); this._gl.pixelStorei(this._gl.UNPACK_FLIP_Y_WEBGL, invertY ? 0 : 1); // Video are upside down by default // Scale the video if it is a NPOT using the current working canvas if (video.videoWidth !== texture._width || video.videoHeight !== texture._height) { if (!texture._workingCanvas) { texture._workingCanvas = document.createElement("canvas"); texture._workingContext = texture._workingCanvas.getContext("2d"); texture._workingCanvas.width = texture._width; texture._workingCanvas.height = texture._height; } texture._workingContext.drawImage(video, 0, 0, video.videoWidth, video.videoHeight, 0, 0, texture._width, texture._height); this._gl.texImage2D(this._gl.TEXTURE_2D, 0, this._gl.RGBA, this._gl.RGBA, this._gl.UNSIGNED_BYTE, texture._workingCanvas); } else { this._gl.texImage2D(this._gl.TEXTURE_2D, 0, this._gl.RGBA, this._gl.RGBA, this._gl.UNSIGNED_BYTE, video); } if (texture.generateMipMaps) { this._gl.generateMipmap(this._gl.TEXTURE_2D); } this._gl.bindTexture(this._gl.TEXTURE_2D, null); this._activeTexturesCache = []; texture.isReady = true; }; Engine.prototype.createRenderTargetTexture = function (size, options) { // old version had a "generateMipMaps" arg instead of options. // if options.generateMipMaps is undefined, consider that options itself if the generateMipmaps value // in the same way, generateDepthBuffer is defaulted to true var generateMipMaps = false; var generateDepthBuffer = true; var samplingMode = BABYLON.Texture.TRILINEAR_SAMPLINGMODE; if (options !== undefined) { generateMipMaps = options.generateMipMaps === undefined ? options : options.generateMipmaps; generateDepthBuffer = options.generateDepthBuffer === undefined ? true : options.generateDepthBuffer; if (options.samplingMode !== undefined) { samplingMode = options.samplingMode; } } var gl = this._gl; var texture = gl.createTexture(); gl.bindTexture(gl.TEXTURE_2D, texture); var width = size.width || size; var height = size.height || size; var filters = getSamplingParameters(samplingMode, generateMipMaps, gl); gl.texParameteri(gl.TEXTURE_2D, gl.TEXTURE_MAG_FILTER, filters.mag); gl.texParameteri(gl.TEXTURE_2D, gl.TEXTURE_MIN_FILTER, filters.min); gl.texParameteri(gl.TEXTURE_2D, gl.TEXTURE_WRAP_S, gl.CLAMP_TO_EDGE); gl.texParameteri(gl.TEXTURE_2D, gl.TEXTURE_WRAP_T, gl.CLAMP_TO_EDGE); gl.texImage2D(gl.TEXTURE_2D, 0, gl.RGBA, width, height, 0, gl.RGBA, gl.UNSIGNED_BYTE, null); var depthBuffer; // Create the depth buffer if (generateDepthBuffer) { depthBuffer = gl.createRenderbuffer(); gl.bindRenderbuffer(gl.RENDERBUFFER, depthBuffer); gl.renderbufferStorage(gl.RENDERBUFFER, gl.DEPTH_COMPONENT16, width, height); } // Create the framebuffer var framebuffer = gl.createFramebuffer(); gl.bindFramebuffer(gl.FRAMEBUFFER, framebuffer); gl.framebufferTexture2D(gl.FRAMEBUFFER, gl.COLOR_ATTACHMENT0, gl.TEXTURE_2D, texture, 0); if (generateDepthBuffer) { gl.framebufferRenderbuffer(gl.FRAMEBUFFER, gl.DEPTH_ATTACHMENT, gl.RENDERBUFFER, depthBuffer); } // Unbind gl.bindTexture(gl.TEXTURE_2D, null); gl.bindRenderbuffer(gl.RENDERBUFFER, null); gl.bindFramebuffer(gl.FRAMEBUFFER, null); texture._framebuffer = framebuffer; if (generateDepthBuffer) { texture._depthBuffer = depthBuffer; } texture._width = width; texture._height = height; texture.isReady = true; texture.generateMipMaps = generateMipMaps; texture.references = 1; texture.samplingMode = samplingMode; this._activeTexturesCache = []; this._loadedTexturesCache.push(texture); return texture; }; Engine.prototype.createCubeTexture = function (rootUrl, scene, extensions, noMipmap) { var _this = this; var gl = this._gl; var texture = gl.createTexture(); texture.isCube = true; texture.url = rootUrl; texture.references = 1; this._loadedTexturesCache.push(texture); var extension = rootUrl.substr(rootUrl.length - 4, 4).toLowerCase(); var isDDS = this.getCaps().s3tc && (extension === ".dds"); if (isDDS) { BABYLON.Tools.LoadFile(rootUrl, function (data) { var info = BABYLON.Internals.DDSTools.GetDDSInfo(data); var loadMipmap = (info.isRGB || info.isLuminance || info.mipmapCount > 1) && !noMipmap; gl.bindTexture(gl.TEXTURE_CUBE_MAP, texture); gl.pixelStorei(gl.UNPACK_FLIP_Y_WEBGL, 1); BABYLON.Internals.DDSTools.UploadDDSLevels(_this._gl, _this.getCaps().s3tc, data, info, loadMipmap, 6); if (!noMipmap && !info.isFourCC && info.mipmapCount === 1) { gl.generateMipmap(gl.TEXTURE_CUBE_MAP); } gl.texParameteri(gl.TEXTURE_CUBE_MAP, gl.TEXTURE_MAG_FILTER, gl.LINEAR); gl.texParameteri(gl.TEXTURE_CUBE_MAP, gl.TEXTURE_MIN_FILTER, loadMipmap ? gl.LINEAR_MIPMAP_LINEAR : gl.LINEAR); gl.texParameteri(gl.TEXTURE_CUBE_MAP, gl.TEXTURE_WRAP_S, gl.CLAMP_TO_EDGE); gl.texParameteri(gl.TEXTURE_CUBE_MAP, gl.TEXTURE_WRAP_T, gl.CLAMP_TO_EDGE); gl.bindTexture(gl.TEXTURE_CUBE_MAP, null); _this._activeTexturesCache = []; texture._width = info.width; texture._height = info.height; texture.isReady = true; }, null, null, true); } else { cascadeLoad(rootUrl, scene, function (imgs) { var width = BABYLON.Tools.GetExponantOfTwo(imgs[0].width, _this._caps.maxCubemapTextureSize); var height = width; _this._workingCanvas.width = width; _this._workingCanvas.height = height; var faces = [ gl.TEXTURE_CUBE_MAP_POSITIVE_X, gl.TEXTURE_CUBE_MAP_POSITIVE_Y, gl.TEXTURE_CUBE_MAP_POSITIVE_Z, gl.TEXTURE_CUBE_MAP_NEGATIVE_X, gl.TEXTURE_CUBE_MAP_NEGATIVE_Y, gl.TEXTURE_CUBE_MAP_NEGATIVE_Z ]; gl.bindTexture(gl.TEXTURE_CUBE_MAP, texture); gl.pixelStorei(gl.UNPACK_FLIP_Y_WEBGL, 0); for (var index = 0; index < faces.length; index++) { _this._workingContext.drawImage(imgs[index], 0, 0, imgs[index].width, imgs[index].height, 0, 0, width, height); gl.texImage2D(faces[index], 0, gl.RGBA, gl.RGBA, gl.UNSIGNED_BYTE, _this._workingCanvas); } if (!noMipmap) { gl.generateMipmap(gl.TEXTURE_CUBE_MAP); } gl.texParameteri(gl.TEXTURE_CUBE_MAP, gl.TEXTURE_MAG_FILTER, gl.LINEAR); gl.texParameteri(gl.TEXTURE_CUBE_MAP, gl.TEXTURE_MIN_FILTER, noMipmap ? gl.LINEAR : gl.LINEAR_MIPMAP_LINEAR); gl.texParameteri(gl.TEXTURE_CUBE_MAP, gl.TEXTURE_WRAP_S, gl.CLAMP_TO_EDGE); gl.texParameteri(gl.TEXTURE_CUBE_MAP, gl.TEXTURE_WRAP_T, gl.CLAMP_TO_EDGE); gl.bindTexture(gl.TEXTURE_CUBE_MAP, null); _this._activeTexturesCache = []; texture._width = width; texture._height = height; texture.isReady = true; }, extensions); } return texture; }; Engine.prototype._releaseTexture = function (texture) { var gl = this._gl; if (texture._framebuffer) { gl.deleteFramebuffer(texture._framebuffer); } if (texture._depthBuffer) { gl.deleteRenderbuffer(texture._depthBuffer); } gl.deleteTexture(texture); for (var channel = 0; channel < this._caps.maxTexturesImageUnits; channel++) { this._gl.activeTexture(this._gl["TEXTURE" + channel]); this._gl.bindTexture(this._gl.TEXTURE_2D, null); this._gl.bindTexture(this._gl.TEXTURE_CUBE_MAP, null); this._activeTexturesCache[channel] = null; } var index = this._loadedTexturesCache.indexOf(texture); if (index !== -1) { this._loadedTexturesCache.splice(index, 1); } }; Engine.prototype.bindSamplers = function (effect) { this._gl.useProgram(effect.getProgram()); var samplers = effect.getSamplers(); for (var index = 0; index < samplers.length; index++) { var uniform = effect.getUniform(samplers[index]); this._gl.uniform1i(uniform, index); } this._currentEffect = null; }; Engine.prototype._bindTexture = function (channel, texture) { this._gl.activeTexture(this._gl["TEXTURE" + channel]); this._gl.bindTexture(this._gl.TEXTURE_2D, texture); this._activeTexturesCache[channel] = null; }; Engine.prototype.setTextureFromPostProcess = function (channel, postProcess) { this._bindTexture(channel, postProcess._textures.data[postProcess._currentRenderTextureInd]); }; Engine.prototype.setTexture = function (channel, texture) { if (channel < 0) { return; } // Not ready? if (!texture || !texture.isReady()) { if (this._activeTexturesCache[channel] != null) { this._gl.activeTexture(this._gl["TEXTURE" + channel]); this._gl.bindTexture(this._gl.TEXTURE_2D, null); this._gl.bindTexture(this._gl.TEXTURE_CUBE_MAP, null); this._activeTexturesCache[channel] = null; } return; } // Video if (texture instanceof BABYLON.VideoTexture) { if (texture.update()) { this._activeTexturesCache[channel] = null; } } else if (texture.delayLoadState === Engine.DELAYLOADSTATE_NOTLOADED) { texture.delayLoad(); return; } if (this._activeTexturesCache[channel] === texture) { return; } this._activeTexturesCache[channel] = texture; var internalTexture = texture.getInternalTexture(); this._gl.activeTexture(this._gl["TEXTURE" + channel]); if (internalTexture.isCube) { this._gl.bindTexture(this._gl.TEXTURE_CUBE_MAP, internalTexture); if (internalTexture._cachedCoordinatesMode !== texture.coordinatesMode) { internalTexture._cachedCoordinatesMode = texture.coordinatesMode; // CUBIC_MODE and SKYBOX_MODE both require CLAMP_TO_EDGE. All other modes use REPEAT. var textureWrapMode = (texture.coordinatesMode !== BABYLON.Texture.CUBIC_MODE && texture.coordinatesMode !== BABYLON.Texture.SKYBOX_MODE) ? this._gl.REPEAT : this._gl.CLAMP_TO_EDGE; this._gl.texParameteri(this._gl.TEXTURE_CUBE_MAP, this._gl.TEXTURE_WRAP_S, textureWrapMode); this._gl.texParameteri(this._gl.TEXTURE_CUBE_MAP, this._gl.TEXTURE_WRAP_T, textureWrapMode); } this._setAnisotropicLevel(this._gl.TEXTURE_CUBE_MAP, texture); } else { this._gl.bindTexture(this._gl.TEXTURE_2D, internalTexture); if (internalTexture._cachedWrapU !== texture.wrapU) { internalTexture._cachedWrapU = texture.wrapU; switch (texture.wrapU) { case BABYLON.Texture.WRAP_ADDRESSMODE: this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_WRAP_S, this._gl.REPEAT); break; case BABYLON.Texture.CLAMP_ADDRESSMODE: this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_WRAP_S, this._gl.CLAMP_TO_EDGE); break; case BABYLON.Texture.MIRROR_ADDRESSMODE: this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_WRAP_S, this._gl.MIRRORED_REPEAT); break; } } if (internalTexture._cachedWrapV !== texture.wrapV) { internalTexture._cachedWrapV = texture.wrapV; switch (texture.wrapV) { case BABYLON.Texture.WRAP_ADDRESSMODE: this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_WRAP_T, this._gl.REPEAT); break; case BABYLON.Texture.CLAMP_ADDRESSMODE: this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_WRAP_T, this._gl.CLAMP_TO_EDGE); break; case BABYLON.Texture.MIRROR_ADDRESSMODE: this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_WRAP_T, this._gl.MIRRORED_REPEAT); break; } } this._setAnisotropicLevel(this._gl.TEXTURE_2D, texture); } }; Engine.prototype._setAnisotropicLevel = function (key, texture) { var anisotropicFilterExtension = this._caps.textureAnisotropicFilterExtension; if (anisotropicFilterExtension && texture._cachedAnisotropicFilteringLevel !== texture.anisotropicFilteringLevel) { this._gl.texParameterf(key, anisotropicFilterExtension.TEXTURE_MAX_ANISOTROPY_EXT, Math.min(texture.anisotropicFilteringLevel, this._caps.maxAnisotropy)); texture._cachedAnisotropicFilteringLevel = texture.anisotropicFilteringLevel; } }; Engine.prototype.readPixels = function (x, y, width, height) { var data = new Uint8Array(height * width * 4); this._gl.readPixels(0, 0, width, height, this._gl.RGBA, this._gl.UNSIGNED_BYTE, data); return data; }; // Dispose Engine.prototype.dispose = function () { this.hideLoadingUI(); this.stopRenderLoop(); while (this.scenes.length) { this.scenes[0].dispose(); } for (var name in this._compiledEffects) { this._gl.deleteProgram(this._compiledEffects[name]._program); } for (var i in this._vertexAttribArrays) { if (i > this._gl.VERTEX_ATTRIB_ARRAY_ENABLED || !this._vertexAttribArrays[i]) { continue; } this._gl.disableVertexAttribArray(i); } // Events window.removeEventListener("blur", this._onBlur); window.removeEventListener("focus", this._onFocus); document.removeEventListener("fullscreenchange", this._onFullscreenChange); document.removeEventListener("mozfullscreenchange", this._onFullscreenChange); document.removeEventListener("webkitfullscreenchange", this._onFullscreenChange); document.removeEventListener("msfullscreenchange", this._onFullscreenChange); document.removeEventListener("pointerlockchange", this._onPointerLockChange); document.removeEventListener("mspointerlockchange", this._onPointerLockChange); document.removeEventListener("mozpointerlockchange", this._onPointerLockChange); document.removeEventListener("webkitpointerlockchange", this._onPointerLockChange); }; // Loading screen Engine.prototype.displayLoadingUI = function () { var _this = this; this._loadingDiv = document.createElement("div"); this._loadingDiv.style.opacity = "0"; this._loadingDiv.style.transition = "opacity 1.5s ease"; // Loading text this._loadingTextDiv = document.createElement("div"); this._loadingTextDiv.style.position = "absolute"; this._loadingTextDiv.style.left = "0"; this._loadingTextDiv.style.top = "50%"; this._loadingTextDiv.style.marginTop = "80px"; this._loadingTextDiv.style.width = "100%"; this._loadingTextDiv.style.height = "20px"; this._loadingTextDiv.style.fontFamily = "Arial"; this._loadingTextDiv.style.fontSize = "14px"; this._loadingTextDiv.style.color = "white"; this._loadingTextDiv.style.textAlign = "center"; this._loadingTextDiv.innerHTML = "Loading"; this._loadingDiv.appendChild(this._loadingTextDiv); // Loading img var imgBack = new Image(); imgBack.src = "data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAGQAAABkCAYAAABw4pVUAAAAAXNSR0IArs4c6QAAAARnQU1BAACxjwv8YQUAAAAJcEhZcwAADsMAAA7DAcdvqGQAAAAYdEVYdFNvZnR3YXJlAHBhaW50Lm5ldCA0LjAuM4zml1AAAARbSURBVHhe7Z09aFNRFMc716kuLrq4FdyLq4Wi4CAoRQcR0UJBUBdRiuLSIYMo6CA4FF2sgw6CFAdFUOpSQYcWO4hD26UQCfXrIQrx/JJzw1OSWq3NPeL/B4Fy+0jg/HO+7j3vpUcI8b/Q39+/49ihfWdPHT94Yf/e3Se3bd263f8lus218TPn6vV6Ya8Wi/MzNRNmj18iusX9W1evmP1/EKNEIVG6CMbG6E3bt+fT++pHha8NoHdT72bLE8NDg7tGU64gLLndV4Wc4m8j/pS+vr4tGB/DT16v3Fyr8dvBe/jbit8BL0AES9LX1iPAz+BR/hFiLVCynj95dPzNy6fv3IZ/k4L3948Sq7FzYGBg4vLFGxitabuOFCbWNKGrMnbiUuo18KaV6tIHv6YtvL9/nOgE31jCktmrY7k6+/zhE4yP4Vf7hiNqh/BWWEl8mzDol4p22Lf7cIdvdUMEvv0Y2S9fE5S1hLzpqTsPkiep//gFGPnR3Yl7GL5p/xYFBrTwM+iXio3GqpwDGL5p/xYNIX7XG8Q6IJRgdIzf1KBBgafII7oMidhyQtVFaMA2Bt7il4huQRhaXphbcR2g4RXqBzKAGHiCCwGFVUAj/m/RTRDj29cvn10I0PZ3LghH5f4CL1EFlQmqqXK3jDDKFxmhQ3Yt6oQseUZGKmMnTpsOqc8o1F9kBOMjQlOLeqEeIyOc6JV6jYLJD/+XyIFvnzdgl9aXRQ5I2qZDK1SpospMqaoqON/wZZGDciLnMMiXRS7IF4hhqMTNTdk7CFu+LHLhR7BQqBvPDJUUQqCGvCMATHUgBmhWNgApmdOda9YpM+VwRYfuyyIXDK8hBlilNerLIheMZCKGwlUAyru6GlwOgPUbRxADdJ9FAChxXY864viyyEXqPxhc0M2TAfAbatSdRyHtXymhByEdRnE3ky+JnHAIhSA0h74kckETmHoQbSgGwJrCIRMEPSRIBCRIMAhZaYhaggQhJXUJEoRU9mofKwh+F22dLRRfEjlJM7w6KQwCoQpBOKTyJZETjmwRxKqtGV8SOSkNOGjKPQppBEgDDkFgpxdBVGkFgaYQQXRIFQSObk0P5ZFIpAZRHXsQ0r0hCluBWKkuvVbYCkQaCdL5ehBScudJP4yY+rLISdps1NBDEJKXMMmoSfggWC4ZQRR17oFYXph7hSiquIKQ+hJGTX1J5MYSPD/GVdNzsgLBwZVCVyAQAkF0ohiI/c1fS6tNXq9UfEnkhudmIQolsS+J3Hh/UtNDzQLhj42VKJFInqLwFYiUU5ToA+HdfI0JevUpQUAIn+vSz2lHIuUV/dJOIHhOY/IWVWGBIHQtzs88s9zyWBuTgcBLzGOmeNnfF/QslSDgMeQW85i3DOQxuipxAkCyZ8SIm4Omp+7MMlCB59j6sKZcMoM4iIEoeI2J9AKxrFobZx0v4vYInuHFS4J1GQRCAGaLEYQXfyMML5XSQgghhBBCCCH+cXp6vgNhKpSKX/XdOAAAAABJRU5ErkJggg=="; imgBack.style.position = "absolute"; imgBack.style.left = "50%"; imgBack.style.top = "50%"; imgBack.style.marginLeft = "-50px"; imgBack.style.marginTop = "-50px"; imgBack.style.transition = "transform 1.0s ease"; imgBack.style.webkitTransition = "-webkit-transform 1.0s ease"; var deg = 360; var onTransitionEnd = function () { deg += 360; imgBack.style.transform = "rotateZ(" + deg + "deg)"; imgBack.style.webkitTransform = "rotateZ(" + deg + "deg)"; }; imgBack.addEventListener("transitionend", onTransitionEnd); imgBack.addEventListener("webkitTransitionEnd", onTransitionEnd); this._loadingDiv.appendChild(imgBack); // front image var imgFront = new Image(); imgFront.src = "data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAGQAAABkCAYAAABw4pVUAAAAAXNSR0IArs4c6QAAAARnQU1BAACxjwv8YQUAAAAJcEhZcwAADsMAAA7DAcdvqGQAAAAYdEVYdFNvZnR3YXJlAHBhaW50Lm5ldCA0LjAuM4zml1AAAAYJSURBVHhe7Zy/qx1FFMff/2Av2Nvbi4WFiiAEY/OQ2IgQsbCJQoqkCAgpFLXyoZURLfwBIiIpgqZJoYQYlWelNsIrNOxDJcrzfHe+G97dnTl75u7euzv7zgcWHrlnZmfOmXPmzI/NjuM4juM4juM4juM4juM4juM4juM4juM45fPic08/uHf5/CvffH7lnT8PfrtxdHS0n3p+/fHGl5+89/prr5599iEWd8bg0rkXHoFyqehKnlxQpjYSDHTm9JMPsGrHylOPPXofvICKXMcIGtXdf/76AYbm6xyNW9e/eAtKC7rbKLXnvHHx5Sf4auc4Ek7OQkFU1Dap/vv37k/wSjblZANFiFIGzw98hhizwqBgs04mCBdQRNCHidoAEtY+lLIvtSdoGFeyql2ZH57HBH4sE7O+o/r9l+8/ZXUni68+2jsHBQQ9qNRGeP/tSxdSYQX/roUcpL4/f3vtM9TD+jTq92n1LQ7jxF1hhGPtwWL3gGccy8JuS1r8sVWBGXNVdSKMYjBGPUJjCzooiGuSpnwlnnOGP2dhHRSLNgpHp2oMKIriK8TmG4Qh/rwW8D6pps9b9im+LDDipXOqMVJrAngBfg9i98gevWKA+/nnCod3Dr5GfaHaDgidVym6HKRjGIkpqthcAVKGxNqBImbEo66kjCih8AOpNmkUmbMuUrR8kEqiU6FvHZLGAPJ71JCYSyhiBqmwFE2GoD6jLGIfDHtG6EzoU4dK21PCqIRMEF0FGRjFzGDtIkXVAdATvsqfT9CJ0JcOFdYiFIsiMlqYy1YOFpQo2OddqBtyEaq9y+efoVh5oPHoROjLKn0j3JIE5Ka8UqZRtGrMnneX6yVofOhDh94MSbznTcpqmDOt1vyQzOgaJAF4F3JBfIXesrNEGWWmjIX7UBZ6jRJbBMLg/DmJiKUGVHleIpnVNTa+jakzkAviJqLhi4MC9XQGBrZeKJZESSrKy7ik0VGFWhQBRDTHIACKQ5l9nAjy75gya4a2w+Jhs0FJdc0xX/GwUbAqFBkZi7QpJ2w16WUbjFyK9MJF3KaoEM74KhVtLrQOrsmRxkbdHEqmSC/c+EuGnIFkjW7Ih2Kr4CCMIvNG2hrrgLpCjiFloooYCjyYrzCRyvhyBthkIPuQtsZGdnbMTezyDiU71KTC5zr7aVsHbsz2tllrEkS5UHwU1tq1HbtPW4UbeB0O7xx8R5EsMJql+BheUmHjkNVmIRP7LutoM3+D4O4tG7vCkNO9ESZ4lL3J6rKRMPx4qKbD/A0icf8CG7tC7kTahnMTwleuYSrsS7GatRAvfZh1tTm5BmmQCdZ8a0Sefe28xUrRBkmFLKy8KTIKUDRX0Y1xagPgwbaIdeFnQULmKak3xvwNMkVGgok/N5XNoehJvejRlCDl9escI28dJU0tZ++nBTJE9mEF647x5Ehbo4s5hDOKFIU0PdofeA5F5k1q63zIWmQqNI/P3ZubjFTqKxQ3jyjHAOX0RdlgVO9hzRFpczRcjZ3Gbxxpc7Qj6+5pTYF2OFXawNI+yDGf1k2NcvOlzBQeDQ/t7zD7DsEDpJ2xATXaNtDWUS4IzP4DS2ljajAVu57SUkYw245ptxZxA5JiZaJ0DswudGn3kYUy54426EjoT4dZfYbccxC2nI92cDkZHQr96jD4AGkMDKeSy/COBsRe6VTSKFN6irLeaCh3IteQjt1E5+oudsG/b/2DfZ5AqsYo8vMDK9LB1HzSsLWvlGThdxXvC6+NsqyPPWP0pMINtbdsajfVeC6f/GZ+cdAofQoB1d+Hf9waY98I7+RXWab3Lt4zYkjHtTnlOLXHYMsCh1zWeQYehu1zfNPOOiys/d91LAKEBSgh6MJMbSA82AaHofDgAIwbgvVvlLNS11nModMm4UZergLHZBZrodmBuA3lBB1thdorSjkOmATMDwg/UBQVtglqQyx6fbEJ+H3IWIapjYAjAfeIgeCMHldueJvFaqDaAHhwf8qNsEEQ1iQbOoUUGIbCLRc8+Bvfp4jyd2FEijuO4ziO4ziO4ziO4ziO4ziO4ziO4ziOUzw7O/8D0P7rcZ/GEboAAAAASUVORK5CYII="; imgFront.style.position = "absolute"; imgFront.style.left = "50%"; imgFront.style.top = "50%"; imgFront.style.marginLeft = "-50px"; imgFront.style.marginTop = "-50px"; this._loadingDiv.appendChild(imgFront); // Resize this._resizeLoadingUI = function () { var canvasRect = _this.getRenderingCanvasClientRect(); _this._loadingDiv.style.position = "absolute"; _this._loadingDiv.style.left = canvasRect.left + "px"; _this._loadingDiv.style.top = canvasRect.top + "px"; _this._loadingDiv.style.width = canvasRect.width + "px"; _this._loadingDiv.style.height = canvasRect.height + "px"; }; this._resizeLoadingUI(); window.addEventListener("resize", this._resizeLoadingUI); this._loadingDiv.style.backgroundColor = this._loadingDivBackgroundColor; document.body.appendChild(this._loadingDiv); setTimeout(function () { _this._loadingDiv.style.opacity = "1"; imgBack.style.transform = "rotateZ(360deg)"; imgBack.style.webkitTransform = "rotateZ(360deg)"; }, 0); }; Object.defineProperty(Engine.prototype, "loadingUIText", { set: function (text) { if (!this._loadingDiv) { return; } this._loadingTextDiv.innerHTML = text; }, enumerable: true, configurable: true }); Object.defineProperty(Engine.prototype, "loadingUIBackgroundColor", { get: function () { return this._loadingDivBackgroundColor; }, set: function (color) { this._loadingDivBackgroundColor = color; if (!this._loadingDiv) { return; } this._loadingDiv.style.backgroundColor = this._loadingDivBackgroundColor; }, enumerable: true, configurable: true }); Engine.prototype.hideLoadingUI = function () { var _this = this; if (!this._loadingDiv) { return; } var onTransitionEnd = function () { if (!_this._loadingDiv) { return; } document.body.removeChild(_this._loadingDiv); window.removeEventListener("resize", _this._resizeLoadingUI); _this._loadingDiv = null; }; this._loadingDiv.style.opacity = "0"; this._loadingDiv.addEventListener("transitionend", onTransitionEnd); }; // FPS Engine.prototype.getFps = function () { return this.fps; }; Engine.prototype.getDeltaTime = function () { return this.deltaTime; }; Engine.prototype._measureFps = function () { this.previousFramesDuration.push(BABYLON.Tools.Now); var length = this.previousFramesDuration.length; if (length >= 2) { this.deltaTime = this.previousFramesDuration[length - 1] - this.previousFramesDuration[length - 2]; } if (length >= this.fpsRange) { if (length > this.fpsRange) { this.previousFramesDuration.splice(0, 1); length = this.previousFramesDuration.length; } var sum = 0; for (var id = 0; id < length - 1; id++) { sum += this.previousFramesDuration[id + 1] - this.previousFramesDuration[id]; } this.fps = 1000.0 / (sum / (length - 1)); } }; // Statics Engine.isSupported = function () { try { // Avoid creating an unsized context for CocoonJS, since size determined on first creation. Is not resizable if (navigator.isCocoonJS) { return true; } var tempcanvas = document.createElement("canvas"); var gl = tempcanvas.getContext("webgl") || tempcanvas.getContext("experimental-webgl"); return gl != null && !!window.WebGLRenderingContext; } catch (e) { return false; } }; Engine._ALPHA_DISABLE = 0; Engine._ALPHA_ADD = 1; Engine._ALPHA_COMBINE = 2; Engine._DELAYLOADSTATE_NONE = 0; Engine._DELAYLOADSTATE_LOADED = 1; Engine._DELAYLOADSTATE_LOADING = 2; Engine._DELAYLOADSTATE_NOTLOADED = 4; Engine._TEXTUREFORMAT_ALPHA = 0; Engine._TEXTUREFORMAT_LUMINANCE = 1; Engine._TEXTUREFORMAT_LUMINANCE_ALPHA = 2; Engine._TEXTUREFORMAT_RGB = 4; Engine._TEXTUREFORMAT_RGBA = 4; Engine.Epsilon = 0.001; Engine.CollisionsEpsilon = 0.001; Engine.ShadersRepository = "Babylon/Shaders/"; return Engine; })(); BABYLON.Engine = Engine; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.engine.js.map var BABYLON; (function (BABYLON) { var Node = (function () { function Node(name, scene) { this.state = ""; this.animations = new Array(); this._childrenFlag = -1; this._isEnabled = true; this._isReady = true; this._currentRenderId = -1; this.name = name; this.id = name; this._scene = scene; this._initCache(); } Node.prototype.getScene = function () { return this._scene; }; Node.prototype.getEngine = function () { return this._scene.getEngine(); }; // override it in derived class Node.prototype.getWorldMatrix = function () { return BABYLON.Matrix.Identity(); }; // override it in derived class if you add new variables to the cache // and call the parent class method Node.prototype._initCache = function () { this._cache = {}; this._cache.parent = undefined; }; Node.prototype.updateCache = function (force) { if (!force && this.isSynchronized()) return; this._cache.parent = this.parent; this._updateCache(); }; // override it in derived class if you add new variables to the cache // and call the parent class method if !ignoreParentClass Node.prototype._updateCache = function (ignoreParentClass) { }; // override it in derived class if you add new variables to the cache Node.prototype._isSynchronized = function () { return true; }; Node.prototype.isSynchronizedWithParent = function () { return this.parent ? this.parent._currentRenderId <= this._currentRenderId : true; }; Node.prototype.isSynchronized = function (updateCache) { var check = this.hasNewParent(); check = check || !this.isSynchronizedWithParent(); check = check || !this._isSynchronized(); if (updateCache) this.updateCache(true); return !check; }; Node.prototype.hasNewParent = function (update) { if (this._cache.parent === this.parent) return false; if (update) this._cache.parent = this.parent; return true; }; Node.prototype.isReady = function () { return this._isReady; }; Node.prototype.isEnabled = function () { if (!this._isEnabled) { return false; } if (this.parent) { return this.parent.isEnabled(); } return true; }; Node.prototype.setEnabled = function (value) { this._isEnabled = value; }; Node.prototype.isDescendantOf = function (ancestor) { if (this.parent) { if (this.parent === ancestor) { return true; } return this.parent.isDescendantOf(ancestor); } return false; }; Node.prototype._getDescendants = function (list, results) { for (var index = 0; index < list.length; index++) { var item = list[index]; if (item.isDescendantOf(this)) { results.push(item); } } }; Node.prototype.getDescendants = function () { var results = []; this._getDescendants(this._scene.meshes, results); this._getDescendants(this._scene.lights, results); this._getDescendants(this._scene.cameras, results); return results; }; Node.prototype._setReady = function (state) { if (state == this._isReady) { return; } if (!state) { this._isReady = false; return; } this._isReady = true; if (this.onReady) { this.onReady(this); } }; return Node; })(); BABYLON.Node = Node; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.node.js.map var BABYLON; (function (BABYLON) { var BoundingSphere = (function () { function BoundingSphere(minimum, maximum) { this.minimum = minimum; this.maximum = maximum; this._tempRadiusVector = BABYLON.Vector3.Zero(); var distance = BABYLON.Vector3.Distance(minimum, maximum); this.center = BABYLON.Vector3.Lerp(minimum, maximum, 0.5); this.radius = distance * 0.5; this.centerWorld = BABYLON.Vector3.Zero(); this._update(BABYLON.Matrix.Identity()); } // Methods BoundingSphere.prototype._update = function (world) { BABYLON.Vector3.TransformCoordinatesToRef(this.center, world, this.centerWorld); BABYLON.Vector3.TransformNormalFromFloatsToRef(1.0, 1.0, 1.0, world, this._tempRadiusVector); this.radiusWorld = Math.max(Math.abs(this._tempRadiusVector.x), Math.abs(this._tempRadiusVector.y), Math.abs(this._tempRadiusVector.z)) * this.radius; }; BoundingSphere.prototype.isInFrustum = function (frustumPlanes) { for (var i = 0; i < 6; i++) { if (frustumPlanes[i].dotCoordinate(this.centerWorld) <= -this.radiusWorld) return false; } return true; }; BoundingSphere.prototype.intersectsPoint = function (point) { var x = this.centerWorld.x - point.x; var y = this.centerWorld.y - point.y; var z = this.centerWorld.z - point.z; var distance = Math.sqrt((x * x) + (y * y) + (z * z)); if (Math.abs(this.radiusWorld - distance) < BABYLON.Engine.Epsilon) return false; return true; }; // Statics BoundingSphere.Intersects = function (sphere0, sphere1) { var x = sphere0.centerWorld.x - sphere1.centerWorld.x; var y = sphere0.centerWorld.y - sphere1.centerWorld.y; var z = sphere0.centerWorld.z - sphere1.centerWorld.z; var distance = Math.sqrt((x * x) + (y * y) + (z * z)); if (sphere0.radiusWorld + sphere1.radiusWorld < distance) return false; return true; }; return BoundingSphere; })(); BABYLON.BoundingSphere = BoundingSphere; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.boundingSphere.js.map var BABYLON; (function (BABYLON) { var BoundingBox = (function () { function BoundingBox(minimum, maximum) { this.minimum = minimum; this.maximum = maximum; this.vectors = new Array(); this.vectorsWorld = new Array(); // Bounding vectors this.vectors.push(this.minimum.clone()); this.vectors.push(this.maximum.clone()); this.vectors.push(this.minimum.clone()); this.vectors[2].x = this.maximum.x; this.vectors.push(this.minimum.clone()); this.vectors[3].y = this.maximum.y; this.vectors.push(this.minimum.clone()); this.vectors[4].z = this.maximum.z; this.vectors.push(this.maximum.clone()); this.vectors[5].z = this.minimum.z; this.vectors.push(this.maximum.clone()); this.vectors[6].x = this.minimum.x; this.vectors.push(this.maximum.clone()); this.vectors[7].y = this.minimum.y; // OBB this.center = this.maximum.add(this.minimum).scale(0.5); this.extendSize = this.maximum.subtract(this.minimum).scale(0.5); this.directions = [BABYLON.Vector3.Zero(), BABYLON.Vector3.Zero(), BABYLON.Vector3.Zero()]; for (var index = 0; index < this.vectors.length; index++) { this.vectorsWorld[index] = BABYLON.Vector3.Zero(); } this.minimumWorld = BABYLON.Vector3.Zero(); this.maximumWorld = BABYLON.Vector3.Zero(); this._update(BABYLON.Matrix.Identity()); } // Methods BoundingBox.prototype.getWorldMatrix = function () { return this._worldMatrix; }; BoundingBox.prototype._update = function (world) { BABYLON.Vector3.FromFloatsToRef(Number.MAX_VALUE, Number.MAX_VALUE, Number.MAX_VALUE, this.minimumWorld); BABYLON.Vector3.FromFloatsToRef(-Number.MAX_VALUE, -Number.MAX_VALUE, -Number.MAX_VALUE, this.maximumWorld); for (var index = 0; index < this.vectors.length; index++) { var v = this.vectorsWorld[index]; BABYLON.Vector3.TransformCoordinatesToRef(this.vectors[index], world, v); if (v.x < this.minimumWorld.x) this.minimumWorld.x = v.x; if (v.y < this.minimumWorld.y) this.minimumWorld.y = v.y; if (v.z < this.minimumWorld.z) this.minimumWorld.z = v.z; if (v.x > this.maximumWorld.x) this.maximumWorld.x = v.x; if (v.y > this.maximumWorld.y) this.maximumWorld.y = v.y; if (v.z > this.maximumWorld.z) this.maximumWorld.z = v.z; } // OBB this.maximumWorld.addToRef(this.minimumWorld, this.center); this.center.scaleInPlace(0.5); BABYLON.Vector3.FromFloatArrayToRef(world.m, 0, this.directions[0]); BABYLON.Vector3.FromFloatArrayToRef(world.m, 4, this.directions[1]); BABYLON.Vector3.FromFloatArrayToRef(world.m, 8, this.directions[2]); this._worldMatrix = world; }; BoundingBox.prototype.isInFrustum = function (frustumPlanes) { return BoundingBox.IsInFrustum(this.vectorsWorld, frustumPlanes); }; BoundingBox.prototype.isCompletelyInFrustum = function (frustumPlanes) { return BoundingBox.IsCompletelyInFrustum(this.vectorsWorld, frustumPlanes); }; BoundingBox.prototype.intersectsPoint = function (point) { var delta = BABYLON.Engine.Epsilon; if (this.maximumWorld.x - point.x < delta || delta > point.x - this.minimumWorld.x) return false; if (this.maximumWorld.y - point.y < delta || delta > point.y - this.minimumWorld.y) return false; if (this.maximumWorld.z - point.z < delta || delta > point.z - this.minimumWorld.z) return false; return true; }; BoundingBox.prototype.intersectsSphere = function (sphere) { return BoundingBox.IntersectsSphere(this.minimumWorld, this.maximumWorld, sphere.centerWorld, sphere.radiusWorld); }; BoundingBox.prototype.intersectsMinMax = function (min, max) { if (this.maximumWorld.x < min.x || this.minimumWorld.x > max.x) return false; if (this.maximumWorld.y < min.y || this.minimumWorld.y > max.y) return false; if (this.maximumWorld.z < min.z || this.minimumWorld.z > max.z) return false; return true; }; // Statics BoundingBox.Intersects = function (box0, box1) { if (box0.maximumWorld.x < box1.minimumWorld.x || box0.minimumWorld.x > box1.maximumWorld.x) return false; if (box0.maximumWorld.y < box1.minimumWorld.y || box0.minimumWorld.y > box1.maximumWorld.y) return false; if (box0.maximumWorld.z < box1.minimumWorld.z || box0.minimumWorld.z > box1.maximumWorld.z) return false; return true; }; BoundingBox.IntersectsSphere = function (minPoint, maxPoint, sphereCenter, sphereRadius) { var vector = BABYLON.Vector3.Clamp(sphereCenter, minPoint, maxPoint); var num = BABYLON.Vector3.DistanceSquared(sphereCenter, vector); return (num <= (sphereRadius * sphereRadius)); }; BoundingBox.IsCompletelyInFrustum = function (boundingVectors, frustumPlanes) { for (var p = 0; p < 6; p++) { for (var i = 0; i < 8; i++) { if (frustumPlanes[p].dotCoordinate(boundingVectors[i]) < 0) { return false; } } } return true; }; BoundingBox.IsInFrustum = function (boundingVectors, frustumPlanes) { for (var p = 0; p < 6; p++) { var inCount = 8; for (var i = 0; i < 8; i++) { if (frustumPlanes[p].dotCoordinate(boundingVectors[i]) < 0) { --inCount; } else { break; } } if (inCount == 0) return false; } return true; }; return BoundingBox; })(); BABYLON.BoundingBox = BoundingBox; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.boundingBox.js.map var BABYLON; (function (BABYLON) { var computeBoxExtents = function (axis, box) { var p = BABYLON.Vector3.Dot(box.center, axis); var r0 = Math.abs(BABYLON.Vector3.Dot(box.directions[0], axis)) * box.extendSize.x; var r1 = Math.abs(BABYLON.Vector3.Dot(box.directions[1], axis)) * box.extendSize.y; var r2 = Math.abs(BABYLON.Vector3.Dot(box.directions[2], axis)) * box.extendSize.z; var r = r0 + r1 + r2; return { min: p - r, max: p + r }; }; var extentsOverlap = function (min0, max0, min1, max1) { return !(min0 > max1 || min1 > max0); }; var axisOverlap = function (axis, box0, box1) { var result0 = computeBoxExtents(axis, box0); var result1 = computeBoxExtents(axis, box1); return extentsOverlap(result0.min, result0.max, result1.min, result1.max); }; var BoundingInfo = (function () { function BoundingInfo(minimum, maximum) { this.minimum = minimum; this.maximum = maximum; this.boundingBox = new BABYLON.BoundingBox(minimum, maximum); this.boundingSphere = new BABYLON.BoundingSphere(minimum, maximum); } // Methods BoundingInfo.prototype._update = function (world) { this.boundingBox._update(world); this.boundingSphere._update(world); }; BoundingInfo.prototype.isInFrustum = function (frustumPlanes) { if (!this.boundingSphere.isInFrustum(frustumPlanes)) return false; return this.boundingBox.isInFrustum(frustumPlanes); }; BoundingInfo.prototype.isCompletelyInFrustum = function (frustumPlanes) { return this.boundingBox.isCompletelyInFrustum(frustumPlanes); }; BoundingInfo.prototype._checkCollision = function (collider) { return collider._canDoCollision(this.boundingSphere.centerWorld, this.boundingSphere.radiusWorld, this.boundingBox.minimumWorld, this.boundingBox.maximumWorld); }; BoundingInfo.prototype.intersectsPoint = function (point) { if (!this.boundingSphere.centerWorld) { return false; } if (!this.boundingSphere.intersectsPoint(point)) { return false; } if (!this.boundingBox.intersectsPoint(point)) { return false; } return true; }; BoundingInfo.prototype.intersects = function (boundingInfo, precise) { if (!this.boundingSphere.centerWorld || !boundingInfo.boundingSphere.centerWorld) { return false; } if (!BABYLON.BoundingSphere.Intersects(this.boundingSphere, boundingInfo.boundingSphere)) { return false; } if (!BABYLON.BoundingBox.Intersects(this.boundingBox, boundingInfo.boundingBox)) { return false; } if (!precise) { return true; } var box0 = this.boundingBox; var box1 = boundingInfo.boundingBox; if (!axisOverlap(box0.directions[0], box0, box1)) return false; if (!axisOverlap(box0.directions[1], box0, box1)) return false; if (!axisOverlap(box0.directions[2], box0, box1)) return false; if (!axisOverlap(box1.directions[0], box0, box1)) return false; if (!axisOverlap(box1.directions[1], box0, box1)) return false; if (!axisOverlap(box1.directions[2], box0, box1)) return false; if (!axisOverlap(BABYLON.Vector3.Cross(box0.directions[0], box1.directions[0]), box0, box1)) return false; if (!axisOverlap(BABYLON.Vector3.Cross(box0.directions[0], box1.directions[1]), box0, box1)) return false; if (!axisOverlap(BABYLON.Vector3.Cross(box0.directions[0], box1.directions[2]), box0, box1)) return false; if (!axisOverlap(BABYLON.Vector3.Cross(box0.directions[1], box1.directions[0]), box0, box1)) return false; if (!axisOverlap(BABYLON.Vector3.Cross(box0.directions[1], box1.directions[1]), box0, box1)) return false; if (!axisOverlap(BABYLON.Vector3.Cross(box0.directions[1], box1.directions[2]), box0, box1)) return false; if (!axisOverlap(BABYLON.Vector3.Cross(box0.directions[2], box1.directions[0]), box0, box1)) return false; if (!axisOverlap(BABYLON.Vector3.Cross(box0.directions[2], box1.directions[1]), box0, box1)) return false; if (!axisOverlap(BABYLON.Vector3.Cross(box0.directions[2], box1.directions[2]), box0, box1)) return false; return true; }; return BoundingInfo; })(); BABYLON.BoundingInfo = BoundingInfo; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.boundingInfo.js.map var BABYLON; (function (BABYLON) { var Light = (function (_super) { __extends(Light, _super); function Light(name, scene) { _super.call(this, name, scene); this.diffuse = new BABYLON.Color3(1.0, 1.0, 1.0); this.specular = new BABYLON.Color3(1.0, 1.0, 1.0); this.intensity = 1.0; this.range = Number.MAX_VALUE; this.includedOnlyMeshes = new Array(); this.excludedMeshes = new Array(); this._excludedMeshesIds = new Array(); this._includedOnlyMeshesIds = new Array(); scene.lights.push(this); } Light.prototype.getShadowGenerator = function () { return this._shadowGenerator; }; Light.prototype.getAbsolutePosition = function () { return BABYLON.Vector3.Zero(); }; Light.prototype.transferToEffect = function (effect, uniformName0, uniformName1) { }; Light.prototype._getWorldMatrix = function () { return BABYLON.Matrix.Identity(); }; Light.prototype.canAffectMesh = function (mesh) { if (!mesh) { return true; } if (this.includedOnlyMeshes.length > 0 && this.includedOnlyMeshes.indexOf(mesh) === -1) { return false; } if (this.excludedMeshes.length > 0 && this.excludedMeshes.indexOf(mesh) !== -1) { return false; } return true; }; Light.prototype.getWorldMatrix = function () { this._currentRenderId = this.getScene().getRenderId(); var worldMatrix = this._getWorldMatrix(); if (this.parent && this.parent.getWorldMatrix) { if (!this._parentedWorldMatrix) { this._parentedWorldMatrix = BABYLON.Matrix.Identity(); } worldMatrix.multiplyToRef(this.parent.getWorldMatrix(), this._parentedWorldMatrix); return this._parentedWorldMatrix; } return worldMatrix; }; Light.prototype.dispose = function () { if (this._shadowGenerator) { this._shadowGenerator.dispose(); this._shadowGenerator = null; } // Remove from scene var index = this.getScene().lights.indexOf(this); this.getScene().lights.splice(index, 1); }; return Light; })(BABYLON.Node); BABYLON.Light = Light; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.light.js.map var BABYLON; (function (BABYLON) { var PointLight = (function (_super) { __extends(PointLight, _super); function PointLight(name, position, scene) { _super.call(this, name, scene); this.position = position; } PointLight.prototype.getAbsolutePosition = function () { return this._transformedPosition ? this._transformedPosition : this.position; }; PointLight.prototype.transferToEffect = function (effect, positionUniformName) { if (this.parent && this.parent.getWorldMatrix) { if (!this._transformedPosition) { this._transformedPosition = BABYLON.Vector3.Zero(); } BABYLON.Vector3.TransformCoordinatesToRef(this.position, this.parent.getWorldMatrix(), this._transformedPosition); effect.setFloat4(positionUniformName, this._transformedPosition.x, this._transformedPosition.y, this._transformedPosition.z, 0); return; } effect.setFloat4(positionUniformName, this.position.x, this.position.y, this.position.z, 0); }; PointLight.prototype.getShadowGenerator = function () { return null; }; PointLight.prototype._getWorldMatrix = function () { if (!this._worldMatrix) { this._worldMatrix = BABYLON.Matrix.Identity(); } BABYLON.Matrix.TranslationToRef(this.position.x, this.position.y, this.position.z, this._worldMatrix); return this._worldMatrix; }; return PointLight; })(BABYLON.Light); BABYLON.PointLight = PointLight; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.pointLight.js.map var BABYLON; (function (BABYLON) { var SpotLight = (function (_super) { __extends(SpotLight, _super); function SpotLight(name, position, direction, angle, exponent, scene) { _super.call(this, name, scene); this.position = position; this.direction = direction; this.angle = angle; this.exponent = exponent; } SpotLight.prototype.getAbsolutePosition = function () { return this.transformedPosition ? this.transformedPosition : this.position; }; SpotLight.prototype.setDirectionToTarget = function (target) { this.direction = BABYLON.Vector3.Normalize(target.subtract(this.position)); return this.direction; }; SpotLight.prototype.computeTransformedPosition = function () { if (this.parent && this.parent.getWorldMatrix) { if (!this.transformedPosition) { this.transformedPosition = BABYLON.Vector3.Zero(); } BABYLON.Vector3.TransformCoordinatesToRef(this.position, this.parent.getWorldMatrix(), this.transformedPosition); return true; } return false; }; SpotLight.prototype.transferToEffect = function (effect, positionUniformName, directionUniformName) { var normalizeDirection; if (this.parent && this.parent.getWorldMatrix) { if (!this._transformedDirection) { this._transformedDirection = BABYLON.Vector3.Zero(); } this.computeTransformedPosition(); BABYLON.Vector3.TransformNormalToRef(this.direction, this.parent.getWorldMatrix(), this._transformedDirection); effect.setFloat4(positionUniformName, this.transformedPosition.x, this.transformedPosition.y, this.transformedPosition.z, this.exponent); normalizeDirection = BABYLON.Vector3.Normalize(this._transformedDirection); } else { effect.setFloat4(positionUniformName, this.position.x, this.position.y, this.position.z, this.exponent); normalizeDirection = BABYLON.Vector3.Normalize(this.direction); } effect.setFloat4(directionUniformName, normalizeDirection.x, normalizeDirection.y, normalizeDirection.z, Math.cos(this.angle * 0.5)); }; SpotLight.prototype._getWorldMatrix = function () { if (!this._worldMatrix) { this._worldMatrix = BABYLON.Matrix.Identity(); } BABYLON.Matrix.TranslationToRef(this.position.x, this.position.y, this.position.z, this._worldMatrix); return this._worldMatrix; }; return SpotLight; })(BABYLON.Light); BABYLON.SpotLight = SpotLight; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.spotLight.js.map var BABYLON; (function (BABYLON) { var DirectionalLight = (function (_super) { __extends(DirectionalLight, _super); function DirectionalLight(name, direction, scene) { _super.call(this, name, scene); this.direction = direction; this.position = direction.scale(-1); } DirectionalLight.prototype.getAbsolutePosition = function () { return this.transformedPosition ? this.transformedPosition : this.position; }; DirectionalLight.prototype.setDirectionToTarget = function (target) { this.direction = BABYLON.Vector3.Normalize(target.subtract(this.position)); return this.direction; }; DirectionalLight.prototype.computeTransformedPosition = function () { if (this.parent && this.parent.getWorldMatrix) { if (!this.transformedPosition) { this.transformedPosition = BABYLON.Vector3.Zero(); } BABYLON.Vector3.TransformCoordinatesToRef(this.position, this.parent.getWorldMatrix(), this.transformedPosition); return true; } return false; }; DirectionalLight.prototype.transferToEffect = function (effect, directionUniformName) { if (this.parent && this.parent.getWorldMatrix) { if (!this._transformedDirection) { this._transformedDirection = BABYLON.Vector3.Zero(); } BABYLON.Vector3.TransformNormalToRef(this.direction, this.parent.getWorldMatrix(), this._transformedDirection); effect.setFloat4(directionUniformName, this._transformedDirection.x, this._transformedDirection.y, this._transformedDirection.z, 1); return; } effect.setFloat4(directionUniformName, this.direction.x, this.direction.y, this.direction.z, 1); }; DirectionalLight.prototype._getWorldMatrix = function () { if (!this._worldMatrix) { this._worldMatrix = BABYLON.Matrix.Identity(); } BABYLON.Matrix.TranslationToRef(this.position.x, this.position.y, this.position.z, this._worldMatrix); return this._worldMatrix; }; return DirectionalLight; })(BABYLON.Light); BABYLON.DirectionalLight = DirectionalLight; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.directionalLight.js.map var BABYLON; (function (BABYLON) { var ShadowGenerator = (function () { function ShadowGenerator(mapSize, light) { var _this = this; // Members this.filter = ShadowGenerator.FILTER_VARIANCESHADOWMAP; this._darkness = 0; this._transparencyShadow = false; this._viewMatrix = BABYLON.Matrix.Zero(); this._projectionMatrix = BABYLON.Matrix.Zero(); this._transformMatrix = BABYLON.Matrix.Zero(); this._worldViewProjection = BABYLON.Matrix.Zero(); this._light = light; this._scene = light.getScene(); light._shadowGenerator = this; // Render target this._shadowMap = new BABYLON.RenderTargetTexture(light.name + "_shadowMap", mapSize, this._scene, false); this._shadowMap.wrapU = BABYLON.Texture.CLAMP_ADDRESSMODE; this._shadowMap.wrapV = BABYLON.Texture.CLAMP_ADDRESSMODE; this._shadowMap.renderParticles = false; // Custom render function var renderSubMesh = function (subMesh) { var mesh = subMesh.getRenderingMesh(); var scene = _this._scene; var engine = scene.getEngine(); // Culling engine.setState(subMesh.getMaterial().backFaceCulling); // Managing instances var batch = mesh._getInstancesRenderList(subMesh._id); if (batch.mustReturn) { return; } var hardwareInstancedRendering = (engine.getCaps().instancedArrays !== null) && (batch.visibleInstances[subMesh._id] !== null); if (_this.isReady(subMesh, hardwareInstancedRendering)) { engine.enableEffect(_this._effect); mesh._bind(subMesh, _this._effect, BABYLON.Material.TriangleFillMode); var material = subMesh.getMaterial(); _this._effect.setMatrix("viewProjection", _this.getTransformMatrix()); // Alpha test if (material && material.needAlphaTesting()) { var alphaTexture = material.getAlphaTestTexture(); _this._effect.setTexture("diffuseSampler", alphaTexture); _this._effect.setMatrix("diffuseMatrix", alphaTexture.getTextureMatrix()); } // Bones var useBones = mesh.skeleton && scene.skeletonsEnabled && mesh.isVerticesDataPresent(BABYLON.VertexBuffer.MatricesIndicesKind) && mesh.isVerticesDataPresent(BABYLON.VertexBuffer.MatricesWeightsKind); if (useBones) { _this._effect.setMatrices("mBones", mesh.skeleton.getTransformMatrices()); } if (hardwareInstancedRendering) { mesh._renderWithInstances(subMesh, BABYLON.Material.TriangleFillMode, batch, _this._effect, engine); } else { if (batch.renderSelf[subMesh._id]) { _this._effect.setMatrix("world", mesh.getWorldMatrix()); // Draw mesh._draw(subMesh, BABYLON.Material.TriangleFillMode); } if (batch.visibleInstances[subMesh._id]) { for (var instanceIndex = 0; instanceIndex < batch.visibleInstances[subMesh._id].length; instanceIndex++) { var instance = batch.visibleInstances[subMesh._id][instanceIndex]; _this._effect.setMatrix("world", instance.getWorldMatrix()); // Draw mesh._draw(subMesh, BABYLON.Material.TriangleFillMode); } } } } else { // Need to reset refresh rate of the shadowMap _this._shadowMap.resetRefreshCounter(); } }; this._shadowMap.customRenderFunction = function (opaqueSubMeshes, alphaTestSubMeshes, transparentSubMeshes) { var index; for (index = 0; index < opaqueSubMeshes.length; index++) { renderSubMesh(opaqueSubMeshes.data[index]); } for (index = 0; index < alphaTestSubMeshes.length; index++) { renderSubMesh(alphaTestSubMeshes.data[index]); } if (_this._transparencyShadow) { for (index = 0; index < transparentSubMeshes.length; index++) { renderSubMesh(transparentSubMeshes.data[index]); } } }; } Object.defineProperty(ShadowGenerator, "FILTER_NONE", { // Static get: function () { return ShadowGenerator._FILTER_NONE; }, enumerable: true, configurable: true }); Object.defineProperty(ShadowGenerator, "FILTER_VARIANCESHADOWMAP", { get: function () { return ShadowGenerator._FILTER_VARIANCESHADOWMAP; }, enumerable: true, configurable: true }); Object.defineProperty(ShadowGenerator, "FILTER_POISSONSAMPLING", { get: function () { return ShadowGenerator._FILTER_POISSONSAMPLING; }, enumerable: true, configurable: true }); Object.defineProperty(ShadowGenerator.prototype, "useVarianceShadowMap", { get: function () { return this.filter === ShadowGenerator.FILTER_VARIANCESHADOWMAP; }, set: function (value) { this.filter = (value ? ShadowGenerator.FILTER_VARIANCESHADOWMAP : ShadowGenerator.FILTER_NONE); }, enumerable: true, configurable: true }); Object.defineProperty(ShadowGenerator.prototype, "usePoissonSampling", { get: function () { return this.filter === ShadowGenerator.FILTER_POISSONSAMPLING; }, set: function (value) { this.filter = (value ? ShadowGenerator.FILTER_POISSONSAMPLING : ShadowGenerator.FILTER_NONE); }, enumerable: true, configurable: true }); ShadowGenerator.prototype.isReady = function (subMesh, useInstances) { var defines = []; if (this.useVarianceShadowMap) { defines.push("#define VSM"); } var attribs = [BABYLON.VertexBuffer.PositionKind]; var mesh = subMesh.getMesh(); var scene = mesh.getScene(); var material = subMesh.getMaterial(); // Alpha test if (material && material.needAlphaTesting()) { defines.push("#define ALPHATEST"); if (mesh.isVerticesDataPresent(BABYLON.VertexBuffer.UVKind)) { attribs.push(BABYLON.VertexBuffer.UVKind); defines.push("#define UV1"); } if (mesh.isVerticesDataPresent(BABYLON.VertexBuffer.UV2Kind)) { attribs.push(BABYLON.VertexBuffer.UV2Kind); defines.push("#define UV2"); } } // Bones if (mesh.skeleton && scene.skeletonsEnabled && mesh.isVerticesDataPresent(BABYLON.VertexBuffer.MatricesIndicesKind) && mesh.isVerticesDataPresent(BABYLON.VertexBuffer.MatricesWeightsKind)) { attribs.push(BABYLON.VertexBuffer.MatricesIndicesKind); attribs.push(BABYLON.VertexBuffer.MatricesWeightsKind); defines.push("#define BONES"); defines.push("#define BonesPerMesh " + (mesh.skeleton.bones.length + 1)); } // Instances if (useInstances) { defines.push("#define INSTANCES"); attribs.push("world0"); attribs.push("world1"); attribs.push("world2"); attribs.push("world3"); } // Get correct effect var join = defines.join("\n"); if (this._cachedDefines !== join) { this._cachedDefines = join; this._effect = this._scene.getEngine().createEffect("shadowMap", attribs, ["world", "mBones", "viewProjection", "diffuseMatrix"], ["diffuseSampler"], join); } return this._effect.isReady(); }; ShadowGenerator.prototype.getShadowMap = function () { return this._shadowMap; }; ShadowGenerator.prototype.getLight = function () { return this._light; }; // Methods ShadowGenerator.prototype.getTransformMatrix = function () { var lightPosition = this._light.position; var lightDirection = this._light.direction; if (this._light.computeTransformedPosition()) { lightPosition = this._light.transformedPosition; } if (!this._cachedPosition || !this._cachedDirection || !lightPosition.equals(this._cachedPosition) || !lightDirection.equals(this._cachedDirection)) { this._cachedPosition = lightPosition.clone(); this._cachedDirection = lightDirection.clone(); var activeCamera = this._scene.activeCamera; BABYLON.Matrix.LookAtLHToRef(lightPosition, this._light.position.add(lightDirection), BABYLON.Vector3.Up(), this._viewMatrix); BABYLON.Matrix.PerspectiveFovLHToRef(Math.PI / 2.0, 1.0, activeCamera.minZ, activeCamera.maxZ, this._projectionMatrix); this._viewMatrix.multiplyToRef(this._projectionMatrix, this._transformMatrix); } return this._transformMatrix; }; ShadowGenerator.prototype.getDarkness = function () { return this._darkness; }; ShadowGenerator.prototype.setDarkness = function (darkness) { if (darkness >= 1.0) this._darkness = 1.0; else if (darkness <= 0.0) this._darkness = 0.0; else this._darkness = darkness; }; ShadowGenerator.prototype.setTransparencyShadow = function (hasShadow) { this._transparencyShadow = hasShadow; }; ShadowGenerator.prototype.dispose = function () { this._shadowMap.dispose(); }; ShadowGenerator._FILTER_NONE = 0; ShadowGenerator._FILTER_VARIANCESHADOWMAP = 1; ShadowGenerator._FILTER_POISSONSAMPLING = 2; return ShadowGenerator; })(); BABYLON.ShadowGenerator = ShadowGenerator; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.shadowGenerator.js.map var BABYLON; (function (BABYLON) { var HemisphericLight = (function (_super) { __extends(HemisphericLight, _super); function HemisphericLight(name, direction, scene) { _super.call(this, name, scene); this.direction = direction; this.groundColor = new BABYLON.Color3(0.0, 0.0, 0.0); } HemisphericLight.prototype.setDirectionToTarget = function (target) { this.direction = BABYLON.Vector3.Normalize(target.subtract(BABYLON.Vector3.Zero())); return this.direction; }; HemisphericLight.prototype.getShadowGenerator = function () { return null; }; HemisphericLight.prototype.transferToEffect = function (effect, directionUniformName, groundColorUniformName) { var normalizeDirection = BABYLON.Vector3.Normalize(this.direction); effect.setFloat4(directionUniformName, normalizeDirection.x, normalizeDirection.y, normalizeDirection.z, 0); effect.setColor3(groundColorUniformName, this.groundColor.scale(this.intensity)); }; HemisphericLight.prototype._getWorldMatrix = function () { if (!this._worldMatrix) { this._worldMatrix = BABYLON.Matrix.Identity(); } return this._worldMatrix; }; return HemisphericLight; })(BABYLON.Light); BABYLON.HemisphericLight = HemisphericLight; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.hemisphericLight.js.map var BABYLON; (function (BABYLON) { var intersectBoxAASphere = function (boxMin, boxMax, sphereCenter, sphereRadius) { if (boxMin.x > sphereCenter.x + sphereRadius) return false; if (sphereCenter.x - sphereRadius > boxMax.x) return false; if (boxMin.y > sphereCenter.y + sphereRadius) return false; if (sphereCenter.y - sphereRadius > boxMax.y) return false; if (boxMin.z > sphereCenter.z + sphereRadius) return false; if (sphereCenter.z - sphereRadius > boxMax.z) return false; return true; }; var getLowestRoot = function (a, b, c, maxR) { var determinant = b * b - 4.0 * a * c; var result = { root: 0, found: false }; if (determinant < 0) return result; var sqrtD = Math.sqrt(determinant); var r1 = (-b - sqrtD) / (2.0 * a); var r2 = (-b + sqrtD) / (2.0 * a); if (r1 > r2) { var temp = r2; r2 = r1; r1 = temp; } if (r1 > 0 && r1 < maxR) { result.root = r1; result.found = true; return result; } if (r2 > 0 && r2 < maxR) { result.root = r2; result.found = true; return result; } return result; }; var Collider = (function () { function Collider() { this.radius = new BABYLON.Vector3(1, 1, 1); this.retry = 0; this.basePointWorld = BABYLON.Vector3.Zero(); this.velocityWorld = BABYLON.Vector3.Zero(); this.normalizedVelocity = BABYLON.Vector3.Zero(); this._collisionPoint = BABYLON.Vector3.Zero(); this._planeIntersectionPoint = BABYLON.Vector3.Zero(); this._tempVector = BABYLON.Vector3.Zero(); this._tempVector2 = BABYLON.Vector3.Zero(); this._tempVector3 = BABYLON.Vector3.Zero(); this._tempVector4 = BABYLON.Vector3.Zero(); this._edge = BABYLON.Vector3.Zero(); this._baseToVertex = BABYLON.Vector3.Zero(); this._destinationPoint = BABYLON.Vector3.Zero(); this._slidePlaneNormal = BABYLON.Vector3.Zero(); this._displacementVector = BABYLON.Vector3.Zero(); } // Methods Collider.prototype._initialize = function (source, dir, e) { this.velocity = dir; BABYLON.Vector3.NormalizeToRef(dir, this.normalizedVelocity); this.basePoint = source; source.multiplyToRef(this.radius, this.basePointWorld); dir.multiplyToRef(this.radius, this.velocityWorld); this.velocityWorldLength = this.velocityWorld.length(); this.epsilon = e; this.collisionFound = false; }; Collider.prototype._checkPointInTriangle = function (point, pa, pb, pc, n) { pa.subtractToRef(point, this._tempVector); pb.subtractToRef(point, this._tempVector2); BABYLON.Vector3.CrossToRef(this._tempVector, this._tempVector2, this._tempVector4); var d = BABYLON.Vector3.Dot(this._tempVector4, n); if (d < 0) return false; pc.subtractToRef(point, this._tempVector3); BABYLON.Vector3.CrossToRef(this._tempVector2, this._tempVector3, this._tempVector4); d = BABYLON.Vector3.Dot(this._tempVector4, n); if (d < 0) return false; BABYLON.Vector3.CrossToRef(this._tempVector3, this._tempVector, this._tempVector4); d = BABYLON.Vector3.Dot(this._tempVector4, n); return d >= 0; }; Collider.prototype._canDoCollision = function (sphereCenter, sphereRadius, vecMin, vecMax) { var distance = BABYLON.Vector3.Distance(this.basePointWorld, sphereCenter); var max = Math.max(this.radius.x, this.radius.y, this.radius.z); if (distance > this.velocityWorldLength + max + sphereRadius) { return false; } if (!intersectBoxAASphere(vecMin, vecMax, this.basePointWorld, this.velocityWorldLength + max)) return false; return true; }; Collider.prototype._testTriangle = function (faceIndex, subMesh, p1, p2, p3) { var t0; var embeddedInPlane = false; if (!subMesh._trianglePlanes) { subMesh._trianglePlanes = []; } if (!subMesh._trianglePlanes[faceIndex]) { subMesh._trianglePlanes[faceIndex] = new BABYLON.Plane(0, 0, 0, 0); subMesh._trianglePlanes[faceIndex].copyFromPoints(p1, p2, p3); } var trianglePlane = subMesh._trianglePlanes[faceIndex]; if ((!subMesh.getMaterial()) && !trianglePlane.isFrontFacingTo(this.normalizedVelocity, 0)) return; var signedDistToTrianglePlane = trianglePlane.signedDistanceTo(this.basePoint); var normalDotVelocity = BABYLON.Vector3.Dot(trianglePlane.normal, this.velocity); if (normalDotVelocity == 0) { if (Math.abs(signedDistToTrianglePlane) >= 1.0) return; embeddedInPlane = true; t0 = 0; } else { t0 = (-1.0 - signedDistToTrianglePlane) / normalDotVelocity; var t1 = (1.0 - signedDistToTrianglePlane) / normalDotVelocity; if (t0 > t1) { var temp = t1; t1 = t0; t0 = temp; } if (t0 > 1.0 || t1 < 0.0) return; if (t0 < 0) t0 = 0; if (t0 > 1.0) t0 = 1.0; } this._collisionPoint.copyFromFloats(0, 0, 0); var found = false; var t = 1.0; if (!embeddedInPlane) { this.basePoint.subtractToRef(trianglePlane.normal, this._planeIntersectionPoint); this.velocity.scaleToRef(t0, this._tempVector); this._planeIntersectionPoint.addInPlace(this._tempVector); if (this._checkPointInTriangle(this._planeIntersectionPoint, p1, p2, p3, trianglePlane.normal)) { found = true; t = t0; this._collisionPoint.copyFrom(this._planeIntersectionPoint); } } if (!found) { var velocitySquaredLength = this.velocity.lengthSquared(); var a = velocitySquaredLength; this.basePoint.subtractToRef(p1, this._tempVector); var b = 2.0 * (BABYLON.Vector3.Dot(this.velocity, this._tempVector)); var c = this._tempVector.lengthSquared() - 1.0; var lowestRoot = getLowestRoot(a, b, c, t); if (lowestRoot.found) { t = lowestRoot.root; found = true; this._collisionPoint.copyFrom(p1); } this.basePoint.subtractToRef(p2, this._tempVector); b = 2.0 * (BABYLON.Vector3.Dot(this.velocity, this._tempVector)); c = this._tempVector.lengthSquared() - 1.0; lowestRoot = getLowestRoot(a, b, c, t); if (lowestRoot.found) { t = lowestRoot.root; found = true; this._collisionPoint.copyFrom(p2); } this.basePoint.subtractToRef(p3, this._tempVector); b = 2.0 * (BABYLON.Vector3.Dot(this.velocity, this._tempVector)); c = this._tempVector.lengthSquared() - 1.0; lowestRoot = getLowestRoot(a, b, c, t); if (lowestRoot.found) { t = lowestRoot.root; found = true; this._collisionPoint.copyFrom(p3); } p2.subtractToRef(p1, this._edge); p1.subtractToRef(this.basePoint, this._baseToVertex); var edgeSquaredLength = this._edge.lengthSquared(); var edgeDotVelocity = BABYLON.Vector3.Dot(this._edge, this.velocity); var edgeDotBaseToVertex = BABYLON.Vector3.Dot(this._edge, this._baseToVertex); a = edgeSquaredLength * (-velocitySquaredLength) + edgeDotVelocity * edgeDotVelocity; b = edgeSquaredLength * (2.0 * BABYLON.Vector3.Dot(this.velocity, this._baseToVertex)) - 2.0 * edgeDotVelocity * edgeDotBaseToVertex; c = edgeSquaredLength * (1.0 - this._baseToVertex.lengthSquared()) + edgeDotBaseToVertex * edgeDotBaseToVertex; lowestRoot = getLowestRoot(a, b, c, t); if (lowestRoot.found) { var f = (edgeDotVelocity * lowestRoot.root - edgeDotBaseToVertex) / edgeSquaredLength; if (f >= 0.0 && f <= 1.0) { t = lowestRoot.root; found = true; this._edge.scaleInPlace(f); p1.addToRef(this._edge, this._collisionPoint); } } p3.subtractToRef(p2, this._edge); p2.subtractToRef(this.basePoint, this._baseToVertex); edgeSquaredLength = this._edge.lengthSquared(); edgeDotVelocity = BABYLON.Vector3.Dot(this._edge, this.velocity); edgeDotBaseToVertex = BABYLON.Vector3.Dot(this._edge, this._baseToVertex); a = edgeSquaredLength * (-velocitySquaredLength) + edgeDotVelocity * edgeDotVelocity; b = edgeSquaredLength * (2.0 * BABYLON.Vector3.Dot(this.velocity, this._baseToVertex)) - 2.0 * edgeDotVelocity * edgeDotBaseToVertex; c = edgeSquaredLength * (1.0 - this._baseToVertex.lengthSquared()) + edgeDotBaseToVertex * edgeDotBaseToVertex; lowestRoot = getLowestRoot(a, b, c, t); if (lowestRoot.found) { f = (edgeDotVelocity * lowestRoot.root - edgeDotBaseToVertex) / edgeSquaredLength; if (f >= 0.0 && f <= 1.0) { t = lowestRoot.root; found = true; this._edge.scaleInPlace(f); p2.addToRef(this._edge, this._collisionPoint); } } p1.subtractToRef(p3, this._edge); p3.subtractToRef(this.basePoint, this._baseToVertex); edgeSquaredLength = this._edge.lengthSquared(); edgeDotVelocity = BABYLON.Vector3.Dot(this._edge, this.velocity); edgeDotBaseToVertex = BABYLON.Vector3.Dot(this._edge, this._baseToVertex); a = edgeSquaredLength * (-velocitySquaredLength) + edgeDotVelocity * edgeDotVelocity; b = edgeSquaredLength * (2.0 * BABYLON.Vector3.Dot(this.velocity, this._baseToVertex)) - 2.0 * edgeDotVelocity * edgeDotBaseToVertex; c = edgeSquaredLength * (1.0 - this._baseToVertex.lengthSquared()) + edgeDotBaseToVertex * edgeDotBaseToVertex; lowestRoot = getLowestRoot(a, b, c, t); if (lowestRoot.found) { f = (edgeDotVelocity * lowestRoot.root - edgeDotBaseToVertex) / edgeSquaredLength; if (f >= 0.0 && f <= 1.0) { t = lowestRoot.root; found = true; this._edge.scaleInPlace(f); p3.addToRef(this._edge, this._collisionPoint); } } } if (found) { var distToCollision = t * this.velocity.length(); if (!this.collisionFound || distToCollision < this.nearestDistance) { if (!this.intersectionPoint) { this.intersectionPoint = this._collisionPoint.clone(); } else { this.intersectionPoint.copyFrom(this._collisionPoint); } this.nearestDistance = distToCollision; this.collisionFound = true; this.collidedMesh = subMesh.getMesh(); } } }; Collider.prototype._collide = function (subMesh, pts, indices, indexStart, indexEnd, decal) { for (var i = indexStart; i < indexEnd; i += 3) { var p1 = pts[indices[i] - decal]; var p2 = pts[indices[i + 1] - decal]; var p3 = pts[indices[i + 2] - decal]; this._testTriangle(i, subMesh, p3, p2, p1); } }; Collider.prototype._getResponse = function (pos, vel) { pos.addToRef(vel, this._destinationPoint); vel.scaleInPlace((this.nearestDistance / vel.length())); this.basePoint.addToRef(vel, pos); pos.subtractToRef(this.intersectionPoint, this._slidePlaneNormal); this._slidePlaneNormal.normalize(); this._slidePlaneNormal.scaleToRef(this.epsilon, this._displacementVector); pos.addInPlace(this._displacementVector); this.intersectionPoint.addInPlace(this._displacementVector); this._slidePlaneNormal.scaleInPlace(BABYLON.Plane.SignedDistanceToPlaneFromPositionAndNormal(this.intersectionPoint, this._slidePlaneNormal, this._destinationPoint)); this._destinationPoint.subtractInPlace(this._slidePlaneNormal); this._destinationPoint.subtractToRef(this.intersectionPoint, vel); }; return Collider; })(); BABYLON.Collider = Collider; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.collider.js.map var BABYLON; (function (BABYLON) { var Camera = (function (_super) { __extends(Camera, _super); function Camera(name, position, scene) { _super.call(this, name, scene); this.position = position; // Members this.upVector = BABYLON.Vector3.Up(); this.orthoLeft = null; this.orthoRight = null; this.orthoBottom = null; this.orthoTop = null; this.fov = 0.8; this.minZ = 1.0; this.maxZ = 10000.0; this.inertia = 0.9; this.mode = Camera.PERSPECTIVE_CAMERA; this.isIntermediate = false; this.viewport = new BABYLON.Viewport(0, 0, 1.0, 1.0); this.subCameras = []; this.layerMask = 0xFFFFFFFF; this._computedViewMatrix = BABYLON.Matrix.Identity(); this._projectionMatrix = new BABYLON.Matrix(); this._postProcesses = new Array(); this._postProcessesTakenIndices = []; scene.cameras.push(this); if (!scene.activeCamera) { scene.activeCamera = this; } } //Cache Camera.prototype._initCache = function () { _super.prototype._initCache.call(this); this._cache.position = new BABYLON.Vector3(Number.MAX_VALUE, Number.MAX_VALUE, Number.MAX_VALUE); this._cache.upVector = new BABYLON.Vector3(Number.MAX_VALUE, Number.MAX_VALUE, Number.MAX_VALUE); this._cache.mode = undefined; this._cache.minZ = undefined; this._cache.maxZ = undefined; this._cache.fov = undefined; this._cache.aspectRatio = undefined; this._cache.orthoLeft = undefined; this._cache.orthoRight = undefined; this._cache.orthoBottom = undefined; this._cache.orthoTop = undefined; this._cache.renderWidth = undefined; this._cache.renderHeight = undefined; }; Camera.prototype._updateCache = function (ignoreParentClass) { if (!ignoreParentClass) { _super.prototype._updateCache.call(this); } var engine = this.getEngine(); this._cache.position.copyFrom(this.position); this._cache.upVector.copyFrom(this.upVector); this._cache.mode = this.mode; this._cache.minZ = this.minZ; this._cache.maxZ = this.maxZ; this._cache.fov = this.fov; this._cache.aspectRatio = engine.getAspectRatio(this); this._cache.orthoLeft = this.orthoLeft; this._cache.orthoRight = this.orthoRight; this._cache.orthoBottom = this.orthoBottom; this._cache.orthoTop = this.orthoTop; this._cache.renderWidth = engine.getRenderWidth(); this._cache.renderHeight = engine.getRenderHeight(); }; Camera.prototype._updateFromScene = function () { this.updateCache(); this._update(); }; // Synchronized Camera.prototype._isSynchronized = function () { return this._isSynchronizedViewMatrix() && this._isSynchronizedProjectionMatrix(); }; Camera.prototype._isSynchronizedViewMatrix = function () { if (!_super.prototype._isSynchronized.call(this)) return false; return this._cache.position.equals(this.position) && this._cache.upVector.equals(this.upVector) && this.isSynchronizedWithParent(); }; Camera.prototype._isSynchronizedProjectionMatrix = function () { var check = this._cache.mode === this.mode && this._cache.minZ === this.minZ && this._cache.maxZ === this.maxZ; if (!check) { return false; } var engine = this.getEngine(); if (this.mode === BABYLON.Camera.PERSPECTIVE_CAMERA) { check = this._cache.fov === this.fov && this._cache.aspectRatio === engine.getAspectRatio(this); } else { check = this._cache.orthoLeft === this.orthoLeft && this._cache.orthoRight === this.orthoRight && this._cache.orthoBottom === this.orthoBottom && this._cache.orthoTop === this.orthoTop && this._cache.renderWidth === engine.getRenderWidth() && this._cache.renderHeight === engine.getRenderHeight(); } return check; }; // Controls Camera.prototype.attachControl = function (element) { }; Camera.prototype.detachControl = function (element) { }; Camera.prototype._update = function () { }; Camera.prototype.attachPostProcess = function (postProcess, insertAt) { if (typeof insertAt === "undefined") { insertAt = null; } if (!postProcess.isReusable() && this._postProcesses.indexOf(postProcess) > -1) { BABYLON.Tools.Error("You're trying to reuse a post process not defined as reusable."); return 0; } if (insertAt == null || insertAt < 0) { this._postProcesses.push(postProcess); this._postProcessesTakenIndices.push(this._postProcesses.length - 1); return this._postProcesses.length - 1; } var add = 0; if (this._postProcesses[insertAt]) { var start = this._postProcesses.length - 1; for (var i = start; i >= insertAt + 1; --i) { this._postProcesses[i + 1] = this._postProcesses[i]; } add = 1; } for (i = 0; i < this._postProcessesTakenIndices.length; ++i) { if (this._postProcessesTakenIndices[i] < insertAt) { continue; } start = this._postProcessesTakenIndices.length - 1; for (var j = start; j >= i; --j) { this._postProcessesTakenIndices[j + 1] = this._postProcessesTakenIndices[j] + add; } this._postProcessesTakenIndices[i] = insertAt; break; } if (!add && this._postProcessesTakenIndices.indexOf(insertAt) == -1) { this._postProcessesTakenIndices.push(insertAt); } var result = insertAt + add; this._postProcesses[result] = postProcess; return result; }; Camera.prototype.detachPostProcess = function (postProcess, atIndices) { if (typeof atIndices === "undefined") { atIndices = null; } var result = []; if (!atIndices) { var length = this._postProcesses.length; for (var i = 0; i < length; i++) { if (this._postProcesses[i] !== postProcess) { continue; } delete this._postProcesses[i]; var index = this._postProcessesTakenIndices.indexOf(i); this._postProcessesTakenIndices.splice(index, 1); } } else { atIndices = (atIndices instanceof Array) ? atIndices : [atIndices]; for (i = 0; i < atIndices.length; i++) { var foundPostProcess = this._postProcesses[atIndices[i]]; if (foundPostProcess !== postProcess) { result.push(i); continue; } delete this._postProcesses[atIndices[i]]; index = this._postProcessesTakenIndices.indexOf(atIndices[i]); this._postProcessesTakenIndices.splice(index, 1); } } return result; }; Camera.prototype.getWorldMatrix = function () { if (!this._worldMatrix) { this._worldMatrix = BABYLON.Matrix.Identity(); } var viewMatrix = this.getViewMatrix(); viewMatrix.invertToRef(this._worldMatrix); return this._worldMatrix; }; Camera.prototype._getViewMatrix = function () { return BABYLON.Matrix.Identity(); }; Camera.prototype.getViewMatrix = function () { this._computedViewMatrix = this._computeViewMatrix(); if (!this.parent || !this.parent.getWorldMatrix || this.isSynchronized()) { return this._computedViewMatrix; } if (!this._worldMatrix) { this._worldMatrix = BABYLON.Matrix.Identity(); } this._computedViewMatrix.invertToRef(this._worldMatrix); this._worldMatrix.multiplyToRef(this.parent.getWorldMatrix(), this._computedViewMatrix); this._computedViewMatrix.invert(); this._currentRenderId = this.getScene().getRenderId(); return this._computedViewMatrix; }; Camera.prototype._computeViewMatrix = function (force) { if (!force && this._isSynchronizedViewMatrix()) { return this._computedViewMatrix; } this._computedViewMatrix = this._getViewMatrix(); if (!this.parent || !this.parent.getWorldMatrix) { this._currentRenderId = this.getScene().getRenderId(); } return this._computedViewMatrix; }; Camera.prototype.getProjectionMatrix = function (force) { if (!force && this._isSynchronizedProjectionMatrix()) { return this._projectionMatrix; } var engine = this.getEngine(); if (this.mode === BABYLON.Camera.PERSPECTIVE_CAMERA) { if (this.minZ <= 0) { this.minZ = 0.1; } BABYLON.Matrix.PerspectiveFovLHToRef(this.fov, engine.getAspectRatio(this), this.minZ, this.maxZ, this._projectionMatrix); return this._projectionMatrix; } var halfWidth = engine.getRenderWidth() / 2.0; var halfHeight = engine.getRenderHeight() / 2.0; BABYLON.Matrix.OrthoOffCenterLHToRef(this.orthoLeft || -halfWidth, this.orthoRight || halfWidth, this.orthoBottom || -halfHeight, this.orthoTop || halfHeight, this.minZ, this.maxZ, this._projectionMatrix); return this._projectionMatrix; }; Camera.prototype.dispose = function () { // Remove from scene var index = this.getScene().cameras.indexOf(this); this.getScene().cameras.splice(index, 1); for (var i = 0; i < this._postProcessesTakenIndices.length; ++i) { this._postProcesses[this._postProcessesTakenIndices[i]].dispose(this); } }; Camera.PERSPECTIVE_CAMERA = 0; Camera.ORTHOGRAPHIC_CAMERA = 1; return Camera; })(BABYLON.Node); BABYLON.Camera = Camera; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.camera.js.map var BABYLON; (function (BABYLON) { var TargetCamera = (function (_super) { __extends(TargetCamera, _super); function TargetCamera(name, position, scene) { _super.call(this, name, position, scene); this.cameraDirection = new BABYLON.Vector3(0, 0, 0); this.cameraRotation = new BABYLON.Vector2(0, 0); this.rotation = new BABYLON.Vector3(0, 0, 0); this.speed = 2.0; this.noRotationConstraint = false; this.lockedTarget = null; this._currentTarget = BABYLON.Vector3.Zero(); this._viewMatrix = BABYLON.Matrix.Zero(); this._camMatrix = BABYLON.Matrix.Zero(); this._cameraTransformMatrix = BABYLON.Matrix.Zero(); this._cameraRotationMatrix = BABYLON.Matrix.Zero(); this._referencePoint = new BABYLON.Vector3(0, 0, 1); this._transformedReferencePoint = BABYLON.Vector3.Zero(); this._lookAtTemp = BABYLON.Matrix.Zero(); this._tempMatrix = BABYLON.Matrix.Zero(); } TargetCamera.prototype._getLockedTargetPosition = function () { if (!this.lockedTarget) { return null; } return this.lockedTarget.position || this.lockedTarget; }; // Cache TargetCamera.prototype._initCache = function () { _super.prototype._initCache.call(this); this._cache.lockedTarget = new BABYLON.Vector3(Number.MAX_VALUE, Number.MAX_VALUE, Number.MAX_VALUE); this._cache.rotation = new BABYLON.Vector3(Number.MAX_VALUE, Number.MAX_VALUE, Number.MAX_VALUE); }; TargetCamera.prototype._updateCache = function (ignoreParentClass) { if (!ignoreParentClass) { _super.prototype._updateCache.call(this); } var lockedTargetPosition = this._getLockedTargetPosition(); if (!lockedTargetPosition) { this._cache.lockedTarget = null; } else { if (!this._cache.lockedTarget) { this._cache.lockedTarget = lockedTargetPosition.clone(); } else { this._cache.lockedTarget.copyFrom(lockedTargetPosition); } } this._cache.rotation.copyFrom(this.rotation); }; // Synchronized TargetCamera.prototype._isSynchronizedViewMatrix = function () { if (!_super.prototype._isSynchronizedViewMatrix.call(this)) { return false; } var lockedTargetPosition = this._getLockedTargetPosition(); return (this._cache.lockedTarget ? this._cache.lockedTarget.equals(lockedTargetPosition) : !lockedTargetPosition) && this._cache.rotation.equals(this.rotation); }; // Methods TargetCamera.prototype._computeLocalCameraSpeed = function () { var engine = this.getEngine(); return this.speed * ((engine.getDeltaTime() / (engine.getFps() * 10.0))); }; // Target TargetCamera.prototype.setTarget = function (target) { this.upVector.normalize(); BABYLON.Matrix.LookAtLHToRef(this.position, target, this.upVector, this._camMatrix); this._camMatrix.invert(); this.rotation.x = Math.atan(this._camMatrix.m[6] / this._camMatrix.m[10]); var vDir = target.subtract(this.position); if (vDir.x >= 0.0) { this.rotation.y = (-Math.atan(vDir.z / vDir.x) + Math.PI / 2.0); } else { this.rotation.y = (-Math.atan(vDir.z / vDir.x) - Math.PI / 2.0); } this.rotation.z = -Math.acos(BABYLON.Vector3.Dot(new BABYLON.Vector3(0, 1.0, 0), this.upVector)); if (isNaN(this.rotation.x)) { this.rotation.x = 0; } if (isNaN(this.rotation.y)) { this.rotation.y = 0; } if (isNaN(this.rotation.z)) { this.rotation.z = 0; } }; TargetCamera.prototype.getTarget = function () { return this._currentTarget; }; TargetCamera.prototype._decideIfNeedsToMove = function () { return Math.abs(this.cameraDirection.x) > 0 || Math.abs(this.cameraDirection.y) > 0 || Math.abs(this.cameraDirection.z) > 0; }; TargetCamera.prototype._updatePosition = function () { this.position.addInPlace(this.cameraDirection); }; TargetCamera.prototype._update = function () { var needToMove = this._decideIfNeedsToMove(); var needToRotate = Math.abs(this.cameraRotation.x) > 0 || Math.abs(this.cameraRotation.y) > 0; // Move if (needToMove) { this._updatePosition(); } // Rotate if (needToRotate) { this.rotation.x += this.cameraRotation.x; this.rotation.y += this.cameraRotation.y; if (!this.noRotationConstraint) { var limit = (Math.PI / 2) * 0.95; if (this.rotation.x > limit) this.rotation.x = limit; if (this.rotation.x < -limit) this.rotation.x = -limit; } } // Inertia if (needToMove) { if (Math.abs(this.cameraDirection.x) < BABYLON.Engine.Epsilon) { this.cameraDirection.x = 0; } if (Math.abs(this.cameraDirection.y) < BABYLON.Engine.Epsilon) { this.cameraDirection.y = 0; } if (Math.abs(this.cameraDirection.z) < BABYLON.Engine.Epsilon) { this.cameraDirection.z = 0; } this.cameraDirection.scaleInPlace(this.inertia); } if (needToRotate) { if (Math.abs(this.cameraRotation.x) < BABYLON.Engine.Epsilon) { this.cameraRotation.x = 0; } if (Math.abs(this.cameraRotation.y) < BABYLON.Engine.Epsilon) { this.cameraRotation.y = 0; } this.cameraRotation.scaleInPlace(this.inertia); } }; TargetCamera.prototype._getViewMatrix = function () { if (!this.lockedTarget) { // Compute if (this.upVector.x != 0 || this.upVector.y != 1.0 || this.upVector.z != 0) { BABYLON.Matrix.LookAtLHToRef(BABYLON.Vector3.Zero(), this._referencePoint, this.upVector, this._lookAtTemp); BABYLON.Matrix.RotationYawPitchRollToRef(this.rotation.y, this.rotation.x, this.rotation.z, this._cameraRotationMatrix); this._lookAtTemp.multiplyToRef(this._cameraRotationMatrix, this._tempMatrix); this._lookAtTemp.invert(); this._tempMatrix.multiplyToRef(this._lookAtTemp, this._cameraRotationMatrix); } else { BABYLON.Matrix.RotationYawPitchRollToRef(this.rotation.y, this.rotation.x, this.rotation.z, this._cameraRotationMatrix); } BABYLON.Vector3.TransformCoordinatesToRef(this._referencePoint, this._cameraRotationMatrix, this._transformedReferencePoint); // Computing target and final matrix this.position.addToRef(this._transformedReferencePoint, this._currentTarget); } else { this._currentTarget.copyFrom(this._getLockedTargetPosition()); } BABYLON.Matrix.LookAtLHToRef(this.position, this._currentTarget, this.upVector, this._viewMatrix); return this._viewMatrix; }; return TargetCamera; })(BABYLON.Camera); BABYLON.TargetCamera = TargetCamera; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.targetCamera.js.map var BABYLON; (function (BABYLON) { var FollowCamera = (function (_super) { __extends(FollowCamera, _super); function FollowCamera(name, position, scene) { _super.call(this, name, position, scene); this.radius = 12; this.rotationOffset = 0; this.heightOffset = 4; this.cameraAcceleration = 0.05; this.maxCameraSpeed = 20; } FollowCamera.prototype.getRadians = function (degrees) { return degrees * Math.PI / 180; }; FollowCamera.prototype.follow = function (cameraTarget) { if (!cameraTarget) return; var radians = this.getRadians(this.rotationOffset) + cameraTarget.rotation.y; var targetX = cameraTarget.position.x + Math.sin(radians) * this.radius; var targetZ = cameraTarget.position.z + Math.cos(radians) * this.radius; var dx = targetX - this.position.x; var dy = (cameraTarget.position.y + this.heightOffset) - this.position.y; var dz = (targetZ) - this.position.z; var vx = dx * this.cameraAcceleration * 2; var vy = dy * this.cameraAcceleration; var vz = dz * this.cameraAcceleration * 2; if (vx > this.maxCameraSpeed || vx < -this.maxCameraSpeed) { vx = vx < 1 ? -this.maxCameraSpeed : this.maxCameraSpeed; } if (vy > this.maxCameraSpeed || vy < -this.maxCameraSpeed) { vy = vy < 1 ? -this.maxCameraSpeed : this.maxCameraSpeed; } if (vz > this.maxCameraSpeed || vz < -this.maxCameraSpeed) { vz = vz < 1 ? -this.maxCameraSpeed : this.maxCameraSpeed; } this.position = new BABYLON.Vector3(this.position.x + vx, this.position.y + vy, this.position.z + vz); this.setTarget(cameraTarget.position); }; FollowCamera.prototype._update = function () { _super.prototype._update.call(this); this.follow(this.target); }; return FollowCamera; })(BABYLON.TargetCamera); BABYLON.FollowCamera = FollowCamera; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.followCamera.js.map var BABYLON; (function (BABYLON) { var FreeCamera = (function (_super) { __extends(FreeCamera, _super); function FreeCamera(name, position, scene) { _super.call(this, name, position, scene); this.ellipsoid = new BABYLON.Vector3(0.5, 1, 0.5); this.keysUp = [38]; this.keysDown = [40]; this.keysLeft = [37]; this.keysRight = [39]; this.checkCollisions = false; this.applyGravity = false; this.angularSensibility = 2000.0; this._keys = []; this._collider = new BABYLON.Collider(); this._needMoveForGravity = true; this._oldPosition = BABYLON.Vector3.Zero(); this._diffPosition = BABYLON.Vector3.Zero(); this._newPosition = BABYLON.Vector3.Zero(); } // Controls FreeCamera.prototype.attachControl = function (element, noPreventDefault) { var _this = this; var previousPosition; var engine = this.getEngine(); if (this._attachedElement) { return; } this._attachedElement = element; if (this._onMouseDown === undefined) { this._onMouseDown = function (evt) { previousPosition = { x: evt.clientX, y: evt.clientY }; if (!noPreventDefault) { evt.preventDefault(); } }; this._onMouseUp = function (evt) { previousPosition = null; if (!noPreventDefault) { evt.preventDefault(); } }; this._onMouseOut = function (evt) { previousPosition = null; _this._keys = []; if (!noPreventDefault) { evt.preventDefault(); } }; this._onMouseMove = function (evt) { if (!previousPosition && !engine.isPointerLock) { return; } var offsetX; var offsetY; if (!engine.isPointerLock) { offsetX = evt.clientX - previousPosition.x; offsetY = evt.clientY - previousPosition.y; } else { offsetX = evt.movementX || evt.mozMovementX || evt.webkitMovementX || evt.msMovementX || 0; offsetY = evt.movementY || evt.mozMovementY || evt.webkitMovementY || evt.msMovementY || 0; } _this.cameraRotation.y += offsetX / _this.angularSensibility; _this.cameraRotation.x += offsetY / _this.angularSensibility; previousPosition = { x: evt.clientX, y: evt.clientY }; if (!noPreventDefault) { evt.preventDefault(); } }; this._onKeyDown = function (evt) { if (_this.keysUp.indexOf(evt.keyCode) !== -1 || _this.keysDown.indexOf(evt.keyCode) !== -1 || _this.keysLeft.indexOf(evt.keyCode) !== -1 || _this.keysRight.indexOf(evt.keyCode) !== -1) { var index = _this._keys.indexOf(evt.keyCode); if (index === -1) { _this._keys.push(evt.keyCode); } if (!noPreventDefault) { evt.preventDefault(); } } }; this._onKeyUp = function (evt) { if (_this.keysUp.indexOf(evt.keyCode) !== -1 || _this.keysDown.indexOf(evt.keyCode) !== -1 || _this.keysLeft.indexOf(evt.keyCode) !== -1 || _this.keysRight.indexOf(evt.keyCode) !== -1) { var index = _this._keys.indexOf(evt.keyCode); if (index >= 0) { _this._keys.splice(index, 1); } if (!noPreventDefault) { evt.preventDefault(); } } }; this._onLostFocus = function () { _this._keys = []; }; this._reset = function () { _this._keys = []; previousPosition = null; _this.cameraDirection = new BABYLON.Vector3(0, 0, 0); _this.cameraRotation = new BABYLON.Vector2(0, 0); }; } element.addEventListener("mousedown", this._onMouseDown, false); element.addEventListener("mouseup", this._onMouseUp, false); element.addEventListener("mouseout", this._onMouseOut, false); element.addEventListener("mousemove", this._onMouseMove, false); BABYLON.Tools.RegisterTopRootEvents([ { name: "keydown", handler: this._onKeyDown }, { name: "keyup", handler: this._onKeyUp }, { name: "blur", handler: this._onLostFocus } ]); }; FreeCamera.prototype.detachControl = function (element) { if (this._attachedElement != element) { return; } element.removeEventListener("mousedown", this._onMouseDown); element.removeEventListener("mouseup", this._onMouseUp); element.removeEventListener("mouseout", this._onMouseOut); element.removeEventListener("mousemove", this._onMouseMove); BABYLON.Tools.UnregisterTopRootEvents([ { name: "keydown", handler: this._onKeyDown }, { name: "keyup", handler: this._onKeyUp }, { name: "blur", handler: this._onLostFocus } ]); this._attachedElement = null; if (this._reset) { this._reset(); } }; FreeCamera.prototype._collideWithWorld = function (velocity) { var globalPosition; if (this.parent) { globalPosition = BABYLON.Vector3.TransformCoordinates(this.position, this.parent.getWorldMatrix()); } else { globalPosition = this.position; } globalPosition.subtractFromFloatsToRef(0, this.ellipsoid.y, 0, this._oldPosition); this._collider.radius = this.ellipsoid; this.getScene()._getNewPosition(this._oldPosition, velocity, this._collider, 3, this._newPosition); this._newPosition.subtractToRef(this._oldPosition, this._diffPosition); if (this._diffPosition.length() > BABYLON.Engine.CollisionsEpsilon) { this.position.addInPlace(this._diffPosition); if (this.onCollide) { this.onCollide(this._collider.collidedMesh); } } }; FreeCamera.prototype._checkInputs = function () { if (!this._localDirection) { this._localDirection = BABYLON.Vector3.Zero(); this._transformedDirection = BABYLON.Vector3.Zero(); } for (var index = 0; index < this._keys.length; index++) { var keyCode = this._keys[index]; var speed = this._computeLocalCameraSpeed(); if (this.keysLeft.indexOf(keyCode) !== -1) { this._localDirection.copyFromFloats(-speed, 0, 0); } else if (this.keysUp.indexOf(keyCode) !== -1) { this._localDirection.copyFromFloats(0, 0, speed); } else if (this.keysRight.indexOf(keyCode) !== -1) { this._localDirection.copyFromFloats(speed, 0, 0); } else if (this.keysDown.indexOf(keyCode) !== -1) { this._localDirection.copyFromFloats(0, 0, -speed); } this.getViewMatrix().invertToRef(this._cameraTransformMatrix); BABYLON.Vector3.TransformNormalToRef(this._localDirection, this._cameraTransformMatrix, this._transformedDirection); this.cameraDirection.addInPlace(this._transformedDirection); } }; FreeCamera.prototype._decideIfNeedsToMove = function () { return this._needMoveForGravity || Math.abs(this.cameraDirection.x) > 0 || Math.abs(this.cameraDirection.y) > 0 || Math.abs(this.cameraDirection.z) > 0; }; FreeCamera.prototype._updatePosition = function () { if (this.checkCollisions && this.getScene().collisionsEnabled) { this._collideWithWorld(this.cameraDirection); if (this.applyGravity) { var oldPosition = this.position; this._collideWithWorld(this.getScene().gravity); this._needMoveForGravity = (BABYLON.Vector3.DistanceSquared(oldPosition, this.position) != 0); } } else { this.position.addInPlace(this.cameraDirection); } }; FreeCamera.prototype._update = function () { this._checkInputs(); _super.prototype._update.call(this); }; return FreeCamera; })(BABYLON.TargetCamera); BABYLON.FreeCamera = FreeCamera; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.freeCamera.js.map var BABYLON; (function (BABYLON) { // We're mainly based on the logic defined into the FreeCamera code var TouchCamera = (function (_super) { __extends(TouchCamera, _super); function TouchCamera(name, position, scene) { _super.call(this, name, position, scene); this._offsetX = null; this._offsetY = null; this._pointerCount = 0; this._pointerPressed = []; this.angularSensibility = 200000.0; this.moveSensibility = 500.0; } TouchCamera.prototype.attachControl = function (canvas, noPreventDefault) { var _this = this; var previousPosition; if (this._attachedCanvas) { return; } this._attachedCanvas = canvas; if (this._onPointerDown === undefined) { this._onPointerDown = function (evt) { if (!noPreventDefault) { evt.preventDefault(); } _this._pointerPressed.push(evt.pointerId); if (_this._pointerPressed.length !== 1) { return; } previousPosition = { x: evt.clientX, y: evt.clientY }; }; this._onPointerUp = function (evt) { if (!noPreventDefault) { evt.preventDefault(); } var index = _this._pointerPressed.indexOf(evt.pointerId); if (index === -1) { return; } _this._pointerPressed.splice(index, 1); if (index != 0) { return; } previousPosition = null; _this._offsetX = null; _this._offsetY = null; }; this._onPointerMove = function (evt) { if (!noPreventDefault) { evt.preventDefault(); } if (!previousPosition) { return; } var index = _this._pointerPressed.indexOf(evt.pointerId); if (index != 0) { return; } _this._offsetX = evt.clientX - previousPosition.x; _this._offsetY = -(evt.clientY - previousPosition.y); }; this._onLostFocus = function () { _this._offsetX = null; _this._offsetY = null; }; } canvas.addEventListener("pointerdown", this._onPointerDown); canvas.addEventListener("pointerup", this._onPointerUp); canvas.addEventListener("pointerout", this._onPointerUp); canvas.addEventListener("pointermove", this._onPointerMove); BABYLON.Tools.RegisterTopRootEvents([ { name: "blur", handler: this._onLostFocus } ]); }; TouchCamera.prototype.detachControl = function (canvas) { if (this._attachedCanvas != canvas) { return; } canvas.removeEventListener("pointerdown", this._onPointerDown); canvas.removeEventListener("pointerup", this._onPointerUp); canvas.removeEventListener("pointerout", this._onPointerUp); canvas.removeEventListener("pointermove", this._onPointerMove); BABYLON.Tools.UnregisterTopRootEvents([ { name: "blur", handler: this._onLostFocus } ]); this._attachedCanvas = null; }; TouchCamera.prototype._checkInputs = function () { if (!this._offsetX) { return; } this.cameraRotation.y += this._offsetX / this.angularSensibility; if (this._pointerPressed.length > 1) { this.cameraRotation.x += -this._offsetY / this.angularSensibility; } else { var speed = this._computeLocalCameraSpeed(); var direction = new BABYLON.Vector3(0, 0, speed * this._offsetY / this.moveSensibility); BABYLON.Matrix.RotationYawPitchRollToRef(this.rotation.y, this.rotation.x, 0, this._cameraRotationMatrix); this.cameraDirection.addInPlace(BABYLON.Vector3.TransformCoordinates(direction, this._cameraRotationMatrix)); } }; return TouchCamera; })(BABYLON.FreeCamera); BABYLON.TouchCamera = TouchCamera; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.touchCamera.js.map var BABYLON; (function (BABYLON) { // We're mainly based on the logic defined into the FreeCamera code var DeviceOrientationCamera = (function (_super) { __extends(DeviceOrientationCamera, _super); function DeviceOrientationCamera(name, position, scene) { var _this = this; _super.call(this, name, position, scene); this._offsetX = null; this._offsetY = null; this._orientationGamma = 0; this._orientationBeta = 0; this._initialOrientationGamma = 0; this._initialOrientationBeta = 0; this.angularSensibility = 10000.0; this.moveSensibility = 50.0; window.addEventListener("resize", function () { _this._initialOrientationGamma = null; }, false); } DeviceOrientationCamera.prototype.attachControl = function (canvas, noPreventDefault) { var _this = this; if (this._attachedCanvas) { return; } this._attachedCanvas = canvas; if (!this._orientationChanged) { this._orientationChanged = function (evt) { if (!_this._initialOrientationGamma) { _this._initialOrientationGamma = evt.gamma; _this._initialOrientationBeta = evt.beta; } _this._orientationGamma = evt.gamma; _this._orientationBeta = evt.beta; _this._offsetY = (_this._initialOrientationBeta - _this._orientationBeta); _this._offsetX = (_this._initialOrientationGamma - _this._orientationGamma); }; } window.addEventListener("deviceorientation", this._orientationChanged); }; DeviceOrientationCamera.prototype.detachControl = function (canvas) { if (this._attachedCanvas != canvas) { return; } window.removeEventListener("deviceorientation", this._orientationChanged); this._attachedCanvas = null; this._orientationGamma = 0; this._orientationBeta = 0; this._initialOrientationGamma = 0; this._initialOrientationBeta = 0; }; DeviceOrientationCamera.prototype._checkInputs = function () { if (!this._offsetX) { return; } this.cameraRotation.y -= this._offsetX / this.angularSensibility; var speed = this._computeLocalCameraSpeed(); var direction = new BABYLON.Vector3(0, 0, speed * this._offsetY / this.moveSensibility); BABYLON.Matrix.RotationYawPitchRollToRef(this.rotation.y, this.rotation.x, 0, this._cameraRotationMatrix); this.cameraDirection.addInPlace(BABYLON.Vector3.TransformCoordinates(direction, this._cameraRotationMatrix)); }; return DeviceOrientationCamera; })(BABYLON.FreeCamera); BABYLON.DeviceOrientationCamera = DeviceOrientationCamera; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.deviceOrientationCamera.js.map var BABYLON; (function (BABYLON) { var eventPrefix = BABYLON.Tools.GetPointerPrefix(); var ArcRotateCamera = (function (_super) { __extends(ArcRotateCamera, _super); function ArcRotateCamera(name, alpha, beta, radius, target, scene) { _super.call(this, name, BABYLON.Vector3.Zero(), scene); this.alpha = alpha; this.beta = beta; this.radius = radius; this.target = target; this.inertialAlphaOffset = 0; this.inertialBetaOffset = 0; this.inertialRadiusOffset = 0; this.lowerAlphaLimit = null; this.upperAlphaLimit = null; this.lowerBetaLimit = 0.01; this.upperBetaLimit = Math.PI; this.lowerRadiusLimit = null; this.upperRadiusLimit = null; this.angularSensibility = 1000.0; this.wheelPrecision = 3.0; this.keysUp = [38]; this.keysDown = [40]; this.keysLeft = [37]; this.keysRight = [39]; this.zoomOnFactor = 1; this.targetScreenOffset = BABYLON.Vector2.Zero(); this._keys = []; this._viewMatrix = new BABYLON.Matrix(); this.checkCollisions = false; this.collisionRadius = new BABYLON.Vector3(0.5, 0.5, 0.5); this._collider = new BABYLON.Collider(); this._previousPosition = BABYLON.Vector3.Zero(); this._collisionVelocity = BABYLON.Vector3.Zero(); this._newPosition = BABYLON.Vector3.Zero(); // Pinch // value for pinch step scaling // set to 20 by default this.pinchPrecision = 20; this.getViewMatrix(); } ArcRotateCamera.prototype._getTargetPosition = function () { return this.target.position || this.target; }; // Cache ArcRotateCamera.prototype._initCache = function () { _super.prototype._initCache.call(this); this._cache.target = new BABYLON.Vector3(Number.MAX_VALUE, Number.MAX_VALUE, Number.MAX_VALUE); this._cache.alpha = undefined; this._cache.beta = undefined; this._cache.radius = undefined; this._cache.targetScreenOffset = undefined; }; ArcRotateCamera.prototype._updateCache = function (ignoreParentClass) { if (!ignoreParentClass) { _super.prototype._updateCache.call(this); } this._cache.target.copyFrom(this._getTargetPosition()); this._cache.alpha = this.alpha; this._cache.beta = this.beta; this._cache.radius = this.radius; this._cache.targetScreenOffset = this.targetScreenOffset.clone(); }; // Synchronized ArcRotateCamera.prototype._isSynchronizedViewMatrix = function () { if (!_super.prototype._isSynchronizedViewMatrix.call(this)) return false; return this._cache.target.equals(this._getTargetPosition()) && this._cache.alpha === this.alpha && this._cache.beta === this.beta && this._cache.radius === this.radius && this._cache.targetScreenOffset.equals(this.targetScreenOffset); }; // Methods ArcRotateCamera.prototype.attachControl = function (element, noPreventDefault) { var _this = this; var previousPosition; var pointerId; // to know if pinch started var pinchStarted = false; // two pinch point on X // that will use for find if user action is pinch open or pinch close var pinchPointX1, pinchPointX2; if (this._attachedElement) { return; } this._attachedElement = element; var engine = this.getEngine(); if (this._onPointerDown === undefined) { this._onPointerDown = function (evt) { if (pointerId) { return; } pointerId = evt.pointerId; previousPosition = { x: evt.clientX, y: evt.clientY }; if (!noPreventDefault) { evt.preventDefault(); } }; this._onPointerUp = function (evt) { previousPosition = null; pointerId = null; if (!noPreventDefault) { evt.preventDefault(); } }; this._onPointerMove = function (evt) { if (!previousPosition) { return; } if (pointerId !== evt.pointerId) { return; } // return pinch is started if (pinchStarted) { return; } var offsetX = evt.clientX - previousPosition.x; var offsetY = evt.clientY - previousPosition.y; _this.inertialAlphaOffset -= offsetX / _this.angularSensibility; _this.inertialBetaOffset -= offsetY / _this.angularSensibility; previousPosition = { x: evt.clientX, y: evt.clientY }; if (!noPreventDefault) { evt.preventDefault(); } }; this._onMouseMove = function (evt) { if (!engine.isPointerLock) { return; } // return pinch is started if (pinchStarted) { return; } var offsetX = evt.movementX || evt.mozMovementX || evt.webkitMovementX || evt.msMovementX || 0; var offsetY = evt.movementY || evt.mozMovementY || evt.webkitMovementY || evt.msMovementY || 0; _this.inertialAlphaOffset -= offsetX / _this.angularSensibility; _this.inertialBetaOffset -= offsetY / _this.angularSensibility; if (!noPreventDefault) { evt.preventDefault(); } }; this._wheel = function (event) { var delta = 0; if (event.wheelDelta) { delta = event.wheelDelta / (_this.wheelPrecision * 40); } else if (event.detail) { delta = -event.detail / _this.wheelPrecision; } if (delta) _this.inertialRadiusOffset += delta; if (event.preventDefault) { if (!noPreventDefault) { event.preventDefault(); } } }; this._onKeyDown = function (evt) { if (_this.keysUp.indexOf(evt.keyCode) !== -1 || _this.keysDown.indexOf(evt.keyCode) !== -1 || _this.keysLeft.indexOf(evt.keyCode) !== -1 || _this.keysRight.indexOf(evt.keyCode) !== -1) { var index = _this._keys.indexOf(evt.keyCode); if (index === -1) { _this._keys.push(evt.keyCode); } if (evt.preventDefault) { if (!noPreventDefault) { evt.preventDefault(); } } } }; this._onKeyUp = function (evt) { if (_this.keysUp.indexOf(evt.keyCode) !== -1 || _this.keysDown.indexOf(evt.keyCode) !== -1 || _this.keysLeft.indexOf(evt.keyCode) !== -1 || _this.keysRight.indexOf(evt.keyCode) !== -1) { var index = _this._keys.indexOf(evt.keyCode); if (index >= 0) { _this._keys.splice(index, 1); } if (evt.preventDefault) { if (!noPreventDefault) { evt.preventDefault(); } } } }; this._onLostFocus = function () { _this._keys = []; pointerId = null; }; this._onGestureStart = function (e) { if (window.MSGesture === undefined) { return; } if (!_this._MSGestureHandler) { _this._MSGestureHandler = new MSGesture(); _this._MSGestureHandler.target = element; } _this._MSGestureHandler.addPointer(e.pointerId); }; this._onGesture = function (e) { _this.radius *= e.scale; if (e.preventDefault) { if (!noPreventDefault) { e.stopPropagation(); e.preventDefault(); } } }; this._reset = function () { _this._keys = []; _this.inertialAlphaOffset = 0; _this.inertialBetaOffset = 0; _this.inertialRadiusOffset = 0; previousPosition = null; pointerId = null; }; this._touchStart = function (event) { if (event.touches.length === 2) { //-- start pinch if two fingers on the screen pinchStarted = true; _this._pinchStart(event); } }; this._touchMove = function (event) { if (pinchStarted) { //-- make scaling _this._pinchMove(event); } }; this._touchEnd = function (event) { if (pinchStarted) { //-- end of pinch _this._pinchEnd(event); } }; this._pinchStart = function (event) { // save origin touch point pinchPointX1 = event.touches[0].clientX; pinchPointX2 = event.touches[1].clientX; // block the camera // if not it rotate around target during pinch pinchStarted = true; }; this._pinchMove = function (event) { // variable for new camera's radius var delta = 0; // variables to know if pinch open or pinch close var direction = 1; var distanceXOrigine, distanceXNow; if (event.touches.length !== 2) return; // calculate absolute distances of the two fingers distanceXOrigine = Math.abs(pinchPointX1 - pinchPointX2); distanceXNow = Math.abs(event.touches[0].clientX - event.touches[1].clientX); // if distanceXNow < distanceXOrigine -> pinch close so direction = -1 if (distanceXNow < distanceXOrigine) { direction = -1; } // calculate new radius delta = (_this.pinchPrecision / (_this.wheelPrecision * 40)) * direction; // set new radius _this.inertialRadiusOffset -= delta; // save origin touch point pinchPointX1 = event.touches[0].clientX; pinchPointX2 = event.touches[1].clientX; }; this._pinchEnd = function (event) { // cancel pinch and deblock camera rotation pinchStarted = false; }; } element.addEventListener(eventPrefix + "down", this._onPointerDown, false); element.addEventListener(eventPrefix + "up", this._onPointerUp, false); element.addEventListener(eventPrefix + "out", this._onPointerUp, false); element.addEventListener(eventPrefix + "move", this._onPointerMove, false); element.addEventListener("mousemove", this._onMouseMove, false); element.addEventListener("MSPointerDown", this._onGestureStart, false); element.addEventListener("MSGestureChange", this._onGesture, false); element.addEventListener('mousewheel', this._wheel, false); element.addEventListener('DOMMouseScroll', this._wheel, false); // pinch element.addEventListener('touchstart', this._touchStart, false); element.addEventListener('touchmove', this._touchMove, false); element.addEventListener('touchend', this._touchEnd, false); BABYLON.Tools.RegisterTopRootEvents([ { name: "keydown", handler: this._onKeyDown }, { name: "keyup", handler: this._onKeyUp }, { name: "blur", handler: this._onLostFocus } ]); }; ArcRotateCamera.prototype.detachControl = function (element) { if (this._attachedElement != element) { return; } element.removeEventListener(eventPrefix + "down", this._onPointerDown); element.removeEventListener(eventPrefix + "up", this._onPointerUp); element.removeEventListener(eventPrefix + "out", this._onPointerUp); element.removeEventListener(eventPrefix + "move", this._onPointerMove); element.removeEventListener("mousemove", this._onMouseMove); element.removeEventListener("MSPointerDown", this._onGestureStart); element.removeEventListener("MSGestureChange", this._onGesture); element.removeEventListener('mousewheel', this._wheel); element.removeEventListener('DOMMouseScroll', this._wheel); // pinch element.removeEventListener('touchstart', this._touchStart); element.removeEventListener('touchmove', this._touchMove); element.removeEventListener('touchend', this._touchEnd); BABYLON.Tools.UnregisterTopRootEvents([ { name: "keydown", handler: this._onKeyDown }, { name: "keyup", handler: this._onKeyUp }, { name: "blur", handler: this._onLostFocus } ]); this._MSGestureHandler = null; this._attachedElement = null; if (this._reset) { this._reset(); } }; ArcRotateCamera.prototype._update = function () { for (var index = 0; index < this._keys.length; index++) { var keyCode = this._keys[index]; if (this.keysLeft.indexOf(keyCode) !== -1) { this.inertialAlphaOffset -= 0.01; } else if (this.keysUp.indexOf(keyCode) !== -1) { this.inertialBetaOffset -= 0.01; } else if (this.keysRight.indexOf(keyCode) !== -1) { this.inertialAlphaOffset += 0.01; } else if (this.keysDown.indexOf(keyCode) !== -1) { this.inertialBetaOffset += 0.01; } } // Inertia if (this.inertialAlphaOffset != 0 || this.inertialBetaOffset != 0 || this.inertialRadiusOffset != 0) { this.alpha += this.inertialAlphaOffset; this.beta += this.inertialBetaOffset; this.radius -= this.inertialRadiusOffset; this.inertialAlphaOffset *= this.inertia; this.inertialBetaOffset *= this.inertia; this.inertialRadiusOffset *= this.inertia; if (Math.abs(this.inertialAlphaOffset) < BABYLON.Engine.Epsilon) this.inertialAlphaOffset = 0; if (Math.abs(this.inertialBetaOffset) < BABYLON.Engine.Epsilon) this.inertialBetaOffset = 0; if (Math.abs(this.inertialRadiusOffset) < BABYLON.Engine.Epsilon) this.inertialRadiusOffset = 0; } // Limits if (this.lowerAlphaLimit && this.alpha < this.lowerAlphaLimit) { this.alpha = this.lowerAlphaLimit; } if (this.upperAlphaLimit && this.alpha > this.upperAlphaLimit) { this.alpha = this.upperAlphaLimit; } if (this.lowerBetaLimit && this.beta < this.lowerBetaLimit) { this.beta = this.lowerBetaLimit; } if (this.upperBetaLimit && this.beta > this.upperBetaLimit) { this.beta = this.upperBetaLimit; } if (this.lowerRadiusLimit && this.radius < this.lowerRadiusLimit) { this.radius = this.lowerRadiusLimit; } if (this.upperRadiusLimit && this.radius > this.upperRadiusLimit) { this.radius = this.upperRadiusLimit; } }; ArcRotateCamera.prototype.setPosition = function (position) { var radiusv3 = position.subtract(this._getTargetPosition()); this.radius = radiusv3.length(); // Alpha this.alpha = Math.acos(radiusv3.x / Math.sqrt(Math.pow(radiusv3.x, 2) + Math.pow(radiusv3.z, 2))); if (radiusv3.z < 0) { this.alpha = 2 * Math.PI - this.alpha; } // Beta this.beta = Math.acos(radiusv3.y / this.radius); }; ArcRotateCamera.prototype._getViewMatrix = function () { // Compute var cosa = Math.cos(this.alpha); var sina = Math.sin(this.alpha); var cosb = Math.cos(this.beta); var sinb = Math.sin(this.beta); var target = this._getTargetPosition(); target.addToRef(new BABYLON.Vector3(this.radius * cosa * sinb, this.radius * cosb, this.radius * sina * sinb), this.position); if (this.checkCollisions) { this._collider.radius = this.collisionRadius; this.position.subtractToRef(this._previousPosition, this._collisionVelocity); this.getScene()._getNewPosition(this._previousPosition, this._collisionVelocity, this._collider, 3, this._newPosition); if (!this._newPosition.equalsWithEpsilon(this.position)) { this.position.copyFrom(this._previousPosition); this.alpha = this._previousAlpha; this.beta = this._previousBeta; this.radius = this._previousRadius; if (this.onCollide) { this.onCollide(this._collider.collidedMesh); } } } BABYLON.Matrix.LookAtLHToRef(this.position, target, this.upVector, this._viewMatrix); this._previousAlpha = this.alpha; this._previousBeta = this.beta; this._previousRadius = this.radius; this._previousPosition.copyFrom(this.position); this._viewMatrix.m[12] += this.targetScreenOffset.x; this._viewMatrix.m[13] += this.targetScreenOffset.y; return this._viewMatrix; }; ArcRotateCamera.prototype.zoomOn = function (meshes) { meshes = meshes || this.getScene().meshes; var minMaxVector = BABYLON.Mesh.MinMax(meshes); var distance = BABYLON.Vector3.Distance(minMaxVector.min, minMaxVector.max); this.radius = distance * this.zoomOnFactor; this.focusOn({ min: minMaxVector.min, max: minMaxVector.max, distance: distance }); }; ArcRotateCamera.prototype.focusOn = function (meshesOrMinMaxVectorAndDistance) { var meshesOrMinMaxVector; var distance; if (meshesOrMinMaxVectorAndDistance.min === undefined) { meshesOrMinMaxVector = meshesOrMinMaxVectorAndDistance || this.getScene().meshes; meshesOrMinMaxVector = BABYLON.Mesh.MinMax(meshesOrMinMaxVector); distance = BABYLON.Vector3.Distance(meshesOrMinMaxVector.min, meshesOrMinMaxVector.max); } else { meshesOrMinMaxVector = meshesOrMinMaxVectorAndDistance; distance = meshesOrMinMaxVectorAndDistance.distance; } this.target = BABYLON.Mesh.Center(meshesOrMinMaxVector); this.maxZ = distance * 2; }; return ArcRotateCamera; })(BABYLON.Camera); BABYLON.ArcRotateCamera = ArcRotateCamera; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.arcRotateCamera.js.map var BABYLON; (function (BABYLON) { var Scene = (function () { // Constructor function Scene(engine) { // Members this.autoClear = true; this.clearColor = new BABYLON.Color3(0.2, 0.2, 0.3); this.ambientColor = new BABYLON.Color3(0, 0, 0); this.forceWireframe = false; this.forcePointsCloud = false; this.forceShowBoundingBoxes = false; this.animationsEnabled = true; this.cameraToUseForPointers = null; // Fog this.fogEnabled = true; this.fogMode = Scene.FOGMODE_NONE; this.fogColor = new BABYLON.Color3(0.2, 0.2, 0.3); this.fogDensity = 0.1; this.fogStart = 0; this.fogEnd = 1000.0; // Lights this.shadowsEnabled = true; this.lightsEnabled = true; this.lights = new Array(); // Cameras this.cameras = new Array(); this.activeCameras = new Array(); // Meshes this.meshes = new Array(); // Geometries this._geometries = new Array(); this.materials = new Array(); this.multiMaterials = new Array(); this.defaultMaterial = new BABYLON.StandardMaterial("default material", this); // Textures this.texturesEnabled = true; this.textures = new Array(); // Particles this.particlesEnabled = true; this.particleSystems = new Array(); // Sprites this.spriteManagers = new Array(); // Layers this.layers = new Array(); // Skeletons this.skeletonsEnabled = true; this.skeletons = new Array(); // Lens flares this.lensFlaresEnabled = true; this.lensFlareSystems = new Array(); // Collisions this.collisionsEnabled = true; this.gravity = new BABYLON.Vector3(0, -9.0, 0); // Postprocesses this.postProcessesEnabled = true; // Customs render targets this.renderTargetsEnabled = true; this.customRenderTargets = new Array(); // Imported meshes this.importedMeshesFiles = new Array(); this._actionManagers = new Array(); this._meshesForIntersections = new BABYLON.SmartArray(256); // Procedural textures this.proceduralTexturesEnabled = true; this._proceduralTextures = new Array(); this.soundTracks = new Array(); this._totalVertices = 0; this._activeVertices = 0; this._activeParticles = 0; this._lastFrameDuration = 0; this._evaluateActiveMeshesDuration = 0; this._renderTargetsDuration = 0; this._particlesDuration = 0; this._renderDuration = 0; this._spritesDuration = 0; this._animationRatio = 0; this._renderId = 0; this._executeWhenReadyTimeoutId = -1; this._toBeDisposed = new BABYLON.SmartArray(256); this._onReadyCallbacks = new Array(); this._pendingData = []; this._onBeforeRenderCallbacks = new Array(); this._onAfterRenderCallbacks = new Array(); this._activeMeshes = new BABYLON.SmartArray(256); this._processedMaterials = new BABYLON.SmartArray(256); this._renderTargets = new BABYLON.SmartArray(256); this._activeParticleSystems = new BABYLON.SmartArray(256); this._activeSkeletons = new BABYLON.SmartArray(32); this._activeBones = 0; this._activeAnimatables = new Array(); this._transformMatrix = BABYLON.Matrix.Zero(); this._scaledPosition = BABYLON.Vector3.Zero(); this._scaledVelocity = BABYLON.Vector3.Zero(); this._engine = engine; engine.scenes.push(this); this._renderingManager = new BABYLON.RenderingManager(this); this.postProcessManager = new BABYLON.PostProcessManager(this); this.postProcessRenderPipelineManager = new BABYLON.PostProcessRenderPipelineManager(); this._boundingBoxRenderer = new BABYLON.BoundingBoxRenderer(this); this._outlineRenderer = new BABYLON.OutlineRenderer(this); this.attachControl(); this._debugLayer = new BABYLON.DebugLayer(this); this.mainSoundTrack = new BABYLON.SoundTrack(this, { mainTrack: true }); } Object.defineProperty(Scene.prototype, "debugLayer", { // Properties get: function () { return this._debugLayer; }, enumerable: true, configurable: true }); Object.defineProperty(Scene.prototype, "meshUnderPointer", { get: function () { return this._meshUnderPointer; }, enumerable: true, configurable: true }); Object.defineProperty(Scene.prototype, "pointerX", { get: function () { return this._pointerX; }, enumerable: true, configurable: true }); Object.defineProperty(Scene.prototype, "pointerY", { get: function () { return this._pointerY; }, enumerable: true, configurable: true }); Scene.prototype.getCachedMaterial = function () { return this._cachedMaterial; }; Scene.prototype.getBoundingBoxRenderer = function () { return this._boundingBoxRenderer; }; Scene.prototype.getOutlineRenderer = function () { return this._outlineRenderer; }; Scene.prototype.getEngine = function () { return this._engine; }; Scene.prototype.getTotalVertices = function () { return this._totalVertices; }; Scene.prototype.getActiveVertices = function () { return this._activeVertices; }; Scene.prototype.getActiveParticles = function () { return this._activeParticles; }; Scene.prototype.getActiveBones = function () { return this._activeBones; }; // Stats Scene.prototype.getLastFrameDuration = function () { return this._lastFrameDuration; }; Scene.prototype.getEvaluateActiveMeshesDuration = function () { return this._evaluateActiveMeshesDuration; }; Scene.prototype.getActiveMeshes = function () { return this._activeMeshes; }; Scene.prototype.getRenderTargetsDuration = function () { return this._renderTargetsDuration; }; Scene.prototype.getRenderDuration = function () { return this._renderDuration; }; Scene.prototype.getParticlesDuration = function () { return this._particlesDuration; }; Scene.prototype.getSpritesDuration = function () { return this._spritesDuration; }; Scene.prototype.getAnimationRatio = function () { return this._animationRatio; }; Scene.prototype.getRenderId = function () { return this._renderId; }; Scene.prototype._updatePointerPosition = function (evt) { var canvasRect = this._engine.getRenderingCanvasClientRect(); this._pointerX = evt.clientX - canvasRect.left; this._pointerY = evt.clientY - canvasRect.top; if (this.cameraToUseForPointers) { this._pointerX = this._pointerX - this.cameraToUseForPointers.viewport.x * this._engine.getRenderWidth(); this._pointerY = this._pointerY - this.cameraToUseForPointers.viewport.y * this._engine.getRenderHeight(); } }; // Pointers handling Scene.prototype.attachControl = function () { var _this = this; this._onPointerMove = function (evt) { var canvas = _this._engine.getRenderingCanvas(); _this._updatePointerPosition(evt); var pickResult = _this.pick(_this._pointerX, _this._pointerY, function (mesh) { return mesh.isPickable && mesh.isVisible && mesh.isReady() && mesh.actionManager && mesh.actionManager.hasPointerTriggers; }, false, _this.cameraToUseForPointers); if (pickResult.hit) { _this._meshUnderPointer = pickResult.pickedMesh; _this.setPointerOverMesh(pickResult.pickedMesh); canvas.style.cursor = "pointer"; } else { _this.setPointerOverMesh(null); canvas.style.cursor = ""; _this._meshUnderPointer = null; } }; this._onPointerDown = function (evt) { var predicate = null; if (!_this.onPointerDown) { predicate = function (mesh) { return mesh.isPickable && mesh.isVisible && mesh.isReady() && mesh.actionManager && mesh.actionManager.hasPickTriggers; }; } _this._updatePointerPosition(evt); var pickResult = _this.pick(_this._pointerX, _this._pointerY, predicate, false, _this.cameraToUseForPointers); if (pickResult.hit) { if (pickResult.pickedMesh.actionManager) { switch (evt.button) { case 0: pickResult.pickedMesh.actionManager.processTrigger(BABYLON.ActionManager.OnLeftPickTrigger, BABYLON.ActionEvent.CreateNew(pickResult.pickedMesh, evt)); break; case 1: pickResult.pickedMesh.actionManager.processTrigger(BABYLON.ActionManager.OnCenterPickTrigger, BABYLON.ActionEvent.CreateNew(pickResult.pickedMesh, evt)); break; case 2: pickResult.pickedMesh.actionManager.processTrigger(BABYLON.ActionManager.OnRightPickTrigger, BABYLON.ActionEvent.CreateNew(pickResult.pickedMesh, evt)); break; } pickResult.pickedMesh.actionManager.processTrigger(BABYLON.ActionManager.OnPickTrigger, BABYLON.ActionEvent.CreateNew(pickResult.pickedMesh, evt)); } } if (_this.onPointerDown) { _this.onPointerDown(evt, pickResult); } }; this._onKeyDown = function (evt) { if (_this.actionManager) { _this.actionManager.processTrigger(BABYLON.ActionManager.OnKeyDownTrigger, BABYLON.ActionEvent.CreateNewFromScene(_this, evt)); } }; this._onKeyUp = function (evt) { if (_this.actionManager) { _this.actionManager.processTrigger(BABYLON.ActionManager.OnKeyUpTrigger, BABYLON.ActionEvent.CreateNewFromScene(_this, evt)); } }; var eventPrefix = BABYLON.Tools.GetPointerPrefix(); this._engine.getRenderingCanvas().addEventListener(eventPrefix + "move", this._onPointerMove, false); this._engine.getRenderingCanvas().addEventListener(eventPrefix + "down", this._onPointerDown, false); window.addEventListener("keydown", this._onKeyDown, false); window.addEventListener("keyup", this._onKeyUp, false); }; Scene.prototype.detachControl = function () { var eventPrefix = BABYLON.Tools.GetPointerPrefix(); this._engine.getRenderingCanvas().removeEventListener(eventPrefix + "move", this._onPointerMove); this._engine.getRenderingCanvas().removeEventListener(eventPrefix + "down", this._onPointerDown); window.removeEventListener("keydown", this._onKeyDown); window.removeEventListener("keyup", this._onKeyUp); }; // Ready Scene.prototype.isReady = function () { if (this._pendingData.length > 0) { return false; } for (var index = 0; index < this._geometries.length; index++) { var geometry = this._geometries[index]; if (geometry.delayLoadState === BABYLON.Engine.DELAYLOADSTATE_LOADING) { return false; } } for (index = 0; index < this.meshes.length; index++) { var mesh = this.meshes[index]; if (!mesh.isReady()) { return false; } var mat = mesh.material; if (mat) { if (!mat.isReady(mesh)) { return false; } } } return true; }; Scene.prototype.resetCachedMaterial = function () { this._cachedMaterial = null; }; Scene.prototype.registerBeforeRender = function (func) { this._onBeforeRenderCallbacks.push(func); }; Scene.prototype.unregisterBeforeRender = function (func) { var index = this._onBeforeRenderCallbacks.indexOf(func); if (index > -1) { this._onBeforeRenderCallbacks.splice(index, 1); } }; Scene.prototype.registerAfterRender = function (func) { this._onAfterRenderCallbacks.push(func); }; Scene.prototype.unregisterAfterRender = function (func) { var index = this._onAfterRenderCallbacks.indexOf(func); if (index > -1) { this._onAfterRenderCallbacks.splice(index, 1); } }; Scene.prototype._addPendingData = function (data) { this._pendingData.push(data); }; Scene.prototype._removePendingData = function (data) { var index = this._pendingData.indexOf(data); if (index !== -1) { this._pendingData.splice(index, 1); } }; Scene.prototype.getWaitingItemsCount = function () { return this._pendingData.length; }; Scene.prototype.executeWhenReady = function (func) { var _this = this; this._onReadyCallbacks.push(func); if (this._executeWhenReadyTimeoutId !== -1) { return; } this._executeWhenReadyTimeoutId = setTimeout(function () { _this._checkIsReady(); }, 150); }; Scene.prototype._checkIsReady = function () { var _this = this; if (this.isReady()) { this._onReadyCallbacks.forEach(function (func) { func(); }); this._onReadyCallbacks = []; this._executeWhenReadyTimeoutId = -1; return; } this._executeWhenReadyTimeoutId = setTimeout(function () { _this._checkIsReady(); }, 150); }; // Animations Scene.prototype.beginAnimation = function (target, from, to, loop, speedRatio, onAnimationEnd, animatable) { if (speedRatio === undefined) { speedRatio = 1.0; } this.stopAnimation(target); if (!animatable) { animatable = new BABYLON.Animatable(this, target, from, to, loop, speedRatio, onAnimationEnd); } // Local animations if (target.animations) { animatable.appendAnimations(target, target.animations); } // Children animations if (target.getAnimatables) { var animatables = target.getAnimatables(); for (var index = 0; index < animatables.length; index++) { this.beginAnimation(animatables[index], from, to, loop, speedRatio, onAnimationEnd, animatable); } } return animatable; }; Scene.prototype.beginDirectAnimation = function (target, animations, from, to, loop, speedRatio, onAnimationEnd) { if (speedRatio === undefined) { speedRatio = 1.0; } var animatable = new BABYLON.Animatable(this, target, from, to, loop, speedRatio, onAnimationEnd, animations); return animatable; }; Scene.prototype.getAnimatableByTarget = function (target) { for (var index = 0; index < this._activeAnimatables.length; index++) { if (this._activeAnimatables[index].target === target) { return this._activeAnimatables[index]; } } return null; }; Scene.prototype.stopAnimation = function (target) { var animatable = this.getAnimatableByTarget(target); if (animatable) { animatable.stop(); } }; Scene.prototype._animate = function () { if (!this.animationsEnabled) { return; } if (!this._animationStartDate) { this._animationStartDate = BABYLON.Tools.Now; } // Getting time var now = BABYLON.Tools.Now; var delay = now - this._animationStartDate; for (var index = 0; index < this._activeAnimatables.length; index++) { if (!this._activeAnimatables[index]._animate(delay)) { this._activeAnimatables.splice(index, 1); index--; } } }; // Matrix Scene.prototype.getViewMatrix = function () { return this._viewMatrix; }; Scene.prototype.getProjectionMatrix = function () { return this._projectionMatrix; }; Scene.prototype.getTransformMatrix = function () { return this._transformMatrix; }; Scene.prototype.setTransformMatrix = function (view, projection) { this._viewMatrix = view; this._projectionMatrix = projection; this._viewMatrix.multiplyToRef(this._projectionMatrix, this._transformMatrix); }; // Methods Scene.prototype.setActiveCameraByID = function (id) { var camera = this.getCameraByID(id); if (camera) { this.activeCamera = camera; return camera; } return null; }; Scene.prototype.setActiveCameraByName = function (name) { var camera = this.getCameraByName(name); if (camera) { this.activeCamera = camera; return camera; } return null; }; Scene.prototype.getMaterialByID = function (id) { for (var index = 0; index < this.materials.length; index++) { if (this.materials[index].id === id) { return this.materials[index]; } } return null; }; Scene.prototype.getMaterialByName = function (name) { for (var index = 0; index < this.materials.length; index++) { if (this.materials[index].name === name) { return this.materials[index]; } } return null; }; Scene.prototype.getCameraByID = function (id) { for (var index = 0; index < this.cameras.length; index++) { if (this.cameras[index].id === id) { return this.cameras[index]; } } return null; }; Scene.prototype.getCameraByName = function (name) { for (var index = 0; index < this.cameras.length; index++) { if (this.cameras[index].name === name) { return this.cameras[index]; } } return null; }; Scene.prototype.getLightByName = function (name) { for (var index = 0; index < this.lights.length; index++) { if (this.lights[index].name === name) { return this.lights[index]; } } return null; }; Scene.prototype.getLightByID = function (id) { for (var index = 0; index < this.lights.length; index++) { if (this.lights[index].id === id) { return this.lights[index]; } } return null; }; Scene.prototype.getGeometryByID = function (id) { for (var index = 0; index < this._geometries.length; index++) { if (this._geometries[index].id === id) { return this._geometries[index]; } } return null; }; Scene.prototype.pushGeometry = function (geometry, force) { if (!force && this.getGeometryByID(geometry.id)) { return false; } this._geometries.push(geometry); return true; }; Scene.prototype.getGeometries = function () { return this._geometries; }; Scene.prototype.getMeshByID = function (id) { for (var index = 0; index < this.meshes.length; index++) { if (this.meshes[index].id === id) { return this.meshes[index]; } } return null; }; Scene.prototype.getLastMeshByID = function (id) { for (var index = this.meshes.length - 1; index >= 0; index--) { if (this.meshes[index].id === id) { return this.meshes[index]; } } return null; }; Scene.prototype.getLastEntryByID = function (id) { for (var index = this.meshes.length - 1; index >= 0; index--) { if (this.meshes[index].id === id) { return this.meshes[index]; } } for (index = this.cameras.length - 1; index >= 0; index--) { if (this.cameras[index].id === id) { return this.cameras[index]; } } for (index = this.lights.length - 1; index >= 0; index--) { if (this.lights[index].id === id) { return this.lights[index]; } } return null; }; Scene.prototype.getNodeByName = function (name) { var mesh = this.getMeshByName(name); if (mesh) { return mesh; } var light = this.getLightByName(name); if (light) { return light; } return this.getCameraByName(name); }; Scene.prototype.getMeshByName = function (name) { for (var index = 0; index < this.meshes.length; index++) { if (this.meshes[index].name === name) { return this.meshes[index]; } } return null; }; Scene.prototype.getLastSkeletonByID = function (id) { for (var index = this.skeletons.length - 1; index >= 0; index--) { if (this.skeletons[index].id === id) { return this.skeletons[index]; } } return null; }; Scene.prototype.getSkeletonById = function (id) { for (var index = 0; index < this.skeletons.length; index++) { if (this.skeletons[index].id === id) { return this.skeletons[index]; } } return null; }; Scene.prototype.getSkeletonByName = function (name) { for (var index = 0; index < this.skeletons.length; index++) { if (this.skeletons[index].name === name) { return this.skeletons[index]; } } return null; }; Scene.prototype.isActiveMesh = function (mesh) { return (this._activeMeshes.indexOf(mesh) !== -1); }; Scene.prototype._evaluateSubMesh = function (subMesh, mesh) { if (mesh.subMeshes.length === 1 || subMesh.isInFrustum(this._frustumPlanes)) { var material = subMesh.getMaterial(); if (mesh.showSubMeshesBoundingBox) { this._boundingBoxRenderer.renderList.push(subMesh.getBoundingInfo().boundingBox); } if (material) { // Render targets if (material.getRenderTargetTextures) { if (this._processedMaterials.indexOf(material) === -1) { this._processedMaterials.push(material); this._renderTargets.concat(material.getRenderTargetTextures()); } } // Dispatch this._activeVertices += subMesh.indexCount; this._renderingManager.dispatch(subMesh); } } }; Scene.prototype._evaluateActiveMeshes = function () { this._activeMeshes.reset(); this._renderingManager.reset(); this._processedMaterials.reset(); this._activeParticleSystems.reset(); this._activeSkeletons.reset(); this._boundingBoxRenderer.reset(); if (!this._frustumPlanes) { this._frustumPlanes = BABYLON.Frustum.GetPlanes(this._transformMatrix); } else { BABYLON.Frustum.GetPlanesToRef(this._transformMatrix, this._frustumPlanes); } // Meshes var meshes; var len; if (this._selectionOctree) { var selection = this._selectionOctree.select(this._frustumPlanes); meshes = selection.data; len = selection.length; } else { len = this.meshes.length; meshes = this.meshes; } for (var meshIndex = 0; meshIndex < len; meshIndex++) { var mesh = meshes[meshIndex]; if (mesh.isBlocked) { continue; } this._totalVertices += mesh.getTotalVertices(); if (!mesh.isReady()) { continue; } mesh.computeWorldMatrix(); // Intersections if (mesh.actionManager && mesh.actionManager.hasSpecificTriggers([BABYLON.ActionManager.OnIntersectionEnterTrigger, BABYLON.ActionManager.OnIntersectionExitTrigger])) { this._meshesForIntersections.pushNoDuplicate(mesh); } // Switch to current LOD var meshLOD = mesh.getLOD(this.activeCamera); if (!meshLOD) { continue; } mesh._preActivate(); if (mesh.isEnabled() && mesh.isVisible && mesh.visibility > 0 && ((mesh.layerMask & this.activeCamera.layerMask) !== 0) && mesh.isInFrustum(this._frustumPlanes)) { this._activeMeshes.push(mesh); mesh._activate(this._renderId); this._activeMesh(meshLOD); } } // Particle systems var beforeParticlesDate = BABYLON.Tools.Now; if (this.particlesEnabled) { BABYLON.Tools.StartPerformanceCounter("Particles", this.particleSystems.length > 0); for (var particleIndex = 0; particleIndex < this.particleSystems.length; particleIndex++) { var particleSystem = this.particleSystems[particleIndex]; if (!particleSystem.isStarted()) { continue; } if (!particleSystem.emitter.position || (particleSystem.emitter && particleSystem.emitter.isEnabled())) { this._activeParticleSystems.push(particleSystem); particleSystem.animate(); } } BABYLON.Tools.EndPerformanceCounter("Particles", this.particleSystems.length > 0); } this._particlesDuration += BABYLON.Tools.Now - beforeParticlesDate; }; Scene.prototype._activeMesh = function (mesh) { if (mesh.skeleton && this.skeletonsEnabled) { this._activeSkeletons.pushNoDuplicate(mesh.skeleton); } if (mesh.showBoundingBox || this.forceShowBoundingBoxes) { this._boundingBoxRenderer.renderList.push(mesh.getBoundingInfo().boundingBox); } if (mesh && mesh.subMeshes) { // Submeshes Octrees var len; var subMeshes; if (mesh._submeshesOctree && mesh.useOctreeForRenderingSelection) { var intersections = mesh._submeshesOctree.select(this._frustumPlanes); len = intersections.length; subMeshes = intersections.data; } else { subMeshes = mesh.subMeshes; len = subMeshes.length; } for (var subIndex = 0; subIndex < len; subIndex++) { var subMesh = subMeshes[subIndex]; this._evaluateSubMesh(subMesh, mesh); } } }; Scene.prototype.updateTransformMatrix = function (force) { this.setTransformMatrix(this.activeCamera.getViewMatrix(), this.activeCamera.getProjectionMatrix(force)); }; Scene.prototype._renderForCamera = function (camera) { var engine = this._engine; this.activeCamera = camera; if (!this.activeCamera) throw new Error("Active camera not set"); BABYLON.Tools.StartPerformanceCounter("Rendering camera " + this.activeCamera.name); // Viewport engine.setViewport(this.activeCamera.viewport); // Camera this._renderId++; this.updateTransformMatrix(); if (this.beforeCameraRender) { this.beforeCameraRender(this.activeCamera); } // Meshes var beforeEvaluateActiveMeshesDate = BABYLON.Tools.Now; BABYLON.Tools.StartPerformanceCounter("Active meshes evaluation"); this._evaluateActiveMeshes(); this._evaluateActiveMeshesDuration += BABYLON.Tools.Now - beforeEvaluateActiveMeshesDate; BABYLON.Tools.EndPerformanceCounter("Active meshes evaluation"); for (var skeletonIndex = 0; skeletonIndex < this._activeSkeletons.length; skeletonIndex++) { var skeleton = this._activeSkeletons.data[skeletonIndex]; skeleton.prepare(); this._activeBones += skeleton.bones.length; } // Render targets var beforeRenderTargetDate = BABYLON.Tools.Now; if (this.renderTargetsEnabled) { BABYLON.Tools.StartPerformanceCounter("Render targets", this._renderTargets.length > 0); for (var renderIndex = 0; renderIndex < this._renderTargets.length; renderIndex++) { var renderTarget = this._renderTargets.data[renderIndex]; if (renderTarget._shouldRender()) { this._renderId++; renderTarget.render(); } } BABYLON.Tools.EndPerformanceCounter("Render targets", this._renderTargets.length > 0); this._renderId++; } if (this._renderTargets.length > 0) { engine.restoreDefaultFramebuffer(); } this._renderTargetsDuration += BABYLON.Tools.Now - beforeRenderTargetDate; // Prepare Frame this.postProcessManager._prepareFrame(); var beforeRenderDate = BABYLON.Tools.Now; // Backgrounds if (this.layers.length) { engine.setDepthBuffer(false); var layerIndex; var layer; for (layerIndex = 0; layerIndex < this.layers.length; layerIndex++) { layer = this.layers[layerIndex]; if (layer.isBackground) { layer.render(); } } engine.setDepthBuffer(true); } // Render BABYLON.Tools.StartPerformanceCounter("Main render"); this._renderingManager.render(null, null, true, true); BABYLON.Tools.EndPerformanceCounter("Main render"); // Bounding boxes this._boundingBoxRenderer.render(); // Lens flares if (this.lensFlaresEnabled) { BABYLON.Tools.StartPerformanceCounter("Lens flares", this.lensFlareSystems.length > 0); for (var lensFlareSystemIndex = 0; lensFlareSystemIndex < this.lensFlareSystems.length; lensFlareSystemIndex++) { this.lensFlareSystems[lensFlareSystemIndex].render(); } BABYLON.Tools.EndPerformanceCounter("Lens flares", this.lensFlareSystems.length > 0); } // Foregrounds if (this.layers.length) { engine.setDepthBuffer(false); for (layerIndex = 0; layerIndex < this.layers.length; layerIndex++) { layer = this.layers[layerIndex]; if (!layer.isBackground) { layer.render(); } } engine.setDepthBuffer(true); } this._renderDuration += BABYLON.Tools.Now - beforeRenderDate; // Finalize frame this.postProcessManager._finalizeFrame(camera.isIntermediate); // Update camera this.activeCamera._updateFromScene(); // Reset some special arrays this._renderTargets.reset(); if (this.afterCameraRender) { this.afterCameraRender(this.activeCamera); } BABYLON.Tools.EndPerformanceCounter("Rendering camera " + this.activeCamera.name); }; Scene.prototype._processSubCameras = function (camera) { if (camera.subCameras.length === 0) { this._renderForCamera(camera); return; } for (var index = 0; index < camera.subCameras.length; index++) { this._renderForCamera(camera.subCameras[index]); } this.activeCamera = camera; this.setTransformMatrix(this.activeCamera.getViewMatrix(), this.activeCamera.getProjectionMatrix()); // Update camera this.activeCamera._updateFromScene(); }; Scene.prototype._checkIntersections = function () { for (var index = 0; index < this._meshesForIntersections.length; index++) { var sourceMesh = this._meshesForIntersections.data[index]; for (var actionIndex = 0; actionIndex < sourceMesh.actionManager.actions.length; actionIndex++) { var action = sourceMesh.actionManager.actions[actionIndex]; if (action.trigger === BABYLON.ActionManager.OnIntersectionEnterTrigger || action.trigger === BABYLON.ActionManager.OnIntersectionExitTrigger) { var otherMesh = action.getTriggerParameter(); var areIntersecting = otherMesh.intersectsMesh(sourceMesh, false); var currentIntersectionInProgress = sourceMesh._intersectionsInProgress.indexOf(otherMesh); if (areIntersecting && currentIntersectionInProgress === -1 && action.trigger === BABYLON.ActionManager.OnIntersectionEnterTrigger) { action._executeCurrent(BABYLON.ActionEvent.CreateNew(sourceMesh)); sourceMesh._intersectionsInProgress.push(otherMesh); } else if (!areIntersecting && currentIntersectionInProgress > -1 && action.trigger === BABYLON.ActionManager.OnIntersectionExitTrigger) { action._executeCurrent(BABYLON.ActionEvent.CreateNew(sourceMesh)); var indexOfOther = sourceMesh._intersectionsInProgress.indexOf(otherMesh); if (indexOfOther > -1) { sourceMesh._intersectionsInProgress.splice(indexOfOther, 1); } } } } } }; Scene.prototype.render = function () { var startDate = BABYLON.Tools.Now; this._particlesDuration = 0; this._spritesDuration = 0; this._activeParticles = 0; this._renderDuration = 0; this._renderTargetsDuration = 0; this._evaluateActiveMeshesDuration = 0; this._totalVertices = 0; this._activeVertices = 0; this._activeBones = 0; this.getEngine().resetDrawCalls(); this._meshesForIntersections.reset(); this.resetCachedMaterial(); BABYLON.Tools.StartPerformanceCounter("Scene rendering"); // Actions if (this.actionManager) { this.actionManager.processTrigger(BABYLON.ActionManager.OnEveryFrameTrigger, null); } // Before render if (this.beforeRender) { this.beforeRender(); } for (var callbackIndex = 0; callbackIndex < this._onBeforeRenderCallbacks.length; callbackIndex++) { this._onBeforeRenderCallbacks[callbackIndex](); } // Animations var deltaTime = Math.max(Scene.MinDeltaTime, Math.min(this._engine.getDeltaTime(), Scene.MaxDeltaTime)); this._animationRatio = deltaTime * (60.0 / 1000.0); this._animate(); // Physics if (this._physicsEngine) { BABYLON.Tools.StartPerformanceCounter("Physics"); this._physicsEngine._runOneStep(deltaTime / 1000.0); BABYLON.Tools.EndPerformanceCounter("Physics"); } // Customs render targets var beforeRenderTargetDate = BABYLON.Tools.Now; var engine = this.getEngine(); if (this.renderTargetsEnabled) { BABYLON.Tools.StartPerformanceCounter("Custom render targets", this.customRenderTargets.length > 0); for (var customIndex = 0; customIndex < this.customRenderTargets.length; customIndex++) { var renderTarget = this.customRenderTargets[customIndex]; if (renderTarget._shouldRender()) { this._renderId++; this.activeCamera = renderTarget.activeCamera || this.activeCamera; if (!this.activeCamera) throw new Error("Active camera not set"); // Viewport engine.setViewport(this.activeCamera.viewport); // Camera this.updateTransformMatrix(); renderTarget.render(); } } BABYLON.Tools.EndPerformanceCounter("Custom render targets", this.customRenderTargets.length > 0); this._renderId++; } if (this.customRenderTargets.length > 0) { engine.restoreDefaultFramebuffer(); } this._renderTargetsDuration += BABYLON.Tools.Now - beforeRenderTargetDate; // Procedural textures if (this.proceduralTexturesEnabled) { BABYLON.Tools.StartPerformanceCounter("Procedural textures", this._proceduralTextures.length > 0); for (var proceduralIndex = 0; proceduralIndex < this._proceduralTextures.length; proceduralIndex++) { var proceduralTexture = this._proceduralTextures[proceduralIndex]; if (proceduralTexture._shouldRender()) { proceduralTexture.render(); } } BABYLON.Tools.EndPerformanceCounter("Procedural textures", this._proceduralTextures.length > 0); } // Clear this._engine.clear(this.clearColor, this.autoClear || this.forceWireframe || this.forcePointsCloud, true); // Shadows if (this.shadowsEnabled) { for (var lightIndex = 0; lightIndex < this.lights.length; lightIndex++) { var light = this.lights[lightIndex]; var shadowGenerator = light.getShadowGenerator(); if (light.isEnabled() && shadowGenerator && shadowGenerator.getShadowMap().getScene().textures.indexOf(shadowGenerator.getShadowMap()) !== -1) { this._renderTargets.push(shadowGenerator.getShadowMap()); } } } // RenderPipeline this.postProcessRenderPipelineManager.update(); // Multi-cameras? if (this.activeCameras.length > 0) { var currentRenderId = this._renderId; for (var cameraIndex = 0; cameraIndex < this.activeCameras.length; cameraIndex++) { this._renderId = currentRenderId; this._processSubCameras(this.activeCameras[cameraIndex]); } } else { if (!this.activeCamera) { throw new Error("No camera defined"); } this._processSubCameras(this.activeCamera); } // Intersection checks this._checkIntersections(); // Update the audio listener attached to the camera this._updateAudioParameters(); // After render if (this.afterRender) { this.afterRender(); } for (callbackIndex = 0; callbackIndex < this._onAfterRenderCallbacks.length; callbackIndex++) { this._onAfterRenderCallbacks[callbackIndex](); } for (var index = 0; index < this._toBeDisposed.length; index++) { this._toBeDisposed.data[index].dispose(); this._toBeDisposed[index] = null; } this._toBeDisposed.reset(); BABYLON.Tools.EndPerformanceCounter("Scene rendering"); this._lastFrameDuration = BABYLON.Tools.Now - startDate; }; Scene.prototype._updateAudioParameters = function () { var listeningCamera; var audioEngine = this._engine.getAudioEngine(); if (this.activeCameras.length > 0) { listeningCamera = this.activeCameras[0]; } else { listeningCamera = this.activeCamera; } if (listeningCamera && audioEngine.canUseWebAudio) { audioEngine.audioContext.listener.setPosition(listeningCamera.position.x, listeningCamera.position.y, listeningCamera.position.z); var mat = BABYLON.Matrix.Invert(listeningCamera.getViewMatrix()); var cameraDirection = BABYLON.Vector3.TransformNormal(new BABYLON.Vector3(0, 0, -1), mat); cameraDirection.normalize(); audioEngine.audioContext.listener.setOrientation(cameraDirection.x, cameraDirection.y, cameraDirection.z, 0, 1, 0); for (var i = 0; i < this.mainSoundTrack.soundCollection.length; i++) { var sound = this.mainSoundTrack.soundCollection[i]; if (sound.useCustomAttenuation) { sound.updateDistanceFromListener(); } } for (var i = 0; i < this.soundTracks.length; i++) { for (var j = 0; j < this.soundTracks[i].soundCollection.length; j++) { var sound = this.soundTracks[i].soundCollection[j]; if (sound.useCustomAttenuation) { sound.updateDistanceFromListener(); } } } } }; Scene.prototype.dispose = function () { this.beforeRender = null; this.afterRender = null; this.skeletons = []; this._boundingBoxRenderer.dispose(); // Debug layer this.debugLayer.hide(); // Events if (this.onDispose) { this.onDispose(); } this._onBeforeRenderCallbacks = []; this._onAfterRenderCallbacks = []; this.detachControl(); // Detach cameras var canvas = this._engine.getRenderingCanvas(); var index; for (index = 0; index < this.cameras.length; index++) { this.cameras[index].detachControl(canvas); } while (this.lights.length) { this.lights[0].dispose(); } while (this.meshes.length) { this.meshes[0].dispose(true); } while (this.cameras.length) { this.cameras[0].dispose(); } while (this.materials.length) { this.materials[0].dispose(); } while (this.particleSystems.length) { this.particleSystems[0].dispose(); } while (this.spriteManagers.length) { this.spriteManagers[0].dispose(); } while (this.layers.length) { this.layers[0].dispose(); } while (this.textures.length) { this.textures[0].dispose(); } // Post-processes this.postProcessManager.dispose(); // Physics if (this._physicsEngine) { this.disablePhysicsEngine(); } // Remove from engine index = this._engine.scenes.indexOf(this); if (index > -1) { this._engine.scenes.splice(index, 1); } this._engine.wipeCaches(); }; // Collisions Scene.prototype._getNewPosition = function (position, velocity, collider, maximumRetry, finalPosition, excludedMesh) { if (typeof excludedMesh === "undefined") { excludedMesh = null; } position.divideToRef(collider.radius, this._scaledPosition); velocity.divideToRef(collider.radius, this._scaledVelocity); collider.retry = 0; collider.initialVelocity = this._scaledVelocity; collider.initialPosition = this._scaledPosition; this._collideWithWorld(this._scaledPosition, this._scaledVelocity, collider, maximumRetry, finalPosition, excludedMesh); finalPosition.multiplyInPlace(collider.radius); }; Scene.prototype._collideWithWorld = function (position, velocity, collider, maximumRetry, finalPosition, excludedMesh) { if (typeof excludedMesh === "undefined") { excludedMesh = null; } var closeDistance = BABYLON.Engine.CollisionsEpsilon * 10.0; if (collider.retry >= maximumRetry) { finalPosition.copyFrom(position); return; } collider._initialize(position, velocity, closeDistance); for (var index = 0; index < this.meshes.length; index++) { var mesh = this.meshes[index]; if (mesh.isEnabled() && mesh.checkCollisions && mesh.subMeshes && mesh !== excludedMesh) { mesh._checkCollision(collider); } } if (!collider.collisionFound) { position.addToRef(velocity, finalPosition); return; } if (velocity.x !== 0 || velocity.y !== 0 || velocity.z !== 0) { collider._getResponse(position, velocity); } if (velocity.length() <= closeDistance) { finalPosition.copyFrom(position); return; } collider.retry++; this._collideWithWorld(position, velocity, collider, maximumRetry, finalPosition, excludedMesh); }; // Octrees Scene.prototype.createOrUpdateSelectionOctree = function (maxCapacity, maxDepth) { if (typeof maxCapacity === "undefined") { maxCapacity = 64; } if (typeof maxDepth === "undefined") { maxDepth = 2; } if (!this._selectionOctree) { this._selectionOctree = new BABYLON.Octree(BABYLON.Octree.CreationFuncForMeshes, maxCapacity, maxDepth); } var min = new BABYLON.Vector3(Number.MAX_VALUE, Number.MAX_VALUE, Number.MAX_VALUE); var max = new BABYLON.Vector3(-Number.MAX_VALUE, -Number.MAX_VALUE, -Number.MAX_VALUE); for (var index = 0; index < this.meshes.length; index++) { var mesh = this.meshes[index]; mesh.computeWorldMatrix(true); var minBox = mesh.getBoundingInfo().boundingBox.minimumWorld; var maxBox = mesh.getBoundingInfo().boundingBox.maximumWorld; BABYLON.Tools.CheckExtends(minBox, min, max); BABYLON.Tools.CheckExtends(maxBox, min, max); } // Update octree this._selectionOctree.update(min, max, this.meshes); return this._selectionOctree; }; // Picking Scene.prototype.createPickingRay = function (x, y, world, camera) { var engine = this._engine; if (!camera) { if (!this.activeCamera) throw new Error("Active camera not set"); camera = this.activeCamera; } var cameraViewport = camera.viewport; var viewport = cameraViewport.toGlobal(engine); // Moving coordinates to local viewport world x = x / this._engine.getHardwareScalingLevel() - viewport.x; y = y / this._engine.getHardwareScalingLevel() - (this._engine.getRenderHeight() - viewport.y - viewport.height); return BABYLON.Ray.CreateNew(x, y, viewport.width, viewport.height, world ? world : BABYLON.Matrix.Identity(), camera.getViewMatrix(), camera.getProjectionMatrix()); // return BABYLON.Ray.CreateNew(x / window.devicePixelRatio, y / window.devicePixelRatio, viewport.width, viewport.height, world ? world : BABYLON.Matrix.Identity(), camera.getViewMatrix(), camera.getProjectionMatrix()); }; Scene.prototype._internalPick = function (rayFunction, predicate, fastCheck) { var pickingInfo = null; for (var meshIndex = 0; meshIndex < this.meshes.length; meshIndex++) { var mesh = this.meshes[meshIndex]; if (predicate) { if (!predicate(mesh)) { continue; } } else if (!mesh.isEnabled() || !mesh.isVisible || !mesh.isPickable) { continue; } var world = mesh.getWorldMatrix(); var ray = rayFunction(world); var result = mesh.intersects(ray, fastCheck); if (!result || !result.hit) continue; if (!fastCheck && pickingInfo != null && result.distance >= pickingInfo.distance) continue; pickingInfo = result; if (fastCheck) { break; } } return pickingInfo || new BABYLON.PickingInfo(); }; Scene.prototype.pick = function (x, y, predicate, fastCheck, camera) { var _this = this; /// Launch a ray to try to pick a mesh in the scene /// X position on screen /// Y position on screen /// Predicate function used to determine eligible meshes. Can be set to null. In this case, a mesh must be enabled, visible and with isPickable set to true /// Launch a fast check only using the bounding boxes. Can be set to null. /// camera to use for computing the picking ray. Can be set to null. In this case, the scene.activeCamera will be used return this._internalPick(function (world) { return _this.createPickingRay(x, y, world, camera); }, predicate, fastCheck); }; Scene.prototype.pickWithRay = function (ray, predicate, fastCheck) { var _this = this; return this._internalPick(function (world) { if (!_this._pickWithRayInverseMatrix) { _this._pickWithRayInverseMatrix = BABYLON.Matrix.Identity(); } world.invertToRef(_this._pickWithRayInverseMatrix); return BABYLON.Ray.Transform(ray, _this._pickWithRayInverseMatrix); }, predicate, fastCheck); }; Scene.prototype.setPointerOverMesh = function (mesh) { if (this._pointerOverMesh === mesh) { return; } if (this._pointerOverMesh && this._pointerOverMesh.actionManager) { this._pointerOverMesh.actionManager.processTrigger(BABYLON.ActionManager.OnPointerOutTrigger, BABYLON.ActionEvent.CreateNew(this._pointerOverMesh)); } this._pointerOverMesh = mesh; if (this._pointerOverMesh && this._pointerOverMesh.actionManager) { this._pointerOverMesh.actionManager.processTrigger(BABYLON.ActionManager.OnPointerOverTrigger, BABYLON.ActionEvent.CreateNew(this._pointerOverMesh)); } }; Scene.prototype.getPointerOverMesh = function () { return this._pointerOverMesh; }; // Physics Scene.prototype.getPhysicsEngine = function () { return this._physicsEngine; }; Scene.prototype.enablePhysics = function (gravity, plugin) { if (this._physicsEngine) { return true; } this._physicsEngine = new BABYLON.PhysicsEngine(plugin); if (!this._physicsEngine.isSupported()) { this._physicsEngine = null; return false; } this._physicsEngine._initialize(gravity); return true; }; Scene.prototype.disablePhysicsEngine = function () { if (!this._physicsEngine) { return; } this._physicsEngine.dispose(); this._physicsEngine = undefined; }; Scene.prototype.isPhysicsEnabled = function () { return this._physicsEngine !== undefined; }; Scene.prototype.setGravity = function (gravity) { if (!this._physicsEngine) { return; } this._physicsEngine._setGravity(gravity); }; Scene.prototype.createCompoundImpostor = function (parts, options) { if (parts.parts) { options = parts; parts = parts.parts; } if (!this._physicsEngine) { return null; } for (var index = 0; index < parts.length; index++) { var mesh = parts[index].mesh; mesh._physicImpostor = parts[index].impostor; mesh._physicsMass = options.mass / parts.length; mesh._physicsFriction = options.friction; mesh._physicRestitution = options.restitution; } return this._physicsEngine._registerMeshesAsCompound(parts, options); }; //ANY Scene.prototype.deleteCompoundImpostor = function (compound) { for (var index = 0; index < compound.parts.length; index++) { var mesh = compound.parts[index].mesh; mesh._physicImpostor = BABYLON.PhysicsEngine.NoImpostor; this._physicsEngine._unregisterMesh(mesh); } }; // Tags Scene.prototype._getByTags = function (list, tagsQuery) { if (tagsQuery === undefined) { // returns the complete list (could be done with BABYLON.Tags.MatchesQuery but no need to have a for-loop here) return list; } var listByTags = []; for (var i in list) { var item = list[i]; if (BABYLON.Tags.MatchesQuery(item, tagsQuery)) { listByTags.push(item); } } return listByTags; }; Scene.prototype.getMeshesByTags = function (tagsQuery) { return this._getByTags(this.meshes, tagsQuery); }; Scene.prototype.getCamerasByTags = function (tagsQuery) { return this._getByTags(this.cameras, tagsQuery); }; Scene.prototype.getLightsByTags = function (tagsQuery) { return this._getByTags(this.lights, tagsQuery); }; Scene.prototype.getMaterialByTags = function (tagsQuery) { return this._getByTags(this.materials, tagsQuery).concat(this._getByTags(this.multiMaterials, tagsQuery)); }; Scene.FOGMODE_NONE = 0; Scene.FOGMODE_EXP = 1; Scene.FOGMODE_EXP2 = 2; Scene.FOGMODE_LINEAR = 3; Scene.MinDeltaTime = 1.0; Scene.MaxDeltaTime = 1000.0; return Scene; })(); BABYLON.Scene = Scene; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.scene.js.map var BABYLON; (function (BABYLON) { var VertexBuffer = (function () { function VertexBuffer(engine, data, kind, updatable, postponeInternalCreation, stride) { if (engine instanceof BABYLON.Mesh) { this._engine = engine.getScene().getEngine(); } else { this._engine = engine; } this._updatable = updatable; this._data = data; if (!postponeInternalCreation) { this.create(); } this._kind = kind; if (stride) { this._strideSize = stride; return; } switch (kind) { case VertexBuffer.PositionKind: this._strideSize = 3; break; case VertexBuffer.NormalKind: this._strideSize = 3; break; case VertexBuffer.UVKind: this._strideSize = 2; break; case VertexBuffer.UV2Kind: this._strideSize = 2; break; case VertexBuffer.ColorKind: this._strideSize = 4; break; case VertexBuffer.MatricesIndicesKind: this._strideSize = 4; break; case VertexBuffer.MatricesWeightsKind: this._strideSize = 4; break; } } // Properties VertexBuffer.prototype.isUpdatable = function () { return this._updatable; }; VertexBuffer.prototype.getData = function () { return this._data; }; VertexBuffer.prototype.getBuffer = function () { return this._buffer; }; VertexBuffer.prototype.getStrideSize = function () { return this._strideSize; }; // Methods VertexBuffer.prototype.create = function (data) { if (!data && this._buffer) { return; } data = data || this._data; if (!this._buffer) { if (this._updatable) { this._buffer = this._engine.createDynamicVertexBuffer(data.length * 4); } else { this._buffer = this._engine.createVertexBuffer(data); } } if (this._updatable) { this._engine.updateDynamicVertexBuffer(this._buffer, data); this._data = data; } }; VertexBuffer.prototype.update = function (data) { this.create(data); }; VertexBuffer.prototype.updateDirectly = function (data, offset) { if (!this._buffer) { return; } if (this._updatable) { this._engine.updateDynamicVertexBuffer(this._buffer, data, offset); this._data = null; } }; VertexBuffer.prototype.dispose = function () { if (!this._buffer) { return; } if (this._engine._releaseBuffer(this._buffer)) { this._buffer = null; } }; Object.defineProperty(VertexBuffer, "PositionKind", { get: function () { return VertexBuffer._PositionKind; }, enumerable: true, configurable: true }); Object.defineProperty(VertexBuffer, "NormalKind", { get: function () { return VertexBuffer._NormalKind; }, enumerable: true, configurable: true }); Object.defineProperty(VertexBuffer, "UVKind", { get: function () { return VertexBuffer._UVKind; }, enumerable: true, configurable: true }); Object.defineProperty(VertexBuffer, "UV2Kind", { get: function () { return VertexBuffer._UV2Kind; }, enumerable: true, configurable: true }); Object.defineProperty(VertexBuffer, "ColorKind", { get: function () { return VertexBuffer._ColorKind; }, enumerable: true, configurable: true }); Object.defineProperty(VertexBuffer, "MatricesIndicesKind", { get: function () { return VertexBuffer._MatricesIndicesKind; }, enumerable: true, configurable: true }); Object.defineProperty(VertexBuffer, "MatricesWeightsKind", { get: function () { return VertexBuffer._MatricesWeightsKind; }, enumerable: true, configurable: true }); VertexBuffer._PositionKind = "position"; VertexBuffer._NormalKind = "normal"; VertexBuffer._UVKind = "uv"; VertexBuffer._UV2Kind = "uv2"; VertexBuffer._ColorKind = "color"; VertexBuffer._MatricesIndicesKind = "matricesIndices"; VertexBuffer._MatricesWeightsKind = "matricesWeights"; return VertexBuffer; })(); BABYLON.VertexBuffer = VertexBuffer; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.vertexBuffer.js.map var BABYLON; (function (BABYLON) { var AbstractMesh = (function (_super) { __extends(AbstractMesh, _super); function AbstractMesh(name, scene) { _super.call(this, name, scene); // Properties this.position = new BABYLON.Vector3(0, 0, 0); this.rotation = new BABYLON.Vector3(0, 0, 0); this.scaling = new BABYLON.Vector3(1, 1, 1); this.billboardMode = AbstractMesh.BILLBOARDMODE_NONE; this.visibility = 1.0; this.alphaIndex = Number.MAX_VALUE; this.infiniteDistance = false; this.isVisible = true; this.isPickable = true; this.showBoundingBox = false; this.showSubMeshesBoundingBox = false; this.onDispose = null; this.checkCollisions = false; this.isBlocker = false; this.renderingGroupId = 0; this.receiveShadows = false; this.renderOutline = false; this.outlineColor = BABYLON.Color3.Red(); this.outlineWidth = 0.02; this.renderOverlay = false; this.overlayColor = BABYLON.Color3.Red(); this.overlayAlpha = 0.5; this.hasVertexAlpha = false; this.useVertexColors = true; this.applyFog = true; this.useOctreeForRenderingSelection = true; this.useOctreeForPicking = true; this.useOctreeForCollisions = true; this.layerMask = 0xFFFFFFFF; // Physics this._physicImpostor = BABYLON.PhysicsEngine.NoImpostor; // Collisions this.ellipsoid = new BABYLON.Vector3(0.5, 1, 0.5); this.ellipsoidOffset = new BABYLON.Vector3(0, 0, 0); this._collider = new BABYLON.Collider(); this._oldPositionForCollisions = new BABYLON.Vector3(0, 0, 0); this._diffPositionForCollisions = new BABYLON.Vector3(0, 0, 0); this._newPositionForCollisions = new BABYLON.Vector3(0, 0, 0); // Cache this._localScaling = BABYLON.Matrix.Zero(); this._localRotation = BABYLON.Matrix.Zero(); this._localTranslation = BABYLON.Matrix.Zero(); this._localBillboard = BABYLON.Matrix.Zero(); this._localPivotScaling = BABYLON.Matrix.Zero(); this._localPivotScalingRotation = BABYLON.Matrix.Zero(); this._localWorld = BABYLON.Matrix.Zero(); this._worldMatrix = BABYLON.Matrix.Zero(); this._rotateYByPI = BABYLON.Matrix.RotationY(Math.PI); this._absolutePosition = BABYLON.Vector3.Zero(); this._collisionsTransformMatrix = BABYLON.Matrix.Zero(); this._collisionsScalingMatrix = BABYLON.Matrix.Zero(); this._isDirty = false; this._pivotMatrix = BABYLON.Matrix.Identity(); this._isDisposed = false; this._renderId = 0; this._intersectionsInProgress = new Array(); this._onAfterWorldMatrixUpdate = new Array(); scene.meshes.push(this); } Object.defineProperty(AbstractMesh, "BILLBOARDMODE_NONE", { get: function () { return AbstractMesh._BILLBOARDMODE_NONE; }, enumerable: true, configurable: true }); Object.defineProperty(AbstractMesh, "BILLBOARDMODE_X", { get: function () { return AbstractMesh._BILLBOARDMODE_X; }, enumerable: true, configurable: true }); Object.defineProperty(AbstractMesh, "BILLBOARDMODE_Y", { get: function () { return AbstractMesh._BILLBOARDMODE_Y; }, enumerable: true, configurable: true }); Object.defineProperty(AbstractMesh, "BILLBOARDMODE_Z", { get: function () { return AbstractMesh._BILLBOARDMODE_Z; }, enumerable: true, configurable: true }); Object.defineProperty(AbstractMesh, "BILLBOARDMODE_ALL", { get: function () { return AbstractMesh._BILLBOARDMODE_ALL; }, enumerable: true, configurable: true }); Object.defineProperty(AbstractMesh.prototype, "isBlocked", { // Methods get: function () { return false; }, enumerable: true, configurable: true }); AbstractMesh.prototype.getLOD = function (camera) { return this; }; AbstractMesh.prototype.getTotalVertices = function () { return 0; }; AbstractMesh.prototype.getIndices = function () { return null; }; AbstractMesh.prototype.getVerticesData = function (kind) { return null; }; AbstractMesh.prototype.isVerticesDataPresent = function (kind) { return false; }; AbstractMesh.prototype.getBoundingInfo = function () { if (this._masterMesh) { return this._masterMesh.getBoundingInfo(); } if (!this._boundingInfo) { this._updateBoundingInfo(); } return this._boundingInfo; }; AbstractMesh.prototype._preActivate = function () { }; AbstractMesh.prototype._activate = function (renderId) { this._renderId = renderId; }; AbstractMesh.prototype.getWorldMatrix = function () { if (this._masterMesh) { return this._masterMesh.getWorldMatrix(); } if (this._currentRenderId !== this.getScene().getRenderId()) { this.computeWorldMatrix(); } return this._worldMatrix; }; Object.defineProperty(AbstractMesh.prototype, "worldMatrixFromCache", { get: function () { return this._worldMatrix; }, enumerable: true, configurable: true }); Object.defineProperty(AbstractMesh.prototype, "absolutePosition", { get: function () { return this._absolutePosition; }, enumerable: true, configurable: true }); AbstractMesh.prototype.rotate = function (axis, amount, space) { if (!this.rotationQuaternion) { this.rotationQuaternion = BABYLON.Quaternion.RotationYawPitchRoll(this.rotation.y, this.rotation.x, this.rotation.z); this.rotation = BABYLON.Vector3.Zero(); } if (!space || space == 0 /* LOCAL */) { var rotationQuaternion = BABYLON.Quaternion.RotationAxis(axis, amount); this.rotationQuaternion = this.rotationQuaternion.multiply(rotationQuaternion); } else { if (this.parent) { var invertParentWorldMatrix = this.parent.getWorldMatrix().clone(); invertParentWorldMatrix.invert(); axis = BABYLON.Vector3.TransformNormal(axis, invertParentWorldMatrix); } rotationQuaternion = BABYLON.Quaternion.RotationAxis(axis, amount); this.rotationQuaternion = rotationQuaternion.multiply(this.rotationQuaternion); } }; AbstractMesh.prototype.translate = function (axis, distance, space) { var displacementVector = axis.scale(distance); if (!space || space == 0 /* LOCAL */) { var tempV3 = this.getPositionExpressedInLocalSpace().add(displacementVector); this.setPositionWithLocalVector(tempV3); } else { this.setAbsolutePosition(this.getAbsolutePosition().add(displacementVector)); } }; AbstractMesh.prototype.getAbsolutePosition = function () { this.computeWorldMatrix(); return this._absolutePosition; }; AbstractMesh.prototype.setAbsolutePosition = function (absolutePosition) { if (!absolutePosition) { return; } var absolutePositionX; var absolutePositionY; var absolutePositionZ; if (absolutePosition.x === undefined) { if (arguments.length < 3) { return; } absolutePositionX = arguments[0]; absolutePositionY = arguments[1]; absolutePositionZ = arguments[2]; } else { absolutePositionX = absolutePosition.x; absolutePositionY = absolutePosition.y; absolutePositionZ = absolutePosition.z; } if (this.parent) { var invertParentWorldMatrix = this.parent.getWorldMatrix().clone(); invertParentWorldMatrix.invert(); var worldPosition = new BABYLON.Vector3(absolutePositionX, absolutePositionY, absolutePositionZ); this.position = BABYLON.Vector3.TransformCoordinates(worldPosition, invertParentWorldMatrix); } else { this.position.x = absolutePositionX; this.position.y = absolutePositionY; this.position.z = absolutePositionZ; } }; AbstractMesh.prototype.setPivotMatrix = function (matrix) { this._pivotMatrix = matrix; this._cache.pivotMatrixUpdated = true; }; AbstractMesh.prototype.getPivotMatrix = function () { return this._pivotMatrix; }; AbstractMesh.prototype._isSynchronized = function () { if (this._isDirty) { return false; } if (this.billboardMode !== AbstractMesh.BILLBOARDMODE_NONE) return false; if (this._cache.pivotMatrixUpdated) { return false; } if (this.infiniteDistance) { return false; } if (!this._cache.position.equals(this.position)) return false; if (this.rotationQuaternion) { if (!this._cache.rotationQuaternion.equals(this.rotationQuaternion)) return false; } else { if (!this._cache.rotation.equals(this.rotation)) return false; } if (!this._cache.scaling.equals(this.scaling)) return false; return true; }; AbstractMesh.prototype._initCache = function () { _super.prototype._initCache.call(this); this._cache.localMatrixUpdated = false; this._cache.position = BABYLON.Vector3.Zero(); this._cache.scaling = BABYLON.Vector3.Zero(); this._cache.rotation = BABYLON.Vector3.Zero(); this._cache.rotationQuaternion = new BABYLON.Quaternion(0, 0, 0, 0); }; AbstractMesh.prototype.markAsDirty = function (property) { if (property === "rotation") { this.rotationQuaternion = null; } this._currentRenderId = Number.MAX_VALUE; this._isDirty = true; }; AbstractMesh.prototype._updateBoundingInfo = function () { this._boundingInfo = this._boundingInfo || new BABYLON.BoundingInfo(this.absolutePosition, this.absolutePosition); this._boundingInfo._update(this.worldMatrixFromCache); this._updateSubMeshesBoundingInfo(this.worldMatrixFromCache); }; AbstractMesh.prototype._updateSubMeshesBoundingInfo = function (matrix) { if (!this.subMeshes) { return; } for (var subIndex = 0; subIndex < this.subMeshes.length; subIndex++) { var subMesh = this.subMeshes[subIndex]; subMesh.updateBoundingInfo(matrix); } }; AbstractMesh.prototype.computeWorldMatrix = function (force) { if (!force && (this._currentRenderId == this.getScene().getRenderId() || this.isSynchronized(true))) { return this._worldMatrix; } this._cache.position.copyFrom(this.position); this._cache.scaling.copyFrom(this.scaling); this._cache.pivotMatrixUpdated = false; this._currentRenderId = this.getScene().getRenderId(); this._isDirty = false; // Scaling BABYLON.Matrix.ScalingToRef(this.scaling.x, this.scaling.y, this.scaling.z, this._localScaling); // Rotation if (this.rotationQuaternion) { this.rotationQuaternion.toRotationMatrix(this._localRotation); this._cache.rotationQuaternion.copyFrom(this.rotationQuaternion); } else { BABYLON.Matrix.RotationYawPitchRollToRef(this.rotation.y, this.rotation.x, this.rotation.z, this._localRotation); this._cache.rotation.copyFrom(this.rotation); } // Translation if (this.infiniteDistance && !this.parent) { var camera = this.getScene().activeCamera; var cameraWorldMatrix = camera.getWorldMatrix(); var cameraGlobalPosition = new BABYLON.Vector3(cameraWorldMatrix.m[12], cameraWorldMatrix.m[13], cameraWorldMatrix.m[14]); BABYLON.Matrix.TranslationToRef(this.position.x + cameraGlobalPosition.x, this.position.y + cameraGlobalPosition.y, this.position.z + cameraGlobalPosition.z, this._localTranslation); } else { BABYLON.Matrix.TranslationToRef(this.position.x, this.position.y, this.position.z, this._localTranslation); } // Composing transformations this._pivotMatrix.multiplyToRef(this._localScaling, this._localPivotScaling); this._localPivotScaling.multiplyToRef(this._localRotation, this._localPivotScalingRotation); // Billboarding if (this.billboardMode !== AbstractMesh.BILLBOARDMODE_NONE && this.getScene().activeCamera) { var localPosition = this.position.clone(); var zero = this.getScene().activeCamera.position.clone(); if (this.parent && this.parent.position) { localPosition.addInPlace(this.parent.position); BABYLON.Matrix.TranslationToRef(localPosition.x, localPosition.y, localPosition.z, this._localTranslation); } if ((this.billboardMode & AbstractMesh.BILLBOARDMODE_ALL) === AbstractMesh.BILLBOARDMODE_ALL) { zero = this.getScene().activeCamera.position; } else { if (this.billboardMode & BABYLON.AbstractMesh.BILLBOARDMODE_X) zero.x = localPosition.x + BABYLON.Engine.Epsilon; if (this.billboardMode & BABYLON.AbstractMesh.BILLBOARDMODE_Y) zero.y = localPosition.y + 0.001; if (this.billboardMode & BABYLON.AbstractMesh.BILLBOARDMODE_Z) zero.z = localPosition.z + 0.001; } BABYLON.Matrix.LookAtLHToRef(localPosition, zero, BABYLON.Vector3.Up(), this._localBillboard); this._localBillboard.m[12] = this._localBillboard.m[13] = this._localBillboard.m[14] = 0; this._localBillboard.invert(); this._localPivotScalingRotation.multiplyToRef(this._localBillboard, this._localWorld); this._rotateYByPI.multiplyToRef(this._localWorld, this._localPivotScalingRotation); } // Local world this._localPivotScalingRotation.multiplyToRef(this._localTranslation, this._localWorld); // Parent if (this.parent && this.parent.getWorldMatrix && this.billboardMode === BABYLON.AbstractMesh.BILLBOARDMODE_NONE) { this._localWorld.multiplyToRef(this.parent.getWorldMatrix(), this._worldMatrix); } else { this._worldMatrix.copyFrom(this._localWorld); } // Bounding info this._updateBoundingInfo(); // Absolute position this._absolutePosition.copyFromFloats(this._worldMatrix.m[12], this._worldMatrix.m[13], this._worldMatrix.m[14]); for (var callbackIndex = 0; callbackIndex < this._onAfterWorldMatrixUpdate.length; callbackIndex++) { this._onAfterWorldMatrixUpdate[callbackIndex](this); } return this._worldMatrix; }; /** * If you'd like to be callbacked after the mesh position, rotation or scaling has been updated * @param func: callback function to add */ AbstractMesh.prototype.registerAfterWorldMatrixUpdate = function (func) { this._onAfterWorldMatrixUpdate.push(func); }; AbstractMesh.prototype.unregisterAfterWorldMatrixUpdate = function (func) { var index = this._onAfterWorldMatrixUpdate.indexOf(func); if (index > -1) { this._onAfterWorldMatrixUpdate.splice(index, 1); } }; AbstractMesh.prototype.setPositionWithLocalVector = function (vector3) { this.computeWorldMatrix(); this.position = BABYLON.Vector3.TransformNormal(vector3, this._localWorld); }; AbstractMesh.prototype.getPositionExpressedInLocalSpace = function () { this.computeWorldMatrix(); var invLocalWorldMatrix = this._localWorld.clone(); invLocalWorldMatrix.invert(); return BABYLON.Vector3.TransformNormal(this.position, invLocalWorldMatrix); }; AbstractMesh.prototype.locallyTranslate = function (vector3) { this.computeWorldMatrix(); this.position = BABYLON.Vector3.TransformCoordinates(vector3, this._localWorld); }; AbstractMesh.prototype.lookAt = function (targetPoint, yawCor, pitchCor, rollCor) { /// Orients a mesh towards a target point. Mesh must be drawn facing user. /// The position (must be in same space as current mesh) to look at /// optional yaw (y-axis) correction in radians /// optional pitch (x-axis) correction in radians /// optional roll (z-axis) correction in radians /// Mesh oriented towards targetMesh yawCor = yawCor || 0; // default to zero if undefined pitchCor = pitchCor || 0; rollCor = rollCor || 0; var dv = targetPoint.subtract(this.position); var yaw = -Math.atan2(dv.z, dv.x) - Math.PI / 2; var len = Math.sqrt(dv.x * dv.x + dv.z * dv.z); var pitch = Math.atan2(dv.y, len); this.rotationQuaternion = BABYLON.Quaternion.RotationYawPitchRoll(yaw + yawCor, pitch + pitchCor, rollCor); }; AbstractMesh.prototype.isInFrustum = function (frustumPlanes) { if (!this._boundingInfo.isInFrustum(frustumPlanes)) { return false; } return true; }; AbstractMesh.prototype.isCompletelyInFrustum = function (camera) { if (!camera) { camera = this.getScene().activeCamera; } var transformMatrix = camera.getViewMatrix().multiply(camera.getProjectionMatrix()); if (!this._boundingInfo.isCompletelyInFrustum(BABYLON.Frustum.GetPlanes(transformMatrix))) { return false; } return true; }; AbstractMesh.prototype.intersectsMesh = function (mesh, precise) { if (!this._boundingInfo || !mesh._boundingInfo) { return false; } return this._boundingInfo.intersects(mesh._boundingInfo, precise); }; AbstractMesh.prototype.intersectsPoint = function (point) { if (!this._boundingInfo) { return false; } return this._boundingInfo.intersectsPoint(point); }; // Physics AbstractMesh.prototype.setPhysicsState = function (impostor, options) { var physicsEngine = this.getScene().getPhysicsEngine(); if (!physicsEngine) { return; } if (impostor.impostor) { // Old API options = impostor; impostor = impostor.impostor; } impostor = impostor || BABYLON.PhysicsEngine.NoImpostor; if (impostor === BABYLON.PhysicsEngine.NoImpostor) { physicsEngine._unregisterMesh(this); return; } options.mass = options.mass || 0; options.friction = options.friction || 0.2; options.restitution = options.restitution || 0.2; this._physicImpostor = impostor; this._physicsMass = options.mass; this._physicsFriction = options.friction; this._physicRestitution = options.restitution; return physicsEngine._registerMesh(this, impostor, options); }; AbstractMesh.prototype.getPhysicsImpostor = function () { if (!this._physicImpostor) { return BABYLON.PhysicsEngine.NoImpostor; } return this._physicImpostor; }; AbstractMesh.prototype.getPhysicsMass = function () { if (!this._physicsMass) { return 0; } return this._physicsMass; }; AbstractMesh.prototype.getPhysicsFriction = function () { if (!this._physicsFriction) { return 0; } return this._physicsFriction; }; AbstractMesh.prototype.getPhysicsRestitution = function () { if (!this._physicRestitution) { return 0; } return this._physicRestitution; }; AbstractMesh.prototype.getPositionInCameraSpace = function (camera) { if (!camera) { camera = this.getScene().activeCamera; } return BABYLON.Vector3.TransformCoordinates(this.absolutePosition, camera.getViewMatrix()); }; AbstractMesh.prototype.getDistanceToCamera = function (camera) { if (!camera) { camera = this.getScene().activeCamera; } return this.absolutePosition.subtract(camera.position).length(); }; AbstractMesh.prototype.applyImpulse = function (force, contactPoint) { if (!this._physicImpostor) { return; } this.getScene().getPhysicsEngine()._applyImpulse(this, force, contactPoint); }; AbstractMesh.prototype.setPhysicsLinkWith = function (otherMesh, pivot1, pivot2, options) { if (!this._physicImpostor) { return; } this.getScene().getPhysicsEngine()._createLink(this, otherMesh, pivot1, pivot2, options); }; AbstractMesh.prototype.updatePhysicsBodyPosition = function () { if (!this._physicImpostor) { return; } this.getScene().getPhysicsEngine()._updateBodyPosition(this); }; // Collisions AbstractMesh.prototype.moveWithCollisions = function (velocity) { var globalPosition = this.getAbsolutePosition(); globalPosition.subtractFromFloatsToRef(0, this.ellipsoid.y, 0, this._oldPositionForCollisions); this._oldPositionForCollisions.addInPlace(this.ellipsoidOffset); this._collider.radius = this.ellipsoid; this.getScene()._getNewPosition(this._oldPositionForCollisions, velocity, this._collider, 3, this._newPositionForCollisions, this); this._newPositionForCollisions.subtractToRef(this._oldPositionForCollisions, this._diffPositionForCollisions); if (this._diffPositionForCollisions.length() > BABYLON.Engine.CollisionsEpsilon) { this.position.addInPlace(this._diffPositionForCollisions); } }; // Submeshes octree /** * This function will create an octree to help select the right submeshes for rendering, picking and collisions * Please note that you must have a decent number of submeshes to get performance improvements when using octree */ AbstractMesh.prototype.createOrUpdateSubmeshesOctree = function (maxCapacity, maxDepth) { if (typeof maxCapacity === "undefined") { maxCapacity = 64; } if (typeof maxDepth === "undefined") { maxDepth = 2; } if (!this._submeshesOctree) { this._submeshesOctree = new BABYLON.Octree(BABYLON.Octree.CreationFuncForSubMeshes, maxCapacity, maxDepth); } this.computeWorldMatrix(true); // Update octree var bbox = this.getBoundingInfo().boundingBox; this._submeshesOctree.update(bbox.minimumWorld, bbox.maximumWorld, this.subMeshes); return this._submeshesOctree; }; // Collisions AbstractMesh.prototype._collideForSubMesh = function (subMesh, transformMatrix, collider) { this._generatePointsArray(); // Transformation if (!subMesh._lastColliderWorldVertices || !subMesh._lastColliderTransformMatrix.equals(transformMatrix)) { subMesh._lastColliderTransformMatrix = transformMatrix.clone(); subMesh._lastColliderWorldVertices = []; subMesh._trianglePlanes = []; var start = subMesh.verticesStart; var end = (subMesh.verticesStart + subMesh.verticesCount); for (var i = start; i < end; i++) { subMesh._lastColliderWorldVertices.push(BABYLON.Vector3.TransformCoordinates(this._positions[i], transformMatrix)); } } // Collide collider._collide(subMesh, subMesh._lastColliderWorldVertices, this.getIndices(), subMesh.indexStart, subMesh.indexStart + subMesh.indexCount, subMesh.verticesStart); }; AbstractMesh.prototype._processCollisionsForSubMeshes = function (collider, transformMatrix) { var subMeshes; var len; // Octrees if (this._submeshesOctree && this.useOctreeForCollisions) { var radius = collider.velocityWorldLength + Math.max(collider.radius.x, collider.radius.y, collider.radius.z); var intersections = this._submeshesOctree.intersects(collider.basePointWorld, radius); len = intersections.length; subMeshes = intersections.data; } else { subMeshes = this.subMeshes; len = subMeshes.length; } for (var index = 0; index < len; index++) { var subMesh = subMeshes[index]; // Bounding test if (len > 1 && !subMesh._checkCollision(collider)) continue; this._collideForSubMesh(subMesh, transformMatrix, collider); } }; AbstractMesh.prototype._checkCollision = function (collider) { // Bounding box test if (!this._boundingInfo._checkCollision(collider)) return; // Transformation matrix BABYLON.Matrix.ScalingToRef(1.0 / collider.radius.x, 1.0 / collider.radius.y, 1.0 / collider.radius.z, this._collisionsScalingMatrix); this.worldMatrixFromCache.multiplyToRef(this._collisionsScalingMatrix, this._collisionsTransformMatrix); this._processCollisionsForSubMeshes(collider, this._collisionsTransformMatrix); }; // Picking AbstractMesh.prototype._generatePointsArray = function () { return false; }; AbstractMesh.prototype.intersects = function (ray, fastCheck) { var pickingInfo = new BABYLON.PickingInfo(); if (!this.subMeshes || !this._boundingInfo || !ray.intersectsSphere(this._boundingInfo.boundingSphere) || !ray.intersectsBox(this._boundingInfo.boundingBox)) { return pickingInfo; } if (!this._generatePointsArray()) { return pickingInfo; } var intersectInfo = null; // Octrees var subMeshes; var len; if (this._submeshesOctree && this.useOctreeForPicking) { var worldRay = BABYLON.Ray.Transform(ray, this.getWorldMatrix()); var intersections = this._submeshesOctree.intersectsRay(worldRay); len = intersections.length; subMeshes = intersections.data; } else { subMeshes = this.subMeshes; len = subMeshes.length; } for (var index = 0; index < len; index++) { var subMesh = subMeshes[index]; // Bounding test if (len > 1 && !subMesh.canIntersects(ray)) continue; var currentIntersectInfo = subMesh.intersects(ray, this._positions, this.getIndices(), fastCheck); if (currentIntersectInfo) { if (fastCheck || !intersectInfo || currentIntersectInfo.distance < intersectInfo.distance) { intersectInfo = currentIntersectInfo; if (fastCheck) { break; } } } } if (intersectInfo) { // Get picked point var world = this.getWorldMatrix(); var worldOrigin = BABYLON.Vector3.TransformCoordinates(ray.origin, world); var direction = ray.direction.clone(); direction.normalize(); direction = direction.scale(intersectInfo.distance); var worldDirection = BABYLON.Vector3.TransformNormal(direction, world); var pickedPoint = worldOrigin.add(worldDirection); // Return result pickingInfo.hit = true; pickingInfo.distance = BABYLON.Vector3.Distance(worldOrigin, pickedPoint); pickingInfo.pickedPoint = pickedPoint; pickingInfo.pickedMesh = this; pickingInfo.bu = intersectInfo.bu; pickingInfo.bv = intersectInfo.bv; pickingInfo.faceId = intersectInfo.faceId; return pickingInfo; } return pickingInfo; }; AbstractMesh.prototype.clone = function (name, newParent, doNotCloneChildren) { return null; }; AbstractMesh.prototype.releaseSubMeshes = function () { if (this.subMeshes) { while (this.subMeshes.length) { this.subMeshes[0].dispose(); } } else { this.subMeshes = new Array(); } }; AbstractMesh.prototype.dispose = function (doNotRecurse) { // Physics if (this.getPhysicsImpostor() != BABYLON.PhysicsEngine.NoImpostor) { this.setPhysicsState(BABYLON.PhysicsEngine.NoImpostor); } for (index = 0; index < this._intersectionsInProgress.length; index++) { var other = this._intersectionsInProgress[index]; var pos = other._intersectionsInProgress.indexOf(this); other._intersectionsInProgress.splice(pos, 1); } this._intersectionsInProgress = []; // SubMeshes this.releaseSubMeshes(); // Remove from scene var index = this.getScene().meshes.indexOf(this); if (index != -1) { // Remove from the scene if mesh found this.getScene().meshes.splice(index, 1); } if (!doNotRecurse) { for (index = 0; index < this.getScene().particleSystems.length; index++) { if (this.getScene().particleSystems[index].emitter == this) { this.getScene().particleSystems[index].dispose(); index--; } } // Children var objects = this.getScene().meshes.slice(0); for (index = 0; index < objects.length; index++) { if (objects[index].parent == this) { objects[index].dispose(); } } } else { for (index = 0; index < this.getScene().meshes.length; index++) { var obj = this.getScene().meshes[index]; if (obj.parent === this) { obj.parent = null; obj.computeWorldMatrix(true); } } } this._onAfterWorldMatrixUpdate = []; this._isDisposed = true; // Callback if (this.onDispose) { this.onDispose(); } }; AbstractMesh._BILLBOARDMODE_NONE = 0; AbstractMesh._BILLBOARDMODE_X = 1; AbstractMesh._BILLBOARDMODE_Y = 2; AbstractMesh._BILLBOARDMODE_Z = 4; AbstractMesh._BILLBOARDMODE_ALL = 7; return AbstractMesh; })(BABYLON.Node); BABYLON.AbstractMesh = AbstractMesh; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.abstractMesh.js.map var BABYLON; (function (BABYLON) { var _InstancesBatch = (function () { function _InstancesBatch() { this.mustReturn = false; this.visibleInstances = new Array(); this.renderSelf = new Array(); } return _InstancesBatch; })(); BABYLON._InstancesBatch = _InstancesBatch; var Mesh = (function (_super) { __extends(Mesh, _super); /** * @param {string} name - The value used by scene.getMeshByName() to do a lookup. * @param {Scene} scene - The scene to add this mesh to. * @param {Node} parent - The parent of this mesh, if it has one * @param {Mesh} source - An optional Mesh from which geometry is shared, cloned. * @param {boolean} doNotCloneChildren - When cloning, skip cloning child meshes of source, default False. * When false, achieved by calling a clone(), also passing False. * This will make creation of children, recursive. */ function Mesh(name, scene, parent, source, doNotCloneChildren) { if (typeof parent === "undefined") { parent = null; } _super.call(this, name, scene); // Members this.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_NONE; this.instances = new Array(); this._LODLevels = new Array(); this._onBeforeRenderCallbacks = new Array(); this._onAfterRenderCallbacks = new Array(); this._visibleInstances = {}; this._renderIdForInstances = new Array(); this._batchCache = new _InstancesBatch(); this._instancesBufferSize = 32 * 16 * 4; if (source) { // Geometry if (source._geometry) { source._geometry.applyToMesh(this); } // Deep copy BABYLON.Tools.DeepCopy(source, this, ["name", "material", "skeleton"], []); // Material this.material = source.material; if (!doNotCloneChildren) { for (var index = 0; index < scene.meshes.length; index++) { var mesh = scene.meshes[index]; if (mesh.parent === source) { // doNotCloneChildren is always going to be False var newChild = mesh.clone(name + "." + mesh.name, this, doNotCloneChildren); } } } for (index = 0; index < scene.particleSystems.length; index++) { var system = scene.particleSystems[index]; if (system.emitter === source) { system.clone(system.name, this); } } this.computeWorldMatrix(true); } // Parent if (parent !== null) { this.parent = parent; } } Mesh.prototype._clone = function () { }; Object.defineProperty(Mesh.prototype, "hasLODLevels", { // Methods get: function () { return this._LODLevels.length > 0; }, enumerable: true, configurable: true }); Mesh.prototype._sortLODLevels = function () { this._LODLevels.sort(function (a, b) { if (a.distance < b.distance) { return 1; } if (a.distance > b.distance) { return -1; } return 0; }); }; Mesh.prototype.addLODLevel = function (distance, mesh) { if (mesh && mesh._masterMesh) { BABYLON.Tools.Warn("You cannot use a mesh as LOD level twice"); return this; } var level = new BABYLON.Internals.MeshLODLevel(distance, mesh); this._LODLevels.push(level); if (mesh) { mesh._masterMesh = this; } this._sortLODLevels(); return this; }; Mesh.prototype.removeLODLevel = function (mesh) { for (var index = 0; index < this._LODLevels.length; index++) { if (this._LODLevels[index].mesh === mesh) { this._LODLevels.splice(index, 1); if (mesh) { mesh._masterMesh = null; } } } this._sortLODLevels(); return this; }; Mesh.prototype.getLOD = function (camera, boundingSphere) { if (!this._LODLevels || this._LODLevels.length === 0) { return this; } var distanceToCamera = (boundingSphere ? boundingSphere : this.getBoundingInfo().boundingSphere).centerWorld.subtract(camera.position).length(); if (this._LODLevels[this._LODLevels.length - 1].distance > distanceToCamera) { return this; } for (var index = 0; index < this._LODLevels.length; index++) { var level = this._LODLevels[index]; if (level.distance < distanceToCamera) { if (level.mesh) { level.mesh._preActivate(); level.mesh._updateSubMeshesBoundingInfo(this.worldMatrixFromCache); } return level.mesh; } } return this; }; Object.defineProperty(Mesh.prototype, "geometry", { get: function () { return this._geometry; }, enumerable: true, configurable: true }); Mesh.prototype.getTotalVertices = function () { if (!this._geometry) { return 0; } return this._geometry.getTotalVertices(); }; Mesh.prototype.getVerticesData = function (kind) { if (!this._geometry) { return null; } return this._geometry.getVerticesData(kind); }; Mesh.prototype.getVertexBuffer = function (kind) { if (!this._geometry) { return undefined; } return this._geometry.getVertexBuffer(kind); }; Mesh.prototype.isVerticesDataPresent = function (kind) { if (!this._geometry) { if (this._delayInfo) { return this._delayInfo.indexOf(kind) !== -1; } return false; } return this._geometry.isVerticesDataPresent(kind); }; Mesh.prototype.getVerticesDataKinds = function () { if (!this._geometry) { var result = []; if (this._delayInfo) { for (var kind in this._delayInfo) { result.push(kind); } } return result; } return this._geometry.getVerticesDataKinds(); }; Mesh.prototype.getTotalIndices = function () { if (!this._geometry) { return 0; } return this._geometry.getTotalIndices(); }; Mesh.prototype.getIndices = function () { if (!this._geometry) { return []; } return this._geometry.getIndices(); }; Object.defineProperty(Mesh.prototype, "isBlocked", { get: function () { return this._masterMesh !== null && this._masterMesh !== undefined; }, enumerable: true, configurable: true }); Mesh.prototype.isReady = function () { if (this.delayLoadState === BABYLON.Engine.DELAYLOADSTATE_LOADING) { return false; } return _super.prototype.isReady.call(this); }; Mesh.prototype.isDisposed = function () { return this._isDisposed; }; // Methods Mesh.prototype._preActivate = function () { var sceneRenderId = this.getScene().getRenderId(); if (this._preActivateId == sceneRenderId) { return; } this._preActivateId = sceneRenderId; this._visibleInstances = null; }; Mesh.prototype._registerInstanceForRenderId = function (instance, renderId) { if (!this._visibleInstances) { this._visibleInstances = {}; this._visibleInstances.defaultRenderId = renderId; this._visibleInstances.selfDefaultRenderId = this._renderId; } if (!this._visibleInstances[renderId]) { this._visibleInstances[renderId] = new Array(); } this._visibleInstances[renderId].push(instance); }; Mesh.prototype.refreshBoundingInfo = function () { var data = this.getVerticesData(BABYLON.VertexBuffer.PositionKind); if (data) { var extend = BABYLON.Tools.ExtractMinAndMax(data, 0, this.getTotalVertices()); this._boundingInfo = new BABYLON.BoundingInfo(extend.minimum, extend.maximum); } if (this.subMeshes) { for (var index = 0; index < this.subMeshes.length; index++) { this.subMeshes[index].refreshBoundingInfo(); } } this._updateBoundingInfo(); }; Mesh.prototype._createGlobalSubMesh = function () { var totalVertices = this.getTotalVertices(); if (!totalVertices || !this.getIndices()) { return null; } this.releaseSubMeshes(); return new BABYLON.SubMesh(0, 0, totalVertices, 0, this.getTotalIndices(), this); }; Mesh.prototype.subdivide = function (count) { if (count < 1) { return; } var totalIndices = this.getTotalIndices(); var subdivisionSize = (totalIndices / count) | 0; var offset = 0; while (subdivisionSize % 3 != 0) { subdivisionSize++; } this.releaseSubMeshes(); for (var index = 0; index < count; index++) { if (offset >= totalIndices) { break; } BABYLON.SubMesh.CreateFromIndices(0, offset, Math.min(subdivisionSize, totalIndices - offset), this); offset += subdivisionSize; } this.synchronizeInstances(); }; Mesh.prototype.setVerticesData = function (kind, data, updatable, stride) { if (kind instanceof Array) { var temp = data; data = kind; kind = temp; BABYLON.Tools.Warn("Deprecated usage of setVerticesData detected (since v1.12). Current signature is setVerticesData(kind, data, updatable)."); } if (!this._geometry) { var vertexData = new BABYLON.VertexData(); vertexData.set(data, kind); var scene = this.getScene(); new BABYLON.Geometry(BABYLON.Geometry.RandomId(), scene, vertexData, updatable, this); } else { this._geometry.setVerticesData(kind, data, updatable, stride); } }; Mesh.prototype.updateVerticesData = function (kind, data, updateExtends, makeItUnique) { if (!this._geometry) { return; } if (!makeItUnique) { this._geometry.updateVerticesData(kind, data, updateExtends); } else { this.makeGeometryUnique(); this.updateVerticesData(kind, data, updateExtends, false); } }; Mesh.prototype.updateVerticesDataDirectly = function (kind, data, offset, makeItUnique) { if (!this._geometry) { return; } if (!makeItUnique) { this._geometry.updateVerticesDataDirectly(kind, data, offset); } else { this.makeGeometryUnique(); this.updateVerticesDataDirectly(kind, data, offset, false); } }; Mesh.prototype.makeGeometryUnique = function () { if (!this._geometry) { return; } var geometry = this._geometry.copy(BABYLON.Geometry.RandomId()); geometry.applyToMesh(this); }; Mesh.prototype.setIndices = function (indices, totalVertices) { if (!this._geometry) { var vertexData = new BABYLON.VertexData(); vertexData.indices = indices; var scene = this.getScene(); new BABYLON.Geometry(BABYLON.Geometry.RandomId(), scene, vertexData, false, this); } else { this._geometry.setIndices(indices, totalVertices); } }; Mesh.prototype._bind = function (subMesh, effect, fillMode) { var engine = this.getScene().getEngine(); // Wireframe var indexToBind; switch (fillMode) { case BABYLON.Material.PointFillMode: indexToBind = null; break; case BABYLON.Material.WireFrameFillMode: indexToBind = subMesh.getLinesIndexBuffer(this.getIndices(), engine); break; default: case BABYLON.Material.TriangleFillMode: indexToBind = this._geometry.getIndexBuffer(); break; } // VBOs engine.bindMultiBuffers(this._geometry.getVertexBuffers(), indexToBind, effect); }; Mesh.prototype._draw = function (subMesh, fillMode, instancesCount) { if (!this._geometry || !this._geometry.getVertexBuffers() || !this._geometry.getIndexBuffer()) { return; } var engine = this.getScene().getEngine(); switch (fillMode) { case BABYLON.Material.PointFillMode: engine.drawPointClouds(subMesh.verticesStart, subMesh.verticesCount, instancesCount); break; case BABYLON.Material.WireFrameFillMode: engine.draw(false, 0, subMesh.linesIndexCount, instancesCount); break; default: engine.draw(true, subMesh.indexStart, subMesh.indexCount, instancesCount); } }; Mesh.prototype.registerBeforeRender = function (func) { this._onBeforeRenderCallbacks.push(func); }; Mesh.prototype.unregisterBeforeRender = function (func) { var index = this._onBeforeRenderCallbacks.indexOf(func); if (index > -1) { this._onBeforeRenderCallbacks.splice(index, 1); } }; Mesh.prototype.registerAfterRender = function (func) { this._onAfterRenderCallbacks.push(func); }; Mesh.prototype.unregisterAfterRender = function (func) { var index = this._onAfterRenderCallbacks.indexOf(func); if (index > -1) { this._onAfterRenderCallbacks.splice(index, 1); } }; Mesh.prototype._getInstancesRenderList = function (subMeshId) { var scene = this.getScene(); this._batchCache.mustReturn = false; this._batchCache.renderSelf[subMeshId] = this.isEnabled() && this.isVisible; this._batchCache.visibleInstances[subMeshId] = null; if (this._visibleInstances) { var currentRenderId = scene.getRenderId(); this._batchCache.visibleInstances[subMeshId] = this._visibleInstances[currentRenderId]; var selfRenderId = this._renderId; if (!this._batchCache.visibleInstances[subMeshId] && this._visibleInstances.defaultRenderId) { this._batchCache.visibleInstances[subMeshId] = this._visibleInstances[this._visibleInstances.defaultRenderId]; currentRenderId = Math.max(this._visibleInstances.defaultRenderId, currentRenderId); selfRenderId = Math.max(this._visibleInstances.selfDefaultRenderId, currentRenderId); } if (this._batchCache.visibleInstances[subMeshId] && this._batchCache.visibleInstances[subMeshId].length) { if (this._renderIdForInstances[subMeshId] === currentRenderId) { this._batchCache.mustReturn = true; return this._batchCache; } if (currentRenderId !== selfRenderId) { this._batchCache.renderSelf[subMeshId] = false; } } this._renderIdForInstances[subMeshId] = currentRenderId; } return this._batchCache; }; Mesh.prototype._renderWithInstances = function (subMesh, fillMode, batch, effect, engine) { var visibleInstances = batch.visibleInstances[subMesh._id]; var matricesCount = visibleInstances.length + 1; var bufferSize = matricesCount * 16 * 4; while (this._instancesBufferSize < bufferSize) { this._instancesBufferSize *= 2; } if (!this._worldMatricesInstancesBuffer || this._worldMatricesInstancesBuffer.capacity < this._instancesBufferSize) { if (this._worldMatricesInstancesBuffer) { engine.deleteInstancesBuffer(this._worldMatricesInstancesBuffer); } this._worldMatricesInstancesBuffer = engine.createInstancesBuffer(this._instancesBufferSize); this._worldMatricesInstancesArray = new Float32Array(this._instancesBufferSize / 4); } var offset = 0; var instancesCount = 0; var world = this.getWorldMatrix(); if (batch.renderSelf[subMesh._id]) { world.copyToArray(this._worldMatricesInstancesArray, offset); offset += 16; instancesCount++; } if (visibleInstances) { for (var instanceIndex = 0; instanceIndex < visibleInstances.length; instanceIndex++) { var instance = visibleInstances[instanceIndex]; instance.getWorldMatrix().copyToArray(this._worldMatricesInstancesArray, offset); offset += 16; instancesCount++; } } var offsetLocation0 = effect.getAttributeLocationByName("world0"); var offsetLocation1 = effect.getAttributeLocationByName("world1"); var offsetLocation2 = effect.getAttributeLocationByName("world2"); var offsetLocation3 = effect.getAttributeLocationByName("world3"); var offsetLocations = [offsetLocation0, offsetLocation1, offsetLocation2, offsetLocation3]; engine.updateAndBindInstancesBuffer(this._worldMatricesInstancesBuffer, this._worldMatricesInstancesArray, offsetLocations); this._draw(subMesh, fillMode, instancesCount); engine.unBindInstancesBuffer(this._worldMatricesInstancesBuffer, offsetLocations); }; Mesh.prototype.render = function (subMesh) { var scene = this.getScene(); // Managing instances var batch = this._getInstancesRenderList(subMesh._id); if (batch.mustReturn) { return; } // Checking geometry state if (!this._geometry || !this._geometry.getVertexBuffers() || !this._geometry.getIndexBuffer()) { return; } for (var callbackIndex = 0; callbackIndex < this._onBeforeRenderCallbacks.length; callbackIndex++) { this._onBeforeRenderCallbacks[callbackIndex](); } var engine = scene.getEngine(); var hardwareInstancedRendering = (engine.getCaps().instancedArrays !== null) && (batch.visibleInstances[subMesh._id] !== null) && (batch.visibleInstances[subMesh._id] !== undefined); // Material var effectiveMaterial = subMesh.getMaterial(); if (!effectiveMaterial || !effectiveMaterial.isReady(this, hardwareInstancedRendering)) { return; } // Outline - step 1 var savedDepthWrite = engine.getDepthWrite(); if (this.renderOutline) { engine.setDepthWrite(false); scene.getOutlineRenderer().render(subMesh, batch); engine.setDepthWrite(savedDepthWrite); } effectiveMaterial._preBind(); var effect = effectiveMaterial.getEffect(); // Bind var fillMode = scene.forcePointsCloud ? BABYLON.Material.PointFillMode : (scene.forceWireframe ? BABYLON.Material.WireFrameFillMode : effectiveMaterial.fillMode); this._bind(subMesh, effect, fillMode); var world = this.getWorldMatrix(); effectiveMaterial.bind(world, this); // Instances rendering if (hardwareInstancedRendering) { this._renderWithInstances(subMesh, fillMode, batch, effect, engine); } else { if (batch.renderSelf[subMesh._id]) { // Draw this._draw(subMesh, fillMode); } if (batch.visibleInstances[subMesh._id]) { for (var instanceIndex = 0; instanceIndex < batch.visibleInstances[subMesh._id].length; instanceIndex++) { var instance = batch.visibleInstances[subMesh._id][instanceIndex]; // World world = instance.getWorldMatrix(); effectiveMaterial.bindOnlyWorldMatrix(world); // Draw this._draw(subMesh, fillMode); } } } // Unbind effectiveMaterial.unbind(); // Outline - step 2 if (this.renderOutline && savedDepthWrite) { engine.setDepthWrite(true); engine.setColorWrite(false); scene.getOutlineRenderer().render(subMesh, batch); engine.setColorWrite(true); } // Overlay if (this.renderOverlay) { var currentMode = engine.getAlphaMode(); engine.setAlphaMode(BABYLON.Engine.ALPHA_COMBINE); scene.getOutlineRenderer().render(subMesh, batch, true); engine.setAlphaMode(currentMode); } for (callbackIndex = 0; callbackIndex < this._onAfterRenderCallbacks.length; callbackIndex++) { this._onAfterRenderCallbacks[callbackIndex](); } }; Mesh.prototype.getEmittedParticleSystems = function () { var results = new Array(); for (var index = 0; index < this.getScene().particleSystems.length; index++) { var particleSystem = this.getScene().particleSystems[index]; if (particleSystem.emitter === this) { results.push(particleSystem); } } return results; }; Mesh.prototype.getHierarchyEmittedParticleSystems = function () { var results = new Array(); var descendants = this.getDescendants(); descendants.push(this); for (var index = 0; index < this.getScene().particleSystems.length; index++) { var particleSystem = this.getScene().particleSystems[index]; if (descendants.indexOf(particleSystem.emitter) !== -1) { results.push(particleSystem); } } return results; }; Mesh.prototype.getChildren = function () { var results = []; for (var index = 0; index < this.getScene().meshes.length; index++) { var mesh = this.getScene().meshes[index]; if (mesh.parent == this) { results.push(mesh); } } return results; }; Mesh.prototype._checkDelayState = function () { var _this = this; var that = this; var scene = this.getScene(); if (this._geometry) { this._geometry.load(scene); } else if (that.delayLoadState === BABYLON.Engine.DELAYLOADSTATE_NOTLOADED) { that.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_LOADING; scene._addPendingData(that); var getBinaryData = (this.delayLoadingFile.indexOf(".babylonbinarymeshdata") !== -1) ? true : false; BABYLON.Tools.LoadFile(this.delayLoadingFile, function (data) { if (data instanceof ArrayBuffer) { _this._delayLoadingFunction(data, _this); } else { _this._delayLoadingFunction(JSON.parse(data), _this); } _this.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_LOADED; scene._removePendingData(_this); }, function () { }, scene.database, getBinaryData); } }; Mesh.prototype.isInFrustum = function (frustumPlanes) { if (this.delayLoadState === BABYLON.Engine.DELAYLOADSTATE_LOADING) { return false; } if (!_super.prototype.isInFrustum.call(this, frustumPlanes)) { return false; } this._checkDelayState(); return true; }; Mesh.prototype.setMaterialByID = function (id) { var materials = this.getScene().materials; for (var index = 0; index < materials.length; index++) { if (materials[index].id == id) { this.material = materials[index]; return; } } // Multi var multiMaterials = this.getScene().multiMaterials; for (index = 0; index < multiMaterials.length; index++) { if (multiMaterials[index].id == id) { this.material = multiMaterials[index]; return; } } }; Mesh.prototype.getAnimatables = function () { var results = []; if (this.material) { results.push(this.material); } if (this.skeleton) { results.push(this.skeleton); } return results; }; // Geometry Mesh.prototype.bakeTransformIntoVertices = function (transform) { // Position if (!this.isVerticesDataPresent(BABYLON.VertexBuffer.PositionKind)) { return; } this._resetPointsArrayCache(); var data = this.getVerticesData(BABYLON.VertexBuffer.PositionKind); var temp = []; for (var index = 0; index < data.length; index += 3) { BABYLON.Vector3.TransformCoordinates(BABYLON.Vector3.FromArray(data, index), transform).toArray(temp, index); } this.setVerticesData(BABYLON.VertexBuffer.PositionKind, temp, this.getVertexBuffer(BABYLON.VertexBuffer.PositionKind).isUpdatable()); // Normals if (!this.isVerticesDataPresent(BABYLON.VertexBuffer.NormalKind)) { return; } data = this.getVerticesData(BABYLON.VertexBuffer.NormalKind); for (index = 0; index < data.length; index += 3) { BABYLON.Vector3.TransformNormal(BABYLON.Vector3.FromArray(data, index), transform).toArray(temp, index); } this.setVerticesData(BABYLON.VertexBuffer.NormalKind, temp, this.getVertexBuffer(BABYLON.VertexBuffer.NormalKind).isUpdatable()); }; // Cache Mesh.prototype._resetPointsArrayCache = function () { this._positions = null; }; Mesh.prototype._generatePointsArray = function () { if (this._positions) return true; this._positions = []; var data = this.getVerticesData(BABYLON.VertexBuffer.PositionKind); if (!data) { return false; } for (var index = 0; index < data.length; index += 3) { this._positions.push(BABYLON.Vector3.FromArray(data, index)); } return true; }; // Clone Mesh.prototype.clone = function (name, newParent, doNotCloneChildren) { return new Mesh(name, this.getScene(), newParent, this, doNotCloneChildren); }; // Dispose Mesh.prototype.dispose = function (doNotRecurse) { if (this._geometry) { this._geometry.releaseForMesh(this, true); } // Instances if (this._worldMatricesInstancesBuffer) { this.getEngine().deleteInstancesBuffer(this._worldMatricesInstancesBuffer); this._worldMatricesInstancesBuffer = null; } while (this.instances.length) { this.instances[0].dispose(); } _super.prototype.dispose.call(this, doNotRecurse); }; // Geometric tools Mesh.prototype.applyDisplacementMap = function (url, minHeight, maxHeight) { var _this = this; var scene = this.getScene(); var onload = function (img) { // Getting height map data var canvas = document.createElement("canvas"); var context = canvas.getContext("2d"); var heightMapWidth = img.width; var heightMapHeight = img.height; canvas.width = heightMapWidth; canvas.height = heightMapHeight; context.drawImage(img, 0, 0); // Create VertexData from map data var buffer = context.getImageData(0, 0, heightMapWidth, heightMapHeight).data; _this.applyDisplacementMapFromBuffer(buffer, heightMapWidth, heightMapHeight, minHeight, maxHeight); }; BABYLON.Tools.LoadImage(url, onload, function () { }, scene.database); }; Mesh.prototype.applyDisplacementMapFromBuffer = function (buffer, heightMapWidth, heightMapHeight, minHeight, maxHeight) { if (!this.isVerticesDataPresent(BABYLON.VertexBuffer.PositionKind) || !this.isVerticesDataPresent(BABYLON.VertexBuffer.NormalKind) || !this.isVerticesDataPresent(BABYLON.VertexBuffer.UVKind)) { BABYLON.Tools.Warn("Cannot call applyDisplacementMap: Given mesh is not complete. Position, Normal or UV are missing"); return; } var positions = this.getVerticesData(BABYLON.VertexBuffer.PositionKind); var normals = this.getVerticesData(BABYLON.VertexBuffer.NormalKind); var uvs = this.getVerticesData(BABYLON.VertexBuffer.UVKind); var position = BABYLON.Vector3.Zero(); var normal = BABYLON.Vector3.Zero(); var uv = BABYLON.Vector2.Zero(); for (var index = 0; index < positions.length; index += 3) { BABYLON.Vector3.FromArrayToRef(positions, index, position); BABYLON.Vector3.FromArrayToRef(normals, index, normal); BABYLON.Vector2.FromArrayToRef(uvs, (index / 3) * 2, uv); // Compute height var u = ((Math.abs(uv.x) * heightMapWidth) % heightMapWidth) | 0; var v = ((Math.abs(uv.y) * heightMapHeight) % heightMapHeight) | 0; var pos = (u + v * heightMapWidth) * 4; var r = buffer[pos] / 255.0; var g = buffer[pos + 1] / 255.0; var b = buffer[pos + 2] / 255.0; var gradient = r * 0.3 + g * 0.59 + b * 0.11; normal.normalize(); normal.scaleInPlace(minHeight + (maxHeight - minHeight) * gradient); position = position.add(normal); position.toArray(positions, index); } BABYLON.VertexData.ComputeNormals(positions, this.getIndices(), normals); this.updateVerticesData(BABYLON.VertexBuffer.PositionKind, positions); this.updateVerticesData(BABYLON.VertexBuffer.NormalKind, normals); }; Mesh.prototype.convertToFlatShadedMesh = function () { /// Update normals and vertices to get a flat shading rendering. /// Warning: This may imply adding vertices to the mesh in order to get exactly 3 vertices per face var kinds = this.getVerticesDataKinds(); var vbs = []; var data = []; var newdata = []; var updatableNormals = false; for (var kindIndex = 0; kindIndex < kinds.length; kindIndex++) { var kind = kinds[kindIndex]; var vertexBuffer = this.getVertexBuffer(kind); if (kind === BABYLON.VertexBuffer.NormalKind) { updatableNormals = vertexBuffer.isUpdatable(); kinds.splice(kindIndex, 1); kindIndex--; continue; } vbs[kind] = vertexBuffer; data[kind] = vbs[kind].getData(); newdata[kind] = []; } // Save previous submeshes var previousSubmeshes = this.subMeshes.slice(0); var indices = this.getIndices(); var totalIndices = this.getTotalIndices(); for (var index = 0; index < totalIndices; index++) { var vertexIndex = indices[index]; for (kindIndex = 0; kindIndex < kinds.length; kindIndex++) { kind = kinds[kindIndex]; var stride = vbs[kind].getStrideSize(); for (var offset = 0; offset < stride; offset++) { newdata[kind].push(data[kind][vertexIndex * stride + offset]); } } } // Updating faces & normal var normals = []; var positions = newdata[BABYLON.VertexBuffer.PositionKind]; for (index = 0; index < totalIndices; index += 3) { indices[index] = index; indices[index + 1] = index + 1; indices[index + 2] = index + 2; var p1 = BABYLON.Vector3.FromArray(positions, index * 3); var p2 = BABYLON.Vector3.FromArray(positions, (index + 1) * 3); var p3 = BABYLON.Vector3.FromArray(positions, (index + 2) * 3); var p1p2 = p1.subtract(p2); var p3p2 = p3.subtract(p2); var normal = BABYLON.Vector3.Normalize(BABYLON.Vector3.Cross(p1p2, p3p2)); for (var localIndex = 0; localIndex < 3; localIndex++) { normals.push(normal.x); normals.push(normal.y); normals.push(normal.z); } } this.setIndices(indices); this.setVerticesData(BABYLON.VertexBuffer.NormalKind, normals, updatableNormals); for (kindIndex = 0; kindIndex < kinds.length; kindIndex++) { kind = kinds[kindIndex]; this.setVerticesData(kind, newdata[kind], vbs[kind].isUpdatable()); } // Updating submeshes this.releaseSubMeshes(); for (var submeshIndex = 0; submeshIndex < previousSubmeshes.length; submeshIndex++) { var previousOne = previousSubmeshes[submeshIndex]; var subMesh = new BABYLON.SubMesh(previousOne.materialIndex, previousOne.indexStart, previousOne.indexCount, previousOne.indexStart, previousOne.indexCount, this); } this.synchronizeInstances(); }; // Instances Mesh.prototype.createInstance = function (name) { return new BABYLON.InstancedMesh(name, this); }; Mesh.prototype.synchronizeInstances = function () { for (var instanceIndex = 0; instanceIndex < this.instances.length; instanceIndex++) { var instance = this.instances[instanceIndex]; instance._syncSubMeshes(); } }; /** * Simplify the mesh according to the given array of settings. * Function will return immediately and will simplify async. * @param settings a collection of simplification settings. * @param parallelProcessing should all levels calculate parallel or one after the other. * @param type the type of simplification to run. * successCallback optional success callback to be called after the simplification finished processing all settings. */ Mesh.prototype.simplify = function (settings, parallelProcessing, type, successCallback) { var _this = this; if (typeof parallelProcessing === "undefined") { parallelProcessing = true; } if (typeof type === "undefined") { type = 0 /* QUADRATIC */; } var getSimplifier = function () { switch (type) { case 0 /* QUADRATIC */: default: return new BABYLON.QuadraticErrorSimplification(_this); } }; if (parallelProcessing) { //parallel simplifier settings.forEach(function (setting) { var simplifier = getSimplifier(); simplifier.simplify(setting, function (newMesh) { _this.addLODLevel(setting.distance, newMesh); //check if it is the last if (setting.quality == settings[settings.length - 1].quality && successCallback) { //all done, run the success callback. successCallback(); } }); }); } else { //single simplifier. var simplifier = getSimplifier(); var runDecimation = function (setting, callback) { simplifier.simplify(setting, function (newMesh) { _this.addLODLevel(setting.distance, newMesh); //run the next quality level callback(); }); }; BABYLON.AsyncLoop.Run(settings.length, function (loop) { runDecimation(settings[loop.index], function () { loop.executeNext(); }); }, function () { //execution ended, run the success callback. if (successCallback) { successCallback(); } }); } }; // Statics Mesh.CreateBox = function (name, size, scene, updatable) { var box = new Mesh(name, scene); var vertexData = BABYLON.VertexData.CreateBox(size); vertexData.applyToMesh(box, updatable); return box; }; Mesh.CreateSphere = function (name, segments, diameter, scene, updatable) { var sphere = new Mesh(name, scene); var vertexData = BABYLON.VertexData.CreateSphere(segments, diameter); vertexData.applyToMesh(sphere, updatable); return sphere; }; // Cylinder and cone (Code inspired by SharpDX.org) Mesh.CreateCylinder = function (name, height, diameterTop, diameterBottom, tessellation, subdivisions, scene, updatable) { // subdivisions is a new parameter, we need to support old signature if (scene === undefined || !(scene instanceof BABYLON.Scene)) { if (scene !== undefined) { updatable = scene; } scene = subdivisions; subdivisions = 1; } var cylinder = new Mesh(name, scene); var vertexData = BABYLON.VertexData.CreateCylinder(height, diameterTop, diameterBottom, tessellation, subdivisions); vertexData.applyToMesh(cylinder, updatable); return cylinder; }; // Torus (Code from SharpDX.org) Mesh.CreateTorus = function (name, diameter, thickness, tessellation, scene, updatable) { var torus = new Mesh(name, scene); var vertexData = BABYLON.VertexData.CreateTorus(diameter, thickness, tessellation); vertexData.applyToMesh(torus, updatable); return torus; }; Mesh.CreateTorusKnot = function (name, radius, tube, radialSegments, tubularSegments, p, q, scene, updatable) { var torusKnot = new Mesh(name, scene); var vertexData = BABYLON.VertexData.CreateTorusKnot(radius, tube, radialSegments, tubularSegments, p, q); vertexData.applyToMesh(torusKnot, updatable); return torusKnot; }; // Lines Mesh.CreateLines = function (name, points, scene, updatable) { var lines = new BABYLON.LinesMesh(name, scene, updatable); var vertexData = BABYLON.VertexData.CreateLines(points); vertexData.applyToMesh(lines, updatable); return lines; }; // Plane & ground Mesh.CreatePlane = function (name, size, scene, updatable) { var plane = new Mesh(name, scene); var vertexData = BABYLON.VertexData.CreatePlane(size); vertexData.applyToMesh(plane, updatable); return plane; }; Mesh.CreateGround = function (name, width, height, subdivisions, scene, updatable) { var ground = new BABYLON.GroundMesh(name, scene); ground._setReady(false); ground._subdivisions = subdivisions; var vertexData = BABYLON.VertexData.CreateGround(width, height, subdivisions); vertexData.applyToMesh(ground, updatable); ground._setReady(true); return ground; }; Mesh.CreateTiledGround = function (name, xmin, zmin, xmax, zmax, subdivisions, precision, scene, updatable) { var tiledGround = new Mesh(name, scene); var vertexData = BABYLON.VertexData.CreateTiledGround(xmin, zmin, xmax, zmax, subdivisions, precision); vertexData.applyToMesh(tiledGround, updatable); return tiledGround; }; Mesh.CreateGroundFromHeightMap = function (name, url, width, height, subdivisions, minHeight, maxHeight, scene, updatable) { var ground = new BABYLON.GroundMesh(name, scene); ground._subdivisions = subdivisions; ground._setReady(false); var onload = function (img) { // Getting height map data var canvas = document.createElement("canvas"); var context = canvas.getContext("2d"); var heightMapWidth = img.width; var heightMapHeight = img.height; canvas.width = heightMapWidth; canvas.height = heightMapHeight; context.drawImage(img, 0, 0); // Create VertexData from map data var buffer = context.getImageData(0, 0, heightMapWidth, heightMapHeight).data; var vertexData = BABYLON.VertexData.CreateGroundFromHeightMap(width, height, subdivisions, minHeight, maxHeight, buffer, heightMapWidth, heightMapHeight); vertexData.applyToMesh(ground, updatable); ground._setReady(true); }; BABYLON.Tools.LoadImage(url, onload, function () { }, scene.database); return ground; }; // Tools Mesh.MinMax = function (meshes) { var minVector = null; var maxVector = null; for (var i in meshes) { var mesh = meshes[i]; var boundingBox = mesh.getBoundingInfo().boundingBox; if (!minVector) { minVector = boundingBox.minimumWorld; maxVector = boundingBox.maximumWorld; continue; } minVector.MinimizeInPlace(boundingBox.minimumWorld); maxVector.MaximizeInPlace(boundingBox.maximumWorld); } return { min: minVector, max: maxVector }; }; Mesh.Center = function (meshesOrMinMaxVector) { var minMaxVector = meshesOrMinMaxVector.min !== undefined ? meshesOrMinMaxVector : Mesh.MinMax(meshesOrMinMaxVector); return BABYLON.Vector3.Center(minMaxVector.min, minMaxVector.max); }; Mesh.MergeMeshes = function (meshes, disposeSource, allow32BitsIndices) { if (typeof disposeSource === "undefined") { disposeSource = true; } var source = meshes[0]; var material = source.material; var scene = source.getScene(); if (!allow32BitsIndices) { var totalVertices = 0; for (var index = 0; index < meshes.length; index++) { totalVertices += meshes[index].getTotalVertices(); if (totalVertices > 65536) { BABYLON.Tools.Warn("Cannot merge meshes because resulting mesh will have more than 65536 vertices. Please use allow32BitsIndices = true to use 32 bits indices"); return null; } } } // Merge var vertexData = BABYLON.VertexData.ExtractFromMesh(source); vertexData.transform(source.getWorldMatrix()); for (index = 1; index < meshes.length; index++) { var otherVertexData = BABYLON.VertexData.ExtractFromMesh(meshes[index]); otherVertexData.transform(meshes[index].getWorldMatrix()); vertexData.merge(otherVertexData); } var newMesh = new Mesh(source.name + "_merged", scene); vertexData.applyToMesh(newMesh); // Setting properties newMesh.material = material; newMesh.checkCollisions = source.checkCollisions; // Cleaning if (disposeSource) { for (index = 0; index < meshes.length; index++) { meshes[index].dispose(); } } return newMesh; }; return Mesh; })(BABYLON.AbstractMesh); BABYLON.Mesh = Mesh; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.mesh.js.map var BABYLON; (function (BABYLON) { var GroundMesh = (function (_super) { __extends(GroundMesh, _super); function GroundMesh(name, scene) { _super.call(this, name, scene); this.generateOctree = false; this._worldInverse = new BABYLON.Matrix(); } Object.defineProperty(GroundMesh.prototype, "subdivisions", { get: function () { return this._subdivisions; }, enumerable: true, configurable: true }); GroundMesh.prototype.optimize = function (chunksCount) { this.subdivide(this._subdivisions); this.createOrUpdateSubmeshesOctree(32); }; GroundMesh.prototype.getHeightAtCoordinates = function (x, z) { var ray = new BABYLON.Ray(new BABYLON.Vector3(x, this.getBoundingInfo().boundingBox.maximumWorld.y + 1, z), new BABYLON.Vector3(0, -1, 0)); this.getWorldMatrix().invertToRef(this._worldInverse); ray = BABYLON.Ray.Transform(ray, this._worldInverse); var pickInfo = this.intersects(ray); if (pickInfo.hit) { return pickInfo.pickedPoint.y; } return 0; }; return GroundMesh; })(BABYLON.Mesh); BABYLON.GroundMesh = GroundMesh; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.groundMesh.js.map var BABYLON; (function (BABYLON) { var InstancedMesh = (function (_super) { __extends(InstancedMesh, _super); function InstancedMesh(name, source) { _super.call(this, name, source.getScene()); source.instances.push(this); this._sourceMesh = source; this.position.copyFrom(source.position); this.rotation.copyFrom(source.rotation); this.scaling.copyFrom(source.scaling); if (source.rotationQuaternion) { this.rotationQuaternion = source.rotationQuaternion.clone(); } this.infiniteDistance = source.infiniteDistance; this.setPivotMatrix(source.getPivotMatrix()); this.refreshBoundingInfo(); this._syncSubMeshes(); } Object.defineProperty(InstancedMesh.prototype, "receiveShadows", { // Methods get: function () { return this._sourceMesh.receiveShadows; }, enumerable: true, configurable: true }); Object.defineProperty(InstancedMesh.prototype, "material", { get: function () { return this._sourceMesh.material; }, enumerable: true, configurable: true }); Object.defineProperty(InstancedMesh.prototype, "visibility", { get: function () { return this._sourceMesh.visibility; }, enumerable: true, configurable: true }); Object.defineProperty(InstancedMesh.prototype, "skeleton", { get: function () { return this._sourceMesh.skeleton; }, enumerable: true, configurable: true }); InstancedMesh.prototype.getTotalVertices = function () { return this._sourceMesh.getTotalVertices(); }; Object.defineProperty(InstancedMesh.prototype, "sourceMesh", { get: function () { return this._sourceMesh; }, enumerable: true, configurable: true }); InstancedMesh.prototype.getVerticesData = function (kind) { return this._sourceMesh.getVerticesData(kind); }; InstancedMesh.prototype.isVerticesDataPresent = function (kind) { return this._sourceMesh.isVerticesDataPresent(kind); }; InstancedMesh.prototype.getIndices = function () { return this._sourceMesh.getIndices(); }; Object.defineProperty(InstancedMesh.prototype, "_positions", { get: function () { return this._sourceMesh._positions; }, enumerable: true, configurable: true }); InstancedMesh.prototype.refreshBoundingInfo = function () { var data = this._sourceMesh.getVerticesData(BABYLON.VertexBuffer.PositionKind); if (data) { var extend = BABYLON.Tools.ExtractMinAndMax(data, 0, this._sourceMesh.getTotalVertices()); this._boundingInfo = new BABYLON.BoundingInfo(extend.minimum, extend.maximum); } this._updateBoundingInfo(); }; InstancedMesh.prototype._preActivate = function () { if (this._currentLOD) { this._currentLOD._preActivate(); } }; InstancedMesh.prototype._activate = function (renderId) { if (this._currentLOD) { this._currentLOD._registerInstanceForRenderId(this, renderId); } }; InstancedMesh.prototype.getLOD = function (camera) { this._currentLOD = this.sourceMesh.getLOD(this.getScene().activeCamera, this.getBoundingInfo().boundingSphere); if (this._currentLOD === this.sourceMesh) { return this; } return this._currentLOD; }; InstancedMesh.prototype._syncSubMeshes = function () { this.releaseSubMeshes(); for (var index = 0; index < this._sourceMesh.subMeshes.length; index++) { this._sourceMesh.subMeshes[index].clone(this, this._sourceMesh); } }; InstancedMesh.prototype._generatePointsArray = function () { return this._sourceMesh._generatePointsArray(); }; // Clone InstancedMesh.prototype.clone = function (name, newParent, doNotCloneChildren) { var result = this._sourceMesh.createInstance(name); // Deep copy BABYLON.Tools.DeepCopy(this, result, ["name"], []); // Bounding info this.refreshBoundingInfo(); // Parent if (newParent) { result.parent = newParent; } if (!doNotCloneChildren) { for (var index = 0; index < this.getScene().meshes.length; index++) { var mesh = this.getScene().meshes[index]; if (mesh.parent == this) { mesh.clone(mesh.name, result); } } } result.computeWorldMatrix(true); return result; }; // Dispoe InstancedMesh.prototype.dispose = function (doNotRecurse) { // Remove from mesh var index = this._sourceMesh.instances.indexOf(this); this._sourceMesh.instances.splice(index, 1); _super.prototype.dispose.call(this, doNotRecurse); }; return InstancedMesh; })(BABYLON.AbstractMesh); BABYLON.InstancedMesh = InstancedMesh; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.instancedMesh.js.map var BABYLON; (function (BABYLON) { var SubMesh = (function () { function SubMesh(materialIndex, verticesStart, verticesCount, indexStart, indexCount, mesh, renderingMesh, createBoundingBox) { if (typeof createBoundingBox === "undefined") { createBoundingBox = true; } this.materialIndex = materialIndex; this.verticesStart = verticesStart; this.verticesCount = verticesCount; this.indexStart = indexStart; this.indexCount = indexCount; this._renderId = 0; this._mesh = mesh; this._renderingMesh = renderingMesh || mesh; mesh.subMeshes.push(this); this._id = mesh.subMeshes.length - 1; if (createBoundingBox) { this.refreshBoundingInfo(); } } SubMesh.prototype.getBoundingInfo = function () { return this._boundingInfo; }; SubMesh.prototype.getMesh = function () { return this._mesh; }; SubMesh.prototype.getRenderingMesh = function () { return this._renderingMesh; }; SubMesh.prototype.getMaterial = function () { var rootMaterial = this._renderingMesh.material; if (rootMaterial && rootMaterial instanceof BABYLON.MultiMaterial) { var multiMaterial = rootMaterial; return multiMaterial.getSubMaterial(this.materialIndex); } if (!rootMaterial) { return this._mesh.getScene().defaultMaterial; } return rootMaterial; }; // Methods SubMesh.prototype.refreshBoundingInfo = function () { var data = this._renderingMesh.getVerticesData(BABYLON.VertexBuffer.PositionKind); if (!data) { this._boundingInfo = this._mesh._boundingInfo; return; } var indices = this._renderingMesh.getIndices(); var extend; if (this.indexStart === 0 && this.indexCount === indices.length) { extend = BABYLON.Tools.ExtractMinAndMax(data, this.verticesStart, this.verticesCount); } else { extend = BABYLON.Tools.ExtractMinAndMaxIndexed(data, indices, this.indexStart, this.indexCount); } this._boundingInfo = new BABYLON.BoundingInfo(extend.minimum, extend.maximum); }; SubMesh.prototype._checkCollision = function (collider) { return this._boundingInfo._checkCollision(collider); }; SubMesh.prototype.updateBoundingInfo = function (world) { if (!this._boundingInfo) { this.refreshBoundingInfo(); } this._boundingInfo._update(world); }; SubMesh.prototype.isInFrustum = function (frustumPlanes) { return this._boundingInfo.isInFrustum(frustumPlanes); }; SubMesh.prototype.render = function () { this._renderingMesh.render(this); }; SubMesh.prototype.getLinesIndexBuffer = function (indices, engine) { if (!this._linesIndexBuffer) { var linesIndices = []; for (var index = this.indexStart; index < this.indexStart + this.indexCount; index += 3) { linesIndices.push(indices[index], indices[index + 1], indices[index + 1], indices[index + 2], indices[index + 2], indices[index]); } this._linesIndexBuffer = engine.createIndexBuffer(linesIndices); this.linesIndexCount = linesIndices.length; } return this._linesIndexBuffer; }; SubMesh.prototype.canIntersects = function (ray) { return ray.intersectsBox(this._boundingInfo.boundingBox); }; SubMesh.prototype.intersects = function (ray, positions, indices, fastCheck) { var intersectInfo = null; for (var index = this.indexStart; index < this.indexStart + this.indexCount; index += 3) { var p0 = positions[indices[index]]; var p1 = positions[indices[index + 1]]; var p2 = positions[indices[index + 2]]; var currentIntersectInfo = ray.intersectsTriangle(p0, p1, p2); if (currentIntersectInfo) { if (currentIntersectInfo.distance < 0) { continue; } if (fastCheck || !intersectInfo || currentIntersectInfo.distance < intersectInfo.distance) { intersectInfo = currentIntersectInfo; intersectInfo.faceId = index / 3; if (fastCheck) { break; } } } } return intersectInfo; }; // Clone SubMesh.prototype.clone = function (newMesh, newRenderingMesh) { var result = new SubMesh(this.materialIndex, this.verticesStart, this.verticesCount, this.indexStart, this.indexCount, newMesh, newRenderingMesh, false); result._boundingInfo = new BABYLON.BoundingInfo(this._boundingInfo.minimum, this._boundingInfo.maximum); return result; }; // Dispose SubMesh.prototype.dispose = function () { if (this._linesIndexBuffer) { this._mesh.getScene().getEngine()._releaseBuffer(this._linesIndexBuffer); this._linesIndexBuffer = null; } // Remove from mesh var index = this._mesh.subMeshes.indexOf(this); this._mesh.subMeshes.splice(index, 1); }; // Statics SubMesh.CreateFromIndices = function (materialIndex, startIndex, indexCount, mesh, renderingMesh) { var minVertexIndex = Number.MAX_VALUE; var maxVertexIndex = -Number.MAX_VALUE; renderingMesh = renderingMesh || mesh; var indices = renderingMesh.getIndices(); for (var index = startIndex; index < startIndex + indexCount; index++) { var vertexIndex = indices[index]; if (vertexIndex < minVertexIndex) minVertexIndex = vertexIndex; if (vertexIndex > maxVertexIndex) maxVertexIndex = vertexIndex; } return new BABYLON.SubMesh(materialIndex, minVertexIndex, maxVertexIndex - minVertexIndex + 1, startIndex, indexCount, mesh, renderingMesh); }; return SubMesh; })(); BABYLON.SubMesh = SubMesh; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.subMesh.js.map var BABYLON; (function (BABYLON) { var BaseTexture = (function () { function BaseTexture(scene) { this.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_NONE; this.hasAlpha = false; this.getAlphaFromRGB = false; this.level = 1; this.isCube = false; this.isRenderTarget = false; this.animations = new Array(); this.coordinatesIndex = 0; this.coordinatesMode = BABYLON.Texture.EXPLICIT_MODE; this.wrapU = BABYLON.Texture.WRAP_ADDRESSMODE; this.wrapV = BABYLON.Texture.WRAP_ADDRESSMODE; this.anisotropicFilteringLevel = 4; this._scene = scene; this._scene.textures.push(this); } BaseTexture.prototype.getScene = function () { return this._scene; }; BaseTexture.prototype.getTextureMatrix = function () { return null; }; BaseTexture.prototype.getReflectionTextureMatrix = function () { return null; }; BaseTexture.prototype.getInternalTexture = function () { return this._texture; }; BaseTexture.prototype.isReady = function () { if (this.delayLoadState === BABYLON.Engine.DELAYLOADSTATE_NOTLOADED) { return true; } if (this._texture) { return this._texture.isReady; } return false; }; BaseTexture.prototype.getSize = function () { if (this._texture._width) { return { width: this._texture._width, height: this._texture._height }; } if (this._texture._size) { return { width: this._texture._size, height: this._texture._size }; } return { width: 0, height: 0 }; }; BaseTexture.prototype.getBaseSize = function () { if (!this.isReady()) return { width: 0, height: 0 }; if (this._texture._size) { return { width: this._texture._size, height: this._texture._size }; } return { width: this._texture._baseWidth, height: this._texture._baseHeight }; }; BaseTexture.prototype.scale = function (ratio) { }; Object.defineProperty(BaseTexture.prototype, "canRescale", { get: function () { return false; }, enumerable: true, configurable: true }); BaseTexture.prototype._removeFromCache = function (url, noMipmap) { var texturesCache = this._scene.getEngine().getLoadedTexturesCache(); for (var index = 0; index < texturesCache.length; index++) { var texturesCacheEntry = texturesCache[index]; if (texturesCacheEntry.url === url && texturesCacheEntry.noMipmap === noMipmap) { texturesCache.splice(index, 1); return; } } }; BaseTexture.prototype._getFromCache = function (url, noMipmap, sampling) { var texturesCache = this._scene.getEngine().getLoadedTexturesCache(); for (var index = 0; index < texturesCache.length; index++) { var texturesCacheEntry = texturesCache[index]; if (texturesCacheEntry.url === url && texturesCacheEntry.noMipmap === noMipmap) { if (!sampling || sampling === texturesCacheEntry.samplingMode) { texturesCacheEntry.references++; return texturesCacheEntry; } } } return null; }; BaseTexture.prototype.delayLoad = function () { }; BaseTexture.prototype.releaseInternalTexture = function () { if (!this._texture) { return; } var texturesCache = this._scene.getEngine().getLoadedTexturesCache(); this._texture.references--; // Final reference ? if (this._texture.references === 0) { var index = texturesCache.indexOf(this._texture); texturesCache.splice(index, 1); this._scene.getEngine()._releaseTexture(this._texture); delete this._texture; } }; BaseTexture.prototype.clone = function () { return null; }; BaseTexture.prototype.dispose = function () { // Remove from scene var index = this._scene.textures.indexOf(this); if (index >= 0) { this._scene.textures.splice(index, 1); } if (this._texture === undefined) { return; } this.releaseInternalTexture(); // Callback if (this.onDispose) { this.onDispose(); } }; return BaseTexture; })(); BABYLON.BaseTexture = BaseTexture; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.baseTexture.js.map var BABYLON; (function (BABYLON) { var RenderingGroup = (function () { function RenderingGroup(index, scene) { this.index = index; this._opaqueSubMeshes = new BABYLON.SmartArray(256); this._transparentSubMeshes = new BABYLON.SmartArray(256); this._alphaTestSubMeshes = new BABYLON.SmartArray(256); this._scene = scene; } RenderingGroup.prototype.render = function (customRenderFunction) { if (customRenderFunction) { customRenderFunction(this._opaqueSubMeshes, this._alphaTestSubMeshes, this._transparentSubMeshes); return true; } if (this._opaqueSubMeshes.length === 0 && this._alphaTestSubMeshes.length === 0 && this._transparentSubMeshes.length === 0) { return false; } var engine = this._scene.getEngine(); // Opaque var subIndex; var submesh; for (subIndex = 0; subIndex < this._opaqueSubMeshes.length; subIndex++) { submesh = this._opaqueSubMeshes.data[subIndex]; submesh.render(); } // Alpha test engine.setAlphaTesting(true); for (subIndex = 0; subIndex < this._alphaTestSubMeshes.length; subIndex++) { submesh = this._alphaTestSubMeshes.data[subIndex]; submesh.render(); } engine.setAlphaTesting(false); // Transparent if (this._transparentSubMeshes.length) { for (subIndex = 0; subIndex < this._transparentSubMeshes.length; subIndex++) { submesh = this._transparentSubMeshes.data[subIndex]; submesh._alphaIndex = submesh.getMesh().alphaIndex; submesh._distanceToCamera = submesh.getBoundingInfo().boundingSphere.centerWorld.subtract(this._scene.activeCamera.position).length(); } var sortedArray = this._transparentSubMeshes.data.slice(0, this._transparentSubMeshes.length); sortedArray.sort(function (a, b) { // Alpha index first if (a._alphaIndex > b._alphaIndex) { return 1; } if (a._alphaIndex < b._alphaIndex) { return -1; } // Then distance to camera if (a._distanceToCamera < b._distanceToCamera) { return 1; } if (a._distanceToCamera > b._distanceToCamera) { return -1; } return 0; }); // Rendering engine.setAlphaMode(BABYLON.Engine.ALPHA_COMBINE); for (subIndex = 0; subIndex < sortedArray.length; subIndex++) { submesh = sortedArray[subIndex]; submesh.render(); } engine.setAlphaMode(BABYLON.Engine.ALPHA_DISABLE); } return true; }; RenderingGroup.prototype.prepare = function () { this._opaqueSubMeshes.reset(); this._transparentSubMeshes.reset(); this._alphaTestSubMeshes.reset(); }; RenderingGroup.prototype.dispatch = function (subMesh) { var material = subMesh.getMaterial(); var mesh = subMesh.getMesh(); if (material.needAlphaBlending() || mesh.visibility < 1.0 || mesh.hasVertexAlpha) { this._transparentSubMeshes.push(subMesh); } else if (material.needAlphaTesting()) { this._alphaTestSubMeshes.push(subMesh); } else { this._opaqueSubMeshes.push(subMesh); // Opaque } }; return RenderingGroup; })(); BABYLON.RenderingGroup = RenderingGroup; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.renderingGroup.js.map var BABYLON; (function (BABYLON) { var RenderingManager = (function () { function RenderingManager(scene) { this._renderingGroups = new Array(); this._scene = scene; } RenderingManager.prototype._renderParticles = function (index, activeMeshes) { if (this._scene._activeParticleSystems.length === 0) { return; } // Particles var beforeParticlesDate = BABYLON.Tools.Now; for (var particleIndex = 0; particleIndex < this._scene._activeParticleSystems.length; particleIndex++) { var particleSystem = this._scene._activeParticleSystems.data[particleIndex]; if (particleSystem.renderingGroupId !== index) { continue; } this._clearDepthBuffer(); if (!particleSystem.emitter.position || !activeMeshes || activeMeshes.indexOf(particleSystem.emitter) !== -1) { this._scene._activeParticles += particleSystem.render(); } } this._scene._particlesDuration += BABYLON.Tools.Now - beforeParticlesDate; }; RenderingManager.prototype._renderSprites = function (index) { if (this._scene.spriteManagers.length === 0) { return; } // Sprites var beforeSpritessDate = BABYLON.Tools.Now; for (var id = 0; id < this._scene.spriteManagers.length; id++) { var spriteManager = this._scene.spriteManagers[id]; if (spriteManager.renderingGroupId === index) { this._clearDepthBuffer(); spriteManager.render(); } } this._scene._spritesDuration += BABYLON.Tools.Now - beforeSpritessDate; }; RenderingManager.prototype._clearDepthBuffer = function () { if (this._depthBufferAlreadyCleaned) { return; } this._scene.getEngine().clear(0, false, true); this._depthBufferAlreadyCleaned = true; }; RenderingManager.prototype.render = function (customRenderFunction, activeMeshes, renderParticles, renderSprites) { for (var index = 0; index < BABYLON.RenderingManager.MAX_RENDERINGGROUPS; index++) { this._depthBufferAlreadyCleaned = false; var renderingGroup = this._renderingGroups[index]; if (renderingGroup) { this._clearDepthBuffer(); if (!renderingGroup.render(customRenderFunction)) { this._renderingGroups.splice(index, 1); } } this._renderSprites(index); if (renderParticles) { this._renderParticles(index, activeMeshes); } } }; RenderingManager.prototype.reset = function () { for (var index in this._renderingGroups) { var renderingGroup = this._renderingGroups[index]; renderingGroup.prepare(); } }; RenderingManager.prototype.dispatch = function (subMesh) { var mesh = subMesh.getMesh(); var renderingGroupId = mesh.renderingGroupId || 0; if (!this._renderingGroups[renderingGroupId]) { this._renderingGroups[renderingGroupId] = new BABYLON.RenderingGroup(renderingGroupId, this._scene); } this._renderingGroups[renderingGroupId].dispatch(subMesh); }; RenderingManager.MAX_RENDERINGGROUPS = 4; return RenderingManager; })(); BABYLON.RenderingManager = RenderingManager; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.renderingManager.js.map var BABYLON; (function (BABYLON) { var Texture = (function (_super) { __extends(Texture, _super); function Texture(url, scene, noMipmap, invertY, samplingMode, onLoad, onError, buffer, deleteBuffer) { if (typeof samplingMode === "undefined") { samplingMode = Texture.TRILINEAR_SAMPLINGMODE; } if (typeof onLoad === "undefined") { onLoad = null; } if (typeof onError === "undefined") { onError = null; } if (typeof buffer === "undefined") { buffer = null; } if (typeof deleteBuffer === "undefined") { deleteBuffer = false; } _super.call(this, scene); this.uOffset = 0; this.vOffset = 0; this.uScale = 1.0; this.vScale = 1.0; this.uAng = 0; this.vAng = 0; this.wAng = 0; this.name = url; this.url = url; this._noMipmap = noMipmap; this._invertY = invertY; this._samplingMode = samplingMode; this._buffer = buffer; this._deleteBuffer = deleteBuffer; if (!url) { return; } this._texture = this._getFromCache(url, noMipmap, samplingMode); if (!this._texture) { if (!scene.useDelayedTextureLoading) { this._texture = scene.getEngine().createTexture(url, noMipmap, invertY, scene, this._samplingMode, onLoad, onError, this._buffer); if (deleteBuffer) { delete this._buffer; } } else { this.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_NOTLOADED; } } } Texture.prototype.delayLoad = function () { if (this.delayLoadState != BABYLON.Engine.DELAYLOADSTATE_NOTLOADED) { return; } this.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_LOADED; this._texture = this._getFromCache(this.url, this._noMipmap, this._samplingMode); if (!this._texture) { this._texture = this.getScene().getEngine().createTexture(this.url, this._noMipmap, this._invertY, this.getScene(), this._samplingMode, null, null, this._buffer); if (this._deleteBuffer) { delete this._buffer; } } }; Texture.prototype._prepareRowForTextureGeneration = function (x, y, z, t) { x -= this.uOffset + 0.5; y -= this.vOffset + 0.5; z -= 0.5; BABYLON.Vector3.TransformCoordinatesFromFloatsToRef(x, y, z, this._rowGenerationMatrix, t); t.x *= this.uScale; t.y *= this.vScale; t.x += 0.5; t.y += 0.5; t.z += 0.5; }; Texture.prototype.getTextureMatrix = function () { if (this.uOffset === this._cachedUOffset && this.vOffset === this._cachedVOffset && this.uScale === this._cachedUScale && this.vScale === this._cachedVScale && this.uAng === this._cachedUAng && this.vAng === this._cachedVAng && this.wAng === this._cachedWAng) { return this._cachedTextureMatrix; } this._cachedUOffset = this.uOffset; this._cachedVOffset = this.vOffset; this._cachedUScale = this.uScale; this._cachedVScale = this.vScale; this._cachedUAng = this.uAng; this._cachedVAng = this.vAng; this._cachedWAng = this.wAng; if (!this._cachedTextureMatrix) { this._cachedTextureMatrix = BABYLON.Matrix.Zero(); this._rowGenerationMatrix = new BABYLON.Matrix(); this._t0 = BABYLON.Vector3.Zero(); this._t1 = BABYLON.Vector3.Zero(); this._t2 = BABYLON.Vector3.Zero(); } BABYLON.Matrix.RotationYawPitchRollToRef(this.vAng, this.uAng, this.wAng, this._rowGenerationMatrix); this._prepareRowForTextureGeneration(0, 0, 0, this._t0); this._prepareRowForTextureGeneration(1.0, 0, 0, this._t1); this._prepareRowForTextureGeneration(0, 1.0, 0, this._t2); this._t1.subtractInPlace(this._t0); this._t2.subtractInPlace(this._t0); BABYLON.Matrix.IdentityToRef(this._cachedTextureMatrix); this._cachedTextureMatrix.m[0] = this._t1.x; this._cachedTextureMatrix.m[1] = this._t1.y; this._cachedTextureMatrix.m[2] = this._t1.z; this._cachedTextureMatrix.m[4] = this._t2.x; this._cachedTextureMatrix.m[5] = this._t2.y; this._cachedTextureMatrix.m[6] = this._t2.z; this._cachedTextureMatrix.m[8] = this._t0.x; this._cachedTextureMatrix.m[9] = this._t0.y; this._cachedTextureMatrix.m[10] = this._t0.z; return this._cachedTextureMatrix; }; Texture.prototype.getReflectionTextureMatrix = function () { if (this.uOffset === this._cachedUOffset && this.vOffset === this._cachedVOffset && this.uScale === this._cachedUScale && this.vScale === this._cachedVScale && this.coordinatesMode === this._cachedCoordinatesMode) { return this._cachedTextureMatrix; } if (!this._cachedTextureMatrix) { this._cachedTextureMatrix = BABYLON.Matrix.Zero(); this._projectionModeMatrix = BABYLON.Matrix.Zero(); } this._cachedCoordinatesMode = this.coordinatesMode; switch (this.coordinatesMode) { case BABYLON.Texture.SPHERICAL_MODE: BABYLON.Matrix.IdentityToRef(this._cachedTextureMatrix); this._cachedTextureMatrix[0] = -0.5 * this.uScale; this._cachedTextureMatrix[5] = -0.5 * this.vScale; this._cachedTextureMatrix[12] = 0.5 + this.uOffset; this._cachedTextureMatrix[13] = 0.5 + this.vOffset; break; case BABYLON.Texture.PLANAR_MODE: BABYLON.Matrix.IdentityToRef(this._cachedTextureMatrix); this._cachedTextureMatrix[0] = this.uScale; this._cachedTextureMatrix[5] = this.vScale; this._cachedTextureMatrix[12] = this.uOffset; this._cachedTextureMatrix[13] = this.vOffset; break; case BABYLON.Texture.PROJECTION_MODE: BABYLON.Matrix.IdentityToRef(this._projectionModeMatrix); this._projectionModeMatrix.m[0] = 0.5; this._projectionModeMatrix.m[5] = -0.5; this._projectionModeMatrix.m[10] = 0.0; this._projectionModeMatrix.m[12] = 0.5; this._projectionModeMatrix.m[13] = 0.5; this._projectionModeMatrix.m[14] = 1.0; this._projectionModeMatrix.m[15] = 1.0; this.getScene().getProjectionMatrix().multiplyToRef(this._projectionModeMatrix, this._cachedTextureMatrix); break; default: BABYLON.Matrix.IdentityToRef(this._cachedTextureMatrix); break; } return this._cachedTextureMatrix; }; Texture.prototype.clone = function () { var newTexture = new BABYLON.Texture(this._texture.url, this.getScene(), this._noMipmap, this._invertY); // Base texture newTexture.hasAlpha = this.hasAlpha; newTexture.level = this.level; newTexture.wrapU = this.wrapU; newTexture.wrapV = this.wrapV; newTexture.coordinatesIndex = this.coordinatesIndex; newTexture.coordinatesMode = this.coordinatesMode; // Texture newTexture.uOffset = this.uOffset; newTexture.vOffset = this.vOffset; newTexture.uScale = this.uScale; newTexture.vScale = this.vScale; newTexture.uAng = this.uAng; newTexture.vAng = this.vAng; newTexture.wAng = this.wAng; return newTexture; }; // Statics Texture.CreateFromBase64String = function (data, name, scene, noMipmap, invertY, samplingMode, onLoad, onError) { if (typeof samplingMode === "undefined") { samplingMode = Texture.TRILINEAR_SAMPLINGMODE; } if (typeof onLoad === "undefined") { onLoad = null; } if (typeof onError === "undefined") { onError = null; } return new Texture("data:" + name, scene, noMipmap, invertY, samplingMode, onLoad, onError, data); }; Texture.NEAREST_SAMPLINGMODE = 1; Texture.BILINEAR_SAMPLINGMODE = 2; Texture.TRILINEAR_SAMPLINGMODE = 3; Texture.EXPLICIT_MODE = 0; Texture.SPHERICAL_MODE = 1; Texture.PLANAR_MODE = 2; Texture.CUBIC_MODE = 3; Texture.PROJECTION_MODE = 4; Texture.SKYBOX_MODE = 5; Texture.CLAMP_ADDRESSMODE = 0; Texture.WRAP_ADDRESSMODE = 1; Texture.MIRROR_ADDRESSMODE = 2; return Texture; })(BABYLON.BaseTexture); BABYLON.Texture = Texture; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.texture.js.map var BABYLON; (function (BABYLON) { var CubeTexture = (function (_super) { __extends(CubeTexture, _super); function CubeTexture(rootUrl, scene, extensions, noMipmap) { _super.call(this, scene); this.coordinatesMode = BABYLON.Texture.CUBIC_MODE; this.name = rootUrl; this.url = rootUrl; this._noMipmap = noMipmap; this.hasAlpha = false; this._texture = this._getFromCache(rootUrl, noMipmap); if (!extensions) { extensions = ["_px.jpg", "_py.jpg", "_pz.jpg", "_nx.jpg", "_ny.jpg", "_nz.jpg"]; } this._extensions = extensions; if (!this._texture) { if (!scene.useDelayedTextureLoading) { this._texture = scene.getEngine().createCubeTexture(rootUrl, scene, extensions, noMipmap); } else { this.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_NOTLOADED; } } this.isCube = true; this._textureMatrix = BABYLON.Matrix.Identity(); } CubeTexture.prototype.clone = function () { var newTexture = new BABYLON.CubeTexture(this.url, this.getScene(), this._extensions, this._noMipmap); // Base texture newTexture.level = this.level; newTexture.wrapU = this.wrapU; newTexture.wrapV = this.wrapV; newTexture.coordinatesIndex = this.coordinatesIndex; newTexture.coordinatesMode = this.coordinatesMode; return newTexture; }; // Methods CubeTexture.prototype.delayLoad = function () { if (this.delayLoadState != BABYLON.Engine.DELAYLOADSTATE_NOTLOADED) { return; } this.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_LOADED; this._texture = this._getFromCache(this.url, this._noMipmap); if (!this._texture) { this._texture = this.getScene().getEngine().createCubeTexture(this.url, this.getScene(), this._extensions); } }; CubeTexture.prototype.getReflectionTextureMatrix = function () { return this._textureMatrix; }; return CubeTexture; })(BABYLON.BaseTexture); BABYLON.CubeTexture = CubeTexture; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.cubeTexture.js.map var BABYLON; (function (BABYLON) { var RenderTargetTexture = (function (_super) { __extends(RenderTargetTexture, _super); function RenderTargetTexture(name, size, scene, generateMipMaps, doNotChangeAspectRatio) { if (typeof doNotChangeAspectRatio === "undefined") { doNotChangeAspectRatio = true; } _super.call(this, null, scene, !generateMipMaps); this.renderList = new Array(); this.renderParticles = true; this.renderSprites = false; this.coordinatesMode = BABYLON.Texture.PROJECTION_MODE; this._currentRefreshId = -1; this._refreshRate = 1; this.name = name; this.isRenderTarget = true; this._size = size; this._generateMipMaps = generateMipMaps; this._doNotChangeAspectRatio = doNotChangeAspectRatio; this._texture = scene.getEngine().createRenderTargetTexture(size, generateMipMaps); // Rendering groups this._renderingManager = new BABYLON.RenderingManager(scene); } RenderTargetTexture.prototype.resetRefreshCounter = function () { this._currentRefreshId = -1; }; Object.defineProperty(RenderTargetTexture.prototype, "refreshRate", { get: function () { return this._refreshRate; }, // Use 0 to render just once, 1 to render on every frame, 2 to render every two frames and so on... set: function (value) { this._refreshRate = value; this.resetRefreshCounter(); }, enumerable: true, configurable: true }); RenderTargetTexture.prototype._shouldRender = function () { if (this._currentRefreshId === -1) { this._currentRefreshId = 1; return true; } if (this.refreshRate == this._currentRefreshId) { this._currentRefreshId = 1; return true; } this._currentRefreshId++; return false; }; RenderTargetTexture.prototype.isReady = function () { if (!this.getScene().renderTargetsEnabled) { return false; } return _super.prototype.isReady.call(this); }; RenderTargetTexture.prototype.getRenderSize = function () { return this._size; }; Object.defineProperty(RenderTargetTexture.prototype, "canRescale", { get: function () { return true; }, enumerable: true, configurable: true }); RenderTargetTexture.prototype.scale = function (ratio) { var newSize = this._size * ratio; this.resize(newSize, this._generateMipMaps); }; RenderTargetTexture.prototype.resize = function (size, generateMipMaps) { this.releaseInternalTexture(); this._texture = this.getScene().getEngine().createRenderTargetTexture(size, generateMipMaps); }; RenderTargetTexture.prototype.render = function (useCameraPostProcess) { var scene = this.getScene(); var engine = scene.getEngine(); if (this._waitingRenderList) { this.renderList = []; for (var index = 0; index < this._waitingRenderList.length; index++) { var id = this._waitingRenderList[index]; this.renderList.push(scene.getMeshByID(id)); } delete this._waitingRenderList; } if (!this.renderList) { return; } // Bind if (!useCameraPostProcess || !scene.postProcessManager._prepareFrame(this._texture)) { engine.bindFramebuffer(this._texture); } // Clear engine.clear(scene.clearColor, true, true); this._renderingManager.reset(); for (var meshIndex = 0; meshIndex < this.renderList.length; meshIndex++) { var mesh = this.renderList[meshIndex]; if (mesh) { if (!mesh.isReady() || (mesh.material && !mesh.material.isReady())) { // Reset _currentRefreshId this.resetRefreshCounter(); continue; } if (mesh.isEnabled() && mesh.isVisible && mesh.subMeshes && ((mesh.layerMask & scene.activeCamera.layerMask) != 0)) { mesh._activate(scene.getRenderId()); for (var subIndex = 0; subIndex < mesh.subMeshes.length; subIndex++) { var subMesh = mesh.subMeshes[subIndex]; scene._activeVertices += subMesh.indexCount; this._renderingManager.dispatch(subMesh); } } } } if (!this._doNotChangeAspectRatio) { scene.updateTransformMatrix(true); } if (this.onBeforeRender) { this.onBeforeRender(); } // Render this._renderingManager.render(this.customRenderFunction, this.renderList, this.renderParticles, this.renderSprites); if (useCameraPostProcess) { scene.postProcessManager._finalizeFrame(false, this._texture); } if (this.onAfterRender) { this.onAfterRender(); } // Unbind engine.unBindFramebuffer(this._texture); if (!this._doNotChangeAspectRatio) { scene.updateTransformMatrix(true); } }; RenderTargetTexture.prototype.clone = function () { var textureSize = this.getSize(); var newTexture = new BABYLON.RenderTargetTexture(this.name, textureSize.width, this.getScene(), this._generateMipMaps); // Base texture newTexture.hasAlpha = this.hasAlpha; newTexture.level = this.level; // RenderTarget Texture newTexture.coordinatesMode = this.coordinatesMode; newTexture.renderList = this.renderList.slice(0); return newTexture; }; return RenderTargetTexture; })(BABYLON.Texture); BABYLON.RenderTargetTexture = RenderTargetTexture; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.renderTargetTexture.js.map var BABYLON; (function (BABYLON) { var ProceduralTexture = (function (_super) { __extends(ProceduralTexture, _super); function ProceduralTexture(name, size, fragment, scene, fallbackTexture, generateMipMaps) { if (typeof generateMipMaps === "undefined") { generateMipMaps = true; } _super.call(this, null, scene, !generateMipMaps); this._currentRefreshId = -1; this._refreshRate = 1; this._vertexDeclaration = [2]; this._vertexStrideSize = 2 * 4; this._uniforms = new Array(); this._samplers = new Array(); this._textures = new Array(); this._floats = new Array(); this._floatsArrays = {}; this._colors3 = new Array(); this._colors4 = new Array(); this._vectors2 = new Array(); this._vectors3 = new Array(); this._matrices = new Array(); this._fallbackTextureUsed = false; scene._proceduralTextures.push(this); this.name = name; this.isRenderTarget = true; this._size = size; this._generateMipMaps = generateMipMaps; this.setFragment(fragment); this._fallbackTexture = fallbackTexture; this._texture = scene.getEngine().createRenderTargetTexture(size, generateMipMaps); // VBO var vertices = []; vertices.push(1, 1); vertices.push(-1, 1); vertices.push(-1, -1); vertices.push(1, -1); this._vertexBuffer = scene.getEngine().createVertexBuffer(vertices); // Indices var indices = []; indices.push(0); indices.push(1); indices.push(2); indices.push(0); indices.push(2); indices.push(3); this._indexBuffer = scene.getEngine().createIndexBuffer(indices); } ProceduralTexture.prototype.reset = function () { if (this._effect === undefined) { return; } var engine = this.getScene().getEngine(); engine._releaseEffect(this._effect); }; ProceduralTexture.prototype.isReady = function () { var _this = this; var engine = this.getScene().getEngine(); var shaders; if (!this._fragment) { return false; } if (this._fallbackTextureUsed) { return true; } if (this._fragment.fragmentElement !== undefined) { shaders = { vertex: "procedural", fragmentElement: this._fragment.fragmentElement }; } else { shaders = { vertex: "procedural", fragment: this._fragment }; } this._effect = engine.createEffect(shaders, ["position"], this._uniforms, this._samplers, "", null, null, function () { _this.releaseInternalTexture(); if (_this._fallbackTexture) { _this._texture = _this._fallbackTexture._texture; _this._texture.references++; } _this._fallbackTextureUsed = true; }); return this._effect.isReady(); }; ProceduralTexture.prototype.resetRefreshCounter = function () { this._currentRefreshId = -1; }; ProceduralTexture.prototype.setFragment = function (fragment) { this._fragment = fragment; }; Object.defineProperty(ProceduralTexture.prototype, "refreshRate", { get: function () { return this._refreshRate; }, // Use 0 to render just once, 1 to render on every frame, 2 to render every two frames and so on... set: function (value) { this._refreshRate = value; this.resetRefreshCounter(); }, enumerable: true, configurable: true }); ProceduralTexture.prototype._shouldRender = function () { if (!this.isReady() || !this._texture) { return false; } if (this._fallbackTextureUsed) { return false; } if (this._currentRefreshId === -1) { this._currentRefreshId = 1; return true; } if (this.refreshRate === this._currentRefreshId) { this._currentRefreshId = 1; return true; } this._currentRefreshId++; return false; }; ProceduralTexture.prototype.getRenderSize = function () { return this._size; }; ProceduralTexture.prototype.resize = function (size, generateMipMaps) { if (this._fallbackTextureUsed) { return; } this.releaseInternalTexture(); this._texture = this.getScene().getEngine().createRenderTargetTexture(size, generateMipMaps); }; ProceduralTexture.prototype._checkUniform = function (uniformName) { if (this._uniforms.indexOf(uniformName) === -1) { this._uniforms.push(uniformName); } }; ProceduralTexture.prototype.setTexture = function (name, texture) { if (this._samplers.indexOf(name) === -1) { this._samplers.push(name); } this._textures[name] = texture; return this; }; ProceduralTexture.prototype.setFloat = function (name, value) { this._checkUniform(name); this._floats[name] = value; return this; }; ProceduralTexture.prototype.setFloats = function (name, value) { this._checkUniform(name); this._floatsArrays[name] = value; return this; }; ProceduralTexture.prototype.setColor3 = function (name, value) { this._checkUniform(name); this._colors3[name] = value; return this; }; ProceduralTexture.prototype.setColor4 = function (name, value) { this._checkUniform(name); this._colors4[name] = value; return this; }; ProceduralTexture.prototype.setVector2 = function (name, value) { this._checkUniform(name); this._vectors2[name] = value; return this; }; ProceduralTexture.prototype.setVector3 = function (name, value) { this._checkUniform(name); this._vectors3[name] = value; return this; }; ProceduralTexture.prototype.setMatrix = function (name, value) { this._checkUniform(name); this._matrices[name] = value; return this; }; ProceduralTexture.prototype.render = function (useCameraPostProcess) { var scene = this.getScene(); var engine = scene.getEngine(); engine.bindFramebuffer(this._texture); // Clear engine.clear(scene.clearColor, true, true); // Render engine.enableEffect(this._effect); engine.setState(false); for (var name in this._textures) { this._effect.setTexture(name, this._textures[name]); } for (name in this._floats) { this._effect.setFloat(name, this._floats[name]); } for (name in this._floatsArrays) { this._effect.setArray(name, this._floatsArrays[name]); } for (name in this._colors3) { this._effect.setColor3(name, this._colors3[name]); } for (name in this._colors4) { var color = this._colors4[name]; this._effect.setFloat4(name, color.r, color.g, color.b, color.a); } for (name in this._vectors2) { this._effect.setVector2(name, this._vectors2[name]); } for (name in this._vectors3) { this._effect.setVector3(name, this._vectors3[name]); } for (name in this._matrices) { this._effect.setMatrix(name, this._matrices[name]); } // VBOs engine.bindBuffers(this._vertexBuffer, this._indexBuffer, this._vertexDeclaration, this._vertexStrideSize, this._effect); // Draw order engine.draw(true, 0, 6); // Unbind engine.unBindFramebuffer(this._texture); }; ProceduralTexture.prototype.clone = function () { var textureSize = this.getSize(); var newTexture = new ProceduralTexture(this.name, textureSize.width, this._fragment, this.getScene(), this._fallbackTexture, this._generateMipMaps); // Base texture newTexture.hasAlpha = this.hasAlpha; newTexture.level = this.level; // RenderTarget Texture newTexture.coordinatesMode = this.coordinatesMode; return newTexture; }; ProceduralTexture.prototype.dispose = function () { var index = this.getScene()._proceduralTextures.indexOf(this); if (index >= 0) { this.getScene()._proceduralTextures.splice(index, 1); } _super.prototype.dispose.call(this); }; return ProceduralTexture; })(BABYLON.Texture); BABYLON.ProceduralTexture = ProceduralTexture; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.proceduralTexture.js.map var BABYLON; (function (BABYLON) { var WoodProceduralTexture = (function (_super) { __extends(WoodProceduralTexture, _super); function WoodProceduralTexture(name, size, scene, fallbackTexture, generateMipMaps) { _super.call(this, name, size, "wood", scene, fallbackTexture, generateMipMaps); this._ampScale = 100.0; this._woodColor = new BABYLON.Color3(0.32, 0.17, 0.09); this.updateShaderUniforms(); this.refreshRate = 0; } WoodProceduralTexture.prototype.updateShaderUniforms = function () { this.setFloat("ampScale", this._ampScale); this.setColor3("woodColor", this._woodColor); }; Object.defineProperty(WoodProceduralTexture.prototype, "ampScale", { get: function () { return this._ampScale; }, set: function (value) { this._ampScale = value; this.updateShaderUniforms(); }, enumerable: true, configurable: true }); Object.defineProperty(WoodProceduralTexture.prototype, "woodColor", { get: function () { return this._woodColor; }, set: function (value) { this._woodColor = value; this.updateShaderUniforms(); }, enumerable: true, configurable: true }); return WoodProceduralTexture; })(BABYLON.ProceduralTexture); BABYLON.WoodProceduralTexture = WoodProceduralTexture; var FireProceduralTexture = (function (_super) { __extends(FireProceduralTexture, _super); function FireProceduralTexture(name, size, scene, fallbackTexture, generateMipMaps) { _super.call(this, name, size, "fire", scene, fallbackTexture, generateMipMaps); this._time = 0.0; this._speed = new BABYLON.Vector2(0.5, 0.3); this._shift = 1.6; this._autoGenerateTime = true; this._alphaThreshold = 0.5; this._fireColors = FireProceduralTexture.RedFireColors; this.updateShaderUniforms(); this.refreshRate = 1; } FireProceduralTexture.prototype.updateShaderUniforms = function () { this.setFloat("time", this._time); this.setVector2("speed", this._speed); this.setFloat("shift", this._shift); this.setColor3("c1", this._fireColors[0]); this.setColor3("c2", this._fireColors[1]); this.setColor3("c3", this._fireColors[2]); this.setColor3("c4", this._fireColors[3]); this.setColor3("c5", this._fireColors[4]); this.setColor3("c6", this._fireColors[5]); this.setFloat("alphaThreshold", this._alphaThreshold); }; FireProceduralTexture.prototype.render = function (useCameraPostProcess) { if (this._autoGenerateTime) { this._time += this.getScene().getAnimationRatio() * 0.03; this.updateShaderUniforms(); } _super.prototype.render.call(this, useCameraPostProcess); }; Object.defineProperty(FireProceduralTexture, "PurpleFireColors", { get: function () { return [ new BABYLON.Color3(0.5, 0.0, 1.0), new BABYLON.Color3(0.9, 0.0, 1.0), new BABYLON.Color3(0.2, 0.0, 1.0), new BABYLON.Color3(1.0, 0.9, 1.0), new BABYLON.Color3(0.1, 0.1, 1.0), new BABYLON.Color3(0.9, 0.9, 1.0) ]; }, enumerable: true, configurable: true }); Object.defineProperty(FireProceduralTexture, "GreenFireColors", { get: function () { return [ new BABYLON.Color3(0.5, 1.0, 0.0), new BABYLON.Color3(0.5, 1.0, 0.0), new BABYLON.Color3(0.3, 0.4, 0.0), new BABYLON.Color3(0.5, 1.0, 0.0), new BABYLON.Color3(0.2, 0.0, 0.0), new BABYLON.Color3(0.5, 1.0, 0.0) ]; }, enumerable: true, configurable: true }); Object.defineProperty(FireProceduralTexture, "RedFireColors", { get: function () { return [ new BABYLON.Color3(0.5, 0.0, 0.1), new BABYLON.Color3(0.9, 0.0, 0.0), new BABYLON.Color3(0.2, 0.0, 0.0), new BABYLON.Color3(1.0, 0.9, 0.0), new BABYLON.Color3(0.1, 0.1, 0.1), new BABYLON.Color3(0.9, 0.9, 0.9) ]; }, enumerable: true, configurable: true }); Object.defineProperty(FireProceduralTexture, "BlueFireColors", { get: function () { return [ new BABYLON.Color3(0.1, 0.0, 0.5), new BABYLON.Color3(0.0, 0.0, 0.5), new BABYLON.Color3(0.1, 0.0, 0.2), new BABYLON.Color3(0.0, 0.0, 1.0), new BABYLON.Color3(0.1, 0.2, 0.3), new BABYLON.Color3(0.0, 0.2, 0.9) ]; }, enumerable: true, configurable: true }); Object.defineProperty(FireProceduralTexture.prototype, "fireColors", { get: function () { return this._fireColors; }, set: function (value) { this._fireColors = value; this.updateShaderUniforms(); }, enumerable: true, configurable: true }); Object.defineProperty(FireProceduralTexture.prototype, "time", { get: function () { return this._time; }, set: function (value) { this._time = value; this.updateShaderUniforms(); }, enumerable: true, configurable: true }); Object.defineProperty(FireProceduralTexture.prototype, "speed", { get: function () { return this._speed; }, set: function (value) { this._speed = value; this.updateShaderUniforms(); }, enumerable: true, configurable: true }); Object.defineProperty(FireProceduralTexture.prototype, "shift", { get: function () { return this._shift; }, set: function (value) { this._shift = value; this.updateShaderUniforms(); }, enumerable: true, configurable: true }); Object.defineProperty(FireProceduralTexture.prototype, "alphaThreshold", { get: function () { return this._alphaThreshold; }, set: function (value) { this._alphaThreshold = value; this.updateShaderUniforms(); }, enumerable: true, configurable: true }); return FireProceduralTexture; })(BABYLON.ProceduralTexture); BABYLON.FireProceduralTexture = FireProceduralTexture; var CloudProceduralTexture = (function (_super) { __extends(CloudProceduralTexture, _super); function CloudProceduralTexture(name, size, scene, fallbackTexture, generateMipMaps) { _super.call(this, name, size, "cloud", scene, fallbackTexture, generateMipMaps); this._skyColor = new BABYLON.Color3(0.15, 0.68, 1.0); this._cloudColor = new BABYLON.Color3(1, 1, 1); this.updateShaderUniforms(); this.refreshRate = 0; } CloudProceduralTexture.prototype.updateShaderUniforms = function () { this.setColor3("skyColor", this._skyColor); this.setColor3("cloudColor", this._cloudColor); }; Object.defineProperty(CloudProceduralTexture.prototype, "skyColor", { get: function () { return this._skyColor; }, set: function (value) { this._skyColor = value; this.updateShaderUniforms(); }, enumerable: true, configurable: true }); Object.defineProperty(CloudProceduralTexture.prototype, "cloudColor", { get: function () { return this._cloudColor; }, set: function (value) { this._cloudColor = value; this.updateShaderUniforms(); }, enumerable: true, configurable: true }); return CloudProceduralTexture; })(BABYLON.ProceduralTexture); BABYLON.CloudProceduralTexture = CloudProceduralTexture; var GrassProceduralTexture = (function (_super) { __extends(GrassProceduralTexture, _super); function GrassProceduralTexture(name, size, scene, fallbackTexture, generateMipMaps) { _super.call(this, name, size, "grass", scene, fallbackTexture, generateMipMaps); this._herb1 = new BABYLON.Color3(0.29, 0.38, 0.02); this._herb2 = new BABYLON.Color3(0.36, 0.49, 0.09); this._herb3 = new BABYLON.Color3(0.51, 0.6, 0.28); this._groundColor = new BABYLON.Color3(1, 1, 1); this._grassColors = [ new BABYLON.Color3(0.29, 0.38, 0.02), new BABYLON.Color3(0.36, 0.49, 0.09), new BABYLON.Color3(0.51, 0.6, 0.28) ]; this.updateShaderUniforms(); this.refreshRate = 0; } GrassProceduralTexture.prototype.updateShaderUniforms = function () { this.setColor3("herb1Color", this._grassColors[0]); this.setColor3("herb2Color", this._grassColors[1]); this.setColor3("herb3Color", this._grassColors[2]); this.setColor3("groundColor", this._groundColor); }; Object.defineProperty(GrassProceduralTexture.prototype, "grassColors", { get: function () { return this._grassColors; }, set: function (value) { this._grassColors = value; this.updateShaderUniforms(); }, enumerable: true, configurable: true }); Object.defineProperty(GrassProceduralTexture.prototype, "groundColor", { get: function () { return this._groundColor; }, set: function (value) { this.groundColor = value; this.updateShaderUniforms(); }, enumerable: true, configurable: true }); return GrassProceduralTexture; })(BABYLON.ProceduralTexture); BABYLON.GrassProceduralTexture = GrassProceduralTexture; var RoadProceduralTexture = (function (_super) { __extends(RoadProceduralTexture, _super); function RoadProceduralTexture(name, size, scene, fallbackTexture, generateMipMaps) { _super.call(this, name, size, "road", scene, fallbackTexture, generateMipMaps); this._roadColor = new BABYLON.Color3(0.53, 0.53, 0.53); this.updateShaderUniforms(); this.refreshRate = 0; } RoadProceduralTexture.prototype.updateShaderUniforms = function () { this.setColor3("roadColor", this._roadColor); }; Object.defineProperty(RoadProceduralTexture.prototype, "roadColor", { get: function () { return this._roadColor; }, set: function (value) { this._roadColor = value; this.updateShaderUniforms(); }, enumerable: true, configurable: true }); return RoadProceduralTexture; })(BABYLON.ProceduralTexture); BABYLON.RoadProceduralTexture = RoadProceduralTexture; var BrickProceduralTexture = (function (_super) { __extends(BrickProceduralTexture, _super); function BrickProceduralTexture(name, size, scene, fallbackTexture, generateMipMaps) { _super.call(this, name, size, "brick", scene, fallbackTexture, generateMipMaps); this._numberOfBricksHeight = 15; this._numberOfBricksWidth = 5; this._jointColor = new BABYLON.Color3(0.72, 0.72, 0.72); this._brickColor = new BABYLON.Color3(0.77, 0.47, 0.40); this.updateShaderUniforms(); this.refreshRate = 0; } BrickProceduralTexture.prototype.updateShaderUniforms = function () { this.setFloat("numberOfBricksHeight", this._numberOfBricksHeight); this.setFloat("numberOfBricksWidth", this._numberOfBricksWidth); this.setColor3("brickColor", this._brickColor); this.setColor3("jointColor", this._jointColor); }; Object.defineProperty(BrickProceduralTexture.prototype, "numberOfBricksHeight", { get: function () { return this._numberOfBricksHeight; }, enumerable: true, configurable: true }); Object.defineProperty(BrickProceduralTexture.prototype, "cloudColor", { set: function (value) { this._numberOfBricksHeight = value; this.updateShaderUniforms(); }, enumerable: true, configurable: true }); Object.defineProperty(BrickProceduralTexture.prototype, "numberOfBricksWidth", { get: function () { return this._numberOfBricksWidth; }, set: function (value) { this._numberOfBricksHeight = value; this.updateShaderUniforms(); }, enumerable: true, configurable: true }); Object.defineProperty(BrickProceduralTexture.prototype, "jointColor", { get: function () { return this._jointColor; }, set: function (value) { this._jointColor = value; this.updateShaderUniforms(); }, enumerable: true, configurable: true }); Object.defineProperty(BrickProceduralTexture.prototype, "brickColor", { get: function () { return this._brickColor; }, set: function (value) { this._brickColor = value; this.updateShaderUniforms(); }, enumerable: true, configurable: true }); return BrickProceduralTexture; })(BABYLON.ProceduralTexture); BABYLON.BrickProceduralTexture = BrickProceduralTexture; var MarbleProceduralTexture = (function (_super) { __extends(MarbleProceduralTexture, _super); function MarbleProceduralTexture(name, size, scene, fallbackTexture, generateMipMaps) { _super.call(this, name, size, "marble", scene, fallbackTexture, generateMipMaps); this._numberOfTilesHeight = 3; this._numberOfTilesWidth = 3; this._amplitude = 9.0; this._marbleColor = new BABYLON.Color3(0.77, 0.47, 0.40); this._jointColor = new BABYLON.Color3(0.72, 0.72, 0.72); this.updateShaderUniforms(); this.refreshRate = 0; } MarbleProceduralTexture.prototype.updateShaderUniforms = function () { this.setFloat("numberOfTilesHeight", this._numberOfTilesHeight); this.setFloat("numberOfTilesWidth", this._numberOfTilesWidth); this.setFloat("amplitude", this._amplitude); this.setColor3("marbleColor", this._marbleColor); this.setColor3("jointColor", this._jointColor); }; Object.defineProperty(MarbleProceduralTexture.prototype, "numberOfTilesHeight", { get: function () { return this._numberOfTilesHeight; }, set: function (value) { this._numberOfTilesHeight = value; this.updateShaderUniforms(); }, enumerable: true, configurable: true }); Object.defineProperty(MarbleProceduralTexture.prototype, "numberOfTilesWidth", { get: function () { return this._numberOfTilesWidth; }, set: function (value) { this._numberOfTilesWidth = value; this.updateShaderUniforms(); }, enumerable: true, configurable: true }); Object.defineProperty(MarbleProceduralTexture.prototype, "jointColor", { get: function () { return this._jointColor; }, set: function (value) { this._jointColor = value; this.updateShaderUniforms(); }, enumerable: true, configurable: true }); Object.defineProperty(MarbleProceduralTexture.prototype, "marbleColor", { get: function () { return this._marbleColor; }, set: function (value) { this._marbleColor = value; this.updateShaderUniforms(); }, enumerable: true, configurable: true }); return MarbleProceduralTexture; })(BABYLON.ProceduralTexture); BABYLON.MarbleProceduralTexture = MarbleProceduralTexture; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.standardProceduralTexture.js.map var BABYLON; (function (BABYLON) { var CustomProceduralTexture = (function (_super) { __extends(CustomProceduralTexture, _super); function CustomProceduralTexture(name, texturePath, size, scene, fallbackTexture, generateMipMaps) { _super.call(this, name, size, null, scene, fallbackTexture, generateMipMaps); this._animate = true; this._time = 0; this._texturePath = texturePath; //Try to load json this.loadJson(texturePath); this.refreshRate = 1; } CustomProceduralTexture.prototype.loadJson = function (jsonUrl) { var _this = this; var that = this; function noConfigFile() { BABYLON.Tools.Log("No config file found in " + jsonUrl + " trying to use ShaderStore or DOM element"); try { that.setFragment(that._texturePath); } catch (ex) { BABYLON.Tools.Error("No json or ShaderStore or DOM element found for CustomProceduralTexture"); } } var configFileUrl = jsonUrl + "/config.json"; var xhr = new XMLHttpRequest(); xhr.open("GET", configFileUrl, true); xhr.addEventListener("load", function () { if (xhr.status === 200 || BABYLON.Tools.ValidateXHRData(xhr, 1)) { try { _this._config = JSON.parse(xhr.response); _this.updateShaderUniforms(); _this.updateTextures(); _this.setFragment(_this._texturePath + "/custom"); _this._animate = _this._config.animate; _this.refreshRate = _this._config.refreshrate; } catch (ex) { noConfigFile(); } } else { noConfigFile(); } }, false); xhr.addEventListener("error", function (event) { noConfigFile(); }, false); try { xhr.send(); } catch (ex) { BABYLON.Tools.Error("CustomProceduralTexture: Error on XHR send request."); } }; CustomProceduralTexture.prototype.isReady = function () { if (!_super.prototype.isReady.call(this)) { return false; } for (var name in this._textures) { var texture = this._textures[name]; if (!texture.isReady()) { return false; } } return true; }; CustomProceduralTexture.prototype.render = function (useCameraPostProcess) { if (this._animate) { this._time += this.getScene().getAnimationRatio() * 0.03; this.updateShaderUniforms(); } _super.prototype.render.call(this, useCameraPostProcess); }; CustomProceduralTexture.prototype.updateTextures = function () { for (var i = 0; i < this._config.sampler2Ds.length; i++) { this.setTexture(this._config.sampler2Ds[i].sample2Dname, new BABYLON.Texture(this._texturePath + "/" + this._config.sampler2Ds[i].textureRelativeUrl, this.getScene())); } }; CustomProceduralTexture.prototype.updateShaderUniforms = function () { if (this._config) { for (var j = 0; j < this._config.uniforms.length; j++) { var uniform = this._config.uniforms[j]; switch (uniform.type) { case "float": this.setFloat(uniform.name, uniform.value); break; case "color3": this.setColor3(uniform.name, new BABYLON.Color3(uniform.r, uniform.g, uniform.b)); break; case "color4": this.setColor4(uniform.name, new BABYLON.Color4(uniform.r, uniform.g, uniform.b, uniform.a)); break; case "vector2": this.setVector2(uniform.name, new BABYLON.Vector2(uniform.x, uniform.y)); break; case "vector3": this.setVector3(uniform.name, new BABYLON.Vector3(uniform.x, uniform.y, uniform.z)); break; } } } this.setFloat("time", this._time); }; Object.defineProperty(CustomProceduralTexture.prototype, "animate", { get: function () { return this._animate; }, set: function (value) { this._animate = value; }, enumerable: true, configurable: true }); return CustomProceduralTexture; })(BABYLON.ProceduralTexture); BABYLON.CustomProceduralTexture = CustomProceduralTexture; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.customProceduralTexture.js.map var BABYLON; (function (BABYLON) { var MirrorTexture = (function (_super) { __extends(MirrorTexture, _super); function MirrorTexture(name, size, scene, generateMipMaps) { var _this = this; _super.call(this, name, size, scene, generateMipMaps, true); this.mirrorPlane = new BABYLON.Plane(0, 1, 0, 1); this._transformMatrix = BABYLON.Matrix.Zero(); this._mirrorMatrix = BABYLON.Matrix.Zero(); this.onBeforeRender = function () { BABYLON.Matrix.ReflectionToRef(_this.mirrorPlane, _this._mirrorMatrix); _this._savedViewMatrix = scene.getViewMatrix(); _this._mirrorMatrix.multiplyToRef(_this._savedViewMatrix, _this._transformMatrix); scene.setTransformMatrix(_this._transformMatrix, scene.getProjectionMatrix()); scene.clipPlane = _this.mirrorPlane; scene.getEngine().cullBackFaces = false; }; this.onAfterRender = function () { scene.setTransformMatrix(_this._savedViewMatrix, scene.getProjectionMatrix()); scene.getEngine().cullBackFaces = true; delete scene.clipPlane; }; } MirrorTexture.prototype.clone = function () { var textureSize = this.getSize(); var newTexture = new BABYLON.MirrorTexture(this.name, textureSize.width, this.getScene(), this._generateMipMaps); // Base texture newTexture.hasAlpha = this.hasAlpha; newTexture.level = this.level; // Mirror Texture newTexture.mirrorPlane = this.mirrorPlane.clone(); newTexture.renderList = this.renderList.slice(0); return newTexture; }; return MirrorTexture; })(BABYLON.RenderTargetTexture); BABYLON.MirrorTexture = MirrorTexture; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.mirrorTexture.js.map var BABYLON; (function (BABYLON) { var DynamicTexture = (function (_super) { __extends(DynamicTexture, _super); function DynamicTexture(name, options, scene, generateMipMaps, samplingMode) { if (typeof samplingMode === "undefined") { samplingMode = BABYLON.Texture.TRILINEAR_SAMPLINGMODE; } _super.call(this, null, scene, !generateMipMaps); this.name = name; this.wrapU = BABYLON.Texture.CLAMP_ADDRESSMODE; this.wrapV = BABYLON.Texture.CLAMP_ADDRESSMODE; this._generateMipMaps = generateMipMaps; if (options.getContext) { this._canvas = options; this._texture = scene.getEngine().createDynamicTexture(options.width, options.height, generateMipMaps, samplingMode); } else { this._canvas = document.createElement("canvas"); if (options.width) { this._texture = scene.getEngine().createDynamicTexture(options.width, options.height, generateMipMaps, samplingMode); } else { this._texture = scene.getEngine().createDynamicTexture(options, options, generateMipMaps, samplingMode); } } var textureSize = this.getSize(); this._canvas.width = textureSize.width; this._canvas.height = textureSize.height; this._context = this._canvas.getContext("2d"); } Object.defineProperty(DynamicTexture.prototype, "canRescale", { get: function () { return true; }, enumerable: true, configurable: true }); DynamicTexture.prototype.scale = function (ratio) { var textureSize = this.getSize(); textureSize.width *= ratio; textureSize.height *= ratio; this._canvas.width = textureSize.width; this._canvas.height = textureSize.height; this.releaseInternalTexture(); this._texture = this.getScene().getEngine().createDynamicTexture(textureSize.width, textureSize.height, this._generateMipMaps, this._samplingMode); }; DynamicTexture.prototype.getContext = function () { return this._context; }; DynamicTexture.prototype.clear = function () { var size = this.getSize(); this._context.fillRect(0, 0, size.width, size.height); }; DynamicTexture.prototype.update = function (invertY) { this.getScene().getEngine().updateDynamicTexture(this._texture, this._canvas, invertY === undefined ? true : invertY); }; DynamicTexture.prototype.drawText = function (text, x, y, font, color, clearColor, invertY, update) { if (typeof update === "undefined") { update = true; } var size = this.getSize(); if (clearColor) { this._context.fillStyle = clearColor; this._context.fillRect(0, 0, size.width, size.height); } this._context.font = font; if (x === null) { var textSize = this._context.measureText(text); x = (size.width - textSize.width) / 2; } this._context.fillStyle = color; this._context.fillText(text, x, y); if (update) { this.update(invertY); } }; DynamicTexture.prototype.clone = function () { var textureSize = this.getSize(); var newTexture = new DynamicTexture(this.name, textureSize.width, this.getScene(), this._generateMipMaps); // Base texture newTexture.hasAlpha = this.hasAlpha; newTexture.level = this.level; // Dynamic Texture newTexture.wrapU = this.wrapU; newTexture.wrapV = this.wrapV; return newTexture; }; return DynamicTexture; })(BABYLON.Texture); BABYLON.DynamicTexture = DynamicTexture; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.dynamicTexture.js.map var BABYLON; (function (BABYLON) { var VideoTexture = (function (_super) { __extends(VideoTexture, _super); function VideoTexture(name, urls, size, scene, generateMipMaps, invertY, samplingMode) { if (typeof samplingMode === "undefined") { samplingMode = BABYLON.Texture.TRILINEAR_SAMPLINGMODE; } var _this = this; _super.call(this, null, scene, !generateMipMaps, invertY); this._autoLaunch = true; this.name = name; this.wrapU = BABYLON.Texture.WRAP_ADDRESSMODE; this.wrapV = BABYLON.Texture.WRAP_ADDRESSMODE; var requiredWidth = size.width || size; var requiredHeight = size.height || size; this._texture = scene.getEngine().createDynamicTexture(requiredWidth, requiredHeight, generateMipMaps, samplingMode); var textureSize = this.getSize(); this.video = document.createElement("video"); this.video.width = textureSize.width; this.video.height = textureSize.height; this.video.autoplay = false; this.video.loop = true; this.video.addEventListener("canplaythrough", function () { if (_this._texture) { _this._texture.isReady = true; } }); urls.forEach(function (url) { var source = document.createElement("source"); source.src = url; _this.video.appendChild(source); }); this._lastUpdate = BABYLON.Tools.Now; } VideoTexture.prototype.update = function () { if (this._autoLaunch) { this._autoLaunch = false; this.video.play(); } var now = BABYLON.Tools.Now; if (now - this._lastUpdate < 15) { return false; } this._lastUpdate = now; this.getScene().getEngine().updateVideoTexture(this._texture, this.video, this._invertY); return true; }; return VideoTexture; })(BABYLON.Texture); BABYLON.VideoTexture = VideoTexture; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.videoTexture.js.map var BABYLON; (function (BABYLON) { var EffectFallbacks = (function () { function EffectFallbacks() { this._defines = {}; this._currentRank = 32; this._maxRank = -1; } EffectFallbacks.prototype.addFallback = function (rank, define) { if (!this._defines[rank]) { if (rank < this._currentRank) { this._currentRank = rank; } if (rank > this._maxRank) { this._maxRank = rank; } this._defines[rank] = new Array(); } this._defines[rank].push(define); }; Object.defineProperty(EffectFallbacks.prototype, "isMoreFallbacks", { get: function () { return this._currentRank <= this._maxRank; }, enumerable: true, configurable: true }); EffectFallbacks.prototype.reduce = function (currentDefines) { var currentFallbacks = this._defines[this._currentRank]; for (var index = 0; index < currentFallbacks.length; index++) { currentDefines = currentDefines.replace("#define " + currentFallbacks[index], ""); } this._currentRank++; return currentDefines; }; return EffectFallbacks; })(); BABYLON.EffectFallbacks = EffectFallbacks; var Effect = (function () { function Effect(baseName, attributesNames, uniformsNames, samplers, engine, defines, fallbacks, onCompiled, onError) { var _this = this; this._isReady = false; this._compilationError = ""; this._valueCache = []; this._engine = engine; this.name = baseName; this.defines = defines; this._uniformsNames = uniformsNames.concat(samplers); this._samplers = samplers; this._attributesNames = attributesNames; this.onError = onError; this.onCompiled = onCompiled; var vertexSource; var fragmentSource; if (baseName.vertexElement) { vertexSource = document.getElementById(baseName.vertexElement); if (!vertexSource) { vertexSource = baseName.vertexElement; } } else { vertexSource = baseName.vertex || baseName; } if (baseName.fragmentElement) { fragmentSource = document.getElementById(baseName.fragmentElement); if (!fragmentSource) { fragmentSource = baseName.fragmentElement; } } else { fragmentSource = baseName.fragment || baseName; } this._loadVertexShader(vertexSource, function (vertexCode) { _this._loadFragmentShader(fragmentSource, function (fragmentCode) { _this._prepareEffect(vertexCode, fragmentCode, attributesNames, defines, fallbacks); }); }); } // Properties Effect.prototype.isReady = function () { return this._isReady; }; Effect.prototype.getProgram = function () { return this._program; }; Effect.prototype.getAttributesNames = function () { return this._attributesNames; }; Effect.prototype.getAttributeLocation = function (index) { return this._attributes[index]; }; Effect.prototype.getAttributeLocationByName = function (name) { var index = this._attributesNames.indexOf(name); return this._attributes[index]; }; Effect.prototype.getAttributesCount = function () { return this._attributes.length; }; Effect.prototype.getUniformIndex = function (uniformName) { return this._uniformsNames.indexOf(uniformName); }; Effect.prototype.getUniform = function (uniformName) { return this._uniforms[this._uniformsNames.indexOf(uniformName)]; }; Effect.prototype.getSamplers = function () { return this._samplers; }; Effect.prototype.getCompilationError = function () { return this._compilationError; }; // Methods Effect.prototype._loadVertexShader = function (vertex, callback) { // DOM element ? if (vertex instanceof HTMLElement) { var vertexCode = BABYLON.Tools.GetDOMTextContent(vertex); callback(vertexCode); return; } // Is in local store ? if (Effect.ShadersStore[vertex + "VertexShader"]) { callback(Effect.ShadersStore[vertex + "VertexShader"]); return; } var vertexShaderUrl; if (vertex[0] === ".") { vertexShaderUrl = vertex; } else { vertexShaderUrl = BABYLON.Engine.ShadersRepository + vertex; } // Vertex shader BABYLON.Tools.LoadFile(vertexShaderUrl + ".vertex.fx", callback); }; Effect.prototype._loadFragmentShader = function (fragment, callback) { // DOM element ? if (fragment instanceof HTMLElement) { var fragmentCode = BABYLON.Tools.GetDOMTextContent(fragment); callback(fragmentCode); return; } // Is in local store ? if (Effect.ShadersStore[fragment + "PixelShader"]) { callback(Effect.ShadersStore[fragment + "PixelShader"]); return; } if (Effect.ShadersStore[fragment + "FragmentShader"]) { callback(Effect.ShadersStore[fragment + "FragmentShader"]); return; } var fragmentShaderUrl; if (fragment[0] === ".") { fragmentShaderUrl = fragment; } else { fragmentShaderUrl = BABYLON.Engine.ShadersRepository + fragment; } // Fragment shader BABYLON.Tools.LoadFile(fragmentShaderUrl + ".fragment.fx", callback); }; Effect.prototype._prepareEffect = function (vertexSourceCode, fragmentSourceCode, attributesNames, defines, fallbacks) { try { var engine = this._engine; this._program = engine.createShaderProgram(vertexSourceCode, fragmentSourceCode, defines); this._uniforms = engine.getUniforms(this._program, this._uniformsNames); this._attributes = engine.getAttributes(this._program, attributesNames); for (var index = 0; index < this._samplers.length; index++) { var sampler = this.getUniform(this._samplers[index]); if (sampler == null) { this._samplers.splice(index, 1); index--; } } engine.bindSamplers(this); this._isReady = true; if (this.onCompiled) { this.onCompiled(this); } } catch (e) { // Is it a problem with precision? if (e.message.indexOf("highp") !== -1) { vertexSourceCode = vertexSourceCode.replace("precision highp float", "precision mediump float"); fragmentSourceCode = fragmentSourceCode.replace("precision highp float", "precision mediump float"); this._prepareEffect(vertexSourceCode, fragmentSourceCode, attributesNames, defines, fallbacks); return; } // Let's go through fallbacks then if (fallbacks && fallbacks.isMoreFallbacks) { defines = fallbacks.reduce(defines); this._prepareEffect(vertexSourceCode, fragmentSourceCode, attributesNames, defines, fallbacks); } else { BABYLON.Tools.Error("Unable to compile effect: " + this.name); BABYLON.Tools.Error("Defines: " + defines); BABYLON.Tools.Error("Error: " + e.message); this._compilationError = e.message; if (this.onError) { this.onError(this, this._compilationError); } } } }; Effect.prototype._bindTexture = function (channel, texture) { this._engine._bindTexture(this._samplers.indexOf(channel), texture); }; Effect.prototype.setTexture = function (channel, texture) { this._engine.setTexture(this._samplers.indexOf(channel), texture); }; Effect.prototype.setTextureFromPostProcess = function (channel, postProcess) { this._engine.setTextureFromPostProcess(this._samplers.indexOf(channel), postProcess); }; //public _cacheMatrix(uniformName, matrix) { // if (!this._valueCache[uniformName]) { // this._valueCache[uniformName] = new BABYLON.Matrix(); // } // for (var index = 0; index < 16; index++) { // this._valueCache[uniformName].m[index] = matrix.m[index]; // } //}; Effect.prototype._cacheFloat2 = function (uniformName, x, y) { if (!this._valueCache[uniformName]) { this._valueCache[uniformName] = [x, y]; return; } this._valueCache[uniformName][0] = x; this._valueCache[uniformName][1] = y; }; Effect.prototype._cacheFloat3 = function (uniformName, x, y, z) { if (!this._valueCache[uniformName]) { this._valueCache[uniformName] = [x, y, z]; return; } this._valueCache[uniformName][0] = x; this._valueCache[uniformName][1] = y; this._valueCache[uniformName][2] = z; }; Effect.prototype._cacheFloat4 = function (uniformName, x, y, z, w) { if (!this._valueCache[uniformName]) { this._valueCache[uniformName] = [x, y, z, w]; return; } this._valueCache[uniformName][0] = x; this._valueCache[uniformName][1] = y; this._valueCache[uniformName][2] = z; this._valueCache[uniformName][3] = w; }; Effect.prototype.setArray = function (uniformName, array) { this._engine.setArray(this.getUniform(uniformName), array); return this; }; Effect.prototype.setMatrices = function (uniformName, matrices) { this._engine.setMatrices(this.getUniform(uniformName), matrices); return this; }; Effect.prototype.setMatrix = function (uniformName, matrix) { //if (this._valueCache[uniformName] && this._valueCache[uniformName].equals(matrix)) // return; //this._cacheMatrix(uniformName, matrix); this._engine.setMatrix(this.getUniform(uniformName), matrix); return this; }; Effect.prototype.setFloat = function (uniformName, value) { if (this._valueCache[uniformName] && this._valueCache[uniformName] === value) return this; this._valueCache[uniformName] = value; this._engine.setFloat(this.getUniform(uniformName), value); return this; }; Effect.prototype.setBool = function (uniformName, bool) { if (this._valueCache[uniformName] && this._valueCache[uniformName] === bool) return this; this._valueCache[uniformName] = bool; this._engine.setBool(this.getUniform(uniformName), bool ? 1 : 0); return this; }; Effect.prototype.setVector2 = function (uniformName, vector2) { if (this._valueCache[uniformName] && this._valueCache[uniformName][0] === vector2.x && this._valueCache[uniformName][1] === vector2.y) return this; this._cacheFloat2(uniformName, vector2.x, vector2.y); this._engine.setFloat2(this.getUniform(uniformName), vector2.x, vector2.y); return this; }; Effect.prototype.setFloat2 = function (uniformName, x, y) { if (this._valueCache[uniformName] && this._valueCache[uniformName][0] === x && this._valueCache[uniformName][1] === y) return this; this._cacheFloat2(uniformName, x, y); this._engine.setFloat2(this.getUniform(uniformName), x, y); return this; }; Effect.prototype.setVector3 = function (uniformName, vector3) { if (this._valueCache[uniformName] && this._valueCache[uniformName][0] === vector3.x && this._valueCache[uniformName][1] === vector3.y && this._valueCache[uniformName][2] === vector3.z) return this; this._cacheFloat3(uniformName, vector3.x, vector3.y, vector3.z); this._engine.setFloat3(this.getUniform(uniformName), vector3.x, vector3.y, vector3.z); return this; }; Effect.prototype.setFloat3 = function (uniformName, x, y, z) { if (this._valueCache[uniformName] && this._valueCache[uniformName][0] === x && this._valueCache[uniformName][1] === y && this._valueCache[uniformName][2] === z) return this; this._cacheFloat3(uniformName, x, y, z); this._engine.setFloat3(this.getUniform(uniformName), x, y, z); return this; }; Effect.prototype.setFloat4 = function (uniformName, x, y, z, w) { if (this._valueCache[uniformName] && this._valueCache[uniformName][0] === x && this._valueCache[uniformName][1] === y && this._valueCache[uniformName][2] === z && this._valueCache[uniformName][3] === w) return this; this._cacheFloat4(uniformName, x, y, z, w); this._engine.setFloat4(this.getUniform(uniformName), x, y, z, w); return this; }; Effect.prototype.setColor3 = function (uniformName, color3) { if (this._valueCache[uniformName] && this._valueCache[uniformName][0] === color3.r && this._valueCache[uniformName][1] === color3.g && this._valueCache[uniformName][2] === color3.b) return this; this._cacheFloat3(uniformName, color3.r, color3.g, color3.b); this._engine.setColor3(this.getUniform(uniformName), color3); return this; }; Effect.prototype.setColor4 = function (uniformName, color3, alpha) { if (this._valueCache[uniformName] && this._valueCache[uniformName][0] === color3.r && this._valueCache[uniformName][1] === color3.g && this._valueCache[uniformName][2] === color3.b && this._valueCache[uniformName][3] === alpha) return this; this._cacheFloat4(uniformName, color3.r, color3.g, color3.b, alpha); this._engine.setColor4(this.getUniform(uniformName), color3, alpha); return this; }; Effect.ShadersStore={anaglyphPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Samplers\nvarying vec2 vUV;\nuniform sampler2D textureSampler;\nuniform sampler2D leftSampler;\n\nvoid main(void)\n{\n vec4 leftFrag = texture2D(leftSampler, vUV);\n leftFrag = vec4(1.0, leftFrag.g, leftFrag.b, 1.0);\n\n vec4 rightFrag = texture2D(textureSampler, vUV);\n rightFrag = vec4(rightFrag.r, 1.0, 1.0, 1.0);\n\n gl_FragColor = vec4(rightFrag.rgb * leftFrag.rgb, 1.0);\n}", blackAndWhitePixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Samplers\nvarying vec2 vUV;\nuniform sampler2D textureSampler;\n\nvoid main(void) \n{\n float luminance = dot(texture2D(textureSampler, vUV).rgb, vec3(0.3, 0.59, 0.11));\n gl_FragColor = vec4(luminance, luminance, luminance, 1.0);\n}", blurPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Samplers\nvarying vec2 vUV;\nuniform sampler2D textureSampler;\n\n// Parameters\nuniform vec2 screenSize;\nuniform vec2 direction;\nuniform float blurWidth;\n\nvoid main(void)\n{\n float weights[7];\n weights[0] = 0.05;\n weights[1] = 0.1;\n weights[2] = 0.2;\n weights[3] = 0.3;\n weights[4] = 0.2;\n weights[5] = 0.1;\n weights[6] = 0.05;\n\n vec2 texelSize = vec2(1.0 / screenSize.x, 1.0 / screenSize.y);\n vec2 texelStep = texelSize * direction * blurWidth;\n vec2 start = vUV - 3.0 * texelStep;\n\n vec4 baseColor = vec4(0., 0., 0., 0.);\n vec2 texelOffset = vec2(0., 0.);\n\n for (int i = 0; i < 7; i++)\n {\n baseColor += texture2D(textureSampler, start + texelOffset) * weights[i];\n texelOffset += texelStep;\n }\n\n gl_FragColor = baseColor;\n}", brickPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\nvarying vec2 vPosition;\nvarying vec2 vUV;\n\nuniform float numberOfBricksHeight;\nuniform float numberOfBricksWidth;\nuniform vec3 brickColor;\nuniform vec3 jointColor;\n\nfloat rand(vec2 n) {\n return fract(cos(dot(n, vec2(12.9898, 4.1414))) * 43758.5453);\n}\n\nfloat noise(vec2 n) {\n const vec2 d = vec2(0.0, 1.0);\n vec2 b = floor(n), f = smoothstep(vec2(0.0), vec2(1.0), fract(n));\n return mix(mix(rand(b), rand(b + d.yx), f.x), mix(rand(b + d.xy), rand(b + d.yy), f.x), f.y);\n}\n\nfloat fbm(vec2 n) {\n float total = 0.0, amplitude = 1.0;\n for (int i = 0; i < 4; i++) {\n total += noise(n) * amplitude;\n n += n;\n amplitude *= 0.5;\n }\n return total;\n}\n\nfloat round(float number){\n return sign(number)*floor(abs(number) + 0.5);\n}\n\nvoid main(void)\n{\n float brickW = 1.0 / numberOfBricksWidth;\n float brickH = 1.0 / numberOfBricksHeight;\n float jointWPercentage = 0.01;\n float jointHPercentage = 0.05;\n vec3 color = brickColor;\n float yi = vUV.y / brickH;\n float nyi = round(yi);\n float xi = vUV.x / brickW;\n\n if (mod(floor(yi), 2.0) == 0.0){\n xi = xi - 0.5;\n }\n\n float nxi = round(xi);\n vec2 brickvUV = vec2((xi - floor(xi)) / brickH, (yi - floor(yi)) / brickW);\n\n if (yi < nyi + jointHPercentage && yi > nyi - jointHPercentage){\n color = mix(jointColor, vec3(0.37, 0.25, 0.25), (yi - nyi) / jointHPercentage + 0.2);\n }\n else if (xi < nxi + jointWPercentage && xi > nxi - jointWPercentage){\n color = mix(jointColor, vec3(0.44, 0.44, 0.44), (xi - nxi) / jointWPercentage + 0.2);\n }\n else {\n float brickColorSwitch = mod(floor(yi) + floor(xi), 3.0);\n\n if (brickColorSwitch == 0.0)\n color = mix(color, vec3(0.33, 0.33, 0.33), 0.3);\n else if (brickColorSwitch == 2.0)\n color = mix(color, vec3(0.11, 0.11, 0.11), 0.3);\n }\n\n gl_FragColor = vec4(color, 1.0);\n}", cloudPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\nvarying vec2 vUV;\n\nuniform vec3 skyColor;\nuniform vec3 cloudColor;\n\nfloat rand(vec2 n) {\n return fract(cos(dot(n, vec2(12.9898, 4.1414))) * 43758.5453);\n}\n\nfloat noise(vec2 n) {\n const vec2 d = vec2(0.0, 1.0);\n vec2 b = floor(n), f = smoothstep(vec2(0.0), vec2(1.0), fract(n));\n return mix(mix(rand(b), rand(b + d.yx), f.x), mix(rand(b + d.xy), rand(b + d.yy), f.x), f.y);\n}\n\nfloat fbm(vec2 n) {\n float total = 0.0, amplitude = 1.0;\n for (int i = 0; i < 4; i++) {\n total += noise(n) * amplitude;\n n += n;\n amplitude *= 0.5;\n }\n return total;\n}\n\nvoid main() {\n\n vec2 p = vUV * 12.0;\n vec3 c = mix(skyColor, cloudColor, fbm(p));\n gl_FragColor = vec4(c, 1);\n\n}", colorPixelShader:"precision highp float;\n\nuniform vec4 color;\n\nvoid main(void) {\n gl_FragColor = color;\n}", colorVertexShader:"precision highp float;\n\n// Attributes\nattribute vec3 position;\n\n// Uniforms\nuniform mat4 worldViewProjection;\n\nvoid main(void) {\n gl_Position = worldViewProjection * vec4(position, 1.0);\n}", convolutionPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Samplers\nvarying vec2 vUV;\nuniform sampler2D textureSampler;\n\nuniform vec2 screenSize;\nuniform float kernel[9];\n\nvoid main(void)\n{\n vec2 onePixel = vec2(1.0, 1.0) / screenSize;\n vec4 colorSum =\n texture2D(textureSampler, vUV + onePixel * vec2(-1, -1)) * kernel[0] +\n texture2D(textureSampler, vUV + onePixel * vec2(0, -1)) * kernel[1] +\n texture2D(textureSampler, vUV + onePixel * vec2(1, -1)) * kernel[2] +\n texture2D(textureSampler, vUV + onePixel * vec2(-1, 0)) * kernel[3] +\n texture2D(textureSampler, vUV + onePixel * vec2(0, 0)) * kernel[4] +\n texture2D(textureSampler, vUV + onePixel * vec2(1, 0)) * kernel[5] +\n texture2D(textureSampler, vUV + onePixel * vec2(-1, 1)) * kernel[6] +\n texture2D(textureSampler, vUV + onePixel * vec2(0, 1)) * kernel[7] +\n texture2D(textureSampler, vUV + onePixel * vec2(1, 1)) * kernel[8];\n\n float kernelWeight =\n kernel[0] +\n kernel[1] +\n kernel[2] +\n kernel[3] +\n kernel[4] +\n kernel[5] +\n kernel[6] +\n kernel[7] +\n kernel[8];\n\n if (kernelWeight <= 0.0) {\n kernelWeight = 1.0;\n }\n\n gl_FragColor = vec4((colorSum / kernelWeight).rgb, 1);\n}", defaultPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n#define MAP_EXPLICIT 0.\n#define MAP_SPHERICAL 1.\n#define MAP_PLANAR 2.\n#define MAP_CUBIC 3.\n#define MAP_PROJECTION 4.\n#define MAP_SKYBOX 5.\n\n// Constants\nuniform vec3 vEyePosition;\nuniform vec3 vAmbientColor;\nuniform vec4 vDiffuseColor;\nuniform vec4 vSpecularColor;\nuniform vec3 vEmissiveColor;\n\n// Input\nvarying vec3 vPositionW;\nvarying vec3 vNormalW;\n\n#ifdef VERTEXCOLOR\nvarying vec4 vColor;\n#endif\n\n// Lights\n#ifdef LIGHT0\nuniform vec4 vLightData0;\nuniform vec4 vLightDiffuse0;\nuniform vec3 vLightSpecular0;\n#ifdef SHADOW0\nvarying vec4 vPositionFromLight0;\nuniform sampler2D shadowSampler0;\nuniform float darkness0;\n#endif\n#ifdef SPOTLIGHT0\nuniform vec4 vLightDirection0;\n#endif\n#ifdef HEMILIGHT0\nuniform vec3 vLightGround0;\n#endif\n#endif\n\n#ifdef LIGHT1\nuniform vec4 vLightData1;\nuniform vec4 vLightDiffuse1;\nuniform vec3 vLightSpecular1;\n#ifdef SHADOW1\nvarying vec4 vPositionFromLight1;\nuniform sampler2D shadowSampler1;\nuniform float darkness1;\n#endif\n#ifdef SPOTLIGHT1\nuniform vec4 vLightDirection1;\n#endif\n#ifdef HEMILIGHT1\nuniform vec3 vLightGround1;\n#endif\n#endif\n\n#ifdef LIGHT2\nuniform vec4 vLightData2;\nuniform vec4 vLightDiffuse2;\nuniform vec3 vLightSpecular2;\n#ifdef SHADOW2\nvarying vec4 vPositionFromLight2;\nuniform sampler2D shadowSampler2;\nuniform float darkness2;\n#endif\n#ifdef SPOTLIGHT2\nuniform vec4 vLightDirection2;\n#endif\n#ifdef HEMILIGHT2\nuniform vec3 vLightGround2;\n#endif\n#endif\n\n#ifdef LIGHT3\nuniform vec4 vLightData3;\nuniform vec4 vLightDiffuse3;\nuniform vec3 vLightSpecular3;\n#ifdef SHADOW3\nvarying vec4 vPositionFromLight3;\nuniform sampler2D shadowSampler3;\nuniform float darkness3;\n#endif\n#ifdef SPOTLIGHT3\nuniform vec4 vLightDirection3;\n#endif\n#ifdef HEMILIGHT3\nuniform vec3 vLightGround3;\n#endif\n#endif\n\n// Samplers\n#ifdef DIFFUSE\nvarying vec2 vDiffuseUV;\nuniform sampler2D diffuseSampler;\nuniform vec2 vDiffuseInfos;\n#endif\n\n#ifdef AMBIENT\nvarying vec2 vAmbientUV;\nuniform sampler2D ambientSampler;\nuniform vec2 vAmbientInfos;\n#endif\n\n#ifdef OPACITY \nvarying vec2 vOpacityUV;\nuniform sampler2D opacitySampler;\nuniform vec2 vOpacityInfos;\n#endif\n\n#ifdef EMISSIVE\nvarying vec2 vEmissiveUV;\nuniform vec2 vEmissiveInfos;\nuniform sampler2D emissiveSampler;\n#endif\n\n#ifdef SPECULAR\nvarying vec2 vSpecularUV;\nuniform vec2 vSpecularInfos;\nuniform sampler2D specularSampler;\n#endif\n\n// Fresnel\n#ifdef FRESNEL\nfloat computeFresnelTerm(vec3 viewDirection, vec3 worldNormal, float bias, float power)\n{\n float fresnelTerm = pow(bias + abs(dot(viewDirection, worldNormal)), power);\n return clamp(fresnelTerm, 0., 1.);\n}\n#endif\n\n#ifdef DIFFUSEFRESNEL\nuniform vec4 diffuseLeftColor;\nuniform vec4 diffuseRightColor;\n#endif\n\n#ifdef OPACITYFRESNEL\nuniform vec4 opacityParts;\n#endif\n\n#ifdef REFLECTIONFRESNEL\nuniform vec4 reflectionLeftColor;\nuniform vec4 reflectionRightColor;\n#endif\n\n#ifdef EMISSIVEFRESNEL\nuniform vec4 emissiveLeftColor;\nuniform vec4 emissiveRightColor;\n#endif\n\n// Reflection\n#ifdef REFLECTION\nvarying vec3 vPositionUVW;\nuniform samplerCube reflectionCubeSampler;\nuniform sampler2D reflection2DSampler;\nuniform vec3 vReflectionInfos;\nuniform mat4 reflectionMatrix;\nuniform mat4 view;\n\nvec3 computeReflectionCoords(float mode, vec4 worldPos, vec3 worldNormal)\n{\n if (mode == MAP_SPHERICAL)\n {\n vec3 coords = vec3(view * vec4(worldNormal, 0.0));\n\n return vec3(reflectionMatrix * vec4(coords, 1.0));\n }\n else if (mode == MAP_PLANAR)\n {\n vec3 viewDir = worldPos.xyz - vEyePosition;\n vec3 coords = normalize(reflect(viewDir, worldNormal));\n\n return vec3(reflectionMatrix * vec4(coords, 1));\n }\n else if (mode == MAP_CUBIC)\n {\n vec3 viewDir = worldPos.xyz - vEyePosition;\n vec3 coords = reflect(viewDir, worldNormal);\n\n return vec3(reflectionMatrix * vec4(coords, 0));\n }\n else if (mode == MAP_PROJECTION)\n {\n return vec3(reflectionMatrix * (view * worldPos));\n }\n else if (mode == MAP_SKYBOX)\n {\n return vPositionUVW;\n }\n\n return vec3(0, 0, 0);\n}\n#endif\n\n// Shadows\n#ifdef SHADOWS\n\nfloat unpack(vec4 color)\n{\n const vec4 bitShift = vec4(1. / (255. * 255. * 255.), 1. / (255. * 255.), 1. / 255., 1.);\n return dot(color, bitShift);\n}\n\nfloat unpackHalf(vec2 color)\n{\n return color.x + (color.y / 255.0);\n}\n\nfloat computeShadow(vec4 vPositionFromLight, sampler2D shadowSampler, float darkness)\n{\n vec3 depth = vPositionFromLight.xyz / vPositionFromLight.w;\n vec2 uv = 0.5 * depth.xy + vec2(0.5, 0.5);\n\n if (uv.x < 0. || uv.x > 1.0 || uv.y < 0. || uv.y > 1.0)\n {\n return 1.0;\n }\n\n float shadow = unpack(texture2D(shadowSampler, uv));\n\n if (depth.z > shadow)\n {\n return darkness;\n }\n return 1.;\n}\n\nfloat computeShadowWithPCF(vec4 vPositionFromLight, sampler2D shadowSampler)\n{\n vec3 depth = vPositionFromLight.xyz / vPositionFromLight.w;\n vec2 uv = 0.5 * depth.xy + vec2(0.5, 0.5);\n\n if (uv.x < 0. || uv.x > 1.0 || uv.y < 0. || uv.y > 1.0)\n {\n return 1.0;\n }\n\n float visibility = 1.;\n\n vec2 poissonDisk[4];\n poissonDisk[0] = vec2(-0.94201624, -0.39906216);\n poissonDisk[1] = vec2(0.94558609, -0.76890725);\n poissonDisk[2] = vec2(-0.094184101, -0.92938870);\n poissonDisk[3] = vec2(0.34495938, 0.29387760);\n\n // Poisson Sampling\n if (unpack(texture2D(shadowSampler, uv + poissonDisk[0] / 1500.0)) < depth.z) visibility -= 0.2;\n if (unpack(texture2D(shadowSampler, uv + poissonDisk[1] / 1500.0)) < depth.z) visibility -= 0.2;\n if (unpack(texture2D(shadowSampler, uv + poissonDisk[2] / 1500.0)) < depth.z) visibility -= 0.2;\n if (unpack(texture2D(shadowSampler, uv + poissonDisk[3] / 1500.0)) < depth.z) visibility -= 0.2;\n\n return visibility;\n}\n\n// Thanks to http://devmaster.net/\nfloat ChebychevInequality(vec2 moments, float t)\n{\n if (t <= moments.x)\n {\n return 1.0;\n }\n\n float variance = moments.y - (moments.x * moments.x);\n variance = max(variance, 0.);\n\n float d = t - moments.x;\n return variance / (variance + d * d);\n}\n\nfloat computeShadowWithVSM(vec4 vPositionFromLight, sampler2D shadowSampler)\n{\n vec3 depth = vPositionFromLight.xyz / vPositionFromLight.w;\n vec2 uv = 0.5 * depth.xy + vec2(0.5, 0.5);\n\n if (uv.x < 0. || uv.x > 1.0 || uv.y < 0. || uv.y > 1.0)\n {\n return 1.0;\n }\n\n vec4 texel = texture2D(shadowSampler, uv);\n\n vec2 moments = vec2(unpackHalf(texel.xy), unpackHalf(texel.zw));\n return clamp(1.3 - ChebychevInequality(moments, depth.z), 0., 1.0);\n}\n#endif\n\n// Bump\n#ifdef BUMP\n#extension GL_OES_standard_derivatives : enable\nvarying vec2 vBumpUV;\nuniform vec2 vBumpInfos;\nuniform sampler2D bumpSampler;\n\n// Thanks to http://www.thetenthplanet.de/archives/1180\nmat3 cotangent_frame(vec3 normal, vec3 p, vec2 uv)\n{\n // get edge vectors of the pixel triangle\n vec3 dp1 = dFdx(p);\n vec3 dp2 = dFdy(p);\n vec2 duv1 = dFdx(uv);\n vec2 duv2 = dFdy(uv);\n\n // solve the linear system\n vec3 dp2perp = cross(dp2, normal);\n vec3 dp1perp = cross(normal, dp1);\n vec3 tangent = dp2perp * duv1.x + dp1perp * duv2.x;\n vec3 binormal = dp2perp * duv1.y + dp1perp * duv2.y;\n\n // construct a scale-invariant frame \n float invmax = inversesqrt(max(dot(tangent, tangent), dot(binormal, binormal)));\n return mat3(tangent * invmax, binormal * invmax, normal);\n}\n\nvec3 perturbNormal(vec3 viewDir)\n{\n vec3 map = texture2D(bumpSampler, vBumpUV).xyz;\n map = map * 255. / 127. - 128. / 127.;\n mat3 TBN = cotangent_frame(vNormalW * vBumpInfos.y, -viewDir, vBumpUV);\n return normalize(TBN * map);\n}\n#endif\n\n#ifdef CLIPPLANE\nvarying float fClipDistance;\n#endif\n\n// Fog\n#ifdef FOG\n\n#define FOGMODE_NONE 0.\n#define FOGMODE_EXP 1.\n#define FOGMODE_EXP2 2.\n#define FOGMODE_LINEAR 3.\n#define E 2.71828\n\nuniform vec4 vFogInfos;\nuniform vec3 vFogColor;\nvarying float fFogDistance;\n\nfloat CalcFogFactor()\n{\n float fogCoeff = 1.0;\n float fogStart = vFogInfos.y;\n float fogEnd = vFogInfos.z;\n float fogDensity = vFogInfos.w;\n\n if (FOGMODE_LINEAR == vFogInfos.x)\n {\n fogCoeff = (fogEnd - fFogDistance) / (fogEnd - fogStart);\n }\n else if (FOGMODE_EXP == vFogInfos.x)\n {\n fogCoeff = 1.0 / pow(E, fFogDistance * fogDensity);\n }\n else if (FOGMODE_EXP2 == vFogInfos.x)\n {\n fogCoeff = 1.0 / pow(E, fFogDistance * fFogDistance * fogDensity * fogDensity);\n }\n\n return clamp(fogCoeff, 0.0, 1.0);\n}\n#endif\n\n// Light Computing\nstruct lightingInfo\n{\n vec3 diffuse;\n vec3 specular;\n};\n\nlightingInfo computeLighting(vec3 viewDirectionW, vec3 vNormal, vec4 lightData, vec3 diffuseColor, vec3 specularColor, float range) {\n lightingInfo result;\n\n vec3 lightVectorW;\n float attenuation = 1.0;\n if (lightData.w == 0.)\n {\n vec3 direction = lightData.xyz - vPositionW;\n\n attenuation = max(0., 1.0 - length(direction) / range);\n lightVectorW = normalize(direction);\n }\n else\n {\n lightVectorW = normalize(-lightData.xyz);\n }\n\n // diffuse\n float ndl = max(0., dot(vNormal, lightVectorW));\n\n // Specular\n vec3 angleW = normalize(viewDirectionW + lightVectorW);\n float specComp = max(0., dot(vNormal, angleW));\n specComp = pow(specComp, max(1., vSpecularColor.a));\n\n result.diffuse = ndl * diffuseColor * attenuation;\n result.specular = specComp * specularColor * attenuation;\n\n return result;\n}\n\nlightingInfo computeSpotLighting(vec3 viewDirectionW, vec3 vNormal, vec4 lightData, vec4 lightDirection, vec3 diffuseColor, vec3 specularColor, float range) {\n lightingInfo result;\n\n vec3 direction = lightData.xyz - vPositionW;\n vec3 lightVectorW = normalize(direction);\n float attenuation = max(0., 1.0 - length(direction) / range);\n\n // diffuse\n float cosAngle = max(0., dot(-lightDirection.xyz, lightVectorW));\n float spotAtten = 0.0;\n\n if (cosAngle >= lightDirection.w)\n {\n cosAngle = max(0., pow(cosAngle, lightData.w));\n spotAtten = max(0., (cosAngle - lightDirection.w) / (1. - cosAngle));\n\n // Diffuse\n float ndl = max(0., dot(vNormal, -lightDirection.xyz));\n\n // Specular\n vec3 angleW = normalize(viewDirectionW - lightDirection.xyz);\n float specComp = max(0., dot(vNormal, angleW));\n specComp = pow(specComp, vSpecularColor.a);\n\n result.diffuse = ndl * spotAtten * diffuseColor * attenuation;\n result.specular = specComp * specularColor * spotAtten * attenuation;\n\n return result;\n }\n\n result.diffuse = vec3(0.);\n result.specular = vec3(0.);\n\n return result;\n}\n\nlightingInfo computeHemisphericLighting(vec3 viewDirectionW, vec3 vNormal, vec4 lightData, vec3 diffuseColor, vec3 specularColor, vec3 groundColor) {\n lightingInfo result;\n\n // Diffuse\n float ndl = dot(vNormal, lightData.xyz) * 0.5 + 0.5;\n\n // Specular\n vec3 angleW = normalize(viewDirectionW + lightData.xyz);\n float specComp = max(0., dot(vNormal, angleW));\n specComp = pow(specComp, vSpecularColor.a);\n\n result.diffuse = mix(groundColor, diffuseColor, ndl);\n result.specular = specComp * specularColor;\n\n return result;\n}\n\nvoid main(void) {\n // Clip plane\n#ifdef CLIPPLANE\n if (fClipDistance > 0.0)\n discard;\n#endif\n\n vec3 viewDirectionW = normalize(vEyePosition - vPositionW);\n\n // Base color\n vec4 baseColor = vec4(1., 1., 1., 1.);\n vec3 diffuseColor = vDiffuseColor.rgb;\n\n // Alpha\n float alpha = vDiffuseColor.a;\n\n#ifdef VERTEXCOLOR\n baseColor.rgb *= vColor.rgb;\n#endif\n\n#ifdef DIFFUSE\n baseColor = texture2D(diffuseSampler, vDiffuseUV);\n\n#ifdef ALPHATEST\n if (baseColor.a < 0.4)\n discard;\n#endif\n\n#ifdef ALPHAFROMDIFFUSE\n alpha *= baseColor.a;\n#endif\n\n baseColor.rgb *= vDiffuseInfos.y;\n#endif\n\n // Bump\n vec3 normalW = normalize(vNormalW);\n\n#ifdef BUMP\n normalW = perturbNormal(viewDirectionW);\n#endif\n\n // Ambient color\n vec3 baseAmbientColor = vec3(1., 1., 1.);\n\n#ifdef AMBIENT\n baseAmbientColor = texture2D(ambientSampler, vAmbientUV).rgb * vAmbientInfos.y;\n#endif\n\n // Lighting\n vec3 diffuseBase = vec3(0., 0., 0.);\n vec3 specularBase = vec3(0., 0., 0.);\n float shadow = 1.;\n\n#ifdef LIGHT0\n#ifdef SPOTLIGHT0\n lightingInfo info = computeSpotLighting(viewDirectionW, normalW, vLightData0, vLightDirection0, vLightDiffuse0.rgb, vLightSpecular0, vLightDiffuse0.a);\n#endif\n#ifdef HEMILIGHT0\n lightingInfo info = computeHemisphericLighting(viewDirectionW, normalW, vLightData0, vLightDiffuse0.rgb, vLightSpecular0, vLightGround0);\n#endif\n#ifdef POINTDIRLIGHT0\n lightingInfo info = computeLighting(viewDirectionW, normalW, vLightData0, vLightDiffuse0.rgb, vLightSpecular0, vLightDiffuse0.a);\n#endif\n#ifdef SHADOW0\n#ifdef SHADOWVSM0\n shadow = computeShadowWithVSM(vPositionFromLight0, shadowSampler0);\n#else\n #ifdef SHADOWPCF0\n shadow = computeShadowWithPCF(vPositionFromLight0, shadowSampler0);\n #else\n shadow = computeShadow(vPositionFromLight0, shadowSampler0, darkness0);\n #endif\n#endif\n#else\n shadow = 1.;\n#endif\n diffuseBase += info.diffuse * shadow;\n specularBase += info.specular * shadow;\n#endif\n\n#ifdef LIGHT1\n#ifdef SPOTLIGHT1\n info = computeSpotLighting(viewDirectionW, normalW, vLightData1, vLightDirection1, vLightDiffuse1.rgb, vLightSpecular1, vLightDiffuse1.a);\n#endif\n#ifdef HEMILIGHT1\n info = computeHemisphericLighting(viewDirectionW, normalW, vLightData1, vLightDiffuse1.rgb, vLightSpecular1, vLightGround1);\n#endif\n#ifdef POINTDIRLIGHT1\n info = computeLighting(viewDirectionW, normalW, vLightData1, vLightDiffuse1.rgb, vLightSpecular1, vLightDiffuse1.a);\n#endif\n#ifdef SHADOW1\n#ifdef SHADOWVSM1\n shadow = computeShadowWithVSM(vPositionFromLight1, shadowSampler1);\n#else\n #ifdef SHADOWPCF1\n shadow = computeShadowWithPCF(vPositionFromLight1, shadowSampler1);\n #else\n shadow = computeShadow(vPositionFromLight1, shadowSampler1, darkness1);\n #endif\n#endif\n#else\n shadow = 1.;\n#endif\n diffuseBase += info.diffuse * shadow;\n specularBase += info.specular * shadow;\n#endif\n\n#ifdef LIGHT2\n#ifdef SPOTLIGHT2\n info = computeSpotLighting(viewDirectionW, normalW, vLightData2, vLightDirection2, vLightDiffuse2.rgb, vLightSpecular2, vLightDiffuse2.a);\n#endif\n#ifdef HEMILIGHT2\n info = computeHemisphericLighting(viewDirectionW, normalW, vLightData2, vLightDiffuse2.rgb, vLightSpecular2, vLightGround2);\n#endif\n#ifdef POINTDIRLIGHT2\n info = computeLighting(viewDirectionW, normalW, vLightData2, vLightDiffuse2.rgb, vLightSpecular2, vLightDiffuse2.a);\n#endif\n#ifdef SHADOW2\n#ifdef SHADOWVSM2\n shadow = computeShadowWithVSM(vPositionFromLight2, shadowSampler2);\n#else\n #ifdef SHADOWPCF2\n shadow = computeShadowWithPCF(vPositionFromLight2, shadowSampler2);\n #else\n shadow = computeShadow(vPositionFromLight2, shadowSampler2, darkness2);\n #endif \n#endif \n#else\n shadow = 1.;\n#endif\n diffuseBase += info.diffuse * shadow;\n specularBase += info.specular * shadow;\n#endif\n\n#ifdef LIGHT3\n#ifdef SPOTLIGHT3\n info = computeSpotLighting(viewDirectionW, normalW, vLightData3, vLightDirection3, vLightDiffuse3.rgb, vLightSpecular3, vLightDiffuse3.a);\n#endif\n#ifdef HEMILIGHT3\n info = computeHemisphericLighting(viewDirectionW, normalW, vLightData3, vLightDiffuse3.rgb, vLightSpecular3, vLightGround3);\n#endif\n#ifdef POINTDIRLIGHT3\n info = computeLighting(viewDirectionW, normalW, vLightData3, vLightDiffuse3.rgb, vLightSpecular3, vLightDiffuse3.a);\n#endif\n#ifdef SHADOW3\n#ifdef SHADOWVSM3\n shadow = computeShadowWithVSM(vPositionFromLight3, shadowSampler3);\n#else\n #ifdef SHADOWPCF3\n shadow = computeShadowWithPCF(vPositionFromLight3, shadowSampler3);\n #else\n shadow = computeShadow(vPositionFromLight3, shadowSampler3, darkness3);\n #endif \n#endif \n#else\n shadow = 1.;\n#endif\n diffuseBase += info.diffuse * shadow;\n specularBase += info.specular * shadow;\n#endif\n\n // Reflection\n vec3 reflectionColor = vec3(0., 0., 0.);\n\n#ifdef REFLECTION\n vec3 vReflectionUVW = computeReflectionCoords(vReflectionInfos.x, vec4(vPositionW, 1.0), normalW);\n\n if (vReflectionInfos.z != 0.0)\n {\n reflectionColor = textureCube(reflectionCubeSampler, vReflectionUVW).rgb * vReflectionInfos.y * shadow;\n }\n else\n {\n vec2 coords = vReflectionUVW.xy;\n\n if (vReflectionInfos.x == MAP_PROJECTION)\n {\n coords /= vReflectionUVW.z;\n }\n\n coords.y = 1.0 - coords.y;\n\n reflectionColor = texture2D(reflection2DSampler, coords).rgb * vReflectionInfos.y * shadow;\n }\n\n#ifdef REFLECTIONFRESNEL\n float reflectionFresnelTerm = computeFresnelTerm(viewDirectionW, normalW, reflectionRightColor.a, reflectionLeftColor.a);\n\n reflectionColor *= reflectionLeftColor.rgb * (1.0 - reflectionFresnelTerm) + reflectionFresnelTerm * reflectionRightColor.rgb;\n#endif\n#endif\n\n#ifdef OPACITY\n vec4 opacityMap = texture2D(opacitySampler, vOpacityUV);\n\n#ifdef OPACITYRGB\n opacityMap.rgb = opacityMap.rgb * vec3(0.3, 0.59, 0.11);\n alpha *= (opacityMap.x + opacityMap.y + opacityMap.z)* vOpacityInfos.y;\n#else\n alpha *= opacityMap.a * vOpacityInfos.y;\n#endif\n\n#endif\n\n#ifdef VERTEXALPHA\n alpha *= vColor.a;\n#endif\n\n#ifdef OPACITYFRESNEL\n float opacityFresnelTerm = computeFresnelTerm(viewDirectionW, normalW, opacityParts.z, opacityParts.w);\n\n alpha += opacityParts.x * (1.0 - opacityFresnelTerm) + opacityFresnelTerm * opacityParts.y;\n#endif\n\n // Emissive\n vec3 emissiveColor = vEmissiveColor;\n#ifdef EMISSIVE\n emissiveColor += texture2D(emissiveSampler, vEmissiveUV).rgb * vEmissiveInfos.y;\n#endif\n\n#ifdef EMISSIVEFRESNEL\n float emissiveFresnelTerm = computeFresnelTerm(viewDirectionW, normalW, emissiveRightColor.a, emissiveLeftColor.a);\n\n emissiveColor *= emissiveLeftColor.rgb * (1.0 - emissiveFresnelTerm) + emissiveFresnelTerm * emissiveRightColor.rgb;\n#endif\n\n // Specular map\n vec3 specularColor = vSpecularColor.rgb;\n#ifdef SPECULAR\n specularColor = texture2D(specularSampler, vSpecularUV).rgb * vSpecularInfos.y;\n#endif\n\n // Fresnel\n#ifdef DIFFUSEFRESNEL\n float diffuseFresnelTerm = computeFresnelTerm(viewDirectionW, normalW, diffuseRightColor.a, diffuseLeftColor.a);\n\n diffuseBase *= diffuseLeftColor.rgb * (1.0 - diffuseFresnelTerm) + diffuseFresnelTerm * diffuseRightColor.rgb;\n#endif\n\n // Composition\n vec3 finalDiffuse = clamp(diffuseBase * diffuseColor + emissiveColor + vAmbientColor, 0.0, 1.0) * baseColor.rgb;\n vec3 finalSpecular = specularBase * specularColor;\n\n#ifdef SPECULAROVERALPHA\n alpha = clamp(alpha + dot(finalSpecular, vec3(0.3, 0.59, 0.11)), 0., 1.);\n#endif\n\n vec4 color = vec4(finalDiffuse * baseAmbientColor + finalSpecular + reflectionColor, alpha);\n\n#ifdef FOG\n float fog = CalcFogFactor();\n color.rgb = fog * color.rgb + (1.0 - fog) * vFogColor;\n#endif\n\n gl_FragColor = color;\n}", defaultVertexShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Attributes\nattribute vec3 position;\nattribute vec3 normal;\n#ifdef UV1\nattribute vec2 uv;\n#endif\n#ifdef UV2\nattribute vec2 uv2;\n#endif\n#ifdef VERTEXCOLOR\nattribute vec4 color;\n#endif\n#ifdef BONES\nattribute vec4 matricesIndices;\nattribute vec4 matricesWeights;\n#endif\n\n// Uniforms\n\n#ifdef INSTANCES\nattribute vec4 world0;\nattribute vec4 world1;\nattribute vec4 world2;\nattribute vec4 world3;\n#else\nuniform mat4 world;\n#endif\n\nuniform mat4 view;\nuniform mat4 viewProjection;\n\n#ifdef DIFFUSE\nvarying vec2 vDiffuseUV;\nuniform mat4 diffuseMatrix;\nuniform vec2 vDiffuseInfos;\n#endif\n\n#ifdef AMBIENT\nvarying vec2 vAmbientUV;\nuniform mat4 ambientMatrix;\nuniform vec2 vAmbientInfos;\n#endif\n\n#ifdef OPACITY\nvarying vec2 vOpacityUV;\nuniform mat4 opacityMatrix;\nuniform vec2 vOpacityInfos;\n#endif\n\n#ifdef EMISSIVE\nvarying vec2 vEmissiveUV;\nuniform vec2 vEmissiveInfos;\nuniform mat4 emissiveMatrix;\n#endif\n\n#ifdef SPECULAR\nvarying vec2 vSpecularUV;\nuniform vec2 vSpecularInfos;\nuniform mat4 specularMatrix;\n#endif\n\n#ifdef BUMP\nvarying vec2 vBumpUV;\nuniform vec2 vBumpInfos;\nuniform mat4 bumpMatrix;\n#endif\n\n#ifdef BONES\nuniform mat4 mBones[BonesPerMesh];\n#endif\n\n#ifdef POINTSIZE\nuniform float pointSize;\n#endif\n\n// Output\nvarying vec3 vPositionW;\nvarying vec3 vNormalW;\n\n#ifdef VERTEXCOLOR\nvarying vec4 vColor;\n#endif\n\n#ifdef CLIPPLANE\nuniform vec4 vClipPlane;\nvarying float fClipDistance;\n#endif\n\n#ifdef FOG\nvarying float fFogDistance;\n#endif\n\n#ifdef SHADOWS\n#ifdef LIGHT0\nuniform mat4 lightMatrix0;\nvarying vec4 vPositionFromLight0;\n#endif\n#ifdef LIGHT1\nuniform mat4 lightMatrix1;\nvarying vec4 vPositionFromLight1;\n#endif\n#ifdef LIGHT2\nuniform mat4 lightMatrix2;\nvarying vec4 vPositionFromLight2;\n#endif\n#ifdef LIGHT3\nuniform mat4 lightMatrix3;\nvarying vec4 vPositionFromLight3;\n#endif\n#endif\n\n#ifdef REFLECTION\nvarying vec3 vPositionUVW;\n#endif\n\nvoid main(void) {\n mat4 finalWorld;\n\n#ifdef REFLECTION\n vPositionUVW = position;\n#endif \n\n#ifdef INSTANCES\n finalWorld = mat4(world0, world1, world2, world3);\n#else\n finalWorld = world;\n#endif\n\n#ifdef BONES\n mat4 m0 = mBones[int(matricesIndices.x)] * matricesWeights.x;\n mat4 m1 = mBones[int(matricesIndices.y)] * matricesWeights.y;\n mat4 m2 = mBones[int(matricesIndices.z)] * matricesWeights.z;\n\n#ifdef BONES4\n mat4 m3 = mBones[int(matricesIndices.w)] * matricesWeights.w;\n finalWorld = finalWorld * (m0 + m1 + m2 + m3);\n#else\n finalWorld = finalWorld * (m0 + m1 + m2);\n#endif \n\n#endif\n gl_Position = viewProjection * finalWorld * vec4(position, 1.0);\n\n vec4 worldPos = finalWorld * vec4(position, 1.0);\n vPositionW = vec3(worldPos);\n vNormalW = normalize(vec3(finalWorld * vec4(normal, 0.0)));\n\n // Texture coordinates\n#ifndef UV1\n vec2 uv = vec2(0., 0.);\n#endif\n#ifndef UV2\n vec2 uv2 = vec2(0., 0.);\n#endif\n\n#ifdef DIFFUSE\n if (vDiffuseInfos.x == 0.)\n {\n vDiffuseUV = vec2(diffuseMatrix * vec4(uv, 1.0, 0.0));\n }\n else\n {\n vDiffuseUV = vec2(diffuseMatrix * vec4(uv2, 1.0, 0.0));\n }\n#endif\n\n#ifdef AMBIENT\n if (vAmbientInfos.x == 0.)\n {\n vAmbientUV = vec2(ambientMatrix * vec4(uv, 1.0, 0.0));\n }\n else\n {\n vAmbientUV = vec2(ambientMatrix * vec4(uv2, 1.0, 0.0));\n }\n#endif\n\n#ifdef OPACITY\n if (vOpacityInfos.x == 0.)\n {\n vOpacityUV = vec2(opacityMatrix * vec4(uv, 1.0, 0.0));\n }\n else\n {\n vOpacityUV = vec2(opacityMatrix * vec4(uv2, 1.0, 0.0));\n }\n#endif\n\n#ifdef EMISSIVE\n if (vEmissiveInfos.x == 0.)\n {\n vEmissiveUV = vec2(emissiveMatrix * vec4(uv, 1.0, 0.0));\n }\n else\n {\n vEmissiveUV = vec2(emissiveMatrix * vec4(uv2, 1.0, 0.0));\n }\n#endif\n\n#ifdef SPECULAR\n if (vSpecularInfos.x == 0.)\n {\n vSpecularUV = vec2(specularMatrix * vec4(uv, 1.0, 0.0));\n }\n else\n {\n vSpecularUV = vec2(specularMatrix * vec4(uv2, 1.0, 0.0));\n }\n#endif\n\n#ifdef BUMP\n if (vBumpInfos.x == 0.)\n {\n vBumpUV = vec2(bumpMatrix * vec4(uv, 1.0, 0.0));\n }\n else\n {\n vBumpUV = vec2(bumpMatrix * vec4(uv2, 1.0, 0.0));\n }\n#endif\n\n // Clip plane\n#ifdef CLIPPLANE\n fClipDistance = dot(worldPos, vClipPlane);\n#endif\n\n // Fog\n#ifdef FOG\n fFogDistance = (view * worldPos).z;\n#endif\n\n // Shadows\n#ifdef SHADOWS\n#ifdef LIGHT0\n vPositionFromLight0 = lightMatrix0 * worldPos;\n#endif\n#ifdef LIGHT1\n vPositionFromLight1 = lightMatrix1 * worldPos;\n#endif\n#ifdef LIGHT2\n vPositionFromLight2 = lightMatrix2 * worldPos;\n#endif\n#ifdef LIGHT3\n vPositionFromLight3 = lightMatrix3 * worldPos;\n#endif\n#endif\n\n // Vertex color\n#ifdef VERTEXCOLOR\n vColor = color;\n#endif\n\n // Point size\n#ifdef POINTSIZE\n gl_PointSize = pointSize;\n#endif\n}", displayPassPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Samplers\nvarying vec2 vUV;\nuniform sampler2D textureSampler;\nuniform sampler2D passSampler;\n\nvoid main(void)\n{\n gl_FragColor = texture2D(passSampler, vUV);\n}", filterPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Samplers\nvarying vec2 vUV;\nuniform sampler2D textureSampler;\n\nuniform mat4 kernelMatrix;\n\nvoid main(void)\n{\n vec3 baseColor = texture2D(textureSampler, vUV).rgb;\n vec3 updatedColor = (kernelMatrix * vec4(baseColor, 1.0)).rgb;\n\n gl_FragColor = vec4(updatedColor, 1.0);\n}", firePixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\nuniform float time;\nuniform vec3 c1;\nuniform vec3 c2;\nuniform vec3 c3;\nuniform vec3 c4;\nuniform vec3 c5;\nuniform vec3 c6;\nuniform vec2 speed;\nuniform float shift;\nuniform float alphaThreshold;\n\nvarying vec2 vUV;\n\nfloat rand(vec2 n) {\n return fract(cos(dot(n, vec2(12.9898, 4.1414))) * 43758.5453);\n}\n\nfloat noise(vec2 n) {\n const vec2 d = vec2(0.0, 1.0);\n vec2 b = floor(n), f = smoothstep(vec2(0.0), vec2(1.0), fract(n));\n return mix(mix(rand(b), rand(b + d.yx), f.x), mix(rand(b + d.xy), rand(b + d.yy), f.x), f.y);\n}\n\nfloat fbm(vec2 n) {\n float total = 0.0, amplitude = 1.0;\n for (int i = 0; i < 4; i++) {\n total += noise(n) * amplitude;\n n += n;\n amplitude *= 0.5;\n }\n return total;\n}\n\nvoid main() {\n vec2 p = vUV * 8.0;\n float q = fbm(p - time * 0.1);\n vec2 r = vec2(fbm(p + q + time * speed.x - p.x - p.y), fbm(p + q - time * speed.y));\n vec3 c = mix(c1, c2, fbm(p + r)) + mix(c3, c4, r.x) - mix(c5, c6, r.y);\n vec3 color = c * cos(shift * vUV.y);\n float luminance = dot(color.rgb, vec3(0.3, 0.59, 0.11));\n\n gl_FragColor = vec4(color, luminance * alphaThreshold + (1.0 - alphaThreshold));\n}", fxaaPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n#define FXAA_REDUCE_MIN (1.0/128.0)\n#define FXAA_REDUCE_MUL (1.0/8.0)\n#define FXAA_SPAN_MAX 8.0\n\nvarying vec2 vUV;\nuniform sampler2D textureSampler;\nuniform vec2 texelSize;\n\nvoid main(){\n vec2 localTexelSize = texelSize;\n vec4 rgbNW = texture2D(textureSampler, (vUV + vec2(-1.0, -1.0) * localTexelSize));\n vec4 rgbNE = texture2D(textureSampler, (vUV + vec2(1.0, -1.0) * localTexelSize));\n vec4 rgbSW = texture2D(textureSampler, (vUV + vec2(-1.0, 1.0) * localTexelSize));\n vec4 rgbSE = texture2D(textureSampler, (vUV + vec2(1.0, 1.0) * localTexelSize));\n vec4 rgbM = texture2D(textureSampler, vUV);\n vec4 luma = vec4(0.299, 0.587, 0.114, 1.0);\n float lumaNW = dot(rgbNW, luma);\n float lumaNE = dot(rgbNE, luma);\n float lumaSW = dot(rgbSW, luma);\n float lumaSE = dot(rgbSE, luma);\n float lumaM = dot(rgbM, luma);\n float lumaMin = min(lumaM, min(min(lumaNW, lumaNE), min(lumaSW, lumaSE)));\n float lumaMax = max(lumaM, max(max(lumaNW, lumaNE), max(lumaSW, lumaSE)));\n\n vec2 dir = vec2(-((lumaNW + lumaNE) - (lumaSW + lumaSE)), ((lumaNW + lumaSW) - (lumaNE + lumaSE)));\n\n float dirReduce = max(\n (lumaNW + lumaNE + lumaSW + lumaSE) * (0.25 * FXAA_REDUCE_MUL),\n FXAA_REDUCE_MIN);\n\n float rcpDirMin = 1.0 / (min(abs(dir.x), abs(dir.y)) + dirReduce);\n dir = min(vec2(FXAA_SPAN_MAX, FXAA_SPAN_MAX),\n max(vec2(-FXAA_SPAN_MAX, -FXAA_SPAN_MAX),\n dir * rcpDirMin)) * localTexelSize;\n\n vec4 rgbA = 0.5 * (\n texture2D(textureSampler, vUV + dir * (1.0 / 3.0 - 0.5)) +\n texture2D(textureSampler, vUV + dir * (2.0 / 3.0 - 0.5)));\n\n vec4 rgbB = rgbA * 0.5 + 0.25 * (\n texture2D(textureSampler, vUV + dir * -0.5) +\n texture2D(textureSampler, vUV + dir * 0.5));\n float lumaB = dot(rgbB, luma);\n if ((lumaB < lumaMin) || (lumaB > lumaMax)) {\n gl_FragColor = rgbA;\n }\n else {\n gl_FragColor = rgbB;\n }\n}", grassPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\nvarying vec2 vPosition;\nvarying vec2 vUV;\n\nuniform vec3 herb1Color;\nuniform vec3 herb2Color;\nuniform vec3 herb3Color;\nuniform vec3 groundColor;\n\nfloat rand(vec2 n) {\n return fract(cos(dot(n, vec2(12.9898, 4.1414))) * 43758.5453);\n}\n\nfloat noise(vec2 n) {\n const vec2 d = vec2(0.0, 1.0);\n vec2 b = floor(n), f = smoothstep(vec2(0.0), vec2(1.0), fract(n));\n return mix(mix(rand(b), rand(b + d.yx), f.x), mix(rand(b + d.xy), rand(b + d.yy), f.x), f.y);\n}\n\nfloat fbm(vec2 n) {\n float total = 0.0, amplitude = 1.0;\n for (int i = 0; i < 4; i++) {\n total += noise(n) * amplitude;\n n += n;\n amplitude *= 0.5;\n }\n return total;\n}\n\nvoid main(void) {\n vec3 color = mix(groundColor, herb1Color, rand(gl_FragCoord.xy * 4.0));\n color = mix(color, herb2Color, rand(gl_FragCoord.xy * 8.0));\n color = mix(color, herb3Color, rand(gl_FragCoord.xy));\n color = mix(color, herb1Color, fbm(gl_FragCoord.xy * 16.0));\n gl_FragColor = vec4(color, 1.0);\n}", layerPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Samplers\nvarying vec2 vUV;\nuniform sampler2D textureSampler;\n\n// Color\nuniform vec4 color;\n\nvoid main(void) {\n vec4 baseColor = texture2D(textureSampler, vUV);\n\n gl_FragColor = baseColor * color;\n}", layerVertexShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Attributes\nattribute vec2 position;\n\n// Uniforms\nuniform mat4 textureMatrix;\n\n// Output\nvarying vec2 vUV;\n\nconst vec2 madd = vec2(0.5, 0.5);\n\nvoid main(void) { \n\n vUV = vec2(textureMatrix * vec4(position * madd + madd, 1.0, 0.0));\n gl_Position = vec4(position, 0.0, 1.0);\n}", legacydefaultPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n#define MAP_PROJECTION 4.\n\n// Constants\nuniform vec3 vEyePosition;\nuniform vec3 vAmbientColor;\nuniform vec4 vDiffuseColor;\nuniform vec4 vSpecularColor;\nuniform vec3 vEmissiveColor;\n\n// Input\nvarying vec3 vPositionW;\nvarying vec3 vNormalW;\n\n#ifdef VERTEXCOLOR\nvarying vec4 vColor;\n#endif\n\n// Lights\n#ifdef LIGHT0\nuniform vec4 vLightData0;\nuniform vec4 vLightDiffuse0;\nuniform vec3 vLightSpecular0;\n#ifdef SHADOW0\nvarying vec4 vPositionFromLight0;\nuniform sampler2D shadowSampler0;\n#endif\n#ifdef SPOTLIGHT0\nuniform vec4 vLightDirection0;\n#endif\n#ifdef HEMILIGHT0\nuniform vec3 vLightGround0;\n#endif\n#endif\n\n#ifdef LIGHT1\nuniform vec4 vLightData1;\nuniform vec4 vLightDiffuse1;\nuniform vec3 vLightSpecular1;\n#ifdef SHADOW1\nvarying vec4 vPositionFromLight1;\nuniform sampler2D shadowSampler1;\n#endif\n#ifdef SPOTLIGHT1\nuniform vec4 vLightDirection1;\n#endif\n#ifdef HEMILIGHT1\nuniform vec3 vLightGround1;\n#endif\n#endif\n\n#ifdef LIGHT2\nuniform vec4 vLightData2;\nuniform vec4 vLightDiffuse2;\nuniform vec3 vLightSpecular2;\n#ifdef SHADOW2\nvarying vec4 vPositionFromLight2;\nuniform sampler2D shadowSampler2;\n#endif\n#ifdef SPOTLIGHT2\nuniform vec4 vLightDirection2;\n#endif\n#ifdef HEMILIGHT2\nuniform vec3 vLightGround2;\n#endif\n#endif\n\n#ifdef LIGHT3\nuniform vec4 vLightData3;\nuniform vec4 vLightDiffuse3;\nuniform vec3 vLightSpecular3;\n#ifdef SHADOW3\nvarying vec4 vPositionFromLight3;\nuniform sampler2D shadowSampler3;\n#endif\n#ifdef SPOTLIGHT3\nuniform vec4 vLightDirection3;\n#endif\n#ifdef HEMILIGHT3\nuniform vec3 vLightGround3;\n#endif\n#endif\n\n// Samplers\n#ifdef DIFFUSE\nvarying vec2 vDiffuseUV;\nuniform sampler2D diffuseSampler;\nuniform vec2 vDiffuseInfos;\n#endif\n\n#ifdef AMBIENT\nvarying vec2 vAmbientUV;\nuniform sampler2D ambientSampler;\nuniform vec2 vAmbientInfos;\n#endif\n\n#ifdef OPACITY \nvarying vec2 vOpacityUV;\nuniform sampler2D opacitySampler;\nuniform vec2 vOpacityInfos;\n#endif\n\n#ifdef REFLECTION\nvarying vec3 vReflectionUVW;\nuniform samplerCube reflectionCubeSampler;\nuniform sampler2D reflection2DSampler;\nuniform vec3 vReflectionInfos;\n#endif\n\n#ifdef EMISSIVE\nvarying vec2 vEmissiveUV;\nuniform vec2 vEmissiveInfos;\nuniform sampler2D emissiveSampler;\n#endif\n\n#ifdef SPECULAR\nvarying vec2 vSpecularUV;\nuniform vec2 vSpecularInfos;\nuniform sampler2D specularSampler;\n#endif\n\n// Fresnel\n#ifdef FRESNEL\nfloat computeFresnelTerm(vec3 viewDirection, vec3 worldNormal, float bias, float power)\n{\n float fresnelTerm = pow(bias + abs(dot(viewDirection, worldNormal)), power);\n return clamp(fresnelTerm, 0., 1.);\n}\n#endif\n\n#ifdef DIFFUSEFRESNEL\nuniform vec4 diffuseLeftColor;\nuniform vec4 diffuseRightColor;\n#endif\n\n#ifdef OPACITYFRESNEL\nuniform vec4 opacityParts;\n#endif\n\n#ifdef REFLECTIONFRESNEL\nuniform vec4 reflectionLeftColor;\nuniform vec4 reflectionRightColor;\n#endif\n\n#ifdef EMISSIVEFRESNEL\nuniform vec4 emissiveLeftColor;\nuniform vec4 emissiveRightColor;\n#endif\n\n// Shadows\n#ifdef SHADOWS\n\nfloat unpack(vec4 color)\n{\n const vec4 bitShift = vec4(1. / (255. * 255. * 255.), 1. / (255. * 255.), 1. / 255., 1.);\n return dot(color, bitShift);\n}\n\nfloat unpackHalf(vec2 color)\n{\n return color.x + (color.y / 255.0);\n}\n\nfloat computeShadow(vec4 vPositionFromLight, sampler2D shadowSampler)\n{\n vec3 depth = vPositionFromLight.xyz / vPositionFromLight.w;\n vec2 uv = 0.5 * depth.xy + vec2(0.5, 0.5);\n\n if (uv.x < 0. || uv.x > 1.0 || uv.y < 0. || uv.y > 1.0)\n {\n return 1.0;\n }\n\n float shadow = unpack(texture2D(shadowSampler, uv));\n\n if (depth.z > shadow)\n {\n return 0.;\n }\n return 1.;\n}\n\n// Thanks to http://devmaster.net/\nfloat ChebychevInequality(vec2 moments, float t)\n{\n if (t <= moments.x)\n {\n return 1.0;\n }\n\n float variance = moments.y - (moments.x * moments.x);\n variance = max(variance, 0.);\n\n float d = t - moments.x;\n return variance / (variance + d * d);\n}\n\nfloat computeShadowWithVSM(vec4 vPositionFromLight, sampler2D shadowSampler)\n{\n vec3 depth = vPositionFromLight.xyz / vPositionFromLight.w;\n vec2 uv = 0.5 * depth.xy + vec2(0.5, 0.5);\n\n if (uv.x < 0. || uv.x > 1.0 || uv.y < 0. || uv.y > 1.0)\n {\n return 1.0;\n }\n\n vec4 texel = texture2D(shadowSampler, uv);\n\n vec2 moments = vec2(unpackHalf(texel.xy), unpackHalf(texel.zw));\n return clamp(1.3 - ChebychevInequality(moments, depth.z), 0., 1.0);\n}\n#endif\n\n#ifdef CLIPPLANE\nvarying float fClipDistance;\n#endif\n\n// Fog\n#ifdef FOG\n\n#define FOGMODE_NONE 0.\n#define FOGMODE_EXP 1.\n#define FOGMODE_EXP2 2.\n#define FOGMODE_LINEAR 3.\n#define E 2.71828\n\nuniform vec4 vFogInfos;\nuniform vec3 vFogColor;\nvarying float fFogDistance;\n\nfloat CalcFogFactor()\n{\n float fogCoeff = 1.0;\n float fogStart = vFogInfos.y;\n float fogEnd = vFogInfos.z;\n float fogDensity = vFogInfos.w;\n\n if (FOGMODE_LINEAR == vFogInfos.x)\n {\n fogCoeff = (fogEnd - fFogDistance) / (fogEnd - fogStart);\n }\n else if (FOGMODE_EXP == vFogInfos.x)\n {\n fogCoeff = 1.0 / pow(E, fFogDistance * fogDensity);\n }\n else if (FOGMODE_EXP2 == vFogInfos.x)\n {\n fogCoeff = 1.0 / pow(E, fFogDistance * fFogDistance * fogDensity * fogDensity);\n }\n\n return clamp(fogCoeff, 0.0, 1.0);\n}\n#endif\n\n// Light Computing\nmat3 computeLighting(vec3 viewDirectionW, vec3 vNormal, vec4 lightData, vec4 diffuseColor, vec3 specularColor) {\n mat3 result;\n\n vec3 lightVectorW;\n if (lightData.w == 0.)\n {\n lightVectorW = normalize(lightData.xyz - vPositionW);\n }\n else\n {\n lightVectorW = normalize(-lightData.xyz);\n }\n\n // diffuse\n float ndl = max(0., dot(vNormal, lightVectorW));\n\n // Specular\n vec3 angleW = normalize(viewDirectionW + lightVectorW);\n float specComp = max(0., dot(vNormal, angleW));\n specComp = max(0., pow(specComp, max(1.0, vSpecularColor.a)));\n\n result[0] = ndl * diffuseColor.rgb;\n result[1] = specComp * specularColor;\n result[2] = vec3(0.);\n\n return result;\n}\n\nmat3 computeSpotLighting(vec3 viewDirectionW, vec3 vNormal, vec4 lightData, vec4 lightDirection, vec4 diffuseColor, vec3 specularColor) {\n mat3 result;\n\n vec3 lightVectorW = normalize(lightData.xyz - vPositionW);\n\n // diffuse\n float cosAngle = max(0., dot(-lightDirection.xyz, lightVectorW));\n float spotAtten = 0.0;\n\n if (cosAngle >= lightDirection.w)\n {\n cosAngle = max(0., pow(cosAngle, lightData.w));\n spotAtten = max(0., (cosAngle - lightDirection.w) / (1. - cosAngle));\n\n // Diffuse\n float ndl = max(0., dot(vNormal, -lightDirection.xyz));\n\n // Specular\n vec3 angleW = normalize(viewDirectionW - lightDirection.xyz);\n float specComp = max(0., dot(vNormal, angleW));\n specComp = pow(specComp, vSpecularColor.a);\n\n result[0] = ndl * spotAtten * diffuseColor.rgb;\n result[1] = specComp * specularColor * spotAtten;\n result[2] = vec3(0.);\n\n return result;\n }\n\n result[0] = vec3(0.);\n result[1] = vec3(0.);\n result[2] = vec3(0.);\n\n return result;\n}\n\nmat3 computeHemisphericLighting(vec3 viewDirectionW, vec3 vNormal, vec4 lightData, vec4 diffuseColor, vec3 specularColor, vec3 groundColor) {\n mat3 result;\n\n // Diffuse\n float ndl = dot(vNormal, lightData.xyz) * 0.5 + 0.5;\n\n // Specular\n vec3 angleW = normalize(viewDirectionW + lightData.xyz);\n float specComp = max(0., dot(vNormal, angleW));\n specComp = pow(specComp, vSpecularColor.a);\n\n result[0] = mix(groundColor, diffuseColor.rgb, ndl);\n result[1] = specComp * specularColor;\n result[2] = vec3(0.);\n\n return result;\n}\n\nvoid main(void) {\n // Clip plane\n#ifdef CLIPPLANE\n if (fClipDistance > 0.0)\n discard;\n#endif\n\n vec3 viewDirectionW = normalize(vEyePosition - vPositionW);\n\n // Base color\n vec4 baseColor = vec4(1., 1., 1., 1.);\n vec3 diffuseColor = vDiffuseColor.rgb;\n\n#ifdef VERTEXCOLOR\n baseColor.rgb *= vColor.rgb;\n#endif\n\n#ifdef DIFFUSE\n baseColor = texture2D(diffuseSampler, vDiffuseUV);\n\n#ifdef ALPHATEST\n if (baseColor.a < 0.4)\n discard;\n#endif\n\n baseColor.rgb *= vDiffuseInfos.y;\n#endif\n\n // Bump\n vec3 normalW = normalize(vNormalW);\n\n // Ambient color\n vec3 baseAmbientColor = vec3(1., 1., 1.);\n\n#ifdef AMBIENT\n baseAmbientColor = texture2D(ambientSampler, vAmbientUV).rgb * vAmbientInfos.y;\n#endif\n\n // Lighting\n vec3 diffuseBase = vec3(0., 0., 0.);\n vec3 specularBase = vec3(0., 0., 0.);\n float shadow = 1.;\n\n#ifdef LIGHT0\n#ifdef SPOTLIGHT0\n mat3 info = computeSpotLighting(viewDirectionW, normalW, vLightData0, vLightDirection0, vLightDiffuse0, vLightSpecular0);\n#endif\n#ifdef HEMILIGHT0\n mat3 info = computeHemisphericLighting(viewDirectionW, normalW, vLightData0, vLightDiffuse0, vLightSpecular0, vLightGround0);\n#endif\n#ifdef POINTDIRLIGHT0\n mat3 info = computeLighting(viewDirectionW, normalW, vLightData0, vLightDiffuse0, vLightSpecular0);\n#endif\n#ifdef SHADOW0\n#ifdef SHADOWVSM0\n shadow = computeShadowWithVSM(vPositionFromLight0, shadowSampler0);\n#else\n shadow = computeShadow(vPositionFromLight0, shadowSampler0);\n#endif\n#else\n shadow = 1.;\n#endif\n diffuseBase += info[0] * shadow;\n specularBase += info[1] * shadow;\n#endif\n\n#ifdef LIGHT1\n#ifdef SPOTLIGHT1\n info = computeSpotLighting(viewDirectionW, normalW, vLightData1, vLightDirection1, vLightDiffuse1, vLightSpecular1);\n#endif\n#ifdef HEMILIGHT1\n info = computeHemisphericLighting(viewDirectionW, normalW, vLightData1, vLightDiffuse1, vLightSpecular1, vLightGround1);\n#endif\n#ifdef POINTDIRLIGHT1\n info = computeLighting(viewDirectionW, normalW, vLightData1, vLightDiffuse1, vLightSpecular1);\n#endif\n#ifdef SHADOW1\n#ifdef SHADOWVSM1\n shadow = computeShadowWithVSM(vPositionFromLight1, shadowSampler1);\n#else\n shadow = computeShadow(vPositionFromLight1, shadowSampler1);\n#endif\n#else\n shadow = 1.;\n#endif\n diffuseBase += info[0] * shadow;\n specularBase += info[1] * shadow;\n#endif\n\n#ifdef LIGHT2\n#ifdef SPOTLIGHT2\n info = computeSpotLighting(viewDirectionW, normalW, vLightData2, vLightDirection2, vLightDiffuse2, vLightSpecular2);\n#endif\n#ifdef HEMILIGHT2\n info = computeHemisphericLighting(viewDirectionW, normalW, vLightData2, vLightDiffuse2, vLightSpecular2, vLightGround2);\n#endif\n#ifdef POINTDIRLIGHT2\n info = computeLighting(viewDirectionW, normalW, vLightData2, vLightDiffuse2, vLightSpecular2);\n#endif\n#ifdef SHADOW2\n#ifdef SHADOWVSM2\n shadow = computeShadowWithVSM(vPositionFromLight2, shadowSampler2);\n#else\n shadow = computeShadow(vPositionFromLight2, shadowSampler2);\n#endif \n#else\n shadow = 1.;\n#endif\n diffuseBase += info[0] * shadow;\n specularBase += info[1] * shadow;\n#endif\n\n#ifdef LIGHT3\n#ifdef SPOTLIGHT3\n info = computeSpotLighting(viewDirectionW, normalW, vLightData3, vLightDirection3, vLightDiffuse3, vLightSpecular3);\n#endif\n#ifdef HEMILIGHT3\n info = computeHemisphericLighting(viewDirectionW, normalW, vLightData3, vLightDiffuse3, vLightSpecular3, vLightGround3);\n#endif\n#ifdef POINTDIRLIGHT3\n info = computeLighting(viewDirectionW, normalW, vLightData3, vLightDiffuse3, vLightSpecular3);\n#endif\n#ifdef SHADOW3\n#ifdef SHADOWVSM3\n shadow = computeShadowWithVSM(vPositionFromLight3, shadowSampler3);\n#else\n shadow = computeShadow(vPositionFromLight3, shadowSampler3);\n#endif \n#else\n shadow = 1.;\n#endif\n diffuseBase += info[0] * shadow;\n specularBase += info[1] * shadow;\n#endif\n\n // Reflection\n vec3 reflectionColor = vec3(0., 0., 0.);\n\n#ifdef REFLECTION\n if (vReflectionInfos.z != 0.0)\n {\n reflectionColor = textureCube(reflectionCubeSampler, vReflectionUVW).rgb * vReflectionInfos.y;\n }\n else\n {\n vec2 coords = vReflectionUVW.xy;\n\n if (vReflectionInfos.x == MAP_PROJECTION)\n {\n coords /= vReflectionUVW.z;\n }\n\n coords.y = 1.0 - coords.y;\n\n reflectionColor = texture2D(reflection2DSampler, coords).rgb * vReflectionInfos.y;\n }\n\n#ifdef REFLECTIONFRESNEL\n float reflectionFresnelTerm = computeFresnelTerm(viewDirectionW, normalW, reflectionRightColor.a, reflectionLeftColor.a);\n\n reflectionColor *= reflectionLeftColor.rgb * (1.0 - reflectionFresnelTerm) + reflectionFresnelTerm * reflectionRightColor.rgb;\n#endif\n#endif\n\n // Alpha\n float alpha = vDiffuseColor.a;\n\n#ifdef OPACITY\n vec4 opacityMap = texture2D(opacitySampler, vOpacityUV);\n#ifdef OPACITYRGB\n opacityMap.rgb = opacityMap.rgb * vec3(0.3, 0.59, 0.11);\n alpha *= (opacityMap.x + opacityMap.y + opacityMap.z)* vOpacityInfos.y;\n#else\n alpha *= opacityMap.a * vOpacityInfos.y;\n#endif\n#endif\n\n#ifdef VERTEXALPHA\n alpha *= vColor.a;\n#endif\n\n#ifdef OPACITYFRESNEL\n float opacityFresnelTerm = computeFresnelTerm(viewDirectionW, normalW, opacityParts.z, opacityParts.w);\n\n alpha += opacityParts.x * (1.0 - opacityFresnelTerm) + opacityFresnelTerm * opacityParts.y;\n#endif\n\n // Emissive\n vec3 emissiveColor = vEmissiveColor;\n#ifdef EMISSIVE\n emissiveColor += texture2D(emissiveSampler, vEmissiveUV).rgb * vEmissiveInfos.y;\n#endif\n\n#ifdef EMISSIVEFRESNEL\n float emissiveFresnelTerm = computeFresnelTerm(viewDirectionW, normalW, emissiveRightColor.a, emissiveLeftColor.a);\n\n emissiveColor *= emissiveLeftColor.rgb * (1.0 - emissiveFresnelTerm) + emissiveFresnelTerm * emissiveRightColor.rgb;\n#endif\n\n // Specular map\n vec3 specularColor = vSpecularColor.rgb;\n#ifdef SPECULAR\n specularColor = texture2D(specularSampler, vSpecularUV).rgb * vSpecularInfos.y;\n#endif\n\n // Fresnel\n#ifdef DIFFUSEFRESNEL\n float diffuseFresnelTerm = computeFresnelTerm(viewDirectionW, normalW, diffuseRightColor.a, diffuseLeftColor.a);\n\n diffuseBase *= diffuseLeftColor.rgb * (1.0 - diffuseFresnelTerm) + diffuseFresnelTerm * diffuseRightColor.rgb;\n#endif\n\n // Composition\n vec3 finalDiffuse = clamp(diffuseBase * diffuseColor + emissiveColor + vAmbientColor, 0.0, 1.0) * baseColor.rgb;\n vec3 finalSpecular = specularBase * specularColor;\n\n vec4 color = vec4(finalDiffuse * baseAmbientColor + finalSpecular + reflectionColor, alpha);\n\n#ifdef FOG\n float fog = CalcFogFactor();\n color.rgb = fog * color.rgb + (1.0 - fog) * vFogColor;\n#endif\n\n gl_FragColor = color;\n}", legacydefaultVertexShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n#define MAP_EXPLICIT 0.\n#define MAP_SPHERICAL 1.\n#define MAP_PLANAR 2.\n#define MAP_CUBIC 3.\n#define MAP_PROJECTION 4.\n#define MAP_SKYBOX 5.\n\n// Attributes\nattribute vec3 position;\nattribute vec3 normal;\n#ifdef UV1\nattribute vec2 uv;\n#endif\n#ifdef UV2\nattribute vec2 uv2;\n#endif\n#ifdef VERTEXCOLOR\nattribute vec4 color;\n#endif\n#ifdef BONES\nattribute vec4 matricesIndices;\nattribute vec4 matricesWeights;\n#endif\n\n// Uniforms\nuniform mat4 world;\nuniform mat4 view;\nuniform mat4 viewProjection;\n\n#ifdef DIFFUSE\nvarying vec2 vDiffuseUV;\nuniform mat4 diffuseMatrix;\nuniform vec2 vDiffuseInfos;\n#endif\n\n#ifdef AMBIENT\nvarying vec2 vAmbientUV;\nuniform mat4 ambientMatrix;\nuniform vec2 vAmbientInfos;\n#endif\n\n#ifdef OPACITY\nvarying vec2 vOpacityUV;\nuniform mat4 opacityMatrix;\nuniform vec2 vOpacityInfos;\n#endif\n\n#ifdef REFLECTION\nuniform vec3 vEyePosition;\nvarying vec3 vReflectionUVW;\nuniform vec3 vReflectionInfos;\nuniform mat4 reflectionMatrix;\n#endif\n\n#ifdef EMISSIVE\nvarying vec2 vEmissiveUV;\nuniform vec2 vEmissiveInfos;\nuniform mat4 emissiveMatrix;\n#endif\n\n#ifdef SPECULAR\nvarying vec2 vSpecularUV;\nuniform vec2 vSpecularInfos;\nuniform mat4 specularMatrix;\n#endif\n\n#ifdef BUMP\nvarying vec2 vBumpUV;\nuniform vec2 vBumpInfos;\nuniform mat4 bumpMatrix;\n#endif\n\n#ifdef BONES\nuniform mat4 mBones[BonesPerMesh];\n#endif\n\n// Output\nvarying vec3 vPositionW;\nvarying vec3 vNormalW;\n\n#ifdef VERTEXCOLOR\nvarying vec4 vColor;\n#endif\n\n#ifdef CLIPPLANE\nuniform vec4 vClipPlane;\nvarying float fClipDistance;\n#endif\n\n#ifdef FOG\nvarying float fFogDistance;\n#endif\n\n#ifdef SHADOWS\n#ifdef LIGHT0\nuniform mat4 lightMatrix0;\nvarying vec4 vPositionFromLight0;\n#endif\n#ifdef LIGHT1\nuniform mat4 lightMatrix1;\nvarying vec4 vPositionFromLight1;\n#endif\n#ifdef LIGHT2\nuniform mat4 lightMatrix2;\nvarying vec4 vPositionFromLight2;\n#endif\n#ifdef LIGHT3\nuniform mat4 lightMatrix3;\nvarying vec4 vPositionFromLight3;\n#endif\n#endif\n\n#ifdef REFLECTION\nvec3 computeReflectionCoords(float mode, vec4 worldPos, vec3 worldNormal)\n{\n if (mode == MAP_SPHERICAL)\n {\n vec3 coords = vec3(view * vec4(worldNormal, 0.0));\n\n return vec3(reflectionMatrix * vec4(coords, 1.0));\n }\n else if (mode == MAP_PLANAR)\n {\n vec3 viewDir = worldPos.xyz - vEyePosition;\n vec3 coords = normalize(reflect(viewDir, worldNormal));\n\n return vec3(reflectionMatrix * vec4(coords, 1));\n }\n else if (mode == MAP_CUBIC)\n {\n vec3 viewDir = worldPos.xyz - vEyePosition;\n vec3 coords = reflect(viewDir, worldNormal);\n\n return vec3(reflectionMatrix * vec4(coords, 0));\n }\n else if (mode == MAP_PROJECTION)\n {\n return vec3(reflectionMatrix * (view * worldPos));\n }\n else if (mode == MAP_SKYBOX)\n {\n return position;\n }\n\n return vec3(0, 0, 0);\n}\n#endif\n\nvoid main(void) {\n mat4 finalWorld;\n\n#ifdef BONES\n mat4 m0 = mBones[int(matricesIndices.x)] * matricesWeights.x;\n mat4 m1 = mBones[int(matricesIndices.y)] * matricesWeights.y;\n mat4 m2 = mBones[int(matricesIndices.z)] * matricesWeights.z;\n\n#ifdef BONES4\n mat4 m3 = mBones[int(matricesIndices.w)] * matricesWeights.w;\n finalWorld = world * (m0 + m1 + m2 + m3);\n#else\n finalWorld = world * (m0 + m1 + m2);\n#endif \n\n#else\n finalWorld = world;\n#endif\n\n gl_Position = viewProjection * finalWorld * vec4(position, 1.0);\n\n vec4 worldPos = finalWorld * vec4(position, 1.0);\n vPositionW = vec3(worldPos);\n vNormalW = normalize(vec3(finalWorld * vec4(normal, 0.0)));\n\n // Texture coordinates\n#ifndef UV1\n vec2 uv = vec2(0., 0.);\n#endif\n#ifndef UV2\n vec2 uv2 = vec2(0., 0.);\n#endif\n\n#ifdef DIFFUSE\n if (vDiffuseInfos.x == 0.)\n {\n vDiffuseUV = vec2(diffuseMatrix * vec4(uv, 1.0, 0.0));\n }\n else\n {\n vDiffuseUV = vec2(diffuseMatrix * vec4(uv2, 1.0, 0.0));\n }\n#endif\n\n#ifdef AMBIENT\n if (vAmbientInfos.x == 0.)\n {\n vAmbientUV = vec2(ambientMatrix * vec4(uv, 1.0, 0.0));\n }\n else\n {\n vAmbientUV = vec2(ambientMatrix * vec4(uv2, 1.0, 0.0));\n }\n#endif\n\n#ifdef OPACITY\n if (vOpacityInfos.x == 0.)\n {\n vOpacityUV = vec2(opacityMatrix * vec4(uv, 1.0, 0.0));\n }\n else\n {\n vOpacityUV = vec2(opacityMatrix * vec4(uv2, 1.0, 0.0));\n }\n#endif\n\n#ifdef REFLECTION\n vReflectionUVW = computeReflectionCoords(vReflectionInfos.x, vec4(vPositionW, 1.0), vNormalW);\n#endif\n\n#ifdef EMISSIVE\n if (vEmissiveInfos.x == 0.)\n {\n vEmissiveUV = vec2(emissiveMatrix * vec4(uv, 1.0, 0.0));\n }\n else\n {\n vEmissiveUV = vec2(emissiveMatrix * vec4(uv2, 1.0, 0.0));\n }\n#endif\n\n#ifdef SPECULAR\n if (vSpecularInfos.x == 0.)\n {\n vSpecularUV = vec2(specularMatrix * vec4(uv, 1.0, 0.0));\n }\n else\n {\n vSpecularUV = vec2(specularMatrix * vec4(uv2, 1.0, 0.0));\n }\n#endif\n\n#ifdef BUMP\n if (vBumpInfos.x == 0.)\n {\n vBumpUV = vec2(bumpMatrix * vec4(uv, 1.0, 0.0));\n }\n else\n {\n vBumpUV = vec2(bumpMatrix * vec4(uv2, 1.0, 0.0));\n }\n#endif\n\n // Clip plane\n#ifdef CLIPPLANE\n fClipDistance = dot(worldPos, vClipPlane);\n#endif\n\n // Fog\n#ifdef FOG\n fFogDistance = (view * worldPos).z;\n#endif\n\n // Shadows\n#ifdef SHADOWS\n#ifdef LIGHT0\n vPositionFromLight0 = lightMatrix0 * worldPos;\n#endif\n#ifdef LIGHT1\n vPositionFromLight1 = lightMatrix1 * worldPos;\n#endif\n#ifdef LIGHT2\n vPositionFromLight2 = lightMatrix2 * worldPos;\n#endif\n#ifdef LIGHT3\n vPositionFromLight3 = lightMatrix3 * worldPos;\n#endif\n#endif\n\n // Vertex color\n#ifdef VERTEXCOLOR\n vColor = color;\n#endif\n}", lensFlarePixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Samplers\nvarying vec2 vUV;\nuniform sampler2D textureSampler;\n\n// Color\nuniform vec4 color;\n\nvoid main(void) {\n vec4 baseColor = texture2D(textureSampler, vUV);\n\n gl_FragColor = baseColor * color;\n}", lensFlareVertexShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Attributes\nattribute vec2 position;\n\n// Uniforms\nuniform mat4 viewportMatrix;\n\n// Output\nvarying vec2 vUV;\n\nconst vec2 madd = vec2(0.5, 0.5);\n\nvoid main(void) { \n\n vUV = position * madd + madd;\n gl_Position = viewportMatrix * vec4(position, 0.0, 1.0);\n}", marblePixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\nvarying vec2 vPosition;\nvarying vec2 vUV;\n\nuniform float numberOfTilesHeight;\nuniform float numberOfTilesWidth;\nuniform float amplitude;\nuniform vec3 brickColor;\nuniform vec3 jointColor;\n\nconst vec3 tileSize = vec3(1.1, 1.0, 1.1);\nconst vec3 tilePct = vec3(0.98, 1.0, 0.98);\n\nfloat rand(vec2 n) {\n return fract(cos(dot(n, vec2(12.9898, 4.1414))) * 43758.5453);\n}\n\nfloat noise(vec2 n) {\n const vec2 d = vec2(0.0, 1.0);\n vec2 b = floor(n), f = smoothstep(vec2(0.0), vec2(1.0), fract(n));\n return mix(mix(rand(b), rand(b + d.yx), f.x), mix(rand(b + d.xy), rand(b + d.yy), f.x), f.y);\n}\n\nfloat turbulence(vec2 P)\n{\n float val = 0.0;\n float freq = 1.0;\n for (int i = 0; i < 4; i++)\n {\n val += abs(noise(P*freq) / freq);\n freq *= 2.07;\n }\n return val;\n}\n\nfloat round(float number){\n return sign(number)*floor(abs(number) + 0.5);\n}\n\nvec3 marble_color(float x)\n{\n vec3 col;\n x = 0.5*(x + 1.);\n x = sqrt(x); \n x = sqrt(x);\n x = sqrt(x);\n col = vec3(.2 + .75*x); \n col.b *= 0.95; \n return col;\n}\n\nvoid main()\n{\n float brickW = 1.0 / numberOfTilesWidth;\n float brickH = 1.0 / numberOfTilesHeight;\n float jointWPercentage = 0.01;\n float jointHPercentage = 0.01;\n vec3 color = brickColor;\n float yi = vUV.y / brickH;\n float nyi = round(yi);\n float xi = vUV.x / brickW;\n\n if (mod(floor(yi), 2.0) == 0.0){\n xi = xi - 0.5;\n }\n\n float nxi = round(xi);\n vec2 brickvUV = vec2((xi - floor(xi)) / brickH, (yi - floor(yi)) / brickW);\n\n if (yi < nyi + jointHPercentage && yi > nyi - jointHPercentage){\n color = mix(jointColor, vec3(0.37, 0.25, 0.25), (yi - nyi) / jointHPercentage + 0.2);\n }\n else if (xi < nxi + jointWPercentage && xi > nxi - jointWPercentage){\n color = mix(jointColor, vec3(0.44, 0.44, 0.44), (xi - nxi) / jointWPercentage + 0.2);\n }\n else {\n float t = 6.28 * brickvUV.x / (tileSize.x + noise(vec2(vUV)*6.0));\n t += amplitude * turbulence(brickvUV.xy);\n t = sin(t);\n color = marble_color(t);\n }\n\n gl_FragColor = vec4(color, 0.0);\n}", oculusDistortionCorrectionPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Samplers\nvarying vec2 vUV;\nuniform sampler2D textureSampler;\nuniform vec2 LensCenter;\nuniform vec2 Scale;\nuniform vec2 ScaleIn;\nuniform vec4 HmdWarpParam;\n\nvec2 HmdWarp(vec2 in01) {\n\n vec2 theta = (in01 - LensCenter) * ScaleIn; // Scales to [-1, 1]\n float rSq = theta.x * theta.x + theta.y * theta.y;\n vec2 rvector = theta * (HmdWarpParam.x + HmdWarpParam.y * rSq + HmdWarpParam.z * rSq * rSq + HmdWarpParam.w * rSq * rSq * rSq);\n return LensCenter + Scale * rvector;\n}\n\nvoid main(void)\n{\n vec2 tc = HmdWarp(vUV);\n if (tc.x <0.0 || tc.x>1.0 || tc.y<0.0 || tc.y>1.0)\n gl_FragColor = vec4(0.0, 0.0, 0.0, 1.0);\n else{\n gl_FragColor = vec4(texture2D(textureSampler, tc).rgb, 1.0);\n }\n}", outlinePixelShader:"precision highp float;\n\nuniform vec4 color;\n\n#ifdef ALPHATEST\nvarying vec2 vUV;\nuniform sampler2D diffuseSampler;\n#endif\n\nvoid main(void) {\n#ifdef ALPHATEST\n if (texture2D(diffuseSampler, vUV).a < 0.4)\n discard;\n#endif\n\n gl_FragColor = color;\n}", outlineVertexShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Attribute\nattribute vec3 position;\nattribute vec3 normal;\n\n#ifdef BONES\nattribute vec4 matricesIndices;\nattribute vec4 matricesWeights;\n#endif\n\n// Uniform\nuniform float offset;\n\n#ifdef INSTANCES\nattribute vec4 world0;\nattribute vec4 world1;\nattribute vec4 world2;\nattribute vec4 world3;\n#else\nuniform mat4 world;\n#endif\n\nuniform mat4 viewProjection;\n#ifdef BONES\nuniform mat4 mBones[BonesPerMesh];\n#endif\n\n#ifdef ALPHATEST\nvarying vec2 vUV;\nuniform mat4 diffuseMatrix;\n#ifdef UV1\nattribute vec2 uv;\n#endif\n#ifdef UV2\nattribute vec2 uv2;\n#endif\n#endif\n\nvoid main(void)\n{\n#ifdef INSTANCES\n mat4 finalWorld = mat4(world0, world1, world2, world3);\n#else\n mat4 finalWorld = world;\n#endif\n\n vec3 offsetPosition = position + normal * offset;\n\n#ifdef BONES\n mat4 m0 = mBones[int(matricesIndices.x)] * matricesWeights.x;\n mat4 m1 = mBones[int(matricesIndices.y)] * matricesWeights.y;\n mat4 m2 = mBones[int(matricesIndices.z)] * matricesWeights.z;\n mat4 m3 = mBones[int(matricesIndices.w)] * matricesWeights.w;\n finalWorld = finalWorld * (m0 + m1 + m2 + m3);\n gl_Position = viewProjection * finalWorld * vec4(offsetPosition, 1.0);\n#else\n gl_Position = viewProjection * finalWorld * vec4(offsetPosition, 1.0);\n#endif\n\n#ifdef ALPHATEST\n#ifdef UV1\n vUV = vec2(diffuseMatrix * vec4(uv, 1.0, 0.0));\n#endif\n#ifdef UV2\n vUV = vec2(diffuseMatrix * vec4(uv2, 1.0, 0.0));\n#endif\n#endif\n}", particlesPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Samplers\nvarying vec2 vUV;\nvarying vec4 vColor;\nuniform vec4 textureMask;\nuniform sampler2D diffuseSampler;\n\n#ifdef CLIPPLANE\nvarying float fClipDistance;\n#endif\n\nvoid main(void) {\n#ifdef CLIPPLANE\n if (fClipDistance > 0.0)\n discard;\n#endif\n vec4 baseColor = texture2D(diffuseSampler, vUV);\n\n gl_FragColor = (baseColor * textureMask + (vec4(1., 1., 1., 1.) - textureMask)) * vColor;\n}", particlesVertexShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Attributes\nattribute vec3 position;\nattribute vec4 color;\nattribute vec4 options;\n\n// Uniforms\nuniform mat4 view;\nuniform mat4 projection;\n\n// Output\nvarying vec2 vUV;\nvarying vec4 vColor;\n\n#ifdef CLIPPLANE\nuniform vec4 vClipPlane;\nuniform mat4 invView;\nvarying float fClipDistance;\n#endif\n\nvoid main(void) { \n vec3 viewPos = (view * vec4(position, 1.0)).xyz; \n vec3 cornerPos;\n float size = options.y;\n float angle = options.x;\n vec2 offset = options.zw;\n\n cornerPos = vec3(offset.x - 0.5, offset.y - 0.5, 0.) * size;\n\n // Rotate\n vec3 rotatedCorner;\n rotatedCorner.x = cornerPos.x * cos(angle) - cornerPos.y * sin(angle);\n rotatedCorner.y = cornerPos.x * sin(angle) + cornerPos.y * cos(angle);\n rotatedCorner.z = 0.;\n\n // Position\n viewPos += rotatedCorner;\n gl_Position = projection * vec4(viewPos, 1.0); \n \n vColor = color;\n vUV = offset;\n\n // Clip plane\n#ifdef CLIPPLANE\n vec4 worldPos = invView * vec4(viewPos, 1.0);\n fClipDistance = dot(worldPos, vClipPlane);\n#endif\n}", passPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Samplers\nvarying vec2 vUV;\nuniform sampler2D textureSampler;\n\nvoid main(void) \n{\n gl_FragColor = texture2D(textureSampler, vUV);\n}", postprocessVertexShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Attributes\nattribute vec2 position;\n\n// Output\nvarying vec2 vUV;\n\nconst vec2 madd = vec2(0.5, 0.5);\n\nvoid main(void) { \n\n vUV = position * madd + madd;\n gl_Position = vec4(position, 0.0, 1.0);\n}", proceduralVertexShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Attributes\nattribute vec2 position;\n\n// Output\nvarying vec2 vPosition;\nvarying vec2 vUV;\n\nconst vec2 madd = vec2(0.5, 0.5);\n\nvoid main(void) { \n vPosition = position;\n vUV = position * madd + madd;\n gl_Position = vec4(position, 0.0, 1.0);\n}", refractionPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Samplers\nvarying vec2 vUV;\nuniform sampler2D textureSampler;\nuniform sampler2D refractionSampler;\n\n// Parameters\nuniform vec3 baseColor;\nuniform float depth;\nuniform float colorLevel;\n\nvoid main() {\n float ref = 1.0 - texture2D(refractionSampler, vUV).r;\n\n vec2 uv = vUV - vec2(0.5);\n vec2 offset = uv * depth * ref;\n vec3 sourceColor = texture2D(textureSampler, vUV - offset).rgb;\n\n gl_FragColor = vec4(sourceColor + sourceColor * ref * colorLevel, 1.0);\n}", roadPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\nvarying vec2 vUV; \nuniform vec3 roadColor;\n\nfloat rand(vec2 n) {\n return fract(cos(dot(n, vec2(12.9898, 4.1414))) * 43758.5453);\n}\n\nfloat noise(vec2 n) {\n const vec2 d = vec2(0.0, 1.0);\n vec2 b = floor(n), f = smoothstep(vec2(0.0), vec2(1.0), fract(n));\n return mix(mix(rand(b), rand(b + d.yx), f.x), mix(rand(b + d.xy), rand(b + d.yy), f.x), f.y);\n}\n\nfloat fbm(vec2 n) {\n float total = 0.0, amplitude = 1.0;\n for (int i = 0; i < 4; i++) {\n total += noise(n) * amplitude;\n n += n;\n amplitude *= 0.5;\n }\n return total;\n}\n\nvoid main(void) {\n float ratioy = mod(gl_FragCoord.y * 100.0 , fbm(vUV * 2.0));\n vec3 color = roadColor * ratioy;\n gl_FragColor = vec4(color, 1.0);\n}", shadowMapPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\nvec4 pack(float depth)\n{\n const vec4 bitOffset = vec4(255. * 255. * 255., 255. * 255., 255., 1.);\n const vec4 bitMask = vec4(0., 1. / 255., 1. / 255., 1. / 255.);\n \n vec4 comp = mod(depth * bitOffset * vec4(254.), vec4(255.)) / vec4(254.);\n comp -= comp.xxyz * bitMask;\n \n return comp;\n}\n\n// Thanks to http://devmaster.net/\nvec2 packHalf(float depth) \n{ \n const vec2 bitOffset = vec2(1.0 / 255., 0.);\n vec2 color = vec2(depth, fract(depth * 255.));\n\n return color - (color.yy * bitOffset);\n}\n\n#ifndef VSM\nvarying vec4 vPosition;\n#endif\n\n#ifdef ALPHATEST\nvarying vec2 vUV;\nuniform sampler2D diffuseSampler;\n#endif\n\nvoid main(void)\n{\n#ifdef ALPHATEST\n if (texture2D(diffuseSampler, vUV).a < 0.4)\n discard;\n#endif\n\n#ifdef VSM\n float moment1 = gl_FragCoord.z / gl_FragCoord.w;\n float moment2 = moment1 * moment1;\n gl_FragColor = vec4(packHalf(moment1), packHalf(moment2));\n#else\n gl_FragColor = pack(vPosition.z / vPosition.w);\n#endif\n}", shadowMapVertexShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Attribute\nattribute vec3 position;\n#ifdef BONES\nattribute vec4 matricesIndices;\nattribute vec4 matricesWeights;\n#endif\n\n// Uniform\n#ifdef INSTANCES\nattribute vec4 world0;\nattribute vec4 world1;\nattribute vec4 world2;\nattribute vec4 world3;\n#else\nuniform mat4 world;\n#endif\n\nuniform mat4 viewProjection;\n#ifdef BONES\nuniform mat4 mBones[BonesPerMesh];\n#endif\n\n#ifndef VSM\nvarying vec4 vPosition;\n#endif\n\n#ifdef ALPHATEST\nvarying vec2 vUV;\nuniform mat4 diffuseMatrix;\n#ifdef UV1\nattribute vec2 uv;\n#endif\n#ifdef UV2\nattribute vec2 uv2;\n#endif\n#endif\n\nvoid main(void)\n{\n#ifdef INSTANCES\n mat4 finalWorld = mat4(world0, world1, world2, world3);\n#else\n mat4 finalWorld = world;\n#endif\n\n#ifdef BONES\n mat4 m0 = mBones[int(matricesIndices.x)] * matricesWeights.x;\n mat4 m1 = mBones[int(matricesIndices.y)] * matricesWeights.y;\n mat4 m2 = mBones[int(matricesIndices.z)] * matricesWeights.z;\n mat4 m3 = mBones[int(matricesIndices.w)] * matricesWeights.w;\n finalWorld = finalWorld * (m0 + m1 + m2 + m3);\n gl_Position = viewProjection * finalWorld * vec4(position, 1.0);\n#else\n#ifndef VSM\n vPosition = viewProjection * finalWorld * vec4(position, 1.0);\n#endif\n gl_Position = viewProjection * finalWorld * vec4(position, 1.0);\n#endif\n\n#ifdef ALPHATEST\n#ifdef UV1\n vUV = vec2(diffuseMatrix * vec4(uv, 1.0, 0.0));\n#endif\n#ifdef UV2\n vUV = vec2(diffuseMatrix * vec4(uv2, 1.0, 0.0));\n#endif\n#endif\n}", spritesPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\nuniform bool alphaTest;\n\nvarying vec4 vColor;\n\n// Samplers\nvarying vec2 vUV;\nuniform sampler2D diffuseSampler;\n\n// Fog\n#ifdef FOG\n\n#define FOGMODE_NONE 0.\n#define FOGMODE_EXP 1.\n#define FOGMODE_EXP2 2.\n#define FOGMODE_LINEAR 3.\n#define E 2.71828\n\nuniform vec4 vFogInfos;\nuniform vec3 vFogColor;\nvarying float fFogDistance;\n\nfloat CalcFogFactor()\n{\n float fogCoeff = 1.0;\n float fogStart = vFogInfos.y;\n float fogEnd = vFogInfos.z;\n float fogDensity = vFogInfos.w;\n\n if (FOGMODE_LINEAR == vFogInfos.x)\n {\n fogCoeff = (fogEnd - fFogDistance) / (fogEnd - fogStart);\n }\n else if (FOGMODE_EXP == vFogInfos.x)\n {\n fogCoeff = 1.0 / pow(E, fFogDistance * fogDensity);\n }\n else if (FOGMODE_EXP2 == vFogInfos.x)\n {\n fogCoeff = 1.0 / pow(E, fFogDistance * fFogDistance * fogDensity * fogDensity);\n }\n\n return min(1., max(0., fogCoeff));\n}\n#endif\n\n\nvoid main(void) {\n vec4 baseColor = texture2D(diffuseSampler, vUV);\n\n if (alphaTest) \n {\n if (baseColor.a < 0.95)\n discard;\n }\n\n baseColor *= vColor;\n\n#ifdef FOG\n float fog = CalcFogFactor();\n baseColor.rgb = fog * baseColor.rgb + (1.0 - fog) * vFogColor;\n#endif\n\n gl_FragColor = baseColor;\n}", spritesVertexShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Attributes\nattribute vec3 position;\nattribute vec4 options;\nattribute vec4 cellInfo;\nattribute vec4 color;\n\n// Uniforms\nuniform vec2 textureInfos;\nuniform mat4 view;\nuniform mat4 projection;\n\n// Output\nvarying vec2 vUV;\nvarying vec4 vColor;\n\n#ifdef FOG\nvarying float fFogDistance;\n#endif\n\nvoid main(void) { \n vec3 viewPos = (view * vec4(position, 1.0)).xyz; \n vec3 cornerPos;\n \n float angle = options.x;\n float size = options.y;\n vec2 offset = options.zw;\n vec2 uvScale = textureInfos.xy;\n\n cornerPos = vec3(offset.x - 0.5, offset.y - 0.5, 0.) * size;\n\n // Rotate\n vec3 rotatedCorner;\n rotatedCorner.x = cornerPos.x * cos(angle) - cornerPos.y * sin(angle);\n rotatedCorner.y = cornerPos.x * sin(angle) + cornerPos.y * cos(angle);\n rotatedCorner.z = 0.;\n\n // Position\n viewPos += rotatedCorner;\n gl_Position = projection * vec4(viewPos, 1.0); \n\n // Color\n vColor = color;\n \n // Texture\n vec2 uvOffset = vec2(abs(offset.x - cellInfo.x), 1.0 - abs(offset.y - cellInfo.y));\n\n vUV = (uvOffset + cellInfo.zw) * uvScale;\n\n // Fog\n#ifdef FOG\n fFogDistance = viewPos.z;\n#endif\n}", woodPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\nvarying vec2 vPosition;\nvarying vec2 vUV;\n\nuniform float ampScale;\nuniform vec3 woodColor;\n\nfloat rand(vec2 n) {\n return fract(cos(dot(n, vec2(12.9898, 4.1414))) * 43758.5453);\n}\n\nfloat noise(vec2 n) {\n const vec2 d = vec2(0.0, 1.0);\n vec2 b = floor(n), f = smoothstep(vec2(0.0), vec2(1.0), fract(n));\n return mix(mix(rand(b), rand(b + d.yx), f.x), mix(rand(b + d.xy), rand(b + d.yy), f.x), f.y);\n}\n\nfloat fbm(vec2 n) {\n float total = 0.0, amplitude = 1.0;\n for (int i = 0; i < 4; i++) {\n total += noise(n) * amplitude;\n n += n;\n amplitude *= 0.5;\n }\n return total;\n}\n\nvoid main(void) {\n float ratioy = mod(vUV.x * ampScale, 2.0 + fbm(vUV * 0.8));\n vec3 wood = woodColor * ratioy;\n gl_FragColor = vec4(wood, 1.0);\n}", }; return Effect; })(); BABYLON.Effect = Effect; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.effect.js.map var BABYLON; (function (BABYLON) { var Material = (function () { function Material(name, scene, doNotAdd) { this.name = name; this.checkReadyOnEveryCall = true; this.checkReadyOnlyOnce = false; this.state = ""; this.alpha = 1.0; this.backFaceCulling = true; this._wasPreviouslyReady = false; this._fillMode = Material.TriangleFillMode; this.pointSize = 1.0; this.id = name; this._scene = scene; if (!doNotAdd) { scene.materials.push(this); } } Object.defineProperty(Material, "TriangleFillMode", { get: function () { return Material._TriangleFillMode; }, enumerable: true, configurable: true }); Object.defineProperty(Material, "WireFrameFillMode", { get: function () { return Material._WireFrameFillMode; }, enumerable: true, configurable: true }); Object.defineProperty(Material, "PointFillMode", { get: function () { return Material._PointFillMode; }, enumerable: true, configurable: true }); Object.defineProperty(Material.prototype, "wireframe", { get: function () { return this._fillMode === Material.WireFrameFillMode; }, set: function (value) { this._fillMode = (value ? Material.WireFrameFillMode : Material.TriangleFillMode); }, enumerable: true, configurable: true }); Object.defineProperty(Material.prototype, "pointsCloud", { get: function () { return this._fillMode === Material.PointFillMode; }, set: function (value) { this._fillMode = (value ? Material.PointFillMode : Material.TriangleFillMode); }, enumerable: true, configurable: true }); Object.defineProperty(Material.prototype, "fillMode", { get: function () { return this._fillMode; }, set: function (value) { this._fillMode = value; }, enumerable: true, configurable: true }); Material.prototype.isReady = function (mesh, useInstances) { return true; }; Material.prototype.getEffect = function () { return this._effect; }; Material.prototype.getScene = function () { return this._scene; }; Material.prototype.needAlphaBlending = function () { return (this.alpha < 1.0); }; Material.prototype.needAlphaTesting = function () { return false; }; Material.prototype.getAlphaTestTexture = function () { return null; }; Material.prototype.trackCreation = function (onCompiled, onError) { }; Material.prototype._preBind = function () { var engine = this._scene.getEngine(); engine.enableEffect(this._effect); engine.setState(this.backFaceCulling); }; Material.prototype.bind = function (world, mesh) { this._scene._cachedMaterial = this; if (this.onBind) { this.onBind(this); } }; Material.prototype.bindOnlyWorldMatrix = function (world) { }; Material.prototype.unbind = function () { }; Material.prototype.dispose = function (forceDisposeEffect) { // Remove from scene var index = this._scene.materials.indexOf(this); this._scene.materials.splice(index, 1); // Shader are kept in cache for further use but we can get rid of this by using forceDisposeEffect if (forceDisposeEffect && this._effect) { this._scene.getEngine()._releaseEffect(this._effect); this._effect = null; } // Callback if (this.onDispose) { this.onDispose(); } }; Material._TriangleFillMode = 0; Material._WireFrameFillMode = 1; Material._PointFillMode = 2; return Material; })(); BABYLON.Material = Material; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.material.js.map var BABYLON; (function (BABYLON) { var maxSimultaneousLights = 4; var FresnelParameters = (function () { function FresnelParameters() { this.isEnabled = true; this.leftColor = BABYLON.Color3.White(); this.rightColor = BABYLON.Color3.Black(); this.bias = 0; this.power = 1; } return FresnelParameters; })(); BABYLON.FresnelParameters = FresnelParameters; var StandardMaterial = (function (_super) { __extends(StandardMaterial, _super); function StandardMaterial(name, scene) { var _this = this; _super.call(this, name, scene); this.ambientColor = new BABYLON.Color3(0, 0, 0); this.diffuseColor = new BABYLON.Color3(1, 1, 1); this.specularColor = new BABYLON.Color3(1, 1, 1); this.specularPower = 64; this.emissiveColor = new BABYLON.Color3(0, 0, 0); this.useAlphaFromDiffuseTexture = false; this.useSpecularOverAlpha = true; this.fogEnabled = true; this._cachedDefines = null; this._renderTargets = new BABYLON.SmartArray(16); this._worldViewProjectionMatrix = BABYLON.Matrix.Zero(); this._globalAmbientColor = new BABYLON.Color3(0, 0, 0); this._scaledDiffuse = new BABYLON.Color3(); this._scaledSpecular = new BABYLON.Color3(); this.getRenderTargetTextures = function () { _this._renderTargets.reset(); if (_this.reflectionTexture && _this.reflectionTexture.isRenderTarget) { _this._renderTargets.push(_this.reflectionTexture); } return _this._renderTargets; }; } StandardMaterial.prototype.needAlphaBlending = function () { return (this.alpha < 1.0) || (this.opacityTexture != null) || this._shouldUseAlphaFromDiffuseTexture() || this.opacityFresnelParameters && this.opacityFresnelParameters.isEnabled; }; StandardMaterial.prototype.needAlphaTesting = function () { return this.diffuseTexture != null && this.diffuseTexture.hasAlpha && !this.diffuseTexture.getAlphaFromRGB; }; StandardMaterial.prototype._shouldUseAlphaFromDiffuseTexture = function () { return this.diffuseTexture != null && this.diffuseTexture.hasAlpha && this.useAlphaFromDiffuseTexture; }; StandardMaterial.prototype.getAlphaTestTexture = function () { return this.diffuseTexture; }; // Methods StandardMaterial.prototype.isReady = function (mesh, useInstances) { if (this.checkReadyOnlyOnce) { if (this._wasPreviouslyReady) { return true; } } var scene = this.getScene(); if (!this.checkReadyOnEveryCall) { if (this._renderId === scene.getRenderId()) { return true; } } var engine = scene.getEngine(); var defines = []; var fallbacks = new BABYLON.EffectFallbacks(); // Textures if (scene.texturesEnabled) { if (this.diffuseTexture && StandardMaterial.DiffuseTextureEnabled) { if (!this.diffuseTexture.isReady()) { return false; } else { defines.push("#define DIFFUSE"); } } if (this.ambientTexture && StandardMaterial.AmbientTextureEnabled) { if (!this.ambientTexture.isReady()) { return false; } else { defines.push("#define AMBIENT"); } } if (this.opacityTexture && StandardMaterial.OpacityTextureEnabled) { if (!this.opacityTexture.isReady()) { return false; } else { defines.push("#define OPACITY"); if (this.opacityTexture.getAlphaFromRGB) { defines.push("#define OPACITYRGB"); } } } if (this.reflectionTexture && StandardMaterial.ReflectionTextureEnabled) { if (!this.reflectionTexture.isReady()) { return false; } else { defines.push("#define REFLECTION"); fallbacks.addFallback(0, "REFLECTION"); } } if (this.emissiveTexture && StandardMaterial.EmissiveTextureEnabled) { if (!this.emissiveTexture.isReady()) { return false; } else { defines.push("#define EMISSIVE"); } } if (this.specularTexture && StandardMaterial.SpecularTextureEnabled) { if (!this.specularTexture.isReady()) { return false; } else { defines.push("#define SPECULAR"); fallbacks.addFallback(0, "SPECULAR"); } } } if (scene.getEngine().getCaps().standardDerivatives && this.bumpTexture && StandardMaterial.BumpTextureEnabled) { if (!this.bumpTexture.isReady()) { return false; } else { defines.push("#define BUMP"); fallbacks.addFallback(0, "BUMP"); } } // Effect if (this.useSpecularOverAlpha) { defines.push("#define SPECULAROVERALPHA"); fallbacks.addFallback(0, "SPECULAROVERALPHA"); } if (scene.clipPlane) { defines.push("#define CLIPPLANE"); } if (engine.getAlphaTesting()) { defines.push("#define ALPHATEST"); } if (this._shouldUseAlphaFromDiffuseTexture()) { defines.push("#define ALPHAFROMDIFFUSE"); } // Point size if (this.pointsCloud || scene.forcePointsCloud) { defines.push("#define POINTSIZE"); } // Fog if (scene.fogEnabled && mesh && mesh.applyFog && scene.fogMode !== BABYLON.Scene.FOGMODE_NONE && this.fogEnabled) { defines.push("#define FOG"); fallbacks.addFallback(1, "FOG"); } var shadowsActivated = false; var lightIndex = 0; if (scene.lightsEnabled) { for (var index = 0; index < scene.lights.length; index++) { var light = scene.lights[index]; if (!light.isEnabled()) { continue; } // Excluded check if (light._excludedMeshesIds.length > 0) { for (var excludedIndex = 0; excludedIndex < light._excludedMeshesIds.length; excludedIndex++) { var excludedMesh = scene.getMeshByID(light._excludedMeshesIds[excludedIndex]); if (excludedMesh) { light.excludedMeshes.push(excludedMesh); } } light._excludedMeshesIds = []; } // Included check if (light._includedOnlyMeshesIds.length > 0) { for (var includedOnlyIndex = 0; includedOnlyIndex < light._includedOnlyMeshesIds.length; includedOnlyIndex++) { var includedOnlyMesh = scene.getMeshByID(light._includedOnlyMeshesIds[includedOnlyIndex]); if (includedOnlyMesh) { light.includedOnlyMeshes.push(includedOnlyMesh); } } light._includedOnlyMeshesIds = []; } if (!light.canAffectMesh(mesh)) { continue; } defines.push("#define LIGHT" + lightIndex); if (lightIndex > 0) { fallbacks.addFallback(lightIndex, "LIGHT" + lightIndex); } var type; if (light instanceof BABYLON.SpotLight) { type = "#define SPOTLIGHT" + lightIndex; } else if (light instanceof BABYLON.HemisphericLight) { type = "#define HEMILIGHT" + lightIndex; } else { type = "#define POINTDIRLIGHT" + lightIndex; } defines.push(type); if (lightIndex > 0) { fallbacks.addFallback(lightIndex, type.replace("#define ", "")); } // Shadows if (scene.shadowsEnabled) { var shadowGenerator = light.getShadowGenerator(); if (mesh && mesh.receiveShadows && shadowGenerator) { defines.push("#define SHADOW" + lightIndex); fallbacks.addFallback(0, "SHADOW" + lightIndex); if (!shadowsActivated) { defines.push("#define SHADOWS"); shadowsActivated = true; } if (shadowGenerator.useVarianceShadowMap) { defines.push("#define SHADOWVSM" + lightIndex); if (lightIndex > 0) { fallbacks.addFallback(0, "SHADOWVSM" + lightIndex); } } if (shadowGenerator.usePoissonSampling) { defines.push("#define SHADOWPCF" + lightIndex); if (lightIndex > 0) { fallbacks.addFallback(0, "SHADOWPCF" + lightIndex); } } } } lightIndex++; if (lightIndex === maxSimultaneousLights) break; } } if (StandardMaterial.FresnelEnabled) { // Fresnel if (this.diffuseFresnelParameters && this.diffuseFresnelParameters.isEnabled || this.opacityFresnelParameters && this.opacityFresnelParameters.isEnabled || this.emissiveFresnelParameters && this.emissiveFresnelParameters.isEnabled || this.reflectionFresnelParameters && this.reflectionFresnelParameters.isEnabled) { var fresnelRank = 1; if (this.diffuseFresnelParameters && this.diffuseFresnelParameters.isEnabled) { defines.push("#define DIFFUSEFRESNEL"); fallbacks.addFallback(fresnelRank, "DIFFUSEFRESNEL"); fresnelRank++; } if (this.opacityFresnelParameters && this.opacityFresnelParameters.isEnabled) { defines.push("#define OPACITYFRESNEL"); fallbacks.addFallback(fresnelRank, "OPACITYFRESNEL"); fresnelRank++; } if (this.reflectionFresnelParameters && this.reflectionFresnelParameters.isEnabled) { defines.push("#define REFLECTIONFRESNEL"); fallbacks.addFallback(fresnelRank, "REFLECTIONFRESNEL"); fresnelRank++; } if (this.emissiveFresnelParameters && this.emissiveFresnelParameters.isEnabled) { defines.push("#define EMISSIVEFRESNEL"); fallbacks.addFallback(fresnelRank, "EMISSIVEFRESNEL"); fresnelRank++; } defines.push("#define FRESNEL"); fallbacks.addFallback(fresnelRank - 1, "FRESNEL"); } } // Attribs var attribs = [BABYLON.VertexBuffer.PositionKind, BABYLON.VertexBuffer.NormalKind]; if (mesh) { if (mesh.isVerticesDataPresent(BABYLON.VertexBuffer.UVKind)) { attribs.push(BABYLON.VertexBuffer.UVKind); defines.push("#define UV1"); } if (mesh.isVerticesDataPresent(BABYLON.VertexBuffer.UV2Kind)) { attribs.push(BABYLON.VertexBuffer.UV2Kind); defines.push("#define UV2"); } if (mesh.useVertexColors && mesh.isVerticesDataPresent(BABYLON.VertexBuffer.ColorKind)) { attribs.push(BABYLON.VertexBuffer.ColorKind); defines.push("#define VERTEXCOLOR"); if (mesh.hasVertexAlpha) { defines.push("#define VERTEXALPHA"); } } if (mesh.skeleton && scene.skeletonsEnabled && mesh.isVerticesDataPresent(BABYLON.VertexBuffer.MatricesIndicesKind) && mesh.isVerticesDataPresent(BABYLON.VertexBuffer.MatricesWeightsKind)) { attribs.push(BABYLON.VertexBuffer.MatricesIndicesKind); attribs.push(BABYLON.VertexBuffer.MatricesWeightsKind); defines.push("#define BONES"); defines.push("#define BonesPerMesh " + (mesh.skeleton.bones.length + 1)); defines.push("#define BONES4"); fallbacks.addFallback(0, "BONES4"); } // Instances if (useInstances) { defines.push("#define INSTANCES"); attribs.push("world0"); attribs.push("world1"); attribs.push("world2"); attribs.push("world3"); } } // Get correct effect var join = defines.join("\n"); if (this._cachedDefines !== join) { this._cachedDefines = join; scene.resetCachedMaterial(); // Legacy browser patch var shaderName = "default"; if (!scene.getEngine().getCaps().standardDerivatives) { shaderName = "legacydefault"; } this._effect = scene.getEngine().createEffect(shaderName, attribs, [ "world", "view", "viewProjection", "vEyePosition", "vLightsType", "vAmbientColor", "vDiffuseColor", "vSpecularColor", "vEmissiveColor", "vLightData0", "vLightDiffuse0", "vLightSpecular0", "vLightDirection0", "vLightGround0", "lightMatrix0", "vLightData1", "vLightDiffuse1", "vLightSpecular1", "vLightDirection1", "vLightGround1", "lightMatrix1", "vLightData2", "vLightDiffuse2", "vLightSpecular2", "vLightDirection2", "vLightGround2", "lightMatrix2", "vLightData3", "vLightDiffuse3", "vLightSpecular3", "vLightDirection3", "vLightGround3", "lightMatrix3", "vFogInfos", "vFogColor", "pointSize", "vDiffuseInfos", "vAmbientInfos", "vOpacityInfos", "vReflectionInfos", "vEmissiveInfos", "vSpecularInfos", "vBumpInfos", "mBones", "vClipPlane", "diffuseMatrix", "ambientMatrix", "opacityMatrix", "reflectionMatrix", "emissiveMatrix", "specularMatrix", "bumpMatrix", "darkness0", "darkness1", "darkness2", "darkness3", "diffuseLeftColor", "diffuseRightColor", "opacityParts", "reflectionLeftColor", "reflectionRightColor", "emissiveLeftColor", "emissiveRightColor" ], [ "diffuseSampler", "ambientSampler", "opacitySampler", "reflectionCubeSampler", "reflection2DSampler", "emissiveSampler", "specularSampler", "bumpSampler", "shadowSampler0", "shadowSampler1", "shadowSampler2", "shadowSampler3" ], join, fallbacks, this.onCompiled, this.onError); } if (!this._effect.isReady()) { return false; } this._renderId = scene.getRenderId(); this._wasPreviouslyReady = true; return true; }; StandardMaterial.prototype.unbind = function () { if (this.reflectionTexture && this.reflectionTexture.isRenderTarget) { this._effect.setTexture("reflection2DSampler", null); } }; StandardMaterial.prototype.bindOnlyWorldMatrix = function (world) { this._effect.setMatrix("world", world); }; StandardMaterial.prototype.bind = function (world, mesh) { var scene = this.getScene(); // Matrices this.bindOnlyWorldMatrix(world); this._effect.setMatrix("viewProjection", scene.getTransformMatrix()); // Bones if (mesh.skeleton && scene.skeletonsEnabled && mesh.isVerticesDataPresent(BABYLON.VertexBuffer.MatricesIndicesKind) && mesh.isVerticesDataPresent(BABYLON.VertexBuffer.MatricesWeightsKind)) { this._effect.setMatrices("mBones", mesh.skeleton.getTransformMatrices()); } if (scene.getCachedMaterial() !== this) { if (StandardMaterial.FresnelEnabled) { // Fresnel if (this.diffuseFresnelParameters && this.diffuseFresnelParameters.isEnabled) { this._effect.setColor4("diffuseLeftColor", this.diffuseFresnelParameters.leftColor, this.diffuseFresnelParameters.power); this._effect.setColor4("diffuseRightColor", this.diffuseFresnelParameters.rightColor, this.diffuseFresnelParameters.bias); } if (this.opacityFresnelParameters && this.opacityFresnelParameters.isEnabled) { this._effect.setColor4("opacityParts", new BABYLON.Color3(this.opacityFresnelParameters.leftColor.toLuminance(), this.opacityFresnelParameters.rightColor.toLuminance(), this.opacityFresnelParameters.bias), this.opacityFresnelParameters.power); } if (this.reflectionFresnelParameters && this.reflectionFresnelParameters.isEnabled) { this._effect.setColor4("reflectionLeftColor", this.reflectionFresnelParameters.leftColor, this.reflectionFresnelParameters.power); this._effect.setColor4("reflectionRightColor", this.reflectionFresnelParameters.rightColor, this.reflectionFresnelParameters.bias); } if (this.emissiveFresnelParameters && this.emissiveFresnelParameters.isEnabled) { this._effect.setColor4("emissiveLeftColor", this.emissiveFresnelParameters.leftColor, this.emissiveFresnelParameters.power); this._effect.setColor4("emissiveRightColor", this.emissiveFresnelParameters.rightColor, this.emissiveFresnelParameters.bias); } } // Textures if (this.diffuseTexture && StandardMaterial.DiffuseTextureEnabled) { this._effect.setTexture("diffuseSampler", this.diffuseTexture); this._effect.setFloat2("vDiffuseInfos", this.diffuseTexture.coordinatesIndex, this.diffuseTexture.level); this._effect.setMatrix("diffuseMatrix", this.diffuseTexture.getTextureMatrix()); } if (this.ambientTexture && StandardMaterial.AmbientTextureEnabled) { this._effect.setTexture("ambientSampler", this.ambientTexture); this._effect.setFloat2("vAmbientInfos", this.ambientTexture.coordinatesIndex, this.ambientTexture.level); this._effect.setMatrix("ambientMatrix", this.ambientTexture.getTextureMatrix()); } if (this.opacityTexture && StandardMaterial.OpacityTextureEnabled) { this._effect.setTexture("opacitySampler", this.opacityTexture); this._effect.setFloat2("vOpacityInfos", this.opacityTexture.coordinatesIndex, this.opacityTexture.level); this._effect.setMatrix("opacityMatrix", this.opacityTexture.getTextureMatrix()); } if (this.reflectionTexture && StandardMaterial.ReflectionTextureEnabled) { if (this.reflectionTexture.isCube) { this._effect.setTexture("reflectionCubeSampler", this.reflectionTexture); } else { this._effect.setTexture("reflection2DSampler", this.reflectionTexture); } this._effect.setMatrix("reflectionMatrix", this.reflectionTexture.getReflectionTextureMatrix()); this._effect.setFloat3("vReflectionInfos", this.reflectionTexture.coordinatesMode, this.reflectionTexture.level, this.reflectionTexture.isCube ? 1 : 0); } if (this.emissiveTexture && StandardMaterial.EmissiveTextureEnabled) { this._effect.setTexture("emissiveSampler", this.emissiveTexture); this._effect.setFloat2("vEmissiveInfos", this.emissiveTexture.coordinatesIndex, this.emissiveTexture.level); this._effect.setMatrix("emissiveMatrix", this.emissiveTexture.getTextureMatrix()); } if (this.specularTexture && StandardMaterial.SpecularTextureEnabled) { this._effect.setTexture("specularSampler", this.specularTexture); this._effect.setFloat2("vSpecularInfos", this.specularTexture.coordinatesIndex, this.specularTexture.level); this._effect.setMatrix("specularMatrix", this.specularTexture.getTextureMatrix()); } if (this.bumpTexture && scene.getEngine().getCaps().standardDerivatives && StandardMaterial.BumpTextureEnabled) { this._effect.setTexture("bumpSampler", this.bumpTexture); this._effect.setFloat2("vBumpInfos", this.bumpTexture.coordinatesIndex, 1.0 / this.bumpTexture.level); this._effect.setMatrix("bumpMatrix", this.bumpTexture.getTextureMatrix()); } // Clip plane if (scene.clipPlane) { var clipPlane = scene.clipPlane; this._effect.setFloat4("vClipPlane", clipPlane.normal.x, clipPlane.normal.y, clipPlane.normal.z, clipPlane.d); } // Point size if (this.pointsCloud) { this._effect.setFloat("pointSize", this.pointSize); } // Colors scene.ambientColor.multiplyToRef(this.ambientColor, this._globalAmbientColor); // Scaling down color according to emissive this._scaledSpecular.r = this.specularColor.r * BABYLON.Tools.Clamp(1.0 - this.emissiveColor.r); this._scaledSpecular.g = this.specularColor.g * BABYLON.Tools.Clamp(1.0 - this.emissiveColor.g); this._scaledSpecular.b = this.specularColor.b * BABYLON.Tools.Clamp(1.0 - this.emissiveColor.b); this._effect.setVector3("vEyePosition", scene.activeCamera.position); this._effect.setColor3("vAmbientColor", this._globalAmbientColor); this._effect.setColor4("vSpecularColor", this._scaledSpecular, this.specularPower); this._effect.setColor3("vEmissiveColor", this.emissiveColor); } // Scaling down color according to emissive this._scaledDiffuse.r = this.diffuseColor.r * BABYLON.Tools.Clamp(1.0 - this.emissiveColor.r); this._scaledDiffuse.g = this.diffuseColor.g * BABYLON.Tools.Clamp(1.0 - this.emissiveColor.g); this._scaledDiffuse.b = this.diffuseColor.b * BABYLON.Tools.Clamp(1.0 - this.emissiveColor.b); this._effect.setColor4("vDiffuseColor", this._scaledDiffuse, this.alpha * mesh.visibility); if (scene.lightsEnabled) { var lightIndex = 0; for (var index = 0; index < scene.lights.length; index++) { var light = scene.lights[index]; if (!light.isEnabled()) { continue; } if (!light.canAffectMesh(mesh)) { continue; } if (light instanceof BABYLON.PointLight) { // Point Light light.transferToEffect(this._effect, "vLightData" + lightIndex); } else if (light instanceof BABYLON.DirectionalLight) { // Directional Light light.transferToEffect(this._effect, "vLightData" + lightIndex); } else if (light instanceof BABYLON.SpotLight) { // Spot Light light.transferToEffect(this._effect, "vLightData" + lightIndex, "vLightDirection" + lightIndex); } else if (light instanceof BABYLON.HemisphericLight) { // Hemispheric Light light.transferToEffect(this._effect, "vLightData" + lightIndex, "vLightGround" + lightIndex); } light.diffuse.scaleToRef(light.intensity, this._scaledDiffuse); light.specular.scaleToRef(light.intensity, this._scaledSpecular); this._effect.setColor4("vLightDiffuse" + lightIndex, this._scaledDiffuse, light.range); this._effect.setColor3("vLightSpecular" + lightIndex, this._scaledSpecular); // Shadows if (scene.shadowsEnabled) { var shadowGenerator = light.getShadowGenerator(); if (mesh.receiveShadows && shadowGenerator) { this._effect.setMatrix("lightMatrix" + lightIndex, shadowGenerator.getTransformMatrix()); this._effect.setTexture("shadowSampler" + lightIndex, shadowGenerator.getShadowMap()); this._effect.setFloat("darkness" + lightIndex, shadowGenerator.getDarkness()); } } lightIndex++; if (lightIndex === maxSimultaneousLights) break; } } // View if (scene.fogEnabled && mesh.applyFog && scene.fogMode !== BABYLON.Scene.FOGMODE_NONE || this.reflectionTexture) { this._effect.setMatrix("view", scene.getViewMatrix()); } // Fog if (scene.fogEnabled && mesh.applyFog && scene.fogMode !== BABYLON.Scene.FOGMODE_NONE) { this._effect.setFloat4("vFogInfos", scene.fogMode, scene.fogStart, scene.fogEnd, scene.fogDensity); this._effect.setColor3("vFogColor", scene.fogColor); } _super.prototype.bind.call(this, world, mesh); }; StandardMaterial.prototype.getAnimatables = function () { var results = []; if (this.diffuseTexture && this.diffuseTexture.animations && this.diffuseTexture.animations.length > 0) { results.push(this.diffuseTexture); } if (this.ambientTexture && this.ambientTexture.animations && this.ambientTexture.animations.length > 0) { results.push(this.ambientTexture); } if (this.opacityTexture && this.opacityTexture.animations && this.opacityTexture.animations.length > 0) { results.push(this.opacityTexture); } if (this.reflectionTexture && this.reflectionTexture.animations && this.reflectionTexture.animations.length > 0) { results.push(this.reflectionTexture); } if (this.emissiveTexture && this.emissiveTexture.animations && this.emissiveTexture.animations.length > 0) { results.push(this.emissiveTexture); } if (this.specularTexture && this.specularTexture.animations && this.specularTexture.animations.length > 0) { results.push(this.specularTexture); } if (this.bumpTexture && this.bumpTexture.animations && this.bumpTexture.animations.length > 0) { results.push(this.bumpTexture); } return results; }; StandardMaterial.prototype.dispose = function (forceDisposeEffect) { if (this.diffuseTexture) { this.diffuseTexture.dispose(); } if (this.ambientTexture) { this.ambientTexture.dispose(); } if (this.opacityTexture) { this.opacityTexture.dispose(); } if (this.reflectionTexture) { this.reflectionTexture.dispose(); } if (this.emissiveTexture) { this.emissiveTexture.dispose(); } if (this.specularTexture) { this.specularTexture.dispose(); } if (this.bumpTexture) { this.bumpTexture.dispose(); } _super.prototype.dispose.call(this, forceDisposeEffect); }; StandardMaterial.prototype.clone = function (name) { var newStandardMaterial = new StandardMaterial(name, this.getScene()); // Base material newStandardMaterial.checkReadyOnEveryCall = this.checkReadyOnEveryCall; newStandardMaterial.alpha = this.alpha; newStandardMaterial.fillMode = this.fillMode; newStandardMaterial.backFaceCulling = this.backFaceCulling; // Standard material if (this.diffuseTexture && this.diffuseTexture.clone) { newStandardMaterial.diffuseTexture = this.diffuseTexture.clone(); } if (this.ambientTexture && this.ambientTexture.clone) { newStandardMaterial.ambientTexture = this.ambientTexture.clone(); } if (this.opacityTexture && this.opacityTexture.clone) { newStandardMaterial.opacityTexture = this.opacityTexture.clone(); } if (this.reflectionTexture && this.reflectionTexture.clone) { newStandardMaterial.reflectionTexture = this.reflectionTexture.clone(); } if (this.emissiveTexture && this.emissiveTexture.clone) { newStandardMaterial.emissiveTexture = this.emissiveTexture.clone(); } if (this.specularTexture && this.specularTexture.clone) { newStandardMaterial.specularTexture = this.specularTexture.clone(); } if (this.bumpTexture && this.bumpTexture.clone) { newStandardMaterial.bumpTexture = this.bumpTexture.clone(); } newStandardMaterial.ambientColor = this.ambientColor.clone(); newStandardMaterial.diffuseColor = this.diffuseColor.clone(); newStandardMaterial.specularColor = this.specularColor.clone(); newStandardMaterial.specularPower = this.specularPower; newStandardMaterial.emissiveColor = this.emissiveColor.clone(); return newStandardMaterial; }; StandardMaterial.DiffuseTextureEnabled = true; StandardMaterial.AmbientTextureEnabled = true; StandardMaterial.OpacityTextureEnabled = true; StandardMaterial.ReflectionTextureEnabled = true; StandardMaterial.EmissiveTextureEnabled = true; StandardMaterial.SpecularTextureEnabled = true; StandardMaterial.BumpTextureEnabled = true; StandardMaterial.FresnelEnabled = true; return StandardMaterial; })(BABYLON.Material); BABYLON.StandardMaterial = StandardMaterial; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.standardMaterial.js.map var BABYLON; (function (BABYLON) { var MultiMaterial = (function (_super) { __extends(MultiMaterial, _super); function MultiMaterial(name, scene) { _super.call(this, name, scene, true); this.subMaterials = new Array(); scene.multiMaterials.push(this); } // Properties MultiMaterial.prototype.getSubMaterial = function (index) { if (index < 0 || index >= this.subMaterials.length) { return this.getScene().defaultMaterial; } return this.subMaterials[index]; }; // Methods MultiMaterial.prototype.isReady = function (mesh) { for (var index = 0; index < this.subMaterials.length; index++) { var subMaterial = this.subMaterials[index]; if (subMaterial) { if (!this.subMaterials[index].isReady(mesh)) { return false; } } } return true; }; return MultiMaterial; })(BABYLON.Material); BABYLON.MultiMaterial = MultiMaterial; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.multiMaterial.js.map var BABYLON; (function (BABYLON) { var Database = (function () { function Database(urlToScene, callbackManifestChecked) { // Handling various flavors of prefixed version of IndexedDB this.idbFactory = (window.indexedDB || window.mozIndexedDB || window.webkitIndexedDB || window.msIndexedDB); this.callbackManifestChecked = callbackManifestChecked; this.currentSceneUrl = BABYLON.Database.ReturnFullUrlLocation(urlToScene); this.db = null; this.enableSceneOffline = false; this.enableTexturesOffline = false; this.manifestVersionFound = 0; this.mustUpdateRessources = false; this.hasReachedQuota = false; this.checkManifestFile(); } Database.prototype.checkManifestFile = function () { var _this = this; function noManifestFile() { BABYLON.Tools.Log("Valid manifest file not found. Scene & textures will be loaded directly from the web server."); that.enableSceneOffline = false; that.enableTexturesOffline = false; that.callbackManifestChecked(false); } var that = this; var manifestURL = this.currentSceneUrl + ".manifest"; var xhr = new XMLHttpRequest(); var manifestURLTimeStamped = manifestURL + (manifestURL.match(/\?/) == null ? "?" : "&") + (new Date()).getTime(); xhr.open("GET", manifestURLTimeStamped, true); xhr.addEventListener("load", function () { if (xhr.status === 200 || BABYLON.Tools.ValidateXHRData(xhr, 1)) { try { var manifestFile = JSON.parse(xhr.response); _this.enableSceneOffline = manifestFile.enableSceneOffline; _this.enableTexturesOffline = manifestFile.enableTexturesOffline; if (manifestFile.version && !isNaN(parseInt(manifestFile.version))) { _this.manifestVersionFound = manifestFile.version; } if (_this.callbackManifestChecked) { _this.callbackManifestChecked(true); } } catch (ex) { noManifestFile(); } } else { noManifestFile(); } }, false); xhr.addEventListener("error", function (event) { noManifestFile(); }, false); try { xhr.send(); } catch (ex) { BABYLON.Tools.Error("Error on XHR send request."); that.callbackManifestChecked(false); } }; Database.prototype.openAsync = function (successCallback, errorCallback) { var _this = this; function handleError() { that.isSupported = false; if (errorCallback) errorCallback(); } var that = this; if (!this.idbFactory || !(this.enableSceneOffline || this.enableTexturesOffline)) { // Your browser doesn't support IndexedDB this.isSupported = false; if (errorCallback) errorCallback(); } else { // If the DB hasn't been opened or created yet if (!this.db) { this.hasReachedQuota = false; this.isSupported = true; var request = this.idbFactory.open("babylonjs", 1); // Could occur if user is blocking the quota for the DB and/or doesn't grant access to IndexedDB request.onerror = function (event) { handleError(); }; // executes when a version change transaction cannot complete due to other active transactions request.onblocked = function (event) { BABYLON.Tools.Error("IDB request blocked. Please reload the page."); handleError(); }; // DB has been opened successfully request.onsuccess = function (event) { _this.db = request.result; successCallback(); }; // Initialization of the DB. Creating Scenes & Textures stores request.onupgradeneeded = function (event) { _this.db = (event.target).result; try { var scenesStore = _this.db.createObjectStore("scenes", { keyPath: "sceneUrl" }); var versionsStore = _this.db.createObjectStore("versions", { keyPath: "sceneUrl" }); var texturesStore = _this.db.createObjectStore("textures", { keyPath: "textureUrl" }); } catch (ex) { BABYLON.Tools.Error("Error while creating object stores. Exception: " + ex.message); handleError(); } }; } else { if (successCallback) successCallback(); } } }; Database.prototype.loadImageFromDB = function (url, image) { var _this = this; var completeURL = BABYLON.Database.ReturnFullUrlLocation(url); var saveAndLoadImage = function () { if (!_this.hasReachedQuota && _this.db !== null) { // the texture is not yet in the DB, let's try to save it _this._saveImageIntoDBAsync(completeURL, image); } else { image.src = url; } }; if (!this.mustUpdateRessources) { this._loadImageFromDBAsync(completeURL, image, saveAndLoadImage); } else { saveAndLoadImage(); } }; Database.prototype._loadImageFromDBAsync = function (url, image, notInDBCallback) { if (this.isSupported && this.db !== null) { var texture; var transaction = this.db.transaction(["textures"]); transaction.onabort = function (event) { image.src = url; }; transaction.oncomplete = function (event) { var blobTextureURL; if (texture) { var URL = window.URL || window.webkitURL; blobTextureURL = URL.createObjectURL(texture.data, { oneTimeOnly: true }); image.onerror = function () { BABYLON.Tools.Error("Error loading image from blob URL: " + blobTextureURL + " switching back to web url: " + url); image.src = url; }; image.src = blobTextureURL; } else { notInDBCallback(); } }; var getRequest = transaction.objectStore("textures").get(url); getRequest.onsuccess = function (event) { texture = (event.target).result; }; getRequest.onerror = function (event) { BABYLON.Tools.Error("Error loading texture " + url + " from DB."); image.src = url; }; } else { BABYLON.Tools.Error("Error: IndexedDB not supported by your browser or BabylonJS Database is not open."); image.src = url; } }; Database.prototype._saveImageIntoDBAsync = function (url, image) { var _this = this; if (this.isSupported) { // In case of error (type not supported or quota exceeded), we're at least sending back XHR data to allow texture loading later on var generateBlobUrl = function () { var blobTextureURL; if (blob) { var URL = window.URL || window.webkitURL; try { blobTextureURL = URL.createObjectURL(blob, { oneTimeOnly: true }); } catch (ex) { blobTextureURL = URL.createObjectURL(blob); } } image.src = blobTextureURL; }; if (BABYLON.Database.isUASupportingBlobStorage) { var xhr = new XMLHttpRequest(), blob; xhr.open("GET", url, true); xhr.responseType = "blob"; xhr.addEventListener("load", function () { if (xhr.status === 200) { // Blob as response (XHR2) blob = xhr.response; var transaction = _this.db.transaction(["textures"], "readwrite"); // the transaction could abort because of a QuotaExceededError error transaction.onabort = function (event) { try { if (event.srcElement.error.name === "QuotaExceededError") { this.hasReachedQuota = true; } } catch (ex) { } generateBlobUrl(); }; transaction.oncomplete = function (event) { generateBlobUrl(); }; var newTexture = { textureUrl: url, data: blob }; try { // Put the blob into the dabase var addRequest = transaction.objectStore("textures").put(newTexture); addRequest.onsuccess = function (event) { }; addRequest.onerror = function (event) { generateBlobUrl(); }; } catch (ex) { // "DataCloneError" generated by Chrome when you try to inject blob into IndexedDB if (ex.code === 25) { BABYLON.Database.isUASupportingBlobStorage = false; } image.src = url; } } else { image.src = url; } }, false); xhr.addEventListener("error", function (event) { BABYLON.Tools.Error("Error in XHR request in BABYLON.Database."); image.src = url; }, false); xhr.send(); } else { image.src = url; } } else { BABYLON.Tools.Error("Error: IndexedDB not supported by your browser or BabylonJS Database is not open."); image.src = url; } }; Database.prototype._checkVersionFromDB = function (url, versionLoaded) { var _this = this; var updateVersion = function (event) { // the version is not yet in the DB or we need to update it _this._saveVersionIntoDBAsync(url, versionLoaded); }; this._loadVersionFromDBAsync(url, versionLoaded, updateVersion); }; Database.prototype._loadVersionFromDBAsync = function (url, callback, updateInDBCallback) { var _this = this; if (this.isSupported) { var version; try { var transaction = this.db.transaction(["versions"]); transaction.oncomplete = function (event) { if (version) { // If the version in the JSON file is > than the version in DB if (_this.manifestVersionFound > version.data) { _this.mustUpdateRessources = true; updateInDBCallback(); } else { callback(version.data); } } else { _this.mustUpdateRessources = true; updateInDBCallback(); } }; transaction.onabort = function (event) { callback(-1); }; var getRequest = transaction.objectStore("versions").get(url); getRequest.onsuccess = function (event) { version = (event.target).result; }; getRequest.onerror = function (event) { BABYLON.Tools.Error("Error loading version for scene " + url + " from DB."); callback(-1); }; } catch (ex) { BABYLON.Tools.Error("Error while accessing 'versions' object store (READ OP). Exception: " + ex.message); callback(-1); } } else { BABYLON.Tools.Error("Error: IndexedDB not supported by your browser or BabylonJS Database is not open."); callback(-1); } }; Database.prototype._saveVersionIntoDBAsync = function (url, callback) { var _this = this; if (this.isSupported && !this.hasReachedQuota) { try { // Open a transaction to the database var transaction = this.db.transaction(["versions"], "readwrite"); // the transaction could abort because of a QuotaExceededError error transaction.onabort = function (event) { try { if (event.srcElement.error.name === "QuotaExceededError") { _this.hasReachedQuota = true; } } catch (ex) { } callback(-1); }; transaction.oncomplete = function (event) { callback(_this.manifestVersionFound); }; var newVersion = { sceneUrl: url, data: this.manifestVersionFound }; // Put the scene into the database var addRequest = transaction.objectStore("versions").put(newVersion); addRequest.onsuccess = function (event) { }; addRequest.onerror = function (event) { BABYLON.Tools.Error("Error in DB add version request in BABYLON.Database."); }; } catch (ex) { BABYLON.Tools.Error("Error while accessing 'versions' object store (WRITE OP). Exception: " + ex.message); callback(-1); } } else { callback(-1); } }; Database.prototype.loadFileFromDB = function (url, sceneLoaded, progressCallBack, errorCallback, useArrayBuffer) { var _this = this; var completeUrl = BABYLON.Database.ReturnFullUrlLocation(url); var saveAndLoadFile = function (event) { // the scene is not yet in the DB, let's try to save it _this._saveFileIntoDBAsync(completeUrl, sceneLoaded, progressCallBack); }; this._checkVersionFromDB(completeUrl, function (version) { if (version !== -1) { if (!_this.mustUpdateRessources) { _this._loadFileFromDBAsync(completeUrl, sceneLoaded, saveAndLoadFile, useArrayBuffer); } else { _this._saveFileIntoDBAsync(completeUrl, sceneLoaded, progressCallBack, useArrayBuffer); } } else { errorCallback(); } }); }; Database.prototype._loadFileFromDBAsync = function (url, callback, notInDBCallback, useArrayBuffer) { if (this.isSupported) { var targetStore; if (url.indexOf(".babylon") !== -1) { targetStore = "scenes"; } else { targetStore = "textures"; } var file; var transaction = this.db.transaction([targetStore]); transaction.oncomplete = function (event) { if (file) { callback(file.data); } else { notInDBCallback(); } }; transaction.onabort = function (event) { notInDBCallback(); }; var getRequest = transaction.objectStore(targetStore).get(url); getRequest.onsuccess = function (event) { file = (event.target).result; }; getRequest.onerror = function (event) { BABYLON.Tools.Error("Error loading file " + url + " from DB."); notInDBCallback(); }; } else { BABYLON.Tools.Error("Error: IndexedDB not supported by your browser or BabylonJS Database is not open."); callback(); } }; Database.prototype._saveFileIntoDBAsync = function (url, callback, progressCallback, useArrayBuffer) { var _this = this; if (this.isSupported) { var targetStore; if (url.indexOf(".babylon") !== -1) { targetStore = "scenes"; } else { targetStore = "textures"; } // Create XHR var xhr = new XMLHttpRequest(), fileData; xhr.open("GET", url, true); if (useArrayBuffer) { xhr.responseType = "arraybuffer"; } xhr.onprogress = progressCallback; xhr.addEventListener("load", function () { if (xhr.status === 200 || BABYLON.Tools.ValidateXHRData(xhr, !useArrayBuffer ? 1 : 6)) { // Blob as response (XHR2) //fileData = xhr.responseText; fileData = !useArrayBuffer ? xhr.responseText : xhr.response; if (!_this.hasReachedQuota) { // Open a transaction to the database var transaction = _this.db.transaction([targetStore], "readwrite"); // the transaction could abort because of a QuotaExceededError error transaction.onabort = function (event) { try { if (event.srcElement.error.name === "QuotaExceededError") { this.hasReachedQuota = true; } } catch (ex) { } callback(fileData); }; transaction.oncomplete = function (event) { callback(fileData); }; var newFile; if (targetStore === "scenes") { newFile = { sceneUrl: url, data: fileData, version: _this.manifestVersionFound }; } else { newFile = { textureUrl: url, data: fileData }; } try { // Put the scene into the database var addRequest = transaction.objectStore(targetStore).put(newFile); addRequest.onsuccess = function (event) { }; addRequest.onerror = function (event) { BABYLON.Tools.Error("Error in DB add file request in BABYLON.Database."); }; } catch (ex) { callback(fileData); } } else { callback(fileData); } } else { callback(); } }, false); xhr.addEventListener("error", function (event) { BABYLON.Tools.Error("error on XHR request."); callback(); }, false); xhr.send(); } else { BABYLON.Tools.Error("Error: IndexedDB not supported by your browser or BabylonJS Database is not open."); callback(); } }; Database.isUASupportingBlobStorage = true; Database.parseURL = function (url) { var a = document.createElement('a'); a.href = url; var urlWithoutHash = url.substring(0, url.lastIndexOf("#")); var fileName = url.substring(urlWithoutHash.lastIndexOf("/") + 1, url.length); var absLocation = url.substring(0, url.indexOf(fileName, 0)); return absLocation; }; Database.ReturnFullUrlLocation = function (url) { if (url.indexOf("http:/") === -1) { return (BABYLON.Database.parseURL(window.location.href) + url); } else { return url; } }; return Database; })(); BABYLON.Database = Database; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.database.js.map var BABYLON; (function (BABYLON) { var SpriteManager = (function () { function SpriteManager(name, imgUrl, capacity, cellSize, scene, epsilon) { this.name = name; this.cellSize = cellSize; this.sprites = new Array(); this.renderingGroupId = 0; this.fogEnabled = true; this._vertexDeclaration = [3, 4, 4, 4]; this._vertexStrideSize = 15 * 4; this._capacity = capacity; this._spriteTexture = new BABYLON.Texture(imgUrl, scene, true, false); this._spriteTexture.wrapU = BABYLON.Texture.CLAMP_ADDRESSMODE; this._spriteTexture.wrapV = BABYLON.Texture.CLAMP_ADDRESSMODE; this._epsilon = epsilon === undefined ? 0.01 : epsilon; this._scene = scene; this._scene.spriteManagers.push(this); // VBO this._vertexDeclaration = [3, 4, 4, 4]; this._vertexStrideSize = 15 * 4; this._vertexBuffer = scene.getEngine().createDynamicVertexBuffer(capacity * this._vertexStrideSize * 4); var indices = []; var index = 0; for (var count = 0; count < capacity; count++) { indices.push(index); indices.push(index + 1); indices.push(index + 2); indices.push(index); indices.push(index + 2); indices.push(index + 3); index += 4; } this._indexBuffer = scene.getEngine().createIndexBuffer(indices); this._vertices = new Float32Array(capacity * this._vertexStrideSize); // Effects this._effectBase = this._scene.getEngine().createEffect("sprites", ["position", "options", "cellInfo", "color"], ["view", "projection", "textureInfos", "alphaTest"], ["diffuseSampler"], ""); this._effectFog = this._scene.getEngine().createEffect("sprites", ["position", "options", "cellInfo", "color"], ["view", "projection", "textureInfos", "alphaTest", "vFogInfos", "vFogColor"], ["diffuseSampler"], "#define FOG"); } SpriteManager.prototype._appendSpriteVertex = function (index, sprite, offsetX, offsetY, rowSize) { var arrayOffset = index * 15; if (offsetX == 0) offsetX = this._epsilon; else if (offsetX == 1) offsetX = 1 - this._epsilon; if (offsetY == 0) offsetY = this._epsilon; else if (offsetY == 1) offsetY = 1 - this._epsilon; this._vertices[arrayOffset] = sprite.position.x; this._vertices[arrayOffset + 1] = sprite.position.y; this._vertices[arrayOffset + 2] = sprite.position.z; this._vertices[arrayOffset + 3] = sprite.angle; this._vertices[arrayOffset + 4] = sprite.size; this._vertices[arrayOffset + 5] = offsetX; this._vertices[arrayOffset + 6] = offsetY; this._vertices[arrayOffset + 7] = sprite.invertU ? 1 : 0; this._vertices[arrayOffset + 8] = sprite.invertV ? 1 : 0; var offset = (sprite.cellIndex / rowSize) >> 0; this._vertices[arrayOffset + 9] = sprite.cellIndex - offset * rowSize; this._vertices[arrayOffset + 10] = offset; // Color this._vertices[arrayOffset + 11] = sprite.color.r; this._vertices[arrayOffset + 12] = sprite.color.g; this._vertices[arrayOffset + 13] = sprite.color.b; this._vertices[arrayOffset + 14] = sprite.color.a; }; SpriteManager.prototype.render = function () { // Check if (!this._effectBase.isReady() || !this._effectFog.isReady() || !this._spriteTexture || !this._spriteTexture.isReady()) return; var engine = this._scene.getEngine(); var baseSize = this._spriteTexture.getBaseSize(); // Sprites var deltaTime = engine.getDeltaTime(); var max = Math.min(this._capacity, this.sprites.length); var rowSize = baseSize.width / this.cellSize; var offset = 0; for (var index = 0; index < max; index++) { var sprite = this.sprites[index]; if (!sprite) { continue; } sprite._animate(deltaTime); this._appendSpriteVertex(offset++, sprite, 0, 0, rowSize); this._appendSpriteVertex(offset++, sprite, 1, 0, rowSize); this._appendSpriteVertex(offset++, sprite, 1, 1, rowSize); this._appendSpriteVertex(offset++, sprite, 0, 1, rowSize); } engine.updateDynamicVertexBuffer(this._vertexBuffer, this._vertices); // Render var effect = this._effectBase; if (this._scene.fogEnabled && this._scene.fogMode !== BABYLON.Scene.FOGMODE_NONE && this.fogEnabled) { effect = this._effectFog; } engine.enableEffect(effect); var viewMatrix = this._scene.getViewMatrix(); effect.setTexture("diffuseSampler", this._spriteTexture); effect.setMatrix("view", viewMatrix); effect.setMatrix("projection", this._scene.getProjectionMatrix()); effect.setFloat2("textureInfos", this.cellSize / baseSize.width, this.cellSize / baseSize.height); // Fog if (this._scene.fogEnabled && this._scene.fogMode !== BABYLON.Scene.FOGMODE_NONE && this.fogEnabled) { effect.setFloat4("vFogInfos", this._scene.fogMode, this._scene.fogStart, this._scene.fogEnd, this._scene.fogDensity); effect.setColor3("vFogColor", this._scene.fogColor); } // VBOs engine.bindBuffers(this._vertexBuffer, this._indexBuffer, this._vertexDeclaration, this._vertexStrideSize, effect); // Draw order effect.setBool("alphaTest", true); engine.setColorWrite(false); engine.draw(true, 0, max * 6); engine.setColorWrite(true); effect.setBool("alphaTest", false); engine.setAlphaMode(BABYLON.Engine.ALPHA_COMBINE); engine.draw(true, 0, max * 6); engine.setAlphaMode(BABYLON.Engine.ALPHA_DISABLE); }; SpriteManager.prototype.dispose = function () { if (this._vertexBuffer) { this._scene.getEngine()._releaseBuffer(this._vertexBuffer); this._vertexBuffer = null; } if (this._indexBuffer) { this._scene.getEngine()._releaseBuffer(this._indexBuffer); this._indexBuffer = null; } if (this._spriteTexture) { this._spriteTexture.dispose(); this._spriteTexture = null; } // Remove from scene var index = this._scene.spriteManagers.indexOf(this); this._scene.spriteManagers.splice(index, 1); // Callback if (this.onDispose) { this.onDispose(); } }; return SpriteManager; })(); BABYLON.SpriteManager = SpriteManager; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.spriteManager.js.map var BABYLON; (function (BABYLON) { var Sprite = (function () { function Sprite(name, manager) { this.name = name; this.color = new BABYLON.Color4(1.0, 1.0, 1.0, 1.0); this.size = 1.0; this.angle = 0; this.cellIndex = 0; this.invertU = 0; this.invertV = 0; this.animations = new Array(); this._animationStarted = false; this._loopAnimation = false; this._fromIndex = 0; this._toIndex = 0; this._delay = 0; this._direction = 1; this._frameCount = 0; this._time = 0; this._manager = manager; this._manager.sprites.push(this); this.position = BABYLON.Vector3.Zero(); } Sprite.prototype.playAnimation = function (from, to, loop, delay) { this._fromIndex = from; this._toIndex = to; this._loopAnimation = loop; this._delay = delay; this._animationStarted = true; this._direction = from < to ? 1 : -1; this.cellIndex = from; this._time = 0; }; Sprite.prototype.stopAnimation = function () { this._animationStarted = false; }; Sprite.prototype._animate = function (deltaTime) { if (!this._animationStarted) return; this._time += deltaTime; if (this._time > this._delay) { this._time = this._time % this._delay; this.cellIndex += this._direction; if (this.cellIndex == this._toIndex) { if (this._loopAnimation) { this.cellIndex = this._fromIndex; } else { this._animationStarted = false; if (this.disposeWhenFinishedAnimating) { this.dispose(); } } } } }; Sprite.prototype.dispose = function () { for (var i = 0; i < this._manager.sprites.length; i++) { if (this._manager.sprites[i] == this) { this._manager.sprites.splice(i, 1); } } }; return Sprite; })(); BABYLON.Sprite = Sprite; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.sprite.js.map var BABYLON; (function (BABYLON) { var Layer = (function () { function Layer(name, imgUrl, scene, isBackground, color) { this.name = name; this._vertexDeclaration = [2]; this._vertexStrideSize = 2 * 4; this.texture = imgUrl ? new BABYLON.Texture(imgUrl, scene, true) : null; this.isBackground = isBackground === undefined ? true : isBackground; this.color = color === undefined ? new BABYLON.Color4(1, 1, 1, 1) : color; this._scene = scene; this._scene.layers.push(this); // VBO var vertices = []; vertices.push(1, 1); vertices.push(-1, 1); vertices.push(-1, -1); vertices.push(1, -1); this._vertexBuffer = scene.getEngine().createVertexBuffer(vertices); // Indices var indices = []; indices.push(0); indices.push(1); indices.push(2); indices.push(0); indices.push(2); indices.push(3); this._indexBuffer = scene.getEngine().createIndexBuffer(indices); // Effects this._effect = this._scene.getEngine().createEffect("layer", ["position"], ["textureMatrix", "color"], ["textureSampler"], ""); } Layer.prototype.render = function () { // Check if (!this._effect.isReady() || !this.texture || !this.texture.isReady()) return; var engine = this._scene.getEngine(); // Render engine.enableEffect(this._effect); engine.setState(false); // Texture this._effect.setTexture("textureSampler", this.texture); this._effect.setMatrix("textureMatrix", this.texture.getTextureMatrix()); // Color this._effect.setFloat4("color", this.color.r, this.color.g, this.color.b, this.color.a); // VBOs engine.bindBuffers(this._vertexBuffer, this._indexBuffer, this._vertexDeclaration, this._vertexStrideSize, this._effect); // Draw order engine.setAlphaMode(BABYLON.Engine.ALPHA_COMBINE); engine.draw(true, 0, 6); engine.setAlphaMode(BABYLON.Engine.ALPHA_DISABLE); }; Layer.prototype.dispose = function () { if (this._vertexBuffer) { this._scene.getEngine()._releaseBuffer(this._vertexBuffer); this._vertexBuffer = null; } if (this._indexBuffer) { this._scene.getEngine()._releaseBuffer(this._indexBuffer); this._indexBuffer = null; } if (this.texture) { this.texture.dispose(); this.texture = null; } // Remove from scene var index = this._scene.layers.indexOf(this); this._scene.layers.splice(index, 1); // Callback if (this.onDispose) { this.onDispose(); } }; return Layer; })(); BABYLON.Layer = Layer; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.layer.js.map var BABYLON; (function (BABYLON) { var Particle = (function () { function Particle() { this.position = BABYLON.Vector3.Zero(); this.direction = BABYLON.Vector3.Zero(); this.color = new BABYLON.Color4(0, 0, 0, 0); this.colorStep = new BABYLON.Color4(0, 0, 0, 0); this.lifeTime = 1.0; this.age = 0; this.size = 0; this.angle = 0; this.angularSpeed = 0; } Particle.prototype.copyTo = function (other) { other.position.copyFrom(this.position); other.direction.copyFrom(this.direction); other.color.copyFrom(this.color); other.colorStep.copyFrom(this.colorStep); other.lifeTime = this.lifeTime; other.age = this.age; other.size = this.size; other.angle = this.angle; other.angularSpeed = this.angularSpeed; }; return Particle; })(); BABYLON.Particle = Particle; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.particle.js.map var BABYLON; (function (BABYLON) { var randomNumber = function (min, max) { if (min === max) { return (min); } var random = Math.random(); return ((random * (max - min)) + min); }; var ParticleSystem = (function () { function ParticleSystem(name, capacity, scene, customEffect) { var _this = this; this.name = name; this.renderingGroupId = 0; this.emitter = null; this.emitRate = 10; this.manualEmitCount = -1; this.updateSpeed = 0.01; this.targetStopDuration = 0; this.disposeOnStop = false; this.minEmitPower = 1; this.maxEmitPower = 1; this.minLifeTime = 1; this.maxLifeTime = 1; this.minSize = 1; this.maxSize = 1; this.minAngularSpeed = 0; this.maxAngularSpeed = 0; this.blendMode = ParticleSystem.BLENDMODE_ONEONE; this.forceDepthWrite = false; this.gravity = BABYLON.Vector3.Zero(); this.direction1 = new BABYLON.Vector3(0, 1.0, 0); this.direction2 = new BABYLON.Vector3(0, 1.0, 0); this.minEmitBox = new BABYLON.Vector3(-0.5, -0.5, -0.5); this.maxEmitBox = new BABYLON.Vector3(0.5, 0.5, 0.5); this.color1 = new BABYLON.Color4(1.0, 1.0, 1.0, 1.0); this.color2 = new BABYLON.Color4(1.0, 1.0, 1.0, 1.0); this.colorDead = new BABYLON.Color4(0, 0, 0, 1.0); this.textureMask = new BABYLON.Color4(1.0, 1.0, 1.0, 1.0); this.particles = new Array(); this._vertexDeclaration = [3, 4, 4]; this._vertexStrideSize = 11 * 4; this._stockParticles = new Array(); this._newPartsExcess = 0; this._scaledColorStep = new BABYLON.Color4(0, 0, 0, 0); this._colorDiff = new BABYLON.Color4(0, 0, 0, 0); this._scaledDirection = BABYLON.Vector3.Zero(); this._scaledGravity = BABYLON.Vector3.Zero(); this._currentRenderId = -1; this._started = false; this._stopped = false; this._actualFrame = 0; this.id = name; this._capacity = capacity; this._scene = scene; this._customEffect = customEffect; scene.particleSystems.push(this); // VBO this._vertexBuffer = scene.getEngine().createDynamicVertexBuffer(capacity * this._vertexStrideSize * 4); var indices = []; var index = 0; for (var count = 0; count < capacity; count++) { indices.push(index); indices.push(index + 1); indices.push(index + 2); indices.push(index); indices.push(index + 2); indices.push(index + 3); index += 4; } this._indexBuffer = scene.getEngine().createIndexBuffer(indices); this._vertices = new Float32Array(capacity * this._vertexStrideSize); // Default behaviors this.startDirectionFunction = function (emitPower, worldMatrix, directionToUpdate) { var randX = randomNumber(_this.direction1.x, _this.direction2.x); var randY = randomNumber(_this.direction1.y, _this.direction2.y); var randZ = randomNumber(_this.direction1.z, _this.direction2.z); BABYLON.Vector3.TransformNormalFromFloatsToRef(randX * emitPower, randY * emitPower, randZ * emitPower, worldMatrix, directionToUpdate); }; this.startPositionFunction = function (worldMatrix, positionToUpdate) { var randX = randomNumber(_this.minEmitBox.x, _this.maxEmitBox.x); var randY = randomNumber(_this.minEmitBox.y, _this.maxEmitBox.y); var randZ = randomNumber(_this.minEmitBox.z, _this.maxEmitBox.z); BABYLON.Vector3.TransformCoordinatesFromFloatsToRef(randX, randY, randZ, worldMatrix, positionToUpdate); }; this.updateFunction = function (particles) { for (var index = 0; index < particles.length; index++) { var particle = particles[index]; particle.age += _this._scaledUpdateSpeed; if (particle.age >= particle.lifeTime) { _this.recycleParticle(particle); index--; continue; } else { particle.colorStep.scaleToRef(_this._scaledUpdateSpeed, _this._scaledColorStep); particle.color.addInPlace(_this._scaledColorStep); if (particle.color.a < 0) particle.color.a = 0; particle.angle += particle.angularSpeed * _this._scaledUpdateSpeed; particle.direction.scaleToRef(_this._scaledUpdateSpeed, _this._scaledDirection); particle.position.addInPlace(_this._scaledDirection); _this.gravity.scaleToRef(_this._scaledUpdateSpeed, _this._scaledGravity); particle.direction.addInPlace(_this._scaledGravity); } } }; } ParticleSystem.prototype.recycleParticle = function (particle) { var lastParticle = this.particles.pop(); if (lastParticle !== particle) { lastParticle.copyTo(particle); this._stockParticles.push(lastParticle); } }; ParticleSystem.prototype.getCapacity = function () { return this._capacity; }; ParticleSystem.prototype.isAlive = function () { return this._alive; }; ParticleSystem.prototype.isStarted = function () { return this._started; }; ParticleSystem.prototype.start = function () { this._started = true; this._stopped = false; this._actualFrame = 0; }; ParticleSystem.prototype.stop = function () { this._stopped = true; }; ParticleSystem.prototype._appendParticleVertex = function (index, particle, offsetX, offsetY) { var offset = index * 11; this._vertices[offset] = particle.position.x; this._vertices[offset + 1] = particle.position.y; this._vertices[offset + 2] = particle.position.z; this._vertices[offset + 3] = particle.color.r; this._vertices[offset + 4] = particle.color.g; this._vertices[offset + 5] = particle.color.b; this._vertices[offset + 6] = particle.color.a; this._vertices[offset + 7] = particle.angle; this._vertices[offset + 8] = particle.size; this._vertices[offset + 9] = offsetX; this._vertices[offset + 10] = offsetY; }; ParticleSystem.prototype._update = function (newParticles) { // Update current this._alive = this.particles.length > 0; this.updateFunction(this.particles); // Add new ones var worldMatrix; if (this.emitter.position) { worldMatrix = this.emitter.getWorldMatrix(); } else { worldMatrix = BABYLON.Matrix.Translation(this.emitter.x, this.emitter.y, this.emitter.z); } for (var index = 0; index < newParticles; index++) { if (this.particles.length === this._capacity) { break; } if (this._stockParticles.length !== 0) { var particle = this._stockParticles.pop(); particle.age = 0; } else { particle = new BABYLON.Particle(); } this.particles.push(particle); var emitPower = randomNumber(this.minEmitPower, this.maxEmitPower); this.startDirectionFunction(emitPower, worldMatrix, particle.direction); particle.lifeTime = randomNumber(this.minLifeTime, this.maxLifeTime); particle.size = randomNumber(this.minSize, this.maxSize); particle.angularSpeed = randomNumber(this.minAngularSpeed, this.maxAngularSpeed); this.startPositionFunction(worldMatrix, particle.position); var step = randomNumber(0, 1.0); BABYLON.Color4.LerpToRef(this.color1, this.color2, step, particle.color); this.colorDead.subtractToRef(particle.color, this._colorDiff); this._colorDiff.scaleToRef(1.0 / particle.lifeTime, particle.colorStep); } }; ParticleSystem.prototype._getEffect = function () { if (this._customEffect) { return this._customEffect; } ; var defines = []; if (this._scene.clipPlane) { defines.push("#define CLIPPLANE"); } // Effect var join = defines.join("\n"); if (this._cachedDefines !== join) { this._cachedDefines = join; this._effect = this._scene.getEngine().createEffect("particles", ["position", "color", "options"], ["invView", "view", "projection", "vClipPlane", "textureMask"], ["diffuseSampler"], join); } return this._effect; }; ParticleSystem.prototype.animate = function () { if (!this._started) return; var effect = this._getEffect(); // Check if (!this.emitter || !effect.isReady() || !this.particleTexture || !this.particleTexture.isReady()) return; if (this._currentRenderId === this._scene.getRenderId()) { return; } this._currentRenderId = this._scene.getRenderId(); this._scaledUpdateSpeed = this.updateSpeed * this._scene.getAnimationRatio(); // determine the number of particles we need to create var emitCout; if (this.manualEmitCount > -1) { emitCout = this.manualEmitCount; this.manualEmitCount = 0; } else { emitCout = this.emitRate; } var newParticles = ((emitCout * this._scaledUpdateSpeed) >> 0); this._newPartsExcess += emitCout * this._scaledUpdateSpeed - newParticles; if (this._newPartsExcess > 1.0) { newParticles += this._newPartsExcess >> 0; this._newPartsExcess -= this._newPartsExcess >> 0; } this._alive = false; if (!this._stopped) { this._actualFrame += this._scaledUpdateSpeed; if (this.targetStopDuration && this._actualFrame >= this.targetStopDuration) this.stop(); } else { newParticles = 0; } this._update(newParticles); // Stopped? if (this._stopped) { if (!this._alive) { this._started = false; if (this.disposeOnStop) { this._scene._toBeDisposed.push(this); } } } // Update VBO var offset = 0; for (var index = 0; index < this.particles.length; index++) { var particle = this.particles[index]; this._appendParticleVertex(offset++, particle, 0, 0); this._appendParticleVertex(offset++, particle, 1, 0); this._appendParticleVertex(offset++, particle, 1, 1); this._appendParticleVertex(offset++, particle, 0, 1); } var engine = this._scene.getEngine(); engine.updateDynamicVertexBuffer(this._vertexBuffer, this._vertices); }; ParticleSystem.prototype.render = function () { var effect = this._getEffect(); // Check if (!this.emitter || !effect.isReady() || !this.particleTexture || !this.particleTexture.isReady() || !this.particles.length) return 0; var engine = this._scene.getEngine(); // Render engine.enableEffect(effect); engine.setState(false); var viewMatrix = this._scene.getViewMatrix(); effect.setTexture("diffuseSampler", this.particleTexture); effect.setMatrix("view", viewMatrix); effect.setMatrix("projection", this._scene.getProjectionMatrix()); effect.setFloat4("textureMask", this.textureMask.r, this.textureMask.g, this.textureMask.b, this.textureMask.a); if (this._scene.clipPlane) { var clipPlane = this._scene.clipPlane; var invView = viewMatrix.clone(); invView.invert(); effect.setMatrix("invView", invView); effect.setFloat4("vClipPlane", clipPlane.normal.x, clipPlane.normal.y, clipPlane.normal.z, clipPlane.d); } // VBOs engine.bindBuffers(this._vertexBuffer, this._indexBuffer, this._vertexDeclaration, this._vertexStrideSize, effect); // Draw order if (this.blendMode === ParticleSystem.BLENDMODE_ONEONE) { engine.setAlphaMode(BABYLON.Engine.ALPHA_ADD); } else { engine.setAlphaMode(BABYLON.Engine.ALPHA_COMBINE); } if (this.forceDepthWrite) { engine.setDepthWrite(true); } engine.draw(true, 0, this.particles.length * 6); engine.setAlphaMode(BABYLON.Engine.ALPHA_DISABLE); return this.particles.length; }; ParticleSystem.prototype.dispose = function () { if (this._vertexBuffer) { this._scene.getEngine()._releaseBuffer(this._vertexBuffer); this._vertexBuffer = null; } if (this._indexBuffer) { this._scene.getEngine()._releaseBuffer(this._indexBuffer); this._indexBuffer = null; } if (this.particleTexture) { this.particleTexture.dispose(); this.particleTexture = null; } // Remove from scene var index = this._scene.particleSystems.indexOf(this); this._scene.particleSystems.splice(index, 1); // Callback if (this.onDispose) { this.onDispose(); } }; // Clone ParticleSystem.prototype.clone = function (name, newEmitter) { var result = new ParticleSystem(name, this._capacity, this._scene); BABYLON.Tools.DeepCopy(this, result, ["particles"], ["_vertexDeclaration", "_vertexStrideSize"]); if (newEmitter === undefined) { newEmitter = this.emitter; } result.emitter = newEmitter; if (this.particleTexture) { result.particleTexture = new BABYLON.Texture(this.particleTexture.url, this._scene); } result.start(); return result; }; ParticleSystem.BLENDMODE_ONEONE = 0; ParticleSystem.BLENDMODE_STANDARD = 1; return ParticleSystem; })(); BABYLON.ParticleSystem = ParticleSystem; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.particleSystem.js.map var BABYLON; (function (BABYLON) { var Animation = (function () { function Animation(name, targetProperty, framePerSecond, dataType, loopMode) { this.name = name; this.targetProperty = targetProperty; this.framePerSecond = framePerSecond; this.dataType = dataType; this.loopMode = loopMode; this._offsetsCache = {}; this._highLimitsCache = {}; this._stopped = false; this.targetPropertyPath = targetProperty.split("."); this.dataType = dataType; this.loopMode = loopMode === undefined ? Animation.ANIMATIONLOOPMODE_CYCLE : loopMode; } Animation.CreateAndStartAnimation = function (name, mesh, tartgetProperty, framePerSecond, totalFrame, from, to, loopMode) { var dataType = undefined; if (!isNaN(parseFloat(from)) && isFinite(from)) { dataType = Animation.ANIMATIONTYPE_FLOAT; } else if (from instanceof BABYLON.Quaternion) { dataType = Animation.ANIMATIONTYPE_QUATERNION; } else if (from instanceof BABYLON.Vector3) { dataType = Animation.ANIMATIONTYPE_VECTOR3; } else if (from instanceof BABYLON.Vector2) { dataType = Animation.ANIMATIONTYPE_VECTOR2; } else if (from instanceof BABYLON.Color3) { dataType = Animation.ANIMATIONTYPE_COLOR3; } if (dataType == undefined) { return; } var animation = new Animation(name, tartgetProperty, framePerSecond, dataType, loopMode); var keys = []; keys.push({ frame: 0, value: from }); keys.push({ frame: totalFrame, value: to }); animation.setKeys(keys); mesh.animations.push(animation); mesh.getScene().beginAnimation(mesh, 0, totalFrame, (animation.loopMode === 1)); }; // Methods Animation.prototype.isStopped = function () { return this._stopped; }; Animation.prototype.getKeys = function () { return this._keys; }; Animation.prototype.getEasingFunction = function () { return this._easingFunction; }; Animation.prototype.setEasingFunction = function (easingFunction) { this._easingFunction = easingFunction; }; Animation.prototype.floatInterpolateFunction = function (startValue, endValue, gradient) { return startValue + (endValue - startValue) * gradient; }; Animation.prototype.quaternionInterpolateFunction = function (startValue, endValue, gradient) { return BABYLON.Quaternion.Slerp(startValue, endValue, gradient); }; Animation.prototype.vector3InterpolateFunction = function (startValue, endValue, gradient) { return BABYLON.Vector3.Lerp(startValue, endValue, gradient); }; Animation.prototype.vector2InterpolateFunction = function (startValue, endValue, gradient) { return BABYLON.Vector2.Lerp(startValue, endValue, gradient); }; Animation.prototype.color3InterpolateFunction = function (startValue, endValue, gradient) { return BABYLON.Color3.Lerp(startValue, endValue, gradient); }; Animation.prototype.matrixInterpolateFunction = function (startValue, endValue, gradient) { var startScale = new BABYLON.Vector3(0, 0, 0); var startRotation = new BABYLON.Quaternion(); var startTranslation = new BABYLON.Vector3(0, 0, 0); startValue.decompose(startScale, startRotation, startTranslation); var endScale = new BABYLON.Vector3(0, 0, 0); var endRotation = new BABYLON.Quaternion(); var endTranslation = new BABYLON.Vector3(0, 0, 0); endValue.decompose(endScale, endRotation, endTranslation); var resultScale = this.vector3InterpolateFunction(startScale, endScale, gradient); var resultRotation = this.quaternionInterpolateFunction(startRotation, endRotation, gradient); var resultTranslation = this.vector3InterpolateFunction(startTranslation, endTranslation, gradient); var result = BABYLON.Matrix.Compose(resultScale, resultRotation, resultTranslation); return result; }; Animation.prototype.clone = function () { var clone = new Animation(this.name, this.targetPropertyPath.join("."), this.framePerSecond, this.dataType, this.loopMode); clone.setKeys(this._keys); return clone; }; Animation.prototype.setKeys = function (values) { this._keys = values.slice(0); this._offsetsCache = {}; this._highLimitsCache = {}; }; Animation.prototype._getKeyValue = function (value) { if (typeof value === "function") { return value(); } return value; }; Animation.prototype._interpolate = function (currentFrame, repeatCount, loopMode, offsetValue, highLimitValue) { if (loopMode === Animation.ANIMATIONLOOPMODE_CONSTANT && repeatCount > 0) { return highLimitValue.clone ? highLimitValue.clone() : highLimitValue; } this.currentFrame = currentFrame; for (var key = 0; key < this._keys.length; key++) { // for each frame, we need the key just before the frame superior if (this._keys[key + 1].frame >= currentFrame) { var startValue = this._getKeyValue(this._keys[key].value); var endValue = this._getKeyValue(this._keys[key + 1].value); // gradient : percent of currentFrame between the frame inf and the frame sup var gradient = (currentFrame - this._keys[key].frame) / (this._keys[key + 1].frame - this._keys[key].frame); // check for easingFunction and correction of gradient if (this._easingFunction != null) { gradient = this._easingFunction.ease(gradient); } switch (this.dataType) { case Animation.ANIMATIONTYPE_FLOAT: switch (loopMode) { case Animation.ANIMATIONLOOPMODE_CYCLE: case Animation.ANIMATIONLOOPMODE_CONSTANT: return this.floatInterpolateFunction(startValue, endValue, gradient); case Animation.ANIMATIONLOOPMODE_RELATIVE: return offsetValue * repeatCount + this.floatInterpolateFunction(startValue, endValue, gradient); } break; case Animation.ANIMATIONTYPE_QUATERNION: var quaternion = null; switch (loopMode) { case Animation.ANIMATIONLOOPMODE_CYCLE: case Animation.ANIMATIONLOOPMODE_CONSTANT: quaternion = this.quaternionInterpolateFunction(startValue, endValue, gradient); break; case Animation.ANIMATIONLOOPMODE_RELATIVE: quaternion = this.quaternionInterpolateFunction(startValue, endValue, gradient).add(offsetValue.scale(repeatCount)); break; } return quaternion; case Animation.ANIMATIONTYPE_VECTOR3: switch (loopMode) { case Animation.ANIMATIONLOOPMODE_CYCLE: case Animation.ANIMATIONLOOPMODE_CONSTANT: return this.vector3InterpolateFunction(startValue, endValue, gradient); case Animation.ANIMATIONLOOPMODE_RELATIVE: return this.vector3InterpolateFunction(startValue, endValue, gradient).add(offsetValue.scale(repeatCount)); } case Animation.ANIMATIONTYPE_VECTOR2: switch (loopMode) { case Animation.ANIMATIONLOOPMODE_CYCLE: case Animation.ANIMATIONLOOPMODE_CONSTANT: return this.vector2InterpolateFunction(startValue, endValue, gradient); case Animation.ANIMATIONLOOPMODE_RELATIVE: return this.vector2InterpolateFunction(startValue, endValue, gradient).add(offsetValue.scale(repeatCount)); } case Animation.ANIMATIONTYPE_COLOR3: switch (loopMode) { case Animation.ANIMATIONLOOPMODE_CYCLE: case Animation.ANIMATIONLOOPMODE_CONSTANT: return this.color3InterpolateFunction(startValue, endValue, gradient); case Animation.ANIMATIONLOOPMODE_RELATIVE: return this.color3InterpolateFunction(startValue, endValue, gradient).add(offsetValue.scale(repeatCount)); } case Animation.ANIMATIONTYPE_MATRIX: switch (loopMode) { case Animation.ANIMATIONLOOPMODE_CYCLE: case Animation.ANIMATIONLOOPMODE_CONSTANT: return this.matrixInterpolateFunction(startValue, endValue, gradient); case Animation.ANIMATIONLOOPMODE_RELATIVE: return startValue; } default: break; } break; } } return this._getKeyValue(this._keys[this._keys.length - 1].value); }; Animation.prototype.animate = function (delay, from, to, loop, speedRatio) { if (!this.targetPropertyPath || this.targetPropertyPath.length < 1) { this._stopped = true; return false; } var returnValue = true; // Adding a start key at frame 0 if missing if (this._keys[0].frame !== 0) { var newKey = { frame: 0, value: this._keys[0].value }; this._keys.splice(0, 0, newKey); } // Check limits if (from < this._keys[0].frame || from > this._keys[this._keys.length - 1].frame) { from = this._keys[0].frame; } if (to < this._keys[0].frame || to > this._keys[this._keys.length - 1].frame) { to = this._keys[this._keys.length - 1].frame; } // Compute ratio var range = to - from; var offsetValue; // ratio represents the frame delta between from and to var ratio = delay * (this.framePerSecond * speedRatio) / 1000.0; var highLimitValue = 0; if (ratio > range && !loop) { returnValue = false; highLimitValue = this._getKeyValue(this._keys[this._keys.length - 1].value); } else { // Get max value if required if (this.loopMode !== Animation.ANIMATIONLOOPMODE_CYCLE) { var keyOffset = to.toString() + from.toString(); if (!this._offsetsCache[keyOffset]) { var fromValue = this._interpolate(from, 0, Animation.ANIMATIONLOOPMODE_CYCLE); var toValue = this._interpolate(to, 0, Animation.ANIMATIONLOOPMODE_CYCLE); switch (this.dataType) { case Animation.ANIMATIONTYPE_FLOAT: this._offsetsCache[keyOffset] = toValue - fromValue; break; case Animation.ANIMATIONTYPE_QUATERNION: this._offsetsCache[keyOffset] = toValue.subtract(fromValue); break; case Animation.ANIMATIONTYPE_VECTOR3: this._offsetsCache[keyOffset] = toValue.subtract(fromValue); case Animation.ANIMATIONTYPE_VECTOR2: this._offsetsCache[keyOffset] = toValue.subtract(fromValue); case Animation.ANIMATIONTYPE_COLOR3: this._offsetsCache[keyOffset] = toValue.subtract(fromValue); default: break; } this._highLimitsCache[keyOffset] = toValue; } highLimitValue = this._highLimitsCache[keyOffset]; offsetValue = this._offsetsCache[keyOffset]; } } if (offsetValue === undefined) { switch (this.dataType) { case Animation.ANIMATIONTYPE_FLOAT: offsetValue = 0; break; case Animation.ANIMATIONTYPE_QUATERNION: offsetValue = new BABYLON.Quaternion(0, 0, 0, 0); break; case Animation.ANIMATIONTYPE_VECTOR3: offsetValue = BABYLON.Vector3.Zero(); break; case Animation.ANIMATIONTYPE_VECTOR2: offsetValue = BABYLON.Vector2.Zero(); break; case Animation.ANIMATIONTYPE_COLOR3: offsetValue = BABYLON.Color3.Black(); } } // Compute value var repeatCount = (ratio / range) >> 0; var currentFrame = returnValue ? from + ratio % range : to; var currentValue = this._interpolate(currentFrame, repeatCount, this.loopMode, offsetValue, highLimitValue); // Set value if (this.targetPropertyPath.length > 1) { var property = this._target[this.targetPropertyPath[0]]; for (var index = 1; index < this.targetPropertyPath.length - 1; index++) { property = property[this.targetPropertyPath[index]]; } property[this.targetPropertyPath[this.targetPropertyPath.length - 1]] = currentValue; } else { this._target[this.targetPropertyPath[0]] = currentValue; } if (this._target.markAsDirty) { this._target.markAsDirty(this.targetProperty); } if (!returnValue) { this._stopped = true; } return returnValue; }; Object.defineProperty(Animation, "ANIMATIONTYPE_FLOAT", { get: function () { return Animation._ANIMATIONTYPE_FLOAT; }, enumerable: true, configurable: true }); Object.defineProperty(Animation, "ANIMATIONTYPE_VECTOR3", { get: function () { return Animation._ANIMATIONTYPE_VECTOR3; }, enumerable: true, configurable: true }); Object.defineProperty(Animation, "ANIMATIONTYPE_VECTOR2", { get: function () { return Animation._ANIMATIONTYPE_VECTOR2; }, enumerable: true, configurable: true }); Object.defineProperty(Animation, "ANIMATIONTYPE_QUATERNION", { get: function () { return Animation._ANIMATIONTYPE_QUATERNION; }, enumerable: true, configurable: true }); Object.defineProperty(Animation, "ANIMATIONTYPE_MATRIX", { get: function () { return Animation._ANIMATIONTYPE_MATRIX; }, enumerable: true, configurable: true }); Object.defineProperty(Animation, "ANIMATIONTYPE_COLOR3", { get: function () { return Animation._ANIMATIONTYPE_COLOR3; }, enumerable: true, configurable: true }); Object.defineProperty(Animation, "ANIMATIONLOOPMODE_RELATIVE", { get: function () { return Animation._ANIMATIONLOOPMODE_RELATIVE; }, enumerable: true, configurable: true }); Object.defineProperty(Animation, "ANIMATIONLOOPMODE_CYCLE", { get: function () { return Animation._ANIMATIONLOOPMODE_CYCLE; }, enumerable: true, configurable: true }); Object.defineProperty(Animation, "ANIMATIONLOOPMODE_CONSTANT", { get: function () { return Animation._ANIMATIONLOOPMODE_CONSTANT; }, enumerable: true, configurable: true }); Animation._ANIMATIONTYPE_FLOAT = 0; Animation._ANIMATIONTYPE_VECTOR3 = 1; Animation._ANIMATIONTYPE_QUATERNION = 2; Animation._ANIMATIONTYPE_MATRIX = 3; Animation._ANIMATIONTYPE_COLOR3 = 4; Animation._ANIMATIONTYPE_VECTOR2 = 5; Animation._ANIMATIONLOOPMODE_RELATIVE = 0; Animation._ANIMATIONLOOPMODE_CYCLE = 1; Animation._ANIMATIONLOOPMODE_CONSTANT = 2; return Animation; })(); BABYLON.Animation = Animation; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.animation.js.map var BABYLON; (function (BABYLON) { var Animatable = (function () { function Animatable(scene, target, fromFrame, toFrame, loopAnimation, speedRatio, onAnimationEnd, animations) { if (typeof fromFrame === "undefined") { fromFrame = 0; } if (typeof toFrame === "undefined") { toFrame = 100; } if (typeof loopAnimation === "undefined") { loopAnimation = false; } if (typeof speedRatio === "undefined") { speedRatio = 1.0; } this.target = target; this.fromFrame = fromFrame; this.toFrame = toFrame; this.loopAnimation = loopAnimation; this.speedRatio = speedRatio; this.onAnimationEnd = onAnimationEnd; this._animations = new Array(); this._paused = false; this.animationStarted = false; if (animations) { this.appendAnimations(target, animations); } this._scene = scene; scene._activeAnimatables.push(this); } // Methods Animatable.prototype.appendAnimations = function (target, animations) { for (var index = 0; index < animations.length; index++) { var animation = animations[index]; animation._target = target; this._animations.push(animation); } }; Animatable.prototype.getAnimationByTargetProperty = function (property) { var animations = this._animations; for (var index = 0; index < animations.length; index++) { if (animations[index].targetProperty === property) { return animations[index]; } } return null; }; Animatable.prototype.pause = function () { if (this._paused) { return; } this._paused = true; }; Animatable.prototype.restart = function () { this._paused = false; }; Animatable.prototype.stop = function () { var index = this._scene._activeAnimatables.indexOf(this); if (index > -1) { this._scene._activeAnimatables.splice(index, 1); } if (this.onAnimationEnd) { this.onAnimationEnd(); } }; Animatable.prototype._animate = function (delay) { if (this._paused) { if (!this._pausedDelay) { this._pausedDelay = delay; } return true; } if (!this._localDelayOffset) { this._localDelayOffset = delay; } else if (this._pausedDelay) { this._localDelayOffset += delay - this._pausedDelay; this._pausedDelay = null; } // Animating var running = false; var animations = this._animations; for (var index = 0; index < animations.length; index++) { var animation = animations[index]; var isRunning = animation.animate(delay - this._localDelayOffset, this.fromFrame, this.toFrame, this.loopAnimation, this.speedRatio); running = running || isRunning; } if (!running && this.onAnimationEnd) { this.onAnimationEnd(); } return running; }; return Animatable; })(); BABYLON.Animatable = Animatable; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.animatable.js.map var BABYLON; (function (BABYLON) { var EasingFunction = (function () { function EasingFunction() { // Properties this._easingMode = EasingFunction.EASINGMODE_EASEIN; } Object.defineProperty(EasingFunction, "EASINGMODE_EASEIN", { get: function () { return EasingFunction._EASINGMODE_EASEIN; }, enumerable: true, configurable: true }); Object.defineProperty(EasingFunction, "EASINGMODE_EASEOUT", { get: function () { return EasingFunction._EASINGMODE_EASEOUT; }, enumerable: true, configurable: true }); Object.defineProperty(EasingFunction, "EASINGMODE_EASEINOUT", { get: function () { return EasingFunction._EASINGMODE_EASEINOUT; }, enumerable: true, configurable: true }); EasingFunction.prototype.setEasingMode = function (easingMode) { var n = Math.min(Math.max(easingMode, 0), 2); this._easingMode = n; }; EasingFunction.prototype.getEasingMode = function () { return this._easingMode; }; EasingFunction.prototype.easeInCore = function (gradient) { throw new Error('You must implement this method'); }; EasingFunction.prototype.ease = function (gradient) { switch (this._easingMode) { case EasingFunction.EASINGMODE_EASEIN: return this.easeInCore(gradient); case EasingFunction.EASINGMODE_EASEOUT: return (1 - this.easeInCore(1 - gradient)); } if (gradient >= 0.5) { return (((1 - this.easeInCore((1 - gradient) * 2)) * 0.5) + 0.5); } return (this.easeInCore(gradient * 2) * 0.5); }; EasingFunction._EASINGMODE_EASEIN = 0; EasingFunction._EASINGMODE_EASEOUT = 1; EasingFunction._EASINGMODE_EASEINOUT = 2; return EasingFunction; })(); BABYLON.EasingFunction = EasingFunction; var CircleEase = (function (_super) { __extends(CircleEase, _super); function CircleEase() { _super.apply(this, arguments); } CircleEase.prototype.easeInCore = function (gradient) { gradient = Math.max(0, Math.min(1, gradient)); return (1.0 - Math.sqrt(1.0 - (gradient * gradient))); }; return CircleEase; })(EasingFunction); BABYLON.CircleEase = CircleEase; var BackEase = (function (_super) { __extends(BackEase, _super); function BackEase(amplitude) { if (typeof amplitude === "undefined") { amplitude = 1; } _super.call(this); this.amplitude = amplitude; } BackEase.prototype.easeInCore = function (gradient) { var num = Math.max(0, this.amplitude); return (Math.pow(gradient, 3.0) - ((gradient * num) * Math.sin(3.1415926535897931 * gradient))); }; return BackEase; })(EasingFunction); BABYLON.BackEase = BackEase; var BounceEase = (function (_super) { __extends(BounceEase, _super); function BounceEase(bounces, bounciness) { if (typeof bounces === "undefined") { bounces = 3; } if (typeof bounciness === "undefined") { bounciness = 2; } _super.call(this); this.bounces = bounces; this.bounciness = bounciness; } BounceEase.prototype.easeInCore = function (gradient) { var y = Math.max(0.0, this.bounces); var bounciness = this.bounciness; if (bounciness <= 1.0) { bounciness = 1.001; } var num9 = Math.pow(bounciness, y); var num5 = 1.0 - bounciness; var num4 = ((1.0 - num9) / num5) + (num9 * 0.5); var num15 = gradient * num4; var num65 = Math.log((-num15 * (1.0 - bounciness)) + 1.0) / Math.log(bounciness); var num3 = Math.floor(num65); var num13 = num3 + 1.0; var num8 = (1.0 - Math.pow(bounciness, num3)) / (num5 * num4); var num12 = (1.0 - Math.pow(bounciness, num13)) / (num5 * num4); var num7 = (num8 + num12) * 0.5; var num6 = gradient - num7; var num2 = num7 - num8; return (((-Math.pow(1.0 / bounciness, y - num3) / (num2 * num2)) * (num6 - num2)) * (num6 + num2)); }; return BounceEase; })(EasingFunction); BABYLON.BounceEase = BounceEase; var CubicEase = (function (_super) { __extends(CubicEase, _super); function CubicEase() { _super.apply(this, arguments); } CubicEase.prototype.easeInCore = function (gradient) { return (gradient * gradient * gradient); }; return CubicEase; })(EasingFunction); BABYLON.CubicEase = CubicEase; var ElasticEase = (function (_super) { __extends(ElasticEase, _super); function ElasticEase(oscillations, springiness) { if (typeof oscillations === "undefined") { oscillations = 3; } if (typeof springiness === "undefined") { springiness = 3; } _super.call(this); this.oscillations = oscillations; this.springiness = springiness; } ElasticEase.prototype.easeInCore = function (gradient) { var num2; var num3 = Math.max(0.0, this.oscillations); var num = Math.max(0.0, this.springiness); if (num == 0) { num2 = gradient; } else { num2 = (Math.exp(num * gradient) - 1.0) / (Math.exp(num) - 1.0); } return (num2 * Math.sin(((6.2831853071795862 * num3) + 1.5707963267948966) * gradient)); }; return ElasticEase; })(EasingFunction); BABYLON.ElasticEase = ElasticEase; var ExponentialEase = (function (_super) { __extends(ExponentialEase, _super); function ExponentialEase(exponent) { if (typeof exponent === "undefined") { exponent = 2; } _super.call(this); this.exponent = exponent; } ExponentialEase.prototype.easeInCore = function (gradient) { if (this.exponent <= 0) { return gradient; } return ((Math.exp(this.exponent * gradient) - 1.0) / (Math.exp(this.exponent) - 1.0)); }; return ExponentialEase; })(EasingFunction); BABYLON.ExponentialEase = ExponentialEase; var PowerEase = (function (_super) { __extends(PowerEase, _super); function PowerEase(power) { if (typeof power === "undefined") { power = 2; } _super.call(this); this.power = power; } PowerEase.prototype.easeInCore = function (gradient) { var y = Math.max(0.0, this.power); return Math.pow(gradient, y); }; return PowerEase; })(EasingFunction); BABYLON.PowerEase = PowerEase; var QuadraticEase = (function (_super) { __extends(QuadraticEase, _super); function QuadraticEase() { _super.apply(this, arguments); } QuadraticEase.prototype.easeInCore = function (gradient) { return (gradient * gradient); }; return QuadraticEase; })(EasingFunction); BABYLON.QuadraticEase = QuadraticEase; var QuarticEase = (function (_super) { __extends(QuarticEase, _super); function QuarticEase() { _super.apply(this, arguments); } QuarticEase.prototype.easeInCore = function (gradient) { return (gradient * gradient * gradient * gradient); }; return QuarticEase; })(EasingFunction); BABYLON.QuarticEase = QuarticEase; var QuinticEase = (function (_super) { __extends(QuinticEase, _super); function QuinticEase() { _super.apply(this, arguments); } QuinticEase.prototype.easeInCore = function (gradient) { return (gradient * gradient * gradient * gradient * gradient); }; return QuinticEase; })(EasingFunction); BABYLON.QuinticEase = QuinticEase; var SineEase = (function (_super) { __extends(SineEase, _super); function SineEase() { _super.apply(this, arguments); } SineEase.prototype.easeInCore = function (gradient) { return (1.0 - Math.sin(1.5707963267948966 * (1.0 - gradient))); }; return SineEase; })(EasingFunction); BABYLON.SineEase = SineEase; var BezierCurveEase = (function (_super) { __extends(BezierCurveEase, _super); function BezierCurveEase(x1, y1, x2, y2) { if (typeof x1 === "undefined") { x1 = 0; } if (typeof y1 === "undefined") { y1 = 0; } if (typeof x2 === "undefined") { x2 = 1; } if (typeof y2 === "undefined") { y2 = 1; } _super.call(this); this.x1 = x1; this.y1 = y1; this.x2 = x2; this.y2 = y2; } BezierCurveEase.prototype.easeInCore = function (gradient) { return BABYLON.BezierCurve.interpolate(gradient, this.x1, this.y1, this.x2, this.y2); }; return BezierCurveEase; })(EasingFunction); BABYLON.BezierCurveEase = BezierCurveEase; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.easing.js.map var BABYLON; (function (BABYLON) { var Octree = (function () { function Octree(creationFunc, maxBlockCapacity, maxDepth) { if (typeof maxDepth === "undefined") { maxDepth = 2; } this.maxDepth = maxDepth; this.dynamicContent = new Array(); this._maxBlockCapacity = maxBlockCapacity || 64; this._selectionContent = new BABYLON.SmartArray(1024); this._creationFunc = creationFunc; } // Methods Octree.prototype.update = function (worldMin, worldMax, entries) { Octree._CreateBlocks(worldMin, worldMax, entries, this._maxBlockCapacity, 0, this.maxDepth, this, this._creationFunc); }; Octree.prototype.addMesh = function (entry) { for (var index = 0; index < this.blocks.length; index++) { var block = this.blocks[index]; block.addEntry(entry); } }; Octree.prototype.select = function (frustumPlanes, allowDuplicate) { this._selectionContent.reset(); for (var index = 0; index < this.blocks.length; index++) { var block = this.blocks[index]; block.select(frustumPlanes, this._selectionContent, allowDuplicate); } if (allowDuplicate) { this._selectionContent.concat(this.dynamicContent); } else { this._selectionContent.concatWithNoDuplicate(this.dynamicContent); } return this._selectionContent; }; Octree.prototype.intersects = function (sphereCenter, sphereRadius, allowDuplicate) { this._selectionContent.reset(); for (var index = 0; index < this.blocks.length; index++) { var block = this.blocks[index]; block.intersects(sphereCenter, sphereRadius, this._selectionContent, allowDuplicate); } if (allowDuplicate) { this._selectionContent.concat(this.dynamicContent); } else { this._selectionContent.concatWithNoDuplicate(this.dynamicContent); } return this._selectionContent; }; Octree.prototype.intersectsRay = function (ray) { this._selectionContent.reset(); for (var index = 0; index < this.blocks.length; index++) { var block = this.blocks[index]; block.intersectsRay(ray, this._selectionContent); } this._selectionContent.concatWithNoDuplicate(this.dynamicContent); return this._selectionContent; }; Octree._CreateBlocks = function (worldMin, worldMax, entries, maxBlockCapacity, currentDepth, maxDepth, target, creationFunc) { target.blocks = new Array(); var blockSize = new BABYLON.Vector3((worldMax.x - worldMin.x) / 2, (worldMax.y - worldMin.y) / 2, (worldMax.z - worldMin.z) / 2); for (var x = 0; x < 2; x++) { for (var y = 0; y < 2; y++) { for (var z = 0; z < 2; z++) { var localMin = worldMin.add(blockSize.multiplyByFloats(x, y, z)); var localMax = worldMin.add(blockSize.multiplyByFloats(x + 1, y + 1, z + 1)); var block = new BABYLON.OctreeBlock(localMin, localMax, maxBlockCapacity, currentDepth + 1, maxDepth, creationFunc); block.addEntries(entries); target.blocks.push(block); } } } }; Octree.CreationFuncForMeshes = function (entry, block) { if (!entry.isBlocked && entry.getBoundingInfo().boundingBox.intersectsMinMax(block.minPoint, block.maxPoint)) { block.entries.push(entry); } }; Octree.CreationFuncForSubMeshes = function (entry, block) { if (entry.getBoundingInfo().boundingBox.intersectsMinMax(block.minPoint, block.maxPoint)) { block.entries.push(entry); } }; return Octree; })(); BABYLON.Octree = Octree; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.octree.js.map var BABYLON; (function (BABYLON) { var OctreeBlock = (function () { function OctreeBlock(minPoint, maxPoint, capacity, depth, maxDepth, creationFunc) { this.entries = new Array(); this._boundingVectors = new Array(); this._capacity = capacity; this._depth = depth; this._maxDepth = maxDepth; this._creationFunc = creationFunc; this._minPoint = minPoint; this._maxPoint = maxPoint; this._boundingVectors.push(minPoint.clone()); this._boundingVectors.push(maxPoint.clone()); this._boundingVectors.push(minPoint.clone()); this._boundingVectors[2].x = maxPoint.x; this._boundingVectors.push(minPoint.clone()); this._boundingVectors[3].y = maxPoint.y; this._boundingVectors.push(minPoint.clone()); this._boundingVectors[4].z = maxPoint.z; this._boundingVectors.push(maxPoint.clone()); this._boundingVectors[5].z = minPoint.z; this._boundingVectors.push(maxPoint.clone()); this._boundingVectors[6].x = minPoint.x; this._boundingVectors.push(maxPoint.clone()); this._boundingVectors[7].y = minPoint.y; } Object.defineProperty(OctreeBlock.prototype, "capacity", { // Property get: function () { return this._capacity; }, enumerable: true, configurable: true }); Object.defineProperty(OctreeBlock.prototype, "minPoint", { get: function () { return this._minPoint; }, enumerable: true, configurable: true }); Object.defineProperty(OctreeBlock.prototype, "maxPoint", { get: function () { return this._maxPoint; }, enumerable: true, configurable: true }); // Methods OctreeBlock.prototype.addEntry = function (entry) { if (this.blocks) { for (var index = 0; index < this.blocks.length; index++) { var block = this.blocks[index]; block.addEntry(entry); } return; } this._creationFunc(entry, this); if (this.entries.length > this.capacity && this._depth < this._maxDepth) { this.createInnerBlocks(); } }; OctreeBlock.prototype.addEntries = function (entries) { for (var index = 0; index < entries.length; index++) { var mesh = entries[index]; this.addEntry(mesh); } }; OctreeBlock.prototype.select = function (frustumPlanes, selection, allowDuplicate) { if (BABYLON.BoundingBox.IsInFrustum(this._boundingVectors, frustumPlanes)) { if (this.blocks) { for (var index = 0; index < this.blocks.length; index++) { var block = this.blocks[index]; block.select(frustumPlanes, selection, allowDuplicate); } return; } if (allowDuplicate) { selection.concat(this.entries); } else { selection.concatWithNoDuplicate(this.entries); } } }; OctreeBlock.prototype.intersects = function (sphereCenter, sphereRadius, selection, allowDuplicate) { if (BABYLON.BoundingBox.IntersectsSphere(this._minPoint, this._maxPoint, sphereCenter, sphereRadius)) { if (this.blocks) { for (var index = 0; index < this.blocks.length; index++) { var block = this.blocks[index]; block.intersects(sphereCenter, sphereRadius, selection, allowDuplicate); } return; } if (allowDuplicate) { selection.concat(this.entries); } else { selection.concatWithNoDuplicate(this.entries); } } }; OctreeBlock.prototype.intersectsRay = function (ray, selection) { if (ray.intersectsBoxMinMax(this._minPoint, this._maxPoint)) { if (this.blocks) { for (var index = 0; index < this.blocks.length; index++) { var block = this.blocks[index]; block.intersectsRay(ray, selection); } return; } selection.concatWithNoDuplicate(this.entries); } }; OctreeBlock.prototype.createInnerBlocks = function () { BABYLON.Octree._CreateBlocks(this._minPoint, this._maxPoint, this.entries, this._capacity, this._depth, this._maxDepth, this, this._creationFunc); }; return OctreeBlock; })(); BABYLON.OctreeBlock = OctreeBlock; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.octreeBlock.js.map var BABYLON; (function (BABYLON) { var Bone = (function () { function Bone(name, skeleton, parentBone, matrix) { this.name = name; this.children = new Array(); this.animations = new Array(); this._worldTransform = new BABYLON.Matrix(); this._absoluteTransform = new BABYLON.Matrix(); this._invertedAbsoluteTransform = new BABYLON.Matrix(); this._skeleton = skeleton; this._matrix = matrix; this._baseMatrix = matrix; skeleton.bones.push(this); if (parentBone) { this._parent = parentBone; parentBone.children.push(this); } else { this._parent = null; } this._updateDifferenceMatrix(); } // Members Bone.prototype.getParent = function () { return this._parent; }; Bone.prototype.getLocalMatrix = function () { return this._matrix; }; Bone.prototype.getBaseMatrix = function () { return this._baseMatrix; }; Bone.prototype.getWorldMatrix = function () { return this._worldTransform; }; Bone.prototype.getInvertedAbsoluteTransform = function () { return this._invertedAbsoluteTransform; }; Bone.prototype.getAbsoluteMatrix = function () { var matrix = this._matrix.clone(); var parent = this._parent; while (parent) { matrix = matrix.multiply(parent.getLocalMatrix()); parent = parent.getParent(); } return matrix; }; // Methods Bone.prototype.updateMatrix = function (matrix) { this._matrix = matrix; this._skeleton._markAsDirty(); this._updateDifferenceMatrix(); }; Bone.prototype._updateDifferenceMatrix = function () { if (this._parent) { this._matrix.multiplyToRef(this._parent._absoluteTransform, this._absoluteTransform); } else { this._absoluteTransform.copyFrom(this._matrix); } this._absoluteTransform.invertToRef(this._invertedAbsoluteTransform); for (var index = 0; index < this.children.length; index++) { this.children[index]._updateDifferenceMatrix(); } }; Bone.prototype.markAsDirty = function () { this._skeleton._markAsDirty(); }; return Bone; })(); BABYLON.Bone = Bone; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.bone.js.map var BABYLON; (function (BABYLON) { var Skeleton = (function () { function Skeleton(name, id, scene) { this.name = name; this.id = id; this.bones = new Array(); this._isDirty = true; this._identity = BABYLON.Matrix.Identity(); this.bones = []; this._scene = scene; scene.skeletons.push(this); } // Members Skeleton.prototype.getTransformMatrices = function () { return this._transformMatrices; }; // Methods Skeleton.prototype._markAsDirty = function () { this._isDirty = true; }; Skeleton.prototype.prepare = function () { if (!this._isDirty) { return; } if (!this._transformMatrices || this._transformMatrices.length !== 16 * (this.bones.length + 1)) { this._transformMatrices = new Float32Array(16 * (this.bones.length + 1)); } for (var index = 0; index < this.bones.length; index++) { var bone = this.bones[index]; var parentBone = bone.getParent(); if (parentBone) { bone.getLocalMatrix().multiplyToRef(parentBone.getWorldMatrix(), bone.getWorldMatrix()); } else { bone.getWorldMatrix().copyFrom(bone.getLocalMatrix()); } bone.getInvertedAbsoluteTransform().multiplyToArray(bone.getWorldMatrix(), this._transformMatrices, index * 16); } this._identity.copyToArray(this._transformMatrices, this.bones.length * 16); this._isDirty = false; }; Skeleton.prototype.getAnimatables = function () { if (!this._animatables || this._animatables.length != this.bones.length) { this._animatables = []; for (var index = 0; index < this.bones.length; index++) { this._animatables.push(this.bones[index]); } } return this._animatables; }; Skeleton.prototype.clone = function (name, id) { var result = new BABYLON.Skeleton(name, id || name, this._scene); for (var index = 0; index < this.bones.length; index++) { var source = this.bones[index]; var parentBone = null; if (source.getParent()) { var parentIndex = this.bones.indexOf(source.getParent()); parentBone = result.bones[parentIndex]; } var bone = new BABYLON.Bone(source.name, result, parentBone, source.getBaseMatrix()); BABYLON.Tools.DeepCopy(source.animations, bone.animations); } return result; }; return Skeleton; })(); BABYLON.Skeleton = Skeleton; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.skeleton.js.map var BABYLON; (function (BABYLON) { var PostProcess = (function () { function PostProcess(name, fragmentUrl, parameters, samplers, ratio, camera, samplingMode, engine, reusable) { this.name = name; this.width = -1; this.height = -1; this._reusable = false; this._textures = new BABYLON.SmartArray(2); this._currentRenderTextureInd = 0; if (camera != null) { this._camera = camera; this._scene = camera.getScene(); camera.attachPostProcess(this); this._engine = this._scene.getEngine(); } else { this._engine = engine; } this._renderRatio = ratio; this.renderTargetSamplingMode = samplingMode ? samplingMode : BABYLON.Texture.NEAREST_SAMPLINGMODE; this._reusable = reusable || false; samplers = samplers || []; samplers.push("textureSampler"); this._effect = this._engine.createEffect({ vertex: "postprocess", fragment: fragmentUrl }, ["position"], parameters || [], samplers, ""); } PostProcess.prototype.isReusable = function () { return this._reusable; }; PostProcess.prototype.activate = function (camera, sourceTexture) { camera = camera || this._camera; var scene = camera.getScene(); var maxSize = camera.getEngine().getCaps().maxTextureSize; var desiredWidth = ((sourceTexture ? sourceTexture._width : this._engine.getRenderingCanvas().width) * this._renderRatio) | 0; var desiredHeight = ((sourceTexture ? sourceTexture._height : this._engine.getRenderingCanvas().height) * this._renderRatio) | 0; desiredWidth = BABYLON.Tools.GetExponantOfTwo(desiredWidth, maxSize); desiredHeight = BABYLON.Tools.GetExponantOfTwo(desiredHeight, maxSize); if (this.width !== desiredWidth || this.height !== desiredHeight) { if (this._textures.length > 0) { for (var i = 0; i < this._textures.length; i++) { this._engine._releaseTexture(this._textures.data[i]); } this._textures.reset(); } this.width = desiredWidth; this.height = desiredHeight; this._textures.push(this._engine.createRenderTargetTexture({ width: this.width, height: this.height }, { generateMipMaps: false, generateDepthBuffer: camera._postProcesses.indexOf(this) === camera._postProcessesTakenIndices[0], samplingMode: this.renderTargetSamplingMode })); if (this._reusable) { this._textures.push(this._engine.createRenderTargetTexture({ width: this.width, height: this.height }, { generateMipMaps: false, generateDepthBuffer: camera._postProcesses.indexOf(this) === camera._postProcessesTakenIndices[0], samplingMode: this.renderTargetSamplingMode })); } if (this.onSizeChanged) { this.onSizeChanged(); } } this._engine.bindFramebuffer(this._textures.data[this._currentRenderTextureInd]); if (this.onActivate) { this.onActivate(camera); } // Clear this._engine.clear(scene.clearColor, scene.autoClear || scene.forceWireframe, true); if (this._reusable) { this._currentRenderTextureInd = (this._currentRenderTextureInd + 1) % 2; } }; PostProcess.prototype.apply = function () { // Check if (!this._effect.isReady()) return null; // States this._engine.enableEffect(this._effect); this._engine.setState(false); this._engine.setAlphaMode(BABYLON.Engine.ALPHA_DISABLE); this._engine.setDepthBuffer(false); this._engine.setDepthWrite(false); // Texture this._effect._bindTexture("textureSampler", this._textures.data[this._currentRenderTextureInd]); // Parameters if (this.onApply) { this.onApply(this._effect); } return this._effect; }; PostProcess.prototype.dispose = function (camera) { camera = camera || this._camera; if (this._textures.length > 0) { for (var i = 0; i < this._textures.length; i++) { this._engine._releaseTexture(this._textures.data[i]); } this._textures.reset(); } camera.detachPostProcess(this); var index = camera._postProcesses.indexOf(this); if (index === camera._postProcessesTakenIndices[0] && camera._postProcessesTakenIndices.length > 0) { this._camera._postProcesses[camera._postProcessesTakenIndices[0]].width = -1; // invalidate frameBuffer to hint the postprocess to create a depth buffer } }; return PostProcess; })(); BABYLON.PostProcess = PostProcess; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.postProcess.js.map var BABYLON; (function (BABYLON) { var PostProcessManager = (function () { function PostProcessManager(scene) { this._vertexDeclaration = [2]; this._vertexStrideSize = 2 * 4; this._scene = scene; // VBO var vertices = []; vertices.push(1, 1); vertices.push(-1, 1); vertices.push(-1, -1); vertices.push(1, -1); this._vertexBuffer = scene.getEngine().createVertexBuffer(vertices); // Indices var indices = []; indices.push(0); indices.push(1); indices.push(2); indices.push(0); indices.push(2); indices.push(3); this._indexBuffer = scene.getEngine().createIndexBuffer(indices); } // Methods PostProcessManager.prototype._prepareFrame = function (sourceTexture) { var postProcesses = this._scene.activeCamera._postProcesses; var postProcessesTakenIndices = this._scene.activeCamera._postProcessesTakenIndices; if (postProcessesTakenIndices.length === 0 || !this._scene.postProcessesEnabled) { return false; } postProcesses[this._scene.activeCamera._postProcessesTakenIndices[0]].activate(this._scene.activeCamera, sourceTexture); return true; }; PostProcessManager.prototype._finalizeFrame = function (doNotPresent, targetTexture) { var postProcesses = this._scene.activeCamera._postProcesses; var postProcessesTakenIndices = this._scene.activeCamera._postProcessesTakenIndices; if (postProcessesTakenIndices.length === 0 || !this._scene.postProcessesEnabled) { return; } var engine = this._scene.getEngine(); for (var index = 0; index < postProcessesTakenIndices.length; index++) { if (index < postProcessesTakenIndices.length - 1) { postProcesses[postProcessesTakenIndices[index + 1]].activate(this._scene.activeCamera); } else { if (targetTexture) { engine.bindFramebuffer(targetTexture); } else { engine.restoreDefaultFramebuffer(); } } if (doNotPresent) { break; } var pp = postProcesses[postProcessesTakenIndices[index]]; var effect = pp.apply(); if (effect) { if (pp.onBeforeRender) { pp.onBeforeRender(effect); } // VBOs engine.bindBuffers(this._vertexBuffer, this._indexBuffer, this._vertexDeclaration, this._vertexStrideSize, effect); // Draw order engine.draw(true, 0, 6); } } // Restore depth buffer engine.setDepthBuffer(true); engine.setDepthWrite(true); }; PostProcessManager.prototype.dispose = function () { if (this._vertexBuffer) { this._scene.getEngine()._releaseBuffer(this._vertexBuffer); this._vertexBuffer = null; } if (this._indexBuffer) { this._scene.getEngine()._releaseBuffer(this._indexBuffer); this._indexBuffer = null; } }; return PostProcessManager; })(); BABYLON.PostProcessManager = PostProcessManager; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.postProcessManager.js.map var BABYLON; (function (BABYLON) { var PassPostProcess = (function (_super) { __extends(PassPostProcess, _super); function PassPostProcess(name, ratio, camera, samplingMode, engine, reusable) { _super.call(this, name, "pass", null, null, ratio, camera, samplingMode, engine, reusable); } return PassPostProcess; })(BABYLON.PostProcess); BABYLON.PassPostProcess = PassPostProcess; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.passPostProcess.js.map var BABYLON; (function (BABYLON) { var BlurPostProcess = (function (_super) { __extends(BlurPostProcess, _super); function BlurPostProcess(name, direction, blurWidth, ratio, camera, samplingMode, engine, reusable) { if (typeof samplingMode === "undefined") { samplingMode = BABYLON.Texture.BILINEAR_SAMPLINGMODE; } var _this = this; _super.call(this, name, "blur", ["screenSize", "direction", "blurWidth"], null, ratio, camera, samplingMode, engine, reusable); this.direction = direction; this.blurWidth = blurWidth; this.onApply = function (effect) { effect.setFloat2("screenSize", _this.width, _this.height); effect.setVector2("direction", _this.direction); effect.setFloat("blurWidth", _this.blurWidth); }; } return BlurPostProcess; })(BABYLON.PostProcess); BABYLON.BlurPostProcess = BlurPostProcess; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.blurPostProcess.js.map var BABYLON; (function (BABYLON) { var FilterPostProcess = (function (_super) { __extends(FilterPostProcess, _super); function FilterPostProcess(name, kernelMatrix, ratio, camera, samplingMode, engine, reusable) { var _this = this; _super.call(this, name, "filter", ["kernelMatrix"], null, ratio, camera, samplingMode, engine, reusable); this.kernelMatrix = kernelMatrix; this.onApply = function (effect) { effect.setMatrix("kernelMatrix", _this.kernelMatrix); }; } return FilterPostProcess; })(BABYLON.PostProcess); BABYLON.FilterPostProcess = FilterPostProcess; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.filterPostProcess.js.map var BABYLON; (function (BABYLON) { var RefractionPostProcess = (function (_super) { __extends(RefractionPostProcess, _super); function RefractionPostProcess(name, refractionTextureUrl, color, depth, colorLevel, ratio, camera, samplingMode, engine, reusable) { var _this = this; _super.call(this, name, "refraction", ["baseColor", "depth", "colorLevel"], ["refractionSampler"], ratio, camera, samplingMode, engine, reusable); this.color = color; this.depth = depth; this.colorLevel = colorLevel; this.onActivate = function (cam) { _this._refRexture = _this._refRexture || new BABYLON.Texture(refractionTextureUrl, cam.getScene()); }; this.onApply = function (effect) { effect.setColor3("baseColor", _this.color); effect.setFloat("depth", _this.depth); effect.setFloat("colorLevel", _this.colorLevel); effect.setTexture("refractionSampler", _this._refRexture); }; } // Methods RefractionPostProcess.prototype.dispose = function (camera) { if (this._refRexture) { this._refRexture.dispose(); } _super.prototype.dispose.call(this, camera); }; return RefractionPostProcess; })(BABYLON.PostProcess); BABYLON.RefractionPostProcess = RefractionPostProcess; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.refractionPostProcess.js.map var BABYLON; (function (BABYLON) { var BlackAndWhitePostProcess = (function (_super) { __extends(BlackAndWhitePostProcess, _super); function BlackAndWhitePostProcess(name, ratio, camera, samplingMode, engine, reusable) { _super.call(this, name, "blackAndWhite", null, null, ratio, camera, samplingMode, engine, reusable); } return BlackAndWhitePostProcess; })(BABYLON.PostProcess); BABYLON.BlackAndWhitePostProcess = BlackAndWhitePostProcess; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.blackAndWhitePostProcess.js.map var BABYLON; (function (BABYLON) { var ConvolutionPostProcess = (function (_super) { __extends(ConvolutionPostProcess, _super); function ConvolutionPostProcess(name, kernel, ratio, camera, samplingMode, engine, reusable) { var _this = this; _super.call(this, name, "convolution", ["kernel", "screenSize"], null, ratio, camera, samplingMode, engine, reusable); this.kernel = kernel; this.onApply = function (effect) { effect.setFloat2("screenSize", _this.width, _this.height); effect.setArray("kernel", _this.kernel); }; } ConvolutionPostProcess.EdgeDetect0Kernel = [1, 0, -1, 0, 0, 0, -1, 0, 1]; ConvolutionPostProcess.EdgeDetect1Kernel = [0, 1, 0, 1, -4, 1, 0, 1, 0]; ConvolutionPostProcess.EdgeDetect2Kernel = [-1, -1, -1, -1, 8, -1, -1, -1, -1]; ConvolutionPostProcess.SharpenKernel = [0, -1, 0, -1, 5, -1, 0, -1, 0]; ConvolutionPostProcess.EmbossKernel = [-2, -1, 0, -1, 1, 1, 0, 1, 2]; ConvolutionPostProcess.GaussianKernel = [0, 1, 0, 1, 1, 1, 0, 1, 0]; return ConvolutionPostProcess; })(BABYLON.PostProcess); BABYLON.ConvolutionPostProcess = ConvolutionPostProcess; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.convolutionPostProcess.js.map var BABYLON; (function (BABYLON) { var FxaaPostProcess = (function (_super) { __extends(FxaaPostProcess, _super); function FxaaPostProcess(name, ratio, camera, samplingMode, engine, reusable) { var _this = this; _super.call(this, name, "fxaa", ["texelSize"], null, ratio, camera, samplingMode, engine, reusable); this.onSizeChanged = function () { _this.texelWidth = 1.0 / _this.width; _this.texelHeight = 1.0 / _this.height; }; this.onApply = function (effect) { effect.setFloat2("texelSize", _this.texelWidth, _this.texelHeight); }; } return FxaaPostProcess; })(BABYLON.PostProcess); BABYLON.FxaaPostProcess = FxaaPostProcess; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.fxaaPostProcess.js.map var BABYLON; (function (BABYLON) { var LensFlare = (function () { function LensFlare(size, position, color, imgUrl, system) { this.size = size; this.position = position; this.dispose = function () { if (this.texture) { this.texture.dispose(); } // Remove from scene var index = this._system.lensFlares.indexOf(this); this._system.lensFlares.splice(index, 1); }; this.color = color || new BABYLON.Color3(1, 1, 1); this.texture = imgUrl ? new BABYLON.Texture(imgUrl, system.getScene(), true) : null; this._system = system; system.lensFlares.push(this); } return LensFlare; })(); BABYLON.LensFlare = LensFlare; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.lensFlare.js.map var BABYLON; (function (BABYLON) { var LensFlareSystem = (function () { function LensFlareSystem(name, emitter, scene) { this.name = name; this.lensFlares = new Array(); this.borderLimit = 300; this._vertexDeclaration = [2]; this._vertexStrideSize = 2 * 4; this._isEnabled = true; this._scene = scene; this._emitter = emitter; scene.lensFlareSystems.push(this); this.meshesSelectionPredicate = function (m) { return m.material && m.isVisible && m.isEnabled() && m.isBlocker && ((m.layerMask & scene.activeCamera.layerMask) != 0); }; // VBO var vertices = []; vertices.push(1, 1); vertices.push(-1, 1); vertices.push(-1, -1); vertices.push(1, -1); this._vertexBuffer = scene.getEngine().createVertexBuffer(vertices); // Indices var indices = []; indices.push(0); indices.push(1); indices.push(2); indices.push(0); indices.push(2); indices.push(3); this._indexBuffer = scene.getEngine().createIndexBuffer(indices); // Effects this._effect = this._scene.getEngine().createEffect("lensFlare", ["position"], ["color", "viewportMatrix"], ["textureSampler"], ""); } Object.defineProperty(LensFlareSystem.prototype, "isEnabled", { get: function () { return this._isEnabled; }, set: function (value) { this._isEnabled = value; }, enumerable: true, configurable: true }); LensFlareSystem.prototype.getScene = function () { return this._scene; }; LensFlareSystem.prototype.getEmitter = function () { return this._emitter; }; LensFlareSystem.prototype.getEmitterPosition = function () { return this._emitter.getAbsolutePosition ? this._emitter.getAbsolutePosition() : this._emitter.position; }; LensFlareSystem.prototype.computeEffectivePosition = function (globalViewport) { var position = this.getEmitterPosition(); position = BABYLON.Vector3.Project(position, BABYLON.Matrix.Identity(), this._scene.getTransformMatrix(), globalViewport); this._positionX = position.x; this._positionY = position.y; position = BABYLON.Vector3.TransformCoordinates(this.getEmitterPosition(), this._scene.getViewMatrix()); if (position.z > 0) { if ((this._positionX > globalViewport.x) && (this._positionX < globalViewport.x + globalViewport.width)) { if ((this._positionY > globalViewport.y) && (this._positionY < globalViewport.y + globalViewport.height)) return true; } } return false; }; LensFlareSystem.prototype._isVisible = function () { if (!this._isEnabled) { return false; } var emitterPosition = this.getEmitterPosition(); var direction = emitterPosition.subtract(this._scene.activeCamera.position); var distance = direction.length(); direction.normalize(); var ray = new BABYLON.Ray(this._scene.activeCamera.position, direction); var pickInfo = this._scene.pickWithRay(ray, this.meshesSelectionPredicate, true); return !pickInfo.hit || pickInfo.distance > distance; }; LensFlareSystem.prototype.render = function () { if (!this._effect.isReady()) return false; var engine = this._scene.getEngine(); var viewport = this._scene.activeCamera.viewport; var globalViewport = viewport.toGlobal(engine); // Position if (!this.computeEffectivePosition(globalViewport)) { return false; } // Visibility if (!this._isVisible()) { return false; } // Intensity var awayX; var awayY; if (this._positionX < this.borderLimit + globalViewport.x) { awayX = this.borderLimit + globalViewport.x - this._positionX; } else if (this._positionX > globalViewport.x + globalViewport.width - this.borderLimit) { awayX = this._positionX - globalViewport.x - globalViewport.width + this.borderLimit; } else { awayX = 0; } if (this._positionY < this.borderLimit + globalViewport.y) { awayY = this.borderLimit + globalViewport.y - this._positionY; } else if (this._positionY > globalViewport.y + globalViewport.height - this.borderLimit) { awayY = this._positionY - globalViewport.y - globalViewport.height + this.borderLimit; } else { awayY = 0; } var away = (awayX > awayY) ? awayX : awayY; if (away > this.borderLimit) { away = this.borderLimit; } var intensity = 1.0 - (away / this.borderLimit); if (intensity < 0) { return false; } if (intensity > 1.0) { intensity = 1.0; } // Position var centerX = globalViewport.x + globalViewport.width / 2; var centerY = globalViewport.y + globalViewport.height / 2; var distX = centerX - this._positionX; var distY = centerY - this._positionY; // Effects engine.enableEffect(this._effect); engine.setState(false); engine.setDepthBuffer(false); engine.setAlphaMode(BABYLON.Engine.ALPHA_ADD); // VBOs engine.bindBuffers(this._vertexBuffer, this._indexBuffer, this._vertexDeclaration, this._vertexStrideSize, this._effect); for (var index = 0; index < this.lensFlares.length; index++) { var flare = this.lensFlares[index]; var x = centerX - (distX * flare.position); var y = centerY - (distY * flare.position); var cw = flare.size; var ch = flare.size * engine.getAspectRatio(this._scene.activeCamera); var cx = 2 * (x / globalViewport.width) - 1.0; var cy = 1.0 - 2 * (y / globalViewport.height); var viewportMatrix = BABYLON.Matrix.FromValues(cw / 2, 0, 0, 0, 0, ch / 2, 0, 0, 0, 0, 1, 0, cx, cy, 0, 1); this._effect.setMatrix("viewportMatrix", viewportMatrix); // Texture this._effect.setTexture("textureSampler", flare.texture); // Color this._effect.setFloat4("color", flare.color.r * intensity, flare.color.g * intensity, flare.color.b * intensity, 1.0); // Draw order engine.draw(true, 0, 6); } engine.setDepthBuffer(true); engine.setAlphaMode(BABYLON.Engine.ALPHA_DISABLE); return true; }; LensFlareSystem.prototype.dispose = function () { if (this._vertexBuffer) { this._scene.getEngine()._releaseBuffer(this._vertexBuffer); this._vertexBuffer = null; } if (this._indexBuffer) { this._scene.getEngine()._releaseBuffer(this._indexBuffer); this._indexBuffer = null; } while (this.lensFlares.length) { this.lensFlares[0].dispose(); } // Remove from scene var index = this._scene.lensFlareSystems.indexOf(this); this._scene.lensFlareSystems.splice(index, 1); }; return LensFlareSystem; })(); BABYLON.LensFlareSystem = LensFlareSystem; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.lensFlareSystem.js.map var BABYLON; (function (BABYLON) { var IntersectionInfo = (function () { function IntersectionInfo(bu, bv, distance) { this.bu = bu; this.bv = bv; this.distance = distance; this.faceId = 0; } return IntersectionInfo; })(); BABYLON.IntersectionInfo = IntersectionInfo; var PickingInfo = (function () { function PickingInfo() { this.hit = false; this.distance = 0; this.pickedPoint = null; this.pickedMesh = null; this.bu = 0; this.bv = 0; this.faceId = -1; } // Methods PickingInfo.prototype.getNormal = function () { if (!this.pickedMesh || !this.pickedMesh.isVerticesDataPresent(BABYLON.VertexBuffer.NormalKind)) { return null; } var indices = this.pickedMesh.getIndices(); var normals = this.pickedMesh.getVerticesData(BABYLON.VertexBuffer.NormalKind); var normal0 = BABYLON.Vector3.FromArray(normals, indices[this.faceId * 3] * 3); var normal1 = BABYLON.Vector3.FromArray(normals, indices[this.faceId * 3 + 1] * 3); var normal2 = BABYLON.Vector3.FromArray(normals, indices[this.faceId * 3 + 2] * 3); normal0 = normal0.scale(this.bu); normal1 = normal1.scale(this.bv); normal2 = normal2.scale(1.0 - this.bu - this.bv); return new BABYLON.Vector3(normal0.x + normal1.x + normal2.x, normal0.y + normal1.y + normal2.y, normal0.z + normal1.z + normal2.z); }; PickingInfo.prototype.getTextureCoordinates = function () { if (!this.pickedMesh || !this.pickedMesh.isVerticesDataPresent(BABYLON.VertexBuffer.UVKind)) { return null; } var indices = this.pickedMesh.getIndices(); var uvs = this.pickedMesh.getVerticesData(BABYLON.VertexBuffer.UVKind); var uv0 = BABYLON.Vector2.FromArray(uvs, indices[this.faceId * 3] * 2); var uv1 = BABYLON.Vector2.FromArray(uvs, indices[this.faceId * 3 + 1] * 2); var uv2 = BABYLON.Vector2.FromArray(uvs, indices[this.faceId * 3 + 2] * 2); uv0 = uv0.scale(this.bu); uv1 = uv1.scale(this.bv); uv2 = uv2.scale(1.0 - this.bu - this.bv); return new BABYLON.Vector2(uv0.x + uv1.x + uv2.x, uv0.y + uv1.y + uv2.y); }; return PickingInfo; })(); BABYLON.PickingInfo = PickingInfo; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.pickingInfo.js.map var BABYLON; (function (BABYLON) { var FilesInput = (function () { /// Register to core BabylonJS object: engine, scene, rendering canvas, callback function when the scene will be loaded, /// loading progress callback and optionnal addionnal logic to call in the rendering loop function FilesInput(p_engine, p_scene, p_canvas, p_sceneLoadedCallback, p_progressCallback, p_additionnalRenderLoopLogicCallback, p_textureLoadingCallback, p_startingProcessingFilesCallback) { this.engine = p_engine; this.canvas = p_canvas; this.currentScene = p_scene; this.sceneLoadedCallback = p_sceneLoadedCallback; this.progressCallback = p_progressCallback; this.additionnalRenderLoopLogicCallback = p_additionnalRenderLoopLogicCallback; this.textureLoadingCallback = p_textureLoadingCallback; this.startingProcessingFilesCallback = p_startingProcessingFilesCallback; } FilesInput.prototype.monitorElementForDragNDrop = function (p_elementToMonitor) { var _this = this; if (p_elementToMonitor) { this.elementToMonitor = p_elementToMonitor; this.elementToMonitor.addEventListener("dragenter", function (e) { _this.drag(e); }, false); this.elementToMonitor.addEventListener("dragover", function (e) { _this.drag(e); }, false); this.elementToMonitor.addEventListener("drop", function (e) { _this.drop(e); }, false); } }; FilesInput.prototype.renderFunction = function () { if (this.additionnalRenderLoopLogicCallback) { this.additionnalRenderLoopLogicCallback(); } if (this.currentScene) { if (this.textureLoadingCallback) { var remaining = this.currentScene.getWaitingItemsCount(); if (remaining > 0) { this.textureLoadingCallback(remaining); } } this.currentScene.render(); } }; FilesInput.prototype.drag = function (e) { e.stopPropagation(); e.preventDefault(); }; FilesInput.prototype.drop = function (eventDrop) { eventDrop.stopPropagation(); eventDrop.preventDefault(); this.loadFiles(eventDrop); }; FilesInput.prototype.loadFiles = function (event) { var _this = this; var that = this; if (this.startingProcessingFilesCallback) this.startingProcessingFilesCallback(); var sceneFileToLoad; var filesToLoad; // Handling data transfer via drag'n'drop if (event && event.dataTransfer && event.dataTransfer.files) { filesToLoad = event.dataTransfer.files; } // Handling files from input files if (event && event.target && event.target.files) { filesToLoad = event.target.files; } if (filesToLoad && filesToLoad.length > 0) { for (var i = 0; i < filesToLoad.length; i++) { switch (filesToLoad[i].type) { case "image/jpeg": case "image/png": BABYLON.FilesInput.FilesTextures[filesToLoad[i].name] = filesToLoad[i]; break; case "image/targa": case "image/vnd.ms-dds": BABYLON.FilesInput.FilesToLoad[filesToLoad[i].name] = filesToLoad[i]; break; default: if (filesToLoad[i].name.indexOf(".babylon") !== -1 && filesToLoad[i].name.indexOf(".manifest") === -1 && filesToLoad[i].name.indexOf(".incremental") === -1 && filesToLoad[i].name.indexOf(".babylonmeshdata") === -1 && filesToLoad[i].name.indexOf(".babylongeometrydata") === -1) { sceneFileToLoad = filesToLoad[i]; } break; } } // If a ".babylon" file has been provided if (sceneFileToLoad) { if (this.currentScene) { this.engine.stopRenderLoop(); this.currentScene.dispose(); } BABYLON.SceneLoader.Load("file:", sceneFileToLoad, this.engine, function (newScene) { that.currentScene = newScene; // Wait for textures and shaders to be ready that.currentScene.executeWhenReady(function () { // Attach camera to canvas inputs if (that.currentScene.activeCamera) { that.currentScene.activeCamera.attachControl(that.canvas); } if (that.sceneLoadedCallback) { that.sceneLoadedCallback(sceneFileToLoad, that.currentScene); } that.engine.runRenderLoop(function () { that.renderFunction(); }); }); }, function (progress) { if (_this.progressCallback) { _this.progressCallback(progress); } }); } else { BABYLON.Tools.Error("Please provide a valid .babylon file."); } } }; FilesInput.FilesTextures = new Array(); FilesInput.FilesToLoad = new Array(); return FilesInput; })(); BABYLON.FilesInput = FilesInput; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.filesInput.js.map var BABYLON; (function (BABYLON) { var OimoJSPlugin = (function () { function OimoJSPlugin() { this._registeredMeshes = []; /** * Update the body position according to the mesh position * @param mesh */ this.updateBodyPosition = function (mesh) { for (var index = 0; index < this._registeredMeshes.length; index++) { var registeredMesh = this._registeredMeshes[index]; if (registeredMesh.mesh === mesh || registeredMesh.mesh === mesh.parent) { var body = registeredMesh.body.body; mesh.computeWorldMatrix(true); var center = mesh.getBoundingInfo().boundingBox.center; body.setPosition(center.x, center.y, center.z); body.setRotation(mesh.rotation.x, mesh.rotation.y, mesh.rotation.z); return; } // Case where the parent has been updated if (registeredMesh.mesh.parent === mesh) { mesh.computeWorldMatrix(true); registeredMesh.mesh.computeWorldMatrix(true); var absolutePosition = registeredMesh.mesh.getAbsolutePosition(); var absoluteRotation = mesh.rotation; body = registeredMesh.body.body; body.setPosition(absolutePosition.x, absolutePosition.y, absolutePosition.z); body.setRotation(absoluteRotation.x, absoluteRotation.y, absoluteRotation.z); return; } } }; } OimoJSPlugin.prototype._checkWithEpsilon = function (value) { return value < BABYLON.PhysicsEngine.Epsilon ? BABYLON.PhysicsEngine.Epsilon : value; }; OimoJSPlugin.prototype.initialize = function (iterations) { this._world = new OIMO.World(); this._world.clear(); }; OimoJSPlugin.prototype.setGravity = function (gravity) { this._world.gravity = gravity; }; OimoJSPlugin.prototype.registerMesh = function (mesh, impostor, options) { var body = null; this.unregisterMesh(mesh); mesh.computeWorldMatrix(true); switch (impostor) { case BABYLON.PhysicsEngine.SphereImpostor: var initialRotation = null; if (mesh.rotationQuaternion) { initialRotation = mesh.rotationQuaternion.clone(); mesh.rotationQuaternion = new BABYLON.Quaternion(0, 0, 0, 1); mesh.computeWorldMatrix(true); } var bbox = mesh.getBoundingInfo().boundingBox; var radiusX = bbox.maximumWorld.x - bbox.minimumWorld.x; var radiusY = bbox.maximumWorld.y - bbox.minimumWorld.y; var radiusZ = bbox.maximumWorld.z - bbox.minimumWorld.z; var size = Math.max(this._checkWithEpsilon(radiusX), this._checkWithEpsilon(radiusY), this._checkWithEpsilon(radiusZ)) / 2; // The delta between the mesh position and the mesh bounding box center var deltaPosition = mesh.position.subtract(bbox.center); // Transform delta position with the rotation if (initialRotation) { var m = new BABYLON.Matrix(); initialRotation.toRotationMatrix(m); deltaPosition = BABYLON.Vector3.TransformCoordinates(deltaPosition, m); } body = new OIMO.Body({ type: 'sphere', size: [size], pos: [bbox.center.x, bbox.center.y, bbox.center.z], rot: [mesh.rotation.x / OIMO.TO_RAD, mesh.rotation.y / OIMO.TO_RAD, mesh.rotation.z / OIMO.TO_RAD], move: options.mass != 0, config: [options.mass, options.friction, options.restitution], world: this._world }); // Restore rotation if (initialRotation) { body.setQuaternion(initialRotation); } this._registeredMeshes.push({ mesh: mesh, body: body, delta: deltaPosition }); break; case BABYLON.PhysicsEngine.PlaneImpostor: case BABYLON.PhysicsEngine.BoxImpostor: initialRotation = null; if (mesh.rotationQuaternion) { initialRotation = mesh.rotationQuaternion.clone(); mesh.rotationQuaternion = new BABYLON.Quaternion(0, 0, 0, 1); mesh.computeWorldMatrix(true); } bbox = mesh.getBoundingInfo().boundingBox; var min = bbox.minimumWorld; var max = bbox.maximumWorld; var box = max.subtract(min); var sizeX = this._checkWithEpsilon(box.x); var sizeY = this._checkWithEpsilon(box.y); var sizeZ = this._checkWithEpsilon(box.z); // The delta between the mesh position and the mesh boudning box center deltaPosition = mesh.position.subtract(bbox.center); // Transform delta position with the rotation if (initialRotation) { m = new BABYLON.Matrix(); initialRotation.toRotationMatrix(m); deltaPosition = BABYLON.Vector3.TransformCoordinates(deltaPosition, m); } body = new OIMO.Body({ type: 'box', size: [sizeX, sizeY, sizeZ], pos: [bbox.center.x, bbox.center.y, bbox.center.z], rot: [mesh.rotation.x / OIMO.TO_RAD, mesh.rotation.y / OIMO.TO_RAD, mesh.rotation.z / OIMO.TO_RAD], move: options.mass != 0, config: [options.mass, options.friction, options.restitution], world: this._world }); if (initialRotation) { body.setQuaternion(initialRotation); } this._registeredMeshes.push({ mesh: mesh, body: body, delta: deltaPosition }); break; } return body; }; OimoJSPlugin.prototype.registerMeshesAsCompound = function (parts, options) { var types = [], sizes = [], positions = [], rotations = []; var initialMesh = parts[0].mesh; for (var index = 0; index < parts.length; index++) { var part = parts[index]; var bodyParameters = this._createBodyAsCompound(part, options, initialMesh); types.push(bodyParameters.type); sizes.push.apply(sizes, bodyParameters.size); positions.push.apply(positions, bodyParameters.pos); rotations.push.apply(rotations, bodyParameters.rot); } var body = new OIMO.Body({ type: types, size: sizes, pos: positions, rot: rotations, move: options.mass != 0, config: [options.mass, options.friction, options.restitution], world: this._world }); this._registeredMeshes.push({ mesh: initialMesh, body: body }); return body; }; OimoJSPlugin.prototype._createBodyAsCompound = function (part, options, initialMesh) { var bodyParameters = null; var mesh = part.mesh; switch (part.impostor) { case BABYLON.PhysicsEngine.SphereImpostor: var bbox = mesh.getBoundingInfo().boundingBox; var radiusX = bbox.maximumWorld.x - bbox.minimumWorld.x; var radiusY = bbox.maximumWorld.y - bbox.minimumWorld.y; var radiusZ = bbox.maximumWorld.z - bbox.minimumWorld.z; var size = Math.max(this._checkWithEpsilon(radiusX), this._checkWithEpsilon(radiusY), this._checkWithEpsilon(radiusZ)) / 2; bodyParameters = { type: 'sphere', /* bug with oimo : sphere needs 3 sizes in this case */ size: [size, -1, -1], pos: [mesh.position.x, mesh.position.y, mesh.position.z], rot: [mesh.rotation.x / OIMO.TO_RAD, mesh.rotation.y / OIMO.TO_RAD, mesh.rotation.z / OIMO.TO_RAD] }; break; case BABYLON.PhysicsEngine.PlaneImpostor: case BABYLON.PhysicsEngine.BoxImpostor: bbox = mesh.getBoundingInfo().boundingBox; var min = bbox.minimumWorld; var max = bbox.maximumWorld; var box = max.subtract(min); var sizeX = this._checkWithEpsilon(box.x); var sizeY = this._checkWithEpsilon(box.y); var sizeZ = this._checkWithEpsilon(box.z); var relativePosition = mesh.position; bodyParameters = { type: 'box', size: [sizeX, sizeY, sizeZ], pos: [relativePosition.x, relativePosition.y, relativePosition.z], rot: [mesh.rotation.x / OIMO.TO_RAD, mesh.rotation.y / OIMO.TO_RAD, mesh.rotation.z / OIMO.TO_RAD] }; break; } return bodyParameters; }; OimoJSPlugin.prototype.unregisterMesh = function (mesh) { for (var index = 0; index < this._registeredMeshes.length; index++) { var registeredMesh = this._registeredMeshes[index]; if (registeredMesh.mesh === mesh || registeredMesh.mesh === mesh.parent) { if (registeredMesh.body) { this._world.removeRigidBody(registeredMesh.body.body); this._unbindBody(registeredMesh.body); } this._registeredMeshes.splice(index, 1); return; } } }; OimoJSPlugin.prototype._unbindBody = function (body) { for (var index = 0; index < this._registeredMeshes.length; index++) { var registeredMesh = this._registeredMeshes[index]; if (registeredMesh.body === body) { registeredMesh.body = null; } } }; OimoJSPlugin.prototype.applyImpulse = function (mesh, force, contactPoint) { for (var index = 0; index < this._registeredMeshes.length; index++) { var registeredMesh = this._registeredMeshes[index]; if (registeredMesh.mesh === mesh || registeredMesh.mesh === mesh.parent) { // Get object mass to have a behaviour similar to cannon.js var mass = registeredMesh.body.body.massInfo.mass; // The force is scaled with the mass of object registeredMesh.body.body.applyImpulse(contactPoint.scale(OIMO.INV_SCALE), force.scale(OIMO.INV_SCALE * mass)); return; } } }; OimoJSPlugin.prototype.createLink = function (mesh1, mesh2, pivot1, pivot2, options) { var body1 = null, body2 = null; for (var index = 0; index < this._registeredMeshes.length; index++) { var registeredMesh = this._registeredMeshes[index]; if (registeredMesh.mesh === mesh1) { body1 = registeredMesh.body.body; } else if (registeredMesh.mesh === mesh2) { body2 = registeredMesh.body.body; } } if (!body1 || !body2) { return false; } if (!options) { options = {}; } new OIMO.Link({ type: options.type, body1: body1, body2: body2, min: options.min, max: options.max, axe1: options.axe1, axe2: options.axe2, pos1: [pivot1.x, pivot1.y, pivot1.z], pos2: [pivot2.x, pivot2.y, pivot2.z], collision: options.collision, spring: options.spring, world: this._world }); return true; }; OimoJSPlugin.prototype.dispose = function () { this._world.clear(); while (this._registeredMeshes.length) { this.unregisterMesh(this._registeredMeshes[0].mesh); } }; OimoJSPlugin.prototype.isSupported = function () { return OIMO !== undefined; }; OimoJSPlugin.prototype._getLastShape = function (body) { var lastShape = body.shapes; while (lastShape.next) { lastShape = lastShape.next; } return lastShape; }; OimoJSPlugin.prototype.runOneStep = function (time) { this._world.step(); // Update the position of all registered meshes var i = this._registeredMeshes.length; var m; while (i--) { var body = this._registeredMeshes[i].body.body; var mesh = this._registeredMeshes[i].mesh; var delta = this._registeredMeshes[i].delta; if (!body.sleeping) { if (body.shapes.next) { var parentShape = this._getLastShape(body); mesh.position.x = parentShape.position.x * OIMO.WORLD_SCALE; mesh.position.y = parentShape.position.y * OIMO.WORLD_SCALE; mesh.position.z = parentShape.position.z * OIMO.WORLD_SCALE; var mtx = BABYLON.Matrix.FromArray(body.getMatrix()); if (!mesh.rotationQuaternion) { mesh.rotationQuaternion = new BABYLON.Quaternion(0, 0, 0, 1); } mesh.rotationQuaternion.fromRotationMatrix(mtx); mesh.computeWorldMatrix(); } else { m = body.getMatrix(); mtx = BABYLON.Matrix.FromArray(m); // Body position var bodyX = mtx.m[12], bodyY = mtx.m[13], bodyZ = mtx.m[14]; if (!delta) { mesh.position.x = bodyX; mesh.position.y = bodyY; mesh.position.z = bodyZ; } else { mesh.position.x = bodyX + delta.x; mesh.position.y = bodyY + delta.y; mesh.position.z = bodyZ + delta.z; } if (!mesh.rotationQuaternion) { mesh.rotationQuaternion = new BABYLON.Quaternion(0, 0, 0, 1); } mesh.rotationQuaternion.fromRotationMatrix(mtx); mesh.computeWorldMatrix(); } } } }; return OimoJSPlugin; })(); BABYLON.OimoJSPlugin = OimoJSPlugin; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.oimoJSPlugin.js.map var BABYLON; (function (BABYLON) { var PhysicsEngine = (function () { function PhysicsEngine(plugin) { this._currentPlugin = plugin || new BABYLON.OimoJSPlugin(); } PhysicsEngine.prototype._initialize = function (gravity) { this._currentPlugin.initialize(); this._setGravity(gravity); }; PhysicsEngine.prototype._runOneStep = function (delta) { if (delta > 0.1) { delta = 0.1; } else if (delta <= 0) { delta = 1.0 / 60.0; } this._currentPlugin.runOneStep(delta); }; PhysicsEngine.prototype._setGravity = function (gravity) { this.gravity = gravity || new BABYLON.Vector3(0, -9.82, 0); this._currentPlugin.setGravity(this.gravity); }; PhysicsEngine.prototype._registerMesh = function (mesh, impostor, options) { return this._currentPlugin.registerMesh(mesh, impostor, options); }; PhysicsEngine.prototype._registerMeshesAsCompound = function (parts, options) { return this._currentPlugin.registerMeshesAsCompound(parts, options); }; PhysicsEngine.prototype._unregisterMesh = function (mesh) { this._currentPlugin.unregisterMesh(mesh); }; PhysicsEngine.prototype._applyImpulse = function (mesh, force, contactPoint) { this._currentPlugin.applyImpulse(mesh, force, contactPoint); }; PhysicsEngine.prototype._createLink = function (mesh1, mesh2, pivot1, pivot2, options) { return this._currentPlugin.createLink(mesh1, mesh2, pivot1, pivot2, options); }; PhysicsEngine.prototype._updateBodyPosition = function (mesh) { this._currentPlugin.updateBodyPosition(mesh); }; PhysicsEngine.prototype.dispose = function () { this._currentPlugin.dispose(); }; PhysicsEngine.prototype.isSupported = function () { return this._currentPlugin.isSupported(); }; PhysicsEngine.NoImpostor = 0; PhysicsEngine.SphereImpostor = 1; PhysicsEngine.BoxImpostor = 2; PhysicsEngine.PlaneImpostor = 3; PhysicsEngine.MeshImpostor = 4; PhysicsEngine.CapsuleImpostor = 5; PhysicsEngine.ConeImpostor = 6; PhysicsEngine.CylinderImpostor = 7; PhysicsEngine.ConvexHullImpostor = 8; PhysicsEngine.Epsilon = 0.001; return PhysicsEngine; })(); BABYLON.PhysicsEngine = PhysicsEngine; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.physicsEngine.js.map var BABYLON; (function (BABYLON) { var serializeLight = function (light) { var serializationObject = {}; serializationObject.name = light.name; serializationObject.id = light.id; serializationObject.tags = BABYLON.Tags.GetTags(light); if (light instanceof BABYLON.PointLight) { serializationObject.type = 0; serializationObject.position = light.position.asArray(); } else if (light instanceof BABYLON.DirectionalLight) { serializationObject.type = 1; var directionalLight = light; serializationObject.position = directionalLight.position.asArray(); serializationObject.direction = directionalLight.direction.asArray(); } else if (light instanceof BABYLON.SpotLight) { serializationObject.type = 2; var spotLight = light; serializationObject.position = spotLight.position.asArray(); serializationObject.direction = spotLight.position.asArray(); serializationObject.angle = spotLight.angle; serializationObject.exponent = spotLight.exponent; } else if (light instanceof BABYLON.HemisphericLight) { serializationObject.type = 3; var hemisphericLight = light; serializationObject.direction = hemisphericLight.direction.asArray(); serializationObject.groundColor = hemisphericLight.groundColor.asArray(); } if (light.intensity) { serializationObject.intensity = light.intensity; } serializationObject.range = light.range; serializationObject.diffuse = light.diffuse.asArray(); serializationObject.specular = light.specular.asArray(); return serializationObject; }; var serializeFresnelParameter = function (fresnelParameter) { var serializationObject = {}; serializationObject.isEnabled = fresnelParameter.isEnabled; serializationObject.leftColor = fresnelParameter.leftColor; serializationObject.rightColor = fresnelParameter.rightColor; serializationObject.bias = fresnelParameter.bias; serializationObject.power = fresnelParameter.power; return serializationObject; }; var serializeCamera = function (camera) { var serializationObject = {}; serializationObject.name = camera.name; serializationObject.tags = BABYLON.Tags.GetTags(camera); serializationObject.id = camera.id; serializationObject.position = camera.position.asArray(); // Parent if (camera.parent) { serializationObject.parentId = camera.parent.id; } // Target serializationObject.rotation = camera.rotation.asArray(); // Locked target if (camera.lockedTarget && camera.lockedTarget.id) { serializationObject.lockedTargetId = camera.lockedTarget.id; } serializationObject.fov = camera.fov; serializationObject.minZ = camera.minZ; serializationObject.maxZ = camera.maxZ; serializationObject.speed = camera.speed; serializationObject.inertia = camera.inertia; serializationObject.checkCollisions = camera.checkCollisions; serializationObject.applyGravity = camera.applyGravity; if (camera.ellipsoid) { serializationObject.ellipsoid = camera.ellipsoid.asArray(); } // Animations appendAnimations(camera, serializationObject); // Layer mask serializationObject.layerMask = camera.layerMask; return serializationObject; }; var appendAnimations = function (source, destination) { if (source.animations) { destination.animations = []; for (var animationIndex = 0; animationIndex < source.animations.length; animationIndex++) { var animation = source.animations[animationIndex]; destination.animations.push(serializeAnimation(animation)); } } }; var serializeAnimation = function (animation) { var serializationObject = {}; serializationObject.name = animation.name; serializationObject.property = animation.targetProperty; serializationObject.framePerSecond = animation.framePerSecond; serializationObject.dataType = animation.dataType; serializationObject.loopBehavior = animation.loopMode; var dataType = animation.dataType; serializationObject.keys = []; var keys = animation.getKeys(); for (var index = 0; index < keys.length; index++) { var animationKey = keys[index]; var key = {}; key.frame = animationKey.frame; switch (dataType) { case BABYLON.Animation.ANIMATIONTYPE_FLOAT: key.values = [animationKey.value]; break; case BABYLON.Animation.ANIMATIONTYPE_QUATERNION: case BABYLON.Animation.ANIMATIONTYPE_MATRIX: case BABYLON.Animation.ANIMATIONTYPE_VECTOR3: key.values = animationKey.value.asArray(); break; } serializationObject.keys.push(key); } return serializationObject; }; var serializeMultiMaterial = function (material) { var serializationObject = {}; serializationObject.name = material.name; serializationObject.id = material.id; serializationObject.tags = BABYLON.Tags.GetTags(material); serializationObject.materials = []; for (var matIndex = 0; matIndex < material.subMaterials.length; matIndex++) { var subMat = material.subMaterials[matIndex]; if (subMat) { serializationObject.materials.push(subMat.id); } else { serializationObject.materials.push(null); } } return serializationObject; }; var serializeMaterial = function (material) { var serializationObject = {}; serializationObject.name = material.name; serializationObject.ambient = material.ambientColor.asArray(); serializationObject.diffuse = material.diffuseColor.asArray(); serializationObject.specular = material.specularColor.asArray(); serializationObject.specularPower = material.specularPower; serializationObject.emissive = material.emissiveColor.asArray(); serializationObject.alpha = material.alpha; serializationObject.id = material.id; serializationObject.tags = BABYLON.Tags.GetTags(material); serializationObject.backFaceCulling = material.backFaceCulling; if (material.diffuseTexture) { serializationObject.diffuseTexture = serializeTexture(material.diffuseTexture); } if (material.diffuseFresnelParameters) { serializationObject.diffuseFresnelParameters = serializeFresnelParameter(material.diffuseFresnelParameters); } if (material.ambientTexture) { serializationObject.ambientTexture = serializeTexture(material.ambientTexture); } if (material.opacityTexture) { serializationObject.opacityTexture = serializeTexture(material.opacityTexture); } if (material.opacityFresnelParameters) { serializationObject.opacityFresnelParameters = serializeFresnelParameter(material.opacityFresnelParameters); } if (material.reflectionTexture) { serializationObject.reflectionTexture = serializeTexture(material.reflectionTexture); } if (material.reflectionFresnelParameters) { serializationObject.reflectionFresnelParameters = serializeFresnelParameter(material.reflectionFresnelParameters); } if (material.emissiveTexture) { serializationObject.emissiveTexture = serializeTexture(material.emissiveTexture); } if (material.emissiveFresnelParameters) { serializationObject.emissiveFresnelParameters = serializeFresnelParameter(material.emissiveFresnelParameters); } if (material.specularTexture) { serializationObject.specularTexture = serializeTexture(material.specularTexture); } if (material.bumpTexture) { serializationObject.bumpTexture = serializeTexture(material.bumpTexture); } return serializationObject; }; var serializeTexture = function (texture) { var serializationObject = {}; if (!texture.name) { return null; } if (texture instanceof BABYLON.CubeTexture) { serializationObject.name = texture.name; serializationObject.hasAlpha = texture.hasAlpha; serializationObject.level = texture.level; serializationObject.coordinatesMode = texture.coordinatesMode; return serializationObject; } if (texture instanceof BABYLON.MirrorTexture) { var mirrorTexture = texture; serializationObject.renderTargetSize = mirrorTexture.getRenderSize(); serializationObject.renderList = []; for (var index = 0; index < mirrorTexture.renderList.length; index++) { serializationObject.renderList.push(mirrorTexture.renderList[index].id); } serializationObject.mirrorPlane = mirrorTexture.mirrorPlane.asArray(); } else if (texture instanceof BABYLON.RenderTargetTexture) { var renderTargetTexture = texture; serializationObject.renderTargetSize = renderTargetTexture.getRenderSize(); serializationObject.renderList = []; for (index = 0; index < renderTargetTexture.renderList.length; index++) { serializationObject.renderList.push(renderTargetTexture.renderList[index].id); } } var regularTexture = texture; serializationObject.name = texture.name; serializationObject.hasAlpha = texture.hasAlpha; serializationObject.level = texture.level; serializationObject.coordinatesIndex = texture.coordinatesIndex; serializationObject.coordinatesMode = texture.coordinatesMode; serializationObject.uOffset = regularTexture.uOffset; serializationObject.vOffset = regularTexture.vOffset; serializationObject.uScale = regularTexture.uScale; serializationObject.vScale = regularTexture.vScale; serializationObject.uAng = regularTexture.uAng; serializationObject.vAng = regularTexture.vAng; serializationObject.wAng = regularTexture.wAng; serializationObject.wrapU = texture.wrapU; serializationObject.wrapV = texture.wrapV; // Animations appendAnimations(texture, serializationObject); return serializationObject; }; var serializeSkeleton = function (skeleton) { var serializationObject = {}; serializationObject.name = skeleton.name; serializationObject.id = skeleton.id; serializationObject.bones = []; for (var index = 0; index < skeleton.bones.length; index++) { var bone = skeleton.bones[index]; var serializedBone = { parentBoneIndex: bone.getParent() ? skeleton.bones.indexOf(bone.getParent()) : -1, name: bone.name, matrix: bone.getLocalMatrix().toArray() }; serializationObject.bones.push(serializedBone); if (bone.animations && bone.animations.length > 0) { serializedBone.animation = serializeAnimation(bone.animations[0]); } } return serializationObject; }; var serializeParticleSystem = function (particleSystem) { var serializationObject = {}; serializationObject.emitterId = particleSystem.emitter.id; serializationObject.capacity = particleSystem.getCapacity(); if (particleSystem.particleTexture) { serializationObject.textureName = particleSystem.particleTexture.name; } serializationObject.minAngularSpeed = particleSystem.minAngularSpeed; serializationObject.maxAngularSpeed = particleSystem.maxAngularSpeed; serializationObject.minSize = particleSystem.minSize; serializationObject.maxSize = particleSystem.maxSize; serializationObject.minLifeTime = particleSystem.minLifeTime; serializationObject.maxLifeTime = particleSystem.maxLifeTime; serializationObject.emitRate = particleSystem.emitRate; serializationObject.minEmitBox = particleSystem.minEmitBox.asArray(); serializationObject.maxEmitBox = particleSystem.maxEmitBox.asArray(); serializationObject.gravity = particleSystem.gravity.asArray(); serializationObject.direction1 = particleSystem.direction1.asArray(); serializationObject.direction2 = particleSystem.direction2.asArray(); serializationObject.color1 = particleSystem.color1.asArray(); serializationObject.color2 = particleSystem.color2.asArray(); serializationObject.colorDead = particleSystem.colorDead.asArray(); serializationObject.updateSpeed = particleSystem.updateSpeed; serializationObject.targetStopDuration = particleSystem.targetStopDuration; serializationObject.textureMask = particleSystem.textureMask.asArray(); serializationObject.blendMode = particleSystem.blendMode; return serializationObject; }; var serializeLensFlareSystem = function (lensFlareSystem) { var serializationObject = {}; serializationObject.emitterId = lensFlareSystem.getEmitter().id; serializationObject.borderLimit = lensFlareSystem.borderLimit; serializationObject.flares = []; for (var index = 0; index < lensFlareSystem.lensFlares.length; index++) { var flare = lensFlareSystem.lensFlares[index]; serializationObject.flares.push({ size: flare.size, position: flare.position, color: flare.color.asArray(), textureName: BABYLON.Tools.GetFilename(flare.texture.name) }); } return serializationObject; }; var serializeShadowGenerator = function (light) { var serializationObject = {}; var shadowGenerator = light.getShadowGenerator(); serializationObject.lightId = light.id; serializationObject.mapSize = shadowGenerator.getShadowMap().getRenderSize(); serializationObject.useVarianceShadowMap = shadowGenerator.useVarianceShadowMap; serializationObject.usePoissonSampling = shadowGenerator.usePoissonSampling; serializationObject.renderList = []; for (var meshIndex = 0; meshIndex < shadowGenerator.getShadowMap().renderList.length; meshIndex++) { var mesh = shadowGenerator.getShadowMap().renderList[meshIndex]; serializationObject.renderList.push(mesh.id); } return serializationObject; }; var serializedGeometries = []; var serializeGeometry = function (geometry, serializationGeometries) { if (serializedGeometries[geometry.id]) { return; } if (geometry instanceof BABYLON.Geometry.Primitives.Box) { serializationGeometries.boxes.push(serializeBox(geometry)); } else if (geometry instanceof BABYLON.Geometry.Primitives.Sphere) { serializationGeometries.spheres.push(serializeSphere(geometry)); } else if (geometry instanceof BABYLON.Geometry.Primitives.Cylinder) { serializationGeometries.cylinders.push(serializeCylinder(geometry)); } else if (geometry instanceof BABYLON.Geometry.Primitives.Torus) { serializationGeometries.toruses.push(serializeTorus(geometry)); } else if (geometry instanceof BABYLON.Geometry.Primitives.Ground) { serializationGeometries.grounds.push(serializeGround(geometry)); } else if (geometry instanceof BABYLON.Geometry.Primitives.Plane) { serializationGeometries.planes.push(serializePlane(geometry)); } else if (geometry instanceof BABYLON.Geometry.Primitives.TorusKnot) { serializationGeometries.torusKnots.push(serializeTorusKnot(geometry)); } else if (geometry instanceof BABYLON.Geometry.Primitives._Primitive) { throw new Error("Unknow primitive type"); } else { serializationGeometries.vertexData.push(serializeVertexData(geometry)); } serializedGeometries[geometry.id] = true; }; var serializeGeometryBase = function (geometry) { var serializationObject = {}; serializationObject.id = geometry.id; if (BABYLON.Tags.HasTags(geometry)) { serializationObject.tags = BABYLON.Tags.GetTags(geometry); } return serializationObject; }; var serializeVertexData = function (vertexData) { var serializationObject = serializeGeometryBase(vertexData); if (vertexData.isVerticesDataPresent(BABYLON.VertexBuffer.PositionKind)) { serializationObject.positions = vertexData.getVerticesData(BABYLON.VertexBuffer.PositionKind); } if (vertexData.isVerticesDataPresent(BABYLON.VertexBuffer.NormalKind)) { serializationObject.normals = vertexData.getVerticesData(BABYLON.VertexBuffer.NormalKind); } if (vertexData.isVerticesDataPresent(BABYLON.VertexBuffer.UVKind)) { serializationObject.uvs = vertexData.getVerticesData(BABYLON.VertexBuffer.UVKind); } if (vertexData.isVerticesDataPresent(BABYLON.VertexBuffer.UV2Kind)) { serializationObject.uvs2 = vertexData.getVerticesData(BABYLON.VertexBuffer.UV2Kind); } if (vertexData.isVerticesDataPresent(BABYLON.VertexBuffer.ColorKind)) { serializationObject.colors = vertexData.getVerticesData(BABYLON.VertexBuffer.ColorKind); } if (vertexData.isVerticesDataPresent(BABYLON.VertexBuffer.MatricesIndicesKind)) { serializationObject.matricesIndices = vertexData.getVerticesData(BABYLON.VertexBuffer.MatricesIndicesKind); serializationObject.matricesIndices._isExpanded = true; } if (vertexData.isVerticesDataPresent(BABYLON.VertexBuffer.MatricesWeightsKind)) { serializationObject.matricesWeights = vertexData.getVerticesData(BABYLON.VertexBuffer.MatricesWeightsKind); } serializationObject.indices = vertexData.getIndices(); return serializationObject; }; var serializePrimitive = function (primitive) { var serializationObject = serializeGeometryBase(primitive); serializationObject.canBeRegenerated = primitive.canBeRegenerated(); return serializationObject; }; var serializeBox = function (box) { var serializationObject = serializePrimitive(box); serializationObject.size = box.size; return serializationObject; }; var serializeSphere = function (sphere) { var serializationObject = serializePrimitive(sphere); serializationObject.segments = sphere.segments; serializationObject.diameter = sphere.diameter; return serializationObject; }; var serializeCylinder = function (cylinder) { var serializationObject = serializePrimitive(cylinder); serializationObject.height = cylinder.height; serializationObject.diameterTop = cylinder.diameterTop; serializationObject.diameterBottom = cylinder.diameterBottom; serializationObject.tessellation = cylinder.tessellation; return serializationObject; }; var serializeTorus = function (torus) { var serializationObject = serializePrimitive(torus); serializationObject.diameter = torus.diameter; serializationObject.thickness = torus.thickness; serializationObject.tessellation = torus.tessellation; return serializationObject; }; var serializeGround = function (ground) { var serializationObject = serializePrimitive(ground); serializationObject.width = ground.width; serializationObject.height = ground.height; serializationObject.subdivisions = ground.subdivisions; return serializationObject; }; var serializePlane = function (plane) { var serializationObject = serializePrimitive(plane); serializationObject.size = plane.size; return serializationObject; }; var serializeTorusKnot = function (torusKnot) { var serializationObject = serializePrimitive(torusKnot); serializationObject.radius = torusKnot.radius; serializationObject.tube = torusKnot.tube; serializationObject.radialSegments = torusKnot.radialSegments; serializationObject.tubularSegments = torusKnot.tubularSegments; serializationObject.p = torusKnot.p; serializationObject.q = torusKnot.q; return serializationObject; }; var serializeMesh = function (mesh, serializationScene) { var serializationObject = {}; serializationObject.name = mesh.name; serializationObject.id = mesh.id; if (BABYLON.Tags.HasTags(mesh)) { serializationObject.tags = BABYLON.Tags.GetTags(mesh); } serializationObject.position = mesh.position.asArray(); if (mesh.rotationQuaternion) { serializationObject.rotationQuaternion = mesh.rotationQuaternion.asArray(); } else if (mesh.rotation) { serializationObject.rotation = mesh.rotation.asArray(); } serializationObject.scaling = mesh.scaling.asArray(); serializationObject.localMatrix = mesh.getPivotMatrix().asArray(); serializationObject.isEnabled = mesh.isEnabled(); serializationObject.isVisible = mesh.isVisible; serializationObject.infiniteDistance = mesh.infiniteDistance; serializationObject.pickable = mesh.isPickable; serializationObject.receiveShadows = mesh.receiveShadows; serializationObject.billboardMode = mesh.billboardMode; serializationObject.visibility = mesh.visibility; serializationObject.checkCollisions = mesh.checkCollisions; // Parent if (mesh.parent) { serializationObject.parentId = mesh.parent.id; } // Geometry var geometry = mesh._geometry; if (geometry) { var geometryId = geometry.id; serializationObject.geometryId = geometryId; if (!mesh.getScene().getGeometryByID(geometryId)) { // geometry was in the memory but not added to the scene, nevertheless it's better to serialize too be able to reload the mesh with its geometry serializeGeometry(geometry, serializationScene.geometries); } // SubMeshes serializationObject.subMeshes = []; for (var subIndex = 0; subIndex < mesh.subMeshes.length; subIndex++) { var subMesh = mesh.subMeshes[subIndex]; serializationObject.subMeshes.push({ materialIndex: subMesh.materialIndex, verticesStart: subMesh.verticesStart, verticesCount: subMesh.verticesCount, indexStart: subMesh.indexStart, indexCount: subMesh.indexCount }); } } // Material if (mesh.material) { serializationObject.materialId = mesh.material.id; } else { mesh.material = null; } // Skeleton if (mesh.skeleton) { serializationObject.skeletonId = mesh.skeleton.id; } // Physics if (mesh.getPhysicsImpostor() !== BABYLON.PhysicsEngine.NoImpostor) { serializationObject.physicsMass = mesh.getPhysicsMass(); serializationObject.physicsFriction = mesh.getPhysicsFriction(); serializationObject.physicsRestitution = mesh.getPhysicsRestitution(); switch (mesh.getPhysicsImpostor()) { case BABYLON.PhysicsEngine.BoxImpostor: serializationObject.physicsImpostor = 1; break; case BABYLON.PhysicsEngine.SphereImpostor: serializationObject.physicsImpostor = 2; break; } } // Instances serializationObject.instances = []; for (var index = 0; index < mesh.instances.length; index++) { var instance = mesh.instances[index]; var serializationInstance = { name: instance.name, position: instance.position, rotation: instance.rotation, rotationQuaternion: instance.rotationQuaternion, scaling: instance.scaling }; serializationObject.instances.push(serializationInstance); // Animations appendAnimations(instance, serializationInstance); } // Animations appendAnimations(mesh, serializationObject); // Layer mask serializationObject.layerMask = mesh.layerMask; return serializationObject; }; var SceneSerializer = (function () { function SceneSerializer() { } SceneSerializer.Serialize = function (scene) { var serializationObject = {}; // Scene serializationObject.useDelayedTextureLoading = scene.useDelayedTextureLoading; serializationObject.autoClear = scene.autoClear; serializationObject.clearColor = scene.clearColor.asArray(); serializationObject.ambientColor = scene.ambientColor.asArray(); serializationObject.gravity = scene.gravity.asArray(); // Fog if (scene.fogMode && scene.fogMode !== 0) { serializationObject.fogMode = scene.fogMode; serializationObject.fogColor = scene.fogColor.asArray(); serializationObject.fogStart = scene.fogStart; serializationObject.fogEnd = scene.fogEnd; serializationObject.fogDensity = scene.fogDensity; } // Lights serializationObject.lights = []; for (var index = 0; index < scene.lights.length; index++) { var light = scene.lights[index]; serializationObject.lights.push(serializeLight(light)); } // Cameras serializationObject.cameras = []; for (index = 0; index < scene.cameras.length; index++) { var camera = scene.cameras[index]; if (camera instanceof BABYLON.FreeCamera) { serializationObject.cameras.push(serializeCamera(camera)); } } if (scene.activeCamera) { serializationObject.activeCameraID = scene.activeCamera.id; } // Materials serializationObject.materials = []; serializationObject.multiMaterials = []; for (index = 0; index < scene.materials.length; index++) { var material = scene.materials[index]; if (material instanceof BABYLON.StandardMaterial) { serializationObject.materials.push(serializeMaterial(material)); } else if (material instanceof BABYLON.MultiMaterial) { serializationObject.multiMaterials.push(serializeMultiMaterial(material)); } } // Skeletons serializationObject.skeletons = []; for (index = 0; index < scene.skeletons.length; index++) { serializationObject.skeletons.push(serializeSkeleton(scene.skeletons[index])); } // Geometries serializationObject.geometries = {}; serializationObject.geometries.boxes = []; serializationObject.geometries.spheres = []; serializationObject.geometries.cylinders = []; serializationObject.geometries.toruses = []; serializationObject.geometries.grounds = []; serializationObject.geometries.planes = []; serializationObject.geometries.torusKnots = []; serializationObject.geometries.vertexData = []; serializedGeometries = []; var geometries = scene.getGeometries(); for (var index = 0; index < geometries.length; index++) { var geometry = geometries[index]; if (geometry.isReady()) { serializeGeometry(geometry, serializationObject.geometries); } } // Meshes serializationObject.meshes = []; for (index = 0; index < scene.meshes.length; index++) { var abstractMesh = scene.meshes[index]; if (abstractMesh instanceof BABYLON.Mesh) { var mesh = abstractMesh; if (mesh.delayLoadState === BABYLON.Engine.DELAYLOADSTATE_LOADED || mesh.delayLoadState === BABYLON.Engine.DELAYLOADSTATE_NONE) { serializationObject.meshes.push(serializeMesh(mesh, serializationObject)); } } } // Particles Systems serializationObject.particleSystems = []; for (index = 0; index < scene.particleSystems.length; index++) { serializationObject.particleSystems.push(serializeParticleSystem(scene.particleSystems[index])); } // Lens flares serializationObject.lensFlareSystems = []; for (index = 0; index < scene.lensFlareSystems.length; index++) { serializationObject.lensFlareSystems.push(serializeLensFlareSystem(scene.lensFlareSystems[index])); } // Shadows serializationObject.shadowGenerators = []; for (index = 0; index < scene.lights.length; index++) { light = scene.lights[index]; if (light.getShadowGenerator()) { serializationObject.shadowGenerators.push(serializeShadowGenerator(light)); } } return serializationObject; }; return SceneSerializer; })(); BABYLON.SceneSerializer = SceneSerializer; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.sceneSerializer.js.map var BABYLON; (function (BABYLON) { var SceneLoader = (function () { function SceneLoader() { } Object.defineProperty(SceneLoader, "ForceFullSceneLoadingForIncremental", { get: function () { return SceneLoader._ForceFullSceneLoadingForIncremental; }, set: function (value) { SceneLoader._ForceFullSceneLoadingForIncremental = value; }, enumerable: true, configurable: true }); Object.defineProperty(SceneLoader, "ShowLoadingScreen", { get: function () { return SceneLoader._ShowLoadingScreen; }, set: function (value) { SceneLoader._ShowLoadingScreen = value; }, enumerable: true, configurable: true }); SceneLoader._getPluginForFilename = function (sceneFilename) { var dotPosition = sceneFilename.lastIndexOf("."); var queryStringPosition = sceneFilename.indexOf("?"); var extension = sceneFilename.substring(dotPosition, queryStringPosition).toLowerCase(); for (var index = 0; index < this._registeredPlugins.length; index++) { var plugin = this._registeredPlugins[index]; if (plugin.extensions.indexOf(extension) !== -1) { return plugin; } } return this._registeredPlugins[this._registeredPlugins.length - 1]; }; // Public functions SceneLoader.RegisterPlugin = function (plugin) { plugin.extensions = plugin.extensions.toLowerCase(); SceneLoader._registeredPlugins.push(plugin); }; SceneLoader.ImportMesh = function (meshesNames, rootUrl, sceneFilename, scene, onsuccess, progressCallBack, onerror) { var manifestChecked = function (success) { scene.database = database; var plugin = SceneLoader._getPluginForFilename(sceneFilename); var importMeshFromData = function (data) { var meshes = []; var particleSystems = []; var skeletons = []; try { if (!plugin.importMesh(meshesNames, scene, data, rootUrl, meshes, particleSystems, skeletons)) { if (onerror) { onerror(scene, 'unable to load the scene'); } return; } } catch (e) { if (onerror) { onerror(scene, e); } return; } if (onsuccess) { scene.importedMeshesFiles.push(rootUrl + sceneFilename); onsuccess(meshes, particleSystems, skeletons); } }; if (sceneFilename.substr && sceneFilename.substr(0, 5) === "data:") { // Direct load importMeshFromData(sceneFilename.substr(5)); return; } BABYLON.Tools.LoadFile(rootUrl + sceneFilename, function (data) { importMeshFromData(data); }, progressCallBack, database); }; // Checking if a manifest file has been set for this scene and if offline mode has been requested var database = new BABYLON.Database(rootUrl + sceneFilename, manifestChecked); }; /** * Load a scene * @param rootUrl a string that defines the root url for scene and resources * @param sceneFilename a string that defines the name of the scene file. can start with "data:" following by the stringified version of the scene * @param engine is the instance of BABYLON.Engine to use to create the scene */ SceneLoader.Load = function (rootUrl, sceneFilename, engine, onsuccess, progressCallBack, onerror) { SceneLoader.Append(rootUrl, sceneFilename, new BABYLON.Scene(engine), onsuccess, progressCallBack, onerror); }; /** * Append a scene * @param rootUrl a string that defines the root url for scene and resources * @param sceneFilename a string that defines the name of the scene file. can start with "data:" following by the stringified version of the scene * @param scene is the instance of BABYLON.Scene to append to */ SceneLoader.Append = function (rootUrl, sceneFilename, scene, onsuccess, progressCallBack, onerror) { var plugin = this._getPluginForFilename(sceneFilename.name || sceneFilename); var database; if (SceneLoader.ShowLoadingScreen) { scene.getEngine().displayLoadingUI(); } var loadSceneFromData = function (data) { scene.database = database; if (!plugin.load(scene, data, rootUrl)) { if (onerror) { onerror(scene); } scene.getEngine().hideLoadingUI(); return; } if (onsuccess) { onsuccess(scene); } if (SceneLoader.ShowLoadingScreen) { scene.executeWhenReady(function () { scene.getEngine().hideLoadingUI(); }); } }; var manifestChecked = function (success) { BABYLON.Tools.LoadFile(rootUrl + sceneFilename, loadSceneFromData, progressCallBack, database); }; if (sceneFilename.substr && sceneFilename.substr(0, 5) === "data:") { // Direct load loadSceneFromData(sceneFilename.substr(5)); return; } if (rootUrl.indexOf("file:") === -1) { // Checking if a manifest file has been set for this scene and if offline mode has been requested database = new BABYLON.Database(rootUrl + sceneFilename, manifestChecked); } else { BABYLON.Tools.ReadFile(sceneFilename, loadSceneFromData, progressCallBack); } }; SceneLoader._ForceFullSceneLoadingForIncremental = false; SceneLoader._ShowLoadingScreen = true; SceneLoader._registeredPlugins = new Array(); return SceneLoader; })(); BABYLON.SceneLoader = SceneLoader; ; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.sceneLoader.js.map var BABYLON; (function (BABYLON) { (function (Internals) { var checkColors4 = function (colors, count) { // Check if color3 was used if (colors.length === count * 3) { var colors4 = []; for (var index = 0; index < colors.length; index += 3) { var newIndex = (index / 3) * 4; colors4[newIndex] = colors[index]; colors4[newIndex + 1] = colors[index + 1]; colors4[newIndex + 2] = colors[index + 2]; colors4[newIndex + 3] = 1.0; } return colors4; } return colors; }; var loadCubeTexture = function (rootUrl, parsedTexture, scene) { var texture = new BABYLON.CubeTexture(rootUrl + parsedTexture.name, scene); texture.name = parsedTexture.name; texture.hasAlpha = parsedTexture.hasAlpha; texture.level = parsedTexture.level; texture.coordinatesMode = parsedTexture.coordinatesMode; return texture; }; var loadTexture = function (rootUrl, parsedTexture, scene) { if (!parsedTexture.name && !parsedTexture.isRenderTarget) { return null; } if (parsedTexture.isCube) { return loadCubeTexture(rootUrl, parsedTexture, scene); } var texture; if (parsedTexture.mirrorPlane) { texture = new BABYLON.MirrorTexture(parsedTexture.name, parsedTexture.renderTargetSize, scene); texture._waitingRenderList = parsedTexture.renderList; texture.mirrorPlane = BABYLON.Plane.FromArray(parsedTexture.mirrorPlane); } else if (parsedTexture.isRenderTarget) { texture = new BABYLON.RenderTargetTexture(parsedTexture.name, parsedTexture.renderTargetSize, scene); texture._waitingRenderList = parsedTexture.renderList; } else { texture = new BABYLON.Texture(rootUrl + parsedTexture.name, scene); } texture.name = parsedTexture.name; texture.hasAlpha = parsedTexture.hasAlpha; texture.getAlphaFromRGB = parsedTexture.getAlphaFromRGB; texture.level = parsedTexture.level; texture.coordinatesIndex = parsedTexture.coordinatesIndex; texture.coordinatesMode = parsedTexture.coordinatesMode; texture.uOffset = parsedTexture.uOffset; texture.vOffset = parsedTexture.vOffset; texture.uScale = parsedTexture.uScale; texture.vScale = parsedTexture.vScale; texture.uAng = parsedTexture.uAng; texture.vAng = parsedTexture.vAng; texture.wAng = parsedTexture.wAng; texture.wrapU = parsedTexture.wrapU; texture.wrapV = parsedTexture.wrapV; // Animations if (parsedTexture.animations) { for (var animationIndex = 0; animationIndex < parsedTexture.animations.length; animationIndex++) { var parsedAnimation = parsedTexture.animations[animationIndex]; texture.animations.push(parseAnimation(parsedAnimation)); } } return texture; }; var parseSkeleton = function (parsedSkeleton, scene) { var skeleton = new BABYLON.Skeleton(parsedSkeleton.name, parsedSkeleton.id, scene); for (var index = 0; index < parsedSkeleton.bones.length; index++) { var parsedBone = parsedSkeleton.bones[index]; var parentBone = null; if (parsedBone.parentBoneIndex > -1) { parentBone = skeleton.bones[parsedBone.parentBoneIndex]; } var bone = new BABYLON.Bone(parsedBone.name, skeleton, parentBone, BABYLON.Matrix.FromArray(parsedBone.matrix)); if (parsedBone.animation) { bone.animations.push(parseAnimation(parsedBone.animation)); } } return skeleton; }; var parseFresnelParameters = function (parsedFresnelParameters) { var fresnelParameters = new BABYLON.FresnelParameters(); fresnelParameters.isEnabled = parsedFresnelParameters.isEnabled; fresnelParameters.leftColor = BABYLON.Color3.FromArray(parsedFresnelParameters.leftColor); fresnelParameters.rightColor = BABYLON.Color3.FromArray(parsedFresnelParameters.rightColor); fresnelParameters.bias = parsedFresnelParameters.bias; fresnelParameters.power = parsedFresnelParameters.power || 1.0; return fresnelParameters; }; var parseMaterial = function (parsedMaterial, scene, rootUrl) { var material; material = new BABYLON.StandardMaterial(parsedMaterial.name, scene); material.ambientColor = BABYLON.Color3.FromArray(parsedMaterial.ambient); material.diffuseColor = BABYLON.Color3.FromArray(parsedMaterial.diffuse); material.specularColor = BABYLON.Color3.FromArray(parsedMaterial.specular); material.specularPower = parsedMaterial.specularPower; material.emissiveColor = BABYLON.Color3.FromArray(parsedMaterial.emissive); material.alpha = parsedMaterial.alpha; material.id = parsedMaterial.id; BABYLON.Tags.AddTagsTo(material, parsedMaterial.tags); material.backFaceCulling = parsedMaterial.backFaceCulling; material.wireframe = parsedMaterial.wireframe; if (parsedMaterial.diffuseTexture) { material.diffuseTexture = loadTexture(rootUrl, parsedMaterial.diffuseTexture, scene); } if (parsedMaterial.diffuseFresnelParameters) { material.diffuseFresnelParameters = parseFresnelParameters(parsedMaterial.diffuseFresnelParameters); } if (parsedMaterial.ambientTexture) { material.ambientTexture = loadTexture(rootUrl, parsedMaterial.ambientTexture, scene); } if (parsedMaterial.opacityTexture) { material.opacityTexture = loadTexture(rootUrl, parsedMaterial.opacityTexture, scene); } if (parsedMaterial.opacityFresnelParameters) { material.opacityFresnelParameters = parseFresnelParameters(parsedMaterial.opacityFresnelParameters); } if (parsedMaterial.reflectionTexture) { material.reflectionTexture = loadTexture(rootUrl, parsedMaterial.reflectionTexture, scene); } if (parsedMaterial.reflectionFresnelParameters) { material.reflectionFresnelParameters = parseFresnelParameters(parsedMaterial.reflectionFresnelParameters); } if (parsedMaterial.emissiveTexture) { material.emissiveTexture = loadTexture(rootUrl, parsedMaterial.emissiveTexture, scene); } if (parsedMaterial.emissiveFresnelParameters) { material.emissiveFresnelParameters = parseFresnelParameters(parsedMaterial.emissiveFresnelParameters); } if (parsedMaterial.specularTexture) { material.specularTexture = loadTexture(rootUrl, parsedMaterial.specularTexture, scene); } if (parsedMaterial.bumpTexture) { material.bumpTexture = loadTexture(rootUrl, parsedMaterial.bumpTexture, scene); } return material; }; var parseMaterialById = function (id, parsedData, scene, rootUrl) { for (var index = 0; index < parsedData.materials.length; index++) { var parsedMaterial = parsedData.materials[index]; if (parsedMaterial.id === id) { return parseMaterial(parsedMaterial, scene, rootUrl); } } return null; }; var parseMultiMaterial = function (parsedMultiMaterial, scene) { var multiMaterial = new BABYLON.MultiMaterial(parsedMultiMaterial.name, scene); multiMaterial.id = parsedMultiMaterial.id; BABYLON.Tags.AddTagsTo(multiMaterial, parsedMultiMaterial.tags); for (var matIndex = 0; matIndex < parsedMultiMaterial.materials.length; matIndex++) { var subMatId = parsedMultiMaterial.materials[matIndex]; if (subMatId) { multiMaterial.subMaterials.push(scene.getMaterialByID(subMatId)); } else { multiMaterial.subMaterials.push(null); } } return multiMaterial; }; var parseLensFlareSystem = function (parsedLensFlareSystem, scene, rootUrl) { var emitter = scene.getLastEntryByID(parsedLensFlareSystem.emitterId); var lensFlareSystem = new BABYLON.LensFlareSystem("lensFlareSystem#" + parsedLensFlareSystem.emitterId, emitter, scene); lensFlareSystem.borderLimit = parsedLensFlareSystem.borderLimit; for (var index = 0; index < parsedLensFlareSystem.flares.length; index++) { var parsedFlare = parsedLensFlareSystem.flares[index]; var flare = new BABYLON.LensFlare(parsedFlare.size, parsedFlare.position, BABYLON.Color3.FromArray(parsedFlare.color), rootUrl + parsedFlare.textureName, lensFlareSystem); } return lensFlareSystem; }; var parseParticleSystem = function (parsedParticleSystem, scene, rootUrl) { var emitter = scene.getLastMeshByID(parsedParticleSystem.emitterId); var particleSystem = new BABYLON.ParticleSystem("particles#" + emitter.name, parsedParticleSystem.capacity, scene); if (parsedParticleSystem.textureName) { particleSystem.particleTexture = new BABYLON.Texture(rootUrl + parsedParticleSystem.textureName, scene); particleSystem.particleTexture.name = parsedParticleSystem.textureName; } particleSystem.minAngularSpeed = parsedParticleSystem.minAngularSpeed; particleSystem.maxAngularSpeed = parsedParticleSystem.maxAngularSpeed; particleSystem.minSize = parsedParticleSystem.minSize; particleSystem.maxSize = parsedParticleSystem.maxSize; particleSystem.minLifeTime = parsedParticleSystem.minLifeTime; particleSystem.maxLifeTime = parsedParticleSystem.maxLifeTime; particleSystem.emitter = emitter; particleSystem.emitRate = parsedParticleSystem.emitRate; particleSystem.minEmitBox = BABYLON.Vector3.FromArray(parsedParticleSystem.minEmitBox); particleSystem.maxEmitBox = BABYLON.Vector3.FromArray(parsedParticleSystem.maxEmitBox); particleSystem.gravity = BABYLON.Vector3.FromArray(parsedParticleSystem.gravity); particleSystem.direction1 = BABYLON.Vector3.FromArray(parsedParticleSystem.direction1); particleSystem.direction2 = BABYLON.Vector3.FromArray(parsedParticleSystem.direction2); particleSystem.color1 = BABYLON.Color4.FromArray(parsedParticleSystem.color1); particleSystem.color2 = BABYLON.Color4.FromArray(parsedParticleSystem.color2); particleSystem.colorDead = BABYLON.Color4.FromArray(parsedParticleSystem.colorDead); particleSystem.updateSpeed = parsedParticleSystem.updateSpeed; particleSystem.targetStopDuration = parsedParticleSystem.targetStopFrame; particleSystem.textureMask = BABYLON.Color4.FromArray(parsedParticleSystem.textureMask); particleSystem.blendMode = parsedParticleSystem.blendMode; particleSystem.start(); return particleSystem; }; var parseShadowGenerator = function (parsedShadowGenerator, scene) { var light = scene.getLightByID(parsedShadowGenerator.lightId); var shadowGenerator = new BABYLON.ShadowGenerator(parsedShadowGenerator.mapSize, light); for (var meshIndex = 0; meshIndex < parsedShadowGenerator.renderList.length; meshIndex++) { var mesh = scene.getMeshByID(parsedShadowGenerator.renderList[meshIndex]); shadowGenerator.getShadowMap().renderList.push(mesh); } if (parsedShadowGenerator.usePoissonSampling) { shadowGenerator.usePoissonSampling = true; } else { shadowGenerator.useVarianceShadowMap = parsedShadowGenerator.useVarianceShadowMap; } return shadowGenerator; }; var parseAnimation = function (parsedAnimation) { var animation = new BABYLON.Animation(parsedAnimation.name, parsedAnimation.property, parsedAnimation.framePerSecond, parsedAnimation.dataType, parsedAnimation.loopBehavior); var dataType = parsedAnimation.dataType; var keys = []; for (var index = 0; index < parsedAnimation.keys.length; index++) { var key = parsedAnimation.keys[index]; var data; switch (dataType) { case BABYLON.Animation.ANIMATIONTYPE_FLOAT: data = key.values[0]; break; case BABYLON.Animation.ANIMATIONTYPE_QUATERNION: data = BABYLON.Quaternion.FromArray(key.values); break; case BABYLON.Animation.ANIMATIONTYPE_MATRIX: data = BABYLON.Matrix.FromArray(key.values); break; case BABYLON.Animation.ANIMATIONTYPE_VECTOR3: default: data = BABYLON.Vector3.FromArray(key.values); break; } keys.push({ frame: key.frame, value: data }); } animation.setKeys(keys); return animation; }; var parseLight = function (parsedLight, scene) { var light; switch (parsedLight.type) { case 0: light = new BABYLON.PointLight(parsedLight.name, BABYLON.Vector3.FromArray(parsedLight.position), scene); break; case 1: light = new BABYLON.DirectionalLight(parsedLight.name, BABYLON.Vector3.FromArray(parsedLight.direction), scene); light.position = BABYLON.Vector3.FromArray(parsedLight.position); break; case 2: light = new BABYLON.SpotLight(parsedLight.name, BABYLON.Vector3.FromArray(parsedLight.position), BABYLON.Vector3.FromArray(parsedLight.direction), parsedLight.angle, parsedLight.exponent, scene); break; case 3: light = new BABYLON.HemisphericLight(parsedLight.name, BABYLON.Vector3.FromArray(parsedLight.direction), scene); light.groundColor = BABYLON.Color3.FromArray(parsedLight.groundColor); break; } light.id = parsedLight.id; BABYLON.Tags.AddTagsTo(light, parsedLight.tags); if (parsedLight.intensity !== undefined) { light.intensity = parsedLight.intensity; } if (parsedLight.range) { light.range = parsedLight.range; } light.diffuse = BABYLON.Color3.FromArray(parsedLight.diffuse); light.specular = BABYLON.Color3.FromArray(parsedLight.specular); if (parsedLight.excludedMeshesIds) { light._excludedMeshesIds = parsedLight.excludedMeshesIds; } // Parent if (parsedLight.parentId) { light._waitingParentId = parsedLight.parentId; } if (parsedLight.includedOnlyMeshesIds) { light._includedOnlyMeshesIds = parsedLight.includedOnlyMeshesIds; } // Actions if (parsedLight.actions !== undefined) { light._waitingActions = parsedLight.actions; } // Animations if (parsedLight.animations) { for (var animationIndex = 0; animationIndex < parsedLight.animations.length; animationIndex++) { var parsedAnimation = parsedLight.animations[animationIndex]; light.animations.push(parseAnimation(parsedAnimation)); } } if (parsedLight.autoAnimate) { scene.beginAnimation(light, parsedLight.autoAnimateFrom, parsedLight.autoAnimateTo, parsedLight.autoAnimateLoop, 1.0); } }; var parseCamera = function (parsedCamera, scene) { var camera; var position = BABYLON.Vector3.FromArray(parsedCamera.position); var lockedTargetMesh = (parsedCamera.lockedTargetId) ? scene.getLastMeshByID(parsedCamera.lockedTargetId) : null; if (parsedCamera.type === "AnaglyphArcRotateCamera" || parsedCamera.type === "ArcRotateCamera") { var alpha = parsedCamera.alpha; var beta = parsedCamera.beta; var radius = parsedCamera.radius; if (parsedCamera.type === "AnaglyphArcRotateCamera") { var eye_space = parsedCamera.eye_space; camera = new BABYLON.AnaglyphArcRotateCamera(parsedCamera.name, alpha, beta, radius, lockedTargetMesh, eye_space, scene); } else { camera = new BABYLON.ArcRotateCamera(parsedCamera.name, alpha, beta, radius, lockedTargetMesh, scene); } } else if (parsedCamera.type === "AnaglyphFreeCamera") { eye_space = parsedCamera.eye_space; camera = new BABYLON.AnaglyphFreeCamera(parsedCamera.name, position, eye_space, scene); } else if (parsedCamera.type === "DeviceOrientationCamera") { camera = new BABYLON.DeviceOrientationCamera(parsedCamera.name, position, scene); } else if (parsedCamera.type === "FollowCamera") { camera = new BABYLON.FollowCamera(parsedCamera.name, position, scene); camera.heightOffset = parsedCamera.heightOffset; camera.radius = parsedCamera.radius; camera.rotationOffset = parsedCamera.rotationOffset; if (lockedTargetMesh) camera.target = lockedTargetMesh; } else if (parsedCamera.type === "GamepadCamera") { camera = new BABYLON.GamepadCamera(parsedCamera.name, position, scene); } else if (parsedCamera.type === "OculusCamera") { camera = new BABYLON.OculusCamera(parsedCamera.name, position, scene); } else if (parsedCamera.type === "OculusGamepadCamera") { camera = new BABYLON.OculusGamepadCamera(parsedCamera.name, position, scene); } else if (parsedCamera.type === "TouchCamera") { camera = new BABYLON.TouchCamera(parsedCamera.name, position, scene); } else if (parsedCamera.type === "VirtualJoysticksCamera") { camera = new BABYLON.VirtualJoysticksCamera(parsedCamera.name, position, scene); } else if (parsedCamera.type === "WebVRCamera") { camera = new BABYLON.WebVRCamera(parsedCamera.name, position, scene); } else if (parsedCamera.type === "VRDeviceOrientationCamera") { camera = new BABYLON.VRDeviceOrientationCamera(parsedCamera.name, position, scene); } else { // Free Camera is the default value camera = new BABYLON.FreeCamera(parsedCamera.name, position, scene); } // Test for lockedTargetMesh & FreeCamera outside of if-else-if nest, since things like GamepadCamera extend FreeCamera if (lockedTargetMesh && camera instanceof BABYLON.FreeCamera) { camera.lockedTarget = lockedTargetMesh; } camera.id = parsedCamera.id; BABYLON.Tags.AddTagsTo(camera, parsedCamera.tags); // Parent if (parsedCamera.parentId) { camera._waitingParentId = parsedCamera.parentId; } // Actions if (parsedCamera.actions !== undefined) { camera._waitingActions = parsedCamera.actions; } // Target if (parsedCamera.target) { camera.setTarget(BABYLON.Vector3.FromArray(parsedCamera.target)); } else { camera.rotation = BABYLON.Vector3.FromArray(parsedCamera.rotation); } camera.fov = parsedCamera.fov; camera.minZ = parsedCamera.minZ; camera.maxZ = parsedCamera.maxZ; camera.speed = parsedCamera.speed; camera.inertia = parsedCamera.inertia; camera.checkCollisions = parsedCamera.checkCollisions; camera.applyGravity = parsedCamera.applyGravity; if (parsedCamera.ellipsoid) { camera.ellipsoid = BABYLON.Vector3.FromArray(parsedCamera.ellipsoid); } // Animations if (parsedCamera.animations) { for (var animationIndex = 0; animationIndex < parsedCamera.animations.length; animationIndex++) { var parsedAnimation = parsedCamera.animations[animationIndex]; camera.animations.push(parseAnimation(parsedAnimation)); } } if (parsedCamera.autoAnimate) { scene.beginAnimation(camera, parsedCamera.autoAnimateFrom, parsedCamera.autoAnimateTo, parsedCamera.autoAnimateLoop, 1.0); } // Layer Mask if (parsedCamera.layerMask && (!isNaN(parsedCamera.layerMask))) { camera.layerMask = Math.abs(parseInt(parsedCamera.layerMask)); } else { camera.layerMask = 0xFFFFFFFF; } return camera; }; var parseGeometry = function (parsedGeometry, scene) { var id = parsedGeometry.id; return scene.getGeometryByID(id); }; var parseBox = function (parsedBox, scene) { if (parseGeometry(parsedBox, scene)) { return null; } var box = new BABYLON.Geometry.Primitives.Box(parsedBox.id, scene, parsedBox.size, parsedBox.canBeRegenerated, null); BABYLON.Tags.AddTagsTo(box, parsedBox.tags); scene.pushGeometry(box, true); return box; }; var parseSphere = function (parsedSphere, scene) { if (parseGeometry(parsedSphere, scene)) { return null; } var sphere = new BABYLON.Geometry.Primitives.Sphere(parsedSphere.id, scene, parsedSphere.segments, parsedSphere.diameter, parsedSphere.canBeRegenerated, null); BABYLON.Tags.AddTagsTo(sphere, parsedSphere.tags); scene.pushGeometry(sphere, true); return sphere; }; var parseCylinder = function (parsedCylinder, scene) { if (parseGeometry(parsedCylinder, scene)) { return null; } var cylinder = new BABYLON.Geometry.Primitives.Cylinder(parsedCylinder.id, scene, parsedCylinder.height, parsedCylinder.diameterTop, parsedCylinder.diameterBottom, parsedCylinder.tessellation, parsedCylinder.subdivisions, parsedCylinder.canBeRegenerated, null); BABYLON.Tags.AddTagsTo(cylinder, parsedCylinder.tags); scene.pushGeometry(cylinder, true); return cylinder; }; var parseTorus = function (parsedTorus, scene) { if (parseGeometry(parsedTorus, scene)) { return null; } var torus = new BABYLON.Geometry.Primitives.Torus(parsedTorus.id, scene, parsedTorus.diameter, parsedTorus.thickness, parsedTorus.tessellation, parsedTorus.canBeRegenerated, null); BABYLON.Tags.AddTagsTo(torus, parsedTorus.tags); scene.pushGeometry(torus, true); return torus; }; var parseGround = function (parsedGround, scene) { if (parseGeometry(parsedGround, scene)) { return null; } var ground = new BABYLON.Geometry.Primitives.Ground(parsedGround.id, scene, parsedGround.width, parsedGround.height, parsedGround.subdivisions, parsedGround.canBeRegenerated, null); BABYLON.Tags.AddTagsTo(ground, parsedGround.tags); scene.pushGeometry(ground, true); return ground; }; var parsePlane = function (parsedPlane, scene) { if (parseGeometry(parsedPlane, scene)) { return null; } var plane = new BABYLON.Geometry.Primitives.Plane(parsedPlane.id, scene, parsedPlane.size, parsedPlane.canBeRegenerated, null); BABYLON.Tags.AddTagsTo(plane, parsedPlane.tags); scene.pushGeometry(plane, true); return plane; }; var parseTorusKnot = function (parsedTorusKnot, scene) { if (parseGeometry(parsedTorusKnot, scene)) { return null; } var torusKnot = new BABYLON.Geometry.Primitives.TorusKnot(parsedTorusKnot.id, scene, parsedTorusKnot.radius, parsedTorusKnot.tube, parsedTorusKnot.radialSegments, parsedTorusKnot.tubularSegments, parsedTorusKnot.p, parsedTorusKnot.q, parsedTorusKnot.canBeRegenerated, null); BABYLON.Tags.AddTagsTo(torusKnot, parsedTorusKnot.tags); scene.pushGeometry(torusKnot, true); return torusKnot; }; var parseVertexData = function (parsedVertexData, scene, rootUrl) { if (parseGeometry(parsedVertexData, scene)) { return null; } var geometry = new BABYLON.Geometry(parsedVertexData.id, scene); BABYLON.Tags.AddTagsTo(geometry, parsedVertexData.tags); if (parsedVertexData.delayLoadingFile) { geometry.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_NOTLOADED; geometry.delayLoadingFile = rootUrl + parsedVertexData.delayLoadingFile; geometry._boundingInfo = new BABYLON.BoundingInfo(BABYLON.Vector3.FromArray(parsedVertexData.boundingBoxMinimum), BABYLON.Vector3.FromArray(parsedVertexData.boundingBoxMaximum)); geometry._delayInfo = []; if (parsedVertexData.hasUVs) { geometry._delayInfo.push(BABYLON.VertexBuffer.UVKind); } if (parsedVertexData.hasUVs2) { geometry._delayInfo.push(BABYLON.VertexBuffer.UV2Kind); } if (parsedVertexData.hasColors) { geometry._delayInfo.push(BABYLON.VertexBuffer.ColorKind); } if (parsedVertexData.hasMatricesIndices) { geometry._delayInfo.push(BABYLON.VertexBuffer.MatricesIndicesKind); } if (parsedVertexData.hasMatricesWeights) { geometry._delayInfo.push(BABYLON.VertexBuffer.MatricesWeightsKind); } geometry._delayLoadingFunction = importVertexData; } else { importVertexData(parsedVertexData, geometry); } scene.pushGeometry(geometry, true); return geometry; }; var parseMesh = function (parsedMesh, scene, rootUrl) { var mesh = new BABYLON.Mesh(parsedMesh.name, scene); mesh.id = parsedMesh.id; BABYLON.Tags.AddTagsTo(mesh, parsedMesh.tags); mesh.position = BABYLON.Vector3.FromArray(parsedMesh.position); if (parsedMesh.rotationQuaternion) { mesh.rotationQuaternion = BABYLON.Quaternion.FromArray(parsedMesh.rotationQuaternion); } else if (parsedMesh.rotation) { mesh.rotation = BABYLON.Vector3.FromArray(parsedMesh.rotation); } mesh.scaling = BABYLON.Vector3.FromArray(parsedMesh.scaling); if (parsedMesh.localMatrix) { mesh.setPivotMatrix(BABYLON.Matrix.FromArray(parsedMesh.localMatrix)); } else if (parsedMesh.pivotMatrix) { mesh.setPivotMatrix(BABYLON.Matrix.FromArray(parsedMesh.pivotMatrix)); } mesh.setEnabled(parsedMesh.isEnabled); mesh.isVisible = parsedMesh.isVisible; mesh.infiniteDistance = parsedMesh.infiniteDistance; mesh.showBoundingBox = parsedMesh.showBoundingBox; mesh.showSubMeshesBoundingBox = parsedMesh.showSubMeshesBoundingBox; if (parsedMesh.applyFog !== undefined) { mesh.applyFog = parsedMesh.applyFog; } if (parsedMesh.pickable !== undefined) { mesh.isPickable = parsedMesh.pickable; } if (parsedMesh.alphaIndex !== undefined) { mesh.alphaIndex = parsedMesh.alphaIndex; } mesh.receiveShadows = parsedMesh.receiveShadows; mesh.billboardMode = parsedMesh.billboardMode; if (parsedMesh.visibility !== undefined) { mesh.visibility = parsedMesh.visibility; } mesh.checkCollisions = parsedMesh.checkCollisions; mesh._shouldGenerateFlatShading = parsedMesh.useFlatShading; // Parent if (parsedMesh.parentId) { mesh._waitingParentId = parsedMesh.parentId; } // Actions if (parsedMesh.actions !== undefined) { mesh._waitingActions = parsedMesh.actions; } // Geometry mesh.hasVertexAlpha = parsedMesh.hasVertexAlpha; if (parsedMesh.delayLoadingFile) { mesh.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_NOTLOADED; mesh.delayLoadingFile = rootUrl + parsedMesh.delayLoadingFile; mesh._boundingInfo = new BABYLON.BoundingInfo(BABYLON.Vector3.FromArray(parsedMesh.boundingBoxMinimum), BABYLON.Vector3.FromArray(parsedMesh.boundingBoxMaximum)); if (parsedMesh._binaryInfo) { mesh._binaryInfo = parsedMesh._binaryInfo; } mesh._delayInfo = []; if (parsedMesh.hasUVs) { mesh._delayInfo.push(BABYLON.VertexBuffer.UVKind); } if (parsedMesh.hasUVs2) { mesh._delayInfo.push(BABYLON.VertexBuffer.UV2Kind); } if (parsedMesh.hasColors) { mesh._delayInfo.push(BABYLON.VertexBuffer.ColorKind); } if (parsedMesh.hasMatricesIndices) { mesh._delayInfo.push(BABYLON.VertexBuffer.MatricesIndicesKind); } if (parsedMesh.hasMatricesWeights) { mesh._delayInfo.push(BABYLON.VertexBuffer.MatricesWeightsKind); } mesh._delayLoadingFunction = importGeometry; if (BABYLON.SceneLoader.ForceFullSceneLoadingForIncremental) { mesh._checkDelayState(); } } else { importGeometry(parsedMesh, mesh); } // Material if (parsedMesh.materialId) { mesh.setMaterialByID(parsedMesh.materialId); } else { mesh.material = null; } // Skeleton if (parsedMesh.skeletonId > -1) { mesh.skeleton = scene.getLastSkeletonByID(parsedMesh.skeletonId); } // Physics if (parsedMesh.physicsImpostor) { if (!scene.isPhysicsEnabled()) { scene.enablePhysics(); } mesh.setPhysicsState({ impostor: parsedMesh.physicsImpostor, mass: parsedMesh.physicsMass, friction: parsedMesh.physicsFriction, restitution: parsedMesh.physicsRestitution }); } // Animations if (parsedMesh.animations) { for (var animationIndex = 0; animationIndex < parsedMesh.animations.length; animationIndex++) { var parsedAnimation = parsedMesh.animations[animationIndex]; mesh.animations.push(parseAnimation(parsedAnimation)); } } if (parsedMesh.autoAnimate) { scene.beginAnimation(mesh, parsedMesh.autoAnimateFrom, parsedMesh.autoAnimateTo, parsedMesh.autoAnimateLoop, 1.0); } // Layer Mask if (parsedMesh.layerMask && (!isNaN(parsedMesh.layerMask))) { mesh.layerMask = Math.abs(parseInt(parsedMesh.layerMask)); } else { mesh.layerMask = 0xFFFFFFFF; } // Instances if (parsedMesh.instances) { for (var index = 0; index < parsedMesh.instances.length; index++) { var parsedInstance = parsedMesh.instances[index]; var instance = mesh.createInstance(parsedInstance.name); BABYLON.Tags.AddTagsTo(instance, parsedInstance.tags); instance.position = BABYLON.Vector3.FromArray(parsedInstance.position); if (parsedInstance.rotationQuaternion) { instance.rotationQuaternion = BABYLON.Quaternion.FromArray(parsedInstance.rotationQuaternion); } else if (parsedInstance.rotation) { instance.rotation = BABYLON.Vector3.FromArray(parsedInstance.rotation); } instance.scaling = BABYLON.Vector3.FromArray(parsedInstance.scaling); instance.checkCollisions = mesh.checkCollisions; if (parsedMesh.animations) { for (animationIndex = 0; animationIndex < parsedMesh.animations.length; animationIndex++) { parsedAnimation = parsedMesh.animations[animationIndex]; instance.animations.push(parseAnimation(parsedAnimation)); } } } } return mesh; }; var parseActions = function (parsedActions, object, scene) { object.actionManager = new BABYLON.ActionManager(scene); // instanciate a new object var instanciate = function (name, params) { var newInstance = Object.create(BABYLON[name].prototype); newInstance.constructor.apply(newInstance, params); return newInstance; }; var parseParameter = function (name, value, target, propertyPath) { var split = value.split(","); if (split.length == 1) { var num = parseFloat(split[0]); if (isNaN(num)) return split[0]; else return num; } var effectiveTarget = propertyPath.split("."); for (var i = 0; i < effectiveTarget.length; i++) { target = target[effectiveTarget[i]]; } if (split.length == 3) { var values = [parseFloat(split[0]), parseFloat(split[1]), parseFloat(split[2])]; if (target instanceof BABYLON.Vector3) return BABYLON.Vector3.FromArray(values); else return BABYLON.Color3.FromArray(values); } if (split.length == 4) { var values = [parseFloat(split[0]), parseFloat(split[1]), parseFloat(split[2]), parseFloat(split[3])]; if (target instanceof BABYLON.Vector4) return BABYLON.Vector4.FromArray(values); else return BABYLON.Color4.FromArray(values); } }; // traverse graph per trigger var traverse = function (parsedAction, trigger, condition, action, actionManager) { var parameters = new Array(); var target = null; var propertyPath = null; // Parameters if (parsedAction.type == 2) parameters.push(actionManager); else parameters.push(trigger); for (var i = 0; i < parsedAction.properties.length; i++) { var value = parsedAction.properties[i].value; if (parsedAction.properties[i].name === "target") { value = target = scene.getNodeByName(value); } else if (parsedAction.properties[i].name != "propertyPath") { if (value === "false" || value === "true") value = value === "true"; else if (parsedAction.type === 2 && parsedAction.properties[i].name === "operator") value = BABYLON.ValueCondition[value]; else value = parseParameter(parsedAction.properties[i].name, value, target, propertyPath); } else { propertyPath = value; } parameters.push(value); } parameters.push(condition); // If interpolate value action if (parsedAction.name === "InterpolateValueAction") { var param = parameters[parameters.length - 2]; parameters[parameters.length - 1] = param; parameters[parameters.length - 2] = condition; } // Action or condition var newAction = instanciate(parsedAction.name, parameters); if (newAction instanceof BABYLON.Condition) { condition = newAction; newAction = action; } else { condition = null; if (action) action.then(newAction); else actionManager.registerAction(newAction); } for (var i = 0; i < parsedAction.children.length; i++) traverse(parsedAction.children[i], trigger, condition, newAction, actionManager); }; for (var i = 0; i < parsedActions.children.length; i++) { var triggerParams; var trigger = parsedActions.children[i]; if (trigger.properties.length > 0) { triggerParams = { trigger: BABYLON.ActionManager[trigger.name], parameter: scene.getMeshByName(trigger.properties[0].value) }; } else triggerParams = BABYLON.ActionManager[trigger.name]; for (var j = 0; j < trigger.children.length; j++) traverse(trigger.children[j], triggerParams, null, null, object.actionManager); } }; var isDescendantOf = function (mesh, names, hierarchyIds) { names = (names instanceof Array) ? names : [names]; for (var i in names) { if (mesh.name === names[i]) { hierarchyIds.push(mesh.id); return true; } } if (mesh.parentId && hierarchyIds.indexOf(mesh.parentId) !== -1) { hierarchyIds.push(mesh.id); return true; } return false; }; var importVertexData = function (parsedVertexData, geometry) { var vertexData = new BABYLON.VertexData(); // positions var positions = parsedVertexData.positions; if (positions) { vertexData.set(positions, BABYLON.VertexBuffer.PositionKind); } // normals var normals = parsedVertexData.normals; if (normals) { vertexData.set(normals, BABYLON.VertexBuffer.NormalKind); } // uvs var uvs = parsedVertexData.uvs; if (uvs) { vertexData.set(uvs, BABYLON.VertexBuffer.UVKind); } // uv2s var uv2s = parsedVertexData.uv2s; if (uv2s) { vertexData.set(uv2s, BABYLON.VertexBuffer.UV2Kind); } // colors var colors = parsedVertexData.colors; if (colors) { vertexData.set(checkColors4(colors, positions.length / 3), BABYLON.VertexBuffer.ColorKind); } // matricesIndices var matricesIndices = parsedVertexData.matricesIndices; if (matricesIndices) { vertexData.set(matricesIndices, BABYLON.VertexBuffer.MatricesIndicesKind); } // matricesWeights var matricesWeights = parsedVertexData.matricesWeights; if (matricesWeights) { vertexData.set(matricesWeights, BABYLON.VertexBuffer.MatricesWeightsKind); } // indices var indices = parsedVertexData.indices; if (indices) { vertexData.indices = indices; } geometry.setAllVerticesData(vertexData, parsedVertexData.updatable); }; var importGeometry = function (parsedGeometry, mesh) { var scene = mesh.getScene(); // Geometry var geometryId = parsedGeometry.geometryId; if (geometryId) { var geometry = scene.getGeometryByID(geometryId); if (geometry) { geometry.applyToMesh(mesh); } } else if (parsedGeometry instanceof ArrayBuffer) { var binaryInfo = mesh._binaryInfo; if (binaryInfo.positionsAttrDesc && binaryInfo.positionsAttrDesc.count > 0) { var positionsData = new Float32Array(parsedGeometry, binaryInfo.positionsAttrDesc.offset, binaryInfo.positionsAttrDesc.count); mesh.setVerticesData(BABYLON.VertexBuffer.PositionKind, positionsData, false); } if (binaryInfo.normalsAttrDesc && binaryInfo.normalsAttrDesc.count > 0) { var normalsData = new Float32Array(parsedGeometry, binaryInfo.normalsAttrDesc.offset, binaryInfo.normalsAttrDesc.count); mesh.setVerticesData(BABYLON.VertexBuffer.NormalKind, normalsData, false); } if (binaryInfo.uvsAttrDesc && binaryInfo.uvsAttrDesc.count > 0) { var uvsData = new Float32Array(parsedGeometry, binaryInfo.uvsAttrDesc.offset, binaryInfo.uvsAttrDesc.count); mesh.setVerticesData(BABYLON.VertexBuffer.UVKind, uvsData, false); } if (binaryInfo.uvs2AttrDesc && binaryInfo.uvs2AttrDesc.count > 0) { var uvs2Data = new Float32Array(parsedGeometry, binaryInfo.uvs2AttrDesc.offset, binaryInfo.uvs2AttrDesc.count); mesh.setVerticesData(BABYLON.VertexBuffer.UV2Kind, uvs2Data, false); } if (binaryInfo.colorsAttrDesc && binaryInfo.colorsAttrDesc.count > 0) { var colorsData = new Float32Array(parsedGeometry, binaryInfo.colorsAttrDesc.offset, binaryInfo.colorsAttrDesc.count); mesh.setVerticesData(BABYLON.VertexBuffer.ColorKind, colorsData, false); } if (binaryInfo.matricesIndicesAttrDesc && binaryInfo.matricesIndicesAttrDesc.count > 0) { var matricesIndicesData = new Int32Array(parsedGeometry, binaryInfo.matricesIndicesAttrDesc.offset, binaryInfo.matricesIndicesAttrDesc.count); mesh.setVerticesData(BABYLON.VertexBuffer.MatricesIndicesKind, matricesIndicesData, false); } if (binaryInfo.matricesWeightsAttrDesc && binaryInfo.matricesWeightsAttrDesc.count > 0) { var matricesWeightsData = new Float32Array(parsedGeometry, binaryInfo.matricesWeightsAttrDesc.offset, binaryInfo.matricesWeightsAttrDesc.count); mesh.setVerticesData(BABYLON.VertexBuffer.MatricesWeightsKind, matricesWeightsData, false); } if (binaryInfo.indicesAttrDesc && binaryInfo.indicesAttrDesc.count > 0) { var indicesData = new Int32Array(parsedGeometry, binaryInfo.indicesAttrDesc.offset, binaryInfo.indicesAttrDesc.count); mesh.setIndices(indicesData); } if (binaryInfo.subMeshesAttrDesc && binaryInfo.subMeshesAttrDesc.count > 0) { var subMeshesData = new Int32Array(parsedGeometry, binaryInfo.subMeshesAttrDesc.offset, binaryInfo.subMeshesAttrDesc.count * 5); mesh.subMeshes = []; for (var i = 0; i < binaryInfo.subMeshesAttrDesc.count; i++) { var materialIndex = subMeshesData[(i * 5) + 0]; var verticesStart = subMeshesData[(i * 5) + 1]; var verticesCount = subMeshesData[(i * 5) + 2]; var indexStart = subMeshesData[(i * 5) + 3]; var indexCount = subMeshesData[(i * 5) + 4]; var subMesh = new BABYLON.SubMesh(materialIndex, verticesStart, verticesCount, indexStart, indexCount, mesh); } } } else if (parsedGeometry.positions && parsedGeometry.normals && parsedGeometry.indices) { mesh.setVerticesData(BABYLON.VertexBuffer.PositionKind, parsedGeometry.positions, false); mesh.setVerticesData(BABYLON.VertexBuffer.NormalKind, parsedGeometry.normals, false); if (parsedGeometry.uvs) { mesh.setVerticesData(BABYLON.VertexBuffer.UVKind, parsedGeometry.uvs, false); } if (parsedGeometry.uvs2) { mesh.setVerticesData(BABYLON.VertexBuffer.UV2Kind, parsedGeometry.uvs2, false); } if (parsedGeometry.colors) { mesh.setVerticesData(BABYLON.VertexBuffer.ColorKind, checkColors4(parsedGeometry.colors, parsedGeometry.positions.length / 3), false); } if (parsedGeometry.matricesIndices) { if (!parsedGeometry.matricesIndices._isExpanded) { var floatIndices = []; for (var i = 0; i < parsedGeometry.matricesIndices.length; i++) { var matricesIndex = parsedGeometry.matricesIndices[i]; floatIndices.push(matricesIndex & 0x000000FF); floatIndices.push((matricesIndex & 0x0000FF00) >> 8); floatIndices.push((matricesIndex & 0x00FF0000) >> 16); floatIndices.push(matricesIndex >> 24); } mesh.setVerticesData(BABYLON.VertexBuffer.MatricesIndicesKind, floatIndices, false); } else { delete parsedGeometry.matricesIndices._isExpanded; mesh.setVerticesData(BABYLON.VertexBuffer.MatricesIndicesKind, parsedGeometry.matricesIndices, false); } } if (parsedGeometry.matricesWeights) { mesh.setVerticesData(BABYLON.VertexBuffer.MatricesWeightsKind, parsedGeometry.matricesWeights, false); } mesh.setIndices(parsedGeometry.indices); // SubMeshes if (parsedGeometry.subMeshes) { mesh.subMeshes = []; for (var subIndex = 0; subIndex < parsedGeometry.subMeshes.length; subIndex++) { var parsedSubMesh = parsedGeometry.subMeshes[subIndex]; var subMesh = new BABYLON.SubMesh(parsedSubMesh.materialIndex, parsedSubMesh.verticesStart, parsedSubMesh.verticesCount, parsedSubMesh.indexStart, parsedSubMesh.indexCount, mesh); } } } // Flat shading if (mesh._shouldGenerateFlatShading) { mesh.convertToFlatShadedMesh(); delete mesh._shouldGenerateFlatShading; } // Update mesh.computeWorldMatrix(true); // Octree if (scene._selectionOctree) { scene._selectionOctree.addMesh(mesh); } }; BABYLON.SceneLoader.RegisterPlugin({ extensions: ".babylon", importMesh: function (meshesNames, scene, data, rootUrl, meshes, particleSystems, skeletons) { var parsedData = JSON.parse(data); var loadedSkeletonsIds = []; var loadedMaterialsIds = []; var hierarchyIds = []; for (var index = 0; index < parsedData.meshes.length; index++) { var parsedMesh = parsedData.meshes[index]; if (!meshesNames || isDescendantOf(parsedMesh, meshesNames, hierarchyIds)) { if (meshesNames instanceof Array) { // Remove found mesh name from list. delete meshesNames[meshesNames.indexOf(parsedMesh.name)]; } // Material ? if (parsedMesh.materialId) { var materialFound = (loadedMaterialsIds.indexOf(parsedMesh.materialId) !== -1); if (!materialFound) { for (var multimatIndex = 0; multimatIndex < parsedData.multiMaterials.length; multimatIndex++) { var parsedMultiMaterial = parsedData.multiMaterials[multimatIndex]; if (parsedMultiMaterial.id == parsedMesh.materialId) { for (var matIndex = 0; matIndex < parsedMultiMaterial.materials.length; matIndex++) { var subMatId = parsedMultiMaterial.materials[matIndex]; loadedMaterialsIds.push(subMatId); parseMaterialById(subMatId, parsedData, scene, rootUrl); } loadedMaterialsIds.push(parsedMultiMaterial.id); parseMultiMaterial(parsedMultiMaterial, scene); materialFound = true; break; } } } if (!materialFound) { loadedMaterialsIds.push(parsedMesh.materialId); parseMaterialById(parsedMesh.materialId, parsedData, scene, rootUrl); } } // Skeleton ? if (parsedMesh.skeletonId > -1 && scene.skeletons) { var skeletonAlreadyLoaded = (loadedSkeletonsIds.indexOf(parsedMesh.skeletonId) > -1); if (!skeletonAlreadyLoaded) { for (var skeletonIndex = 0; skeletonIndex < parsedData.skeletons.length; skeletonIndex++) { var parsedSkeleton = parsedData.skeletons[skeletonIndex]; if (parsedSkeleton.id === parsedMesh.skeletonId) { skeletons.push(parseSkeleton(parsedSkeleton, scene)); loadedSkeletonsIds.push(parsedSkeleton.id); } } } } var mesh = parseMesh(parsedMesh, scene, rootUrl); meshes.push(mesh); } } for (index = 0; index < scene.meshes.length; index++) { var currentMesh = scene.meshes[index]; if (currentMesh._waitingParentId) { currentMesh.parent = scene.getLastEntryByID(currentMesh._waitingParentId); currentMesh._waitingParentId = undefined; } } // Particles if (parsedData.particleSystems) { for (index = 0; index < parsedData.particleSystems.length; index++) { var parsedParticleSystem = parsedData.particleSystems[index]; if (hierarchyIds.indexOf(parsedParticleSystem.emitterId) !== -1) { particleSystems.push(parseParticleSystem(parsedParticleSystem, scene, rootUrl)); } } } return true; }, load: function (scene, data, rootUrl) { var parsedData = JSON.parse(data); // Scene scene.useDelayedTextureLoading = parsedData.useDelayedTextureLoading && !BABYLON.SceneLoader.ForceFullSceneLoadingForIncremental; scene.autoClear = parsedData.autoClear; scene.clearColor = BABYLON.Color3.FromArray(parsedData.clearColor); scene.ambientColor = BABYLON.Color3.FromArray(parsedData.ambientColor); scene.gravity = BABYLON.Vector3.FromArray(parsedData.gravity); // Fog if (parsedData.fogMode && parsedData.fogMode !== 0) { scene.fogMode = parsedData.fogMode; scene.fogColor = BABYLON.Color3.FromArray(parsedData.fogColor); scene.fogStart = parsedData.fogStart; scene.fogEnd = parsedData.fogEnd; scene.fogDensity = parsedData.fogDensity; } for (var index = 0; index < parsedData.lights.length; index++) { var parsedLight = parsedData.lights[index]; parseLight(parsedLight, scene); } // Materials if (parsedData.materials) { for (index = 0; index < parsedData.materials.length; index++) { var parsedMaterial = parsedData.materials[index]; parseMaterial(parsedMaterial, scene, rootUrl); } } if (parsedData.multiMaterials) { for (index = 0; index < parsedData.multiMaterials.length; index++) { var parsedMultiMaterial = parsedData.multiMaterials[index]; parseMultiMaterial(parsedMultiMaterial, scene); } } // Skeletons if (parsedData.skeletons) { for (index = 0; index < parsedData.skeletons.length; index++) { var parsedSkeleton = parsedData.skeletons[index]; parseSkeleton(parsedSkeleton, scene); } } // Geometries var geometries = parsedData.geometries; if (geometries) { // Boxes var boxes = geometries.boxes; if (boxes) { for (index = 0; index < boxes.length; index++) { var parsedBox = boxes[index]; parseBox(parsedBox, scene); } } // Spheres var spheres = geometries.spheres; if (spheres) { for (index = 0; index < spheres.length; index++) { var parsedSphere = spheres[index]; parseSphere(parsedSphere, scene); } } // Cylinders var cylinders = geometries.cylinders; if (cylinders) { for (index = 0; index < cylinders.length; index++) { var parsedCylinder = cylinders[index]; parseCylinder(parsedCylinder, scene); } } // Toruses var toruses = geometries.toruses; if (toruses) { for (index = 0; index < toruses.length; index++) { var parsedTorus = toruses[index]; parseTorus(parsedTorus, scene); } } // Grounds var grounds = geometries.grounds; if (grounds) { for (index = 0; index < grounds.length; index++) { var parsedGround = grounds[index]; parseGround(parsedGround, scene); } } // Planes var planes = geometries.planes; if (planes) { for (index = 0; index < planes.length; index++) { var parsedPlane = planes[index]; parsePlane(parsedPlane, scene); } } // TorusKnots var torusKnots = geometries.torusKnots; if (torusKnots) { for (index = 0; index < torusKnots.length; index++) { var parsedTorusKnot = torusKnots[index]; parseTorusKnot(parsedTorusKnot, scene); } } // VertexData var vertexData = geometries.vertexData; if (vertexData) { for (index = 0; index < vertexData.length; index++) { var parsedVertexData = vertexData[index]; parseVertexData(parsedVertexData, scene, rootUrl); } } } for (index = 0; index < parsedData.meshes.length; index++) { var parsedMesh = parsedData.meshes[index]; parseMesh(parsedMesh, scene, rootUrl); } for (index = 0; index < parsedData.cameras.length; index++) { var parsedCamera = parsedData.cameras[index]; parseCamera(parsedCamera, scene); } if (parsedData.activeCameraID) { scene.setActiveCameraByID(parsedData.activeCameraID); } for (index = 0; index < scene.cameras.length; index++) { var camera = scene.cameras[index]; if (camera._waitingParentId) { camera.parent = scene.getLastEntryByID(camera._waitingParentId); camera._waitingParentId = undefined; } } for (index = 0; index < scene.lights.length; index++) { var light = scene.lights[index]; if (light._waitingParentId) { light.parent = scene.getLastEntryByID(light._waitingParentId); light._waitingParentId = undefined; } } for (index = 0; index < scene.meshes.length; index++) { var mesh = scene.meshes[index]; if (mesh._waitingParentId) { mesh.parent = scene.getLastEntryByID(mesh._waitingParentId); mesh._waitingParentId = undefined; } if (mesh._waitingActions) { parseActions(mesh._waitingActions, mesh, scene); mesh._waitingActions = undefined; } } // Particles Systems if (parsedData.particleSystems) { for (index = 0; index < parsedData.particleSystems.length; index++) { var parsedParticleSystem = parsedData.particleSystems[index]; parseParticleSystem(parsedParticleSystem, scene, rootUrl); } } // Lens flares if (parsedData.lensFlareSystems) { for (index = 0; index < parsedData.lensFlareSystems.length; index++) { var parsedLensFlareSystem = parsedData.lensFlareSystems[index]; parseLensFlareSystem(parsedLensFlareSystem, scene, rootUrl); } } // Shadows if (parsedData.shadowGenerators) { for (index = 0; index < parsedData.shadowGenerators.length; index++) { var parsedShadowGenerator = parsedData.shadowGenerators[index]; parseShadowGenerator(parsedShadowGenerator, scene); } } // Actions (scene) if (parsedData.actions) { parseActions(parsedData.actions, scene, scene); } // Finish return true; } }); })(BABYLON.Internals || (BABYLON.Internals = {})); var Internals = BABYLON.Internals; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.babylonFileLoader.js.map var BABYLON; (function (BABYLON) { // Unique ID when we import meshes from Babylon to CSG var currentCSGMeshId = 0; // # class Vertex // Represents a vertex of a polygon. Use your own vertex class instead of this // one to provide additional features like texture coordinates and vertex // colors. Custom vertex classes need to provide a `pos` property and `clone()`, // `flip()`, and `interpolate()` methods that behave analogous to the ones // defined by `BABYLON.CSG.Vertex`. This class provides `normal` so convenience // functions like `BABYLON.CSG.sphere()` can return a smooth vertex normal, but `normal` // is not used anywhere else. // Same goes for uv, it allows to keep the original vertex uv coordinates of the 2 meshes var Vertex = (function () { function Vertex(pos, normal, uv) { this.pos = pos; this.normal = normal; this.uv = uv; } Vertex.prototype.clone = function () { return new Vertex(this.pos.clone(), this.normal.clone(), this.uv.clone()); }; // Invert all orientation-specific data (e.g. vertex normal). Called when the // orientation of a polygon is flipped. Vertex.prototype.flip = function () { this.normal = this.normal.scale(-1); }; // Create a new vertex between this vertex and `other` by linearly // interpolating all properties using a parameter of `t`. Subclasses should // override this to interpolate additional properties. Vertex.prototype.interpolate = function (other, t) { return new Vertex(BABYLON.Vector3.Lerp(this.pos, other.pos, t), BABYLON.Vector3.Lerp(this.normal, other.normal, t), BABYLON.Vector2.Lerp(this.uv, other.uv, t)); }; return Vertex; })(); // # class Plane // Represents a plane in 3D space. var Plane = (function () { function Plane(normal, w) { this.normal = normal; this.w = w; } Plane.FromPoints = function (a, b, c) { var v0 = c.subtract(a); var v1 = b.subtract(a); if (v0.lengthSquared() === 0 || v1.lengthSquared() === 0) { return null; } var n = BABYLON.Vector3.Normalize(BABYLON.Vector3.Cross(v0, v1)); return new Plane(n, BABYLON.Vector3.Dot(n, a)); }; Plane.prototype.clone = function () { return new Plane(this.normal.clone(), this.w); }; Plane.prototype.flip = function () { this.normal.scaleInPlace(-1); this.w = -this.w; }; // Split `polygon` by this plane if needed, then put the polygon or polygon // fragments in the appropriate lists. Coplanar polygons go into either // `coplanarFront` or `coplanarBack` depending on their orientation with // respect to this plane. Polygons in front or in back of this plane go into // either `front` or `back`. Plane.prototype.splitPolygon = function (polygon, coplanarFront, coplanarBack, front, back) { var COPLANAR = 0; var FRONT = 1; var BACK = 2; var SPANNING = 3; // Classify each point as well as the entire polygon into one of the above // four classes. var polygonType = 0; var types = []; for (var i = 0; i < polygon.vertices.length; i++) { var t = BABYLON.Vector3.Dot(this.normal, polygon.vertices[i].pos) - this.w; var type = (t < -Plane.EPSILON) ? BACK : (t > Plane.EPSILON) ? FRONT : COPLANAR; polygonType |= type; types.push(type); } switch (polygonType) { case COPLANAR: (BABYLON.Vector3.Dot(this.normal, polygon.plane.normal) > 0 ? coplanarFront : coplanarBack).push(polygon); break; case FRONT: front.push(polygon); break; case BACK: back.push(polygon); break; case SPANNING: var f = [], b = []; for (i = 0; i < polygon.vertices.length; i++) { var j = (i + 1) % polygon.vertices.length; var ti = types[i], tj = types[j]; var vi = polygon.vertices[i], vj = polygon.vertices[j]; if (ti != BACK) f.push(vi); if (ti != FRONT) b.push(ti != BACK ? vi.clone() : vi); if ((ti | tj) == SPANNING) { t = (this.w - BABYLON.Vector3.Dot(this.normal, vi.pos)) / BABYLON.Vector3.Dot(this.normal, vj.pos.subtract(vi.pos)); var v = vi.interpolate(vj, t); f.push(v); b.push(v.clone()); } } if (f.length >= 3) { var poly = new Polygon(f, polygon.shared); if (poly.plane) front.push(poly); } if (b.length >= 3) { poly = new Polygon(b, polygon.shared); if (poly.plane) back.push(poly); } break; } }; Plane.EPSILON = 1e-5; return Plane; })(); // # class Polygon // Represents a convex polygon. The vertices used to initialize a polygon must // be coplanar and form a convex loop. // // Each convex polygon has a `shared` property, which is shared between all // polygons that are clones of each other or were split from the same polygon. // This can be used to define per-polygon properties (such as surface color). var Polygon = (function () { function Polygon(vertices, shared) { this.vertices = vertices; this.shared = shared; this.plane = Plane.FromPoints(vertices[0].pos, vertices[1].pos, vertices[2].pos); } Polygon.prototype.clone = function () { var vertices = this.vertices.map(function (v) { return v.clone(); }); return new Polygon(vertices, this.shared); }; Polygon.prototype.flip = function () { this.vertices.reverse().map(function (v) { v.flip(); }); this.plane.flip(); }; return Polygon; })(); // # class Node // Holds a node in a BSP tree. A BSP tree is built from a collection of polygons // by picking a polygon to split along. That polygon (and all other coplanar // polygons) are added directly to that node and the other polygons are added to // the front and/or back subtrees. This is not a leafy BSP tree since there is // no distinction between internal and leaf nodes. var Node = (function () { function Node(polygons) { this.plane = null; this.front = null; this.back = null; this.polygons = []; if (polygons) { this.build(polygons); } } Node.prototype.clone = function () { var node = new Node(); node.plane = this.plane && this.plane.clone(); node.front = this.front && this.front.clone(); node.back = this.back && this.back.clone(); node.polygons = this.polygons.map(function (p) { return p.clone(); }); return node; }; // Convert solid space to empty space and empty space to solid space. Node.prototype.invert = function () { for (var i = 0; i < this.polygons.length; i++) { this.polygons[i].flip(); } if (this.plane) { this.plane.flip(); } if (this.front) { this.front.invert(); } if (this.back) { this.back.invert(); } var temp = this.front; this.front = this.back; this.back = temp; }; // Recursively remove all polygons in `polygons` that are inside this BSP // tree. Node.prototype.clipPolygons = function (polygons) { if (!this.plane) return polygons.slice(); var front = [], back = []; for (var i = 0; i < polygons.length; i++) { this.plane.splitPolygon(polygons[i], front, back, front, back); } if (this.front) { front = this.front.clipPolygons(front); } if (this.back) { back = this.back.clipPolygons(back); } else { back = []; } return front.concat(back); }; // Remove all polygons in this BSP tree that are inside the other BSP tree // `bsp`. Node.prototype.clipTo = function (bsp) { this.polygons = bsp.clipPolygons(this.polygons); if (this.front) this.front.clipTo(bsp); if (this.back) this.back.clipTo(bsp); }; // Return a list of all polygons in this BSP tree. Node.prototype.allPolygons = function () { var polygons = this.polygons.slice(); if (this.front) polygons = polygons.concat(this.front.allPolygons()); if (this.back) polygons = polygons.concat(this.back.allPolygons()); return polygons; }; // Build a BSP tree out of `polygons`. When called on an existing tree, the // new polygons are filtered down to the bottom of the tree and become new // nodes there. Each set of polygons is partitioned using the first polygon // (no heuristic is used to pick a good split). Node.prototype.build = function (polygons) { if (!polygons.length) return; if (!this.plane) this.plane = polygons[0].plane.clone(); var front = [], back = []; for (var i = 0; i < polygons.length; i++) { this.plane.splitPolygon(polygons[i], this.polygons, this.polygons, front, back); } if (front.length) { if (!this.front) this.front = new Node(); this.front.build(front); } if (back.length) { if (!this.back) this.back = new Node(); this.back.build(back); } }; return Node; })(); var CSG = (function () { function CSG() { this.polygons = new Array(); } // Convert BABYLON.Mesh to BABYLON.CSG CSG.FromMesh = function (mesh) { var vertex, normal, uv, position, polygon, polygons = [], vertices; if (mesh instanceof BABYLON.Mesh) { mesh.computeWorldMatrix(true); var matrix = mesh.getWorldMatrix(); var meshPosition = mesh.position.clone(); var meshRotation = mesh.rotation.clone(); var meshScaling = mesh.scaling.clone(); } else { throw 'BABYLON.CSG: Wrong Mesh type, must be BABYLON.Mesh'; } var indices = mesh.getIndices(), positions = mesh.getVerticesData(BABYLON.VertexBuffer.PositionKind), normals = mesh.getVerticesData(BABYLON.VertexBuffer.NormalKind), uvs = mesh.getVerticesData(BABYLON.VertexBuffer.UVKind); var subMeshes = mesh.subMeshes; for (var sm = 0, sml = subMeshes.length; sm < sml; sm++) { for (var i = subMeshes[sm].indexStart, il = subMeshes[sm].indexCount + subMeshes[sm].indexStart; i < il; i += 3) { vertices = []; for (var j = 0; j < 3; j++) { var sourceNormal = new BABYLON.Vector3(normals[indices[i + j] * 3], normals[indices[i + j] * 3 + 1], normals[indices[i + j] * 3 + 2]); uv = new BABYLON.Vector2(uvs[indices[i + j] * 2], uvs[indices[i + j] * 2 + 1]); var sourcePosition = new BABYLON.Vector3(positions[indices[i + j] * 3], positions[indices[i + j] * 3 + 1], positions[indices[i + j] * 3 + 2]); position = BABYLON.Vector3.TransformCoordinates(sourcePosition, matrix); normal = BABYLON.Vector3.TransformNormal(sourceNormal, matrix); vertex = new Vertex(position, normal, uv); vertices.push(vertex); } polygon = new Polygon(vertices, { subMeshId: sm, meshId: currentCSGMeshId, materialIndex: subMeshes[sm].materialIndex }); // To handle the case of degenerated triangle // polygon.plane == null <=> the polygon does not represent 1 single plane <=> the triangle is degenerated if (polygon.plane) polygons.push(polygon); } } var csg = CSG.FromPolygons(polygons); csg.matrix = matrix; csg.position = meshPosition; csg.rotation = meshRotation; csg.scaling = meshScaling; currentCSGMeshId++; return csg; }; // Construct a BABYLON.CSG solid from a list of `BABYLON.CSG.Polygon` instances. CSG.FromPolygons = function (polygons) { var csg = new BABYLON.CSG(); csg.polygons = polygons; return csg; }; CSG.prototype.clone = function () { var csg = new BABYLON.CSG(); csg.polygons = this.polygons.map(function (p) { return p.clone(); }); csg.copyTransformAttributes(this); return csg; }; CSG.prototype.toPolygons = function () { return this.polygons; }; CSG.prototype.union = function (csg) { var a = new Node(this.clone().polygons); var b = new Node(csg.clone().polygons); a.clipTo(b); b.clipTo(a); b.invert(); b.clipTo(a); b.invert(); a.build(b.allPolygons()); return CSG.FromPolygons(a.allPolygons()).copyTransformAttributes(this); }; CSG.prototype.unionInPlace = function (csg) { var a = new Node(this.polygons); var b = new Node(csg.polygons); a.clipTo(b); b.clipTo(a); b.invert(); b.clipTo(a); b.invert(); a.build(b.allPolygons()); this.polygons = a.allPolygons(); }; CSG.prototype.subtract = function (csg) { var a = new Node(this.clone().polygons); var b = new Node(csg.clone().polygons); a.invert(); a.clipTo(b); b.clipTo(a); b.invert(); b.clipTo(a); b.invert(); a.build(b.allPolygons()); a.invert(); return CSG.FromPolygons(a.allPolygons()).copyTransformAttributes(this); }; CSG.prototype.subtractInPlace = function (csg) { var a = new Node(this.polygons); var b = new Node(csg.polygons); a.invert(); a.clipTo(b); b.clipTo(a); b.invert(); b.clipTo(a); b.invert(); a.build(b.allPolygons()); a.invert(); this.polygons = a.allPolygons(); }; CSG.prototype.intersect = function (csg) { var a = new Node(this.clone().polygons); var b = new Node(csg.clone().polygons); a.invert(); b.clipTo(a); b.invert(); a.clipTo(b); b.clipTo(a); a.build(b.allPolygons()); a.invert(); return CSG.FromPolygons(a.allPolygons()).copyTransformAttributes(this); }; CSG.prototype.intersectInPlace = function (csg) { var a = new Node(this.polygons); var b = new Node(csg.polygons); a.invert(); b.clipTo(a); b.invert(); a.clipTo(b); b.clipTo(a); a.build(b.allPolygons()); a.invert(); this.polygons = a.allPolygons(); }; // Return a new BABYLON.CSG solid with solid and empty space switched. This solid is // not modified. CSG.prototype.inverse = function () { var csg = this.clone(); csg.inverseInPlace(); return csg; }; CSG.prototype.inverseInPlace = function () { this.polygons.map(function (p) { p.flip(); }); }; // This is used to keep meshes transformations so they can be restored // when we build back a Babylon Mesh // NB : All CSG operations are performed in world coordinates CSG.prototype.copyTransformAttributes = function (csg) { this.matrix = csg.matrix; this.position = csg.position; this.rotation = csg.rotation; this.scaling = csg.scaling; return this; }; // Build Raw mesh from CSG // Coordinates here are in world space CSG.prototype.buildMeshGeometry = function (name, scene, keepSubMeshes) { var matrix = this.matrix.clone(); matrix.invert(); var mesh = new BABYLON.Mesh(name, scene), vertices = [], indices = [], normals = [], uvs = [], vertex = BABYLON.Vector3.Zero(), normal = BABYLON.Vector3.Zero(), uv = BABYLON.Vector2.Zero(), polygons = this.polygons, polygonIndices = [0, 0, 0], polygon, vertice_dict = {}, vertex_idx, currentIndex = 0, subMesh_dict = {}, subMesh_obj; if (keepSubMeshes) { // Sort Polygons, since subMeshes are indices range polygons.sort(function (a, b) { if (a.shared.meshId === b.shared.meshId) { return a.shared.subMeshId - b.shared.subMeshId; } else { return a.shared.meshId - b.shared.meshId; } }); } for (var i = 0, il = polygons.length; i < il; i++) { polygon = polygons[i]; // Building SubMeshes if (!subMesh_dict[polygon.shared.meshId]) { subMesh_dict[polygon.shared.meshId] = {}; } if (!subMesh_dict[polygon.shared.meshId][polygon.shared.subMeshId]) { subMesh_dict[polygon.shared.meshId][polygon.shared.subMeshId] = { indexStart: +Infinity, indexEnd: -Infinity, materialIndex: polygon.shared.materialIndex }; } subMesh_obj = subMesh_dict[polygon.shared.meshId][polygon.shared.subMeshId]; for (var j = 2, jl = polygon.vertices.length; j < jl; j++) { polygonIndices[0] = 0; polygonIndices[1] = j - 1; polygonIndices[2] = j; for (var k = 0; k < 3; k++) { vertex.copyFrom(polygon.vertices[polygonIndices[k]].pos); normal.copyFrom(polygon.vertices[polygonIndices[k]].normal); uv.copyFrom(polygon.vertices[polygonIndices[k]].uv); var localVertex = BABYLON.Vector3.TransformCoordinates(vertex, matrix); var localNormal = BABYLON.Vector3.TransformNormal(normal, matrix); vertex_idx = vertice_dict[localVertex.x + ',' + localVertex.y + ',' + localVertex.z]; // Check if 2 points can be merged if (!(typeof vertex_idx !== 'undefined' && normals[vertex_idx * 3] === localNormal.x && normals[vertex_idx * 3 + 1] === localNormal.y && normals[vertex_idx * 3 + 2] === localNormal.z && uvs[vertex_idx * 2] === uv.x && uvs[vertex_idx * 2 + 1] === uv.y)) { vertices.push(localVertex.x, localVertex.y, localVertex.z); uvs.push(uv.x, uv.y); normals.push(normal.x, normal.y, normal.z); vertex_idx = vertice_dict[localVertex.x + ',' + localVertex.y + ',' + localVertex.z] = (vertices.length / 3) - 1; } indices.push(vertex_idx); subMesh_obj.indexStart = Math.min(currentIndex, subMesh_obj.indexStart); subMesh_obj.indexEnd = Math.max(currentIndex, subMesh_obj.indexEnd); currentIndex++; } } } mesh.setVerticesData(BABYLON.VertexBuffer.PositionKind, vertices); mesh.setVerticesData(BABYLON.VertexBuffer.NormalKind, normals); mesh.setVerticesData(BABYLON.VertexBuffer.UVKind, uvs); mesh.setIndices(indices); if (keepSubMeshes) { // We offset the materialIndex by the previous number of materials in the CSG mixed meshes var materialIndexOffset = 0, materialMaxIndex; mesh.subMeshes.length = 0; for (var m in subMesh_dict) { materialMaxIndex = -1; for (var sm in subMesh_dict[m]) { subMesh_obj = subMesh_dict[m][sm]; BABYLON.SubMesh.CreateFromIndices(subMesh_obj.materialIndex + materialIndexOffset, subMesh_obj.indexStart, subMesh_obj.indexEnd - subMesh_obj.indexStart + 1, mesh); materialMaxIndex = Math.max(subMesh_obj.materialIndex, materialMaxIndex); } materialIndexOffset += ++materialMaxIndex; } } return mesh; }; // Build Mesh from CSG taking material and transforms into account CSG.prototype.toMesh = function (name, material, scene, keepSubMeshes) { var mesh = this.buildMeshGeometry(name, scene, keepSubMeshes); mesh.material = material; mesh.position.copyFrom(this.position); mesh.rotation.copyFrom(this.rotation); mesh.scaling.copyFrom(this.scaling); mesh.computeWorldMatrix(true); return mesh; }; return CSG; })(); BABYLON.CSG = CSG; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.csg.js.map var BABYLON; (function (BABYLON) { var OculusDistortionCorrectionPostProcess = (function (_super) { __extends(OculusDistortionCorrectionPostProcess, _super); //ANY function OculusDistortionCorrectionPostProcess(name, camera, isRightEye, cameraSettings) { var _this = this; _super.call(this, name, "oculusDistortionCorrection", [ 'LensCenter', 'Scale', 'ScaleIn', 'HmdWarpParam' ], null, cameraSettings.PostProcessScaleFactor, camera, BABYLON.Texture.BILINEAR_SAMPLINGMODE, null, null); this._isRightEye = isRightEye; this._distortionFactors = cameraSettings.DistortionK; this._postProcessScaleFactor = cameraSettings.PostProcessScaleFactor; this._lensCenterOffset = cameraSettings.LensCenterOffset; this.onSizeChanged = function () { _this.aspectRatio = _this.width * .5 / _this.height; _this._scaleIn = new BABYLON.Vector2(2, 2 / _this.aspectRatio); _this._scaleFactor = new BABYLON.Vector2(.5 * (1 / _this._postProcessScaleFactor), .5 * (1 / _this._postProcessScaleFactor) * _this.aspectRatio); _this._lensCenter = new BABYLON.Vector2(_this._isRightEye ? 0.5 - _this._lensCenterOffset * 0.5 : 0.5 + _this._lensCenterOffset * 0.5, 0.5); }; this.onApply = function (effect) { effect.setFloat2("LensCenter", _this._lensCenter.x, _this._lensCenter.y); effect.setFloat2("Scale", _this._scaleFactor.x, _this._scaleFactor.y); effect.setFloat2("ScaleIn", _this._scaleIn.x, _this._scaleIn.y); effect.setFloat4("HmdWarpParam", _this._distortionFactors[0], _this._distortionFactors[1], _this._distortionFactors[2], _this._distortionFactors[3]); }; } return OculusDistortionCorrectionPostProcess; })(BABYLON.PostProcess); BABYLON.OculusDistortionCorrectionPostProcess = OculusDistortionCorrectionPostProcess; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.oculusDistortionCorrectionPostProcess.js.map // Mainly based on these 2 articles : // Creating an universal virtual touch joystick working for all Touch models thanks to Hand.JS : http://blogs.msdn.com/b/davrous/archive/2013/02/22/creating-an-universal-virtual-touch-joystick-working-for-all-touch-models-thanks-to-hand-js.aspx // & on Seb Lee-Delisle original work: http://seb.ly/2011/04/multi-touch-game-controller-in-javascripthtml5-for-ipad/ var BABYLON; (function (BABYLON) { (function (JoystickAxis) { JoystickAxis[JoystickAxis["X"] = 0] = "X"; JoystickAxis[JoystickAxis["Y"] = 1] = "Y"; JoystickAxis[JoystickAxis["Z"] = 2] = "Z"; })(BABYLON.JoystickAxis || (BABYLON.JoystickAxis = {})); var JoystickAxis = BABYLON.JoystickAxis; var VirtualJoystick = (function () { function VirtualJoystick(leftJoystick) { var _this = this; if (leftJoystick) { this._leftJoystick = true; } else { this._leftJoystick = false; } this._joystickIndex = VirtualJoystick._globalJoystickIndex; VirtualJoystick._globalJoystickIndex++; // By default left & right arrow keys are moving the X // and up & down keys are moving the Y this._axisTargetedByLeftAndRight = 0 /* X */; this._axisTargetedByUpAndDown = 1 /* Y */; this.reverseLeftRight = false; this.reverseUpDown = false; // collections of pointers this._touches = new BABYLON.VirtualJoystick.Collection(); this.deltaPosition = BABYLON.Vector3.Zero(); this._joystickSensibility = 25; this._inversedSensibility = 1 / (this._joystickSensibility / 1000); this._rotationSpeed = 25; this._inverseRotationSpeed = 1 / (this._rotationSpeed / 1000); this._rotateOnAxisRelativeToMesh = false; // injecting a canvas element on top of the canvas 3D game if (!VirtualJoystick.vjCanvas) { window.addEventListener("resize", function () { VirtualJoystick.vjCanvasWidth = window.innerWidth; VirtualJoystick.vjCanvasHeight = window.innerHeight; VirtualJoystick.vjCanvas.width = VirtualJoystick.vjCanvasWidth; VirtualJoystick.vjCanvas.height = VirtualJoystick.vjCanvasHeight; VirtualJoystick.halfWidth = VirtualJoystick.vjCanvasWidth / 2; VirtualJoystick.halfHeight = VirtualJoystick.vjCanvasHeight / 2; }, false); VirtualJoystick.vjCanvas = document.createElement("canvas"); VirtualJoystick.vjCanvasWidth = window.innerWidth; VirtualJoystick.vjCanvasHeight = window.innerHeight; VirtualJoystick.vjCanvas.width = window.innerWidth; VirtualJoystick.vjCanvas.height = window.innerHeight; VirtualJoystick.vjCanvas.style.width = "100%"; VirtualJoystick.vjCanvas.style.height = "100%"; VirtualJoystick.vjCanvas.style.position = "absolute"; VirtualJoystick.vjCanvas.style.backgroundColor = "transparent"; VirtualJoystick.vjCanvas.style.top = "0px"; VirtualJoystick.vjCanvas.style.left = "0px"; VirtualJoystick.vjCanvas.style.zIndex = "5"; VirtualJoystick.vjCanvas.style.msTouchAction = "none"; VirtualJoystick.vjCanvasContext = VirtualJoystick.vjCanvas.getContext('2d'); VirtualJoystick.vjCanvasContext.strokeStyle = "#ffffff"; VirtualJoystick.vjCanvasContext.lineWidth = 2; document.body.appendChild(VirtualJoystick.vjCanvas); } VirtualJoystick.halfWidth = VirtualJoystick.vjCanvas.width / 2; VirtualJoystick.halfHeight = VirtualJoystick.vjCanvas.height / 2; this.pressed = false; // default joystick color this._joystickColor = "cyan"; this._joystickPointerID = -1; // current joystick position this._joystickPointerPos = new BABYLON.Vector2(0, 0); // origin joystick position this._joystickPointerStartPos = new BABYLON.Vector2(0, 0); this._deltaJoystickVector = new BABYLON.Vector2(0, 0); VirtualJoystick.vjCanvas.addEventListener('pointerdown', function (evt) { _this._onPointerDown(evt); }, false); VirtualJoystick.vjCanvas.addEventListener('pointermove', function (evt) { _this._onPointerMove(evt); }, false); VirtualJoystick.vjCanvas.addEventListener('pointerup', function (evt) { _this._onPointerUp(evt); }, false); VirtualJoystick.vjCanvas.addEventListener('pointerout', function (evt) { _this._onPointerUp(evt); }, false); VirtualJoystick.vjCanvas.addEventListener("contextmenu", function (evt) { evt.preventDefault(); // Disables system menu }, false); requestAnimationFrame(function () { _this._drawVirtualJoystick(); }); } VirtualJoystick.prototype.setJoystickSensibility = function (newJoystickSensibility) { this._joystickSensibility = newJoystickSensibility; this._inversedSensibility = 1 / (this._joystickSensibility / 1000); }; VirtualJoystick.prototype._onPointerDown = function (e) { var positionOnScreenCondition; e.preventDefault(); if (this._leftJoystick === true) { positionOnScreenCondition = (e.clientX < VirtualJoystick.halfWidth); } else { positionOnScreenCondition = (e.clientX > VirtualJoystick.halfWidth); } if (positionOnScreenCondition && this._joystickPointerID < 0) { // First contact will be dedicated to the virtual joystick this._joystickPointerID = e.pointerId; this._joystickPointerStartPos.x = e.clientX; this._joystickPointerStartPos.y = e.clientY; this._joystickPointerPos = this._joystickPointerStartPos.clone(); this._deltaJoystickVector.x = 0; this._deltaJoystickVector.y = 0; this.pressed = true; this._touches.add(e.pointerId.toString(), e); } else { // You can only trigger the action buttons with a joystick declared if (VirtualJoystick._globalJoystickIndex < 2 && this._action) { this._action(); this._touches.add(e.pointerId.toString(), e); } } }; VirtualJoystick.prototype._onPointerMove = function (e) { // If the current pointer is the one associated to the joystick (first touch contact) if (this._joystickPointerID == e.pointerId) { this._joystickPointerPos.x = e.clientX; this._joystickPointerPos.y = e.clientY; this._deltaJoystickVector = this._joystickPointerPos.clone(); this._deltaJoystickVector = this._deltaJoystickVector.subtract(this._joystickPointerStartPos); var directionLeftRight = this.reverseLeftRight ? -1 : 1; var deltaJoystickX = directionLeftRight * this._deltaJoystickVector.x / this._inversedSensibility; switch (this._axisTargetedByLeftAndRight) { case 0 /* X */: this.deltaPosition.x = Math.min(1, Math.max(-1, deltaJoystickX)); break; case 1 /* Y */: this.deltaPosition.y = Math.min(1, Math.max(-1, deltaJoystickX)); break; case 2 /* Z */: this.deltaPosition.z = Math.min(1, Math.max(-1, deltaJoystickX)); break; } var directionUpDown = this.reverseUpDown ? 1 : -1; var deltaJoystickY = directionUpDown * this._deltaJoystickVector.y / this._inversedSensibility; switch (this._axisTargetedByUpAndDown) { case 0 /* X */: this.deltaPosition.x = Math.min(1, Math.max(-1, deltaJoystickY)); break; case 1 /* Y */: this.deltaPosition.y = Math.min(1, Math.max(-1, deltaJoystickY)); break; case 2 /* Z */: this.deltaPosition.z = Math.min(1, Math.max(-1, deltaJoystickY)); break; } } else { if (this._touches.item(e.pointerId.toString())) { this._touches.item(e.pointerId.toString()).x = e.clientX; this._touches.item(e.pointerId.toString()).y = e.clientY; } } }; VirtualJoystick.prototype._onPointerUp = function (e) { this._clearCanvas(); if (this._joystickPointerID == e.pointerId) { this._joystickPointerID = -1; this.pressed = false; } this._deltaJoystickVector.x = 0; this._deltaJoystickVector.y = 0; this._touches.remove(e.pointerId.toString()); }; /** * Change the color of the virtual joystick * @param newColor a string that must be a CSS color value (like "red") or the hexa value (like "#FF0000") */ VirtualJoystick.prototype.setJoystickColor = function (newColor) { this._joystickColor = newColor; }; VirtualJoystick.prototype.setActionOnTouch = function (action) { this._action = action; }; // Define which axis you'd like to control for left & right VirtualJoystick.prototype.setAxisForLeftRight = function (axis) { switch (axis) { case 0 /* X */: case 1 /* Y */: case 2 /* Z */: this._axisTargetedByLeftAndRight = axis; break; default: this._axisTargetedByLeftAndRight = 0 /* X */; break; } }; // Define which axis you'd like to control for up & down VirtualJoystick.prototype.setAxisForUpDown = function (axis) { switch (axis) { case 0 /* X */: case 1 /* Y */: case 2 /* Z */: this._axisTargetedByUpAndDown = axis; break; default: this._axisTargetedByUpAndDown = 1 /* Y */; break; } }; VirtualJoystick.prototype._clearCanvas = function () { if (this._leftJoystick) { VirtualJoystick.vjCanvasContext.clearRect(0, 0, VirtualJoystick.vjCanvasWidth / 2, VirtualJoystick.vjCanvasHeight); } else { VirtualJoystick.vjCanvasContext.clearRect(VirtualJoystick.vjCanvasWidth / 2, 0, VirtualJoystick.vjCanvasWidth, VirtualJoystick.vjCanvasHeight); } }; VirtualJoystick.prototype._drawVirtualJoystick = function () { var _this = this; if (this.pressed) { this._clearCanvas(); this._touches.forEach(function (touch) { if (touch.pointerId === _this._joystickPointerID) { VirtualJoystick.vjCanvasContext.beginPath(); VirtualJoystick.vjCanvasContext.strokeStyle = _this._joystickColor; VirtualJoystick.vjCanvasContext.lineWidth = 6; VirtualJoystick.vjCanvasContext.arc(_this._joystickPointerStartPos.x, _this._joystickPointerStartPos.y, 40, 0, Math.PI * 2, true); VirtualJoystick.vjCanvasContext.stroke(); VirtualJoystick.vjCanvasContext.beginPath(); VirtualJoystick.vjCanvasContext.strokeStyle = _this._joystickColor; VirtualJoystick.vjCanvasContext.lineWidth = 2; VirtualJoystick.vjCanvasContext.arc(_this._joystickPointerStartPos.x, _this._joystickPointerStartPos.y, 60, 0, Math.PI * 2, true); VirtualJoystick.vjCanvasContext.stroke(); VirtualJoystick.vjCanvasContext.beginPath(); VirtualJoystick.vjCanvasContext.strokeStyle = _this._joystickColor; VirtualJoystick.vjCanvasContext.arc(_this._joystickPointerPos.x, _this._joystickPointerPos.y, 40, 0, Math.PI * 2, true); VirtualJoystick.vjCanvasContext.stroke(); } else { VirtualJoystick.vjCanvasContext.beginPath(); VirtualJoystick.vjCanvasContext.fillStyle = "white"; VirtualJoystick.vjCanvasContext.beginPath(); VirtualJoystick.vjCanvasContext.strokeStyle = "red"; VirtualJoystick.vjCanvasContext.lineWidth = 6; VirtualJoystick.vjCanvasContext.arc(touch.x, touch.y, 40, 0, Math.PI * 2, true); VirtualJoystick.vjCanvasContext.stroke(); } ; }); } requestAnimationFrame(function () { _this._drawVirtualJoystick(); }); }; VirtualJoystick.prototype.releaseCanvas = function () { if (VirtualJoystick.vjCanvas) { document.body.removeChild(VirtualJoystick.vjCanvas); VirtualJoystick.vjCanvas = null; } }; VirtualJoystick._globalJoystickIndex = 0; return VirtualJoystick; })(); BABYLON.VirtualJoystick = VirtualJoystick; })(BABYLON || (BABYLON = {})); var BABYLON; (function (BABYLON) { (function (VirtualJoystick) { var Collection = (function () { function Collection() { this._count = 0; this._collection = new Array(); } Collection.prototype.Count = function () { return this._count; }; Collection.prototype.add = function (key, item) { if (this._collection[key] != undefined) { return undefined; } this._collection[key] = item; return ++this._count; }; Collection.prototype.remove = function (key) { if (this._collection[key] == undefined) { return undefined; } delete this._collection[key]; return --this._count; }; Collection.prototype.item = function (key) { return this._collection[key]; }; Collection.prototype.forEach = function (block) { var key; for (key in this._collection) { if (this._collection.hasOwnProperty(key)) { block(this._collection[key]); } } }; return Collection; })(); VirtualJoystick.Collection = Collection; })(BABYLON.VirtualJoystick || (BABYLON.VirtualJoystick = {})); var VirtualJoystick = BABYLON.VirtualJoystick; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.virtualJoystick.js.map var BABYLON; (function (BABYLON) { var OculusRiftDevKit2013_Metric = { HResolution: 1280, VResolution: 800, HScreenSize: 0.149759993, VScreenSize: 0.0935999975, VScreenCenter: 0.0467999987, EyeToScreenDistance: 0.0410000011, LensSeparationDistance: 0.0635000020, InterpupillaryDistance: 0.0640000030, DistortionK: [1.0, 0.219999999, 0.239999995, 0.0], ChromaAbCorrection: [0.995999992, -0.00400000019, 1.01400006, 0.0], PostProcessScaleFactor: 1.714605507808412, LensCenterOffset: 0.151976421 }; var _OculusInnerCamera = (function (_super) { __extends(_OculusInnerCamera, _super); function _OculusInnerCamera(name, position, scene, isLeftEye) { _super.call(this, name, position, scene); this._workMatrix = new BABYLON.Matrix(); this._actualUp = new BABYLON.Vector3(0, 0, 0); // Constants this._aspectRatioAspectRatio = OculusRiftDevKit2013_Metric.HResolution / (2 * OculusRiftDevKit2013_Metric.VResolution); this._aspectRatioFov = (2 * Math.atan((OculusRiftDevKit2013_Metric.PostProcessScaleFactor * OculusRiftDevKit2013_Metric.VScreenSize) / (2 * OculusRiftDevKit2013_Metric.EyeToScreenDistance))); var hMeters = (OculusRiftDevKit2013_Metric.HScreenSize / 4) - (OculusRiftDevKit2013_Metric.LensSeparationDistance / 2); var h = (4 * hMeters) / OculusRiftDevKit2013_Metric.HScreenSize; this._hMatrix = BABYLON.Matrix.Translation(isLeftEye ? h : -h, 0, 0); this.viewport = new BABYLON.Viewport(isLeftEye ? 0 : 0.5, 0, 0.5, 1.0); this._preViewMatrix = BABYLON.Matrix.Translation(isLeftEye ? .5 * OculusRiftDevKit2013_Metric.InterpupillaryDistance : -.5 * OculusRiftDevKit2013_Metric.InterpupillaryDistance, 0, 0); // Postprocess var postProcess = new BABYLON.OculusDistortionCorrectionPostProcess("Oculus Distortion", this, !isLeftEye, OculusRiftDevKit2013_Metric); } _OculusInnerCamera.prototype.getProjectionMatrix = function () { BABYLON.Matrix.PerspectiveFovLHToRef(this._aspectRatioFov, this._aspectRatioAspectRatio, this.minZ, this.maxZ, this._workMatrix); this._workMatrix.multiplyToRef(this._hMatrix, this._projectionMatrix); return this._projectionMatrix; }; _OculusInnerCamera.prototype._getViewMatrix = function () { BABYLON.Matrix.RotationYawPitchRollToRef(this.rotation.y, this.rotation.x, this.rotation.z, this._cameraRotationMatrix); BABYLON.Vector3.TransformCoordinatesToRef(this._referencePoint, this._cameraRotationMatrix, this._transformedReferencePoint); BABYLON.Vector3.TransformNormalToRef(this.upVector, this._cameraRotationMatrix, this._actualUp); // Computing target and final matrix this.position.addToRef(this._transformedReferencePoint, this._currentTarget); BABYLON.Matrix.LookAtLHToRef(this.position, this._currentTarget, this._actualUp, this._workMatrix); this._workMatrix.multiplyToRef(this._preViewMatrix, this._viewMatrix); return this._viewMatrix; }; return _OculusInnerCamera; })(BABYLON.FreeCamera); var OculusCamera = (function (_super) { __extends(OculusCamera, _super); function OculusCamera(name, position, scene) { _super.call(this, name, position, scene); this._leftCamera = new _OculusInnerCamera(name + "_left", position.clone(), scene, true); this._rightCamera = new _OculusInnerCamera(name + "_right", position.clone(), scene, false); this.subCameras.push(this._leftCamera); this.subCameras.push(this._rightCamera); this._deviceOrientationHandler = this._onOrientationEvent.bind(this); } OculusCamera.prototype._update = function () { this._leftCamera.position.copyFrom(this.position); this._rightCamera.position.copyFrom(this.position); this._updateCamera(this._leftCamera); this._updateCamera(this._rightCamera); _super.prototype._update.call(this); }; OculusCamera.prototype._updateCamera = function (camera) { camera.minZ = this.minZ; camera.maxZ = this.maxZ; camera.rotation.x = this.rotation.x; camera.rotation.y = this.rotation.y; camera.rotation.z = this.rotation.z; }; // Oculus events OculusCamera.prototype._onOrientationEvent = function (evt) { var yaw = evt.alpha / 180 * Math.PI; var pitch = evt.beta / 180 * Math.PI; var roll = evt.gamma / 180 * Math.PI; if (!this._offsetOrientation) { this._offsetOrientation = { yaw: yaw, pitch: pitch, roll: roll }; return; } else { this.rotation.y += yaw - this._offsetOrientation.yaw; this.rotation.x += pitch - this._offsetOrientation.pitch; this.rotation.z += this._offsetOrientation.roll - roll; this._offsetOrientation.yaw = yaw; this._offsetOrientation.pitch = pitch; this._offsetOrientation.roll = roll; } }; OculusCamera.prototype.attachControl = function (element, noPreventDefault) { _super.prototype.attachControl.call(this, element, noPreventDefault); window.addEventListener("deviceorientation", this._deviceOrientationHandler); }; OculusCamera.prototype.detachControl = function (element) { _super.prototype.detachControl.call(this, element); window.removeEventListener("deviceorientation", this._deviceOrientationHandler); }; return OculusCamera; })(BABYLON.FreeCamera); BABYLON.OculusCamera = OculusCamera; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.oculusCamera.js.map var BABYLON; (function (BABYLON) { var OculusRiftDevKit2013_Metric = { HResolution: 1280, VResolution: 800, HScreenSize: 0.149759993, VScreenSize: 0.0935999975, VScreenCenter: 0.0467999987, EyeToScreenDistance: 0.0410000011, LensSeparationDistance: 0.0635000020, InterpupillaryDistance: 0.0640000030, DistortionK: [1.0, 0.219999999, 0.239999995, 0.0], ChromaAbCorrection: [0.995999992, -0.00400000019, 1.01400006, 0.0], PostProcessScaleFactor: 1.714605507808412, LensCenterOffset: 0.151976421 }; var _OculusInnerGamepadCamera = (function (_super) { __extends(_OculusInnerGamepadCamera, _super); function _OculusInnerGamepadCamera(name, position, scene, isLeftEye) { _super.call(this, name, position, scene); this._workMatrix = new BABYLON.Matrix(); this._actualUp = new BABYLON.Vector3(0, 0, 0); // Constants this._aspectRatioAspectRatio = OculusRiftDevKit2013_Metric.HResolution / (2 * OculusRiftDevKit2013_Metric.VResolution); this._aspectRatioFov = (2 * Math.atan((OculusRiftDevKit2013_Metric.PostProcessScaleFactor * OculusRiftDevKit2013_Metric.VScreenSize) / (2 * OculusRiftDevKit2013_Metric.EyeToScreenDistance))); var hMeters = (OculusRiftDevKit2013_Metric.HScreenSize / 4) - (OculusRiftDevKit2013_Metric.LensSeparationDistance / 2); var h = (4 * hMeters) / OculusRiftDevKit2013_Metric.HScreenSize; this._hMatrix = BABYLON.Matrix.Translation(isLeftEye ? h : -h, 0, 0); this.viewport = new BABYLON.Viewport(isLeftEye ? 0 : 0.5, 0, 0.5, 1.0); this._preViewMatrix = BABYLON.Matrix.Translation(isLeftEye ? .5 * OculusRiftDevKit2013_Metric.InterpupillaryDistance : -.5 * OculusRiftDevKit2013_Metric.InterpupillaryDistance, 0, 0); // Postprocess var postProcess = new BABYLON.OculusDistortionCorrectionPostProcess("Oculus Distortion", this, !isLeftEye, OculusRiftDevKit2013_Metric); } _OculusInnerGamepadCamera.prototype.getProjectionMatrix = function () { BABYLON.Matrix.PerspectiveFovLHToRef(this._aspectRatioFov, this._aspectRatioAspectRatio, this.minZ, this.maxZ, this._workMatrix); this._workMatrix.multiplyToRef(this._hMatrix, this._projectionMatrix); return this._projectionMatrix; }; _OculusInnerGamepadCamera.prototype._getViewMatrix = function () { BABYLON.Matrix.RotationYawPitchRollToRef(this.rotation.y, this.rotation.x, this.rotation.z, this._cameraRotationMatrix); BABYLON.Vector3.TransformCoordinatesToRef(this._referencePoint, this._cameraRotationMatrix, this._transformedReferencePoint); BABYLON.Vector3.TransformNormalToRef(this.upVector, this._cameraRotationMatrix, this._actualUp); // Computing target and final matrix this.position.addToRef(this._transformedReferencePoint, this._currentTarget); BABYLON.Matrix.LookAtLHToRef(this.position, this._currentTarget, this._actualUp, this._workMatrix); this._workMatrix.multiplyToRef(this._preViewMatrix, this._viewMatrix); return this._viewMatrix; }; return _OculusInnerGamepadCamera; })(BABYLON.FreeCamera); var OculusGamepadCamera = (function (_super) { __extends(OculusGamepadCamera, _super); function OculusGamepadCamera(name, position, scene) { var _this = this; _super.call(this, name, position, scene); this.angularSensibility = 200; this.moveSensibility = 75; this._leftCamera = new _OculusInnerGamepadCamera(name + "_left", position.clone(), scene, true); this._rightCamera = new _OculusInnerGamepadCamera(name + "_right", position.clone(), scene, false); this.subCameras.push(this._leftCamera); this.subCameras.push(this._rightCamera); this._deviceOrientationHandler = this._onOrientationEvent.bind(this); this._gamepads = new BABYLON.Gamepads(function (gamepad) { _this._onNewGameConnected(gamepad); }); } OculusGamepadCamera.prototype._onNewGameConnected = function (gamepad) { // Only the first gamepad can control the camera if (gamepad.index === 0) { this._gamepad = gamepad; } }; OculusGamepadCamera.prototype._update = function () { this._leftCamera.position.copyFrom(this.position); this._rightCamera.position.copyFrom(this.position); this._updateCamera(this._leftCamera); this._updateCamera(this._rightCamera); _super.prototype._update.call(this); }; OculusGamepadCamera.prototype._checkInputs = function () { if (!this._gamepad) { return; } var LSValues = this._gamepad.leftStick; var normalizedLX = LSValues.x / this.moveSensibility; var normalizedLY = LSValues.y / this.moveSensibility; LSValues.x = Math.abs(normalizedLX) > 0.005 ? 0 + normalizedLX : 0; LSValues.y = Math.abs(normalizedLY) > 0.005 ? 0 + normalizedLY : 0; var cameraTransform = BABYLON.Matrix.RotationYawPitchRoll(this.rotation.y, this.rotation.x, 0); var deltaTransform = BABYLON.Vector3.TransformCoordinates(new BABYLON.Vector3(LSValues.x, 0, -LSValues.y), cameraTransform); this.cameraDirection = this.cameraDirection.add(deltaTransform); }; OculusGamepadCamera.prototype._updateCamera = function (camera) { camera.minZ = this.minZ; camera.maxZ = this.maxZ; camera.rotation.x = this.rotation.x; camera.rotation.y = this.rotation.y; camera.rotation.z = this.rotation.z; }; // Oculus events OculusGamepadCamera.prototype._onOrientationEvent = function (evt) { var yaw = evt.alpha / 180 * Math.PI; var pitch = evt.beta / 180 * Math.PI; var roll = evt.gamma / 180 * Math.PI; if (!this._offsetOrientation) { this._offsetOrientation = { yaw: yaw, pitch: pitch, roll: roll }; return; } else { this.rotation.y += yaw - this._offsetOrientation.yaw; this.rotation.x += pitch - this._offsetOrientation.pitch; this.rotation.z += this._offsetOrientation.roll - roll; this._offsetOrientation.yaw = yaw; this._offsetOrientation.pitch = pitch; this._offsetOrientation.roll = roll; } }; OculusGamepadCamera.prototype.attachControl = function (element, noPreventDefault) { _super.prototype.attachControl.call(this, element, noPreventDefault); window.addEventListener("deviceorientation", this._deviceOrientationHandler); }; OculusGamepadCamera.prototype.detachControl = function (element) { _super.prototype.detachControl.call(this, element); window.removeEventListener("deviceorientation", this._deviceOrientationHandler); }; OculusGamepadCamera.prototype.dispose = function () { this._gamepads.dispose(); _super.prototype.dispose.call(this); }; return OculusGamepadCamera; })(BABYLON.FreeCamera); BABYLON.OculusGamepadCamera = OculusGamepadCamera; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.oculusGamepadCamera.js.map var BABYLON; (function (BABYLON) { // We're mainly based on the logic defined into the FreeCamera code var VirtualJoysticksCamera = (function (_super) { __extends(VirtualJoysticksCamera, _super); function VirtualJoysticksCamera(name, position, scene) { _super.call(this, name, position, scene); this._leftjoystick = new BABYLON.VirtualJoystick(true); this._leftjoystick.setAxisForUpDown(2 /* Z */); this._leftjoystick.setAxisForLeftRight(0 /* X */); this._leftjoystick.setJoystickSensibility(0.15); this._rightjoystick = new BABYLON.VirtualJoystick(false); this._rightjoystick.setAxisForUpDown(0 /* X */); this._rightjoystick.setAxisForLeftRight(1 /* Y */); this._rightjoystick.reverseUpDown = true; this._rightjoystick.setJoystickSensibility(0.05); this._rightjoystick.setJoystickColor("yellow"); } VirtualJoysticksCamera.prototype._checkInputs = function () { var cameraTransform = BABYLON.Matrix.RotationYawPitchRoll(this.rotation.y, this.rotation.x, 0); var deltaTransform = BABYLON.Vector3.TransformCoordinates(this._leftjoystick.deltaPosition, cameraTransform); this.cameraDirection = this.cameraDirection.add(deltaTransform); this.cameraRotation = this.cameraRotation.addVector3(this._rightjoystick.deltaPosition); if (!this._leftjoystick.pressed) { this._leftjoystick.deltaPosition = this._leftjoystick.deltaPosition.scale(0.9); } if (!this._rightjoystick.pressed) { this._rightjoystick.deltaPosition = this._rightjoystick.deltaPosition.scale(0.9); } }; VirtualJoysticksCamera.prototype.dispose = function () { this._leftjoystick.releaseCanvas(); _super.prototype.dispose.call(this); }; return VirtualJoysticksCamera; })(BABYLON.FreeCamera); BABYLON.VirtualJoysticksCamera = VirtualJoysticksCamera; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.virtualJoysticksCamera.js.map var BABYLON; (function (BABYLON) { var ShaderMaterial = (function (_super) { __extends(ShaderMaterial, _super); function ShaderMaterial(name, scene, shaderPath, options) { _super.call(this, name, scene); this._textures = new Array(); this._floats = new Array(); this._floatsArrays = {}; this._colors3 = new Array(); this._colors4 = new Array(); this._vectors2 = new Array(); this._vectors3 = new Array(); this._matrices = new Array(); this._cachedWorldViewMatrix = new BABYLON.Matrix(); this._shaderPath = shaderPath; options.needAlphaBlending = options.needAlphaBlending || false; options.needAlphaTesting = options.needAlphaTesting || false; options.attributes = options.attributes || ["position", "normal", "uv"]; options.uniforms = options.uniforms || ["worldViewProjection"]; options.samplers = options.samplers || []; this._options = options; } ShaderMaterial.prototype.needAlphaBlending = function () { return this._options.needAlphaBlending; }; ShaderMaterial.prototype.needAlphaTesting = function () { return this._options.needAlphaTesting; }; ShaderMaterial.prototype._checkUniform = function (uniformName) { if (this._options.uniforms.indexOf(uniformName) === -1) { this._options.uniforms.push(uniformName); } }; ShaderMaterial.prototype.setTexture = function (name, texture) { if (this._options.samplers.indexOf(name) === -1) { this._options.samplers.push(name); } this._textures[name] = texture; return this; }; ShaderMaterial.prototype.setFloat = function (name, value) { this._checkUniform(name); this._floats[name] = value; return this; }; ShaderMaterial.prototype.setFloats = function (name, value) { this._checkUniform(name); this._floatsArrays[name] = value; return this; }; ShaderMaterial.prototype.setColor3 = function (name, value) { this._checkUniform(name); this._colors3[name] = value; return this; }; ShaderMaterial.prototype.setColor4 = function (name, value) { this._checkUniform(name); this._colors4[name] = value; return this; }; ShaderMaterial.prototype.setVector2 = function (name, value) { this._checkUniform(name); this._vectors2[name] = value; return this; }; ShaderMaterial.prototype.setVector3 = function (name, value) { this._checkUniform(name); this._vectors3[name] = value; return this; }; ShaderMaterial.prototype.setMatrix = function (name, value) { this._checkUniform(name); this._matrices[name] = value; return this; }; ShaderMaterial.prototype.isReady = function () { var scene = this.getScene(); var engine = scene.getEngine(); if (!this.checkReadyOnEveryCall) { if (this._renderId === scene.getRenderId()) { return true; } } var previousEffect = this._effect; this._effect = engine.createEffect(this._shaderPath, this._options.attributes, this._options.uniforms, this._options.samplers, "", null, this.onCompiled, this.onError); if (!this._effect.isReady()) { return false; } if (previousEffect !== this._effect) { scene.resetCachedMaterial(); } this._renderId = scene.getRenderId(); return true; }; ShaderMaterial.prototype.bindOnlyWorldMatrix = function (world) { var scene = this.getScene(); if (this._options.uniforms.indexOf("world") !== -1) { this._effect.setMatrix("world", world); } if (this._options.uniforms.indexOf("worldView") !== -1) { world.multiplyToRef(scene.getViewMatrix(), this._cachedWorldViewMatrix); this._effect.setMatrix("worldView", this._cachedWorldViewMatrix); } if (this._options.uniforms.indexOf("worldViewProjection") !== -1) { this._effect.setMatrix("worldViewProjection", world.multiply(scene.getTransformMatrix())); } }; ShaderMaterial.prototype.bind = function (world) { // Std values this.bindOnlyWorldMatrix(world); if (this.getScene().getCachedMaterial() !== this) { if (this._options.uniforms.indexOf("view") !== -1) { this._effect.setMatrix("view", this.getScene().getViewMatrix()); } if (this._options.uniforms.indexOf("projection") !== -1) { this._effect.setMatrix("projection", this.getScene().getProjectionMatrix()); } if (this._options.uniforms.indexOf("viewProjection") !== -1) { this._effect.setMatrix("viewProjection", this.getScene().getTransformMatrix()); } for (var name in this._textures) { this._effect.setTexture(name, this._textures[name]); } for (name in this._floats) { this._effect.setFloat(name, this._floats[name]); } for (name in this._floatsArrays) { this._effect.setArray(name, this._floatsArrays[name]); } for (name in this._colors3) { this._effect.setColor3(name, this._colors3[name]); } for (name in this._colors4) { var color = this._colors4[name]; this._effect.setFloat4(name, color.r, color.g, color.b, color.a); } for (name in this._vectors2) { this._effect.setVector2(name, this._vectors2[name]); } for (name in this._vectors3) { this._effect.setVector3(name, this._vectors3[name]); } for (name in this._matrices) { this._effect.setMatrix(name, this._matrices[name]); } } _super.prototype.bind.call(this, world, null); }; ShaderMaterial.prototype.dispose = function (forceDisposeEffect) { for (var name in this._textures) { this._textures[name].dispose(); } this._textures = []; _super.prototype.dispose.call(this, forceDisposeEffect); }; return ShaderMaterial; })(BABYLON.Material); BABYLON.ShaderMaterial = ShaderMaterial; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.shaderMaterial.js.map var BABYLON; (function (BABYLON) { var VertexData = (function () { function VertexData() { } VertexData.prototype.set = function (data, kind) { switch (kind) { case BABYLON.VertexBuffer.PositionKind: this.positions = data; break; case BABYLON.VertexBuffer.NormalKind: this.normals = data; break; case BABYLON.VertexBuffer.UVKind: this.uvs = data; break; case BABYLON.VertexBuffer.UV2Kind: this.uv2s = data; break; case BABYLON.VertexBuffer.ColorKind: this.colors = data; break; case BABYLON.VertexBuffer.MatricesIndicesKind: this.matricesIndices = data; break; case BABYLON.VertexBuffer.MatricesWeightsKind: this.matricesWeights = data; break; } }; VertexData.prototype.applyToMesh = function (mesh, updatable) { this._applyTo(mesh, updatable); }; VertexData.prototype.applyToGeometry = function (geometry, updatable) { this._applyTo(geometry, updatable); }; VertexData.prototype.updateMesh = function (mesh, updateExtends, makeItUnique) { this._update(mesh); }; VertexData.prototype.updateGeometry = function (geometry, updateExtends, makeItUnique) { this._update(geometry); }; VertexData.prototype._applyTo = function (meshOrGeometry, updatable) { if (this.positions) { meshOrGeometry.setVerticesData(BABYLON.VertexBuffer.PositionKind, this.positions, updatable); } if (this.normals) { meshOrGeometry.setVerticesData(BABYLON.VertexBuffer.NormalKind, this.normals, updatable); } if (this.uvs) { meshOrGeometry.setVerticesData(BABYLON.VertexBuffer.UVKind, this.uvs, updatable); } if (this.uv2s) { meshOrGeometry.setVerticesData(BABYLON.VertexBuffer.UV2Kind, this.uv2s, updatable); } if (this.colors) { meshOrGeometry.setVerticesData(BABYLON.VertexBuffer.ColorKind, this.colors, updatable); } if (this.matricesIndices) { meshOrGeometry.setVerticesData(BABYLON.VertexBuffer.MatricesIndicesKind, this.matricesIndices, updatable); } if (this.matricesWeights) { meshOrGeometry.setVerticesData(BABYLON.VertexBuffer.MatricesWeightsKind, this.matricesWeights, updatable); } if (this.indices) { meshOrGeometry.setIndices(this.indices); } }; VertexData.prototype._update = function (meshOrGeometry, updateExtends, makeItUnique) { if (this.positions) { meshOrGeometry.updateVerticesData(BABYLON.VertexBuffer.PositionKind, this.positions, updateExtends, makeItUnique); } if (this.normals) { meshOrGeometry.updateVerticesData(BABYLON.VertexBuffer.NormalKind, this.normals, updateExtends, makeItUnique); } if (this.uvs) { meshOrGeometry.updateVerticesData(BABYLON.VertexBuffer.UVKind, this.uvs, updateExtends, makeItUnique); } if (this.uv2s) { meshOrGeometry.updateVerticesData(BABYLON.VertexBuffer.UV2Kind, this.uv2s, updateExtends, makeItUnique); } if (this.colors) { meshOrGeometry.updateVerticesData(BABYLON.VertexBuffer.ColorKind, this.colors, updateExtends, makeItUnique); } if (this.matricesIndices) { meshOrGeometry.updateVerticesData(BABYLON.VertexBuffer.MatricesIndicesKind, this.matricesIndices, updateExtends, makeItUnique); } if (this.matricesWeights) { meshOrGeometry.updateVerticesData(BABYLON.VertexBuffer.MatricesWeightsKind, this.matricesWeights, updateExtends, makeItUnique); } if (this.indices) { meshOrGeometry.setIndices(this.indices); } }; VertexData.prototype.transform = function (matrix) { var transformed = BABYLON.Vector3.Zero(); if (this.positions) { var position = BABYLON.Vector3.Zero(); for (var index = 0; index < this.positions.length; index += 3) { BABYLON.Vector3.FromArrayToRef(this.positions, index, position); BABYLON.Vector3.TransformCoordinatesToRef(position, matrix, transformed); this.positions[index] = transformed.x; this.positions[index + 1] = transformed.y; this.positions[index + 2] = transformed.z; } } if (this.normals) { var normal = BABYLON.Vector3.Zero(); for (index = 0; index < this.normals.length; index += 3) { BABYLON.Vector3.FromArrayToRef(this.normals, index, normal); BABYLON.Vector3.TransformNormalToRef(normal, matrix, transformed); this.normals[index] = transformed.x; this.normals[index + 1] = transformed.y; this.normals[index + 2] = transformed.z; } } }; VertexData.prototype.merge = function (other) { if (other.indices) { if (!this.indices) { this.indices = []; } var offset = this.positions ? this.positions.length / 3 : 0; for (var index = 0; index < other.indices.length; index++) { this.indices.push(other.indices[index] + offset); } } if (other.positions) { if (!this.positions) { this.positions = []; } for (index = 0; index < other.positions.length; index++) { this.positions.push(other.positions[index]); } } if (other.normals) { if (!this.normals) { this.normals = []; } for (index = 0; index < other.normals.length; index++) { this.normals.push(other.normals[index]); } } if (other.uvs) { if (!this.uvs) { this.uvs = []; } for (index = 0; index < other.uvs.length; index++) { this.uvs.push(other.uvs[index]); } } if (other.uv2s) { if (!this.uv2s) { this.uv2s = []; } for (index = 0; index < other.uv2s.length; index++) { this.uv2s.push(other.uv2s[index]); } } if (other.matricesIndices) { if (!this.matricesIndices) { this.matricesIndices = []; } for (index = 0; index < other.matricesIndices.length; index++) { this.matricesIndices.push(other.matricesIndices[index]); } } if (other.matricesWeights) { if (!this.matricesWeights) { this.matricesWeights = []; } for (index = 0; index < other.matricesWeights.length; index++) { this.matricesWeights.push(other.matricesWeights[index]); } } if (other.colors) { if (!this.colors) { this.colors = []; } for (index = 0; index < other.colors.length; index++) { this.colors.push(other.colors[index]); } } }; // Statics VertexData.ExtractFromMesh = function (mesh) { return VertexData._ExtractFrom(mesh); }; VertexData.ExtractFromGeometry = function (geometry) { return VertexData._ExtractFrom(geometry); }; VertexData._ExtractFrom = function (meshOrGeometry) { var result = new BABYLON.VertexData(); if (meshOrGeometry.isVerticesDataPresent(BABYLON.VertexBuffer.PositionKind)) { result.positions = meshOrGeometry.getVerticesData(BABYLON.VertexBuffer.PositionKind); } if (meshOrGeometry.isVerticesDataPresent(BABYLON.VertexBuffer.NormalKind)) { result.normals = meshOrGeometry.getVerticesData(BABYLON.VertexBuffer.NormalKind); } if (meshOrGeometry.isVerticesDataPresent(BABYLON.VertexBuffer.UVKind)) { result.uvs = meshOrGeometry.getVerticesData(BABYLON.VertexBuffer.UVKind); } if (meshOrGeometry.isVerticesDataPresent(BABYLON.VertexBuffer.UV2Kind)) { result.uv2s = meshOrGeometry.getVerticesData(BABYLON.VertexBuffer.UV2Kind); } if (meshOrGeometry.isVerticesDataPresent(BABYLON.VertexBuffer.ColorKind)) { result.colors = meshOrGeometry.getVerticesData(BABYLON.VertexBuffer.ColorKind); } if (meshOrGeometry.isVerticesDataPresent(BABYLON.VertexBuffer.MatricesIndicesKind)) { result.matricesIndices = meshOrGeometry.getVerticesData(BABYLON.VertexBuffer.MatricesIndicesKind); } if (meshOrGeometry.isVerticesDataPresent(BABYLON.VertexBuffer.MatricesWeightsKind)) { result.matricesWeights = meshOrGeometry.getVerticesData(BABYLON.VertexBuffer.MatricesWeightsKind); } result.indices = meshOrGeometry.getIndices(); return result; }; VertexData.CreateBox = function (size) { var normalsSource = [ new BABYLON.Vector3(0, 0, 1), new BABYLON.Vector3(0, 0, -1), new BABYLON.Vector3(1, 0, 0), new BABYLON.Vector3(-1, 0, 0), new BABYLON.Vector3(0, 1, 0), new BABYLON.Vector3(0, -1, 0) ]; var indices = []; var positions = []; var normals = []; var uvs = []; size = size || 1; for (var index = 0; index < normalsSource.length; index++) { var normal = normalsSource[index]; // Get two vectors perpendicular to the face normal and to each other. var side1 = new BABYLON.Vector3(normal.y, normal.z, normal.x); var side2 = BABYLON.Vector3.Cross(normal, side1); // Six indices (two triangles) per face. var verticesLength = positions.length / 3; indices.push(verticesLength); indices.push(verticesLength + 1); indices.push(verticesLength + 2); indices.push(verticesLength); indices.push(verticesLength + 2); indices.push(verticesLength + 3); // Four vertices per face. var vertex = normal.subtract(side1).subtract(side2).scale(size / 2); positions.push(vertex.x, vertex.y, vertex.z); normals.push(normal.x, normal.y, normal.z); uvs.push(1.0, 1.0); vertex = normal.subtract(side1).add(side2).scale(size / 2); positions.push(vertex.x, vertex.y, vertex.z); normals.push(normal.x, normal.y, normal.z); uvs.push(0.0, 1.0); vertex = normal.add(side1).add(side2).scale(size / 2); positions.push(vertex.x, vertex.y, vertex.z); normals.push(normal.x, normal.y, normal.z); uvs.push(0.0, 0.0); vertex = normal.add(side1).subtract(side2).scale(size / 2); positions.push(vertex.x, vertex.y, vertex.z); normals.push(normal.x, normal.y, normal.z); uvs.push(1.0, 0.0); } // Result var vertexData = new BABYLON.VertexData(); vertexData.indices = indices; vertexData.positions = positions; vertexData.normals = normals; vertexData.uvs = uvs; return vertexData; }; VertexData.CreateSphere = function (segments, diameter) { segments = segments || 32; diameter = diameter || 1; var radius = diameter / 2; var totalZRotationSteps = 2 + segments; var totalYRotationSteps = 2 * totalZRotationSteps; var indices = []; var positions = []; var normals = []; var uvs = []; for (var zRotationStep = 0; zRotationStep <= totalZRotationSteps; zRotationStep++) { var normalizedZ = zRotationStep / totalZRotationSteps; var angleZ = (normalizedZ * Math.PI); for (var yRotationStep = 0; yRotationStep <= totalYRotationSteps; yRotationStep++) { var normalizedY = yRotationStep / totalYRotationSteps; var angleY = normalizedY * Math.PI * 2; var rotationZ = BABYLON.Matrix.RotationZ(-angleZ); var rotationY = BABYLON.Matrix.RotationY(angleY); var afterRotZ = BABYLON.Vector3.TransformCoordinates(BABYLON.Vector3.Up(), rotationZ); var complete = BABYLON.Vector3.TransformCoordinates(afterRotZ, rotationY); var vertex = complete.scale(radius); var normal = BABYLON.Vector3.Normalize(vertex); positions.push(vertex.x, vertex.y, vertex.z); normals.push(normal.x, normal.y, normal.z); uvs.push(normalizedZ, normalizedY); } if (zRotationStep > 0) { var verticesCount = positions.length / 3; for (var firstIndex = verticesCount - 2 * (totalYRotationSteps + 1); (firstIndex + totalYRotationSteps + 2) < verticesCount; firstIndex++) { indices.push((firstIndex)); indices.push((firstIndex + 1)); indices.push(firstIndex + totalYRotationSteps + 1); indices.push((firstIndex + totalYRotationSteps + 1)); indices.push((firstIndex + 1)); indices.push((firstIndex + totalYRotationSteps + 2)); } } } // Result var vertexData = new BABYLON.VertexData(); vertexData.indices = indices; vertexData.positions = positions; vertexData.normals = normals; vertexData.uvs = uvs; return vertexData; }; VertexData.CreateCylinder = function (height, diameterTop, diameterBottom, tessellation, subdivisions) { if (typeof subdivisions === "undefined") { subdivisions = 1; } var radiusTop = diameterTop / 2; var radiusBottom = diameterBottom / 2; var indices = []; var positions = []; var normals = []; var uvs = []; height = height || 1; diameterTop = diameterTop || 0.5; diameterBottom = diameterBottom || 1; tessellation = tessellation || 16; subdivisions = subdivisions || 1; subdivisions = (subdivisions < 1) ? 1 : subdivisions; var getCircleVector = function (i) { var angle = (i * 2.0 * Math.PI / tessellation); var dx = Math.cos(angle); var dz = Math.sin(angle); return new BABYLON.Vector3(dx, 0, dz); }; var createCylinderCap = function (isTop) { var radius = isTop ? radiusTop : radiusBottom; if (radius == 0) { return; } var vbase = positions.length / 3; var offset = new BABYLON.Vector3(0, height / 2, 0); var textureScale = new BABYLON.Vector2(0.5, 0.5); if (!isTop) { offset.scaleInPlace(-1); textureScale.x = -textureScale.x; } for (i = 0; i < tessellation; i++) { var circleVector = getCircleVector(i); var position = circleVector.scale(radius).add(offset); var textureCoordinate = new BABYLON.Vector2(circleVector.x * textureScale.x + 0.5, circleVector.z * textureScale.y + 0.5); positions.push(position.x, position.y, position.z); uvs.push(textureCoordinate.x, textureCoordinate.y); } for (var i = 0; i < tessellation - 2; i++) { if (!isTop) { indices.push(vbase); indices.push(vbase + (i + 2) % tessellation); indices.push(vbase + (i + 1) % tessellation); } else { indices.push(vbase); indices.push(vbase + (i + 1) % tessellation); indices.push(vbase + (i + 2) % tessellation); } } }; var base = new BABYLON.Vector3(0, -1, 0).scale(height / 2); var offset = new BABYLON.Vector3(0, 1, 0).scale(height / subdivisions); var stride = tessellation + 1; for (var i = 0; i <= tessellation; i++) { var circleVector = getCircleVector(i); var textureCoordinate = new BABYLON.Vector2(i / tessellation, 0); var position, radius = radiusBottom; for (var s = 0; s <= subdivisions; s++) { // Update variables position = circleVector.scale(radius); position.addInPlace(base.add(offset.scale(s))); textureCoordinate.y += 1 / subdivisions; radius += (radiusTop - radiusBottom) / subdivisions; // Push in arrays positions.push(position.x, position.y, position.z); uvs.push(textureCoordinate.x, textureCoordinate.y); } } subdivisions += 1; for (var s = 0; s < subdivisions - 1; s++) { for (var i = 0; i <= tessellation; i++) { indices.push(i * subdivisions + s); indices.push((i * subdivisions + (s + subdivisions)) % (stride * subdivisions)); indices.push(i * subdivisions + (s + 1)); indices.push(i * subdivisions + (s + 1)); indices.push((i * subdivisions + (s + subdivisions)) % (stride * subdivisions)); indices.push((i * subdivisions + (s + subdivisions + 1)) % (stride * subdivisions)); } } // Create flat triangle fan caps to seal the top and bottom. createCylinderCap(true); createCylinderCap(false); // Normals BABYLON.VertexData.ComputeNormals(positions, indices, normals); // Result var vertexData = new BABYLON.VertexData(); vertexData.indices = indices; vertexData.positions = positions; vertexData.normals = normals; vertexData.uvs = uvs; return vertexData; }; VertexData.CreateTorus = function (diameter, thickness, tessellation) { var indices = []; var positions = []; var normals = []; var uvs = []; diameter = diameter || 1; thickness = thickness || 0.5; tessellation = tessellation || 16; var stride = tessellation + 1; for (var i = 0; i <= tessellation; i++) { var u = i / tessellation; var outerAngle = i * Math.PI * 2.0 / tessellation - Math.PI / 2.0; var transform = BABYLON.Matrix.Translation(diameter / 2.0, 0, 0).multiply(BABYLON.Matrix.RotationY(outerAngle)); for (var j = 0; j <= tessellation; j++) { var v = 1 - j / tessellation; var innerAngle = j * Math.PI * 2.0 / tessellation + Math.PI; var dx = Math.cos(innerAngle); var dy = Math.sin(innerAngle); // Create a vertex. var normal = new BABYLON.Vector3(dx, dy, 0); var position = normal.scale(thickness / 2); var textureCoordinate = new BABYLON.Vector2(u, v); position = BABYLON.Vector3.TransformCoordinates(position, transform); normal = BABYLON.Vector3.TransformNormal(normal, transform); positions.push(position.x, position.y, position.z); normals.push(normal.x, normal.y, normal.z); uvs.push(textureCoordinate.x, textureCoordinate.y); // And create indices for two triangles. var nextI = (i + 1) % stride; var nextJ = (j + 1) % stride; indices.push(i * stride + j); indices.push(i * stride + nextJ); indices.push(nextI * stride + j); indices.push(i * stride + nextJ); indices.push(nextI * stride + nextJ); indices.push(nextI * stride + j); } } // Result var vertexData = new BABYLON.VertexData(); vertexData.indices = indices; vertexData.positions = positions; vertexData.normals = normals; vertexData.uvs = uvs; return vertexData; }; VertexData.CreateLines = function (points) { var indices = []; var positions = []; for (var index = 0; index < points.length; index++) { positions.push(points[index].x, points[index].y, points[index].z); if (index > 0) { indices.push(index - 1); indices.push(index); } } // Result var vertexData = new BABYLON.VertexData(); vertexData.indices = indices; vertexData.positions = positions; return vertexData; }; VertexData.CreateGround = function (width, height, subdivisions) { var indices = []; var positions = []; var normals = []; var uvs = []; var row, col; width = width || 1; height = height || 1; subdivisions = subdivisions || 1; for (row = 0; row <= subdivisions; row++) { for (col = 0; col <= subdivisions; col++) { var position = new BABYLON.Vector3((col * width) / subdivisions - (width / 2.0), 0, ((subdivisions - row) * height) / subdivisions - (height / 2.0)); var normal = new BABYLON.Vector3(0, 1.0, 0); positions.push(position.x, position.y, position.z); normals.push(normal.x, normal.y, normal.z); uvs.push(col / subdivisions, 1.0 - row / subdivisions); } } for (row = 0; row < subdivisions; row++) { for (col = 0; col < subdivisions; col++) { indices.push(col + 1 + (row + 1) * (subdivisions + 1)); indices.push(col + 1 + row * (subdivisions + 1)); indices.push(col + row * (subdivisions + 1)); indices.push(col + (row + 1) * (subdivisions + 1)); indices.push(col + 1 + (row + 1) * (subdivisions + 1)); indices.push(col + row * (subdivisions + 1)); } } // Result var vertexData = new BABYLON.VertexData(); vertexData.indices = indices; vertexData.positions = positions; vertexData.normals = normals; vertexData.uvs = uvs; return vertexData; }; VertexData.CreateTiledGround = function (xmin, zmin, xmax, zmax, subdivisions, precision) { if (typeof subdivisions === "undefined") { subdivisions = { w: 1, h: 1 }; } if (typeof precision === "undefined") { precision = { w: 1, h: 1 }; } var indices = []; var positions = []; var normals = []; var uvs = []; var row, col, tileRow, tileCol; subdivisions.h = (subdivisions.w < 1) ? 1 : subdivisions.h; subdivisions.w = (subdivisions.w < 1) ? 1 : subdivisions.w; precision.w = (precision.w < 1) ? 1 : precision.w; precision.h = (precision.h < 1) ? 1 : precision.h; var tileSize = { 'w': (xmax - xmin) / subdivisions.w, 'h': (zmax - zmin) / subdivisions.h }; for (tileRow = 0; tileRow < subdivisions.h; tileRow++) { for (tileCol = 0; tileCol < subdivisions.w; tileCol++) { applyTile(xmin + tileCol * tileSize.w, zmin + tileRow * tileSize.h, xmin + (tileCol + 1) * tileSize.w, zmin + (tileRow + 1) * tileSize.h); } } function applyTile(xTileMin, zTileMin, xTileMax, zTileMax) { // Indices var base = positions.length / 3; var rowLength = precision.w + 1; for (row = 0; row < precision.h; row++) { for (col = 0; col < precision.w; col++) { var square = [ base + col + row * rowLength, base + (col + 1) + row * rowLength, base + (col + 1) + (row + 1) * rowLength, base + col + (row + 1) * rowLength ]; indices.push(square[1]); indices.push(square[2]); indices.push(square[3]); indices.push(square[0]); indices.push(square[1]); indices.push(square[3]); } } // Position, normals and uvs var position = BABYLON.Vector3.Zero(); var normal = new BABYLON.Vector3(0, 1.0, 0); for (row = 0; row <= precision.h; row++) { position.z = (row * (zTileMax - zTileMin)) / precision.h + zTileMin; for (col = 0; col <= precision.w; col++) { position.x = (col * (xTileMax - xTileMin)) / precision.w + xTileMin; position.y = 0; positions.push(position.x, position.y, position.z); normals.push(normal.x, normal.y, normal.z); uvs.push(col / precision.w, row / precision.h); } } } // Result var vertexData = new BABYLON.VertexData(); vertexData.indices = indices; vertexData.positions = positions; vertexData.normals = normals; vertexData.uvs = uvs; return vertexData; }; VertexData.CreateGroundFromHeightMap = function (width, height, subdivisions, minHeight, maxHeight, buffer, bufferWidth, bufferHeight) { var indices = []; var positions = []; var normals = []; var uvs = []; var row, col; for (row = 0; row <= subdivisions; row++) { for (col = 0; col <= subdivisions; col++) { var position = new BABYLON.Vector3((col * width) / subdivisions - (width / 2.0), 0, ((subdivisions - row) * height) / subdivisions - (height / 2.0)); // Compute height var heightMapX = (((position.x + width / 2) / width) * (bufferWidth - 1)) | 0; var heightMapY = ((1.0 - (position.z + height / 2) / height) * (bufferHeight - 1)) | 0; var pos = (heightMapX + heightMapY * bufferWidth) * 4; var r = buffer[pos] / 255.0; var g = buffer[pos + 1] / 255.0; var b = buffer[pos + 2] / 255.0; var gradient = r * 0.3 + g * 0.59 + b * 0.11; position.y = minHeight + (maxHeight - minHeight) * gradient; // Add vertex positions.push(position.x, position.y, position.z); normals.push(0, 0, 0); uvs.push(col / subdivisions, 1.0 - row / subdivisions); } } for (row = 0; row < subdivisions; row++) { for (col = 0; col < subdivisions; col++) { indices.push(col + 1 + (row + 1) * (subdivisions + 1)); indices.push(col + 1 + row * (subdivisions + 1)); indices.push(col + row * (subdivisions + 1)); indices.push(col + (row + 1) * (subdivisions + 1)); indices.push(col + 1 + (row + 1) * (subdivisions + 1)); indices.push(col + row * (subdivisions + 1)); } } // Normals BABYLON.VertexData.ComputeNormals(positions, indices, normals); // Result var vertexData = new BABYLON.VertexData(); vertexData.indices = indices; vertexData.positions = positions; vertexData.normals = normals; vertexData.uvs = uvs; return vertexData; }; VertexData.CreatePlane = function (size) { var indices = []; var positions = []; var normals = []; var uvs = []; size = size || 1; // Vertices var halfSize = size / 2.0; positions.push(-halfSize, -halfSize, 0); normals.push(0, 0, -1.0); uvs.push(0.0, 0.0); positions.push(halfSize, -halfSize, 0); normals.push(0, 0, -1.0); uvs.push(1.0, 0.0); positions.push(halfSize, halfSize, 0); normals.push(0, 0, -1.0); uvs.push(1.0, 1.0); positions.push(-halfSize, halfSize, 0); normals.push(0, 0, -1.0); uvs.push(0.0, 1.0); // Indices indices.push(0); indices.push(1); indices.push(2); indices.push(0); indices.push(2); indices.push(3); // Result var vertexData = new BABYLON.VertexData(); vertexData.indices = indices; vertexData.positions = positions; vertexData.normals = normals; vertexData.uvs = uvs; return vertexData; }; // based on http://code.google.com/p/away3d/source/browse/trunk/fp10/Away3D/src/away3d/primitives/TorusKnot.as?spec=svn2473&r=2473 VertexData.CreateTorusKnot = function (radius, tube, radialSegments, tubularSegments, p, q) { var indices = []; var positions = []; var normals = []; var uvs = []; radius = radius || 2; tube = tube || 0.5; radialSegments = radialSegments || 32; tubularSegments = tubularSegments || 32; p = p || 2; q = q || 3; // Helper var getPos = function (angle) { var cu = Math.cos(angle); var su = Math.sin(angle); var quOverP = q / p * angle; var cs = Math.cos(quOverP); var tx = radius * (2 + cs) * 0.5 * cu; var ty = radius * (2 + cs) * su * 0.5; var tz = radius * Math.sin(quOverP) * 0.5; return new BABYLON.Vector3(tx, ty, tz); }; for (var i = 0; i <= radialSegments; i++) { var modI = i % radialSegments; var u = modI / radialSegments * 2 * p * Math.PI; var p1 = getPos(u); var p2 = getPos(u + 0.01); var tang = p2.subtract(p1); var n = p2.add(p1); var bitan = BABYLON.Vector3.Cross(tang, n); n = BABYLON.Vector3.Cross(bitan, tang); bitan.normalize(); n.normalize(); for (var j = 0; j < tubularSegments; j++) { var modJ = j % tubularSegments; var v = modJ / tubularSegments * 2 * Math.PI; var cx = -tube * Math.cos(v); var cy = tube * Math.sin(v); positions.push(p1.x + cx * n.x + cy * bitan.x); positions.push(p1.y + cx * n.y + cy * bitan.y); positions.push(p1.z + cx * n.z + cy * bitan.z); uvs.push(i / radialSegments); uvs.push(j / tubularSegments); } } for (i = 0; i < radialSegments; i++) { for (j = 0; j < tubularSegments; j++) { var jNext = (j + 1) % tubularSegments; var a = i * tubularSegments + j; var b = (i + 1) * tubularSegments + j; var c = (i + 1) * tubularSegments + jNext; var d = i * tubularSegments + jNext; indices.push(d); indices.push(b); indices.push(a); indices.push(d); indices.push(c); indices.push(b); } } // Normals BABYLON.VertexData.ComputeNormals(positions, indices, normals); // Result var vertexData = new BABYLON.VertexData(); vertexData.indices = indices; vertexData.positions = positions; vertexData.normals = normals; vertexData.uvs = uvs; return vertexData; }; // Tools VertexData.ComputeNormals = function (positions, indices, normals) { var positionVectors = []; var facesOfVertices = []; var index; for (index = 0; index < positions.length; index += 3) { var vector3 = new BABYLON.Vector3(positions[index], positions[index + 1], positions[index + 2]); positionVectors.push(vector3); facesOfVertices.push([]); } // Compute normals var facesNormals = []; for (index = 0; index < indices.length / 3; index++) { var i1 = indices[index * 3]; var i2 = indices[index * 3 + 1]; var i3 = indices[index * 3 + 2]; var p1 = positionVectors[i1]; var p2 = positionVectors[i2]; var p3 = positionVectors[i3]; var p1p2 = p1.subtract(p2); var p3p2 = p3.subtract(p2); facesNormals[index] = BABYLON.Vector3.Normalize(BABYLON.Vector3.Cross(p1p2, p3p2)); facesOfVertices[i1].push(index); facesOfVertices[i2].push(index); facesOfVertices[i3].push(index); } for (index = 0; index < positionVectors.length; index++) { var faces = facesOfVertices[index]; var normal = BABYLON.Vector3.Zero(); for (var faceIndex = 0; faceIndex < faces.length; faceIndex++) { normal.addInPlace(facesNormals[faces[faceIndex]]); } normal = BABYLON.Vector3.Normalize(normal.scale(1.0 / faces.length)); normals[index * 3] = normal.x; normals[index * 3 + 1] = normal.y; normals[index * 3 + 2] = normal.z; } }; return VertexData; })(); BABYLON.VertexData = VertexData; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.mesh.vertexData.js.map var BABYLON; (function (BABYLON) { var buildCamera = function (that, name) { that._leftCamera.isIntermediate = true; that.subCameras.push(that._leftCamera); that.subCameras.push(that._rightCamera); that._leftTexture = new BABYLON.PassPostProcess(name + "_leftTexture", 1.0, that._leftCamera); that._anaglyphPostProcess = new BABYLON.AnaglyphPostProcess(name + "_anaglyph", 1.0, that._rightCamera); that._anaglyphPostProcess.onApply = function (effect) { effect.setTextureFromPostProcess("leftSampler", that._leftTexture); }; that._update(); }; var AnaglyphArcRotateCamera = (function (_super) { __extends(AnaglyphArcRotateCamera, _super); // ANY function AnaglyphArcRotateCamera(name, alpha, beta, radius, target, eyeSpace, scene) { _super.call(this, name, alpha, beta, radius, target, scene); this._eyeSpace = BABYLON.Tools.ToRadians(eyeSpace); this._leftCamera = new BABYLON.ArcRotateCamera(name + "_left", alpha - this._eyeSpace, beta, radius, target, scene); this._rightCamera = new BABYLON.ArcRotateCamera(name + "_right", alpha + this._eyeSpace, beta, radius, target, scene); buildCamera(this, name); } AnaglyphArcRotateCamera.prototype._update = function () { this._updateCamera(this._leftCamera); this._updateCamera(this._rightCamera); this._leftCamera.alpha = this.alpha - this._eyeSpace; this._rightCamera.alpha = this.alpha + this._eyeSpace; _super.prototype._update.call(this); }; AnaglyphArcRotateCamera.prototype._updateCamera = function (camera) { camera.beta = this.beta; camera.radius = this.radius; camera.minZ = this.minZ; camera.maxZ = this.maxZ; camera.fov = this.fov; camera.target = this.target; }; return AnaglyphArcRotateCamera; })(BABYLON.ArcRotateCamera); BABYLON.AnaglyphArcRotateCamera = AnaglyphArcRotateCamera; var AnaglyphFreeCamera = (function (_super) { __extends(AnaglyphFreeCamera, _super); function AnaglyphFreeCamera(name, position, eyeSpace, scene) { _super.call(this, name, position, scene); this._eyeSpace = BABYLON.Tools.ToRadians(eyeSpace); this._transformMatrix = new BABYLON.Matrix(); this._leftCamera = new BABYLON.FreeCamera(name + "_left", position.clone(), scene); this._rightCamera = new BABYLON.FreeCamera(name + "_right", position.clone(), scene); buildCamera(this, name); } AnaglyphFreeCamera.prototype._getSubCameraPosition = function (eyeSpace, result) { var target = this.getTarget(); BABYLON.Matrix.Translation(-target.x, -target.y, -target.z).multiplyToRef(BABYLON.Matrix.RotationY(eyeSpace), this._transformMatrix); this._transformMatrix = this._transformMatrix.multiply(BABYLON.Matrix.Translation(target.x, target.y, target.z)); BABYLON.Vector3.TransformCoordinatesToRef(this.position, this._transformMatrix, result); }; AnaglyphFreeCamera.prototype._update = function () { this._getSubCameraPosition(-this._eyeSpace, this._leftCamera.position); this._getSubCameraPosition(this._eyeSpace, this._rightCamera.position); this._updateCamera(this._leftCamera); this._updateCamera(this._rightCamera); _super.prototype._update.call(this); }; AnaglyphFreeCamera.prototype._updateCamera = function (camera) { camera.minZ = this.minZ; camera.maxZ = this.maxZ; camera.fov = this.fov; camera.viewport = this.viewport; camera.setTarget(this.getTarget()); }; return AnaglyphFreeCamera; })(BABYLON.FreeCamera); BABYLON.AnaglyphFreeCamera = AnaglyphFreeCamera; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.anaglyphCamera.js.map var BABYLON; (function (BABYLON) { var AnaglyphPostProcess = (function (_super) { __extends(AnaglyphPostProcess, _super); function AnaglyphPostProcess(name, ratio, camera, samplingMode, engine, reusable) { _super.call(this, name, "anaglyph", null, ["leftSampler"], ratio, camera, samplingMode, engine, reusable); } return AnaglyphPostProcess; })(BABYLON.PostProcess); BABYLON.AnaglyphPostProcess = AnaglyphPostProcess; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.anaglyphPostProcess.js.map var BABYLON; (function (BABYLON) { var Tags = (function () { function Tags() { } Tags.EnableFor = function (obj) { obj._tags = obj._tags || {}; obj.hasTags = function () { return Tags.HasTags(obj); }; obj.addTags = function (tagsString) { return Tags.AddTagsTo(obj, tagsString); }; obj.removeTags = function (tagsString) { return Tags.RemoveTagsFrom(obj, tagsString); }; obj.matchesTagsQuery = function (tagsQuery) { return Tags.MatchesQuery(obj, tagsQuery); }; }; Tags.DisableFor = function (obj) { delete obj._tags; delete obj.hasTags; delete obj.addTags; delete obj.removeTags; delete obj.matchesTagsQuery; }; Tags.HasTags = function (obj) { if (!obj._tags) { return false; } return !BABYLON.Tools.IsEmpty(obj._tags); }; Tags.GetTags = function (obj) { if (!obj._tags) { return null; } return obj._tags; }; // the tags 'true' and 'false' are reserved and cannot be used as tags // a tag cannot start with '||', '&&', and '!' // it cannot contain whitespaces Tags.AddTagsTo = function (obj, tagsString) { if (!tagsString) { return; } var tags = tagsString.split(" "); for (var t in tags) { Tags._AddTagTo(obj, tags[t]); } }; Tags._AddTagTo = function (obj, tag) { tag = tag.trim(); if (tag === "" || tag === "true" || tag === "false") { return; } if (tag.match(/[\s]/) || tag.match(/^([!]|([|]|[&]){2})/)) { return; } Tags.EnableFor(obj); obj._tags[tag] = true; }; Tags.RemoveTagsFrom = function (obj, tagsString) { if (!Tags.HasTags(obj)) { return; } var tags = tagsString.split(" "); for (var t in tags) { Tags._RemoveTagFrom(obj, tags[t]); } }; Tags._RemoveTagFrom = function (obj, tag) { delete obj._tags[tag]; }; Tags.MatchesQuery = function (obj, tagsQuery) { if (tagsQuery === undefined) { return true; } if (tagsQuery === "") { return Tags.HasTags(obj); } return BABYLON.Internals.AndOrNotEvaluator.Eval(tagsQuery, function (r) { return Tags.HasTags(obj) && obj._tags[r]; }); }; return Tags; })(); BABYLON.Tags = Tags; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.tags.js.map var BABYLON; (function (BABYLON) { (function (Internals) { var AndOrNotEvaluator = (function () { function AndOrNotEvaluator() { } AndOrNotEvaluator.Eval = function (query, evaluateCallback) { if (!query.match(/\([^\(\)]*\)/g)) { query = AndOrNotEvaluator._HandleParenthesisContent(query, evaluateCallback); } else { query = query.replace(/\([^\(\)]*\)/g, function (r) { // remove parenthesis r = r.slice(1, r.length - 1); return AndOrNotEvaluator._HandleParenthesisContent(r, evaluateCallback); }); } if (query === "true") { return true; } if (query === "false") { return false; } return AndOrNotEvaluator.Eval(query, evaluateCallback); }; AndOrNotEvaluator._HandleParenthesisContent = function (parenthesisContent, evaluateCallback) { evaluateCallback = evaluateCallback || (function (r) { return r === "true" ? true : false; }); var result; var or = parenthesisContent.split("||"); for (var i in or) { var ori = AndOrNotEvaluator._SimplifyNegation(or[i].trim()); var and = ori.split("&&"); if (and.length > 1) { for (var j = 0; j < and.length; ++j) { var andj = AndOrNotEvaluator._SimplifyNegation(and[j].trim()); if (andj !== "true" && andj !== "false") { if (andj[0] === "!") { result = !evaluateCallback(andj.substring(1)); } else { result = evaluateCallback(andj); } } else { result = andj === "true" ? true : false; } if (!result) { ori = "false"; break; } } } if (result || ori === "true") { result = true; break; } // result equals false (or undefined) if (ori !== "true" && ori !== "false") { if (ori[0] === "!") { result = !evaluateCallback(ori.substring(1)); } else { result = evaluateCallback(ori); } } else { result = ori === "true" ? true : false; } } // the whole parenthesis scope is replaced by 'true' or 'false' return result ? "true" : "false"; }; AndOrNotEvaluator._SimplifyNegation = function (booleanString) { booleanString = booleanString.replace(/^[\s!]+/, function (r) { // remove whitespaces r = r.replace(/[\s]/g, function () { return ""; }); return r.length % 2 ? "!" : ""; }); booleanString = booleanString.trim(); if (booleanString === "!true") { booleanString = "false"; } else if (booleanString === "!false") { booleanString = "true"; } return booleanString; }; return AndOrNotEvaluator; })(); Internals.AndOrNotEvaluator = AndOrNotEvaluator; })(BABYLON.Internals || (BABYLON.Internals = {})); var Internals = BABYLON.Internals; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.andOrNotEvaluator.js.map var BABYLON; (function (BABYLON) { var PostProcessRenderPass = (function () { function PostProcessRenderPass(scene, name, size, renderList, beforeRender, afterRender) { this._enabled = true; this._refCount = 0; this._name = name; this._renderTexture = new BABYLON.RenderTargetTexture(name, size, scene); this.setRenderList(renderList); this._renderTexture.onBeforeRender = beforeRender; this._renderTexture.onAfterRender = afterRender; this._scene = scene; this._renderList = renderList; } // private PostProcessRenderPass.prototype._incRefCount = function () { if (this._refCount === 0) { this._scene.customRenderTargets.push(this._renderTexture); } return ++this._refCount; }; PostProcessRenderPass.prototype._decRefCount = function () { this._refCount--; if (this._refCount <= 0) { this._scene.customRenderTargets.splice(this._scene.customRenderTargets.indexOf(this._renderTexture), 1); } return this._refCount; }; PostProcessRenderPass.prototype._update = function () { this.setRenderList(this._renderList); }; // public PostProcessRenderPass.prototype.setRenderList = function (renderList) { this._renderTexture.renderList = renderList; }; PostProcessRenderPass.prototype.getRenderTexture = function () { return this._renderTexture; }; return PostProcessRenderPass; })(); BABYLON.PostProcessRenderPass = PostProcessRenderPass; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.postProcessRenderPass.js.map var BABYLON; (function (BABYLON) { var PostProcessRenderEffect = (function () { function PostProcessRenderEffect(engine, name, getPostProcess, singleInstance) { this._engine = engine; this._name = name; this._singleInstance = singleInstance || true; this._getPostProcess = getPostProcess; this._cameras = []; this._indicesForCamera = []; this._postProcesses = {}; this._renderPasses = {}; this._renderEffectAsPasses = {}; } PostProcessRenderEffect.prototype._update = function () { for (var renderPassName in this._renderPasses) { this._renderPasses[renderPassName]._update(); } }; PostProcessRenderEffect.prototype.addPass = function (renderPass) { this._renderPasses[renderPass._name] = renderPass; this._linkParameters(); }; PostProcessRenderEffect.prototype.removePass = function (renderPass) { delete this._renderPasses[renderPass._name]; this._linkParameters(); }; PostProcessRenderEffect.prototype.addRenderEffectAsPass = function (renderEffect) { this._renderEffectAsPasses[renderEffect._name] = renderEffect; this._linkParameters(); }; PostProcessRenderEffect.prototype.getPass = function (passName) { for (var renderPassName in this._renderPasses) { if (renderPassName === passName) { return this._renderPasses[passName]; } } }; PostProcessRenderEffect.prototype.emptyPasses = function () { this._renderPasses = {}; this._linkParameters(); }; PostProcessRenderEffect.prototype._attachCameras = function (cameras) { var cameraKey; var _cam = BABYLON.Tools.MakeArray(cameras || this._cameras); for (var i = 0; i < _cam.length; i++) { var camera = _cam[i]; var cameraName = camera.name; if (this._singleInstance) { cameraKey = 0; } else { cameraKey = cameraName; } this._postProcesses[cameraKey] = this._postProcesses[cameraKey] || this._getPostProcess(); var index = camera.attachPostProcess(this._postProcesses[cameraKey]); if (!this._indicesForCamera[cameraName]) { this._indicesForCamera[cameraName] = []; } this._indicesForCamera[cameraName].push(index); if (this._cameras.indexOf(camera) === -1) { this._cameras[cameraName] = camera; } for (var passName in this._renderPasses) { this._renderPasses[passName]._incRefCount(); } } this._linkParameters(); }; PostProcessRenderEffect.prototype._detachCameras = function (cameras) { var _cam = BABYLON.Tools.MakeArray(cameras || this._cameras); for (var i = 0; i < _cam.length; i++) { var camera = _cam[i]; var cameraName = camera.name; camera.detachPostProcess(this._postProcesses[this._singleInstance ? 0 : cameraName], this._indicesForCamera[cameraName]); var index = this._cameras.indexOf(cameraName); this._indicesForCamera.splice(index, 1); this._cameras.splice(index, 1); for (var passName in this._renderPasses) { this._renderPasses[passName]._decRefCount(); } } }; PostProcessRenderEffect.prototype._enable = function (cameras) { var _cam = BABYLON.Tools.MakeArray(cameras || this._cameras); for (var i = 0; i < _cam.length; i++) { var camera = _cam[i]; var cameraName = camera.name; for (var j = 0; j < this._indicesForCamera[cameraName].length; j++) { if (camera._postProcesses[this._indicesForCamera[cameraName][j]] === undefined) { cameras[i].attachPostProcess(this._postProcesses[this._singleInstance ? 0 : cameraName], this._indicesForCamera[cameraName][j]); } } for (var passName in this._renderPasses) { this._renderPasses[passName]._incRefCount(); } } }; PostProcessRenderEffect.prototype._disable = function (cameras) { var _cam = BABYLON.Tools.MakeArray(cameras || this._cameras); for (var i = 0; i < _cam.length; i++) { var camera = _cam[i]; var cameraName = camera.Name; camera.detachPostProcess(this._postProcesses[this._singleInstance ? 0 : cameraName], this._indicesForCamera[cameraName]); for (var passName in this._renderPasses) { this._renderPasses[passName]._decRefCount(); } } }; PostProcessRenderEffect.prototype.getPostProcess = function (camera) { if (this._singleInstance) { return this._postProcesses[0]; } else { return this._postProcesses[camera.name]; } }; PostProcessRenderEffect.prototype._linkParameters = function () { var _this = this; for (var index in this._postProcesses) { if (this.applyParameters) { this.applyParameters(this._postProcesses[index]); } this._postProcesses[index].onBeforeRender = function (effect) { _this._linkTextures(effect); }; } }; PostProcessRenderEffect.prototype._linkTextures = function (effect) { for (var renderPassName in this._renderPasses) { effect.setTexture(renderPassName, this._renderPasses[renderPassName].getRenderTexture()); } for (var renderEffectName in this._renderEffectAsPasses) { effect.setTextureFromPostProcess(renderEffectName + "Sampler", this._renderEffectAsPasses[renderEffectName].getPostProcess()); } }; return PostProcessRenderEffect; })(); BABYLON.PostProcessRenderEffect = PostProcessRenderEffect; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.postProcessRenderEffect.js.map var BABYLON; (function (BABYLON) { var PostProcessRenderPipeline = (function () { function PostProcessRenderPipeline(engine, name) { this._engine = engine; this._name = name; this._renderEffects = {}; this._renderEffectsForIsolatedPass = {}; this._cameras = []; } PostProcessRenderPipeline.prototype.addEffect = function (renderEffect) { this._renderEffects[renderEffect._name] = renderEffect; }; PostProcessRenderPipeline.prototype._enableEffect = function (renderEffectName, cameras) { var renderEffects = this._renderEffects[renderEffectName]; if (!renderEffects) { return; } renderEffects._enable(BABYLON.Tools.MakeArray(cameras || this._cameras)); }; PostProcessRenderPipeline.prototype._disableEffect = function (renderEffectName, cameras) { var renderEffects = this._renderEffects[renderEffectName]; if (!renderEffects) { return; } renderEffects._disable(BABYLON.Tools.MakeArray(cameras || this._cameras)); }; PostProcessRenderPipeline.prototype._attachCameras = function (cameras, unique) { var _cam = BABYLON.Tools.MakeArray(cameras || this._cameras); var indicesToDelete = []; for (var i = 0; i < _cam.length; i++) { var camera = _cam[i]; var cameraName = camera.name; if (this._cameras.indexOf(camera) === -1) { this._cameras[cameraName] = camera; } else if (unique) { indicesToDelete.push(i); } } for (var i = 0; i < indicesToDelete.length; i++) { cameras.splice(indicesToDelete[i], 1); } for (var renderEffectName in this._renderEffects) { this._renderEffects[renderEffectName]._attachCameras(_cam); } }; PostProcessRenderPipeline.prototype._detachCameras = function (cameras) { var _cam = BABYLON.Tools.MakeArray(cameras || this._cameras); for (var renderEffectName in this._renderEffects) { this._renderEffects[renderEffectName]._detachCameras(_cam); } for (var i = 0; i < _cam.length; i++) { this._cameras.splice(this._cameras.indexOf(_cam[i]), 1); } }; PostProcessRenderPipeline.prototype._enableDisplayOnlyPass = function (passName, cameras) { var _this = this; var _cam = BABYLON.Tools.MakeArray(cameras || this._cameras); var pass = null; for (var renderEffectName in this._renderEffects) { pass = this._renderEffects[renderEffectName].getPass(passName); if (pass != null) { break; } } if (pass === null) { return; } for (var renderEffectName in this._renderEffects) { this._renderEffects[renderEffectName]._disable(_cam); } pass._name = PostProcessRenderPipeline.PASS_SAMPLER_NAME; for (var i = 0; i < _cam.length; i++) { var camera = _cam[i]; var cameraName = camera.name; this._renderEffectsForIsolatedPass[cameraName] = this._renderEffectsForIsolatedPass[cameraName] || new BABYLON.PostProcessRenderEffect(this._engine, PostProcessRenderPipeline.PASS_EFFECT_NAME, function () { return new BABYLON.DisplayPassPostProcess(PostProcessRenderPipeline.PASS_EFFECT_NAME, 1.0, null, null, _this._engine, true); }); this._renderEffectsForIsolatedPass[cameraName].emptyPasses(); this._renderEffectsForIsolatedPass[cameraName].addPass(pass); this._renderEffectsForIsolatedPass[cameraName]._attachCameras(camera); } }; PostProcessRenderPipeline.prototype._disableDisplayOnlyPass = function (cameras) { var _this = this; var _cam = BABYLON.Tools.MakeArray(cameras || this._cameras); for (var i = 0; i < _cam.length; i++) { var camera = _cam[i]; var cameraName = camera.name; this._renderEffectsForIsolatedPass[cameraName] = this._renderEffectsForIsolatedPass[cameraName] || new BABYLON.PostProcessRenderEffect(this._engine, PostProcessRenderPipeline.PASS_EFFECT_NAME, function () { return new BABYLON.DisplayPassPostProcess(PostProcessRenderPipeline.PASS_EFFECT_NAME, 1.0, null, null, _this._engine, true); }); this._renderEffectsForIsolatedPass[cameraName]._disable(camera); } for (var renderEffectName in this._renderEffects) { this._renderEffects[renderEffectName]._enable(_cam); } }; PostProcessRenderPipeline.prototype._update = function () { for (var renderEffectName in this._renderEffects) { this._renderEffects[renderEffectName]._update(); } for (var i = 0; i < this._cameras.length; i++) { var cameraName = this._cameras[i].name; if (this._renderEffectsForIsolatedPass[cameraName]) { this._renderEffectsForIsolatedPass[cameraName]._update(); } } }; PostProcessRenderPipeline.PASS_EFFECT_NAME = "passEffect"; PostProcessRenderPipeline.PASS_SAMPLER_NAME = "passSampler"; return PostProcessRenderPipeline; })(); BABYLON.PostProcessRenderPipeline = PostProcessRenderPipeline; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.postProcessRenderPipeline.js.map var BABYLON; (function (BABYLON) { var PostProcessRenderPipelineManager = (function () { function PostProcessRenderPipelineManager() { this._renderPipelines = {}; } PostProcessRenderPipelineManager.prototype.addPipeline = function (renderPipeline) { this._renderPipelines[renderPipeline._name] = renderPipeline; }; PostProcessRenderPipelineManager.prototype.attachCamerasToRenderPipeline = function (renderPipelineName, cameras, unique) { var renderPipeline = this._renderPipelines[renderPipelineName]; if (!renderPipeline) { return; } renderPipeline._attachCameras(cameras, unique); }; PostProcessRenderPipelineManager.prototype.detachCamerasFromRenderPipeline = function (renderPipelineName, cameras) { var renderPipeline = this._renderPipelines[renderPipelineName]; if (!renderPipeline) { return; } renderPipeline._detachCameras(cameras); }; PostProcessRenderPipelineManager.prototype.enableEffectInPipeline = function (renderPipelineName, renderEffectName, cameras) { var renderPipeline = this._renderPipelines[renderPipelineName]; if (!renderPipeline) { return; } renderPipeline._enableEffect(renderEffectName, cameras); }; PostProcessRenderPipelineManager.prototype.disableEffectInPipeline = function (renderPipelineName, renderEffectName, cameras) { var renderPipeline = this._renderPipelines[renderPipelineName]; if (!renderPipeline) { return; } renderPipeline._disableEffect(renderEffectName, cameras); }; PostProcessRenderPipelineManager.prototype.enableDisplayOnlyPassInPipeline = function (renderPipelineName, passName, cameras) { var renderPipeline = this._renderPipelines[renderPipelineName]; if (!renderPipeline) { return; } renderPipeline._enableDisplayOnlyPass(passName, cameras); }; PostProcessRenderPipelineManager.prototype.disableDisplayOnlyPassInPipeline = function (renderPipelineName, cameras) { var renderPipeline = this._renderPipelines[renderPipelineName]; if (!renderPipeline) { return; } renderPipeline._disableDisplayOnlyPass(cameras); }; PostProcessRenderPipelineManager.prototype.update = function () { for (var renderPipelineName in this._renderPipelines) { this._renderPipelines[renderPipelineName]._update(); } }; return PostProcessRenderPipelineManager; })(); BABYLON.PostProcessRenderPipelineManager = PostProcessRenderPipelineManager; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.postProcessRenderPipelineManager.js.map var BABYLON; (function (BABYLON) { var DisplayPassPostProcess = (function (_super) { __extends(DisplayPassPostProcess, _super); function DisplayPassPostProcess(name, ratio, camera, samplingMode, engine, reusable) { _super.call(this, name, "displayPass", ["passSampler"], ["passSampler"], ratio, camera, samplingMode, engine, reusable); } return DisplayPassPostProcess; })(BABYLON.PostProcess); BABYLON.DisplayPassPostProcess = DisplayPassPostProcess; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.displayPassPostProcess.js.map var BABYLON; (function (BABYLON) { var BoundingBoxRenderer = (function () { function BoundingBoxRenderer(scene) { this.frontColor = new BABYLON.Color3(1, 1, 1); this.backColor = new BABYLON.Color3(0.1, 0.1, 0.1); this.showBackLines = true; this.renderList = new BABYLON.SmartArray(32); this._scene = scene; this._colorShader = new BABYLON.ShaderMaterial("colorShader", scene, "color", { attributes: ["position"], uniforms: ["worldViewProjection", "color"] }); var engine = this._scene.getEngine(); var boxdata = BABYLON.VertexData.CreateBox(1.0); this._vb = new BABYLON.VertexBuffer(engine, boxdata.positions, BABYLON.VertexBuffer.PositionKind, false); this._ib = engine.createIndexBuffer([0, 1, 1, 2, 2, 3, 3, 0, 4, 5, 5, 6, 6, 7, 7, 4, 0, 7, 1, 6, 2, 5, 3, 4]); } BoundingBoxRenderer.prototype.reset = function () { this.renderList.reset(); }; BoundingBoxRenderer.prototype.render = function () { if (this.renderList.length === 0 || !this._colorShader.isReady()) { return; } var engine = this._scene.getEngine(); engine.setDepthWrite(false); this._colorShader._preBind(); for (var boundingBoxIndex = 0; boundingBoxIndex < this.renderList.length; boundingBoxIndex++) { var boundingBox = this.renderList.data[boundingBoxIndex]; var min = boundingBox.minimum; var max = boundingBox.maximum; var diff = max.subtract(min); var median = min.add(diff.scale(0.5)); var worldMatrix = BABYLON.Matrix.Scaling(diff.x, diff.y, diff.z).multiply(BABYLON.Matrix.Translation(median.x, median.y, median.z)).multiply(boundingBox.getWorldMatrix()); // VBOs engine.bindBuffers(this._vb.getBuffer(), this._ib, [3], 3 * 4, this._colorShader.getEffect()); if (this.showBackLines) { // Back engine.setDepthFunctionToGreaterOrEqual(); this._scene.resetCachedMaterial(); this._colorShader.setColor4("color", this.backColor.toColor4()); this._colorShader.bind(worldMatrix); // Draw order engine.draw(false, 0, 24); } // Front engine.setDepthFunctionToLess(); this._scene.resetCachedMaterial(); this._colorShader.setColor4("color", this.frontColor.toColor4()); this._colorShader.bind(worldMatrix); // Draw order engine.draw(false, 0, 24); } this._colorShader.unbind(); engine.setDepthFunctionToLessOrEqual(); engine.setDepthWrite(true); }; BoundingBoxRenderer.prototype.dispose = function () { this._colorShader.dispose(); this._vb.dispose(); this._scene.getEngine()._releaseBuffer(this._ib); }; return BoundingBoxRenderer; })(); BABYLON.BoundingBoxRenderer = BoundingBoxRenderer; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.boundingBoxRenderer.js.map var BABYLON; (function (BABYLON) { (function (Internals) { /* * Based on jsTGALoader - Javascript loader for TGA file * By Vincent Thibault * @blog http://blog.robrowser.com/javascript-tga-loader.html */ var TGATools = (function () { function TGATools() { } TGATools.GetTGAHeader = function (data) { var offset = 0; var header = { id_length: data[offset++], colormap_type: data[offset++], image_type: data[offset++], colormap_index: data[offset++] | data[offset++] << 8, colormap_length: data[offset++] | data[offset++] << 8, colormap_size: data[offset++], origin: [ data[offset++] | data[offset++] << 8, data[offset++] | data[offset++] << 8 ], width: data[offset++] | data[offset++] << 8, height: data[offset++] | data[offset++] << 8, pixel_size: data[offset++], flags: data[offset++] }; return header; }; TGATools.UploadContent = function (gl, data) { // Not enough data to contain header ? if (data.length < 19) { BABYLON.Tools.Error("Unable to load TGA file - Not enough data to contain header"); return; } // Read Header var offset = 18; var header = TGATools.GetTGAHeader(data); // Assume it's a valid Targa file. if (header.id_length + offset > data.length) { BABYLON.Tools.Error("Unable to load TGA file - Not enough data"); return; } // Skip not needed data offset += header.id_length; var use_rle = false; var use_pal = false; var use_rgb = false; var use_grey = false; switch (header.image_type) { case TGATools._TYPE_RLE_INDEXED: use_rle = true; case TGATools._TYPE_INDEXED: use_pal = true; break; case TGATools._TYPE_RLE_RGB: use_rle = true; case TGATools._TYPE_RGB: use_rgb = true; break; case TGATools._TYPE_RLE_GREY: use_rle = true; case TGATools._TYPE_GREY: use_grey = true; break; } var pixel_data; var numAlphaBits = header.flags & 0xf; var pixel_size = header.pixel_size >> 3; var pixel_total = header.width * header.height * pixel_size; // Read palettes var palettes; if (use_pal) { palettes = data.subarray(offset, offset += header.colormap_length * (header.colormap_size >> 3)); } // Read LRE if (use_rle) { pixel_data = new Uint8Array(pixel_total); var c, count, i; var localOffset = 0; var pixels = new Uint8Array(pixel_size); while (offset < pixel_total && localOffset < pixel_total) { c = data[offset++]; count = (c & 0x7f) + 1; // RLE pixels if (c & 0x80) { for (i = 0; i < pixel_size; ++i) { pixels[i] = data[offset++]; } for (i = 0; i < count; ++i) { pixel_data.set(pixels, localOffset + i * pixel_size); } localOffset += pixel_size * count; } else { count *= pixel_size; for (i = 0; i < count; ++i) { pixel_data[localOffset + i] = data[offset++]; } localOffset += count; } } } else { pixel_data = data.subarray(offset, offset += (use_pal ? header.width * header.height : pixel_total)); } // Load to texture var x_start, y_start, x_step, y_step, y_end, x_end; switch ((header.flags & TGATools._ORIGIN_MASK) >> TGATools._ORIGIN_SHIFT) { default: case TGATools._ORIGIN_UL: x_start = 0; x_step = 1; x_end = header.width; y_start = 0; y_step = 1; y_end = header.height; break; case TGATools._ORIGIN_BL: x_start = 0; x_step = 1; x_end = header.width; y_start = header.height - 1; y_step = -1; y_end = -1; break; case TGATools._ORIGIN_UR: x_start = header.width - 1; x_step = -1; x_end = -1; y_start = 0; y_step = 1; y_end = header.height; break; case TGATools._ORIGIN_BR: x_start = header.width - 1; x_step = -1; x_end = -1; y_start = header.height - 1; y_step = -1; y_end = -1; break; } // Load the specify method var func = '_getImageData' + (use_grey ? 'Grey' : '') + (header.pixel_size) + 'bits'; var imageData = TGATools[func](header, palettes, pixel_data, y_start, y_step, y_end, x_start, x_step, x_end); gl.texImage2D(gl.TEXTURE_2D, 0, gl.RGBA, header.width, header.height, 0, gl.RGBA, gl.UNSIGNED_BYTE, imageData); }; TGATools._getImageData8bits = function (header, palettes, pixel_data, y_start, y_step, y_end, x_start, x_step, x_end) { var image = pixel_data, colormap = palettes; var width = header.width, height = header.height; var color, i = 0, x, y; var imageData = new Uint8Array(width * height * 4); for (y = y_start; y !== y_end; y += y_step) { for (x = x_start; x !== x_end; x += x_step, i++) { color = image[i]; imageData[(x + width * y) * 4 + 3] = 255; imageData[(x + width * y) * 4 + 2] = colormap[(color * 3) + 0]; imageData[(x + width * y) * 4 + 1] = colormap[(color * 3) + 1]; imageData[(x + width * y) * 4 + 0] = colormap[(color * 3) + 2]; } } return imageData; }; TGATools._getImageData16bits = function (header, palettes, pixel_data, y_start, y_step, y_end, x_start, x_step, x_end) { var image = pixel_data; var width = header.width, height = header.height; var color, i = 0, x, y; var imageData = new Uint8Array(width * height * 4); for (y = y_start; y !== y_end; y += y_step) { for (x = x_start; x !== x_end; x += x_step, i += 2) { color = image[i + 0] + (image[i + 1] << 8); // Inversed ? imageData[(x + width * y) * 4 + 0] = (color & 0x7C00) >> 7; imageData[(x + width * y) * 4 + 1] = (color & 0x03E0) >> 2; imageData[(x + width * y) * 4 + 2] = (color & 0x001F) >> 3; imageData[(x + width * y) * 4 + 3] = (color & 0x8000) ? 0 : 255; } } return imageData; }; TGATools._getImageData24bits = function (header, palettes, pixel_data, y_start, y_step, y_end, x_start, x_step, x_end) { var image = pixel_data; var width = header.width, height = header.height; var i = 0, x, y; var imageData = new Uint8Array(width * height * 4); for (y = y_start; y !== y_end; y += y_step) { for (x = x_start; x !== x_end; x += x_step, i += 3) { imageData[(x + width * y) * 4 + 3] = 255; imageData[(x + width * y) * 4 + 2] = image[i + 0]; imageData[(x + width * y) * 4 + 1] = image[i + 1]; imageData[(x + width * y) * 4 + 0] = image[i + 2]; } } return imageData; }; TGATools._getImageData32bits = function (header, palettes, pixel_data, y_start, y_step, y_end, x_start, x_step, x_end) { var image = pixel_data; var width = header.width, height = header.height; var i = 0, x, y; var imageData = new Uint8Array(width * height * 4); for (y = y_start; y !== y_end; y += y_step) { for (x = x_start; x !== x_end; x += x_step, i += 4) { imageData[(x + width * y) * 4 + 2] = image[i + 0]; imageData[(x + width * y) * 4 + 1] = image[i + 1]; imageData[(x + width * y) * 4 + 0] = image[i + 2]; imageData[(x + width * y) * 4 + 3] = image[i + 3]; } } return imageData; }; TGATools._getImageDataGrey8bits = function (header, palettes, pixel_data, y_start, y_step, y_end, x_start, x_step, x_end) { var image = pixel_data; var width = header.width, height = header.height; var color, i = 0, x, y; var imageData = new Uint8Array(width * height * 4); for (y = y_start; y !== y_end; y += y_step) { for (x = x_start; x !== x_end; x += x_step, i++) { color = image[i]; imageData[(x + width * y) * 4 + 0] = color; imageData[(x + width * y) * 4 + 1] = color; imageData[(x + width * y) * 4 + 2] = color; imageData[(x + width * y) * 4 + 3] = 255; } } return imageData; }; TGATools._getImageDataGrey16bits = function (header, palettes, pixel_data, y_start, y_step, y_end, x_start, x_step, x_end) { var image = pixel_data; var width = header.width, height = header.height; var i = 0, x, y; var imageData = new Uint8Array(width * height * 4); for (y = y_start; y !== y_end; y += y_step) { for (x = x_start; x !== x_end; x += x_step, i += 2) { imageData[(x + width * y) * 4 + 0] = image[i + 0]; imageData[(x + width * y) * 4 + 1] = image[i + 0]; imageData[(x + width * y) * 4 + 2] = image[i + 0]; imageData[(x + width * y) * 4 + 3] = image[i + 1]; } } return imageData; }; TGATools._TYPE_NO_DATA = 0; TGATools._TYPE_INDEXED = 1; TGATools._TYPE_RGB = 2; TGATools._TYPE_GREY = 3; TGATools._TYPE_RLE_INDEXED = 9; TGATools._TYPE_RLE_RGB = 10; TGATools._TYPE_RLE_GREY = 11; TGATools._ORIGIN_MASK = 0x30; TGATools._ORIGIN_SHIFT = 0x04; TGATools._ORIGIN_BL = 0x00; TGATools._ORIGIN_BR = 0x01; TGATools._ORIGIN_UL = 0x02; TGATools._ORIGIN_UR = 0x03; return TGATools; })(); Internals.TGATools = TGATools; })(BABYLON.Internals || (BABYLON.Internals = {})); var Internals = BABYLON.Internals; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.tools.tga.js.map var BABYLON; (function (BABYLON) { (function (Internals) { // Based on demo done by Brandon Jones - http://media.tojicode.com/webgl-samples/dds.html // All values and structures referenced from: // http://msdn.microsoft.com/en-us/library/bb943991.aspx/ var DDS_MAGIC = 0x20534444; var DDSD_CAPS = 0x1, DDSD_HEIGHT = 0x2, DDSD_WIDTH = 0x4, DDSD_PITCH = 0x8, DDSD_PIXELFORMAT = 0x1000, DDSD_MIPMAPCOUNT = 0x20000, DDSD_LINEARSIZE = 0x80000, DDSD_DEPTH = 0x800000; var DDSCAPS_COMPLEX = 0x8, DDSCAPS_MIPMAP = 0x400000, DDSCAPS_TEXTURE = 0x1000; var DDSCAPS2_CUBEMAP = 0x200, DDSCAPS2_CUBEMAP_POSITIVEX = 0x400, DDSCAPS2_CUBEMAP_NEGATIVEX = 0x800, DDSCAPS2_CUBEMAP_POSITIVEY = 0x1000, DDSCAPS2_CUBEMAP_NEGATIVEY = 0x2000, DDSCAPS2_CUBEMAP_POSITIVEZ = 0x4000, DDSCAPS2_CUBEMAP_NEGATIVEZ = 0x8000, DDSCAPS2_VOLUME = 0x200000; var DDPF_ALPHAPIXELS = 0x1, DDPF_ALPHA = 0x2, DDPF_FOURCC = 0x4, DDPF_RGB = 0x40, DDPF_YUV = 0x200, DDPF_LUMINANCE = 0x20000; function FourCCToInt32(value) { return value.charCodeAt(0) + (value.charCodeAt(1) << 8) + (value.charCodeAt(2) << 16) + (value.charCodeAt(3) << 24); } function Int32ToFourCC(value) { return String.fromCharCode(value & 0xff, (value >> 8) & 0xff, (value >> 16) & 0xff, (value >> 24) & 0xff); } var FOURCC_DXT1 = FourCCToInt32("DXT1"); var FOURCC_DXT3 = FourCCToInt32("DXT3"); var FOURCC_DXT5 = FourCCToInt32("DXT5"); var headerLengthInt = 31; // Offsets into the header array var off_magic = 0; var off_size = 1; var off_flags = 2; var off_height = 3; var off_width = 4; var off_mipmapCount = 7; var off_pfFlags = 20; var off_pfFourCC = 21; var off_RGBbpp = 22; var off_RMask = 23; var off_GMask = 24; var off_BMask = 25; var off_AMask = 26; var off_caps1 = 27; var off_caps2 = 28; ; var DDSTools = (function () { function DDSTools() { } DDSTools.GetDDSInfo = function (arrayBuffer) { var header = new Int32Array(arrayBuffer, 0, headerLengthInt); var mipmapCount = 1; if (header[off_flags] & DDSD_MIPMAPCOUNT) { mipmapCount = Math.max(1, header[off_mipmapCount]); } return { width: header[off_width], height: header[off_height], mipmapCount: mipmapCount, isFourCC: (header[off_pfFlags] & DDPF_FOURCC) === DDPF_FOURCC, isRGB: (header[off_pfFlags] & DDPF_RGB) === DDPF_RGB, isLuminance: (header[off_pfFlags] & DDPF_LUMINANCE) === DDPF_LUMINANCE, isCube: (header[off_caps2] & DDSCAPS2_CUBEMAP) === DDSCAPS2_CUBEMAP }; }; DDSTools.GetRGBAArrayBuffer = function (width, height, dataOffset, dataLength, arrayBuffer) { var byteArray = new Uint8Array(dataLength); var srcData = new Uint8Array(arrayBuffer); var index = 0; for (var y = height - 1; y >= 0; y--) { for (var x = 0; x < width; x++) { var srcPos = dataOffset + (x + y * width) * 4; byteArray[index + 2] = srcData[srcPos]; byteArray[index + 1] = srcData[srcPos + 1]; byteArray[index] = srcData[srcPos + 2]; byteArray[index + 3] = srcData[srcPos + 3]; index += 4; } } return byteArray; }; DDSTools.GetRGBArrayBuffer = function (width, height, dataOffset, dataLength, arrayBuffer) { var byteArray = new Uint8Array(dataLength); var srcData = new Uint8Array(arrayBuffer); var index = 0; for (var y = height - 1; y >= 0; y--) { for (var x = 0; x < width; x++) { var srcPos = dataOffset + (x + y * width) * 3; byteArray[index + 2] = srcData[srcPos]; byteArray[index + 1] = srcData[srcPos + 1]; byteArray[index] = srcData[srcPos + 2]; index += 3; } } return byteArray; }; DDSTools.GetLuminanceArrayBuffer = function (width, height, dataOffset, dataLength, arrayBuffer) { var byteArray = new Uint8Array(dataLength); var srcData = new Uint8Array(arrayBuffer); var index = 0; for (var y = height - 1; y >= 0; y--) { for (var x = 0; x < width; x++) { var srcPos = dataOffset + (x + y * width); byteArray[index] = srcData[srcPos]; index++; } } return byteArray; }; DDSTools.UploadDDSLevels = function (gl, ext, arrayBuffer, info, loadMipmaps, faces) { var header = new Int32Array(arrayBuffer, 0, headerLengthInt), fourCC, blockBytes, internalFormat, width, height, dataLength, dataOffset, byteArray, mipmapCount, i; if (header[off_magic] != DDS_MAGIC) { BABYLON.Tools.Error("Invalid magic number in DDS header"); return; } if (!info.isFourCC && !info.isRGB && !info.isLuminance) { BABYLON.Tools.Error("Unsupported format, must contain a FourCC, RGB or LUMINANCE code"); return; } if (info.isFourCC) { fourCC = header[off_pfFourCC]; switch (fourCC) { case FOURCC_DXT1: blockBytes = 8; internalFormat = ext.COMPRESSED_RGBA_S3TC_DXT1_EXT; break; case FOURCC_DXT3: blockBytes = 16; internalFormat = ext.COMPRESSED_RGBA_S3TC_DXT3_EXT; break; case FOURCC_DXT5: blockBytes = 16; internalFormat = ext.COMPRESSED_RGBA_S3TC_DXT5_EXT; break; default: console.error("Unsupported FourCC code:", Int32ToFourCC(fourCC)); return; } } mipmapCount = 1; if (header[off_flags] & DDSD_MIPMAPCOUNT && loadMipmaps !== false) { mipmapCount = Math.max(1, header[off_mipmapCount]); } var bpp = header[off_RGBbpp]; for (var face = 0; face < faces; face++) { var sampler = faces == 1 ? gl.TEXTURE_2D : (gl.TEXTURE_CUBE_MAP_POSITIVE_X + face); width = header[off_width]; height = header[off_height]; dataOffset = header[off_size] + 4; for (i = 0; i < mipmapCount; ++i) { if (info.isRGB) { if (bpp == 24) { dataLength = width * height * 3; byteArray = DDSTools.GetRGBArrayBuffer(width, height, dataOffset, dataLength, arrayBuffer); gl.texImage2D(sampler, i, gl.RGB, width, height, 0, gl.RGB, gl.UNSIGNED_BYTE, byteArray); } else { dataLength = width * height * 4; byteArray = DDSTools.GetRGBAArrayBuffer(width, height, dataOffset, dataLength, arrayBuffer); gl.texImage2D(sampler, i, gl.RGBA, width, height, 0, gl.RGBA, gl.UNSIGNED_BYTE, byteArray); } } else if (info.isLuminance) { var unpackAlignment = gl.getParameter(gl.UNPACK_ALIGNMENT); var unpaddedRowSize = width; var paddedRowSize = Math.floor((width + unpackAlignment - 1) / unpackAlignment) * unpackAlignment; dataLength = paddedRowSize * (height - 1) + unpaddedRowSize; byteArray = DDSTools.GetLuminanceArrayBuffer(width, height, dataOffset, dataLength, arrayBuffer); gl.texImage2D(sampler, i, gl.LUMINANCE, width, height, 0, gl.LUMINANCE, gl.UNSIGNED_BYTE, byteArray); } else { dataLength = Math.max(4, width) / 4 * Math.max(4, height) / 4 * blockBytes; byteArray = new Uint8Array(arrayBuffer, dataOffset, dataLength); gl.compressedTexImage2D(sampler, i, internalFormat, width, height, 0, byteArray); } dataOffset += dataLength; width *= 0.5; height *= 0.5; width = Math.max(1.0, width); height = Math.max(1.0, height); } } }; return DDSTools; })(); Internals.DDSTools = DDSTools; })(BABYLON.Internals || (BABYLON.Internals = {})); var Internals = BABYLON.Internals; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.tools.dds.js.map var BABYLON; (function (BABYLON) { var SmartArray = (function () { function SmartArray(capacity) { this.length = 0; this._duplicateId = 0; this.data = new Array(capacity); this._id = SmartArray._GlobalId++; } SmartArray.prototype.push = function (value) { this.data[this.length++] = value; if (this.length > this.data.length) { this.data.length *= 2; } if (!value.__smartArrayFlags) { value.__smartArrayFlags = {}; } value.__smartArrayFlags[this._id] = this._duplicateId; }; SmartArray.prototype.pushNoDuplicate = function (value) { if (value.__smartArrayFlags && value.__smartArrayFlags[this._id] === this._duplicateId) { return; } this.push(value); }; SmartArray.prototype.sort = function (compareFn) { this.data.sort(compareFn); }; SmartArray.prototype.reset = function () { this.length = 0; this._duplicateId++; }; SmartArray.prototype.concat = function (array) { if (array.length === 0) { return; } if (this.length + array.length > this.data.length) { this.data.length = (this.length + array.length) * 2; } for (var index = 0; index < array.length; index++) { this.data[this.length++] = (array.data || array)[index]; } }; SmartArray.prototype.concatWithNoDuplicate = function (array) { if (array.length === 0) { return; } if (this.length + array.length > this.data.length) { this.data.length = (this.length + array.length) * 2; } for (var index = 0; index < array.length; index++) { var item = (array.data || array)[index]; this.pushNoDuplicate(item); } }; SmartArray.prototype.indexOf = function (value) { var position = this.data.indexOf(value); if (position >= this.length) { return -1; } return position; }; SmartArray._GlobalId = 0; return SmartArray; })(); BABYLON.SmartArray = SmartArray; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.smartArray.js.map var BABYLON; (function (BABYLON) { var CannonJSPlugin = (function () { function CannonJSPlugin() { this._registeredMeshes = []; this._physicsMaterials = []; this.updateBodyPosition = function (mesh) { for (var index = 0; index < this._registeredMeshes.length; index++) { var registeredMesh = this._registeredMeshes[index]; if (registeredMesh.mesh === mesh || registeredMesh.mesh === mesh.parent) { var body = registeredMesh.body; var center = mesh.getBoundingInfo().boundingBox.center; body.position.set(center.x, center.z, center.y); body.quaternion.x = mesh.rotationQuaternion.x; body.quaternion.z = mesh.rotationQuaternion.y; body.quaternion.y = mesh.rotationQuaternion.z; body.quaternion.w = -mesh.rotationQuaternion.w; return; } } }; } CannonJSPlugin.prototype.initialize = function (iterations) { if (typeof iterations === "undefined") { iterations = 10; } this._world = new CANNON.World(); this._world.broadphase = new CANNON.NaiveBroadphase(); this._world.solver.iterations = iterations; }; CannonJSPlugin.prototype._checkWithEpsilon = function (value) { return value < BABYLON.PhysicsEngine.Epsilon ? BABYLON.PhysicsEngine.Epsilon : value; }; CannonJSPlugin.prototype.runOneStep = function (delta) { this._world.step(delta); for (var index = 0; index < this._registeredMeshes.length; index++) { var registeredMesh = this._registeredMeshes[index]; if (registeredMesh.isChild) { continue; } // Body position var bodyX = registeredMesh.body.position.x, bodyY = registeredMesh.body.position.y, bodyZ = registeredMesh.body.position.z; var deltaPos = registeredMesh.delta; if (deltaPos) { registeredMesh.mesh.position.x = bodyX + deltaPos.x; registeredMesh.mesh.position.y = bodyZ + deltaPos.y; registeredMesh.mesh.position.z = bodyY + deltaPos.z; } else { registeredMesh.mesh.position.x = bodyX; registeredMesh.mesh.position.y = bodyZ; registeredMesh.mesh.position.z = bodyY; } if (!registeredMesh.mesh.rotationQuaternion) { registeredMesh.mesh.rotationQuaternion = new BABYLON.Quaternion(0, 0, 0, 1); } registeredMesh.mesh.rotationQuaternion.x = registeredMesh.body.quaternion.x; registeredMesh.mesh.rotationQuaternion.y = registeredMesh.body.quaternion.z; registeredMesh.mesh.rotationQuaternion.z = registeredMesh.body.quaternion.y; registeredMesh.mesh.rotationQuaternion.w = -registeredMesh.body.quaternion.w; } }; CannonJSPlugin.prototype.setGravity = function (gravity) { this._world.gravity.set(gravity.x, gravity.z, gravity.y); }; CannonJSPlugin.prototype.registerMesh = function (mesh, impostor, options) { this.unregisterMesh(mesh); mesh.computeWorldMatrix(true); switch (impostor) { case BABYLON.PhysicsEngine.SphereImpostor: var bbox = mesh.getBoundingInfo().boundingBox; var radiusX = bbox.maximumWorld.x - bbox.minimumWorld.x; var radiusY = bbox.maximumWorld.y - bbox.minimumWorld.y; var radiusZ = bbox.maximumWorld.z - bbox.minimumWorld.z; return this._createSphere(Math.max(this._checkWithEpsilon(radiusX), this._checkWithEpsilon(radiusY), this._checkWithEpsilon(radiusZ)) / 2, mesh, options); case BABYLON.PhysicsEngine.BoxImpostor: bbox = mesh.getBoundingInfo().boundingBox; var min = bbox.minimumWorld; var max = bbox.maximumWorld; var box = max.subtract(min).scale(0.5); return this._createBox(this._checkWithEpsilon(box.x), this._checkWithEpsilon(box.y), this._checkWithEpsilon(box.z), mesh, options); case BABYLON.PhysicsEngine.PlaneImpostor: return this._createPlane(mesh, options); case BABYLON.PhysicsEngine.MeshImpostor: var rawVerts = mesh.getVerticesData(BABYLON.VertexBuffer.PositionKind); var rawFaces = mesh.getIndices(); return this._createConvexPolyhedron(rawVerts, rawFaces, mesh, options); } return null; }; CannonJSPlugin.prototype._createSphere = function (radius, mesh, options) { var shape = new CANNON.Sphere(radius); if (!options) { return shape; } return this._createRigidBodyFromShape(shape, mesh, options.mass, options.friction, options.restitution); }; CannonJSPlugin.prototype._createBox = function (x, y, z, mesh, options) { var shape = new CANNON.Box(new CANNON.Vec3(x, z, y)); if (!options) { return shape; } return this._createRigidBodyFromShape(shape, mesh, options.mass, options.friction, options.restitution); }; CannonJSPlugin.prototype._createPlane = function (mesh, options) { var shape = new CANNON.Plane(); if (!options) { return shape; } return this._createRigidBodyFromShape(shape, mesh, options.mass, options.friction, options.restitution); }; CannonJSPlugin.prototype._createConvexPolyhedron = function (rawVerts, rawFaces, mesh, options) { var verts = [], faces = []; mesh.computeWorldMatrix(true); for (var i = 0; i < rawVerts.length; i += 3) { var transformed = BABYLON.Vector3.Zero(); BABYLON.Vector3.TransformNormalFromFloatsToRef(rawVerts[i], rawVerts[i + 1], rawVerts[i + 2], mesh.getWorldMatrix(), transformed); verts.push(new CANNON.Vec3(transformed.x, transformed.z, transformed.y)); } for (var j = 0; j < rawFaces.length; j += 3) { faces.push([rawFaces[j], rawFaces[j + 2], rawFaces[j + 1]]); } var shape = new CANNON.ConvexPolyhedron(verts, faces); if (!options) { return shape; } return this._createRigidBodyFromShape(shape, mesh, options.mass, options.friction, options.restitution); }; CannonJSPlugin.prototype._addMaterial = function (friction, restitution) { var index; var mat; for (index = 0; index < this._physicsMaterials.length; index++) { mat = this._physicsMaterials[index]; if (mat.friction === friction && mat.restitution === restitution) { return mat; } } var currentMat = new CANNON.Material(); currentMat.friction = friction; currentMat.restitution = restitution; this._physicsMaterials.push(currentMat); for (index = 0; index < this._physicsMaterials.length; index++) { mat = this._physicsMaterials[index]; var contactMaterial = new CANNON.ContactMaterial(mat, currentMat, mat.friction * currentMat.friction, mat.restitution * currentMat.restitution); contactMaterial.contactEquationStiffness = 1e10; contactMaterial.contactEquationRegularizationTime = 10; this._world.addContactMaterial(contactMaterial); } return currentMat; }; CannonJSPlugin.prototype._createRigidBodyFromShape = function (shape, mesh, mass, friction, restitution) { var initialRotation = null; if (mesh.rotationQuaternion) { initialRotation = mesh.rotationQuaternion.clone(); mesh.rotationQuaternion = new BABYLON.Quaternion(0, 0, 0, 1); } // The delta between the mesh position and the mesh bounding box center var bbox = mesh.getBoundingInfo().boundingBox; var deltaPosition = mesh.position.subtract(bbox.center); var material = this._addMaterial(friction, restitution); var body = new CANNON.RigidBody(mass, shape, material); if (initialRotation) { body.quaternion.x = initialRotation.x; body.quaternion.z = initialRotation.y; body.quaternion.y = initialRotation.z; body.quaternion.w = -initialRotation.w; } body.position.set(bbox.center.x, bbox.center.z, bbox.center.y); this._world.add(body); this._registeredMeshes.push({ mesh: mesh, body: body, material: material, delta: deltaPosition }); return body; }; CannonJSPlugin.prototype.registerMeshesAsCompound = function (parts, options) { var compoundShape = new CANNON.Compound(); for (var index = 0; index < parts.length; index++) { var mesh = parts[index].mesh; var shape = this.registerMesh(mesh, parts[index].impostor); if (index == 0) { compoundShape.addChild(shape, new CANNON.Vec3(0, 0, 0)); } else { compoundShape.addChild(shape, new CANNON.Vec3(mesh.position.x, mesh.position.z, mesh.position.y)); } } var initialMesh = parts[0].mesh; var body = this._createRigidBodyFromShape(compoundShape, initialMesh, options.mass, options.friction, options.restitution); body.parts = parts; return body; }; CannonJSPlugin.prototype._unbindBody = function (body) { for (var index = 0; index < this._registeredMeshes.length; index++) { var registeredMesh = this._registeredMeshes[index]; if (registeredMesh.body === body) { registeredMesh.body = null; registeredMesh.delta = 0; } } }; CannonJSPlugin.prototype.unregisterMesh = function (mesh) { for (var index = 0; index < this._registeredMeshes.length; index++) { var registeredMesh = this._registeredMeshes[index]; if (registeredMesh.mesh === mesh) { // Remove body if (registeredMesh.body) { this._world.remove(registeredMesh.body); this._unbindBody(registeredMesh.body); } this._registeredMeshes.splice(index, 1); return; } } }; CannonJSPlugin.prototype.applyImpulse = function (mesh, force, contactPoint) { var worldPoint = new CANNON.Vec3(contactPoint.x, contactPoint.z, contactPoint.y); var impulse = new CANNON.Vec3(force.x, force.z, force.y); for (var index = 0; index < this._registeredMeshes.length; index++) { var registeredMesh = this._registeredMeshes[index]; if (registeredMesh.mesh === mesh) { registeredMesh.body.applyImpulse(impulse, worldPoint); return; } } }; CannonJSPlugin.prototype.createLink = function (mesh1, mesh2, pivot1, pivot2) { var body1 = null, body2 = null; for (var index = 0; index < this._registeredMeshes.length; index++) { var registeredMesh = this._registeredMeshes[index]; if (registeredMesh.mesh === mesh1) { body1 = registeredMesh.body; } else if (registeredMesh.mesh === mesh2) { body2 = registeredMesh.body; } } if (!body1 || !body2) { return false; } var constraint = new CANNON.PointToPointConstraint(body1, new CANNON.Vec3(pivot1.x, pivot1.z, pivot1.y), body2, new CANNON.Vec3(pivot2.x, pivot2.z, pivot2.y)); this._world.addConstraint(constraint); return true; }; CannonJSPlugin.prototype.dispose = function () { while (this._registeredMeshes.length) { this.unregisterMesh(this._registeredMeshes[0].mesh); } }; CannonJSPlugin.prototype.isSupported = function () { return window.CANNON !== undefined; }; return CannonJSPlugin; })(); BABYLON.CannonJSPlugin = CannonJSPlugin; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.cannonJSPlugin.js.map var BABYLON; (function (BABYLON) { var Condition = (function () { function Condition(actionManager) { this._actionManager = actionManager; } Condition.prototype.isValid = function () { return true; }; Condition.prototype._getProperty = function (propertyPath) { return this._actionManager._getProperty(propertyPath); }; Condition.prototype._getEffectiveTarget = function (target, propertyPath) { return this._actionManager._getEffectiveTarget(target, propertyPath); }; return Condition; })(); BABYLON.Condition = Condition; var ValueCondition = (function (_super) { __extends(ValueCondition, _super); function ValueCondition(actionManager, target, propertyPath, value, operator) { if (typeof operator === "undefined") { operator = ValueCondition.IsEqual; } _super.call(this, actionManager); this.propertyPath = propertyPath; this.value = value; this.operator = operator; this._target = this._getEffectiveTarget(target, this.propertyPath); this._property = this._getProperty(this.propertyPath); } Object.defineProperty(ValueCondition, "IsEqual", { get: function () { return ValueCondition._IsEqual; }, enumerable: true, configurable: true }); Object.defineProperty(ValueCondition, "IsDifferent", { get: function () { return ValueCondition._IsDifferent; }, enumerable: true, configurable: true }); Object.defineProperty(ValueCondition, "IsGreater", { get: function () { return ValueCondition._IsGreater; }, enumerable: true, configurable: true }); Object.defineProperty(ValueCondition, "IsLesser", { get: function () { return ValueCondition._IsLesser; }, enumerable: true, configurable: true }); // Methods ValueCondition.prototype.isValid = function () { switch (this.operator) { case ValueCondition.IsGreater: return this._target[this._property] > this.value; case ValueCondition.IsLesser: return this._target[this._property] < this.value; case ValueCondition.IsEqual: case ValueCondition.IsDifferent: var check; if (this.value.equals) { check = this.value.equals(this._target[this._property]); } else { check = this.value === this._target[this._property]; } return this.operator === ValueCondition.IsEqual ? check : !check; } return false; }; ValueCondition._IsEqual = 0; ValueCondition._IsDifferent = 1; ValueCondition._IsGreater = 2; ValueCondition._IsLesser = 3; return ValueCondition; })(Condition); BABYLON.ValueCondition = ValueCondition; var PredicateCondition = (function (_super) { __extends(PredicateCondition, _super); function PredicateCondition(actionManager, predicate) { _super.call(this, actionManager); this.predicate = predicate; } PredicateCondition.prototype.isValid = function () { return this.predicate(); }; return PredicateCondition; })(Condition); BABYLON.PredicateCondition = PredicateCondition; var StateCondition = (function (_super) { __extends(StateCondition, _super); function StateCondition(actionManager, target, value) { _super.call(this, actionManager); this.value = value; this._target = target; } // Methods StateCondition.prototype.isValid = function () { return this._target.state === this.value; }; return StateCondition; })(Condition); BABYLON.StateCondition = StateCondition; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.condition.js.map var BABYLON; (function (BABYLON) { var Action = (function () { function Action(triggerOptions, condition) { this.triggerOptions = triggerOptions; if (triggerOptions.parameter) { this.trigger = triggerOptions.trigger; this._triggerParameter = triggerOptions.parameter; } else { this.trigger = triggerOptions; } this._nextActiveAction = this; this._condition = condition; } // Methods Action.prototype._prepare = function () { }; Action.prototype.getTriggerParameter = function () { return this._triggerParameter; }; Action.prototype._executeCurrent = function (evt) { if (this._condition) { var currentRenderId = this._actionManager.getScene().getRenderId(); // We cache the current evaluation for the current frame if (this._condition._evaluationId === currentRenderId) { if (!this._condition._currentResult) { return; } } else { this._condition._evaluationId = currentRenderId; if (!this._condition.isValid()) { this._condition._currentResult = false; return; } this._condition._currentResult = true; } } this._nextActiveAction.execute(evt); if (this._nextActiveAction._child) { if (!this._nextActiveAction._child._actionManager) { this._nextActiveAction._child._actionManager = this._actionManager; } this._nextActiveAction = this._nextActiveAction._child; } else { this._nextActiveAction = this; } }; Action.prototype.execute = function (evt) { }; Action.prototype.then = function (action) { this._child = action; action._actionManager = this._actionManager; action._prepare(); return action; }; Action.prototype._getProperty = function (propertyPath) { return this._actionManager._getProperty(propertyPath); }; Action.prototype._getEffectiveTarget = function (target, propertyPath) { return this._actionManager._getEffectiveTarget(target, propertyPath); }; return Action; })(); BABYLON.Action = Action; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.action.js.map var BABYLON; (function (BABYLON) { var ActionEvent = (function () { function ActionEvent(source, pointerX, pointerY, meshUnderPointer, sourceEvent) { this.source = source; this.pointerX = pointerX; this.pointerY = pointerY; this.meshUnderPointer = meshUnderPointer; this.sourceEvent = sourceEvent; } ActionEvent.CreateNew = function (source, evt) { var scene = source.getScene(); return new ActionEvent(source, scene.pointerX, scene.pointerY, scene.meshUnderPointer, evt); }; ActionEvent.CreateNewFromScene = function (scene, evt) { return new ActionEvent(null, scene.pointerX, scene.pointerY, scene.meshUnderPointer, evt); }; return ActionEvent; })(); BABYLON.ActionEvent = ActionEvent; var ActionManager = (function () { function ActionManager(scene) { // Members this.actions = new Array(); this._scene = scene; scene._actionManagers.push(this); } Object.defineProperty(ActionManager, "NothingTrigger", { get: function () { return ActionManager._NothingTrigger; }, enumerable: true, configurable: true }); Object.defineProperty(ActionManager, "OnPickTrigger", { get: function () { return ActionManager._OnPickTrigger; }, enumerable: true, configurable: true }); Object.defineProperty(ActionManager, "OnLeftPickTrigger", { get: function () { return ActionManager._OnLeftPickTrigger; }, enumerable: true, configurable: true }); Object.defineProperty(ActionManager, "OnRightPickTrigger", { get: function () { return ActionManager._OnRightPickTrigger; }, enumerable: true, configurable: true }); Object.defineProperty(ActionManager, "OnCenterPickTrigger", { get: function () { return ActionManager._OnCenterPickTrigger; }, enumerable: true, configurable: true }); Object.defineProperty(ActionManager, "OnPointerOverTrigger", { get: function () { return ActionManager._OnPointerOverTrigger; }, enumerable: true, configurable: true }); Object.defineProperty(ActionManager, "OnPointerOutTrigger", { get: function () { return ActionManager._OnPointerOutTrigger; }, enumerable: true, configurable: true }); Object.defineProperty(ActionManager, "OnEveryFrameTrigger", { get: function () { return ActionManager._OnEveryFrameTrigger; }, enumerable: true, configurable: true }); Object.defineProperty(ActionManager, "OnIntersectionEnterTrigger", { get: function () { return ActionManager._OnIntersectionEnterTrigger; }, enumerable: true, configurable: true }); Object.defineProperty(ActionManager, "OnIntersectionExitTrigger", { get: function () { return ActionManager._OnIntersectionExitTrigger; }, enumerable: true, configurable: true }); Object.defineProperty(ActionManager, "OnKeyDownTrigger", { get: function () { return ActionManager._OnKeyDownTrigger; }, enumerable: true, configurable: true }); Object.defineProperty(ActionManager, "OnKeyUpTrigger", { get: function () { return ActionManager._OnKeyUpTrigger; }, enumerable: true, configurable: true }); // Methods ActionManager.prototype.dispose = function () { var index = this._scene._actionManagers.indexOf(this); if (index > -1) { this._scene._actionManagers.splice(index, 1); } }; ActionManager.prototype.getScene = function () { return this._scene; }; ActionManager.prototype.hasSpecificTriggers = function (triggers) { for (var index = 0; index < this.actions.length; index++) { var action = this.actions[index]; if (triggers.indexOf(action.trigger) > -1) { return true; } } return false; }; Object.defineProperty(ActionManager.prototype, "hasPointerTriggers", { get: function () { for (var index = 0; index < this.actions.length; index++) { var action = this.actions[index]; if (action.trigger >= ActionManager._OnPickTrigger && action.trigger <= ActionManager._OnPointerOutTrigger) { return true; } } return false; }, enumerable: true, configurable: true }); Object.defineProperty(ActionManager.prototype, "hasPickTriggers", { get: function () { for (var index = 0; index < this.actions.length; index++) { var action = this.actions[index]; if (action.trigger >= ActionManager._OnPickTrigger && action.trigger <= ActionManager._OnCenterPickTrigger) { return true; } } return false; }, enumerable: true, configurable: true }); ActionManager.prototype.registerAction = function (action) { if (action.trigger === ActionManager.OnEveryFrameTrigger) { if (this.getScene().actionManager !== this) { BABYLON.Tools.Warn("OnEveryFrameTrigger can only be used with scene.actionManager"); return null; } } this.actions.push(action); action._actionManager = this; action._prepare(); return action; }; ActionManager.prototype.processTrigger = function (trigger, evt) { for (var index = 0; index < this.actions.length; index++) { var action = this.actions[index]; if (action.trigger === trigger) { if (trigger === ActionManager.OnKeyUpTrigger || trigger === ActionManager.OnKeyDownTrigger) { var parameter = action.getTriggerParameter(); if (parameter) { if (evt.sourceEvent.key !== parameter) { continue; } } } action._executeCurrent(evt); } } }; ActionManager.prototype._getEffectiveTarget = function (target, propertyPath) { var properties = propertyPath.split("."); for (var index = 0; index < properties.length - 1; index++) { target = target[properties[index]]; } return target; }; ActionManager.prototype._getProperty = function (propertyPath) { var properties = propertyPath.split("."); return properties[properties.length - 1]; }; ActionManager._NothingTrigger = 0; ActionManager._OnPickTrigger = 1; ActionManager._OnLeftPickTrigger = 2; ActionManager._OnRightPickTrigger = 3; ActionManager._OnCenterPickTrigger = 4; ActionManager._OnPointerOverTrigger = 5; ActionManager._OnPointerOutTrigger = 6; ActionManager._OnEveryFrameTrigger = 7; ActionManager._OnIntersectionEnterTrigger = 8; ActionManager._OnIntersectionExitTrigger = 9; ActionManager._OnKeyDownTrigger = 10; ActionManager._OnKeyUpTrigger = 11; return ActionManager; })(); BABYLON.ActionManager = ActionManager; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.actionManager.js.map var BABYLON; (function (BABYLON) { var InterpolateValueAction = (function (_super) { __extends(InterpolateValueAction, _super); function InterpolateValueAction(triggerOptions, target, propertyPath, value, duration, condition, stopOtherAnimations) { if (typeof duration === "undefined") { duration = 1000; } _super.call(this, triggerOptions, condition); this.propertyPath = propertyPath; this.value = value; this.duration = duration; this.stopOtherAnimations = stopOtherAnimations; this._target = target; } InterpolateValueAction.prototype._prepare = function () { this._target = this._getEffectiveTarget(this._target, this.propertyPath); this._property = this._getProperty(this.propertyPath); }; InterpolateValueAction.prototype.execute = function () { var scene = this._actionManager.getScene(); var keys = [ { frame: 0, value: this._target[this._property] }, { frame: 100, value: this.value } ]; var dataType; if (typeof this.value === "number") { dataType = BABYLON.Animation.ANIMATIONTYPE_FLOAT; } else if (this.value instanceof BABYLON.Color3) { dataType = BABYLON.Animation.ANIMATIONTYPE_COLOR3; } else if (this.value instanceof BABYLON.Vector3) { dataType = BABYLON.Animation.ANIMATIONTYPE_VECTOR3; } else if (this.value instanceof BABYLON.Matrix) { dataType = BABYLON.Animation.ANIMATIONTYPE_MATRIX; } else if (this.value instanceof BABYLON.Quaternion) { dataType = BABYLON.Animation.ANIMATIONTYPE_QUATERNION; } else { BABYLON.Tools.Warn("InterpolateValueAction: Unsupported type (" + typeof this.value + ")"); return; } var animation = new BABYLON.Animation("InterpolateValueAction", this._property, 100 * (1000.0 / this.duration), dataType, BABYLON.Animation.ANIMATIONLOOPMODE_CONSTANT); animation.setKeys(keys); if (this.stopOtherAnimations) { scene.stopAnimation(this._target); } scene.beginDirectAnimation(this._target, [animation], 0, 100); }; return InterpolateValueAction; })(BABYLON.Action); BABYLON.InterpolateValueAction = InterpolateValueAction; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.interpolateValueAction.js.map var BABYLON; (function (BABYLON) { var SwitchBooleanAction = (function (_super) { __extends(SwitchBooleanAction, _super); function SwitchBooleanAction(triggerOptions, target, propertyPath, condition) { _super.call(this, triggerOptions, condition); this.propertyPath = propertyPath; this._target = target; } SwitchBooleanAction.prototype._prepare = function () { this._target = this._getEffectiveTarget(this._target, this.propertyPath); this._property = this._getProperty(this.propertyPath); }; SwitchBooleanAction.prototype.execute = function () { this._target[this._property] = !this._target[this._property]; }; return SwitchBooleanAction; })(BABYLON.Action); BABYLON.SwitchBooleanAction = SwitchBooleanAction; var SetStateAction = (function (_super) { __extends(SetStateAction, _super); function SetStateAction(triggerOptions, target, value, condition) { _super.call(this, triggerOptions, condition); this.value = value; this._target = target; } SetStateAction.prototype.execute = function () { this._target.state = this.value; }; return SetStateAction; })(BABYLON.Action); BABYLON.SetStateAction = SetStateAction; var SetValueAction = (function (_super) { __extends(SetValueAction, _super); function SetValueAction(triggerOptions, target, propertyPath, value, condition) { _super.call(this, triggerOptions, condition); this.propertyPath = propertyPath; this.value = value; this._target = target; } SetValueAction.prototype._prepare = function () { this._target = this._getEffectiveTarget(this._target, this.propertyPath); this._property = this._getProperty(this.propertyPath); }; SetValueAction.prototype.execute = function () { this._target[this._property] = this.value; }; return SetValueAction; })(BABYLON.Action); BABYLON.SetValueAction = SetValueAction; var IncrementValueAction = (function (_super) { __extends(IncrementValueAction, _super); function IncrementValueAction(triggerOptions, target, propertyPath, value, condition) { _super.call(this, triggerOptions, condition); this.propertyPath = propertyPath; this.value = value; this._target = target; } IncrementValueAction.prototype._prepare = function () { this._target = this._getEffectiveTarget(this._target, this.propertyPath); this._property = this._getProperty(this.propertyPath); if (typeof this._target[this._property] !== "number") { BABYLON.Tools.Warn("Warning: IncrementValueAction can only be used with number values"); } }; IncrementValueAction.prototype.execute = function () { this._target[this._property] += this.value; }; return IncrementValueAction; })(BABYLON.Action); BABYLON.IncrementValueAction = IncrementValueAction; var PlayAnimationAction = (function (_super) { __extends(PlayAnimationAction, _super); function PlayAnimationAction(triggerOptions, target, from, to, loop, condition) { _super.call(this, triggerOptions, condition); this.from = from; this.to = to; this.loop = loop; this._target = target; } PlayAnimationAction.prototype._prepare = function () { }; PlayAnimationAction.prototype.execute = function () { var scene = this._actionManager.getScene(); scene.beginAnimation(this._target, this.from, this.to, this.loop); }; return PlayAnimationAction; })(BABYLON.Action); BABYLON.PlayAnimationAction = PlayAnimationAction; var StopAnimationAction = (function (_super) { __extends(StopAnimationAction, _super); function StopAnimationAction(triggerOptions, target, condition) { _super.call(this, triggerOptions, condition); this._target = target; } StopAnimationAction.prototype._prepare = function () { }; StopAnimationAction.prototype.execute = function () { var scene = this._actionManager.getScene(); scene.stopAnimation(this._target); }; return StopAnimationAction; })(BABYLON.Action); BABYLON.StopAnimationAction = StopAnimationAction; var DoNothingAction = (function (_super) { __extends(DoNothingAction, _super); function DoNothingAction(triggerOptions, condition) { if (typeof triggerOptions === "undefined") { triggerOptions = BABYLON.ActionManager.NothingTrigger; } _super.call(this, triggerOptions, condition); } DoNothingAction.prototype.execute = function () { }; return DoNothingAction; })(BABYLON.Action); BABYLON.DoNothingAction = DoNothingAction; var CombineAction = (function (_super) { __extends(CombineAction, _super); function CombineAction(triggerOptions, children, condition) { _super.call(this, triggerOptions, condition); this.children = children; } CombineAction.prototype._prepare = function () { for (var index = 0; index < this.children.length; index++) { this.children[index]._actionManager = this._actionManager; this.children[index]._prepare(); } }; CombineAction.prototype.execute = function (evt) { for (var index = 0; index < this.children.length; index++) { this.children[index].execute(evt); } }; return CombineAction; })(BABYLON.Action); BABYLON.CombineAction = CombineAction; var ExecuteCodeAction = (function (_super) { __extends(ExecuteCodeAction, _super); function ExecuteCodeAction(triggerOptions, func, condition) { _super.call(this, triggerOptions, condition); this.func = func; } ExecuteCodeAction.prototype.execute = function (evt) { this.func(evt); }; return ExecuteCodeAction; })(BABYLON.Action); BABYLON.ExecuteCodeAction = ExecuteCodeAction; var SetParentAction = (function (_super) { __extends(SetParentAction, _super); function SetParentAction(triggerOptions, target, parent, condition) { _super.call(this, triggerOptions, condition); this._target = target; this._parent = parent; } SetParentAction.prototype._prepare = function () { }; SetParentAction.prototype.execute = function () { if (this._target.parent === this._parent) { return; } var invertParentWorldMatrix = this._parent.getWorldMatrix().clone(); invertParentWorldMatrix.invert(); this._target.position = BABYLON.Vector3.TransformCoordinates(this._target.position, invertParentWorldMatrix); this._target.parent = this._parent; }; return SetParentAction; })(BABYLON.Action); BABYLON.SetParentAction = SetParentAction; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.directActions.js.map var BABYLON; (function (BABYLON) { var Geometry = (function () { function Geometry(id, scene, vertexData, updatable, mesh) { this.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_NONE; this._totalVertices = 0; this._indices = []; this.id = id; this._engine = scene.getEngine(); this._meshes = []; this._scene = scene; // vertexData if (vertexData) { this.setAllVerticesData(vertexData, updatable); } else { this._totalVertices = 0; this._indices = []; } // applyToMesh if (mesh) { this.applyToMesh(mesh); } } Geometry.prototype.getScene = function () { return this._scene; }; Geometry.prototype.getEngine = function () { return this._engine; }; Geometry.prototype.isReady = function () { return this.delayLoadState === BABYLON.Engine.DELAYLOADSTATE_LOADED || this.delayLoadState === BABYLON.Engine.DELAYLOADSTATE_NONE; }; Geometry.prototype.setAllVerticesData = function (vertexData, updatable) { vertexData.applyToGeometry(this, updatable); }; Geometry.prototype.setVerticesData = function (kind, data, updatable, stride) { this._vertexBuffers = this._vertexBuffers || {}; if (this._vertexBuffers[kind]) { this._vertexBuffers[kind].dispose(); } this._vertexBuffers[kind] = new BABYLON.VertexBuffer(this._engine, data, kind, updatable, this._meshes.length === 0, stride); if (kind === BABYLON.VertexBuffer.PositionKind) { stride = this._vertexBuffers[kind].getStrideSize(); this._totalVertices = data.length / stride; var extend = BABYLON.Tools.ExtractMinAndMax(data, 0, this._totalVertices); var meshes = this._meshes; var numOfMeshes = meshes.length; for (var index = 0; index < numOfMeshes; index++) { var mesh = meshes[index]; mesh._resetPointsArrayCache(); mesh._boundingInfo = new BABYLON.BoundingInfo(extend.minimum, extend.maximum); mesh._createGlobalSubMesh(); mesh.computeWorldMatrix(true); } } }; Geometry.prototype.updateVerticesDataDirectly = function (kind, data, offset) { var vertexBuffer = this.getVertexBuffer(kind); if (!vertexBuffer) { return; } vertexBuffer.updateDirectly(data, offset); }; Geometry.prototype.updateVerticesData = function (kind, data, updateExtends) { var vertexBuffer = this.getVertexBuffer(kind); if (!vertexBuffer) { return; } vertexBuffer.update(data); if (kind === BABYLON.VertexBuffer.PositionKind) { var extend; var stride = vertexBuffer.getStrideSize(); this._totalVertices = data.length / stride; if (updateExtends) { extend = BABYLON.Tools.ExtractMinAndMax(data, 0, this._totalVertices); } var meshes = this._meshes; var numOfMeshes = meshes.length; for (var index = 0; index < numOfMeshes; index++) { var mesh = meshes[index]; mesh._resetPointsArrayCache(); if (updateExtends) { mesh._boundingInfo = new BABYLON.BoundingInfo(extend.minimum, extend.maximum); } } } }; Geometry.prototype.getTotalVertices = function () { if (!this.isReady()) { return 0; } return this._totalVertices; }; Geometry.prototype.getVerticesData = function (kind) { var vertexBuffer = this.getVertexBuffer(kind); if (!vertexBuffer) { return null; } return vertexBuffer.getData(); }; Geometry.prototype.getVertexBuffer = function (kind) { if (!this.isReady()) { return null; } return this._vertexBuffers[kind]; }; Geometry.prototype.getVertexBuffers = function () { if (!this.isReady()) { return null; } return this._vertexBuffers; }; Geometry.prototype.isVerticesDataPresent = function (kind) { if (!this._vertexBuffers) { if (this._delayInfo) { return this._delayInfo.indexOf(kind) !== -1; } return false; } return this._vertexBuffers[kind] !== undefined; }; Geometry.prototype.getVerticesDataKinds = function () { var result = []; if (!this._vertexBuffers && this._delayInfo) { for (var kind in this._delayInfo) { result.push(kind); } } else { for (kind in this._vertexBuffers) { result.push(kind); } } return result; }; Geometry.prototype.setIndices = function (indices, totalVertices) { if (this._indexBuffer) { this._engine._releaseBuffer(this._indexBuffer); } this._indices = indices; if (this._meshes.length !== 0 && this._indices) { this._indexBuffer = this._engine.createIndexBuffer(this._indices); } if (totalVertices !== undefined) { this._totalVertices = totalVertices; } var meshes = this._meshes; var numOfMeshes = meshes.length; for (var index = 0; index < numOfMeshes; index++) { meshes[index]._createGlobalSubMesh(); } }; Geometry.prototype.getTotalIndices = function () { if (!this.isReady()) { return 0; } return this._indices.length; }; Geometry.prototype.getIndices = function () { if (!this.isReady()) { return null; } return this._indices; }; Geometry.prototype.getIndexBuffer = function () { if (!this.isReady()) { return null; } return this._indexBuffer; }; Geometry.prototype.releaseForMesh = function (mesh, shouldDispose) { var meshes = this._meshes; var index = meshes.indexOf(mesh); if (index === -1) { return; } for (var kind in this._vertexBuffers) { this._vertexBuffers[kind].dispose(); } if (this._indexBuffer && this._engine._releaseBuffer(this._indexBuffer)) { this._indexBuffer = null; } meshes.splice(index, 1); mesh._geometry = null; if (meshes.length === 0 && shouldDispose) { this.dispose(); } }; Geometry.prototype.applyToMesh = function (mesh) { if (mesh._geometry === this) { return; } var previousGeometry = mesh._geometry; if (previousGeometry) { previousGeometry.releaseForMesh(mesh); } var meshes = this._meshes; // must be done before setting vertexBuffers because of mesh._createGlobalSubMesh() mesh._geometry = this; this._scene.pushGeometry(this); meshes.push(mesh); if (this.isReady()) { this._applyToMesh(mesh); } else { mesh._boundingInfo = this._boundingInfo; } }; Geometry.prototype._applyToMesh = function (mesh) { var numOfMeshes = this._meshes.length; for (var kind in this._vertexBuffers) { if (numOfMeshes === 1) { this._vertexBuffers[kind].create(); } this._vertexBuffers[kind]._buffer.references = numOfMeshes; if (kind === BABYLON.VertexBuffer.PositionKind) { mesh._resetPointsArrayCache(); var extend = BABYLON.Tools.ExtractMinAndMax(this._vertexBuffers[kind].getData(), 0, this._totalVertices); mesh._boundingInfo = new BABYLON.BoundingInfo(extend.minimum, extend.maximum); mesh._createGlobalSubMesh(); //bounding info was just created again, world matrix should be applied again. mesh._updateBoundingInfo(); } } // indexBuffer if (numOfMeshes === 1 && this._indices) { this._indexBuffer = this._engine.createIndexBuffer(this._indices); } if (this._indexBuffer) { this._indexBuffer.references = numOfMeshes; } }; Geometry.prototype.load = function (scene, onLoaded) { var _this = this; if (this.delayLoadState === BABYLON.Engine.DELAYLOADSTATE_LOADING) { return; } if (this.isReady()) { if (onLoaded) { onLoaded(); } return; } this.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_LOADING; scene._addPendingData(this); BABYLON.Tools.LoadFile(this.delayLoadingFile, function (data) { _this._delayLoadingFunction(JSON.parse(data), _this); _this.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_LOADED; _this._delayInfo = []; scene._removePendingData(_this); var meshes = _this._meshes; var numOfMeshes = meshes.length; for (var index = 0; index < numOfMeshes; index++) { _this._applyToMesh(meshes[index]); } if (onLoaded) { onLoaded(); } }, function () { }, scene.database); }; Geometry.prototype.dispose = function () { var meshes = this._meshes; var numOfMeshes = meshes.length; var index; for (index = 0; index < numOfMeshes; index++) { this.releaseForMesh(meshes[index]); } this._meshes = []; for (var kind in this._vertexBuffers) { this._vertexBuffers[kind].dispose(); } this._vertexBuffers = []; this._totalVertices = 0; if (this._indexBuffer) { this._engine._releaseBuffer(this._indexBuffer); } this._indexBuffer = null; this._indices = []; this.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_NONE; this.delayLoadingFile = null; this._delayLoadingFunction = null; this._delayInfo = []; this._boundingInfo = null; // todo: .dispose() var geometries = this._scene.getGeometries(); index = geometries.indexOf(this); if (index > -1) { geometries.splice(index, 1); } }; Geometry.prototype.copy = function (id) { var vertexData = new BABYLON.VertexData(); vertexData.indices = []; var indices = this.getIndices(); for (var index = 0; index < indices.length; index++) { vertexData.indices.push(indices[index]); } var updatable = false; var stopChecking = false; for (var kind in this._vertexBuffers) { vertexData.set(this.getVerticesData(kind), kind); if (!stopChecking) { updatable = this.getVertexBuffer(kind).isUpdatable(); stopChecking = !updatable; } } var geometry = new Geometry(id, this._scene, vertexData, updatable, null); geometry.delayLoadState = this.delayLoadState; geometry.delayLoadingFile = this.delayLoadingFile; geometry._delayLoadingFunction = this._delayLoadingFunction; for (kind in this._delayInfo) { geometry._delayInfo = geometry._delayInfo || []; geometry._delayInfo.push(kind); } // Bounding info var extend = BABYLON.Tools.ExtractMinAndMax(this.getVerticesData(BABYLON.VertexBuffer.PositionKind), 0, this.getTotalVertices()); geometry._boundingInfo = new BABYLON.BoundingInfo(extend.minimum, extend.maximum); return geometry; }; // Statics Geometry.ExtractFromMesh = function (mesh, id) { var geometry = mesh._geometry; if (!geometry) { return null; } return geometry.copy(id); }; // from http://stackoverflow.com/questions/105034/how-to-create-a-guid-uuid-in-javascript/2117523#answer-2117523 // be aware Math.random() could cause collisions Geometry.RandomId = function () { return 'xxxxxxxx-xxxx-4xxx-yxxx-xxxxxxxxxxxx'.replace(/[xy]/g, function (c) { var r = Math.random() * 16 | 0, v = c === 'x' ? r : (r & 0x3 | 0x8); return v.toString(16); }); }; return Geometry; })(); BABYLON.Geometry = Geometry; (function (Geometry) { /////// Primitives ////////////////////////////////////////////// (function (Primitives) { /// Abstract class var _Primitive = (function (_super) { __extends(_Primitive, _super); function _Primitive(id, scene, vertexData, canBeRegenerated, mesh) { this._beingRegenerated = true; this._canBeRegenerated = canBeRegenerated; _super.call(this, id, scene, vertexData, false, mesh); // updatable = false to be sure not to update vertices this._beingRegenerated = false; } _Primitive.prototype.canBeRegenerated = function () { return this._canBeRegenerated; }; _Primitive.prototype.regenerate = function () { if (!this._canBeRegenerated) { return; } this._beingRegenerated = true; this.setAllVerticesData(this._regenerateVertexData(), false); this._beingRegenerated = false; }; _Primitive.prototype.asNewGeometry = function (id) { return _super.prototype.copy.call(this, id); }; // overrides _Primitive.prototype.setAllVerticesData = function (vertexData, updatable) { if (!this._beingRegenerated) { return; } _super.prototype.setAllVerticesData.call(this, vertexData, false); }; _Primitive.prototype.setVerticesData = function (kind, data, updatable) { if (!this._beingRegenerated) { return; } _super.prototype.setVerticesData.call(this, kind, data, false); }; // to override // protected _Primitive.prototype._regenerateVertexData = function () { throw new Error("Abstract method"); }; _Primitive.prototype.copy = function (id) { throw new Error("Must be overriden in sub-classes."); }; return _Primitive; })(Geometry); Primitives._Primitive = _Primitive; var Box = (function (_super) { __extends(Box, _super); function Box(id, scene, size, canBeRegenerated, mesh) { this.size = size; _super.call(this, id, scene, this._regenerateVertexData(), canBeRegenerated, mesh); } Box.prototype._regenerateVertexData = function () { return BABYLON.VertexData.CreateBox(this.size); }; Box.prototype.copy = function (id) { return new Box(id, this.getScene(), this.size, this.canBeRegenerated(), null); }; return Box; })(_Primitive); Primitives.Box = Box; var Sphere = (function (_super) { __extends(Sphere, _super); function Sphere(id, scene, segments, diameter, canBeRegenerated, mesh) { this.segments = segments; this.diameter = diameter; _super.call(this, id, scene, this._regenerateVertexData(), canBeRegenerated, mesh); } Sphere.prototype._regenerateVertexData = function () { return BABYLON.VertexData.CreateSphere(this.segments, this.diameter); }; Sphere.prototype.copy = function (id) { return new Sphere(id, this.getScene(), this.segments, this.diameter, this.canBeRegenerated(), null); }; return Sphere; })(_Primitive); Primitives.Sphere = Sphere; var Cylinder = (function (_super) { __extends(Cylinder, _super); function Cylinder(id, scene, height, diameterTop, diameterBottom, tessellation, subdivisions, canBeRegenerated, mesh) { if (typeof subdivisions === "undefined") { subdivisions = 1; } this.height = height; this.diameterTop = diameterTop; this.diameterBottom = diameterBottom; this.tessellation = tessellation; this.subdivisions = subdivisions; _super.call(this, id, scene, this._regenerateVertexData(), canBeRegenerated, mesh); } Cylinder.prototype._regenerateVertexData = function () { return BABYLON.VertexData.CreateCylinder(this.height, this.diameterTop, this.diameterBottom, this.tessellation, this.subdivisions); }; Cylinder.prototype.copy = function (id) { return new Cylinder(id, this.getScene(), this.height, this.diameterTop, this.diameterBottom, this.tessellation, this.subdivisions, this.canBeRegenerated(), null); }; return Cylinder; })(_Primitive); Primitives.Cylinder = Cylinder; var Torus = (function (_super) { __extends(Torus, _super); function Torus(id, scene, diameter, thickness, tessellation, canBeRegenerated, mesh) { this.diameter = diameter; this.thickness = thickness; this.tessellation = tessellation; _super.call(this, id, scene, this._regenerateVertexData(), canBeRegenerated, mesh); } Torus.prototype._regenerateVertexData = function () { return BABYLON.VertexData.CreateTorus(this.diameter, this.thickness, this.tessellation); }; Torus.prototype.copy = function (id) { return new Torus(id, this.getScene(), this.diameter, this.thickness, this.tessellation, this.canBeRegenerated(), null); }; return Torus; })(_Primitive); Primitives.Torus = Torus; var Ground = (function (_super) { __extends(Ground, _super); function Ground(id, scene, width, height, subdivisions, canBeRegenerated, mesh) { this.width = width; this.height = height; this.subdivisions = subdivisions; _super.call(this, id, scene, this._regenerateVertexData(), canBeRegenerated, mesh); } Ground.prototype._regenerateVertexData = function () { return BABYLON.VertexData.CreateGround(this.width, this.height, this.subdivisions); }; Ground.prototype.copy = function (id) { return new Ground(id, this.getScene(), this.width, this.height, this.subdivisions, this.canBeRegenerated(), null); }; return Ground; })(_Primitive); Primitives.Ground = Ground; var TiledGround = (function (_super) { __extends(TiledGround, _super); function TiledGround(id, scene, xmin, zmin, xmax, zmax, subdivisions, precision, canBeRegenerated, mesh) { this.xmin = xmin; this.zmin = zmin; this.xmax = xmax; this.zmax = zmax; this.subdivisions = subdivisions; this.precision = precision; _super.call(this, id, scene, this._regenerateVertexData(), canBeRegenerated, mesh); } TiledGround.prototype._regenerateVertexData = function () { return BABYLON.VertexData.CreateTiledGround(this.xmin, this.zmin, this.xmax, this.zmax, this.subdivisions, this.precision); }; TiledGround.prototype.copy = function (id) { return new TiledGround(id, this.getScene(), this.xmin, this.zmin, this.xmax, this.zmax, this.subdivisions, this.precision, this.canBeRegenerated(), null); }; return TiledGround; })(_Primitive); Primitives.TiledGround = TiledGround; var Plane = (function (_super) { __extends(Plane, _super); function Plane(id, scene, size, canBeRegenerated, mesh) { this.size = size; _super.call(this, id, scene, this._regenerateVertexData(), canBeRegenerated, mesh); } Plane.prototype._regenerateVertexData = function () { return BABYLON.VertexData.CreatePlane(this.size); }; Plane.prototype.copy = function (id) { return new Plane(id, this.getScene(), this.size, this.canBeRegenerated(), null); }; return Plane; })(_Primitive); Primitives.Plane = Plane; var TorusKnot = (function (_super) { __extends(TorusKnot, _super); function TorusKnot(id, scene, radius, tube, radialSegments, tubularSegments, p, q, canBeRegenerated, mesh) { this.radius = radius; this.tube = tube; this.radialSegments = radialSegments; this.tubularSegments = tubularSegments; this.p = p; this.q = q; _super.call(this, id, scene, this._regenerateVertexData(), canBeRegenerated, mesh); } TorusKnot.prototype._regenerateVertexData = function () { return BABYLON.VertexData.CreateTorusKnot(this.radius, this.tube, this.radialSegments, this.tubularSegments, this.p, this.q); }; TorusKnot.prototype.copy = function (id) { return new TorusKnot(id, this.getScene(), this.radius, this.tube, this.radialSegments, this.tubularSegments, this.p, this.q, this.canBeRegenerated(), null); }; return TorusKnot; })(_Primitive); Primitives.TorusKnot = TorusKnot; })(Geometry.Primitives || (Geometry.Primitives = {})); var Primitives = Geometry.Primitives; })(BABYLON.Geometry || (BABYLON.Geometry = {})); var Geometry = BABYLON.Geometry; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.geometry.js.map var BABYLON; (function (BABYLON) { var Gamepads = (function () { function Gamepads(ongamedpadconnected) { var _this = this; this.babylonGamepads = []; this.oneGamepadConnected = false; this.isMonitoring = false; this.gamepadEventSupported = 'GamepadEvent' in window; this.gamepadSupportAvailable = (navigator.getGamepads || !!navigator.webkitGetGamepads || !!navigator.msGetGamepads || !!navigator.webkitGamepads); this.buttonADataURL = "data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAEAAAABACAYAAACqaXHeAAAABGdBTUEAAK/INwWK6QAAABl0RVh0U29mdHdhcmUAQWRvYmUgSW1hZ2VSZWFkeXHJZTwAAA9aSURBVHja7FtpbBzneX7m3otcihSpm9Z9UJalxPKhVLZlp6ktNzEaxE0CtAnQAgnSoPWPBi3syuiPwordFi5Qt2haFygCoylSV4Vby6os1I3kOLYrS65kXXQoypJJSaFEUTyXy925+rzfzC6HFFlL1kpAIe7i5czO7H7zPs97ft8MtTAMcSu/dNzirxkCZgiYIWCGgBkCZgi4hV/mDR5fSxAt+0ZiX0ucDxMSTJLK+f83BFSA6TFgK75OclshouKBFbA+xaV4k7Z+fD6sNRlmjYFXQMu4NiUVS/oHe5/ecnHo3MYxd7QthN9UcsdW6FqEPwgDOFbqpAajL2VlTrTULzj4Ow8+s4+nipSxWMoxIUkyrl/pGswFtIR7WzHgDCX77K7vfHNkbOA+AryjYZadb27OIJdzCNZBKmXw4kbk35qPsTEfJbeEkZESentHMdBfGtY142gu1bDvqV/925f4tQJlNCaj4hXX7RHXS0AFuJEAXvfHr/zmk67vPjir0V68aFEe8xtuQ6O1FHlrEXLmHBiaDUtzYBlpNYjrF+GFZfhhCcPeBQy53ehzT+H8QBe6uwfRf7l8xjKsvX/y5X98jl8fThDhJ4i46QQkrS5I6v7oX7/++77vPtLUlFnZtnIRlubvxRxnHbJmE79sxD/SqG0oZk8MFarRqufUkQAFrxcXSkfx0eB+nOggKX2jHYZhvf79r/z4L2IiipO84aYRkASfefnAX695p3P3c9mM/UufuaMVdzRvxVx7A0xaWdOMqVULJ6Z3TZv6KmHo0ztK6CkfxpHe3Th0pAuF0fLbn1u+9cmv3vW77bE3fGoSPi0BVfAvvPEHm9rPv//iooWz5m9Z/wCWZx+Go9UrN48QTD9IGMZ1cJIzTPisRQclPMrhME4W9mDfB2+i+2z/+TXz7/z2E7/85+9OIuGGE6BV3H77zm/d33nx6Ktr18zFg2t+DQude2n1tLJ8tcJ90vDhpG5Am7qTkJAQErywiLOld7G3/d9xvL0Hy1vWPbbtS3//00Q4hDeaAFXintrx1fu7+jp2r13bgofX/gaazbVkJQdLT9P6VqRFDSu2hIgXlBUBLgtCr3cce47/CMePX0Rr08qtzz7+8k8TpfKGtcKq1jPZre7oObyjdWkGd628l7AXwvMCeL7HjO6qrS8S1E5kTE9tfbiur665ccU9EB1EF9Ep0WXesEZIJb9j5/b/XUtzNrt29Rw0og2lchmBVqLo8LSAHlCixbTpddGm8Y7pjkttCCUP+JQy3FiatNuxdvUx9F4ayopO/OL9sQeEN4oA/eHn577oWPbGVes11PsrUBxjDafze1Te1VzouqnK2TgmLQljQqmrnAsT+iaPVb5b2co7EC+QhBgUeM1R1AcrsGp9Jy6+4W8U3fZ8r+e3EnOI2uaAX3l+zgNB4O9rW5/B8tY5WGo9BtOrJ4uMfUl+uj0B8HTmPXj8Pex86xVEnTDBBSE2r78fX9i09RPyZfT2A5ceIMSPwDOH8JH7Kk5+fAHtR0Zh6MZ9e7534Wc3wgO0sXLhD9OpFOa0egjGMhguD8BgTJooMfPbV1h/umz25ondcFP90IzY2iTgrfY9uH31aqSc9CeSEHkBEyITv28M8XMGc2/z0HGCpWCs8BS/9sWrDYOrJuCBZ+vu5sUfXbicia5kYGzUw4DWTwJKbApSjHuTBBjT2H68zg0MD4KlEwabZi0Y7wd85u/3O9/B6sVrPlEXeiF9nMmRxPt6Qf4y/HyIbh3HwkdF1zefGt5fUwK8wP2WAGwh02MFE/5ogYr3Qg/STL0W3d8aB1ppa+Pw0uI2Tz6/134Mg+UoIGZlZ2HMLaJYHkPICr6//RBamvPj/UA4dYKsegGrXqAXMaqNsDT6SreOY5Gu/FptCeBFN+caAphGiKFiGaOjA3AJHoGt6r7GgNbjqjo5yQkBUVHQ8PaJExjiaZ2yue12nO27gCNdHSptvf/xGdw11I2UZSmvCIJgQiJMhoEfeqpNDvUSRvUB5hMX9fUecg0aBi+Hm2uaAz633bmbm1VN8+h07LfKJdkOkQB2fL4BTlsj8No4YLG2putMSjwjp3QNvZdH8YsiExV501isFjU30lpF7D8dVfCA8sFHp7BuWYtaIwiCsCrCSDVhh9IX8k0CoHsoMQ84FrfFAE3zQAK0VaLzO9tK79XKAxSj+aYALt3XLfNipZD1v492YexrE/sP0zBgUIQIoYaflAXbz16CzyY6YKqYl8uheTarRioD7xAxCQHUpv18L1Yud+Iloujtk4zQo9WZcKURqjbHclzKvj0Gvcw8UA6oY2WqonSuGQGb5I+TJgEFEsB4daXzc0eopabcX13W0BXwgAnRZL4Q62s8ppnR/pFz/QjF+tRvxeIsY/cizGwRt83P4czACL8HdA1JUivCNGVogvdkNkgaGDNe4CvXFyJ8n+B5XGLJ1FmJXJ53AzjZKgGbatkKL5c/liNWIPO8uM/4VO2uKCQZjLmBqQAGJ4EmI8NMabDTOuyUobYXmPlCEpiqA1IkYdWSBpjpEDl6wsrF9aAjqHNOPXDyXAGprAknY5B0btOGGk/GlfE1taqofCNuuYNIJ+omOiZ1rpUHtEYWjkpWoP5EWV2sb5isA7aIQTHHxaIniNADui8PIs0Eb6SY/Z0UQc+j+mXYuoM7Vy/Age7zkBUyCZGLhRLSOYcWpfXFA1wPhqup8JNKq5UkKeoqSHxPLSoqnUQtw5ioc60IyE/VkOji8mYE2nZELNgCXLaOkGDFJBg4OzCMDEcxCfAzS1pQX5fHSNDLClLGwmwzls6vQ09hGFJYegdZ1hha2bqIBNelB5Qjog02TzpFNVEquYpMuTSYr/lcQPKPJHoRQ8W1GYO3lDgpO9pPWTEZEQGnuodg5Hyk66Lyd8fKOQQ6gqyWict7GeuWz8HQyWEFw+bB7ksF3Nk2V1nfpZTLQqSLslzXlDmHpsQ1osVoy/Solwf/GpdErpaAQUqjWxL2GWcWaSfAMIis7RBwiuCdtD1OgmNHBJCg7r4uZBnbdjaaq+3YewB+USYicY8juYPnMtloqdCjG3f39eO+3JKIAFadSiiZigBdgdcqItMxsmZbIbvUIKlzzQjoEgLGRjU2KTp8AjRCkzEnAG0mtQh8Ku0oAqok8JzP+Lw0MkB3jpKjKpapaL5WKZxafDdBqoC6O8LtyMAQhoZdzG7MwLU8FUYKPINcl+qimismRj26v2I71I3jDxfdpM41I6CTsmG4X0djKyc8RYu9t0Vl2QJbBJ5xFPiICJIg1hdhR3fs5HnWeldleZXABLA98b7Y5HtjkgwNEtbTN4iFC5oI3I1CTsAbsfVjAizJB3Qbx9HphRp6eqr3TDprSYA0FI/3ntOxbpUNM2OjpEcE6HYEWkhIKw+ICeBxi+T09F1WZU+iJq2n8fRDf4Ymu3XSrcOIgg8H9uOFn31fNUVC0oddZ7B5YxtDwlTgo66SEici2fokwCJjju0hw7J54WypQsB7tSRAza+H+nld30Y+m2b7SS+Qn9PKFl1egRciHIfWpxC8x+7tdA97+3zUcNyWX4Ci/THOoD2x/hmlQTox+3gDjWYeg/4gmF853xjBpUsjaGnJR24fu36FNzX5pmfY7EPStlSLIgb6gwk616QRYk8tS88/l/2PT/loyqbQkEmhPpNGNp1CmvtieQHvONGtL4sdy9Hjp5kkpTWmSzM7L529hErHs0cCpt2qW00BymDV3JXSU8HkAXKIjtNnedxS48m4Mr5cR9YlMrx+XTqNRmbP2ZkMOjvHKir/PNa5pouiitFjH44iZ6YwO5tFAy+eo6SdpOUJyhBQTJR+HT9HYLJaFve0PqQmTQLaVOCdmIRIWE+wrmWTzG8iAugF7qgWjSWkGbYa32EjJQTkGFv5dBZNJKCeHdb77UPXZP1rWhKLZ4Rqjv2Fz86lLMNlpusCY9BnqTNUIyTgrVhhs7rVq2KoW2TSxWlXLOCqWX4svmpzZdEjWvgQcdVWPnu+i4ClUS+HyLIFnsVf/9eBduw8eKYy2D1XMxO8Jg+IB9wl+3s/uAC3qKMpXY88m/ecnUHaSis3Na8Ab1UtaCh3j1y+sm8m9o0J+9Fv9MR4Zhw6DufTWasOebsOs+xZKHJOtvtQtertulrwV+0BtH5yWvyW7CxubsCTX9+KUQZ4ga7qmdGUFmrya8QWHwcxlReMF8Mw4QETrR8oy7tq2ivH5Tvya8n8aXZMGc4An/nRDpy52FfR8b5KCJCImt8YkYF/KDtnegfwz3sPodGajQajCTk9z/4mQ6iphMWv9AA9IeMWdyYdn+gBkVc5amwHWV6lHvVaI2YZzfinN95Ngv/htcT/p31CRNbdV8l8e++xD5HPNeHxhx5Bgf18kTN5T1kvjBfEjGjBJCai4gnjHqAnlvqS8e9NeujEjEul/NokDbai4V/2voafHD1S0evdWLeb8ojMNyly5fS//ffbcD0L33j4K4RX4rtMh/UUGLXmr6BWXN9MEFAhYfzmZ6hcXI+TpISRH8061Ui68gTWGUJP4aU9P8ZrB39S+Xkx1ummPSMkbebnJcxU1jm4D5eGhvB7j32HJcpUJHhxLIfxTZpxwGa8eKrHC51a9Tmp+N5P1RsQ01cJAwEflHw8/+pfYn/HgaQ+n7/a1vd6k+BUS2XvVD401TXhu488gQ0r71QUuLJsrWT8mSYtfkBMm0BAmFhNrgDX4oRqqeaJMw4c6TyIv/qPP0Xf8KUJ6sXuP1XluuEEyGsD5TXKgsqBNQvW4RtbnkDb4ttJQlGt/IQqLMJE7tWqOSBZCSrL6dFSqq3AnzhzDC/tewHt5w4nr3suvgN0+P8o3TeegFe3vYDHtj+xhLt/Q3kkeW5d693YuuHXsWHZPcixW4tCwo+trVU9QEs8G6HFqW5kdBiHTu3H64dfxpGuK8r665Tv7tz2D6e/tP23cT0E1OA5QR2iiIbs1i9u/9qTPPC12CtwlIofjZVvW/BZ3LVsC5bPW4u5DQuxaPay2NpRIuy61IkLA+dw8hdHceDUPpw49z9TXUysvWPXtl3bQ4yQtMJ1a18DAsbvRO/atvM5DXXPPbp9yzP8+GXBXTkngKYBdTWvE5RXdm87+HQEfLh2T57UIAdM95Js9+04LKSDbLzG31+Omxpx9xfxKR6AukkhMP0aKuUHsag5VEzE3fGSddsUVu6KFzIE+H/iJry0mX+bu8VfMwTMEDBDwAwBMwTMEHALv/5XgAEASpR5N6rB30UAAAAASUVORK5CYII="; this._callbackGamepadConnected = ongamedpadconnected; if (this.gamepadSupportAvailable) { // Checking if the gamepad connected event is supported (like in Firefox) if (this.gamepadEventSupported) { window.addEventListener('gamepadconnected', function (evt) { _this._onGamepadConnected(evt); }, false); window.addEventListener('gamepaddisconnected', function (evt) { _this._onGamepadDisconnected(evt); }, false); } else { this._startMonitoringGamepads(); } if (!this.oneGamepadConnected) { this._insertGamepadDOMInstructions(); } } else { this._insertGamepadDOMNotSupported(); } } Gamepads.prototype._insertGamepadDOMInstructions = function () { Gamepads.gamepadDOMInfo = document.createElement("div"); var buttonAImage = document.createElement("img"); buttonAImage.src = this.buttonADataURL; var spanMessage = document.createElement("span"); spanMessage.innerHTML = "to activate gamepad"; Gamepads.gamepadDOMInfo.appendChild(buttonAImage); Gamepads.gamepadDOMInfo.appendChild(spanMessage); Gamepads.gamepadDOMInfo.style.position = "absolute"; Gamepads.gamepadDOMInfo.style.width = "100%"; Gamepads.gamepadDOMInfo.style.height = "48px"; Gamepads.gamepadDOMInfo.style.bottom = "0px"; Gamepads.gamepadDOMInfo.style.backgroundColor = "rgba(1, 1, 1, 0.15)"; Gamepads.gamepadDOMInfo.style.textAlign = "center"; Gamepads.gamepadDOMInfo.style.zIndex = "10"; buttonAImage.style.position = "relative"; buttonAImage.style.bottom = "8px"; spanMessage.style.position = "relative"; spanMessage.style.fontSize = "32px"; spanMessage.style.bottom = "32px"; spanMessage.style.color = "green"; document.body.appendChild(Gamepads.gamepadDOMInfo); }; Gamepads.prototype._insertGamepadDOMNotSupported = function () { Gamepads.gamepadDOMInfo = document.createElement("div"); var spanMessage = document.createElement("span"); spanMessage.innerHTML = "gamepad not supported"; Gamepads.gamepadDOMInfo.appendChild(spanMessage); Gamepads.gamepadDOMInfo.style.position = "absolute"; Gamepads.gamepadDOMInfo.style.width = "100%"; Gamepads.gamepadDOMInfo.style.height = "40px"; Gamepads.gamepadDOMInfo.style.bottom = "0px"; Gamepads.gamepadDOMInfo.style.backgroundColor = "rgba(1, 1, 1, 0.15)"; Gamepads.gamepadDOMInfo.style.textAlign = "center"; Gamepads.gamepadDOMInfo.style.zIndex = "10"; spanMessage.style.position = "relative"; spanMessage.style.fontSize = "32px"; spanMessage.style.color = "red"; document.body.appendChild(Gamepads.gamepadDOMInfo); }; Gamepads.prototype.dispose = function () { document.body.removeChild(Gamepads.gamepadDOMInfo); }; Gamepads.prototype._onGamepadConnected = function (evt) { var newGamepad = this._addNewGamepad(evt.gamepad); if (this._callbackGamepadConnected) this._callbackGamepadConnected(newGamepad); this._startMonitoringGamepads(); }; Gamepads.prototype._addNewGamepad = function (gamepad) { if (!this.oneGamepadConnected) { this.oneGamepadConnected = true; if (Gamepads.gamepadDOMInfo) { document.body.removeChild(Gamepads.gamepadDOMInfo); Gamepads.gamepadDOMInfo = null; } } var newGamepad; if (gamepad.id.search("Xbox 360") !== -1 || gamepad.id.search("xinput") !== -1) { newGamepad = new BABYLON.Xbox360Pad(gamepad.id, gamepad.index, gamepad); } else { newGamepad = new BABYLON.GenericPad(gamepad.id, gamepad.index, gamepad); } this.babylonGamepads.push(newGamepad); return newGamepad; }; Gamepads.prototype._onGamepadDisconnected = function (evt) { for (var i in this.babylonGamepads) { if (this.babylonGamepads[i].index == evt.gamepad.index) { this.babylonGamepads.splice(i, 1); break; } } // If no gamepads are left, stop the polling loop. if (this.babylonGamepads.length == 0) { this._stopMonitoringGamepads(); } }; Gamepads.prototype._startMonitoringGamepads = function () { if (!this.isMonitoring) { this.isMonitoring = true; this._checkGamepadsStatus(); } }; Gamepads.prototype._stopMonitoringGamepads = function () { this.isMonitoring = false; }; Gamepads.prototype._checkGamepadsStatus = function () { var _this = this; // updating gamepad objects this._updateGamepadObjects(); for (var i in this.babylonGamepads) { this.babylonGamepads[i].update(); } if (this.isMonitoring) { if (window.requestAnimationFrame) { window.requestAnimationFrame(function () { _this._checkGamepadsStatus(); }); } else if (window.mozRequestAnimationFrame) { window.mozRequestAnimationFrame(function () { _this._checkGamepadsStatus(); }); } else if (window.webkitRequestAnimationFrame) { window.webkitRequestAnimationFrame(function () { _this._checkGamepadsStatus(); }); } } }; // This function is called only on Chrome, which does not yet support // connection/disconnection events, but requires you to monitor // an array for changes. Gamepads.prototype._updateGamepadObjects = function () { var gamepads = navigator.getGamepads ? navigator.getGamepads() : (navigator.webkitGetGamepads ? navigator.webkitGetGamepads() : []); for (var i = 0; i < gamepads.length; i++) { if (gamepads[i]) { if (!(gamepads[i].index in this.babylonGamepads)) { var newGamepad = this._addNewGamepad(gamepads[i]); if (this._callbackGamepadConnected) { this._callbackGamepadConnected(newGamepad); } } else { this.babylonGamepads[i].browserGamepad = gamepads[i]; } } } }; return Gamepads; })(); BABYLON.Gamepads = Gamepads; var StickValues = (function () { function StickValues(x, y) { this.x = x; this.y = y; } return StickValues; })(); BABYLON.StickValues = StickValues; var Gamepad = (function () { function Gamepad(id, index, browserGamepad) { this.id = id; this.index = index; this.browserGamepad = browserGamepad; if (this.browserGamepad.axes.length >= 2) { this._leftStick = { x: this.browserGamepad.axes[0], y: this.browserGamepad.axes[1] }; } if (this.browserGamepad.axes.length >= 4) { this._rightStick = { x: this.browserGamepad.axes[2], y: this.browserGamepad.axes[3] }; } } Gamepad.prototype.onleftstickchanged = function (callback) { this._onleftstickchanged = callback; }; Gamepad.prototype.onrightstickchanged = function (callback) { this._onrightstickchanged = callback; }; Object.defineProperty(Gamepad.prototype, "leftStick", { get: function () { return this._leftStick; }, set: function (newValues) { if (this._onleftstickchanged && (this._leftStick.x !== newValues.x || this._leftStick.y !== newValues.y)) { this._onleftstickchanged(newValues); } this._leftStick = newValues; }, enumerable: true, configurable: true }); Object.defineProperty(Gamepad.prototype, "rightStick", { get: function () { return this._rightStick; }, set: function (newValues) { if (this._onrightstickchanged && (this._rightStick.x !== newValues.x || this._rightStick.y !== newValues.y)) { this._onrightstickchanged(newValues); } this._rightStick = newValues; }, enumerable: true, configurable: true }); Gamepad.prototype.update = function () { if (this._leftStick) { this.leftStick = { x: this.browserGamepad.axes[0], y: this.browserGamepad.axes[1] }; } if (this._rightStick) { this.rightStick = { x: this.browserGamepad.axes[2], y: this.browserGamepad.axes[3] }; } }; return Gamepad; })(); BABYLON.Gamepad = Gamepad; var GenericPad = (function (_super) { __extends(GenericPad, _super); function GenericPad(id, index, gamepad) { _super.call(this, id, index, gamepad); this.id = id; this.index = index; this.gamepad = gamepad; this._buttons = new Array(gamepad.buttons.length); } GenericPad.prototype.onbuttondown = function (callback) { this._onbuttondown = callback; }; GenericPad.prototype.onbuttonup = function (callback) { this._onbuttonup = callback; }; GenericPad.prototype._setButtonValue = function (newValue, currentValue, buttonIndex) { if (newValue !== currentValue) { if (this._onbuttondown && newValue === 1) { this._onbuttondown(buttonIndex); } if (this._onbuttonup && newValue === 0) { this._onbuttonup(buttonIndex); } } return newValue; }; GenericPad.prototype.update = function () { _super.prototype.update.call(this); for (var index = 0; index < this._buttons.length; index++) { this._buttons[index] = this._setButtonValue(this.gamepad.buttons[index].value, this._buttons[index], index); } }; return GenericPad; })(Gamepad); BABYLON.GenericPad = GenericPad; (function (Xbox360Button) { Xbox360Button[Xbox360Button["A"] = 0] = "A"; Xbox360Button[Xbox360Button["B"] = 1] = "B"; Xbox360Button[Xbox360Button["X"] = 2] = "X"; Xbox360Button[Xbox360Button["Y"] = 3] = "Y"; Xbox360Button[Xbox360Button["Start"] = 4] = "Start"; Xbox360Button[Xbox360Button["Back"] = 5] = "Back"; Xbox360Button[Xbox360Button["LB"] = 6] = "LB"; Xbox360Button[Xbox360Button["RB"] = 7] = "RB"; Xbox360Button[Xbox360Button["LeftStick"] = 8] = "LeftStick"; Xbox360Button[Xbox360Button["RightStick"] = 9] = "RightStick"; })(BABYLON.Xbox360Button || (BABYLON.Xbox360Button = {})); var Xbox360Button = BABYLON.Xbox360Button; (function (Xbox360Dpad) { Xbox360Dpad[Xbox360Dpad["Up"] = 0] = "Up"; Xbox360Dpad[Xbox360Dpad["Down"] = 1] = "Down"; Xbox360Dpad[Xbox360Dpad["Left"] = 2] = "Left"; Xbox360Dpad[Xbox360Dpad["Right"] = 3] = "Right"; })(BABYLON.Xbox360Dpad || (BABYLON.Xbox360Dpad = {})); var Xbox360Dpad = BABYLON.Xbox360Dpad; var Xbox360Pad = (function (_super) { __extends(Xbox360Pad, _super); function Xbox360Pad() { _super.apply(this, arguments); this._leftTrigger = 0; this._rightTrigger = 0; this._buttonA = 0; this._buttonB = 0; this._buttonX = 0; this._buttonY = 0; this._buttonBack = 0; this._buttonStart = 0; this._buttonLB = 0; this._buttonRB = 0; this._buttonLeftStick = 0; this._buttonRightStick = 0; this._dPadUp = 0; this._dPadDown = 0; this._dPadLeft = 0; this._dPadRight = 0; } Xbox360Pad.prototype.onlefttriggerchanged = function (callback) { this._onlefttriggerchanged = callback; }; Xbox360Pad.prototype.onrighttriggerchanged = function (callback) { this._onrighttriggerchanged = callback; }; Object.defineProperty(Xbox360Pad.prototype, "leftTrigger", { get: function () { return this._leftTrigger; }, set: function (newValue) { if (this._onlefttriggerchanged && this._leftTrigger !== newValue) { this._onlefttriggerchanged(newValue); } this._leftTrigger = newValue; }, enumerable: true, configurable: true }); Object.defineProperty(Xbox360Pad.prototype, "rightTrigger", { get: function () { return this._rightTrigger; }, set: function (newValue) { if (this._onrighttriggerchanged && this._rightTrigger !== newValue) { this._onrighttriggerchanged(newValue); } this._rightTrigger = newValue; }, enumerable: true, configurable: true }); Xbox360Pad.prototype.onbuttondown = function (callback) { this._onbuttondown = callback; }; Xbox360Pad.prototype.onbuttonup = function (callback) { this._onbuttonup = callback; }; Xbox360Pad.prototype.ondpaddown = function (callback) { this._ondpaddown = callback; }; Xbox360Pad.prototype.ondpadup = function (callback) { this._ondpadup = callback; }; Xbox360Pad.prototype._setButtonValue = function (newValue, currentValue, buttonType) { if (newValue !== currentValue) { if (this._onbuttondown && newValue === 1) { this._onbuttondown(buttonType); } if (this._onbuttonup && newValue === 0) { this._onbuttonup(buttonType); } } return newValue; }; Xbox360Pad.prototype._setDPadValue = function (newValue, currentValue, buttonType) { if (newValue !== currentValue) { if (this._ondpaddown && newValue === 1) { this._ondpaddown(buttonType); } if (this._ondpadup && newValue === 0) { this._ondpadup(buttonType); } } return newValue; }; Object.defineProperty(Xbox360Pad.prototype, "buttonA", { get: function () { return this._buttonA; }, set: function (value) { this._buttonA = this._setButtonValue(value, this._buttonA, 0 /* A */); }, enumerable: true, configurable: true }); Object.defineProperty(Xbox360Pad.prototype, "buttonB", { get: function () { return this._buttonB; }, set: function (value) { this._buttonB = this._setButtonValue(value, this._buttonB, 1 /* B */); }, enumerable: true, configurable: true }); Object.defineProperty(Xbox360Pad.prototype, "buttonX", { get: function () { return this._buttonX; }, set: function (value) { this._buttonX = this._setButtonValue(value, this._buttonX, 2 /* X */); }, enumerable: true, configurable: true }); Object.defineProperty(Xbox360Pad.prototype, "buttonY", { get: function () { return this._buttonY; }, set: function (value) { this._buttonY = this._setButtonValue(value, this._buttonY, 3 /* Y */); }, enumerable: true, configurable: true }); Object.defineProperty(Xbox360Pad.prototype, "buttonStart", { get: function () { return this._buttonStart; }, set: function (value) { this._buttonStart = this._setButtonValue(value, this._buttonStart, 4 /* Start */); }, enumerable: true, configurable: true }); Object.defineProperty(Xbox360Pad.prototype, "buttonBack", { get: function () { return this._buttonBack; }, set: function (value) { this._buttonBack = this._setButtonValue(value, this._buttonBack, 5 /* Back */); }, enumerable: true, configurable: true }); Object.defineProperty(Xbox360Pad.prototype, "buttonLB", { get: function () { return this._buttonLB; }, set: function (value) { this._buttonLB = this._setButtonValue(value, this._buttonLB, 6 /* LB */); }, enumerable: true, configurable: true }); Object.defineProperty(Xbox360Pad.prototype, "buttonRB", { get: function () { return this._buttonRB; }, set: function (value) { this._buttonRB = this._setButtonValue(value, this._buttonRB, 7 /* RB */); }, enumerable: true, configurable: true }); Object.defineProperty(Xbox360Pad.prototype, "buttonLeftStick", { get: function () { return this._buttonLeftStick; }, set: function (value) { this._buttonLeftStick = this._setButtonValue(value, this._buttonLeftStick, 8 /* LeftStick */); }, enumerable: true, configurable: true }); Object.defineProperty(Xbox360Pad.prototype, "buttonRightStick", { get: function () { return this._buttonRightStick; }, set: function (value) { this._buttonRightStick = this._setButtonValue(value, this._buttonRightStick, 9 /* RightStick */); }, enumerable: true, configurable: true }); Object.defineProperty(Xbox360Pad.prototype, "dPadUp", { get: function () { return this._dPadUp; }, set: function (value) { this._dPadUp = this._setDPadValue(value, this._dPadUp, 0 /* Up */); }, enumerable: true, configurable: true }); Object.defineProperty(Xbox360Pad.prototype, "dPadDown", { get: function () { return this._dPadDown; }, set: function (value) { this._dPadDown = this._setDPadValue(value, this._dPadDown, 1 /* Down */); }, enumerable: true, configurable: true }); Object.defineProperty(Xbox360Pad.prototype, "dPadLeft", { get: function () { return this._dPadLeft; }, set: function (value) { this._dPadLeft = this._setDPadValue(value, this._dPadLeft, 2 /* Left */); }, enumerable: true, configurable: true }); Object.defineProperty(Xbox360Pad.prototype, "dPadRight", { get: function () { return this._dPadRight; }, set: function (value) { this._dPadRight = this._setDPadValue(value, this._dPadRight, 3 /* Right */); }, enumerable: true, configurable: true }); Xbox360Pad.prototype.update = function () { _super.prototype.update.call(this); this.buttonA = this.browserGamepad.buttons[0].value; this.buttonB = this.browserGamepad.buttons[1].value; this.buttonX = this.browserGamepad.buttons[2].value; this.buttonY = this.browserGamepad.buttons[3].value; this.buttonLB = this.browserGamepad.buttons[4].value; this.buttonRB = this.browserGamepad.buttons[5].value; this.leftTrigger = this.browserGamepad.buttons[6].value; this.rightTrigger = this.browserGamepad.buttons[7].value; this.buttonBack = this.browserGamepad.buttons[8].value; this.buttonStart = this.browserGamepad.buttons[9].value; this.buttonLeftStick = this.browserGamepad.buttons[10].value; this.buttonRightStick = this.browserGamepad.buttons[11].value; this.dPadUp = this.browserGamepad.buttons[12].value; this.dPadDown = this.browserGamepad.buttons[13].value; this.dPadLeft = this.browserGamepad.buttons[14].value; this.dPadRight = this.browserGamepad.buttons[15].value; }; return Xbox360Pad; })(Gamepad); BABYLON.Xbox360Pad = Xbox360Pad; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.gamepads.js.map var BABYLON; (function (BABYLON) { // We're mainly based on the logic defined into the FreeCamera code var GamepadCamera = (function (_super) { __extends(GamepadCamera, _super); function GamepadCamera(name, position, scene) { var _this = this; _super.call(this, name, position, scene); this.angularSensibility = 200; this.moveSensibility = 75; this._gamepads = new BABYLON.Gamepads(function (gamepad) { _this._onNewGameConnected(gamepad); }); } GamepadCamera.prototype._onNewGameConnected = function (gamepad) { // Only the first gamepad can control the camera if (gamepad.index === 0) { this._gamepad = gamepad; } }; GamepadCamera.prototype._checkInputs = function () { if (!this._gamepad) { return; } var LSValues = this._gamepad.leftStick; var normalizedLX = LSValues.x / this.moveSensibility; var normalizedLY = LSValues.y / this.moveSensibility; LSValues.x = Math.abs(normalizedLX) > 0.005 ? 0 + normalizedLX : 0; LSValues.y = Math.abs(normalizedLY) > 0.005 ? 0 + normalizedLY : 0; var RSValues = this._gamepad.rightStick; var normalizedRX = RSValues.x / this.angularSensibility; var normalizedRY = RSValues.y / this.angularSensibility; RSValues.x = Math.abs(normalizedRX) > 0.001 ? 0 + normalizedRX : 0; RSValues.y = Math.abs(normalizedRY) > 0.001 ? 0 + normalizedRY : 0; ; var cameraTransform = BABYLON.Matrix.RotationYawPitchRoll(this.rotation.y, this.rotation.x, 0); var deltaTransform = BABYLON.Vector3.TransformCoordinates(new BABYLON.Vector3(LSValues.x, 0, -LSValues.y), cameraTransform); this.cameraDirection = this.cameraDirection.add(deltaTransform); this.cameraRotation = this.cameraRotation.add(new BABYLON.Vector2(RSValues.y, RSValues.x)); }; GamepadCamera.prototype.dispose = function () { this._gamepads.dispose(); _super.prototype.dispose.call(this); }; return GamepadCamera; })(BABYLON.FreeCamera); BABYLON.GamepadCamera = GamepadCamera; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.gamepadCamera.js.map var BABYLON; (function (BABYLON) { var LinesMesh = (function (_super) { __extends(LinesMesh, _super); function LinesMesh(name, scene, updatable) { if (typeof updatable === "undefined") { updatable = false; } _super.call(this, name, scene); this.color = new BABYLON.Color3(1, 1, 1); this.alpha = 1; this._indices = new Array(); this._colorShader = new BABYLON.ShaderMaterial("colorShader", scene, "color", { attributes: ["position"], uniforms: ["worldViewProjection", "color"], needAlphaBlending: true }); } Object.defineProperty(LinesMesh.prototype, "material", { get: function () { return this._colorShader; }, enumerable: true, configurable: true }); Object.defineProperty(LinesMesh.prototype, "isPickable", { get: function () { return false; }, enumerable: true, configurable: true }); Object.defineProperty(LinesMesh.prototype, "checkCollisions", { get: function () { return false; }, enumerable: true, configurable: true }); LinesMesh.prototype._bind = function (subMesh, effect, fillMode) { var engine = this.getScene().getEngine(); var indexToBind = this._geometry.getIndexBuffer(); // VBOs engine.bindBuffers(this._geometry.getVertexBuffer(BABYLON.VertexBuffer.PositionKind).getBuffer(), indexToBind, [3], 3 * 4, this._colorShader.getEffect()); // Color this._colorShader.setColor4("color", this.color.toColor4(this.alpha)); }; LinesMesh.prototype._draw = function (subMesh, fillMode, instancesCount) { if (!this._geometry || !this._geometry.getVertexBuffers() || !this._geometry.getIndexBuffer()) { return; } var engine = this.getScene().getEngine(); // Draw order engine.draw(false, subMesh.indexStart, subMesh.indexCount); }; LinesMesh.prototype.intersects = function (ray, fastCheck) { return null; }; LinesMesh.prototype.dispose = function (doNotRecurse) { this._colorShader.dispose(); _super.prototype.dispose.call(this, doNotRecurse); }; return LinesMesh; })(BABYLON.Mesh); BABYLON.LinesMesh = LinesMesh; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.linesMesh.js.map var BABYLON; (function (BABYLON) { var OutlineRenderer = (function () { function OutlineRenderer(scene) { this._scene = scene; } OutlineRenderer.prototype.render = function (subMesh, batch, useOverlay) { if (typeof useOverlay === "undefined") { useOverlay = false; } var scene = this._scene; var engine = this._scene.getEngine(); var hardwareInstancedRendering = (engine.getCaps().instancedArrays !== null) && (batch.visibleInstances[subMesh._id] !== null) && (batch.visibleInstances[subMesh._id] !== undefined); if (!this.isReady(subMesh, hardwareInstancedRendering)) { return; } var mesh = subMesh.getRenderingMesh(); var material = subMesh.getMaterial(); engine.enableEffect(this._effect); this._effect.setFloat("offset", useOverlay ? 0 : mesh.outlineWidth); this._effect.setColor4("color", useOverlay ? mesh.overlayColor : mesh.outlineColor, useOverlay ? mesh.overlayAlpha : 1.0); this._effect.setMatrix("viewProjection", scene.getTransformMatrix()); // Bones var useBones = mesh.skeleton && scene.skeletonsEnabled && mesh.isVerticesDataPresent(BABYLON.VertexBuffer.MatricesIndicesKind) && mesh.isVerticesDataPresent(BABYLON.VertexBuffer.MatricesWeightsKind); if (useBones) { this._effect.setMatrices("mBones", mesh.skeleton.getTransformMatrices()); } mesh._bind(subMesh, this._effect, BABYLON.Material.TriangleFillMode); // Alpha test if (material && material.needAlphaTesting()) { var alphaTexture = material.getAlphaTestTexture(); this._effect.setTexture("diffuseSampler", alphaTexture); this._effect.setMatrix("diffuseMatrix", alphaTexture.getTextureMatrix()); } if (hardwareInstancedRendering) { mesh._renderWithInstances(subMesh, BABYLON.Material.TriangleFillMode, batch, this._effect, engine); } else { if (batch.renderSelf[subMesh._id]) { this._effect.setMatrix("world", mesh.getWorldMatrix()); // Draw mesh._draw(subMesh, BABYLON.Material.TriangleFillMode); } if (batch.visibleInstances[subMesh._id]) { for (var instanceIndex = 0; instanceIndex < batch.visibleInstances[subMesh._id].length; instanceIndex++) { var instance = batch.visibleInstances[subMesh._id][instanceIndex]; this._effect.setMatrix("world", instance.getWorldMatrix()); // Draw mesh._draw(subMesh, BABYLON.Material.TriangleFillMode); } } } }; OutlineRenderer.prototype.isReady = function (subMesh, useInstances) { var defines = []; var attribs = [BABYLON.VertexBuffer.PositionKind, BABYLON.VertexBuffer.NormalKind]; var mesh = subMesh.getMesh(); var material = subMesh.getMaterial(); // Alpha test if (material && material.needAlphaTesting()) { defines.push("#define ALPHATEST"); if (mesh.isVerticesDataPresent(BABYLON.VertexBuffer.UVKind)) { attribs.push(BABYLON.VertexBuffer.UVKind); defines.push("#define UV1"); } if (mesh.isVerticesDataPresent(BABYLON.VertexBuffer.UV2Kind)) { attribs.push(BABYLON.VertexBuffer.UV2Kind); defines.push("#define UV2"); } } // Bones if (mesh.skeleton && mesh.isVerticesDataPresent(BABYLON.VertexBuffer.MatricesIndicesKind) && mesh.isVerticesDataPresent(BABYLON.VertexBuffer.MatricesWeightsKind)) { attribs.push(BABYLON.VertexBuffer.MatricesIndicesKind); attribs.push(BABYLON.VertexBuffer.MatricesWeightsKind); defines.push("#define BONES"); defines.push("#define BonesPerMesh " + (mesh.skeleton.bones.length + 1)); } // Instances if (useInstances) { defines.push("#define INSTANCES"); attribs.push("world0"); attribs.push("world1"); attribs.push("world2"); attribs.push("world3"); } // Get correct effect var join = defines.join("\n"); if (this._cachedDefines != join) { this._cachedDefines = join; this._effect = this._scene.getEngine().createEffect("outline", attribs, ["world", "mBones", "viewProjection", "diffuseMatrix", "offset", "color"], ["diffuseSampler"], join); } return this._effect.isReady(); }; return OutlineRenderer; })(); BABYLON.OutlineRenderer = OutlineRenderer; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.outlineRenderer.js.map var BABYLON; (function (BABYLON) { var MeshAssetTask = (function () { function MeshAssetTask(name, meshesNames, rootUrl, sceneFilename) { this.name = name; this.meshesNames = meshesNames; this.rootUrl = rootUrl; this.sceneFilename = sceneFilename; this.isCompleted = false; } MeshAssetTask.prototype.run = function (scene, onSuccess, onError) { var _this = this; BABYLON.SceneLoader.ImportMesh(this.meshesNames, this.rootUrl, this.sceneFilename, scene, function (meshes, particleSystems, skeletons) { _this.loadedMeshes = meshes; _this.loadedParticleSystems = particleSystems; _this.loadedSkeletons = skeletons; _this.isCompleted = true; if (_this.onSuccess) { _this.onSuccess(_this); } onSuccess(); }, null, function () { if (_this.onError) { _this.onError(_this); } onError(); }); }; return MeshAssetTask; })(); BABYLON.MeshAssetTask = MeshAssetTask; var TextFileAssetTask = (function () { function TextFileAssetTask(name, url) { this.name = name; this.url = url; this.isCompleted = false; } TextFileAssetTask.prototype.run = function (scene, onSuccess, onError) { var _this = this; BABYLON.Tools.LoadFile(this.url, function (data) { _this.text = data; _this.isCompleted = true; if (_this.onSuccess) { _this.onSuccess(_this); } onSuccess(); }, null, scene.database, false, function () { if (_this.onError) { _this.onError(_this); } onError(); }); }; return TextFileAssetTask; })(); BABYLON.TextFileAssetTask = TextFileAssetTask; var BinaryFileAssetTask = (function () { function BinaryFileAssetTask(name, url) { this.name = name; this.url = url; this.isCompleted = false; } BinaryFileAssetTask.prototype.run = function (scene, onSuccess, onError) { var _this = this; BABYLON.Tools.LoadFile(this.url, function (data) { _this.data = data; _this.isCompleted = true; if (_this.onSuccess) { _this.onSuccess(_this); } onSuccess(); }, null, scene.database, true, function () { if (_this.onError) { _this.onError(_this); } onError(); }); }; return BinaryFileAssetTask; })(); BABYLON.BinaryFileAssetTask = BinaryFileAssetTask; var ImageAssetTask = (function () { function ImageAssetTask(name, url) { this.name = name; this.url = url; this.isCompleted = false; } ImageAssetTask.prototype.run = function (scene, onSuccess, onError) { var _this = this; var img = new Image(); img.onload = function () { _this.image = img; _this.isCompleted = true; if (_this.onSuccess) { _this.onSuccess(_this); } onSuccess(); }; img.onerror = function () { if (_this.onError) { _this.onError(_this); } onError(); }; img.src = this.url; }; return ImageAssetTask; })(); BABYLON.ImageAssetTask = ImageAssetTask; var TextureAssetTask = (function () { function TextureAssetTask(name, url, noMipmap, invertY, samplingMode) { if (typeof samplingMode === "undefined") { samplingMode = BABYLON.Texture.TRILINEAR_SAMPLINGMODE; } this.name = name; this.url = url; this.noMipmap = noMipmap; this.invertY = invertY; this.samplingMode = samplingMode; this.isCompleted = false; } TextureAssetTask.prototype.run = function (scene, onSuccess, onError) { var _this = this; var onload = function () { _this.isCompleted = true; if (_this.onSuccess) { _this.onSuccess(_this); } onSuccess(); }; var onerror = function () { if (_this.onError) { _this.onError(_this); } onError(); }; this.texture = new BABYLON.Texture(this.url, scene, this.noMipmap, this.invertY, this.samplingMode, onload, onError); }; return TextureAssetTask; })(); BABYLON.TextureAssetTask = TextureAssetTask; var AssetsManager = (function () { function AssetsManager(scene) { this._tasks = new Array(); this._waitingTasksCount = 0; this.useDefaultLoadingScreen = true; this._scene = scene; } AssetsManager.prototype.addMeshTask = function (taskName, meshesNames, rootUrl, sceneFilename) { var task = new MeshAssetTask(taskName, meshesNames, rootUrl, sceneFilename); this._tasks.push(task); return task; }; AssetsManager.prototype.addTextFileTask = function (taskName, url) { var task = new TextFileAssetTask(taskName, url); this._tasks.push(task); return task; }; AssetsManager.prototype.addBinaryFileTask = function (taskName, url) { var task = new BinaryFileAssetTask(taskName, url); this._tasks.push(task); return task; }; AssetsManager.prototype.addImageTask = function (taskName, url) { var task = new ImageAssetTask(taskName, url); this._tasks.push(task); return task; }; AssetsManager.prototype.addTextureTask = function (taskName, url, noMipmap, invertY, samplingMode) { if (typeof samplingMode === "undefined") { samplingMode = BABYLON.Texture.TRILINEAR_SAMPLINGMODE; } var task = new TextureAssetTask(taskName, url, noMipmap, invertY, samplingMode); this._tasks.push(task); return task; }; AssetsManager.prototype._decreaseWaitingTasksCount = function () { this._waitingTasksCount--; if (this._waitingTasksCount === 0) { if (this.onFinish) { this.onFinish(this._tasks); } this._scene.getEngine().hideLoadingUI(); } }; AssetsManager.prototype._runTask = function (task) { var _this = this; task.run(this._scene, function () { if (_this.onTaskSuccess) { _this.onTaskSuccess(task); } _this._decreaseWaitingTasksCount(); }, function () { if (_this.onTaskError) { _this.onTaskError(task); } _this._decreaseWaitingTasksCount(); }); }; AssetsManager.prototype.reset = function () { this._tasks = new Array(); return this; }; AssetsManager.prototype.load = function () { this._waitingTasksCount = this._tasks.length; if (this._waitingTasksCount === 0) { if (this.onFinish) { this.onFinish(this._tasks); } return this; } if (this.useDefaultLoadingScreen) { this._scene.getEngine().displayLoadingUI(); } for (var index = 0; index < this._tasks.length; index++) { var task = this._tasks[index]; this._runTask(task); } return this; }; return AssetsManager; })(); BABYLON.AssetsManager = AssetsManager; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.assetsManager.js.map var BABYLON; (function (BABYLON) { var VRDeviceOrientationCamera = (function (_super) { __extends(VRDeviceOrientationCamera, _super); function VRDeviceOrientationCamera(name, position, scene) { _super.call(this, name, position, scene); this._alpha = 0; this._beta = 0; this._gamma = 0; } VRDeviceOrientationCamera.prototype._onOrientationEvent = function (evt) { this._alpha = +evt.alpha | 0; this._beta = +evt.beta | 0; this._gamma = +evt.gamma | 0; if (this._gamma < 0) { this._gamma = 90 + this._gamma; } else { // Incline it in the correct angle. this._gamma = 270 - this._gamma; } this.rotation.x = this._gamma / 180.0 * Math.PI; this.rotation.y = -this._alpha / 180.0 * Math.PI; this.rotation.z = this._beta / 180.0 * Math.PI; }; return VRDeviceOrientationCamera; })(BABYLON.OculusCamera); BABYLON.VRDeviceOrientationCamera = VRDeviceOrientationCamera; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.vrDeviceOrientationCamera.js.map var BABYLON; (function (BABYLON) { var WebVRCamera = (function (_super) { __extends(WebVRCamera, _super); function WebVRCamera(name, position, scene) { _super.call(this, name, position, scene); this._hmdDevice = null; this._sensorDevice = null; this._cacheState = null; this._cacheQuaternion = new BABYLON.Quaternion(); this._cacheRotation = BABYLON.Vector3.Zero(); this._vrEnabled = false; this._getWebVRDevices = this._getWebVRDevices.bind(this); } WebVRCamera.prototype._getWebVRDevices = function (devices) { var size = devices.length; var i = 0; // Reset devices. this._sensorDevice = null; this._hmdDevice = null; while (i < size && this._hmdDevice === null) { if (devices[i] instanceof HMDVRDevice) { this._hmdDevice = devices[i]; } i++; } i = 0; while (i < size && this._sensorDevice === null) { if (devices[i] instanceof PositionSensorVRDevice && (!this._hmdDevice || devices[i].hardwareUnitId === this._hmdDevice.hardwareUnitId)) { this._sensorDevice = devices[i]; } i++; } this._vrEnabled = this._sensorDevice && this._hmdDevice ? true : false; }; WebVRCamera.prototype._update = function () { if (this._vrEnabled) { this._cacheState = this._sensorDevice.getState(); this._cacheQuaternion.copyFromFloats(this._cacheState.orientation.x, this._cacheState.orientation.y, this._cacheState.orientation.z, this._cacheState.orientation.w); this._cacheQuaternion.toEulerAnglesToRef(this._cacheRotation); this.rotation.x = -this._cacheRotation.z; this.rotation.y = -this._cacheRotation.y; this.rotation.z = this._cacheRotation.x; } _super.prototype._update.call(this); }; WebVRCamera.prototype.attachControl = function (element, noPreventDefault) { _super.prototype.attachControl.call(this, element, noPreventDefault); if (navigator.getVRDevices) { navigator.getVRDevices().then(this._getWebVRDevices); } else if (navigator.mozGetVRDevices) { navigator.mozGetVRDevices(this._getWebVRDevices); } }; WebVRCamera.prototype.detachControl = function (element) { _super.prototype.detachControl.call(this, element); this._vrEnabled = false; }; return WebVRCamera; })(BABYLON.OculusCamera); BABYLON.WebVRCamera = WebVRCamera; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.webVRCamera.js.map var BABYLON; (function (BABYLON) { // Standard optimizations var SceneOptimization = (function () { function SceneOptimization(priority) { if (typeof priority === "undefined") { priority = 0; } this.priority = priority; this.apply = function (scene) { return true; }; } return SceneOptimization; })(); BABYLON.SceneOptimization = SceneOptimization; var TextureOptimization = (function (_super) { __extends(TextureOptimization, _super); function TextureOptimization(priority, maximumSize) { if (typeof priority === "undefined") { priority = 0; } if (typeof maximumSize === "undefined") { maximumSize = 1024; } var _this = this; _super.call(this, priority); this.priority = priority; this.maximumSize = maximumSize; this.apply = function (scene) { var allDone = true; for (var index = 0; index < scene.textures.length; index++) { var texture = scene.textures[index]; if (!texture.canRescale) { continue; } var currentSize = texture.getSize(); var maxDimension = Math.max(currentSize.width, currentSize.height); if (maxDimension > _this.maximumSize) { texture.scale(0.5); allDone = false; } } return allDone; }; } return TextureOptimization; })(SceneOptimization); BABYLON.TextureOptimization = TextureOptimization; var HardwareScalingOptimization = (function (_super) { __extends(HardwareScalingOptimization, _super); function HardwareScalingOptimization(priority, maximumScale) { if (typeof priority === "undefined") { priority = 0; } if (typeof maximumScale === "undefined") { maximumScale = 2; } var _this = this; _super.call(this, priority); this.priority = priority; this.maximumScale = maximumScale; this._currentScale = 1; this.apply = function (scene) { _this._currentScale++; scene.getEngine().setHardwareScalingLevel(_this._currentScale); return _this._currentScale >= _this.maximumScale; }; } return HardwareScalingOptimization; })(SceneOptimization); BABYLON.HardwareScalingOptimization = HardwareScalingOptimization; var ShadowsOptimization = (function (_super) { __extends(ShadowsOptimization, _super); function ShadowsOptimization() { _super.apply(this, arguments); this.apply = function (scene) { scene.shadowsEnabled = false; return true; }; } return ShadowsOptimization; })(SceneOptimization); BABYLON.ShadowsOptimization = ShadowsOptimization; var PostProcessesOptimization = (function (_super) { __extends(PostProcessesOptimization, _super); function PostProcessesOptimization() { _super.apply(this, arguments); this.apply = function (scene) { scene.postProcessesEnabled = false; return true; }; } return PostProcessesOptimization; })(SceneOptimization); BABYLON.PostProcessesOptimization = PostProcessesOptimization; var LensFlaresOptimization = (function (_super) { __extends(LensFlaresOptimization, _super); function LensFlaresOptimization() { _super.apply(this, arguments); this.apply = function (scene) { scene.lensFlaresEnabled = false; return true; }; } return LensFlaresOptimization; })(SceneOptimization); BABYLON.LensFlaresOptimization = LensFlaresOptimization; var ParticlesOptimization = (function (_super) { __extends(ParticlesOptimization, _super); function ParticlesOptimization() { _super.apply(this, arguments); this.apply = function (scene) { scene.particlesEnabled = false; return true; }; } return ParticlesOptimization; })(SceneOptimization); BABYLON.ParticlesOptimization = ParticlesOptimization; var RenderTargetsOptimization = (function (_super) { __extends(RenderTargetsOptimization, _super); function RenderTargetsOptimization() { _super.apply(this, arguments); this.apply = function (scene) { scene.renderTargetsEnabled = false; return true; }; } return RenderTargetsOptimization; })(SceneOptimization); BABYLON.RenderTargetsOptimization = RenderTargetsOptimization; var MergeMeshesOptimization = (function (_super) { __extends(MergeMeshesOptimization, _super); function MergeMeshesOptimization() { _super.apply(this, arguments); var _this = this; this._canBeMerged = function (abstractMesh) { if (!(abstractMesh instanceof BABYLON.Mesh)) { return false; } var mesh = abstractMesh; if (!mesh.isVisible || !mesh.isEnabled()) { return false; } if (mesh.instances.length > 0) { return false; } if (mesh.skeleton || mesh.hasLODLevels) { return false; } return true; }; this.apply = function (scene) { var globalPool = scene.meshes.slice(0); var globalLength = globalPool.length; for (var index = 0; index < globalLength; index++) { var currentPool = new Array(); var current = globalPool[index]; // Checks if (!_this._canBeMerged(current)) { continue; } currentPool.push(current); for (var subIndex = index + 1; subIndex < globalLength; subIndex++) { var otherMesh = globalPool[subIndex]; if (!_this._canBeMerged(otherMesh)) { continue; } if (otherMesh.material !== current.material) { continue; } if (otherMesh.checkCollisions !== current.checkCollisions) { continue; } currentPool.push(otherMesh); globalLength--; globalPool.splice(subIndex, 1); subIndex--; } if (currentPool.length < 2) { continue; } // Merge meshes BABYLON.Mesh.MergeMeshes(currentPool); } return true; }; } return MergeMeshesOptimization; })(SceneOptimization); BABYLON.MergeMeshesOptimization = MergeMeshesOptimization; // Options var SceneOptimizerOptions = (function () { function SceneOptimizerOptions(targetFrameRate, trackerDuration) { if (typeof targetFrameRate === "undefined") { targetFrameRate = 60; } if (typeof trackerDuration === "undefined") { trackerDuration = 2000; } this.targetFrameRate = targetFrameRate; this.trackerDuration = trackerDuration; this.optimizations = new Array(); } SceneOptimizerOptions.LowDegradationAllowed = function (targetFrameRate) { var result = new SceneOptimizerOptions(targetFrameRate); var priority = 0; result.optimizations.push(new MergeMeshesOptimization(priority)); result.optimizations.push(new ShadowsOptimization(priority)); result.optimizations.push(new LensFlaresOptimization(priority)); // Next priority priority++; result.optimizations.push(new PostProcessesOptimization(priority)); result.optimizations.push(new ParticlesOptimization(priority)); // Next priority priority++; result.optimizations.push(new TextureOptimization(priority, 1024)); return result; }; SceneOptimizerOptions.ModerateDegradationAllowed = function (targetFrameRate) { var result = new SceneOptimizerOptions(targetFrameRate); var priority = 0; result.optimizations.push(new MergeMeshesOptimization(priority)); result.optimizations.push(new ShadowsOptimization(priority)); result.optimizations.push(new LensFlaresOptimization(priority)); // Next priority priority++; result.optimizations.push(new PostProcessesOptimization(priority)); result.optimizations.push(new ParticlesOptimization(priority)); // Next priority priority++; result.optimizations.push(new TextureOptimization(priority, 512)); // Next priority priority++; result.optimizations.push(new RenderTargetsOptimization(priority)); // Next priority priority++; result.optimizations.push(new HardwareScalingOptimization(priority, 2)); return result; }; SceneOptimizerOptions.HighDegradationAllowed = function (targetFrameRate) { var result = new SceneOptimizerOptions(targetFrameRate); var priority = 0; result.optimizations.push(new MergeMeshesOptimization(priority)); result.optimizations.push(new ShadowsOptimization(priority)); result.optimizations.push(new LensFlaresOptimization(priority)); // Next priority priority++; result.optimizations.push(new PostProcessesOptimization(priority)); result.optimizations.push(new ParticlesOptimization(priority)); // Next priority priority++; result.optimizations.push(new TextureOptimization(priority, 256)); // Next priority priority++; result.optimizations.push(new RenderTargetsOptimization(priority)); // Next priority priority++; result.optimizations.push(new HardwareScalingOptimization(priority, 4)); return result; }; return SceneOptimizerOptions; })(); BABYLON.SceneOptimizerOptions = SceneOptimizerOptions; // Scene optimizer tool var SceneOptimizer = (function () { function SceneOptimizer() { } SceneOptimizer._CheckCurrentState = function (scene, options, currentPriorityLevel, onSuccess, onFailure) { // TODO: add an epsilon if (scene.getEngine().getFps() >= options.targetFrameRate) { if (onSuccess) { onSuccess(); } return; } // Apply current level of optimizations var allDone = true; var noOptimizationApplied = true; for (var index = 0; index < options.optimizations.length; index++) { var optimization = options.optimizations[index]; if (optimization.priority === currentPriorityLevel) { noOptimizationApplied = false; allDone = allDone && optimization.apply(scene); } } // If no optimization was applied, this is a failure :( if (noOptimizationApplied) { if (onFailure) { onFailure(); } return; } // If all optimizations were done, move to next level if (allDone) { currentPriorityLevel++; } // Let's the system running for a specific amount of time before checking FPS scene.executeWhenReady(function () { setTimeout(function () { SceneOptimizer._CheckCurrentState(scene, options, currentPriorityLevel, onSuccess, onFailure); }, options.trackerDuration); }); }; SceneOptimizer.OptimizeAsync = function (scene, options, onSuccess, onFailure) { if (!options) { options = SceneOptimizerOptions.ModerateDegradationAllowed(); } // Let's the system running for a specific amount of time before checking FPS scene.executeWhenReady(function () { setTimeout(function () { SceneOptimizer._CheckCurrentState(scene, options, 0, onSuccess, onFailure); }, options.trackerDuration); }); }; return SceneOptimizer; })(); BABYLON.SceneOptimizer = SceneOptimizer; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.sceneOptimizer.js.map var BABYLON; (function (BABYLON) { (function (Internals) { var MeshLODLevel = (function () { function MeshLODLevel(distance, mesh) { this.distance = distance; this.mesh = mesh; } return MeshLODLevel; })(); Internals.MeshLODLevel = MeshLODLevel; })(BABYLON.Internals || (BABYLON.Internals = {})); var Internals = BABYLON.Internals; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.meshLODLevel.js.map var BABYLON; (function (BABYLON) { var AudioEngine = (function () { function AudioEngine() { this.audioContext = null; this.canUseWebAudio = false; try { if (typeof AudioContext !== 'undefined') { this.audioContext = new AudioContext(); this.canUseWebAudio = true; } else if (typeof webkitAudioContext !== 'undefined') { this.audioContext = new webkitAudioContext(); this.canUseWebAudio = true; } } catch (e) { this.canUseWebAudio = false; BABYLON.Tools.Error("Your browser doesn't support Web Audio."); } // create a global volume gain node if (this.canUseWebAudio) { this.masterGain = this.audioContext.createGain(); this.masterGain.gain.value = 1; this.masterGain.connect(this.audioContext.destination); } } AudioEngine.prototype.getGlobalVolume = function () { if (this.canUseWebAudio) { return this.masterGain.gain.value; } else { return -1; } }; AudioEngine.prototype.setGlobalVolume = function (newVolume) { if (this.canUseWebAudio) { this.masterGain.gain.value = newVolume; } }; AudioEngine.prototype.connectToAnalyser = function (analyser) { if (this.canUseWebAudio) { this.masterGain.disconnect(); analyser.connectAudioNodes(this.masterGain, this.audioContext.destination); } }; return AudioEngine; })(); BABYLON.AudioEngine = AudioEngine; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.audioengine.js.map var BABYLON; (function (BABYLON) { var Sound = (function () { /** * Create a sound and attach it to a scene * @param name Name of your sound * @param urlOrArrayBuffer Url to the sound to load async or ArrayBuffer * @param readyToPlayCallback Provide a callback function if you'd like to load your code once the sound is ready to be played * @param options Objects to provide with the current available options: autoplay, loop, volume, spatialSound, maxDistance, rolloffFactor, refDistance, distanceModel, panningModel */ function Sound(name, urlOrArrayBuffer, scene, readyToPlayCallback, options) { var _this = this; this.autoplay = false; this.loop = false; this.useCustomAttenuation = false; this.spatialSound = false; this.refDistance = 1; this.rolloffFactor = 1; this.maxDistance = 100; this.distanceModel = "linear"; this.panningModel = "HRTF"; this.startTime = 0; this.startOffset = 0; this._position = BABYLON.Vector3.Zero(); this._localDirection = new BABYLON.Vector3(1, 0, 0); this._volume = 1; this._isLoaded = false; this._isReadyToPlay = false; this._isPlaying = false; this._isDirectional = false; // Used if you'd like to create a directional sound. // If not set, the sound will be omnidirectional this._coneInnerAngle = 360; this._coneOuterAngle = 360; this._coneOuterGain = 0; this._name = name; this._scene = scene; this._audioEngine = this._scene.getEngine().getAudioEngine(); this._readyToPlayCallback = readyToPlayCallback; // Default custom attenuation function is a linear attenuation this._customAttenuationFunction = function (currentVolume, currentDistance, maxDistance, refDistance, rolloffFactor) { if (currentDistance < maxDistance) { return currentVolume * (1 - currentDistance / maxDistance); } else { return 0; } }; if (options) { this.autoplay = options.autoplay || false; this.loop = options.loop || false; this._volume = options.volume || 1; this.spatialSound = options.spatialSound || false; this.maxDistance = options.maxDistance || 100; this.useCustomAttenuation = options.useCustomAttenation || false; this.rolloffFactor = options.rolloffFactor || 1; this.refDistance = options.refDistance || 1; this.distanceModel = options.distanceModel || "linear"; this.panningModel = options.panningModel || "HRTF"; } if (this._audioEngine.canUseWebAudio) { this._soundGain = this._audioEngine.audioContext.createGain(); this._soundGain.gain.value = this._volume; if (this.spatialSound) { this._createSpatialParameters(); } else { this._audioNode = this._soundGain; } this._scene.mainSoundTrack.AddSound(this); if (typeof (urlOrArrayBuffer) === "string") { BABYLON.Tools.LoadFile(urlOrArrayBuffer, function (data) { _this._soundLoaded(data); }, null, null, true); } else { if (urlOrArrayBuffer instanceof ArrayBuffer) { this._soundLoaded(urlOrArrayBuffer); } else { BABYLON.Tools.Error("Parameter must be a URL to the sound or an ArrayBuffer of the sound."); } } } } Sound.prototype._soundLoaded = function (audioData) { var _this = this; this._isLoaded = true; this._audioEngine.audioContext.decodeAudioData(audioData, function (buffer) { _this._audioBuffer = buffer; _this._isReadyToPlay = true; if (_this.autoplay) { _this.play(); } if (_this._readyToPlayCallback) { _this._readyToPlayCallback(); } }, function (error) { BABYLON.Tools.Error("Error while decoding audio data: " + error.err); }); }; Sound.prototype.updateOptions = function (options) { if (options) { this.loop = options.loop || this.loop; this.maxDistance = options.maxDistance || this.maxDistance; this.useCustomAttenuation = options.useCustomAttenation || this.useCustomAttenuation; this.rolloffFactor = options.rolloffFactor || this.rolloffFactor; this.refDistance = options.refDistance || this.refDistance; this.distanceModel = options.distanceModel || this.distanceModel; this.panningModel = options.panningModel || this.panningModel; } }; Sound.prototype._createSpatialParameters = function () { if (this._audioEngine.canUseWebAudio) { this._soundPanner = this._audioEngine.audioContext.createPanner(); if (this.useCustomAttenuation) { // Tricks to disable in a way embedded Web Audio attenuation this._soundPanner.distanceModel = "linear"; this._soundPanner.maxDistance = Number.MAX_VALUE; this._soundPanner.refDistance = 1; this._soundPanner.rolloffFactor = 1; this._soundPanner.panningModel = "HRTF"; } else { this._soundPanner.distanceModel = this.distanceModel; this._soundPanner.maxDistance = this.maxDistance; this._soundPanner.refDistance = this.refDistance; this._soundPanner.rolloffFactor = this.rolloffFactor; this._soundPanner.panningModel = this.panningModel; } this._soundPanner.connect(this._soundGain); this._audioNode = this._soundPanner; } }; Sound.prototype.connectToSoundTrackAudioNode = function (soundTrackAudioNode) { if (this._audioEngine.canUseWebAudio) { this._audioNode.disconnect(); this._audioNode.connect(soundTrackAudioNode); } }; /** * Transform this sound into a directional source * @param coneInnerAngle Size of the inner cone in degree * @param coneOuterAngle Size of the outer cone in degree * @param coneOuterGain Volume of the sound outside the outer cone (between 0.0 and 1.0) */ Sound.prototype.setDirectionalCone = function (coneInnerAngle, coneOuterAngle, coneOuterGain) { if (coneOuterAngle < coneInnerAngle) { BABYLON.Tools.Error("setDirectionalCone(): outer angle of the cone must be superior or equal to the inner angle."); return; } this._coneInnerAngle = coneInnerAngle; this._coneOuterAngle = coneOuterAngle; this._coneOuterGain = coneOuterGain; this._isDirectional = true; if (this._isPlaying && this.loop) { this.stop(); this.play(); } }; Sound.prototype.setPosition = function (newPosition) { this._position = newPosition; if (this._isPlaying && this.spatialSound) { this._soundPanner.setPosition(this._position.x, this._position.y, this._position.z); } }; Sound.prototype.setLocalDirectionToMesh = function (newLocalDirection) { this._localDirection = newLocalDirection; if (this._connectedMesh && this._isPlaying) { this._updateDirection(); } }; Sound.prototype._updateDirection = function () { var mat = this._connectedMesh.getWorldMatrix(); var direction = BABYLON.Vector3.TransformNormal(this._localDirection, mat); direction.normalize(); this._soundPanner.setOrientation(direction.x, direction.y, direction.z); }; Sound.prototype.updateDistanceFromListener = function () { if (this._connectedMesh && this.useCustomAttenuation) { var distance = this._connectedMesh.getDistanceToCamera(this._scene.activeCamera); this._soundGain.gain.value = this._customAttenuationFunction(this._volume, distance, this.maxDistance, this.refDistance, this.rolloffFactor); } }; Sound.prototype.setAttenuationFunction = function (callback) { this._customAttenuationFunction = callback; }; /** * Play the sound * @param time (optional) Start the sound after X seconds. Start immediately (0) by default. */ Sound.prototype.play = function (time) { if (this._isReadyToPlay) { try { var startTime = time ? this._audioEngine.audioContext.currentTime + time : 0; this._soundSource = this._audioEngine.audioContext.createBufferSource(); this._soundSource.buffer = this._audioBuffer; if (this.spatialSound) { this._soundPanner.setPosition(this._position.x, this._position.y, this._position.z); if (this._isDirectional) { this._soundPanner.coneInnerAngle = this._coneInnerAngle; this._soundPanner.coneOuterAngle = this._coneOuterAngle; this._soundPanner.coneOuterGain = this._coneOuterGain; if (this._connectedMesh) { this._updateDirection(); } else { this._soundPanner.setOrientation(this._localDirection.x, this._localDirection.y, this._localDirection.z); } } } this._soundSource.connect(this._audioNode); this._soundSource.loop = this.loop; this.startTime = startTime; this._soundSource.start(startTime, this.startOffset % this._soundSource.buffer.duration); this._isPlaying = true; } catch (ex) { BABYLON.Tools.Error("Error while trying to play audio: " + this._name + ", " + ex.message); } } }; /** * Stop the sound * @param time (optional) Stop the sound after X seconds. Stop immediately (0) by default. */ Sound.prototype.stop = function (time) { if (this._isPlaying) { var stopTime = time ? this._audioEngine.audioContext.currentTime + time : 0; this._soundSource.stop(stopTime); this._isPlaying = false; } }; Sound.prototype.pause = function () { if (this._isPlaying) { this._soundSource.stop(0); this.startOffset += this._audioEngine.audioContext.currentTime - this.startTime; } }; Sound.prototype.setVolume = function (newVolume) { this._volume = newVolume; if (this._audioEngine.canUseWebAudio) { this._soundGain.gain.value = newVolume; } }; Sound.prototype.getVolume = function () { return this._volume; }; Sound.prototype.attachToMesh = function (meshToConnectTo) { var _this = this; this._connectedMesh = meshToConnectTo; if (!this.spatialSound) { this._createSpatialParameters(); this.spatialSound = true; if (this._isPlaying && this.loop) { this.stop(); this.play(); } } meshToConnectTo.registerAfterWorldMatrixUpdate(function (connectedMesh) { return _this._onRegisterAfterWorldMatrixUpdate(connectedMesh); }); }; Sound.prototype._onRegisterAfterWorldMatrixUpdate = function (connectedMesh) { this.setPosition(connectedMesh.position); if (this._isDirectional && this._isPlaying) { this._updateDirection(); } }; return Sound; })(); BABYLON.Sound = Sound; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.sound.js.map var BABYLON; (function (BABYLON) { var SoundTrack = (function () { function SoundTrack(scene, options) { this.id = -1; this._isMainTrack = false; this._scene = scene; this._audioEngine = scene.getEngine().getAudioEngine(); this.soundCollection = new Array(); if (this._audioEngine.canUseWebAudio) { this._trackGain = this._audioEngine.audioContext.createGain(); //this._trackConvolver = this._audioEngine.audioContext.createConvolver(); //this._trackConvolver.connect(this._trackGain); this._trackGain.connect(this._audioEngine.masterGain); if (options) { if (options.volume) { this._trackGain.gain.value = options.volume; } if (options.mainTrack) { this._isMainTrack = options.mainTrack; } } } if (!this._isMainTrack) { this._scene.soundTracks.push(this); this.id = this._scene.soundTracks.length - 1; } } SoundTrack.prototype.AddSound = function (sound) { sound.connectToSoundTrackAudioNode(this._trackGain); if (sound.soundTrackId) { if (sound.soundTrackId === -1) { this._scene.mainSoundTrack.RemoveSound(sound); } else { this._scene.soundTracks[sound.soundTrackId].RemoveSound(sound); } } this.soundCollection.push(sound); sound.soundTrackId = this.id; }; SoundTrack.prototype.RemoveSound = function (sound) { var index = this.soundCollection.indexOf(sound); if (index !== -1) { this.soundCollection.splice(index, 1); } }; SoundTrack.prototype.setVolume = function (newVolume) { if (this._audioEngine.canUseWebAudio) { this._trackGain.gain.value = newVolume; } }; return SoundTrack; })(); BABYLON.SoundTrack = SoundTrack; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.soundtrack.js.map var BABYLON; (function (BABYLON) { var DebugLayer = (function () { function DebugLayer(scene) { var _this = this; this._enabled = false; this._labelsEnabled = false; this._displayStatistics = true; this._displayTree = false; this._displayLogs = false; this._identityMatrix = BABYLON.Matrix.Identity(); this.axisRatio = 0.02; this.accentColor = "orange"; this._scene = scene; this._syncPositions = function () { var engine = _this._scene.getEngine(); var canvasRect = engine.getRenderingCanvasClientRect(); if (_this._showUI) { _this._statsDiv.style.left = (canvasRect.width - 410) + "px"; _this._statsDiv.style.top = (canvasRect.height - 290) + "px"; _this._statsDiv.style.width = "400px"; _this._statsDiv.style.height = "auto"; _this._statsSubsetDiv.style.maxHeight = "240px"; _this._optionsDiv.style.left = "0px"; _this._optionsDiv.style.top = "10px"; _this._optionsDiv.style.width = "200px"; _this._optionsDiv.style.height = "auto"; _this._optionsSubsetDiv.style.maxHeight = (canvasRect.height - 225) + "px"; _this._logDiv.style.left = "0px"; _this._logDiv.style.top = (canvasRect.height - 170) + "px"; _this._logDiv.style.width = "600px"; _this._logDiv.style.height = "160px"; _this._treeDiv.style.left = (canvasRect.width - 310) + "px"; _this._treeDiv.style.top = "10px"; _this._treeDiv.style.width = "300px"; _this._treeDiv.style.height = "auto"; _this._treeSubsetDiv.style.maxHeight = (canvasRect.height - 340) + "px"; } _this._globalDiv.style.left = canvasRect.left + "px"; _this._globalDiv.style.top = canvasRect.top + "px"; _this._drawingCanvas.style.left = "0px"; _this._drawingCanvas.style.top = "0px"; _this._drawingCanvas.style.width = engine.getRenderWidth() + "px"; _this._drawingCanvas.style.height = engine.getRenderHeight() + "px"; var devicePixelRatio = window.devicePixelRatio || 1; var context = _this._drawingContext; var backingStoreRatio = context.webkitBackingStorePixelRatio || context.mozBackingStorePixelRatio || context.msBackingStorePixelRatio || context.oBackingStorePixelRatio || context.backingStorePixelRatio || 1; _this._ratio = devicePixelRatio / backingStoreRatio; _this._drawingCanvas.width = engine.getRenderWidth() * _this._ratio; _this._drawingCanvas.height = engine.getRenderHeight() * _this._ratio; }; this._onCanvasClick = function (evt) { _this._clickPosition = { x: evt.clientX * _this._ratio, y: evt.clientY * _this._ratio }; }; this._syncData = function () { if (_this._showUI) { if (_this._displayStatistics) { _this._displayStats(); _this._statsDiv.style.display = ""; } else { _this._statsDiv.style.display = "none"; } if (_this._displayLogs) { _this._logDiv.style.display = ""; } else { _this._logDiv.style.display = "none"; } if (_this._displayTree) { _this._treeDiv.style.display = ""; if (_this._needToRefreshMeshesTree) { _this._needToRefreshMeshesTree = false; _this._refreshMeshesTreeContent(); } } else { _this._treeDiv.style.display = "none"; } } if (_this._labelsEnabled || !_this._showUI) { _this._drawingContext.clearRect(0, 0, _this._drawingCanvas.width, _this._drawingCanvas.height); var engine = _this._scene.getEngine(); var viewport = _this._scene.activeCamera.viewport; var globalViewport = viewport.toGlobal(engine); // Meshes var meshes = _this._scene.getActiveMeshes(); for (var index = 0; index < meshes.length; index++) { var mesh = meshes.data[index]; var position = mesh.getBoundingInfo().boundingSphere.center; var projectedPosition = BABYLON.Vector3.Project(position, mesh.getWorldMatrix(), _this._scene.getTransformMatrix(), globalViewport); if (mesh.renderOverlay || _this.shouldDisplayAxis && _this.shouldDisplayAxis(mesh)) { _this._renderAxis(projectedPosition, mesh, globalViewport); } if (!_this.shouldDisplayLabel || _this.shouldDisplayLabel(mesh)) { _this._renderLabel(mesh.name, projectedPosition, 12, function () { mesh.renderOverlay = !mesh.renderOverlay; }, function () { return mesh.renderOverlay ? 'red' : 'black'; }); } } // Cameras var cameras = _this._scene.cameras; for (index = 0; index < cameras.length; index++) { var camera = cameras[index]; if (camera === _this._scene.activeCamera) { continue; } projectedPosition = BABYLON.Vector3.Project(BABYLON.Vector3.Zero(), camera.getWorldMatrix(), _this._scene.getTransformMatrix(), globalViewport); if (!_this.shouldDisplayLabel || _this.shouldDisplayLabel(camera)) { _this._renderLabel(camera.name, projectedPosition, 12, function () { _this._scene.activeCamera.detachControl(engine.getRenderingCanvas()); _this._scene.activeCamera = camera; _this._scene.activeCamera.attachControl(engine.getRenderingCanvas()); }, function () { return "purple"; }); } } // Lights var lights = _this._scene.lights; for (index = 0; index < lights.length; index++) { var light = lights[index]; if (light.position) { projectedPosition = BABYLON.Vector3.Project(light.getAbsolutePosition(), _this._identityMatrix, _this._scene.getTransformMatrix(), globalViewport); if (!_this.shouldDisplayLabel || _this.shouldDisplayLabel(light)) { _this._renderLabel(light.name, projectedPosition, -20, function () { light.setEnabled(!light.isEnabled()); }, function () { return light.isEnabled() ? "orange" : "gray"; }); } } } } _this._clickPosition = undefined; }; } DebugLayer.prototype._refreshMeshesTreeContent = function () { while (this._treeSubsetDiv.hasChildNodes()) { this._treeSubsetDiv.removeChild(this._treeSubsetDiv.lastChild); } // Add meshes var sortedArray = this._scene.meshes.slice(0, this._scene.meshes.length); sortedArray.sort(function (a, b) { if (a.name === b.name) { return 0; } return (a.name > b.name) ? 1 : -1; }); for (var index = 0; index < sortedArray.length; index++) { var mesh = sortedArray[index]; if (!mesh.isEnabled()) { continue; } this._generateAdvancedCheckBox(this._treeSubsetDiv, mesh.name, mesh.getTotalVertices() + " verts", mesh.isVisible, function (element, m) { m.isVisible = element.checked; }, mesh); } }; DebugLayer.prototype._renderSingleAxis = function (zero, unit, unitText, label, color) { this._drawingContext.beginPath(); this._drawingContext.moveTo(zero.x, zero.y); this._drawingContext.lineTo(unit.x, unit.y); this._drawingContext.strokeStyle = color; this._drawingContext.lineWidth = 4; this._drawingContext.stroke(); this._drawingContext.font = "normal 14px Segoe UI"; this._drawingContext.fillStyle = color; this._drawingContext.fillText(label, unitText.x, unitText.y); }; DebugLayer.prototype._renderAxis = function (projectedPosition, mesh, globalViewport) { var position = mesh.getBoundingInfo().boundingSphere.center; var worldMatrix = mesh.getWorldMatrix(); var unprojectedVector = BABYLON.Vector3.UnprojectFromTransform(projectedPosition.add(new BABYLON.Vector3(this._drawingCanvas.width * this.axisRatio, 0, 0)), globalViewport.width, globalViewport.height, worldMatrix, this._scene.getTransformMatrix()); var unit = (unprojectedVector.subtract(position)).length(); var xAxis = BABYLON.Vector3.Project(position.add(new BABYLON.Vector3(unit, 0, 0)), worldMatrix, this._scene.getTransformMatrix(), globalViewport); var xAxisText = BABYLON.Vector3.Project(position.add(new BABYLON.Vector3(unit * 1.5, 0, 0)), worldMatrix, this._scene.getTransformMatrix(), globalViewport); this._renderSingleAxis(projectedPosition, xAxis, xAxisText, "x", "#FF0000"); var yAxis = BABYLON.Vector3.Project(position.add(new BABYLON.Vector3(0, unit, 0)), worldMatrix, this._scene.getTransformMatrix(), globalViewport); var yAxisText = BABYLON.Vector3.Project(position.add(new BABYLON.Vector3(0, unit * 1.5, 0)), worldMatrix, this._scene.getTransformMatrix(), globalViewport); this._renderSingleAxis(projectedPosition, yAxis, yAxisText, "y", "#00FF00"); var zAxis = BABYLON.Vector3.Project(position.add(new BABYLON.Vector3(0, 0, unit)), worldMatrix, this._scene.getTransformMatrix(), globalViewport); var zAxisText = BABYLON.Vector3.Project(position.add(new BABYLON.Vector3(0, 0, unit * 1.5)), worldMatrix, this._scene.getTransformMatrix(), globalViewport); this._renderSingleAxis(projectedPosition, zAxis, zAxisText, "z", "#0000FF"); }; DebugLayer.prototype._renderLabel = function (text, projectedPosition, labelOffset, onClick, getFillStyle) { if (projectedPosition.z > 0 && projectedPosition.z < 1.0) { this._drawingContext.font = "normal 12px Segoe UI"; var textMetrics = this._drawingContext.measureText(text); var centerX = projectedPosition.x - textMetrics.width / 2; var centerY = projectedPosition.y; if (this._isClickInsideRect(centerX - 5, centerY - labelOffset - 12, textMetrics.width + 10, 17)) { onClick(); } this._drawingContext.beginPath(); this._drawingContext.rect(centerX - 5, centerY - labelOffset - 12, textMetrics.width + 10, 17); this._drawingContext.fillStyle = getFillStyle(); this._drawingContext.globalAlpha = 0.5; this._drawingContext.fill(); this._drawingContext.globalAlpha = 1.0; this._drawingContext.strokeStyle = '#FFFFFF'; this._drawingContext.lineWidth = 1; this._drawingContext.stroke(); this._drawingContext.fillStyle = "#FFFFFF"; this._drawingContext.fillText(text, centerX, centerY - labelOffset); this._drawingContext.beginPath(); this._drawingContext.arc(projectedPosition.x, centerY, 5, 0, 2 * Math.PI, false); this._drawingContext.fill(); } }; DebugLayer.prototype._isClickInsideRect = function (x, y, width, height) { if (!this._clickPosition) { return false; } if (this._clickPosition.x < x || this._clickPosition.x > x + width) { return false; } if (this._clickPosition.y < y || this._clickPosition.y > y + height) { return false; } return true; }; DebugLayer.prototype.isVisible = function () { return this._enabled; }; DebugLayer.prototype.hide = function () { if (!this._enabled) { return; } this._enabled = false; var engine = this._scene.getEngine(); this._scene.unregisterAfterRender(this._syncData); document.body.removeChild(this._globalDiv); window.removeEventListener("resize", this._syncPositions); this._scene.forceShowBoundingBoxes = false; this._scene.forceWireframe = false; BABYLON.StandardMaterial.DiffuseTextureEnabled = true; BABYLON.StandardMaterial.AmbientTextureEnabled = true; BABYLON.StandardMaterial.SpecularTextureEnabled = true; BABYLON.StandardMaterial.EmissiveTextureEnabled = true; BABYLON.StandardMaterial.BumpTextureEnabled = true; BABYLON.StandardMaterial.OpacityTextureEnabled = true; BABYLON.StandardMaterial.ReflectionTextureEnabled = true; this._scene.shadowsEnabled = true; this._scene.particlesEnabled = true; this._scene.postProcessesEnabled = true; this._scene.collisionsEnabled = true; this._scene.lightsEnabled = true; this._scene.texturesEnabled = true; this._scene.lensFlaresEnabled = true; this._scene.proceduralTexturesEnabled = true; this._scene.renderTargetsEnabled = true; engine.getRenderingCanvas().removeEventListener("click", this._onCanvasClick); }; DebugLayer.prototype.show = function (showUI) { if (typeof showUI === "undefined") { showUI = true; } if (this._enabled) { return; } this._enabled = true; this._showUI = showUI; var engine = this._scene.getEngine(); this._globalDiv = document.createElement("div"); document.body.appendChild(this._globalDiv); this._generateDOMelements(); window.addEventListener("resize", this._syncPositions); engine.getRenderingCanvas().addEventListener("click", this._onCanvasClick); this._syncPositions(); this._scene.registerAfterRender(this._syncData); }; DebugLayer.prototype._clearLabels = function () { this._drawingContext.clearRect(0, 0, this._drawingCanvas.width, this._drawingCanvas.height); for (var index = 0; index < this._scene.meshes.length; index++) { var mesh = this._scene.meshes[index]; mesh.renderOverlay = false; } }; DebugLayer.prototype._generateheader = function (root, text) { var header = document.createElement("div"); header.innerHTML = text + " "; header.style.textAlign = "right"; header.style.width = "100%"; header.style.color = "white"; header.style.backgroundColor = "Black"; header.style.padding = "5px 5px 4px 0px"; header.style.marginLeft = "-5px"; header.style.fontWeight = "bold"; root.appendChild(header); }; DebugLayer.prototype._generateTexBox = function (root, title, color) { var label = document.createElement("label"); label.innerHTML = title; label.style.color = color; root.appendChild(label); root.appendChild(document.createElement("br")); }; DebugLayer.prototype._generateAdvancedCheckBox = function (root, leftTitle, rightTitle, initialState, task, tag) { if (typeof tag === "undefined") { tag = null; } var label = document.createElement("label"); var boundingBoxesCheckbox = document.createElement("input"); boundingBoxesCheckbox.type = "checkbox"; boundingBoxesCheckbox.checked = initialState; boundingBoxesCheckbox.addEventListener("change", function (evt) { task(evt.target, tag); }); label.appendChild(boundingBoxesCheckbox); var container = document.createElement("span"); var leftPart = document.createElement("span"); var rightPart = document.createElement("span"); rightPart.style.cssFloat = "right"; leftPart.innerHTML = leftTitle; rightPart.innerHTML = rightTitle; rightPart.style.fontSize = "12px"; rightPart.style.maxWidth = "200px"; container.appendChild(leftPart); container.appendChild(rightPart); label.appendChild(container); root.appendChild(label); root.appendChild(document.createElement("br")); }; DebugLayer.prototype._generateCheckBox = function (root, title, initialState, task, tag) { if (typeof tag === "undefined") { tag = null; } var label = document.createElement("label"); var boundingBoxesCheckbox = document.createElement("input"); boundingBoxesCheckbox.type = "checkbox"; boundingBoxesCheckbox.checked = initialState; boundingBoxesCheckbox.addEventListener("change", function (evt) { task(evt.target, tag); }); label.appendChild(boundingBoxesCheckbox); label.appendChild(document.createTextNode(title)); root.appendChild(label); root.appendChild(document.createElement("br")); }; DebugLayer.prototype._generateRadio = function (root, title, name, initialState, task, tag) { if (typeof tag === "undefined") { tag = null; } var label = document.createElement("label"); var boundingBoxesRadio = document.createElement("input"); boundingBoxesRadio.type = "radio"; boundingBoxesRadio.name = name; boundingBoxesRadio.checked = initialState; boundingBoxesRadio.addEventListener("change", function (evt) { task(evt.target, tag); }); label.appendChild(boundingBoxesRadio); label.appendChild(document.createTextNode(title)); root.appendChild(label); root.appendChild(document.createElement("br")); }; DebugLayer.prototype._generateDOMelements = function () { var _this = this; this._globalDiv.id = "DebugLayer"; this._globalDiv.style.position = "absolute"; this._globalDiv.style.fontFamily = "Segoe UI, Arial"; this._globalDiv.style.fontSize = "14px"; this._globalDiv.style.color = "white"; // Drawing canvas this._drawingCanvas = document.createElement("canvas"); this._drawingCanvas.id = "DebugLayerDrawingCanvas"; this._drawingCanvas.style.position = "absolute"; this._drawingCanvas.style.pointerEvents = "none"; this._drawingContext = this._drawingCanvas.getContext("2d"); this._globalDiv.appendChild(this._drawingCanvas); if (this._showUI) { var background = "rgba(128, 128, 128, 0.4)"; var border = "rgb(180, 180, 180) solid 1px"; // Stats this._statsDiv = document.createElement("div"); this._statsDiv.id = "DebugLayerStats"; this._statsDiv.style.border = border; this._statsDiv.style.position = "absolute"; this._statsDiv.style.background = background; this._statsDiv.style.padding = "0px 0px 0px 5px"; this._generateheader(this._statsDiv, "STATISTICS"); this._statsSubsetDiv = document.createElement("div"); this._statsSubsetDiv.style.paddingTop = "5px"; this._statsSubsetDiv.style.paddingBottom = "5px"; this._statsSubsetDiv.style.overflowY = "auto"; this._statsDiv.appendChild(this._statsSubsetDiv); // Tree this._treeDiv = document.createElement("div"); this._treeDiv.id = "DebugLayerTree"; this._treeDiv.style.border = border; this._treeDiv.style.position = "absolute"; this._treeDiv.style.background = background; this._treeDiv.style.padding = "0px 0px 0px 5px"; this._treeDiv.style.display = "none"; this._generateheader(this._treeDiv, "MESHES TREE"); this._treeSubsetDiv = document.createElement("div"); this._treeSubsetDiv.style.paddingTop = "5px"; this._treeSubsetDiv.style.paddingRight = "5px"; this._treeSubsetDiv.style.overflowY = "auto"; this._treeSubsetDiv.style.maxHeight = "300px"; this._treeDiv.appendChild(this._treeSubsetDiv); this._needToRefreshMeshesTree = true; // Logs this._logDiv = document.createElement("div"); this._logDiv.style.border = border; this._logDiv.id = "DebugLayerLogs"; this._logDiv.style.position = "absolute"; this._logDiv.style.background = background; this._logDiv.style.padding = "0px 0px 0px 5px"; this._logDiv.style.display = "none"; this._generateheader(this._logDiv, "LOGS"); this._logSubsetDiv = document.createElement("div"); this._logSubsetDiv.style.height = "127px"; this._logSubsetDiv.style.paddingTop = "5px"; this._logSubsetDiv.style.overflowY = "auto"; this._logSubsetDiv.style.fontSize = "12px"; this._logSubsetDiv.style.fontFamily = "consolas"; this._logSubsetDiv.innerHTML = BABYLON.Tools.LogCache; this._logDiv.appendChild(this._logSubsetDiv); BABYLON.Tools.OnNewCacheEntry = function (entry) { _this._logSubsetDiv.innerHTML = entry + _this._logSubsetDiv.innerHTML; }; // Options this._optionsDiv = document.createElement("div"); this._optionsDiv.id = "DebugLayerOptions"; this._optionsDiv.style.border = border; this._optionsDiv.style.position = "absolute"; this._optionsDiv.style.background = background; this._optionsDiv.style.padding = "0px 0px 0px 5px"; this._optionsDiv.style.overflowY = "auto"; this._generateheader(this._optionsDiv, "OPTIONS"); this._optionsSubsetDiv = document.createElement("div"); this._optionsSubsetDiv.style.paddingTop = "5px"; this._optionsSubsetDiv.style.paddingBottom = "5px"; this._optionsSubsetDiv.style.overflowY = "auto"; this._optionsSubsetDiv.style.maxHeight = "200px"; this._optionsDiv.appendChild(this._optionsSubsetDiv); this._generateTexBox(this._optionsSubsetDiv, "Windows:", this.accentColor); this._generateCheckBox(this._optionsSubsetDiv, "Statistics", this._displayStatistics, function (element) { _this._displayStatistics = element.checked; }); this._generateCheckBox(this._optionsSubsetDiv, "Logs", this._displayLogs, function (element) { _this._displayLogs = element.checked; }); this._generateCheckBox(this._optionsSubsetDiv, "Meshes tree", this._displayTree, function (element) { _this._displayTree = element.checked; _this._needToRefreshMeshesTree = true; }); this._optionsSubsetDiv.appendChild(document.createElement("br")); this._generateTexBox(this._optionsSubsetDiv, "General:", this.accentColor); this._generateCheckBox(this._optionsSubsetDiv, "Bounding boxes", this._scene.forceShowBoundingBoxes, function (element) { _this._scene.forceShowBoundingBoxes = element.checked; }); this._generateCheckBox(this._optionsSubsetDiv, "Clickable labels", this._labelsEnabled, function (element) { _this._labelsEnabled = element.checked; if (!_this._labelsEnabled) { _this._clearLabels(); } }); this._generateCheckBox(this._optionsSubsetDiv, "Generate user marks (F12)", BABYLON.Tools.PerformanceLogLevel === BABYLON.Tools.PerformanceUserMarkLogLevel, function (element) { if (element.checked) { BABYLON.Tools.PerformanceLogLevel = BABYLON.Tools.PerformanceUserMarkLogLevel; } else { BABYLON.Tools.PerformanceLogLevel = BABYLON.Tools.PerformanceNoneLogLevel; } }); ; this._optionsSubsetDiv.appendChild(document.createElement("br")); this._generateTexBox(this._optionsSubsetDiv, "Rendering mode:", this.accentColor); this._generateRadio(this._optionsSubsetDiv, "Solid", "renderMode", !this._scene.forceWireframe && !this._scene.forcePointsCloud, function (element) { if (element.checked) { _this._scene.forceWireframe = false; _this._scene.forcePointsCloud = false; } }); this._generateRadio(this._optionsSubsetDiv, "Wireframe", "renderMode", this._scene.forceWireframe, function (element) { if (element.checked) { _this._scene.forceWireframe = true; _this._scene.forcePointsCloud = false; } }); this._generateRadio(this._optionsSubsetDiv, "Point", "renderMode", this._scene.forcePointsCloud, function (element) { if (element.checked) { _this._scene.forceWireframe = false; _this._scene.forcePointsCloud = true; } }); this._optionsSubsetDiv.appendChild(document.createElement("br")); this._generateTexBox(this._optionsSubsetDiv, "Texture channels:", this.accentColor); this._generateCheckBox(this._optionsSubsetDiv, "Diffuse", BABYLON.StandardMaterial.DiffuseTextureEnabled, function (element) { BABYLON.StandardMaterial.DiffuseTextureEnabled = element.checked; }); this._generateCheckBox(this._optionsSubsetDiv, "Ambient", BABYLON.StandardMaterial.AmbientTextureEnabled, function (element) { BABYLON.StandardMaterial.AmbientTextureEnabled = element.checked; }); this._generateCheckBox(this._optionsSubsetDiv, "Specular", BABYLON.StandardMaterial.SpecularTextureEnabled, function (element) { BABYLON.StandardMaterial.SpecularTextureEnabled = element.checked; }); this._generateCheckBox(this._optionsSubsetDiv, "Emissive", BABYLON.StandardMaterial.EmissiveTextureEnabled, function (element) { BABYLON.StandardMaterial.EmissiveTextureEnabled = element.checked; }); this._generateCheckBox(this._optionsSubsetDiv, "Bump", BABYLON.StandardMaterial.BumpTextureEnabled, function (element) { BABYLON.StandardMaterial.BumpTextureEnabled = element.checked; }); this._generateCheckBox(this._optionsSubsetDiv, "Opacity", BABYLON.StandardMaterial.OpacityTextureEnabled, function (element) { BABYLON.StandardMaterial.OpacityTextureEnabled = element.checked; }); this._generateCheckBox(this._optionsSubsetDiv, "Reflection", BABYLON.StandardMaterial.ReflectionTextureEnabled, function (element) { BABYLON.StandardMaterial.ReflectionTextureEnabled = element.checked; }); this._generateCheckBox(this._optionsSubsetDiv, "Fresnel", BABYLON.StandardMaterial.FresnelEnabled, function (element) { BABYLON.StandardMaterial.FresnelEnabled = element.checked; }); this._optionsSubsetDiv.appendChild(document.createElement("br")); this._generateTexBox(this._optionsSubsetDiv, "Options:", this.accentColor); this._generateCheckBox(this._optionsSubsetDiv, "Animations", this._scene.animationsEnabled, function (element) { _this._scene.animationsEnabled = element.checked; }); this._generateCheckBox(this._optionsSubsetDiv, "Collisions", this._scene.collisionsEnabled, function (element) { _this._scene.collisionsEnabled = element.checked; }); this._generateCheckBox(this._optionsSubsetDiv, "Fog", this._scene.fogEnabled, function (element) { _this._scene.fogEnabled = element.checked; }); this._generateCheckBox(this._optionsSubsetDiv, "Lens flares", this._scene.lensFlaresEnabled, function (element) { _this._scene.lensFlaresEnabled = element.checked; }); this._generateCheckBox(this._optionsSubsetDiv, "Lights", this._scene.lightsEnabled, function (element) { _this._scene.lightsEnabled = element.checked; }); this._generateCheckBox(this._optionsSubsetDiv, "Particles", this._scene.particlesEnabled, function (element) { _this._scene.particlesEnabled = element.checked; }); this._generateCheckBox(this._optionsSubsetDiv, "Post-processes", this._scene.postProcessesEnabled, function (element) { _this._scene.postProcessesEnabled = element.checked; }); this._generateCheckBox(this._optionsSubsetDiv, "Procedural textures", this._scene.proceduralTexturesEnabled, function (element) { _this._scene.proceduralTexturesEnabled = element.checked; }); this._generateCheckBox(this._optionsSubsetDiv, "Render targets", this._scene.renderTargetsEnabled, function (element) { _this._scene.renderTargetsEnabled = element.checked; }); this._generateCheckBox(this._optionsSubsetDiv, "Shadows", this._scene.shadowsEnabled, function (element) { _this._scene.shadowsEnabled = element.checked; }); this._generateCheckBox(this._optionsSubsetDiv, "Skeletons", this._scene.skeletonsEnabled, function (element) { _this._scene.skeletonsEnabled = element.checked; }); this._generateCheckBox(this._optionsSubsetDiv, "Textures", this._scene.texturesEnabled, function (element) { _this._scene.texturesEnabled = element.checked; }); this._globalDiv.appendChild(this._statsDiv); this._globalDiv.appendChild(this._logDiv); this._globalDiv.appendChild(this._optionsDiv); this._globalDiv.appendChild(this._treeDiv); } }; DebugLayer.prototype._displayStats = function () { var scene = this._scene; var engine = scene.getEngine(); var glInfo = engine.getGlInfo(); this._statsSubsetDiv.innerHTML = "Babylon.js v" + BABYLON.Engine.Version + " - " + BABYLON.Tools.Format(engine.getFps(), 0) + " fps

" + "
" + "Count
" + "Total meshes: " + scene.meshes.length + "
" + "Total vertices: " + scene.getTotalVertices() + "
" + "Total materials: " + scene.materials.length + "
" + "Total textures: " + scene.textures.length + "
" + "Active meshes: " + scene.getActiveMeshes().length + "
" + "Active vertices: " + scene.getActiveVertices() + "
" + "Active bones: " + scene.getActiveBones() + "
" + "Active particles: " + scene.getActiveParticles() + "
" + "Draw calls: " + engine.drawCalls + "

" + "Duration
" + "Meshes selection: " + BABYLON.Tools.Format(scene.getEvaluateActiveMeshesDuration()) + " ms
" + "Render Targets: " + BABYLON.Tools.Format(scene.getRenderTargetsDuration()) + " ms
" + "Particles: " + BABYLON.Tools.Format(scene.getParticlesDuration()) + " ms
" + "Sprites: " + BABYLON.Tools.Format(scene.getSpritesDuration()) + " ms

" + "Render: " + BABYLON.Tools.Format(scene.getRenderDuration()) + " ms
" + "Frame: " + BABYLON.Tools.Format(scene.getLastFrameDuration()) + " ms
" + "Potential FPS: " + BABYLON.Tools.Format(1000.0 / scene.getLastFrameDuration(), 0) + "

" + "
" + "
" + "Extensions
" + "Std derivatives: " + (engine.getCaps().standardDerivatives ? "Yes" : "No") + "
" + "Compressed textures: " + (engine.getCaps().s3tc ? "Yes" : "No") + "
" + "Hardware instances: " + (engine.getCaps().instancedArrays ? "Yes" : "No") + "
" + "Texture float: " + (engine.getCaps().textureFloat ? "Yes" : "No") + "
" + "32bits indices: " + (engine.getCaps().uintIndices ? "Yes" : "No") + "
" + "Caps.
" + "Max textures units: " + engine.getCaps().maxTexturesImageUnits + "
" + "Max textures size: " + engine.getCaps().maxTextureSize + "
" + "Max anisotropy: " + engine.getCaps().maxAnisotropy + "


" + "

" + "Info
" + glInfo.version + "
" + glInfo.renderer + "
"; if (this.customStatsFunction) { this._statsSubsetDiv.innerHTML += this._statsSubsetDiv.innerHTML; } }; return DebugLayer; })(); BABYLON.DebugLayer = DebugLayer; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.debugLayer.js.map var BABYLON; (function (BABYLON) { var RawTexture = (function (_super) { __extends(RawTexture, _super); function RawTexture(data, width, height, format, scene, generateMipMaps, invertY, samplingMode) { if (typeof generateMipMaps === "undefined") { generateMipMaps = true; } if (typeof invertY === "undefined") { invertY = false; } if (typeof samplingMode === "undefined") { samplingMode = BABYLON.Texture.TRILINEAR_SAMPLINGMODE; } _super.call(this, null, scene, !generateMipMaps, invertY); this._texture = scene.getEngine().createRawTexture(data, width, height, format, generateMipMaps, invertY, samplingMode); this.wrapU = BABYLON.Texture.CLAMP_ADDRESSMODE; this.wrapV = BABYLON.Texture.CLAMP_ADDRESSMODE; } // Statics RawTexture.CreateLuminanceTexture = function (data, width, height, scene, generateMipMaps, invertY, samplingMode) { if (typeof generateMipMaps === "undefined") { generateMipMaps = true; } if (typeof invertY === "undefined") { invertY = false; } if (typeof samplingMode === "undefined") { samplingMode = BABYLON.Texture.TRILINEAR_SAMPLINGMODE; } return new RawTexture(data, width, height, BABYLON.Engine.TEXTUREFORMAT_LUMINANCE, scene, generateMipMaps, invertY, samplingMode); }; RawTexture.CreateLuminanceAlphaTexture = function (data, width, height, scene, generateMipMaps, invertY, samplingMode) { if (typeof generateMipMaps === "undefined") { generateMipMaps = true; } if (typeof invertY === "undefined") { invertY = false; } if (typeof samplingMode === "undefined") { samplingMode = BABYLON.Texture.TRILINEAR_SAMPLINGMODE; } return new RawTexture(data, width, height, BABYLON.Engine.TEXTUREFORMAT_LUMINANCE_ALPHA, scene, generateMipMaps, invertY, samplingMode); }; RawTexture.CreateAlphaTexture = function (data, width, height, scene, generateMipMaps, invertY, samplingMode) { if (typeof generateMipMaps === "undefined") { generateMipMaps = true; } if (typeof invertY === "undefined") { invertY = false; } if (typeof samplingMode === "undefined") { samplingMode = BABYLON.Texture.TRILINEAR_SAMPLINGMODE; } return new RawTexture(data, width, height, BABYLON.Engine.TEXTUREFORMAT_ALPHA, scene, generateMipMaps, invertY, samplingMode); }; RawTexture.CreateRGBTexture = function (data, width, height, scene, generateMipMaps, invertY, samplingMode) { if (typeof generateMipMaps === "undefined") { generateMipMaps = true; } if (typeof invertY === "undefined") { invertY = false; } if (typeof samplingMode === "undefined") { samplingMode = BABYLON.Texture.TRILINEAR_SAMPLINGMODE; } return new RawTexture(data, width, height, BABYLON.Engine.TEXTUREFORMAT_RGB, scene, generateMipMaps, invertY, samplingMode); }; RawTexture.CreateRGBATexture = function (data, width, height, scene, generateMipMaps, invertY, samplingMode) { if (typeof generateMipMaps === "undefined") { generateMipMaps = true; } if (typeof invertY === "undefined") { invertY = false; } if (typeof samplingMode === "undefined") { samplingMode = BABYLON.Texture.TRILINEAR_SAMPLINGMODE; } return new RawTexture(data, width, height, BABYLON.Engine.TEXTUREFORMAT_RGBA, scene, generateMipMaps, invertY, samplingMode); }; return RawTexture; })(BABYLON.Texture); BABYLON.RawTexture = RawTexture; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.rawTexture.js.map var BABYLON; (function (BABYLON) { var IndexedVector2 = (function (_super) { __extends(IndexedVector2, _super); function IndexedVector2(original, index) { _super.call(this, original.x, original.y); this.index = index; } return IndexedVector2; })(BABYLON.Vector2); var PolygonPoints = (function () { function PolygonPoints() { this.elements = new Array(); } PolygonPoints.prototype.add = function (originalPoints) { var _this = this; var result = new Array(); originalPoints.forEach(function (point) { if (result.length === 0 || !(BABYLON.Tools.WithinEpsilon(point.x, result[0].x, 0.00001) && BABYLON.Tools.WithinEpsilon(point.y, result[0].y, 0.00001))) { var newPoint = new IndexedVector2(point, _this.elements.length); result.push(newPoint); _this.elements.push(newPoint); } }); return result; }; PolygonPoints.prototype.computeBounds = function () { var lmin = new BABYLON.Vector2(this.elements[0].x, this.elements[0].y); var lmax = new BABYLON.Vector2(this.elements[0].x, this.elements[0].y); this.elements.forEach(function (point) { // x if (point.x < lmin.x) { lmin.x = point.x; } else if (point.x > lmax.x) { lmax.x = point.x; } // y if (point.y < lmin.y) { lmin.y = point.y; } else if (point.y > lmax.y) { lmax.y = point.y; } }); return { min: lmin, max: lmax, width: lmax.x - lmin.x, height: lmax.y - lmin.y }; }; return PolygonPoints; })(); var Polygon = (function () { function Polygon() { } Polygon.Rectangle = function (xmin, ymin, xmax, ymax) { return [ new BABYLON.Vector2(xmin, ymin), new BABYLON.Vector2(xmax, ymin), new BABYLON.Vector2(xmax, ymax), new BABYLON.Vector2(xmin, ymax) ]; }; Polygon.Circle = function (radius, cx, cy, numberOfSides) { if (typeof cx === "undefined") { cx = 0; } if (typeof cy === "undefined") { cy = 0; } if (typeof numberOfSides === "undefined") { numberOfSides = 32; } var result = new Array(); var angle = 0; var increment = (Math.PI * 2) / numberOfSides; for (var i = 0; i < numberOfSides; i++) { result.push(new BABYLON.Vector2(cx + Math.cos(angle) * radius, cy + Math.sin(angle) * radius)); angle -= increment; } return result; }; Polygon.Parse = function (input) { var floats = input.split(/[^-+eE\.\d]+/).map(parseFloat).filter(function (val) { return (!isNaN(val)); }); var i, result = []; for (i = 0; i < (floats.length & 0x7FFFFFFE); i += 2) { result.push(new poly2tri.Point(floats[i], floats[i + 1])); } return result; }; Polygon.StartingAt = function (x, y) { return BABYLON.Path2.StartingAt(x, y); }; return Polygon; })(); BABYLON.Polygon = Polygon; var PolygonMeshBuilder = (function () { function PolygonMeshBuilder(name, contours, scene) { this._points = new PolygonPoints(); if (!("poly2tri" in window)) { throw "PolygonMeshBuilder cannot be used because poly2tri is not referenced"; } this._name = name; this._scene = scene; var points; if (contours instanceof BABYLON.Path2) { points = contours.getPoints(); } else { points = contours; } this._swctx = new poly2tri.SweepContext(this._points.add(points)); } PolygonMeshBuilder.prototype.addHole = function (hole) { this._swctx.addHole(this._points.add(hole)); return this; }; PolygonMeshBuilder.prototype.build = function (updatable) { if (typeof updatable === "undefined") { updatable = false; } var result = new BABYLON.Mesh(this._name, this._scene); var normals = []; var positions = []; var uvs = []; var bounds = this._points.computeBounds(); this._points.elements.forEach(function (p) { normals.push(0, 1.0, 0); positions.push(p.x, 0, p.y); uvs.push((p.x - bounds.min.x) / bounds.width, (p.y - bounds.min.y) / bounds.height); }); var indices = []; this._swctx.triangulate(); this._swctx.getTriangles().forEach(function (triangle) { triangle.getPoints().forEach(function (point) { indices.push(point.index); }); }); result.setVerticesData(positions, BABYLON.VertexBuffer.PositionKind, updatable); result.setVerticesData(normals, BABYLON.VertexBuffer.NormalKind, updatable); result.setVerticesData(uvs, BABYLON.VertexBuffer.UVKind, updatable); result.setIndices(indices); return result; }; return PolygonMeshBuilder; })(); BABYLON.PolygonMeshBuilder = PolygonMeshBuilder; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.polygonMesh.js.map var BABYLON; (function (BABYLON) { var SimplificationSettings = (function () { function SimplificationSettings(quality, distance) { this.quality = quality; this.distance = distance; } return SimplificationSettings; })(); BABYLON.SimplificationSettings = SimplificationSettings; /** * The implemented types of simplification. * At the moment only Quadratic Error Decimation is implemented. */ (function (SimplificationType) { SimplificationType[SimplificationType["QUADRATIC"] = 0] = "QUADRATIC"; })(BABYLON.SimplificationType || (BABYLON.SimplificationType = {})); var SimplificationType = BABYLON.SimplificationType; var DecimationTriangle = (function () { function DecimationTriangle(vertices) { this.vertices = vertices; this.error = new Array(4); this.deleted = false; this.isDirty = false; this.borderFactor = 0; } return DecimationTriangle; })(); BABYLON.DecimationTriangle = DecimationTriangle; var DecimationVertex = (function () { function DecimationVertex(position, normal, uv, id) { this.position = position; this.normal = normal; this.uv = uv; this.id = id; this.isBorder = true; this.q = new QuadraticMatrix(); this.triangleCount = 0; this.triangleStart = 0; } return DecimationVertex; })(); BABYLON.DecimationVertex = DecimationVertex; var QuadraticMatrix = (function () { function QuadraticMatrix(data) { this.data = new Array(10); for (var i = 0; i < 10; ++i) { if (data && data[i]) { this.data[i] = data[i]; } else { this.data[i] = 0; } } } QuadraticMatrix.prototype.det = function (a11, a12, a13, a21, a22, a23, a31, a32, a33) { var det = this.data[a11] * this.data[a22] * this.data[a33] + this.data[a13] * this.data[a21] * this.data[a32] + this.data[a12] * this.data[a23] * this.data[a31] - this.data[a13] * this.data[a22] * this.data[a31] - this.data[a11] * this.data[a23] * this.data[a32] - this.data[a12] * this.data[a21] * this.data[a33]; return det; }; QuadraticMatrix.prototype.addInPlace = function (matrix) { for (var i = 0; i < 10; ++i) { this.data[i] += matrix.data[i]; } }; QuadraticMatrix.prototype.addArrayInPlace = function (data) { for (var i = 0; i < 10; ++i) { this.data[i] += data[i]; } }; QuadraticMatrix.prototype.add = function (matrix) { var m = new QuadraticMatrix(); for (var i = 0; i < 10; ++i) { m.data[i] = this.data[i] + matrix.data[i]; } return m; }; QuadraticMatrix.FromData = function (a, b, c, d) { return new QuadraticMatrix(QuadraticMatrix.DataFromNumbers(a, b, c, d)); }; //returning an array to avoid garbage collection QuadraticMatrix.DataFromNumbers = function (a, b, c, d) { return [a * a, a * b, a * c, a * d, b * b, b * c, b * d, c * c, c * d, d * d]; }; return QuadraticMatrix; })(); BABYLON.QuadraticMatrix = QuadraticMatrix; var Reference = (function () { function Reference(vertexId, triangleId) { this.vertexId = vertexId; this.triangleId = triangleId; } return Reference; })(); BABYLON.Reference = Reference; /** * An implementation of the Quadratic Error simplification algorithm. * Original paper : http://www1.cs.columbia.edu/~cs4162/html05s/garland97.pdf * Ported mostly from QSlim and http://voxels.blogspot.de/2014/05/quadric-mesh-simplification-with-source.html to babylon JS * @author RaananW */ var QuadraticErrorSimplification = (function () { function QuadraticErrorSimplification(_mesh) { this._mesh = _mesh; this.initialised = false; this.syncIterations = 5000; this.aggressiveness = 7; this.decimationIterations = 100; } QuadraticErrorSimplification.prototype.simplify = function (settings, successCallback) { var _this = this; this.initWithMesh(this._mesh, function () { _this.runDecimation(settings, successCallback); }); }; QuadraticErrorSimplification.prototype.runDecimation = function (settings, successCallback) { var _this = this; var targetCount = ~~(this.triangles.length * settings.quality); var deletedTriangles = 0; var triangleCount = this.triangles.length; var iterationFunction = function (iteration, callback) { setTimeout(function () { if (iteration % 5 === 0) { _this.updateMesh(iteration === 0); } for (var i = 0; i < _this.triangles.length; ++i) { _this.triangles[i].isDirty = false; } var threshold = 0.000000001 * Math.pow((iteration + 3), _this.aggressiveness); var trianglesIterator = function (i) { var tIdx = ~~(((_this.triangles.length / 2) + i) % _this.triangles.length); var t = _this.triangles[tIdx]; if (!t) return; if (t.error[3] > threshold || t.deleted || t.isDirty) { return; } for (var j = 0; j < 3; ++j) { if (t.error[j] < threshold) { var deleted0 = []; var deleted1 = []; var i0 = t.vertices[j]; var i1 = t.vertices[(j + 1) % 3]; var v0 = _this.vertices[i0]; var v1 = _this.vertices[i1]; if (v0.isBorder !== v1.isBorder) continue; var p = BABYLON.Vector3.Zero(); var n = BABYLON.Vector3.Zero(); var uv = BABYLON.Vector2.Zero(); var color = new BABYLON.Color4(0, 0, 0, 1); _this.calculateError(v0, v1, p, n, uv, color); if (_this.isFlipped(v0, i1, p, deleted0, t.borderFactor)) continue; if (_this.isFlipped(v1, i0, p, deleted1, t.borderFactor)) continue; v0.position = p; v0.normal = n; if (v0.uv) v0.uv = uv; else if (v0.color) v0.color = color; v0.q = v1.q.add(v0.q); var tStart = _this.references.length; deletedTriangles = _this.updateTriangles(v0.id, v0, deleted0, deletedTriangles); deletedTriangles = _this.updateTriangles(v0.id, v1, deleted1, deletedTriangles); var tCount = _this.references.length - tStart; if (tCount <= v0.triangleCount) { if (tCount) { for (var c = 0; c < tCount; c++) { _this.references[v0.triangleStart + c] = _this.references[tStart + c]; } } } else { v0.triangleStart = tStart; } v0.triangleCount = tCount; break; } } }; BABYLON.AsyncLoop.SyncAsyncForLoop(_this.triangles.length, _this.syncIterations, trianglesIterator, callback, function () { return (triangleCount - deletedTriangles <= targetCount); }); }, 0); }; BABYLON.AsyncLoop.Run(this.decimationIterations, function (loop) { if (triangleCount - deletedTriangles <= targetCount) loop.breakLoop(); else { iterationFunction(loop.index, function () { loop.executeNext(); }); } }, function () { setTimeout(function () { successCallback(_this.reconstructMesh()); }, 0); }); }; QuadraticErrorSimplification.prototype.initWithMesh = function (mesh, callback) { var _this = this; if (!mesh) return; this.vertices = []; this.triangles = []; this._mesh = mesh; //It is assumed that a mesh has positions, normals and either uvs or colors. var positionData = this._mesh.getVerticesData(BABYLON.VertexBuffer.PositionKind); var normalData = this._mesh.getVerticesData(BABYLON.VertexBuffer.NormalKind); var uvs = this._mesh.getVerticesData(BABYLON.VertexBuffer.UVKind); var colorsData = this._mesh.getVerticesData(BABYLON.VertexBuffer.ColorKind); var indices = mesh.getIndices(); var vertexInit = function (i) { var vertex = new DecimationVertex(BABYLON.Vector3.FromArray(positionData, i * 3), BABYLON.Vector3.FromArray(normalData, i * 3), null, i); if (_this._mesh.isVerticesDataPresent(BABYLON.VertexBuffer.UVKind)) { vertex.uv = BABYLON.Vector2.FromArray(uvs, i * 2); } else if (_this._mesh.isVerticesDataPresent(BABYLON.VertexBuffer.ColorKind)) { vertex.color = BABYLON.Color4.FromArray(colorsData, i * 4); } _this.vertices.push(vertex); }; var totalVertices = mesh.getTotalVertices(); BABYLON.AsyncLoop.SyncAsyncForLoop(totalVertices, this.syncIterations, vertexInit, function () { var indicesInit = function (i) { var pos = i * 3; var i0 = indices[pos + 0]; var i1 = indices[pos + 1]; var i2 = indices[pos + 2]; var triangle = new DecimationTriangle([_this.vertices[i0].id, _this.vertices[i1].id, _this.vertices[i2].id]); _this.triangles.push(triangle); }; BABYLON.AsyncLoop.SyncAsyncForLoop(indices.length / 3, _this.syncIterations, indicesInit, function () { _this.init(callback); }); }); }; QuadraticErrorSimplification.prototype.init = function (callback) { var _this = this; var triangleInit1 = function (i) { var t = _this.triangles[i]; t.normal = BABYLON.Vector3.Cross(_this.vertices[t.vertices[1]].position.subtract(_this.vertices[t.vertices[0]].position), _this.vertices[t.vertices[2]].position.subtract(_this.vertices[t.vertices[0]].position)).normalize(); for (var j = 0; j < 3; j++) { _this.vertices[t.vertices[j]].q.addArrayInPlace(QuadraticMatrix.DataFromNumbers(t.normal.x, t.normal.y, t.normal.z, -(BABYLON.Vector3.Dot(t.normal, _this.vertices[t.vertices[0]].position)))); } }; BABYLON.AsyncLoop.SyncAsyncForLoop(this.triangles.length, this.syncIterations, triangleInit1, function () { var triangleInit2 = function (i) { var t = _this.triangles[i]; for (var j = 0; j < 3; ++j) { t.error[j] = _this.calculateError(_this.vertices[t.vertices[j]], _this.vertices[t.vertices[(j + 1) % 3]]); } t.error[3] = Math.min(t.error[0], t.error[1], t.error[2]); }; BABYLON.AsyncLoop.SyncAsyncForLoop(_this.triangles.length, _this.syncIterations, triangleInit2, function () { _this.initialised = true; callback(); }); }); }; QuadraticErrorSimplification.prototype.reconstructMesh = function () { var newTriangles = []; var i; for (i = 0; i < this.vertices.length; ++i) { this.vertices[i].triangleCount = 0; } var t; var j; for (i = 0; i < this.triangles.length; ++i) { if (!this.triangles[i].deleted) { t = this.triangles[i]; for (j = 0; j < 3; ++j) { this.vertices[t.vertices[j]].triangleCount = 1; } newTriangles.push(t); } } var newVerticesOrder = []; //compact vertices, get the IDs of the vertices used. var dst = 0; for (i = 0; i < this.vertices.length; ++i) { if (this.vertices[i].triangleCount) { this.vertices[i].triangleStart = dst; this.vertices[dst].position = this.vertices[i].position; this.vertices[dst].normal = this.vertices[i].normal; this.vertices[dst].uv = this.vertices[i].uv; this.vertices[dst].color = this.vertices[i].color; newVerticesOrder.push(i); dst++; } } for (i = 0; i < newTriangles.length; ++i) { t = newTriangles[i]; for (j = 0; j < 3; ++j) { t.vertices[j] = this.vertices[t.vertices[j]].triangleStart; } } this.vertices = this.vertices.slice(0, dst); var newPositionData = []; var newNormalData = []; var newUVsData = []; var newColorsData = []; for (i = 0; i < newVerticesOrder.length; ++i) { newPositionData.push(this.vertices[i].position.x); newPositionData.push(this.vertices[i].position.y); newPositionData.push(this.vertices[i].position.z); newNormalData.push(this.vertices[i].normal.x); newNormalData.push(this.vertices[i].normal.y); newNormalData.push(this.vertices[i].normal.z); if (this.vertices[i].uv) { newUVsData.push(this.vertices[i].uv.x); newUVsData.push(this.vertices[i].uv.y); } else if (this.vertices[i].color) { newColorsData.push(this.vertices[i].color.r); newColorsData.push(this.vertices[i].color.g); newColorsData.push(this.vertices[i].color.b); newColorsData.push(this.vertices[i].color.a); } } var newIndicesArray = []; for (i = 0; i < newTriangles.length; ++i) { newIndicesArray.push(newTriangles[i].vertices[0]); newIndicesArray.push(newTriangles[i].vertices[1]); newIndicesArray.push(newTriangles[i].vertices[2]); } //not cloning, to avoid geometry problems. Creating a whole new mesh. var newMesh = new BABYLON.Mesh(this._mesh.name + "Decimated", this._mesh.getScene()); newMesh.material = this._mesh.material; newMesh.parent = this._mesh.parent; newMesh.setIndices(newIndicesArray); newMesh.setVerticesData(BABYLON.VertexBuffer.PositionKind, newPositionData); newMesh.setVerticesData(BABYLON.VertexBuffer.NormalKind, newNormalData); if (newUVsData.length > 0) newMesh.setVerticesData(BABYLON.VertexBuffer.UVKind, newUVsData); if (newColorsData.length > 0) newMesh.setVerticesData(BABYLON.VertexBuffer.ColorKind, newColorsData); //preparing the skeleton support if (this._mesh.skeleton) { //newMesh.skeleton = this._mesh.skeleton.clone("", ""); //newMesh.getScene().beginAnimation(newMesh.skeleton, 0, 100, true, 1.0); } return newMesh; }; QuadraticErrorSimplification.prototype.isFlipped = function (vertex1, index2, point, deletedArray, borderFactor) { for (var i = 0; i < vertex1.triangleCount; ++i) { var t = this.triangles[this.references[vertex1.triangleStart + i].triangleId]; if (t.deleted) continue; var s = this.references[vertex1.triangleStart + i].vertexId; var id1 = t.vertices[(s + 1) % 3]; var id2 = t.vertices[(s + 2) % 3]; if ((id1 === index2 || id2 === index2) && borderFactor < 2) { deletedArray[i] = true; continue; } var d1 = this.vertices[id1].position.subtract(point); d1 = d1.normalize(); var d2 = this.vertices[id2].position.subtract(point); d2 = d2.normalize(); if (Math.abs(BABYLON.Vector3.Dot(d1, d2)) > 0.999) return true; var normal = BABYLON.Vector3.Cross(d1, d2).normalize(); deletedArray[i] = false; if (BABYLON.Vector3.Dot(normal, t.normal) < 0.2) return true; } return false; }; QuadraticErrorSimplification.prototype.updateTriangles = function (vertexId, vertex, deletedArray, deletedTriangles) { var newDeleted = deletedTriangles; for (var i = 0; i < vertex.triangleCount; ++i) { var ref = this.references[vertex.triangleStart + i]; var t = this.triangles[ref.triangleId]; if (t.deleted) continue; if (deletedArray[i]) { t.deleted = true; newDeleted++; continue; } t.vertices[ref.vertexId] = vertexId; t.isDirty = true; t.error[0] = this.calculateError(this.vertices[t.vertices[0]], this.vertices[t.vertices[1]]) + (t.borderFactor / 2); t.error[1] = this.calculateError(this.vertices[t.vertices[1]], this.vertices[t.vertices[2]]) + (t.borderFactor / 2); t.error[2] = this.calculateError(this.vertices[t.vertices[2]], this.vertices[t.vertices[0]]) + (t.borderFactor / 2); t.error[3] = Math.min(t.error[0], t.error[1], t.error[2]); this.references.push(ref); } return newDeleted; }; QuadraticErrorSimplification.prototype.identifyBorder = function () { for (var i = 0; i < this.vertices.length; ++i) { var vCount = []; var vId = []; var v = this.vertices[i]; var j; for (j = 0; j < v.triangleCount; ++j) { var triangle = this.triangles[this.references[v.triangleStart + j].triangleId]; for (var ii = 0; ii < 3; ii++) { var ofs = 0; var id = triangle.vertices[ii]; while (ofs < vCount.length) { if (vId[ofs] === id) break; ++ofs; } if (ofs === vCount.length) { vCount.push(1); vId.push(id); } else { vCount[ofs]++; } } } for (j = 0; j < vCount.length; ++j) { if (vCount[j] === 1) { this.vertices[vId[j]].isBorder = true; } else { this.vertices[vId[j]].isBorder = false; } } } }; QuadraticErrorSimplification.prototype.updateMesh = function (identifyBorders) { if (typeof identifyBorders === "undefined") { identifyBorders = false; } var i; if (!identifyBorders) { var newTrianglesVector = []; for (i = 0; i < this.triangles.length; ++i) { if (!this.triangles[i].deleted) { newTrianglesVector.push(this.triangles[i]); } } this.triangles = newTrianglesVector; } for (i = 0; i < this.vertices.length; ++i) { this.vertices[i].triangleCount = 0; this.vertices[i].triangleStart = 0; } var t; var j; var v; for (i = 0; i < this.triangles.length; ++i) { t = this.triangles[i]; for (j = 0; j < 3; ++j) { v = this.vertices[t.vertices[j]]; v.triangleCount++; } } var tStart = 0; for (i = 0; i < this.vertices.length; ++i) { this.vertices[i].triangleStart = tStart; tStart += this.vertices[i].triangleCount; this.vertices[i].triangleCount = 0; } var newReferences = new Array(this.triangles.length * 3); for (i = 0; i < this.triangles.length; ++i) { t = this.triangles[i]; for (j = 0; j < 3; ++j) { v = this.vertices[t.vertices[j]]; newReferences[v.triangleStart + v.triangleCount] = new Reference(j, i); v.triangleCount++; } } this.references = newReferences; if (identifyBorders) { this.identifyBorder(); } }; QuadraticErrorSimplification.prototype.vertexError = function (q, point) { var x = point.x; var y = point.y; var z = point.z; return q.data[0] * x * x + 2 * q.data[1] * x * y + 2 * q.data[2] * x * z + 2 * q.data[3] * x + q.data[4] * y * y + 2 * q.data[5] * y * z + 2 * q.data[6] * y + q.data[7] * z * z + 2 * q.data[8] * z + q.data[9]; }; QuadraticErrorSimplification.prototype.calculateError = function (vertex1, vertex2, pointResult, normalResult, uvResult, colorResult) { var q = vertex1.q.add(vertex2.q); var border = vertex1.isBorder && vertex2.isBorder; var error = 0; var qDet = q.det(0, 1, 2, 1, 4, 5, 2, 5, 7); if (qDet !== 0 && !border) { if (!pointResult) { pointResult = BABYLON.Vector3.Zero(); } pointResult.x = -1 / qDet * (q.det(1, 2, 3, 4, 5, 6, 5, 7, 8)); pointResult.y = 1 / qDet * (q.det(0, 2, 3, 1, 5, 6, 2, 7, 8)); pointResult.z = -1 / qDet * (q.det(0, 1, 3, 1, 4, 6, 2, 5, 8)); error = this.vertexError(q, pointResult); //TODO this should be correctly calculated if (normalResult) { normalResult.copyFrom(vertex1.normal); if (vertex1.uv) uvResult.copyFrom(vertex1.uv); else if (vertex1.color) colorResult.copyFrom(vertex1.color); } } else { var p3 = (vertex1.position.add(vertex2.position)).divide(new BABYLON.Vector3(2, 2, 2)); //var norm3 = (vertex1.normal.add(vertex2.normal)).divide(new Vector3(2, 2, 2)).normalize(); var error1 = this.vertexError(q, vertex1.position); var error2 = this.vertexError(q, vertex2.position); var error3 = this.vertexError(q, p3); error = Math.min(error1, error2, error3); if (error === error1) { if (pointResult) { pointResult.copyFrom(vertex1.position); normalResult.copyFrom(vertex1.normal); if (vertex1.uv) uvResult.copyFrom(vertex1.uv); else if (vertex1.color) colorResult.copyFrom(vertex1.color); } } else if (error === error2) { if (pointResult) { pointResult.copyFrom(vertex2.position); normalResult.copyFrom(vertex2.normal); if (vertex2.uv) uvResult.copyFrom(vertex2.uv); else if (vertex2.color) colorResult.copyFrom(vertex2.color); } } else { if (pointResult) { pointResult.copyFrom(p3); normalResult.copyFrom(vertex1.normal); if (vertex1.uv) uvResult.copyFrom(vertex1.uv); else if (vertex1.color) colorResult.copyFrom(vertex1.color); } } } return error; }; return QuadraticErrorSimplification; })(); BABYLON.QuadraticErrorSimplification = QuadraticErrorSimplification; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.meshSimplification.js.map var BABYLON; (function (BABYLON) { var Analyser = (function () { function Analyser(scene) { this.SMOOTHING = 0.75; this.FFT_SIZE = 512; this.BARGRAPHAMPLITUDE = 256; this._debugCanvasWidth = 320; this._debugCanvasHeight = 200; this._scene = scene; this._audioEngine = scene.getEngine().getAudioEngine(); if (this._audioEngine.canUseWebAudio) { this._webAudioAnalyser = this._audioEngine.audioContext.createAnalyser(); this._webAudioAnalyser.minDecibels = -140; this._webAudioAnalyser.maxDecibels = 0; this._byteFreqs = new Uint8Array(this._webAudioAnalyser.frequencyBinCount); this._byteTime = new Uint8Array(this._webAudioAnalyser.frequencyBinCount); this._floatFreqs = new Float32Array(this._webAudioAnalyser.frequencyBinCount); } } Analyser.prototype.getFrequencyBinCount = function () { return this._webAudioAnalyser.frequencyBinCount; }; Analyser.prototype.getByteFrequencyData = function () { this._webAudioAnalyser.smoothingTimeConstant = this.SMOOTHING; this._webAudioAnalyser.fftSize = this.FFT_SIZE; this._webAudioAnalyser.getByteFrequencyData(this._byteFreqs); return this._byteFreqs; }; Analyser.prototype.getByteTimeDomainData = function () { this._webAudioAnalyser.smoothingTimeConstant = this.SMOOTHING; this._webAudioAnalyser.fftSize = this.FFT_SIZE; this._webAudioAnalyser.getByteTimeDomainData(this._byteTime); return this._byteTime; }; Analyser.prototype.getFloatFrequencyData = function () { this._webAudioAnalyser.smoothingTimeConstant = this.SMOOTHING; this._webAudioAnalyser.fftSize = this.FFT_SIZE; this._webAudioAnalyser.getFloatFrequencyData(this._floatFreqs); return this._floatFreqs; }; Analyser.prototype.drawDebugCanvas = function () { var _this = this; if (this._audioEngine.canUseWebAudio) { if (!this._debugCanvas) { this._debugCanvas = document.createElement("canvas"); this._debugCanvas.width = this._debugCanvasWidth; this._debugCanvas.height = this._debugCanvasHeight; this._debugCanvas.style.position = "absolute"; this._debugCanvas.style.top = "30px"; this._debugCanvas.style.left = "10px"; this._debugCanvasContext = this._debugCanvas.getContext("2d"); document.body.appendChild(this._debugCanvas); this._registerFunc = function () { _this.drawDebugCanvas(); }; this._scene.registerBeforeRender(this._registerFunc); } if (this._registerFunc) { var workingArray = this.getByteFrequencyData(); this._debugCanvasContext.fillStyle = 'rgb(0, 0, 0)'; this._debugCanvasContext.fillRect(0, 0, this._debugCanvasWidth, this._debugCanvasHeight); for (var i = 0; i < this.getFrequencyBinCount(); i++) { var value = workingArray[i]; var percent = value / this.BARGRAPHAMPLITUDE; var height = this._debugCanvasHeight * percent; var offset = this._debugCanvasHeight - height - 1; var barWidth = this._debugCanvasWidth / this.getFrequencyBinCount(); var hue = i / this.getFrequencyBinCount() * 360; this._debugCanvasContext.fillStyle = 'hsl(' + hue + ', 100%, 50%)'; this._debugCanvasContext.fillRect(i * barWidth, offset, barWidth, height); } } } }; Analyser.prototype.stopDebugCanvas = function () { if (this._debugCanvas) { this._scene.unregisterBeforeRender(this._registerFunc); this._registerFunc = null; document.body.removeChild(this._debugCanvas); this._debugCanvas = null; this._debugCanvasContext = null; } }; Analyser.prototype.connectAudioNodes = function (inputAudioNode, outputAudioNode) { if (this._audioEngine.canUseWebAudio) { inputAudioNode.connect(this._webAudioAnalyser); this._webAudioAnalyser.connect(outputAudioNode); } }; return Analyser; })(); BABYLON.Analyser = Analyser; })(BABYLON || (BABYLON = {})); //# sourceMappingURL=babylon.analyser.js.map